text
stringlengths
957
885k
<reponame>bennuttall/piwheels # The piwheels project # Copyright (c) 2017 <NAME> <https://github.com/bennuttall> # Copyright (c) 2017 <NAME> <<EMAIL>> # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # * Neither the name of the copyright holder nor the # names of its contributors may be used to endorse or promote products # derived from this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE # LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR # CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF # SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS # INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN # CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. """ Defines the :class:`SlaveDriver` task; see class for more details. .. autoclass:: SlaveDriver :members: """ from datetime import datetime, timedelta, timezone from .. import const, protocols, tasks, transport from ..states import SlaveState, FileState from .the_oracle import DbClient from .file_juggler import FsClient UTC = timezone.utc class SlaveDriver(tasks.PausingTask): """ This task handles interaction with the build slaves using the slave protocol. Interaction is driven by the slaves (i.e. the master doesn't *push* jobs, rather the slaves *request* a job and the master replies with the next (package, version) tuple from the internal "builds" queue). The task also incidentally interacts with several other queues: the internal "status" queue is sent details of every reply sent to a build slave (the :meth:`~.PiWheelsMaster.main_loop` method passes this information on to any listening monitors). Also, the internal "indexes" queue is informed of any packages that need web page indexes re-building (as a result of a successful build). """ # pylint: disable=too-many-instance-attributes name = 'master.slave_driver' def __init__(self, config): super().__init__(config, control_protocol=protocols.slave_driver_control) self.abi_queues = {} self.excluded_builds = {} slave_queue = self.socket( transport.ROUTER, protocol=protocols.slave_driver) slave_queue.bind(config.slave_queue) self.register(slave_queue, self.handle_slave) builds_queue = self.socket( transport.PULL, protocol=reversed(protocols.the_architect)) builds_queue.hwm = 10 builds_queue.bind(config.builds_queue) self.register(builds_queue, self.handle_build) self.status_queue = self.socket( transport.PUSH, protocol=protocols.monitor_stats) self.status_queue.hwm = 10 self.status_queue.connect(const.INT_STATUS_QUEUE) SlaveState.status_queue = self.status_queue self.web_queue = self.socket( transport.REQ, protocol=reversed(protocols.the_scribe)) self.web_queue.connect(config.web_queue) self.stats_queue = self.socket( transport.PUSH, protocol=reversed(protocols.big_brother)) self.stats_queue.connect(config.stats_queue) delete_queue = self.socket( transport.REP, protocol=reversed(protocols.cloud_gazer)) delete_queue.bind(const.SKIP_QUEUE) self.register(delete_queue, self.handle_delete) self.db = DbClient(config, self.logger) self.fs = FsClient(config, self.logger) self.slaves = {} self.pypi_simple = config.pypi_simple self.every(timedelta(seconds=10), self.remove_expired) def close(self): self.fs.close() self.db.close() SlaveState.status_queue = None super().close() def list_slaves(self): """ Additional task control method to trigger a "HELLO" message to the internal control queue. See :meth:`~.tasks.Task.quit` for more information. """ self._ctrl('HELLO') def kill_slave(self, slave_id): """ Additional task control method to trigger a "KILL" message to the internal control queue. See :meth:`handle_control` for more information. """ self._ctrl('KILL', slave_id) def sleep_slave(self, slave_id): """ Additional task control method to trigger a "SLEEP" message to the internal control queue. See :meth:`handle_control` for more information. """ self._ctrl('SLEEP', slave_id) def skip_slave(self, slave_id): """ Additional task control method to trigger a "SKIP" message to the internal control queue. See :meth:`handle_control` for more information. """ self._ctrl('SKIP', slave_id) def wake_slave(self, slave_id): """ Additional task control method to trigger a "WAKE" message to the internal control queue. See :meth:`handle_control` for more information. """ self._ctrl('WAKE', slave_id) def remove_expired(self): """ Remove slaves which have exceeded their timeout. """ expired = { address: slave for address, slave in self.slaves.items() if slave.expired } for address, slave in expired.items(): if slave.reply[0] == 'BUILD': package, version = slave.reply[1] self.logger.warning( 'slave %d (%s): timed out while building %s %s for %s', slave.slave_id, slave.label, package, version, slave.native_abi) else: self.logger.warning( 'slave %d (%s): timed out during %s', slave.slave_id, slave.label, slave.reply[0]) # Send a fake DIE message to the status queue so that listening # monitors know to remove the entry slave.reply = ('DIE', None) del self.slaves[address] def handle_control(self, queue): """ Handle incoming requests to the internal control queue. This class understands a couple of extra control messages unique to it, specifically "KILL" to tell a build slave to terminate, "SKIP" to tell a build slave to terminate its current build immmediately, and "HELLO" to cause all "HELLO" messages from build slaves to be replayed (for the benefit of a newly attached monitor process). """ try: super().handle_control(queue) except tasks.TaskControl as ctrl: if ctrl.msg in ('KILL', 'SLEEP', 'SKIP', 'WAKE'): for slave in self.slaves.values(): if ctrl.data is None or slave.slave_id == ctrl.data: { 'KILL': slave.kill, 'SLEEP': slave.sleep, 'SKIP': slave.skip, 'WAKE': slave.wake, }[ctrl.msg]() elif ctrl.msg == 'HELLO': for slave in self.slaves.values(): slave.hello() else: raise # pragma: no cover def handle_build(self, queue): """ Refresh the ABI-specific queues of package versions waiting to be built. The queues are limited to 1000 packages per ABI, and are kept as lists ordered by release date. When a message arrives from :class:`TheArchitect` it refreshes (replaces) all current queues. There is, however, still a duplication possibility as :class:`TheArchitect` doesn't know what packages are actively being built; this method handles filtering out such packages. Even if the active builds fail (because build slaves crash, or the network dies) this doesn't matter as a future re-run of the build queue query will return these packages again, and if no build slaves are actively working on them at that time they will then be retried. """ try: msg, new_queues = queue.recv_msg() except IOError as e: self.logger.error(str(e)) else: self.logger.info('refreshing build-queue') now = datetime.now(tz=UTC) build_abis = self.db.get_build_abis() # Prune expired entries from the excluded_builds buffer and add # empty dicts for new ABIs for abi in build_abis: try: excluded = self.excluded_builds[abi] except KeyError: excluded = {} self.excluded_builds[abi] = { key: expires for key, expires in excluded.items() if expires > now } # Set up the new queues without recent builds (and converting # list-pairs into tuples) self.abi_queues = { abi: [ (package, version) for package, version in new_queue if (package, version) not in self.excluded_builds[abi] and (package, None) not in self.excluded_builds[abi] ] for abi, new_queue in new_queues.items() } for abi in build_abis: self.abi_queues.setdefault(abi, []) self.stats_queue.send_msg('STATBQ', { abi: len(queue) for (abi, queue) in self.abi_queues.items() }) def handle_delete(self, queue): """ Handle package or version deletion requests. When the PyPI upstream deletes a version or package, the :class:`CloudGazer` task requests that other tasks perform the deletion on its behalf. In the case of this task, this involves cancelling any pending builds of that package (version), and ignoring any builds involving that package (version) in the next queue update from :class:`TheArchitect`. """ msg, data = queue.recv_msg() if msg == 'DELVER': del_pkg, del_ver = data elif msg == 'DELPKG': del_pkg, del_ver = data, None self.logger.info('marking package %s %s as excluded', del_pkg, del_ver) for abi in self.db.get_build_abis(): try: excluded = self.excluded_builds[abi] except KeyError: excluded = {} self.excluded_builds[abi] = excluded excluded[(del_pkg, del_ver)] = ( datetime.now(tz=UTC) + timedelta(hours=1)) try: build_queue = self.abi_queues[abi] except KeyError: build_queue = [] self.abi_queues[abi] = [ (pkg, ver) for pkg, ver in build_queue if (del_pkg, del_ver) not in ((pkg, ver), (pkg, None)) ] for slave in self.slaves.values(): if slave.reply[0] == 'BUILD': build_pkg, build_ver = slave.reply[1] if build_pkg == del_pkg and del_ver in (None, build_ver): self.logger.info('skipping deleted package %s %s', del_pkg, del_ver) slave.skip() queue.send_msg('OK') def handle_slave(self, queue): """ Handle requests from build slaves. See the :doc:`slaves` chapter for an overview of the protocol for messages between build slaves and :class:`SlaveDriver`. This method retrieves the message from the build slave, finds the associated :class:`~.states.SlaveState` and updates it with the message, then calls the appropriate message handler. The handler will be expected to return a reply (in the usual form of a list of strings) or ``None`` if no reply should be sent (e.g. for a final "BYE" message). """ try: address, msg, data = queue.recv_addr_msg() except IOError as e: self.logger.error(str(e)) return try: slave = self.slaves[address] except KeyError: if msg == 'HELLO': slave = SlaveState(address, *data) else: self.logger.error('invalid first message from slave: %s', msg) return slave.request = msg, data handler = { 'HELLO': self.do_hello, 'BYE': self.do_bye, 'IDLE': self.do_idle, 'BUSY': self.do_busy, 'BUILT': self.do_built, 'SENT': self.do_sent, }[msg] msg, data = handler(slave) if msg is not None: slave.reply = msg, data queue.send_addr_msg(address, msg, data) def do_hello(self, slave): """ Handler for the build slave's initial "HELLO" message. This associates the specified *slave* state with the slave's address and returns "HELLO" with the master's id for the slave (the id communicated back simply for consistency of logging; administrators can correlate master log messages with slave log messages when both have the same id number; we can't use IP address for this as multiple slaves can run on one machine). :param SlaveState slave: The object representing the current status of the build slave. """ self.logger.warning( 'slave %d (%s): hello (build_timeout=%s, busy_timeout=%s, abi=%s, ' 'platform=%s, os_name=%s, os_version=%s, board_revision=%s, ' 'board_serial=%s)', slave.slave_id, slave.label, slave.build_timeout, slave.busy_timeout, slave.native_abi, slave.native_platform, slave.os_name, slave.os_version, slave.board_revision, slave.board_serial) self.slaves[slave.address] = slave return 'ACK', [slave.slave_id, self.pypi_simple] def do_bye(self, slave): """ Handler for the build slave's final "BYE" message upon shutdown. This removes the associated state from the internal ``slaves`` dict. :param SlaveState slave: The object representing the current status of the build slave. """ self.logger.warning('slave %d (%s): shutdown', slave.slave_id, slave.label) # Send a fake DIE message to the status queue so that listening # monitors know to remove the entry slave.reply = 'DIE', protocols.NoData del self.slaves[slave.address] return None, None def do_idle(self, slave): """ Handler for the build slave's "IDLE" message (which is effectively the slave requesting work). If the master wants to terminate the slave, it sends back "BYE". If the build queue (for the slave's ABI) is empty or the task is currently paused, "SLEEP" is returned indicating the slave should wait a while and then try again. If a job can be retrieved from the (ABI specific) build queue, then a "BUILD" message is sent back with the required package and version. :param SlaveState slave: The object representing the current status of the build slave. """ if slave.reply[0] not in ('ACK', 'SLEEP', 'DONE'): self.logger.error( 'slave %d (%s): protocol error (IDLE after %s)', slave.slave_id, slave.label, slave.reply[0]) return 'DIE', protocols.NoData elif slave.killed: return 'DIE', protocols.NoData elif self.paused: self.logger.info( 'slave %d (%s): sleeping because master is paused', slave.slave_id, slave.label) return 'SLEEP', True else: try: abi_queue = self.abi_queues[slave.native_abi] excluded_builds = self.excluded_builds[slave.native_abi] except KeyError: abi_queue = [] try: while abi_queue: package, version = abi_queue.pop(0) if (package, version) not in excluded_builds: self.logger.info( 'slave %d (%s): build %s %s', slave.slave_id, slave.label, package, version) excluded_builds[(package, version)] = ( datetime.now(tz=UTC) + slave.build_timeout) return 'BUILD', [package, version] self.logger.info( 'slave %d (%s): sleeping because no builds', slave.slave_id, slave.label) return 'SLEEP', False finally: # Only push queue stats if there's space in the stats_queue # (it's not essential; just a nice-to-have) if self.stats_queue.poll(0, transport.POLLOUT): self.stats_queue.send_msg('STATBQ', { abi: len(queue) for (abi, queue) in self.abi_queues.items() }) def do_busy(self, slave): """ Handler for the build slave's "BUSY" message, which is sent periodically during package builds. If the slave fails to respond with a BUSY ping for a duration longer than :attr:`SlaveState.busy_timeout` then the master will assume the slave has died and remove it from the internal state mapping (if the slave happens to resurrect itself later the master will simply treat it as a new build slave). In response to "BUSY" the master can respond "CONT" to indicate the build should continue processing, or "DONE" to indicate that the build slave should immediately terminate and discard the build and return to "IDLE" state. """ if slave.skipped: self.logger.info('slave %d (%s): build skipped', slave.slave_id, slave.label) return 'DONE', protocols.NoData else: return 'CONT', protocols.NoData def do_built(self, slave): """ Handler for the build slave's "BUILT" message, which is sent after an attempted package build succeeds or fails. The handler logs the result in the database and, if files have been generated by the build, informs the :class:`~.file_juggler.FileJuggler` task to expect a file transfer before sending "SEND" back to the build slave with the required filename. If no files were generated (e.g. in the case of a failed build, or a degenerate success), "DONE" is returned indicating that the build slave is free to discard all resources generated during the build and return to its idle state. """ if slave.reply[0] != 'BUILD': self.logger.error( 'slave %d (%s): protocol error (BUILT after %s)', slave.slave_id, slave.label, slave.reply[0]) return 'DIE', protocols.NoData elif slave.skipped: # If the build was skipped, throw away the result without recording # success or failure (it may have been skipped because we know # there's something wrong with the slave) self.logger.info('slave %d (%s): build skipped', slave.slave_id, slave.label) return 'DONE', protocols.NoData else: build_armv6l_hack(slave.build) if slave.build.status and not slave.build.transfers_done: self.logger.info('slave %d (%s): build succeeded', slave.slave_id, slave.label) self.fs.expect(slave.slave_id, slave.build.files[slave.build.next_file]) self.logger.info('slave %d (%s): send %s', slave.slave_id, slave.label, slave.build.next_file) return 'SEND', slave.build.next_file else: self.logger.info('slave %d (%s): build failed', slave.slave_id, slave.label) self.db.log_build(slave.build) self.web_queue.send_msg('LOG', ( slave.build.build_id, slave.build.output)) self.web_queue.recv_msg() self.web_queue.send_msg('PROJECT', slave.build.package) self.web_queue.recv_msg() return 'DONE', protocols.NoData def do_sent(self, slave): """ Handler for the build slave's "SENT" message indicating that it's finished sending the requested file to :class:`FileJuggler`. The :class:`FsClient` RPC mechanism is used to ask :class:`FileJuggler` to verify the transfer against the stored hash and, if this is successful, a message is sent to :class:`TheScribe` to regenerate the package's index. If further files remain to be transferred, another "SEND" message is returned to the build slave. Otherwise, "DONE" is sent to free all build resources. If a transfer fails to verify, another "SEND" message with the same filename is returned to the build slave. """ if slave.reply[0] != 'SEND': self.logger.error( 'slave %d (%s): protocol error (SENT after %s)', slave.slave_id, slave.label, slave.reply[0]) return 'DIE', protocols.NoData elif self.fs.verify(slave.slave_id, slave.build.package): slave.build.files[slave.build.next_file].verified() self.logger.info( 'slave %d (%s): verified transfer of %s', slave.slave_id, slave.label, slave.reply[1]) if slave.build.transfers_done: self.db.log_build(slave.build) self.web_queue.send_msg('LOG', ( slave.build.build_id, slave.build.output)) self.web_queue.recv_msg() self.web_queue.send_msg('BOTH', slave.build.package) self.web_queue.recv_msg() return 'DONE', protocols.NoData else: self.fs.expect(slave.slave_id, slave.build.files[slave.build.next_file]) self.logger.info('slave %d (%s): send %s', slave.slave_id, slave.label, slave.build.next_file) return 'SEND', slave.build.next_file else: self.logger.info('slave %d (%s): re-send %s', slave.slave_id, slave.label, slave.build.next_file) return 'SEND', slave.build.next_file def build_armv6l_hack(build): """ A dirty hack for armv6l wheels; if the build contains any arch-specific wheels for armv7l, generate equivalent armv6l entries from them (with the transferred flag set to True as nothing actually needs transferring). """ for file in list(build.files.values()): if file.platform_tag == 'linux_armv7l': armv7_name = file.filename armv6_name = armv7_name[:-16] + 'linux_armv6l.whl' if armv6_name not in build.files: build.files[armv6_name] = FileState( armv6_name, file.filesize, file.filehash, file.package_tag, file.package_version_tag, file.py_version_tag, file.abi_tag, 'linux_armv6l', file.requires_python, file.dependencies, True)
from django.test import TestCase import sys import pytest class Test_MixStyle(TestCase): # unittest style @classmethod def setUpClass(cls): print('mix style (unittest) - setup > {}'.format(sys._getframe().f_code.co_name)) @classmethod def tearDownClass(cls): print('mix style (unittest) - teardown > {}'.format(sys._getframe().f_code.co_name)) def setUp(self): print('mix style (unittest) - setup > {}'.format(sys._getframe().f_code.co_name)) def tearDown(self): print('mix style (unittest) - teardown > {}'.format(sys._getframe().f_code.co_name)) # classic xunit style @classmethod def setup_class(cls): print('mix style (classic xunit) - setup > {}'.format(sys._getframe().f_code.co_name)) @classmethod def teardown_class(cls): print('mix style (classic xunit) - teardown > {}'.format(sys._getframe().f_code.co_name)) def setup_method(self, method): print('mix style (classic xunit) - setup > {}'.format(sys._getframe().f_code.co_name)) def teardown_method(self, method): print('mix style (classic xunit) - teardown > {}'.format(sys._getframe().f_code.co_name)) # fixture style @pytest.fixture(autouse=True) def scope_default(self, request): print('mix style (fixture) - setup > {}'.format(sys._getframe().f_code.co_name)) def fin_scope_default(): print('mix style (fixture) - teardown > {}'.format(sys._getframe().f_code.co_name)) request.addfinalizer(fin_scope_default) @pytest.fixture(autouse=True, scope='function') def scope_function(self, request): print('mix style (fixture) - setup > {}'.format(sys._getframe().f_code.co_name)) def fin_scope_function(): print('mix style (fixture) - teardown > {}'.format(sys._getframe().f_code.co_name)) request.addfinalizer(fin_scope_function) @pytest.fixture(autouse=True, scope='class') def scope_class(self, request): print('mix style (fixture) - setup > {}'.format(sys._getframe().f_code.co_name)) def fin_scope_class(): print('mix style (fixture) - teardown > {}'.format(sys._getframe().f_code.co_name)) request.addfinalizer(fin_scope_class) @pytest.fixture(autouse=True, scope='module') def scope_module(self, request): print('mix style (fixture) - setup > {}'.format(sys._getframe().f_code.co_name)) def fin_scope_module(): print('mix style (fixture) - teardown > {}'.format(sys._getframe().f_code.co_name)) request.addfinalizer(fin_scope_module) @pytest.fixture(autouse=True, scope='session') def scope_session(self, request): print('mix style (fixture) - setup > {}'.format(sys._getframe().f_code.co_name)) def fin_scope_session(): print('mix style (fixture) - teardown > {}'.format(sys._getframe().f_code.co_name)) request.addfinalizer(fin_scope_session) # test method def testSpam(self): print('mix style > [{}]'.format(sys._getframe().f_code.co_name)) assert True def testHam(self): print('mix style > [{}]'.format(sys._getframe().f_code.co_name)) assert True
"""xiRT main module to run the training and prediction.""" import argparse import logging import os import pickle import sys import time from datetime import datetime import numpy as np import pandas as pd import yaml from xirt import __version__ as xv from xirt import features as xf from xirt import predictor as xr from xirt import xirtnet, qc import matplotlib matplotlib.use('Agg') logger = logging.getLogger(__name__) def arg_parser(): # pragma: not covered """ Parse the arguments from the CLI. Returns: arguments, from parse_args """ description = """ xiRT is a machine learning tool for the (multidimensional) RT prediction of linear and crosslinked peptides. Use --help to see the command line arguments. Visit the documentation to get more information: https://xirt.readthedocs.io/en/latest/ Current Version: {} """.format(xv.__version__) parser = argparse.ArgumentParser(description=description) parser.add_argument("-i", "--in_peptides", help="Input peptide table to learn (and predict) the retention times.", required=True, action="store", dest="in_peptides") parser.add_argument("-o", "--out_dir", help="Directory to store the results", required=True, action="store", dest="out_dir") parser.add_argument("-x", "--xirt_params", help="YAML parameter file to control xiRT's deep learning architecture.", required=True, action="store", dest="xirt_params") parser.add_argument("-l", "--learning_params", help="YAML parameter file to control training and testing splits and data.", required=True, action="store", dest="learning_params") parser.add_argument('--write', dest='write', action='store_true', help="Flag for writing result prediction files. If false only summaries" "are written (default: --write).") parser.add_argument('--no-write', dest='write', action='store_false', help="Flag for writing result prediction files. If false only summaries" "are written (default: --write).") parser.set_defaults(write=True) return parser def xirt_runner(peptides_file, out_dir, xirt_loc, setup_loc, nrows=None, perform_qc=True, write=True, write_dummy=True): """ Execute xiRT, train a model or generate predictions for RT across multiple RT domains. Args: peptides_file: str, location of the input psm/csm file out_dir: str, folder to store the results to xirt_loc: str, location of the yaml file for xirt setup_loc: str, location of the setup yaml single_pep_predictions: nrows: int, number of rows to sample (for quicker testing purposes only) perform_qc: bool, indicates if qc plots should be done. write: bool, indicates result predictions should be stored write_dummy: bool if true dummy txt file is written after execution (for snakemake usag) Returns: None """ start_time = time.time() xirt_params = yaml.load(open(xirt_loc), Loader=yaml.FullLoader) learning_params = yaml.load(open(setup_loc), Loader=yaml.FullLoader) matches_df = pd.read_csv(peptides_file, nrows=nrows) logger.info("xi params: {}".format(xirt_loc)) logger.info("learning_params: {}".format(setup_loc)) logger.info("peptides: {}".format(peptides_file)) # convenience short cuts if learning_params["train"]["mode"] == "train": n_splits = 1 elif learning_params["train"]["mode"] == "predict": n_splits = 0 else: n_splits = learning_params["train"]["ncv"] test_size = learning_params["train"]["test_frac"] outpath = os.path.abspath(out_dir) xirt_params["callbacks"]["callback_path"] = os.path.join(outpath, "callbacks") # preprocess training data training_data = xr.preprocess(matches_df, sequence_type=learning_params["train"]["sequence_type"], max_length=learning_params["preprocessing"]["max_length"], cl_residue=learning_params["preprocessing"]["cl_residue"], fraction_cols=xirt_params["predictions"]["fractions"]) # set training index by FDR and duplicates training_data.set_fdr_mask(fdr_cutoff=learning_params["train"]["fdr"], str_filter=learning_params["preprocessing"]["filter"]) training_data.set_unique_shuffled_sampled_training_idx( sample_frac=learning_params["train"]["sample_frac"], random_state=learning_params["train"]["sample_state"]) # adjust RT if necessary to guarantee smooth learning # gradient length > 30 minutes (1500 seconds) for cont_col in xirt_params["predictions"]["continues"]: if training_data.psms[cont_col].max() > 1500: training_data.psms[cont_col] = training_data.psms[cont_col] / 60.0 # init neural network structure xirtnetwork = xirtnet.xiRTNET(xirt_params, input_dim=training_data.features1.shape[1]) # get the columns where the RT information is stored frac_cols = sorted([xirtnetwork.output_p[tt.lower() + "-column"] for tt in xirt_params["predictions"]["fractions"]]) cont_cols = sorted([xirtnetwork.output_p[tt.lower() + "-column"] for tt in xirt_params["predictions"]["continues"]]) # init data structures for results histories = [] model_summary = [] # manual accuracy for ordinal data accuracies_all = [] if "ordinal" in ";".join([xirtnetwork.output_p[i + "-column"] for i in xirtnetwork.tasks]): has_ordinal = True else: has_ordinal = False cv_counter = 1 # perform crossvalidation # train on n-1 fold, use test_size from n-1 folds for validation and test/predict RT # on the remaining fold logger.info("Starting crossvalidation (nfolds={})".format(n_splits)) start_timecv = time.time() for train_idx, val_idx, pred_idx in training_data.iter_splits(n_splits=n_splits, test_size=test_size): logger.info("---------------------------------------------------------") logger.info("Starting crossvalidation iteration: {}".format(cv_counter)) logger.info("# Train peptides: {}".format(len(train_idx))) logger.info("# Validation peptides: {}".format(len(val_idx))) logger.info("# Prediction peptides: {}".format(len(pred_idx))) logger.info("# Rescoring Candidates peptides: {}".format(len(training_data.predict_idx))) logger.info("Train indices: {}".format(train_idx[0:10])) logger.info("Validation indices: {}".format(val_idx[0:10])) logger.info("Prediction indices: {}".format(pred_idx[0:10])) logger.info("Rescoring Candidates indices: {}".format(training_data.predict_idx[0:10])) # init the network model # either load from existing or create from config if learning_params["train"]["pretrained_model"].lower() != "none": logger.info("Loading existing model from reference.") xirtnetwork.load_model(learning_params["train"]["pretrained_model"]) else: logger.info("Building new model from config.") xirtnetwork.build_model(siamese=xirt_params["siamese"]["use"]) # once model architecture is there, check if weights should be loaded # loading predefined weights if learning_params["train"]["pretrained_weights"].lower() != "none": logger.info("Loading pre-trained weights into model.") xirtnetwork.model.load_weights(learning_params["train"]["pretrained_weights"]) # after loading the weights, we need to pop / re-design the layers for transfer learning if learning_params["train"]["pretrained_model"].lower() != "none": logger.info("Adjusting model architecture.") xirtnetwork.adjust_model() # finally compile xirtnetwork.compile() callbacks = xirtnetwork.get_callbacks(suffix=str(cv_counter).zfill(2)) # assemble training data xt_cv = training_data.get_features(train_idx) yt_cv = training_data.get_classes(train_idx, frac_cols=frac_cols, cont_cols=cont_cols) # validation data xv_cv = training_data.get_features(val_idx) yv_cv = training_data.get_classes(val_idx, frac_cols=frac_cols, cont_cols=cont_cols) # prediction data xp_cv = training_data.get_features(pred_idx) yp_cv = training_data.get_classes(pred_idx, frac_cols=frac_cols, cont_cols=cont_cols) # fit the mode, use the validation split to determine the best # epoch for selecting the best weights logger.info("Fitting model.") history = xirtnetwork.model.fit(xt_cv, yt_cv, validation_data=(xv_cv, yv_cv), epochs=xirt_params["learning"]["epochs"], batch_size=xirt_params["learning"]["batch_size"], verbose=xirt_params["learning"]["verbose"], callbacks=callbacks) metric_columns = xirtnetwork.model.metrics_names # model evaluation training (t), validation (v), prediction (p) model_summary.append(xirtnetwork.model.evaluate(xt_cv, yt_cv, batch_size=512)) model_summary.append(xirtnetwork.model.evaluate(xv_cv, yv_cv, batch_size=512)) model_summary.append(xirtnetwork.model.evaluate(xp_cv, yp_cv, batch_size=512)) # use the training for predicting unseen RTs training_data.predict_and_store(xirtnetwork, xp_cv, pred_idx, cv=cv_counter) if has_ordinal: train_preds = xirtnetwork.model.predict(xt_cv) val_preds = xirtnetwork.model.predict(xv_cv) pred_preds = xirtnetwork.model.predict(xp_cv) accuracies_all.extend(xr.compute_accuracy(train_preds, training_data.psms.loc[train_idx], xirtnetwork.tasks, xirtnetwork.output_p)) accuracies_all.extend(xr.compute_accuracy(val_preds, training_data.psms.loc[val_idx], xirtnetwork.tasks, xirtnetwork.output_p)) accuracies_all.extend(xr.compute_accuracy(pred_preds, training_data.psms.loc[pred_idx], xirtnetwork.tasks, xirtnetwork.output_p)) # store metrics # store model? / callback df_history = pd.DataFrame(history.history) df_history["CV"] = cv_counter df_history["epoch"] = np.arange(1, len(df_history) + 1) cv_counter += 1 histories.append(df_history) logger.info("Finished CV training model.") # CV training done, now deal with the data not used for training if learning_params["train"]["mode"] != "predict": # store model summary data model_summary_df = pd.DataFrame(model_summary, columns=metric_columns) model_summary_df["CV"] = np.repeat(np.arange(1, n_splits + 1), 3) model_summary_df["Split"] = np.tile(["Train", "Validation", "Prediction"], n_splits) # store manual accuray for ordinal data if has_ordinal: for count, task_i in enumerate(frac_cols): taski_short = task_i.split("_")[0] if "ordinal" in xirtnetwork.output_p[taski_short + "-column"]: # accuracies_all contains accuracies for train, validation, pred # problem is that accuracies are computed after the loop and stored in a 1d-ar # retrieve information again if len(frac_cols) == 1: model_summary_df[taski_short + "_ordinal-accuracy"] = accuracies_all else: model_summary_df[taski_short + "_ordinal-accuracy"] = \ accuracies_all[count::len(frac_cols)] if learning_params["train"]["refit"]: logger.info("Refitting model on entire data to predict unseen data.") callbacks = xirtnetwork.get_callbacks(suffix="full") xrefit = training_data.get_features(training_data.train_idx) yrefit = training_data.get_classes(training_data.train_idx, frac_cols=frac_cols, cont_cols=cont_cols) xirtnetwork.build_model(siamese=xirt_params["siamese"]["use"]) xirtnetwork.compile() if learning_params["train"]["pretrained_weights"].lower() != "none": logger.info("Loading pretrained weights into model for refit option.") xirtnetwork.model.load_weights(learning_params["train"]["pretrained_weights"]) _ = xirtnetwork.model.fit(xrefit, yrefit, validation_split=test_size, epochs=xirt_params["learning"]["epochs"], batch_size=xirt_params["learning"]["batch_size"], verbose=xirt_params["learning"]["verbose"], callbacks=callbacks) else: logger.info("Selecting best performing CV model to predict unseen data.") # load the best performing model across cv from the validation split best_model_idx = np.argmin( model_summary_df[model_summary_df["Split"] == "Validation"]["loss"].values) logger.info("Best Model: {}".format(best_model_idx)) logger.info("Loading weights.") xirtnetwork.model.load_weights(os.path.join(xirtnetwork.callback_p["callback_path"], "xirt_weights_{}.h5".format( str(best_model_idx + 1).zfill(2)))) logger.info("Model Summary:") logger.info(model_summary_df.groupby("Split").agg([np.mean, np.std]).to_string()) else: logger.info("Loading model weights.") xirtnetwork.build_model(siamese=xirt_params["siamese"]["use"]) xirtnetwork.compile() xirtnetwork.model.load_weights(learning_params["train"]["pretrained_weights"]) logger.info("Reassigning prediction index for prediction mode.") training_data.predict_idx = training_data.psms.index model_summary_df = pd.DataFrame() df_history_all = pd.DataFrame() # get the 'unvalidation data', e.g. data that was not used during training because # here the CSMs are that we want to save / rescore later! # assign prediction fold to entire data xu = training_data.get_features(training_data.predict_idx) yu = training_data.get_classes(training_data.predict_idx, frac_cols=frac_cols, cont_cols=cont_cols) training_data.predict_and_store(xirtnetwork, xu, training_data.predict_idx, cv=-1) eval_unvalidation = xirtnetwork.model.evaluate(xu, yu, batch_size=512) if has_ordinal: accs_tmp = xr.compute_accuracy(xirtnetwork.model.predict(xu), training_data.psms.loc[training_data.predict_idx], xirtnetwork.tasks, xirtnetwork.output_p) eval_unvalidation.extend(np.hstack([-1, "Unvalidation", accs_tmp])) else: eval_unvalidation.extend([-1, "Unvalidation"]) # prediction modes dont have any training information if learning_params["train"]["mode"] != "predict": # collect epoch training data model_summary_df.loc[len(model_summary_df)] = eval_unvalidation df_history_all = pd.concat(histories) df_history_all = df_history_all.reset_index(drop=False).rename(columns={"index": "epoch"}) df_history_all["epoch"] += 1 # compute features for rescoring xf.compute_prediction_errors(training_data.psms, training_data.prediction_df, xirtnetwork.tasks, frac_cols, (xirtnetwork.siamese_p["single_predictions"] & xirtnetwork.siamese_p["use"])) # store results features_exhaustive = xf.add_interactions(training_data.prediction_df.filter(regex="error"), degree=len(xirtnetwork.tasks)) # qc # only training procedure includes qc if perform_qc and (learning_params["train"]["mode"] != "predict"): logger.info("Generating qc plots.") qc.plot_epoch_cv(callback_path=xirtnetwork.callback_p["callback_path"], tasks=xirtnetwork.tasks, xirt_params=xirt_params, outpath=outpath) qc.plot_summary_strip(model_summary_df, tasks=xirtnetwork.tasks, xirt_params=xirt_params, outpath=outpath) qc.plot_cv_predictions(training_data.prediction_df, training_data.psms, xirt_params=xirt_params, outpath=outpath) qc.plot_error_characteristics(training_data.prediction_df, training_data.psms, xirtnetwork.tasks, xirt_params, outpath, max_fdr=0.01) logger.info("Writing output tables.") # store setup in summary model_summary_df["xirt_params_loc"] = xirt_loc model_summary_df["xirt_params_base"] = os.path.basename(xirt_loc).split(".")[0] model_summary_df["learning_params"] = setup_loc model_summary_df["peptides"] = peptides_file df_history_all.to_csv(os.path.join(outpath, "epoch_history.csv")) model_summary_df.to_csv(os.path.join(outpath, "model_summary.csv")) if write: # store data training_data.psms.to_csv(os.path.join(outpath, "processed_psms.csv")) training_data_Xy = ((training_data.features1, training_data.features2), training_data.get_classes(training_data.psms.index, frac_cols=frac_cols, cont_cols=cont_cols)) with open(os.path.join(xirt_params["callbacks"]["callback_path"], "Xy_data.p"), 'wb') as po: pickle.dump(training_data_Xy, po, protocol=pickle.HIGHEST_PROTOCOL) with open(os.path.join(xirt_params["callbacks"]["callback_path"], "encoder.p"), 'wb') as po: pickle.dump(training_data.le, po, protocol=pickle.HIGHEST_PROTOCOL) training_data.psms.to_csv(os.path.join(outpath, "processed_psms.csv")) training_data.prediction_df.to_csv(os.path.join(outpath, "error_features.csv")) features_exhaustive.to_csv(os.path.join(outpath, "error_features_interactions.csv")) # write a text file to indicate xirt is done. if write_dummy: with open(xirt_loc.replace(".yaml", ".txt"), "w") as of: of.write("done.") logger.info("Completed xiRT run.") logger.info("End Time: {}".format(datetime.now().strftime("%H:%M:%S"))) end_time = time.time() logger.info("xiRT CV-training took: {:.2f} minutes".format((end_time - start_timecv) / 60.)) logger.info("xiRT took: {:.2f} minutes".format((end_time - start_time) / 60.)) def main(): # pragma: no cover """Run xiRT main function.""" parser = arg_parser() try: args = parser.parse_args(sys.argv[1:]) except TypeError: parser.print_usage() # create dir if not there if not os.path.exists(args.out_dir): os.makedirs(args.out_dir) # create logger logger = logging.getLogger('xirt') logger.setLevel(logging.DEBUG) # create console handler and set level to debug ch = logging.FileHandler(os.path.join(args.out_dir, "xirt_logger.log"), "w") ch.setLevel(logging.DEBUG) ch.setFormatter(logging.Formatter('%(asctime)s - %(name)s - %(levelname)s - %(message)s')) logger.addHandler(ch) sh = logging.StreamHandler(sys.stdout) sh.setLevel(logging.DEBUG) sh.setFormatter(logging.Formatter('%(asctime)s - %(name)s - %(levelname)s - %(message)s')) logger.addHandler(sh) logger.info("command line call:") logger.info( "xirt -i {} -o {} -x {} -l {}".format(args.in_peptides, args.out_dir, args.xirt_params, args.learning_params)) logger.info("Init logging file.") logger.info("Starting Time: {}".format(datetime.now().strftime("%H:%M:%S"))) logger.info("Starting xiRT.") logger.info("Using xiRT version: {}".format(xv.__version__)) # call function xirt_runner(args.in_peptides, args.out_dir, args.xirt_params, args.learning_params, write=args.write) if __name__ == "__main__": # pragma: no cover main()
#!/usr/bin/env python #description:Linkedin employee search module# from colorama import Fore,Back,Style import os,sys import urllib import requests import re,string class module_element(object): def __init__(self): self.title = "Linkedin gathering : \n" self.require = {"enterprise":[{"value":"","required":"yes"}],"limit_search":[{"value":"","required":"yes"}]} self.export = [] self.export_file = "" self.export_status = False def show_options(self): #print Back.WHITE + Fore.WHITE + "Module parameters" + Style.RESET_ALL for line in self.require: if self.require[line][0]["value"] == "": value = "No value" else: value = self.require[line][0]["value"] if self.require[line][0]["required"] == "yes": print Fore.RED + Style.BRIGHT + "- "+Style.RESET_ALL + line + ":" + Fore.RED + "is_required" + Style.RESET_ALL + ":" + value else: print Fore.WHITE + Style.BRIGHT + "* "+Style.RESET_ALL + line + "(" + Fore.GREEN + "not_required" + Style.RESET_ALL + "):" + value #print Back.WHITE + Fore.WHITE + "End parameters" + Style.RESET_ALL def export_data(self, argv=False): if len(self.export) > 0: if self.export_file == "": if argv == False: user_input = raw_input("operative (export file name ?) > ") else: user_input = argv if os.path.exists("export/"+user_input): self.export_file = "export/"+user_input elif os.path.exists(user_input): self.export_file = user_input else: print Fore.GREEN + "Writing " + user_input + " file" + Style.RESET_ALL self.export_file = "export/"+user_input self.export_data() elif self.export_status == False: file_open = open(self.export_file,"a+") file_open.write(self.title) for line in self.export: file_open.write("- " + line +"\n") print Fore.GREEN + "File writed : " + self.export_file + Style.RESET_ALL file_open.close() self.export_status = True else: print Back.YELLOW + Fore.BLACK + "Module empty result" + Style.RESET_ALL def set_options(self,name,value): if name in self.require: self.require[name][0]["value"] = value else: print Fore.RED + "Option not found" + Style.RESET_ALL def check_require(self): for line in self.require: for option in self.require[line]: if option["required"] == "yes": if option["value"] == "": return False return True def get_options(self,name): if name in self.require: return self.require[name][0]["value"] else: return False def set_agv(self, argv): self.argv = argv def run_module(self): ret = self.check_require() if ret == False: print Back.YELLOW + Fore.BLACK + "Please set the required parameters" + Style.RESET_ALL else: self.main() def main(self): userAgent = "(Mozilla/5.0 (Windows; U; Windows NT 6.0;en-US; rv:1.9.2) Gecko/20100115 Firefox/3.6" quantity = "100" server = "www.google.com" word = self.get_options("enterprise") limit = int(self.get_options("limit_search")) counter = 0 result = "" totalresults = "" print Fore.GREEN + "Search Linkedin research" + Style.RESET_ALL url="http://"+ server + "/search?num=" + str(limit) + "&start=0&hl=en&meta=&q=site%3Alinkedin.com/in%20" + word r=requests.get(url) result = r.content if result != "": regex = re.compile('">[a-zA-Z0-9._ -]* \| LinkedIn') output = regex.findall(result) if len(output) > 0: for line in output: if line.strip() != "": if " | LinkedIn" in line and '">' in line: people = line.strip().replace(' | LinkedIn','').replace('">','') print Fore.BLUE + "* "+ Style.RESET_ALL + people self.export.append(people) else: print Fore.RED + "Nothing on linkedin." + Style.RESET_ALL else: print Fore.RED + "Can't get response" + Style.RESET_ALL
# Lint as: python3 # Copyright 2019 DeepMind Technologies Limited. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Resnet.""" import types from typing import Mapping, Optional, Sequence, Union from haiku._src import basic from haiku._src import batch_norm from haiku._src import conv from haiku._src import module from haiku._src import pool import jax import jax.numpy as jnp # If forking replace this block with `import haiku as hk`. hk = types.ModuleType("haiku") hk.Module = module.Module hk.BatchNorm = batch_norm.BatchNorm hk.Conv2D = conv.Conv2D hk.Linear = basic.Linear hk.max_pool = pool.max_pool del basic, batch_norm, conv, module, pool class BlockV1(hk.Module): """ResNet V1 block with optional bottleneck.""" def __init__( self, channels: int, stride: Union[int, Sequence[int]], use_projection: bool, bn_config: Mapping[str, float], bottleneck: bool, name: Optional[str] = None, ): super().__init__(name=name) self.use_projection = use_projection bn_config = dict(bn_config) bn_config.setdefault("create_scale", True) bn_config.setdefault("create_offset", True) bn_config.setdefault("decay_rate", 0.999) if self.use_projection: self.proj_conv = hk.Conv2D( output_channels=channels, kernel_shape=1, stride=stride, with_bias=False, padding="SAME", name="shortcut_conv") self.proj_batchnorm = hk.BatchNorm(name="shortcut_batchnorm", **bn_config) channel_div = 4 if bottleneck else 1 conv_0 = hk.Conv2D( output_channels=channels // channel_div, kernel_shape=1 if bottleneck else 3, stride=1, with_bias=False, padding="SAME", name="conv_0") bn_0 = hk.BatchNorm(name="batchnorm_0", **bn_config) conv_1 = hk.Conv2D( output_channels=channels // channel_div, kernel_shape=3, stride=stride, with_bias=False, padding="SAME", name="conv_1") bn_1 = hk.BatchNorm(name="batchnorm_1", **bn_config) layers = ((conv_0, bn_0), (conv_1, bn_1)) if bottleneck: conv_2 = hk.Conv2D( output_channels=channels, kernel_shape=1, stride=1, with_bias=False, padding="SAME", name="conv_2") bn_2 = hk.BatchNorm(name="batchnorm_2", scale_init=jnp.zeros, **bn_config) layers = layers + ((conv_2, bn_2),) self.layers = layers def __call__(self, inputs, is_training, test_local_stats): out = shortcut = inputs if self.use_projection: shortcut = self.proj_conv(shortcut) shortcut = self.proj_batchnorm(shortcut, is_training, test_local_stats) for i, (conv_i, bn_i) in enumerate(self.layers): out = conv_i(out) out = bn_i(out, is_training, test_local_stats) if i < len(self.layers) - 1: # Don't apply relu on last layer out = jax.nn.relu(out) return jax.nn.relu(out + shortcut) class BlockV2(hk.Module): """ResNet V2 block with optional bottleneck.""" def __init__( self, channels: int, stride: Union[int, Sequence[int]], use_projection: bool, bn_config: Mapping[str, float], bottleneck: bool, name: Optional[str] = None, ): super().__init__(name=name) self.use_projection = use_projection bn_config = dict(bn_config) bn_config.setdefault("create_scale", True) bn_config.setdefault("create_offset", True) if self.use_projection: self.proj_conv = hk.Conv2D( output_channels=channels, kernel_shape=1, stride=stride, with_bias=False, padding="SAME", name="shortcut_conv") channel_div = 4 if bottleneck else 1 conv_0 = hk.Conv2D( output_channels=channels // channel_div, kernel_shape=1 if bottleneck else 3, stride=1, with_bias=False, padding="SAME", name="conv_0") bn_0 = hk.BatchNorm(name="batchnorm_0", **bn_config) conv_1 = hk.Conv2D( output_channels=channels // channel_div, kernel_shape=3, stride=stride, with_bias=False, padding="SAME", name="conv_1") bn_1 = hk.BatchNorm(name="batchnorm_1", **bn_config) layers = ((conv_0, bn_0), (conv_1, bn_1)) if bottleneck: conv_2 = hk.Conv2D( output_channels=channels, kernel_shape=1, stride=1, with_bias=False, padding="SAME", name="conv_2") # NOTE: Some implementations of ResNet50 v2 suggest initializing # gamma/scale here to zeros. bn_2 = hk.BatchNorm(name="batchnorm_2", **bn_config) layers = layers + ((conv_2, bn_2),) self.layers = layers def __call__(self, inputs, is_training, test_local_stats): x = shortcut = inputs for i, (conv_i, bn_i) in enumerate(self.layers): x = bn_i(x, is_training, test_local_stats) x = jax.nn.relu(x) if i == 0 and self.use_projection: shortcut = self.proj_conv(x) x = conv_i(x) return x + shortcut class BlockGroup(hk.Module): """Higher level block for ResNet implementation.""" def __init__( self, channels: int, num_blocks: int, stride: Union[int, Sequence[int]], bn_config: Mapping[str, float], resnet_v2: bool, bottleneck: bool, use_projection: bool, name: Optional[str] = None, ): super().__init__(name=name) block_cls = BlockV2 if resnet_v2 else BlockV1 self.blocks = [] for i in range(num_blocks): self.blocks.append( block_cls(channels=channels, stride=(1 if i else stride), use_projection=(i == 0 and use_projection), bottleneck=bottleneck, bn_config=bn_config, name="block_%d" % (i))) def __call__(self, inputs, is_training, test_local_stats): out = inputs for block in self.blocks: out = block(out, is_training, test_local_stats) return out def check_length(length, value, name): if len(value) != length: raise ValueError(f"`{name}` must be of length 4 not {len(value)}") class ResNet(hk.Module): """ResNet model.""" BlockGroup = BlockGroup # pylint: disable=invalid-name BlockV1 = BlockV1 # pylint: disable=invalid-name BlockV2 = BlockV2 # pylint: disable=invalid-name def __init__( self, blocks_per_group: Sequence[int], num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, bottleneck: bool = True, channels_per_group: Sequence[int] = (256, 512, 1024, 2048), use_projection: Sequence[bool] = (True, True, True, True), name: Optional[str] = None, ): """Constructs a ResNet model. Args: blocks_per_group: A sequence of length 4 that indicates the number of blocks created in each group. num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. By default the ``decay_rate`` is ``0.9`` and ``eps`` is ``1e-5``. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. bottleneck: Whether the block should bottleneck or not. Defaults to ``True``. channels_per_group: A sequence of length 4 that indicates the number of channels used for each block in each group. use_projection: A sequence of length 4 that indicates whether each residual block should use projection. name: Name of the module. """ super().__init__(name=name) self.resnet_v2 = resnet_v2 bn_config = dict(bn_config or {}) bn_config.setdefault("decay_rate", 0.9) bn_config.setdefault("eps", 1e-5) bn_config.setdefault("create_scale", True) bn_config.setdefault("create_offset", True) # Number of blocks in each group for ResNet. check_length(4, blocks_per_group, "blocks_per_group") check_length(4, channels_per_group, "channels_per_group") self.initial_conv = hk.Conv2D( output_channels=64, kernel_shape=7, stride=2, with_bias=False, padding="SAME", name="initial_conv") if not self.resnet_v2: self.initial_batchnorm = hk.BatchNorm(name="initial_batchnorm", **bn_config) self.block_groups = [] strides = (1, 2, 2, 2) for i in range(4): self.block_groups.append( BlockGroup(channels=channels_per_group[i], num_blocks=blocks_per_group[i], stride=strides[i], bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=bottleneck, use_projection=use_projection[i], name="block_group_%d" % (i))) if self.resnet_v2: self.final_batchnorm = hk.BatchNorm(name="final_batchnorm", **bn_config) self.logits = hk.Linear(num_classes, w_init=jnp.zeros, name="logits") def __call__(self, inputs, is_training, test_local_stats=False): out = inputs out = self.initial_conv(out) if not self.resnet_v2: out = self.initial_batchnorm(out, is_training, test_local_stats) out = jax.nn.relu(out) out = hk.max_pool(out, window_shape=(1, 3, 3, 1), strides=(1, 2, 2, 1), padding="SAME") for block_group in self.block_groups: out = block_group(out, is_training, test_local_stats) if self.resnet_v2: out = self.final_batchnorm(out, is_training, test_local_stats) out = jax.nn.relu(out) out = jnp.mean(out, axis=[1, 2]) return self.logits(out) class ResNet18(ResNet): """ResNet18.""" def __init__(self, num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, name: Optional[str] = None): """Constructs a ResNet model. Args: num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. name: Name of the module. """ super().__init__(blocks_per_group=(2, 2, 2, 2), num_classes=num_classes, bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=False, channels_per_group=(64, 128, 256, 512), use_projection=(False, True, True, True), name=name) class ResNet34(ResNet): """ResNet34.""" def __init__(self, num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, name: Optional[str] = None): """Constructs a ResNet model. Args: num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. name: Name of the module. """ super().__init__(blocks_per_group=(3, 4, 6, 3), num_classes=num_classes, bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=False, channels_per_group=(64, 128, 256, 512), use_projection=(False, True, True, True), name=name) class ResNet50(ResNet): """ResNet50.""" def __init__(self, num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, name: Optional[str] = None): """Constructs a ResNet model. Args: num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. name: Name of the module. """ super().__init__(blocks_per_group=(3, 4, 6, 3), num_classes=num_classes, bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=True, name=name) class ResNet101(ResNet): """ResNet101.""" def __init__(self, num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, name: Optional[str] = None): """Constructs a ResNet model. Args: num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. name: Name of the module. """ super().__init__(blocks_per_group=(3, 4, 23, 3), num_classes=num_classes, bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=True, name=name) class ResNet152(ResNet): """ResNet152.""" def __init__(self, num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, name: Optional[str] = None): """Constructs a ResNet model. Args: num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. name: Name of the module. """ super().__init__(blocks_per_group=(3, 8, 36, 3), num_classes=num_classes, bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=True, name=name) class ResNet200(ResNet): """ResNet200.""" def __init__(self, num_classes: int, bn_config: Optional[Mapping[str, float]] = None, resnet_v2: bool = False, name: Optional[str] = None): """Constructs a ResNet model. Args: num_classes: The number of classes to classify the inputs into. bn_config: A dictionary of two elements, ``decay_rate`` and ``eps`` to be passed on to the :class:`~haiku.BatchNorm` layers. resnet_v2: Whether to use the v1 or v2 ResNet implementation. Defaults to ``False``. name: Name of the module. """ super().__init__(blocks_per_group=(3, 24, 36, 3), num_classes=num_classes, bn_config=bn_config, resnet_v2=resnet_v2, bottleneck=True, name=name)
# -*- coding: utf-8 -*- # Author: <NAME> <<EMAIL>> # # License: BSD (3-clause) from pathlib import Path from shutil import copyfile import numpy as np from numpy.testing import assert_allclose import pandas as pd import pytest import mne from mne.channels import make_standard_montage from mne.channels.montage import transform_to_head from mne.datasets.testing import data_path, requires_testing_data from mne.io import read_raw_nirx, read_fiducials from mne.utils import check_version from mne_nirs.io.fold._fold import _generate_montage_locations,\ _find_closest_standard_location, _read_fold_xls from mne_nirs.io import fold_landmark_specificity from mne_nirs.io.fold import fold_channel_specificity thisfile = Path(__file__).parent.resolve() foldfile = thisfile / "data" / "example.xls" # https://github.com/mne-tools/mne-testing-data/pull/72 fname_nirx_15_3_short = Path(data_path(download=False)) / \ 'NIRx' / 'nirscout' / 'nirx_15_3_recording' requires_xlrd = pytest.mark.skipif( not check_version('xlrd', '1.0'), reason='Requires xlrd >= 1.0') @requires_xlrd @pytest.mark.parametrize('fold_files', (str, None, list)) def test_channel_specificity(monkeypatch, tmp_path, fold_files): raw = read_raw_nirx(fname_nirx_15_3_short, preload=True) raw.pick(range(2)) kwargs = dict() n_want = 6 if fold_files is list: kwargs = dict(fold_files=[foldfile]) elif fold_files is str: kwargs = dict(fold_files=tmp_path) n_want *= 2 else: assert fold_files is None monkeypatch.setenv('MNE_NIRS_FOLD_PATH', str(tmp_path)) assert len(kwargs) == 0 with pytest.raises(FileNotFoundError, match=r'fold_files\[0\] does.*'): fold_channel_specificity(raw) n_want *= 2 copyfile(foldfile, tmp_path / '10-10.xls') copyfile(foldfile, tmp_path / '10-5.xls') res = fold_channel_specificity(raw, **kwargs) assert len(res) == 2 assert res[0].shape == (n_want, 14) montage = make_standard_montage( 'standard_1005', head_size=0.09700884729534559) fids = read_fiducials( Path(mne.__file__).parent / 'data' / 'fsaverage' / 'fsaverage-fiducials.fif')[0] for f in fids: f['coord_frame'] = montage.dig[0]['coord_frame'] montage.dig[:3] = fids S, D = raw.ch_names[0].split()[0].split('_') assert S == 'S1' and D == 'D2' montage.rename_channels({'PO8': S, 'P6': D}) # not in the tables! # taken from standard_1020.elc s_mri = np.array([55.6666, -97.6251, 2.7300]) / 1000. d_mri = np.array([67.8877, -75.9043, 28.0910]) / 1000. trans = mne.transforms._get_trans('fsaverage', 'mri', 'head')[0] ch_pos = montage.get_positions()['ch_pos'] assert_allclose(ch_pos[S], s_mri, atol=1e-6) assert_allclose(ch_pos[D], d_mri, atol=1e-6) raw.set_montage(montage) montage = transform_to_head(montage) s_head = mne.transforms.apply_trans(trans, s_mri) d_head = mne.transforms.apply_trans(trans, d_mri) assert_allclose(montage._get_ch_pos()['S1'], s_head, atol=1e-6) assert_allclose(montage._get_ch_pos()['D2'], d_head, atol=1e-6) for ch in raw.info['chs']: assert_allclose(ch['loc'][3:6], s_head, atol=1e-6) assert_allclose(ch['loc'][6:9], d_head, atol=1e-6) res_1 = fold_channel_specificity(raw, **kwargs)[0] assert res_1.shape == (0, 14) # TODO: This is wrong, should be P08 not P08h, and distance should be 0 mm! with pytest.warns(RuntimeWarning, match='.*PO8h?/P6.*TP8/T8.*'): res_1 = fold_channel_specificity(raw, interpolate=True, **kwargs)[0] montage.rename_channels({S: D, D: S}) # reversed with pytest.warns(RuntimeWarning, match='.*PO8h?/P6.*TP8/T8.*'): res_2 = fold_channel_specificity(raw, interpolate=True, **kwargs)[0] # We should check the whole thing, but this is probably good enough assert (res_1['Specificity'] == res_2['Specificity']).all() @requires_xlrd def test_landmark_specificity(): raw = read_raw_nirx(fname_nirx_15_3_short, preload=True) with pytest.warns(RuntimeWarning, match='No fOLD table entry'): res = fold_landmark_specificity(raw, "L Superior Frontal Gyrus", [foldfile], interpolate=True) assert len(res) == len(raw.ch_names) assert np.max(res) <= 100 assert np.min(res) >= 0 @requires_xlrd def test_fold_workflow(): # Read raw data raw = read_raw_nirx(fname_nirx_15_3_short, preload=True) reference_locations = _generate_montage_locations() channel_of_interest = raw.copy().pick(1) # Get source and detector labels source_locs = channel_of_interest.info['chs'][0]['loc'][3:6] source_label = _find_closest_standard_location(source_locs, reference_locations) assert source_label == "T7" detector_locs = channel_of_interest.info['chs'][0]['loc'][6:9] detector_label = _find_closest_standard_location(detector_locs, reference_locations) assert detector_label == "TP7" # Find correct fOLD elements tbl = _read_fold_xls(foldfile, atlas="Juelich") tbl = tbl.query("Source == @source_label").\ query("Detector == @detector_label") # Query region of interest specificity = tbl.query("Landmark == 'L Mid Orbital Gyrus'")["Specificity"] assert specificity.values == 12.34 @requires_xlrd def test_fold_reader(): tbl = _read_fold_xls(foldfile, atlas="Juelich") assert isinstance(tbl, pd.DataFrame) assert tbl.shape == (11, 10) assert "L Superior Frontal Gyrus" in \ list(tbl["Landmark"]) @requires_testing_data def test_label_finder(): """Test locating labels.""" raw = read_raw_nirx(fname_nirx_15_3_short, preload=True) reference_locations = _generate_montage_locations() # Test central head position source raw_cz = raw.copy().pick(25) assert _find_closest_standard_location( raw_cz.info['chs'][0]['loc'][3:6], reference_locations) == "Cz" # Test right auditory position detector raw_cz = raw.copy().pick(4) assert _find_closest_standard_location( raw_cz.info['chs'][0]['loc'][6:9], reference_locations) == "T8" # Test right auditory position source raw_cz = raw.copy().pick(4) assert _find_closest_standard_location( raw_cz.info['chs'][0]['loc'][3:6], reference_locations) == "TP8" # Test left auditory position source raw_cz = raw.copy().pick(1) assert _find_closest_standard_location( raw_cz.info['chs'][0]['loc'][3:6], reference_locations) == "T7" # Test left auditory position detector raw_cz = raw.copy().pick(1) assert _find_closest_standard_location( raw_cz.info['chs'][0]['loc'][6:9], reference_locations) == "TP7" # Test rear position detector raw_cz = raw.copy().pick(9) assert _find_closest_standard_location( raw_cz.info['chs'][0]['loc'][6:9], reference_locations) == "PO2"
<reponame>WongLynn/vnpy_Amerlin-1.1.20<filename>vnpy/trader/gateway/ctpGateway/ctpGateway.py # encoding: UTF-8 ''' vn.ctp的gateway接入 考虑到现阶段大部分CTP中的ExchangeID字段返回的都是空值 vtSymbol直接使用symbol ''' import os import json from copy import copy from datetime import datetime, timedelta import pandas as pd from vnpy.api.ctp import MdApi, TdApi, defineDict from vnpy.trader.vtGateway import * from vnpy.trader.vtFunction import getJsonPath, getTempPath from vnpy.trader.vtConstant import GATEWAYTYPE_FUTURES, VN_SEPARATOR from .language import text import re import pymongo from vnpy.trader.vtGlobal import globalSetting # 以下为一些VT类型和CTP类型的映射字典 # 价格类型映射 priceTypeMap = {} priceTypeMap[PRICETYPE_LIMITPRICE] = defineDict["THOST_FTDC_OPT_LimitPrice"] priceTypeMap[PRICETYPE_MARKETPRICE] = defineDict["THOST_FTDC_OPT_AnyPrice"] priceTypeMapReverse = {v: k for k, v in list(priceTypeMap.items())} # 方向类型映射 directionMap = {} directionMap[DIRECTION_LONG] = defineDict['THOST_FTDC_D_Buy'] directionMap[DIRECTION_SHORT] = defineDict['THOST_FTDC_D_Sell'] directionMapReverse = {v: k for k, v in list(directionMap.items())} # 开平类型映射 offsetMap = {} offsetMap[OFFSET_OPEN] = defineDict['THOST_FTDC_OF_Open'] offsetMap[OFFSET_CLOSE] = defineDict['THOST_FTDC_OF_Close'] offsetMap[OFFSET_CLOSETODAY] = defineDict['THOST_FTDC_OF_CloseToday'] offsetMap[OFFSET_CLOSEYESTERDAY] = defineDict['THOST_FTDC_OF_CloseYesterday'] offsetMapReverse = {v:k for k,v in list(offsetMap.items())} # 交易所类型映射 exchangeMap = {} exchangeMap[EXCHANGE_CFFEX] = 'CFFEX' exchangeMap[EXCHANGE_SHFE] = 'SHFE' exchangeMap[EXCHANGE_CZCE] = 'CZCE' exchangeMap[EXCHANGE_DCE] = 'DCE' exchangeMap[EXCHANGE_SSE] = 'SSE' exchangeMap[EXCHANGE_INE] = 'INE' exchangeMap[EXCHANGE_UNKNOWN] = '' exchangeMapReverse = {v:k for k,v in list(exchangeMap.items())} # 持仓类型映射 posiDirectionMap = {} posiDirectionMap[DIRECTION_NET] = defineDict["THOST_FTDC_PD_Net"] posiDirectionMap[DIRECTION_LONG] = defineDict["THOST_FTDC_PD_Long"] posiDirectionMap[DIRECTION_SHORT] = defineDict["THOST_FTDC_PD_Short"] posiDirectionMapReverse = {v:k for k,v in list(posiDirectionMap.items())} # 产品类型映射 productClassMap = {} productClassMap[PRODUCT_FUTURES] = defineDict["THOST_FTDC_PC_Futures"] productClassMap[PRODUCT_OPTION] = defineDict["THOST_FTDC_PC_Options"] productClassMap[PRODUCT_COMBINATION] = defineDict["THOST_FTDC_PC_Combination"] productClassMapReverse = {v:k for k,v in list(productClassMap.items())} # 委托状态映射 statusMap = {} statusMap[STATUS_ALLTRADED] = defineDict["THOST_FTDC_OST_AllTraded"] statusMap[STATUS_PARTTRADED] = defineDict["THOST_FTDC_OST_PartTradedQueueing"] statusMap[STATUS_NOTTRADED] = defineDict["THOST_FTDC_OST_NoTradeQueueing"] statusMap[STATUS_CANCELLED] = defineDict["THOST_FTDC_OST_Canceled"] statusMap[STATUS_SUBMITTED] = defineDict["THOST_FTDC_OAS_Submitted"] statusMapReverse = {v:k for k,v in list(statusMap.items())} # 全局字典, key:symbol, value:exchange symbolExchangeDict = {} # 夜盘交易时间段分隔判断 NIGHT_TRADING = datetime(1900, 1, 1, 20).time() ######################################################################## class CtpGateway(VtGateway): """CTP接口""" BARCOLUMN = ["datetime", "open", "high", "low", "close", "volume"] #---------------------------------------------------------------------- def __init__(self, eventEngine, gatewayName='CTP'): """Constructor""" super(CtpGateway, self).__init__(eventEngine, gatewayName) self.mdApi = CtpMdApi(self) # 行情API self.tdApi = CtpTdApi(self) # 交易API self.mdConnected = False # 行情API连接状态,登录完成后为True self.tdConnected = False # 交易API连接状态 self.qryEnabled = False # 循环查询 self.fileName = self.gatewayName + '_connect.json' self.filePath = getJsonPath(self.fileName, __file__) self.trade_days = None self.current_datetime = None self.dbURI = None self.dbName = None self.jaqsUser = None self.jaqsPass = None self.ds = None #---------------------------------------------------------------------- def connect(self): """连接""" try: f = open(self.filePath,'r', encoding="utf-8") except IOError: log = VtLogData() log.gatewayName = self.gatewayName log.logContent = text.LOADING_ERROR self.onLog(log) return # 解析json文件 setting = json.load(f) try: userID = str(setting['userID']) password = str(setting['password']) brokerID = str(setting['brokerID']) tdAddress = str(setting['tdAddress']) mdAddress = str(setting['mdAddress']) # 如果json文件提供了验证码 if 'authCode' in setting: authCode = str(setting['authCode']) userProductInfo = str(setting['userProductInfo']) self.tdApi.requireAuthentication = True else: authCode = None userProductInfo = None except KeyError: log = VtLogData() log.gatewayName = self.gatewayName log.logContent = text.CONFIG_KEY_MISSING self.onLog(log) return # 创建行情和交易接口对象 self.mdApi.connect(userID, password, brokerID, mdAddress) self.tdApi.connect(userID, password, brokerID, tdAddress,authCode, userProductInfo) # 初始化并启动查询 setQryEnabled = setting.get('setQryEnabled', False) self.setQryEnabled(setQryEnabled) setQryFreq = setting.get('setQryFreq', 60) self.initQuery(setQryFreq) self.dbURI = setting.get('mongoDbURI',None) self.dbName = setting.get('mongoDbName',None) self.jaqsUser = setting.get('jaqsUser',None) self.jaqsPass = setting.get('jaqsPass',None) if not self.dbURI and self.jaqsUser: from jaqs.data import DataView,RemoteDataService data_config = { "remote.data.address": "tcp://data.quantos.org:8910", "remote.data.username": self.jaqsUser, "remote.data.password": self.jaqsPass } self.ds = RemoteDataService() self.ds.init_from_config(data_config) self.trade_days = self.ds.query_trade_dates(19910101, 20291231) def update_current_datetime(self, dt): if self.current_datetime is None or dt > self.current_datetime: self.current_datetime = dt def onTick(self, tick): super(CtpGateway, self).onTick(tick) if tick.datetime is None: tick.datetime = datetime.strptime(' '.join([tick.date, tick.time]), '%Y%m%d %H:%M:%S.%f') self.update_current_datetime(tick.datetime) #---------------------------------------------------------------------- def subscribe(self, subscribeReq): """订阅行情""" self.mdApi.subscribe(subscribeReq) #---------------------------------------------------------------------- def sendOrder(self, orderReq): """发单""" return self.tdApi.sendOrder(orderReq) #---------------------------------------------------------------------- def cancelOrder(self, cancelOrderReq): """撤单""" self.tdApi.cancelOrder(cancelOrderReq) #---------------------------------------------------------------------- def qryAccount(self): """查询账户资金""" self.tdApi.qryAccount() #---------------------------------------------------------------------- def qryPosition(self): """查询持仓""" self.tdApi.qryPosition() #---------------------------------------------------------------------- def close(self): """关闭""" if self.mdConnected: self.mdApi.close() if self.tdConnected: self.tdApi.close() #---------------------------------------------------------------------- def initQuery(self, freq = 60): """初始化连续查询""" if self.qryEnabled: # 需要循环的查询函数列表 self.qryFunctionList = [self.qryAccount, self.qryPosition] self.qryCount = 0 # 查询触发倒计时 self.qryTrigger = freq # 查询触发点 self.qryNextFunction = 0 # 上次运行的查询函数索引 self.startQuery() #---------------------------------------------------------------------- def query(self, event): """注册到事件处理引擎上的查询函数""" self.qryCount += 1 if self.qryCount > self.qryTrigger: # 清空倒计时 self.qryCount = 0 # 执行查询函数 function = self.qryFunctionList[self.qryNextFunction] function() # 计算下次查询函数的索引,如果超过了列表长度,则重新设为0 self.qryNextFunction += 1 if self.qryNextFunction == len(self.qryFunctionList): self.qryNextFunction = 0 #---------------------------------------------------------------------- def startQuery(self): """启动连续查询""" self.eventEngine.register(EVENT_TIMER, self.query) #---------------------------------------------------------------------- def setQryEnabled(self, qryEnabled): """设置是否要启动循环查询""" self.qryEnabled = qryEnabled def _select_trade_days(self, start, end): s = self.trade_days.searchsorted(start) if start else 0 e = self.trade_days.searchsorted(end, "right") return self.trade_days[s:e] def make_dt(self, date, time): day, month, year = list(self.split_time(date)) second, minute, hour = list(self.split_time(time)) return datetime(year, month, day, hour, minute, second) @staticmethod def split_time(time): for i in range(2): yield time % 100 time = int(time/100) yield time def loadHistoryBar(self, vtSymbol, type_, size=None, since=None): # if type_ not in ['1min','5min','15min']: # log = VtLogData() # log.gatewayName = self.gatewayName # log.logContent = u'CTP初始化数据只接受1分钟,5分钟,15分钟bar' # self.onLog(log) # return if self.dbURI and not self.jaqsUser: symbol = vtSymbol.split(':')[0] maincontract = re.split(r'(\d)', symbol)[0] query_symbol = '_'.join([maincontract,type_]) self.dbClient = pymongo.MongoClient(self.dbURI) if self.dbName not in self.dbClient.list_database_names(): return self.tdApi.writeLog('MongoDB not found') if query_symbol in self.dbClient[self.dbName].collection_names(): collection = self.dbClient[self.dbName][query_symbol] if since: since = datetime.strptime(str(since),"%Y%m%d") Cursor = collection.find({"datetime": {"$gt":since}}) if size: Cursor = collection.find({}).sort([("datetime",-1)]).limit(size) data_df = pd.DataFrame(list(Cursor)) data_df.sort_values(by=['datetime'], inplace=True) else: self.tdApi.writeLog('History Data of %s not found in DB'%query_symbol) data_df = pd.DataFrame([]) return data_df elif self.jaqsUser and not self.dbURI: if type_ not in ['1min','5min','15min']: log = VtLogData() log.gatewayName = self.gatewayName log.logContent = u'CTP初始化数据只接受1分钟,5分钟,15分钟bar' self.onLog(log) return typeMap = {} typeMap['1min'] = '1M' typeMap['5min'] = '5M' typeMap['15min'] = '15M' freq_map = { "1min": "1M", "5min": "5M", "15min": "15M" } freq_delta = { "1M": timedelta(minutes=1), "5M": timedelta(minutes=5), "15M": timedelta(minutes=15), } symbol = vtSymbol.split(':')[0] exchange = symbolExchangeDict.get(symbol, EXCHANGE_UNKNOWN) if exchangeMap[EXCHANGE_SHFE] in exchange: exchange = 'SHF' elif exchangeMap[EXCHANGE_CFFEX] in exchange: exchange = 'CFE' elif exchangeMap[EXCHANGE_CZCE] in exchange: exchange = 'CZC' symbol = symbol + '.' + exchange freq = typeMap[type_] delta = freq_delta[freq] if since: start = int(since) else: start = None end = self.current_datetime or datetime.now() end = end.year*10000+end.month*100+end.day days = self._select_trade_days(start, end) results = {} if start is None: days = reversed(days) length = 0 for date in days: bar, msg = self.ds.bar(symbol, trade_date=date, freq=freq) if msg != "0,": raise Exception(msg) bar["datetime"] = list(map(self.make_dt, bar.date, bar.time)) bar["datetime"] -= delta results[date] = bar[self.BARCOLUMN] length += len(bar) if size and (length >= size): break data = pd.concat([results[date] for date in sorted(results.keys())], ignore_index=True) if size: if since: data = data.iloc[:size] else: data = data.iloc[-size:] return data elif not (self.jaqsUser and self.dbURI): self.tdApi.writeLog('Please fill History Data source in CTP_setting.json') def qryAllOrders(self, vtSymbol, order_id, status= None): pass def initPosition(self,vtSymbol): self.qryPosition() self.qryAccount() def qryInstrument(self): self.tdApi.restQryInstrument() ######################################################################## class CtpMdApi(MdApi): """CTP行情API实现""" #---------------------------------------------------------------------- def __init__(self, gateway): """Constructor""" super(CtpMdApi, self).__init__() self.gateway = gateway # gateway对象 self.gatewayName = gateway.gatewayName # gateway对象名称 self.reqID = EMPTY_INT # 操作请求编号 self.connectionStatus = False # 连接状态 self.loginStatus = False # 登录状态 self.subscribedSymbols = set() # 已订阅合约代码 self.userID = EMPTY_STRING # 账号 self.password = EMPTY_STRING # 密码 self.brokerID = EMPTY_STRING # 经纪商代码 self.address = EMPTY_STRING # 服务器地址 self.tradingDt = None # 交易日datetime对象 self.tradingDate = EMPTY_STRING # 交易日期字符串 self.tickTime = None # 最新行情time对象 self.lastTickDict = {} #---------------------------------------------------------------------- def onFrontConnected(self): """服务器连接""" self.connectionStatus = True self.writeLog(text.DATA_SERVER_CONNECTED) self.login() #---------------------------------------------------------------------- def onFrontDisconnected(self, n): """服务器断开""" self.connectionStatus = False self.loginStatus = False self.gateway.mdConnected = False self.writeLog(text.DATA_SERVER_DISCONNECTED) #---------------------------------------------------------------------- def onHeartBeatWarning(self, n): """心跳报警""" # 因为API的心跳报警比较常被触发,且与API工作关系不大,因此选择忽略 pass #---------------------------------------------------------------------- def onRspError(self, error, n, last): """错误回报""" err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRspUserLogin(self, data, error, n, last): """登陆回报""" print(data,error,'登陆回报登陆回报登陆回报登陆回报') # 如果登录成功,推送日志信息 if error['ErrorID'] == 0: self.loginStatus = True self.gateway.mdConnected = True self.writeLog(text.DATA_SERVER_LOGIN) # 重新订阅之前订阅的合约 for subscribeReq in self.subscribedSymbols: self.subscribe(subscribeReq) # 获取交易日 self.tradingDate = data['TradingDay'] self.tradingDt = datetime.strptime(self.tradingDate, '%Y%m%d') # 否则,推送错误信息 else: err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRspUserLogout(self, data, error, n, last): """登出回报""" # 如果登出成功,推送日志信息 if error['ErrorID'] == 0: self.loginStatus = False self.gateway.mdConnected = False self.writeLog(text.DATA_SERVER_LOGOUT) # 否则,推送错误信息 else: err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRspSubMarketData(self, data, error, n, last): """订阅合约回报""" # 通常不在乎订阅错误,选择忽略 pass #---------------------------------------------------------------------- def onRspUnSubMarketData(self, data, error, n, last): """退订合约回报""" # 同上 pass #---------------------------------------------------------------------- def onRtnDepthMarketData(self, data): """行情推送""" """{'AskPrice5': 1.7976931348623157e+308, 'CurrDelta': 1.7976931348623157e+308, 'AskPrice2': 1.7976931348623157e+308, 'BidPrice4': 1.7976931348623157e+308, 'AveragePrice': 35830.96499402925, 'AskVolume4': 0, 'BidPrice1': 3607.0, 'UpdateTime': '07:54:53', 'AskPrice4': 1.7976931348623157e+308, 'PreOpenInterest': 1214400.0, 'LastPrice': 3607.0, 'ExchangeInstID': '', 'BidPrice2': 1.7976931348623157e+308, 'BidPrice3': 1.7976931348623157e+308, 'HighestPrice': 3616.0, 'AskPrice3': 1.7976931348623157e+308, 'BidVolume5': 0, 'ActionDay': '20181203', 'PreSettlementPrice': 3591.0, 'BidVolume4': 0, 'AskVolume2': 0, 'InstrumentID': 'rb1901', 'AskVolume3': 0, 'Volume': 564418, 'Turnover': 20223641600.0, 'BidPrice5': 1.7976931348623157e+308, 'AskVolume5': 0,'OpenPrice': 3590.0, 'PreClosePrice': 3587.0, 'OpenInterest': 1133022.0, 'ClosePrice': 1.7976931348623157e+308, 'LowerLimitPrice': 3339.0, 'BidVolume3': 0, 'BidVolume2': 0, 'UpperLimitPrice': 3842.0, 'BidVolume1': 7, 'TradingDay': '20181203', 'AskVolume1': 94, 'AskPrice1': 3608.0, 'SettlementPrice':1.7976931348623157e+308, 'LowestPrice': 3562.0, 'UpdateMillisec': 500, 'PreDelta': 0.0, 'ExchangeID': ''} """ # 创建对象 tick = VtTickData() tick.gatewayName = self.gatewayName tick.symbol = data['InstrumentID'] tick.exchange = symbolExchangeDict.get(tick.symbol, EXCHANGE_UNKNOWN) tick.vtSymbol = VN_SEPARATOR.join([tick.symbol, tick.gatewayName]) tick.lastPrice = data['LastPrice'] tick.volume = data['Volume'] tick.openInterest = data['OpenInterest'] tick.time = '.'.join([data['UpdateTime'], str(data['UpdateMillisec'])]) # 上期所和郑商所可以直接使用,大商所需要转换 tick.date = data['ActionDay'] tick.openPrice = data['OpenPrice'] tick.highPrice = data['HighestPrice'] tick.lowPrice = data['LowestPrice'] tick.preClosePrice = data['PreClosePrice'] tick.upperLimit = data['UpperLimitPrice'] tick.lowerLimit = data['LowerLimitPrice'] # CTP只有一档行情 tick.bidPrice1 = data['BidPrice1'] tick.bidVolume1 = data['BidVolume1'] tick.askPrice1 = data['AskPrice1'] tick.askVolume1 = data['AskVolume1'] # 大商所日期转换 if tick.exchange is EXCHANGE_DCE: newTime = datetime.strptime(tick.time, '%H:%M:%S.%f').time() # 最新tick时间戳 # 如果新tick的时间小于夜盘分隔,且上一个tick的时间大于夜盘分隔,则意味着越过了12点 if (self.tickTime and newTime < NIGHT_TRADING and self.tickTime > NIGHT_TRADING): self.tradingDt += timedelta(1) # 日期加1 self.tradingDate = self.tradingDt.strftime('%Y%m%d') # 生成新的日期字符串 tick.date = self.tradingDate # 使用本地维护的日期 self.tickTime = newTime # 更新上一个tick时间 # 处理tick成交量 get_tick = self.lastTickDict.get(str(tick.symbol),None) if get_tick: tick.lastVolume = tick.volume - get_tick.volume else: tick.lastVolume = 0 if tick.lastVolume == 0: tick.volumeChange = 0 else: tick.volumeChange = 1 self.gateway.onTick(tick) self.lastTickDict[str(tick.symbol)] = tick #---------------------------------------------------------------------- def onRspSubForQuoteRsp(self, data, error, n, last): """订阅期权询价""" pass #---------------------------------------------------------------------- def onRspUnSubForQuoteRsp(self, data, error, n, last): """退订期权询价""" pass #---------------------------------------------------------------------- def onRtnForQuoteRsp(self, data): """期权询价推送""" pass #---------------------------------------------------------------------- def connect(self, userID, password, brokerID, address): """初始化连接""" self.userID = userID # 账号 self.password = password # 密码 self.brokerID = brokerID # 经纪商代码 self.address = address # 服务器地址 # 如果尚未建立服务器连接,则进行连接 if not self.connectionStatus: # 创建C++环境中的API对象,这里传入的参数是需要用来保存.con文件的文件夹路径 path = getTempPath(self.gatewayName + '_') self.createFtdcMdApi(path) # 注册服务器地址 self.registerFront(self.address) # 初始化连接,成功会调用onFrontConnected self.init() # 若已经连接但尚未登录,则进行登录 else: if not self.loginStatus: self.login() #---------------------------------------------------------------------- def subscribe(self, subscribeReq): """订阅合约""" # 这里的设计是,如果尚未登录就调用了订阅方法 # 则先保存订阅请求,登录完成后会自动订阅 if self.loginStatus: self.subscribeMarketData(str(subscribeReq.symbol)) self.subscribedSymbols.add(subscribeReq) #---------------------------------------------------------------------- def login(self): """登录""" # 如果填入了用户名密码等,则登录 if self.userID and self.password and self.brokerID: req = {} req['UserID'] = self.userID req['Password'] = <PASSWORD> req['BrokerID'] = self.brokerID self.reqID += 1 self.reqUserLogin(req, self.reqID) #---------------------------------------------------------------------- def close(self): """关闭""" self.exit() #---------------------------------------------------------------------- def writeLog(self, content): """发出日志""" log = VtLogData() log.gatewayName = self.gatewayName log.logContent = content self.gateway.onLog(log) ######################################################################## class CtpTdApi(TdApi): """CTP交易API实现""" #---------------------------------------------------------------------- def __init__(self, gateway): """API对象的初始化函数""" super(CtpTdApi, self).__init__() self.gateway = gateway # gateway对象 self.gatewayName = gateway.gatewayName # gateway对象名称 self.reqID = EMPTY_INT # 操作请求编号 self.orderRef = EMPTY_INT # 订单编号 self.connectionStatus = False # 连接状态 self.loginStatus = False # 登录状态 self.authStatus = False # 验证状态 self.loginFailed = False # 登录失败(账号密码错误) self.userID = EMPTY_STRING # 账号 self.password = EMPTY_STRING # 密码 self.brokerID = EMPTY_STRING # 经纪商代码 self.address = EMPTY_STRING # 服务器地址 self.frontID = EMPTY_INT # 前置机编号 self.sessionID = EMPTY_INT # 会话编号 self.posDict = {} self.symbolExchangeDict = {} # 保存合约代码和交易所的印射关系 self.symbolSizeDict = {} # 保存合约代码和合约大小的印射关系 self.contractsList = [] self.requireAuthentication = False #---------------------------------------------------------------------- def onFrontConnected(self): """服务器连接""" self.connectionStatus = True self.writeLog(text.TRADING_SERVER_CONNECTED) if self.requireAuthentication: self.authenticate() else: self.login() #---------------------------------------------------------------------- def onFrontDisconnected(self, n): """服务器断开""" self.connectionStatus = False self.loginStatus = False self.gateway.tdConnected = False self.writeLog(text.TRADING_SERVER_DISCONNECTED) #---------------------------------------------------------------------- def onHeartBeatWarning(self, n): """""" pass #---------------------------------------------------------------------- def onRspAuthenticate(self, data, error, n, last): """验证客户端回报""" print(data,error,'验证客户端回报验证客户端回报验证客户端回报验证客户端回报') if error['ErrorID'] == 0: self.authStatus = True self.writeLog(text.TRADING_SERVER_AUTHENTICATED) self.login() #---------------------------------------------------------------------- def onRspUserLogin(self, data, error, n, last): """登陆回报""" """{'FFEXTime': '18:26:27', 'UserID': '119247', 'TradingDay': '20181101', 'CZCETime': '18:26:27', 'BrokerID': '9999', 'SHFETime': '18:26:27', 'INETime': '--:--:--', 'DCETime': '18:26:27', 'LoginTime': '16:39:33', 'MaxOrderRef': '1', 'FrontID': 1, 'SystemName': 'TradingHosting', 'SessionID': 221906687} {'ErrorID': 0, 'ErrorMsg': 'CTP:正确'} """ # 如果登录成功,推送日志信息 if error['ErrorID'] == 0: self.frontID = str(data['FrontID']) self.sessionID = str(data['SessionID']) self.loginStatus = True self.gateway.tdConnected = True self.writeLog(text.TRADING_SERVER_LOGIN) # 确认结算信息 req = {} req['BrokerID'] = self.brokerID req['InvestorID'] = self.userID self.reqID += 1 self.reqSettlementInfoConfirm(req, self.reqID) # 否则,推送错误信息 else: err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) # 标识登录失败,防止用错误信息连续重复登录 self.loginFailed = True #---------------------------------------------------------------------- def onRspUserLogout(self, data, error, n, last): """登出回报""" print(data,error,'登出回报登出回报登出回报v') # 如果登出成功,推送日志信息 if error['ErrorID'] == 0: self.loginStatus = False self.gateway.tdConnected = False self.writeLog(text.TRADING_SERVER_LOGOUT) # 否则,推送错误信息 else: err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRspUserPasswordUpdate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspTradingAccountPasswordUpdate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspOrderInsert(self, data, error, n, last): """发单错误(柜台)""" """{'TimeCondition': '3', 'BusinessUnit': '', 'UserID': '119247', 'ContingentCondition': '1', 'CombHedgeFlag': '1', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'GTDDate': '', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'OrderPriceType': '2', 'InvestorID': '119247', 'RequestID': 0, 'InstrumentID': 'I', 'UserForceClose': 0, 'ForceCloseReason': '0', 'VolumeCondition': '1', 'MinVolume': 1, 'LimitPrice': 3178.6, 'IsSwapOrder': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': '', 'OrderRef': '6', 'Direction': '0'} {'ErrorID': 16, 'ErrorMsg': 'CTP:找不到合约'} {'TimeCondition': '3', 'BusinessUnit': '', 'UserID': '119247', 'ContingentCondition': '1', 'CombHedgeFlag': '1', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'GTDDate': '', 'StopPrice': 0.0, 'CombOffsetFlag': '3', 'OrderPriceType': '2', 'InvestorID': '119247', 'RequestID': 0, 'InstrumentID': 'rb1901', 'UserForceClose': 0, 'ForceCloseReason': '0', 'VolumeCondition': '1', 'MinVolume': 1, 'LimitPrice': 3851.0, 'IsSwapOrder': 0, 'VolumeTotalOriginal': 0, 'ExchangeID': '', 'OrderRef': '17', 'Direction': '0'} {'ErrorID': 15, 'ErrorMsg': 'CTP:报单字段有误'} """ # 推送委托信息 order = VtOrderData() order.gatewayName = self.gatewayName order.symbol = data['InstrumentID'] order.exchange = exchangeMapReverse[data['ExchangeID']] order.vtSymbol = VN_SEPARATOR.join([order.symbol, self.gatewayName]) order.orderID = data['OrderRef'] order.vtOrderID = VN_SEPARATOR.join([self.gatewayName, order.orderID]) order.direction = directionMapReverse.get(data['Direction'], DIRECTION_UNKNOWN) order.offset = offsetMapReverse.get(data['CombOffsetFlag'], OFFSET_UNKNOWN) order.status = STATUS_REJECTED order.price = data['LimitPrice'] order.totalVolume = data['VolumeTotalOriginal'] order.orderDatetime = datetime.now() self.gateway.onOrder(order) # 推送错误信息 err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRspParkedOrderInsert(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspParkedOrderAction(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspOrderAction(self, data, error, n, last): """撤单错误(柜台)""" err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRspQueryMaxOrderVolume(self, data, error, n, last): """""" pass def restQryInstrument(self): self.reqID += 1 self.reqQryInstrument({}, self.reqID) #---------------------------------------------------------------------- def onRspSettlementInfoConfirm(self, data, error, n, last): """确认结算信息回报""" """{'ConfirmDate': '20181101', 'ConfirmTime': '16:39:33', 'BrokerID': '9999', 'InvestorID': '119247'} {'ErrorID': 0, 'ErrorMsg': '正确'}""" log = VtLogData() log.gatewayName = self.gatewayName log.logContent = '结算信息确认完成' self.gateway.onLog(log) #self.writeLog(text.SETTLEMENT_INFO_CONFIRMED) # 查询合约代码 self.reqID += 1 self.reqQryInstrument({}, self.reqID) #查询合约费率 self.reqID += 1 self.reqQryInstrumentMarginRate({}, self.reqID) #---------------------------------------------------------------------- def onRspRemoveParkedOrder(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspRemoveParkedOrderAction(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspExecOrderInsert(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspExecOrderAction(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspForQuoteInsert(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQuoteInsert(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQuoteAction(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspLockInsert(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspCombActionInsert(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryOrder(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryTrade(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInvestorPosition(self, data, error, n, last): """持仓查询回报""" """{'ShortFrozen': 0, 'FrozenMargin': 0.0, 'BrokerID': '9999', 'CashIn': 0.0, 'FrozenCommission': 0.0, 'UseMargin': 0.0, 'MarginRateByVolume': 0.0, 'CloseProfitByDate': 720.0, 'InstrumentID': 'rb1901', 'StrikeFrozen': 0, 'CombLongFrozen': 0, 'CloseProfitByTrade': 600.0, 'TodayPosition': 0, 'TradingDay': '20181106', 'CombShortFrozen': 0, 'YdStrikeFrozen': 0, 'PreSettlementPrice': 4037.0, 'OpenVolume': 0, 'CloseVolume': 1, 'SettlementPrice': 3965.0, 'OpenCost': 0.0, 'HedgeFlag': '1', 'OpenAmount': 0.0, 'StrikeFrozenAmount': 0.0, 'InvestorID': '119247', 'PositionCost': 0.0, 'LongFrozenAmount': 0.0, 'ExchangeID': '', 'PreMargin': 0.0, 'CloseProfit': 720.0, 'CloseAmount': 39650.0, 'LongFrozen': 0, 'PosiDirection': '3', 'CombPosition': 0, 'YdPosition': 1, 'PositionDate': '2', 'AbandonFrozen': 0, 'ShortFrozenAmount': 0.0, 'FrozenCash': 0.0, 'SettlementID': 1, 'Position': 0, 'ExchangeMargin': 0.0, 'MarginRateByMoney': 0.1, 'PositionProfit': 0.0, 'Commission': 3.9650000000000003} {'ErrorID': 0, 'ErrorMsg': ''}""" # print(data,error,'持仓查询回报持仓查询回报持仓查询回报持仓查询回报') if not data['InstrumentID']: return # 获取持仓缓存对象 posName = VN_SEPARATOR.join([data['InstrumentID'], data['PosiDirection']]) if posName in self.posDict: pos = self.posDict[posName] else: pos = VtPositionData() self.posDict[posName] = pos pos.gatewayName = self.gatewayName pos.symbol = data['InstrumentID'] pos.vtSymbol = VN_SEPARATOR.join([pos.symbol, pos.gatewayName]) pos.direction = posiDirectionMapReverse.get(data['PosiDirection'], '') pos.vtPositionName = VN_SEPARATOR.join([pos.symbol, pos.direction]) # 针对上期所持仓的今昨分条返回(有昨仓、无今仓),读取昨仓数据 pos.ydPosition = 0 exchange = self.symbolExchangeDict.get(pos.symbol, EXCHANGE_UNKNOWN) if exchange == EXCHANGE_SHFE: if data['YdPosition'] and not data['TodayPosition']: pos.ydPosition = data['Position'] # 否则基于总持仓和今持仓来计算昨仓数据 else: pos.ydPosition = data['Position'] - data['TodayPosition'] # 计算成本 size = self.symbolSizeDict[pos.symbol] cost = pos.price * pos.position * size # 汇总总仓 pos.position += data['Position'] pos.positionProfit += data['PositionProfit'] # 计算持仓均价 if pos.position and pos.symbol in self.symbolSizeDict: pos.price = (cost + data['PositionCost']) / (pos.position * size) # 读取冻结 if pos.direction is DIRECTION_LONG: pos.frozen += data['LongFrozen'] else: pos.frozen += data['ShortFrozen'] # 查询回报结束 if last: # 遍历推送 for pos in list(self.posDict.values()): self.gateway.onPosition(pos) # 清空缓存 self.posDict.clear() #---------------------------------------------------------------------- def onRspQryTradingAccount(self, data, error, n, last): """账户资金查询回报AccountInfo""" """{'ReserveBalance': 0.0, 'Reserve': 0.0, 'SpecProductCommission': 0.0, 'FrozenMargin': 0.0, 'BrokerID': '9999', 'CashIn': 0.0, 'FundMortgageOut': 0.0, 'FrozenCommission': 0.0, 'SpecProductPositionProfitByAlg': 0.0, 'Commission': 3.9650000000000003, 'SpecProductPositionProfit': 0.0, 'Deposit': 0.0, 'DeliveryMargin': 0.0, 'TradingDay': '20181106', 'CurrencyID': 'CNY', 'Interest': 0.0, 'PreDeposit': 465082.24000000005, 'Available': 454475.27499999997, 'SpecProductFrozenMargin': 0.0, 'AccountID': '119247', 'SpecProductMargin': 0.0, 'PreFundMortgageOut': 0.0, 'InterestBase': 0.0, 'SpecProductExchangeMargin': 0.0, 'PreBalance': 860199.24, 'Balance': 845555.275, 'MortgageableFund': 363004.22, 'Withdraw': 0.0, 'SpecProductFrozenCommission': 0.0, 'PreMortgage': 0.0, 'SpecProductCloseProfit': 0.0, 'WithdrawQuota': 363004.22, 'FundMortgageAvailable': 0.0, 'BizType': '\x00', 'PreCredit': 0.0, 'FrozenCash': 0.0, 'SettlementID': 1, 'CloseProfit': 720.0, 'ExchangeDeliveryMargin': 0.0, 'Mortgage': 0.0, 'Credit': 0.0, 'CurrMargin': 391080.00000000006, 'FundMortgageIn': 0.0, 'ExchangeMargin': 391080.00000000006, 'PreFundMortgageIn': 0.0, 'PositionProfit': -15360.0, 'PreMargin': 395117.0} {'ErrorID': 0, 'ErrorMsg': ''} """ # print(data,error,'账户资金查询回报AccountInfo账户资金查询回报AccountInfo账户资金查询回报AccountInfo账户资金查询回报AccountInfo') account = VtAccountData() account.gatewayName = self.gatewayName # 账户代码 account.accountID = data['AccountID'] account.vtAccountID = VN_SEPARATOR.join([self.gatewayName, account.accountID]) # 数值相关 account.preBalance = data['PreBalance'] account.available = data['Available'] account.commission = data['Commission'] account.margin = data['CurrMargin'] account.closeProfit = data['CloseProfit'] account.positionProfit = data['PositionProfit'] # 这里的balance和快期中的账户不确定是否一样,需要测试 account.balance = (data['PreBalance'] - data['PreCredit'] - data['PreMortgage'] + data['Mortgage'] - data['Withdraw'] + data['Deposit'] + data['CloseProfit'] + data['PositionProfit'] + data['CashIn'] - data['Commission']) self.gateway.onAccount(account) self.writeLog(f"A/C-{account.accountID}: balance:{account.balance}, pre:{account.preBalance}") self.writeLog(f"unsettled_pnl:{account.positionProfit}, closed_pnl:{account.closeProfit}, commission:{account.commission}") #---------------------------------------------------------------------- def onRspQryInvestor(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryTradingCode(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInstrumentMarginRate(self, data, error, n, last): pass #---------------------------------------------------------------------- def onRspQryInstrumentCommissionRate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryExchange(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryProduct(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInstrument(self, data, error, n, last): """合约回报查询""" """ {'ShortMarginRatio': 0.08, 'EndDelivDate': '20190422', 'ProductID': 'au', 'PriceTick': 0.05, 'PositionType': '2', 'MinLimitOrderVolume': 1, 'ExchangeID': 'SHFE', 'DeliveryYear': 2019, 'MaxLimitOrderVolume': 500, 'MinSellVolume': 0, 'MinMarketOrderVolume': 1, 'InstrumentName': '黄金1904', 'InstrumentCode': '', 'IsTrading': 1, 'InstrumentID': 'au1904', 'LongMarginRatio': 0.08, 'UnderlyingMultiple': 0.0, 'OptionsType': '\x00', 'CreateDate': '20180206', 'ProductClass': '1', 'CombinationType': '0', 'OpenDate': '20180316', 'MinBuyVolume': 0, 'VolumeMultiple': 1000, 'UnderlyingInstrID': '', 'PositionDateType': '1', 'ExpireDate': '20190415', 'ExchangeInstID': 'au1904', 'DeliveryMonth': 4, 'MaxMarketOrderVolume': 30, 'InstLifePhase': '1', 'MaxMarginSideAlgorithm': '1', 'StartDelivDate': '20190416', 'StrikePrice': 0.0} {'ErrorID': 0, 'ErrorMsg': ''} {'ShortMarginRatio': 0.2, 'EndDelivDate': '20190315', 'ProductID': 'IF', 'PriceTick': 0.2, 'PositionType': '2', 'MinLimitOrderVolume': 1, 'ExchangeID': 'CFFEX', 'DeliveryYear': 2019, 'MaxLimitOrderVolume': 20, 'MinSellVolume': 0, 'MinMarketOrderVolume': 1, 'InstrumentName': '沪深300股指1903', 'InstrumentCode': '', 'IsTrading': 1, 'InstrumentID': 'IF1903', 'LongMarginRatio': 0.2, 'UnderlyingMultiple': 0.0, 'OptionsType': '\x00', 'CreateDate': '20180613', 'ProductClass': '1', 'CombinationType': '0', 'OpenDate': '20180723', 'MinBuyVolume': 0, 'VolumeMultiple': 300, 'UnderlyingInstrID': '', 'PositionDateType': '2', 'ExpireDate': '20190315', 'ExchangeInstID': 'IF1903', 'DeliveryMonth': 3, 'MaxMarketOrderVolume': 10, 'InstLifePhase': '1', 'MaxMarginSideAlgorithm': '1', 'StartDelivDate': '20190315', 'StrikePrice': 0.0} {'ErrorID': 0, 'ErrorMsg': ''} """ contract = VtContractData() contract.gatewayName = self.gatewayName contract.symbol = data['InstrumentID'] contract.exchange = exchangeMapReverse[data['ExchangeID']] contract.vtSymbol = VN_SEPARATOR.join([contract.symbol, contract.gatewayName]) contract.name = data['InstrumentName'] #contract.name = data['InstrumentName'].decode('GBK') # 合约数值 contract.size = data['VolumeMultiple'] contract.priceTick = data['PriceTick'] contract.strikePrice = data['StrikePrice'] contract.underlyingSymbol = data['UnderlyingInstrID'] contract.productClass = productClassMapReverse.get(data['ProductClass'], PRODUCT_UNKNOWN) # 期权类型 if contract.productClass is PRODUCT_OPTION: if data['OptionsType'] == '1': contract.optionType = OPTION_CALL elif data['OptionsType'] == '2': contract.optionType = OPTION_PUT # 缓存代码和交易所的印射关系 self.symbolExchangeDict[contract.symbol] = contract.exchange self.symbolSizeDict[contract.symbol] = contract.size # 推送 self.gateway.onContract(contract) self.contractsList.append(contract.symbol + VN_SEPARATOR + contract.exchange) a = {"contracts":self.contractsList} with open(getTempPath('contractList.json'),'w') as f: json.dump(a,f,indent=4, ensure_ascii=False) # 缓存合约代码和交易所映射 symbolExchangeDict[contract.symbol] = contract.exchange if last: self.writeLog(text.CONTRACT_DATA_RECEIVED) #---------------------------------------------------------------------- def onRspQryDepthMarketData(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQrySettlementInfo(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryTransferBank(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInvestorPositionDetail(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryNotice(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQrySettlementInfoConfirm(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInvestorPositionCombineDetail(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryCFMMCTradingAccountKey(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryEWarrantOffset(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInvestorProductGroupMargin(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryExchangeMarginRate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryExchangeMarginRateAdjust(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryExchangeRate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQrySecAgentACIDMap(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryProductExchRate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryProductGroup(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryOptionInstrTradeCost(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryOptionInstrCommRate(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryExecOrder(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryForQuote(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryQuote(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryLock(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryLockPosition(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryInvestorLevel(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryExecFreeze(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryCombInstrumentGuard(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryCombAction(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryTransferSerial(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryAccountregister(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspError(self, error, n, last): """错误回报""" print(error,'错误回报错误回报错误回报错误回报错误回报') err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRtnOrder(self, data): # self.writeLog('报单回报%s'%data) """报单回报""" """{'BusinessUnit': '9999cad', 'RelativeOrderSysID': '', 'UserID': '119247', 'ContingentCondition': '1', 'TraderID': '9999cad', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'UpdateTime': '', 'OrderPriceType': '2', 'SequenceNo': 0, 'ActiveTraderID': '', 'ActiveTime': '', 'FrontID': 1, 'RequestID': 0, 'InsertDate': '20181102', 'InstrumentID': 'IF1811', 'ZCETotalTradedVolume': 0, 'ForceCloseReason': '0', 'ClearingPartID': '', 'TradingDay': '20181101', 'CancelTime': '', 'OrderSource': '0', 'ActiveUserID': '', 'MinVolume': 1, 'LimitPrice': 3157.8, 'BrokerOrderSeq': 15467, 'NotifySequence': 0, 'UserForceClose': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': 'CFFEX', 'ClientID': '9999119227', 'OrderRef': '1', 'Direction': '0', 'TimeCondition': '3', 'InsertTime': '16:34:06', 'UserProductInfo': '', 'InvestorID': '119247', 'OrderSysID': '', 'GTDDate': '', 'StatusMsg': '报单已提交', 'BranchID': '', 'CombHedgeFlag': '1', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'VolumeTraded': 0, 'OrderLocalID': ' 132', 'ParticipantID': '9999', 'OrderType': '0', 'SuspendTime': '', 'SessionID': 200083135, 'VolumeTotal': 1, 'OrderSubmitStatus': '0', 'VolumeCondition': '1', 'SettlementID': 1, 'IsSwapOrder': 0, 'ExchangeInstID': 'IF1811', 'OrderStatus': 'a', 'InstallID': 1} {'BusinessUnit': '9999cad', 'RelativeOrderSysID': '', 'UserID': '119247', 'ContingentCondition': '1', 'TraderID': '9999cad', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'UpdateTime': '', 'OrderPriceType': '2', 'SequenceNo': 181, 'ActiveTraderID': '9999cad', 'ActiveTime': '', 'FrontID': 1, 'RequestID': 0, 'InsertDate': '20181031', 'InstrumentID': 'IF1811', 'ZCETotalTradedVolume': 0, 'ForceCloseReason': '0', 'ClearingPartID': '', 'TradingDay': '20181101', 'CancelTime': '', 'OrderSource': '\x00', 'ActiveUserID': '', 'MinVolume': 1, 'LimitPrice': 3157.8, 'BrokerOrderSeq': 15467, 'NotifySequence': 1, 'UserForceClose': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': 'CFFEX', 'ClientID': '9999119227', 'OrderRef': '1', 'Direction': '0', 'TimeCondition': '3', 'InsertTime': '18:21:00', 'UserProductInfo': '', 'InvestorID': '119247', 'OrderSysID': ' 15215', 'GTDDate': '', 'StatusMsg': '未成交', 'BranchID': '', 'CombHedgeFlag': '1', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'VolumeTraded': 0, 'OrderLocalID': ' 132', 'ParticipantID': '9999', 'OrderType': '\x00', 'SuspendTime': '', 'SessionID': 200083135, 'VolumeTotal': 1, 'OrderSubmitStatus': '3', 'VolumeCondition': '1', 'SettlementID': 1, 'IsSwapOrder': 0, 'ExchangeInstID': 'IF1811', 'OrderStatus': '3', 'InstallID': 1} {'BusinessUnit': '9999cad', 'RelativeOrderSysID': '', 'UserID': '119247', 'ContingentCondition': '1', 'TraderID': '9999cad', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'UpdateTime': '', 'OrderPriceType': '1', 'SequenceNo': 0, 'ActiveTraderID': '', 'ActiveTime': '', 'FrontID': 1, 'RequestID': 0, 'InsertDate': '20181102', 'InstrumentID': 'IF1811', 'ZCETotalTradedVolume': 0, 'ForceCloseReason': '0', 'ClearingPartID': '', 'TradingDay': '20181101', 'CancelTime': '', 'OrderSource': '0', 'ActiveUserID': '', 'MinVolume': 1, 'LimitPrice': 3157.8, 'BrokerOrderSeq': 15676, 'NotifySequence': 1, 'UserForceClose': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': 'CFFEX', 'ClientID': '9999119227', 'OrderRef': '4', 'Direction': '0', 'TimeCondition': '3', 'InsertTime': '16:40:06', 'UserProductInfo': '', 'InvestorID': '119247', 'OrderSysID': '', 'GTDDate': '', 'StatusMsg': '已撤单报单被拒绝CFFEX:不被支持的报单类型', 'BranchID': '', 'CombHedgeFlag': '1', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'VolumeTraded': 0, 'OrderLocalID': ' 176', 'ParticipantID': '9999', 'OrderType': '0', 'SuspendTime': '', 'SessionID': 221906687, 'VolumeTotal': 1, 'OrderSubmitStatus': '4', 'VolumeCondition': '1', 'SettlementID': 1, 'IsSwapOrder': 0, 'ExchangeInstID': 'IF1811', 'OrderStatus': '5', 'InstallID': 1} !!!!!!!!!!!SHFE不支持市价单!!!!!!!!!!!!!!!!! {'BusinessUnit': '9999cad', 'RelativeOrderSysID': '', 'UserID': '119247', 'ContingentCondition': '1', 'TraderID': '9999cad', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'UpdateTime': '', 'OrderPriceType': '2', 'SequenceNo': 205, 'ActiveTraderID': '9999cad', 'ActiveTime': '', 'FrontID': 1, 'RequestID': 0, 'InsertDate': '20181031', 'InstrumentID': 'IF1811', 'ZCETotalTradedVolume': 0, 'ForceCloseReason': '0', 'ClearingPartID': '', 'TradingDay': '20181101', 'CancelTime': '', 'OrderSource': '\x00', 'ActiveUserID': '119247', 'MinVolume': 1, 'LimitPrice': 3157.8, 'BrokerOrderSeq': 15467, 'NotifySequence': 1, 'UserForceClose': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': 'CFFEX', 'ClientID': '9999119227', 'OrderRef': '1', 'Direction': '0', 'TimeCondition': '3', 'InsertTime': '18:21:00', 'UserProductInfo': '', 'InvestorID': '119247', 'OrderSysID': ' 15215', 'GTDDate': '', 'StatusMsg': '已撤单', 'BranchID': '', 'CombHedgeFlag': '1', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'VolumeTraded': 0, 'OrderLocalID': ' 132', 'ParticipantID': '9999', 'OrderType': '\x00', 'SuspendTime': '', 'SessionID': 200083135, 'VolumeTotal': 1, 'OrderSubmitStatus': '3', 'VolumeCondition': '1', 'SettlementID': 1, 'IsSwapOrder': 0, 'ExchangeInstID': 'IF1811', 'OrderStatus': '5', 'InstallID': 1} {'BusinessUnit': '9999cad', 'RelativeOrderSysID': '', 'UserID': '119247', 'ContingentCondition': '1', 'TraderID': '9999cad', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'UpdateTime': '', 'OrderPriceType': '2', 'SequenceNo': 321, 'ActiveTraderID': '9999cad', 'ActiveTime': '', 'FrontID': 1, 'RequestID': 0, 'InsertDate': '20181031', 'InstrumentID': 'IF1811', 'ZCETotalTradedVolume': 0, 'ForceCloseReason': '0', 'ClearingPartID': '', 'TradingDay': '20181101', 'CancelTime': '', 'OrderSource': '\x00', 'ActiveUserID': '', 'MinVolume': 1, 'LimitPrice': 3180.0, 'BrokerOrderSeq': 15852, 'NotifySequence': 1, 'UserForceClose': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': 'CFFEX', 'ClientID': '9999119227', 'OrderRef': '5', 'Direction': '0', 'TimeCondition': '3', 'InsertTime': '18:34:00', 'UserProductInfo': '', 'InvestorID': '119247', 'OrderSysID': ' 15591', 'GTDDate': '', 'StatusMsg': '全部成交', 'BranchID': '', 'CombHedgeFlag': '1', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'VolumeTraded': 1, 'OrderLocalID': ' 207', 'ParticipantID': '9999', 'OrderType': '\x00', 'SuspendTime': '', 'SessionID': 248121201, 'VolumeTotal': 0, 'OrderSubmitStatus': '3', 'VolumeCondition': '1', 'SettlementID': 1, 'IsSwapOrder': 0, 'ExchangeInstID': 'IF1811', 'OrderStatus': '0', 'InstallID': 1} {'BusinessUnit': '', 'RelativeOrderSysID': '', 'UserID': '119247', 'ContingentCondition': '1', 'TraderID': '9999caf', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'UpdateTime': '', 'OrderPriceType': '2', 'SequenceNo': 949, 'ActiveTraderID': '9999caf', 'ActiveTime': '', 'FrontID': 1, 'RequestID': 0, 'InsertDate': '20181112', 'InstrumentID': 'j1901', 'ZCETotalTradedVolume': 0, 'ForceCloseReason': '0', 'ClearingPartID': '', 'TradingDay': '20181113', 'CancelTime': '', 'OrderSource': '\x00', 'ActiveUserID': '', 'MinVolume': 1, 'LimitPrice': 2302.0, 'BrokerOrderSeq': 1692, 'NotifySequence': 1, 'UserForceClose': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': 'DCE', 'ClientID': '9999119227', 'OrderRef': '6', 'Direction': '0', 'TimeCondition': '3', 'InsertTime': '18:13:49', 'UserProductInfo': '', 'InvestorID': '119247', 'OrderSysID': ' 1596', 'GTDDate': '', 'StatusMsg': '全部成交', 'BranchID': '', 'CombHedgeFlag': '1', 'StopPrice': 0.0, 'CombOffsetFlag': '1', 'VolumeTraded': 1, 'OrderLocalID': ' 506', 'ParticipantID': '9999', 'OrderType': '\x00', 'SuspendTime': '', 'SessionID': -624024875, 'VolumeTotal': 0, 'OrderSubmitStatus': '3', 'VolumeCondition': '1', 'SettlementID': 1, 'IsSwapOrder': 0, 'ExchangeInstID': 'j1901', 'OrderStatus': '0', 'InstallID': 1} """ # 更新最大报单编号 newref = data['OrderRef'] self.orderRef = max(self.orderRef, int(newref)) # 创建报单数据对象 order = VtOrderData() order.gatewayName = self.gatewayName # 保存代码和报单号 order.symbol = data['InstrumentID'] order.exchange = exchangeMapReverse[data['ExchangeID']] order.vtSymbol = VN_SEPARATOR.join([order.symbol, order.gatewayName]) order.orderID = data['OrderRef'] # CTP的报单号一致性维护需要基于frontID, sessionID, orderID三个字段 # 但在本接口设计中,已经考虑了CTP的OrderRef的自增性,避免重复 # 唯一可能出现OrderRef重复的情况是多处登录并在非常接近的时间内(几乎同时发单) # 考虑到VtTrader的应用场景,认为以上情况不会构成问题 order.vtOrderID = VN_SEPARATOR.join([self.gatewayName, order.orderID]) order.direction = directionMapReverse.get(data['Direction'], DIRECTION_UNKNOWN) order.offset = offsetMapReverse.get(data['CombOffsetFlag'], OFFSET_UNKNOWN) order.status = statusMapReverse.get(data['OrderStatus'], STATUS_UNKNOWN) # 价格、报单量等数值 order.price = data['LimitPrice'] order.totalVolume = data['VolumeTotalOriginal'] order.tradedVolume = data['VolumeTraded'] order.orderTime = data['InsertTime'] order.cancelTime = data['CancelTime'] order.frontID = data['FrontID'] order.sessionID = data['SessionID'] order.orderDatetime = datetime.strptime(' '.join([data['TradingDay'], order.orderTime]), '%Y%m%d %H:%M:%S') if order.cancelTime: order.cancelDatetime = datetime.strptime(' '.join([data['TradingDay'], order.cancelTime]), '%Y%m%d %H:%M:%S') # 推送 self.gateway.onOrder(order) #---------------------------------------------------------------------- def onRtnTrade(self, data): """成交回报TradeInfo""" """{'TradingRole': '\x00', 'BusinessUnit': '', 'TradeType': '\x00', 'UserID': '119247', 'OrderSysID': ' 15591', 'TraderID': '9999cad', 'ExchangeID': 'CFFEX', 'BrokerID': '9999', 'OrderRef': '5', 'SequenceNo': 322, 'TradeSource': '0', 'ParticipantID': '9999', 'OrderLocalID': ' 207', 'InvestorID': '119247', 'InstrumentID': 'IF1811', 'BrokerOrderSeq': 15852, 'OffsetFlag': '0', 'TradeID': ' 11418', 'PriceSource': '\x00', 'TradingDay': '20181101', 'ClearingPartID': '9999', 'SettlementID': 1, 'Volume': 1, 'Price': 3180.0, 'ExchangeInstID': 'IF1811', 'TradeTime': '18:34:33', 'TradeDate': '20181031', 'ClientID': '9999119227', 'HedgeFlag': '1', 'Direction': '0'} """ # 创建报单数据对象 trade = VtTradeData() trade.gatewayName = self.gatewayName # 保存代码和报单号 trade.symbol = data['InstrumentID'] trade.exchange = exchangeMapReverse[data['ExchangeID']] trade.vtSymbol = VN_SEPARATOR.join([trade.symbol, trade.gatewayName]) trade.tradeID = data['TradeID'] trade.vtTradeID = VN_SEPARATOR.join([self.gatewayName, trade.tradeID]) trade.orderID = data['OrderRef'] trade.vtOrderID = VN_SEPARATOR.join([self.gatewayName, trade.orderID]) # 方向 trade.direction = directionMapReverse.get(data['Direction'], '') # 开平 offset = offsetMapReverse.get(data['OffsetFlag'], '') if offset in [OFFSET_CLOSEYESTERDAY,OFFSET_CLOSETODAY]: trade.offset = OFFSET_CLOSE else: trade.offset = offset # 价格、报单量等数值 trade.price = data['Price'] trade.volume = data['Volume'] trade.tradeTime = data['TradeTime'] trade.tradeDatetime =datetime.strptime(' '.join([data['TradeDate'], trade.tradeTime]), '%Y%m%d %H:%M:%S') # 推送 self.gateway.onTrade(trade) #---------------------------------------------------------------------- def onErrRtnOrderInsert(self, data, error): print(data,error) """发单错误回报(交易所)""" """{'TimeCondition': '3', 'BusinessUnit': '', 'UserID': '119247', 'ContingentCondition': '1', 'CombHedgeFlag': '1', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'GTDDate': '', 'StopPrice': 0.0, 'CombOffsetFlag': '0', 'OrderPriceType': '2', 'InvestorID': '119247', 'RequestID': 0, 'InstrumentID': 'I', 'UserForceClose': 0, 'ForceCloseReason': '0', 'VolumeCondition': '1', 'MinVolume': 1, 'LimitPrice': 3178.6, 'IsSwapOrder': 0, 'VolumeTotalOriginal': 1, 'ExchangeID': '', 'OrderRef': '6', 'Direction': '0'} {'ErrorID': 16, 'ErrorMsg': 'CTP:找不到合约'} {'TimeCondition': '3', 'BusinessUnit': '', 'UserID': '119247', 'ContingentCondition': '1', 'CombHedgeFlag': '1', 'IsAutoSuspend': 0, 'BrokerID': '9999', 'GTDDate': '', 'StopPrice': 0.0, 'CombOffsetFlag': '1', 'OrderPriceType': '2', 'InvestorID': '119247', 'RequestID': 0, 'InstrumentID': 'rb1901', 'UserForceClose': 0, 'ForceCloseReason': '0', 'VolumeCondition': '1', 'MinVolume': 1, 'LimitPrice': 3988.0, 'IsSwapOrder': 0, 'VolumeTotalOriginal': 10, 'ExchangeID': 'SHFE', 'OrderRef': '4', 'Direction': '0'} {'ErrorID': 51, 'ErrorMsg': 'CTP:平昨仓位不足'}""" # 推送委托信息 order = VtOrderData() order.gatewayName = self.gatewayName order.symbol = data['InstrumentID'] order.exchange = exchangeMapReverse[data['ExchangeID']] order.vtSymbol = VN_SEPARATOR.join([order.symbol,order.gatewayName]) order.orderID = data['OrderRef'] order.vtOrderID = VN_SEPARATOR.join([self.gatewayName, order.orderID]) order.direction = directionMapReverse.get(data['Direction'], DIRECTION_UNKNOWN) order.offset = offsetMapReverse.get(data['CombOffsetFlag'], OFFSET_UNKNOWN) order.status = STATUS_REJECTED order.price = data['LimitPrice'] order.totalVolume = data['VolumeTotalOriginal'] order.orderDatetime = datetime.now() self.gateway.onOrder(order) # 推送错误信息 err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onErrRtnOrderAction(self, data, error): """撤单错误回报(交易所)""" print(data,error,'撤单错误回报(交易所)撤单错误回报(交易所)') err = VtErrorData() err.gatewayName = self.gatewayName err.errorID = error['ErrorID'] err.errorMsg = error['ErrorMsg'] #err.errorMsg = error['ErrorMsg'].decode('gbk') self.gateway.onError(err) #---------------------------------------------------------------------- def onRtnInstrumentStatus(self, data): """""" pass #---------------------------------------------------------------------- def onRtnTradingNotice(self, data): """""" pass #---------------------------------------------------------------------- def onRtnErrorConditionalOrder(self, data): """""" pass #---------------------------------------------------------------------- def onRtnExecOrder(self, data): """""" pass #---------------------------------------------------------------------- def onErrRtnExecOrderInsert(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnExecOrderAction(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnForQuoteInsert(self, data, error): """""" pass #---------------------------------------------------------------------- def onRtnQuote(self, data): """""" pass #---------------------------------------------------------------------- def onErrRtnQuoteInsert(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnQuoteAction(self, data, error): """""" pass #---------------------------------------------------------------------- def onRtnForQuoteRsp(self, data): """""" pass #---------------------------------------------------------------------- def onRtnCFMMCTradingAccountToken(self, data): """""" pass #---------------------------------------------------------------------- def onRtnLock(self, data): """""" pass #---------------------------------------------------------------------- def onErrRtnLockInsert(self, data, error): """""" pass #---------------------------------------------------------------------- def onRtnCombAction(self, data): """""" pass #---------------------------------------------------------------------- def onErrRtnCombActionInsert(self, data, error): """""" pass #---------------------------------------------------------------------- def onRspQryContractBank(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryParkedOrder(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryParkedOrderAction(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryTradingNotice(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryBrokerTradingParams(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQryBrokerTradingAlgos(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQueryCFMMCTradingAccountToken(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRtnFromBankToFutureByBank(self, data): """""" pass #---------------------------------------------------------------------- def onRtnFromFutureToBankByBank(self, data): """""" pass #---------------------------------------------------------------------- def onRtnRepealFromBankToFutureByBank(self, data): """""" pass #---------------------------------------------------------------------- def onRtnRepealFromFutureToBankByBank(self, data): """""" pass #---------------------------------------------------------------------- def onRtnFromBankToFutureByFuture(self, data): """""" pass #---------------------------------------------------------------------- def onRtnFromFutureToBankByFuture(self, data): """""" pass #---------------------------------------------------------------------- def onRtnRepealFromBankToFutureByFutureManual(self, data): """""" pass #---------------------------------------------------------------------- def onRtnRepealFromFutureToBankByFutureManual(self, data): """""" pass #---------------------------------------------------------------------- def onRtnQueryBankBalanceByFuture(self, data): """""" pass #---------------------------------------------------------------------- def onErrRtnBankToFutureByFuture(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnFutureToBankByFuture(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnRepealBankToFutureByFutureManual(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnRepealFutureToBankByFutureManual(self, data, error): """""" pass #---------------------------------------------------------------------- def onErrRtnQueryBankBalanceByFuture(self, data, error): """""" pass #---------------------------------------------------------------------- def onRtnRepealFromBankToFutureByFuture(self, data): """""" pass #---------------------------------------------------------------------- def onRtnRepealFromFutureToBankByFuture(self, data): """""" pass #---------------------------------------------------------------------- def onRspFromBankToFutureByFuture(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspFromFutureToBankByFuture(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRspQueryBankAccountMoneyByFuture(self, data, error, n, last): """""" pass #---------------------------------------------------------------------- def onRtnOpenAccountByBank(self, data): """""" pass #---------------------------------------------------------------------- def onRtnCancelAccountByBank(self, data): """""" pass #---------------------------------------------------------------------- def onRtnChangeAccountByBank(self, data): """""" pass #---------------------------------------------------------------------- def connect(self, userID, password, brokerID, address, authCode, userProductInfo = 'CTP'): """初始化连接""" self.userID = userID # 账号 self.password = password # 密码 self.brokerID = brokerID # 经纪商代码 self.address = address # 服务器地址 self.authCode = authCode # 验证码 self.userProductInfo = userProductInfo # 产品信息 # 如果尚未建立服务器连接,则进行连接 if not self.connectionStatus: # 创建C++环境中的API对象,这里传入的参数是需要用来保存.con文件的文件夹路径 path = getTempPath(self.gatewayName + '_') self.createFtdcTraderApi(path) # 设置数据同步模式为推送从今日开始所有数据 self.subscribePrivateTopic(0) self.subscribePublicTopic(0) # 注册服务器地址 self.registerFront(self.address) # 初始化连接,成功会调用onFrontConnected self.init() # 若已经连接但尚未登录,则进行登录 else: if self.requireAuthentication and not self.authStatus: self.authenticate() elif not self.loginStatus: self.login() #---------------------------------------------------------------------- def login(self): """连接服务器""" # 如果之前有过登录失败,则不再进行尝试 if self.loginFailed: return # 如果填入了用户名密码等,则登录 if self.userID and self.password and self.brokerID: req = {} req['UserID'] = self.userID req['Password'] = <PASSWORD> req['BrokerID'] = self.brokerID self.reqID += 1 self.reqUserLogin(req, self.reqID) #---------------------------------------------------------------------- def authenticate(self): """申请验证""" if self.userID and self.brokerID and self.authCode and self.userProductInfo: req = {} req['UserID'] = self.userID req['BrokerID'] = self.brokerID req['AuthCode'] = self.authCode req['UserProductInfo'] = self.userProductInfo self.reqID +=1 self.reqAuthenticate(req, self.reqID) #---------------------------------------------------------------------- def qryAccount(self): """查询账户""" self.reqID += 1 self.reqQryTradingAccount({}, self.reqID) #---------------------------------------------------------------------- def qryPosition(self): """查询持仓""" self.reqID += 1 req = {} req['BrokerID'] = self.brokerID req['InvestorID'] = self.userID self.reqQryInvestorPosition(req, self.reqID) #---------------------------------------------------------------------- def sendOrder(self, orderReq): """发单""" """ {'InstrumentID': 'IF1811', 'LimitPrice': 3157.8, 'VolumeTotalOriginal': 1, 'OrderPriceType': '2', 'Direction': '0', 'CombOffsetFlag': '0', 'OrderRef': '1', 'InvestorID': '119247', 'UserID': '119247', 'BrokerID': '9999', 'CombHedgeFlag': '1', 'ContingentCondition': '1', 'ForceCloseReason': '0', 'IsAutoSuspend': 0, 'TimeCondition': '3', 'VolumeCondition': '1', 'MinVolume': 1} """ self.reqID += 1 self.orderRef += 1 req = {} req['InstrumentID'] = orderReq.symbol req['LimitPrice'] = orderReq.price req['VolumeTotalOriginal'] = int(orderReq.volume) # 下面如果由于传入的类型本接口不支持,则会返回空字符串 req['OrderPriceType'] = priceTypeMap.get(orderReq.priceType, '') req['Direction'] = directionMap.get(orderReq.direction, '') req['CombOffsetFlag'] = offsetMap.get(orderReq.offset, '') req['OrderRef'] = str(self.orderRef) req['InvestorID'] = self.userID req['UserID'] = self.userID req['BrokerID'] = self.brokerID req['CombHedgeFlag'] = defineDict['THOST_FTDC_HF_Speculation'] # 投机单 req['ContingentCondition'] = defineDict['THOST_FTDC_CC_Immediately'] # 立即发单 req['ForceCloseReason'] = defineDict['THOST_FTDC_FCC_NotForceClose'] # 非强平 req['IsAutoSuspend'] = 0 # 非自动挂起 req['TimeCondition'] = defineDict['THOST_FTDC_TC_GFD'] # 今日有效 req['VolumeCondition'] = defineDict['THOST_FTDC_VC_AV'] # 任意成交量 req['MinVolume'] = 1 # 最小成交量为1 # if orderReq.offset == OFFSET_OPEN: # req['StopPrice'] = orderReq.price + 15 # 判断FAK和FOK if orderReq.priceType == PRICETYPE_FAK: req['OrderPriceType'] = defineDict["THOST_FTDC_OPT_LimitPrice"] req['TimeCondition'] = defineDict['THOST_FTDC_TC_IOC'] req['VolumeCondition'] = defineDict['THOST_FTDC_VC_AV'] if orderReq.priceType == PRICETYPE_FOK: req['OrderPriceType'] = defineDict["THOST_FTDC_OPT_LimitPrice"] req['TimeCondition'] = defineDict['THOST_FTDC_TC_IOC'] req['VolumeCondition'] = defineDict['THOST_FTDC_VC_CV'] self.reqOrderInsert(req, self.reqID) # 返回订单号(字符串),便于某些算法进行动态管理 self.writeLog('Gateway 发单:%s'%req) vtOrderID = VN_SEPARATOR.join([self.gatewayName, str(self.orderRef)]) return vtOrderID #---------------------------------------------------------------------- def cancelOrder(self, cancelOrderReq): """撤单""" self.reqID += 1 req = {} req['InstrumentID'] = cancelOrderReq.symbol req['ExchangeID'] = cancelOrderReq.exchange req['OrderRef'] = cancelOrderReq.orderID req['FrontID'] = cancelOrderReq.frontID req['SessionID'] = cancelOrderReq.sessionID req['ActionFlag'] = defineDict['THOST_FTDC_AF_Delete'] req['BrokerID'] = self.brokerID req['InvestorID'] = self.userID self.reqOrderAction(req, self.reqID) #---------------------------------------------------------------------- def close(self): """关闭""" self.exit() #---------------------------------------------------------------------- def writeLog(self, content): """发出日志""" log = VtLogData() log.gatewayName = self.gatewayName log.logContent = content self.gateway.onLog(log)
import torch from torch import nn from torch.autograd import Function from .voxel_layer import (dynamic_point_to_voxel_backward, dynamic_point_to_voxel_forward) class _dynamic_scatter(Function): @staticmethod def forward(ctx, feats, coors, reduce_type='max'): """convert kitti points(N, >=3) to voxels. Args: feats: [N, C] float tensor. points features to be reduced into voxels. coors: [N, ndim] int tensor. corresponding voxel coordinates (specifically multi-dim voxel index) of each points. reduce_type: str. reduce op. support 'max', 'sum' and 'mean' Returns: tuple voxel_feats: [M, C] float tensor. reduced features. input features that shares the same voxel coordinates are reduced to one row coordinates: [M, ndim] int tensor, voxel coordinates. """ results = dynamic_point_to_voxel_forward(feats, coors, reduce_type) (voxel_feats, voxel_coors, point2voxel_map, voxel_points_count) = results ctx.reduce_type = reduce_type ctx.save_for_backward(feats, voxel_feats, point2voxel_map, voxel_points_count) ctx.mark_non_differentiable(voxel_coors) return voxel_feats, voxel_coors @staticmethod def backward(ctx, grad_voxel_feats, grad_voxel_coors=None): (feats, voxel_feats, point2voxel_map, voxel_points_count) = ctx.saved_tensors grad_feats = torch.zeros_like(feats) # TODO: whether to use index put or use cuda_backward # To use index put, need point to voxel index dynamic_point_to_voxel_backward(grad_feats, grad_voxel_feats.contiguous(), feats, voxel_feats, point2voxel_map, voxel_points_count, ctx.reduce_type) return grad_feats, None, None dynamic_scatter = _dynamic_scatter.apply class DynamicScatter(nn.Module): def __init__(self, voxel_size, point_cloud_range, average_points: bool): super(DynamicScatter, self).__init__() """Scatters points into voxels, used in the voxel encoder with dynamic voxelization **Note**: The CPU and GPU implementation get the same output, but have numerical difference after summation and division (e.g., 5e-7). Args: average_points (bool): whether to use avg pooling to scatter points into voxel voxel_size (list): list [x, y, z] size of three dimension point_cloud_range (list): [x_min, y_min, z_min, x_max, y_max, z_max] """ self.voxel_size = voxel_size self.point_cloud_range = point_cloud_range self.average_points = average_points def forward_single(self, points, coors): reduce = 'mean' if self.average_points else 'max' return dynamic_scatter(points.contiguous(), coors.contiguous(), reduce) def forward(self, points, coors): """ Args: input: NC points """ if coors.size(-1) == 3: return self.forward_single(points, coors) else: batch_size = coors[-1, 0].int() + 1 voxels, voxel_coors = [], [] for i in range(batch_size): inds = torch.where(coors[:, 0] == i) voxel, voxel_coor = self.forward_single( points[inds], coors[inds][:, 1:]) coor_pad = nn.functional.pad( voxel_coor, (1, 0), mode='constant', value=i) voxel_coors.append(coor_pad) voxels.append(voxel) features = torch.cat(voxels, dim=0) feature_coors = torch.cat(voxel_coors, dim=0) return features, feature_coors def __repr__(self): tmpstr = self.__class__.__name__ + '(' tmpstr += 'voxel_size=' + str(self.voxel_size) tmpstr += ', point_cloud_range=' + str(self.point_cloud_range) tmpstr += ', average_points=' + str(self.average_points) tmpstr += ')' return tmpstr
<gh_stars>10-100 #!/usr/bin/env python ################################################################################# # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ################################################################################ """ This script is a python implementation of the "boot.go" script in "beam-sdks-python-container" project of Apache Beam, see in: https://github.com/apache/beam/blob/release-2.14.0/sdks/python/container/boot.go It is implemented in golang and will introduce unnecessary dependencies if used in pure python project. So we add a python implementation which will be used when the python worker runs in process mode. It downloads and installs users' python artifacts, then launches the python SDK harness of Apache Beam. """ import argparse import os from subprocess import call import grpc import logging import sys from apache_beam.portability.api.beam_provision_api_pb2_grpc import ProvisionServiceStub from apache_beam.portability.api.beam_provision_api_pb2 import GetProvisionInfoRequest from apache_beam.portability.api.endpoints_pb2 import ApiServiceDescriptor from google.protobuf import json_format, text_format def check_not_empty(check_str, error_message): if check_str == "": logging.fatal(error_message) exit(1) python_exec = sys.executable if __name__ == "__main__": # print INFO and higher level messages logging.basicConfig(stream=sys.stdout, level=logging.INFO) parser = argparse.ArgumentParser() parser.add_argument("--id", default="", help="Local identifier (required).") parser.add_argument("--logging_endpoint", default="", help="Logging endpoint (required).") parser.add_argument("--provision_endpoint", default="", help="Provision endpoint (required).") parser.add_argument("--control_endpoint", default="", help="Control endpoint (required).") parser.add_argument("--semi_persist_dir", default="/tmp", help="Local semi-persistent directory (optional).") args = parser.parse_known_args()[0] worker_id = args.id logging_endpoint = args.logging_endpoint provision_endpoint = args.provision_endpoint control_endpoint = args.control_endpoint semi_persist_dir = args.semi_persist_dir check_not_empty(worker_id, "No id provided.") check_not_empty(logging_endpoint, "No logging endpoint provided.") check_not_empty(provision_endpoint, "No provision endpoint provided.") check_not_empty(control_endpoint, "No control endpoint provided.") logging.info("Initializing python harness: %s" % " ".join(sys.argv)) metadata = [("worker_id", worker_id)] # read job information from provision stub with grpc.insecure_channel(provision_endpoint) as channel: client = ProvisionServiceStub(channel=channel) info = client.GetProvisionInfo(GetProvisionInfoRequest(), metadata=metadata).info options = json_format.MessageToJson(info.pipeline_options) os.environ["WORKER_ID"] = worker_id os.environ["PIPELINE_OPTIONS"] = options os.environ["SEMI_PERSISTENT_DIRECTORY"] = semi_persist_dir os.environ["LOGGING_API_SERVICE_DESCRIPTOR"] = text_format.MessageToString( ApiServiceDescriptor(url=logging_endpoint)) os.environ["CONTROL_API_SERVICE_DESCRIPTOR"] = text_format.MessageToString( ApiServiceDescriptor(url=control_endpoint)) env = dict(os.environ) if "FLINK_BOOT_TESTING" in os.environ and os.environ["FLINK_BOOT_TESTING"] == "1": exit(0) call([python_exec, "-m", "pyflink.fn_execution.beam.beam_sdk_worker_main"], stdout=sys.stdout, stderr=sys.stderr, env=env)
#importing libraries import turtle import random import time #creating turtle screen screen = turtle.Screen() screen.title('SNAKE GAME') screen.setup(width = 900, height = 750) screen.tracer(0) turtle.bgcolor('#f0e4d7') turtle.speed(5) turtle.pensize(4) turtle.penup() turtle.goto(-310,250) turtle.pendown() turtle.color('black') turtle.forward(700) turtle.right(90) turtle.forward(600) turtle.right(90) turtle.forward(700) turtle.right(90) turtle.forward(600) turtle.penup() turtle.hideturtle() #score score = 0 delay = 0.1 #snake snake = turtle.Turtle() snake.speed(0) snake.shape('square') snake.color("black") snake.penup() snake.goto(0,0) snake.direction = 'stop' #food fruit = turtle.Turtle() fruit.speed(0) fruit.shape('circle') fruit.color('red') fruit.penup() fruit.goto(30,30) old_fruit=[] #scoring scoring = turtle.Turtle() scoring.speed(0) scoring.color("black") scoring.penup() scoring.hideturtle() scoring.goto(0,300) scoring.write("Score :",align="center",font=("Courier",24,"bold")) #######define how to move def snake_go_up(): if snake.direction != "down": snake.direction = "up" def snake_go_down(): if snake.direction != "up": snake.direction = "down" def snake_go_left(): if snake.direction != "right": snake.direction = "left" def snake_go_right(): if snake.direction != "left": snake.direction = "right" def snake_move(): if snake.direction == "up": y = snake.ycor() snake.sety(y + 20) if snake.direction == "down": y = snake.ycor() snake.sety(y - 20) if snake.direction == "left": x = snake.xcor() snake.setx(x - 20) if snake.direction == "right": x = snake.xcor() snake.setx(x + 20) # Keyboard bindings screen.listen() screen.onkeypress(snake_go_up, "Up") screen.onkeypress(snake_go_down, "Down") screen.onkeypress(snake_go_left, "Left") screen.onkeypress(snake_go_right, "Right") #main loop while True: screen.update() #snake and fruit coliisions if snake.distance(fruit)< 20: x = random.randint(-290,270) y = random.randint(-240,240) fruit.goto(x,y) scoring.clear() score+=1 scoring.write("Score:{}".format(score),align="center",font=("Courier",24,"bold")) delay-=0.001 ## creating new_ball new_fruit = turtle.Turtle() new_fruit.speed(0) new_fruit.shape('square') new_fruit.color('red') new_fruit.penup() old_fruit.append(new_fruit) #adding ball to snake for index in range(len(old_fruit)-1,0,-1): a = old_fruit[index-1].xcor() b = old_fruit[index-1].ycor() old_fruit[index].goto(a,b) if len(old_fruit)>0: a= snake.xcor() b = snake.ycor() old_fruit[0].goto(a,b) snake_move() ##snake and border collision if snake.xcor()>380 or snake.xcor()< -300 or snake.ycor()>240 or snake.ycor()<-240: time.sleep(1) screen.clear() screen.bgcolor('#f0e4d7') scoring.goto(0,0) scoring.write(" GAME OVER \n Your Score is {}".format(score),align="center",font=("Courier",30,"bold")) ## snake collision for food in old_fruit: if food.distance(snake) < 20: time.sleep(1) screen.clear() screen.bgcolor('#f0e4d7') scoring.goto(0,0) scoring.write(" GAME OVER \n Your Score is {}".format(score),align="center",font=("Courier",30,"bold")) time.sleep(delay) turtle.Terminator()
<filename>avalanche/benchmarks/scenarios/online_scenario.py<gh_stars>0 ################################################################################ # Copyright (c) 2022 ContinualAI. # # Copyrights licensed under the MIT License. # # See the accompanying LICENSE file for terms. # # # # Date: 11-04-2022 # # Author(s): <NAME> # # E-mail: <EMAIL> # # Website: avalanche.continualai.org # ################################################################################ from copy import copy from typing import Callable, Iterable, List import torch from avalanche.benchmarks.scenarios.generic_scenario import ( CLExperience, EagerCLStream, CLStream, ExperienceAttribute, CLScenario, ) from avalanche.benchmarks.utils import AvalancheSubset class OnlineCLExperience(CLExperience): """Online CL (OCL) Experience. OCL experiences are created by splitting a larger experience. Therefore, they keep track of the original experience for logging purposes. """ def __init__( self, current_experience: int = None, origin_stream=None, origin_experience=None, is_first_subexp: bool = False, sub_stream_length: int = None, ): """Init. :param current_experience: experience identifier. :param origin_stream: origin stream. :param origin_experience: origin experience used to create self. :param is_first_subexp: whether self is the first in the sub-experiences stream. :param sub_stream_length: the sub-stream length. """ super().__init__(current_experience, origin_stream) self.origin_experience = ExperienceAttribute(origin_experience) self.is_first_subexp = ExperienceAttribute(is_first_subexp) self.sub_stream_length = ExperienceAttribute(sub_stream_length) def fixed_size_experience_split( experience: CLExperience, experience_size: int, shuffle: bool = True, drop_last: bool = False, ): """Returns a lazy stream generated by splitting an experience into smaller ones. Splits the experience in smaller experiences of size `experience_size`. :param experience: The experience to split. :param experience_size: The experience size (number of instances). :param shuffle: If True, instances will be shuffled before splitting. :param drop_last: If True, the last mini-experience will be dropped if not of size `experience_size` :return: The list of datasets that will be used to create the mini-experiences. """ def gen(): exp_dataset = experience.dataset exp_indices = list(range(len(exp_dataset))) if shuffle: exp_indices = torch.as_tensor(exp_indices)[ torch.randperm(len(exp_indices)) ].tolist() init_idx = 0 is_first = True while init_idx < len(exp_indices): final_idx = init_idx + experience_size # Exclusive if final_idx > len(exp_indices): if drop_last: break final_idx = len(exp_indices) exp = OnlineCLExperience( origin_experience=experience, is_first_subexp=is_first ) exp.dataset = AvalancheSubset( exp_dataset, indices=exp_indices[init_idx:final_idx] ) is_first = False yield exp init_idx = final_idx return gen() def split_online_stream( original_stream: EagerCLStream, experience_size: int, shuffle: bool = False, drop_last: bool = False, experience_split_strategy: Callable[ [CLExperience], Iterable[CLExperience] ] = None, ): """Split a stream of large batches to create an online stream of small mini-batches. The resulting stream can be used for Online Continual Learning (OCL) scenarios (or data-incremental, or other online-based settings). For efficiency reasons, the resulting stream is an iterator, generating experience on-demand. :param original_stream: The stream with the original data. :param experience_size: The size of the experience, as an int. Ignored if `custom_split_strategy` is used. :param shuffle: If True, experiences will be split by first shuffling instances in each experience. This will use the default PyTorch random number generator at its current state. Defaults to False. Ignored if `experience_split_strategy` is used. :param drop_last: If True, if the last experience doesn't contain `experience_size` instances, then the last experience will be dropped. Defaults to False. Ignored if `experience_split_strategy` is used. :param experience_split_strategy: A function that implements a custom splitting strategy. The function must accept an experience and return an experience's iterator. Defaults to None, which means that the standard splitting strategy will be used (which creates experiences of size `experience_size`). A good starting to understand the mechanism is to look at the implementation of the standard splitting function :func:`fixed_size_experience_split_strategy`. :return: A lazy online stream with experiences of size `experience_size`. """ if experience_split_strategy is None: def split_foo(exp: CLExperience, size: int): return fixed_size_experience_split(exp, size, shuffle, drop_last) def exps_iter(): for exp in original_stream: for sub_exp in split_foo(exp, experience_size): yield exp return CLStream( name=original_stream.name, exps_iter=exps_iter(), set_stream_info=True ) class OnlineCLScenario(CLScenario): def __init__( self, original_streams: List[EagerCLStream], experience_size: int = 10, stream_split_strategy="fixed_size_split", ): if stream_split_strategy == "fixed_size_split": def split_foo(s): return split_online_stream(s, experience_size) else: raise ValueError("Unknown experience split strategy") streams_dict = {s.name: s for s in original_streams} if "train" not in streams_dict: raise ValueError("Missing train stream for `original_streams`.") online_train_stream = split_foo(streams_dict["train"]) streams = [online_train_stream] for s in original_streams: s = copy(s) s.name = "original_" + s.name streams.append(s) super().__init__(streams)
<reponame>rdo-infra/ci-conf #!/usr/bin/env python import csv import json import os import re import sys import time from datetime import datetime from io import StringIO from tempfile import mkstemp import click import dlrnapi_client import requests import yaml from dlrnapi_client.rest import ApiException from jinja2 import Environment, FileSystemLoader from rich import print as rich_print from rich.console import Console from rich.table import Table from urllib3.exceptions import InsecureRequestWarning console = Console() def date_diff_in_seconds(dt2, dt1): timedelta = dt2 - dt1 return timedelta.days * 24 * 3600 + timedelta.seconds def dhms_from_seconds(seconds): minutes, seconds = divmod(seconds, 60) hours, minutes = divmod(minutes, 60) return (hours, minutes, seconds) def strip_date_time_from_string(input_string): regex_object = re.compile(r'[\d*-]*\d* [\d*:]*') return regex_object.search(input_string).group() def convert_string_date_object(date_string): return datetime.strptime(date_string, '%Y-%m-%d %H:%M:%S') def download_file(url): requests.packages.urllib3.disable_warnings( category=InsecureRequestWarning) response = requests.get(url, stream=True, verify=False) response.raise_for_status() file_descriptor, path = mkstemp(prefix="job-output-") with open(path, "wb") as file: for chunk in response.iter_content(chunk_size=1024): if chunk: file.write(chunk) os.close(file_descriptor) return path def delete_file(path): os.remove(path) def find_job_run_time(url): try: path = download_file(url + "/job-output.txt") except requests.exceptions.RequestException: return "N/A" with open(path, "r") as file: first_line = file.readline() for last_line in file: pass start_time = strip_date_time_from_string(first_line) start_time_ob = convert_string_date_object(start_time) end_time = strip_date_time_from_string(last_line) end_time_ob = convert_string_date_object(end_time) hours, minutes, seconds = dhms_from_seconds( date_diff_in_seconds(end_time_ob, start_time_ob)) delete_file(path) return f"{hours} hr {minutes} mins {seconds} secs" def find_failure_reason(url): try: path = download_file(url + "/logs/failures_file") except requests.exceptions.RequestException: return "N/A" with open(path, "r") as file: first_line = file.readline() delete_file(path) return first_line.rstrip() def web_scrape(url): try: requests.packages.urllib3.disable_warnings( category=InsecureRequestWarning) response = requests.get(url, verify=False) response.raise_for_status() except requests.exceptions.HTTPError as err: raise SystemExit(err) except requests.exceptions.RequestException as error: raise SystemExit(error) return response.text def url_response_in_yaml(url): text_response = web_scrape(url) processed_data = yaml.safe_load(text_response) return processed_data def gather_basic_info_from_criteria(url): criteria_content = url_response_in_yaml(url) api_url = criteria_content['api_url'] base_url = criteria_content['base_url'] return api_url, base_url def find_jobs_in_integration_criteria(url, promotion_name='current-tripleo'): criteria_content = url_response_in_yaml(url) return criteria_content['promotions'][promotion_name]['criteria'] def find_jobs_in_component_criteria(url, component): criteria_content = url_response_in_yaml(url) return criteria_content['promoted-components'][component] def fetch_hashes_from_commit_yaml(url): """ This function finds commit hash, distro hash, extended_hash from commit.yaml :param url for commit.yaml :returns strings for commit_hash, distro_hash, extended_hash """ commit_yaml_content = url_response_in_yaml(url) commit_hash = commit_yaml_content['commits'][0]['commit_hash'] distro_hash = commit_yaml_content['commits'][0]['distro_hash'] extended_hash = commit_yaml_content['commits'][0]['extended_hash'] return commit_hash, distro_hash, extended_hash def find_results_from_dlrn_agg(api_url, test_hash): api_client = dlrnapi_client.ApiClient(host=api_url) api_instance = dlrnapi_client.DefaultApi(api_client) params = dlrnapi_client.AggQuery(aggregate_hash=test_hash) api_response = api_instance.api_agg_status_get(params=params) return api_response def format_ts_from_last_modified(ts, pattern='%a, %d %b %Y %H:%M:%S %Z'): ts = datetime.strptime(ts, pattern) return int(time.mktime(ts.timetuple())) # get the date of the consistent link in dlrn def get_consistent(url, component=None): if "centos7" not in url: dlrn_tag = "/promoted-components" short_url = url.split("/")[:-5] else: dlrn_tag = "/consistent" short_url = url.split("/")[:-3] short_url = "/".join(short_url) if component is None: # integration build, use last promoted_components date response = requests.get(short_url + dlrn_tag + '/delorean.repo') if response.ok: cd = response.headers['Last-Modified'] consistent_date = format_ts_from_last_modified(cd) else: return None else: # TO-DO normalize component and intergration config short_url = (short_url + '/component/' + component + '/consistent/delorean.repo') response = requests.get(short_url) if response.ok: cd = response.headers['Last-Modified'] consistent_date = format_ts_from_last_modified(cd) else: return None return consistent_date def get_dlrn_versions_csv(base_url, component, tag): if component: control_tag = "{}/component/{}/{}/versions.csv".format(base_url, component, tag) else: control_tag = "{}/{}/versions.csv".format(base_url, tag) return control_tag def get_csv(url): response = requests.get(url) if response.ok: content = response.content.decode('utf-8') f = StringIO(content) reader = csv.reader(f, delimiter=',') return [content, reader] def get_diff(component, control_tag, file1, test_tag, file2): # compare the raw string if file1[0] == file2[0]: return False else: # for the line by line diff, use csv content table = Table(show_header=True, header_style="bold") table.add_column(control_tag, style="dim", width=85) table.add_column(test_tag, style="dim", width=85) for f1, f2 in zip(file1[1], file2[1]): if f1 != f2: table.add_row(str(f1[9]), str(f2[9])) return table def get_dlrn_promotions(api_url, promotion_name, aggregate_hash=None, commit_hash=None, distro_hash=None, component=None): api_client = dlrnapi_client.ApiClient(host=api_url) api_instance = dlrnapi_client.DefaultApi(api_client) query = dlrnapi_client.PromotionQuery(limit=1, promote_name=promotion_name) if component: query.component = component pr = api_instance.api_promotions_get_with_http_info(query)[0][0] consistent = get_consistent(pr.repo_url, component) promotion = {} promotion = pr.to_dict() promotion['lastest_build'] = consistent return promotion def find_results_from_dlrn_repo_status(api_url, commit_hash, distro_hash, extended_hash): """ This function returns api_response from dlrn for a particular commit_hash, distro_hash, extended_hash. https://github.com/softwarefactory-project/dlrnapi_client/blob/master/ docs/DefaultApi.md#api_repo_status_get :param api_url: the dlrn api endpoint for a particular release :param commit_hash: For a particular repo, commit.yaml contains this info. :param distro_hash: For a particular repo, commit.yaml contains this info. :param extended_hash: For a particular repo, commit.yaml contains this info. :return api_response: from dlrnapi server containing result of passing/failing jobs """ if extended_hash == "None": extended_hash = None api_client = dlrnapi_client.ApiClient(host=api_url) api_instance = dlrnapi_client.DefaultApi(api_client) params = dlrnapi_client.Params2(commit_hash=commit_hash, distro_hash=distro_hash, extended_hash=extended_hash) try: api_response = api_instance.api_repo_status_get(params=params) except ApiException as err: print("Exception when calling DefaultApi->api_repo_status_get:" " %s\n" % err) return api_response def conclude_results_from_dlrn(api_response): passed_jobs = set() all_jobs_result_available = set() for job in api_response: all_jobs_result_available.add(job.job_id) if job.success: passed_jobs.add(job.job_id) failed_jobs = all_jobs_result_available.difference(passed_jobs) return all_jobs_result_available, passed_jobs, failed_jobs def get_job_history(job_name, zuul, component=None): if 'rdo' in zuul or 'redhat' in zuul: url = zuul + "?job_name={}".format(job_name) else: # upstream upstream_job = job_name.split("-") # remove periodic- del upstream_job[0] # remove -branch del upstream_job[-1] if component: # component jobs remove both -master and -component del upstream_job[-1] upstream_job = '-'.join([str(elem) for elem in upstream_job]) url = zuul + "?job_name={}".format(upstream_job) out = json.loads(web_scrape(url)) # key job_name, value = { SUCCESS: count, # FAILURE: count, # OTHER: count} job_history = {} job_history[job_name] = {'SUCCESS': 0, 'FAILURE': 0, 'OTHER': 0} limit = 5 for index, execution in enumerate(out): if index == limit: break if execution['result'] == "SUCCESS": job_history[job_name]['SUCCESS'] += 1 elif execution['result'] == "FAILURE": job_history[job_name]['FAILURE'] += 1 else: job_history[job_name]['OTHER'] += 1 return job_history def latest_job_results_url(api_response, all_jobs): logs_job = {} for particular_job in all_jobs: latest_log = {} for job in api_response: if job.job_id == particular_job: latest_log[job.timestamp] = job.url logs_job[particular_job] = latest_log[max(latest_log.keys())] return logs_job def print_a_set_in_table(input_set, header="Job name"): table = Table(show_header=True, header_style="bold") table.add_column(header, style="dim", width=80) for job in input_set: table.add_row(job) console.print(table) def print_failed_in_criteria(input_set, config, stream, compare_upstream, header="Job name", component=None): table = Table(show_header=True, header_style="bold") table.add_column(header, width=80) table.add_column("Integration PASSED History", width=15) table.add_column("Integration FAILURE History", width=15) table.add_column("Integration Other History", width=15) if compare_upstream: table.add_column("Upstream PASSED History", width=10) table.add_column("Upstream FAILURE History", width=10) table.add_column("Upstream Other History", width=10) for job in input_set: int_history = get_job_history(job, config[stream]['periodic_builds_url'], component) if compare_upstream: upstream_builds_url = config[stream]['upstream_builds_url'] # do not look for ovb jobs in upstream if "featureset" not in job: up_history = get_job_history(job, upstream_builds_url, component) table.add_row(job, str(int_history[job]['SUCCESS']), str(int_history[job]['FAILURE']), str(int_history[job]['OTHER']), str(up_history[job]['SUCCESS']), str(up_history[job]['FAILURE']), str(up_history[job]['OTHER'])) else: table.add_row(job, str(int_history[job]['SUCCESS']), str(int_history[job]['FAILURE']), str(int_history[job]['OTHER'])) console.print(table) def load_conf_file(config_file, key): config = {} with open(config_file, "r") as file: config = yaml.safe_load(file) return config def influxdb_jobs(jobs_result): # https://docs.influxdata.com/influxdb/v2.0/reference/syntax/line-protocol/ # jobs_result = the measurement # job_type is a tag, note the space # rest of the values are fields in a row of data # grafana can only color code w/ numbers, not text # 0 = failed, 5 = pending, 9 = success # grafana thresholds. if jobs_result['status'] == "failed": jobs_result['status'] = 0 elif jobs_result['status'] == "pending": jobs_result['status'] = 5 elif jobs_result['status'] == "passed": jobs_result['status'] = 9 results_influxdb_line = ('jobs_result,' 'job_type={job_type},' 'job_name={job},' 'release={release} ' 'name="{promote_name}",' 'test_hash="{test_hash}",' 'criteria="{criteria}",' 'status="{status}",' 'logs="{logs}",' 'failure_reason="{failure_reason}",' 'duration="{duration}",' 'component="{component}",' 'distro="{distro}"') if jobs_result['component'] is None: jobs_result['job_type'] = "integration" else: jobs_result['job_type'] = "component" return results_influxdb_line.format(**jobs_result) def influxdb_promo(promotion): # grafana renders epoch only w/ * 1000 gr_promotion_date = str(int(promotion['timestamp']) * 1000000000) gr_latest_build = str(int(promotion['lastest_build']) * 1000) promotion['grafana_timestamp'] = gr_promotion_date promotion['grafana_latest_build'] = gr_latest_build promotion_influxdb_line = ("dlrn-promotion," "release={release},distro={distro}," "promo_name={promote_name} " "commit_hash=\"{commit_hash}\"," "distro_hash=\"{distro_hash}\"," "aggregate_hash=\"{aggregate_hash}\"," "repo_hash=\"{repo_hash}\"," "repo_url=\"{repo_url}\"," "latest_build_date={grafana_latest_build}," "component=\"{component}\"," "promotion_details=\"{dlrn_details}\"," "extended_hash=\"{extended_hash}\" " "{grafana_timestamp}") return promotion_influxdb_line.format(**promotion) def render_testproject_yaml(jobs, hash, stream, config): jobs_list = jobs path = os.path.dirname(__file__) file_loader = FileSystemLoader(path + '/templates') env = Environment(loader=file_loader) template = env.get_template('.zuul.yaml.j2') output = template.render(jobs=jobs_list, hash=hash) print("\n\n###### testproject to rerun required jobs ######") print(config[stream]['testproject_url'] + "\n") print(output) def track_integration_promotion(args, config): distro = args['distro'] release = args['release'] aggregate_hash = args['aggregate_hash'] influx = args['influx'] stream = args['stream'] compare_upstream = args['compare_upstream'] promotion_name = args['promotion_name'] url = config[stream]['criteria'][distro][release]['int_url'] dlrn_api_url, dlrn_trunk_url = gather_basic_info_from_criteria(url) promotions = get_dlrn_promotions(dlrn_api_url, promotion_name) if distro != "centos-7": md5sum_url = dlrn_trunk_url + aggregate_hash + '/delorean.repo.md5' test_hash = web_scrape(md5sum_url) api_response = find_results_from_dlrn_agg(dlrn_api_url, test_hash) else: commit_url = dlrn_trunk_url + aggregate_hash + '/commit.yaml' commit_hash, distro_hash, extended_hash = fetch_hashes_from_commit_yaml( commit_url) api_response = find_results_from_dlrn_repo_status(dlrn_api_url, commit_hash, distro_hash, extended_hash) test_hash = commit_hash (all_jobs_result_available, passed_jobs, failed_jobs) = conclude_results_from_dlrn(api_response) jobs_in_criteria = set(find_jobs_in_integration_criteria( url, promotion_name=promotion_name)) jobs_which_need_pass_to_promote = jobs_in_criteria.difference(passed_jobs) jobs_with_no_result = jobs_in_criteria.difference(all_jobs_result_available) all_jobs = all_jobs_result_available.union(jobs_with_no_result) # get the dlrn details, hash under test ( hut ) and promoted hash ( ph ) if distro != "centos-7": dlrn_api_suffix = "api/civotes_agg_detail.html?ref_hash=" # hash under test hut = "{}/{}{}".format(dlrn_api_url, dlrn_api_suffix, test_hash) # promoted hash ph = "{}/{}{}".format(dlrn_api_url, dlrn_api_suffix, promotions['aggregate_hash']) else: dlrn_api_suffix = "api/civotes_detail.html?commit_hash=" # hash under test hut = "{}/{}{}&distro_hash={}".format(dlrn_api_url, dlrn_api_suffix, commit_hash, distro_hash) # promoted hash ph = "{}/{}{}&distro_hash={}".format(dlrn_api_url, dlrn_api_suffix, promotions['commit_hash'], promotions['distro_hash']) if influx: # NOTE(dviroel): excluding jobs results from influx when promotion_name # is "current-tripleo-rdo" since we are not using this info anywhere. if promotion_name != 'current-tripleo-rdo': # print out jobs in influxdb format log_urls = latest_job_results_url( api_response, all_jobs_result_available) for job in all_jobs: log_url = log_urls.get(job, "N/A") if job in passed_jobs: status = 'passed' elif job in failed_jobs: status = 'failed' else: status = 'pending' if status == 'failed': failure_reason = find_failure_reason(log_url) else: failure_reason = "N/A" jobs_result = {} jobs_result['release'] = release jobs_result['promote_name'] = promotion_name jobs_result['job'] = job jobs_result['test_hash'] = test_hash jobs_result['component'] = None jobs_result['criteria'] = job in jobs_in_criteria jobs_result['status'] = status jobs_result['logs'] = log_url jobs_result['failure_reason'] = failure_reason jobs_result['duration'] = find_job_run_time( log_url) jobs_result['distro'] = distro print(influxdb_jobs(jobs_result)) # print out last promotions in influxdb format promotions['release'] = release promotions['distro'] = distro promotions['dlrn_details'] = ph print(influxdb_promo(promotions)) else: last_p = datetime.utcfromtimestamp(promotions['timestamp']) console.print(f"Hash under test: {hut}", f"\nlast_promotion={last_p}") print_a_set_in_table(passed_jobs, "Jobs which passed:") print_a_set_in_table(failed_jobs, "Jobs which failed:") print_a_set_in_table(jobs_with_no_result, "Pending running jobs") needed_txt = ("Jobs which are in promotion criteria and need " "pass to promote the Hash:") print_failed_in_criteria(jobs_which_need_pass_to_promote, config, stream, compare_upstream, needed_txt) console.print("Logs of jobs which are failing:-") log_urls = latest_job_results_url( api_response, failed_jobs) for value in log_urls.values(): console.print(value) # get package diff for the integration test # control_url c_url = get_dlrn_versions_csv(dlrn_trunk_url, None, promotion_name) # test_url, what is currently getting tested t_url = get_dlrn_versions_csv(dlrn_trunk_url, None, aggregate_hash) c_csv = get_csv(c_url) t_csv = get_csv(t_url) pkg_diff = get_diff(None, promotion_name, c_csv, aggregate_hash, t_csv) if pkg_diff: console.print("\n Packages Tested") rich_print(pkg_diff) # jobs_which_need_pass_to_promote are any job that hasn't registered # success w/ dlrn. jobs_with_no_result are any jobs in pending. # We only want test project config for jobs that have completed. tp_jobs = jobs_which_need_pass_to_promote - jobs_with_no_result if tp_jobs: render_testproject_yaml(tp_jobs, test_hash, stream, config) def track_component_promotion(cargs, config): """ Find the failing jobs which are blocking promotion of a component. :param release: The OpenStack release e.g. wallaby :param component: """ distro = cargs['distro'] release = cargs['release'] influx = cargs['influx'] test_component = cargs['component'] stream = cargs['stream'] compare_upstream = cargs['compare_upstream'] url = config[stream]['criteria'][distro][release]['comp_url'] dlrn_api_url, dlrn_trunk_url = gather_basic_info_from_criteria(url) if distro == "centos-7": raise Exception("centos-7 components do not exist") if test_component == "all": all_components = ["baremetal", "cinder", "clients", "cloudops", "common", "compute", "glance", "manila", "network", "octavia", "security", "swift", "tempest", "tripleo", "ui", "validation"] pkg_diff = None else: all_components = [test_component] # get package diff for the component # control_url c_url = get_dlrn_versions_csv(dlrn_trunk_url, all_components[0], "current-tripleo") # test_url, what is currently getting tested t_url = get_dlrn_versions_csv(dlrn_trunk_url, all_components[0], "component-ci-testing") c_csv = get_csv(c_url) t_csv = get_csv(t_url) pkg_diff = get_diff(all_components[0], "current-tripleo", c_csv, "component-ci-testing", t_csv) for component in all_components: commit_url = '{}component/{}/component-ci-testing/commit.yaml'.format( dlrn_trunk_url, component) commit_hash, distro_hash, extended_hash = fetch_hashes_from_commit_yaml( commit_url) api_response = find_results_from_dlrn_repo_status(dlrn_api_url, commit_hash, distro_hash, extended_hash) # component promotion details promotions = get_dlrn_promotions(dlrn_api_url, "promoted-components", component=component) dlrn_api_suffix = "api/civotes_detail.html?commit_hash=" # hash under test hut = "{}/{}{}&distro_hash={}".format(dlrn_api_url, dlrn_api_suffix, commit_hash, distro_hash) ph = "{}/{}{}&distro_hash={}".format(dlrn_api_url, dlrn_api_suffix, promotions['commit_hash'], promotions['distro_hash']) (all_jobs_result_available, passed_jobs, failed_jobs) = conclude_results_from_dlrn(api_response) if 'consistent' in all_jobs_result_available: all_jobs_result_available.remove('consistent') if 'consistent' in passed_jobs: passed_jobs.remove('consistent') if 'consistent' in failed_jobs: failed_jobs.remove('consistent') jobs_in_criteria = set(find_jobs_in_component_criteria(url, component)) jobs_which_need_pass_to_promote = jobs_in_criteria.difference( passed_jobs) jobs_with_no_result = jobs_in_criteria.difference( all_jobs_result_available) all_jobs = all_jobs_result_available.union(jobs_with_no_result) if influx: log_urls = latest_job_results_url( api_response, all_jobs_result_available) for job in all_jobs: log_url = log_urls.get(job, "N/A") if job in passed_jobs: status = 'passed' elif job in failed_jobs: status = 'failed' else: status = 'pending' if status == 'failed': failure_reason = find_failure_reason(log_url) else: failure_reason = "N/A" jobs_result = {} jobs_result['release'] = release jobs_result['promote_name'] = "promoted-components" jobs_result['job'] = job jobs_result['test_hash'] = commit_hash + '_' + distro_hash[0:8] jobs_result['component'] = component jobs_result['criteria'] = job in jobs_in_criteria jobs_result['status'] = status jobs_result['logs'] = log_url jobs_result['failure_reason'] = failure_reason jobs_result['duration'] = find_job_run_time( log_url) jobs_result['distro'] = distro # print out jobs in influxdb format print(influxdb_jobs(jobs_result)) # print out promtions in influxdb format promotions['release'] = release promotions['distro'] = distro promotions['dlrn_details'] = ph print(influxdb_promo(promotions)) else: log_urls = latest_job_results_url( api_response, failed_jobs) header = ("{} component jobs which need pass to promote " "the hash: ").format(component) if failed_jobs: component_status = "Red" elif not jobs_which_need_pass_to_promote: component_status = "Green" else: component_status = "Yellow" last_p = datetime.utcfromtimestamp(promotions['timestamp']) console.print(f"{component} component", f"status={component_status}", f"last_promotion={last_p}", f"\nHash_under_test={hut}") print_a_set_in_table(passed_jobs, "Jobs which passed:") if component_status != "Green": print_a_set_in_table(failed_jobs, "Jobs which failed:") print_a_set_in_table(jobs_with_no_result, "Pending running jobs") print_failed_in_criteria(jobs_which_need_pass_to_promote, config, stream, compare_upstream, header, component) if component_status == "Red": console.print("Logs of failing jobs:") for value in log_urls.values(): console.print(value) if pkg_diff: console.print("\nPackages Tested: {}".format(all_components[0])) rich_print(pkg_diff) print('\n') # jobs_which_need_pass_to_promote are any job that hasn't registered # success w/ dlrn. jobs_with_no_result are any jobs in pending. # We only want test project config for jobs that have completed. tp_jobs = jobs_which_need_pass_to_promote - jobs_with_no_result # execute if there are failing jobs in criteria and if # you are only looking at one component and not all components if tp_jobs and len(all_components) == 1: render_testproject_yaml(tp_jobs, commit_hash, stream, config) @ click.command() @ click.option("--release", default='master', type=click.Choice(['master', 'wallaby', 'victoria', 'ussuri', 'train', 'stein', 'queens', 'osp17', 'osp16-2'])) @ click.option("--distro", default='centos-8', type=click.Choice(['centos-8', 'centos-9', 'centos-7', 'rhel-8', 'rhel-9'])) @ click.option("--component", type=click.Choice(["all", "baremetal", "cinder", "clients", "cloudops", "common", "compute", "glance", "manila", "network", "octavia", "security", "swift", "tempest", "tripleo", "ui", "validation"])) @ click.option("--influx", is_flag=True, default=False) @ click.option("--compare_upstream", is_flag=True, default=False) @ click.option("--aggregate_hash", required=False, default="tripleo-ci-testing", # TO-DO w/ tripleo-get-hash help=("default:tripleo-ci-testing" "\nexample:tripleo-ci-testing/e6/ad/e6ad...")) @ click.option("--promotion_name", required=False, default="current-tripleo", type=click.Choice(["current-tripleo", "current-tripleo-rdo"])) @ click.option("--config_file", default=os.path.dirname(__file__) + '/conf_ruck_rover.yaml') def main(release, distro, config_file, influx=False, component=None, compare_upstream=False, aggregate_hash="tripleo-ci-testing", promotion_name="current-tripleo"): if release in ('osp16-2', 'osp17'): stream = 'downstream' if config_file != os.path.dirname(__file__) + '/conf_ruck_rover.yaml': print('using custom config file: {}'.format(config_file)) else: downstream_urls = 'https://url.corp.redhat.com/ruck-rover-0' config_file = download_file(downstream_urls) config = load_conf_file(config_file, "downstream") else: config = load_conf_file(config_file, "upstream") stream = 'upstream' # come on click, not sure how to get click params. c_args = {} for i in dir(): # fix-me eval c_args[i] = eval(i) # pylint: disable=eval-used c_args["stream"] = stream if release in ('stein', 'queens'): config['distro'] = "centos-7" if release == 'osp16-2': config['distro'] = "rhel-8" c_args['distro'] = "rhel-8" # prompt user: #osp-17 can be rhel-8 or rhel-9 if release == 'osp17' and distro == 'centos-8': print("\nOSP-17 can be either --distro rhel-8 or --distro rhel-9") print("ERROR: please set the distro option on the cli") sys.exit(1) if component: track_component_promotion(c_args, config) else: track_integration_promotion(c_args, config) if __name__ == '__main__': main() # pylint: disable=no-value-for-parameter
''' Neural networks. Forward propagation in an already trained network in TensorFlow 2.0. Computing the regularised cost function. TF 2.0: sigmoid_step_option 0-4 all take 0.1-0.2 sec. <NAME> 09-19/03/2018, 31/01-07/02, 04/03/2020 ''' import numpy as np import scipy.io # to open Matlab's .mat files import tensorflow as tf from tensorflow.python.ops import math_ops import matplotlib.pyplot as plt import time ### User input ### data_pipeline_option = 0 # {0, 1} sigmoid_step_option = 0 # {0, 1, 2, 3, 4} loss_regularization_option = 0 # {0, 1, 2} digit_selection_option = 0 # {0, 1} - use 0 because 1 makes it ~1.5 sec slower batch_size = 5000 # try: 50 or 3900 or 4999 or 5000 (which is X.shape[0]) or 50000 ### End of input ### # The network parameters are here for info, they are not actually used. input_layer_size = 400 # 20x20 Input Images of Digits hidden_layer_size = 25 # 25 hidden units num_labels = 10 # 10 labels, from 1 to 10 # (note that we have mapped "0" to label 10) # =========== Part 1: Loading [and Visualizing] Data ============= data = scipy.io.loadmat('../machine-learning-ex4/ex4/ex4data1.mat') X = data['X'] y = data['y'] y = y % 10 # Transforming 10 to 0, which is its original meaning. # ================ Part 2: Loading Pameters ================ # In this part of the exercise, we load some pre-initialized # neural network parameters. params = scipy.io.loadmat('../machine-learning-ex4/ex4/ex4weights.mat') Theta1 = params['Theta1'] # Theta1 has size 25 x 401 Theta2 = params['Theta2'] # Theta2 has size 10 x 26 # To narrow computation to a subset of data for quick testing: #X, y = X[1990:2010,:], y[1990:2010,:] # ================ Part 3: Compute Cost (Feedforward) ================ tf.keras.backend.clear_session() # not strictly necessary start_time = time.time() if data_pipeline_option==0: dataset_X = tf.data.Dataset.from_tensor_slices(X).batch(batch_size) #dataset_y = tf.data.Dataset.from_tensor_slices(y).batch(batch_size) # not needed else: dataset = tf.data.Dataset.from_tensor_slices((X,y)).batch(batch_size) # Both options for l0 are good: l0 = tf.keras.layers.Dense(Theta1.shape[0], use_bias=True, activation='sigmoid', kernel_initializer=tf.constant_initializer(Theta1[:,1:].T), bias_initializer=tf.constant_initializer(Theta1[:,0])) #l0 = tf.keras.layers.Dense(Theta1.shape[0], use_bias=True, activation=tf.nn.sigmoid, kernel_initializer=tf.constant_initializer(Theta1[:,1:].T), bias_initializer=tf.constant_initializer(Theta1[:,0])) # No activation is specified, meaning we get the identity function as activation. l1 = tf.keras.layers.Dense(Theta2.shape[0], use_bias=True, kernel_initializer=tf.constant_initializer(Theta2[:,1:].T), bias_initializer=tf.constant_initializer(Theta2[:,0])) # With tf.gather, I permute the 10 columns: digits [1,2,...,9,0] are mapped to digits [0,1,2,...,9], that is, column 9 (digit 0, encoded with position 10 of [1, 2, ... 10]) must come first, the rest must be shifted up by one. if sigmoid_step_option in [0, 3]: # We apply sigmoid function. # Both options work: l1.activation=lambda x: tf.gather(tf.sigmoid(x), tf.concat([tf.constant(9, dtype=tf.int32, shape=[1]), tf.range(0,9, dtype=tf.int32)], 0), axis=1) #l1.activation=lambda x: tf.sigmoid(tf.gather(x, tf.concat([tf.constant(9, dtype=tf.int32, shape=[1]), tf.range(0,9, dtype=tf.int32)], 0), axis=1)) # ...tf.gather(x, np.concatenate(([9], np.arange(0,9))), axis=1)... would do the same with np arrays. else: # sigmoid_step_option in [1, 2, 4]; in these cases sigmoid function is not yet applied. # Here activation=tf.nn.sigmoid would be wrong because l2 (in sigmoid_step_option==1) or # the loss function (in sigmoid_step_option==2) turns the logits values into sigmoid(output), # so there must be no application of sigmoid in the output of this layer. l1.activation=lambda x: tf.gather(x, tf.concat([tf.constant(9, dtype=tf.int32, shape=[1]), tf.range(0,9, dtype=tf.int32)], 0), axis=1) if sigmoid_step_option != 1: layers_model = [l0, l1] else: # sigmoid_step_option=1 # Without specifying kernel_initializer to be the identity matrix, it would multiply with a random matrix! l2 = tf.keras.layers.Dense(Theta2.shape[0], activation='sigmoid', kernel_initializer=tf.constant_initializer(np.eye(Theta2.shape[0])), use_bias=False) layers_model = [l0, l1, l2] # For sigmoid_step_option in [0, 1, 3], pred has been fed through a sigmoid function, it's in [0; 1]. # For sigmoid_step_option in [2, 4], pred has not been fed through a sigmoid function, it's in ]-infty; infty[. model = tf.keras.Sequential(layers_model) if data_pipeline_option==0: pred = model.predict(dataset_X) else: dataset_X = dataset.map(lambda x, y: x) pred = model.predict(dataset_X) # y needs to be turned into one hot encoding ''' # Version for TensorFlow 1.x y_idcc = tf.feature_column.categorical_column_with_identity(key='labels', num_buckets=10) y_onehot = tf.feature_column.indicator_column(y_idcc) y_layer = tf.feature_column.input_layer({'labels': y_temp}, y_onehot) loss = tf.losses.sigmoid_cross_entropy(y_layer, logits) * 10 ''' ''' # This works but it is very clumsy and about 0.2 sec slower than tf.one_hot(). l10 = tf.feature_column.categorical_column_with_identity(key='labels', num_buckets=10) l11 = tf.feature_column.indicator_column(l10) l12 = tf.keras.layers.DenseFeatures(l11) layers_y = [l12] model_y = tf.keras.Sequential(layers_y) y_onehot = model_y.predict({'labels': y}).astype(np.int16) ''' y_onehot = tf.one_hot(y.reshape(-1), 10) # Multiplying by 10 is needed only because the course material divides by number of samples but not by number of classes when taking the mean. if sigmoid_step_option in [0, 1]: # These all work well: #loss = tf.math.reduce_mean(tf.math.add(tf.math.multiply(y_onehot, tf.math.negative(tf.math.log(pred))), tf.math.multiply(tf.math.subtract(1.0, y_onehot), tf.math.negative((tf.math.log(tf.math.subtract(1.0, pred))))))) * 10 #loss = tf.math.reduce_mean(tf.math.multiply(y_onehot, -tf.math.log(pred)) + tf.math.multiply(1-y_onehot, -(tf.math.log(1-pred)))) * 10 #loss = (-tf.reduce_sum(y_onehot * tf.math.log(pred))-tf.reduce_sum((1-y_onehot) * tf.math.log(1-pred)))/batch_size #loss = np.mean(np.multiply(y_onehot, -np.log(pred)) + np.multiply(1-y_onehot, -np.log(1-pred)), axis=None) * 10 loss = tf.reduce_mean(tf.keras.losses.binary_crossentropy(y_onehot, pred, from_logits=False)) * 10 #loss = np.mean(tf.keras.losses.binary_crossentropy(y_onehot, pred, from_logits=False).numpy()) * 10 elif sigmoid_step_option==2: # binary_crossentropy() computes -sum_j (t_j log(q_j) + (1-t_j)*log(1-q_j)). loss = tf.reduce_mean(tf.keras.losses.binary_crossentropy(y_onehot, pred, from_logits=True)) * 10 #loss = np.mean(tf.keras.losses.binary_crossentropy(y_onehot, pred, from_logits=True).numpy()) * 10 #loss = tf.reduce_mean(tf.keras.losses.binary_crossentropy(y_onehot, tf.nn.sigmoid(pred), from_logits=False)) * 10 elif sigmoid_step_option==3: ''' https://github.com/tensorflow/tensorflow/blob/r2.0/tensorflow/python/ops/nn_impl.py#L112 shows tf.nn.sigmoid_cross_entropy_with_logits() works as if it applied a sigmoid function to its input. We compensate for this by applying logit function (log(p/(1-p))), which is the inverse of the sigmoid or logistic function. ''' loss = tf.reduce_mean(tf.reduce_sum(tf.nn.sigmoid_cross_entropy_with_logits(labels=tf.cast(y_onehot, dtype=tf.float32), logits=math_ops.log(pred/(1-pred))), axis=1)) else: # if sigmoid_step_option==4 ''' https://github.com/tensorflow/tensorflow/blob/r2.0/tensorflow/python/ops/nn_impl.py#L112 shows tf.nn.sigmoid_cross_entropy_with_logits() works as if it applied a sigmoid function on its input. ''' loss = tf.reduce_mean(tf.reduce_sum(tf.nn.sigmoid_cross_entropy_with_logits(labels=tf.cast(y_onehot, dtype=tf.float32), logits=pred), axis=1)) #loss = tf.reduce_mean(tf.nn.sigmoid_cross_entropy_with_logits(labels=tf.cast(y_onehot, tf.float32), logits=pred)) * 10 # These don't work because categorical_crossentropy() computes something else than what we seek! # categorical_crossentropy() computes -sum_j t_j log(q_j). #loss = tf.reduce_mean(tf.keras.losses.categorical_crossentropy(y_onehot, pred, from_logits=False)) * 10 #loss = np.mean(tf.keras.losses.categorical_crossentropy(y_onehot, pred, from_logits=False).numpy())*10 #loss = np.mean(tf.keras.losses.categorical_crossentropy(tf.constant(y_onehot), tf.constant(pred), from_logits=False).numpy())*10 #loss = np.sum(tf.keras.losses.categorical_crossentropy(y_onehot, pred, from_logits=False).numpy())*10/batch_size #loss = np.sum(tf.keras.losses.categorical_crossentropy(y_onehot.T, pred.T, from_logits=False).numpy())/(10*batch_size) #loss = np.sum(tf.keras.losses.categorical_crossentropy(y_onehot, pred, from_logits=True).numpy())/batch_size #loss = np.mean(tf.keras.losses.categorical_crossentropy(tf.constant(y_onehot), tf.constant(pred), from_logits=True).numpy()) # Selecting which digit # If there were no rearrangement of columns by tf.gather, digits would be stored as [1,2,...,9,0] ##digit = (tf.argmax(pred, axis=1)+1) % 10 ##digit = tf.map_fn(lambda x: (tf.argmax(x, axis=0, output_type=tf.int32)+1) % 10, pred, dtype=tf.int32) # If columns are rearranged by tf.gather, then digits are stored as [0,1,2,...,9]. if digit_selection_option == 0: pred_digit = tf.argmax(pred, axis=1) else: pred_digit = tf.map_fn(lambda x: tf.argmax(x, axis=0, output_type=tf.int32), pred, dtype=tf.int32) pred_np = pred_digit.numpy().reshape(-1,1) # =============== Part 4: Implement Regularization =============== # Once your cost function implementation is correct, you should now # continue to implement the regularization with the cost. lambda0 = 1 # losswp = loss with penalty from regularisation if loss_regularization_option == 0: losswp = loss + lambda0 * 0.5 * (np.sum(Theta1[:,1:]*Theta1[:,1:], axis=None) + np.sum(Theta2[:,1:]*Theta2[:,1:], axis=None)) / len(y) elif loss_regularization_option == 1: losswp = loss + lambda0 * 0.5 * tf.math.reduce_sum(tf.math.square(tf.constant(Theta1[:,1:], dtype=tf.float32))) / len(y)\ + lambda0 * 0.5 * tf.math.reduce_sum(tf.math.square(tf.constant(Theta2[:,1:], dtype=tf.float32))) / len(y) else: regularizer = tf.keras.regularizers.l2(lambda0 * 0.5) losswp = loss + tf.cast(regularizer(Theta1[:,1:]), dtype=tf.float32) / len(y)\ + tf.cast(regularizer(Theta2[:,1:]), dtype=tf.float32) / len(y) print('\nCost at parameters (loaded from ex4weights): {0:.6f}.'.format(loss)) print('Expected loss (approx.): 0.287629.') print('\nRegularised cost at parameters (loaded from ex4weights): {0:.6f}.'.format(losswp)) print('Expected regularised loss (approx.): 0.383770.') print('\nTraining Set Accuracy: {0:.2f}%.'.format(np.mean(pred_np == y) * 100)) print('Expected training accuracy on complete Training Set (approx.): 97.5%.') print('\nTime elapsed: {:.2f} sec'.format(time.time() - start_time))
<filename>pyxllib/debug/specialist/tictoc.py #!/usr/bin/env python3 # -*- coding: utf-8 -*- # @Author : 陈坤泽 # @Email : <EMAIL> # @Date : 2020/09/20 import time import timeit from humanfriendly import format_timespan from pyxllib.text.pupil import shorten, listalign from pyxllib.algo.pupil import natural_sort, ValuesStat __tictoc = """ 基于 pytictoc 代码,做了些自定义扩展 原版备注: Module with class TicToc to replicate the functionality of MATLAB's tic and toc. Documentation: https://pypi.python.org/pypi/pytictoc __author__ = '<NAME>' __version__ = '1.4.0' __version_date__ = '29 April 2017' """ class TicToc: """ Replicate the functionality of MATLAB's tic and toc. #Methods TicToc.tic() #start or re-start the timer TicToc.toc() #print elapsed time since timer start TicToc.tocvalue() #return floating point value of elapsed time since timer start #Attributes TicToc.start #Time from timeit.default_timer() when t.tic() was last called TicToc.end #Time from timeit.default_timer() when t.toc() or t.tocvalue() was last called TicToc.elapsed #t.end - t.start; i.e., time elapsed from t.start when t.toc() or t.tocvalue() was last called """ def __init__(self, title='', *, disable=False): """Create instance of TicToc class.""" self.start = timeit.default_timer() self.end = float('nan') self.elapsed = float('nan') self.title = title self.disable = disable def tic(self): """Start the timer.""" self.start = timeit.default_timer() def toc(self, msg='', restart=False): """ Report time elapsed since last call to tic(). Optional arguments: msg - String to replace default message of 'Elapsed time is' restart - Boolean specifying whether to restart the timer """ self.end = timeit.default_timer() self.elapsed = self.end - self.start if not self.disable: # print(f'{self.title} {msg} {self.elapsed:.3f} 秒.') print(f'{self.title} {msg} elapsed {format_timespan(self.elapsed)}.') if restart: self.start = timeit.default_timer() def tocvalue(self, restart=False): """ Return time elapsed since last call to tic(). Optional argument: restart - Boolean specifying whether to restart the timer """ self.end = timeit.default_timer() self.elapsed = self.end - self.start if restart: self.start = timeit.default_timer() return self.elapsed @staticmethod def process_time(msg='time.process_time():'): """计算从python程序启动到目前为止总用时""" print(f'{msg} {format_timespan(time.process_time())}.') def __enter__(self): """Start the timer when using TicToc in a context manager.""" from pyxllib.debug.specialist import get_xllog if self.title == '__main__' and not self.disable: get_xllog().info(f'time.process_time(): {format_timespan(time.process_time())}.') self.start = timeit.default_timer() def __exit__(self, exc_type, exc_val, exc_tb): """On exit, print time elapsed since entering context manager.""" from pyxllib.debug.specialist import get_xllog elapsed = self.tocvalue() xllog = get_xllog() if exc_tb is None: if not self.disable: xllog.info(f'{self.title} finished in {format_timespan(elapsed)}.') else: xllog.info(f'{self.title} interrupt in {format_timespan(elapsed)},') __timer = """ """ class Timer: """分析性能用的计时器类,支持with语法调用 必须显示地指明每一轮的start()和end(),否则会报错 """ def __init__(self, title=''): """ :param title: 计时器名称 """ # 不同的平台应该使用的计时器不同,这个直接用timeit中的配置最好 self.default_timer = timeit.default_timer # 标题 self.title = title self.data = [] self.start_clock = float('nan') def start(self): self.start_clock = self.default_timer() def stop(self): self.data.append(self.default_timer() - self.start_clock) def report(self, msg=''): """ 报告目前性能统计情况 """ msg = f'{self.title} {msg}' n = len(self.data) if n >= 1: print(msg, '用时(秒) ' + ValuesStat(self.data).summary(valfmt='.3f')) elif n == 1: sum_ = sum(self.data) print(f'{msg} 用时: {sum_:.3f}s') else: # 没有统计数据,则补充执行一次stop后汇报 print(f'{msg} 暂无计时信息') def __enter__(self): return self def __exit__(self, *args): self.report() def performit(title, stmt="pass", setup="pass", repeat=1, number=1, globals=None): """ 在timeit.repeat的基础上,做了层封装 200920周日15:33,简化函数,该函数不再获得执行结果,避免重复运行 :param title: 测试标题、名称功能 :return: 返回原函数单次执行结果 """ data = timeit.repeat(stmt=stmt, setup=setup, repeat=repeat, number=number, globals=globals) print(title, '用时(秒) ' + ValuesStat(data).summary(valfmt='.3f')) return data def perftest(title, stmt="pass", repeat=1, number=1, globals=None, res_width=None, print_=True): """ 与performit的区别是,自己手动循环,记录程序运行结果 :param title: 测试标题、名称功能 :param res_width: 运行结果内容展示的字符上限数 :param print_: 输出报告 :return: 返回原函数单次执行结果 这里为了同时获得表达式返回值,就没有用标注你的timeit.repeat实现了 """ # 1 确保stmt是可调用对象 if callable(stmt): func = stmt else: code = compile(stmt, '', 'eval') def func(): return eval(code, globals) # 2 原函数运行结果(这里要先重载stdout) data = [] res = '' for i in range(repeat): start = time.time() for j in range(number): res = func() data.append(time.time() - start) # 3 报告格式 if res_width is None: # 如果性能报告比较短,只有一次测试,那res_width默认长度可以高一点 res_width = 50 if len(data) > 1 else 200 if res is None: res = '' else: res = '运行结果:' + shorten(str(res), res_width) if print_: print(title, '用时(秒) ' + ValuesStat(data).summary(valfmt='.3f'), res) return data class PerfTest: """ 这里模仿了unittest的机制 v0.0.38 重要改动,将number等参数移到perf操作,而不是类初始化中操作,继承使用上会更简单 """ def perf(self, number=1, repeat=1, globals=None): """ :param number: 有些代码运算过快,可以多次运行迭代为一个单元 :param repeat: 对单元重复执行次数,最后会计算平均值、标准差 关于number和repeat的区别: number张纸量repeat次 如果是纸箱这么厚的纸,number可以不设,默认是1 """ # 1 找到所有perf_为前缀,且callable的函数方法 funcnames = [] for k in dir(self): if k.startswith('perf_'): if callable(getattr(self, k)): funcnames.append(k) # 2 自然排序 funcnames = natural_sort(funcnames) funcnames2 = listalign([fn[5:] for fn in funcnames], 'r') for i, funcname in enumerate(funcnames): perftest(funcnames2[i], getattr(self, funcname), number=number, repeat=repeat, globals=globals)
#!/usr/bin/env python ############################################################################### # $Id$ # # Project: GDAL/OGR Test Suite # Purpose: MG4Lidar Reading Driver testing. # Author: <NAME> <even dot rouault at mines dash paris dot org> # ############################################################################### # Copyright (c) 2010, <NAME> <even dot rouault at mines-paris dot org> # # Permission is hereby granted, free of charge, to any person obtaining a # copy of this software and associated documentation files (the "Software"), # to deal in the Software without restriction, including without limitation # the rights to use, copy, modify, merge, publish, distribute, sublicense, # and/or sell copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS # OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL # THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING # FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER # DEALINGS IN THE SOFTWARE. ############################################################################### import os import sys sys.path.append('../pymod') import gdaltest from osgeo import gdal ############################################################################### # Test reading a MG4Lidar file # def mg4lidar_1(): drv = gdal.GetDriverByName('MG4Lidar') if drv is None: return 'skip' if not gdaltest.download_file('http://home.gdal.org/tmp/GDAL_MG4Lidar_Src.zip', 'GDAL_MG4Lidar_Src.zip'): return 'skip' try: os.stat('tmp/cache/GDAL_MG4Lidar_Src') except OSError: try: gdaltest.unzip('tmp/cache', 'tmp/cache/GDAL_MG4Lidar_Src.zip') try: os.stat('tmp/cache/GDAL_MG4Lidar_Src') except OSError: return 'skip' except OSError: return 'skip' ds = gdal.Open('tmp/cache/GDAL_MG4Lidar_Src/Tetons_200k.view') if ds is None: gdaltest.post_reason('could not open dataset') return 'fail' prj = ds.GetProjectionRef() if prj.find('NAD83 / UTM zone 12N') == -1: gdaltest.post_reason('did not get expected projection') print(prj) return 'success' gt = ds.GetGeoTransform() ref_gt = (504489.919999999983702, 3.078227571115974, 0, 4795848.389999999664724, 0, -3.078259860787739) for i in range(6): if abs(gt[i] - ref_gt[i]) > 1e-6: gdaltest.post_reason('did not get expected geotransform') print(gt) return 'fail' cs = ds.GetRasterBand(1).Checksum() if cs != 13216: gdaltest.post_reason('did not get expected checksum') print(cs) return 'success' cs = ds.GetRasterBand(1).GetOverview(0).Checksum() if cs != 64099: gdaltest.post_reason('did not get expected overview checksum') print(cs) return 'success' ds = None return 'success' gdaltest_list = [ mg4lidar_1] if __name__ == '__main__': gdaltest.setup_run('mg4lidar') gdaltest.run_tests(gdaltest_list) gdaltest.summarize()
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created on Fri Oct 25 08:48:00 2019 Recreated from <NAME> @author: nikkicreange """ #!/usr/bin/python # See http://maggotroot.blogspot.ch/2013/11/constrained-linear-least-squares-in.html for more info ''' A simple library to solve constrained linear least squares problems with sparse and dense matrices. Uses cvxopt library for optimization ''' __author__ = '<NAME>' __email__ = '<EMAIL>' __version__ = '1.0' __date__ = '22.11.2013' __license__ = 'WTFPL' import numpy as np from cvxopt import solvers, matrix, spmatrix, mul import itertools from scipy import sparse def scipy_sparse_to_spmatrix(A): coo = A.tocoo() SP = spmatrix(coo.data, coo.row.tolist(), coo.col.tolist()) return SP def spmatrix_sparse_to_scipy(A): data = np.array(A.V).squeeze() rows = np.array(A.I).squeeze() cols = np.array(A.J).squeeze() return sparse.coo_matrix( (data, (rows, cols)) ) def sparse_None_vstack(A1, A2): if A1 is None: return A2 else: return sparse.vstack([A1, A2]) def numpy_None_vstack(A1, A2): if A1 is None: return A2 else: return np.vstack([A1, A2]) def numpy_None_concatenate(A1, A2): if A1 is None: return A2 else: return np.concatenate([A1, A2]) def get_shape(A): if isinstance(C, spmatrix): return C.size else: return C.shape def numpy_to_cvxopt_matrix(A): if A is None: return A if sparse.issparse(A): if isinstance(A, sparse.spmatrix): return scipy_sparse_to_spmatrix(A) else: return A else: if isinstance(A, np.ndarray): if A.ndim == 1: return matrix(A, (A.shape[0], 1), 'd') else: return matrix(A, A.shape, 'd') else: return A def cvxopt_to_numpy_matrix(A): if A is None: return A if isinstance(A, spmatrix): return spmatrix_sparse_to_scipy(A) elif isinstance(A, matrix): return np.array(A).squeeze() else: return np.array(A).squeeze() def lsqlin(C, d, reg=0, A=None, b=None, Aeq=None, beq=None, \ lb=None, ub=None, x0=None, opts=None): ''' Solve linear constrained l2-regularized least squares. Can handle both dense and sparse matrices. Matlab's lsqlin equivalent. It is actually wrapper around CVXOPT QP solver. min_x ||C*x - d||^2_2 + reg * ||x||^2_2 s.t. A * x <= b Aeq * x = beq lb <= x <= ub Input arguments: C is m x n dense or sparse matrix d is n x 1 dense matrix reg is regularization parameter A is p x n dense or sparse matrix b is p x 1 dense matrix Aeq is q x n dense or sparse matrix beq is q x 1 dense matrix lb is n x 1 matrix or scalar ub is n x 1 matrix or scalar Output arguments: Return dictionary, the output of CVXOPT QP. Dont pass matlab-like empty lists to avoid setting parameters, just use None: lsqlin(C, d, 0.05, None, None, Aeq, beq) #Correct lsqlin(C, d, 0.05, [], [], Aeq, beq) #Wrong! ''' sparse_case = False if sparse.issparse(A): #detects both np and cxopt sparse sparse_case = True #We need A to be scipy sparse, as I couldn't find how #CVXOPT spmatrix can be vstacked if isinstance(A, spmatrix): A = spmatrix_sparse_to_scipy(A) C = numpy_to_cvxopt_matrix(C) d = numpy_to_cvxopt_matrix(d) Q = C.T * C q = - d.T * C nvars = C.size[1] if reg > 0: if sparse_case: I = scipy_sparse_to_spmatrix(sparse.eye(nvars, nvars,\ format='coo')) else: I = matrix(np.eye(nvars), (nvars, nvars), 'd') Q = Q + reg * I lb = cvxopt_to_numpy_matrix(lb) ub = cvxopt_to_numpy_matrix(ub) b = cvxopt_to_numpy_matrix(b) if lb is not None: #Modify 'A' and 'b' to add lb inequalities if lb.size == 1: lb = np.repeat(lb, nvars) if sparse_case: lb_A = -sparse.eye(nvars, nvars, format='coo') A = sparse_None_vstack(A, lb_A) else: lb_A = -np.eye(nvars) A = numpy_None_vstack(A, lb_A) b = numpy_None_concatenate(b, -lb) if ub is not None: #Modify 'A' and 'b' to add ub inequalities if ub.size == 1: ub = np.repeat(ub, nvars) if sparse_case: ub_A = sparse.eye(nvars, nvars, format='coo') A = sparse_None_vstack(A, ub_A) else: ub_A = np.eye(nvars) A = numpy_None_vstack(A, ub_A) b = numpy_None_concatenate(b, ub) #Convert data to CVXOPT format A = numpy_to_cvxopt_matrix(A) Aeq = numpy_to_cvxopt_matrix(Aeq) b = numpy_to_cvxopt_matrix(b) beq = numpy_to_cvxopt_matrix(beq) #Set up options if opts is not None: for k, v in opts.items(): solvers.options[k] = v #Run CVXOPT.SQP solver sol = solvers.qp(Q, q.T, A, b, Aeq, beq, None, x0) return sol def lsqnonneg(C, d, opts): ''' Solves nonnegative linear least-squares problem: min_x ||C*x - d||_2^2, where x >= 0 ''' return lsqlin(C, d, reg = 0, A = None, b = None, Aeq = None, \ beq = None, lb = 0, ub = None, x0 = None, opts = opts)
<gh_stars>0 from flask import render_template,redirect,url_for,abort,request,flash from app.main import main from .forms import UpdateProfile,CreateBlog from flask_login import login_required,current_user from ..email import mail_message from app.models import User,Blog,Comment,Follower from ..import db from app.requests import get_quotes @main.route('/') @login_required def index(): quotes = get_quotes() blogs = Blog.query.all() if request.method == "POST": new_follower = Follower(email = request.form.get("follower")) return render_template("index.html", blogs = blogs, quotes = quotes) def save_picture(form_picture): picture_path =('app/static/photos') return picture_path @main.route('/new_post', methods=['POST','GET']) @login_required def new_blog(): followers = Follower.query.all() form = CreateBlog() if form.validate_on_submit(): title = form.title.data content = form.content.data user_id = current_user._get_current_object().id blog = Blog(title=title,content=content,user_id=user_id) blog.save() for follower in followers: mail_message("New Blog Post","email/new_blog",follower.email,blog=blog) return redirect(url_for('main.index')) flash('You Posted a new Blog') return render_template('newblogs.html', form = form) @main.route('/blog/<id>') @login_required def blog(id): comments = Comment.query.filter_by(blog_id=id).all() blog = Blog.query.get(id) return render_template('blog.html', blog=blog,comments=comments) @main.route('/blog/<blog_id>/update',methods = ['GET','POST']) @login_required def updatedblog(blog_id): blog = Blog.query.get(blog_id) if blog.user != current_user: abort(403) form = CreateBlog() if form.validate_on_submit(): blog.title = form.title.data blog.content = form.content.data db.session.commit() flash("You have updated your Blog!") return redirect(url_for('main.blog',id = blog.id)) if request.method == 'GET': form.title.data = blog.title form.content.data = blog.content return render_template('newblogs.html', form = form) @main.route('/blog/<blog_id>/delete', methods=["DELETE"]) @login_required def delete_post(blog_id): blog = Blog.query.filter_by(blog_id).first() db.session.delete(blog) db.session.commit() if blog.user != current_user: abort(403) blog.delete() flash("blog deleted") return redirect(url_for('main.index')) @main.route('/user/<string:username>') @login_required def user_posts(username): user = User.query.filter_by(username=username).first() blogs = Blog.query.filter_by(user=user) return render_template('post.html',blogs=blogs,user = user) @main.route('/subscribe',methods = ['POST','GET']) @login_required def subscribe(): email = request.form.get('follower') new_follower = Follower(email = email) new_follower.save_follower() mail_message("Subscribed to Blog-1","email/follower",new_follower.email,new_follower=new_follower) flash('Sucessfuly subscribed!') return redirect(url_for('main.index')) @main.route('/profile',methods = ['POST','GET']) @login_required def profile(): form = UpdateProfile() if form.validate_on_submit(): if form.profile_pic.data: picture_file = save_picture(form.profile_pic.data) current_user.profile_pic_path = picture_file current_user.username = form.username.data current_user.email = form.email.data current_user.bio = form.bio.data db.session.commit() flash('Succesfully updated your profile') return redirect(url_for('main.profile')) elif request.method == 'GET': form.username.data = current_user.username form.email.data = current_user.email form.bio.data = current_user.bio profile_pic_path = url_for('static',filename = 'photos/'+ current_user.profile_pic_path) return render_template('profile/profile.html', profile_pic_path=profile_pic_path, form = form) @main.route('/user/<name>/updateprofile', methods = ['POST','GET']) @login_required def updateprofile(name): form = UpdateProfile() user = User.query.filter_by(username = name).first() if user == None: abort(404) if form.validate_on_submit(): user.bio = form.bio.data user.save() return redirect(url_for('.profile',name = name)) return render_template('profile/updateprofile.html',form =form) @main.route('/comment/<blog_id>', methods = ['Post','GET']) @login_required def comment(blog_id): blog = Blog.query.get(blog_id) comment =request.form.get('newcomment') new_comment = Comment(comment = comment, user_id = current_user._get_current_object().id, blog_id=blog_id) new_comment.save() return redirect(url_for('main.blog',id = blog.id))
<reponame>MrEliptik/PaperWithCodeScrapper import urllib import requests from bs4 import BeautifulSoup as bs from validator_collection import checkers class Scraper: def __init__(self): self.rootURL = 'https://paperswithcode.com' self.trendingPapersURL = self.rootURL self.latestURL = 'https://paperswithcode.com/latest' self.greatestURL = 'https://paperswithcode.com/greatest' self.linkToPaperPage = None self.trendingPapers = None self.latestPapers = None self.greatestPapers = None def scrapTrending(self): req = requests.get(self.trendingPapersURL) soup = bs(req.text, 'lxml') self.trendingPapers = self.scrapPage(soup).copy() return self.trendingPapers def scrapLatest(self): req = requests.get(self.latestURL) soup = bs(req.text, 'lxml') self.latestPapers = self.scrapPage(soup).copy() return self.latestPapers def scrapGreatest(self): req = requests.get(self.greatestURL) soup = bs(req.text, 'lxml') self.greatestPapers = self.scrapPage(soup).copy() return self.greatestPapers def scrapPage(self, soup): papers_dict = {} papers = [] items_divs = soup.find_all('div', {'class':'row infinite-item item'}) for item in items_divs: for child in item.children: # Image try: # Check if classes are in child attributes if set(child.attrs['class']) <= set(['col-lg-3', 'item-image-col']): # Image url print(child.find('div', {'class':'item-image'})['style']) papers_dict['image'] = self.rootURL + str(child.find('div', {'class':'item-image'})['style'].split("('", 1)[1].split("')")[0]) print(papers_dict['image']) except: pass # Content try: if set(child.attrs['class']) <= set(['col-lg-9', 'item-col']): # Title print(child.find('h1').a.string) papers_dict['title'] = child.find('h1').a.string # Nb stars print(child.find('span', {'class':'badge badge-secondary'}).text.strip()) papers_dict['nb_stars'] = child.find('span', {'class':'badge badge-secondary'}).text.strip() # Star/hour print(child.find('div', {'class':'stars-accumulated text-center'}).text.strip()) papers_dict['hourly_stars'] = child.find('div', {'class':'stars-accumulated text-center'}).text.strip() # Paper page link link print(child.find('a', {'class':'badge badge-light'})['href']) linkToPaperPage = child.find('a', {'class':'badge badge-light'})['href'] except: pass if linkToPaperPage != None: req = requests.get(self.rootURL + linkToPaperPage) linkToPaperPage = None soup = bs(req.text, 'lxml') print(soup.find('a', {'class':'badge badge-light'})['href']) pdf_link = soup.find('a', {'class':'badge badge-light'})['href'] # Check if the link found is the pdf or a search query if checkers.is_url(pdf_link): r = requests.get(pdf_link) else: r = requests.get(self.rootURL + pdf_link) content_type = r.headers.get('content-type') if 'application/pdf' in content_type: papers_dict['pdf'] = pdf_link # Github link print(soup.find('a', {'class':'code-table-link'})['href']) papers_dict['github'] = soup.find('a', {'class':'code-table-link'})['href'] elif 'text/html' in content_type: soup = bs(r.text, 'lxml') # PDF link print(soup.find('a', {'class':'badge badge-light'})['href']) papers_dict['pdf'] = soup.find('a', {'class':'badge badge-light'})['href'] # Github link print(soup.find('a', {'class':'code-table-link'})['href']) papers_dict['github'] = soup.find('a', {'class':'code-table-link'})['href'] papers.append(papers_dict.copy()) return papers
<reponame>davidlrobinson/sentdex-blob<filename>env.py import gym from gym import spaces from gym.utils import seeding import numpy as np import cv2 import matplotlib.pyplot as plt import time from blob import Blob SIZE = 10 N_EPISODES = 5 MOVE_REWARD = -1 ENEMY_REWARD = -300 FOOD_REWARD = 25 SHOW_EVERY = 1 class BlobEnv(gym.Env): def __init__(self, size): self.seed() self.size = size self.reset() self.viewer = None self.action_space = spaces.Discrete(9) # 8 principle winds and no movement self.observation_space = spaces.Box(low=0, high=size-1, shape=(3, 2), dtype=int) # x and y coords of player, food, and enemy def seed(self, seed=None): self.np_random, seed = seeding.np_random(seed) return [seed] def step(self, action): if action == 0: x, y = 0, 0 # no movement elif action == 1: x, y = 0, 1 # up elif action == 2: x, y = 1, 1 # up-right elif action == 3: x, y = 1, 0 # right elif action == 4: x, y = 1, -1 # down-right elif action == 5: x, y = 0, -1 # down elif action == 6: x, y = -1, -1 # down-left elif action == 7: x, y = -1, 0 # left elif action == 8: x, y = -1, 1 # up-left self.player.move(x, y, bound=self.size-1) self.enemy.move(*self.np_random.randint(-1, 2, (2,)), bound=self.size-1) self.state = np.array([self.player.pos, self.food.pos, self.enemy.pos]) if self.player.pos == self.enemy.pos: reward = ENEMY_REWARD done = True elif self.player.pos == self.food.pos: reward = FOOD_REWARD done = True else: reward = MOVE_REWARD done = False return self.state, reward, done, {} def reset(self): self.player = Blob(*self.np_random.randint(0, self.size, (2,), dtype=int)) self.food = Blob(*self.np_random.randint(0, self.size, (2,), dtype=int)) self.enemy = Blob(*self.np_random.randint(0, self.size, (2,), dtype=int)) self.state = np.array([self.player.pos, self.food.pos, self.enemy.pos]) return self.state def render(self, mode='human'): screen_size = 300 size = self.size scale = screen_size // size blob_vertices = [(0, 0), (0, scale), (scale, scale), (scale, 0)] if self.viewer is None: from gym.envs.classic_control import rendering self.viewer = rendering.Viewer(screen_size, screen_size) player = rendering.FilledPolygon(blob_vertices) player.set_color(0, 0, 255) self.playertrans = rendering.Transform() player.add_attr(self.playertrans) self.viewer.add_geom(player) food = rendering.FilledPolygon(blob_vertices) food.set_color(0, 255, 0) self.foodtrans = rendering.Transform() food.add_attr(self.foodtrans) self.viewer.add_geom(food) enemy = rendering.FilledPolygon(blob_vertices) enemy.set_color(255, 0, 0) self.enemytrans = rendering.Transform() enemy.add_attr(self.enemytrans) self.viewer.add_geom(enemy) self.playertrans.set_translation(self.player.x*scale, self.player.y*scale) self.foodtrans.set_translation(self.food.x*scale, self.food.y*scale) self.enemytrans.set_translation(self.enemy.x*scale, self.enemy.y*scale) return self.viewer.render() def close(self): if self.viewer: self.viewer.close() self.viewer = None if __name__ == "__main__": env = BlobEnv(SIZE) for i in range(N_EPISODES): env.reset() for t in range(200): if i % SHOW_EVERY == 0: env.render() observation, reward, done, info = env.step(env.action_space.sample()) if done: print("Episode {} finished after {} timesteps".format(i+1, t+1)) break env.close()
#!/usr/bin/python import logging from datetime import date from django.core.management.base import BaseCommand, CommandError from django.db import transaction from django.core.mail import send_mail from detention_notifier.models import Detention, DetentionMailer, Offense, Code, DetentionErrorNotification from academics.models import Teacher, Student, AcademicYear, Term from academics.utils import fmpxmlparser logger = logging.getLogger(__name__) class Command(BaseCommand): help = "Import Detentions" def add_arguments(self, parser): parser.add_argument('filename', metavar='FILENAME', help='The filename to process the detentions from') def handle(self, *args, **kwargs): logger.info("Beginning detention import routine") data = fmpxmlparser.parse_from_file(kwargs['filename']) results = data['results'] seen_ids = set() with transaction.atomic(): detention_mailer = DetentionMailer.objects.get() skip_processing_before = detention_mailer.skip_processing_before for row in results: fields = row['parsed_fields'] incident_id = fields['IDINCIDENT'] detention_date = fields['Det Date'] raw_code = fields['Code'] or "" raw_offense = fields['Offense'] comments = fields['Comments'] or "" student_id = fields['IDSTUDENT'] teacher_id = fields['KSTeachers::IDTEACHER'] raw_academic_year = fields['AcademicYear'] raw_term = fields['Term'] if skip_processing_before and detention_date < skip_processing_before: continue try: code = Code.objects.get(code=raw_code) except Code.DoesNotExist: code = Code(code=raw_code) code.save() if not code.process: continue try: academic_year = AcademicYear.objects.get(year=raw_academic_year) except AcademicYear.DoesNotExist: academic_year = AcademicYear(year=raw_academic_year) academic_year.save() try: term = Term.objects.get(academic_year=academic_year, term=raw_term) except Term.DoesNotExist: term = Term(academic_year=academic_year, term=raw_term) term.save() if raw_offense: try: offense = Offense.objects.get(offense__iexact=raw_offense) except Offense.DoesNotExist: error_recipients = [o.address for o in DetentionErrorNotification.objects.filter(mailer=detention_mailer)] if not error_recipients: raise ValueError("No error recipients are defined") send_mail("Error importing detention", "Error importing detention {id:}: offense '{offense:}' does not exist".format( id=incident_id, offense=raw_offense), '<EMAIL>', error_recipients) continue else: offense = None if teacher_id: teacher = Teacher.objects.get(teacher_id=teacher_id) else: teacher = None if student_id: student = Student.objects.get(student_id=student_id) else: student = None if not incident_id: logger.error("Blank incident ID") continue seen_ids.add(incident_id) try: incident = Detention.objects.get(incident_id=incident_id) logger.info("Found detention {id:}".format(id=incident_id)) force_save = False except Detention.DoesNotExist: logger.info("Creating detention {id:}".format(id=incident_id)) incident = Detention( incident_id=incident_id, code=code, student=student, teacher=teacher ) force_save = True attr_map = { 'detention_date': detention_date, 'code': code, 'offense': offense, 'comments': comments, 'term': term, 'student': student, 'teacher': teacher, } for attr in attr_map: db_value = getattr(incident, attr) if db_value != attr_map[attr]: setattr(incident, attr, attr_map[attr]) logger.info("Updating {attr:} on {incident_id:} from {old_value:} to {new_value:}".format( attr=attr, incident_id=incident_id, old_value=db_value, new_value=attr_map[attr])) force_save = True if force_save: incident.save() extra_detentions = Detention.objects.exclude(incident_id__in=seen_ids) if extra_detentions: logger.warn("Deleting {} detentions".format(extra_detentions.count())) extra_detentions.delete()
<reponame>noooway/exj from kivy.app import App from kivy.uix.boxlayout import BoxLayout from kivy.uix.gridlayout import GridLayout from kivy.uix.button import Button from kivy.uix.label import Label from kivy.uix.textinput import TextInput from ExerciseRunning import * class ExerciseRunningInputWidget( GridLayout ): def __init__( self, exercise_running, current_training_screen, **kwargs ): super( ExerciseRunningInputWidget, self ).__init__( **kwargs ) self.cols = 1 self.spacing = 1 self.row_default_height = 40 self.row_force_default = True self.size_hint_y = None self.bind( minimum_height = self.setter('height') ) self.exercise_name = exercise_running.description['name'] title_layout = BoxLayout( orientation = 'horizontal', spacing = 30 ) excercise_label = Label( text = self.exercise_name ) title_layout.add_widget( excercise_label ) title_layout.add_widget( Label( text = "Distance (km)" ) ) title_layout.add_widget( Label( text = "Time" ) ) del_excercise_btn = Button( text = "Del Exc", size_hint_x = 0.3 ) del_excercise_btn.on_press = \ lambda: current_training_screen.remove_exercise( self ) title_layout.add_widget( del_excercise_btn ) self.add_widget( title_layout ) self.add_dist_time_intervals_from_exercise( exercise_running, current_training_screen ) add_interval_btn_layout = BoxLayout( orientation = 'horizontal', spacing = 30 ) add_interval_btn_layout.add_widget( Label( text='', size_hint = (0.30, 1.0) ) ) add_interval_btn_layout.add_widget( Button( text = 'Add interval', size_hint = (0.775, 1.0), on_press = lambda x: self.add_dist_time_interval( current_training_screen, index_in_layout = 2 ) ) ) self.add_widget( add_interval_btn_layout ) comment_text = exercise_running.description.get( 'comment', 'Comment Exercise') self.comment = TextInput( hint_text = comment_text ) self.comment.bind( text = current_training_screen.update_training_from_user_input ) self.add_widget( self.comment ) def add_dist_time_intervals_from_exercise( self, exercise_running, current_training_screen ): for (dist, time) in zip( exercise_running.description['distances'], exercise_running.description['times'] ): self.add_dist_time_interval( current_training_screen, dist, time ) def add_dist_time_interval( self, current_training_screen, hint_dist = '1.0', hint_time = '4:00', index_in_layout = 0 ): interval_layout = GridLayout( rows = 1, spacing = 30 ) interval_layout.height = 30 pos_shift = Label( text='' ) interval_layout.add_widget( pos_shift ) distance = TextInput( hint_text = str( hint_dist ) ) interval_layout.add_widget( distance ) time = TextInput( hint_text = str( hint_time ) ) interval_layout.add_widget( time ) distance.bind( text = current_training_screen.update_training_from_user_input ) time.bind( text = current_training_screen.update_training_from_user_input ) del_button = Button( text = "Del Int", size_hint_x = 0.3 ) del_button.on_press = lambda: self.remove_interval_widget( current_training_screen, interval_layout ) interval_layout.add_widget( del_button ) self.add_widget( interval_layout, index = index_in_layout ) def exercise_from_user_input( self ): # todo: add input check intervals = len( self.children[2:-1] ) distances = [] times = [] for dist_time_interval in self.children[2:-1]: dist_input = dist_time_interval.children[2].text time_input = dist_time_interval.children[1].text if dist_input is not None: distances.insert( 0, dist_input ) if time_input is not None: times.insert( 0, time_input ) comment = self.comment.text exc = ExerciseRunning( name = self.exercise_name, intervals = intervals, distances = distances, times = times, description_dict = { 'comment': comment } ) return( exc ) def remove_interval_widget( self, current_training_screen, interval_layout ): self.remove_widget( interval_layout ) current_training_screen.update_training_from_user_input() print( 'deleting' )
import warnings import numpy as np import networkx as nx from scipy.stats import logistic from mossspider.estimators.utils import fast_exp_map def uniform_network(n, degree, pr_w=0.35, seed=None): """Generates a uniform random graph for a set number of nodes (n) and specified max and min degree (degree). Additionally, assigns a binary baseline covariate, W, to each observation. Parameters ---------- n : int Number of nodes in the generated network degree : list, set, array An array of two elements. The first element is the minimum degree and the second element is the maximum degree. pr_w : float, optional Probability of W=1. W is a binary baseline covariate assigned to each unit. seed : int, None, optional Random seed to use. Default is None. Returns ------- networkx.Graph Examples -------- Loading the necessary functions >>> from mossspider.dgm import uniform_network Generating the uniform network >>> G = uniform_network(n=500, degree=[0, 2]) """ rng = np.random.default_rng(seed) # Processing degree data if len(degree) > 2: warnings.warn('It looks like your specified bounds is more than two floats. Only the first two ' 'specified bounds are used by the bound statement. So only ' + str(degree[0:2]) + ' will be used', UserWarning) if type(degree) is float or type(degree) is int or type(degree) is str: raise ValueError("degree must be a container of integers") elif degree[0] > degree[1]: raise ValueError('degree thresholds must be listed in ascending order') elif type(degree[0]) is str or type(degree[1]) is str: raise ValueError('degree must be integers') elif type(degree[0]) is float or type(degree[1]) is float: raise ValueError('degree must be integers') elif degree[0] < 0 or degree[1] < 0: raise ValueError('Both degree values must be positive values') else: # Completed all checks pass # checking if even sum for degrees, since needed sum = 1 while sum % 2 != 0: # Degree distribution must be even degree_dist = list(rng.integers(degree[0], # ... proposed degree distribution for min degree degree[1]+1, # ... and max degree (+1 to be inclusive) size=n)) # ... for the n units sum = np.sum(degree_dist) # ... update the sum value to see if valid # Generate network with proposed degree distribution G = nx.configuration_model(degree_dist, # Generate network seed=seed) # ... with seed for consistency # Removing multiple edges! G = nx.Graph(G) # No multi-loops in networks we consider here # Removing self-loops G.remove_edges_from(nx.selfloop_edges(G)) # No self-loops in networks we consider here # Generating baseline covariate W w = rng.binomial(n=1, p=pr_w, size=n) # Generate W for node in G.nodes(): # Adding W to the network node attributes G.nodes[node]['W'] = w[node] # ... via simple indexing # Returning the completed graph return G def clustered_power_law_network(n_cluster, edges=3, pr_cluster=0.75, pr_between=0.0007, pr_w=0.35, seed=None): """Generate a graph with the following features: follows a power-law degree distribution, high(er) clustering coefficient, and an underlying community structure. This graph is created by generating a number of subgraphs with power-law distributions and clustering. The subgraphs are generated using ``networkx.powerlaw_cluster_graph(n=n_cluster[...], m=edges, p=p_cluster)``. This process is repeated for each element in the ``n_cluster`` argument. Then the subgraphs are then randomly connected by creating random edges between nodes of the subgraphs. Parameters ---------- n_cluster : list, set, array, ndarray Specify the N for each subgraph in the clustered power-law network via a list. List should be positive integers that correspond to the N for each subgraph. edges : int, optional Number of edges to generate within each cluster. Equivalent to the ``m`` argument in ``networkx.powerlaw_cluster_graph``. pr_cluster : float, optional Probability of a new node forming a triad with neighbors of connected nodes pr_between : float, optional Probability of an edge between nodes of each cluster. Evaluated for all node pairs, so should be relatively low to keep a high community structure. Default is 0.0007. pr_w : float, optional Probability of the binary baseline covariate W for the network. Default is 0.35. seed : int, None, optional Random seed. Default is None. Returns ------- networkx.Graph Examples -------- Loading the necessary functions >>> from mossspider.dgm import clustered_power_law_network Generating the clustered power-law network >>> G = clustered_power_law_network(n_cluster=[50, 50, 50, 50]) """ # Prep environment rng = np.random.default_rng(seed) N = nx.Graph() for i in range(len(n_cluster)): # Generate the component / subgraph G = nx.powerlaw_cluster_graph(int(n_cluster[i]), m=edges, p=pr_cluster, seed=int(rng.integers(10000, 500000, size=1)[0])) # Re-label nodes so no corresponding overlaps between node labels if i == 0: start_label = 0 else: start_label = np.sum(n_cluster[:i]) mapping = {} for j in range(n_cluster[i]): mapping[j] = start_label + j H = nx.relabel_nodes(G, mapping) # Adding component / subgraph to overall network N.add_nodes_from(H.nodes) N.add_edges_from(H.edges) # Creating some random connections across groups for i in range(len(n_cluster)): # Gettings IDs for the subgraph first_id = int(np.sum(n_cluster[:i])) last_id = int(np.sum(n_cluster[:i + 1])) # Only adding edges to > last_id for j in range(first_id + 1, last_id + 1): for n in list(N.nodes()): if n > last_id: if rng.uniform(0, 1) < pr_between: N.add_edge(j, n) # Generating baseline covariate W w = rng.binomial(n=1, p=pr_w, size=np.sum(n_cluster)) # Generate W for node in N.nodes(): # Adding W to the network node attributes N.nodes[node]['W'] = w[node] # ... via simple indexing # Returning the generated network return N def generate_observed(graph, seed=None): r"""Simulates the exposure and outcome for the uniform random graph (following mechanisms are from Sofrygin & van <NAME> 2017). .. math:: A = \text{Bernoulli}(\text{expit}(-1.2 + 1.5 W + 0.6 W^s)) \\ Y = \text{Bernoulli}(\text{expit}(-2.5 + 0.5 A + 1.5 A^s + 1.5 W + 1.5 W^s)) Parameters ---------- graph : Graph Graph generated by the `uniform_network` function. seed : int, None, optional Random seed to use. Default is None. Returns ------- Network object with node attributes Examples -------- Loading the necessary functions >>> from mossspider.dgm import uniform_network, generate_observed Generating the uniform network >>> G = uniform_network(n=500, degree=[0, 2]) Generating exposure A and outcome Y for network >>> H = generate_observed(graph=G) References ---------- <NAME>, & <NAME>. (2017). Semi-parametric estimation and inference for the mean outcome of the single time-point intervention in a causally connected population. *Journal of Causal Inference*, 5(1). """ rng = np.random.default_rng(seed) n = len(graph.nodes()) w = np.array([d['W'] for n, d in graph.nodes(data=True)]) adj_mat = nx.adjacency_matrix(graph) # Calculating map(W), generating A, and adding to network w_s = fast_exp_map(adj_mat, w, measure='sum') a = rng.binomial(n=1, p=logistic.cdf(-1.2 + 1.5*w + 0.6*w_s), size=n) for node in graph.nodes(): graph.nodes[node]['A'] = a[node] # Calculating map(A), generating Y, and adding to network a_s = fast_exp_map(adj_mat, a, measure='sum') y = rng.binomial(n=1, p=logistic.cdf(-2.5 + 1.5*w + 0.5*a + 1.5*a_s + 1.5*w_s), size=n) for node in graph.nodes(): graph.nodes[node]['Y'] = y[node] return graph def generate_truth(graph, p): """Simulates the true conditional mean outcome for a given network, distribution of W, and policy. The true mean under the policy is simulated as .. math:: A = Bernoulli(p) \\ Y = Bernoulli(expit(-2.5 + 1.5*W + 0.5*A + 1.5*map(A) + 1.5*map(W))) Returns ------- float Examples -------- Loading the necessary functions >>> from mossspider.dgm import uniform_network, generate_truth Generating the uniform network >>> G = uniform_network(n=500, degree=[0, 2]) Calculating truth for a policy via a large number of replicates >>> true_p = [] >>> for i in range(1000): >>> y_mean = generate_truth(graph=G, p=0.5) >>> true_p.append(y_mean) >>> np.mean(true_p) # 'true' value for the stochastic policy To reduce random error, a large number of replicates should be used """ n = len(graph.nodes()) w = np.array([d['W'] for n, d in graph.nodes(data=True)]) # Calculating map(W), generating A, and adding to network a = np.random.binomial(n=1, p=p, size=n) for node in graph.nodes(): graph.nodes[node]['A'] = a[node] # Calculating map(A), generating Y, and adding to network adj_mat = nx.adjacency_matrix(graph) w_s = fast_exp_map(adj_mat, w, measure='sum') a_s = fast_exp_map(adj_mat, a, measure='sum') y = np.random.binomial(n=1, p=logistic.cdf(-2.5 + 1.5*w + 0.5*a + 1.5*a_s + 1.5*w_s), size=n) return np.mean(y)
<reponame>JIAQING-XIE/Google_NLP_DL import re import torch import numpy as np from sklearn.model_selection import train_test_split from gensim.models import KeyedVectors from gensim.scripts.glove2word2vec import glove2word2vec from stanfordcorenlp import StanfordCoreNLP path = r'C:\\Users\\11415\\Desktop\\stanford-corenlp-4.2.2\\' nlp = StanfordCoreNLP(path) class Data(): def __init__(self, data_path, method = "BIOES"): self.data_path = data_path self.method = method def transform(self, method = "re"): """ 1.分词 2.transform T to B, I, E according to its position """ word_lists = [] train_word_lists = [] tag_lists = [] with open(self.data_path, encoding='utf-8') as reader: for line in reader.readlines(): count = 0 tag_list = [] train_word_list = [] for part in line.strip().split('####'): # take '####' as the split standard if count == 0: sen_tk = self.tokenize(part) word_lists.append(sen_tk) count+=1 else: for element in part.split(' '): if element[0] == "=": tag_list.append(element.split("=")[2]) train_word_list.append("=") else: tag_list.append(element.split("=")[1]) train_word_list.append(element.split("=")[0]) train_word_lists.append(train_word_list) tag_lists.append(tag_list) for i in range(len(train_word_lists)): assert train_word_lists[i] == word_lists[i], " line {}, \n {} \n {}".format(i, word_lists[i], train_word_lists[i]) return train_word_lists, tag_lists def to_id(self, word_lists, tag_lists, make_vocab = False): if make_vocab: word2id = self.build_map(word_lists) tag2id = self.build_map(tag_lists) return word_lists, tag_lists, word2id, tag2id else: return word_lists, tag_lists def id2word(self, word2id): id_to_word = {id: word for (word, id) in word2id.items()} return id_to_word def extend_maps(self, word2id, tag2id, for_crf=True): word2id['<unk>'] = len(word2id) word2id['<pad>'] = len(word2id) tag2id['<unk>'] = len(tag2id) tag2id['<pad>'] = len(tag2id) # 如果是加了CRF的bilstm 那么还要加入<start> 和 <end>token if for_crf: word2id['<start>'] = len(word2id) word2id['<end>'] = len(word2id) tag2id['<start>'] = len(tag2id) tag2id['<end>'] = len(tag2id) return word2id, tag2id def check(self, group1, group2): """ compare the array with the marked entities after '####' to check if they have the same length. If not, delete that word in the tokenized group. """ new_group = [] i = 0 j = 0 while i < len(group1): while j < len(group2): if group1[i] == group2[j]: new_group.append(group1[i]) i+=1 # move to next j+=1 # move to next elif group1[i] in group2[j]: # meet mark behind current = i for current in range(i, len(group1) + 1): if ''.join(group1[i:current]) in group2[j]: if ''.join(group1[i:current]) == group2[j]: new_group.append(group2[j]) i = current j+=1 break else: break return new_group def substring(self, words): """ check one string if its the substring of the other strings !!!! very slow and takes up a huge amount of CPU. Please do not use it. """ for i in range(len(words)): for j in range(i, len(words)): if len(words) >= 4: if words[i] in words[j]: words[j] = words[i] elif words[j] in words[i]: words[i] = words[j] return words def statistics(self, tags, processed = False): for tag in tags: count = 0 for i in range(len(tag)-1): if tag[i] != 'O' and not processed: # 一定是entity if tag[i+1] == 'O' and count == 0: tag[i] = 'S' + tag[i][1:] elif tag[i+1] != 'O' and count==0: tag[i] = 'B' + tag[i][1:] tag[i+1] = 'I' + tag[i+1][1:] count+=1 elif count!=0 and tag[i+1] != 'O': tag[i] = 'I'+ tag[i][1:] tag[i+1] = 'E' + tag[i+1][1:] count+=1 elif count!=0 and tag[i+1] == 'O': tag[i] = 'E' + tag[i][1:] count = 0 tmp = i + 1 if tmp == len(tag) -1: if tag[tmp] != 'O' and tag[i] == 'O': tag[tmp] = 'S' + tag[tmp][1:] break # count the number of entities: num_entities = {'POS':0, 'NEU':0, 'NEG':0} i = 0 count = 0 for ta in tags: while i < len(ta): if ta[i][:1] == 'S' or ta[i][:1] == 'E': num_entities[ta[i][2:]]+=1 i+=1 i = 0 print(num_entities) return tags def tokenize(self, sentence, method = "re"): """ tokenize the sentence into an array of words with certain patterns """ if method == "nlp": pattern = re.compile(r'<[^>]+>', re.S) punc = '!@#¥%&*()—“:’;、。,?》《%' sentence = sentence.strip() sentence = pattern.sub('', sentence) sentence = re.sub(r"[%s]+" % punc, "", sentence) sen_tk = nlp.word_tokenize(sentence) elif method == "re": sentence = re.sub(r'(?<=\d)[\.](?=\d)','',sentence) sentence = re.sub(r' - ', ",", sentence) sentence = re.sub(r'-- ', " ", sentence) sentence = re.sub(r'- ', " ", sentence) sentence = re.sub(r'--', " -- ", sentence) sentence = sentence.replace(",", " , ") sentence = sentence.replace(":", " , ") sentence = sentence.replace(".", " . ") sentence = sentence.replace("=)", " = ") sentence = sentence.replace("?", " ? ") sentence = sentence.replace("!", " ! ") sentence = sentence.replace(";", " ; ") sentence = sentence.replace("$", " $ ") sentence = sentence.replace("%", " % ") sentence = sentence.replace("#", " # ") sentence = sentence.replace(">", " > ") #sentence = sentence.replace("*", " " ) sentence = sentence.replace("n't", " n't") sentence = sentence.replace("'few", " few") sentence = re.sub(r'N\'T', " N'T",sentence) sentence = re.sub(r'didnt', "did n't",sentence) sentence = re.sub(r'dont', "do n't",sentence) sentence = re.sub(r'cant', "ca n't",sentence) sentence = re.sub(r'wouldnt', "would n't",sentence) sentence = re.sub(r'\'ve', " 've", sentence) sentence = re.sub(r'\'have', " have", sentence) sentence = re.sub(r'\'re', " 're", sentence) sentence = re.sub(r'\'s', " 's", sentence) sentence = re.sub(r'\'m ', " 'm ", sentence) sentence = re.sub(r'\'M ', " 'M ", sentence) sentence = re.sub(r'\'d', " 'd", sentence) sentence = re.sub(r'\'ll', " 'll", sentence) sentence = re.sub(r'[()]', "", sentence) sentence = re.sub(r'[\"\"]', "", sentence) sentence = re.sub(r'\' ', " ", sentence) sentence = re.sub(r'@', " @ ", sentence) sentence = sentence.replace("cannot", "can not") sentence = sentence.replace(" ", " ") sen_tk = re.split(" ", sentence) while '' in sen_tk: sen_tk.remove('') # 去除空字符 i = 0 while i < len(sen_tk) -1: # 去除多余句号(句中+句尾) if sen_tk[i] == "." and sen_tk[i+1] == ".": del sen_tk[i] else: i+=1 return sen_tk def save(self): pass def train_valid_split(self, words, tags): """ split to train and vadiation datasets X : words list->list y: tags list->list """ X_train, X_valid, y_train, y_valid = train_test_split(words, tags, test_size=0.1, random_state=30244) print("----- Training statistics -----") train_tags = self.statistics(y_train, processed=True) print("----- Validation statistics -----") valid_tags = self.statistics(y_valid, processed=True) return X_train, X_valid, y_train, y_valid def build_map(self,lists): maps = {} for list_ in lists: for e in list_: if e not in maps: maps[e] = len(maps) return maps class Glove(): def __init__(self, vocab_size, embed_size, word2id): self.vocab_size =len(word2id) self.embed_size = embed_size self.word2id = word2id def glove_word2vec(self, glove_inputfile, word2vec_output_file): glove2word2vec(glove_inputfile, word2vec_output_file) def get_weight(self, file, word2id, id2word): wvmodel = KeyedVectors.load_word2vec_format(file \ , binary=False, encoding='utf-8') torch.manual_seed(131415) weight = torch.Tensor(self.vocab_size, self.embed_size).uniform_(-0.5, 0.5) for i in range(len(wvmodel.index2word)): try: index = word2id[wvmodel.indexword[i]] except: continue weight[index, :] = torch.from_numpy(wvmodel.get_vector( id2word[word2id[wvmodel.index2word[i]]])) return weight
from enum import Enum from typing import List, Union, Tuple, Optional, Iterator from smbus2 import SMBus class PinMode(Enum): output = 0 input = 1 class PCA9536Pin: """A single pin of the PCA9536 GPIO expander.""" def __init__(self, device: "PCA9536", index: int): """Initialise the PCA9536Pin. Args: device: A PCA9536 object. index: The pin index, 0 through 3.""" self.device = device self.index = index @property def mode(self) -> PinMode: """Get or set the pin input/output mode. The mode is a PinMode object, either PinMode.input or PinMode.output. When setting the mode, the strings "input" and "output" can be used interchangeably with the values PinMode.input and PinMode.output, respectively.""" return self.device.mode[self.index] @mode.setter def mode(self, value: Union[PinMode, str]) -> None: self.device.mode = self._value_to_list(value) # type: ignore @property def polarity_inversion(self) -> bool: """Get or set the polarity inversion. If the polarity inversion is True, polarity of the read bit is inverted: a low logic level will correspond to True, and a high logic level to False. The polarity inversion does not affect the output.""" return self.device.polarity_inversion[self.index] @polarity_inversion.setter def polarity_inversion(self, value: bool) -> None: self.device.polarity_inversion = self._value_to_list(value) # type: ignore def read(self) -> bool: """Read the current logic level. If the polarity inversion if False, this returns True if the logic level is high, and low if it is False. If the polarity inversion is True, these values are inverted.""" return self.device.read()[self.index] def write(self, value: bool) -> None: """Set the output logic level. Sets the output logic level to low if value is False, and to high if value is True. This only sets the output flip-flop of the GPIO expander. If the mode of the pin is set to input, this has no effect on the logic level.""" self.device.write(*self._value_to_list(value)) def _value_to_list(self, value) -> Tuple: """Helper function to produce inputs for the function calls to the PCA9536.""" result = [None, None, None, None] result[self.index] = value return tuple(result) class PCA9536: """Driver for the PCA9536 GPIO expander.""" def __init__(self, bus: SMBus, address: int = 0x41): """Initialise the PCA9536. Args: bus: An open SMBus object. address: The I2C address of the device. Defaults to 0x41. Since it is fixed, one should never have to change this.""" self.address = address self.bus = bus self._pins: List[PCA9536Pin] = [PCA9536Pin(self, index) for index in range(4)] def __getitem__(self, item: int) -> PCA9536Pin: return self._pins[item] def __iter__(self) -> Iterator[PCA9536Pin]: yield from self._pins @property def mode(self) -> Tuple[PinMode, PinMode, PinMode, PinMode]: """Get or set the input/output mode of the pins. The mode is a tuple of four PinMode objects, each representing the mode of a pin. Setting the mode is done with either a single PinMode object to set the mode of all pins: device.mode = PinMode.input Or with a tuple of four PinMode objects: device.mode = PinMode.input, PinMode.input, PinMode.output, PinMode.output In such a tuple values can be None in order to leave them unchanged: device.mode = PinMode.input, PinMode.input, None, None When setting the mode, the strings "input" and "output" can be used interchangeably with the values PinMode.input and PinMode.output, respectively. E.g.: device.mode = "output" device.mode = PinMode.input, "output", "input", None """ data = _read_bits( bus=self.bus, address=self.address, register=0x03, bitmask=0x0F ) return ( PinMode(data & 0x01), PinMode((data & 0x02) >> 1), PinMode((data & 0x04) >> 2), PinMode((data & 0x08) >> 3), ) @mode.setter def mode( self, value: Union[ PinMode, str, Tuple[ Optional[Union[PinMode, str]], Optional[Union[PinMode, str]], Optional[Union[PinMode, str]], Optional[Union[PinMode, str]], ], ], ) -> None: if not isinstance(value, tuple): value = value, value, value, value values: List[Optional[PinMode]] = [ PinMode[v] if isinstance(v, str) else v for v in value ] bitmask = _bools_to_bits(*(value is not None for value in values)) mode = _bools_to_bits(*(value == PinMode.input for value in values)) _write_bits( bus=self.bus, address=self.address, register=0x03, value=mode, bitmask=bitmask, ) @property def polarity_inversion(self) -> Tuple[bool, bool, bool, bool]: """Get or set the polarity inversion of the pins. The polarity inversion is a tuple of four booleans. If the polarity inversion of a pin is True, polarity of the read bit is inverted: a low logic level will correspond to True, and a high logic level to False. Setting the polarity inversion is done with either a single boolean to set all pins: device.polarity_inversion = False Or with a tuple of four booleans: device.polarity_inversion = False, False, True, True In such a tuple values can be None in order to leave them unchanged: device.polarity_inversion = False, None, True, True""" data = _read_bits( bus=self.bus, address=self.address, register=0x02, bitmask=0x0F ) return ( bool(data & 0x01), bool((data & 0x02) >> 1), bool((data & 0x04) >> 2), bool((data & 0x08) >> 3), ) @polarity_inversion.setter def polarity_inversion( self, value: Union[ bool, Tuple[ Optional[bool], Optional[bool], Optional[bool], Optional[bool], ], ], ): if not isinstance(value, tuple): value = value, value, value, value bitmask = _bools_to_bits(*(value is not None for value in value)) polarity = _bools_to_bits(*(value is True for value in value)) _write_bits( bus=self.bus, address=self.address, register=0x02, value=polarity, bitmask=bitmask, ) def read(self) -> Tuple[bool, bool, bool, bool]: """Read the current logic levels. Returns a tuple of four booleans. If the polarity inversion if False, this returns True if the logic level is high, and low if it is False. If the polarity inversion is True, these values are inverted.""" data = _read_bits( bus=self.bus, address=self.address, register=0x00, bitmask=0x0F ) return _bits_to_bools(data) def write( self, pin_0: Optional[bool] = None, pin_1: Optional[bool] = None, pin_2: Optional[bool] = None, pin_3: Optional[bool] = None, ): """Set one or more output logic levels. Sets a output logic level to low if value is False, and to high if value is True. This only sets the output flip-flops of the GPIO expander. If the mode of the pin is set to input, this has no effect on the logic level.""" pins = (pin_0, pin_1, pin_2, pin_3) value = _bools_to_bits(*(pin is True for pin in pins)) bitmask = _bools_to_bits(*(pin is not None for pin in pins)) _write_bits( bus=self.bus, address=self.address, register=0x01, value=value, bitmask=bitmask, ) def _bools_to_bits(bool_0: bool, bool_1: bool, bool_2: bool, bool_3: bool) -> int: return (bool_0 * 0x01) | (bool_1 * 0x02) | (bool_2 * 0x04) | (bool_3 * 0x08) def _bits_to_bools(bits: int) -> Tuple[bool, bool, bool, bool]: return ( bool(bits & 0x01), bool(bits & 0x02), bool(bits & 0x04), bool(bits & 0x08), ) def _read_bits(bus: SMBus, address: int, register: int, bitmask: int) -> int: return bus.read_byte_data(address, register=register) & bitmask def _write_bits( bus: SMBus, address: int, register: int, value: int, bitmask: int ) -> None: other_bits = _read_bits( bus=bus, address=address, register=register, bitmask=0xFF - bitmask ) value_bits = value & bitmask bus.write_byte_data(address, register=register, value=other_bits | value_bits)
<reponame>genmeblog/twixtbot #! /usr/bin/env python """ Shared Memory Message Passing Protocol """ # python import argparse import collections import mmap import multiprocessing import os import select import socket import struct import sys debug = False # mine import timestat IntPacker = struct.Struct("<L") QUERY_AVAILABLE = "QQ" REPLY_AVAILABLE = "RR" ANSWER_SENT = "SS" SUICIDE_CODE = 0xdead3149 def checksum(b): return 0xcc # return reduce(lambda x,y:x^y, map(ord, b)) class Client: def __init__(self, location, slots_needed=1, quiet=False): self.quiet = quiet self._init_socket(location) self._init_shmem(location) self._request_slots(slots_needed) self.min_timeout = 0.001 self.max_timeout = 3.0 def _init_socket(self, location): sock_name = location + ".sock" self.socket = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) self.socket.connect(sock_name) def _init_shmem(self, location): shmem_name = location + ".shm" self.shm_file = open(shmem_name, "r+b") self.shmem = mmap.mmap(self.shm_file.fileno(), 0) def _request_slots(self, slots_needed): outdata = struct.pack("<L", slots_needed) if debug: print >>sys.stderr, "Sent request for %d slot(s)" % (slots_needed) self.socket.send(outdata) if slots_needed == SUICIDE_CODE: return self.slots = [] self.cb_by_slot = dict() # receive a message telling me the query_size, reply_size, and # slot indices I may use if debug: print >>sys.stderr, "expecting %d bytes" % (4*(2+slots_needed)) indata = self.socket.recv(4*(2+slots_needed), socket.MSG_WAITALL) if debug: print >>sys.stderr, "received %d bytes" % (len(indata)) self.query_size = IntPacker.unpack_from(indata, 0)[0] self.reply_size = IntPacker.unpack_from(indata, 4)[0] for i in range(slots_needed): self.slots.append(IntPacker.unpack_from(indata, 8+i*4)[0]) self.slot_size = 3 + max(self.query_size, self.reply_size) self.unused_slots = list(self.slots) if not self.quiet: print "query_size=",self.query_size,"reply_size=",self.reply_size,"my_slots=[",",".join(map(str,self.slots)),"]" sys.stdout.flush() # end _request_slots def slot_locations(self, slot): return slot*self.slot_size, (slot+1)*self.slot_size def is_full(self): return len(self.unused_slots) == 0 def write_query(self, request, reply_callback): if not type(request) == str: raise ValueError('queries must be bytes (strings)') if len(request) > self.query_size: raise ValueError('query too long') if not self.unused_slots: raise Exception('Too many queries!') slot = self.unused_slots.pop() if debug: print "POP",slot x, y = self.slot_locations(slot) self.shmem[x:x+len(request)] = request cs = checksum(request) self.shmem[y-3] = chr(cs) self.shmem[y-2:y] = QUERY_AVAILABLE if debug: print >>sys.stderr, "client sent %d bytes with checksum %d" % (len(request), cs) self.cb_by_slot[slot] = reply_callback def handle_ready_replies(self): ready_slots = [] for slot in self.cb_by_slot.keys(): x, y = self.slot_locations(slot) status = self.shmem[y-2:y] if status == REPLY_AVAILABLE: ready_slots.append(slot) for slot in ready_slots: self.process_reply(slot) return len(ready_slots) def process_reply(self, slot): assert not slot in self.unused_slots, (slot, self.unused_slots) cb = self.cb_by_slot[slot] del self.cb_by_slot[slot] self.unused_slots.append(slot) if debug: print "PUSH",slot x, y = self.slot_locations(slot) replydata = bytes(self.shmem[x:x+self.reply_size]) cs = checksum(replydata) if debug: print >>sys.stderr, "client received %d bytes with checksum %d" % (len(replydata), cs) assert cs == ord(self.shmem[y-3]) cb(replydata) def handle_read(self): """ Receive a message telling me which slots have finished replies """ indata = self.socket.recv(4*len(self.slots)) if debug: print >>sys.stderr, "Client just read %d bytes", (len(indata)) if len(indata) % 4 != 0: raise Exception("odd number of bytes") if len(indata) == 0: raise Exception("Server went away") for i in range(0, len(indata), 4): slot = IntPacker.unpack_from(indata, i)[0] self.process_reply(slot) ######################## class ServerSocketProcess(multiprocessing.Process): def __init__(self, location, capacity, query_size, reply_size, shmem, notify_pipe): multiprocessing.Process.__init__(self) # self.daemon = True self.location = location self.capacity = capacity self.query_size = query_size self.reply_size = reply_size self.slot_size = 3 + max(self.query_size, self.reply_size) self.shmem = shmem self.notify_pipe = notify_pipe self._init_socket() self.unused_slots = list(range(self.capacity)) self.slot_user = dict() self.unallocated_sockets = [] def _init_socket(self): self.socket_name = self.location + ".sock" if os.path.exists(self.socket_name): os.remove(self.socket_name) self.main_socket = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) self.main_socket.bind(self.socket_name) self.main_socket.listen(5) self.all_sockets = [self.main_socket, self.notify_pipe] print "Ready for connections on", self.socket_name sys.stdout.flush() def slot_locations(self, slot): return slot*self.slot_size, (slot+1)*self.slot_size def read_main_socket(self): new_sock, _ = self.main_socket.accept() self.all_sockets.append(new_sock) self.unallocated_sockets.append(new_sock) print "opened connection. cons=%d free_slots=%d" % (len(self.all_sockets)-1, len(self.unused_slots)) sys.stdout.flush() def allocate_other_socket(self, sock): try: # Receive the message requesting how many slots the client wants indata = sock.recv(4, socket.MSG_WAITALL) if len(indata) == 0: # counterparty left the house self.free_socket(sock) return elif len(indata) != 4: print "error: want exactly 4 bytes for capacity request" sys.stdout.flush() self.free_socket(sock) return assert sock in self.unallocated_sockets self.unallocated_sockets.remove(sock) desire = IntPacker.unpack(indata)[0] if desire == SUICIDE_CODE: print "suicide requested" sys.stdout.flush() self.notify_pipe.send("DIE") self.notify_pipe.close() self.main_socket.close() sys.exit(0) if desire > len(self.unused_slots): print "error: more slots requested (%d) than available (%d)" % (desire, len(self.unused_slots)) sys.stdout.flush() self.free_socket(sock) return alloc_slots = [self.unused_slots.pop() for _ in range(desire)] msg_ints = [self.query_size, self.reply_size] + alloc_slots assert len(alloc_slots) == desire assert len(msg_ints) == 2+desire outdata = ''.join([IntPacker.pack(n) for n in msg_ints]) for slot in alloc_slots: self.slot_user[slot] = sock sock.send(outdata) print "%d slot%s allocated, %d unused, outdata len=%d" % (desire, "" if desire == 1 else "s", len(self.unused_slots), len(outdata)) sys.stdout.flush() except socket.error as serr: print "error in sock.send() in allocate_other_socket():",serr self.free_socket(sock) #end allocate_other_socket() def read_other_socket(self, sock): self.allocate_other_socket(sock) def free_socket(self, sock): if not sock in self.all_sockets: print "attempt to re-close socket!" return self.all_sockets.remove(sock) my_slots = [slot for slot, user in self.slot_user.items() if user == sock] for slot in my_slots: self.unused_slots.append(slot) del self.slot_user[slot] print "closed connection fielno=%d. conns=%d free_slots=%d" % (sock.fileno(), len(self.all_sockets)-1, len(self.unused_slots)) sock.close() sys.stdout.flush() def send_out_replies(self): self.notify_pipe.recv_bytes() outs_by_socket = collections.defaultdict(list) for slot, sock in self.slot_user.items(): x, y = self.slot_locations(slot) status = self.shmem[y-2:y] if status == REPLY_AVAILABLE: outs_by_socket[sock].append(slot) self.shmem[y-2:y] = ANSWER_SENT for sock, outs in outs_by_socket.items(): outdata = ''.join([IntPacker.pack(n) for n in outs]) assert len(outdata) == 4*len(outs) try: sock.send(outdata) except socket.error as serr: print "error sock.send() fileno:",sock.fileno(),"error:",serr self.free_socket(sock) # send_out_replies def run(self): while True: rd, _, _ = select.select(self.all_sockets, [], []) for sock in rd: if sock == self.main_socket: self.read_main_socket() elif sock == self.notify_pipe: self.send_out_replies() else: self.read_other_socket(sock) class Server: def __init__(self, location, capacity, query_size, reply_size, milestone_step=0): self.location = location self.capacity = capacity self.query_size = query_size self.reply_size = reply_size self.slot_size = 3 + max(query_size, reply_size) self.next_milestone = milestone_step self.milestone_step = milestone_step self.min_timeout = 0.001 # self.max_timeout = 0.064 self.max_timeout = 1.0 self._init_shmem() self._init_timers() print "query_size",query_size,"reply_size",reply_size def slot_locations(self, slot): return slot*self.slot_size, (slot+1)*self.slot_size def _init_shmem(self): self.shmem_name = self.location + ".shm" self.shmem_file = open(self.shmem_name, "w+b") self.shmem_file.seek(self.slot_size*self.capacity - 1, 0) self.shmem_file.write(b'\0') self.shmem_file.seek(0, 0) self.shmem = mmap.mmap(self.shmem_file.fileno(), 0) def _init_timers(self): self.waiting_timer = timestat.TimeStat("waiting", ignore=15.0) self.preproc_timer = timestat.TimeStat("preprocessing") self.gpu_timer = timestat.WorkTimeStat("gpu") self.pp_shm_timer = timestat.WorkTimeStat("pp_shmem") self.pp_sock_timer = timestat.WorkTimeStat("pp_socket") def _look_for_jobs(self): for slot in range(self.capacity): x, y = self.slot_locations(slot) status = self.shmem[y-2:y] if status == QUERY_AVAILABLE: self.job_slots.append(slot) def run(self): self.sock_conn, self.gpu_conn = multiprocessing.Pipe(True) socketeer = ServerSocketProcess(self.location, self.capacity, self.query_size, self.reply_size, self.shmem, self.sock_conn) socketeer.start() self.run_gpu_side() def run_gpu_side(self): print >>sys.stderr, "gpu side going!" cur_timeout = self.min_timeout while True: self.waiting_timer.start() self.job_slots = [] self._look_for_jobs() timeout = 0.0 if self.job_slots else cur_timeout if debug: print >>sys.stderr, "timeout=", timeout rd, _, _ = select.select([self.gpu_conn], [], [], timeout) for sock in rd: x = sock.recv() if x == "DIE" or len(x) == 0: print "connecting socket closed; gpu side quit." sys.stdout.flush() sys.exit(0) self.waiting_timer.stop() if self.job_slots: self.prepare_run_and_reply() cur_timeout = self.min_timeout elif cur_timeout < self.max_timeout: cur_timeout *= 2 if self.milestone_step and self.gpu_timer.total_work() >= self.next_milestone: print "----" print str(self.waiting_timer) print str(self.preproc_timer) print str(self.gpu_timer) print str(self.pp_shm_timer) print str(self.pp_sock_timer) sys.stdout.flush() self.next_milestone += self.milestone_step # end run() def prepare_run_and_reply(self): if debug: print >>sys.stderr, "jobs", ",".join(map(str,self.job_slots)) self.preproc_timer.start() work = [] for slot in self.job_slots: x, y = self.slot_locations(slot) wtd = bytes(self.shmem[x:x+self.query_size]) cs = checksum(wtd) if debug: print >>sys.stderr, "server received %d bytes with checksum %d" % (len(wtd), cs) assert cs == ord(self.shmem[y-3]), (cs, ord(self.shmem[y-3])) work.append(wtd) self.preproc_timer.stop() self.gpu_timer.start(len(self.job_slots)) if debug: print >>sys.stderr, "about to call self.run_jobs" replies = self.run_jobs(work) if debug: print >>sys.stderr, "finished with self.run_jobs" self.gpu_timer.stop() self.pp_shm_timer.start(len(self.job_slots)) for reply, slot in zip(replies, self.job_slots): assert len(reply) <= self.reply_size x, y = self.slot_locations(slot) self.shmem[x:x+len(reply)] = reply cs = checksum(reply) self.shmem[y-3] = chr(cs) self.shmem[y-2:y] = REPLY_AVAILABLE if debug: print >>sys.stderr, "server sent %d bytes with checksum %d" % (len(reply), cs) self.pp_shm_timer.stop() self.pp_sock_timer.start(len(self.job_slots)) self.gpu_conn.send_bytes("GO") self.pp_sock_timer.stop() self.job_slots = [] #end prepare_run_and_reply class SillyServer(Server): def run_jobs(self, jobs): out = [''.join(reversed(job)) for job in jobs] return out if __name__ == "__main__": if len(sys.argv) == 2: print "running silly server" sys.stdout.flush() S = SillyServer(sys.argv[1], 10, 100, 100) S.run() elif len(sys.argv) == 3: print "running silly client" def cb(x): print "got back",x C = Client(sys.argv[1]) C.write_query(sys.argv[2], cb) C.handle_read() else: print >>sys.stderr, "usage: %s location [send_message]" % (sys.argv[0])
<gh_stars>0 # -*- coding: utf-8 -*- import csv from datetime import datetime, timedelta import string try: import cStringIO as StringIO except ImportError: import StringIO import locale try: locale.setlocale(locale.LC_ALL, 'en_US') except locale.Error: pass from gluon.dal import Field from gluon.html import * from gluon.http import HTTP def get_id(args): """Return ID at first arg if defined and a number, else zero """ id = 0 if args: try: id = to_int(args[0]) except ValueError: pass return id def to_int(s): """Return integer from this string """ return int('0' + ''.join(c for c in s if c.isdigit())) def safe(*words): """Return string safe for using in URL """ safe_chars = string.letters + string.digits + '-' result = [] for word in words: result.append(''.join(c for c in str(word).strip().replace(' ', '-') if c in safe_chars)) return '-'.join(result) def format_records(records, num_columns=2): trs = [] for i, record in enumerate(records): if i % 2 == 0: tds = [] tds.append(XML(record.pretty_link)) if i % 2 == num_columns - 1: trs.append(TR(tds)) return TABLE(trs) class Places: def __init__(self, db, expire_db_secs=3600): """ expire_db_secs: how long before refresh database """ self.db = db self.fields = 'iso', 'country', 'capital', 'area', 'population', 'continent', 'tld', 'currency_code', 'currency_name', 'phone', 'postal_code_format', 'postal_code_regex', 'languages', 'neighbours' self.numeric_fields = 'area', 'population' db.define_table('places', Field('created_on', 'datetime', writable=False, readable=False, default=datetime.now), Field('country_id', 'integer', writable=False, readable=False), Field('national_flag', writable=False, represent=lambda path: IMG(_src=path)), Field('area', 'double', represent=lambda area: locale.format("%d", area, grouping=True) + ' square kilometres'), Field('population', 'integer', represent=lambda pop: locale.format("%d", pop, grouping=True)), #Field('population', 'integer', represent=lambda pop: '{0:,d}'.format(pop)), *[Field(field, 'string') for field in self.fields if field not in self.numeric_fields] #format=lambda record: XML('<a href="%(pretty_url)s">%(country)s (%(iso)s)</a>' % record) ) # define user friendly url for accessing a place db.places.pretty_url = Field.Virtual('pretty_url', lambda record: URL(c='default', f='view', extension=False, args=safe(record.places.country, record.places.country_id))) db.places.pretty_link = Field.Virtual('pretty_link', lambda record: str(\ DIV( A( IMG(_src=record.places.national_flag), #db.places.national_flag.represent(record.national_flag), ' %s' % (record.places.country), _href=URL(c='default', f='view', extension=False, args=safe(record.places.country, record.places.country_id)) ) ) )) db.places.continent.represent = lambda continent: A(continent, _href=URL(f='continent', args=continent)) db.places.neighbours.represent = lambda neighbours: DIV( [A(neighbour + ' ', _href=URL(f='iso', args=neighbour)) for neighbour in neighbours.split(',')] ) #db.places.pretty_url = Field.Virtual('pretty_url', lambda record: URL(c='default', f='view', extension=False, args=safe(record.places.country, record.places.country_id))) if db(db.places).count() == 0: self.load() else: created_on = db(db.places).select().first().created_on if created_on is None or created_on + timedelta(seconds=expire_db_secs) < datetime.now(): self.load() def get(self, country_id=None, iso=None): if country_id is not None: logic = self.db.places.country_id == country_id elif iso is not None: logic = self.db.places.iso == iso place = self.db(logic).select().first() if place: return place else: raise HTTP(404, 'Invalid record') def search(self, logic=None, limitby=None): return self.db(logic).select(limitby=limitby, orderby=self.db.places.country_id) def load(self): """Load places from CSV file and delete any existing """ text = """\ AD,Andorra,Andorra la Vella,468,84000,EU,.ad,EUR,Euro,376,AD###,^(?:AD)*(\d{3})$,ca,"ES,FR" AE,United Arab Emirates,Abu Dhabi,82880,4975593,AS,.ae,AED,Dirham,971,,,"ar-AE,fa,en,hi,ur","SA,OM" AF,Afghanistan,Kabul,647500,29121286,AS,.af,AFN,Afghani,93,,,"fa-AF,ps,uz-AF,tk","TM,CN,IR,TJ,PK,UZ" AG,Antigua and Barbuda,St. John's,443,86754,NA,.ag,XCD,Dollar,+1-268,,,en-AG, AI,Anguilla,The Valley,102,13254,NA,.ai,XCD,Dollar,+1-264,,,en-AI, AL,Albania,Tirana,28748,2986952,EU,.al,ALL,Lek,355,,,"sq,el","MK,GR,CS,ME,RS,XK" AM,Armenia,Yerevan,29800,2968000,AS,.am,AMD,Dram,374,######,^(\d{6})$,hy,"GE,IR,AZ,TR" AO,Angola,Luanda,1246700,13068161,AF,.ao,AOA,Kwanza,244,,,pt-AO,"CD,NA,ZM,CG" AQ,Antarctica,,14000000,0,AN,.aq,,,,,,, AR,Argentina,Buenos Aires,2766890,41343201,SA,.ar,ARS,Peso,54,@####@@@,^([A-Z]\d{4}[A-Z]{3})$,"es-AR,en,it,de,fr,gn","CL,BO,UY,PY,BR" AS,American Samoa,Pago Pago,199,57881,OC,.as,USD,Dollar,+1-684,,,"en-AS,sm,to", AT,Austria,Vienna,83858,8205000,EU,.at,EUR,Euro,43,####,^(\d{4})$,"de-AT,hr,hu,sl","CH,DE,HU,SK,CZ,IT,SI,LI" AU,Australia,Canberra,7686850,21515754,OC,.au,AUD,Dollar,61,####,^(\d{4})$,en-AU, AW,Aruba,Oranjestad,193,71566,NA,.aw,AWG,Guilder,297,,,"nl-AW,es,en", AX,Aland Islands,Mariehamn,1580,26711,EU,.ax,EUR,Euro,+358-18,#####,^(?:FI)*(\d{5})$,sv-AX, AZ,Azerbaijan,Baku,86600,8303512,AS,.az,AZN,Manat,994,AZ ####,^(?:AZ)*(\d{4})$,"az,ru,hy","GE,IR,AM,TR,RU" BA,Bosnia and Herzegovina,Sarajevo,51129,4590000,EU,.ba,BAM,Marka,387,#####,^(\d{5})$,"bs,hr-BA,sr-BA","CS,HR,ME,RS" BB,Barbados,Bridgetown,431,285653,NA,.bb,BBD,Dollar,+1-246,BB#####,^(?:BB)*(\d{5})$,en-BB, BD,Bangladesh,Dhaka,144000,156118464,AS,.bd,BDT,Taka,880,####,^(\d{4})$,"bn-BD,en","MM,IN" BE,Belgium,Brussels,30510,10403000,EU,.be,EUR,Euro,32,####,^(\d{4})$,"nl-BE,fr-BE,de-BE","DE,NL,LU,FR" BF,Burkina Faso,Ouagadougou,274200,16241811,AF,.bf,XOF,Franc,226,,,fr-BF,"NE,BJ,GH,CI,TG,ML" BG,Bulgaria,Sofia,110910,7148785,EU,.bg,BGN,Lev,359,####,^(\d{4})$,"bg,tr-BG","MK,GR,RO,CS,TR,RS" BH,Bahrain,Manama,665,738004,AS,.bh,BHD,Dinar,973,####|###,^(\d{3}\d?)$,"ar-BH,en,fa,ur", BI,Burundi,Bujumbura,27830,9863117,AF,.bi,BIF,Franc,257,,,"fr-BI,rn","TZ,CD,RW" BJ,Benin,Porto-Novo,112620,9056010,AF,.bj,XOF,Franc,229,,,fr-BJ,"NE,TG,BF,NG" BL,Saint Barthelemy,Gustavia,21,8450,NA,.gp,EUR,Euro,590,### ###,,fr, BM,Bermuda,Hamilton,53,65365,NA,.bm,BMD,Dollar,+1-441,@@ ##,^([A-Z]{2}\d{2})$,"en-BM,pt", BN,Brunei,Bandar Seri Begawan,5770,395027,AS,.bn,BND,Dollar,673,@@####,^([A-Z]{2}\d{4})$,"ms-BN,en-BN",MY BO,Bolivia,Sucre,1098580,9947418,SA,.bo,BOB,Boliviano,591,,,"es-BO,qu,ay","PE,CL,PY,BR,AR" BQ,"Bonaire, Saint Eustatius and Saba ",,328,18012,NA,.bq,USD,Dollar,599,,,"nl,pap,en", BR,Brazil,Brasilia,8511965,201103330,SA,.br,BRL,Real,55,#####-###,^(\d{8})$,"pt-BR,es,en,fr","SR,PE,BO,UY,GY,PY,GF,VE,CO,AR" BS,Bahamas,Nassau,13940,301790,NA,.bs,BSD,Dollar,+1-242,,,en-BS, BT,Bhutan,Thimphu,47000,699847,AS,.bt,BTN,Ngultrum,975,,,dz,"CN,IN" BV,Bouvet Island,,49,0,AN,.bv,NOK,Krone,,,,, BW,Botswana,Gaborone,600370,2029307,AF,.bw,BWP,Pula,267,,,"en-BW,tn-BW","ZW,ZA,NA" BY,Belarus,Minsk,207600,9685000,EU,.by,BYR,Ruble,375,######,^(\d{6})$,"be,ru","PL,LT,UA,RU,LV" BZ,Belize,Belmopan,22966,314522,NA,.bz,BZD,Dollar,501,,,"en-BZ,es","GT,MX" CA,Canada,Ottawa,9984670,33679000,NA,.ca,CAD,Dollar,1,@#@ #@#,^([ABCEGHJKLMNPRSTVXY]\d[ABCEGHJKLMNPRSTVWXYZ]) ?(\d[ABCEGHJKLMNPRSTVWXYZ]\d)$ ,"en-CA,fr-CA,iu",US CC,Cocos Islands,West Island,14,628,AS,.cc,AUD,Dollar,61,,,"ms-CC,en", CD,Democratic Republic of the Congo,Kinshasa,2345410,70916439,AF,.cd,CDF,Franc,243,,,"fr-CD,ln,kg","TZ,CF,SS,RW,ZM,BI,UG,CG,AO" CF,Central African Republic,Bangui,622984,4844927,AF,.cf,XAF,Franc,236,,,"fr-CF,sg,ln,kg","TD,SD,CD,SS,CM,CG" CG,Republic of the Congo,Brazzaville,342000,3039126,AF,.cg,XAF,Franc,242,,,"fr-CG,kg,ln-CG","CF,GA,CD,CM,AO" CH,Switzerland,Berne,41290,7581000,EU,.ch,CHF,Franc,41,####,^(\d{4})$,"de-CH,fr-CH,it-CH,rm","DE,IT,LI,FR,AT" CI,Ivory Coast,Yamoussoukro,322460,21058798,AF,.ci,XOF,Franc,225,,,fr-CI,"LR,GH,GN,BF,ML" CK,Cook Islands,Avarua,240,21388,OC,.ck,NZD,Dollar,682,,,"en-CK,mi", CL,Chile,Santiago,756950,16746491,SA,.cl,CLP,Peso,56,#######,^(\d{7})$,es-CL,"PE,BO,AR" CM,Cameroon,Yaounde,475440,19294149,AF,.cm,XAF,Franc,237,,,"en-CM,fr-CM","TD,CF,GA,GQ,CG,NG" CN,China,Beijing,9596960,1330044000,AS,.cn,CNY,Yuan Renminbi,86,######,^(\d{6})$,"zh-CN,yue,wuu,dta,ug,za","LA,BT,TJ,KZ,MN,AF,NP,MM,KG,PK,KP,RU,VN,IN" CO,Colombia,Bogota,1138910,44205293,SA,.co,COP,Peso,57,,,es-CO,"EC,PE,PA,BR,VE" CR,Costa Rica,San Jose,51100,4516220,NA,.cr,CRC,Colon,506,####,^(\d{4})$,"es-CR,en","PA,NI" CU,Cuba,Havana,110860,11423000,NA,.cu,CUP,Peso,53,CP #####,^(?:CP)*(\d{5})$,es-CU,US CV,Cape Verde,Praia,4033,508659,AF,.cv,CVE,Escudo,238,####,^(\d{4})$,pt-CV, CW,Curacao, Willemstad,444,141766,NA,.cw,ANG,Guilder,599,,,"nl,pap", CX,Christmas Island,Flying Fish Cove,135,1500,AS,.cx,AUD,Dollar,61,####,^(\d{4})$,"en,zh,ms-CC", CY,Cyprus,Nicosia,9250,1102677,EU,.cy,EUR,Euro,357,####,^(\d{4})$,"el-CY,tr-CY,en", CZ,Czech Republic,Prague,78866,10476000,EU,.cz,CZK,Koruna,420,### ##,^(\d{5})$,"cs,sk","PL,DE,SK,AT" DE,Germany,Berlin,357021,81802257,EU,.de,EUR,Euro,49,#####,^(\d{5})$,de,"CH,PL,NL,DK,BE,CZ,LU,FR,AT" DJ,Djibouti,Djibouti,23000,740528,AF,.dj,DJF,Franc,253,,,"fr-DJ,ar,so-DJ,aa","ER,ET,SO" DK,Denmark,Copenhagen,43094,5484000,EU,.dk,DKK,Krone,45,####,^(\d{4})$,"da-DK,en,fo,de-DK",DE DM,Dominica,Roseau,754,72813,NA,.dm,XCD,Dollar,+1-767,,,en-DM, DO,Dominican Republic,Santo Domingo,48730,9823821,NA,.do,DOP,Peso,+1-809 and 1-829,#####,^(\d{5})$,es-DO,HT DZ,Algeria,Algiers,2381740,34586184,AF,.dz,DZD,Dinar,213,#####,^(\d{5})$,ar-DZ,"NE,EH,LY,MR,TN,MA,ML" EC,Ecuador,Quito,283560,14790608,SA,.ec,USD,Dollar,593,@####@,^([a-zA-Z]\d{4}[a-zA-Z])$,es-EC,"PE,CO" EE,Estonia,Tallinn,45226,1291170,EU,.ee,EUR,Euro,372,#####,^(\d{5})$,"et,ru","RU,LV" EG,Egypt,Cairo,1001450,80471869,AF,.eg,EGP,Pound,20,#####,^(\d{5})$,"ar-EG,en,fr","LY,SD,IL" EH,Western Sahara,El-Aaiun,266000,273008,AF,.eh,MAD,Dirham,212,,,"ar,mey","DZ,MR,MA" ER,Eritrea,Asmara,121320,5792984,AF,.er,ERN,Nakfa,291,,,"aa-ER,ar,tig,kun,ti-ER","ET,SD,DJ" ES,Spain,Madrid,504782,46505963,EU,.es,EUR,Euro,34,#####,^(\d{5})$,"es-ES,ca,gl,eu,oc","AD,PT,GI,FR,MA" ET,Ethiopia,Addis Ababa,1127127,88013491,AF,.et,ETB,Birr,251,####,^(\d{4})$,"am,en-ET,om-ET,ti-ET,so-ET,sid","ER,KE,SD,SS,SO,DJ" FI,Finland,Helsinki,337030,5244000,EU,.fi,EUR,Euro,358,#####,^(?:FI)*(\d{5})$,"fi-FI,sv-FI,smn","NO,RU,SE" FJ,Fiji,Suva,18270,875983,OC,.fj,FJD,Dollar,679,,,"en-FJ,fj", FK,Falkland Islands,Stanley,12173,2638,SA,.fk,FKP,Pound,500,,,en-FK, FM,Micronesia,Palikir,702,107708,OC,.fm,USD,Dollar,691,#####,^(\d{5})$,"en-FM,chk,pon,yap,kos,uli,woe,nkr,kpg", FO,Faroe Islands,Torshavn,1399,48228,EU,.fo,DKK,Krone,298,FO-###,^(?:FO)*(\d{3})$,"fo,da-FO", FR,France,Paris,547030,64768389,EU,.fr,EUR,Euro,33,#####,^(\d{5})$,"fr-FR,frp,br,co,ca,eu,oc","CH,DE,BE,LU,IT,AD,MC,ES" GA,Gabon,Libreville,267667,1545255,AF,.ga,XAF,Franc,241,,,fr-GA,"CM,GQ,CG" GB,United Kingdom,London,244820,62348447,EU,.uk,GBP,Pound,44,@# #@@|@## #@@|@@# #@@|@@## #@@|@#@ #@@|@@#@ #@@|GIR0AA,^(([A-Z]\d{2}[A-Z]{2})|([A-Z]\d{3}[A-Z]{2})|([A-Z]{2}\d{2}[A-Z]{2})|([A-Z]{2}\d{3}[A-Z]{2})|([A-Z]\d[A-Z]\d[A-Z]{2})|([A-Z]{2}\d[A-Z]\d[A-Z]{2})|(GIR0AA))$,"en-GB,cy-GB,gd",IE GD,Grenada,St. George's,344,107818,NA,.gd,XCD,Dollar,+1-473,,,en-GD, GE,Georgia,Tbilisi,69700,4630000,AS,.ge,GEL,Lari,995,####,^(\d{4})$,"ka,ru,hy,az","AM,AZ,TR,RU" GF,French Guiana,Cayenne,91000,195506,SA,.gf,EUR,Euro,594,#####,^((97|98)3\d{2})$,fr-GF,"SR,BR" GG,Guernsey,St Peter Port,78,65228,EU,.gg,GBP,Pound,+44-1481,@# #@@|@## #@@|@@# #@@|@@## #@@|@#@ #@@|@@#@ #@@|GIR0AA,^(([A-Z]\d{2}[A-Z]{2})|([A-Z]\d{3}[A-Z]{2})|([A-Z]{2}\d{2}[A-Z]{2})|([A-Z]{2}\d{3}[A-Z]{2})|([A-Z]\d[A-Z]\d[A-Z]{2})|([A-Z]{2}\d[A-Z]\d[A-Z]{2})|(GIR0AA))$,"en,fr", GH,Ghana,Accra,239460,24339838,AF,.gh,GHS,Cedi,233,,,"en-GH,ak,ee,tw","CI,TG,BF" GI,Gibraltar,Gibraltar,6.5,27884,EU,.gi,GIP,Pound,350,,,"en-GI,es,it,pt",ES GL,Greenland,Nuuk,2166086,56375,NA,.gl,DKK,Krone,299,####,^(\d{4})$,"kl,da-GL,en", GM,Gambia,Banjul,11300,1593256,AF,.gm,GMD,Dalasi,220,,,"en-GM,mnk,wof,wo,ff",SN GN,Guinea,Conakry,245857,10324025,AF,.gn,GNF,Franc,224,,,fr-GN,"LR,SN,SL,CI,GW,ML" GP,Guadeloupe,Basse-Terre,1780,443000,NA,.gp,EUR,Euro,590,#####,^((97|98)\d{3})$,fr-GP,AN GQ,Equatorial Guinea,Malabo,28051,1014999,AF,.gq,XAF,Franc,240,,,"es-GQ,fr","GA,CM" GR,Greece,Athens,131940,11000000,EU,.gr,EUR,Euro,30,### ##,^(\d{5})$,"el-GR,en,fr","AL,MK,TR,BG" GS,South Georgia and the South Sandwich Islands,Grytviken,3903,30,AN,.gs,GBP,Pound,,,,en, GT,Guatemala,Guatemala City,108890,13550440,NA,.gt,GTQ,Quetzal,502,#####,^(\d{5})$,es-GT,"MX,HN,BZ,SV" GU,Guam,Hagatna,549,159358,OC,.gu,USD,Dollar,+1-671,969##,^(969\d{2})$,"en-GU,ch-GU", GW,Guinea-Bissau,Bissau,36120,1565126,AF,.gw,XOF,Franc,245,####,^(\d{4})$,"pt-GW,pov","SN,GN" GY,Guyana,Georgetown,214970,748486,SA,.gy,GYD,Dollar,592,,,en-GY,"SR,BR,VE" HK,Hong Kong,Hong Kong,1092,6898686,AS,.hk,HKD,Dollar,852,,,"zh-HK,yue,zh,en", HM,Heard Island and McDonald Islands,,412,0,AN,.hm,AUD,Dollar, ,,,, HN,Honduras,Tegucigalpa,112090,7989415,NA,.hn,HNL,Lempira,504,@@####,^([A-Z]{2}\d{4})$,es-HN,"GT,NI,SV" HR,Croatia,Zagreb,56542,4491000,EU,.hr,HRK,Kuna,385,#####,^(?:HR)*(\d{5})$,"hr-HR,sr","HU,SI,CS,BA,ME,RS" HT,Haiti,Port-au-Prince,27750,9648924,NA,.ht,HTG,Gourde,509,HT####,^(?:HT)*(\d{4})$,"ht,fr-HT",DO HU,Hungary,Budapest,93030,9982000,EU,.hu,HUF,Forint,36,####,^(\d{4})$,hu-HU,"SK,SI,RO,UA,CS,HR,AT,RS" ID,Indonesia,Jakarta,1919440,242968342,AS,.id,IDR,Rupiah,62,#####,^(\d{5})$,"id,en,nl,jv","PG,TL,MY" IE,Ireland,Dublin,70280,4622917,EU,.ie,EUR,Euro,353,,,"en-IE,ga-IE",GB IL,Israel,Jerusalem,20770,7353985,AS,.il,ILS,Shekel,972,#####,^(\d{5})$,"he,ar-IL,en-IL,","SY,JO,LB,EG,PS" IM,Isle of Man,"Douglas, Isle of Man",572,75049,EU,.im,GBP,Pound,+44-1624,@# #@@|@## #@@|@@# #@@|@@## #@@|@#@ #@@|@@#@ #@@|GIR0AA,^(([A-Z]\d{2}[A-Z]{2})|([A-Z]\d{3}[A-Z]{2})|([A-Z]{2}\d{2}[A-Z]{2})|([A-Z]{2}\d{3}[A-Z]{2})|([A-Z]\d[A-Z]\d[A-Z]{2})|([A-Z]{2}\d[A-Z]\d[A-Z]{2})|(GIR0AA))$,"en,gv", IN,India,New Delhi,3287590,1173108018,AS,.in,INR,Rupee,91,######,^(\d{6})$,"en-IN,hi,bn,te,mr,ta,ur,gu,kn,ml,or,pa,as,bh,sat,ks,ne,sd,kok,doi,mni,sit,sa,fr,lus,inc","CN,NP,MM,BT,PK,BD" IO,British Indian Ocean Territory,Diego Garcia,60,4000,AS,.io,USD,Dollar,246,,,en-IO, IQ,Iraq,Baghdad,437072,29671605,AS,.iq,IQD,Dinar,964,#####,^(\d{5})$,"ar-IQ,ku,hy","SY,SA,IR,JO,TR,KW" IR,Iran,Tehran,1648000,76923300,AS,.ir,IRR,Rial,98,##########,^(\d{10})$,"fa-IR,ku","TM,AF,IQ,AM,PK,AZ,TR" IS,Iceland,Reykjavik,103000,308910,EU,.is,ISK,Krona,354,###,^(\d{3})$,"is,en,de,da,sv,no", IT,Italy,Rome,301230,60340328,EU,.it,EUR,Euro,39,#####,^(\d{5})$,"it-IT,de-IT,fr-IT,sc,ca,co,sl","CH,VA,SI,SM,FR,AT" JE,Jersey,Saint Helier,116,90812,EU,.je,GBP,Pound,+44-1534,@# #@@|@## #@@|@@# #@@|@@## #@@|@#@ #@@|@@#@ #@@|GIR0AA,^(([A-Z]\d{2}[A-Z]{2})|([A-Z]\d{3}[A-Z]{2})|([A-Z]{2}\d{2}[A-Z]{2})|([A-Z]{2}\d{3}[A-Z]{2})|([A-Z]\d[A-Z]\d[A-Z]{2})|([A-Z]{2}\d[A-Z]\d[A-Z]{2})|(GIR0AA))$,"en,pt", JM,Jamaica,Kingston,10991,2847232,NA,.jm,JMD,Dollar,+1-876,,,en-JM, JO,Jordan,Amman,92300,6407085,AS,.jo,JOD,Dinar,962,#####,^(\d{5})$,"ar-JO,en","SY,SA,IQ,IL,PS" JP,Japan,Tokyo,377835,127288000,AS,.jp,JPY,Yen,81,###-####,^(\d{7})$,ja, KE,Kenya,Nairobi,582650,40046566,AF,.ke,KES,Shilling,254,#####,^(\d{5})$,"en-KE,sw-KE","ET,TZ,SS,SO,UG" KG,Kyrgyzstan,Bishkek,198500,5508626,AS,.kg,KGS,Som,996,######,^(\d{6})$,"ky,uz,ru","CN,TJ,UZ,KZ" KH,Cambodia,Phnom Penh,181040,14453680,AS,.kh,KHR,Riels,855,#####,^(\d{5})$,"km,fr,en","LA,TH,VN" KI,Kiribati,Tarawa,811,92533,OC,.ki,AUD,Dollar,686,,,"en-KI,gil", KM,Comoros,Moroni,2170,773407,AF,.km,KMF,Franc,269,,,"ar,fr-KM", KN,Saint Kitts and Nevis,Basseterre,261,51134,NA,.kn,XCD,Dollar,+1-869,,,en-KN, KP,North Korea,Pyongyang,120540,22912177,AS,.kp,KPW,Won,850,###-###,^(\d{6})$,ko-KP,"CN,KR,RU" KR,South Korea,Seoul,98480,48422644,AS,.kr,KRW,Won,82,SEOUL ###-###,^(?:SEOUL)*(\d{6})$,"ko-KR,en",KP XK,Kosovo,Pristina,10908,1800000,EU,,EUR,Euro,,,,"sq,sr","RS,AL,MK,ME" KW,Kuwait,Kuwait City,17820,2789132,AS,.kw,KWD,Dinar,965,#####,^(\d{5})$,"ar-KW,en","SA,IQ" KY,Cayman Islands,George Town,262,44270,NA,.ky,KYD,Dollar,+1-345,,,en-KY, KZ,Kazakhstan,Astana,2717300,15340000,AS,.kz,KZT,Tenge,7,######,^(\d{6})$,"kk,ru","TM,CN,KG,UZ,RU" LA,Laos,Vientiane,236800,6368162,AS,.la,LAK,Kip,856,#####,^(\d{5})$,"lo,fr,en","CN,MM,KH,TH,VN" LB,Lebanon,Beirut,10400,4125247,AS,.lb,LBP,Pound,961,#### ####|####,^(\d{4}(\d{4})?)$,"ar-LB,fr-LB,en,hy","SY,IL" LC,Saint Lucia,Castries,616,160922,NA,.lc,XCD,Dollar,+1-758,,,en-LC, LI,Liechtenstein,Vaduz,160,35000,EU,.li,CHF,Franc,423,####,^(\d{4})$,de-LI,"CH,AT" LK,Sri Lanka,Colombo,65610,21513990,AS,.lk,LKR,Rupee,94,#####,^(\d{5})$,"si,ta,en", LR,Liberia,Monrovia,111370,3685076,AF,.lr,LRD,Dollar,231,####,^(\d{4})$,en-LR,"SL,CI,GN" LS,Lesotho,Maseru,30355,1919552,AF,.ls,LSL,Loti,266,###,^(\d{3})$,"en-LS,st,zu,xh",ZA LT,Lithuania,Vilnius,65200,3565000,EU,.lt,LTL,Litas,370,LT-#####,^(?:LT)*(\d{5})$,"lt,ru,pl","PL,BY,RU,LV" LU,Luxembourg,Luxembourg,2586,497538,EU,.lu,EUR,Euro,352,L-####,^(\d{4})$,"lb,de-LU,fr-LU","DE,BE,FR" LV,Latvia,Riga,64589,2217969,EU,.lv,EUR,Euro,371,LV-####,^(?:LV)*(\d{4})$,"lv,ru,lt","LT,EE,BY,RU" LY,Libya,Tripolis,1759540,6461454,AF,.ly,LYD,Dinar,218,,,"ar-LY,it,en","TD,NE,DZ,SD,TN,EG" MA,Morocco,Rabat,446550,31627428,AF,.ma,MAD,Dirham,212,#####,^(\d{5})$,"ar-MA,fr","DZ,EH,ES" MC,Monaco,Monaco,1.95,32965,EU,.mc,EUR,Euro,377,#####,^(\d{5})$,"fr-MC,en,it",FR MD,Moldova,Chisinau,33843,4324000,EU,.md,MDL,Leu,373,MD-####,^(?:MD)*(\d{4})$,"ro,ru,gag,tr","RO,UA" ME,Montenegro,Podgorica,14026,666730,EU,.me,EUR,Euro,382,#####,^(\d{5})$,"sr,hu,bs,sq,hr,rom","AL,HR,BA,RS,XK" MF,Saint Martin,Marigot,53,35925,NA,.gp,EUR,Euro,590,### ###,,fr,SX MG,Madagascar,Antananarivo,587040,21281844,AF,.mg,MGA,Ariary,261,###,^(\d{3})$,"fr-MG,mg", MH,Marshall Islands,Majuro,181.3,65859,OC,.mh,USD,Dollar,692,,,"mh,en-MH", MK,Macedonia,Skopje,25333,2062294,EU,.mk,MKD,Denar,389,####,^(\d{4})$,"mk,sq,tr,rmm,sr","AL,GR,CS,BG,RS,XK" ML,Mali,Bamako,1240000,13796354,AF,.ml,XOF,Franc,223,,,"fr-ML,bm","SN,NE,DZ,CI,GN,MR,BF" MM,Myanmar,<NAME>,678500,53414374,AS,.mm,MMK,Kyat,95,#####,^(\d{5})$,my,"CN,LA,TH,BD,IN" MN,Mongolia,Ulan Bator,1565000,3086918,AS,.mn,MNT,Tugrik,976,######,^(\d{6})$,"mn,ru","CN,RU" MO,Macao,Macao,254,449198,AS,.mo,MOP,Pataca,853,,,"zh,zh-MO,pt", MP,Northern Mariana Islands,Saipan,477,53883,OC,.mp,USD,Dollar,+1-670,,,"fil,tl,zh,ch-MP,en-MP", MQ,Martinique,Fort-de-France,1100,432900,NA,.mq,EUR,Euro,596,#####,^(\d{5})$,fr-MQ, MR,Mauritania,Nouakchott,1030700,3205060,AF,.mr,MRO,Ouguiya,222,,,"ar-MR,fuc,snk,fr,mey,wo","SN,DZ,EH,ML" MS,Montserrat,Plymouth,102,9341,NA,.ms,XCD,Dollar,+1-664,,,en-MS, MT,Malta,Valletta,316,403000,EU,.mt,EUR,Euro,356,@@@ ###|@@@ ##,^([A-Z]{3}\d{2}\d?)$,"mt,en-MT", MU,Mauritius,Port Louis,2040,1294104,AF,.mu,MUR,Rupee,230,,,"en-MU,bho,fr", MV,Maldives,Male,300,395650,AS,.mv,MVR,Rufiyaa,960,#####,^(\d{5})$,"dv,en", MW,Malawi,Lilongwe,118480,15447500,AF,.mw,MWK,Kwacha,265,,,"ny,yao,tum,swk","TZ,MZ,ZM" MX,Mexico,Mexico City,1972550,112468855,NA,.mx,MXN,Peso,52,#####,^(\d{5})$,es-MX,"GT,US,BZ" MY,Malaysia,Kuala Lumpur,329750,28274729,AS,.my,MYR,Ringgit,60,#####,^(\d{5})$,"ms-MY,en,zh,ta,te,ml,pa,th","BN,TH,ID" MZ,Mozambique,Maputo,801590,22061451,AF,.mz,MZN,Metical,258,####,^(\d{4})$,"pt-MZ,vmw","ZW,TZ,SZ,ZA,ZM,MW" NA,Namibia,Windhoek,825418,2128471,AF,.na,NAD,Dollar,264,,,"en-NA,af,de,hz,naq","ZA,BW,ZM,AO" NC,New Caledonia,Noumea,19060,216494,OC,.nc,XPF,Franc,687,#####,^(\d{5})$,fr-NC, NE,Niger,Niamey,1267000,15878271,AF,.ne,XOF,Franc,227,####,^(\d{4})$,"fr-NE,ha,kr,dje","TD,BJ,DZ,LY,BF,NG,ML" NF,Norfolk Island,Kingston,34.6,1828,OC,.nf,AUD,Dollar,672,####,^(\d{4})$,en-NF, NG,Nigeria,Abuja,923768,154000000,AF,.ng,NGN,Naira,234,######,^(\d{6})$,"en-NG,ha,yo,ig,ff","TD,NE,BJ,CM" NI,Nicaragua,Managua,129494,5995928,NA,.ni,NIO,Cordoba,505,###-###-#,^(\d{7})$,"es-NI,en","CR,HN" NL,Netherlands,Amsterdam,41526,16645000,EU,.nl,EUR,Euro,31,#### @@,^(\d{4}[A-Z]{2})$,"nl-NL,fy-NL","DE,BE" NO,Norway,Oslo,324220,5009150,EU,.no,NOK,Krone,47,####,^(\d{4})$,"no,nb,nn,se,fi","FI,RU,SE" NP,Nepal,Kathmandu,140800,28951852,AS,.np,NPR,Rupee,977,#####,^(\d{5})$,"ne,en","CN,IN" NR,Nauru,Yaren,21,10065,OC,.nr,AUD,Dollar,674,,,"na,en-NR", NU,Niue,Alofi,260,2166,OC,.nu,NZD,Dollar,683,,,"niu,en-NU", NZ,New Zealand,Wellington,268680,4252277,OC,.nz,NZD,Dollar,64,####,^(\d{4})$,"en-NZ,mi", OM,Oman,Muscat,212460,2967717,AS,.om,OMR,Rial,968,###,^(\d{3})$,"ar-OM,en,bal,ur","SA,YE,AE" PA,Panama,Panama City,78200,3410676,NA,.pa,PAB,Balboa,507,,,"es-PA,en","CR,CO" PE,Peru,Lima,1285220,29907003,SA,.pe,PEN,Sol,51,,,"es-PE,qu,ay","EC,CL,BO,BR,CO" PF,French Polynesia,Papeete,4167,270485,OC,.pf,XPF,Franc,689,#####,^((97|98)7\d{2})$,"fr-PF,ty", PG,Papua New Guinea,Port Moresby,462840,6064515,OC,.pg,PGK,Kina,675,###,^(\d{3})$,"en-PG,ho,meu,tpi",ID PH,Philippines,Manila,300000,99900177,AS,.ph,PHP,Peso,63,####,^(\d{4})$,"tl,en-PH,fil", PK,Pakistan,Islamabad,803940,184404791,AS,.pk,PKR,Rupee,92,#####,^(\d{5})$,"ur-PK,en-PK,pa,sd,ps,brh","CN,AF,IR,IN" PL,Poland,Warsaw,312685,38500000,EU,.pl,PLN,Zloty,48,##-###,^(\d{5})$,pl,"DE,LT,SK,CZ,BY,UA,RU" PM,Saint Pierre and Miquelon,Saint-Pierre,242,7012,NA,.pm,EUR,Euro,508,#####,^(97500)$,fr-PM, PN,Pitcairn,Adamstown,47,46,OC,.pn,NZD,Dollar,870,,,en-PN, PR,Puerto Rico,San Juan,9104,3916632,NA,.pr,USD,Dollar,+1-787 and 1-939,#####-####,^(\d{9})$,"en-PR,es-PR", PS,Palestinian Territory,East Jerusalem,5970,3800000,AS,.ps,ILS,Shekel,970,,,ar-PS,"JO,IL" PT,Portugal,Lisbon,92391,10676000,EU,.pt,EUR,Euro,351,####-###,^(\d{7})$,"pt-PT,mwl",ES PW,Palau,Melekeok,458,19907,OC,.pw,USD,Dollar,680,96940,^(96940)$,"pau,sov,en-PW,tox,ja,fil,zh", PY,Paraguay,Asuncion,406750,6375830,SA,.py,PYG,Guarani,595,####,^(\d{4})$,"es-PY,gn","BO,BR,AR" QA,Qatar,Doha,11437,840926,AS,.qa,QAR,Rial,974,,,"ar-QA,es",SA RE,Reunion,Saint-Denis,2517,776948,AF,.re,EUR,Euro,262,#####,^((97|98)(4|7|8)\d{2})$,fr-RE, RO,Romania,Bucharest,237500,21959278,EU,.ro,RON,Leu,40,######,^(\d{6})$,"ro,hu,rom","MD,HU,UA,CS,BG,RS" RS,Serbia,Belgrade,88361,7344847,EU,.rs,RSD,Dinar,381,######,^(\d{6})$,"sr,hu,bs,rom","AL,HU,MK,RO,HR,BA,BG,ME,XK" RU,Russia,Moscow,17100000,140702000,EU,.ru,RUB,Ruble,7,######,^(\d{6})$,"ru,tt,xal,cau,ady,kv,ce,tyv,cv,udm,tut,mns,bua,myv,mdf,chm,ba,inh,tut,kbd,krc,ava,sah,nog","GE,CN,BY,UA,KZ,LV,PL,EE,LT,FI,MN,NO,AZ,KP" RW,Rwanda,Kigali,26338,11055976,AF,.rw,RWF,Franc,250,,,"rw,en-RW,fr-RW,sw","TZ,CD,BI,UG" SA,Saudi Arabia,Riyadh,1960582,25731776,AS,.sa,SAR,Rial,966,#####,^(\d{5})$,ar-SA,"QA,OM,IQ,YE,JO,AE,KW" SB,Solomon Islands,Honiara,28450,559198,OC,.sb,SBD,Dollar,677,,,"en-SB,tpi", SC,Seychelles,Victoria,455,88340,AF,.sc,SCR,Rupee,248,,,"en-SC,fr-SC", SD,Sudan,Khartoum,1861484,35000000,AF,.sd,SDG,Pound,249,#####,^(\d{5})$,"ar-SD,en,fia","SS,TD,EG,ET,ER,LY,CF" SS,South Sudan,Juba,644329,8260490,AF,,SSP,Pound,211,,,en,"CD,CF,ET,KE,SD,UG," SE,Sweden,Stockholm,449964,9555893,EU,.se,SEK,Krona,46,### ##,^(?:SE)*(\d{5})$,"sv-SE,se,sma,fi-SE","NO,FI" SG,Singapore,Singapur,692.7,4701069,AS,.sg,SGD,Dollar,65,######,^(\d{6})$,"cmn,en-SG,ms-SG,ta-SG,zh-SG", SH,Saint Helena,Jamestown,410,7460,AF,.sh,SHP,Pound,290,STHL 1ZZ,^(STHL1ZZ)$,en-SH, SI,Slovenia,Ljubljana,20273,2007000,EU,.si,EUR,Euro,386,####,^(?:SI)*(\d{4})$,"sl,sh","HU,IT,HR,AT" SJ,Svalbard and <NAME>,Longyearbyen,62049,2550,EU,.sj,NOK,Krone,47,,,"no,ru", SK,Slovakia,Bratislava,48845,5455000,EU,.sk,EUR,Euro,421,### ##,^(\d{5})$,"sk,hu","PL,HU,CZ,UA,AT" SL,Sierra Leone,Freetown,71740,5245695,AF,.sl,SLL,Leone,232,,,"en-SL,men,tem","LR,GN" SM,San Marino,San Marino,61.2,31477,EU,.sm,EUR,Euro,378,4789#,^(4789\d)$,it-SM,IT SN,Senegal,Dakar,196190,12323252,AF,.sn,XOF,Franc,221,#####,^(\d{5})$,"fr-SN,wo,fuc,mnk","GN,MR,GW,GM,ML" SO,Somalia,Mogadishu,637657,10112453,AF,.so,SOS,Shilling,252,@@ #####,^([A-Z]{2}\d{5})$,"so-SO,ar-SO,it,en-SO","ET,KE,DJ" SR,Suriname,Paramaribo,163270,492829,SA,.sr,SRD,Dollar,597,,,"nl-SR,en,srn,hns,jv","GY,BR,GF" ST,Sao Tome and Principe,Sao Tome,1001,175808,AF,.st,STD,Dobra,239,,,pt-ST, SV,El Salvador,San Salvador,21040,6052064,NA,.sv,USD,Dollar,503,CP ####,^(?:CP)*(\d{4})$,es-SV,"GT,HN" SX,Sint Maarten,Philipsburg,34,37429,NA,.sx,ANG,Guilder,599,,,"nl,en",MF SY,Syria,Damascus,185180,22198110,AS,.sy,SYP,Pound,963,,,"ar-SY,ku,hy,arc,fr,en","IQ,JO,IL,TR,LB" SZ,Swaziland,Mbabane,17363,1354051,AF,.sz,SZL,Lilangeni,268,@###,^([A-Z]\d{3})$,"en-SZ,ss-SZ","ZA,MZ" TC,Turks and Caicos Islands,Cockburn Town,430,20556,NA,.tc,USD,Dollar,+1-649,TKCA 1ZZ,^(TKCA 1ZZ)$,en-TC, TD,Chad,N'Djamena,1284000,10543464,AF,.td,XAF,Franc,235,,,"fr-TD,ar-TD,sre","NE,LY,CF,SD,CM,NG" TF,French Southern Territories,Port-aux-Francais,7829,140,AN,.tf,EUR,Euro ,,,,fr, TG,Togo,Lome,56785,6587239,AF,.tg,XOF,Franc,228,,,"fr-TG,ee,hna,kbp,dag,ha","BJ,GH,BF" TH,Thailand,Bangkok,514000,67089500,AS,.th,THB,Baht,66,#####,^(\d{5})$,"th,en","LA,MM,KH,MY" TJ,Tajikistan,Dushanbe,143100,7487489,AS,.tj,TJS,Somoni,992,######,^(\d{6})$,"tg,ru","CN,AF,KG,UZ" TK,Tokelau,,10,1466,OC,.tk,NZD,Dollar,690,,,"tkl,en-TK", TL,East Timor,Dili,15007,1154625,OC,.tl,USD,Dollar,670,,,"tet,pt-TL,id,en",ID TM,Turkmenistan,Ashgabat,488100,4940916,AS,.tm,TMT,Manat,993,######,^(\d{6})$,"tk,ru,uz","AF,IR,UZ,KZ" TN,Tunisia,Tunis,163610,10589025,AF,.tn,TND,Dinar,216,####,^(\d{4})$,"ar-TN,fr","DZ,LY" TO,Tonga,Nuku'alofa,748,122580,OC,.to,TOP,Pa'anga,676,,,"to,en-TO", TR,Turkey,Ankara,780580,77804122,AS,.tr,TRY,Lira,90,#####,^(\d{5})$,"tr-TR,ku,diq,az,av","SY,GE,IQ,IR,GR,AM,AZ,BG" TT,Trinidad and Tobago,Port of Spain,5128,1228691,NA,.tt,TTD,Dollar,+1-868,,,"en-TT,hns,fr,es,zh", TV,Tuvalu,Funafuti,26,10472,OC,.tv,AUD,Dollar,688,,,"tvl,en,sm,gil", TW,Taiwan,Taipei,35980,22894384,AS,.tw,TWD,Dollar,886,#####,^(\d{5})$,"zh-TW,zh,nan,hak", TZ,Tanzania,Dodoma,945087,41892895,AF,.tz,TZS,Shilling,255,,,"sw-TZ,en,ar","MZ,KE,CD,RW,ZM,BI,UG,MW" UA,Ukraine,Kiev,603700,45415596,EU,.ua,UAH,Hryvnia,380,#####,^(\d{5})$,"uk,ru-UA,rom,pl,hu","PL,MD,HU,SK,BY,RO,RU" UG,Uganda,Kampala,236040,33398682,AF,.ug,UGX,Shilling,256,,,"en-UG,lg,sw,ar","TZ,KE,SS,CD,RW" UM,United States Minor Outlying Islands,,0,0,OC,.um,USD,Dollar ,1,,,en-UM, US,United States,Washington,9629091,310232863,NA,.us,USD,Dollar,1,#####-####,^\d{5}(-\d{4})?$,"en-US,es-US,haw,fr","CA,MX,CU" UY,Uruguay,Montevideo,176220,3477000,SA,.uy,UYU,Peso,598,#####,^(\d{5})$,es-UY,"BR,AR" UZ,Uzbekistan,Tashkent,447400,27865738,AS,.uz,UZS,Som,998,######,^(\d{6})$,"uz,ru,tg","TM,AF,KG,TJ,KZ" VA,Vatican,Vatican City,0.44,921,EU,.va,EUR,Euro,379,#####,^(\d{5})$,"la,it,fr",IT VC,Saint Vincent and the Grenadines,Kingstown,389,104217,NA,.vc,XCD,Dollar,+1-784,,,"en-VC,fr", VE,Venezuela,Caracas,912050,27223228,SA,.ve,VEF,Bolivar,58,####,^(\d{4})$,es-VE,"GY,BR,CO" VG,British Virgin Islands,Road Town,153,21730,NA,.vg,USD,Dollar,+1-284,,,en-VG, VI,U.S. Virgin Islands,Charlotte Amalie,352,108708,NA,.vi,USD,Dollar,+1-340,#####-####,^\d{5}(-\d{4})?$,en-VI, VN,Vietnam,Hanoi,329560,89571130,AS,.vn,VND,Dong,84,######,^(\d{6})$,"vi,en,fr,zh,km","CN,LA,KH" VU,Vanuatu,Port Vila,12200,221552,OC,.vu,VUV,Vatu,678,,,"bi,en-VU,fr-VU", WF,Wallis and Futuna,Mata Utu,274,16025,OC,.wf,XPF,Franc,681,#####,^(986\d{2})$,"wls,fud,fr-WF", WS,Samoa,Apia,2944,192001,OC,.ws,WST,Tala,685,,,"sm,en-WS", YE,Yemen,Sanaa,527970,23495361,AS,.ye,YER,Rial,967,,,ar-YE,"SA,OM" YT,Mayotte,Mamoudzou,374,159042,AF,.yt,EUR,Euro,262,#####,^(\d{5})$,fr-YT, ZA,South Africa,Pretoria,1219912,49000000,AF,.za,ZAR,Rand,27,####,^(\d{4})$,"zu,xh,af,nso,en-ZA,tn,st,ts,ss,ve,nr","ZW,SZ,MZ,BW,NA,LS" ZM,Zambia,Lusaka,752614,13460305,AF,.zm,ZMW,Kwacha,260,#####,^(\d{5})$,"en-ZM,bem,loz,lun,lue,ny,toi","ZW,TZ,MZ,CD,NA,MW,AO" ZW,Zimbabwe,Harare,390580,11651858,AF,.zw,ZWL,Dollar,263,,,"en-ZW,sn,nr,nd","ZA,MZ,BW,ZM" CS,Serbia and Montenegro,Belgrade,102350,10829175,EU,.cs,RSD,Dinar,381,#####,^(\d{5})$,"cu,hu,sq,sr","AL,HU,MK,RO,HR,BA,BG" AN,Netherlands Antilles,Willemstad,960,136197,NA,.an,ANG,Guilder,599,,,"nl-AN,en,es",GP""" fp = StringIO.StringIO(text) rows = list(csv.reader(fp)) # sort by country name rows.sort(key=lambda row: row[1]) # delete existing places before inserting new ones self.db(self.db.places).delete() for i, row in enumerate(rows): # remove surrounding text row = [e.strip() for e in row] record = dict(zip(self.fields, row)) # convert numeric fields to proper type for field in self.numeric_fields: try: value = int(record[field]) except ValueError: value = float(record[field]) record[field] = value # add country_id for ordering on GAE, which does not use sequential ID's record['country_id'] = i + 1 record['national_flag'] = URL(c='static', f='images/flags/%s.png' % record['iso'].lower()) self.db.places.insert(**record)
<gh_stars>0 """ validataclass Copyright (c) 2021, binary butterfly GmbH and contributors Use of this source code is governed by an MIT-style license that can be found in the LICENSE file. """ import re from typing import Any, Optional, Union from .string_validator import StringValidator from validataclass.exceptions import RegexMatchError __all__ = [ 'RegexValidator', ] class RegexValidator(StringValidator): """ Validator that matches strings against a specified regular expression, optionally with minimal/maximal length requirements. This validator is based on the `StringValidator` which first handles type checking and optional length requirements. The input string is then matched against the regex using `re.fullmatch()` from the Python standard library, which means that the *full* string must match the regex. The regex can be specified either as a precompiled pattern (see `re.compile()`) or as a string which will be compiled by the class. Regex flags (e.g. `re.IGNORECASE` for case-insensitive matching) can only be set by precompiling a pattern with those flags. For further information on regular expressions, see: https://docs.python.org/3/library/re.html If the input string does not match the regex, a `RegexMatchError` validation error with the error code 'invalid_string_format' is raised. The error code can be overridden with the 'custom_error_code' parameter to get more explicit error messages. By default only "safe" singleline strings are allowed (i.e. no non-printable characters). See the `StringValidator` options 'unsafe' and 'multiline' for more details. Examples: ``` # Import Python standard library for regular expressions import re # Use a precompiled regular expression to match lower-case hexadecimal numbers (e.g. '0', '123abc', '00ff00') RegexValidator(re.compile(r'[0-9a-f]+')) # Same as above, but with the re.IGNORECASE flag for case-insensitive matching (e.g. '123abc', '123ABC') RegexValidator(re.compile(r'[0-9a-f]+', re.IGNORECASE)) # Same as above, but using a raw string instead of a precompiled pattern (explicitly allowing uppercase letters in character class) RegexValidator(r'[0-9a-fA-F]+') # As above, but setting string length requirements to only allow 6-digit hex numbers (e.g. '123abc') RegexValidator(re.compile(r'[0-9a-f]+', re.IGNORECASE), min_length=6, max_length=6) # Set a custom error code (on error, validator will raise RegexMatchError with dict representation {'code': 'invalid_hex_number'}) RegexValidator(re.compile(r'[0-9a-f]+'), custom_error_code='invalid_hex_number') ``` Valid input: Any `str` that matches the regex Output: `str` (unmodified input if valid) """ # Precompiled regex pattern regex_pattern: re.Pattern # Error code to use in RegexMatchError exception (use default if None) custom_error_code: Optional[str] = None def __init__(self, pattern: Union[re.Pattern, str], *, custom_error_code: Optional[str] = None, **kwargs): """ Create a RegexValidator with a specified regex pattern (as string or precompiled `re.Pattern` object). Optionally with a custom error code. Other keyword arguments (e.g. 'min_length', 'max_length', 'multiline' and 'unsafe') will be passed to `StringValidator`. """ # Initialize base StringValidator (may set min_length/max_length via kwargs) super().__init__(**kwargs) # Save regex pattern (precompile if necessary) if isinstance(pattern, re.Pattern): self.regex_pattern = pattern else: self.regex_pattern = re.compile(pattern) # Save custom error code if custom_error_code is not None: self.custom_error_code = custom_error_code def validate(self, input_data: Any) -> str: """ Validate input as string and match full string against regular expression. Returns unmodified string. """ # Validate input with base StringValidator (checks length requirements) input_data = super().validate(input_data) # Match full string against Regex pattern if not self.regex_pattern.fullmatch(input_data): raise RegexMatchError(code=self.custom_error_code) return input_data
<filename>tests/test_scanner.py import pytest from utils.scanner import StringScanner @pytest.fixture def scanner(): src = 'Hello, world!' return StringScanner(src) class TestScanner: def test_init(self): src = 'Hello, world!' scanner = StringScanner(src) assert scanner.text == src assert scanner.pos == 0 assert scanner.match == None def test_repr(self, scanner): should_be = '<StringScanner: position=0 text="Hello, world!">' assert repr(scanner) == should_be def test_check_valid(self, scanner): stuff = scanner.check(r'\w+') assert stuff == 'Hello' assert scanner.match == stuff assert scanner.pos == 0 def test_check_invalid(self, scanner): stuff = scanner.check(r'\s+') assert stuff == None assert scanner.match == stuff assert scanner.pos == 0 def test_skip_valid(self, scanner): num_skipped = scanner.skip(r'\w+') assert num_skipped == 5 assert scanner.pos == 5 assert scanner.match == 'Hello' def test_skip_invalid(self, scanner): num_skipped = scanner.skip(r'\s+') assert num_skipped == 0 assert scanner.pos == 0 assert scanner.match ==None def test_unscan(self, scanner): scanner.scan(r'\w+') assert scanner.pos == 5 assert scanner.match == 'Hello' scanner.unscan() assert scanner.pos == 0 assert scanner.match == None def test_getch(self, scanner): first_char = scanner.getch() assert scanner.pos == 1 assert first_char == 'H' assert scanner.match == 'H' second_char = scanner.getch() assert scanner.pos == 2 assert second_char == 'e' assert scanner.match == 'e' def test_append(self, scanner): text = scanner.text old_pos = scanner.pos old_match = scanner.match scanner.append('blah') assert scanner.text == text + 'blah' assert scanner.pos == old_pos assert scanner.match == old_match def test_not_at_eos(self, scanner): assert scanner.pos == 0 assert len(scanner.text) > 0 assert not scanner.end_of_string def test_at_eos(self, scanner): scanner.scan('Hello, world!') assert scanner.pos == len(scanner.text) assert scanner.end_of_string def test_simple_getitem(self, scanner): assert scanner[2] == 'l' assert scanner[-1] == '!' def test_getitem_slice(self, scanner): assert scanner[:5] == 'Hello' assert scanner[1:5:2] == 'el' assert scanner[5:] == ', world!' def test_invalid_getitem(self, scanner): with pytest.raises(IndexError): scanner[123] with pytest.raises(TypeError): # Because we shouldn't be trying to access a string using a # string index scanner['blah'] def test_current_char(self, scanner): assert scanner.current_char == 'H' scanner.scan(r'\w+,') assert scanner.current_char == ' ' def test_current_char_at_eos(self, scanner): scanner.scan('Hello, world!') assert scanner.end_of_string assert scanner.current_char == None def test_peek(self, scanner): """ Make sure that using peek() doesn't affect the state of the scanner """ assert scanner.pos == 0 assert scanner.current_char == 'H' assert scanner.match == None assert scanner.peek() == 'e' assert scanner.pos == 0 assert scanner.current_char == 'H' assert scanner.match == None def test_peek_multiple_chars(self, scanner): assert scanner.peek(2) == 'el' assert scanner.peek(5) == 'ello,' def test_rest(self, scanner): scanner.scan(r'\w+') old_pos = scanner.pos assert scanner.rest == ', world!' assert scanner.pos == old_pos
<gh_stars>1-10 import numpy as np import nibabel import pytest from nilearn._utils.testing import write_tmp_imgs from nilearn.decomposition.dict_learning import DictLearning from nilearn.decomposition.tests.test_canica import _make_canica_test_data from nilearn.image import iter_img, get_data from nilearn.input_data import NiftiMasker from nilearn.decomposition.tests.test_multi_pca import _tmp_dir def test_dict_learning(): data, mask_img, components, rng = _make_canica_test_data(n_subjects=8) masker = NiftiMasker(mask_img=mask_img).fit() mask = get_data(mask_img) != 0 flat_mask = mask.ravel() dict_init = masker.inverse_transform(components[:, flat_mask]) dict_learning = DictLearning(n_components=4, random_state=0, dict_init=dict_init, mask=mask_img, smoothing_fwhm=0., alpha=1) dict_learning_auto_init = DictLearning(n_components=4, random_state=0, mask=mask_img, smoothing_fwhm=0., n_epochs=10, alpha=1) maps = {} for estimator in [dict_learning, dict_learning_auto_init]: estimator.fit(data) maps[estimator] = get_data(estimator.components_img_) maps[estimator] = np.reshape( np.rollaxis(maps[estimator], 3, 0)[:, mask], (4, flat_mask.sum())) masked_components = components[:, flat_mask] for this_dict_learning in [dict_learning]: these_maps = maps[this_dict_learning] S = np.sqrt(np.sum(masked_components ** 2, axis=1)) S[S == 0] = 1 masked_components /= S[:, np.newaxis] S = np.sqrt(np.sum(these_maps ** 2, axis=1)) S[S == 0] = 1 these_maps /= S[:, np.newaxis] K = np.abs(masked_components.dot(these_maps.T)) recovered_maps = np.sum(K > 0.9) assert(recovered_maps >= 2) # Smoke test n_epochs > 1 dict_learning = DictLearning(n_components=4, random_state=0, dict_init=dict_init, mask=mask_img, smoothing_fwhm=0., n_epochs=2, alpha=1) dict_learning.fit(data) def test_component_sign(): # Regression test # We should have a heuristic that flips the sign of components in # DictLearning to have more positive values than negative values, for # instance by making sure that the largest value is positive. data, mask_img, components, rng = _make_canica_test_data(n_subjects=2, noisy=True) for mp in components: assert -mp.min() <= mp.max() dict_learning = DictLearning(n_components=4, random_state=rng, mask=mask_img, smoothing_fwhm=0., alpha=1) dict_learning.fit(data) for mp in iter_img(dict_learning.components_img_): mp = get_data(mp) assert np.sum(mp[mp <= 0]) <= np.sum(mp[mp > 0]) def test_masker_attributes_with_fit(): # Test base module at sub-class data, mask_img, components, rng = _make_canica_test_data(n_subjects=3) # Passing mask_img dict_learning = DictLearning(n_components=3, mask=mask_img, random_state=0) dict_learning.fit(data) assert dict_learning.mask_img_ == mask_img assert dict_learning.mask_img_ == dict_learning.masker_.mask_img_ # Passing masker masker = NiftiMasker(mask_img=mask_img) dict_learning = DictLearning(n_components=3, mask=masker, random_state=0) dict_learning.fit(data) assert dict_learning.mask_img_ == dict_learning.masker_.mask_img_ dict_learning = DictLearning(mask=mask_img, n_components=3) with pytest.raises(ValueError, match="Object has no components_ attribute. " "This is probably because " "fit has not been called"): dict_learning.transform(data) # Test if raises an error when empty list of provided. with pytest.raises(ValueError, match='Need one or more Niimg-like objects ' 'as input, an empty list was given.'): dict_learning.fit([]) # Test passing masker arguments to estimator dict_learning = DictLearning(n_components=3, target_affine=np.eye(4), target_shape=(6, 8, 10), mask_strategy='background') dict_learning.fit(data) def test_components_img(): data, mask_img, _, _ = _make_canica_test_data(n_subjects=3) n_components = 3 dict_learning = DictLearning(n_components=n_components, mask=mask_img) dict_learning.fit(data) components_img = dict_learning.components_img_ assert isinstance(components_img, nibabel.Nifti1Image) check_shape = data[0].shape + (n_components,) assert components_img.shape, check_shape def test_with_globbing_patterns_with_single_subject(): # single subject data, mask_img, _, _ = _make_canica_test_data(n_subjects=1) n_components = 3 dictlearn = DictLearning(n_components=n_components, mask=mask_img) with write_tmp_imgs(data[0], create_files=True, use_wildcards=True) as img: input_image = _tmp_dir() + img dictlearn.fit(input_image) components_img = dictlearn.components_img_ assert isinstance(components_img, nibabel.Nifti1Image) # n_components = 3 check_shape = data[0].shape[:3] + (3,) assert components_img.shape, check_shape def test_with_globbing_patterns_with_multi_subjects(): # multi subjects data, mask_img, _, _ = _make_canica_test_data(n_subjects=3) n_components = 3 dictlearn = DictLearning(n_components=n_components, mask=mask_img) with write_tmp_imgs(data[0], data[1], data[2], create_files=True, use_wildcards=True) as img: input_image = _tmp_dir() + img dictlearn.fit(input_image) components_img = dictlearn.components_img_ assert isinstance(components_img, nibabel.Nifti1Image) # n_components = 3 check_shape = data[0].shape[:3] + (3,) assert components_img.shape, check_shape
<reponame>kirylkrauchuk/redistimeseries import time from RLTest import Env import time def assert_msg(env, msg, expected_type, expected_data): env.assertEqual(expected_type, msg['type']) env.assertEqual(expected_data, msg['data']) def test_keyspace(): sample_len = 1024 env = Env() with env.getClusterConnectionIfNeeded() as r: r.execute_command('config', 'set', 'notify-keyspace-events', 'KEA') pubsub = r.pubsub() pubsub.psubscribe('__key*') time.sleep(1) env.assertEqual('psubscribe', pubsub.get_message()['type']) r.execute_command('ts.add', 'tester{2}', 100, 1.1) assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester{2}') # Test MADD generate events for each key updated r.execute_command("ts.madd", 'tester{2}', "*", 10, 'test_key2{2}', 2000, 20) assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add') assert_msg(env, pubsub.get_message(), 'pmessage', b'test_key2{2}') # Test INCRBY generate event on key r.execute_command("ts.INCRBY", 'tester{2}', "100") assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.incrby') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester{2}') # Test DECRBY generate event on key r.execute_command("ts.DECRBY", 'tester{2}', "13") assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.decrby') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester{2}') def test_keyspace_create_rules(): sample_len = 1024 env = Env() with env.getClusterConnectionIfNeeded() as r: r.execute_command('config', 'set', 'notify-keyspace-events', 'KEA') pubsub = r.pubsub() pubsub.psubscribe('__key*') time.sleep(1) env.assertEqual('psubscribe', pubsub.get_message()['type']) r.execute_command('TS.CREATE', 'tester_src{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.create') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') r.execute_command('TS.CREATE', 'tester_dest{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.create') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') r.execute_command('TS.CREATERULE', 'tester_src{2}', 'tester_dest{2}', 'AGGREGATION', 'COUNT', 10) assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.createrule:src') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.createrule:dest') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') r.execute_command('TS.DELETERULE', 'tester_src{2}', 'tester_dest{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.deleterule:src') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.deleterule:dest') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') def test_keyspace_rules_send(): sample_len = 1024 env = Env() with env.getClusterConnectionIfNeeded() as r: r.execute_command('config', 'set', 'notify-keyspace-events', 'KEA') pubsub = r.pubsub() pubsub.psubscribe('__key*') time.sleep(1) env.assertEqual('psubscribe', pubsub.get_message()['type']) r.execute_command('TS.CREATE', 'tester_src{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.create') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') r.execute_command('TS.CREATE', 'tester_dest{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.create') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') r.execute_command('TS.CREATERULE', 'tester_src{2}', 'tester_dest{2}', 'AGGREGATION', 'MAX', 1) assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.createrule:src') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.createrule:dest') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') r.execute_command('ts.add', 'tester_src{2}', 100, 1.1) assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') r.execute_command('ts.add', 'tester_src{2}', 101, 1.1) # First getting the event from the dest on the previous window assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add:dest') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}') r.execute_command('ts.incrby', 'tester_src{2}', 3) assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.add:dest') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_dest{2}') assert_msg(env, pubsub.get_message(), 'pmessage', b'ts.incrby') assert_msg(env, pubsub.get_message(), 'pmessage', b'tester_src{2}')
<reponame>daojiaxu/semeval_11 import os import numpy as np # from semeval.datasets import pre_deal import pre_deal_bert import new_pre_deal from keras.preprocessing import sequence from mxnet.contrib import text from transformers import BertTokenizer import pandas as pd from bert_serving.client import BertClient max_len = 1000 tokenizer = BertTokenizer.from_pretrained("bert-large-uncased") def get_vector(): # 文本 texts = [] list = os.listdir("train-articles") for i in range(0, len(list)): f = open("train-articles/" + list[i], encoding='utf8') texts.append(f.read()) glove_6b50d = text.embedding.create("glove", pretrained_file_name='glove.6B.300d.txt') vectors = [] for i in range(0, len(texts)): a = glove_6b50d.get_vecs_by_tokens(tokenizer.tokenize(texts[i])[0:1200]) b = a.asnumpy() if (a.shape[0] < 1200): x = 1200 - int(a.shape[0]) shape_zeros = np.zeros((x, 300)) vector = np.vstack((b, shape_zeros)) vector = vector.tolist() else: vector = b.tolist() vectors.append(vector) vectors = np.array(vectors) np.save("glove_300d_1200.npy", vectors) return vectors def get_vector_test(): # 文本 texts = [] list = os.listdir("dev-articles") for i in range(0, len(list)): f = open("dev-articles/" + list[i], encoding='utf8') texts.append(f.read()) glove_6b50d = text.embedding.create("glove", pretrained_file_name='glove.6B.300d.txt') vectors = [] for i in range(0, len(texts)): a = glove_6b50d.get_vecs_by_tokens(tokenizer.tokenize(texts[i])[0:1200]) b = a.asnumpy() if (a.shape[0] < 1200): x = 1200 - int(a.shape[0]) shape_zeros = np.zeros((x, 300)) vector = np.vstack((b, shape_zeros)) vector = vector.tolist() else: vector = b.tolist() vectors.append(vector) vectors = np.array(vectors) np.save("glove_test_300d_1200.npy", vectors) return vectors def get_labels_vector(): labels_vector_dict, texts = pre_deal_bert.get_labels_vector() labels_vector = [] for key in labels_vector_dict.keys(): labels_vector.append(labels_vector_dict[key]) labels_vector = sequence.pad_sequences(np.array(labels_vector), maxlen=1200, padding='post') np.save("train_labels_vector_1200.npy", labels_vector) def get_labels_vector_new(): labels_vector_dict = new_pre_deal.get_labels_vector_new() labels_vector = [] for key in labels_vector_dict.keys(): labels_vector.append(labels_vector_dict[key]) labels_vector = sequence.pad_sequences(np.array(labels_vector), maxlen=1200, padding='post') np.save("new_train_labels_vector_1200.npy", labels_vector) def get_bert_labels_vector_new(): labels_vector_dict = new_pre_deal.get_labels_vector_new() labels_vector = [] for key in labels_vector_dict.keys(): labels_vector.append(labels_vector_dict[key]) labels_vector = sequence.pad_sequences(np.array(labels_vector), maxlen=500, padding='post') np.save("new_train_dev_labels_vector_500.npy", labels_vector) def new_get_train_dev_vector(): # 文本 texts = [] list = os.listdir("train_dev_articles") for i in range(0, len(list)): f = open("train_dev_articles/" + list[i], encoding='utf8') texts.append(f.read()) glove_6b50d = text.embedding.create("glove", pretrained_file_name='glove.6B.300d.txt') vectors = [] for i in range(0, len(texts)): a = glove_6b50d.get_vecs_by_tokens(tokenizer.tokenize(texts[i])[0:1200]) b = a.asnumpy() if (a.shape[0] < 1200): x = 1200 - int(a.shape[0]) shape_zeros = np.zeros((x, 300)) vector = np.vstack((b, shape_zeros)) vector = vector.tolist() else: vector = b.tolist() vectors.append(vector) vectors = np.array(vectors) np.save("new_train_dev_glove_300d_1200.npy", vectors) return vectors def new_get_train_dev_vector_bert(): # 文本 texts = [] list = os.listdir("train_dev_articles") for i in range(0, len(list)): f = open("train_dev_articles/" + list[i], encoding='utf8') texts.append(f.read()) bc = BertClient(ip='192.168.3.11', port=5555, port_out=5556, check_version=False) texts_vector = bc.encode(texts) np.save("train_dev_vector_bert_450.npy", texts_vector) return texts_vector def new_get_dev_vector_bert(): # 文本 texts = [] list = os.listdir("dev_articles") for i in range(0, len(list)): f = open("dev_articles/" + list[i], encoding='utf8') texts.append(f.read()) bc = BertClient(ip='192.168.3.11', port=5555, port_out=5556, check_version=False) texts_vector = bc.encode(texts) np.save("dev_vector_bert_500.npy", texts_vector) return texts_vector def get_vector_train_tc(): # 文本 train_articles = pd.read_excel("mapping_TC.xlsx") text_list_train = [] labels_list_train = [] for i in range(0, 6369): text_list_train.append(str(train_articles['Associated_Propaganda'][i])) labels_list_train.append(train_articles['Classification'][i]) glove_6b50d = text.embedding.create("glove", pretrained_file_name='glove.6B.300d.txt') vectors = [] for i in range(0, len(text_list_train)): a = glove_6b50d.get_vecs_by_tokens(tokenizer.tokenize(text_list_train[i])[0:100]) b = a.asnumpy() if (a.shape[0] < 100): x = 100 - int(a.shape[0]) shape_zeros = np.zeros((x, 300)) vector = np.vstack((b, shape_zeros)) vector = vector.tolist() else: vector = b.tolist() vectors.append(vector) vectors = np.array(vectors) np.save("tc_glove_train.npy", vectors) return vectors def get_vector_test_tc(): # 文本 dev_articles = pd.read_excel("TC_dev_predict.xlsx") text_list_dev = [] for i in range(0, 1063): text_list_dev.append(dev_articles['Associated_Propaganda'][i]) glove_6b50d = text.embedding.create("glove", pretrained_file_name='glove.6B.300d.txt') vectors = [] for i in range(0, len(text_list_dev)): a = glove_6b50d.get_vecs_by_tokens(tokenizer.tokenize(text_list_dev[i])[0:100]) b = a.asnumpy() if (a.shape[0] < 100): x = 100 - int(a.shape[0]) shape_zeros = np.zeros((x, 300)) vector = np.vstack((b, shape_zeros)) vector = vector.tolist() else: vector = b.tolist() vectors.append(vector) vectors = np.array(vectors) np.save("tc_glove_test.npy", vectors) return vectors def get_vector_test_final(): # 文本 texts = [] list = os.listdir("test-articles") for i in range(0, len(list)): f = open("test-articles/" + list[i], encoding='utf8') texts.append(f.read()) glove_6b50d = text.embedding.create("glove", pretrained_file_name='glove.6B.300d.txt') vectors = [] for i in range(0, len(texts)): a = glove_6b50d.get_vecs_by_tokens(tokenizer.tokenize(texts[i])[0:1200]) b = a.asnumpy() if (a.shape[0] < 1200): x = 1200 - int(a.shape[0]) shape_zeros = np.zeros((x, 300)) vector = np.vstack((b, shape_zeros)) vector = vector.tolist() else: vector = b.tolist() vectors.append(vector) vectors = np.array(vectors) np.save("glove_final_300d_1200.npy", vectors) return vectors def get_test(): texts_vector = np.load("train_case_512.npy") return texts_vector if __name__ == '__main__': # get_labels_vector_new() #new_get_train_dev_vector() #new_get_train_dev_vector_bert() #get_bert_labels_vector_new() text_vector = get_test()
import asyncio import socket import threading import time from collections import deque from contextlib import suppress from btclib_node.constants import NodeStatus, P2pConnStatus from btclib_node.p2p.address import NetworkAddress, to_ipv6 from btclib_node.p2p.connection import Connection from btclib_node.p2p.messages.ping import Ping class P2pManager(threading.Thread): def __init__(self, node, port, peer_db): super().__init__() self.node = node self.logger = node.logger self.port = port self.peer_db = peer_db self.connections = {} self.messages = deque() self.handshake_messages = deque() self.nonces = [] self.last_connection_id = -1 self.loop = asyncio.new_event_loop() def create_connection(self, client, address): client.settimeout(0.0) self.last_connection_id += 1 conn = Connection(self, client, address, self.last_connection_id) self.connections[self.last_connection_id] = conn task = asyncio.run_coroutine_threadsafe(conn.run(), self.loop) conn.task = task def remove_connection(self, id): if id in self.connections.keys(): self.connections[id].stop() self.connections.pop(id) async def async_create_connection(self, address): client = await address.connect() if client: self.create_connection(client, address) def connect(self, address): address = NetworkAddress(ip=to_ipv6(address[0]), port=address[1]) asyncio.run_coroutine_threadsafe( self.async_create_connection(address), self.loop ) async def manage_connections(self, loop): await self.peer_db.get_dns_nodes() while True: now = time.time() for conn in self.connections.copy().values(): if conn.status == P2pConnStatus.Closed: self.remove_connection(conn.id) if now - conn.last_receive > 120: if not conn.ping_sent: ping_msg = Ping() conn.send(ping_msg) conn.ping_sent = now conn.ping_nonce = ping_msg.nonce elif now - conn.ping_sent > 120: self.remove_connection(conn.id) if self.node.status < NodeStatus.HeaderSynced: connection_num = 1 else: connection_num = 10 if len(self.connections) < connection_num and not self.peer_db.is_empty(): already_connected = [conn.address for conn in self.connections.values()] try: address = self.peer_db.random_address() if address not in already_connected: sock = await address.connect() if sock: self.create_connection(sock, address) except Exception: self.logger.exception("Exception occurred") await asyncio.sleep(0.1) async def server(self, loop): server_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM) server_socket.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) server_socket.bind(("0.0.0.0", self.port)) server_socket.listen() server_socket.settimeout(0.0) with server_socket: while True: client, addr = await loop.sock_accept(server_socket) address = NetworkAddress(ip=to_ipv6(addr[0]), port=addr[1]) self.create_connection(client, address) def run(self): self.logger.info("Starting P2P manager") loop = self.loop asyncio.set_event_loop(loop) asyncio.run_coroutine_threadsafe(self.server(loop), loop) asyncio.run_coroutine_threadsafe(self.manage_connections(loop), loop) loop.run_forever() def stop(self): self.loop.call_soon_threadsafe(self.loop.stop) for conn in self.connections.copy().values(): conn.stop() while self.loop.is_running(): pass pending = asyncio.all_tasks(self.loop) for task in pending: task.cancel() with suppress(asyncio.CancelledError): self.loop.run_until_complete(task) self.loop.close() self.logger.info("Stopping P2P Manager") def send(self, msg, id): if id in self.connections: self.connections[id].send(msg) def sendall(self, msg): for conn in self.connections.copy().values(): conn.send(msg)
<filename>app/core/migrations/0011_auto_20200903_2018.py # Generated by Django 3.0.10 on 2020-09-03 20:18 from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('core', '0010_orgunit_is_hqunit'), ] operations = [ migrations.CreateModel( name='Action', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('in_process_step', models.PositiveSmallIntegerField()), ('name', models.CharField(max_length=255)), ('notes', models.TextField()), ('trigger', models.CharField(max_length=255)), ('effects', models.CharField(max_length=255)), ], ), migrations.CreateModel( name='BCMActivity', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(max_length=255)), ('id_BIA', models.CharField(max_length=15)), ('MTPD', models.PositiveSmallIntegerField(choices=[(1, '4 godz.'), (2, '1 dzień'), (3, '2 dni'), (4, '1 tydzień'), (5, '2 tygodnie'), (6, 'do odwołania')])), ('min_recovery_level', models.TextField()), ('TTN', models.PositiveSmallIntegerField(choices=[(1, '4 godz.'), (2, '1 dzień'), (3, '2 dni'), (4, '1 tydzień'), (5, '2 tygodnie'), (6, 'do odwołania')])), ('performer', models.ForeignKey(blank=True, null=True, on_delete=django.db.models.deletion.SET_NULL, to='core.OrgUnit')), ], ), migrations.CreateModel( name='Procedure', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('version', models.CharField(max_length=5)), ('effective_date', models.DateField()), ('goal', models.CharField(max_length=255)), ('actions', models.ManyToManyField(to='core.Action')), ('developed_by', models.OneToOneField(blank=True, null=True, on_delete=django.db.models.deletion.SET_NULL, to='core.OrgUnit')), ], ), migrations.CreateModel( name='WorkTask', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('in_action_order', models.PositiveSmallIntegerField()), ('task', models.TextField()), ('participants', models.CharField(max_length=63)), ('applications', models.CharField(max_length=63)), ('action', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='core.Action')), ('performer', models.OneToOneField(blank=True, null=True, on_delete=django.db.models.deletion.SET_NULL, to='core.OrgUnit')), ], ), migrations.RemoveField( model_name='activity', name='input', ), migrations.RemoveField( model_name='activity', name='performer', ), migrations.RemoveField( model_name='activity', name='process', ), migrations.RemoveField( model_name='activity', name='product', ), migrations.DeleteModel( name='Product', ), migrations.AlterField( model_name='process', name='type', field=models.CharField(choices=[('Operacyjny', 'Operacyjny'), ('Zarządzania', 'Zarządzania'), ('Wsparcia', 'Wsparcia')], max_length=15), ), migrations.DeleteModel( name='Activity', ), migrations.AddField( model_name='procedure', name='process', field=models.ForeignKey(limit_choices_to={'is_megaprocess': False}, on_delete=django.db.models.deletion.CASCADE, to='core.Process'), ), migrations.AddField( model_name='bcmactivity', name='process', field=models.ForeignKey(limit_choices_to={'is_megaprocess': False}, on_delete=django.db.models.deletion.CASCADE, to='core.Process'), ), ]
<reponame>KrishnanS2006/HackDefyProject<gh_stars>1-10 from flask import Flask, render_template, redirect, url_for, request, flash, session from flask_socketio import SocketIO from flask_socketio import send, emit, join_room, leave_room from data import * import random app = Flask(__name__) app.secret_key = b'_5#y2L"F4Q8z\n\xec]/' socketio = SocketIO(app, cors_allowed_origins="*") #Generates Random 6 digit Room Code def generateCode(n): range_start = 10**(n-1) range_end = (10**n)-1 return random.randint(range_start, range_end) # End @socketio.on('joined', namespace='/room') def joined(message): """Sent by clients when they enter a room. A status message is broadcast to all people in the room.""" room = session.get('room') join_room(room) print("Joined!!!") emit('status', {'msg': session.get('username') + ' has entered the room.'}, room=room) @socketio.on('text', namespace='/room') def text(message): """Sent by a client when the user entered a new message. The message is sent to all people in the room.""" room = session.get('room') print("Message!!!", message) emit('message', {'msg': session.get('username') + ':' + message['msg']}, room=room) @socketio.on('left', namespace='/room') def left(message): """Sent by clients when they leave a room. A status message is broadcast to all people in the room.""" room = session.get('room') leave_room(room) print("Left :( :( :(") emit('status', {'msg': session.get('username') + ' has left the room.'}, room=room) @app.route("/", methods=["GET", "POST"]) def index(): if request.method == "POST": if not session.get("username"): flash("You are not logged in!", category="error") return redirect(url_for("login")) video = request.form.get("video") code = request.form.get("code") if video and code: flash("You can't create and join a room!", category="error") return redirect(url_for("index")) if video: code = generateCode(6) while not d_add_room(code, session["username"], video): code = generateCode(6) flash("Your Room was successfully created!", category="success") return redirect(url_for("room_view", code=code)) elif code: room_exists = d_get_room(code) if room_exists: flash("You have successfully joined the room!", category="success") return redirect(url_for("room_view", code=code)) flash("This room code does not exist. Please use a valid room code!", category="error") return redirect(url_for("index")) return render_template("index.html") @app.route("/room/<code>", methods=["GET", "POST"]) def room_view(code=None): if not session.get("username"): flash("You are not logged in!", category="success") return redirect(url_for("login")) if not code: flash("This code could not be found! Please check your code.", category="error") return redirect(url_for("index")) room_exists = d_get_room(code) if not room_exists: flash("This room code does not exist. Please use a valid room code!", category="error") return redirect(url_for("index")) session["room"] = code return render_template("room.html", name=d_get_room(code)["Host"].id, room=code, video=d_get_video(code)) @app.route("/register", methods= ["GET", "POST"]) def register(): if session.get("username"): flash("You are already logged in!", category="success") if request.method == "POST": username = request.form.get("username") password = request.form.get("password") if d_add_user(username, password): flash("Successfully registered!", category="success") session["username"] = username return redirect(url_for("index")) else: flash("This Username already exists! Please choose another username.", category="error") return redirect(url_for("login")) return render_template("register.html") @app.route("/login", methods= ["GET", "POST"]) def login(): if session.get("username"): flash("You are already logged in!", category="success") if request.method == "POST": username = request.form.get("username") password = request.form.get("password") if d_login(username, password): flash("You have been successfully logged in!", category="success") session["username"] = username return redirect(url_for("index")) else: flash("Invalid Username or Password!", category="error") return redirect(url_for("login")) return render_template("login.html") @app.route("/logout") def logout(): if not session.get("username"): flash("You are not logged in!", category="error") session.clear() return redirect(url_for("login")) if __name__ == "__main__": try: from pip._internal.operations import freeze except ImportError: # pip < 10.0 from pip.operations import freeze x = freeze.freeze() for p in x: print(p) socketio.run(app)
# Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. import six import webob.exc from neutron_lib import context from neutron_lib.plugins import constants from oslo_config import cfg from oslo_utils import uuidutils from gbpservice.neutron.db import servicechain_db as svcchain_db from gbpservice.neutron.extensions import servicechain as service_chain from gbpservice.neutron.tests.unit import common as cm from gbpservice.neutron.tests.unit.db.grouppolicy import test_group_policy_db JSON_FORMAT = 'json' GP_PLUGIN_KLASS = ( "gbpservice.neutron.services.grouppolicy.plugin.GroupPolicyPlugin") class ServiceChainDBTestBase(test_group_policy_db.GroupPolicyDBTestBase): def _get_resource_plural(self, resource): if resource.endswith('y'): resource_plural = resource.replace('y', 'ies') else: resource_plural = resource + 's' return resource_plural def _test_list_resources(self, resource, items, neutron_context=None, query_params=None): resource_plural = self._get_resource_plural(resource) res = self._list(resource_plural, neutron_context=neutron_context, query_params=query_params) params = query_params.split('&') params = dict((x.split('=')[0], x.split('=')[1].split(',')) for x in params) count = getattr(self.plugin, 'get_%s_count' % resource_plural)( neutron_context or context.get_admin_context(), params) self.assertEqual(len(res[resource_plural]), count) resource = resource.replace('-', '_') self.assertEqual(sorted([i['id'] for i in res[resource_plural]]), sorted([i[resource]['id'] for i in items])) def _create_profiled_servicechain_node( self, service_type=constants.LOADBALANCERV2, shared_profile=False, profile_tenant_id=None, **kwargs): prof = self.create_service_profile( service_type=service_type, shared=shared_profile, tenant_id=profile_tenant_id or self._tenant_id)['service_profile'] return self.create_servicechain_node( service_profile_id=prof['id'], **kwargs) class ServiceChainDBTestPlugin(svcchain_db.ServiceChainDbPlugin): supported_extension_aliases = ['servicechain'] + ( test_group_policy_db.UNSUPPORTED_REQUIRED_EXTS) path_prefix = "/servicechain" DB_GP_PLUGIN_KLASS = (ServiceChainDBTestPlugin.__module__ + '.' + ServiceChainDBTestPlugin.__name__) class ServiceChainDbTestCase(test_group_policy_db.GroupPolicyDbTestCase): def setUp(self, core_plugin=None, sc_plugin=None, service_plugins=None, ext_mgr=None, gp_plugin=None): super(ServiceChainDbTestCase, self).setUp( gp_plugin=gp_plugin or GP_PLUGIN_KLASS, core_plugin=core_plugin, sc_plugin=sc_plugin, service_plugins=service_plugins, ext_mgr=ext_mgr) self.plugin = self._sc_plugin class TestServiceChainResources(ServiceChainDbTestCase): def _test_show_resource(self, resource, resource_id, attrs): resource_plural = self._get_resource_plural(resource) req = self.new_show_request(resource_plural, resource_id, fmt=self.fmt) res = self.deserialize(self.fmt, req.get_response(self.ext_api)) for k, v in six.iteritems(attrs): self.assertEqual(v, res[resource][k]) def test_create_servicechain_specs_same_node(self): template1 = '{"key1":"value1"}' sp = self.create_service_profile( service_type=constants.FIREWALL)['service_profile'] scn = self.create_servicechain_node( config=template1, service_profile_id=sp['id']) scn_id = scn['servicechain_node']['id'] spec1 = {"servicechain_spec": {'name': 'scs1', 'tenant_id': self._tenant_id, 'nodes': [scn_id]}} spec_req = self.new_create_request('servicechain_specs', spec1, self.fmt) spec_res = spec_req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPCreated.code, spec_res.status_int) res = self.deserialize(self.fmt, spec_res) self.assertIn('servicechain_spec', res) self.assertEqual([scn_id], res['servicechain_spec']['nodes']) spec2 = {"servicechain_spec": {'name': 'scs2', 'tenant_id': self._tenant_id, 'nodes': [scn_id]}} spec_req = self.new_create_request('servicechain_specs', spec2, self.fmt) spec_res = spec_req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPCreated.code, spec_res.status_int) res = self.deserialize(self.fmt, spec_res) self.assertIn('servicechain_spec', res) self.assertEqual([scn_id], res['servicechain_spec']['nodes']) def test_create_and_show_servicechain_node(self): profile = self.create_service_profile(service_type=constants.FIREWALL) attrs = cm.get_create_servicechain_node_default_attrs( service_profile_id=profile['service_profile']['id'], config="config1") scn = self.create_servicechain_node( service_profile_id=profile['service_profile']['id'], config="config1") for k, v in six.iteritems(attrs): self.assertEqual(v, scn['servicechain_node'][k]) self._test_show_resource('servicechain_node', scn['servicechain_node']['id'], attrs) def test_list_servicechain_nodes(self): scns = [ self._create_profiled_servicechain_node(name='scn1', description='scn'), self._create_profiled_servicechain_node(name='scn2', description='scn'), self._create_profiled_servicechain_node(name='scn3', description='scn')] self._test_list_resources('servicechain_node', scns, query_params='description=scn') def test_update_servicechain_node(self): name = 'new_servicechain_node' description = 'new desc' config = 'new_config' profile = self.create_service_profile(service_type=constants.FIREWALL) attrs = cm.get_create_servicechain_node_default_attrs( name=name, description=description, config=config, service_profile_id=profile['service_profile']['id']) scn = self.create_servicechain_node( service_profile_id=profile['service_profile']['id']) data = {'servicechain_node': {'name': name, 'description': description, 'config': config}} req = self.new_update_request('servicechain_nodes', data, scn['servicechain_node']['id']) res = self.deserialize(self.fmt, req.get_response(self.ext_api)) for k, v in six.iteritems(attrs): self.assertEqual(v, res['servicechain_node'][k]) self._test_show_resource('servicechain_node', scn['servicechain_node']['id'], attrs) def test_delete_servicechain_node(self): ctx = context.get_admin_context() scn = self._create_profiled_servicechain_node() scn_id = scn['servicechain_node']['id'] scs = self.create_servicechain_spec(nodes=[scn_id]) scs_id = scs['servicechain_spec']['id'] # Deleting Service Chain Node in use by a Spec should fail self.assertRaises(service_chain.ServiceChainNodeInUse, self.plugin.delete_servicechain_node, ctx, scn_id) req = self.new_delete_request('servicechain_specs', scs_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) # After deleting the Service Chain Spec, node delete should succeed req = self.new_delete_request('servicechain_nodes', scn_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) self.assertRaises(service_chain.ServiceChainNodeNotFound, self.plugin.get_servicechain_node, ctx, scn_id) def test_create_and_show_servicechain_spec(self): name = "scs1" scn = self._create_profiled_servicechain_node() scn_id = scn['servicechain_node']['id'] attrs = cm.get_create_servicechain_spec_default_attrs( name=name, nodes=[scn_id]) scs = self.create_servicechain_spec(name=name, nodes=[scn_id]) for k, v in six.iteritems(attrs): self.assertEqual(v, scs['servicechain_spec'][k]) self._test_show_resource('servicechain_spec', scs['servicechain_spec']['id'], attrs) def test_create_spec_multiple_nodes(self): name = "scs1" scn1 = self._create_profiled_servicechain_node() scn1_id = scn1['servicechain_node']['id'] scn2 = self._create_profiled_servicechain_node() scn2_id = scn2['servicechain_node']['id'] attrs = cm.get_create_servicechain_spec_default_attrs( name=name, nodes=[scn1_id, scn2_id]) scs = self.create_servicechain_spec( name=name, nodes=[scn1_id, scn2_id]) for k, v in six.iteritems(attrs): self.assertEqual(v, scs['servicechain_spec'][k]) def test_list_servicechain_specs(self): scs = [self.create_servicechain_spec(name='scs1', description='scs'), self.create_servicechain_spec(name='scs2', description='scs'), self.create_servicechain_spec(name='scs3', description='scs')] self._test_list_resources('servicechain_spec', scs, query_params='description=scs') def test_node_ordering_list_servicechain_specs(self): scn1_id = self._create_profiled_servicechain_node()[ 'servicechain_node']['id'] scn2_id = self._create_profiled_servicechain_node()[ 'servicechain_node']['id'] nodes_list = [scn1_id, scn2_id] scs = self.create_servicechain_spec(name='scs1', nodes=nodes_list) self.assertEqual(nodes_list, scs['servicechain_spec']['nodes']) res = self._list('servicechain_specs') self.assertEqual(1, len(res['servicechain_specs'])) self.assertEqual(nodes_list, res['servicechain_specs'][0]['nodes']) # Delete the service chain spec and create another with nodes in # reverse order and verify that that proper ordering is maintained req = self.new_delete_request('servicechain_specs', scs['servicechain_spec']['id']) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) nodes_list.reverse() scs = self.create_servicechain_spec(name='scs1', nodes=nodes_list) self.assertEqual(scs['servicechain_spec']['nodes'], nodes_list) res = self._list('servicechain_specs') self.assertEqual(1, len(res['servicechain_specs'])) self.assertEqual(nodes_list, res['servicechain_specs'][0]['nodes']) def test_update_servicechain_spec(self): name = "new_servicechain_spec1" description = 'new desc' scn_id = self._create_profiled_servicechain_node()[ 'servicechain_node']['id'] attrs = cm.get_create_servicechain_spec_default_attrs( name=name, description=description, nodes=[scn_id]) scs = self.create_servicechain_spec() data = {'servicechain_spec': {'name': name, 'description': description, 'nodes': [scn_id]}} req = self.new_update_request('servicechain_specs', data, scs['servicechain_spec']['id']) res = self.deserialize(self.fmt, req.get_response(self.ext_api)) for k, v in six.iteritems(attrs): self.assertEqual(v, res['servicechain_spec'][k]) self._test_show_resource('servicechain_spec', scs['servicechain_spec']['id'], attrs) def test_delete_servicechain_spec(self): ctx = context.get_admin_context() scs = self.create_servicechain_spec() scs_id = scs['servicechain_spec']['id'] req = self.new_delete_request('servicechain_specs', scs_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) self.assertRaises(service_chain.ServiceChainSpecNotFound, self.plugin.get_servicechain_spec, ctx, scs_id) def test_delete_spec_in_use_by_policy_action_rejected(self): ctx = context.get_admin_context() scs_id = self.create_servicechain_spec()['servicechain_spec']['id'] data = {'policy_action': {'action_type': 'redirect', 'tenant_id': self._tenant_id, 'action_value': scs_id}} pa_req = self.new_create_request('grouppolicy/policy_actions', data, self.fmt) res = pa_req.get_response(self.ext_api) if res.status_int >= webob.exc.HTTPClientError.code: raise webob.exc.HTTPClientError(code=res.status_int) self.assertRaises(service_chain.ServiceChainSpecInUse, self.plugin.delete_servicechain_spec, ctx, scs_id) def test_delete_spec_in_use_by_instance_rejected(self): ctx = context.get_admin_context() scs_id = self.create_servicechain_spec()['servicechain_spec']['id'] sci = self.create_servicechain_instance(servicechain_specs=[scs_id]) sci_id = sci['servicechain_instance']['id'] # Deleting the Spec used by Instance should not be allowed self.assertRaises(service_chain.ServiceChainSpecInUse, self.plugin.delete_servicechain_spec, ctx, scs_id) req = self.new_delete_request('servicechain_instances', sci_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) self.assertRaises(service_chain.ServiceChainInstanceNotFound, self.plugin.get_servicechain_instance, ctx, sci_id) # Deleting the spec should succeed after the instance is deleted req = self.new_delete_request('servicechain_specs', scs_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) self.assertRaises(service_chain.ServiceChainSpecNotFound, self.plugin.get_servicechain_spec, ctx, scs_id) def test_create_and_show_servicechain_instance(self): scs_id = self.create_servicechain_spec()['servicechain_spec']['id'] policy_target_group_id = uuidutils.generate_uuid() classifier_id = uuidutils.generate_uuid() config_param_values = "{}" attrs = cm.get_create_servicechain_instance_default_attrs( servicechain_specs=[scs_id], provider_ptg_id=policy_target_group_id, consumer_ptg_id=policy_target_group_id, management_ptg_id=policy_target_group_id, classifier_id=classifier_id, config_param_values=config_param_values) sci = self.create_servicechain_instance( servicechain_specs=[scs_id], provider_ptg_id=policy_target_group_id, consumer_ptg_id=policy_target_group_id, management_ptg_id=policy_target_group_id, classifier_id=classifier_id, config_param_values=config_param_values) for k, v in six.iteritems(attrs): self.assertEqual(v, sci['servicechain_instance'][k]) self._test_show_resource('servicechain_instance', sci['servicechain_instance']['id'], attrs) req = self.new_delete_request('servicechain_instances', sci['servicechain_instance']['id']) req.get_response(self.ext_api) def test_list_servicechain_instances(self): servicechain_instances = [self.create_servicechain_instance( name='sci1', description='sci'), self.create_servicechain_instance(name='sci2', description='sci'), self.create_servicechain_instance(name='sci3', description='sci')] self._test_list_resources('servicechain_instance', servicechain_instances, query_params='description=sci') def test_spec_ordering_list_servicechain_instances(self): scs1_id = self.create_servicechain_spec()['servicechain_spec']['id'] scs2_id = self.create_servicechain_spec()['servicechain_spec']['id'] specs_list = [scs1_id, scs2_id] sci = self.create_servicechain_instance(name='sci1', servicechain_specs=specs_list) self.assertEqual(specs_list, sci['servicechain_instance']['servicechain_specs']) res = self._list('servicechain_instances') self.assertEqual(1, len(res['servicechain_instances'])) result_instance = res['servicechain_instances'][0] self.assertEqual(specs_list, result_instance['servicechain_specs']) # Delete the service chain instance and create another with specs in # reverse order and verify that that proper ordering is maintained req = self.new_delete_request('servicechain_instances', sci['servicechain_instance']['id']) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) specs_list.reverse() sci = self.create_servicechain_instance(name='sci1', servicechain_specs=specs_list) self.assertEqual(specs_list, sci['servicechain_instance']['servicechain_specs']) res = self._list('servicechain_instances') self.assertEqual(1, len(res['servicechain_instances'])) result_instance = res['servicechain_instances'][0] self.assertEqual(specs_list, result_instance['servicechain_specs']) def test_update_servicechain_instance(self): name = "new_servicechain_instance" description = 'new desc' config_param_values = "{}" scs_id = self.create_servicechain_spec()['servicechain_spec']['id'] provider_ptg_id = uuidutils.generate_uuid() consumer_ptg_id = uuidutils.generate_uuid() management_ptg_id = uuidutils.generate_uuid() classifier_id = uuidutils.generate_uuid() attrs = cm.get_create_servicechain_instance_default_attrs( name=name, description=description, servicechain_specs=[scs_id], provider_ptg_id=provider_ptg_id, consumer_ptg_id=consumer_ptg_id, management_ptg_id=management_ptg_id, classifier_id=classifier_id, config_param_values=config_param_values) sci = self.create_servicechain_instance( servicechain_specs=[scs_id], provider_ptg_id=provider_ptg_id, consumer_ptg_id=consumer_ptg_id, management_ptg_id=management_ptg_id, classifier_id=classifier_id, config_param_values=config_param_values) new_classifier_id = uuidutils.generate_uuid() new_scs_id = self.create_servicechain_spec()['servicechain_spec']['id'] attrs.update({'servicechain_specs': [new_scs_id], 'classifier_id': new_classifier_id}) data = {'servicechain_instance': {'name': name, 'description': description, 'servicechain_specs': [new_scs_id], 'classifier_id': new_classifier_id}} req = self.new_update_request('servicechain_instances', data, sci['servicechain_instance']['id']) res = self.deserialize(self.fmt, req.get_response(self.ext_api)) for k, v in six.iteritems(attrs): self.assertEqual(v, res['servicechain_instance'][k]) self._test_show_resource('servicechain_instance', sci['servicechain_instance']['id'], attrs) req = self.new_delete_request('servicechain_instances', sci['servicechain_instance']['id']) req.get_response(self.ext_api) def test_delete_servicechain_instance(self): ctx = context.get_admin_context() sci = self.create_servicechain_instance() sci_id = sci['servicechain_instance']['id'] req = self.new_delete_request('servicechain_instances', sci_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) self.assertRaises(service_chain.ServiceChainInstanceNotFound, self.plugin.get_servicechain_instance, ctx, sci_id) def test_create_and_show_service_profile(self): attrs = cm.get_create_service_profile_default_attrs( service_type=constants.FIREWALL, vendor="vendor1") scn = self.create_service_profile( service_type=constants.FIREWALL, vendor="vendor1") for k, v in six.iteritems(attrs): self.assertEqual(scn['service_profile'][k], v) self._test_show_resource('service_profile', scn['service_profile']['id'], attrs) def test_list_service_profile(self): scns = [self.create_service_profile(name='sp1', description='sp', service_type='LOADBALANCERV2'), self.create_service_profile(name='sp2', description='sp', service_type='LOADBALANCERV2'), self.create_service_profile(name='sp3', description='sp', service_type='LOADBALANCERV2')] self._test_list_resources('service_profile', scns, query_params='description=sp') def test_update_service_profile(self): name = 'new_service_profile' description = 'new desc' attrs = cm.get_create_service_profile_default_attrs( name=name, description=description, service_type=constants.FIREWALL) scn = self.create_service_profile(service_type=constants.FIREWALL) data = {'service_profile': {'name': name, 'description': description}} req = self.new_update_request('service_profiles', data, scn['service_profile']['id']) res = self.deserialize(self.fmt, req.get_response(self.ext_api)) for k, v in six.iteritems(attrs): self.assertEqual(res['service_profile'][k], v) self._test_show_resource('service_profile', scn['service_profile']['id'], attrs) def test_delete_service_profile(self): ctx = context.get_admin_context() sp = self.create_service_profile(service_type='LOADBALANCERV2') sp_id = sp['service_profile']['id'] scn = self.create_servicechain_node(service_profile_id=sp_id) scn_id = scn['servicechain_node']['id'] # Deleting Service Chain Node in use by a Spec should fail self.assertRaises(service_chain.ServiceProfileInUse, self.plugin.delete_service_profile, ctx, sp_id) req = self.new_delete_request('servicechain_nodes', scn_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) # After deleting the Service Chain Spec, node delete should succeed req = self.new_delete_request('service_profiles', sp_id) res = req.get_response(self.ext_api) self.assertEqual(webob.exc.HTTPNoContent.code, res.status_int) self.assertRaises(service_chain.ServiceProfileNotFound, self.plugin.get_service_profile, ctx, sp_id) class TestServiceChainStatusAttributesForResources( test_group_policy_db.TestStatusAttributesForResources): def test_set_status_attrs(self): for resource_name in service_chain.RESOURCE_ATTRIBUTE_MAP: self._test_set_status_attrs(self._get_resource_singular( resource_name), self._sc_plugin) class TestQuotasForServiceChain(ServiceChainDbTestCase): def setUp(self, core_plugin=None, sc_plugin=None, gp_plugin=None, service_plugins=None, ext_mgr=None): cfg.CONF.set_override('quota_servicechain_node', 1, group='QUOTAS') cfg.CONF.set_override('quota_servicechain_spec', 1, group='QUOTAS') cfg.CONF.set_override('quota_servicechain_instance', 1, group='QUOTAS') cfg.CONF.set_override('quota_service_profile', 1, group='QUOTAS') super(TestQuotasForServiceChain, self).setUp( core_plugin=core_plugin, sc_plugin=sc_plugin, gp_plugin=gp_plugin, service_plugins=service_plugins, ext_mgr=ext_mgr) def tearDown(self): cfg.CONF.set_override('quota_servicechain_node', -1, group='QUOTAS') cfg.CONF.set_override('quota_servicechain_spec', -1, group='QUOTAS') cfg.CONF.set_override('quota_servicechain_instance', -1, group='QUOTAS') cfg.CONF.set_override('quota_service_profile', -1, group='QUOTAS') super(TestQuotasForServiceChain, self).tearDown() def test_servicechain_node_quota(self): self.create_servicechain_node() self.assertRaises(webob.exc.HTTPClientError, self.create_servicechain_node) def test_servicechain_spec_quota(self): self.create_servicechain_spec() self.assertRaises(webob.exc.HTTPClientError, self.create_servicechain_spec) def test_servicechain_instance_quota(self): self.create_servicechain_instance() self.assertRaises(webob.exc.HTTPClientError, self.create_servicechain_instance) def test_service_profile(self): self.create_service_profile(service_type=constants.FIREWALL) self.assertRaises(webob.exc.HTTPClientError, self.create_service_profile, service_type=constants.FIREWALL)
import unittest import functools from ..symbol_type import SymbolType from ..lex_token import Token from ..syntax_nonterminal import Nonterminal from ..syntax_productions import productionList # todo, 把formatter改写为一个类 # Config isKeepComment = True isKeepGap = True class Indenter: IndentWidth = 4 def __init__(self): self.nowLevel = 0 def toCode(self): return ' ' * self.IndentWidth * self.nowLevel def postAddAdd(self): code = self.toCode() self.nowLevel += 1 return code def preAddAdd(self): self.nowLevel += 1 return self.toCode() def postSubSub(self): code = self.toCode() self.nowLevel -= 1 return code def preSubSub(self): if self.nowLevel > 0: self.nowLevel -= 1 return self.toCode() class GapManager: def __init__(self): self.count = 0 self.commentListAhead = [] self.commentListBehind = [] def insertCommentAhead(self, comment): self.commentListAhead.append(comment) def insertCommentBehind(self, comment): self.commentListBehind.append(comment) def placeGap(self, increment): self.count += increment return '' def startNewBlock(self): code = '' for comment in self.commentListAhead: code += comment + '\n' if self.count > 0: code += '\n' for comment in self.commentListBehind: code += comment + '\n' self.count = 0 self.commentListAhead = [] self.commentListBehind = [] return code SCFormatter = None class Formatter: def __init__(self, tokens, ast): global SCFormatter SCFormatter = self self.tokens = tokens self.ast = ast self.indenter = Indenter() self.gapManager = GapManager() self.tokenIndex = -1 self.reset() def toCode(self): return self.ast.toCode() # ---- for Token and String ---- def Token2Code(self, token): self.tokenIndex += 1 code = token.text return code def String2Code(self, s): self.tokenIndex += 1 return s; # ---- for Utility ---- @staticmethod def _eatSpace(token): enterCount = 0 while token.kind == SymbolType.TokenType.SpaceLike: if token.text == '\n': enterCount += 1 token = token.nextToken return token, enterCount def restoreComment(self): TokenType = SymbolType.TokenType if self.tokenIndex < 0: return '' commentList = [] lastToken = self.tokens[self.tokenIndex] stopToken = self.tokens[self.tokenIndex + 1] if self.tokenIndex + 1 < len(self.tokens) else None nextToken = lastToken.nextToken while nextToken is not stopToken: if isKeepComment and nextToken.kind == TokenType.Comment: commentWithIndent = self.indenter.toCode() + nextToken.text commentList.append(commentWithIndent) elif isKeepGap and nextToken.text == '\n': nextToken, enterCount = Formatter._eatSpace(nextToken) if enterCount >= 2: self.gapManager.placeGap(1) continue nextToken = nextToken.nextToken lastToken = None code = '' if len(commentList) == 0: pass elif len(commentList) == 1: self.gapManager.insertCommentBehind(commentList[0]) else: self.gapManager.insertCommentAhead(commentList[0]) for i in range(1, len(commentList)): self.gapManager.insertCommentBehind(commentList[i]) return code def reset(self): self.indenter = Indenter() self.gapManager = GapManager() self.tokenIndex = -1 # do injection from . import syntax_tree_to_code syntax_tree_to_code.doInjection(productionList, Token, Nonterminal) # shortcut for frequently call def I(): # 正确的排版,新的一行总会是G()或者I()开头 code = SCFormatter.restoreComment() code += SCFormatter.gapManager.startNewBlock() code += SCFormatter.indenter.toCode() return code def IAA(): code = SCFormatter.restoreComment() code += SCFormatter.gapManager.startNewBlock() code += SCFormatter.indenter.postAddAdd() return code def SSI(): code = SCFormatter.restoreComment() code += SCFormatter.gapManager.startNewBlock() code += SCFormatter.indenter.preSubSub() return code def STR(s): return SCFormatter.String2Code(s) def Token2Code(token): return SCFormatter.Token2Code(token) def G(increment = 1): return SCFormatter.gapManager.placeGap(increment) def E(): return '\n' class Test(unittest.TestCase): def DtestIndenter(self): I = Indenter() print(I.toCode()) def test(self): pass
<reponame>zeta1999/OpenJij # Copyright 2019 Jij Inc. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import cxxjij import openjij from openjij.sampler import SASampler from openjij.model import BinaryQuadraticModel, ChimeraModel from .base_gpu_chimera import BaseGPUChimeraSampler from openjij.utils.graph_utils import chimera_to_ind import numpy as np import dimod class GPUChimeraSASampler(SASampler, BaseGPUChimeraSampler): """Sampler with Simulated Annealing (SA) on GPU. Inherits from :class:`openjij.sampler.sampler.BaseSampler`. Args: beta_min (float): Minimum inverse temperature. beta_max (float): Maximum inverse temperature. num_sweeps (int): Length of Monte Carlo step. schedule_info (dict): Information about a annealing schedule. num_reads (int): Number of iterations. unit_num_L (int): Length of one side of two-dimensional lattice in which chimera unit cells are arranged. Raises: ValueError: If variables violate as below. - trotter number is odd. - no input "unit_num_L" to an argument or this constructor. - given problem graph is incompatible with chimera graph. AttributeError: If GPU doesn't work. """ def __init__(self, beta_min=None, beta_max=None, num_sweeps=1000, schedule=None, num_reads=1, unit_num_L=None, ): super().__init__(beta_min=beta_min, beta_max=beta_max, num_reads=num_reads, num_sweeps=num_sweeps, schedule=schedule) self.unit_num_L = unit_num_L self._make_system = { 'singlespinflip': cxxjij.system.make_chimera_classical_gpu } self._algorithm = { 'singlespinflip': cxxjij.algorithm.Algorithm_GPU_run } def sample_ising(self, h, J, beta_min=None, beta_max=None, num_sweeps=None, num_reads=1, schedule=None, initial_state=None, updater='single spin flip', reinitialize_state=True, seed=None, unit_num_L=None, ): """sample with Ising model. Args: h (dict): linear biases J (dict): quadratic biases beta_min (float): minimal value of inverse temperature beta_max (float): maximum value of inverse temperature num_sweeps (int): number of sweeps num_reads (int): number of reads schedule (list): list of inverse temperature initial_state (dict): initial state updater(str): updater algorithm reinitialize_state (bool): if true reinitialize state for each run seed (int): seed for Monte Carlo algorithm unit_num_L (int): number of chimera units Returns: :class:`openjij.sampler.response.Response`: results Examples:: >>> sampler = oj.GPUChimeraSASampler(unit_num_L=2) >>> h = {0: -1, 1: -1, 2: 1, 3: 1}, >>> J = {(0, 4): -1, (2, 5): -1} >>> res = sampler.sample_ising(h, J) """ self.unit_num_L = unit_num_L if unit_num_L else self.unit_num_L model = openjij.ChimeraModel(linear=h, quadratic=J, var_type='SPIN', unit_num_L=self.unit_num_L, gpu=True) # define Chimera structure structure = {} structure['size'] = 8 * self.unit_num_L * self.unit_num_L structure['dict'] = {} if isinstance(model.indices[0], int): # identity dict for ind in model.indices: structure['dict'][ind] = ind elif isinstance(model.indices[0], tuple): # map chimera coordinate to index for ind in model.indices: structure['dict'][ind] = model.to_index(*ind, self.unit_num_L) return self._sampling(model, beta_min, beta_max, num_sweeps, num_reads, schedule, initial_state, updater, reinitialize_state, seed, structure)
# -*- coding: utf-8 -*- """ """ import pytest import sqlalchemy as sa from pynuget import db def test_count_packages(session): session.add(db.Package(name="pkg_2", latest_version="0.0.1")) session.commit() assert db.count_packages(session) == 2 def test_search_packages(session): # Test with no args result = db.search_packages(session) assert len(result) == 3 assert type(result[0]) == db.Version assert result[0].package.latest_version == "0.0.3" # add a little more dummy data pkg = db.Package(name="test_proj", latest_version="0.1.3") session.add(pkg) session.commit() session.add(db.Version(package_id=pkg.package_id, version="0.1.3")) session.commit() # Test with a search query. Note that the wildcards are added by # the function, and so they're not needed. result = db.search_packages(session, search_query='test') assert len(result) == 1 assert result[0].package.name == "test_proj" # Test with a filter. result = db.search_packages(session, filter_='IsLatestVersion', search_query='%dummy%') assert len(result) == 1 assert result[0].version == "0.0.3" # Test with a different order_by result = db.search_packages(session, order_by=sa.desc(db.Version.version)) assert len(result) == 4 assert result[0].version == '0.1.3' assert result[-1].version == '0.0.1' def test_package_updates(session): # Add more more dummy data pkg = db.Package(name="test_proj", latest_version="0.1.4") session.add(pkg) session.commit() session.add(db.Version(package_id=pkg.package_id, version="0.1.3")) session.add(db.Version(package_id=pkg.package_id, version="0.1.4")) session.commit() data = {1: '0.0.2', 2: '0.1.3'} result = db.package_updates(session, data) assert len(result) == 2 assert type(result[0]) == db.Version assert result[0].package.name == "dummy" assert result[0].version == "0.0.3" assert result[1].package.name == "test_proj" assert result[1].version == "0.1.4" # if we currently have the latest version, return nothing. Do not return # packages that we don't have installed. data = {1: '0.0.3'} result = db.package_updates(session, data) assert len(result) == 0 def test_find_by_pkg_name(session): result_1 = db.find_by_pkg_name(session, 'dummy') assert type(result_1) == list assert len(result_1) == 3 assert type(result_1[0]) == db.Version result_2 = db.find_by_pkg_name(session, 'dummy', "0.0.1") assert len(result_2) == 1 assert result_2[0].version == "0.0.1" def test_validate_id_and_version(session): result_1 = db.validate_id_and_version(session, 'dummy', "0.0.1") assert result_1 is True result_2 = db.validate_id_and_version(session, 'dummy', "9.9.9") assert result_2 is False def test_increment_download_count(session): # Get the previous values version_sql = (session.query(db.Version.version_download_count) .filter(db.Version.version_id == 1)) package_sql = (session.query(db.Package.download_count) .filter(db.Package.name == 'dummy')) prev_version_count = version_sql.scalar() prev_package_count = package_sql.scalar() # Run the function db.increment_download_count(session, 'dummy', '0.0.1') # Make our asserations assert prev_version_count + 1 == version_sql.scalar() assert prev_package_count + 1 == package_sql.scalar() def test_insert_or_update_package(session): name = "NewPackage" title = "Some Title" latest_version = "0.0.1" # Test Insert db.insert_or_update_package(session, name, title, latest_version) sql = (session.query(db.Package) .filter(db.Package.name == name) ) result = sql.scalar() assert isinstance(result, db.Package) assert result.name == name assert result.title == title assert result.latest_version == latest_version assert result.download_count == 0 # Test update db.insert_or_update_package(session, name, "New Title", "0.0.2") result = sql.scalar() assert result.title == "New Title" assert result.latest_version == '0.0.2' assert result.download_count == 0 def test_insert_version(session): sql = session.query(sa.func.count(db.Version.version_id)) version_count = sql.scalar() db.insert_version(session, package_id=1, version="0.0.1") # Make sure it was added assert version_count + 1 == sql.scalar() def test_delete_version(session): # Add additional dummy data. pkg = db.Package(name="Foo", latest_version="0.9.6") session.add(pkg) session.commit() session.add(db.Version(package_id=pkg.package_id, version="0.9.6")) session.add(db.Version(package_id=pkg.package_id, version="0.9.7")) session.commit() # The package we're interested in. pkg_id = 'dummy' # get our initial counts version_count = (session.query(sa.func.count(db.Version.version_id)) .join(db.Package) .filter(db.Package.name == pkg_id)) package_count = session.query(sa.func.count(db.Package.package_id)) initial_version_count = version_count.scalar() initial_package_count = package_count.scalar() db.delete_version(session, pkg_id, '0.0.2') # The number of versions for our package should have decreased by 1. assert initial_version_count - 1 == version_count.scalar() # We should still have 2 packages assert initial_package_count == 2 assert initial_package_count == package_count.scalar() # The deleted version should not show up at all. (Note this particular # test only works because our dummy data only has 1 instance of "0.0.2") assert '0.0.2' not in session.query(db.Version.version).all() # Deleting the highest version should change the `latest_version` value qry = session.query(db.Package).filter(db.Package.name == 'dummy') db.delete_version(session, pkg_id, '0.0.3') assert qry.one().latest_version == '0.0.1' # Deleting the last version of a package should remove the row from the # Packages table. db.delete_version(session, pkg_id, '0.0.1') assert version_count.scalar() == 0 assert package_count.scalar() == 1
import re from lxml.etree import XMLSyntaxError from galaxy.tool_util.verify import asserts from galaxy.util import ( asbool, parse_xml_string, unicodify, ) def assert_is_valid_xml(output): """ Simple assertion that just verifies the specified output is valid XML.""" try: parse_xml_string(output) except XMLSyntaxError as e: raise AssertionError(f"Expected valid XML, but could not parse output. {unicodify(e)}") def assert_has_element_with_path(output, path, negate: bool = False): """ Asserts the specified output has at least one XML element with a path matching the specified path argument. Valid paths are the simplified subsets of XPath implemented by lxml.etree; https://lxml.de/xpathxslt.html for more information.""" assert_xml_element(output, path, negate=negate) def assert_has_n_elements_with_path(output, path, n: int = None, delta: int = 0, min: int = None, max: int = None, negate: bool = False): """ Asserts the specified output has exactly n elements matching the path specified.""" assert_xml_element(output, path, n=n, delta=delta, min=min, max=max, negate=negate) def assert_element_text_matches(output, path, expression, negate: bool = False): """ Asserts the text of the first element matching the specified path matches the specified regular expression.""" sub = {"tag": "has_text_matching", 'attributes': {'expression': expression, 'negate': negate}} assert_xml_element(output, path, asserts.verify_assertions, [sub]) def assert_element_text_is(output, path, text, negate: bool = False): """ Asserts the text of the first element matching the specified path matches exactly the specified text. """ assert_element_text_matches(output, path, re.escape(text) + "$", negate=negate) def assert_attribute_matches(output, path, attribute, expression, negate: bool = False): """ Asserts the specified attribute of the first element matching the specified path matches the specified regular expression.""" sub = {"tag": "has_text_matching", 'attributes': {'expression': expression, 'negate': negate}} assert_xml_element(output, path, asserts.verify_assertions, [sub], attribute=attribute) def assert_attribute_is(output, path, attribute, text, negate: bool = False): """ Asserts the specified attribute of the first element matching the specified path matches exactly the specified text.""" assert_attribute_matches(output, path, attribute, re.escape(text) + "$", negate=negate) def assert_element_text(output, path, verify_assertions_function, children, negate: bool = False): """ Recursively checks the specified assertions against the text of the first element matching the specified path.""" assert_xml_element(output, path, verify_assertions_function, children, negate=negate) def assert_xml_element(output, path, verify_assertions_function=None, children=None, attribute=None, all=False, n: int = None, delta: int = 0, min: int = None, max: int = None, negate: bool = False): """ Check if path occurs in the xml. If n and delta or min and max are given also the number of occurences is checked. If there are any sub assertions then check them against - the element's text if attribute is None - the content of the attribute If all is True then the sub assertions are checked for all occurences. """ children = children or [] all = asbool(all) # assert that path is in output (the specified number of times) xml = parse_xml_string(output) asserts._util._assert_presence_number(xml, path, n, delta, min, max, negate, lambda x, p: x.find(p) is not None, lambda x, p: len(x.findall(p)), "{expected} path '{text}' in xml", "{expected} {n}+-{delta} occurrences of path '{text}' in xml", "{expected} that the number of occurences of path '{text}' in xml is in [{min}:{max}]") # check sub-assertions if len(children) == 0 or verify_assertions_function is None: return for occ in xml.findall(path): if attribute is None or attribute == "": content = occ.text else: content = occ.attrib[attribute] try: verify_assertions_function(content, children) except AssertionError as e: if attribute is not None and attribute != "": raise AssertionError(f"Attribute '{attribute}' on element with path '{path}': {str(e)}") else: raise AssertionError(f"Text of element with path '{path}': {str(e)}") if not all: break
import re import uuid from mapswipe_workers.auth import firebaseDB from mapswipe_workers.definitions import CustomError, logger def remove_all_team_members(team_id): """Remove teamId attribute for all users of the team.""" fb_db = firebaseDB() # noqa E841 try: # check if team exist in firebase if not fb_db.reference(f"v2/teams/{team_id}").get(): raise CustomError(f"can't find team in firebase: {team_id}") # get team name from firebase team_name = fb_db.reference(f"v2/teams/{team_id}/teamName").get() # generate random uuid4 token team_members = ( fb_db.reference("v2/users/") .order_by_child("teamId") .equal_to(team_id) .get() ) # remove teamId attribute for each members if not team_members: logger.info(f"there are no members of the team {team_id} - '{team_name}'") else: for user_id in team_members.keys(): # update data in firebase ref = fb_db.reference(f"v2/users/{user_id}/") ref.update({"teamId": None}) logger.info( f"removed teamId {team_id} - '{team_name}' for user {user_id}" ) logger.info( f"removed all team members from team: {team_id} - '{team_name}'" ) except Exception as e: logger.info(f"could not create team: {team_name}") raise CustomError(e) def create_team(team_name): """Create new team in Firebase.""" fb_db = firebaseDB() # noqa E841 try: # generate random uuid4 token team_token = str(uuid.uuid4()) # set data in firebase ref = fb_db.reference("v2/teams/") team_ref = ref.push() team_ref.set({"teamName": team_name, "teamToken": team_token}) logger.info(f"created team: {team_ref.key} - '{team_name}' - {team_token}") return team_ref.key, team_token except Exception as e: logger.info(f"could not create team: {team_name}") raise CustomError(e) def delete_team(team_id): """Delete team in Firebase.""" # TODO: What is the consequence of this on projects and users # do we expect that the teamId is removed there as well? # teamId is removed for users, but not for projects at the moment fb_db = firebaseDB() # noqa E841 try: # check if team exist in firebase if not fb_db.reference(f"v2/teams/{team_id}").get(): raise CustomError(f"can't find team in firebase: {team_id}") # remove all team members remove_all_team_members(team_id) # get team name from firebase team_name = fb_db.reference(f"v2/teams/{team_id}/teamName").get() # check if reference path is valid, e.g. if team_id is None ref = fb_db.reference(f"v2/teams/{team_id}") if not re.match(r"/v2/\w+/[-a-zA-Z0-9]+", ref.path): raise CustomError( f"""Given argument resulted in invalid Firebase Realtime Database reference. {ref.path}""" ) # delete team in firebase ref.delete() logger.info(f"deleted team: {team_id} - '{team_name}'") except Exception as e: logger.info(f"could not delete team: {team_id}") raise CustomError(e) def renew_team_token(team_id): """Create new team in Firebase.""" fb_db = firebaseDB() # noqa E841 try: # check if team exist in firebase if not fb_db.reference(f"v2/teams/{team_id}").get(): raise CustomError(f"can't find team in firebase: {team_id}") # get team name from firebase team_name = fb_db.reference(f"v2/teams/{team_id}/teamName").get() # check if reference path is valid ref = fb_db.reference(f"v2/teams/{team_id}") if not re.match(r"/v2/\w+/[-a-zA-Z0-9]+", ref.path): raise CustomError( f"""Given argument resulted in invalid Firebase Realtime Database reference. {ref.path}""" ) # generate new uuid4 token new_team_token = str(uuid.uuid4()) # set team token in firebase ref.update({"teamToken": new_team_token}) logger.info(f"renewed team token: {team_id} - '{team_name}' - {new_team_token}") return new_team_token except Exception as e: logger.info(f"could not delete team: {team_id}") raise CustomError(e)
<reponame>nickpartner-goahead/resilient-community-apps<gh_stars>10-100 # -*- coding: utf-8 -*- """Tests using pytest_resilient_circuits""" import pytest from resilient_circuits.util import get_config_data, get_function_definition from resilient_circuits import SubmitTestFunction, FunctionResult from mock import patch PACKAGE_NAME = "fn_qradar_integration" FUNCTION_NAME = "qradar_get_reference_tables" # Read the default configuration-data section from the package config_data = get_config_data(PACKAGE_NAME) # Provide a simulation of the Resilient REST API (uncomment to connect to a real appliance) resilient_mock = "pytest_resilient_circuits.BasicResilientMock" MOCK_GET_TABLE_RESPONSE = [ { "timeout_type": "LAST_SEEN", "number_of_elements": 0, "creation_time": 1464119414213, "name": "Mock URLs Data", "namespace": "SHARED", "key_name_types": { "Brand": "ALNIC", "First Seen Date": "DATE", "Identifier": "NUM", "Confidence": "NUM", "Last Seen Date": "DATE", "Report URL": "ALNIC", "Malware Family": "ALNIC", "Portal URL": "ALNIC", "Infrastructure Type": "ALNIC", "Provider": "ALN" }, "element_type": "ALNIC", "collection_id": 181 }, { "timeout_type": "LAST_SEEN", "number_of_elements": 100, "creation_time": 1464119421471, "name": "Les faux logiciels malveillants hachent les données SHA", "namespace": "SHARED", "key_name_types": { "Brand": "ALNIC", "First Seen Date": "DATE", "Identifier": "NUM", "Confidence": "NUM", "Last Seen Date": "DATE", "Portal URL": "ALNIC", "Malware Family": "ALNIC", "Report URL": "ALNIC", "Infrastructure Type": "ALNIC", "Provider": "ALN" }, "element_type": "ALNIC", "collection_id": 190 }] def call_qradar_get_reference_tables_function(circuits, function_params, timeout=5): # Create the submitTestFunction event evt = SubmitTestFunction("qradar_get_reference_tables", function_params) # Fire a message to the function circuits.manager.fire(evt) # circuits will fire an "exception" event if an exception is raised in the FunctionComponent # return this exception if it is raised exception_event = circuits.watcher.wait("exception", parent=None, timeout=timeout) if exception_event is not False: exception = exception_event.args[1] raise exception # else return the FunctionComponent's results else: event = circuits.watcher.wait("qradar_get_reference_tables_result", parent=evt, timeout=timeout) assert event assert isinstance(event.kwargs["result"], FunctionResult) pytest.wait_for(event, "complete", True) return event.kwargs["result"].value class TestQradarGetReferenceTables: """ Tests for the qradar_get_reference_tables function""" def test_function_definition(self): """ Test that the package provides customization_data that defines the function """ func = get_function_definition(PACKAGE_NAME, FUNCTION_NAME) assert func is not None mock_inputs_1 = { } expected_results_1 = MOCK_GET_TABLE_RESPONSE mock_inputs_2 = { } expected_results_2 = MOCK_GET_TABLE_RESPONSE @pytest.mark.parametrize("mock_inputs, expected_results", [ (mock_inputs_1, expected_results_1), (mock_inputs_2, expected_results_2) ]) @pytest.mark.livetest def test_live_success(self, circuits_app, mock_inputs, expected_results): """ Test calling with sample values for the parameters """ results = call_qradar_get_reference_tables_function(circuits_app, mock_inputs) assert results assert results['content'] # Ensure we have some results for entry in results['content']: assert entry.get('collection_id', False) assert entry.get('name', False) assert isinstance(entry.get('number_of_elements', False), int) @pytest.mark.parametrize("mock_inputs, expected_results", [ (mock_inputs_1, expected_results_1), (mock_inputs_2, expected_results_2) ]) def test_mocked_success(self, circuits_app, mock_inputs, expected_results): """ Test calling with sample values for the parameters """ with patch('fn_qradar_integration.lib.reference_data.ReferenceTableFacade.ReferenceTableFacade.get_all_reference_tables') as patched_add_element: patched_add_element.return_value = expected_results results = call_qradar_get_reference_tables_function(circuits_app, mock_inputs) assert results assert results['content'] # Ensure we have some results for entry in results['content']: assert entry.get('collection_id', False) assert entry.get('name', False) assert isinstance(entry.get('number_of_elements', False), int)
<gh_stars>1-10 import sys sys.path.append("../../utils") import numpy as np from scipy.ndimage import convolve, distance_transform_edt from utils.gaussian_kernel import getGaussianKernel def _funcHeavyside(x, eps=1.): ''' Return a value of the H(x); heavyside function ''' return .5*(1 + (2./np.pi*np) * np.arctan(x/eps)) def _funcDelta(x, eps=1.): ''' Return a value of the delta(x); delta function ''' return eps / (x**2. + eps**2.) / np.pi def _calcLaplacian(x): ''' Apply Laplacian operator ''' # Laplacian kernel LAPLACIAN = np.array([[0., 1., 0.], [1., -4., 1.], [0., 1., 0.]]) return convolve(x, LAPLACIAN, mode="nearest") def _calcGradient(x): ''' Return gradient map ''' # Pad input domain pad = np.pad(x, pad_width=1, mode="edge") # Calculate derivatives gradx = .5*(pad[2:, 1:-1] - pad[:-2, 1:-1]) grady = .5*(pad[1:-1, 2:] - pad[1:-1, :-2]) return (gradx, grady) def _calcCurvature(u, eta=1.e-8): ''' Return curvature energy ''' # Pad input domain pad = np.pad(u, pad_width=1, mode="edge") # Calculate derivatives fx = .5*(pad[2:, 1:-1] - pad[:-2, 1:-1]) fy = .5*(pad[1:-1, 2:] - pad[1:-1, :-2]) fxx = pad[2:, 1:-1] - 2.*u + pad[:-2, 1:-1] fyy = pad[1:-1, 2:] - 2.*u + pad[1:-1, :-2] fxy = .25*(pad[2:, 2:] + pad[:-2, :-2] - pad[:-2, 2:] - pad[2:, :-2]) return ((fxx*fy**2 - 2*fxy*fx*fy + fyy*fx**2) / (np.power(fx**2. + fy**2., 1.5) + eta)) class RSF(object): ''' Minimization of Region scalable fitting energy Parameters ---------------- image: (H, W) ndarray input image. seed: (H, W) ndarray input seed. Returns ---------------- Region (H, W) ndarray segmentation label ''' def __init__(self, maxIter=500, dt=.1, tol=1.e-4, mu=1., nu=.3e-3, lambda1=1., lambda2=1., threshold=0.): # Model parameter self.mu = mu self.nu = nu self.lambda1 = lambda1 self.lambda2 = lambda2 self.maxIter = 500 self.dt = dt self.tol = tol self.threshold = threshold def getInitLevelSet(self, seed): ''' Initialize level-set as signed distance function ''' # Make seed be float type seed = seed.astype(np.float) # Get signed distance function based on seed map phi = (distance_transform_edt(seed) - distance_transform_edt(1-seed) + distance_transform_edt(seed-.5 > 0)) return phi def getRevLevelSet(self, u, phi, sigma=3): ''' Evolve level-set ''' # Curvature curvature = _calcCurvature(phi) Ecurv = self.nu*_funcDelta(phi)*curvature # Regularization laplacian = _calcLaplacian(phi) Ereg = self.mu*(laplacian - curvature); # Build scaling kernel #height, width = (4*sigma + 1, 4*sigma + 1) #KERNEL = np.ones((height, width), dtype=np.float64) #KERNEL = KERNEL / height / width KERNEL = getGaussianKernel(sigma, (4*sigma+1, 4*sigma+1), ndim=2) # Region scalable fitting energy region = _funcHeavyside(phi) KIH1 = convolve(region*u, KERNEL, mode="nearest") KH1 = convolve(region, KERNEL, mode="nearest") f1 = KIH1 / KH1 KIH2 = convolve((1. - region)*u, KERNEL, mode="nearest") KH2 = convolve((1. - region), KERNEL, mode="nearest") f2 = KIH2 / KH2 R1 = (self.lambda1 - self.lambda2)*u*y; R2 = convolve(self.lambda1*f1, KERNEL, mode="nearest") R3 = convolve(self.lambda2*f1*f1 - self.lambda2*f2*f2, KERNEL, mode="nearest") Ersf = -_funcDelta(phi)*(R1 - 2.*R2*u + R3) # Evolve level-set revPhi = phi + self.dt*(Ecurv + Ereg + Ersf) return revPhi def run(self, image, seed): # Convert input image format to be a float container image = np.array(image, dtype=np.float32) image = (image - image.min())/(image.max() - image.min()) # Initialize level-set phi = self.getInitLevelSet(seed) for _ in range(self.maxIter): # keep previous level prevPhi = phi.copy() # Update level-set function phi = self.getRevLevelSet(image, phi) # Evaluate mean-square energy to confine convergence mse = np.sqrt(((phi-prevPhi)**2.).mean()) if mse < self.tol: break # Return positive levels as region region = np.uint8(phi > self.threshold) return region
<reponame>NeonOcean/Environment<filename>S4/S4 Library/simulation/gsi_handlers/animation_archive_handlers.py import itertools from animation.animation_utils import clip_event_type_name from gsi_handlers.gameplay_archiver import GameplayArchiver from sims4.gsi.schema import GsiGridSchema, GsiFieldVisualizers from sims4.utils import setdefault_callable from uid import UniqueIdGenerator import services import sims4.log logger = sims4.log.Logger('GSI') with sims4.reload.protected(globals()): gsi_log_id = UniqueIdGenerator() animation_archive = {} class AnimationArchiveGSILog: def __init__(self): self.clear_log() def clear_log(self): self.id = gsi_log_id() services_time_service = services.time_service() if services_time_service is not None and services_time_service.sim_timeline is not None: self.now = str(services_time_service.sim_timeline.now) else: self.now = 'Unavailable' self.events = [] self.asm_requests = {} animation_archive_schema = GsiGridSchema(label='Animation Archive', sim_specific=True) animation_archive_schema.add_field('game_time', label='GameTime', hidden=True) animation_archive_schema.add_field('arb_id', label='ARB ID', visualizer=GsiFieldVisualizers.INT) animation_archive_schema.add_field('asm', label='ASM', width=20) animation_archive_schema.add_field('request', label='Request', width=20) animation_archive_schema.add_field('arb', label='ARB String', width=75) with animation_archive_schema.add_has_many('Actors', GsiGridSchema) as sub_schema: sub_schema.add_field('name', label='Actor Name', width=20) sub_schema.add_field('actor', label='Actor', width=35) sub_schema.add_field('actor_id', label='Actor ID', width=35) sub_schema.add_field('suffix', label='Suffix', width=10) with animation_archive_schema.add_has_many('Params', GsiGridSchema) as sub_schema: sub_schema.add_field('name', label='Param Name', width=25) sub_schema.add_field('value', label='Value', width=25) sub_schema.add_field('type', label='Type', width=25) sub_schema.add_field('data', label='Data', width=25) with animation_archive_schema.add_has_many('Events', GsiGridSchema) as sub_schema: sub_schema.add_field('clip_name', label='Clip Name', width=20) sub_schema.add_field('type', label='Type', width=15) sub_schema.add_field('event_id', label='ID', width=5, visualizer=GsiFieldVisualizers.INT) sub_schema.add_field('callbacks', label='Callbacks', width=30) sub_schema.add_field('event_data', label='Event Data', width=30) sub_schema.add_field('tag', label='Tag', width=5) sub_schema.add_field('errors', label='Errors', width=10) archiver = GameplayArchiver('animation_archive', animation_archive_schema, add_to_archive_enable_functions=True) def get_animation_log(arb, clear=False): animation_log = setdefault_callable(animation_archive, id(arb), AnimationArchiveGSILog) if clear: del animation_archive[id(arb)] return animation_log def process_actors(animation_log, asm): actors = [] if asm not in animation_log.asm_requests: for (name, obj, suffix) in asm.actors_info_gen(): actors.append({'name': name, 'actor': str(obj), 'actor_id': str(obj.id), 'suffix': suffix}) return actors def process_parameters(animation_log, asm): params = [] if asm not in animation_log.asm_requests: all_param_dicts = asm.get_all_parameters() for param_dict in all_param_dicts: for (k, v) in param_dict.items(): if isinstance(k, str): params.append({'name': k, 'value': str(v), 'type': 'Global'}) else: params.append({'name': '{}:{}'.format(k[1], k[0]), 'value': str(v), 'type': 'Object', 'data': str(k[2])}) return params def process_animation_request(arb, animation_log): pass def process_handled_events(arb, animation_log): pass def archive_animation_request(arb): animation_log = get_animation_log(arb, clear=True) if animation_log is None: return process_handled_events(arb, animation_log) process_animation_request(arb, animation_log) object_manager = services.object_manager() for asm_request in animation_log.asm_requests.values(): asm_request['arb_id'] = int(animation_log.id) asm_request['game_time'] = animation_log.now asm_request['arb'] = animation_log.arb_contents for actor_id in arb.actor_ids: actor = object_manager.get(actor_id) if actor is not None and actor.is_sim: archiver.archive(data=asm_request, object_id=actor.id)
import typing as t import discord from discord.ext.commands import Cog, Context, command, has_any_role from bot import constants from bot.bot import Bot from bot.decorators import in_whitelist from bot.log import get_logger from bot.utils.checks import InWhitelistCheckFailure log = get_logger(__name__) # Sent via DMs once user joins the guild ON_JOIN_MESSAGE = """ Welcome to Python Discord! To show you what kind of community we are, we've created this video: https://youtu.be/ZH26PuX3re0 As a new user, you have read-only access to a few select channels to give you a taste of what our server is like. \ In order to see the rest of the channels and to send messages, you first have to accept our rules. """ VERIFIED_MESSAGE = f""" You are now verified! You can find a copy of our rules for reference at <https://pythondiscord.com/pages/rules>. Additionally, if you'd like to receive notifications for the announcements \ we post in <#{constants.Channels.announcements}> from time to time, you can send `!subscribe` to <#{constants.Channels.bot_commands}> at any time \ to assign yourself the **Announcements** role. We'll mention this role every time we make an announcement. If you'd like to unsubscribe from the announcement notifications, simply send `!unsubscribe` to \ <#{constants.Channels.bot_commands}>. To introduce you to our community, we've made the following video: https://youtu.be/ZH26PuX3re0 """ async def safe_dm(coro: t.Coroutine) -> None: """ Execute `coro` ignoring disabled DM warnings. The 50_0007 error code indicates that the target user does not accept DMs. As it turns out, this error code can appear on both 400 and 403 statuses, we therefore catch any Discord exception. If the request fails on any other error code, the exception propagates, and must be handled by the caller. """ try: await coro except discord.HTTPException as discord_exc: log.trace(f"DM dispatch failed on status {discord_exc.status} with code: {discord_exc.code}") if discord_exc.code != 50_007: # If any reason other than disabled DMs raise class Verification(Cog): """ User verification and role management. Statistics are collected in the 'verification.' namespace. Additionally, this cog offers the !subscribe and !unsubscribe commands, """ def __init__(self, bot: Bot) -> None: """Start internal tasks.""" self.bot = bot self.pending_members = set() # region: listeners @Cog.listener() async def on_member_join(self, member: discord.Member) -> None: """Attempt to send initial direct message to each new member.""" if member.guild.id != constants.Guild.id: return # Only listen for PyDis events # If the user has the pending flag set, they will be using the alternate # gate and will not need a welcome DM with verification instructions. # We will send them an alternate DM once they verify with the welcome # video when they pass the gate. if member.pending: return log.trace(f"Sending on join message to new member: {member.id}") try: await safe_dm(member.send(ON_JOIN_MESSAGE)) except discord.HTTPException: log.exception("DM dispatch failed on unexpected error code") @Cog.listener() async def on_member_update(self, before: discord.Member, after: discord.Member) -> None: """Check if we need to send a verification DM to a gated user.""" if before.pending is True and after.pending is False: try: # If the member has not received a DM from our !accept command # and has gone through the alternate gating system we should send # our alternate welcome DM which includes info such as our welcome # video. await safe_dm(after.send(VERIFIED_MESSAGE)) except discord.HTTPException: log.exception("DM dispatch failed on unexpected error code") # endregion # region: subscribe commands @command(name='subscribe') @in_whitelist(channels=(constants.Channels.bot_commands,)) async def subscribe_command(self, ctx: Context, *_) -> None: # We don't actually care about the args """Subscribe to announcement notifications by assigning yourself the role.""" has_role = False for role in ctx.author.roles: if role.id == constants.Roles.announcements: has_role = True break if has_role: await ctx.send(f"{ctx.author.mention} You're already subscribed!") return log.debug(f"{ctx.author} called !subscribe. Assigning the 'Announcements' role.") await ctx.author.add_roles(discord.Object(constants.Roles.announcements), reason="Subscribed to announcements") log.trace(f"Deleting the message posted by {ctx.author}.") await ctx.send( f"{ctx.author.mention} Subscribed to <#{constants.Channels.announcements}> notifications.", ) @command(name='unsubscribe') @in_whitelist(channels=(constants.Channels.bot_commands,)) async def unsubscribe_command(self, ctx: Context, *_) -> None: # We don't actually care about the args """Unsubscribe from announcement notifications by removing the role from yourself.""" has_role = False for role in ctx.author.roles: if role.id == constants.Roles.announcements: has_role = True break if not has_role: await ctx.send(f"{ctx.author.mention} You're already unsubscribed!") return log.debug(f"{ctx.author} called !unsubscribe. Removing the 'Announcements' role.") await ctx.author.remove_roles( discord.Object(constants.Roles.announcements), reason="Unsubscribed from announcements" ) log.trace(f"Deleting the message posted by {ctx.author}.") await ctx.send( f"{ctx.author.mention} Unsubscribed from <#{constants.Channels.announcements}> notifications." ) # endregion # region: miscellaneous # This cannot be static (must have a __func__ attribute). async def cog_command_error(self, ctx: Context, error: Exception) -> None: """Check for & ignore any InWhitelistCheckFailure.""" if isinstance(error, InWhitelistCheckFailure): error.handled = True @command(name='verify') @has_any_role(*constants.MODERATION_ROLES) async def perform_manual_verification(self, ctx: Context, user: discord.Member) -> None: """Command for moderators to verify any user.""" log.trace(f'verify command called by {ctx.author} for {user.id}.') if not user.pending: log.trace(f'{user.id} is already verified, aborting.') await ctx.send(f'{constants.Emojis.cross_mark} {user.mention} is already verified.') return # Adding a role automatically verifies the user, so we add and remove the Announcements role. temporary_role = self.bot.get_guild(constants.Guild.id).get_role(constants.Roles.announcements) await user.add_roles(temporary_role) await user.remove_roles(temporary_role) log.trace(f'{user.id} manually verified.') await ctx.send(f'{constants.Emojis.check_mark} {user.mention} is now verified.') # endregion def setup(bot: Bot) -> None: """Load the Verification cog.""" bot.add_cog(Verification(bot))
"""Call arbitrary API endpoints.""" import json import click from SoftLayer.CLI import environment from SoftLayer.CLI import exceptions from SoftLayer.CLI import formatting from SoftLayer.CLI import helpers from SoftLayer import utils SPLIT_TOKENS = [ ('in', ' IN '), ('eq', '='), ] def _build_filters(_filters): """Builds filters using the filter options passed into the CLI. This only supports the equals keyword at the moment. """ root = utils.NestedDict({}) for _filter in _filters: operation = None for operation, token in SPLIT_TOKENS: # split "some.key=value" into ["some.key", "value"] top_parts = _filter.split(token, 1) if len(top_parts) == 2: break else: raise exceptions.CLIAbort('Failed to find valid operation for: %s' % _filter) key, value = top_parts current = root # split "some.key" into ["some", "key"] parts = [part.strip() for part in key.split('.')] # Actually drill down and add the filter for part in parts[:-1]: current = current[part] if operation == 'eq': current[parts[-1]] = utils.query_filter(value.strip()) elif operation == 'in': current[parts[-1]] = { 'operation': 'in', 'options': [{ 'name': 'data', 'value': [p.strip() for p in value.split(',')], }], } return root.to_dict() def _build_python_example(args, kwargs): sorted_kwargs = sorted(kwargs.items()) call_str = 'import SoftLayer\n\n' call_str += 'client = SoftLayer.create_client_from_env()\n' call_str += 'result = client.call(' arg_list = [repr(arg) for arg in args] arg_list += [key + '=' + repr(value) for key, value in sorted_kwargs if value] call_str += ',\n '.join(arg_list) call_str += ')' return call_str def _validate_filter(ctx, param, value): # pylint: disable=unused-argument """Validates a JSON style object filter""" _filter = None if value: try: _filter = json.loads(value) if not isinstance(_filter, dict): raise exceptions.CLIAbort("\"{}\" should be a JSON object, but is a {} instead.". format(_filter, type(_filter))) except json.JSONDecodeError as error: raise exceptions.CLIAbort("\"{}\" is not valid JSON. {}".format(value, error)) return _filter def _validate_parameters(ctx, param, value): # pylint: disable=unused-argument """Checks if value is a JSON string, and converts it to a datastructure if that is true""" validated_values = [] for parameter in value: if isinstance(parameter, str): # looks like a JSON string... if '{' in parameter or '[' in parameter: try: parameter = json.loads(parameter) except json.JSONDecodeError as error: click.secho("{} looked like json, but was invalid, passing to API as is. {}". format(parameter, error), fg='red') validated_values.append(parameter) return validated_values @click.command('call', short_help="Call arbitrary API endpoints.") @click.argument('service') @click.argument('method') @click.argument('parameters', nargs=-1, callback=_validate_parameters) @click.option('--id', '_id', help="Init parameter") @helpers.multi_option('--filter', '-f', '_filters', help="Object filters. This should be of the form: 'property=value' or 'nested.property=value'." "Complex filters should use --json-filter.") @click.option('--mask', help="String-based object mask") @click.option('--limit', type=click.INT, help="Result limit") @click.option('--offset', type=click.INT, help="Result offset") @click.option('--output-python / --no-output-python', help="Show python example code instead of executing the call") @click.option('--json-filter', callback=_validate_filter, help="A JSON string to be passed in as the object filter to the API call. " "Remember to use double quotes (\") for variable names. Can NOT be used with --filter. " "Dont use whitespace outside of strings, or the slcli might have trouble parsing it.") @environment.pass_env def cli(env, service, method, parameters, _id, _filters, mask, limit, offset, output_python=False, json_filter=None): """Call arbitrary API endpoints with the given SERVICE and METHOD. For parameters that require a datatype, use a JSON string for that parameter. Example:: slcli call-api Account getObject slcli call-api Account getVirtualGuests --limit=10 --mask=id,hostname slcli call-api Virtual_Guest getObject --id=12345 slcli call-api Metric_Tracking_Object getBandwidthData --id=1234 \\ "2015-01-01 00:00:00" "2015-01-1 12:00:00" public slcli call-api Account getVirtualGuests \\ -f 'virtualGuests.datacenter.name=dal05' \\ -f 'virtualGuests.maxCpu=4' \\ --mask=id,hostname,datacenter.name,maxCpu slcli call-api Account getVirtualGuests \\ -f 'virtualGuests.datacenter.name IN dal05,sng01' slcli call-api Account getVirtualGuests \\ --json-filter '{"virtualGuests":{"hostname":{"operation":"^= test"}}}' --limit=10 slcli -v call-api SoftLayer_User_Customer addBulkPortalPermission --id=1234567 \\ '[{"keyName": "NETWORK_MESSAGE_DELIVERY_MANAGE"}]' """ if _filters and json_filter: raise exceptions.CLIAbort("--filter and --json-filter cannot be used together.") object_filter = _build_filters(_filters) if json_filter: object_filter.update(json_filter) args = [service, method] + list(parameters) kwargs = { 'id': _id, 'filter': object_filter, 'mask': mask, 'limit': limit, 'offset': offset, } if output_python: env.out(_build_python_example(args, kwargs)) else: result = env.client.call(*args, **kwargs) env.fout(formatting.iter_to_table(result))
# coding: utf-8 from django.core import mail from django.conf import settings from django.test import TestCase from django.test.utils import override_settings from django_factory_boy import auth from journalmanager import models as jmodels from journalmanager.tests import modelfactories from editorialmanager import notifications from . import modelfactories as editorial_modelfactories class IssueBoardMessageTests(TestCase): ACTIONS = [ 'issue_add_no_replicated_board', 'issue_add_replicated_board', ] def setUp(self): self.editor = auth.UserF(is_active=True) self.journal = modelfactories.JournalFactory.create(editor=self.editor) self.issue = modelfactories.IssueFactory(journal=self.journal) self.expected_recipients = [self.editor.email, ] self.expected_subject_sufix_by_action = { 'issue_add_no_replicated_board': "Issue Board can't be replicated", 'issue_add_replicated_board': "Issue has a new replicated board", } def _make_subject(self, action, subject=''): subject_prefix = settings.EMAIL_SUBJECT_PREFIX subject_suffix = self.expected_subject_sufix_by_action[action] return ' '.join([subject_prefix, subject, subject_suffix]) def tearDown(self): """ Restore the default values. """ @override_settings(CELERY_EAGER_PROPAGATES_EXCEPTIONS=True, CELERY_ALWAYS_EAGER=True, BROKER_BACKEND='memory') def test_each_action(self): email_count = 0 for action in self.ACTIONS: # with expected_subject = self._make_subject(action) email_count += 1 # when result = notifications.issue_board_replica(issue=self.issue, action=action) # then self.assertTrue(result) self.assertEqual(len(mail.outbox), email_count) new_email = mail.outbox[-1] self.assertEqual(new_email.subject, expected_subject) self.assertEqual(len(self.expected_recipients), len(new_email.to)) for recipient in self.expected_recipients: self.assertIn(recipient, new_email.to) @override_settings(CELERY_EAGER_PROPAGATES_EXCEPTIONS=True, CELERY_ALWAYS_EAGER=True, BROKER_BACKEND='memory') def test_each_action_with_disable_notifications_for_editor(self): """ for each action, test notifications are sent, but editor will have disable notifications """ editor_profile = self.editor.get_profile() editor_profile.email_notifications = False editor_profile.save() # update self.expected_recipients self.expected_recipients.remove(editor_profile.user.email) for action in self.ACTIONS: # with expected_subject = self._make_subject(action) # when result = notifications.issue_board_replica(issue=self.issue, action=action) # then # no mail sent, since the only recipient: editor, "choose" to not receive emails self.assertIsNone(result) class BoardMembersMessageTests(TestCase): ACTIONS = [ 'board_add_member', 'board_edit_member', 'board_delete_member', ] def setUp(self): # create librarian group and those members self.librarian_group = modelfactories.GroupFactory(name="Librarian") self.librarian1 = auth.UserF(is_active=True) self.librarian2 = auth.UserF(is_active=True) self.librarian1.groups.add(self.librarian_group) self.librarian1.save() self.librarian2.groups.add(self.librarian_group) self.librarian2.save() self.collection = modelfactories.CollectionFactory.create() self.editor = auth.UserF(is_active=True) self.journal = modelfactories.JournalFactory.create(editor=self.editor) self.issue = modelfactories.IssueFactory(journal=self.journal) self.board = editorial_modelfactories.EditorialBoardFactory.create(issue=self.issue) self.member = editorial_modelfactories.EditorialMemberFactory.create(board=self.board) # link journal to collection jmodels.Membership.objects.create(journal=self.journal, collection=self.collection, created_by=auth.UserF(is_active=True)) # link librarians and collection self.collection.add_user(self.librarian1) self.collection.add_user(self.librarian2) self.expected_recipients = [] self.expected_bcc_recipients = [self.librarian1.email, self.librarian2.email, ] self.expected_subject_sufix_by_action = { 'board_add_member': "Member of the journal board, was added", 'board_edit_member': "Member of the journal board, was edited", 'board_delete_member': "Member of the journal board, was deleted", } def _make_subject(self, action, subject=''): subject_prefix = settings.EMAIL_SUBJECT_PREFIX subject_suffix = self.expected_subject_sufix_by_action[action] return ' '.join([subject_prefix, subject, subject_suffix]) @override_settings(CELERY_EAGER_PROPAGATES_EXCEPTIONS=True, CELERY_ALWAYS_EAGER=True, BROKER_BACKEND='memory') def test_each_action(self): email_count = 0 for action in self.ACTIONS: # with expected_subject = self._make_subject(action) message = 'Audit Log change message goes here!' email_count += 1 # when result = notifications.board_members_send_email_by_action(self.member, self.editor, message, action) # then self.assertTrue(result) self.assertEqual(len(mail.outbox), email_count) new_email = mail.outbox[-1] self.assertEqual(new_email.subject, expected_subject) self.assertEqual(len(self.expected_recipients), len(new_email.to)) self.assertEqual(len(self.expected_bcc_recipients), len(new_email.bcc)) for recipient in self.expected_recipients: self.assertIn(recipient, new_email.to) for recipient in self.expected_bcc_recipients: self.assertIn(recipient, new_email.bcc) @override_settings(CELERY_EAGER_PROPAGATES_EXCEPTIONS=True, CELERY_ALWAYS_EAGER=True, BROKER_BACKEND='memory') def test_each_action_with_disable_notifications_for_one_librarian(self): """ for each action, test notifications are sent, but librarian2 will have disable notifications """ librarian2_profile = self.librarian2.get_profile() librarian2_profile.email_notifications = False librarian2_profile.save() # remove it from expected_bcc_recipients self.expected_bcc_recipients.remove(librarian2_profile.user.email) email_count = 0 for action in self.ACTIONS: # with expected_subject = self._make_subject(action) message = 'Audit Log change message goes here!' email_count += 1 # when result = notifications.board_members_send_email_by_action(self.member, self.editor, message, action) # then self.assertTrue(result) self.assertEqual(len(mail.outbox), email_count) new_email = mail.outbox[-1] self.assertEqual(new_email.subject, expected_subject) self.assertEqual(len(self.expected_recipients), len(new_email.to)) self.assertEqual(len(self.expected_bcc_recipients), len(new_email.bcc)) for recipient in self.expected_recipients: self.assertIn(recipient, new_email.to) for recipient in self.expected_bcc_recipients: self.assertIn(recipient, new_email.bcc)
import logging from typing import Optional import xbmcaddon import os from .kodi_rpc import get_item_info, get_properties from .periodic_updater import PeriodicUpdater from .preferences import Preferences ADDON = xbmcaddon.Addon() logger = logging.getLogger(ADDON.getAddonInfo('id')) def same_audio(audio1, audio2) -> bool: """Check if same audio, needed because other attributes can differ""" if (audio1['name'] == audio2['name'] and audio1['language'] == audio2['language'] and audio1['isimpaired'] == audio2['isimpaired']): return True return False def same_subtitle(subtitle1, subtitle2) -> bool: """Check if same subtitle, needed because other attributes can be differ""" if subtitle1 == subtitle2: return True if subtitle1 is None or subtitle2 is None: return False if (subtitle1['name'] == subtitle2['name'] and subtitle1['language'] == subtitle2['language'] and subtitle1['isforced'] == subtitle2['isforced'] and subtitle1['isimpaired'] == subtitle2['isimpaired']): return True return False def find_audio_stream(requested_audio, audio_streams) -> Optional[int]: for audio_stream in audio_streams: if same_audio(requested_audio, audio_stream): return audio_stream["index"] return None def find_subtitle_stream(requested_subtitle, subtitles) -> Optional[int]: for subtitle in subtitles: if same_subtitle(requested_subtitle, subtitle): return subtitle["index"] return None class Tracker(): def __init__(self, periodic_updater: PeriodicUpdater, preferences: Preferences): logger.debug("--> Tracker Init") self.preferences = preferences self.periodic_updater = periodic_updater periodic_updater._callback = self._update_item # Hmmm self.audio = None self.subtitle = None self.set_audio_stream = None self.set_subtitle_stream = None def _reset(self): self.audio = None self.subtitle = None def _get_audio(self, properties): return properties["currentaudiostream"] def _get_subtitle(self, properties): if properties["subtitleenabled"] == False: return None sub = properties["currentsubtitle"] logger.debug(sub) return sub def _update_item(self, initial: bool = False): logger.debug("--> Update item") item_info = get_item_info() item_type = item_info["type"] if item_type != "episode" and item_type != "unknown": logger.debug("Not an episode: %s", item_type) return try: file = item_info["file"] filename = os.path.basename(file) path = os.path.dirname(file) if item_type == "episode": show_id = item_info["tvshowid"] season = item_info["season"] episode = item_info["episode"] else: show_id = path season = 1 episode = 1 logger.debug("path: %s, filename: %s, show: %s, season:%d, episode:%d", path, filename, show_id, season, episode) item_props = get_properties() current_audio = self._get_audio(item_props) current_subtitle = self._get_subtitle(item_props) current_percentage = item_props["percentage"] logger.debug( "percentage: %.1f", current_percentage) logger.debug( "audio: %d, %s, %s", current_audio["index"], current_audio["language"], current_audio["name"]) logger.debug( "subtitle: %s", f'{current_subtitle["index"]}, {current_subtitle["language"]}, {current_subtitle["name"]}' if current_subtitle else "subtitles disabled") if initial: self.audio = current_audio self.subtitle = current_subtitle stored_info = self.preferences.get(show_id, season, episode) logger.debug("Initial stored info: %s", stored_info) if stored_info is not None: # Will match the stored settings self.audio = stored_info["audio"] self.subtitle = stored_info["subtitle"] if not same_audio(stored_info["audio"], current_audio): logger.info( "Current audio is different from data audio -> Overriding audio") logger.debug(stored_info["audio"]) logger.debug(item_props["audiostreams"]) stream = find_audio_stream( stored_info["audio"], item_props["audiostreams"]) if stream is not None and self.set_audio_stream: logger.debug("Setting audiostream: %d, %s, %s", stream, stored_info["audio"]["language"], stored_info["audio"]["name"]) self.set_audio_stream(stream) if not same_subtitle(stored_info["subtitle"], current_subtitle): logger.info( "Current subtitle is different from data subtitle -> Overriding subtitle") logger.debug(stored_info["subtitle"]) logger.debug(item_props["subtitles"]) stream = find_subtitle_stream( stored_info["subtitle"], item_props["subtitles"]) logger.debug("Setting subtitlestream: %d, %s", stream, f'{stored_info["subtitle"]["language"]}, {stored_info["subtitle"]["name"]}' if stored_info["subtitle"] else "subtitles disabled") enabled = stored_info["subtitle"] is not None if stream is not None and self.set_subtitle_stream: self.set_subtitle_stream(enabled, stream) if not initial and current_percentage > 2: # Check for changes and store if different cause it is what the user specified if not same_audio(self.audio, current_audio) or not same_subtitle(self.subtitle, current_subtitle): logger.debug("same_audio: %s\n %s\n %s", same_audio( self.audio, current_audio), self.audio, current_audio) logger.debug("same_subtitle: %s\n %s\n %s", same_subtitle( self.subtitle, current_subtitle), self.subtitle, current_subtitle) self.preferences.set(show_id, season, episode, { "audio": current_audio, "subtitle": current_subtitle}) self.audio = current_audio self.subtitle = current_subtitle except Exception as e: logger.error(e) def start(self): logger.debug("--> Start") self._reset() self._update_item(initial=True) self.periodic_updater.start() def stop(self): logger.debug("--> Stop") self.periodic_updater.stop()
import logging import syslog from passlib.hash import sha512_crypt import ajenti import ajenti.usersync from ajenti.api import * def restrict(permission): """ Marks a decorated function as requiring ``permission``. If the invoking user doesn't have one, :class:`SecurityError` is raised. """ def decorator(fx): def wrapper(*args, **kwargs): UserManager.get().require_permission(extract_context(), permission) return fx(*args, **kwargs) return wrapper return decorator class SecurityError (Exception): """ Indicates that user didn't have a required permission. .. attribute:: permission permission ID """ def __init__(self, permission): self.permission = permission def __str__(self): return 'Permission "%s" required' % self.permission @plugin @persistent @rootcontext class UserManager (BasePlugin): default_classconfig = {'sync-provider': ''} classconfig_root = True def check_password(self, username, password, env=None): """ Verifies the given username/password combo :type username: str :type password: str :rtype: bool """ if not username or not password: return False provider = self.get_sync_provider(fallback=True) if username == 'root' and not provider.syncs_root: provider = ajenti.usersync.AjentiSyncProvider.get() if not username in ajenti.config.tree.users: return False try: provider.sync() except Exception as e: logging.error(str(e)) result = provider.check_password(username, password) provider_name = type(provider).__name__ ip_notion = '' ip = env.get('REMOTE_ADDR', None) if env else None if ip: ip_notion = ' from %s' % ip if not result: msg = 'failed login attempt for %s ("%s") through %s%s' % \ (username, password, provider_name, ip_notion) syslog.syslog(syslog.LOG_WARNING, msg) logging.warn(msg) else: msg = 'user %s logged in through %s%s' % (username, provider_name, ip_notion) syslog.syslog(syslog.LOG_INFO, msg) logging.info(msg) return result def hash_password(self, password): """ :type password: str :rtype: str """ if not password.startswith('sha512|'): password = '<PASSWORD>|%s' % <PASSWORD>.encrypt(password) return password def hash_passwords(self): for user in ajenti.config.tree.users.values(): if not user.password.startswith('sha512|'): user.password = self.hash_password(user.password) def has_permission(self, context, permission): """ Checks whether the current user has a permission :type permission: str :rtype: bool """ if context.user.name == 'root': return True if not permission in context.user.permissions: return False return True def require_permission(self, context, permission): """ Checks current user for given permission and raises :class:`SecurityError` if he doesn't have one :type permission: str :raises: SecurityError """ if not self.has_permission(context, permission): raise SecurityError(permission) def get_sync_provider(self, fallback=False): """ :type fallback: bool :rtype: ajenti.usersync.UserSyncProvider """ for p in ajenti.usersync.UserSyncProvider.get_classes(): p.get() if p.id == self.classconfig['sync-provider']: try: p.get().test() except: if fallback: return ajenti.usersync.AjentiSyncProvider.get() return p.get() def set_sync_provider(self, provider_id): self.classconfig['sync-provider'] = provider_id self.save_classconfig() def set_password(self, username, password): ajenti.config.tree.users[username].password = self.hash_password(password) @interface class PermissionProvider (object): """ Override to create your own set of permissions """ def get_permissions(self): """ Should return a list of permission names :rtype: list """ return [] def get_name(self): """ Should return a human-friendly name for this set of permissions (displayed in Configurator) :rtype: str """ return '' __all__ = ['restrict', 'PermissionProvider', 'SecurityError', 'UserManager']
<filename>monitoring/monitorlib/scd.py<gh_stars>1-10 import math from datetime import datetime, timedelta from typing import Dict, List, Optional, Tuple, Literal from .typing import ImplicitDict, StringBasedDateTime import s2sphere import shapely.geometry from monitoring.monitorlib import geo TIME_FORMAT_CODE = 'RFC3339' DATE_FORMAT = '%Y-%m-%dT%H:%M:%S.%fZ' EARTH_CIRCUMFERENCE_M = 40.075e6 API_0_3_5 = '0.3.5' # API version 0.3.17 is programmatically identical to version 1.0.0, so both these versions can be used interchangeably. API_1_0_0 = '1.0.0' API_0_3_17 = API_1_0_0 # In Both SCOPE_SC = 'utm.strategic_coordination' SCOPE_CM = 'utm.constraint_management' # In 0.3.5 SCOPE_CI = 'utm.constraint_consumption' # In 0.3.17 SCOPE_CP = 'utm.constraint_processing' SCOPE_CM_SA = 'utm.conformance_monitoring_sa' SCOPE_AA = 'utm.availability_arbitration' NO_OVN_PHRASES = {'', 'Available from USS'} def latitude_degrees(distance_meters: float) -> float: return 360 * distance_meters / EARTH_CIRCUMFERENCE_M def parse_time(time: Dict) -> datetime: t_str = time['value'] if t_str[-1] == 'Z': t_str = t_str[0:-1] return datetime.fromisoformat(t_str) def offset_time(vol4s: List[Dict], dt: timedelta) -> List[Dict]: for vol4 in vol4s: vol4['time_start'] = make_time(parse_time(vol4['time_start']) + dt) vol4['time_end'] = make_time(parse_time(vol4['time_end']) + dt) return vol4s class Subscription(dict): @property def valid(self) -> bool: if self.version is None: return False return True @property def version(self) -> Optional[int]: return self.get('version', None) ################################################################################ #################### Start of ASTM-standard definitions ##################### #################### interfaces/astm-utm/Protocol/utm.yaml ##################### ################################################################################ class LatLngPoint(ImplicitDict): '''A class to hold information about a location as Latitude / Longitude pair ''' lat: float lng: float class Radius(ImplicitDict): ''' A class to hold the radius of a circle for the outline_circle object ''' value: float units: str class Polygon(ImplicitDict): ''' A class to hold the polygon object, used in the outline_polygon of the Volume3D object ''' vertices: List[LatLngPoint] # A minimum of three LatLngPoints are required class Circle(ImplicitDict): ''' A class the details of a circle object used in the outline_circle object ''' center: LatLngPoint radius: Radius class Altitude(ImplicitDict): ''' A class to hold altitude information ''' value:float reference:Literal['W84'] units: str class Time(ImplicitDict): ''' A class to hold Time details ''' value: StringBasedDateTime format:Literal['RFC3339'] class Volume3D(ImplicitDict): '''A class to hold Volume3D objects ''' outline_circle: Optional[Circle] outline_polygon: Optional[Polygon] altitude_lower: Optional[Altitude] altitude_upper: Optional[Altitude] class Volume4D(ImplicitDict): '''A class to hold Volume4D objects ''' volume: Volume3D time_start: Optional[Time] time_end: Optional[Time] class OperationalIntentReference(ImplicitDict): id: str manager: str uss_availability: str version: int state: str ovn: str time_start: Time time_end: Time uss_base_url: str subscription_id: str class ErrorResponse(ImplicitDict): message: str class QueryOperationalIntentReferenceParameters(ImplicitDict): area_of_interest: Volume4D class QueryOperationalIntentReferenceResponse(ImplicitDict): operational_intent_references: List[OperationalIntentReference] class ImplicitSubscriptionParameters(ImplicitDict): uss_base_url: str notify_for_constraints: Optional[bool] class PutOperationalIntentReferenceParameters(ImplicitDict): extents: Volume4D key: List[str] state: str uss_base_url: str subscription_id: Optional[str] new_subscription: Optional[ImplicitSubscriptionParameters] class SubscriptionState(ImplicitDict): subscription_id: str notification_index: int class SubscriberToNotify(ImplicitDict): uss_base_url: str subscriptions: List[SubscriptionState] class ChangeOperationalIntentReferenceResponse(ImplicitDict): subscribers: List[SubscriberToNotify] operational_intent_reference: OperationalIntentReference class OperationalIntentDetails(ImplicitDict): volumes: List[Volume4D] off_nominal_volumes: List[Volume4D] priority: int class OperationalIntent(ImplicitDict): reference: OperationalIntentReference details: OperationalIntentDetails class GetOperationalIntentDetailsResponse(ImplicitDict): operational_intent: OperationalIntent class PutOperationalIntentDetailsParameters(ImplicitDict): operational_intent_id: str operational_intent: Optional[OperationalIntent] subscriptions: List[SubscriptionState] ################################################################################ #################### End of ASTM-standard definitions ##################### #################### interfaces/astm-utm/Protocol/utm.yaml ##################### ################################################################################ class DeleteAllFlightsRequest(ImplicitDict): extents: List[Volume4D] def make_vol4( t0: Optional[datetime] = None, t1: Optional[datetime] = None, alt0: Optional[float] = None, alt1: Optional[float] = None, circle: Dict = None, polygon: Dict = None) -> Volume4D: kwargs = dict() if circle is not None: kwargs['outline_circle'] = circle if polygon is not None: kwargs['outline_polygon'] = polygon if alt0 is not None: kwargs['altitude_lower'] = make_altitude(alt0) if alt1 is not None: kwargs['altitude_upper'] = make_altitude(alt1) vol3 = Volume3D(**kwargs) kwargs = {'volume': vol3} if t0 is not None: kwargs['time_start'] = make_time(t0) if t1 is not None: kwargs['time_end'] = make_time(t1) return Volume4D(**kwargs) def make_time(t: datetime) -> Time: return Time(value=t.isoformat() + 'Z', format='RFC3339') def make_altitude(alt_meters: float) -> Altitude: return Altitude(value=alt_meters, reference='W84', units='M') def make_circle(lat: float, lng: float, radius: float) -> Circle: return Circle( center=LatLngPoint(lat=lat, lng=lng), radius=Radius(value=radius, units='M')) def make_polygon(coords: List[Tuple[float, float]]=None, latlngrect: s2sphere.LatLngRect=None) -> Polygon: if coords is not None: return Polygon(vertices=[LatLngPoint(lat=lat, lng=lng) for (lat, lng) in coords]) return Polygon(vertices=[ LatLngPoint(lat=latlngrect.lat_lo().degrees, lng=latlngrect.lng_lo().degrees), LatLngPoint(lat=latlngrect.lat_lo().degrees, lng=latlngrect.lng_hi().degrees), LatLngPoint(lat=latlngrect.lat_hi().degrees, lng=latlngrect.lng_hi().degrees), LatLngPoint(lat=latlngrect.lat_hi().degrees, lng=latlngrect.lng_lo().degrees), ]) def start_of(vol4s: List[Volume4D]) -> datetime: return min([parse_time(vol4['time_start']) for vol4 in vol4s]) def end_of(vol4s: List[Volume4D]) -> datetime: return max([parse_time(vol4['time_end']) for vol4 in vol4s]) def rect_bounds_of(vol4s: List[Volume4D]) -> s2sphere.LatLngRect: lat_min = 90 lat_max = -90 lng_min = 360 lng_max = -360 for vol4 in vol4s: if 'outline_polygon' in vol4.volume: for v in vol4.volume.outline_polygon.vertices: lat_min = min(lat_min, v.lat) lat_max = max(lat_max, v.lat) lng_min = min(lng_min, v.lng) lng_max = max(lng_max, v.lng) if 'outline_circle' in vol4.volume: circle = vol4.volume.outline_circle if circle.radius.units != 'M': raise ValueError('Unsupported circle radius units: {}'.format(circle.radius.units)) lat_radius = 360 * circle.radius.value / geo.EARTH_CIRCUMFERENCE_M lng_radius = 360 * circle.radius.value / (geo.EARTH_CIRCUMFERENCE_M * math.cos(math.radians(lat_radius))) lat_min = min(lat_min, circle.center.lat - lat_radius) lat_max = max(lat_max, circle.center.lat + lat_radius) lng_min = min(lng_min, circle.center.lng - lng_radius) lng_max = max(lng_max, circle.center.lng + lng_radius) p1 = s2sphere.LatLng.from_degrees(lat_min, lng_min) p2 = s2sphere.LatLng.from_degrees(lat_max, lng_max) return s2sphere.LatLngRect.from_point_pair(p1, p2) def meter_altitude_bounds_of(vol4s: List[Volume4D]) -> Tuple[float, float]: alt_lo = min(vol4.volume.altitude_lower.value for vol4 in vol4s if 'altitude_lower' in vol4.volume) alt_hi = max(vol4.volume.altitude_upper.value for vol4 in vol4s if 'altitude_upper' in vol4.volume) if not all(vol4.volume.altitude_lower.units == 'M' for vol4 in vol4s if 'altitude_lower' in vol4.volume): raise ValueError('altitude_lower units must always be M') if not all(vol4.volume.altitude_upper.units == 'M' for vol4 in vol4s if 'altitude_upper' in vol4.volume): raise ValueError('altitude_upper units must always be M') return alt_lo, alt_hi def vol4_intersect(vol4_1: Volume4D, vol4_2: Volume4D) -> bool: if parse_time(vol4_1.time_end) < parse_time(vol4_2.time_start): return False if parse_time(vol4_1.time_start) > parse_time(vol4_2.time_end): return False if vol4_1.volume.altitude_upper.value < vol4_2.volume.altitude_lower.value: return False if vol4_1.volume.altitude_lower.value > vol4_2.volume.altitude_upper.value: return False if 'outline_circle' in vol4_1.volume: circle = vol4_1.volume.outline_circle if circle.radius.units != 'M': raise ValueError('Unsupported circle radius units: {}'.format(circle.radius.units)) ref = s2sphere.LatLng.from_degrees(circle.center.lat, circle.center.lng) footprint1 = shapely.geometry.Point(0, 0).buffer(vol4_1.volume.outline_circle.radius.value) elif 'outline_polygon' in vol4_1.volume: p = vol4_1.volume.outline_polygon.vertices[0] ref = s2sphere.LatLng.from_degrees(p.lat, p.lng) footprint1 = shapely.geometry.Polygon( geo.flatten(ref, s2sphere.LatLng.from_degrees(v.lat, v.lng)) for v in vol4_1.volume.outline_polygon.vertices) else: raise ValueError('Neither outline_circle nor outline_polygon specified') if 'outline_circle' in vol4_2.volume: circle = vol4_2.volume.outline_circle if circle.radius.units != 'M': raise ValueError('Unsupported circle radius units: {}'.format(circle.radius.units)) xy = geo.flatten(ref, s2sphere.LatLng.from_degrees(circle.center.lat, circle.center.lng)) footprint2 = shapely.geometry.Point(*xy).buffer(circle.radius.value) elif 'outline_polygon' in vol4_1.volume: footprint2 = shapely.geometry.Polygon( geo.flatten(ref, s2sphere.LatLng.from_degrees(v.lat, v.lng)) for v in vol4_2.volume.outline_polygon.vertices) else: raise ValueError('Neither outline_circle nor outline_polygon specified') return footprint1.intersects(footprint2) def vol4s_intersect(vol4s_1: List[Volume4D], vol4s_2: List[Volume4D]) -> bool: for v1 in vol4s_1: for v2 in vol4s_2: if vol4_intersect(v1, v2): return True return False
<filename>src/server.py<gh_stars>0 import numpy as np import sys import os import random from collections import defaultdict from bottle import route, run, response, abort, static_file, request, redirect import mimetypes, base64 from decorators import gzipped, session_logged from index import Index if len(sys.argv) < 2: print('usage: %s <index-directory+>' % sys.argv[0]) sys.exit(1) indexes = {} default_index = None for directory in sys.argv[1:]: name = directory.split('/')[-1] if default_index is None: default_index = name indexes[name] = Index(directory) def closest(db, target, n): return db.closest(target, n) def closest_diverse(db, target, n, random_ratio = .4, mmr_redundancy = .95): np.random.seed(target) split = int(n * random_ratio) #selected = np.random.randint(0, db.vectors.shape[0], n * 2) selected = np.random.choice(range(db.vectors.shape[0]), n * 3, replace=False) scores = np.dot(db.vectors[selected], db.vectors[target].T) result = list(db.closest(target, n - split)) + [(scores[i], selected[i]) for i in range(len(selected))] filtered_for_doubles = [] seen_images = set() for score, i in result: if i not in seen_images: filtered_for_doubles.append((score, i)) seen_images.add(i) sorted_results = sorted(filtered_for_doubles, key=lambda x: -x[0]) selected = np.zeros((n, db.vectors.shape[1])) selected[0] = db.vectors[target] selected_ids = [target] v = db.vectors[sorted_results[0][1]] j = 0 for i in range(1, n): value = 1 while j < len(sorted_results) - 1 and value > mmr_redundancy: j += 1 v = db.vectors[sorted_results[j][1]] value = max(np.dot(selected[:len(selected_ids)], v.T)) #print(i, j, value) if j == len(sorted_results) - 1: break selected[i] = v selected_ids.append(j) if len(selected_ids) < len(sorted_results): selected_ids = range(len(sorted_results))[:n] return [(1, target)] + [sorted_results[j] for j in selected_ids[1:]] ######################### @route('/static/<path:path>') def callback(path): return static_file(path, root='./static/') def template(body): with open('static/style.css') as fp: css = fp.read() return '''<DOCTYPE html> <html> <head> <style>''' + css + '''</style> </head> <body> <div style="position:fixed; left:0px; bottom:0px; font-size: 300%"> <a href="javascript:history.back()">🡄</a> <a href="javascript:history.forward()">🡆</a> <a href="/">🏠</a> </div> ''' + body + '''</body> </html>''' def get_image_url(index, num, use_data_url=False): if index not in indexes: print('index "%s" not found' % index) return '' db = indexes[index] name = db.image(num) mime = mimetypes.guess_type(name) if mime[0] is not None: if use_data_url: try: encoded = base64.b64encode(open(name, 'rb').read()) return 'data:%s;base64,%s' % (mime[0], encoded.decode()) except: print('not found', name) return '' else: return '/image/%s/%d' % (index, num) return '' @route('/image/<index>/<num:int>') def image(index, num): if index not in indexes: abort(404, 'index "%s" not found' % index) db = indexes[index] name = db.image(num) mime = mimetypes.guess_type(name) if mime[0] is not None: return static_file(name.split('/')[-1], root=db.image_directory, mimetype=mime[0]) abort(404, 'image %d not found' % num) @gzipped() @route('/1d-sorted/<index>/m=<method>/t=<target:int>/n=<num:int>/r=<redundancy:float>') @session_logged() def sorted_1d(index, method='diverse', target=0, num=109, redundancy=.95): if index not in indexes: abort(404, 'index "%s" not found' % index) db = indexes[index] if db.image(target) is None: abort(404, 'not found') if method == 'diverse': found = closest_diverse(db, target, num, mmr_redundancy=redundancy) elif method == 'closest': found = db.closest(target, num) else: abort(501, 'method not supported') content = '' for score, i in found: description = db.description(i) if i == target: content += '<img style="float:left" title="%s" alt="%s" width="224" height="224" src="%s">' % (description, description, get_image_url(index, i)) else: content += '<a href="/1d-sorted/%s/m=%s/t=%d/n=%d/r=%g"><img title="%s" alt="%s" width="112" height="112" src="%s"></a>' % (index, method, i, num, redundancy, description, description, get_image_url(index, i)) #response.set_header("Cache-Control", "public, max-age=604800") return template(content) @gzipped() @route('/2d-sorted/<index>/m=<method>/t=<target:int>/w=<N:int>/h=<M:int>/r=<random_ratio:float>/t=<redundancy_threshold:float>') @session_logged() def sorted_2d(index, method='diverse', target=0, N=12, M=8, random_ratio=.1, redundancy_threshold=.75): if index not in indexes: abort(404, 'index "%s" not found' % index) db = indexes[index] if db.image(target) is None: abort(404, 'not found') import grid_sort NUM = N * M if method == 'diverse': found = np.array([x[1] for x in closest_diverse(db, target, NUM - 3, random_ratio=random_ratio, mmr_redundancy=redundancy_threshold)]) elif method == 'closest': found = np.array([x[1] for x in db.closest(target, NUM - 3)]) else: abort(501, 'method not supported') vectors = db.vectors[found] indices = np.arange(NUM).reshape(N, M) fixed = np.zeros((N, M)) CN, CM = N // 2 - 1, M // 2 - 1 indices[N - 1, M - 1] = indices[CN, CM] indices[N - 1, M - 2] = indices[CN + 1, CM] indices[N - 1, M - 3] = indices[CN, CM + 1] indices[0, 0] = indices[CN + 1, CM + 1] indices[CN, CM] = 0 indices[CN + 1, CM] = 0 indices[CN, CM + 1] = 0 indices[CN + 1, CM + 1] = 0 fixed[CN, CM] = 1 fixed[CN + 1, CM] = 1 fixed[CN, CM + 1] = 1 fixed[CN + 1, CM + 1] = 1 grid_sort.seed(target) indices = grid_sort.sort(vectors, N, M, indices, fixed) table = '<table border="0" cellspacing="0" cellpadding="0" style="margin: auto">' for j in range(M): row = '<tr>' for i in range(N): image = found[indices[i, j]] description = db.description(image) if i == CN and j == CM: row += '<td colspan="2" rowspan="2" style="text-align: center"><img title="%s" alt="%s" src="%s" width="210" height="210"></td>' % (description, description, get_image_url(index, image)) elif i == CN + 1 and j == CM: pass elif i == CN and j == CM + 1: pass elif i == CN + 1 and j == CM + 1: pass else: row += '<td><a href="/2d-sorted/%s/m=%s/t=%d/w=%d/h=%d/r=%g/t=%g"><img title="%s" alt="%s" src="%s" width="112" height="112"></a></td>' % (index, method, image, N, M, random_ratio, redundancy_threshold, description, description, get_image_url(index, image)) row += '</tr>' table += row table += '</table>' return template(table) @route('/starting-point/<index>/w=<width:int>/h=<height:int>') @session_logged() def starting_point(index, width=14, height=8): if index not in indexes: abort(404, 'index "%s" not found' % index) db = indexes[index] random.seed(hash(request.query.parameters)) indices = random.sample(range(0, len(db.images)), width * height) parameters = request.query.parameters parameters = parameters.replace('$INDEX', index).replace('$WIDTH', str(width)).replace('$HEIGHT', str(height)) table = '<table border="0" cellspacing="0" cellpadding="0" style="margin: auto">' for j in range(height): row = '<tr>' for i in range(width): image = indices[j * width + i] description = db.description(image) row += '<td><a href="%s"><img title="%s" alt="%s" src="%s" width="112" height="112"></a></td>' % (parameters.replace('$TARGET', str(image)), description, description, get_image_url(index, image)) row += '</tr>' table += row table += '</table>' return template(table) @route('/') @session_logged() def index(): body = '' for name in indexes: body += '<h1>%s</h1>' % name body += '<ul>' body += '<li><a href="/starting-point/%s/w=14/h=8?parameters=/2d-sorted/$INDEX/m=diverse/t=$TARGET/w=$WIDTH/h=$HEIGHT/r=.5/t=.85">Diverse, 2d-sorted</a></li>' % (name) body += '<li><a href="/starting-point/%s/w=14/h=8?parameters=/2d-sorted/$INDEX/m=closest/t=$TARGET/w=$WIDTH/h=$HEIGHT/r=.5/t=.85">Closest, 2d-sorted</a></li>' % (name) body += '<li><a href="/starting-point/%s/w=14/h=8?parameters=/1d-sorted/$INDEX/m=diverse/t=$TARGET/n=115/r=.95">Diverse, 1d-sorted</a></li>' % (name) body += '<li><a href="/starting-point/%s/w=14/h=8?parameters=/1d-sorted/$INDEX/m=closest/t=$TARGET/n=115/r=.95">Closest, 1d-sorted</a></li>' % (name) body += '</ul>' return template(body) if __name__ == '__main__': run(server='bjoern', host='localhost', port=8080)
<filename>evology/bin/gp/gp_bin/gp.py import operator import math import random import numpy as np from deap import algorithms from deap import base from deap import creator from deap import tools from deap import gp import matplotlib.pyplot as plt from networkx.drawing.nx_agraph import graphviz_layout import networkx as nx import pydot from networkx.drawing.nx_pydot import graphviz_layout # in Conda prompt conda install -c alubbock pygraphviz run in admin mode # Define new functions def protectedDiv(left, right): try: return left / right except ZeroDivisionError: return 1 pset = gp.PrimitiveSet("MAIN", 1) pset.addPrimitive(operator.add, 2) pset.addPrimitive(operator.sub, 2) pset.addPrimitive(operator.mul, 2) pset.addPrimitive(protectedDiv, 2) pset.addPrimitive(operator.neg, 1) # pset.addPrimitive(math.cos, 1) # pset.addPrimitive(math.sin, 1) # pset.addPrimitive(math.exp, 1) # pset.addEphemeralConstant("rand101", lambda: random.randint(-1,1)) pset.renameArguments(ARG0="x") creator.create("FitnessMin", base.Fitness, weights=(-1.0,)) creator.create("Individual", gp.PrimitiveTree, fitness=creator.FitnessMin) toolbox = base.Toolbox() toolbox.register("expr", gp.genHalfAndHalf, pset=pset, min_=1, max_=2) toolbox.register("individual", tools.initIterate, creator.Individual, toolbox.expr) toolbox.register("population", tools.initRepeat, list, toolbox.individual) toolbox.register("compile", gp.compile, pset=pset) def evalSymbReg(individual, points): # Transform the tree expression in a callable function func = toolbox.compile(expr=individual) # Evaluate the mean squared error between the expression # and the real function : x**4 + x**3 + x**2 + x sqerrors = ((func(x) - x**4 - x**3 - x**2 - x)**2 for x in points) return math.fsum(sqerrors) / len(points), toolbox.register("evaluate", evalSymbReg, points=[x / 10.0 for x in range(-10, 10)]) toolbox.register("select", tools.selTournament, tournsize=3) toolbox.register("mate", gp.cxOnePoint) toolbox.register("expr_mut", gp.genFull, min_=0, max_=2) toolbox.register("mutate", gp.mutUniform, expr=toolbox.expr_mut, pset=pset) toolbox.decorate( "mate", gp.staticLimit(key=operator.attrgetter("height"), max_value=17) ) toolbox.decorate( "mutate", gp.staticLimit(key=operator.attrgetter("height"), max_value=17) ) def main(): random.seed(8) hof = tools.HallOfFame(1) halloffame = hof population = toolbox.population(n=300) cxpb = 0.5 ngen = 50 mutpb = 0.1 verbose = True stats_fit = tools.Statistics(lambda ind: ind.fitness.values) stats_size = tools.Statistics(len) mstats = tools.MultiStatistics(fitness=stats_fit, size=stats_size) mstats.register("avg", np.mean) mstats.register("std", np.std) mstats.register("min", np.min) mstats.register("max", np.max) stats = mstats logbook = tools.Logbook() logbook.header = ["gen", "nevals"] + (stats.fields if stats else []) # Evaluate the individuals with an invalid fitness invalid_ind = [ind for ind in population if not ind.fitness.valid] fitnesses = toolbox.map(toolbox.evaluate, invalid_ind) for ind, fit in zip(invalid_ind, fitnesses): ind.fitness.values = fit if halloffame is not None: halloffame.update(population) record = stats.compile(population) if stats else {} logbook.record(gen=0, nevals=len(invalid_ind), **record) if verbose: print(logbook.stream) # Begin the generational process for gen in range(1, ngen + 1): # Select the next generation individuals offspring = toolbox.select(population, len(population)) # Vary the pool of individuals offspring = [toolbox.clone(ind) for ind in population] for i in range(1, len(offspring), 2): if random.random() < cxpb: offspring[i - 1], offspring[i] = toolbox.mate( offspring[i - 1], offspring[i] ) del offspring[i - 1].fitness.values, offspring[i].fitness.values for i in range(len(offspring)): if random.random() < mutpb: (offspring[i],) = toolbox.mutate(offspring[i]) del offspring[i].fitness.values # Evaluate the individuals with an invalid fitness invalid_ind = [ind for ind in offspring if not ind.fitness.valid] fitnesses = toolbox.map(toolbox.evaluate, invalid_ind) for ind, fit in zip(invalid_ind, fitnesses): ind.fitness.values = fit # Update the hall of fame with the generated individuals if halloffame is not None: halloffame.update(offspring) # Replace the current population by the offspring population[:] = offspring # Append the current generation statistics to the logbook record = stats.compile(population) if stats else {} logbook.record(gen=gen, nevals=len(invalid_ind), **record) if verbose: print(logbook.stream) # print log return population, logbook, hof pop, log, hof = main() bests = tools.selBest(pop, k=1) # def plot_graph(tree): # nodes, edges, labels = gp.graph(tree) # graph = nx.Graph() # graph.add_nodes_from(nodes) # graph.add_edges_from(edges) # pos = graphviz_layout(graph, prog="dot") # run dot -c in conda prompt # plt.figure(figsize=(7, 7)) # nx.draw_networkx_nodes(graph, pos, node_size=900, node_color="w") # nx.draw_networkx_edges(graph, pos) # nx.draw_networkx_labels(graph, pos, labels) # plt.axis("off") # plt.show() # print("Pop") # for i in range(len(pop)): # print(pop[i]) # plot_graph(pop[i]) print("Best ") print(bests[0]) print(type(bests[0])) print(toolbox.compile(expr=bests[0])) # Show solution def func(x): return x ** 3 + x ** 2 + x + 1 X = np.linspace(-1, 1, 100) Y_true = func(X) Y_reconstructed = [toolbox.compile(bests[0])(x) for x in X] plt.plot(X, Y_true, label = 'True function') plt.plot(X, Y_reconstructed, label = 'GP symoblic regression') plt.legend() plt.show() nodes, edges, labels = gp.graph(bests[0]) graph = nx.Graph() graph.add_nodes_from(nodes) graph.add_edges_from(edges) pos = graphviz_layout(graph, prog = 'dot') # prog="twopi") # run dot -c in conda prompt #"dot" plt.figure(figsize=(7, 7)) nx.draw_networkx_nodes(graph, pos, node_size=900, node_color="w", node_shape='o') nx.draw_networkx_edges(graph, pos) nx.draw_networkx_labels(graph, pos, labels) plt.axis("off") plt.show() gen = log.select("gen") fit_mins = log.chapters["fitness"].select("min") size_avgs = log.chapters["size"].select("avg") fig, ax1 = plt.subplots() line1 = ax1.plot(gen, fit_mins, "b-", label="Minimum Fitness") ax1.set_xlabel("Generation") ax1.set_ylabel("Fitness", color="b") for tl in ax1.get_yticklabels(): tl.set_color("b") ax2 = ax1.twinx() line2 = ax2.plot(gen, size_avgs, "r-", label="Average Size") ax2.set_ylabel("Size", color="r") for tl in ax2.get_yticklabels(): tl.set_color("r") lns = line1 + line2 labs = [l.get_label() for l in lns] ax1.legend(lns, labs, loc="center right") plt.show()
""" Residential Efficiency outputs ------------------------------ output functions for Residential Efficiency component """ import os.path import aaem.constants as constants from aaem.components import comp_order import aaem_summaries.web_lib as wl from pandas import DataFrame COMPONENT_NAME = "Residential Energy Efficiency" DESCRIPTION = """ This component calculates the potential change in heating fuel usage from residential-building energy efficiency improvements. """ def generate_web_summary (web_object, community): """generate html summary for a community. generates web_object.directory/community/<component>.html and associated csv files. Parameters ---------- web_object: WebSummary a WebSummary object community: str community name See also -------- aaem.web : WebSummary object definition """ ## get the template template = web_object.component_html ## get the component (the modeled one) modeled = web_object.results[community][COMPONENT_NAME] start_year = modeled.start_year end_year = modeled.actual_end_year ## for make table functions projects = {'Modeled ' + COMPONENT_NAME: modeled} ## get forecast stuff (consumption, generation, etc) fc = modeled.forecast generation = fc.generation['generation diesel'].\ ix[start_year:end_year] ## get the diesel prices diesel_price = web_object.results[community]['community data'].\ get_item('community','diesel prices').ix[start_year:end_year] ## get diesel generator efficiency eff = modeled.cd['diesel generation efficiency'] ## get generation fuel costs per year (modeled) base_cost = generation/eff * diesel_price base_cost.name = 'Base Cost' base_cost = DataFrame(base_cost) base_cost['Base Cost'] = (modeled.baseline_HF_cost + modeled.baseline_kWh_cost)[:modeled.actual_project_life] table1 = wl.make_costs_table(community, COMPONENT_NAME, projects, base_cost, web_object.directory) ## get generation fuel used (modeled) base_con = generation/eff base_con.name = 'Base Consumption' base_con = DataFrame(base_con) #~ base_con['Base Consumption'] = modeled.baseline_kWh_consumption #~ table2 = wl.make_consumption_table(community, COMPONENT_NAME, #~ projects, base_con, #~ web_object.directory, #~ 'proposed_kWh_consumption') base_con['Base Consumption'] = modeled.baseline_fuel_Hoil_consumption[:modeled.actual_project_life] table3 = wl.make_consumption_table(community, COMPONENT_NAME, projects, base_con, web_object.directory, 'savings_HF') #~ table3[0][-1] year = modeled.comp_specs['data']['Year'] current = [ {'words':'Households ('+ str(int(year)) + ')' , 'value': int(modeled.comp_specs['data']['Total Occupied'])}, {'words':'Households with BEES certification' + \ ' ('+ str(int(year)) +')', 'value': str(modeled.comp_specs['data']['BEES Number'])}, {'words': 'Households participating in weatherization of home ' + \ 'energy rebate programs ('+ str(int(year)) +')', 'value': str(modeled.comp_specs['data']['Post-Retrofit Number'])}, {'words':'Estimated Total Households (' +\ str(int(modeled.start_year)) +')', 'value': modeled.init_HH}, ] ## info for modeled info = create_project_details_list (modeled) ## info table (list to send to template) info_for_projects = [{'name': 'Current System', 'info':current}, {'name':'Modeled Efficiency Project','info':info}] ## create list of charts charts = [ {'name':'costs', 'data': str(table1).replace('nan','null'), 'title': 'Estimated Heating Fuel + Electricity Costs for residential sector', 'type': "'$'", 'plot': True,}, #~ {'name':'E_consumption', 'data': str(table2).replace('nan','null'), #~ 'title':'Electricity Consumed', #~ 'type': "'other'",'plot': True,}, {'name':'H_consumption', 'data': str(table3).replace('nan','null'), 'title':'Heating Oil Consumed by residential sector', 'type': "'other'", 'plot': True,} ] ## generate html ## generate html msg = None if community in web_object.bad_data_coms: msg = web_object.bad_data_msg pth = os.path.join(web_object.directory, community.replace("'",''), COMPONENT_NAME.replace(' ','_').lower() + '.html') with open(pth, 'w') as html: html.write(template.render( info = info_for_projects, type = COMPONENT_NAME, com = community.replace("'",'') , charts = charts, summary_pages = ['Summary'] + comp_order , sections = web_object.get_summary_pages(), description = DESCRIPTION, metadata = web_object.metadata, message = msg )) def create_project_details_list (project): """makes a projects details section for the html Parameters ---------- project: ResidentialBuildings A ResidentialBuildings object thats run function has been called Returns ------- A dictionary with values used by summary """ ex_h_savings = (1 - \ ( project.proposed_HF_consumption / project.baseline_HF_consumption )[0])*100 #~ print ex_h_savings return [ {'words':'Capital cost', 'value': '${:,.0f}'.format(project.get_NPV_costs())}, {'words':'Lifetime energy cost savings', 'value': '${:,.0f}'.format(project.get_NPV_benefits())}, {'words':'Net lifetime savings', 'value': '${:,.0f}'.format(project.get_NPV_net_benefit())}, {'words':'Benefit-cost ratio', 'value': '{:,.1f}'.format(project.get_BC_ratio())}, {'words':'Expected space heating savings ', 'value': '{:,.2f}%'.format(ex_h_savings)}, {'words': 'Estimated households to be retrofit ('\ + str(int(project.start_year)) +')' , 'value': int(project.opportunity_HH)}, {'words':'Estimated cost to refit household', 'value': '${:,.2f}/home'.format(project.refit_cost_rate)}, ]
<reponame>frank-chris/ScrapingTwitterPostsOnPolitics<filename>scripts/calc_answers.py """ <NAME> (<EMAIL>) Script to find the answers for the Assignment 1 question from the scraped CSVs """ usage = "Usage:\n\n\ \ python3 calc_answers.py DIR_PATH\n\n\ \ * DIR_PATH: \n\ path to the directory which contains the scraped CSV files for the subtopics \ should not contain any other CSV file except the 'n' CSV files corresponding to \ 'n' subtopics (all processing, like removing duplicates, concatenation etc should \ be done before)\n" import pandas as pd import plotly.graph_objects as go from tqdm import tqdm from ast import literal_eval import numpy as np import sys import os if __name__ == "__main__": try: assert(len(sys.argv) == 2) assert(os.path.isdir(sys.argv[1])) except: print(usage) exit() dir_path = sys.argv[1] file_paths = [os.path.join(dir_path, path) for path in os.listdir(dir_path)] month_fig = go.Figure() stats = open('stats.txt', 'a') for f_path in tqdm(file_paths): print('\n' + f_path + ':\n', file=stats) # read subtopic file subtopic_df = pd.read_csv(f_path, sep='\t', dtype={'place':str}, error_bad_lines=False) subtopic_df['hashtags'].fillna(value='[]', inplace=True) subtopic_df['urls'].fillna(value='[]', inplace=True) subtopic_df['photos'].fillna(value='[]', inplace=True) subtopic_df['mentions'].fillna(value='[]', inplace=True) # top 10 hashtags hashtags = pd.Series(subtopic_df['hashtags'].apply(literal_eval).sum()) top10hashtags = hashtags.value_counts()[:10] print('top 10 hashtags\n', top10hashtags, file=stats) fig = go.Figure() fig.add_trace(go.Bar(x=['#' + i for i in top10hashtags.index], y=top10hashtags)) fig.update_layout(font_size=13, title_text='Top 10 hashtags for ' + os.path.basename(f_path).replace('.csv', ''), xaxis_title='Hashtag', yaxis_title='Frequency') fig.show() # top 10 mentions mentions = pd.Series([x['screen_name'] for x in subtopic_df['mentions'].apply(literal_eval).sum()]) top10mentions = mentions.value_counts()[:10] print('top 10 mentions\n', top10mentions, file=stats) fig = go.Figure() fig.add_trace(go.Bar(x=['@' + i for i in top10mentions.index], y=top10mentions)) fig.update_layout(font_size=13, title_text='Top 10 mentions for ' + os.path.basename(f_path).replace('.csv', ''), xaxis_title='Mention', yaxis_title='Frequency') fig.show() # top 5 languages top5langs = subtopic_df['language'].value_counts()[:5] print('language tags', subtopic_df['language'].value_counts(), file=stats) fig = go.Figure() fig.add_trace(go.Bar(x=top5langs.index, y=top5langs)) fig.update_layout(font_size=13, title_text='Top 5 language tags for ' + os.path.basename(f_path).replace('.csv', ''), xaxis_title='Language Tag', yaxis_title='Frequency') fig.show() # month-wise plot months = subtopic_df['date'].value_counts().sort_index() month_fig.add_trace(go.Scatter(x=months.index, y = months, name=os.path.basename(f_path).replace('.csv', ''))) # words words = (' '.join([str(i) for i in list(subtopic_df['tweet'])])).split() words_df = pd.DataFrame() words_df['words'] = words words_df.to_csv(f_path.replace('.csv', '_words.csv'), index=False, header=False) # stats print('No of tweets', subtopic_df.index.size, file=stats) print('No of mentions', len(mentions), file=stats) print('No of hashtags', len(hashtags), file=stats) print('No of unique mentions', mentions.nunique(), file=stats) print('No of unique hashtags', hashtags.nunique(), file=stats) print('No of unique languages', subtopic_df['language'].nunique(), file=stats) days = subtopic_df['date'].value_counts().sort_index() print('Max number of tweets in a day', days.max(), file=stats) print('Time zones', subtopic_df['timezone'].nunique(), file=stats) print('No of conversations/threads', subtopic_df['conversation_id'].nunique(), file=stats) print('No of users', subtopic_df['user_id'].nunique(), file=stats) print('No of places', subtopic_df['place'].nunique(), file=stats) # urls = pd.Series(subtopic_df['urls'].apply(literal_eval).sum()) # print('No of urls', urls.nunique(), file=stats) # photos = pd.Series(subtopic_df['photos'].apply(literal_eval).sum()) # print('No of photos', photos.nunique(), file=stats) print('Total number of likes', subtopic_df['likes_count'].sum(), file=stats) print('No of videos', subtopic_df['video'].sum(), file=stats) print('geo tags count', subtopic_df['geo'].nunique(), file=stats) print('percentage of tweets that are retweets', 100 - (subtopic_df['retweet']=='False').sum()*100/subtopic_df.index.size, file=stats) print('Total no of retweets received', subtopic_df['retweets_count'].sum(), file=stats) print('Total no of replies received', subtopic_df['replies_count'].sum(), file=stats) month_fig.update_layout(font_size=13, title_text='Monthly distribution of tweets', xaxis_title='Month', yaxis_title='No. of tweets', legend_title_text='Subtopic') month_fig.show() stats.close()
<gh_stars>0 import datetime, time import re import sys try: import simplejson as json except ImportError: import json from dogshell.common import report_errors, report_warnings, CommandLineClient def prettyprint_event(event): title = event['title'] or '' handle = event.get('handle', '') or '' date = event['date_happened'] dt = datetime.datetime.fromtimestamp(date) link = event['url'] print((title + ' (' + handle + ')').strip()) print(dt.isoformat(' ') + ' | '+ link) def print_event(event): prettyprint_event(event) def prettyprint_event_details(event): prettyprint_event(event) def print_event_details(event): prettyprint_event(event) time_pat = re.compile(r'(?P<delta>[0-9]*\.?[0-9]+)(?P<unit>[mhd])') def parse_time(timestring): now = time.mktime(datetime.datetime.now().timetuple()) if timestring is None: t = now else: try: t = int(timestring) except: match = time_pat.match(timestring) if match is None: raise Exception delta = float(match.group('delta')) unit = match.group('unit') if unit == 'm': delta = delta * 60 if unit == 'h': delta = delta * 60 * 60 if unit == 'd': delta = delta * 60 * 60 * 24 t = now - int(delta) return int(t) class EventClient(CommandLineClient): def setup_parser(self, subparsers): parser = subparsers.add_parser('event', help='Post events, get event details, and view the event stream.') verb_parsers = parser.add_subparsers(title='Verbs') post_parser = verb_parsers.add_parser('post', help='Post events.') post_parser.add_argument('title', help='event title') post_parser.add_argument('--date_happened', help='POSIX timestamp when the event occurred. if unset defaults to the current time.') post_parser.add_argument('--handle', help='user to post as. if unset, submits as the generic API user.') post_parser.add_argument('--priority', help='"normal" or "low". defaults to "normal"') post_parser.add_argument('--related_event_id', help='event to post as a child of. if unset, posts a top-level event') post_parser.add_argument('--tags', help='comma separated list of tags') post_parser.add_argument('--host', help='related host') post_parser.add_argument('--device', help='related device (e.g. eth0, /dev/sda1)') post_parser.add_argument('--type', help='type of event, e.g. nagios, jenkins, etc.') post_parser.add_argument('message', help='event message body. if unset, reads from stdin.', nargs="?") post_parser.set_defaults(func=self._post) show_parser = verb_parsers.add_parser('show', help='Show event details.') show_parser.add_argument('event_id', help='event to show') show_parser.set_defaults(func=self._show) stream_parser = verb_parsers.add_parser('stream', help='Delete comments.', description="Stream start and end times can be specified as either a POSIX timestamp (e.g. the output of `date +%s`) or as a period of time in the past (e.g. '5m', '6h', '3d').") stream_parser.add_argument('start', help='start date for the stream request') stream_parser.add_argument('end', help='end date for the stream request (defaults to "now")', nargs='?') stream_parser.add_argument('--priority', help='filter by priority. "normal" or "low". defaults to "normal"') stream_parser.add_argument('--sources', help='comma separated list of sources to filter by') stream_parser.add_argument('--tags', help='comma separated list of tags to filter by') stream_parser.set_defaults(func=self._stream) def _post(self, args): self.dog.timeoue = args.timeout format = args.format message = args.message if message is None: message = sys.stdin.read() if args.tags is not None: tags = [t.strip() for t in args.tags.split(',')] else: tags = None res = self.dog.event_with_response(args.title, message, args.date_happened, args.handle, args.priority, args.related_event_id, tags, args.host, args.device) report_warnings(res) report_errors(res) if format == 'pretty': prettyprint_event(res['event']) elif format == 'raw': print(json.dumps(res)) else: print_event(res['event']) def _show(self, args): self.dog.timeoue = args.timeout format = args.format res = self.dog.get_event(args.event_id) report_warnings(res) report_errors(res) if format == 'pretty': prettyprint_event_details(res['event']) elif format == 'raw': print(json.dumps(res)) else: print_event_details(res['event']) def _stream(self, args): self.dog.timeoue = args.timeout format = args.format if args.sources is not None: sources = [s.strip() for s in args.sources.split(',')] else: sources = None if args.tags is not None: tags = [t.strip() for t in args.tags.split(',')] else: tags = None start = parse_time(args.start) end = parse_time(args.end) res = self.dog.stream(start, end, args.priority, sources, tags) report_warnings(res) report_errors(res) if format == 'pretty': for event in res['events']: prettyprint_event(event) print() elif format == 'raw': print(json.dumps(res)) else: for event in res['events']: print_event(event) print()
<gh_stars>100-1000 # -*- coding: utf-8 -*- import datetime from south.db import db from south.v2 import DataMigration from django.core.management import call_command from django.db import models class Migration(DataMigration): def forwards(self, orm): """ Load the two statuses. """ call_command('loaddata', 'state.json') def backwards(self, orm): """ No backwards. """ raise RuntimeError('No reverse for state.json') models = { 'auth.group': { 'Meta': {'object_name': 'Group'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, 'auth.permission': { 'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, 'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('<PASSWORD>', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, 'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) }, 'idea.comment': { 'Meta': {'object_name': 'Comment'}, 'creator': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'idea': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['idea.Idea']"}), 'text': ('django.db.models.fields.TextField', [], {}), 'time': ('django.db.models.fields.DateField', [], {'auto_now': 'True', 'blank': 'True'}) }, 'idea.idea': { 'Meta': {'object_name': 'Idea'}, 'creator': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'state': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['idea.State']"}), 'text': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), 'time': ('django.db.models.fields.DateField', [], {'default': 'datetime.datetime(2013, 1, 31, 0, 0)'}), 'title': ('django.db.models.fields.CharField', [], {'max_length': '140'}) }, 'idea.state': { 'Meta': {'object_name': 'State'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}), 'previous': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['idea.State']", 'unique': 'True', 'null': 'True', 'blank': 'True'}) }, 'idea.vote': { 'Meta': {'object_name': 'Vote'}, 'creator': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'idea': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['idea.Idea']"}), 'time': ('django.db.models.fields.DateField', [], {'auto_now': 'True', 'blank': 'True'}) } } complete_apps = ['idea'] symmetrical = True
<filename>disp/database/api.py """ Module for providing a MongoDB database (collection) interface for AIRSS searches """ import os import zlib import enum from logging import getLogger, INFO, WARNING import hashlib import time from datetime import datetime, timedelta from monty.serialization import loadfn from fireworks.utilities.fw_utilities import get_my_host, get_my_ip import pymongo from pymongo import MongoClient from pymongo.errors import PyMongoError import gridfs import pandas as pd from mongoengine import connect, get_connection from mongoengine.connection import ConnectionFailure from disp.database.odm import (ResFile, ParamFile, SeedFile, InitialStructureFile, Creator) # pylint: disable=too-many-instance-attributes, too-many-arguments, import-outside-toplevel, no-member, protected-access def get_db_file_path(): """Returns the path of the db file""" return os.environ.get('DISP_DB_FILE') DB_FILE = get_db_file_path() class DocumentType(enum.Enum): RES = 'res' SEED = 'seed' INITIAL_STRUCTURE = 'initial_structure' PARAM = 'param' class SearchDB: """ Database backend for storing search results """ logger = getLogger(__name__) INDICES = [ 'project_name', 'seed_name', 'created_on', 'md5hash', 'struct_name' ] _ATOMATE_TASK_COLL = 'atomate_tasks' # Name of the collection for atomate tasks INDICES_ATOMATE = [ 'project_name', 'seed_name', 'struct_name', 'uuid', 'unique_name', 'task_label', 'disp_type', 'last_updated' ] def __init__(self, host: str = 'localhost', port: int = 27017, database: str = 'disp-db', user: str = None, password: str = <PASSWORD>, collection: str = 'disp_entry', lpad=None, **kwargs): self.host = host self.db_name = database self.user = user self.password = password self.port = int(port) self.identity = {} self.lpad = lpad try: self._engine_connection = connect(db=self.db_name, alias='disp', host=host, username=user, port=int(port), password=password, authentication_source=kwargs.get( 'authsource', None)) except ConnectionFailure: self.logger.info('Reusing existing connections') self._engine_connection = get_connection('disp') # Direct connection with PyMongo try: self.connection = MongoClient(host=self.host, port=self.port, username=self.user, password=self.password, **kwargs) self.database = self.connection[self.db_name] except PyMongoError: self.logger.error('Mongodb connection failed') raise RuntimeError # Authenticate through pymongo try: if self.user: self.database.authenticate(self.user, self.password, source=kwargs.get( 'authsource', None)) except PyMongoError: self.logger.error('Mongodb authentication failed') raise RuntimeError self.collection = self.database[collection] self.gfs = gridfs.GridFS(self.database, collection=collection + '-fs') def set_identity(self, fw_id, uuid=None, fw_worker=None): """Populate the identity dictionary""" self.identity['fw_id'] = fw_id if uuid: self.identity['uuid'] = uuid self.identity['hostname'] = get_my_host() self.identity['ip_address'] = get_my_ip() if fw_worker: self.identity['fw_worker'] = fw_worker def include_creator(self, entry): """Return a 'Creator' embedded document for recording the creator of any created document""" if self.identity: entry.creator = Creator(**self.identity) def build_indexes(self, additional_fields=None, fw_additional_fields=None, wf_additional_fields=None, background=True): """ Build the indexes to accelerate queries Args: indexes (list): list of single field indexes to be built. background (bool): Run in the background or not. """ if additional_fields is None: additional_fields = [] if fw_additional_fields is None: fw_additional_fields = [] if wf_additional_fields is None: wf_additional_fields = [] _indices = list(self.INDICES) _indices.extend(additional_fields) for key in _indices: self.collection.create_index(key, background=background) # Create compound index for project_name and seed_name for key in ['project_name', 'seed_name']: self.collection.create_index([(key, pymongo.DESCENDING), ('created_on', pymongo.DESCENDING)]) # For selection with _cls self.collection.create_index([(key, pymongo.DESCENDING), ('_cls', pymongo.DESCENDING)]) self.collection.create_index(key) # Build indices for atomate tasks collection # Assuming the collection is in the same database for key in self.INDICES_ATOMATE: self.database[self._ATOMATE_TASK_COLL].create_index( key, background=background) # Create compound index for project_name and seed_name for key in ['project_name', 'seed_name']: self.database[self._ATOMATE_TASK_COLL].create_index([ (key, pymongo.DESCENDING), ('last_update', pymongo.DESCENDING) ]) # Fireworks tasks related if self.lpad is not None: lpad = self.lpad for name in [ 'project_name', 'seed_name', 'struct_name', *fw_additional_fields ]: lpad.fireworks.create_index('spec.' + name, background=background) for name in [ 'project_name', 'seed_name', 'disp_type', *wf_additional_fields ]: lpad.workflows.create_index('metadata.' + name, background=background) def insert_seed(self, project_name: str, seed_name: str, seed_content: str): """Insert a single record of the seed for structure generation""" md5hash = hashlib.md5(seed_content.encode()).hexdigest() seed = SeedFile.objects(md5hash=md5hash, project_name=project_name, seed_name=seed_name).first() if not seed: seed = SeedFile(md5hash=md5hash, seed_name=seed_name, content=seed_content, project_name=project_name) self.include_creator(seed) seed.save() return seed def insert_param(self, project_name: str, param_content: str, seed_name: str): """Insert a single record for paramter""" md5hash = hashlib.md5(param_content.encode()).hexdigest() param = ParamFile.objects(md5hash=md5hash, project_name=project_name).first() if not param: param = ParamFile(md5hash=md5hash, content=param_content, project_name=project_name, seed_name=seed_name) self.include_creator(param) param.save() return param def insert_search_record(self, project_name: str, struct_name: str, res_content: str, param_content=None, seed_name=None, seed_hash=None, seed_content=None): """Insert a record of the resultant structure of a search""" if seed_hash and seed_content: md5hash = hashlib.md5(seed_content.encode()).hexdigest() assert md5hash == seed_hash, 'The seed_hash does not match seed_content!!' # Seed content supplied but no hash given - insert this seed to the database if (not seed_hash) and seed_name and seed_content: seed_file = self.insert_seed(project_name, seed_name, seed_content) else: seed_file = None if param_content: param_file = self.insert_param(project_name, param_content, seed_name) else: param_file = None res_record = ResFile(seed_name=seed_name, project_name=project_name, content=res_content, struct_name=struct_name) # Link to the Param and Seed files res_record.param_file = param_file res_record.seed_file = seed_file self.include_creator(res_record) # Link with the initial structure of this record # Link to the last record in case of Firework level rerun init = InitialStructureFile.objects( project_name=project_name, seed_name=seed_name, struct_name=struct_name).order_by('-created_on').first() if init: res_record.init_structure_file = init res_record.save() return res_record def insert_initial_structure(self, project_name: str, struct_name: str, struct_content: str, seed_name: str, seed_content: str): """Insert a record of a randomly generated structure""" seed_file = self.insert_seed(project_name, seed_name, seed_content) init_structure = InitialStructureFile(project_name=project_name, struct_name=struct_name, seed_name=seed_name, content=struct_content) init_structure.seed_file = seed_file self.include_creator(init_structure) init_structure.save() return init_structure @staticmethod def retrieve_project(project_name: str, include_seed=False, include_param=False, additional_filters=None, include_initial_structure=False): """ Retrieve all results from a single projection Args: project_name: Name of the projection to query include_seed: Include the content of thhe seed in the result. include_param: Include the 'param' file content in the result. include_initial_structure: Include initial structures Returns: list: a QuerySet object containing the ResFile instances """ qset = ResFile.objects(project_name=project_name) if not include_seed: qset = qset.exclude('seed_file') if not include_initial_structure: qset = qset.exclude('init_structure_file') if not include_param: qset = qset.exclude('param_file') if additional_filters: qset = qset.filter(__raw__=additional_filters) return qset.all() @staticmethod def get_summary_df(projects=None, seeds=None): """ Summarise the database using pandas.DataFrame Generate a report for the status of the database. Not including the actual content of the seed. """ res = ResFile.objects() if projects: res = res.filter(project_name__in=projects) if seeds: res = res.filter(seed_name__in=seeds) fields = ['seed_name', 'project_name', 'created_on', 'struct_name'] res = res.only(*fields) # Here we use what is not part of the public API.... results = [rfile._data for rfile in res] if results: dataframe = pd.DataFrame(results)[fields] return dataframe return pd.DataFrame([], columns=fields) def throughput_summary(self, past_days=2, start_date=None, projects=None, seeds=None, aggregate='H', group_by='seed_name', plot=True): """ Summarise the througput of search Args: projects(list): List of projects to include seeds(list): :List of seeds to include Returns: A dataframe of search results per hour """ import matplotlib.pyplot as plt query = ResFile.objects() if projects: query = query.filter(project_name__in=projects) if seeds: query = query.filter(seed_name__in=seeds) now = datetime.utcnow() if start_date is None: dstart = now - timedelta(days=past_days) else: dstart = datetime.strptime(start_date, '%Y-%m-%d') dfinish = dstart + timedelta(days=past_days) query = query.filter(created_on__gte=dstart, created_on__lte=dfinish) included = ['id', 'created_on', 'seed_name', 'project_name'] query = query.only(*included) results = [resfile._data for resfile in query] if not results: self.logger.warning('No structure is found.') return None # Add in worker information dataframe = pd.DataFrame(results)[included] if group_by == 'worker_name': worker_res = query.aggregate(worker_aggregation()) worker_info = pd.DataFrame(worker_res) worker_info['worker_name'] = worker_info['worker_name'].apply( lambda x: x[0] if x else None) dataframe = dataframe.merge(worker_info, left_on='id', right_on='_id', how='left') dataframe.set_index('created_on', inplace=True) dataframe['uid'] = [ row.project_name + ':' + row.seed_name for _, row in dataframe.iterrows() ] #dataframe = dataframe.set_index('created_on', inplace=True) tdf = dataframe.groupby(group_by).resample( aggregate)[group_by].count().unstack(level=0) tdf.name = 'Completed' if plot: tdf.index = tdf.index.tz_localize('UTC').tz_convert( 'Europe/London') tdf.index = [x.strftime('%d/%m %H00') for x in tdf.index] tdf.plot.bar(stacked=True) plt.xlabel('Creation time') plt.ylabel('Count') plt.title('New structures') plt.tight_layout() plt.legend(loc=None) plt.show() else: # Save the data tdf.to_csv('throughput.csv') return tdf def throughput_summary_atomate(self, past_days=2, start_date=None, projects=None, seeds=None, aggregate='H', group_by='seed_name', plot=True): """ Summarise the througput of atomate calculations. Args: projects (list): List of projects to include seeds (list): :List of seeds to include Returns: A dataframe of search results per hour """ import matplotlib.pyplot as plt task_coll = self.database[self._ATOMATE_TASK_COLL] query = {} if projects: query['project_name'] = {'$in': projects} if seeds: query['seed_name'] = {'$in': seeds} if start_date is None: dstart = datetime.utcnow() - timedelta(days=past_days) else: dstart = datetime.strptime(start_date, '%Y-%m-%d') query['last_updated'] = { '$gte': dstart, '$lte': dstart + timedelta(days=past_days) } included = ['last_updated', 'seed_name', 'project_name', 'dir_name'] results = list(task_coll.find(query, included)) if not results: self.logger.warning('No structure is found.') return None # Add in worker information dataframe = pd.DataFrame(results)[included] dataframe.dropna(inplace=True) dataframe['uid'] = [ row.project_name + ':' + row.seed_name for _, row in dataframe.iterrows() ] machine = [] for value in dataframe['dir_name']: host = value.split(':')[0] if '.' in host: host = host.split('.', 1)[1] # Skip the first part of the hostname machine.append(host) dataframe['worker_name'] = machine dataframe.set_index('last_updated', inplace=True) dataframe = dataframe.groupby(group_by).resample( aggregate)[group_by].count().unstack(level=0) dataframe.name = 'Completed' dataframe.index = dataframe.index.tz_localize('UTC').tz_convert( 'Europe/London') if plot: dataframe.plot.bar(stacked=True) plt.xlabel('Creation time') plt.xlabel('Count') plt.title('Completed Calculations') plt.tight_layout() plt.show() else: # Save the data dataframe.to_csv('throughput.csv') return dataframe def show_struct_counts(self, project_regex=None, seed_regex=None, states=None, include_workflows=True, include_atomate=False, show_priority=False, include_res=True, verbose=False): """ Display count of the structures """ if include_workflows and not include_atomate: wf_mode = 'search' elif include_atomate: wf_mode = 'ato' else: wf_mode = 'none' counter = StructCounts(self.collection, self.database.fireworks, self.database.workflows, states=states, seed_regex=seed_regex, project_regex=project_regex, wf_mode=wf_mode, show_priority=show_priority, include_res=include_res, verbose=verbose) return counter.get_summary_df() @classmethod def from_db_file(cls, db_file: str): """ Create from a database file. File requires host, port, database, collection, username and password Args: db_file (str): path to the file containing the credentials Returns: MMDb object """ creds = loadfn(db_file) user = creds.get('user') password = creds.get('password') kwargs = creds.get('mongoclient_kwargs', {}) # any other MongoClient kwargs can go here ... if 'authsource' in creds: kwargs['authsource'] = creds['authsource'] else: kwargs['authsource'] = creds['database'] return cls(host=creds['host'], port=int(creds.get('port', 27017)), database=creds['database'], collection=creds['collection'], user=user, password=password, **kwargs) def upload_dot_castep(self, struct_name, seed_name, project_name): """Update the dot CASTEP files""" fname = struct_name + '.castep' query = { 'struct_name': struct_name, 'seed_name': seed_name, 'project_name': project_name } if self.gfs.exists(query): raise FileExistsError(f'File {fname} exists already') with open(fname, 'rb') as fhandle: content = zlib.compress(fhandle.read()) self.gfs.put(content, filename=fname, project_name=project_name, seed_name=seed_name, struct_name=struct_name) def retrieve_dot_castep(self, struct_name, seed_name, project_name): """Retrieve a dot CASTEP file""" fname = struct_name + '.castep' query = { 'struct_name': struct_name, 'seed_name': seed_name, 'project_name': project_name } gfile = self.gfs.find_one(query) if not gfile: raise FileNotFoundError(f'Cannot found {fname}!') content = gfile.read() with open(fname, 'wb') as fhandle: fhandle.write(zlib.decompress(content)) def delete_dot_castep(self, struct_name, seed_name, project_name): """Delete dot CASTEP files""" query = { 'struct_name': struct_name, 'seed_name': seed_name, 'project_name': project_name } to_delete = [] for gfile in self.gfs.find(query): to_delete.append(gfile._id) # pytest: disable=protected-access for _id in to_delete: self.gfs.delete(_id) def get_hash(string): """Returns the md5hash for a string""" return hashlib.md5(string.encode()).hexdigest() def get_pipeline(cls_string, project_regex=None, seed_regex=None, projects=None, seeds=None): """ Obtain the pipline for querying SearchDB """ pipeline = [{ '$match': { '_cls': cls_string } }, { '$group': { '_id': { 'seed': '$seed_name', 'project': '$project_name' }, 'count': { '$sum': 1 } } }] # Add regular expression matches if project_regex: pipeline[0]['$match']['project_name'] = {'$regex': project_regex} if seed_regex: pipeline[0]['$match']['seed_name'] = {'$regex': seed_regex} # Query directly by list of seeds/projects - this overrides the regex options if projects: pipeline[0]['$match']['project_name'] = {'$in': projects} if seeds: pipeline[0]['$match']['seed_name'] = {'$in': seeds} return pipeline def get_atomate_wflows(wf_coll, states, seed_regex=None, project_regex=None) -> pd.DataFrame: """Obtain workflow informaton for atomate jobs""" return get_workflows(wf_coll, ['atomate-relax'], states, seed_regex=seed_regex, project_regex=project_regex) def get_std_wflows(wf_coll, states, seed_regex=None, project_regex=None) -> pd.DataFrame: """Obtain workflow informaton for standard search jobs""" return get_workflows(wf_coll, ['relax', 'search'], states, seed_regex=seed_regex, project_regex=project_regex) def get_workflows(wf_coll, disp_types, states, seed_regex=None, project_regex=None) -> pd.DataFrame: """Obtain atomate workflows matching certain criteria""" query = {} if seed_regex: query['metadata.seed_name'] = {'$regex': seed_regex} if project_regex: query['metadata.project_name'] = {'$regex': project_regex} if states: query['state'] = {'$in': states} query['metadata.disp_type'] = {'$in': disp_types} projection = ['state', 'metadata'] cursor = wf_coll.find(query, projection) records = [] for entry in cursor: dtmp = { 'state': entry['state'], } dtmp.update(entry['metadata']) records.append(dtmp) return pd.DataFrame(records) def worker_aggregation(launch_col='launches'): """ Find the worker identify for each creator.fw_id """ pipline = [{'$project': {'_id': 1, 'creator.fw_id': 1}}] lookup_stage = { '$lookup': { 'from': launch_col, 'let': { 'creator_id': '$creator.fw_id' }, 'as': 'launch', 'pipeline': [{ '$match': { '$expr': { '$and': [{ '$eq': ['$fw_id', '$$creator_id'] }, { '$eq': ['$action.stored_data.relax_status', 'FINISHED'] }] } } }, { '$project': { 'fworker.name': 1 } }] } } pipline.append(lookup_stage) # Project worker name to the top level project_stage = {'$project': {'worker_name': '$launch.fworker.name'}} pipline.append(project_stage) return pipline class StructCounts: """Class for querying the database to obtain the structure counts""" def __init__(self, disp_coll: str, fw_coll: str, wf_coll: str, states=None, seed_regex=None, project_regex=None, wf_mode='search', show_priority=False, include_res=True, verbose=True): """Initialise a StructCounts object""" self.disp_coll = disp_coll self.fw_coll = fw_coll self.wf_coll = wf_coll self.states = states self.seed_regex = seed_regex self.project_regex = project_regex self.seeds = [] self.projects = [] self.verbose = verbose self.wf_mode = wf_mode self.show_priority = show_priority # Not used self.include_res = include_res # Query the structure counts self.logger = getLogger(__name__) if verbose: self.logger.setLevel(INFO) else: self.logger.setLevel(WARNING) def get_summary_df(self): """Main loginc for getting the summary of the data""" # First, obtain the workflows to be included if self.verbose: self.logger.info('Collecting workflow information') ttmp = time.time() # This would set some filters - based on the state and selected projects wdf = self.get_wf_collection() if len(wdf) == 0 and self.wf_mode != 'none': self.logger.info('No workflow matches the query.') if self.projects is not None or self.seeds is None: return wdf if self.verbose: ttmp = time.time() - ttmp self.logger.info( 'Workflow information collected - time elapsed: %.2f s', ttmp) sdf, idf = self.get_res_entries() # No relaxed structures - just return the workflow information if len(sdf) == 0 or not self.include_res: return wdf # Get summary of the relaxed / initial structures struct_count = sdf.groupby(['project', 'seed'])[['res']].sum() init_count = idf.groupby(['project', 'seed'])[['init_structs']].sum() try: final_df = struct_count.merge(init_count, left_index=True, right_index=True, how='outer') except ValueError: final_df = struct_count.copy() final_df['init_structures'] = 0.0 # Handle cases with missing columns if len(final_df.columns) == 2: final_df.columns = pd.MultiIndex.from_tuples([('Structure', 'RES'), ('Structure', 'Init') ]) elif 'res' in final_df.columns: final_df.columns = pd.MultiIndex.from_tuples([ ('Structure', 'RES'), ]) elif 'init_structs' in final_df.columns: final_df.columns = pd.MultiIndex.from_tuples([ ('Structure', 'Init'), ]) # Blend in workflow information if len(wdf) > 0: final_df = final_df.merge(wdf, left_index=True, right_index=True, how='right') # Fill NaN as 0.0 final_df = final_df.fillna(0.0) return final_df def get_wf_collection(self): """Get atomate workflow statistics""" if self.wf_mode == 'search': wf_records = get_std_wflows(self.wf_coll, self.states, self.seed_regex, self.project_regex) elif self.wf_mode == 'ato': wf_records = get_atomate_wflows(self.wf_coll, self.states, self.seed_regex, self.project_regex) elif self.wf_mode == 'none': wf_records = [] else: raise ValueError(f'Unknown wf_mode: {self.wf_mode}') if len(wf_records) != 0: # Group data by project_name, 'seed_name' and 'state' then unstack wf_df = wf_records.groupby(['project_name', 'seed_name', 'state' ]).count().unstack()[['disp_type' ]].fillna(0.0) wf_df[('disp_type', 'ALL')] = wf_df.sum(axis=1) wf_df = wf_df.rename( columns={'disp_type': f'WF count - {self.wf_mode}'}) wf_df.columns.names = [None, None] wf_df.index.names = ['project', 'seed'] # If no contrains on the seeds / projects is imposed, use the workflow results to # limit them if self.seed_regex is None: self.projects = wf_records.project_name.unique().tolist() if self.project_regex is None: self.seeds = wf_records.seed_name.unique().tolist() else: # NO entry - return an empty dataframe wf_df = pd.DataFrame() return wf_df def get_res_entries(self): """Obtain the entry of res files""" ttmp = time.time() # Check if any filters have been applied - warning if thait is not the case has_no_filter = all( tmp is None for tmp in [self.project_regex, self.projects, self.seeds, self.seed_regex]) if has_no_filter: self.logger.info( 'WARNING: No effective filters applied - projecting the entire database!!' ) # Find the SHELX entries for the matching entries res = self.disp_coll.aggregate( get_pipeline('DispEntry.ResFile', project_regex=self.project_regex, projects=self.projects, seeds=self.seeds, seed_regex=self.seed_regex)) data = [(item['_id']['seed'], item['_id']['project'], item['count']) for item in res] sdf = pd.DataFrame(data, columns=['seed', 'project', 'res']) dtime = time.time() - ttmp self.logger.info( f'Obtained relaxed structure counts - time elapsed {dtime:.2f}') # Include initial structures ttmp = time.time() res = self.disp_coll.aggregate( get_pipeline('DispEntry.InitialStructureFile', project_regex=self.project_regex, seed_regex=self.seed_regex, projects=self.projects, seeds=self.seeds)) data = [(item['_id']['seed'], item['_id']['project'], item['count']) for item in res] idf = pd.DataFrame(data, columns=['seed', 'project', 'init_structs']) dtime = time.time() - ttmp self.logger.info( f'Obtained initial structure counts - time elapsed {dtime:.2f} s') return sdf, idf
<filename>Federated_Learning/paper_model/FedAvg/tensorflow/Models.py<gh_stars>0 import os import tensorflow as tf import numpy as np from dataSets import DataSet class Models(object): def __init__(self, modelName, inputs): self.inputs = inputs self.model_name = modelName if self.model_name == 'mnist_2nn': self.mnist_2nn_construct(inputs) elif self.model_name == 'mnist_cnn': self.mnist_cnn_construct(inputs) elif self.model_name == 'cifar10_cnn': self.cifar10_cnn_construct(inputs) def mnist_2nn_construct(self, inputs): self.fc1 = self.full_connect(inputs, 784, 200, 'h1') self.fc2 = self.full_connect(self.fc1, 200, 200, 'h2') self.outputs = self.full_connect(self.fc2, 200, 10, 'last_layer', relu=False) def mnist_cnn_construct(self, inputs): self.trans_inputs = tf.reshape(inputs, [-1, 28, 28, 1]) self.cov1 = self.convolve(self.trans_inputs, 1, 5, 1, 1, 32, 'cov1', True, 'SAME') self.pool1 = self.max_pool_nxn(self.cov1, 2, 2, 'pool1') self.cov2 = self.convolve(self.pool1, 32, 5, 1, 1, 64, 'cov2', True, 'SAME') self.pool2 = self.max_pool_nxn(self.cov2, 2, 2, 'pool2') with tf.variable_scope('transform') as scope: self.trans_pool2 = tf.reshape(self.pool2, [-1, 7 * 7 * 64]) self.fc1 = self.full_connect(self.trans_pool2, 7 * 7 * 64, 512, 'fc1') self.outputs = self.full_connect(self.fc1, 512, 10, 'last_layer', relu=False) def cifar10_cnn_construct(self, inputs): self.cov1 = self.convolve(inputs, 3, 5, 1, 1, 64, 'cov1', True, 'SAME') self.pool1 = self.max_pool_nxn(self.cov1, 3, 2, 'pool1') self.cov2 = self.convolve(self.pool1, 64, 5, 1, 1, 64, 'cov2', True, 'SAME') self.pool2 = self.max_pool_nxn(self.cov2, 3, 2, 'pool2') with tf.variable_scope('transform') as scope: self.trans_pool2 = tf.reshape(self.pool2, [-1, 6 * 6 * 64]) self.fc1 = self.full_connect(self.trans_pool2, 6 * 6 * 64, 384, 'fc1') self.fc2 = self.full_connect(self.fc1, 384, 192, 'fc2') self.outputs = self.full_connect(self.fc2, 192, 10, 'last_layer', relu=False) def full_connect(self, inputs, num_in, num_out, name, relu=True): with tf.variable_scope(name) as scope: weights = tf.get_variable('weights', shape=[num_in, num_out], dtype=tf.float32, trainable=True) biases = tf.get_variable('biases', shape=[num_out], dtype=tf.float32, trainable=True) ws_plus_bs = tf.nn.xw_plus_b(inputs, weights, biases) if relu == True: outputs = tf.nn.relu(ws_plus_bs) return outputs else: return ws_plus_bs def convolve(self, inputs, inputs_channels, kernel_size, stride_y, stride_x, num_features, name, relu=True, padding='SAME'): with tf.variable_scope(name) as scope: weights = tf.get_variable('weights', shape=[kernel_size, kernel_size, inputs_channels, num_features], dtype=tf.float32, trainable=True) biases = tf.get_variable('baises', shape=[num_features], dtype=tf.float32, trainable=True) conv = tf.nn.conv2d(inputs, weights, [1, stride_y, stride_x, 1], padding=padding) cov_puls_bs = tf.nn.bias_add(conv, biases) if relu == True: outputs = tf.nn.relu(cov_puls_bs) return outputs else: return cov_puls_bs def max_pool_nxn(self, inputs, ksize, ssize, name): with tf.variable_scope(name) as scope: return tf.nn.max_pool(inputs, ksize=[1, ksize, ksize, 1], strides=[1, ssize, ssize, 1], padding='SAME') if __name__=='__main__': # GPU preparation os.environ['CUDA_VISIBLE_DEVICES'] = '0,1,2,3,4,5,6,7' mnist = DataSet('mnist', is_IID=1) with tf.variable_scope('inputs') as scope: input_images = tf.placeholder(shape=[None, 784], dtype=tf.float32, name='input_images') true_label = tf.placeholder(shape=[None, 10], dtype=tf.float32, name='true_label') mnist_2nn = Models('mnist_2nn', input_images) predict_label = tf.nn.softmax(mnist_2nn.outputs) with tf.variable_scope('loss') as scope: Cross_entropy = -tf.reduce_mean(true_label*tf.log(predict_label), axis=1) with tf.variable_scope('train') as scope: optimizer = tf.train.GradientDescentOptimizer(0.01) train = optimizer.minimize(Cross_entropy) with tf.variable_scope('validation') as scope: correct_prediction = tf.equal(tf.argmax(predict_label, axis=1), tf.argmax(true_label, axis=1)) accuracy = tf.reduce_mean(tf.cast(correct_prediction, 'float')) # ---------------------------------------- train --------------------------------------------- # with tf.Session(config=tf.ConfigProto( log_device_placement=False, \ allow_soft_placement=True, \ gpu_options=tf.GPUOptions(allow_growth=True))) as sess: sess.run(tf.initialize_all_variables()) for i in range(1000): batch_images, batch_labels = mnist.next_batch(100) sess.run(train, feed_dict={input_images: batch_images, true_label: batch_labels}) if i%20 == 0: batch_images = mnist.test_data batch_labels = mnist.test_label print(sess.run(accuracy, feed_dict={input_images: batch_images, true_label: batch_labels}))
# Copyright 2020-present <NAME> # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. #: This should be an up to date list of strings which discord renders as emojis as of 2021-03-22 #: Each one adds an html element to the message toward the 200 element rendering issue. DISCORD_EMOJIS = [ "\ud83d\ude00", "\ud83d\ude03", "\ud83d\ude04", "\ud83d\ude01", "\ud83d\ude06", "\ud83d\ude06", "\ud83d\ude05", "\ud83d\ude02", "\ud83e\udd23", "\ud83e\udd23", "\N{WHITE SMILING FACE}\N{VARIATION SELECTOR-16}", "\ud83d\ude0a", "\ud83d\ude07", "\ud83d\ude42", "\ud83d\ude42", "\ud83d\ude43", "\ud83d\ude43", "\ud83d\ude09", "\ud83d\ude0c", "\ud83d\ude0d", "\ud83e\udd70", "\ud83d\ude18", "\ud83d\ude17", "\ud83d\ude19", "\ud83d\ude1a", "\ud83d\ude0b", "\ud83d\ude1b", "\ud83d\ude1d", "\ud83d\ude1c", "\ud83e\udd2a", "\ud83e\udd28", "\ud83e\uddd0", "\ud83e\udd13", "\ud83e\udd13", "\ud83d\ude0e", "\ud83e\udd29", "\ud83e\udd73", "\ud83d\ude0f", "\ud83d\ude12", "\ud83d\ude1e", "\ud83d\ude14", "\ud83d\ude1f", "\ud83d\ude15", "\ud83d\ude41", "\ud83d\ude41", "\N{WHITE FROWNING FACE}\N{VARIATION SELECTOR-16}", "\N{WHITE FROWNING FACE}\N{VARIATION SELECTOR-16}", "\ud83d\ude23", "\ud83d\ude16", "\ud83d\ude2b", "\ud83d\ude29", "\ud83e\udd7a", "\ud83d\ude22", "\ud83d\ude2d", "\ud83d\ude24", "\ud83d\ude20", "\ud83d\ude21", "\ud83e\udd2c", "\ud83e\udd2f", "\ud83d\ude33", "\ud83e\udd75", "\ud83e\udd76", "\ud83d\ude31", "\ud83d\ude28", "\ud83d\ude30", "\ud83d\ude25", "\ud83d\ude13", "\ud83e\udd17", "\ud83e\udd17", "\ud83e\udd14", "\ud83e\udd14", "\ud83e\udd2d", "\ud83e\udd71", "\ud83e\udd2b", "\ud83e\udd25", "\ud83e\udd25", "\ud83d\ude36", "\ud83d\ude10", "\ud83d\ude11", "\ud83d\ude2c", "\ud83d\ude44", "\ud83d\ude44", "\ud83d\ude2f", "\ud83d\ude26", "\ud83d\ude27", "\ud83d\ude2e", "\ud83d\ude32", "\ud83d\ude34", "\ud83e\udd24", "\ud83e\udd24", "\ud83d\ude2a", "\ud83d\ude35", "\ud83e\udd10", "\ud83e\udd10", "\ud83e\udd74", "\ud83e\udd22", "\ud83e\udd22", "\ud83e\udd2e", "\ud83e\udd27", "\ud83e\udd27", "\ud83d\ude37", "\ud83e\udd12", "\ud83e\udd12", "\ud83e\udd15", "\ud83e\udd15", "\ud83e\udd11", "\ud83e\udd11", "\ud83e\udd20", "\ud83e\udd20", "\ud83d\ude08", "\ud83d\udc7f", "\ud83d\udc79", "\ud83d\udc7a", "\ud83e\udd21", "\ud83e\udd21", "\ud83d\udca9", "\ud83d\udca9", "\ud83d\udca9", "\ud83d\udca9", "\ud83d\udc7b", "\ud83d\udc80", "\ud83d\udc80", "\N{SKULL AND CROSSBONES}\N{VARIATION SELECTOR-16}", "\N{SKULL AND CROSSBONES}\N{VARIATION SELECTOR-16}", "\ud83d\udc7d", "\ud83d\udc7e", "\ud83e\udd16", "\ud83e\udd16", "\ud83c\udf83", "\ud83d\ude3a", "\ud83d\ude38", "\ud83d\ude39", "\ud83d\ude3b", "\ud83d\ude3c", "\ud83d\ude3d", "\ud83d\ude40", "\ud83d\ude3f", "\ud83d\ude3e", "\ud83e\udd32", "\ud83d\udc50", "\ud83d\ude4c", "\ud83d\udc4f", "\ud83e\udd1d", "\ud83e\udd1d", "\ud83d\udc4d", "\ud83d\udc4d", "\ud83d\udc4d", "\ud83d\udc4e", "\ud83d\udc4e", "\ud83d\udc4e", "\ud83d\udc4a", "\N{RAISED FIST}", "\ud83e\udd1b", "\ud83e\udd1b", "\ud83e\udd1c", "\ud83e\udd1c", "\ud83e\udd1e", "\ud83e\udd1e", "\N{VICTORY HAND}\N{VARIATION SELECTOR-16}", "\ud83e\udd1f", "\ud83e\udd18", "\ud83e\udd18", "\ud83d\udc4c", "\ud83e\udd0f", "\ud83d\udc48", "\ud83d\udc49", "\ud83d\udc46", "\ud83d\udc47", "\N{WHITE UP POINTING INDEX}\N{VARIATION SELECTOR-16}", "\N{RAISED HAND}", "\ud83e\udd1a", "\ud83e\udd1a", "\ud83d\udd90\N{VARIATION SELECTOR-16}", "\ud83d\udd90\N{VARIATION SELECTOR-16}", "\ud83d\udd96", "\ud83d\udd96", "\ud83d\udc4b", "\ud83e\udd19", "\ud83e\udd19", "\ud83d\udcaa", "\ud83e\uddbe", "\ud83d\udd95", "\ud83d\udd95", "\N{WRITING HAND}\N{VARIATION SELECTOR-16}", "\ud83d\ude4f", "\ud83e\uddb6", "\ud83e\uddb5", "\ud83e\uddbf", "\ud83d\udc84", "\ud83d\udc8b", "\ud83d\udc44", "\ud83e\uddb7", "\ud83e\uddb4", "\ud83d\udc45", "\ud83d\udc42", "\ud83e\uddbb", "\ud83d\udc43", "\ud83d\udc63", "\ud83d\udc41\N{VARIATION SELECTOR-16}", "\ud83d\udc40", "\ud83e\udde0", "\ud83d\udde3\N{VARIATION SELECTOR-16}", "\ud83d\udde3\N{VARIATION SELECTOR-16}", "\ud83d\udc64", "\ud83d\udc65", "\ud83d\udc76", "\ud83d\udc67", "\ud83e\uddd2", "\ud83d\udc66", "\ud83d\udc69", "\ud83e\uddd1", "\ud83d\udc68", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddb1", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddb1", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddb0", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddb0", "\ud83d\udc71\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc71", "\ud83d\udc71", "\ud83d\udc71\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddb3", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddb3", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddb2", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddb2", "\ud83e\uddd4", "\ud83d\udc75", "\ud83d\udc75", "\ud83e\uddd3", "\ud83d\udc74", "\ud83d\udc72", "\ud83d\udc72", "\ud83d\udc73", "\ud83d\udc73", "\ud83d\udc73\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc73\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd5", "\ud83d\udc6e", "\ud83d\udc6e", "\ud83d\udc6e\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc6e\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc77", "\ud83d\udc77\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc77\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc82", "\ud83d\udc82", "\ud83d\udc82\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc82\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udd75\N{VARIATION SELECTOR-16}", "\ud83d\udd75\N{VARIATION SELECTOR-16}", "\ud83d\udd75\N{VARIATION SELECTOR-16}", "\ud83d\udd75\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udd75\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{STAFF OF AESCULAPIUS}\N{VARIATION SELECTOR-16}", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{STAFF OF AESCULAPIUS}\N{VARIATION SELECTOR-16}", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udf3e", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udf3e", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udf73", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udf73", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udf93", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udf93", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udfa4", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udfa4", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udfeb", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udfeb", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udfed", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udfed", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udcbb", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udcbb", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udcbc", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udcbc", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udd27", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udd27", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udd2c", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udd2c", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83c\udfa8", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83c\udfa8", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\ude92", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\ude92", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{AIRPLANE}\N{VARIATION SELECTOR-16}", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{AIRPLANE}\N{VARIATION SELECTOR-16}", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\ude80", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\ude80", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{SCALES}\N{VARIATION SELECTOR-16}", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{SCALES}\N{VARIATION SELECTOR-16}", "\ud83d\udc70", "\ud83e\udd35", "\ud83d\udc78", "\ud83e\udd34", "\ud83e\uddb8", "\ud83e\uddb8\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddb8\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddb9", "\ud83e\uddb9\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddb9\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd36", "\ud83e\udd36", "\ud83c\udf85", "\ud83e\uddd9", "\ud83e\uddd9\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd9\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddd", "\ud83e\udddd\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddd\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddb", "\ud83e\udddb\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddb\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddf", "\ud83e\udddf\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddf\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddde", "\ud83e\uddde\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddde\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddc", "\ud83e\udddc\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udddc\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddda", "\ud83e\uddda\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddda\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc7c", "\ud83e\udd30", "\ud83e\udd30", "\ud83e\udd31", "\ud83d\ude47", "\ud83d\ude47", "\ud83d\ude47\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude47\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc81", "\ud83d\udc81", "\ud83d\udc81\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc81\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude45", "\ud83d\ude45", "\ud83d\ude45\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude45\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude46", "\ud83d\ude46", "\ud83d\ude46\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude46\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude4b", "\ud83d\ude4b", "\ud83d\ude4b\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude4b\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddcf", "\ud83e\uddcf\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddcf\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd26", "\ud83e\udd26", "\ud83e\udd26", "\ud83e\udd26\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd26\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd37", "\ud83e\udd37", "\ud83e\udd37\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd37\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude4e", "\ud83d\ude4e", "\ud83d\ude4e\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude4e\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude4d", "\ud83d\ude4d\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\ude4d\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc87", "\ud83d\udc87", "\ud83d\udc87\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc87\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc86", "\ud83d\udc86", "\ud83d\udc86\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc86\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd6", "\ud83e\uddd6\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd6\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc85", "\ud83e\udd33", "\ud83d\udc83", "\ud83d\udd7a", "\ud83d\udd7a", "\ud83d\udc6f", "\ud83d\udc6f", "\ud83d\udc6f\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc6f\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udd74\N{VARIATION SELECTOR-16}", "\ud83d\udd74\N{VARIATION SELECTOR-16}", "\ud83d\udeb6", "\ud83d\udeb6", "\ud83d\udeb6\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udeb6\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfc3", "\ud83c\udfc3", "\ud83c\udfc3\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfc3\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddcd", "\ud83e\uddcd\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddcd\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddce", "\ud83e\uddce\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddce\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddaf", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddaf", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddbc", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddbc", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83e\uddbd", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83e\uddbd", "\ud83e\uddd1\N{ZERO WIDTH JOINER}\ud83e\udd1d\N{ZERO WIDTH JOINER}\ud83e\uddd1", "\ud83d\udc6b", "\ud83d\udc6d", "\ud83d\udc6c", "\ud83d\udc91", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc68", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc69", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc69", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc68", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc68", "\ud83d\udc8f", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc8b\N{ZERO WIDTH JOINER}\ud83d\udc68", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc8b\N{ZERO WIDTH JOINER}\ud83d\udc69", "\ud83d\udc69\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc8b\N{ZERO WIDTH JOINER}\ud83d\udc69", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc8b\N{ZERO WIDTH JOINER}\ud83d\udc68", "\ud83d\udc68\N{ZERO WIDTH JOINER}\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83d\udc8b\N{ZERO WIDTH JOINER}\ud83d\udc68", "\ud83d\udc6a", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc66\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc66\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc66\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc66\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc69\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc66\N{ZERO WIDTH JOINER}\ud83d\udc66", "\ud83d\udc68\N{ZERO WIDTH JOINER}\ud83d\udc67\N{ZERO WIDTH JOINER}\ud83d\udc67", "\ud83e\uddf6", "\ud83e\uddf5", "\ud83e\udde5", "\ud83e\udd7c", "\ud83e\uddba", "\ud83d\udc5a", "\ud83d\udc55", "\ud83d\udc56", "\ud83e\ude73", "\ud83d\udc54", "\ud83d\udc57", "\ud83d\udc59", "\ud83e\ude71", "\ud83d\udc58", "\ud83e\udd7b", "\ud83e\udd7f", "\ud83d\udc60", "\ud83d\udc61", "\ud83d\udc62", "\ud83e\ude70", "\ud83d\udc5e", "\ud83d\udc5f", "\ud83e\udd7e", "\ud83e\ude72", "\ud83e\udde6", "\ud83e\udde4", "\ud83e\udde3", "\ud83c\udfa9", "\ud83e\udde2", "\ud83d\udc52", "\ud83c\udf93", "\N{HELMET WITH WHITE CROSS}\N{VARIATION SELECTOR-16}", "\N{HELMET WITH WHITE CROSS}\N{VARIATION SELECTOR-16}", "\ud83d\udc51", "\ud83d\udc8d", "\ud83d\udc5d", "\ud83d\udc5b", "\ud83d\udc5c", "\ud83d\udcbc", "\ud83c\udf92", "\ud83e\uddf3", "\ud83d\udc53", "\ud83d\udd76\N{VARIATION SELECTOR-16}", "\ud83e\udd7d", "\ud83e\udd3f", "\ud83c\udf02", "\ud83d\udc36", "\ud83d\udc31", "\ud83d\udc2d", "\ud83d\udc39", "\ud83d\udc30", "\ud83e\udd8a", "\ud83e\udd8a", "\ud83d\udc3b", "\ud83d\udc3c", "\ud83d\udc28", "\ud83d\udc2f", "\ud83e\udd81", "\ud83e\udd81", "\ud83d\udc2e", "\ud83d\udc37", "\ud83d\udc3d", "\ud83d\udc38", "\ud83d\udc35", "\ud83d\ude48", "\ud83d\ude49", "\ud83d\ude4a", "\ud83d\udc12", "\ud83d\udc14", "\ud83d\udc27", "\ud83d\udc26", "\ud83d\udc24", "\ud83d\udc23", "\ud83d\udc25", "\ud83e\udd86", "\ud83e\udd85", "\ud83e\udd89", "\ud83e\udd87", "\ud83d\udc3a", "\ud83d\udc17", "\ud83d\udc34", "\ud83e\udd84", "\ud83e\udd84", "\ud83d\udc1d", "\ud83d\udc1b", "\ud83e\udd8b", "\ud83d\udc0c", "\ud83d\udc1a", "\ud83d\udc1e", "\ud83d\udc1c", "\ud83e\udd9f", "\ud83e\udd97", "\ud83d\udd77\N{VARIATION SELECTOR-16}", "\ud83d\udd78\N{VARIATION SELECTOR-16}", "\ud83e\udd82", "\ud83d\udc22", "\ud83d\udc0d", "\ud83e\udd8e", "\ud83e\udd96", "\ud83e\udd95", "\ud83d\udc19", "\ud83e\udd91", "\ud83e\udd90", "\ud83e\udd9e", "\ud83e\uddaa", "\ud83e\udd80", "\ud83d\udc21", "\ud83d\udc20", "\ud83d\udc1f", "\ud83d\udc2c", "\ud83d\udc33", "\ud83d\udc0b", "\ud83e\udd88", "\ud83d\udc0a", "\ud83d\udc05", "\ud83d\udc06", "\ud83e\udd93", "\ud83e\udd8d", "\ud83e\udda7", "\ud83d\udc18", "\ud83e\udd9b", "\ud83e\udd8f", "\ud83e\udd8f", "\ud83d\udc2a", "\ud83d\udc2b", "\ud83e\udd92", "\ud83e\udd98", "\ud83d\udc03", "\ud83d\udc02", "\ud83d\udc04", "\ud83d\udc0e", "\ud83d\udc16", "\ud83d\udc0f", "\ud83e\udd99", "\ud83d\udc11", "\ud83d\udc10", "\ud83e\udd8c", "\ud83d\udc15", "\ud83e\uddae", "\ud83d\udc15\N{ZERO WIDTH JOINER}\ud83e\uddba", "\ud83d\udc29", "\ud83d\udc08", "\ud83d\udc13", "\ud83e\udd83", "\ud83e\udd9a", "\ud83e\udd9c", "\ud83e\udda2", "\ud83e\udda9", "\ud83d\udd4a\N{VARIATION SELECTOR-16}", "\ud83d\udd4a\N{VARIATION SELECTOR-16}", "\ud83d\udc07", "\ud83e\udda5", "\ud83e\udda6", "\ud83e\udda8", "\ud83e\udd9d", "\ud83e\udda1", "\ud83d\udc01", "\ud83d\udc00", "\ud83d\udc3f\N{VARIATION SELECTOR-16}", "\ud83e\udd94", "\ud83d\udc3e", "\ud83d\udc3e", "\ud83d\udc09", "\ud83d\udc32", "\ud83c\udf35", "\ud83c\udf84", "\ud83c\udf32", "\ud83c\udf33", "\ud83c\udf34", "\ud83c\udf31", "\ud83c\udf3f", "\N{SHAMROCK}\N{VARIATION SELECTOR-16}", "\ud83c\udf40", "\ud83c\udf8d", "\ud83c\udf8b", "\ud83c\udf43", "\ud83c\udf42", "\ud83c\udf41", "\ud83c\udf44", "\ud83c\udf3e", "\ud83d\udc90", "\ud83c\udf37", "\ud83c\udf39", "\ud83e\udd40", "\ud83e\udd40", "\ud83c\udf3a", "\ud83c\udf38", "\ud83c\udf3c", "\ud83c\udf3b", "\ud83c\udf1e", "\ud83c\udf1d", "\ud83c\udf1b", "\ud83c\udf1c", "\ud83c\udf1a", "\ud83c\udf15", "\ud83c\udf16", "\ud83c\udf17", "\ud83c\udf18", "\ud83c\udf11", "\ud83c\udf12", "\ud83c\udf13", "\ud83c\udf14", "\ud83c\udf19", "\ud83c\udf0e", "\ud83c\udf0d", "\ud83c\udf0f", "\ud83e\ude90", "\ud83d\udcab", "\N{WHITE MEDIUM STAR}", "\ud83c\udf1f", "\N{SPARKLES}", "\N{HIGH VOLTAGE SIGN}", "\N{COMET}\N{VARIATION SELECTOR-16}", "\ud83d\udca5", "\ud83d\udd25", "\ud83d\udd25", "\ud83c\udf2a\N{VARIATION SELECTOR-16}", "\ud83c\udf2a\N{VARIATION SELECTOR-16}", "\ud83c\udf08", "\N{BLACK SUN WITH RAYS}\N{VARIATION SELECTOR-16}", "\ud83c\udf24\N{VARIATION SELECTOR-16}", "\ud83c\udf24\N{VARIATION SELECTOR-16}", "\N{SUN BEHIND CLOUD}", "\ud83c\udf25\N{VARIATION SELECTOR-16}", "\ud83c\udf25\N{VARIATION SELECTOR-16}", "\N{CLOUD}\N{VARIATION SELECTOR-16}", "\ud83c\udf26\N{VARIATION SELECTOR-16}", "\ud83c\udf26\N{VARIATION SELECTOR-16}", "\ud83c\udf27\N{VARIATION SELECTOR-16}", "\ud83c\udf27\N{VARIATION SELECTOR-16}", "\N{THUNDER CLOUD AND RAIN}\N{VARIATION SELECTOR-16}", "\N{THUNDER CLOUD AND RAIN}\N{VARIATION SELECTOR-16}", "\ud83c\udf29\N{VARIATION SELECTOR-16}", "\ud83c\udf29\N{VARIATION SELECTOR-16}", "\ud83c\udf28\N{VARIATION SELECTOR-16}", "\ud83c\udf28\N{VARIATION SELECTOR-16}", "\N{SNOWFLAKE}\N{VARIATION SELECTOR-16}", "\N{SNOWMAN}\N{VARIATION SELECTOR-16}", "\N{SNOWMAN WITHOUT SNOW}", "\ud83c\udf2c\N{VARIATION SELECTOR-16}", "\ud83d\udca8", "\ud83d\udca7", "\ud83d\udca6", "\N{UMBRELLA WITH RAIN DROPS}", "\N{UMBRELLA}\N{VARIATION SELECTOR-16}", "\ud83c\udf0a", "\ud83c\udf2b\N{VARIATION SELECTOR-16}", "\ud83c\udf4f", "\ud83c\udf4e", "\ud83c\udf50", "\ud83c\udf4a", "\ud83c\udf4b", "\ud83c\udf4c", "\ud83c\udf49", "\ud83c\udf47", "\ud83c\udf53", "\ud83c\udf48", "\ud83c\udf52", "\ud83c\udf51", "\ud83e\udd6d", "\ud83c\udf4d", "\ud83e\udd65", "\ud83e\udd5d", "\ud83e\udd5d", "\ud83c\udf45", "\ud83c\udf46", "\ud83e\udd51", "\ud83e\udd66", "\ud83e\udd6c", "\ud83e\udd52", "\ud83c\udf36\N{VARIATION SELECTOR-16}", "\ud83c\udf3d", "\ud83e\udd55", "\ud83e\uddc5", "\ud83e\uddc4", "\ud83e\udd54", "\ud83c\udf60", "\ud83e\udd50", "\ud83e\udd6f", "\ud83c\udf5e", "\ud83e\udd56", "\ud83e\udd56", "\ud83e\udd68", "\ud83e\uddc0", "\ud83e\uddc0", "\ud83e\udd5a", "\ud83c\udf73", "\ud83e\udd5e", "\ud83e\uddc7", "\ud83e\udd53", "\ud83e\udd69", "\ud83c\udf57", "\ud83c\udf56", "\ud83c\udf2d", "\ud83c\udf2d", "\ud83c\udf54", "\ud83c\udf5f", "\ud83c\udf55", "\ud83e\udd6a", "\ud83e\uddc6", "\ud83e\udd59", "\ud83e\udd59", "\ud83c\udf2e", "\ud83c\udf2f", "\ud83e\udd57", "\ud83e\udd57", "\ud83e\udd58", "\ud83e\udd58", "\ud83e\udd6b", "\ud83c\udf5d", "\ud83c\udf5c", "\ud83c\udf72", "\ud83c\udf5b", "\ud83c\udf63", "\ud83c\udf71", "\ud83e\udd5f", "\ud83c\udf64", "\ud83c\udf59", "\ud83c\udf5a", "\ud83c\udf58", "\ud83c\udf65", "\ud83e\udd60", "\ud83e\udd6e", "\ud83c\udf62", "\ud83c\udf61", "\ud83c\udf67", "\ud83c\udf68", "\ud83c\udf66", "\ud83e\udd67", "\ud83e\uddc1", "\ud83c\udf70", "\ud83c\udf82", "\ud83c\udf6e", "\ud83c\udf6e", "\ud83c\udf6e", "\ud83c\udf6d", "\ud83c\udf6c", "\ud83c\udf6b", "\ud83c\udf7f", "\ud83c\udf69", "\ud83c\udf6a", "\ud83c\udf30", "\ud83e\udd5c", "\ud83e\udd5c", "\ud83c\udf6f", "\ud83e\uddc8", "\ud83e\udd5b", "\ud83e\udd5b", "\ud83c\udf7c", "\N{HOT BEVERAGE}", "\ud83c\udf75", "\ud83e\uddc9", "\ud83e\udd64", "\ud83e\uddc3", "\ud83e\uddca", "\ud83c\udf76", "\ud83c\udf7a", "\ud83c\udf7b", "\ud83e\udd42", "\ud83e\udd42", "\ud83c\udf77", "\ud83e\udd43", "\ud83e\udd43", "\ud83c\udf78", "\ud83c\udf79", "\ud83c\udf7e", "\ud83c\udf7e", "\ud83e\udd44", "\ud83c\udf74", "\ud83c\udf7d\N{VARIATION SELECTOR-16}", "\ud83c\udf7d\N{VARIATION SELECTOR-16}", "\ud83e\udd63", "\ud83e\udd61", "\ud83e\udd62", "\ud83e\uddc2", "\N{SOCCER BALL}", "\ud83c\udfc0", "\ud83c\udfc8", "\N{BASEBALL}", "\ud83e\udd4e", "\ud83c\udfbe", "\ud83c\udfd0", "\ud83c\udfc9", "\ud83e\udd4f", "\ud83c\udfb1", "\ud83c\udfd3", "\ud83c\udfd3", "\ud83c\udff8", "\ud83c\udfd2", "\ud83c\udfd1", "\ud83e\udd4d", "\ud83c\udfcf", "\ud83c\udfcf", "\ud83e\udd45", "\ud83e\udd45", "\N{FLAG IN HOLE}", "\ud83c\udff9", "\ud83c\udff9", "\ud83c\udfa3", "\ud83e\udd4a", "\ud83e\udd4a", "\ud83e\udd4b", "\ud83e\udd4b", "\ud83c\udfbd", "\ud83d\udef9", "\ud83d\udef7", "\ud83e\ude82", "\N{ICE SKATE}\N{VARIATION SELECTOR-16}", "\ud83e\udd4c", "\ud83c\udfbf", "\N{SKIER}\N{VARIATION SELECTOR-16}", "\ud83c\udfc2", "\ud83c\udfcb\N{VARIATION SELECTOR-16}", "\ud83c\udfcb\N{VARIATION SELECTOR-16}", "\ud83c\udfcb\N{VARIATION SELECTOR-16}", "\ud83c\udfcb\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfcb\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd3c", "\ud83e\udd3c", "\ud83e\udd3c", "\ud83e\udd3c\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd3c\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd38", "\ud83e\udd38", "\ud83e\udd38\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd38\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\N{PERSON WITH BALL}\N{VARIATION SELECTOR-16}", "\N{PERSON WITH BALL}\N{VARIATION SELECTOR-16}", "\N{PERSON WITH BALL}\N{VARIATION SELECTOR-16}", "\N{PERSON WITH BALL}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\N{PERSON WITH BALL}\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd3a", "\ud83e\udd3a", "\ud83e\udd3a", "\ud83e\udd3e", "\ud83e\udd3e", "\ud83e\udd3e\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd3e\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfcc\N{VARIATION SELECTOR-16}", "\ud83c\udfcc\N{VARIATION SELECTOR-16}", "\ud83c\udfcc\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfcc\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfc7", "\ud83e\uddd8", "\ud83e\uddd8\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd8\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfc4", "\ud83c\udfc4", "\ud83c\udfc4\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfc4\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfca", "\ud83c\udfca", "\ud83c\udfca\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfca\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd3d", "\ud83e\udd3d", "\ud83e\udd3d\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd3d\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udea3", "\ud83d\udea3", "\ud83d\udea3\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udea3\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd7", "\ud83e\uddd7\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\uddd7\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udeb5", "\ud83d\udeb5", "\ud83d\udeb5\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udeb5\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udeb4", "\ud83d\udeb4", "\ud83d\udeb4\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udeb4\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfc6", "\ud83e\udd47", "\ud83e\udd47", "\ud83e\udd48", "\ud83e\udd48", "\ud83e\udd49", "\ud83e\udd49", "\ud83c\udfc5", "\ud83c\udfc5", "\ud83c\udf96\N{VARIATION SELECTOR-16}", "\ud83c\udff5\N{VARIATION SELECTOR-16}", "\ud83c\udf97\N{VARIATION SELECTOR-16}", "\ud83c\udfab", "\ud83c\udf9f\N{VARIATION SELECTOR-16}", "\ud83c\udf9f\N{VARIATION SELECTOR-16}", "\ud83c\udfaa", "\ud83e\udd39", "\ud83e\udd39", "\ud83e\udd39", "\ud83e\udd39\N{ZERO WIDTH JOINER}\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83e\udd39\N{ZERO WIDTH JOINER}\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\ud83c\udfad", "\ud83c\udfa8", "\ud83c\udfac", "\ud83c\udfa4", "\ud83c\udfa7", "\ud83c\udfbc", "\ud83c\udfb9", "\ud83e\udd41", "\ud83e\udd41", "\ud83c\udfb7", "\ud83c\udfba", "\ud83e\ude95", "\ud83c\udfb8", "\ud83c\udfbb", "\ud83c\udfb2", "\N{BLACK CHESS PAWN}\N{VARIATION SELECTOR-16}", "\ud83c\udfaf", "\ud83e\ude81", "\ud83e\ude80", "\ud83c\udfb3", "\ud83c\udfae", "\ud83c\udfb0", "\ud83e\udde9", "\ud83d\ude97", "\ud83d\ude95", "\ud83d\ude99", "\ud83d\ude8c", "\ud83d\ude8e", "\ud83c\udfce\N{VARIATION SELECTOR-16}", "\ud83c\udfce\N{VARIATION SELECTOR-16}", "\ud83d\ude93", "\ud83d\ude91", "\ud83d\ude92", "\ud83d\ude90", "\ud83d\ude9a", "\ud83d\ude9b", "\ud83d\ude9c", "\ud83d\udefa", "\ud83d\udef5", "\ud83d\udef5", "\ud83c\udfcd\N{VARIATION SELECTOR-16}", "\ud83c\udfcd\N{VARIATION SELECTOR-16}", "\ud83d\udef4", "\ud83d\udeb2", "\ud83e\uddbc", "\ud83e\uddbd", "\ud83d\udea8", "\ud83d\ude94", "\ud83d\ude8d", "\ud83d\ude98", "\ud83d\ude96", "\ud83d\udea1", "\ud83d\udea0", "\ud83d\ude9f", "\ud83d\ude83", "\ud83d\ude8b", "\ud83d\ude9e", "\ud83d\ude9d", "\ud83d\ude84", "\ud83d\ude85", "\ud83d\ude88", "\ud83d\ude82", "\ud83d\ude86", "\ud83d\ude87", "\ud83d\ude8a", "\ud83d\ude89", "\N{AIRPLANE}\N{VARIATION SELECTOR-16}", "\ud83d\udeeb", "\ud83d\udeec", "\ud83d\udee9\N{VARIATION SELECTOR-16}", "\ud83d\udee9\N{VARIATION SELECTOR-16}", "\ud83d\udcba", "\ud83d\udef0\N{VARIATION SELECTOR-16}", "\ud83d\ude80", "\ud83d\udef8", "\ud83d\ude81", "\ud83d\udef6", "\ud83d\udef6", "\N{SAILBOAT}", "\ud83d\udea4", "\ud83d\udee5\N{VARIATION SELECTOR-16}", "\ud83d\udef3\N{VARIATION SELECTOR-16}", "\ud83d\udef3\N{VARIATION SELECTOR-16}", "\N{FERRY}\N{VARIATION SELECTOR-16}", "\ud83d\udea2", "\N{ANCHOR}", "\N{FUEL PUMP}", "\ud83d\udea7", "\ud83d\udea6", "\ud83d\udea5", "\ud83d\ude8f", "\ud83d\uddfa\N{VARIATION SELECTOR-16}", "\ud83d\uddfa\N{VARIATION SELECTOR-16}", "\ud83d\uddff", "\ud83d\uddfd", "\ud83d\uddfc", "\ud83c\udff0", "\ud83c\udfef", "\ud83c\udfdf\N{VARIATION SELECTOR-16}", "\ud83c\udfa1", "\ud83c\udfa2", "\ud83c\udfa0", "\N{FOUNTAIN}", "\N{UMBRELLA ON GROUND}\N{VARIATION SELECTOR-16}", "\N{UMBRELLA ON GROUND}\N{VARIATION SELECTOR-16}", "\ud83c\udfd6\N{VARIATION SELECTOR-16}", "\ud83c\udfd6\N{VARIATION SELECTOR-16}", "\ud83c\udfdd\N{VARIATION SELECTOR-16}", "\ud83c\udfdd\N{VARIATION SELECTOR-16}", "\ud83c\udfdc\N{VARIATION SELECTOR-16}", "\ud83c\udf0b", "\N{MOUNTAIN}\N{VARIATION SELECTOR-16}", "\ud83c\udfd4\N{VARIATION SELECTOR-16}", "\ud83c\udfd4\N{VARIATION SELECTOR-16}", "\ud83d\uddfb", "\ud83c\udfd5\N{VARIATION SELECTOR-16}", "\N{TENT}", "\ud83c\udfe0", "\ud83c\udfe1", "\ud83c\udfd8\N{VARIATION SELECTOR-16}", "\ud83c\udfd8\N{VARIATION SELECTOR-16}", "\ud83c\udfda\N{VARIATION SELECTOR-16}", "\ud83c\udfda\N{VARIATION SELECTOR-16}", "\ud83c\udfd7\N{VARIATION SELECTOR-16}", "\ud83c\udfd7\N{VARIATION SELECTOR-16}", "\ud83c\udfed", "\ud83c\udfe2", "\ud83c\udfec", "\ud83c\udfe3", "\ud83c\udfe4", "\ud83c\udfe5", "\ud83c\udfe6", "\ud83c\udfe8", "\ud83c\udfea", "\ud83c\udfeb", "\ud83c\udfe9", "\ud83d\udc92", "\ud83c\udfdb\N{VARIATION SELECTOR-16}", "\N{CHURCH}", "\ud83d\udd4c", "\ud83d\uded5", "\ud83d\udd4d", "\ud83d\udd4b", "\N{SHINTO SHRINE}\N{VARIATION SELECTOR-16}", "\ud83d\udee4\N{VARIATION SELECTOR-16}", "\ud83d\udee4\N{VARIATION SELECTOR-16}", "\ud83d\udee3\N{VARIATION SELECTOR-16}", "\ud83d\uddfe", "\ud83c\udf91", "\ud83c\udfde\N{VARIATION SELECTOR-16}", "\ud83c\udfde\N{VARIATION SELECTOR-16}", "\ud83c\udf05", "\ud83c\udf04", "\ud83c\udf20", "\ud83c\udf87", "\ud83c\udf86", "\ud83c\udf07", "\ud83c\udf07", "\ud83c\udf06", "\ud83c\udfd9\N{VARIATION SELECTOR-16}", "\ud83c\udf03", "\ud83c\udf0c", "\ud83c\udf09", "\ud83c\udf01", "\N{WATCH}", "\ud83d\udcf1", "\ud83d\udcf2", "\ud83d\udcbb", "\N{KEYBOARD}\N{VARIATION SELECTOR-16}", "\ud83d\udda5\N{VARIATION SELECTOR-16}", "\ud83d\udda5\N{VARIATION SELECTOR-16}", "\ud83d\udda8\N{VARIATION SELECTOR-16}", "\ud83d\uddb1\N{VARIATION SELECTOR-16}", "\ud83d\uddb1\N{VARIATION SELECTOR-16}", "\ud83d\uddb2\N{VARIATION SELECTOR-16}", "\ud83d\udd79\N{VARIATION SELECTOR-16}", "\ud83d\udddc\N{VARIATION SELECTOR-16}", "\ud83d\udcbd", "\ud83d\udcbe", "\ud83d\udcbf", "\ud83d\udcc0", "\ud83d\udcfc", "\ud83d\udcf7", "\ud83d\udcf8", "\ud83d\udcf9", "\ud83c\udfa5", "\ud83d\udcfd\N{VARIATION SELECTOR-16}", "\ud83d\udcfd\N{VARIATION SELECTOR-16}", "\ud83c\udf9e\N{VARIATION SELECTOR-16}", "\ud83d\udcde", "\N{BLACK TELEPHONE}\N{VARIATION SELECTOR-16}", "\ud83d\udcdf", "\ud83d\udce0", "\ud83d\udcfa", "\ud83d\udcfb", "\ud83c\udf99\N{VARIATION SELECTOR-16}", "\ud83c\udf99\N{VARIATION SELECTOR-16}", "\ud83c\udf9a\N{VARIATION SELECTOR-16}", "\ud83c\udf9b\N{VARIATION SELECTOR-16}", "\ud83e\udded", "\N{STOPWATCH}\N{VARIATION SELECTOR-16}", "\N{TIMER CLOCK}\N{VARIATION SELECTOR-16}", "\N{TIMER CLOCK}\N{VARIATION SELECTOR-16}", "\N{ALARM CLOCK}", "\ud83d\udd70\N{VARIATION SELECTOR-16}", "\ud83d\udd70\N{VARIATION SELECTOR-16}", "\N{HOURGLASS}", "\N{HOURGLASS WITH FLOWING SAND}", "\ud83d\udce1", "\ud83d\udd0b", "\ud83d\udd0c", "\ud83d\udca1", "\ud83d\udd26", "\ud83d\udd6f\N{VARIATION SELECTOR-16}", "\ud83e\uddef", "\ud83d\udee2\N{VARIATION SELECTOR-16}", "\ud83d\udee2\N{VARIATION SELECTOR-16}", "\ud83d\udcb8", "\ud83d\udcb5", "\ud83d\udcb4", "\ud83d\udcb6", "\ud83d\udcb7", "\ud83d\udcb0", "\ud83d\udcb3", "\ud83d\udc8e", "\N{SCALES}\N{VARIATION SELECTOR-16}", "\ud83e\uddf0", "\ud83d\udd27", "\ud83d\udd28", "\N{HAMMER AND PICK}\N{VARIATION SELECTOR-16}", "\N{HAMMER AND PICK}\N{VARIATION SELECTOR-16}", "\ud83d\udee0\N{VARIATION SELECTOR-16}", "\ud83d\udee0\N{VARIATION SELECTOR-16}", "\N{PICK}\N{VARIATION SELECTOR-16}", "\ud83d\udd29", "\N{GEAR}\N{VARIATION SELECTOR-16}", "\ud83e\uddf1", "\N{CHAINS}\N{VARIATION SELECTOR-16}", "\ud83e\uddf2", "\ud83d\udd2b", "\ud83d\udca3", "\ud83e\udde8", "\ud83e\ude93", "\ud83e\ude92", "\ud83d\udd2a", "\ud83d\udde1\N{VARIATION SELECTOR-16}", "\ud83d\udde1\N{VARIATION SELECTOR-16}", "\N{CROSSED SWORDS}\N{VARIATION SELECTOR-16}", "\ud83d\udee1\N{VARIATION SELECTOR-16}", "\ud83d\udeac", "\N{COFFIN}\N{VARIATION SELECTOR-16}", "\N{FUNERAL URN}\N{VARIATION SELECTOR-16}", "\N{FUNERAL URN}\N{VARIATION SELECTOR-16}", "\ud83c\udffa", "\ud83e\ude94", "\ud83d\udd2e", "\ud83d\udcff", "\ud83e\uddff", "\ud83d\udc88", "\N{ALEMBIC}\N{VARIATION SELECTOR-16}", "\ud83d\udd2d", "\ud83d\udd2c", "\ud83d\udd73\N{VARIATION SELECTOR-16}", "\ud83e\uddaf", "\ud83e\ude7a", "\ud83e\ude79", "\ud83d\udc8a", "\ud83d\udc89", "\ud83e\ude78", "\ud83e\uddec", "\ud83e\udda0", "\ud83e\uddeb", "\ud83e\uddea", "\ud83c\udf21\N{VARIATION SELECTOR-16}", "\ud83e\ude91", "\ud83e\uddf9", "\ud83e\uddfa", "\ud83e\uddfb", "\ud83d\udebd", "\ud83d\udeb0", "\ud83d\udebf", "\ud83d\udec1", "\ud83d\udec0", "\ud83e\uddfc", "\ud83e\uddfd", "\ud83e\uddf4", "\ud83d\udece\N{VARIATION SELECTOR-16}", "\ud83d\udece\N{VARIATION SELECTOR-16}", "\ud83d\udd11", "\ud83d\udddd\N{VARIATION SELECTOR-16}", "\ud83d\udddd\N{VARIATION SELECTOR-16}", "\ud83d\udeaa", "\ud83d\udecb\N{VARIATION SELECTOR-16}", "\ud83d\udecb\N{VARIATION SELECTOR-16}", "\ud83d\udecf\N{VARIATION SELECTOR-16}", "\ud83d\udecc", "\ud83e\uddf8", "\ud83d\uddbc\N{VARIATION SELECTOR-16}", "\ud83d\uddbc\N{VARIATION SELECTOR-16}", "\ud83d\udecd\N{VARIATION SELECTOR-16}", "\ud83d\uded2", "\ud83d\uded2", "\ud83c\udf81", "\ud83c\udf88", "\ud83c\udf8f", "\ud83c\udf80", "\ud83c\udf8a", "\ud83c\udf89", "\ud83c\udf8e", "\ud83c\udfee", "\ud83c\udf90", "\ud83e\udde7", "\N{ENVELOPE}\N{VARIATION SELECTOR-16}", "\ud83d\udce9", "\ud83d\udce8", "\ud83d\udce7", "\ud83d\udce7", "\ud83d\udc8c", "\ud83d\udce5", "\ud83d\udce4", "\ud83d\udce6", "\ud83c\udff7\N{VARIATION SELECTOR-16}", "\ud83d\udcea", "\ud83d\udceb", "\ud83d\udcec", "\ud83d\udced", "\ud83d\udcee", "\ud83d\udcef", "\ud83d\udcdc", "\ud83d\udcc3", "\ud83d\udcc4", "\ud83d\udcd1", "\ud83e\uddfe", "\ud83d\udcca", "\ud83d\udcc8", "\ud83d\udcc9", "\ud83d\uddd2\N{VARIATION SELECTOR-16}", "\ud83d\uddd2\N{VARIATION SELECTOR-16}", "\ud83d\uddd3\N{VARIATION SELECTOR-16}", "\ud83d\uddd3\N{VARIATION SELECTOR-16}", "\ud83d\udcc6", "\ud83d\udcc5", "\ud83d\uddd1\N{VARIATION SELECTOR-16}", "\ud83d\udcc7", "\ud83d\uddc3\N{VARIATION SELECTOR-16}", "\ud83d\uddc3\N{VARIATION SELECTOR-16}", "\ud83d\uddf3\N{VARIATION SELECTOR-16}", "\ud83d\uddf3\N{VARIATION SELECTOR-16}", "\ud83d\uddc4\N{VARIATION SELECTOR-16}", "\ud83d\udccb", "\ud83d\udcc1", "\ud83d\udcc2", "\ud83d\uddc2\N{VARIATION SELECTOR-16}", "\ud83d\uddc2\N{VARIATION SELECTOR-16}", "\ud83d\uddde\N{VARIATION SELECTOR-16}", "\ud83d\uddde\N{VARIATION SELECTOR-16}", "\ud83d\udcf0", "\ud83d\udcd3", "\ud83d\udcd4", "\ud83d\udcd2", "\ud83d\udcd5", "\ud83d\udcd7", "\ud83d\udcd8", "\ud83d\udcd9", "\ud83d\udcda", "\ud83d\udcd6", "\ud83d\udd16", "\ud83e\uddf7", "\ud83d\udd17", "\ud83d\udcce", "\ud83d\udd87\N{VARIATION SELECTOR-16}", "\ud83d\udd87\N{VARIATION SELECTOR-16}", "\ud83d\udcd0", "\ud83d\udccf", "\ud83e\uddee", "\ud83d\udccc", "\ud83d\udccd", "\N{BLACK SCISSORS}\N{VARIATION SELECTOR-16}", "\ud83d\udd8a\N{VARIATION SELECTOR-16}", "\ud83d\udd8a\N{VARIATION SELECTOR-16}", "\ud83d\udd8b\N{VARIATION SELECTOR-16}", "\ud83d\udd8b\N{VARIATION SELECTOR-16}", "\N{BLACK NIB}\N{VARIATION SELECTOR-16}", "\ud83d\udd8c\N{VARIATION SELECTOR-16}", "\ud83d\udd8c\N{VARIATION SELECTOR-16}", "\ud83d\udd8d\N{VARIATION SELECTOR-16}", "\ud83d\udd8d\N{VARIATION SELECTOR-16}", "\ud83d\udcdd", "\ud83d\udcdd", "\N{PENCIL}\N{VARIATION SELECTOR-16}", "\ud83d\udd0d", "\ud83d\udd0e", "\ud83d\udd0f", "\ud83d\udd10", "\ud83d\udd12", "\ud83d\udd13", "\N{HEAVY BLACK HEART}\N{VARIATION SELECTOR-16}", "\ud83e\udde1", "\ud83d\udc9b", "\ud83d\udc9a", "\ud83d\udc99", "\ud83d\udc9c", "\ud83d\udda4", "\ud83e\udd0e", "\ud83e\udd0d", "\ud83d\udc94", "\N{HEAVY HEART EXCLAMATION MARK ORNAMENT}\N{VARIATION SELECTOR-16}", "\N{HEAVY HEART EXCLAMATION MARK ORNAMENT}\N{VARIATION SELECTOR-16}", "\ud83d\udc95", "\ud83d\udc9e", "\ud83d\udc93", "\ud83d\udc97", "\ud83d\udc96", "\ud83d\udc98", "\ud83d\udc9d", "\ud83d\udc9f", "\N{PEACE SYMBOL}\N{VARIATION SELECTOR-16}", "\N{PEACE SYMBOL}\N{VARIATION SELECTOR-16}", "\N{LATIN CROSS}\N{VARIATION SELECTOR-16}", "\N{LATIN CROSS}\N{VARIATION SELECTOR-16}", "\N{STAR AND CRESCENT}\N{VARIATION SELECTOR-16}", "\ud83d\udd49\N{VARIATION SELECTOR-16}", "\N{WHEEL OF DHARMA}\N{VARIATION SELECTOR-16}", "\N{STAR OF DAVID}\N{VARIATION SELECTOR-16}", "\ud83d\udd2f", "\ud83d\udd4e", "\N{YIN YANG}\N{VARIATION SELECTOR-16}", "\N{ORTHODOX CROSS}\N{VARIATION SELECTOR-16}", "\ud83d\uded0", "\ud83d\uded0", "\N{OPHIUCHUS}", "\N{ARIES}", "\N{TAURUS}", "\N{GEMINI}", "\N{CANCER}", "\N{LEO}", "\N{VIRGO}", "\N{LIBRA}", "\N{SCORPIUS}", "\N{SAGITTARIUS}", "\N{CAPRICORN}", "\N{AQUARIUS}", "\N{PISCES}", "\ud83c\udd94", "\N{ATOM SYMBOL}\N{VARIATION SELECTOR-16}", "\N{ATOM SYMBOL}\N{VARIATION SELECTOR-16}", "\ud83c\ude51", "\N{RADIOACTIVE SIGN}\N{VARIATION SELECTOR-16}", "\N{RADIOACTIVE SIGN}\N{VARIATION SELECTOR-16}", "\N{BIOHAZARD SIGN}\N{VARIATION SELECTOR-16}", "\N{BIOHAZARD SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udcf4", "\ud83d\udcf3", "\ud83c\ude36", "\ud83c\ude1a", "\ud83c\ude38", "\ud83c\ude3a", "\ud83c\ude37\N{VARIATION SELECTOR-16}", "\N{EIGHT POINTED BLACK STAR}\N{VARIATION SELECTOR-16}", "\ud83c\udd9a", "\ud83d\udcae", "\ud83c\ude50", "\N{CIRCLED IDEOGRAPH SECRET}\N{VARIATION SELECTOR-16}", "\N{CIRCLED IDEOGRAPH CONGRATULATION}\N{VARIATION SELECTOR-16}", "\ud83c\ude34", "\ud83c\ude35", "\ud83c\ude39", "\ud83c\ude32", "\ud83c\udd70\N{VARIATION SELECTOR-16}", "\ud83c\udd71\N{VARIATION SELECTOR-16}", "\ud83c\udd8e", "\ud83c\udd91", "\ud83c\udd7e\N{VARIATION SELECTOR-16}", "\ud83c\udd98", "\N{CROSS MARK}", "\N{HEAVY LARGE CIRCLE}", "\ud83d\uded1", "\ud83d\uded1", "\N{NO ENTRY}", "\ud83d\udcdb", "\ud83d\udeab", "\ud83d\udcaf", "\ud83d\udca2", "\N{HOT SPRINGS}\N{VARIATION SELECTOR-16}", "\ud83d\udeb7", "\ud83d\udeaf", "\ud83d\udeb3", "\ud83d\udeb1", "\ud83d\udd1e", "\ud83d\udcf5", "\ud83d\udead", "\N{HEAVY EXCLAMATION MARK SYMBOL}", "\N{WHITE EXCLAMATION MARK ORNAMENT}", "\N{BLACK QUESTION MARK ORNAMENT}", "\N{WHITE QUESTION MARK ORNAMENT}", "\N{DOUBLE EXCLAMATION MARK}\N{VARIATION SELECTOR-16}", "\N{EXCLAMATION QUESTION MARK}\N{VARIATION SELECTOR-16}", "\ud83d\udd05", "\ud83d\udd06", "\N{PART ALTERNATION MARK}\N{VARIATION SELECTOR-16}", "\N{WARNING SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udeb8", "\ud83d\udd31", "\N{FLEUR-DE-LIS}\N{VARIATION SELECTOR-16}", "\ud83d\udd30", "\N{BLACK UNIVERSAL RECYCLING SYMBOL}\N{VARIATION SELECTOR-16}", "\N{WHITE HEAVY CHECK MARK}", "\ud83c\ude2f", "\ud83d\udcb9", "\N{SPARKLE}\N{VARIATION SELECTOR-16}", "\N{EIGHT SPOKED ASTERISK}\N{VARIATION SELECTOR-16}", "\N{NEGATIVE SQUARED CROSS MARK}", "\ud83c\udf10", "\ud83d\udca0", "\N{CIRCLED LATIN CAPITAL LETTER M}\N{VARIATION SELECTOR-16}", "\ud83c\udf00", "\ud83d\udca4", "\ud83c\udfe7", "\ud83d\udebe", "\N{WHEELCHAIR SYMBOL}", "\ud83c\udd7f\N{VARIATION SELECTOR-16}", "\ud83c\ude33", "\ud83c\ude02\N{VARIATION SELECTOR-16}", "\ud83d\udec2", "\ud83d\udec3", "\ud83d\udec4", "\ud83d\udec5", "\ud83d\udeb9", "\ud83d\udeba", "\ud83d\udebc", "\ud83d\udebb", "\ud83d\udeae", "\ud83c\udfa6", "\ud83d\udcf6", "\ud83c\ude01", "\ud83d\udd23", "\N{INFORMATION SOURCE}\N{VARIATION SELECTOR-16}", "\ud83d\udd24", "\ud83d\udd21", "\ud83d\udd20", "\ud83c\udd96", "\ud83c\udd97", "\ud83c\udd99", "\ud83c\udd92", "\ud83c\udd95", "\ud83c\udd93", "\N{DIGIT ZERO}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT ONE}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT TWO}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT THREE}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT FOUR}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT FIVE}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT SIX}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT SEVEN}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT EIGHT}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{DIGIT NINE}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\ud83d\udd1f", "\ud83d\udd22", "\N{NUMBER SIGN}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{ASTERISK}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{ASTERISK}\N{VARIATION SELECTOR-16}\N{COMBINING ENCLOSING KEYCAP}", "\N{EJECT SYMBOL}\N{VARIATION SELECTOR-16}", "\N{EJECT SYMBOL}\N{VARIATION SELECTOR-16}", "\N{BLACK RIGHT-POINTING TRIANGLE}\N{VARIATION SELECTOR-16}", "\N{DOUBLE VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{DOUBLE VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{BLACK RIGHT-POINTING TRIANGLE WITH DOUBLE VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{BLACK SQUARE FOR STOP}\N{VARIATION SELECTOR-16}", "\N{BLACK CIRCLE FOR RECORD}\N{VARIATION SELECTOR-16}", "\N{BLACK RIGHT-POINTING DOUBLE TRIANGLE WITH VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{BLACK RIGHT-POINTING DOUBLE TRIANGLE WITH VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{BLACK LEFT-POINTING DOUBLE TRIANGLE WITH VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{BLACK LEFT-POINTING DOUBLE TRIANGLE WITH VERTICAL BAR}\N{VARIATION SELECTOR-16}", "\N{BLACK RIGHT-POINTING DOUBLE TRIANGLE}", "\N{BLACK LEFT-POINTING DOUBLE TRIANGLE}", "\N{BLACK UP-POINTING DOUBLE TRIANGLE}", "\N{BLACK DOWN-POINTING DOUBLE TRIANGLE}", "\N{BLACK LEFT-POINTING TRIANGLE}\N{VARIATION SELECTOR-16}", "\ud83d\udd3c", "\ud83d\udd3d", "\N{BLACK RIGHTWARDS ARROW}\N{VARIATION SELECTOR-16}", "\N{LEFTWARDS BLACK ARROW}\N{VARIATION SELECTOR-16}", "\N{UPWARDS BLACK ARROW}\N{VARIATION SELECTOR-16}", "\N{DOWNWARDS BLACK ARROW}\N{VARIATION SELECTOR-16}", "\N{NORTH EAST ARROW}\N{VARIATION SELECTOR-16}", "\N{SOUTH EAST ARROW}\N{VARIATION SELECTOR-16}", "\N{SOUTH WEST ARROW}\N{VARIATION SELECTOR-16}", "\N{NORTH WEST ARROW}\N{VARIATION SELECTOR-16}", "\N{UP DOWN ARROW}\N{VARIATION SELECTOR-16}", "\N{LEFT RIGHT ARROW}\N{VARIATION SELECTOR-16}", "\N{RIGHTWARDS ARROW WITH HOOK}\N{VARIATION SELECTOR-16}", "\N{LEFTWARDS ARROW WITH HOOK}\N{VARIATION SELECTOR-16}", "\N{ARROW POINTING RIGHTWARDS THEN CURVING UPWARDS}\N{VARIATION SELECTOR-16}", "\N{ARROW POINTING RIGHTWARDS THEN CURVING DOWNWARDS}\N{VARIATION SELECTOR-16}", "\ud83d\udd00", "\ud83d\udd01", "\ud83d\udd02", "\ud83d\udd04", "\ud83d\udd03", "\ud83c\udfb5", "\ud83c\udfb6", "\N{HEAVY PLUS SIGN}", "\N{HEAVY MINUS SIGN}", "\N{HEAVY DIVISION SIGN}", "\N{HEAVY MULTIPLICATION X}\N{VARIATION SELECTOR-16}", "\N{PERMANENT PAPER SIGN}\N{VARIATION SELECTOR-16}", "\ud83d\udcb2", "\ud83d\udcb1", "\N{TRADE MARK SIGN}\N{VARIATION SELECTOR-16}", "\N{COPYRIGHT SIGN}\N{VARIATION SELECTOR-16}", "\N{REGISTERED SIGN}\N{VARIATION SELECTOR-16}", "\N{WAVY DASH}\N{VARIATION SELECTOR-16}", "\N{CURLY LOOP}", "\N{DOUBLE CURLY LOOP}", "\ud83d\udd1a", "\ud83d\udd19", "\ud83d\udd1b", "\ud83d\udd1d", "\ud83d\udd1c", "\N{HEAVY CHECK MARK}\N{VARIATION SELECTOR-16}", "\N{BALLOT BOX WITH CHECK}\N{VARIATION SELECTOR-16}", "\ud83d\udd18", "\N{MEDIUM WHITE CIRCLE}", "\N{MEDIUM BLACK CIRCLE}", "\ud83d\udd34", "\ud83d\udd35", "\ud83d\udfe4", "\ud83d\udfe3", "\ud83d\udfe2", "\ud83d\udfe1", "\ud83d\udfe0", "\ud83d\udd3a", "\ud83d\udd3b", "\ud83d\udd38", "\ud83d\udd39", "\ud83d\udd36", "\ud83d\udd37", "\ud83d\udd33", "\ud83d\udd32", "\N{BLACK SMALL SQUARE}\N{VARIATION SELECTOR-16}", "\N{WHITE SMALL SQUARE}\N{VARIATION SELECTOR-16}", "\N{BLACK MEDIUM SMALL SQUARE}", "\N{WHITE MEDIUM SMALL SQUARE}", "\N{BLACK MEDIUM SQUARE}\N{VARIATION SELECTOR-16}", "\N{WHITE MEDIUM SQUARE}\N{VARIATION SELECTOR-16}", "\N{BLACK LARGE SQUARE}", "\N{WHITE LARGE SQUARE}", "\ud83d\udfe7", "\ud83d\udfe6", "\ud83d\udfe5", "\ud83d\udfeb", "\ud83d\udfea", "\ud83d\udfe9", "\ud83d\udfe8", "\ud83d\udd08", "\ud83d\udd07", "\ud83d\udd09", "\ud83d\udd0a", "\ud83d\udd14", "\ud83d\udd15", "\ud83d\udce3", "\ud83d\udce2", "\ud83d\udde8\N{VARIATION SELECTOR-16}", "\ud83d\udde8\N{VARIATION SELECTOR-16}", "\ud83d\udc41\N{ZERO WIDTH JOINER}\ud83d\udde8", "\ud83d\udcac", "\ud83d\udcad", "\ud83d\uddef\N{VARIATION SELECTOR-16}", "\ud83d\uddef\N{VARIATION SELECTOR-16}", "\N{BLACK SPADE SUIT}\N{VARIATION SELECTOR-16}", "\N{BLACK CLUB SUIT}\N{VARIATION SELECTOR-16}", "\N{BLACK HEART SUIT}\N{VARIATION SELECTOR-16}", "\N{BLACK DIAMOND SUIT}\N{VARIATION SELECTOR-16}", "\ud83c\udccf", "\ud83c\udfb4", "\ud83c\udc04", "\ud83d\udd50", "\ud83d\udd51", "\ud83d\udd52", "\ud83d\udd53", "\ud83d\udd54", "\ud83d\udd55", "\ud83d\udd56", "\ud83d\udd57", "\ud83d\udd58", "\ud83d\udd59", "\ud83d\udd5a", "\ud83d\udd5b", "\ud83d\udd5c", "\ud83d\udd5d", "\ud83d\udd5e", "\ud83d\udd5f", "\ud83d\udd60", "\ud83d\udd61", "\ud83d\udd62", "\ud83d\udd63", "\ud83d\udd64", "\ud83d\udd65", "\ud83d\udd66", "\ud83d\udd67", "\N{FEMALE SIGN}\N{VARIATION SELECTOR-16}", "\N{MALE SIGN}\N{VARIATION SELECTOR-16}", "\N{STAFF OF AESCULAPIUS}\N{VARIATION SELECTOR-16}", "\ud83c\uddff", "\ud83c\uddfe", "\ud83c\uddfd", "\ud83c\uddfc", "\ud83c\uddfb", "\ud83c\uddfa", "\ud83c\uddf9", "\ud83c\uddf8", "\ud83c\uddf7", "\ud83c\uddf6", "\ud83c\uddf5", "\ud83c\uddf4", "\ud83c\uddf3", "\ud83c\uddf2", "\ud83c\uddf1", "\ud83c\uddf0", "\ud83c\uddef", "\ud83c\uddee", "\ud83c\udded", "\ud83c\uddec", "\ud83c\uddeb", "\ud83c\uddea", "\ud83c\udde9", "\ud83c\udde8", "\ud83c\udde7", "\ud83c\udde6", "\ud83c\udff3\N{VARIATION SELECTOR-16}", "\ud83c\udff4", "\ud83c\udfc1", "\ud83d\udea9", "\ud83c\udff3\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83c\udf08", "\ud83c\udff3\N{VARIATION SELECTOR-16}\N{ZERO WIDTH JOINER}\ud83c\udf08", "\ud83c\udff4\N{ZERO WIDTH JOINER}\N{SKULL AND CROSSBONES}\N{VARIATION SELECTOR-16}", "\ud83c\udde6\ud83c\uddeb", "\ud83c\udde6\ud83c\uddfd", "\ud83c\udde6\ud83c\uddf1", "\ud83c\udde9\ud83c\uddff", "\ud83c\udde6\ud83c\uddf8", "\ud83c\udde6\ud83c\udde9", "\ud83c\udde6\ud83c\uddf4", "\ud83c\udde6\ud83c\uddee", "\ud83c\udde6\ud83c\uddf6", "\ud83c\udde6\ud83c\uddec", "\ud83c\udde6\ud83c\uddf7", "\ud83c\udde6\ud83c\uddf2", "\ud83c\udde6\ud83c\uddfc", "\ud83c\udde6\ud83c\uddfa", "\ud83c\udde6\ud83c\uddf9", "\ud83c\udde6\ud83c\uddff", "\ud83c\udde7\ud83c\uddf8", "\ud83c\udde7\ud83c\udded", "\ud83c\udde7\ud83c\udde9", "\ud83c\udde7\ud83c\udde7", "\ud83c\udde7\ud83c\uddfe", "\ud83c\udde7\ud83c\uddea", "\ud83c\udde7\ud83c\uddff", "\ud83c\udde7\ud83c\uddef", "\ud83c\udde7\ud83c\uddf2", "\ud83c\udde7\ud83c\uddf9", "\ud83c\udde7\ud83c\uddf4", "\ud83c\udde7\ud83c\udde6", "\ud83c\udde7\ud83c\uddfc", "\ud83c\udde7\ud83c\uddf7", "\ud83c\uddee\ud83c\uddf4", "\ud83c\uddfb\ud83c\uddec", "\ud83c\udde7\ud83c\uddf3", "\ud83c\udde7\ud83c\uddec", "\ud83c\udde7\ud83c\uddeb", "\ud83c\udde7\ud83c\uddee", "\ud83c\uddf0\ud83c\udded", "\ud83c\udde8\ud83c\uddf2", "\ud83c\udde8\ud83c\udde6", "\ud83c\uddee\ud83c\udde8", "\ud83c\udde8\ud83c\uddfb", "\ud83c\udde7\ud83c\uddf6", "\ud83c\uddf0\ud83c\uddfe", "\ud83c\udde8\ud83c\uddeb", "\ud83c\uddf9\ud83c\udde9", "\ud83c\udde8\ud83c\uddf1", "\ud83c\udde8\ud83c\uddf3", "\ud83c\udde8\ud83c\uddfd", "\ud83c\udde8\ud83c\udde8", "\ud83c\udde8\ud83c\uddf4", "\ud83c\uddf0\ud83c\uddf2", "\ud83c\udde8\ud83c\uddec", "\ud83c\udde8\ud83c\udde9", "\ud83c\udde8\ud83c\uddf0", "\ud83c\udde8\ud83c\uddf7", "\ud83c\udde8\ud83c\uddee", "\ud83c\udded\ud83c\uddf7", "\ud83c\udde8\ud83c\uddfa", "\ud83c\udde8\ud83c\uddfc", "\ud83c\udde8\ud83c\uddfe", "\ud83c\udde8\ud83c\uddff", "\ud83c\udde9\ud83c\uddf0", "\ud83c\udde9\ud83c\uddef", "\ud83c\udde9\ud83c\uddf2", "\ud83c\udde9\ud83c\uddf4", "\ud83c\uddea\ud83c\udde8", "\ud83c\uddea\ud83c\uddec", "\ud83c\uddf8\ud83c\uddfb", "\ud83c\uddec\ud83c\uddf6", "\ud83c\uddea\ud83c\uddf7", "\ud83c\uddea\ud83c\uddea", "\ud83c\uddea\ud83c\uddf9", "\ud83c\uddea\ud83c\uddfa", "\ud83c\uddeb\ud83c\uddf0", "\ud83c\uddeb\ud83c\uddf4", "\ud83c\uddeb\ud83c\uddef", "\ud83c\uddeb\ud83c\uddee", "\ud83c\uddeb\ud83c\uddf7", "\ud83c\uddec\ud83c\uddeb", "\ud83c\uddf5\ud83c\uddeb", "\ud83c\uddf9\ud83c\uddeb", "\ud83c\uddec\ud83c\udde6", "\ud83c\uddec\ud83c\uddf2", "\ud83c\uddec\ud83c\uddea", "\ud83c\udde9\ud83c\uddea", "\ud83c\uddec\ud83c\udded", "\ud83c\uddec\ud83c\uddee", "\ud83c\uddec\ud83c\uddf7", "\ud83c\uddec\ud83c\uddf1", "\ud83c\uddec\ud83c\udde9", "\ud83c\uddec\ud83c\uddf5", "\ud83c\uddec\ud83c\uddfa", "\ud83c\uddec\ud83c\uddf9", "\ud83c\uddec\ud83c\uddec", "\ud83c\uddec\ud83c\uddf3", "\ud83c\uddec\ud83c\uddfc", "\ud83c\uddec\ud83c\uddfe", "\ud83c\udded\ud83c\uddf9", "\ud83c\udded\ud83c\uddf3", "\ud83c\udded\ud83c\uddf0", "\ud83c\udded\ud83c\uddfa", "\ud83c\uddee\ud83c\uddf8", "\ud83c\uddee\ud83c\uddf3", "\ud83c\uddee\ud83c\udde9", "\ud83c\uddee\ud83c\uddf7", "\ud83c\uddee\ud83c\uddf6", "\ud83c\uddee\ud83c\uddea", "\ud83c\uddee\ud83c\uddf2", "\ud83c\uddee\ud83c\uddf1", "\ud83c\uddee\ud83c\uddf9", "\ud83c\uddef\ud83c\uddf2", "\ud83c\uddef\ud83c\uddf5", "\ud83c\udf8c", "\ud83c\uddef\ud83c\uddea", "\ud83c\uddef\ud83c\uddf4", "\ud83c\uddf0\ud83c\uddff", "\ud83c\uddf0\ud83c\uddea", "\ud83c\uddf0\ud83c\uddee", "\ud83c\uddfd\ud83c\uddf0", "\ud83c\uddf0\ud83c\uddfc", "\ud83c\uddf0\ud83c\uddec", "\ud83c\uddf1\ud83c\udde6", "\ud83c\uddf1\ud83c\uddfb", "\ud83c\uddf1\ud83c\udde7", "\ud83c\uddf1\ud83c\uddf8", "\ud83c\uddf1\ud83c\uddf7", "\ud83c\uddf1\ud83c\uddfe", "\ud83c\uddf1\ud83c\uddee", "\ud83c\uddf1\ud83c\uddf9", "\ud83c\uddf1\ud83c\uddfa", "\ud83c\uddf2\ud83c\uddf4", "\ud83c\uddf2\ud83c\uddf0", "\ud83c\uddf2\ud83c\uddec", "\ud83c\uddf2\ud83c\uddfc", "\ud83c\uddf2\ud83c\uddfe", "\ud83c\uddf2\ud83c\uddfb", "\ud83c\uddf2\ud83c\uddf1", "\ud83c\uddf2\ud83c\uddf9", "\ud83c\uddf2\ud83c\udded", "\ud83c\uddf2\ud83c\uddf6", "\ud83c\uddf2\ud83c\uddf7", "\ud83c\uddf2\ud83c\uddfa", "\ud83c\uddfe\ud83c\uddf9", "\ud83c\uddf2\ud83c\uddfd", "\ud83c\uddeb\ud83c\uddf2", "\ud83c\uddf2\ud83c\udde9", "\ud83c\uddf2\ud83c\udde8", "\ud83c\uddf2\ud83c\uddf3", "\ud83c\uddf2\ud83c\uddea", "\ud83c\uddf2\ud83c\uddf8", "\ud83c\uddf2\ud83c\udde6", "\ud83c\uddf2\ud83c\uddff", "\ud83c\uddf2\ud83c\uddf2", "\ud83c\uddf3\ud83c\udde6", "\ud83c\uddf3\ud83c\uddf7", "\ud83c\uddf3\ud83c\uddf5", "\ud83c\uddf3\ud83c\uddf1", "\ud83c\uddf3\ud83c\udde8", "\ud83c\uddf3\ud83c\uddff", "\ud83c\uddf3\ud83c\uddee", "\ud83c\uddf3\ud83c\uddea", "\ud83c\uddf3\ud83c\uddec", "\ud83c\uddf3\ud83c\uddfa", "\ud83c\uddf3\ud83c\uddeb", "\ud83c\uddf0\ud83c\uddf5", "\ud83c\uddf2\ud83c\uddf5", "\ud83c\uddf3\ud83c\uddf4", "\ud83c\uddf4\ud83c\uddf2", "\ud83c\uddf5\ud83c\uddf0", "\ud83c\uddf5\ud83c\uddfc", "\ud83c\uddf5\ud83c\uddf8", "\ud83c\uddf5\ud83c\udde6", "\ud83c\uddf5\ud83c\uddec", "\ud83c\uddf5\ud83c\uddfe", "\ud83c\uddf5\ud83c\uddea", "\ud83c\uddf5\ud83c\udded", "\ud83c\uddf5\ud83c\uddf3", "\ud83c\uddf5\ud83c\uddf1", "\ud83c\uddf5\ud83c\uddf9", "\ud83c\uddf5\ud83c\uddf7", "\ud83c\uddf6\ud83c\udde6", "\ud83c\uddf7\ud83c\uddea", "\ud83c\uddf7\ud83c\uddf4", "\ud83c\uddf7\ud83c\uddfa", "\ud83c\uddf7\ud83c\uddfc", "\ud83c\uddfc\ud83c\uddf8", "\ud83c\uddf8\ud83c\uddf2", "\ud83c\uddf8\ud83c\uddf9", "\ud83c\uddf8\ud83c\udde6", "\ud83c\uddf8\ud83c\uddf3", "\ud83c\uddf7\ud83c\uddf8", "\ud83c\uddf8\ud83c\udde8", "\ud83c\uddf8\ud83c\uddf1", "\ud83c\uddf8\ud83c\uddec", "\ud83c\uddf8\ud83c\uddfd", "\ud83c\uddf8\ud83c\uddf0", "\ud83c\uddf8\ud83c\uddee", "\ud83c\uddec\ud83c\uddf8", "\ud83c\uddf8\ud83c\udde7", "\ud83c\uddf8\ud83c\uddf4", "\ud83c\uddff\ud83c\udde6", "\ud83c\uddf0\ud83c\uddf7", "\ud83c\uddf8\ud83c\uddf8", "\ud83c\uddea\ud83c\uddf8", "\ud83c\uddf1\ud83c\uddf0", "\ud83c\udde7\ud83c\uddf1", "\ud83c\uddf8\ud83c\udded", "\ud83c\uddf0\ud83c\uddf3", "\ud83c\uddf1\ud83c\udde8", "\ud83c\uddf5\ud83c\uddf2", "\ud83c\uddfb\ud83c\udde8", "\ud83c\uddf8\ud83c\udde9", "\ud83c\uddf8\ud83c\uddf7", "\ud83c\uddf8\ud83c\uddff", "\ud83c\uddf8\ud83c\uddea", "\ud83c\udde8\ud83c\udded", "\ud83c\uddf8\ud83c\uddfe", "\ud83c\uddf9\ud83c\uddfc", "\ud83c\uddf9\ud83c\uddef", "\ud83c\uddf9\ud83c\uddff", "\ud83c\uddf9\ud83c\udded", "\ud83c\uddf9\ud83c\uddf1", "\ud83c\uddf9\ud83c\uddec", "\ud83c\uddf9\ud83c\uddf0", "\ud83c\uddf9\ud83c\uddf4", "\ud83c\uddf9\ud83c\uddf9", "\ud83c\uddf9\ud83c\uddf3", "\ud83c\uddf9\ud83c\uddf7", "\ud83c\uddf9\ud83c\uddf2", "\ud83c\uddf9\ud83c\udde8", "\ud83c\uddfb\ud83c\uddee", "\ud83c\uddf9\ud83c\uddfb", "\ud83c\uddfa\ud83c\uddec", "\ud83c\uddfa\ud83c\udde6", "\ud83c\udde6\ud83c\uddea", "\ud83c\uddec\ud83c\udde7", "\ud83c\udff4\udb40\udc67\udb40\udc62\udb40\udc65\udb40\udc6e\udb40\udc67\udb40\udc7f", "\ud83c\udff4\udb40\udc67\udb40\udc62\udb40\udc73\udb40\udc63\udb40\udc74\udb40\udc7f", "\ud83c\udff4\udb40\udc67\udb40\udc62\udb40\udc77\udb40\udc6c\udb40\udc73\udb40\udc7f", "\ud83c\uddfa\ud83c\uddf8", "\ud83c\uddfa\ud83c\uddfe", "\ud83c\uddfa\ud83c\uddff", "\ud83c\uddfb\ud83c\uddfa", "\ud83c\uddfb\ud83c\udde6", "\ud83c\uddfb\ud83c\uddea", "\ud83c\uddfb\ud83c\uddf3", "\ud83c\uddfc\ud83c\uddeb", "\ud83c\uddea\ud83c\udded", "\ud83c\uddfe\ud83c\uddea", "\ud83c\uddff\ud83c\uddf2", "\ud83c\uddff\ud83c\uddfc", "\ud83c\udde6\ud83c\udde8", "\ud83c\udde7\ud83c\uddfb", "\ud83c\udde8\ud83c\uddf5", "\ud83c\uddea\ud83c\udde6", "\ud83c\udde9\ud83c\uddec", "\ud83c\udded\ud83c\uddf2", "\ud83c\uddf2\ud83c\uddeb", "\ud83c\uddf8\ud83c\uddef", "\ud83c\uddf9\ud83c\udde6", "\ud83c\uddfa\ud83c\uddf2", "\ud83c\uddfa\ud83c\uddf3", ]
# Copyright (c) nexB Inc. and others. All rights reserved. # http://nexb.com and https://github.com/nexB/vulnerablecode/ # The VulnerableCode software is licensed under the Apache License version 2.0. # Data generated with VulnerableCode require an acknowledgment. # # You may not use this software except in compliance with the License. # You may obtain a copy of the License at: http://apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software distributed # under the License is distributed on an 'AS IS' BASIS, WITHOUT WARRANTIES OR # CONDITIONS OF ANY KIND, either express or implied. See the License for the # specific language governing permissions and limitations under the License. # # When you publish or redistribute any data created with VulnerableCode or any VulnerableCode # derivative work, you must accompany this data with the following acknowledgment: # # Generated with VulnerableCode and provided on an 'AS IS' BASIS, WITHOUT WARRANTIES # OR CONDITIONS OF ANY KIND, either express or implied. No content created from # VulnerableCode should be considered or used as legal advice. Consult an Attorney # for any legal advice. # VulnerableCode is a free software from nexB Inc. and others. # Visit https://github.com/nexB/vulnerablecode/ for support and download. import os from unittest import TestCase from vulnerabilities.data_source import Advisory from vulnerabilities.data_source import Reference from vulnerabilities.data_source import VulnerabilitySeverity from vulnerabilities.importers.suse_scores import SUSESeverityScoreDataSource from vulnerabilities.helpers import load_yaml from vulnerabilities.severity_systems import ScoringSystem BASE_DIR = os.path.dirname(os.path.abspath(__file__)) TEST_DATA = os.path.join(BASE_DIR, "test_data/suse_scores", "suse-cvss-scores.yaml") class TestSUSESeverityScoreDataSource(TestCase): def test_to_advisory(self): raw_data = load_yaml(TEST_DATA) expected_data = [ Advisory( summary="", impacted_package_urls=[], resolved_package_urls=[], references=[ Reference( reference_id="", url="https://ftp.suse.com/pub/projects/security/yaml/suse-cvss-scores.yaml", severities=[ VulnerabilitySeverity( system=ScoringSystem( identifier="cvssv2", name="CVSSv2 Base Score", url="https://www.first.org/cvss/v2/", notes="cvssv2 base score", ), value="4.3", ), VulnerabilitySeverity( system=ScoringSystem( identifier="cvssv2_vector", name="CVSSv2 Vector", url="https://www.first.org/cvss/v2/", notes="cvssv2 vector, used to get additional info about nature and severity of vulnerability", # nopep8 ), value="AV:N/AC:M/Au:N/C:N/I:N/A:P", ), VulnerabilitySeverity( system=ScoringSystem( identifier="cvssv3.1", name="CVSSv3.1 Base Score", url="https://www.first.org/cvss/v3-1/", notes="cvssv3.1 base score", ), value="3.7", ), VulnerabilitySeverity( system=ScoringSystem( identifier="cvssv3.1_vector", name="CVSSv3.1 Vector", url="https://www.first.org/cvss/v3-1/", notes="cvssv3.1 vector, used to get additional info about nature and severity of vulnerability", # nopep8 ), value="CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:L", ), ], ) ], vulnerability_id="CVE-2004-0230", ), Advisory( summary="", impacted_package_urls=[], resolved_package_urls=[], references=[ Reference( reference_id="", url="https://ftp.suse.com/pub/projects/security/yaml/suse-cvss-scores.yaml", severities=[ VulnerabilitySeverity( system=ScoringSystem( identifier="cvssv3", name="CVSSv3 Base Score", url="https://www.first.org/cvss/v3-0/", notes="cvssv3 base score", ), value="8.6", ), VulnerabilitySeverity( system=ScoringSystem( identifier="cvssv3_vector", name="CVSSv3 Vector", url="https://www.first.org/cvss/v3-0/", notes="cvssv3 vector, used to get additional info about nature and severity of vulnerability", # nopep8 ), value="CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:C/C:H/I:N/A:N", ), ], ) ], vulnerability_id="CVE-2003-1605", ), ] found_data = SUSESeverityScoreDataSource.to_advisory(raw_data) found_advisories = list(map(Advisory.normalized, found_data)) expected_advisories = list(map(Advisory.normalized, expected_data)) assert sorted(found_advisories) == sorted(expected_advisories)
<reponame>brzx/pydataloader #!/usr/bin/python # -*- coding: utf-8 -*- import targetTools import beatbox, pdb import datetime class SFDCTools(targetTools.TargetTools): def __init__(self, credential, log): self.credential = credential self.log = log def getConnection(self): self.sf = beatbox._tPartnerNS self.svc = beatbox.PythonClient() beatbox.gzipRequest = False if self.credential["url"] == "test": self.svc.serverUrl = self.svc.serverUrl.replace('login.', 'test.') try: self.svc.login(self.credential["username"], self.credential["password"]) return self.svc except Exception as e: self.log.AppendText(str(e)) self.log.AppendText("\n") return None def validTarget(self, target): reflag = False soql = "select id from %s limit 1" % (target, ) try: self.svc.query(soql) reflag = True except Exception as e: self.log.AppendText("target table does not exists\n") self.log.AppendText(str(e)) self.log.AppendText("\n") return reflag def upsertData(self, data, tarTable, tarList, credential, keys): fieldList = self.svc.describeSObjects(tarTable)[0].fields.keys() fieldDict = {} for f in fieldList: for t in tarList: if f.upper() == t.upper(): fieldDict[t] = f if not any(f == keys["keyinfo"][0].upper() \ for f in map(lambda x:x.upper(), fieldList)): self.log.AppendText("Skipped 'upsert' because the custom \ external Id field doesn't exist") self.log.AppendText("upsert\n") for row in data: upsertDict = {} upsertDict["type"] = tarTable for n, t in enumerate(tarList): upsertDict[fieldDict[t]] = row[n] self.log.AppendText(str(upsertDict)) self.log.AppendText("\n") try: ur = self.svc.upsert(fieldDict[keys["keyinfo"][0]], upsertDict) self.log.AppendText(str(ur[0])) self.log.AppendText("\n") except Exception as e: self.log.AppendText("\n") self.log.AppendText(str(e)) self.log.AppendText("\n") self.log.AppendText("upsert data finish\n") def insertData(self, data, tarTable, tarList, credential): self.log.AppendText("insert\n") tl = map(lambda x:x['name'], tarList) for row in data: insertDict = {} insertDict["type"] = tarTable for index, item in enumerate(tl): if tarList[index]['name'] == item and tarList[index]['type'] == 'text': insertDict[item] = row[index] elif tarList[index]['name'] == item and tarList[index]['type'] == 'date': insertDict[item] = datetime.datetime(int(row[index].split('-')[0]), int(row[index].split('-')[1]), int(row[index].split('-')[2])) else: pass self.log.AppendText(str(insertDict)) #pdb.set_trace() try: ur = self.svc.create([insertDict]) self.log.AppendText(str(ur[0])) self.log.AppendText("\n") except Exception as e: self.log.AppendText("\n") self.log.AppendText(str(e)) self.log.AppendText("\n") self.log.AppendText("insert data finish\n") if __name__ == "__main__": pass
<gh_stars>1000+ import pytest from schematics.models import Model from schematics.types import IntType, StringType from schematics.types.compound import ModelType, ListType from schematics.exceptions import DataError from schematics.util import ImportStringError def test_simple_embedded_models(): class Location(Model): country_code = StringType() class Player(Model): id = IntType() location = ModelType(Location) p = Player(dict(id=1, location={"country_code": "US"})) assert p.id == 1 assert p.location.country_code == "US" p.location = Location({"country_code": "IS"}) assert isinstance(p.location, Location) assert p.location.country_code == "IS" def test_simple_embedded_models_is_none(): class Location(Model): country_code = StringType() class Player(Model): id = IntType() location = ModelType(Location) p = Player(dict(id=1)) assert p.id == 1 assert p.location is None def test_simple_embedded_model_set_to_none(): class Location(Model): country_code = StringType() class Player(Model): id = IntType() location = ModelType(Location) p = Player(dict(id=1)) p.location = None assert p.id == 1 assert p.location is None def test_simple_embedded_model_is_none_within_listtype(): class QuestionResources(Model): type = StringType() class Question(Model): id = StringType() resources = ModelType(QuestionResources) class QuestionPack(Model): id = StringType() questions = ListType(ModelType(Question)) question_pack = QuestionPack({ "id": "1", "questions": [ { "id": "1", }, ] }) assert question_pack.questions[0].resources is None def test_raises_validation_error_on_init_with_partial_submodel(): class User(Model): name = StringType(required=True) age = IntType(required=True) class Card(Model): user = ModelType(User) u = User({'name': 'Arthur'}) c = Card({'user': u}) with pytest.raises(DataError): c.validate() def test_model_type(): class User(Model): name = StringType() class Card(Model): user = ModelType(User) c = Card({"user": {'name': u'Doggy'}}) assert isinstance(c.user, User) assert c.user.name == "Doggy" def test_equality_with_embedded_models(): class Location(Model): country_code = StringType() class Player(Model): id = IntType() location = ModelType(Location) p1 = Player(dict(id=1, location={"country_code": "US"})) p2 = Player(dict(id=1, location={"country_code": "US"})) assert id(p1.location) != id(p2.location) assert p1.location == p2.location assert p1 == p2 def test_default_value_when_embedded_model(): class Question(Model): question_id = StringType(required=True) type = StringType(default="text") class QuestionPack(Model): question = ModelType(Question) pack = QuestionPack({ "question": { "question_id": 1 } }) assert pack.question.question_id == "1" assert pack.question.type == "text" def test_export_loop_with_subclassed_model(): class Asset(Model): file_name = StringType() class S3Asset(Asset): bucket_name = StringType() class Product(Model): title = StringType() asset = ModelType(Asset) asset = S3Asset({'bucket_name': 'assets_bucket', 'file_name': 'bar'}) product = Product({'title': 'baz', 'asset': asset}) primitive = product.to_primitive() assert 'bucket_name' in primitive['asset'] native = product.to_native() assert 'bucket_name' in native['asset'] def test_conversion_error_recursive_overhead(): conversions = [0] class Leaf(Model): pass next_model = Leaf data = 'not a mapping' for i in range(20): class Recursive(Model): x = ModelType(next_model, required=True) def __init__(self, *args, **kwargs): super(type(self), self).__init__(*args, **kwargs) conversions[0] += 1 assert conversions[0] < 25 next_model = Recursive data = {'x': data} with pytest.raises(DataError): next_model(data) def test_mock_object(): class User(Model): name = StringType(required=True) age = IntType(required=True) assert ModelType(User, required=True).mock() is not None def test_specify_model_by_name(): class M(Model): to_one = ModelType('M') to_many = ListType(ModelType('M')) matrix = ListType(ListType(ModelType('M'))) assert M.to_one.model_class is M assert M.to_many.field.model_class is M assert M.matrix.field.field.model_class is M def test_model_context_pass_to_type(): from schematics.types import BaseType from schematics.datastructures import Context class CustomType(BaseType): def to_native(self, value, context=None): suffix = context.suffix return str(value) + suffix def to_primitive(self, value, context=None): suffix = context.suffix return value[:-len(suffix)] class Thing(Model): x = CustomType() context = {'suffix': 'z'} input = {'x': 'thingie'} thing = Thing(input, context=context) assert thing.x == 'thingiez' assert thing.to_primitive(context=context) == {'x': 'thingie'} # try it with a Context object model_context = Context(suffix='z!') thing2 = Thing(input, context=model_context) assert thing2.x == 'thingiez!' export_context = Context(suffix='z!') assert thing2.to_primitive(context=export_context) == {'x': 'thingie'} with pytest.raises(AttributeError): # can't reuse the same Context object as was used for model # TODO this may be unexpected to the uninitiated; a custom exception # could explain it better. thing2.to_primitive(context=model_context) def test_model_app_data_pass_to_type(): from schematics.types import BaseType class CustomType(BaseType): def to_native(self, value, context=None): suffix = context.app_data['suffix'] return str(value) + suffix def to_primitive(self, value, context=None): suffix = context.app_data['suffix'] return value[:-len(suffix)] class Thing(Model): x = CustomType() app_data = {'suffix': 'z'} input = {'x': 'thingie'} thing = Thing(input, app_data=app_data) assert thing.x == 'thingiez' assert thing.to_primitive(app_data=app_data) == {'x': 'thingie'} class OuterModel: class InnerModel(Model): test = StringType() def test_deep_string_search(): class TestModel(Model): deep_model = ModelType('test_model_type.OuterModel.InnerModel') test = TestModel(dict(deep_model=dict(test='Abc'))) assert test.validate() is None class TestModel2(Model): invalid_model = ModelType('a.c.d.e') with pytest.raises(ImportStringError): TestModel2(dict(invalid_model=dict(a='1'))) def test_recursive_string_self_reference(): class RecursiveTestModel(Model): recursive_model = ModelType('RecursiveTestModel') test = StringType() test = RecursiveTestModel(dict(recursive_model=dict(test='Abc'))) assert test.validate() is None assert test.recursive_model.test == 'Abc' def test_circular_string_reference(): class TestModel1(Model): model2 = ModelType('TestModel2') name = StringType() class TestModel2(Model): model1 = ModelType('TestModel1') description = StringType() data1 = {'name': 'Test1'} data2 = {'description': 'Test2', 'model1': data1} # TODO: we might want to support locals import late binding someday/somehow with pytest.raises(ImportStringError): test = TestModel1({ 'name': 'Root', 'model2': data2 })
<gh_stars>0 import imageio from imgaug import augmenters as iaa import math import random from tensorflow.keras.preprocessing.image import ImageDataGenerator class Augmentor(object): def __init__(self): self.function = self._get_augmentor() def _get_augmentor(self): return iaa.Sequential( [ iaa.OneOf([ iaa.OneOf([ iaa.AdditiveGaussianNoise(scale=(0.04, 0.3)), iaa.SaltAndPepper(0.01) ]), iaa.CoarseDropout(p=(0.02, 0.1)), iaa.GaussianBlur(sigma=(0.1, 2.0)) ]) ], random_order=False ) def process_image(self, image): return self.function(image=image) class SubsetGenerator(object): def __init__(self, original_datagen, augmented_datagen, dataframe, x_col, target_size, color_mode="grayscale", class_mode=None, **kwargs): self.dataframe = dataframe self.x_col = x_col self.target_size = target_size self.color_mode = color_mode self.class_mode = class_mode self.augmented = augmented_datagen.flow_from_dataframe( dataframe=self.dataframe, x_col=self.x_col, target_size=self.target_size, color_mode=self.color_mode, class_mode=self.class_mode, **kwargs ) self.original = original_datagen.flow_from_dataframe( dataframe=self.dataframe, x_col=self.x_col, target_size=self.target_size, color_mode=self.color_mode, class_mode=self.class_mode, **kwargs ) def __len__(self): return len(self.augmented) @property def as_tuple(self): return zip(self.augmented, self.original) @property def steps_per_epoch(self): return self.original.n // self.original.batch_size @property def image_shape(self): return self.augmented.image_shape def reset(self): self.augmented.reset() self.original.reset() class DataGenerator(object): _common_data_gen_params = dict( samplewise_center=False, samplewise_std_normalization=False, rescale=1. / 255 ) def __init__(self, dataset, unique_by, path_column, image_size, augmentor=Augmentor()): self.dataset = dataset self.unique_by = unique_by self.image_size = image_size self.augmentor = augmentor self._augmented_datagen = ImageDataGenerator( **self._common_data_gen_params, preprocessing_function=augmentor.process_image ) self._original_datagen = ImageDataGenerator( **self._common_data_gen_params ) self.train_df, self.valid_df, self.test_df = self._split_dataset() self.train_generator = SubsetGenerator( original_datagen=self._original_datagen, augmented_datagen=self._augmented_datagen, dataframe=self.train_df, x_col=path_column, target_size=image_size, batch_size=16, seed=1 ) self.validation_generator = SubsetGenerator( original_datagen=self._original_datagen, augmented_datagen=self._augmented_datagen, dataframe=self.valid_df, x_col=path_column, target_size=image_size, batch_size=16, seed=1 ) self.test_generator = SubsetGenerator( original_datagen=self._original_datagen, augmented_datagen=self._augmented_datagen, dataframe=self.test_df, x_col=path_column, target_size=image_size, batch_size=1, suffle=False, seed=1 ) @property def image_shape(self): return self.train_generator.image_shape def _split_dataset(self, seed=1234, shuffle=True, split_percentages=(0.66, 0.14, 0.2)): if not isinstance(split_percentages, (list, tuple)): raise ValueError("'split' argument must be a tuple or list") else: if sum(split_percentages) != 1.0: raise ValueError("'split' must sum up to 1.0") split_train, split_val, split_test = split_percentages unique_choices = self.dataset.df[self.unique_by].unique().tolist() nb_unique = len(unique_choices) nb_train = math.floor(nb_unique * split_train) nb_val = math.floor(nb_unique * split_val) nb_test = nb_unique - nb_train - nb_val if shuffle: random.seed(seed) random.shuffle(unique_choices) result_choices = [] start = 0 for value in [nb_train, nb_val, nb_test]: end = start + value result_choices.append( unique_choices[start: end] ) start = end train_choices, val_choices, test_choices = result_choices train_df = self.dataset.df.loc[self.dataset.df[self.unique_by].isin(train_choices)] val_df = self.dataset.df.loc[self.dataset.df[self.unique_by].isin(val_choices)] test_df = self.dataset.df.loc[self.dataset.df[self.unique_by].isin(test_choices)] return train_df.sample(frac=1, random_state=seed), val_df.sample(frac=1, random_state=seed), test_df.sample( frac=1, random_state=seed) def print_sample_augmented_images(self, num_augmentations=20): seq = get_augmentator() rnd_image = df_images_filtered.sample() image = imageio.imread(rnd_image[IMAGE_PATH_COLUMN_NAME].item()) print("Original:") show_original = ia.imshow(image) images_aug = [seq(image=image) for _ in range(num_augmentations)] print("Augmented:") show_augmented = ia.imshow(ia.draw_grid(images_aug)) return show_original, show_augmented
import numpy as np import tensorflow as tf #import keras from tensorflow import keras import pickle import os from utils import preprocess_flags from utils import data_folder,kernel_folder,arch_folder,results_folder def main(_): FLAGS = tf.compat.v1.app.flags.FLAGS.flag_values_dict() FLAGS = preprocess_flags(FLAGS) globals().update(FLAGS) if init_dist != "gaussian": raise NotImplementedError("Initialization distributions other than Gaussian are not implemented for computing pac bayes bounds!") from mpi4py import MPI comm = MPI.COMM_WORLD rank = comm.Get_rank() size = comm.Get_size() print(rank) if n_gpus>0: os.environ["CUDA_VISIBLE_DEVICES"]=str((rank)%n_gpus) config = tf.compat.v1.ConfigProto() config.gpu_options.allow_growth = True #tf.enable_eager_execution(config=config) set_session = tf.compat.v1.keras.backend.set_session config.log_device_placement = False # to log device placement (on which device the operation ran) sess = tf.compat.v1.Session(config=config) set_session(sess) # set this TensorFlow session as the default session for Keras '''GET DATA''' from utils import load_data,load_model,load_kernel train_images,flat_train_images,ys,_,_ = load_data(FLAGS) X = flat_train_images ys2 = [[y] for y in ys] Y = np.array(ys2) image_size = train_images.shape[1] number_channels = train_images.shape[-1] input_dim = flat_train_images.shape[1] print("compute probability and bound", network, dataset) if using_NTK: FLAGS["use_empirical_NTK"] = True theta = load_kernel(FLAGS) print(theta) #if using NTK, the above gets the NTK kernel, but we also need the non-NTK one to compute the bound! FLAGS["use_empirical_NTK"] = False K_pre = load_kernel(FLAGS) print(K_pre) if normalize_kernel: K_pre = K_pre/K_pre.max() K = kernel_mult*K_pre if theta.shape[0] >= m: #must have compute kernel for GP_train theta = theta[:m,:m] if K.shape[0] >= m: #must have compute kernel for GP_train K = K[:m,:m] else: K_pre = load_kernel(FLAGS) print(K_pre) if normalize_kernel: K_pre = K_pre/K_pre.max() K = kernel_mult*K_pre if K.shape[0] >= m: #must have compute kernel for GP_train K = K[:m,:m] #finding log marginal likelihood of data if using_EP: from GP_prob.GP_prob_gpy2 import GP_prob logPU = GP_prob(K,X,Y, method="EP", using_exactPB=using_exactPB) elif using_Laplace: from GP_prob.GP_prob_gpy2 import GP_prob # from GP_prob.GP_prob_numpy import GP_prob logPU = GP_prob(K,X,Y,method="Laplace", using_exactPB=using_exactPB) # logPU = GP_prob(K,np.squeeze(Y)) elif using_Laplace2: # from GP_prob.GP_prob_gpy import GP_prob from GP_prob.GP_prob_numpy import GP_prob #this gives different results because it uses a worse implementation of Laplace, by using a more Naive Newton method to find the maximum of the posterior # logPU = GP_prob(K,X,Y,method="Laplace") logPU = GP_prob(K,np.squeeze(Y)) elif using_MC: from GP_prob.GP_prob_MC import GP_prob logPU = GP_prob(K,X,Y,FLAGS) elif using_regression: from GP_prob.GP_prob_regression import GP_prob # logPU = GP_prob(K,X,Y,sigma_noise=np.sqrt(total_samples/2)) logPU = GP_prob(K,X,Y,sigma_noise=1.0) elif using_NTK: # from GP_prob.GP_prob_regression import GP_prob # logPU = GP_prob(K,X,Y,sigma_noise=np.sqrt(total_samples/2)) # logPU = GP_prob(K,X,Y,sigma_noise=1.0, posterior="ntk") from GP_prob.GP_prob_ntk import GP_prob logPU = GP_prob(K,theta,X,Y,t=1e2) if rank == 0: print(logPU) #compute PAC-Bayes bound delta = 2**-10 bound = (-logPU+2*np.log(total_samples)+1-np.log(delta))/total_samples bound = 1-np.exp(-bound) print("pre-confusion-correction bound: ", bound) rho = confusion/(1.0+confusion) bound = (bound - 0.5*rho)/(1-rho) #to correct for the confusion changing the training data distribution (in training set, but not in test set)! print("Bound: ", bound) print("Accuracy bound: ", 1-bound) useful_flags = ["dataset","boolfun_comp","boolfun", "network", "m","label_corruption","confusion", "number_layers", "sigmaw", "sigmab", "binarized", "pooling", "intermediate_pooling", "whitening", "training", "n_gpus", "kernel_mult", "normalize_kernel"] with open(results_folder+prefix+"bounds.txt","a") as file: file.write("#") for key in useful_flags: file.write("{}\t".format(key)) file.write("bound") file.write("\t") file.write("logP") file.write("\n") for key in useful_flags: file.write("{}\t".format(FLAGS[key])) file.write("{}".format(bound)) file.write("\t") file.write("{}".format(logPU)) file.write("\n") if __name__ == '__main__': f = tf.compat.v1.app.flags from utils import define_default_flags define_default_flags(f) f.DEFINE_boolean('using_EP', False, "Whether to use Expectation Propagation method for computing probability") f.DEFINE_boolean('using_Laplace', False, "Whether to use Laplace method for computing probability") f.DEFINE_boolean('using_Laplace2', False, "Whether my numpy implementation of Laplace method for computing probability") f.DEFINE_boolean('using_regression', False, "Whether to use the exact relative entropy for MSE GP regression") f.DEFINE_boolean('using_NTK', False, "Whether to use the exact relative entropy for MSE GP regression, with NTK posterior") f.DEFINE_boolean('using_exactPB', False, "Whether using exact PAC-Bayes on approximate posterior rather than approximate PAC-Bayes on exact postierior") f.DEFINE_boolean('using_MC', False, "Whether to use Monte Carlo method for computing probability") f.DEFINE_boolean('normalize_kernel', False, "Whether to normalize the kernel (by dividing by max value) or not") f.DEFINE_integer('num_post_samples', int(1e5), "Number of approximate EP posterior samples in importance-sampling-based Monte Carlo estimation of marginal likelihood") f.DEFINE_float('cov_mult', 1.0, "Factor by which to multiply the variance of the approximate posterior, to focus the importance sampling more in the non-zero likelihood region, at the risk of biasing away from true posterior.") f.DEFINE_float('kernel_mult', 1.0, "Factor by which to multiply the kernel before computing approximate marginal likelihood") f.DEFINE_float('mean_mult', 1.0, "Factor by which to multiply the mean of the approximate posterior, to focus the importance sampling more in the non-zero likelihood region, at the risk of biasing away from true posterior.") tf.compat.v1.app.run()
<reponame>openprocurement/openprocurement.auctions.flash<gh_stars>0 # -*- coding: utf-8 -*- import unittest from openprocurement.auctions.core.tests.base import snitch from openprocurement.auctions.core.tests.blanks.chronograph_blanks import ( # AuctionSwitchAuctionResourceTest switch_to_auction, # AuctionSwitchUnsuccessfulResourceTest switch_to_unsuccessful, # AuctionComplaintSwitchResourceTest switch_to_pending, switch_to_complaint, # AuctionAwardComplaintSwitchResourceTest switch_to_pending_award, switch_to_complaint_award, ) from openprocurement.auctions.flash.tests import fixtures from openprocurement.auctions.flash.tests.base import ( BaseAuctionWebTest, test_lots, test_bids, test_organization ) from openprocurement.auctions.flash.tests.blanks.chronograph_blanks import ( # AuctionSwitchtenderingResourceTest switch_to_tendering_by_enquiryPeriod_endDate, switch_to_tendering_by_auctionPeriod_startDate, switch_to_tendering_auctionPeriod, # AuctionSwitchQualificationResourceTest switch_to_qualification, ) class AuctionSwitchtenderingResourceTest(BaseAuctionWebTest): test_switch_to_tendering_by_enquiryPeriod_endDate = \ snitch(switch_to_tendering_by_enquiryPeriod_endDate) test_switch_to_tendering_by_auctionPeriod_startDate = \ snitch(switch_to_tendering_by_auctionPeriod_startDate) test_switch_to_tendering_auctionPeriod = \ snitch(switch_to_tendering_auctionPeriod) class AuctionSwitchQualificationResourceTest(BaseAuctionWebTest): initial_status = 'active.tendering' initial_bids = test_bids[:1] test_switch_to_qualification = snitch(switch_to_qualification) class AuctionSwitchAuctionResourceTest(BaseAuctionWebTest): initial_status = 'active.tendering' initial_bids = test_bids test_switch_to_auction = snitch(switch_to_auction) class AuctionSwitchUnsuccessfulResourceTest(BaseAuctionWebTest): initial_status = 'active.tendering' test_switch_to_unsuccessful = snitch(switch_to_unsuccessful) class AuctionLotSwitchQualificationResourceTest( AuctionSwitchQualificationResourceTest ): initial_lots = test_lots class AuctionLotSwitchAuctionResourceTest(AuctionSwitchAuctionResourceTest): initial_lots = test_lots class AuctionLotSwitchUnsuccessfulResourceTest( AuctionSwitchUnsuccessfulResourceTest ): initial_lots = test_lots class AuctionComplaintSwitchResourceTest(BaseAuctionWebTest): initial_organization = test_organization test_switch_to_pending = snitch(switch_to_pending) test_switch_to_complaint = snitch(switch_to_complaint) class AuctionLotComplaintSwitchResourceTest( AuctionComplaintSwitchResourceTest ): initial_lots = test_lots class AuctionAwardComplaintSwitchResourceTest(BaseAuctionWebTest): initial_status = 'active.auction' initial_bids = test_bids initial_organization = test_organization def setUp(self): super(AuctionAwardComplaintSwitchResourceTest, self).setUp() # Create award fixtures.create_award(self) test_auction_award_complaint_switch_to_pending = snitch( switch_to_pending_award ) test_auction_award_complaint_switch_to_complaint = snitch( switch_to_complaint_award ) class AuctionLotAwardComplaintSwitchResourceTest( AuctionAwardComplaintSwitchResourceTest ): initial_status = 'active.auction' initial_lots = test_lots def setUp(self): super(AuctionAwardComplaintSwitchResourceTest, self).setUp() # Create award fixtures.create_award(self) def suite(): tests = unittest.TestSuite() tests.addTest(unittest.makeSuite(AuctionSwitchtenderingResourceTest)) tests.addTest(unittest.makeSuite(AuctionSwitchQualificationResourceTest)) tests.addTest(unittest.makeSuite(AuctionSwitchAuctionResourceTest)) tests.addTest(unittest.makeSuite(AuctionSwitchUnsuccessfulResourceTest)) tests.addTest(unittest.makeSuite( AuctionLotSwitchQualificationResourceTest )) tests.addTest(unittest.makeSuite(AuctionLotSwitchAuctionResourceTest)) tests.addTest(unittest.makeSuite(AuctionLotSwitchUnsuccessfulResourceTest)) tests.addTest(unittest.makeSuite(AuctionComplaintSwitchResourceTest)) tests.addTest(unittest.makeSuite(AuctionLotComplaintSwitchResourceTest)) tests.addTest(unittest.makeSuite(AuctionAwardComplaintSwitchResourceTest)) tests.addTest(unittest.makeSuite( AuctionLotAwardComplaintSwitchResourceTest )) return tests if __name__ == '__main__': unittest.main(defaultTest='suite')
#!/usr/bin/env python # _*_coding:utf-8_*_ import sys import pandas as pd import numpy as np import rpy2 import rpy2.robjects from rpy2.robjects import numpy2ri numpy2ri.activate() r = rpy2.robjects.r r.library('Peptides') GROUPS_SA = ['ALFCGIVW', 'RKQEND', 'MSPTHY'] #solventaccess GROUPS_HB = ['ILVWAMGT', 'FYSQCN', 'PHKEDR'] # HEIJNE&BLOMBERG1979 def fasta_iter(fname): header = None chunks = [] with open(fname) as f: for line in f: if line[0] == '>': if header is not None: yield header,''.join(chunks) header = line[1:].strip().split()[0] chunks = [] else: chunks.append(line.strip()) if header is not None: yield header, ''.join(chunks) def ctdd(sequence, groups): code = [] for group in groups: for i, aa in enumerate(sequence): if aa in group: code.append((i + 1)/len(sequence) * 100) break else: code.append(0) return code def main(args): if len(args) < 3: sys.stderr.write("This is an internal FACS script and is not meant to be used independently") sys.exit(1) ifile = args[1] ofile = args[2] groups = [set(g) for g in (GROUPS_SA+GROUPS_HB)] seqs = [] headers = [] encodings = [] for h,seq in fasta_iter(ifile): seqs.append(seq) headers.append(h) encodings.append(ctdd(seq, groups)) # We can do this inside the loop so that we are not forced to pre-load all # the sequences into memory. However, it becomes much slower rpy2.robjects.globalenv['seq'] = seqs aaComp = r('aaComp(seq)') rfeatures = r(''' ch <- charge(seq=seq, pH=7, pKscale="EMBOSS") pI <- pI(seq=seq, pKscale="EMBOSS") aIndex <- aIndex(seq=seq) instaIndex <- instaIndex(seq=seq) boman <- boman(seq=seq) hydrophobicity <- hydrophobicity(seq=seq, scale="Eisenberg") hmoment <- hmoment(seq=seq, angle=100, window=11) cbind(ch, pI, aIndex, instaIndex, boman, hydrophobicity, hmoment) ''') aaComp = np.array([np.array(v) for v in aaComp]) aaComp = aaComp[:,:,1] features = np.hstack([aaComp, rfeatures, encodings]) # The column names must match those in the saved model features = pd.DataFrame(features, index=headers, columns=[ "tinyAA", "smallAA", "aliphaticAA", "aromaticAA", "nonpolarAA", "polarAA", "chargedAA", "basicAA", "acidicAA", "charge", "pI", "aindex", "instaindex", "boman", "hydrophobicity", "hmoment", "SA.G1.residue0", "SA.G2.residue0", "SA.G3.residue0", "hb.Group.1.residue0", "hb.Group.2.residue0", "hb.Group.3.residue0", ]) features.insert(0, 'group', 'Unk') features.insert(0, 'sequence', seqs) features.to_csv(ofile, sep='\t', index_label='access') if __name__ == '__main__': main(sys.argv)
<reponame>trer/bombots import os import pygame as pg class TexMan: # Texture Manager def __init__(self, scale): mod_dir = os.path.dirname(__file__) filename = os.path.join(mod_dir, 'res', 'bb_sprites.png') self.spr = pg.image.load(filename).convert_alpha() self.src_scale = 32 # Determined by sheet self.dst_scale = scale # Determined by environment # [TODO: Make this into a dictionary, add animation system] self.spr_floor = self.copy_spr((5, 0)) self.spr_box = self.copy_spr((5, 1)) self.spr_wall = self.copy_spr((6, 0)) self.spr_bot = { 'red' : { 'n' : self.copy_spr((0, 1)), 's' : self.copy_spr((0, 0)), 'e' : self.copy_spr((0, 2)), 'w' : self.copy_spr((0, 3)) }, 'green' : { 'n' : self.copy_spr((1, 1)), 's' : self.copy_spr((1, 0)), 'e' : self.copy_spr((1, 2)), 'w' : self.copy_spr((1, 3)) }, 'blue' : { 'n' : self.copy_spr((2, 1)), 's' : self.copy_spr((2, 0)), 'e' : self.copy_spr((2, 2)), 'w' : self.copy_spr((2, 3)) }, 'yellow' : { 'n' : self.copy_spr((3, 1)), 's' : self.copy_spr((3, 0)), 'e' : self.copy_spr((3, 2)), 'w' : self.copy_spr((3, 3)) } } self.spr_pop_ext = self.copy_spr((5, 2)) self.spr_pop_num = self.copy_spr((5, 3)) self.spr_bomb = [ self.copy_spr((4, 0)), self.copy_spr((4, 1)), self.copy_spr((4, 2)), self.copy_spr((4, 3)) ] self.spr_fire = { 'n' : self.copy_spr((7, 0)), 's' : self.copy_spr((7, 3)), 'e' : self.copy_spr((6, 3)), 'w' : self.copy_spr((6, 1)), 'h' : self.copy_spr((6, 2)), 'v' : self.copy_spr((7, 2)), 'x' : self.copy_spr((7, 1)) } self.spr_fire_n = self.copy_spr((7, 0)) # North end self.spr_fire_s = self.copy_spr((7, 3)) # South end self.spr_fire_e = self.copy_spr((6, 3)) # East end self.spr_fire_w = self.copy_spr((6, 1)) # West end self.spr_fire_h = self.copy_spr((6, 2)) # Horizontal beam self.spr_fire_v = self.copy_spr((7, 2)) # Vertical beam self.spr_fire_x = self.copy_spr((7, 1)) # Cross-section # Copy specific sprite from sheet to surface (pos is sheet index, not in pixels) def copy_spr(self, pos): spr = pg.Surface((self.src_scale, self.src_scale), pg.SRCALPHA) spr.blit(self.spr, (0, 0, self.src_scale, self.src_scale), (self.src_scale * pos[0], self.src_scale * pos[1], self.src_scale, self.src_scale)) return pg.transform.scale(spr, (self.dst_scale, self.dst_scale))
<filename>squall/routing/path.py import inspect import re from collections import Counter from typing import Any, Callable, Dict, List, Optional, Tuple from urllib.parse import urljoin from squall import convertors, params PARAM_REGEX = re.compile("{([a-zA-Z_][a-zA-Z0-9_]*)(:[a-zA-Z_][a-zA-Z0-9_]*)?}") class Path: __slots__ = ["path", "handler"] def __init__(self, path: str, handler: Callable[..., Any]) -> None: self.path = path self.handler = handler def strip_trailing_slash(self) -> None: """Strip trailing slash if path differ form '/' >>> p = Path("/my/route/", lambda: None) >>> assert p.path == "/my/route/" >>> p.strip_trailing_slash() >>> assert p.path == "/my/route" """ if self.path != "/": self.path = self.path.rstrip("/") def append_left(self, prefix: str) -> None: """Prepend provided prefix to the path :param prefix: Prefix path to add >>> p = Path("/my/route", lambda: None) >>> assert p.path == "/my/route" >>> p.append_left("/api/v1") >>> assert p.path == "/api/v1/my/route" """ if not prefix.endswith("/"): prefix += "/" self.path = urljoin(prefix, self.path.strip("/")) @property def path_params(self) -> List[Tuple[str, Optional[str]]]: """Returns dynamic path parameters and their path-declared convertor aliases >>> p = Path("/user/{user_id:int}/notes/{note:uuid}/type/{type}", lambda: None) >>> assert p.path_params == [ >>> ("user_id", "int"), >>> ("note", "uuid"), >>> ("type", None) >>> ] """ result, names = [], [] for param in PARAM_REGEX.finditer(self.path): name, suffix = param.groups("") names.append(name) convertor = suffix.lstrip(":") if suffix else None result.append((name, convertor)) if duplicates := [i for i, cnt in Counter(names).items() if cnt > 1]: raise ValueError( f'Path "{self.path}" contains ' f"duplicate params: {', '.join(duplicates)}" ) return result @property def schema_path(self) -> str: """Returns simplified path without convertor aliases >>> p = Path("/user/{user_id:int}/notes/{note:uuid}/type/{type}", lambda: None) >>> assert p.schema_path == "/user/{user_id}/notes/{note}/type/{type}" """ result = self.path for match in PARAM_REGEX.finditer(self.path): param_name, convertor_type = match.groups("") result = result.replace( "{" f"{param_name}{convertor_type}" "}", "{" f"{param_name}" "}", ) return result @property def router_path(self) -> str: """Returns path with detailed convertors aliases information. Also uses handler annotations for lookup. Used for exact pattern registration in squall-router library >>> async def my_handler(user_id: int, note): pass >>> >>> p = Path("/user/{user_id}/notes/{note:uuid}", my_handler) >>> assert p.router_path == "/user/{user_id:int}/notes/{note:uuid}" """ result = self.schema_path from_handler = self.get_path_params_from_handler() for param_name, convertor_name in self.path_params: if convertor_name := convertor_name or from_handler.get(param_name): result = result.replace( "{" f"{param_name}" "}", "{" f"{param_name}:{convertor_name}" "}", ) return result def get_path_params_from_handler(self) -> Dict[str, Optional[str]]: """Returns handler parameters affiliated with path. >>> from uuid import UUID >>> >>> async def my_handler(user_id: int, note: UUID): pass >>> >>> p = Path("/user/{user_id}/notes/{note}", my_handler) >>> assert p.get_path_params_from_handler() == { >>> "user_id": "int", >>> "note": "uuid" >>> } """ results = {} path_params = dict(self.path_params) for k, v in inspect.signature(self.handler).parameters.items(): name = k if isinstance(v.default, params.Path): if alias := v.default.alias: name = alias elif v.default is v.empty: name = k if name not in path_params: continue validate = path_params[name] if v.annotation != v.empty: if convertor := convertors.database.get_by_type(v.annotation): if validate is None: validate = convertor.alias elif convertor.alias != path_params[name]: raise ValueError( f"Parameter {name} have different annotation and convertor types: " f"{convertor.alias} != {path_params[name]}" ) else: raise ValueError( f"Parameter `{name}` have unknown convertor type: {v.annotation}" ) results[name] = validate return results
<reponame>KnowingNothing/akg-test from collections import namedtuple import os import logging def get_block_str_from_config(config: namedtuple): block_param = "" if "block_x" in getattr(config, "_fields"): block_param += str(config.block_x) + " " if "block_y" in getattr(config, "_fields"): block_param += str(config.block_y) + " " if "block_z" in getattr(config, "_fields"): block_param += str(config.block_z) + " " return block_param def get_thread_str_from_config(config: namedtuple): thread_param = "" if "thread_x" in getattr(config, "_fields"): thread_param += str(config.thread_x) + " " if "thread_y" in getattr(config, "_fields"): thread_param += str(config.thread_y) + " " if "thread_z" in getattr(config, "_fields"): thread_param += str(config.thread_z) + " " return thread_param def get_parallel_build_num(): """get the num of parallel build""" env_dic = os.environ try: return int(env_dic.get('BUILD_PARALLEL_NUM').lower()) if env_dic.get('BUILD_PARALLEL_NUM') else 1 except NameError as e: logging.error(e) return 1 def get_available_gpu_num(): """get the num of gpu""" env_dic = os.environ try: return [int(id) for id in env_dic.get('USE_GPU_DEVICES').split(",")] if env_dic.get('USE_GPU_DEVICES') else [0, ] except NameError as e: logging.error(e) return 1 def get_real_attr(value ,key ,need_tune_json, need_tune_keys): if key not in need_tune_keys: return value if need_tune_json[key]['dtype'] == "bool": if need_tune_json[key]['options'][value].lower() == "true": return True elif need_tune_json[key]['options'][value].lower() == "false": return False else: raise TypeError("Wrong boolean type, please check json file") elif need_tune_json[key]['dtype'] == "str": if isinstance(need_tune_json[key]['options'][value], str): return need_tune_json[key]['options'][value] else: raise TypeError("Wrong str type, please check json file") elif need_tune_json[key]['dtype'] == "int": if isinstance(need_tune_json[key]['options'][value], int): return need_tune_json[key]['options'][value] else: raise TypeError("Wrong int type, please check json file") def merge_attrs(attrs, config, need_tune_json): tiling = [getattr(config, name) for name in getattr( config, '_fields') if name.startswith('tiling')] dim_str = '' d_config = config._asdict() d_attrs = attrs._asdict() is_2d_tiling = False for name in getattr(config, '_fields'): if name.startswith('tiling'): if name.count("_") == 2: is_2d_tiling = True break for i, element in enumerate(tiling): if is_2d_tiling: if i % 2 == 0: dim_str += "0 " + str(i//2) + " " dim_str += str(element) + " " else: # 1d tiling dim_str += "0 " + str(i) + " " + str(element) + " 1 " # add block, thread information block = [str(getattr(config, name)) for name in getattr( config, '_fields') if name.startswith('block')] bind_block_str = ' '.join(block) thread = [str(getattr(config, name)) for name in getattr( config, '_fields') if name.startswith('thread')] bind_thread_str = ' '.join(thread) d_attrs['dim'] = dim_str d_attrs['bind_block'] = bind_block_str d_attrs['bind_thread'] = bind_thread_str need_tune_keys = need_tune_json.keys() for key in need_tune_keys: d_attrs[key] = d_config[key] # make a new attrs with config info attrs_type = type(attrs) config_list = [get_real_attr(d_attrs[k],k,need_tune_json, need_tune_keys) for k in d_attrs] new_attrs = attrs_type(*config_list) return new_attrs def get_skip_configs_from_log(skip_configs_log): skip_config_set = set() if skip_configs_log != "": with open(skip_configs_log, 'r') as file: for line in file: config = str(line.split("|")[1]).strip() skip_config_set.add(config) print("SKIP CONFIGS NUMBER:", len(skip_config_set)) return skip_config_set def get_tuning_attrs_from_json(tuning_attrs_json): import json need_tune_spaces = [[]] keys = [] json_string = dict() if tuning_attrs_json != "": with open(tuning_attrs_json,'r') as file: json_string =json.load(file) for key in json_string.keys(): keys.append(key) num_options = len(json_string[key]['options']) tmp_spaces = [] for space in need_tune_spaces: for i in range(num_options): tmp_space = space[:] tmp_space.append(i) tmp_spaces.append(tmp_space) need_tune_spaces = tmp_spaces[:] return (keys, need_tune_spaces, json_string) if __name__ == "__main__": """test components""" file_name = "tuning_attrs_descs/reduce_tuning_attrs_desc.json" keys, need_tune_spaces = get_tuning_attrs_from_json(file_name) print(keys) print(need_tune_spaces)
import json import math import pandas as pd from scipy import stats from lib.settings import DATA_DIR from lib.characters import ALL_NAMES from lib.episodes import getSequentialEpisodeNumber raw_comments = pd.read_csv(DATA_DIR / "comments.csv") raw_mentions = pd.read_csv(DATA_DIR / "character-mentions.csv") raw_sentiments = pd.read_csv(DATA_DIR / "comment-sentiments.csv") partial_comments = raw_comments[["ID", "Season", "Episode"]] comments = pd.merge( partial_comments, raw_sentiments, left_on="ID", right_on="Comment ID", validate="1:1", ) mentions = pd.merge( partial_comments, raw_mentions, left_on="ID", right_on="Comment ID", validate="1:m" ) agg_columns = { "mean": ("Compound Score", "mean"), "n": ("Compound Score", "count"), "err": ("Compound Score", "sem"), } agg_scores_overall = comments.groupby(["Season", "Episode"]).agg(**agg_columns) agg_scores_by_character = mentions.groupby(["Name", "Season", "Episode"]).agg( **agg_columns ) total_mentions_by_episode = agg_scores_by_character.groupby( ["Season", "Episode"] ).n.sum() # Setup the dict to collect the mean scores as lists of dicts means_data = {"overall": []} for name in ALL_NAMES: means_data[name] = [] def create_means_entry(season, episode, mean, n, err): if n < 30: return None margin_of_err = stats.t.ppf(0.95, n - 1) * err return { "season": season, "episode": episode, "x": getSequentialEpisodeNumber(season, episode), "y": mean, "n": n, "lower": mean - margin_of_err, "upper": mean + margin_of_err, } # Collect overall scores from all comments for row in agg_scores_overall.itertuples(name="Row"): entry = create_means_entry(row[0][0], row[0][1], *row[1:]) if entry == None: continue means_data["overall"].append(entry) for row in agg_scores_by_character.itertuples(name="Row"): name = row[0][0] season = row[0][1] episode = row[0][2] n = row[2] if means_data[name] == None: means_data[name] = [] entry = create_means_entry(season, episode, *row[1:]) if entry == None: continue entry["proportion"] = n / (total_mentions_by_episode[(season, episode)]) means_data[name].append(entry) json.dump(means_data, open(DATA_DIR / "mean-scores.json", "w"), indent=2) # View the average score by character avg_score_by_char = ( mentions.groupby("Name") .agg(mean=("Compound Score", "mean"), n=("Compound Score", "count")) .sort_values("mean") ) # Weight the characters' average scores by the natural log of the number of mentions weighted_avg_scores_by_char = ( avg_score_by_char["mean"] * avg_score_by_char["n"].apply(math.log) ).sort_values() # Export the views as CSV for the client avg_score_by_char.to_csv( DATA_DIR / "avg-score-by-character.csv", index_label="name", header=True ) weighted_avg_scores_by_char.to_csv( DATA_DIR / "weighted-avg-score-by-character.csv", index_label="name", header=["weigted_mean"], )
<reponame>Waterpine/dataprep-1 """ This file defines palettes used for EDA. """ from bokeh.palettes import Category10, Category20, Greys256, Pastel1, viridis BRG = ["#1f78b4", "#d62728", "#2ca02c"] CATEGORY10 = Category10[10] CATEGORY20 = Category20[20] GREYS256 = Greys256 PASTEL1 = Pastel1[9] VIRIDIS = viridis(256) RDBU = [ "#053061", "#063263", "#073466", "#083669", "#09386c", "#0a3a6f", "#0b3c72", "#0c3e75", "#0d4078", "#0e437b", "#0f457e", "#114781", "#124984", "#134b87", "#144d8a", "#154f8d", "#165190", "#175493", "#185695", "#195898", "#1a5a9b", "#1c5c9e", "#1d5ea1", "#1e60a4", "#1f62a7", "#2064aa", "#2166ac", "#2368ad", "#246aae", "#256caf", "#276db0", "#286fb0", "#2971b1", "#2b73b2", "#2c75b3", "#2d76b4", "#2f78b5", "#307ab6", "#317cb7", "#337db8", "#347fb9", "#3581b9", "#3783ba", "#3884bb", "#3986bc", "#3b88bd", "#3c8abe", "#3d8bbf", "#3f8dc0", "#408fc1", "#4191c2", "#4393c3", "#4694c4", "#4996c5", "#4c98c6", "#4f9ac7", "#529cc8", "#559ec9", "#58a0ca", "#5ba2cb", "#5ea4cc", "#61a6cd", "#65a8ce", "#68aacf", "#6bacd0", "#6eaed1", "#71b0d2", "#74b2d3", "#77b4d5", "#7ab6d6", "#7db8d7", "#80bad8", "#84bcd9", "#87beda", "#8ac0db", "#8dc2dc", "#90c4dd", "#93c5de", "#95c6df", "#98c8df", "#9ac9e0", "#9dcae1", "#9fcbe1", "#a2cde2", "#a4cee3", "#a7cfe4", "#a9d0e4", "#abd2e5", "#aed3e6", "#b0d4e6", "#b3d5e7", "#b5d7e8", "#b8d8e8", "#bad9e9", "#bddaea", "#bfdceb", "#c2ddeb", "#c4deec", "#c7dfed", "#c9e1ed", "#cce2ee", "#cee3ef", "#d1e5f0", "#d2e5f0", "#d3e6f0", "#d5e7f0", "#d6e7f1", "#d8e8f1", "#d9e9f1", "#dbe9f1", "#dceaf2", "#deebf2", "#dfecf2", "#e1ecf3", "#e2edf3", "#e4eef3", "#e5eef3", "#e7eff4", "#e8f0f4", "#eaf1f4", "#ebf1f4", "#edf2f5", "#eef3f5", "#f0f3f5", "#f1f4f6", "#f3f5f6", "#f4f5f6", "#f6f6f6", "#f7f6f6", "#f7f5f4", "#f7f4f2", "#f7f3f0", "#f8f2ee", "#f8f0ec", "#f8efea", "#f8eee8", "#f9ede7", "#f9ece5", "#f9ebe3", "#f9eae1", "#f9e9df", "#fae8dd", "#fae7db", "#fae5d9", "#fae4d7", "#fbe3d6", "#fbe2d4", "#fbe1d2", "#fbe0d0", "#fcdfce", "#fcdecc", "#fcddca", "#fcdcc8", "#fddbc7", "#fcd8c4", "#fcd6c1", "#fbd4be", "#fbd2bc", "#fbd0b9", "#faceb6", "#faccb4", "#facab1", "#f9c7ae", "#f9c5ab", "#f9c3a9", "#f8c1a6", "#f8bfa3", "#f8bda1", "#f7bb9e", "#f7b99b", "#f7b698", "#f6b496", "#f6b293", "#f5b090", "#f5ae8e", "#f5ac8b", "#f4aa88", "#f4a886", "#f4a683", "#f3a380", "#f2a07e", "#f19e7c", "#ef9b7a", "#ee9878", "#ed9676", "#ec9374", "#eb9072", "#ea8d70", "#e88b6e", "#e7886c", "#e6856a", "#e58368", "#e48065", "#e27d63", "#e17b61", "#e0785f", "#df755d", "#de725b", "#dd7059", "#db6d57", "#da6a55", "#d96853", "#d86551", "#d7624f", "#d6604d", "#d45d4b", "#d35a4a", "#d15749", "#d05447", "#ce5146", "#cd4f44", "#cc4c43", "#ca4942", "#c94641", "#c7433f", "#c6403e", "#c53e3c", "#c33b3b", "#c2383a", "#c03538", "#bf3237", "#be3036", "#bc2d34", "#bb2a33", "#b92732", "#b82431", "#b6212f", "#b51f2e", "#b41c2d", "#b2192b", "#b0172a", "#ad162a", "#aa1529", "#a71429", "#a41328", "#a11228", "#9e1127", "#9b1027", "#991027", "#960f26", "#930e26", "#900d25", "#8d0c25", "#8a0b24", "#870a24", "#840923", "#810823", "#7e0722", "#7b0622", "#780521", "#750421", "#720320", "#6f0220", "#6c011f", "#69001f", "#67001f", ] YlGnBu = [ "#ffffd9", "#feffd8", "#feffd6", "#fdfed5", "#fdfed4", "#fcfed3", "#fcfed2", "#fbfdd0", "#fafdcf", "#fafdce", "#f9fdcd", "#f9fdcb", "#f8fcca", "#f7fcc9", "#f7fcc8", "#f6fcc7", "#f6fbc6", "#f5fbc5", "#f4fbc4", "#f4fbc3", "#f3fac2", "#f2fac1", "#f1fac0", "#f1f9bf", "#f0f9be", "#eff9bd", "#eff9bc", "#eef8bb", "#edf8bb", "#ecf8ba", "#ebf7b9", "#eaf7b9", "#eaf7b8", "#e9f6b8", "#e8f6b7", "#e7f6b7", "#e6f5b6", "#e5f5b6", "#e4f4b5", "#e3f4b5", "#e2f4b5", "#e1f3b4", "#e0f3b4", "#dff2b4", "#ddf2b4", "#dcf1b4", "#dbf1b4", "#daf0b4", "#d9f0b3", "#d7efb3", "#d6efb3", "#d5eeb3", "#d3eeb3", "#d2edb3", "#d1edb4", "#cfecb4", "#ceecb4", "#ccebb4", "#cbebb4", "#c9eab4", "#c8e9b4", "#c6e9b4", "#c4e8b4", "#c3e7b5", "#c1e7b5", "#bfe6b5", "#bde5b5", "#bce5b5", "#bae4b5", "#b8e3b6", "#b6e2b6", "#b4e2b6", "#b2e1b6", "#b0e0b6", "#aedfb6", "#acdfb7", "#aadeb7", "#a8ddb7", "#a6dcb7", "#a4dbb7", "#a2dbb8", "#a0dab8", "#9ed9b8", "#9cd8b8", "#99d7b9", "#97d7b9", "#95d6b9", "#93d5b9", "#91d4b9", "#8fd3ba", "#8dd2ba", "#8ad2ba", "#88d1ba", "#86d0bb", "#84cfbb", "#82cebb", "#80cebb", "#7ecdbc", "#7cccbc", "#7acbbc", "#78cabc", "#76cabd", "#73c9bd", "#71c8bd", "#6fc7bd", "#6dc6be", "#6bc6be", "#6ac5be", "#68c4be", "#66c3bf", "#64c3bf", "#62c2bf", "#60c1bf", "#5ec0c0", "#5cbfc0", "#5abfc0", "#59bec0", "#57bdc0", "#55bcc1", "#53bbc1", "#52bac1", "#50bac1", "#4eb9c1", "#4db8c1", "#4bb7c1", "#49b6c2", "#48b5c2", "#46b4c2", "#45b3c2", "#43b2c2", "#42b1c2", "#40b0c2", "#3fafc2", "#3daec2", "#3cadc2", "#3bacc2", "#39abc2", "#38aac2", "#37a9c2", "#35a8c2", "#34a7c2", "#33a6c2", "#32a5c2", "#31a3c1", "#30a2c1", "#2fa1c1", "#2ea0c1", "#2d9fc1", "#2c9dc0", "#2b9cc0", "#2a9bc0", "#299ac0", "#2898bf", "#2897bf", "#2796bf", "#2695be", "#2693be", "#2592be", "#2591bd", "#248fbd", "#248ebc", "#238cbc", "#238bbb", "#228abb", "#2288ba", "#2287ba", "#2185b9", "#2184b9", "#2182b8", "#2181b8", "#217fb7", "#217eb6", "#207cb6", "#207bb5", "#2079b5", "#2078b4", "#2076b3", "#2075b3", "#2073b2", "#2072b1", "#2070b1", "#216fb0", "#216daf", "#216cae", "#216aae", "#2169ad", "#2167ac", "#2166ac", "#2164ab", "#2163aa", "#2261aa", "#2260a9", "#225ea8", "#225da7", "#225ca7", "#225aa6", "#2259a5", "#2257a5", "#2256a4", "#2354a3", "#2353a3", "#2352a2", "#2350a1", "#234fa0", "#234ea0", "#234c9f", "#234b9e", "#234a9d", "#23499d", "#23479c", "#23469b", "#23459a", "#224499", "#224298", "#224197", "#224096", "#223f95", "#223e94", "#213d93", "#213c92", "#213a91", "#203990", "#20388f", "#20378d", "#1f368c", "#1f358b", "#1e348a", "#1e3388", "#1d3287", "#1d3185", "#1c3184", "#1c3082", "#1b2f81", "#1a2e7f", "#1a2d7e", "#192c7c", "#182b7a", "#172b79", "#172a77", "#162975", "#152874", "#142772", "#132770", "#13266e", "#12256c", "#11246b", "#102469", "#0f2367", "#0e2265", "#0d2163", "#0d2161", "#0c2060", "#0b1f5e", "#0a1e5c", "#091e5a", "#081d58", ]
<gh_stars>0 from common.services import cointainer_web3 as web3 import logging import sha3 logger = logging.getLogger('watchtower.ingester.tasks') WETH_CONTRACT_ADDRESS = '0xc02aaa39b223fe8d0a0e5c4f27ead9083c756cc2' ZX_PROXY_CONTRACT = '0xdef1c0ded9bec7f1a1670819833240f027b25eff' k = sha3.keccak_256() k.update('Withdrawal(address,uint256)'.encode('utf-8')) weth_withdrawal_topic = '0x' + k.hexdigest() k = sha3.keccak_256() k.update('Deposit(address,uint256)'.encode('utf-8')) weth_deposit_topic = '0x' + k.hexdigest() def get_dex_eth_deposits(block): block_hash = web3.toHex(block.get('hash')) block_height = block.get('number') logs = web3.eth.getLogs({ 'fromBlock': block_height, 'toBlock': block_height, 'topics': [weth_deposit_topic] }) if len(logs) < 1: logger.info('No logs of type weth deposit found for block %s %s', block_height, block_hash) from_addresses = dict() contract_addresses = dict() weth_deposit_transactions = dict() for tx in block.transactions: from_addresses[tx.get('hash').hex()] = tx['from'] contract_addresses[tx.get('hash').hex()] = tx['to'] for log in logs: txid = web3.toHex(log.get('transactionHash')) log_contract_address = log.get('address').lower() contract_address = contract_addresses.get(txid) if contract_address != None: contract_address = contract_address.lower() if log_contract_address != WETH_CONTRACT_ADDRESS: continue if contract_address != ZX_PROXY_CONTRACT: continue weth_deposit_transactions[txid] = ({ 'txid': txid, 'contract_address': contract_address, 'from_address': from_addresses.get(txid), 'to_address': contract_address, 'block_height': block_height, 'block_hash': block_hash, 'amount': int(log.get('data'), 16) }) return weth_deposit_transactions def get_dex_eth_withdrawals(block): block_hash = web3.toHex(block.get('hash')) block_height = block.get('number') logs = web3.eth.getLogs({ 'fromBlock': block_height, 'toBlock': block_height, 'topics': [weth_withdrawal_topic] }) if len(logs) < 1: logger.info('No logs of type weth withdrawal found for block %s %s', block_height, block_hash) from_addresses = dict() contract_addresses = dict() weth_withdrawal_transactions = dict() for tx in block.transactions: from_addresses[tx.get('hash').hex()] = tx['from'] contract_addresses[tx.get('hash').hex()] = tx['to'] for log in logs: txid = web3.toHex(log.get('transactionHash')) log_contract_address = log.get('address').lower() contract_address = contract_addresses.get(txid) if contract_address != None: contract_address = contract_address.lower() if log_contract_address != WETH_CONTRACT_ADDRESS: continue if contract_address != ZX_PROXY_CONTRACT: continue weth_withdrawal_transactions[txid] = ({ 'txid': txid, 'contract_address': contract_address, 'from_address': contract_address, 'to_address': from_addresses.get(txid), 'block_height': block_height, 'block_hash': block_hash, 'amount': int(log.get('data'), 16) }) return weth_withdrawal_transactions def get_dex_eth_txs(block): withdrawals = get_dex_eth_withdrawals(block) deposits = get_dex_eth_deposits(block) all = withdrawals.copy() all.update(deposits) return all
<filename>PixivDownloader.py # -*- coding: utf-8 -*- """ Created on Sat Mar 16 19:38:14 2019 AIに食わせる画像を探すためにpixivpyをやります。 タグで探せるようにつくります。 とりあえずクラス化しました。 """ from pixivpy3 import AppPixivAPI from pixivpy3 import PixivAPI import os class PixivDownloader : def __init__(self): self.pixiv = PixivAPI() self.app_pixiv = AppPixivAPI() def login(self, user_id, user_password): return self.pixiv.login(user_id, user_password) def download(self, save_num, query, search_mode = "text", search_types = ["illustration"], save_path = "C:/Users/"+ os.environ.get("USERNAME") +"/Pictures", worst_score = 0, worst_views = 0, worst_favo = 0, r18_flag = False, ): # 検索 search_result = self.pixiv.search_works(query, page = 1, per_page = save_num, mode = search_mode, types = search_types) # save_num の数ダウンロードしたいが、そもそも画像が少ない場合はあるだけダウンロード if save_num > search_result.pagination.total: save_num = search_result.pagination.total # セーブ先 無ければつくる save_path = save_path + "/" + query[0] + "/" if not os.path.exists(save_path): os.mkdir(save_path) current_work = 0 total_downloaded = 0 page_num = 2 while total_downloaded < save_num: if current_work == save_num: # 条件不一致で飛ばされるので、不足分を補う為にもう一度読み込み if search_result.pagination.next == None: # これ以上読み込めない場合は終了 break current_work = 0 search_result = self.pixiv.search_works(query, page = page_num, per_page = save_num, mode = search_mode, types = search_types) if save_num > len(search_result.response): save_num = len(search_result.response) page_num += 1 work = search_result.response[current_work] current_work += 1 if work.page_count > 1: # 複数セット省く print("Out "+work.title+":セット") continue if work.stats.score < worst_score: # Scoreによる選別 continue if work.stats.views_count < worst_views: # 閲覧数による選別 print("Out "+work.title+":閲覧数") continue if work.stats.favorited_count.public < worst_favo: # いいねによる選別 print("Out "+work.title+":いいね") continue if r18_flag == (work.age_limit == "all-age"): # 年齢制限の有無 print("Out "+work.title+":年齢制限") continue if os.path.exists(save_path+str(work.id)+"_p0.png") or os.path.exists(save_path+str(work.id)+"_p0.jpg"): # 既に同名のファイルがある場合 print(work.title +" has already downloaded") continue # Download self.pixiv.download(work.image_urls.large, save_path) total_downloaded += 1; print("Downloaded {0}/{1}".format(total_downloaded, save_num)+':'+str(work.title)) # 使用例 if __name__ == "__main__": # 指定するものとか save_works_num = 1000 favo = 10 mode = ["exact_tag"] search_tags = [["カリオストロ(グラブル)"], ["櫻井桃華"], ["ネロ・クラウディウス"], ["ギルガメッシュ"], ["沙都子"], ["木之本桜"]] save_path = "" p = PixivDownloader() p.login("id", "pass") data = [] for data in search_tags: p.download(save_works_num, data, search_mode = mode, save_path=save_path, worst_favo=favo) print("Complete!")
#--------ESRI 2010------------------------------------- #------------------------------------------------------------------------------- # Copyright 2010-2013 Esri # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. #------------------------------------------------------------------------------- # Rejoin tracks # This script will take any number of tracks selected in #'inTrackLines' and condense them to one track, updating # all the associated points to the new single track id # INPUTS: # Input Track Lines (FEATURELAYER) # Input Track Points (FEATURELAYER) # Field in which Track IDs are stored (FIELD) # Field in which start date time of track line is stored (FIELD) # Field in which finish date time of track line is stored (FIELD) # OUTPUTS: # Output Track Lines - derived (FEATURELAYER) # Output Track Points - derived (FEATURELAYER) #------------------------------------------------------------------------------- import arcpy from arcpy import env import datetime env.overwriteOutput = True try: #set features and cursors so that they are deletable in #'finally' block should the script fail prior to their creation updatefeat, updt_cursor = None, None ft, linecursor = None, None feat, ptcursor = None, None inTrackLines = arcpy.GetParameterAsText(0) inTrackPoints = arcpy.GetParameterAsText(1) inTrackIDField = arcpy.GetParameterAsText(2) inStartDateTimeField = arcpy.GetParameterAsText(3) inFinishDateTimeField = arcpy.GetParameterAsText(4) #we'll need to join the lines, so get the shape field name #desc = arcpy.Describe(inTrackLines) #shapefieldname = desc.ShapeFieldName #iterate over each track line, gathering data and deleting all but the first updt_cursor = arcpy.UpdateCursor(inTrackLines,"",None,"",inStartDateTimeField) #updatefeat = updt_cursor.next() #UDPATE updatefeat = next(updt_cursor) loweststart = None highestfinish = None newtrackid = None changedtrackids = None ptarray = arcpy.Array() while updatefeat: startdt = updatefeat.getValue(inStartDateTimeField) finishdt = updatefeat.getValue(inFinishDateTimeField) shp = updatefeat.shape polyline = shp.getPart(0) #pt = polyline.next() #UDPATE pt = next(polyline) while pt: #add the polyline to the point array that will be used to recreate a joined polyline later ptarray.add(pt) #pt = polyline.next() #UPDATE pt = next(polyline) if loweststart: if startdt < loweststart: loweststart = startdt else: loweststart = startdt if highestfinish: if finishdt > highestfinish: highestfinish = finishdt else: highestfinish = finishdt if newtrackid: if changedtrackids: changedtrackids += " OR \"" + inTrackIDField + "\" = '" + updatefeat.getValue(inTrackIDField) + "'" else: changedtrackids = "\"" + inTrackIDField + "\" = '" + updatefeat.getValue(inTrackIDField) + "'" updt_cursor.deleteRow(updatefeat) else: newtrackid = updatefeat.getValue(inTrackIDField) #updatefeat = updt_cursor.next() #UPDATE updatefeat = next(updt_cursor) #now, update the track line being left with new start and finish datetimes, and new geometry linecursor = arcpy.UpdateCursor(inTrackLines) #ft = linecursor.next() #UPDATE ft = next(linecursor) ft.setValue(inStartDateTimeField, loweststart) ft.setValue(inFinishDateTimeField, highestfinish) ft.shape = ptarray linecursor.updateRow(ft) #finally, update all points with the Track IDs affected to the new Track ID arcpy.AddMessage("update track points where " + changedtrackids) ptcursor = arcpy.UpdateCursor(inTrackPoints,changedtrackids) #feat = ptcursor.next() #UPDATE feat = next(ptcursor) while feat: feat.setValue(inTrackIDField, newtrackid) ptcursor.updateRow(feat) #feat = ptcursor.next() #UPDATE feat = next(ptcursor) arcpy.SetParameterAsText(5, inTrackLines) arcpy.SetParameterAsText(6, inTrackPoints) except: if not arcpy.GetMessages() == "": arcpy.AddMessage(arcpy.GetMessages(2)) finally: if updatefeat: del updatefeat if updt_cursor: del updt_cursor if ft: del ft if linecursor: del linecursor if feat: del feat if ptcursor: del ptcursor
import cv2 import numpy as np class Thresholds: def __init__(self): self._HLS_H_THRESHOLD = (100, 255) self._HLS_L_THRESHOLD = (100, 255) self._HLS_S_THRESHOLD = (100, 255) self._SOBEL_THRESHOLD = (20, 100) self._SOBEL_KERNEL = 3 self._GRAD_MAG_THRESHOLD = (30, 170) self._GRAD_DIR_THRESHOLD = (1.5, np.pi/2) # Function that filters the H-channel of HLS with a threshold def hls_h_select(self, img): hls = cv2.cvtColor(img, cv2.COLOR_BGR2HLS) h_channel = hls[:,:,0] binary_output = np.zeros_like(h_channel) binary_output[(h_channel > self._HLS_H_THRESHOLD[0]) & (h_channel <= self._HLS_H_THRESHOLD[1])] = 1 return binary_output # Function that filters the L-channel of HLS with a threshold def hls_l_select(self, img): hls = cv2.cvtColor(img, cv2.COLOR_BGR2HLS) l_channel = hls[:,:,1] binary_output = np.zeros_like(l_channel) binary_output[(l_channel > self._HLS_L_THRESHOLD[0]) & (l_channel <= self._HLS_L_THRESHOLD[1])] = 1 return binary_output # Function that filters the S-channel of HLS with a threshold def hls_s_select(self, img): hls = cv2.cvtColor(img, cv2.COLOR_BGR2HLS) s_channel = hls[:,:,2] binary_output = np.zeros_like(s_channel) binary_output[(s_channel > self._HLS_S_THRESHOLD[0]) & (s_channel <= self._HLS_S_THRESHOLD[1])] = 1 return binary_output # Function that filters gradient's orientation with a threshold def abs_sobel_thresh(self, img, orient='x'): # Convert to grayscale gray = cv2.cvtColor(img, cv2.COLOR_BGR2GRAY) # Apply x or y gradient with the OpenCV Sobel() function # and take the absolute value if orient == 'x': abs_sobel = np.absolute(cv2.Sobel(gray, cv2.CV_64F, 1, 0, ksize=self._SOBEL_KERNEL)) if orient == 'y': abs_sobel = np.absolute(cv2.Sobel(gray, cv2.CV_64F, 0, 1, ksize=self._SOBEL_KERNEL)) # Rescale back to 8 bit integer scaled_sobel = np.uint8(255*abs_sobel/np.max(abs_sobel)) # Create a copy and apply the threshold binary_output = np.zeros_like(scaled_sobel) # Here I'm using inclusive (>=, <=) thresholds, but exclusive is ok too binary_output[(scaled_sobel >= self._SOBEL_THRESHOLD[0]) & (scaled_sobel <= self._SOBEL_THRESHOLD[1])] = 1 # Return the result return binary_output # Function that filters gradient's magnitude with a threshold def mag_thresh(self, img): # Convert to grayscale gray = cv2.cvtColor(img, cv2.COLOR_BGR2GRAY) # Take both Sobel x and y gradients sobelx = cv2.Sobel(gray, cv2.CV_64F, 1, 0, ksize=self._SOBEL_KERNEL) sobely = cv2.Sobel(gray, cv2.CV_64F, 0, 1, ksize=self._SOBEL_KERNEL) # Calculate the gradient magnitude gradmag = np.sqrt(sobelx**2 + sobely**2) # Rescale to 8 bit scale_factor = np.max(gradmag)/255 gradmag = (gradmag/scale_factor).astype(np.uint8) # Create a binary image of ones where threshold is met, zeros otherwise binary_output = np.zeros_like(gradmag) binary_output[(gradmag >= self._GRAD_MAG_THRESHOLD[0]) & (gradmag <= self._GRAD_MAG_THRESHOLD[1])] = 1 # Return the binary image return binary_output # Function that filters gradient's direction with a threshold def dir_threshold(self, img): # Grayscale gray = cv2.cvtColor(img, cv2.COLOR_BGR2GRAY) # Calculate the x and y gradients sobelx = cv2.Sobel(gray, cv2.CV_64F, 1, 0, ksize=self._SOBEL_KERNEL) sobely = cv2.Sobel(gray, cv2.CV_64F, 0, 1, ksize=self._SOBEL_KERNEL) # Take the absolute value of the gradient direction, # apply a threshold, and create a binary image result absgraddir = np.arctan2(np.absolute(sobely), np.absolute(sobelx)) binary_output = np.zeros_like(absgraddir) binary_output[(absgraddir >= self._GRAD_DIR_THRESHOLD[0]) & (absgraddir <= self._GRAD_DIR_THRESHOLD[1])] = 1 # Return the binary image return binary_output def combine(self, img): # Combine thresholding gradx = self.abs_sobel_thresh(img, orient='x') mag_binary = self.mag_thresh(img) s_binary = self.hls_s_select(img) l_binary = self.hls_l_select(img) combined = np.zeros_like(gradx) combined[(gradx == 1) | ((s_binary == 1) & (l_binary == 1))] = 1 return combined
<gh_stars>0 import json from collections import defaultdict from typing import List, Dict, Any, Union import numpy as np from py_lex import EmoLex import torch from torch.utils.data import Dataset from pytorch_gleam.data.datasets.base_datasets import BaseDataModule from pytorch_gleam.data.collators import MultiClassFrameEdgeBatchCollator import pytorch_gleam.data.datasets.senticnet5 as senticnet5 from tqdm import tqdm def read_jsonl(path): with open(path, 'r') as f: for line in f: line = line.strip() if line: ex = json.loads(line) yield ex def get_sentic(word_text): word_text = word_text.lower() if word_text == 'coronavirus' or word_text == 'covid-19' or word_text == 'covid' or word_text == 'covid19': word_text = 'virus' if word_text not in senticnet5.senticnet: word_text = word_text[:-1] if word_text not in senticnet5.senticnet: word_text = word_text[:-1] if word_text not in senticnet5.senticnet: return None p_v, a_v, s_v, ap_v, p_m, s_m, po_l, po_v, s1, s2, s3, s4, s5 = senticnet5.senticnet[word_text] return { 'pleasantness_value': float(p_v), 'attention_value': float(a_v), 'sensitivity_value': float(s_v), 'aptitude_value': float(ap_v), 'primary_mood': p_m, 'secondary_mood': s_m, 'polarity_label': po_l, 'polarity_value': float(po_v), 'semantics': [s1, s2, s3, s4, s5], } def add_sentic_token_features(token_data): sentic = get_sentic(token_data['text']) token_data['sentic'] = sentic return token_data def align_tokens(tokens, wpt_tokens, seq_offset=0): align_map = {} for token in tokens: token['wpt_idxs'] = set() start = token['start'] end = token['end'] for char_idx in range(start, end): sub_token_idx = wpt_tokens.char_to_token(char_idx, sequence_index=seq_offset) # White spaces have no token and will return None if sub_token_idx is not None: align_map[sub_token_idx] = token token['wpt_idxs'].add(sub_token_idx) return align_map def align_token_sequences(m_tokens, t_tokens, wpt_tokens): m_align_map = align_tokens(m_tokens, wpt_tokens) t_align_map = align_tokens(t_tokens, wpt_tokens, seq_offset=1) align_map = {**m_align_map, **t_align_map} aligned_tokens = [] for sub_token_idx in range(len(wpt_tokens['input_ids'])): if sub_token_idx not in align_map: # CLS, SEP, or other special token aligned_token = { 'pos': 'NONE', 'dep': 'NONE', 'head': 'NONE', 'sentic': None, 'text': '[CLS]' if sub_token_idx == 0 else '[SEP]', 'wpt_idxs': {sub_token_idx} } align_map[sub_token_idx] = aligned_token aligned_token = align_map[sub_token_idx] aligned_tokens.append(aligned_token) return align_map, aligned_tokens def flatten(multi_list): return [item for sub_list in multi_list for item in sub_list] def create_adjacency_matrix(edges, size, t_map, r_map): adj = np.eye(size, dtype=np.float32) for input_idx in range(size): input_idx_text = t_map[input_idx] i_edges = set(flatten([r_map[e_txt] for e_txt in edges[input_idx_text]])) for edge_idx in i_edges: adj[input_idx, edge_idx] = 1.0 adj[edge_idx, input_idx] = 1.0 return adj def sentic_expand(sentic_edges, expand_list): new_edges = set(sentic_edges) for edge in sentic_edges: edge_info = senticnet5.senticnet[edge] for i in expand_list: new_edges.add(edge_info[i]) return new_edges def create_edges( m_tokens, t_tokens, wpt_tokens, num_semantic_hops, num_emotion_hops, num_lexical_hops, emotion_type, emolex, lex_edge_expanded ): seq_len = len(wpt_tokens['input_ids']) align_map, a_tokens = align_token_sequences(m_tokens, t_tokens, wpt_tokens) semantic_edges = defaultdict(set) emotion_edges = defaultdict(set) reverse_emotion_edges = defaultdict(set) lexical_edges = defaultdict(set) reverse_lexical_dep_edges = defaultdict(set) reverse_lexical_pos_edges = defaultdict(set) lexical_dep_edges = defaultdict(set) lexical_pos_edges = defaultdict(set) root_text = None r_map = defaultdict(set) t_map = {} for token in a_tokens: text = token['text'].lower() head = token['head'].lower() for wpt_idx in token['wpt_idxs']: t_map[wpt_idx] = text r_map[text].add(wpt_idx) pos = token['pos'] dep = token['dep'] reverse_lexical_dep_edges[dep].add(text) reverse_lexical_pos_edges[pos].add(text) lexical_dep_edges[text].add(dep) lexical_pos_edges[text].add(pos) # will be two roots with two sequences if dep == 'ROOT': root_text = text sentic = token['sentic'] if sentic is not None: for sem in sentic['semantics']: semantic_edges[text].add(sem) for i in range(num_semantic_hops-1): semantic_edges[text] = sentic_expand(semantic_edges[text], [8, 9, 10, 11, 12]) if emotion_type == 'senticnet': emotion_edges[text].add(sentic['primary_mood']) emotion_edges[text].add(sentic['secondary_mood']) reverse_emotion_edges[sentic['primary_mood']].add(text) reverse_emotion_edges[sentic['secondary_mood']].add(text) elif emotion_type == 'emolex': for emotion in emolex.categorize_token(text): emotion_edges[text].add(emotion) reverse_emotion_edges[emotion].add(text) else: raise ValueError(f'Invalid emotion type: {emotion_type}') # for emotion in [sentic['primary_mood'], sentic['secondary_mood']]: # emotion_edges[text] = emotion_edges[text].union(emotion_nodes[emotion]) # for i in range(num_emotion_hops - 1): # new_emotions = sentic_expand(emotion_edges[text], [4, 5]) # for emotion in new_emotions: # emotion_edges[text] = emotion_edges[text].union(emotion_nodes[emotion]) lexical_edges[text].add(head) lexical_edges['[CLS]'].add(root_text) lexical_edges['[SEP]'].add(root_text) # text -> emotion node -> other text in sentence with same emotions for text in emotion_edges.keys(): emotions = emotion_edges[text] emotion_edges[text] = emotion_edges[text].union( set(flatten(reverse_emotion_edges[emotion] for emotion in emotions)) ) if 'dep' in lex_edge_expanded: for text in lexical_edges.keys(): # expand lexical edges to same dependency roles text_deps = lexical_dep_edges[text] lexical_edges[text] = lexical_edges[text].union( set(flatten(reverse_lexical_dep_edges[dep] for dep in text_deps)) ) if 'pos' in lex_edge_expanded: for text in lexical_edges.keys(): # expand lexical edges to same pos tags text_pos = lexical_pos_edges[text] lexical_edges[text] = lexical_edges[text].union( set(flatten(reverse_lexical_pos_edges[pos] for pos in text_pos)) ) semantic_adj = create_adjacency_matrix( edges=semantic_edges, size=seq_len, t_map=t_map, r_map=r_map ) emotion_adj = create_adjacency_matrix( edges=emotion_edges, size=seq_len, t_map=t_map, r_map=r_map ) lexical_adj = create_adjacency_matrix( edges=lexical_edges, size=seq_len, t_map=t_map, r_map=r_map ) edges = { 'semantic': semantic_adj, 'emotion': emotion_adj, 'lexical': lexical_adj, } return edges class MultiClassFrameEdgeDataset(Dataset): examples: List[Dict[Any, Union[Any, Dict]]] def __init__( self, data_path: Union[str, List[str]], frame_path: str, label_name: str, tokenizer, label_map: Dict[str, int], emo_path: str, num_semantic_hops: int = 3, num_emotion_hops: int = 1, num_lexical_hops: int = 1, emotion_type: str = 'senticnet', lex_edge_expanded: str = 'none', ): super().__init__() self.frame_path = frame_path self.tokenizer = tokenizer self.label_name = label_name self.label_map = label_map self.num_semantic_hops = num_semantic_hops self.num_emotion_hops = num_emotion_hops self.num_lexical_hops = num_lexical_hops self.emotion_type = emotion_type self.lex_edge_expanded = lex_edge_expanded self.emolex = EmoLex(emo_path) self.examples = [] with open(self.frame_path) as f: self.frames = json.load(f) if isinstance(data_path, str): self.read_path(data_path) else: for stage, stage_path in enumerate(data_path): self.read_path(stage_path, stage) def parse_example(self, ex): ex_id = ex['id'] ex_text = ex['full_text'] if 'full_text' in ex else ex['text'] ex_text = ex_text.strip().replace('\r', ' ').replace('\n', ' ') ex_examples = [] for f_id, f_label in ex[self.label_name].items(): frame = self.frames[f_id] frame_text = frame['text'] ex_label = 0 if f_label in self.label_map: ex_label = self.label_map[f_label] token_data = self.tokenizer( frame_text, ex_text ) tweet_parse = [add_sentic_token_features(x) for x in ex['parse']] f_parse = [add_sentic_token_features(x) for x in frame['parse']] ex_edges = create_edges( f_parse, tweet_parse, token_data, self.num_semantic_hops, self.num_emotion_hops, self.num_lexical_hops, self.emotion_type, self.emolex, self.lex_edge_expanded, ) example = { 'ids': f'{ex_id}|{f_id}', 'label': ex_label, 'input_ids': token_data['input_ids'], 'attention_mask': token_data['attention_mask'], 'edges': ex_edges } if 'token_type_ids' in token_data: example['token_type_ids'] = token_data['token_type_ids'] ex_examples.append(example) return ex_examples def read_path(self, data_path, stage=0): for ex in tqdm(read_jsonl(data_path)): for ex_examples in self.parse_example(ex): self.examples.append(ex_examples) def __len__(self): return len(self.examples) def __getitem__(self, idx): if torch.is_tensor(idx): idx = idx.tolist() example = self.examples[idx] return example def worker_init_fn(self, _): pass class MultiClassFrameEdgeDataModule(BaseDataModule): def __init__( self, label_name: str, label_map: Dict[str, int], frame_path: str, emo_path: str, num_semantic_hops: int = 3, num_emotion_hops: int = 1, num_lexical_hops: int = 1, emotion_type: str = 'senticnet', lex_edge_expanded: str = 'none', train_path: str = None, val_path: str = None, test_path: str = None, predict_path: str = None, *args, **kwargs ): super().__init__(*args, **kwargs) self.label_map = label_map self.label_name = label_name self.train_path = train_path self.val_path = val_path self.test_path = test_path self.predict_path = predict_path self.frame_path = frame_path if self.train_path is not None: self.train_dataset = MultiClassFrameEdgeDataset( tokenizer=self.tokenizer, data_path=self.train_path, frame_path=self.frame_path, label_name=self.label_name, label_map=self.label_map, emo_path=emo_path, num_semantic_hops=num_semantic_hops, num_emotion_hops=num_emotion_hops, num_lexical_hops=num_lexical_hops, emotion_type=emotion_type, lex_edge_expanded=lex_edge_expanded, ) if self.val_path is not None: self.val_dataset = MultiClassFrameEdgeDataset( tokenizer=self.tokenizer, data_path=self.val_path, frame_path=self.frame_path, label_name=self.label_name, label_map=self.label_map, emo_path=emo_path, num_semantic_hops=num_semantic_hops, num_emotion_hops=num_emotion_hops, num_lexical_hops=num_lexical_hops, emotion_type=emotion_type, lex_edge_expanded=lex_edge_expanded, ) if self.test_path is not None: self.test_dataset = MultiClassFrameEdgeDataset( tokenizer=self.tokenizer, data_path=self.test_path, frame_path=self.frame_path, label_name=self.label_name, label_map=self.label_map, emo_path=emo_path, num_semantic_hops=num_semantic_hops, num_emotion_hops=num_emotion_hops, num_lexical_hops=num_lexical_hops, emotion_type=emotion_type, lex_edge_expanded=lex_edge_expanded, ) if self.predict_path is not None: self.predict_dataset = MultiClassFrameEdgeDataset( tokenizer=self.tokenizer, data_path=self.predict_path, frame_path=self.frame_path, label_name=self.label_name, label_map=self.label_map, emo_path=emo_path, num_semantic_hops=num_semantic_hops, num_emotion_hops=num_emotion_hops, num_lexical_hops=num_lexical_hops, emotion_type=emotion_type, lex_edge_expanded=lex_edge_expanded, ) def create_collator(self): return MultiClassFrameEdgeBatchCollator( max_seq_len=self.max_seq_len, use_tpus=self.use_tpus, )
from threading import Timer, Thread """ @Todos - Create a method that will call the stop method when the process exits. Because the timer thread continues to run even if the main program/thread is killed by keyboard interrupt, which means that the stop method is never called. - Create a method that allows user to specify if the interval should start running immediately. Meaning that I can create the interval and store the reference first without letting it run, this is so to allow me to do some settings/changes to the object first, or to allow user to only execute this 'loop' when certain conditions are met. - Create a method/check for the user to specify how many times this interval should run. So example would be, I only want this interval based loop to loop a maximum of 10 times before I want it to automatically stop. Or perhaps a time limit for how long this loop should loop for, like loopFor(10mins), meaning after 10 mins, the loop should call self.stop method. This can be possibly implemented by using another 'kill interval' timer that calls the stop method upon timeout. - Since this module is based on the Timer Class from the threading library, and based on threads, it is not advised to use this setInterval Class when doing actions that are CPU intensive and blocking on other threads, which may interfere with the timing of this Class. Will be working on another class based on the same idea that will run in a seperate process instead to allow true parallel and non concurrent execution style. """ class setInterval: """ setInterval Class: This is used to create a type of loop, where a given function/method is called repeatedly every 'n' given seconds, until the stop method is called, or when the main thread dies/exits. Used this to emulate the behaviour of the native setInterval function in JavaScript. """ # To pass in the interval time, callback function, and any arguements for the callback function into the constructor def __init__(self, time, fn, *args, **kwargs): self.__time = time self.fn = fn self.args = args self.kwargs = kwargs # 1st call to function will only happen after the 1st time interval. # Delay the first call to the timeout method by the given time interval self.start() # self.__thread = Thread(target=self.start) # Testing to use threads, so I can make it a daemon to die on main thread exits. # Method to start the timer def start(self): self.__t = Timer(self.__time, self.timeOut) self.__t.start() # Return self to allow the user to do method call chainging. E.g. loop = setInterval(3, fn).start() return self # Method that is run everytime the Timer time's out. def timeOut(self): # Call the given function with any arguements supplied self.fn(*self.args, **self.kwargs) # Call start method to create another Timer object to call this function again on timeout. self.start() # Method to stop the loop, if needed, execute the callback one last time def stop(self, oneLastTime=False): # Kill the timer that repeatedly calls the timeOut method. self.__t.cancel() # If 'oneLastTime' is True, Call the given function with any arguements supplied for the last time. if oneLastTime: self.fn(*self.args, **self.kwargs) # Set/Change the interval for which the timer takes to timeout. New interval will start immediately. def set_interval(self, time): # Stop the current timer self.stop() # Set the time into the object's field self.__time = time # Reset the timer with a newly created Timer object using start method. self.start() # Set the arguements to be passed into the callback function def set_args(self, *args, **kwargs): # Set the input arguements into the object's fields. self.args = args self.kwargs = kwargs if __name__ == "__main__": # If this module called as a standalone module to see how it works, then run the below example code from time import sleep # Print out the docs for setInterval in formatted doc strings # help(setInterval) def hi(val): print(val) try: tout = setInterval(1, hi, 'hei') sleep(3) tout.set_interval(0.1) sleep(2) tout.set_interval(1) tout.set_args('Nuggets') sleep(3) except (KeyboardInterrupt, SystemExit): # Stop the interval, but execute the callback one last time before killing the loop tout.stop(True) tout.stop(True) # If the keyboard interrupts at any time # except KeyboardInterrupt:
# -*- coding: utf-8 -*- # Модуль переменных параметров настройки "Общие данные для расчета динамики" # (таблица "Динамика": com_dynamics) RastrWin3 class ComDynamics: """ """ table: str = 'com_dynamics' table_name: str = '"Общие данные для расчета динамики"' Tras: str = 'Tras' # Время расчета (Tras) Hint: str = 'Hint' # Начальный шаг интегрирования (H_инт) Hmin: str = 'Hmin' # Минимальный шаг интегрирования (H_мин) Hmax: str = 'Hmax' # Максимальный шаг интегрирования (H_макс) Hout: str = 'Hout' # Шаг печати (H_печ) Mint: str = 'Mint' # Основной метод интегрирования (Осн.Метод) SMint: str = 'SMint' # Стартовый метод интегрирования (Старт.Метод) IntEpsilon: str = 'IntEpsilon' # Точность шага интегрирования (dInt) InformOnStepChange: str = 'InformOnStepChange' # Информировать об изменении шага (Выводить шаг) Tf: str = 'Tf' # Постоянная сглаживания угловой скорости (частоты) узла (Tf) dEf: str = 'dEf' # Точность балансировки эдс при учете явнополюсности (dEf) Npf: str = 'Npf' # Макс число пересчетов УР на шаге при учете явнополюсности (Ит) Valid: str = 'Valid' # Контроль входных параметров (Контр.) dempfrec: str = 'dempfrec' # Демпфирование в уравнениях движения (Демпф) corrT: str = 'corrT' # Корректировать Т в парковских моделях (Корр Т) IsDemp: str = 'IsDemp' # Учет демп. момента в моделях с демп контурами (Уч Демп) frSXNtoY: str = 'frSXNtoY' # Напряжения перехода с СХН на шунт (V_минСХРН) SXNTolerance: str = 'SXNTolerance' # Допустимый небаланс СХН (SXNTol) SnapPath: str = 'SnapPath' # Выходной каталог файлов результатов (Кат. результатов) MaxResultFiles: str = 'MaxResultFiles' # Максимальное кол-во файлов результатов (Макс. файлов) SnapTemplate: str = 'SnapTemplate' # Шаблон имени выходного файла (Шаблон имени) SnapAutoLoad: str = 'SnapAutoLoad' # Автозагрузка последнего результата (Автозагрузка) SnapMaxCount: str = 'SnapMaxCount' # Максимальное кол-во слотов результатов (Макс. рез-тов) TripGeneratorOnSpeed: str = 'TripGeneratorOnSpeed' # Отключать генератор при превышении скорости % (Уставка автоматов безопасности) PickupDropout: str = 'PickupDropout' # Информировать о пуске/возврате автоматики (Информировать о пуске/возврате автоматики) RealtimeCSV: str = 'RealtimeCSV' # Выводить контролируемые величины в CSV (Выводить контролируемые величины в CSV) PeriodAngle: str = 'PeriodAngle' # Отображать углы в диапазоне +/-180 (Отображать углы в диапазоне +/-180) ResultFlowDirection: str = 'ResultFlowDirection' # Положительное направление результатов (Положительное направление результатов) TreatWarningsAsErrors: str = 'TreatWarningsAsErrors' # Считать предупреждения ошибками (Предупреждение=Ошибка) EventProcess: str = 'EventProcess' # Метод обработки дискретных изменений (Дискретные изменения) com_dynamics_table = 'com_dynamics' com_dynamics_attributes_list = ['Tras', 'Hint', 'Hmin', 'Hmax', 'Hout', 'Mint', 'SMint', 'IntEpsilon', 'InformOnStepChange', 'Tf', 'dEf', 'Npf', 'Valid', 'dempfrec', 'corrT', 'IsDemp', 'frSXNtoY', 'SXNTolerance', 'SnapPath', 'MaxResultFiles', 'SnapTemplate', 'SnapAutoLoad', 'SnapMaxCount', 'TripGeneratorOnSpeed', 'PickupDropout', 'RealtimeCSV', 'PeriodAngle', 'ResultFlowDirection', 'TreatWarningsAsErrors', 'EventProcess', ] com_dynamics_attributes = { 'Tras': 'Время расчета (Tras)', 'Hint': 'Начальный шаг интегрирования (H_инт)', 'Hmin': 'Минимальный шаг интегрирования (H_мин)', 'Hmax': 'Максимальный шаг интегрирования (H_макс)', 'Hout': 'Шаг печати (H_печ)', 'Mint': 'Основной метод интегрирования (Осн.Метод)', 'SMint': 'Стартовый метод интегрирования (Старт.Метод)', 'IntEpsilon': 'Точность шага интегрирования (dInt)', 'InformOnStepChange': 'Информировать об изменении шага (Выводить шаг)', 'Tf': 'Постоянная сглаживания угловой скорости (частоты) узла (Tf)', 'dEf': 'Точность балансировки эдс при учете явнополюсности (dEf)', 'Npf': 'Макс число пересчетов УР на шаге при учете явнополюсности (Ит)', 'Valid': 'Контроль входных параметров (Контр.)', 'dempfrec': 'Демпфирование в уравнениях движения (Демпф)', 'corrT': 'Корректировать Т в парковских моделях (Корр Т)', 'IsDemp': 'Учет демп. момента в моделях с демп контурами (Уч Демп)', 'frSXNtoY': 'Напряжения перехода с СХН на шунт (V_минСХРН)', 'SXNTolerance': 'Допустимый небаланс СХН (SXNTol)', 'SnapPath': 'Выходной каталог файлов результатов (Кат. результатов)', 'MaxResultFiles': 'Максимальное кол-во файлов результатов (Макс. файлов)', 'SnapTemplate': 'Шаблон имени выходного файла (Шаблон имени)', 'SnapAutoLoad': 'Автозагрузка последнего результата (Автозагрузка)', 'SnapMaxCount': 'Максимальное кол-во слотов результатов (Макс. рез-тов)', 'TripGeneratorOnSpeed': 'Отключать генератор при превышении скорости % (Уставка автоматов безопасности)', 'PickupDropout': 'Информировать о пуске/возврате автоматики (Информировать о пуске/возврате автоматики)', 'RealtimeCSV': 'Выводить контролируемые величины в CSV (Выводить контролируемые величины в CSV)', 'PeriodAngle': 'Отображать углы в диапазоне +/-180 (Отображать углы в диапазоне +/-180)', 'ResultFlowDirection': 'Положительное направление результатов (Положительное направление результатов)', 'TreatWarningsAsErrors': 'Считать предупреждения ошибками (Предупреждение=Ошибка)', 'EventProcess': 'Метод обработки дискретных изменений (Дискретные изменения)' }
<filename>apps/webapp/views.py from django.contrib.auth.decorators import login_required from django.http import HttpResponse, HttpResponseRedirect from django.shortcuts import redirect, render from django.views import generic from django.urls import reverse_lazy from django.utils.decorators import method_decorator from . forms import FilmForm, VehicleForm from . models import Film, FilmCharacter, FilmPlanet, Person, Planet, Species, Starship, Vehicle, VehiclePassenger class HomePageView(generic.TemplateView): template_name = 'webapp/home.html' class AboutPageView(generic.TemplateView): template_name = 'webapp/about.html' def get_context_data(self, **kwargs): context = super().get_context_data(**kwargs) context['Films'] = Film.objects.all().count() context['Persons'] = Person.objects.all().count() context['Planets'] = Planet.objects.all().count() context['Species'] = Species.objects.all().count() context['Starships'] = Starship.objects.all().count() context['Vehicles'] = Vehicle.objects.all().count() return context class ContributerPageView(generic.TemplateView): template_name = 'webapp/contributers.html' # def about(request): # # stripe_key = settings.STRIPE_KEYS['publishable'] # # data = cache.get('resource_data') # # if not data: # # data = get_resource_stats() # # cache.set('resource_data', data, 10000) # # data['stripe_key'] = stripe_key # data = 'A long time ago in a galaxy far, far away.' # return render(request, "about.html", data) class DocsPageView(generic.TemplateView): template_name = 'webapp/docs.html' class RootPageView(generic.TemplateView): template_name = 'webapp/root.html' @method_decorator(login_required, name='dispatch') class FilmCreateView(generic.View): model = Film form_class = FilmForm success_message = "Film created successfully" template_name = 'webapp/film_new.html' def dispatch(self, *args, **kwargs): return super().dispatch(*args, **kwargs) def post(self, request): form = FilmForm(request.POST) if form.is_valid(): film = form.save(commit=False) film.save() for character in form.cleaned_data['characters']: FilmCharacter.objects.create(film=film, character=character) for planet in form.cleaned_data['planets']: FilmPlanet.objects.create(film=film, planet=planet) return redirect(film) # shortcut to object's get_absolute_url() # return HttpResponseRedirect(film.get_absolute_url()) return render(request, 'webapp/film_new.html', {'form': form}) def get(self, request): form = FilmForm() return render(request, 'webapp/film_new.html', {'form': form}) @method_decorator(login_required, name='dispatch') class FilmDeleteView(generic.DeleteView): model = Film success_message = "Film deleted successfully" success_url = reverse_lazy('films') context_object_name = 'film' template_name = 'webapp/film_delete.html' def dispatch(self, *args, **kwargs): return super().dispatch(*args, **kwargs) def delete(self, request, *args, **kwargs): self.object = self.get_object() # Delete FilmJurisdiction entries FilmCharacter.objects \ .filter(film_id=self.object.film_id) \ .delete() FilmPlanet.objects \ .filter(film_id=self.object.film_id) \ .delete() self.object.delete() return HttpResponseRedirect(self.get_success_url()) @method_decorator(login_required, name='dispatch') class FilmUpdateview(generic.UpdateView): model = Film form_class = FilmForm context_object_name = 'film' success_message = "Film updated successfully" template_name = 'webapp/film_update.html' def dispatch(self, *args, **kwargs): return super().dispatch(*args, **kwargs) def form_valid(self, form): film = form.save(commit=False) film.save() # If any existing characters are not in updated list, delete them new_character_ids = [] old_character_ids = FilmCharacter.objects \ .values_list('character_id', flat=True) \ .filter(film_id=film.film_id) # New Character list new_characters = form.cleaned_data['characters'] # Insert new unmatched character entries for character in new_characters: new_id = character.person_id new_character_ids.append(new_id) if new_id in old_character_ids: continue else: FilmCharacter.objects \ .create(film=film, character=character) # Delete old unmatched character entries for old_character_id in old_character_ids: if old_character_id in new_character_ids: continue else: FilmCharacter.objects \ .filter(film_id=film.film_id, character_id=old_character_id) \ .delete() # If any existing planets are not in updated list, delete them new_planet_ids = [] old_planet_ids = FilmPlanet.objects \ .values_list('planet_id', flat=True) \ .filter(film_id=film.film_id) # New Planet list new_planets = form.cleaned_data['planets'] # Insert new unmatched planet entries for planet in new_planets: new_id = planet.planet_id new_planet_ids.append(new_id) if new_id in old_planet_ids: continue else: FilmPlanet.objects \ .create(film=film, planet=planet) # Delete old unmatched planet entries for old_planet_id in old_planet_ids: if old_planet_id in new_planet_ids: continue else: FilmPlanet.objects \ .filter(film_id=film.film_id, planet_id=old_planet_id) \ .delete() # return HttpResponseRedirect(film.get_absolute_url()) return redirect('film_detail', pk=film.pk) class FilmPageView(generic.TemplateView): template_name = 'webapp/film_docs.html' class PersonPageView(generic.TemplateView): template_name = 'webapp/person_docs.html' class PlanetPageView(generic.TemplateView): template_name = 'webapp/planet_docs.html' class SpeciesPageView(generic.TemplateView): template_name = 'webapp/species_docs.html' class StarshipPageView(generic.TemplateView): template_name = 'webapp/starship_docs.html' class VehiclePageView(generic.TemplateView): template_name = 'webapp/vehicle_docs.html' class FilmDetailView(generic.DetailView): model = Film context_object_name = 'film' template_name = 'webapp/film_detail.html' def get_object(self): return super().get_object() class FilmListView(generic.ListView): model = Film context_object_name = 'films' template_name = 'webapp/films.html' # paginate_by = 20 # def dispatch(self, *args, **kwargs): # return super().dispatch(*args, **kwargs) def get_queryset(self): return Film.objects.all() # return Person.objects.select_related('homeworld').order_by('name') class PersonDetailView(generic.DetailView): model = Person context_object_name = 'persons' template_name = 'webapp/person_detail.html' def get_object(self): person = super().get_object() return person class PersonListView(generic.ListView): model = Person context_object_name = 'persons' template_name = 'webapp/persons.html' # paginate_by = 20 # def dispatch(self, *args, **kwargs): # return super().dispatch(*args, **kwargs) def get_queryset(self): return Person.objects.all() # return Person.objects.select_related('homeworld').order_by('name') class PlanetDetailView(generic.DetailView): model = Planet context_object_name = 'planets' template_name = 'webapp/planet_detail.html' def get_object(self): planet = super().get_object() return planet class PlanetListView(generic.ListView): model = Planet context_object_name = 'planets' template_name = 'webapp/planets.html' # paginate_by = 20 # def dispatch(self, *args, **kwargs): # return super().dispatch(*args, **kwargs) def get_queryset(self): return Planet.objects.all() # return Person.objects.select_related('homeworld').order_by('name') class SpeciesDetailView(generic.DetailView): model = Species context_object_name = 'species' template_name = 'webapp/species_detail.html' def get_object(self): species = super().get_object() return species class SpeciesListView(generic.ListView): model = Species context_object_name = 'species' template_name = 'webapp/species.html' # paginate_by = 20 # def dispatch(self, *args, **kwargs): # return super().dispatch(*args, **kwargs) def get_queryset(self): return Species.objects.all() # return Species.objects.select_related('homeworld').order_by('name') class StarshipDetailView(generic.DetailView): model = Starship context_object_name = 'starships' template_name = 'webapp/starship_detail.html' def get_object(self): starship = super().get_object() return starship class StarshipListView(generic.ListView): model = Starship context_object_name = 'starships' template_name = 'webapp/starships.html' def get_queryset(self): return Starship.objects.all() # return Starship.objects.select_related('?').order_by('?') @method_decorator(login_required, name='dispatch') class VehicleCreateView(generic.View): model = Vehicle form_class = VehicleForm success_message = "Vehicle created successfully" template_name = 'webapp/vehicle_new.html' def dispatch(self, *args, **kwargs): return super().dispatch(*args, **kwargs) def post(self, request): form = VehicleForm(request.POST) if form.is_valid(): vehicle = form.save(commit=False) vehicle.save() if form.cleaned_data['passengers']: for passenger in form.cleaned_data['passengers']: VehiclePassenger.objects.create(vehicle=vehicle, passenger=passenger) return HttpResponseRedirect(vehicle.get_absolute_url()) return render(request, 'webapp/vehicle_new.html', {'form': form}) def get(self, request): form = VehicleForm() return render(request, 'webapp/vehicle_new.html', {'form': form}) @method_decorator(login_required, name='dispatch') class VehicleDeleteView(generic.DeleteView): model = Vehicle success_message = "Vehicle deleted successfully" success_url = reverse_lazy('vehicles') context_object_name = 'vehicles' template_name = 'webapp/vehicle_delete.html' def dispatch(self, *args, **kwargs): return super().dispatch(*args, **kwargs) def delete(self, request, *args, **kwargs): self.object = self.get_object() # Delete VehiclePassenger entries VehiclePassenger.objects \ .filter(vehicle_id=self.object.vehicle_id) \ .delete() self.object.delete() return HttpResponseRedirect(self.get_success_url()) class VehicleDetailView(generic.DetailView): model = Vehicle context_object_name = 'vehicles' template_name = 'webapp/vehicle_detail.html' def get_object(self): return super().get_object() class VehicleListView(generic.ListView): model = Vehicle context_object_name = 'vehicles' template_name = 'webapp/vehicles.html' def get_queryset(self): return Vehicle.objects.all() @method_decorator(login_required, name='dispatch') class VehicleUpdateView(generic.UpdateView): model = Vehicle form_class = VehicleForm context_object_name = 'vehicles' success_message = "Vehicle updated successfully" template_name = 'webapp/vehicle_update.html' def dispatch(self, *args, **kwargs): return super().dispatch(*args, **kwargs) def form_valid(self, form): vehicle = form.save(commit=False) vehicle.save() return HttpResponseRedirect(vehicle.get_absolute_url())
<filename>lib/meshrenderer/gl_utils/window.py # -*- coding: utf-8 -*- # flake8: noqa import cyglfw3 as glfw from OpenGL.GL import * from OpenGL.GL.NV.bindless_texture import * class Window(object): def __init__( self, window_width, window_height, samples=1, window_title="", monitor=1, show_at_center=True, offscreen=False, ): self.window_title = window_title assert glfw.Init(), "Glfw Init failed!" glfw.WindowHint(glfw.SAMPLES, samples) if offscreen: glfw.WindowHint(glfw.VISIBLE, False) mon = glfw.GetMonitors()[monitor] if monitor != None else None self.windowID = glfw.CreateWindow(window_width, window_height, self.window_title, mon) assert self.windowID, "Could not create Window!" glfw.MakeContextCurrent(self.windowID) if not glInitBindlessTextureNV(): raise RuntimeError("Bindless Textures not supported") self.framebuf_width, self.framebuf_height = glfw.GetFramebufferSize(self.windowID) self.framebuffer_size_callback = [] def framebuffer_size_callback(window, w, h): self.framebuf_width, self.framebuf_height = w, h for callback in self.framebuffer_size_callback: callback(w, h) glfw.SetFramebufferSizeCallback(self.windowID, framebuffer_size_callback) self.key_callback = [] def key_callback(window, key, scancode, action, mode): if action == glfw.PRESS: if key == glfw.KEY_ESCAPE: glfw.SetWindowShouldClose(window, True) for callback in self.key_callback: callback(key, scancode, action, mode) glfw.SetKeyCallback(self.windowID, key_callback) self.mouse_callback = [] def mouse_callback(window, xpos, ypos): for callback in self.mouse_callback: callback(xpos, ypos) glfw.SetCursorPosCallback(self.windowID, mouse_callback) self.mouse_button_callback = [] def mouse_button_callback(window, button, action, mods): for callback in self.mouse_button_callback: callback(button, action, mods) glfw.SetMouseButtonCallback(self.windowID, mouse_button_callback) self.scroll_callback = [] def scroll_callback(window, xoffset, yoffset): for callback in self.scroll_callback: callback(xoffset, yoffset) glfw.SetScrollCallback(self.windowID, scroll_callback) self.previous_second = glfw.GetTime() self.frame_count = 0.0 if show_at_center: monitors = glfw.GetMonitors() assert monitor >= 0 and monitor < len(monitors), "Invalid monitor selected." vidMode = glfw.GetVideoMode(monitors[monitor]) glfw.SetWindowPos( self.windowID, vidMode.width / 2 - self.framebuf_width / 2, vidMode.height / 2 - self.framebuf_height / 2, ) def update_fps_counter(self): current_second = glfw.GetTime() elapsed_seconds = current_second - self.previous_second if elapsed_seconds > 1.0: self.previous_second = current_second fps = float(self.frame_count) / float(elapsed_seconds) glfw.SetWindowTitle(self.windowID, "%s @ FPS: %.2f" % (self.window_title, fps)) self.frame_count = 0.0 self.frame_count += 1.0 def is_open(self): return not glfw.WindowShouldClose(self.windowID) def swap_buffers(self): glfw.SwapBuffers(self.windowID) def poll_events(self): glfw.PollEvents() def update(self): self.swap_buffers() self.poll_events() self.update_fps_counter() def close(self): glfw.Terminate() def __enter__(self): return self def __exit__(self, type, value, traceback): self.close()
from multiprocessing import Process, Queue from langumo.building import Builder from langumo.utils import (AuxiliaryFile, AuxiliaryFileManager, colorful, SentenceSplitter) from typing import Iterable class Parser: def prepare(self, raw: AuxiliaryFile): pass def extract(self, raw: AuxiliaryFile) -> Iterable[str]: raise NotImplementedError('this method must be implemented by ' 'inheritor.') def parse(self, text: str) -> str: raise NotImplementedError('this method must be implemented by ' 'inheritor.') class ParseRawFile(Builder): def __init__(self, parser: Parser, lang: str, min_len: int, max_len: int, newline: str = '[NEWLINE]', num_workers: int = 1): self.parser = parser self.lang = lang self.min_len = min_len self.max_len = max_len self.newline = newline self.num_workers = num_workers def _parse_worker(self, from_queue: Queue, to_queue: Queue): splitter = SentenceSplitter(self.lang) while True: # Get raw-formatted document from main process. document = from_queue.get() if document is None: to_queue.put(None) break # Parse the document to the plain text. parsed = self.parser.parse(document) # Divide the document into sequences with required length. group_sentences = [] for paragraph in parsed.splitlines(): for sentence in splitter.tokenize(paragraph): group_sentences.append(sentence) if sum(len(s) for s in group_sentences) > self.max_len: to_queue.put(' '.join(group_sentences)) group_sentences.clear() # Use custom line-break token instead of `\n` which is used for # separating sequences. if group_sentences: group_sentences.append(self.newline) # Use the remainder in dataset if its length is suitable. if group_sentences and group_sentences[-1] == self.newline: group_sentences = group_sentences[:-1] text = ' '.join(group_sentences) if len(text) > self.min_len and len(text) < self.max_len: to_queue.put(text) def _collect_worker(self, parsed: AuxiliaryFile, to_queue: Queue): terminated = 0 with parsed.open('w') as fp: while terminated < self.num_workers: text = to_queue.get() if text is None: terminated += 1 continue text += '\n' if not text.endswith('\n') else '' fp.write(text) def build(self, afm: AuxiliaryFileManager, raw: AuxiliaryFile ) -> AuxiliaryFile: parsed = afm.create() self.parser.prepare(raw) # Create processes for parsing texts in parallel and a process for # collecting the parsed texts and saving to the auxiliary file. from_queue, to_queue = Queue(), Queue() parsers = [Process(target=self._parse_worker, args=(from_queue, to_queue), daemon=True) for _ in range(self.num_workers)] collector = Process(target=self._collect_worker, args=(parsed, to_queue), daemon=True) # Start the processes. print(colorful.render(f'<r>[*]</r> parse raw-formatted corpus file ' f'with <g>{self.parser.__class__.__name__}</g>')) for p in parsers: p.start() collector.start() # Feed the extracted raw-formatted document to each parser process. for document in self.parser.extract(raw): from_queue.put(document) for _ in range(self.num_workers): from_queue.put(None) # Wait for terminating the processes. for p in parsers: p.join() collector.join() return parsed
<filename>tests/test_controllers.py from pilco.controllers import RbfController, LinearController, squash_sin import numpy as np import os import tensorflow as tf import oct2py octave = oct2py.Oct2Py() dir_path = os.path.dirname(os.path.realpath("__file__")) + "/tests/Matlab Code" octave.addpath(dir_path) from gpflow import config float_type = config.default_float() def test_rbf(): np.random.seed(0) d = 3 # Input dimension k = 2 # Number of outputs b = 100 # basis functions # Training Dataset X0 = np.random.rand(100, d) A = np.random.rand(d, k) Y0 = np.sin(X0).dot(A) + 1e-3*(np.random.rand(100, k) - 0.5) # Just something smooth rbf = RbfController(3, 2, b) rbf.set_data((X0, Y0)) # Generate input m = np.random.rand(1, d) # But MATLAB defines it as m' s = np.random.rand(d, d) s = s.dot(s.T) # Make s positive semidefinite M, S, V = rbf.compute_action(m, s, squash=False) # convert data to the struct expected by the MATLAB implementation lengthscales = np.stack([model.kernel.lengthscales.numpy() for model in rbf.models]) variance = np.stack([model.kernel.variance.numpy() for model in rbf.models]) noise = np.stack([model.likelihood.variance.numpy() for model in rbf.models]) hyp = np.log(np.hstack( (lengthscales, np.sqrt(variance[:, None]), np.sqrt(noise[:, None])) )).T gpmodel = oct2py.io.Struct() gpmodel.hyp = hyp gpmodel.inputs = X0 gpmodel.targets = Y0 # Call gp0 in octave M_mat, S_mat, V_mat = octave.gp2(gpmodel, m.T, s, nout=3) assert M.shape == M_mat.T.shape assert S.shape == S_mat.shape assert V.shape == V_mat.shape np.testing.assert_allclose(M, M_mat.T, rtol=1e-4) np.testing.assert_allclose(S, S_mat, rtol=1e-4) np.testing.assert_allclose(V, V_mat, rtol=1e-4) def test_linear(): np.random.seed(0) d = 3 # Input dimension k = 2 # Output dimension # Generate input m = np.random.rand(1, d) # But MATLAB defines it as m' s = np.random.rand(d, d) s = s.dot(s.T) # Make s positive semidefinite W = np.random.rand(k, d) # But MATLAB defines it as m' b = np.random.rand(1, k) linear = LinearController(d, k) linear.W.assign(W) linear.b.assign(b) M, S, V = linear.compute_action(m, s, squash=False) # convert data to the struct expected by the MATLAB implementation policy = oct2py.io.Struct() policy.p = oct2py.io.Struct() policy.p.w = W policy.p.b = b.T # Call function in octave M_mat, S_mat, V_mat = octave.conlin(policy, m.T, s, nout=3) assert M.shape == M_mat.T.shape assert S.shape == S_mat.shape assert V.shape == V_mat.shape #np.testing.assert_allclose(M, M_mat.T, rtol=1e-4) np.testing.assert_allclose(S, S_mat, rtol=1e-4) np.testing.assert_allclose(V, V_mat, rtol=1e-4) def test_squash(): np.random.seed(0) d = 3 # Control dimensions m = np.random.rand(1, d) # But MATLAB defines it as m' s = np.random.rand(d, d) s = s.dot(s.T) e = 7.0 M, S, V = squash_sin(m, s, e) M_mat, S_mat, V_mat = octave.gSin(m.T, s, e, nout=3) M_mat = np.asarray(M_mat) assert M.shape == M_mat.T.shape assert S.shape == S_mat.shape assert V.shape == V_mat.shape np.testing.assert_allclose(M, M_mat.T, rtol=1e-4) np.testing.assert_allclose(S, S_mat, rtol=1e-4) np.testing.assert_allclose(V, V_mat, rtol=1e-4) if __name__ == '__main__': test_rbf() test_linear() test_squash()
from tw.api import Widget from tw.forms import CalendarDatePicker, CalendarDateTimePicker, TableForm, DataGrid from tw.forms.fields import (SingleSelectField, MultipleSelectField, InputField, HiddenField, TextField, FileField, PasswordField, TextArea, Label) from formencode.schema import Schema from formencode.validators import StringBool from formencode import Invalid class SproxMethodPutHiddenField(HiddenField): available_engines = ['mako', 'genshi'] template="sprox.widgets.tw1widgets.templates.hidden_put" class SproxCalendarDatePicker(CalendarDatePicker): date_format = '%Y-%m-%d' class SproxTimePicker(CalendarDateTimePicker): date_format = '%H:%M:%S' class SproxCalendarDateTimePicker(CalendarDateTimePicker): date_format = '%Y-%m-%d %H:%M:%S' class SproxDataGrid(DataGrid): available_engines = ['mako', 'genshi'] template = "sprox.widgets.tw1widgets.templates.datagrid" params = ['pks', 'controller', 'xml_fields'] xml_fields = ['actions'] class ContainerWidget(Widget): template = "genshi:sprox.widgets.tw1widgets.templates.container" params = ["controller",] class TableLabelWidget(Widget): template = "genshi:sprox.widgets.tw1widgets.templates.tableLabel" params = ["identifier", "controller"] class ModelLabelWidget(Widget): available_engines = ['mako', 'genshi'] template = "sprox.widgets.tw1widgets.templates.modelLabel" params = ["identifier", "controller"] class EntityLabelWidget(Widget): template = "genshi:sprox.widgets.tw1widgets.templates.entityLabel" params = ["entity", "controller"] class RecordViewWidget(Widget): template = "genshi:sprox.widgets.tw1widgets.templates.recordViewTable" params = ["entity"] class RecordFieldWidget(Widget): template = "genshi:sprox.widgets.tw1widgets.templates.recordField" params = ['field_name'] class TableDefWidget(Widget): template = "genshi:sprox.widgets.tw1widgets.templates.tableDef" params = ["identifier"] class EntityDefWidget(Widget): available_engines = ['genshi'] template = "sprox.widgets.tw1widgets.templates.entityDef" params = ["entity"] class TableWidget(Widget): available_engines = ['genshi'] template = "genshi:sprox.widgets.tw1widgets.templates.table" class SproxTableForm(TableForm): available_engines = ['mako', 'genshi'] validator = Schema(ignore_missing_keys=True, allow_extra_fields=True) template = "sprox.widgets.tw1widgets.templates.tableForm" #custom checkbox widget since I am not happy with the behavior of the TW one class SproxCheckBox(InputField): available_engines = ['mako', 'genshi'] template = "sprox.widgets.tw1widgets.templates.checkbox" validator = StringBool def update_params(self, d): InputField.update_params(self, d) try: checked = self.validator.to_python(d.value) except Invalid: checked = False d.attrs['checked'] = checked or None class PropertyMixin(Widget): params = ['entity', 'field_name', 'provider', 'dropdown_field_names'] def _my_update_params(self, d, nullable=False): entity = self.entity options = self.provider.get_dropdown_options(self.entity, self.field_name, self.dropdown_field_names) if nullable: options.append([None,"-----------"]) if len(options) == 0: return {} d['options']= options return d class PropertySingleSelectField(SingleSelectField, PropertyMixin): params=["nullable", "disabled"] nullable=False disabled=False def update_params(self, d): self._my_update_params(d,nullable=self.nullable) SingleSelectField.update_params(self, d) return d class PropertyMultipleSelectField(MultipleSelectField, PropertyMixin): params=["disabled"] disabled=False def update_params(self, d): self._my_update_params(d) MultipleSelectField.update_params(self, d) return d class SubDocument(TextField): pass
import datetime import dateutil.tz import pytz import requests_mock import warnings try: import zoneinfo except ImportError: from backports import zoneinfo from exchangelib.errors import UnknownTimeZone, NaiveDateTimeNotAllowed from exchangelib.ewsdatetime import EWSDateTime, EWSDate, EWSTimeZone, UTC from exchangelib.winzone import generate_map, CLDR_TO_MS_TIMEZONE_MAP, CLDR_WINZONE_URL, CLDR_WINZONE_VERSION from exchangelib.util import CONNECTION_ERRORS from .common import TimedTestCase class EWSDateTimeTest(TimedTestCase): def test_super_methods(self): tz = EWSTimeZone('Europe/Copenhagen') self.assertIsInstance(EWSDateTime.now(), EWSDateTime) self.assertIsInstance(EWSDateTime.now(tz=tz), EWSDateTime) self.assertIsInstance(EWSDateTime.utcnow(), EWSDateTime) self.assertIsInstance(EWSDateTime.fromtimestamp(123456789), EWSDateTime) self.assertIsInstance(EWSDateTime.fromtimestamp(123456789, tz=tz), EWSDateTime) self.assertIsInstance(EWSDateTime.utcfromtimestamp(123456789), EWSDateTime) def test_ewstimezone(self): # Test autogenerated translations tz = EWSTimeZone('Europe/Copenhagen') self.assertIsInstance(tz, EWSTimeZone) self.assertEqual(tz.key, 'Europe/Copenhagen') self.assertEqual(tz.ms_id, 'Romance Standard Time') # self.assertEqual(EWSTimeZone('Europe/Copenhagen').ms_name, '') # EWS works fine without the ms_name # Test localzone() tz = EWSTimeZone.localzone() self.assertIsInstance(tz, EWSTimeZone) # Test common helpers tz = EWSTimeZone('UTC') self.assertIsInstance(tz, EWSTimeZone) self.assertEqual(tz.key, 'UTC') self.assertEqual(tz.ms_id, 'UTC') tz = EWSTimeZone('GMT') self.assertIsInstance(tz, EWSTimeZone) self.assertEqual(tz.key, 'GMT') self.assertEqual(tz.ms_id, 'UTC') # Test mapper contents. Latest map from unicode.org has 394 entries self.assertGreater(len(EWSTimeZone.IANA_TO_MS_MAP), 300) for k, v in EWSTimeZone.IANA_TO_MS_MAP.items(): self.assertIsInstance(k, str) self.assertIsInstance(v, tuple) self.assertEqual(len(v), 2) self.assertIsInstance(v[0], str) # Test timezone unknown by ZoneInfo with self.assertRaises(UnknownTimeZone) as e: EWSTimeZone('UNKNOWN') self.assertEqual(e.exception.args[0], 'No time zone found with key UNKNOWN') # Test timezone known by IANA but with no Winzone mapping with self.assertRaises(UnknownTimeZone) as e: del EWSTimeZone.IANA_TO_MS_MAP['Africa/Tripoli'] EWSTimeZone('Africa/Tripoli') self.assertEqual(e.exception.args[0], 'No Windows timezone name found for timezone "Africa/Tripoli"') # Test __eq__ with non-EWSTimeZone compare self.assertFalse(EWSTimeZone('GMT') == zoneinfo.ZoneInfo('UTC')) # Test from_ms_id() with non-standard MS ID self.assertEqual(EWSTimeZone('Europe/Copenhagen'), EWSTimeZone.from_ms_id('Europe/Copenhagen')) def test_localize(self): # Test some corner cases around DST tz = EWSTimeZone('Europe/Copenhagen') with warnings.catch_warnings(): # localize() is deprecated but we still want to test it. Silence the DeprecationWarning warnings.simplefilter("ignore") self.assertEqual( str(tz.localize(EWSDateTime(2023, 10, 29, 2, 36, 0), is_dst=False)), '2023-10-29 02:36:00+01:00' ) self.assertEqual( str(tz.localize(EWSDateTime(2023, 10, 29, 2, 36, 0), is_dst=None)), '2023-10-29 02:36:00+02:00' ) self.assertEqual( str(tz.localize(EWSDateTime(2023, 10, 29, 2, 36, 0), is_dst=True)), '2023-10-29 02:36:00+02:00' ) self.assertEqual( str(tz.localize(EWSDateTime(2023, 3, 26, 2, 36, 0), is_dst=False)), '2023-03-26 02:36:00+01:00' ) self.assertEqual( str(tz.localize(EWSDateTime(2023, 3, 26, 2, 36, 0), is_dst=None)), '2023-03-26 02:36:00+01:00' ) self.assertEqual( str(tz.localize(EWSDateTime(2023, 3, 26, 2, 36, 0), is_dst=True)), '2023-03-26 02:36:00+02:00' ) def test_ewsdatetime(self): # Test a static timezone tz = EWSTimeZone('Etc/GMT-5') dt = EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=tz) self.assertIsInstance(dt, EWSDateTime) self.assertIsInstance(dt.tzinfo, EWSTimeZone) self.assertEqual(dt.tzinfo.ms_id, tz.ms_id) self.assertEqual(dt.tzinfo.ms_name, tz.ms_name) self.assertEqual(str(dt), '2000-01-02 03:04:05+05:00') self.assertEqual( repr(dt), "EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=EWSTimeZone(key='Etc/GMT-5'))" ) # Test a DST timezone tz = EWSTimeZone('Europe/Copenhagen') dt = EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=tz) self.assertIsInstance(dt, EWSDateTime) self.assertIsInstance(dt.tzinfo, EWSTimeZone) self.assertEqual(dt.tzinfo.ms_id, tz.ms_id) self.assertEqual(dt.tzinfo.ms_name, tz.ms_name) self.assertEqual(str(dt), '2000-01-02 03:04:05+01:00') self.assertEqual( repr(dt), "EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=EWSTimeZone(key='Europe/Copenhagen'))" ) # Test from_string with self.assertRaises(NaiveDateTimeNotAllowed): EWSDateTime.from_string('2000-01-02T03:04:05') self.assertEqual( EWSDateTime.from_string('2000-01-02T03:04:05+01:00'), EWSDateTime(2000, 1, 2, 2, 4, 5, tzinfo=UTC) ) self.assertEqual( EWSDateTime.from_string('2000-01-02T03:04:05Z'), EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=UTC) ) self.assertIsInstance(EWSDateTime.from_string('2000-01-02T03:04:05+01:00'), EWSDateTime) self.assertIsInstance(EWSDateTime.from_string('2000-01-02T03:04:05Z'), EWSDateTime) # Test addition, subtraction, summertime etc self.assertIsInstance(dt + datetime.timedelta(days=1), EWSDateTime) self.assertIsInstance(dt - datetime.timedelta(days=1), EWSDateTime) self.assertIsInstance(dt - EWSDateTime.now(tz=tz), datetime.timedelta) self.assertIsInstance(EWSDateTime.now(tz=tz), EWSDateTime) # Test various input for from_datetime() self.assertEqual(dt, EWSDateTime.from_datetime( datetime.datetime(2000, 1, 2, 3, 4, 5, tzinfo=EWSTimeZone('Europe/Copenhagen')) )) self.assertEqual(dt, EWSDateTime.from_datetime( datetime.datetime(2000, 1, 2, 3, 4, 5, tzinfo=zoneinfo.ZoneInfo('Europe/Copenhagen')) )) self.assertEqual(dt, EWSDateTime.from_datetime( datetime.datetime(2000, 1, 2, 3, 4, 5, tzinfo=dateutil.tz.gettz('Europe/Copenhagen')) )) self.assertEqual(dt, EWSDateTime.from_datetime( datetime.datetime(2000, 1, 2, 3, 4, 5, tzinfo=pytz.timezone('Europe/Copenhagen')) )) self.assertEqual(dt.ewsformat(), '2000-01-02T03:04:05+01:00') utc_tz = EWSTimeZone('UTC') self.assertEqual(dt.astimezone(utc_tz).ewsformat(), '2000-01-02T02:04:05Z') # Test summertime dt = EWSDateTime(2000, 8, 2, 3, 4, 5, tzinfo=tz) self.assertEqual(dt.astimezone(utc_tz).ewsformat(), '2000-08-02T01:04:05Z') # Test in-place add and subtract dt = EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=tz) dt += datetime.timedelta(days=1) self.assertIsInstance(dt, EWSDateTime) self.assertEqual(dt, EWSDateTime(2000, 1, 3, 3, 4, 5, tzinfo=tz)) dt = EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=tz) dt -= datetime.timedelta(days=1) self.assertIsInstance(dt, EWSDateTime) self.assertEqual(dt, EWSDateTime(2000, 1, 1, 3, 4, 5, tzinfo=tz)) # Test ewsformat() failure dt = EWSDateTime(2000, 1, 2, 3, 4, 5) with self.assertRaises(ValueError): dt.ewsformat() # Test wrong tzinfo type with self.assertRaises(ValueError): EWSDateTime(2000, 1, 2, 3, 4, 5, tzinfo=pytz.timezone('Europe/Copenhagen')) with self.assertRaises(ValueError): EWSDateTime.from_datetime(EWSDateTime(2000, 1, 2, 3, 4, 5)) def test_generate(self): try: version, tz_map = generate_map() except CONNECTION_ERRORS: # generate_map() requires access to unicode.org, which may be unavailable. Don't fail test, since this is # out of our control. return self.assertEqual(version, CLDR_WINZONE_VERSION) self.assertDictEqual(tz_map, CLDR_TO_MS_TIMEZONE_MAP) @requests_mock.mock() def test_generate_failure(self, m): m.get(CLDR_WINZONE_URL, status_code=500) with self.assertRaises(ValueError): generate_map() def test_ewsdate(self): self.assertEqual(EWSDate(2000, 1, 1).ewsformat(), '2000-01-01') self.assertEqual(EWSDate.from_string('2000-01-01'), EWSDate(2000, 1, 1)) self.assertEqual(EWSDate.from_string('2000-01-01Z'), EWSDate(2000, 1, 1)) self.assertEqual(EWSDate.from_string('2000-01-01+01:00'), EWSDate(2000, 1, 1)) self.assertEqual(EWSDate.from_string('2000-01-01-01:00'), EWSDate(2000, 1, 1)) self.assertIsInstance(EWSDate(2000, 1, 2) - EWSDate(2000, 1, 1), datetime.timedelta) self.assertIsInstance(EWSDate(2000, 1, 2) + datetime.timedelta(days=1), EWSDate) self.assertIsInstance(EWSDate(2000, 1, 2) - datetime.timedelta(days=1), EWSDate) # Test in-place add and subtract dt = EWSDate(2000, 1, 2) dt += datetime.timedelta(days=1) self.assertIsInstance(dt, EWSDate) self.assertEqual(dt, EWSDate(2000, 1, 3)) dt = EWSDate(2000, 1, 2) dt -= datetime.timedelta(days=1) self.assertIsInstance(dt, EWSDate) self.assertEqual(dt, EWSDate(2000, 1, 1)) with self.assertRaises(ValueError): EWSDate.from_date(EWSDate(2000, 1, 2))
<filename>test/test_im.py import unittest from unittest.mock import patch, PropertyMock, MagicMock from os import path from src import im from io import BytesIO THUMB_LENGTH = str(290) IMAGE_PNG = 'kosys.png' def with_image(name, consumer): p = path.dirname(__file__) + '/fixture/images/' + name with open(p, 'rb') as f: image = BytesIO(f.read()) consumer((image, name)) class ImageMagickTestCase(unittest.TestCase): def setUp(self): self.app = im.app.test_client() def tearDown(self): None def test_ping(self): response = self.app.get('/ping') self.assertEqual(response.data, b'pong') def test_resize_with_valid_params(self): def action(image): params = dict(width=THUMB_LENGTH, height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 200) with_image(IMAGE_PNG, action) def test_resize_without_width(self): def action(image): params = dict(height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image(IMAGE_PNG, action) def test_resize_without_height(self): def action(image): params = dict(width=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image(IMAGE_PNG, action) def test_resize_without_data(self): params = dict(width=THUMB_LENGTH, height=THUMB_LENGTH) response = self.request_resize(params) self.assertEqual(response.status_code, 400) def test_resize_with_too_large_width(self): def action(image): params = dict(width=str(im.MAX_THUMB_LENGTH + 1), height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image(IMAGE_PNG, action) def test_resize_with_too_large_height(self): def action(image): params = dict(width=THUMB_LENGTH, height=str(im.MAX_THUMB_LENGTH + 1), data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image(IMAGE_PNG, action) def test_resize_with_unsupported_format(self): def action(image): params = dict(width=THUMB_LENGTH, height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image('favicon.ico', action) def test_resize_with_invalid_format(self): def action(image): params = dict(width=THUMB_LENGTH, height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image('invalid.md', action) def test_attempt_command_injection_with_width(self): def action(image): params = dict(width="|| rm -Rf /", height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image(IMAGE_PNG, action) def test_attempt_command_injection_with_height(self): def action(image): params = dict(width=THUMB_LENGTH, height="|| rm -Rf /", data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 400) with_image(IMAGE_PNG, action) @patch('subprocess.Popen') def test_error_occurred_on_command_execution(self, popen): def action(image): params = dict(width=THUMB_LENGTH, height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 500) popen.side_effect = OSError() with_image(IMAGE_PNG, action) @patch('subprocess.Popen.wait') def test_command_result_non_0_code(self, wait): def action(image): params = dict(width=THUMB_LENGTH, height=THUMB_LENGTH, data=image) response = self.request_resize(params) self.assertEqual(response.status_code, 500) wait.return_value = 1 with_image(IMAGE_PNG, action) def request_resize(self, params): return self.app.post('/resize', content_type='multipart/form-data', data=params ) if __name__ == '__main__': unittest.main()
<reponame>hwpplayers/ironic<filename>ironic/tests/unit/drivers/test_ipmi.py # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from ironic.conductor import task_manager from ironic.drivers.modules import agent from ironic.drivers.modules import ipmitool from ironic.drivers.modules import iscsi_deploy from ironic.drivers.modules import noop from ironic.drivers.modules import noop_mgmt from ironic.drivers.modules import pxe from ironic.drivers.modules.storage import cinder from ironic.drivers.modules.storage import noop as noop_storage from ironic.tests.unit.db import base as db_base from ironic.tests.unit.objects import utils as obj_utils class IPMIHardwareTestCase(db_base.DbTestCase): def setUp(self): super(IPMIHardwareTestCase, self).setUp() self.config(enabled_hardware_types=['ipmi'], enabled_power_interfaces=['ipmitool'], enabled_management_interfaces=['ipmitool', 'noop'], enabled_raid_interfaces=['no-raid', 'agent'], enabled_console_interfaces=['no-console'], enabled_vendor_interfaces=['ipmitool', 'no-vendor']) def _validate_interfaces(self, task, **kwargs): self.assertIsInstance( task.driver.management, kwargs.get('management', ipmitool.IPMIManagement)) self.assertIsInstance( task.driver.power, kwargs.get('power', ipmitool.IPMIPower)) self.assertIsInstance( task.driver.boot, kwargs.get('boot', pxe.PXEBoot)) self.assertIsInstance( task.driver.deploy, kwargs.get('deploy', iscsi_deploy.ISCSIDeploy)) self.assertIsInstance( task.driver.console, kwargs.get('console', noop.NoConsole)) self.assertIsInstance( task.driver.raid, kwargs.get('raid', noop.NoRAID)) self.assertIsInstance( task.driver.vendor, kwargs.get('vendor', ipmitool.VendorPassthru)) self.assertIsInstance( task.driver.storage, kwargs.get('storage', noop_storage.NoopStorage)) self.assertIsInstance( task.driver.rescue, kwargs.get('rescue', noop.NoRescue)) def test_default_interfaces(self): node = obj_utils.create_test_node(self.context, driver='ipmi') with task_manager.acquire(self.context, node.id) as task: self._validate_interfaces(task) def test_override_with_shellinabox(self): self.config(enabled_console_interfaces=['ipmitool-shellinabox', 'ipmitool-socat']) node = obj_utils.create_test_node( self.context, driver='ipmi', deploy_interface='direct', raid_interface='agent', console_interface='ipmitool-shellinabox', vendor_interface='no-vendor') with task_manager.acquire(self.context, node.id) as task: self._validate_interfaces( task, deploy=agent.AgentDeploy, console=ipmitool.IPMIShellinaboxConsole, raid=agent.AgentRAID, vendor=noop.NoVendor) def test_override_with_cinder_storage(self): self.config(enabled_storage_interfaces=['noop', 'cinder']) node = obj_utils.create_test_node( self.context, driver='ipmi', storage_interface='cinder') with task_manager.acquire(self.context, node.id) as task: self._validate_interfaces(task, storage=cinder.CinderStorage) def test_override_with_agent_rescue(self): self.config(enabled_rescue_interfaces=['no-rescue', 'agent']) node = obj_utils.create_test_node( self.context, driver='ipmi', rescue_interface='agent') with task_manager.acquire(self.context, node.id) as task: self._validate_interfaces(task, rescue=agent.AgentRescue) def test_override_with_noop_mgmt(self): self.config(enabled_management_interfaces=['ipmitool', 'noop']) node = obj_utils.create_test_node( self.context, driver='ipmi', management_interface='noop') with task_manager.acquire(self.context, node.id) as task: self._validate_interfaces(task, management=noop_mgmt.NoopManagement)
<reponame>servoz/capsul # -*- coding: utf-8 -*- from __future__ import print_function from __future__ import absolute_import import os import shutil import unittest import tempfile import sys import six from traits.api import File from capsul.api import Process, Pipeline, Switch, get_process_instance class Identity(Process): input_image = File(optional=False, output=False) output_image = File(optional=False, output=True) class ComplexPipeline(Pipeline): """Pipeline to test complex constructions behaviours """ def pipeline_definition(self): # Create processes self.add_process('first_pipeline', 'capsul.process.test.test_pipeline') self.add_process('pipeline_1', 'capsul.process.test.test_pipeline', make_optional=['output_1', 'output_10','output_100']) #self.export_parameter('pipeline_1', 'output_1') self.add_process('pipeline_10', 'capsul.process.test.test_pipeline', make_optional=['output_1', 'output_10','output_100']) self.add_process('pipeline_100', 'capsul.process.test.test_pipeline', make_optional=['output_1', 'output_10','output_100']) self.add_switch('select_threshold', ['threshold_1', 'threshold_10', 'threshold_100'], ['output_a', 'output_b', 'output_c']) self.add_process('identity_a', Identity) self.add_process('identity_b', Identity) self.add_process('identity_c', Identity) self.export_parameter('first_pipeline', 'select_method') self.add_link('select_method->pipeline_1.select_method') self.add_link('select_method->pipeline_10.select_method') self.add_link('select_method->pipeline_100.select_method') self.add_link('first_pipeline.output_1->pipeline_1.input_image') self.add_link('first_pipeline.output_10->pipeline_10.input_image') self.add_link('first_pipeline.output_100->pipeline_100.input_image') self.add_link('pipeline_1.output_1->select_threshold.threshold_1_switch_output_a') self.add_link('pipeline_1.output_10->select_threshold.threshold_10_switch_output_a') self.add_link('pipeline_1.output_100->select_threshold.threshold_100_switch_output_a') self.add_link('pipeline_10.output_1->select_threshold.threshold_1_switch_output_b') self.add_link('pipeline_10.output_10->select_threshold.threshold_10_switch_output_b') self.add_link('pipeline_10.output_100->select_threshold.threshold_100_switch_output_b') self.add_link('pipeline_100.output_1->select_threshold.threshold_1_switch_output_c') self.add_link('pipeline_100.output_10->select_threshold.threshold_10_switch_output_c') self.add_link('pipeline_100.output_100->select_threshold.threshold_100_switch_output_c') self.add_link('select_threshold.output_a->identity_a.input_image') self.add_link('select_threshold.output_b->identity_b.input_image') self.add_link('select_threshold.output_c->identity_c.input_image') self.export_parameter('identity_a', 'output_image', 'output_a') self.export_parameter('identity_b', 'output_image', 'output_b') self.export_parameter('identity_c', 'output_image', 'output_c') self.node_position = {'first_pipeline': (118.0, 486.0), 'identity_a': (870.0, 644.0), 'identity_b': (867.0, 742.0), 'identity_c': (866.0, 846.0), 'inputs': (-107.0, 491.0), 'outputs': (1111.0, 723.0), 'pipeline_1': (329.0, 334.0), 'pipeline_10': (331.0, 533.0), 'pipeline_100': (334.0, 738.0), 'select_threshold': (559.0, 453.0)} class TestComplexPipeline(unittest.TestCase): expected_status = [ ({}, { '': { '_activated': True, '_enabled': True, }, 'first_pipeline': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_100': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'first_pipeline.mask_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_100': { '_activated': True, '_enabled': True, }, 'pipeline_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_gt_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_gt_10': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_gt_100': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'pipeline_1.mask_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.mask_10': { '_activated': False, '_enabled': True, }, 'pipeline_1.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_gt_1': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_gt_10': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_gt_100': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'pipeline_10.mask_1': { '_activated': True, '_enabled': True, }, 'pipeline_10.mask_10': { '_activated': False, '_enabled': True, }, 'pipeline_10.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_100': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_gt_1': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_gt_10': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_gt_100': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'pipeline_100.mask_1': { '_activated': True, '_enabled': True, }, 'pipeline_100.mask_10': { '_activated': False, '_enabled': True, }, 'pipeline_100.mask_100': { '_activated': False, '_enabled': True, }, 'select_threshold': { '_activated': True, '_enabled': True, }, 'identity_a': { '_activated': True, '_enabled': True, }, 'identity_b': { '_activated': True, '_enabled': True, }, 'identity_c': { '_activated': True, '_enabled': True, }, } ), ({'select_method': 'lower than'}, { '': { '_activated': True, '_enabled': True, }, 'first_pipeline': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_100': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'first_pipeline.mask_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_100': { '_activated': True, '_enabled': True, }, 'pipeline_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_lt_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_lt_10': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_lt_100': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'pipeline_1.mask_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.mask_10': { '_activated': False, '_enabled': True, }, 'pipeline_1.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_lt_1': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_lt_10': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_lt_100': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'pipeline_10.mask_1': { '_activated': True, '_enabled': True, }, 'pipeline_10.mask_10': { '_activated': False, '_enabled': True, }, 'pipeline_10.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_100': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_lt_1': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_lt_10': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_lt_100': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'pipeline_100.mask_1': { '_activated': True, '_enabled': True, }, 'pipeline_100.mask_10': { '_activated': False, '_enabled': True, }, 'pipeline_100.mask_100': { '_activated': False, '_enabled': True, }, 'select_threshold': { '_activated': True, '_enabled': True, }, 'identity_a': { '_activated': True, '_enabled': True, }, 'identity_b': { '_activated': True, '_enabled': True, }, 'identity_c': { '_activated': True, '_enabled': True, }, } ), ({'select_threshold': 'threshold_10'}, { '': { '_activated': True, '_enabled': True, }, 'first_pipeline': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_100': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'first_pipeline.mask_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_100': { '_activated': True, '_enabled': True, }, 'pipeline_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_gt_1': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_gt_10': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_gt_100': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'pipeline_1.mask_1': { '_activated': False, '_enabled': True, }, 'pipeline_1.mask_10': { '_activated': True, '_enabled': True, }, 'pipeline_1.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_gt_1': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_gt_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_gt_100': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'pipeline_10.mask_1': { '_activated': False, '_enabled': True, }, 'pipeline_10.mask_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_100': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_gt_1': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_gt_10': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_gt_100': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_lt_1': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_lt_10': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_lt_100': { '_activated': False, '_enabled': False, }, 'pipeline_100.mask_1': { '_activated': False, '_enabled': True, }, 'pipeline_100.mask_10': { '_activated': True, '_enabled': True, }, 'pipeline_100.mask_100': { '_activated': False, '_enabled': True, }, 'select_threshold': { '_activated': True, '_enabled': True, }, 'identity_a': { '_activated': True, '_enabled': True, }, 'identity_b': { '_activated': True, '_enabled': True, }, 'identity_c': { '_activated': True, '_enabled': True, }, } ), ({'select_threshold': 'threshold_10', 'select_method': 'lower than'}, { '': { '_activated': True, '_enabled': True, }, 'first_pipeline': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_lt_100': { '_activated': True, '_enabled': True, }, 'first_pipeline.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'first_pipeline.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'first_pipeline.mask_1': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_10': { '_activated': True, '_enabled': True, }, 'first_pipeline.mask_100': { '_activated': True, '_enabled': True, }, 'pipeline_1': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_lt_1': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_lt_10': { '_activated': True, '_enabled': True, }, 'pipeline_1.threshold_lt_100': { '_activated': False, '_enabled': True, }, 'pipeline_1.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'pipeline_1.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'pipeline_1.mask_1': { '_activated': False, '_enabled': True, }, 'pipeline_1.mask_10': { '_activated': True, '_enabled': True, }, 'pipeline_1.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_lt_1': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_lt_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.threshold_lt_100': { '_activated': False, '_enabled': True, }, 'pipeline_10.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'pipeline_10.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'pipeline_10.mask_1': { '_activated': False, '_enabled': True, }, 'pipeline_10.mask_10': { '_activated': True, '_enabled': True, }, 'pipeline_10.mask_100': { '_activated': False, '_enabled': True, }, 'pipeline_100': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_lt_1': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_lt_10': { '_activated': True, '_enabled': True, }, 'pipeline_100.threshold_lt_100': { '_activated': False, '_enabled': True, }, 'pipeline_100.threshold_gt_1': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_gt_10': { '_activated': False, '_enabled': False, }, 'pipeline_100.threshold_gt_100': { '_activated': False, '_enabled': False, }, 'pipeline_100.mask_1': { '_activated': False, '_enabled': True, }, 'pipeline_100.mask_10': { '_activated': True, '_enabled': True, }, 'pipeline_100.mask_100': { '_activated': False, '_enabled': True, }, 'select_threshold': { '_activated': True, '_enabled': True, }, 'identity_a': { '_activated': True, '_enabled': True, }, 'identity_b': { '_activated': True, '_enabled': True, }, 'identity_c': { '_activated': True, '_enabled': True, }, } ), ] def test_activations(self): for kwargs, activations_to_check in self.expected_status: pipeline = get_process_instance(ComplexPipeline, **kwargs) for full_node_name, node_activations in six.iteritems(activations_to_check): split = full_node_name.split('.') node_pipeline = pipeline for i in split[:-1]: node_pipeline = node_pipeline.nodes[i].process node_name = split[-1] try: node = node_pipeline.nodes[node_name] except KeyError: raise KeyError('Pipeline {0} has no node named {1}'.format(node_pipeline.pipeline, node_name)) try: what = 'activation of node {0}'.format(full_node_name or 'main pipeline node') expected = node_activations.get('_activated') if expected is not None: got = node.activated self.assertEqual(expected, got) what = 'enabled for node {0}'.format(full_node_name or 'main pipeline node') expected = node_activations.get('_enabled') if expected is not None: got = node.enabled self.assertEqual(expected, got) except AssertionError: raise AssertionError('Wrong activation within ComplexPipeline with parameters {0}: {1} is supposed to be {2} but is {3}'.format(kwargs, what, expected, got)) def test(): """ Function to execute unitest """ suite = unittest.TestLoader().loadTestsFromTestCase(TestComplexPipeline) runtime = unittest.TextTestRunner(verbosity=2).run(suite) return runtime.wasSuccessful() if __name__ == '__main__': print('Test return code:', test()) if '-v' in sys.argv[1:]: from pprint import pprint pipeline = get_process_instance(ComplexPipeline) from soma.qt_gui.qt_backend import QtGui from capsul.qt_gui.widgets import PipelineDeveloperView #from capsul.qt_gui.widgets.activation_inspector import ActivationInspectorApp #app = ActivationInspectorApp(ComplexPipeline) app = QtGui.QApplication(sys.argv) view = PipelineDeveloperView(pipeline, allow_open_controller=True, show_sub_pipelines=True) view.show() app.exec_() del view
import scrapelib import datetime import os import re from collections import defaultdict from billy.scrape import ScrapeError from billy.scrape.bills import BillScraper, Bill from billy.scrape.votes import Vote from billy.scrape.utils import convert_pdf import lxml.html def action_type(action): # http://www.scstatehouse.gov/actionsearch.php is very useful for this classifiers = (('Adopted', 'bill:passed'), ('Amended and adopted', ['bill:passed', 'amendment:passed']), ('Amended', 'amendment:passed'), ('Certain items vetoed', 'governor:vetoed:line-item'), ('Committed to', 'committee:referred'), ('Committee Amendment Adopted', 'amendment:passed'), ('Committee Amendment Amended and Adopted', ['amendment:passed', 'amendment:amended']), ('Committee Amendment Amended', 'amendment:amended'), ('Committee Amendment Tabled', 'amendment:tabled'), ('Committee report: Favorable', 'committee:passed:favorable'), ('Committee report: Majority favorable', 'committee:passed'), ('House amendment amended', 'amendment:amended'), ('Introduced and adopted', ['bill:introduced', 'bill:passed']), ('Introduced, adopted', ['bill:introduced', 'bill:passed']), ('Introduced and read first time', ['bill:introduced', 'bill:reading:1']), ('Introduced, read first time', ['bill:introduced', 'bill:reading:1']), ('Introduced', 'bill:introduced'), ('Prefiled', 'bill:filed'), ('Read second time', 'bill:reading:2'), ('Read third time', ['bill:passed', 'bill:reading:3']), ('Recommitted to Committee', 'committee:referred'), ('Referred to Committee', 'committee:referred'), ('Rejected', 'bill:failed'), ('Senate amendment amended', 'amendment:amended'), ('Signed by governor', 'governor:signed'), ('Signed by Governor', 'governor:signed'), ('Tabled', 'bill:failed'), ('Veto overridden', 'bill:veto_override:passed'), ('Veto sustained', 'bill:veto_override:failed'), ('Vetoed by Governor', 'governor:vetoed'), ) for prefix, atype in classifiers: if action.lower().startswith(prefix.lower()): return atype # otherwise return 'other' class SCBillScraper(BillScraper): jurisdiction = 'sc' urls = { 'lower' : { 'daily-bill-index': "http://www.scstatehouse.gov/hintro/hintros.php", }, 'upper' : { 'daily-bill-index': "http://www.scstatehouse.gov/sintro/sintros.php", } } _subjects = defaultdict(set) def scrape_subjects(self, session_code): # only need to do it once if self._subjects: return subject_search_url = 'http://www.scstatehouse.gov/subjectsearch.php' data = self.post(subject_search_url, data=dict((('GETINDEX','Y'), ('SESSION', session_code), ('INDEXCODE','0'), ('INDEXTEXT', ''), ('AORB', 'B'), ('PAGETYPE', '0')))).text doc = lxml.html.fromstring(data) # skip first two subjects, filler options for option in doc.xpath('//option')[2:]: subject = option.text code = option.get('value') url = '%s?AORB=B&session=%s&indexcode=%s' % (subject_search_url, session_code, code) data = self.get(url).text doc = lxml.html.fromstring(data) for bill in doc.xpath('//span[@style="font-weight:bold;"]'): match = re.match('(?:H|S) \d{4}', bill.text) if match: # remove * and leading zeroes bill_id = match.group().replace('*', ' ') bill_id = re.sub(' 0*', ' ', bill_id) self._subjects[bill_id].add(subject) def scrape_vote_history(self, bill, vurl): html = self.get(vurl).text doc = lxml.html.fromstring(html) doc.make_links_absolute(vurl) # skip first two rows for row in doc.xpath('//table/tr')[2:]: tds = row.getchildren() if len(tds) != 11: self.warning('irregular vote row: %s' % vurl) continue timestamp, motion, vote, yeas, nays, nv, exc, pres, abst, total, result = tds timestamp = timestamp.text.replace(u'\xa0', ' ') timestamp = datetime.datetime.strptime(timestamp, '%m/%d/%Y %H:%M %p') yeas = int(yeas.text) nays = int(nays.text) others = int(nv.text) + int(exc.text) + int(abst.text) + int(pres.text) assert yeas + nays + others == int(total.text) passed = (result.text == 'Passed') vote_link = vote.xpath('a')[0] if '[H]' in vote_link.text: chamber = 'lower' else: chamber = 'upper' vote = Vote(chamber, timestamp, motion.text, passed, yeas, nays, others) vote.add_source(vurl) rollcall_pdf = vote_link.get('href') self.scrape_rollcall(vote, rollcall_pdf) vote.add_source(rollcall_pdf) bill.add_vote(vote) def scrape_rollcall(self, vote, vurl): (path, resp) = self.urlretrieve(vurl) pdflines = convert_pdf(path, 'text') os.remove(path) current_vfunc = None for line in pdflines.split('\n'): line = line.strip() # change what is being recorded if line.startswith('YEAS') or line.startswith('AYES'): current_vfunc = vote.yes elif line.startswith('NAYS'): current_vfunc = vote.no elif (line.startswith('EXCUSED') or line.startswith('NOT VOTING') or line.startswith('ABSTAIN')): current_vfunc = vote.other # skip these elif not line or line.startswith('Page '): continue # if a vfunc is active elif current_vfunc: # split names apart by 3 or more spaces names = re.split('\s{3,}', line) for name in names: if name: current_vfunc(name.strip()) def scrape_details(self, bill_detail_url, session, chamber, bill_id): page = self.get(bill_detail_url).text if 'INVALID BILL NUMBER' in page: self.warning('INVALID BILL %s' % bill_detail_url) return doc = lxml.html.fromstring(page) doc.make_links_absolute(bill_detail_url) bill_div = doc.xpath('//div[@style="margin:0 0 40px 0;"]')[0] bill_type = bill_div.xpath('span/text()')[0] if 'General Bill' in bill_type: bill_type = 'bill' elif 'Concurrent Resolution' in bill_type: bill_type = 'concurrent resolution' elif 'Joint Resolution' in bill_type: bill_type = 'joint resolution' elif 'Resolution' in bill_type: bill_type = 'resolution' else: raise ValueError('unknown bill type: %s' % bill_type) # this is fragile, but less fragile than it was b = bill_div.xpath('./b[text()="Summary:"]')[0] bill_summary = b.getnext().tail.strip() bill = Bill(session, chamber, bill_id, bill_summary, type=bill_type) bill['subjects'] = list(self._subjects[bill_id]) # sponsors for sponsor in doc.xpath('//a[contains(@href, "member.php")]/text()'): bill.add_sponsor('primary', sponsor) for sponsor in doc.xpath('//a[contains(@href, "committee.php")]/text()'): sponsor = sponsor.replace(u'\xa0', ' ').strip() bill.add_sponsor('primary', sponsor) # find versions version_url = doc.xpath('//a[text()="View full text"]/@href')[0] version_html = self.get(version_url).text version_doc = lxml.html.fromstring(version_html) version_doc.make_links_absolute(version_url) for version in version_doc.xpath('//a[contains(@href, "/prever/")]'): # duplicate versions with same date, use first appearance bill.add_version(version.text, version.get('href'), on_duplicate='use_old', mimetype='text/html') # actions for row in bill_div.xpath('table/tr'): date_td, chamber_td, action_td = row.xpath('td') date = datetime.datetime.strptime(date_td.text, "%m/%d/%y") action_chamber = {'Senate':'upper', 'House':'lower', None: 'other'}[chamber_td.text] action = action_td.text_content() action = action.split('(House Journal')[0] action = action.split('(Senate Journal')[0].strip() atype = action_type(action) bill.add_action(action_chamber, action, date, atype) # votes vurl = doc.xpath('//a[text()="View Vote History"]/@href') if vurl: vurl = vurl[0] self.scrape_vote_history(bill, vurl) bill.add_source(bill_detail_url) self.save_bill(bill) def scrape(self, chamber, session): # start with subjects session_code = self.metadata['session_details'][session]['_code'] self.scrape_subjects(session_code) # get bill index index_url = self.urls[chamber]['daily-bill-index'] chamber_letter = 'S' if chamber == 'upper' else 'H' page = self.get(index_url).text doc = lxml.html.fromstring(page) doc.make_links_absolute(index_url) # visit each day and extract bill ids days = doc.xpath('//div/b/a/@href') for day_url in days: try: data = self.get(day_url).text except scrapelib.HTTPError: continue doc = lxml.html.fromstring(data) doc.make_links_absolute(day_url) for bill_a in doc.xpath('//p/a[1]'): bill_id = bill_a.text.replace('.', '') if bill_id.startswith(chamber_letter): self.scrape_details(bill_a.get('href'), session, chamber, bill_id)
<reponame>thechiragthakur/Data-Science-Using-Python<gh_stars>0 #!/usr/bin/env python # coding: utf-8 # # ASSIGNMENT 1 # Pima Indians Diabetes Database. # It consists 768 tuples each having 9 attributes. # In[1]: import pandas as pd #imported the dataset given to us pid=pd.read_csv("C:\\Users\\Micontroller Lab N16\\IIT MANDI\\3rd Week\\pima-indians-diabetes.csv",sep=',') #made a copy of the original dataset pid1=pid.copy() print(pid1) #looked for any null value present in the dataset print(pid1.isnull().sum()) # In[2]: pid.columns #created a list of all the columns present in the dataset pid_col=list(pid.columns) pid_col pid_col1=pid_col.copy() #we do not want to bring changes in the class column so we removed it from the copied dataset pid_col1.remove('class') pid_col1 # Question 1. Write a python program to # # a. Normalize all the attributes, except class attribute, of pima-indians-diabetes.csv # using min-max normalization to transform the data in the range [0-1]. Save the file as # pima-indians-diabetes-Normalised.csv # # b. Standardize, all the attributes, except class attribute, of pima-indians- # diabetes.csv using z-normalization. Save the file as pima-indians- # diabetes-Standardised.csv # In[3]: #Using minmaxscaler function from scikit-learn library for min max normalization from sklearn.preprocessing import MinMaxScaler pid1_mms=pid.copy() scaler = MinMaxScaler(copy=True, feature_range=(0,1)) print(scaler.fit(pid1_mms)) #fitting the model pid1_mms=scaler.fit_transform(pid1_mms) print(pid1_mms) #normalized dataset print('\n\n') # In[4]: #Using StandardScaler function from scikit-learn library for standardization. from sklearn.preprocessing import StandardScaler pid1_ss=pid1.copy() scaler = StandardScaler() standard_df = scaler.fit_transform(pid1_ss) #fitting the model print(pid1_ss) #standardized dataset # Question 2. Split the data of each class from pima-indians-diabetes.csv into train data and test # data. Train data contain 70% of tuples from each of the class and test data contain remaining # 30% of tuples from each class. Save the train data as diabetes-train.csv and save the # test data as diabetes-test.csv # a. Classify every test tuple using K-nearest neighbor (KNN) method for the different values # of K (1, 3, 5, 7, 9, 11, 13, 15, 17, 21). Perform the following analysis : # i. Find confusion matrix (use ‘confusion_matrix’) for each K. # ii. Find the classification accuracy (You can use ‘accuracy_score’) for each K. Note the # value of K for which the accuracy is high. # In[5]: X1 = pid1.drop(['class'], axis = 1)# X denotes the input functions and here class defines whether the person is ill or not print(X1) y1 = pid['class'] #y denotes the output functions print(y1) # In[6]: from sklearn.model_selection import train_test_split #As given we are assigning 70% of data for training and 30% for testing X1_train, X1_test, y1_train, y1_test = train_test_split(X1, y1, train_size = 0.7, random_state = 42) print(X1_train) print(y1_train) print(X1_test) print(y1_test) # In[7]: import numpy as np import matplotlib.pyplot as plt from sklearn.neighbors import KNeighborsClassifier from sklearn.metrics import accuracy_score,confusion_matrix neighbors=[1,3,5,7,9,11,13,15,17,19,21] train_accuracy = np.empty(len(neighbors)) test_accuracy = np.empty(len(neighbors)) # Loop over K values for i, k in enumerate(neighbors): knn = KNeighborsClassifier(n_neighbors=k) knn.fit(X1_train, y1_train) print('Predicted Outcomes for neighbours =',k,'are', knn.predict(X1_test)) print('\n') print('Accuracy = ',knn.score(X1_test, y1_test)) print('\n') matrix = confusion_matrix(y1_test,knn.predict(X1_test)) print('Confusion Matrix = ',matrix) print('\n\n') # Compute traning and test data accuracy train_accuracy[i] = knn.score(X1_train, y1_train) test_accuracy[i] = knn.score(X1_test, y1_test) # Generate plot plt.plot(neighbors, test_accuracy, label = 'Testing dataset Accuracy') plt.plot(neighbors, train_accuracy, label = 'Training dataset Accuracy') plt.legend() plt.xlabel('n_neighbors') plt.ylabel('Accuracy') plt.show() # Question 3. Split the data of each class from pima-indians-diabetes-Normalised.csv into # train data and test data. Train data should contain same 70% of tuples in Question 2 from # each of the class and test data contain remaining same 30% of tuples from each class. Save the # # train data as diabetes-train-normalise.csv and save the test data as diabetes- # test-normalise.csv # # a. Classify every test tuple using K-nearest neighbor (KNN) method for the different values # of K (1, 3, 5, 7, 9, 11, 13, 15, 17, 21). Perform the following analysis : # i. Find confusion matrix (use ‘confusion_matrix’) for each K. # ii. Find the classification accuracy (You can use ‘accuracy_score’) for each K. Note the # value of K for which the accuracy is high. # In[8]: X2 = pid1_mms X2 y2 = pid['class'] y2 # In[9]: from sklearn.model_selection import train_test_split X2_train, X2_test, y2_train, y2_test = train_test_split(X2, y2, train_size = 0.7, random_state = 42) print(X2_train) print(y2_train) print(X2_test) print(y2_test) # In[10]: import numpy as np import matplotlib.pyplot as plt neighbors=[1,3,5,7,9,11,13,15,17,19,21] train_accuracy = np.empty(len(neighbors)) test_accuracy = np.empty(len(neighbors)) acc=[] # Loop over K values for i, k in enumerate(neighbors): knn = KNeighborsClassifier(n_neighbors=k) knn.fit(X2_train, y2_train) print('Predicted Outcomes for neighbours =',k,'are', knn.predict(X2_test)) print('\n') print('Accuracy = ',knn.score(X2_test, y2_test)) print('\n') matrix = confusion_matrix(y2_test,knn.predict(X2_test)) print('Confusion Matrix = ',matrix) print('\n\n') # Compute traning and test data accuracy train_accuracy[i] = knn.score(X2_train, y2_train) test_accuracy[i] = knn.score(X2_test, y2_test) # Generate plot plt.plot(neighbors, test_accuracy, label = 'Testing dataset Accuracy') plt.plot(neighbors, train_accuracy, label = 'Training dataset Accuracy') plt.legend() plt.xlabel('n_neighbors') plt.ylabel('Accuracy') plt.show() # Question 4. Split the data of each class from pima-indians-diabetes-Standardised.csv into # train data and test data. Train data should contain same 70% of tuples in Question 2 from # each of the class and test data contain remaining same 30% of tuples from each class. Save the # # train data as diabetes-train-standardise.csv and save the test data as diabetes- # test-standardise.csv # # a. Classify every test tuple using K-nearest neighbor (KNN) method for the different values # of K (1, 3, 5, 7, 9, 11, 13, 15, 17, 21). Perform the following analysis : # i. Find confusion matrix (use ‘confusion_matrix’) for each K. # # ii. Find the classification accuracy (You can use ‘accuracy_score’) for each K. Note the # value of K for which the accuracy is high. # In[11]: X3 = pid1_ss X3 y3 = pid1_ss['class'] y3 # In[12]: from sklearn.model_selection import train_test_split X3_train, X3_test, y3_train, y3_test = train_test_split(X3, y3, train_size = 0.7, random_state = 42) print(X3_train) print(y3_train) print(X3_test) print(y3_test) # In[13]: import numpy as np import matplotlib.pyplot as plt neighbors=[1,3,5,7,9,11,13,15,17,19,21] train_accuracy = np.empty(len(neighbors)) test_accuracy = np.empty(len(neighbors)) acc=[] # Loop over K values for i, k in enumerate(neighbors): knn = KNeighborsClassifier(n_neighbors=k) knn.fit(X3_train, y3_train) print('Predicted Outcomes for neighbours =',k,'are', knn.predict(X3_test)) print('\n') print('Accuracy = ',knn.score(X3_test, y3_test)) print('\n') matrix = confusion_matrix(y3_test,knn.predict(X3_test)) print('Confusion Matrix = ',matrix) print('\n\n') # Compute traning and test data accuracy train_accuracy[i] = knn.score(X3_train, y3_train) test_accuracy[i] = knn.score(X3_test, y3_test) # Generate plot plt.plot(neighbors, test_accuracy, label = 'Testing dataset Accuracy') plt.plot(neighbors, train_accuracy, label = 'Training dataset Accuracy') plt.legend() plt.xlabel('n_neighbors') plt.ylabel('Accuracy') plt.show() # 6. Why the value of K is considered as odd integer? # Suppose P1 is the point, for which label needs to predict. First, you find the k closest point to P1 and then classify points by majority vote of its k neighbors. Each object votes for their class and the class with the most votes is taken as the prediction. # if k=even it will be difficult to choose class as the voting may be tied.
<filename>preprocessor/preprocessor.py<gh_stars>0 import os import random import json import tgt import librosa import numpy as np from tqdm import tqdm import audio as Audio from text import grapheme_to_phoneme from utils.tools import read_lexicon from g2p_en import G2p random.seed(1234) class Preprocessor: def __init__(self, config): self.config = config self.in_dir = config["path"]["raw_path"] self.out_dir = config["path"]["preprocessed_path"] self.val_size = config["preprocessing"]["val_size"] self.sampling_rate = config["preprocessing"]["audio"]["sampling_rate"] self.skip_len = config["preprocessing"]["audio"]["skip_len"] self.trim_top_db = config["preprocessing"]["audio"]["trim_top_db"] self.filter_length = config["preprocessing"]["stft"]["filter_length"] self.hop_length = config["preprocessing"]["stft"]["hop_length"] self.g2p = G2p() self.lexicon = read_lexicon(config["path"]["lexicon_path"]) self.STFT = Audio.stft.TacotronSTFT( config["preprocessing"]["stft"]["filter_length"], config["preprocessing"]["stft"]["hop_length"], config["preprocessing"]["stft"]["win_length"], config["preprocessing"]["mel"]["n_mel_channels"], config["preprocessing"]["audio"]["sampling_rate"], config["preprocessing"]["mel"]["mel_fmin"], config["preprocessing"]["mel"]["mel_fmax"], ) def build_from_path(self): os.makedirs((os.path.join(self.out_dir, "mel")), exist_ok=True) print("Processing Data ...") out = list() n_frames = 0 # Compute pitch, energy, duration, and mel-spectrogram speakers = {} for i, speaker in enumerate(tqdm(os.listdir(self.in_dir))): speakers[speaker] = i for wav_name in tqdm(os.listdir(os.path.join(self.in_dir, speaker))): if ".wav" not in wav_name: continue basename = wav_name.split(".")[0] ret = self.process_utterance(speaker, basename) if ret is None: continue else: info, n = ret out.append(info) n_frames += n # Save files with open(os.path.join(self.out_dir, "speakers.json"), "w") as f: f.write(json.dumps(speakers)) print( "Total time: {} hours".format( n_frames * self.hop_length / self.sampling_rate / 3600 ) ) random.shuffle(out) out = [r for r in out if r is not None] # Write metadata with open(os.path.join(self.out_dir, "train.txt"), "w", encoding="utf-8") as f: for m in out[self.val_size :]: f.write(m + "\n") with open(os.path.join(self.out_dir, "val.txt"), "w", encoding="utf-8") as f: for m in out[: self.val_size]: f.write(m + "\n") return out def process_utterance(self, speaker, basename): wav_path = os.path.join(self.in_dir, speaker, "{}.wav".format(basename)) text_path = os.path.join(self.in_dir, speaker, "{}.lab".format(basename)) # Read and trim wav files wav, _ = librosa.load(wav_path) wav = wav.astype(np.float32) if len(wav) < self.skip_len: return None wav = librosa.effects.trim(wav, top_db=self.trim_top_db, frame_length=self.filter_length, hop_length=self.hop_length)[0] # Compute mel-scale spectrogram mel_spectrogram, _ = Audio.stft.get_mel_spectrogram(self.STFT, wav) mel_spectrogram = mel_spectrogram.squeeze(1).numpy() # Read raw text with open(text_path, "r") as f: raw_text = f.readline().strip("\n") # Get phoneme phone = grapheme_to_phoneme(raw_text, self.g2p, self.lexicon) text = "{" + " ".join(phone) + "}" # Save files mel_filename = "{}-mel-{}.npy".format(speaker, basename) np.save( os.path.join(self.out_dir, "mel", mel_filename), mel_spectrogram.T, ) return ( "|".join([basename, speaker, text, raw_text]), mel_spectrogram.shape[1], )
<filename>supervision/ssim.py # code from https://github.com/Po-Hsun-Su/pytorch-ssim import torch import numpy import math def __gaussian__(kernel_size, std, data_type=torch.float32): gaussian = numpy.array([math.exp(-(x - kernel_size//2)**2/float(2*std**2)) for x in range(kernel_size)]) gaussian /= numpy.sum(gaussian) return torch.tensor(gaussian, dtype=data_type) def __create_kernel__(kernel_size, data_type=torch.float32, channels=3, std=1.5): gaussian1d = __gaussian__(kernel_size, std).unsqueeze(1) gaussian2d = torch.mm(gaussian1d, gaussian1d.t())\ .type(data_type)\ .unsqueeze(0)\ .unsqueeze(0) window = gaussian2d.expand(channels, 1, kernel_size, kernel_size).contiguous() return window def __ssim_gaussian__(prediction, groundtruth, kernel, kernel_size, channels=3): padding = kernel_size // 2 prediction_mean = torch.nn.functional.conv2d(prediction, kernel, padding = padding, groups = channels) groundtruth_mean = torch.nn.functional.conv2d(groundtruth, kernel, padding = padding, groups = channels) prediction_mean_squared = prediction_mean.pow(2) groundtruth_mean_squared = groundtruth_mean.pow(2) prediction_mean_times_groundtruth_mean = prediction_mean * groundtruth_mean prediction_sigma_squared = torch.nn.functional.conv2d(prediction * prediction, kernel, padding=padding, groups=channels)\ - prediction_mean_squared groundtruth_sigma_squared = torch.nn.functional.conv2d(groundtruth * groundtruth, kernel, padding=padding, groups=channels)\ - groundtruth_mean_squared prediction_groundtruth_covariance = torch.nn.functional.conv2d(prediction * groundtruth, kernel, padding=padding, groups=channels)\ - prediction_mean_times_groundtruth_mean C1 = 0.01**2 # assume that images are in the [0, 1] range C2 = 0.03**2 # assume that images are in the [0, 1] range return ( ( # numerator (2 * prediction_mean_times_groundtruth_mean + C1) # luminance term * (2 * prediction_groundtruth_covariance + C2) # structural term ) / # division ( # denominator (prediction_mean_squared + groundtruth_mean_squared + C1) # luminance term * (prediction_sigma_squared + groundtruth_sigma_squared + C2) # structural term ) ) def ssim_gaussian(prediction, groundtruth, kernel_size = 11, std=1.5): (_, channels, _, _) = prediction.size() kernel = __create_kernel__(kernel_size, data_type=prediction.type(),\ channels=channels, std=std) if prediction.is_cuda: kernel = kernel.to(prediction.get_device()) kernel = kernel.type_as(prediction) return __ssim_gaussian__(prediction, groundtruth, kernel, kernel_size, channels) def ssim_box(prediction, groundtruth, kernel_size=3): C1 = 0.01 ** 2 C2 = 0.03 ** 2 prediction_mean = torch.nn.AvgPool2d(kernel_size, stride=1)(prediction) groundtruth_mean = torch.nn.AvgPool2d(kernel_size, stride=1)(groundtruth) prediction_groundtruth_mean = prediction_mean * groundtruth_mean prediction_mean_squared = prediction_mean.pow(2) groundtruth_mean_squared = groundtruth_mean.pow(2) prediction_sigma = torch.nn.AvgPool2d(kernel_size, stride=1)(prediction * prediction) - prediction_mean_squared groundtruth_sigma = torch.nn.AvgPool2d(kernel_size, stride=1)(groundtruth * groundtruth) - groundtruth_mean_squared correlation = torch.nn.AvgPool2d(kernel_size, stride=1)(prediction * groundtruth) - prediction_groundtruth_mean numerator = (2 * prediction_groundtruth_mean + C1) * (2 * correlation + C2) denominator = (prediction_mean_squared + groundtruth_mean_squared + C1)\ * (prediction_sigma + groundtruth_sigma + C2) ssim = numerator / denominator pad = kernel_size // 2 return torch.nn.functional.pad(ssim, (pad, pad, pad, pad)) def ssim_loss(prediction, groundtruth, kernel_size=5, std=1.5, mode='gaussian'): if mode == 'gaussian': return ssim_gaussian(prediction, groundtruth, kernel_size=kernel_size, std=std) elif mode == 'box': return ssim_box(prediction, groundtruth, kernel_size=kernel_size)
# -*- coding: utf-8 -*- model = { 'tlh': 0, "e' ": 1, 'gh ': 2, "i' ": 3, " 'e": 4, "u' ": 5, ' vi': 6, 'atl': 7, "a' ": 8, ' gh': 9, 'ej ': 10, ' ho': 11, ' ch': 12, ' mu': 13, ' tl': 14, 'nga': 15, 'mey': 16, "wi'": 17, "be'": 18, 'an ': 19, 'ch ': 20, 'gan': 21, 'chu': 22, 'lh ': 23, 'ing': 24, "'e'": 25, 'hin': 26, 'jat': 27, 'lhi': 28, ' da': 29, ' ja': 30, "o' ": 31, 'ugh': 32, 'aq ': 33, 'cha': 34, ' po': 35, 'ey ': 36, " 'a": 37, ' je': 38, "'ej": 39, ' pa': 40, 'ng ': 41, 'ad ': 42, ' qa': 43, 'oh ': 44, 'eh ': 45, 'ah ': 46, 'gha': 47, 'je ': 48, ' lu': 49, 'hol': 50, "aw'": 51, ' ji': 52, 'ong': 53, "pu'": 54, 'aj ': 55, 'vad': 56, "w' ": 57, "' j": 58, "ha'": 59, 'is ': 60, 'tah': 61, "' '": 62, 'ang': 63, "h '": 64, 'pon': 65, 'am ': 66, 'law': 67, "mo'": 68, "qu'": 69, 'hbe': 70, 'ol ': 71, 'vam': 72, 'agh': 73, "mu'": 74, 'ahv': 75, 'bej': 76, 'ogh': 77, 'uch': 78, "' v": 79, 'ach': 80, 'hug': 81, ' lo': 82, ' qu': 83, 'cho': 84, 'hva': 85, 'ij ': 86, ' la': 87, "lu'": 88, 'vis': 89, ' ne': 90, ' pu': 91, ' so': 92, ' ta': 93, ' va': 94, "'ac": 95, "di'": 96, "hu'": 97, 'lah': 98, 'moh': 99, " 'o": 100, "' m": 101, 'daq': 102, 'hah': 103, 'n h': 104, 'neh': 105, "u'm": 106, "ay'": 107, 'gho': 108, 'h v': 109, 'meh': 110, 'oy ': 111, ' ma': 112, ' nu': 113, "'me": 114, 'el ': 115, ' ba': 116, ' be': 117, ' de': 118, ' ng': 119, "' t": 120, 'h d': 121, 'hvi': 122, 'oq ': 123, ' wa': 124, "' l": 125, "'wi": 126, 'hme': 127, "li'": 128, 'uq ': 129, ' bo': 130, 'bog': 131, 'del': 132, 'h p': 133, 'h t': 134, 'ich': 135, 'vil': 136, ' qe': 137, ' wi': 138, 'ahb': 139, 'ban': 140, 'eng': 141, 'haq': 142, 'hoh': 143, 'ov ': 144, 'viq': 145, ' ha': 146, ' ti': 147, "' n": 148, "' p": 149, "'a'": 150, 'hwi': 151, 'igh': 152, "lo'": 153, "y' ": 154, ' du': 155, ' no': 156, ' yu': 157, "'mo": 158, "'va": 159, 'daj': 160, 'das': 161, 'egh': 162, 'hom': 163, 'muc': 164, 'om ': 165, 'otl': 166, 'us ': 167, ' bi': 168, ' tu': 169, "' h": 170, 'chm': 171, 'h q': 172, 'hov': 173, 'nis': 174, 'qar': 175, 'uj ': 176, "' q": 177, "'ch": 178, 'h m': 179, 'hmo': 180, 'jih': 181, 'par': 182, 'wij': 183, ' hu': 184, "' d": 185, "'a ": 186, 'etl': 187, 'h g': 188, 'h j': 189, 'h l': 190, 'lod': 191, 'maq': 192, 'och': 193, "wa'": 194, 'yuq': 195, ' di': 196, ' le': 197, ' pe': 198, ' ya': 199, "'di": 200, 'che': 201, 'ech': 202, 'ih ': 203, 'ija': 204, 'in ': 205, "j '": 206, 'j m': 207, 'lhw': 208, "pa'": 209, " 'i": 210, ' mi': 211, ' qi': 212, ' ro': 213, ' ru': 214, "'be": 215, 'anp': 216, 'ghi': 217, 'ghu': 218, 'h b': 219, 'hay': 220, 'hch': 221, 'iq ': 222, 'npu': 223, 'od ': 224, 'paq': 225, 'qay': 226, 'rda': 227, 'soh': 228, ' do': 229, ' me': 230, ' qo': 231, ' sa': 232, "' c": 233, "' g": 234, "' s": 235, "'lu": 236, 'aml': 237, 'ard': 238, 'as ': 239, 'd p': 240, 'gme': 241, 'h n': 242, 'hta': 243, "i'v": 244, 'j j': 245, 'jij': 246, 'len': 247, 'ngm': 248, 'qan': 249, 'qme': 250, 'vaj': 251, 'wiv': 252, ' mo': 253, ' ni': 254, "'la": 255, "'pu": 256, "'qu": 257, 'ar ': 258, 'arm': 259, 'dwi': 260, 'g p': 261, 'ghd': 262, 'h c': 263, 'ham': 264, 'hla': 265, 'hqu': 266, 'ilo': 267, 'iqa': 268, 'iqi': 269, 'j p': 270, 'j t': 271, 'j v': 272, 'lad': 273, 'lho': 274, 'mar': 275, 'mug': 276, 'pus': 277, 'q s': 278, 'q t': 279, 'rgh': 280, 'rma': 281, 'sov': 282, "ta'": 283, 'tin': 284, "tu'": 285, "u'd": 286, 'vet': 287, 'yli': 288, "yu'": 289, ' to': 290, "'oh": 291, 'aqq': 292, 'art': 293, 'at ': 294, 'ayl': 295, 'ayt': 296, 'et ': 297, 'haj': 298, 'har': 299, }
# Copyright 2018 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """This example demonstrates how to add a keyword to an ad group.""" from __future__ import absolute_import import argparse import six import sys import google.ads.google_ads.client def main(client, customer_id, ad_group_id, keyword): ad_group_service = client.get_service('AdGroupService', version='v1') ad_group_criterion_service = client.get_service('AdGroupCriterionService', version='v1') # Create keyword. ad_group_criterion_operation = client.get_type('AdGroupCriterionOperation', version='v1') ad_group_criterion = ad_group_criterion_operation.create ad_group_criterion.ad_group.value = ad_group_service.ad_group_path( customer_id, ad_group_id) ad_group_criterion.status = client.get_type( 'AdGroupCriterionStatusEnum').ENABLED ad_group_criterion.keyword.text.value = keyword ad_group_criterion.keyword.match_type = client.get_type( 'KeywordMatchTypeEnum').EXACT # Optional field # All fields can be referenced from the protos directly. # The protos are located in subdirectories under # google/ads/googleads/v0/proto. # ad_group_criterion.negative.value = True # Optional repeated field # final_url = ad_group_criterion.final_urls.add() # final_url.value = 'https://www.example.com' # Add keyword try: ad_group_criterion_response = ( ad_group_criterion_service.mutate_ad_group_criteria( customer_id, [ad_group_criterion_operation])) except google.ads.google_ads.errors.GoogleAdsException as ex: print('Request with ID "%s" failed with status "%s" and includes the ' 'following errors:' % (ex.request_id, ex.error.code().name)) for error in ex.failure.errors: print('\tError with message "%s".' % error.message) if error.location: for field_path_element in error.location.field_path_elements: print('\t\tOn field: %s' % field_path_element.field_name) sys.exit(1) print('Created keyword %s.' % ad_group_criterion_response.results[0].resource_name) if __name__ == '__main__': # GoogleAdsClient will read the google-ads.yaml configuration file in the # home directory if none is specified. google_ads_client = (google.ads.google_ads.client.GoogleAdsClient .load_from_storage()) parser = argparse.ArgumentParser( description=('Adds a keyword to the provided ad group, for the ' 'specified customer.')) # The following argument(s) should be provided to run the example. parser.add_argument('-c', '--customer_id', type=six.text_type, required=True, help='The Google Ads customer ID.') parser.add_argument('-a', '--ad_group_id', type=six.text_type, required=True, help='The ad group ID.') parser.add_argument('-k', '--keyword', type=six.text_type, required=False, default='mars cruise', help=('The keyword to be added to the ad group. Note ' 'that you will receive an error response if you ' 'attempt to create a duplicate keyword.')) args = parser.parse_args() main(google_ads_client, args.customer_id, args.ad_group_id, args.keyword)
# Copyright 2021 Huawei Technologies Co., Ltd # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================ import mindspore.ops as P from mindspore import nn class Module3(nn.Cell): def __init__(self, conv2d_0_in_channels, conv2d_0_out_channels, conv2d_0_kernel_size, conv2d_0_stride, conv2d_0_padding, conv2d_0_pad_mode, conv2d_0_group): super(Module3, self).__init__() self.conv2d_0 = nn.Conv2d(in_channels=conv2d_0_in_channels, out_channels=conv2d_0_out_channels, kernel_size=conv2d_0_kernel_size, stride=conv2d_0_stride, padding=conv2d_0_padding, pad_mode=conv2d_0_pad_mode, dilation=(1, 1), group=conv2d_0_group, has_bias=True) self.relu_1 = nn.ReLU() def construct(self, x): opt_conv2d_0 = self.conv2d_0(x) opt_relu_1 = self.relu_1(opt_conv2d_0) return opt_relu_1 class Module8(nn.Cell): def __init__(self, conv2d_0_in_channels, conv2d_0_out_channels, module3_0_conv2d_0_in_channels, module3_0_conv2d_0_out_channels, module3_0_conv2d_0_kernel_size, module3_0_conv2d_0_stride, module3_0_conv2d_0_padding, module3_0_conv2d_0_pad_mode, module3_0_conv2d_0_group, module3_1_conv2d_0_in_channels, module3_1_conv2d_0_out_channels, module3_1_conv2d_0_kernel_size, module3_1_conv2d_0_stride, module3_1_conv2d_0_padding, module3_1_conv2d_0_pad_mode, module3_1_conv2d_0_group): super(Module8, self).__init__() self.module3_0 = Module3(conv2d_0_in_channels=module3_0_conv2d_0_in_channels, conv2d_0_out_channels=module3_0_conv2d_0_out_channels, conv2d_0_kernel_size=module3_0_conv2d_0_kernel_size, conv2d_0_stride=module3_0_conv2d_0_stride, conv2d_0_padding=module3_0_conv2d_0_padding, conv2d_0_pad_mode=module3_0_conv2d_0_pad_mode, conv2d_0_group=module3_0_conv2d_0_group) self.module3_1 = Module3(conv2d_0_in_channels=module3_1_conv2d_0_in_channels, conv2d_0_out_channels=module3_1_conv2d_0_out_channels, conv2d_0_kernel_size=module3_1_conv2d_0_kernel_size, conv2d_0_stride=module3_1_conv2d_0_stride, conv2d_0_padding=module3_1_conv2d_0_padding, conv2d_0_pad_mode=module3_1_conv2d_0_pad_mode, conv2d_0_group=module3_1_conv2d_0_group) self.conv2d_0 = nn.Conv2d(in_channels=conv2d_0_in_channels, out_channels=conv2d_0_out_channels, kernel_size=(1, 1), stride=(1, 1), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) def construct(self, x): module3_0_opt = self.module3_0(x) module3_1_opt = self.module3_1(module3_0_opt) opt_conv2d_0 = self.conv2d_0(module3_1_opt) return opt_conv2d_0 class Module0(nn.Cell): def __init__(self, conv2d_0_in_channels, conv2d_0_out_channels, conv2d_2_in_channels, conv2d_2_out_channels, conv2d_2_group, conv2d_4_in_channels, conv2d_4_out_channels): super(Module0, self).__init__() self.conv2d_0 = nn.Conv2d(in_channels=conv2d_0_in_channels, out_channels=conv2d_0_out_channels, kernel_size=(1, 1), stride=(1, 1), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) self.relu_1 = nn.ReLU() self.conv2d_2 = nn.Conv2d(in_channels=conv2d_2_in_channels, out_channels=conv2d_2_out_channels, kernel_size=(3, 3), stride=(1, 1), padding=(1, 1, 1, 1), pad_mode="pad", dilation=(1, 1), group=conv2d_2_group, has_bias=True) self.relu_3 = nn.ReLU() self.conv2d_4 = nn.Conv2d(in_channels=conv2d_4_in_channels, out_channels=conv2d_4_out_channels, kernel_size=(1, 1), stride=(1, 1), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) self.relu_6 = nn.ReLU() def construct(self, x): opt_conv2d_0 = self.conv2d_0(x) opt_relu_1 = self.relu_1(opt_conv2d_0) opt_conv2d_2 = self.conv2d_2(opt_relu_1) opt_relu_3 = self.relu_3(opt_conv2d_2) opt_conv2d_4 = self.conv2d_4(opt_relu_3) opt_add_5 = P.Add()(x, opt_conv2d_4) opt_relu_6 = self.relu_6(opt_add_5) return opt_relu_6 class Module10(nn.Cell): def __init__(self, module0_0_conv2d_0_in_channels, module0_0_conv2d_0_out_channels, module0_0_conv2d_2_in_channels, module0_0_conv2d_2_out_channels, module0_0_conv2d_2_group, module0_0_conv2d_4_in_channels, module0_0_conv2d_4_out_channels, module0_1_conv2d_0_in_channels, module0_1_conv2d_0_out_channels, module0_1_conv2d_2_in_channels, module0_1_conv2d_2_out_channels, module0_1_conv2d_2_group, module0_1_conv2d_4_in_channels, module0_1_conv2d_4_out_channels, module0_2_conv2d_0_in_channels, module0_2_conv2d_0_out_channels, module0_2_conv2d_2_in_channels, module0_2_conv2d_2_out_channels, module0_2_conv2d_2_group, module0_2_conv2d_4_in_channels, module0_2_conv2d_4_out_channels, module0_3_conv2d_0_in_channels, module0_3_conv2d_0_out_channels, module0_3_conv2d_2_in_channels, module0_3_conv2d_2_out_channels, module0_3_conv2d_2_group, module0_3_conv2d_4_in_channels, module0_3_conv2d_4_out_channels): super(Module10, self).__init__() self.module0_0 = Module0(conv2d_0_in_channels=module0_0_conv2d_0_in_channels, conv2d_0_out_channels=module0_0_conv2d_0_out_channels, conv2d_2_in_channels=module0_0_conv2d_2_in_channels, conv2d_2_out_channels=module0_0_conv2d_2_out_channels, conv2d_2_group=module0_0_conv2d_2_group, conv2d_4_in_channels=module0_0_conv2d_4_in_channels, conv2d_4_out_channels=module0_0_conv2d_4_out_channels) self.module0_1 = Module0(conv2d_0_in_channels=module0_1_conv2d_0_in_channels, conv2d_0_out_channels=module0_1_conv2d_0_out_channels, conv2d_2_in_channels=module0_1_conv2d_2_in_channels, conv2d_2_out_channels=module0_1_conv2d_2_out_channels, conv2d_2_group=module0_1_conv2d_2_group, conv2d_4_in_channels=module0_1_conv2d_4_in_channels, conv2d_4_out_channels=module0_1_conv2d_4_out_channels) self.module0_2 = Module0(conv2d_0_in_channels=module0_2_conv2d_0_in_channels, conv2d_0_out_channels=module0_2_conv2d_0_out_channels, conv2d_2_in_channels=module0_2_conv2d_2_in_channels, conv2d_2_out_channels=module0_2_conv2d_2_out_channels, conv2d_2_group=module0_2_conv2d_2_group, conv2d_4_in_channels=module0_2_conv2d_4_in_channels, conv2d_4_out_channels=module0_2_conv2d_4_out_channels) self.module0_3 = Module0(conv2d_0_in_channels=module0_3_conv2d_0_in_channels, conv2d_0_out_channels=module0_3_conv2d_0_out_channels, conv2d_2_in_channels=module0_3_conv2d_2_in_channels, conv2d_2_out_channels=module0_3_conv2d_2_out_channels, conv2d_2_group=module0_3_conv2d_2_group, conv2d_4_in_channels=module0_3_conv2d_4_in_channels, conv2d_4_out_channels=module0_3_conv2d_4_out_channels) def construct(self, x): module0_0_opt = self.module0_0(x) module0_1_opt = self.module0_1(module0_0_opt) module0_2_opt = self.module0_2(module0_1_opt) module0_3_opt = self.module0_3(module0_2_opt) return module0_3_opt class Module1(nn.Cell): def __init__(self): super(Module1, self).__init__() self.module0_0 = Module0(conv2d_0_in_channels=720, conv2d_0_out_channels=720, conv2d_2_in_channels=720, conv2d_2_out_channels=720, conv2d_2_group=6, conv2d_4_in_channels=720, conv2d_4_out_channels=720) self.module0_1 = Module0(conv2d_0_in_channels=720, conv2d_0_out_channels=720, conv2d_2_in_channels=720, conv2d_2_out_channels=720, conv2d_2_group=6, conv2d_4_in_channels=720, conv2d_4_out_channels=720) def construct(self, x): module0_0_opt = self.module0_0(x) module0_1_opt = self.module0_1(module0_0_opt) return module0_1_opt class MindSporeModel(nn.Cell): def __init__(self): super(MindSporeModel, self).__init__() self.conv2d_0 = nn.Conv2d(in_channels=3, out_channels=32, kernel_size=(3, 3), stride=(2, 2), padding=(1, 1, 1, 1), pad_mode="pad", dilation=(1, 1), group=1, has_bias=True) self.relu_1 = nn.ReLU() self.conv2d_2 = nn.Conv2d(in_channels=32, out_channels=80, kernel_size=(1, 1), stride=(2, 2), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) self.module8_0 = Module8(conv2d_0_in_channels=80, conv2d_0_out_channels=80, module3_0_conv2d_0_in_channels=32, module3_0_conv2d_0_out_channels=80, module3_0_conv2d_0_kernel_size=(1, 1), module3_0_conv2d_0_stride=(1, 1), module3_0_conv2d_0_padding=0, module3_0_conv2d_0_pad_mode="valid", module3_0_conv2d_0_group=1, module3_1_conv2d_0_in_channels=80, module3_1_conv2d_0_out_channels=80, module3_1_conv2d_0_kernel_size=(3, 3), module3_1_conv2d_0_stride=(2, 2), module3_1_conv2d_0_padding=(1, 1, 1, 1), module3_1_conv2d_0_pad_mode="pad", module3_1_conv2d_0_group=1) self.relu_9 = nn.ReLU() self.module0_0 = Module0(conv2d_0_in_channels=80, conv2d_0_out_channels=80, conv2d_2_in_channels=80, conv2d_2_out_channels=80, conv2d_2_group=1, conv2d_4_in_channels=80, conv2d_4_out_channels=80) self.conv2d_17 = nn.Conv2d(in_channels=80, out_channels=240, kernel_size=(1, 1), stride=(2, 2), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) self.module8_1 = Module8(conv2d_0_in_channels=240, conv2d_0_out_channels=240, module3_0_conv2d_0_in_channels=80, module3_0_conv2d_0_out_channels=240, module3_0_conv2d_0_kernel_size=(1, 1), module3_0_conv2d_0_stride=(1, 1), module3_0_conv2d_0_padding=0, module3_0_conv2d_0_pad_mode="valid", module3_0_conv2d_0_group=1, module3_1_conv2d_0_in_channels=240, module3_1_conv2d_0_out_channels=240, module3_1_conv2d_0_kernel_size=(3, 3), module3_1_conv2d_0_stride=(2, 2), module3_1_conv2d_0_padding=(1, 1, 1, 1), module3_1_conv2d_0_pad_mode="pad", module3_1_conv2d_0_group=2) self.relu_24 = nn.ReLU() self.module10_0 = Module10(module0_0_conv2d_0_in_channels=240, module0_0_conv2d_0_out_channels=240, module0_0_conv2d_2_in_channels=240, module0_0_conv2d_2_out_channels=240, module0_0_conv2d_2_group=2, module0_0_conv2d_4_in_channels=240, module0_0_conv2d_4_out_channels=240, module0_1_conv2d_0_in_channels=240, module0_1_conv2d_0_out_channels=240, module0_1_conv2d_2_in_channels=240, module0_1_conv2d_2_out_channels=240, module0_1_conv2d_2_group=2, module0_1_conv2d_4_in_channels=240, module0_1_conv2d_4_out_channels=240, module0_2_conv2d_0_in_channels=240, module0_2_conv2d_0_out_channels=240, module0_2_conv2d_2_in_channels=240, module0_2_conv2d_2_out_channels=240, module0_2_conv2d_2_group=2, module0_2_conv2d_4_in_channels=240, module0_2_conv2d_4_out_channels=240, module0_3_conv2d_0_in_channels=240, module0_3_conv2d_0_out_channels=240, module0_3_conv2d_2_in_channels=240, module0_3_conv2d_2_out_channels=240, module0_3_conv2d_2_group=2, module0_3_conv2d_4_in_channels=240, module0_3_conv2d_4_out_channels=240) self.conv2d_53 = nn.Conv2d(in_channels=240, out_channels=720, kernel_size=(1, 1), stride=(2, 2), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) self.module8_2 = Module8(conv2d_0_in_channels=720, conv2d_0_out_channels=720, module3_0_conv2d_0_in_channels=240, module3_0_conv2d_0_out_channels=720, module3_0_conv2d_0_kernel_size=(1, 1), module3_0_conv2d_0_stride=(1, 1), module3_0_conv2d_0_padding=0, module3_0_conv2d_0_pad_mode="valid", module3_0_conv2d_0_group=1, module3_1_conv2d_0_in_channels=720, module3_1_conv2d_0_out_channels=720, module3_1_conv2d_0_kernel_size=(3, 3), module3_1_conv2d_0_stride=(2, 2), module3_1_conv2d_0_padding=(1, 1, 1, 1), module3_1_conv2d_0_pad_mode="pad", module3_1_conv2d_0_group=6) self.relu_60 = nn.ReLU() self.module10_1 = Module10(module0_0_conv2d_0_in_channels=720, module0_0_conv2d_0_out_channels=720, module0_0_conv2d_2_in_channels=720, module0_0_conv2d_2_out_channels=720, module0_0_conv2d_2_group=6, module0_0_conv2d_4_in_channels=720, module0_0_conv2d_4_out_channels=720, module0_1_conv2d_0_in_channels=720, module0_1_conv2d_0_out_channels=720, module0_1_conv2d_2_in_channels=720, module0_1_conv2d_2_out_channels=720, module0_1_conv2d_2_group=6, module0_1_conv2d_4_in_channels=720, module0_1_conv2d_4_out_channels=720, module0_2_conv2d_0_in_channels=720, module0_2_conv2d_0_out_channels=720, module0_2_conv2d_2_in_channels=720, module0_2_conv2d_2_out_channels=720, module0_2_conv2d_2_group=6, module0_2_conv2d_4_in_channels=720, module0_2_conv2d_4_out_channels=720, module0_3_conv2d_0_in_channels=720, module0_3_conv2d_0_out_channels=720, module0_3_conv2d_2_in_channels=720, module0_3_conv2d_2_out_channels=720, module0_3_conv2d_2_group=6, module0_3_conv2d_4_in_channels=720, module0_3_conv2d_4_out_channels=720) self.module10_2 = Module10(module0_0_conv2d_0_in_channels=720, module0_0_conv2d_0_out_channels=720, module0_0_conv2d_2_in_channels=720, module0_0_conv2d_2_out_channels=720, module0_0_conv2d_2_group=6, module0_0_conv2d_4_in_channels=720, module0_0_conv2d_4_out_channels=720, module0_1_conv2d_0_in_channels=720, module0_1_conv2d_0_out_channels=720, module0_1_conv2d_2_in_channels=720, module0_1_conv2d_2_out_channels=720, module0_1_conv2d_2_group=6, module0_1_conv2d_4_in_channels=720, module0_1_conv2d_4_out_channels=720, module0_2_conv2d_0_in_channels=720, module0_2_conv2d_0_out_channels=720, module0_2_conv2d_2_in_channels=720, module0_2_conv2d_2_out_channels=720, module0_2_conv2d_2_group=6, module0_2_conv2d_4_in_channels=720, module0_2_conv2d_4_out_channels=720, module0_3_conv2d_0_in_channels=720, module0_3_conv2d_0_out_channels=720, module0_3_conv2d_2_in_channels=720, module0_3_conv2d_2_out_channels=720, module0_3_conv2d_2_group=6, module0_3_conv2d_4_in_channels=720, module0_3_conv2d_4_out_channels=720) self.module10_3 = Module10(module0_0_conv2d_0_in_channels=720, module0_0_conv2d_0_out_channels=720, module0_0_conv2d_2_in_channels=720, module0_0_conv2d_2_out_channels=720, module0_0_conv2d_2_group=6, module0_0_conv2d_4_in_channels=720, module0_0_conv2d_4_out_channels=720, module0_1_conv2d_0_in_channels=720, module0_1_conv2d_0_out_channels=720, module0_1_conv2d_2_in_channels=720, module0_1_conv2d_2_out_channels=720, module0_1_conv2d_2_group=6, module0_1_conv2d_4_in_channels=720, module0_1_conv2d_4_out_channels=720, module0_2_conv2d_0_in_channels=720, module0_2_conv2d_0_out_channels=720, module0_2_conv2d_2_in_channels=720, module0_2_conv2d_2_out_channels=720, module0_2_conv2d_2_group=6, module0_2_conv2d_4_in_channels=720, module0_2_conv2d_4_out_channels=720, module0_3_conv2d_0_in_channels=720, module0_3_conv2d_0_out_channels=720, module0_3_conv2d_2_in_channels=720, module0_3_conv2d_2_out_channels=720, module0_3_conv2d_2_group=6, module0_3_conv2d_4_in_channels=720, module0_3_conv2d_4_out_channels=720) self.module1_0 = Module1() self.conv2d_159 = nn.Conv2d(in_channels=720, out_channels=1920, kernel_size=(1, 1), stride=(2, 2), padding=0, pad_mode="valid", dilation=(1, 1), group=1, has_bias=True) self.module8_3 = Module8(conv2d_0_in_channels=1920, conv2d_0_out_channels=1920, module3_0_conv2d_0_in_channels=720, module3_0_conv2d_0_out_channels=1920, module3_0_conv2d_0_kernel_size=(1, 1), module3_0_conv2d_0_stride=(1, 1), module3_0_conv2d_0_padding=0, module3_0_conv2d_0_pad_mode="valid", module3_0_conv2d_0_group=1, module3_1_conv2d_0_in_channels=1920, module3_1_conv2d_0_out_channels=1920, module3_1_conv2d_0_kernel_size=(3, 3), module3_1_conv2d_0_stride=(2, 2), module3_1_conv2d_0_padding=(1, 1, 1, 1), module3_1_conv2d_0_pad_mode="pad", module3_1_conv2d_0_group=16) self.relu_166 = nn.ReLU() self.avgpool2d_167 = nn.AvgPool2d(kernel_size=(7, 7)) self.flatten_168 = nn.Flatten() self.dense_169 = nn.Dense(in_channels=1920, out_channels=1000, has_bias=True) def construct(self, input_1): opt_conv2d_0 = self.conv2d_0(input_1) opt_relu_1 = self.relu_1(opt_conv2d_0) opt_conv2d_2 = self.conv2d_2(opt_relu_1) module8_0_opt = self.module8_0(opt_relu_1) opt_add_8 = P.Add()(opt_conv2d_2, module8_0_opt) opt_relu_9 = self.relu_9(opt_add_8) module0_0_opt = self.module0_0(opt_relu_9) opt_conv2d_17 = self.conv2d_17(module0_0_opt) module8_1_opt = self.module8_1(module0_0_opt) opt_add_23 = P.Add()(opt_conv2d_17, module8_1_opt) opt_relu_24 = self.relu_24(opt_add_23) module10_0_opt = self.module10_0(opt_relu_24) opt_conv2d_53 = self.conv2d_53(module10_0_opt) module8_2_opt = self.module8_2(module10_0_opt) opt_add_59 = P.Add()(opt_conv2d_53, module8_2_opt) opt_relu_60 = self.relu_60(opt_add_59) module10_1_opt = self.module10_1(opt_relu_60) module10_2_opt = self.module10_2(module10_1_opt) module10_3_opt = self.module10_3(module10_2_opt) module1_0_opt = self.module1_0(module10_3_opt) opt_conv2d_159 = self.conv2d_159(module1_0_opt) module8_3_opt = self.module8_3(module1_0_opt) opt_add_165 = P.Add()(opt_conv2d_159, module8_3_opt) opt_relu_166 = self.relu_166(opt_add_165) opt_avgpool2d_167 = self.avgpool2d_167(opt_relu_166) opt_flatten_168 = self.flatten_168(opt_avgpool2d_167) opt_dense_169 = self.dense_169(opt_flatten_168) return opt_dense_169
<gh_stars>10-100 #!/bin/python import argparse import os import glob import json import shutil import urllib.parse import re import bs4 as bs import subprocess def get_path(url: str): urlpath = urllib.parse.urlparse(url).path match = re.search(r"^(/books/\d+)?/(.+?)(/content|/encrypted/\d+)?$", urlpath) path = match.group(2) if path[-8:].find(".") == -1: if str(match.group(3)).find("encrypted") >= 0: path += ".jpg" else: path += ".html" return path def export(dir, book_name, tmp_dir, out_dir): pages = [] pages_files = glob.glob(os.path.join(dir, '*_pages.json'))[0] with open(pages_files) as f: pages = json.load(f) if len(pages) == 0: return print("Copying files") if os.path.isdir(tmp_dir): shutil.rmtree(tmp_dir) shutil.copytree(dir, tmp_dir) filelist = [] pageimages = [] with open(os.path.join(tmp_dir, 'renames.json')) as f: renames = json.load(f) print("Fixing files") for page in pages: path = get_path(page["absoluteURL"]) changed = False file = os.path.join(tmp_dir, path) with open(file) as f: soup = bs.BeautifulSoup(f.read(), 'html.parser') for style in soup.head.find_all("style"): # some xhtml files contain "body{visibility:hidden}" making content invisible if style.string.find("visibility:hidden") != -1: style.decompose() changed = True for link in soup.find_all("link", href=True): if link["href"][0] == "/": new_path = get_path(link["href"]) link["href"] = os.path.relpath(os.path.join(tmp_dir, new_path), os.path.dirname(file)) changed = True for source in soup.find_all(["img", "script"], src=True): if source["src"][0] == "/": new_path = get_path(source["src"]) if new_path in renames: new_path = renames[new_path] source["src"] = os.path.relpath(os.path.join(tmp_dir, new_path), os.path.dirname(file)) changed = True if source.has_attr("id") and source["id"] == "pbk-page": pageimages.append(os.path.join(os.path.dirname(file), source["src"])); if changed: with open(file, "wb") as f: f.write(str(soup).encode("utf-8")) filelist.append(file) if len(pageimages) > 0: filelist = pageimages create_pdf(out_dir, book_name, filelist) def create_pdf(out_dir, book_name, filelist): print("Generating PDF, Please Wait! This will take a while.") outfile = os.path.join(out_dir, book_name + ".pdf") if filelist[0][-4:] == 'html': params = ["--no-pdf-compression", "--disable-javascript"] args = ["wkhtmltopdf"] else: params = [] args = ["magick"] args = args + params + filelist + [outfile] result = subprocess.run(args, stdout=subprocess.PIPE, stderr=subprocess.PIPE) print("Created {:s}".format(outfile)) if result.returncode != 0: print(result.stderr) print("Warning! There was some error while creating PDF!") def main(): parser = argparse.ArgumentParser() parser.add_argument('dir', type=str, help='path to a location of book') parser.add_argument('--book-name', type=str, default='Book', help='name of the book. Default=[%(default)s]') parser.add_argument('--tmp-dir', type=str, default='tmp', help='specify a directory to keep temporally files. Default=[%(default)s]') parser.add_argument('--out-dir', type=str, default='.', help='specify a directory where to save exported book. Default=[Current Directory]') args = parser.parse_args() try: os.makedirs(args.out_dir, exist_ok=True) except OSError as e: print("Unable to create output directory {:s}: {:s}" .format(args.out_dir, e)) if not os.path.isdir(args.dir): print("Wrong location to book!") return export(args.dir, args.book_name, args.tmp_dir, args.out_dir) if __name__ == '__main__': main()
<reponame>wubinbai/argus-freesound import torch from torch import nn import torch.nn.functional as F class ChannelAttention(nn.Module): def __init__(self, in_planes, ratio=16): super(ChannelAttention, self).__init__() self.avg_pool = nn.AdaptiveAvgPool2d(1) self.max_pool = nn.AdaptiveMaxPool2d(1) self.fc1 = nn.Conv2d(in_planes, in_planes // ratio, 1, bias=False) self.relu1 = nn.ReLU() self.fc2 = nn.Conv2d(in_planes // ratio, in_planes, 1, bias=False) self.sigmoid = nn.Sigmoid() def forward(self, x): avg_out = self.fc2(self.relu1(self.fc1(self.avg_pool(x)))) max_out = self.fc2(self.relu1(self.fc1(self.max_pool(x)))) out = avg_out + max_out return self.sigmoid(out) class SpatialAttention(nn.Module): def __init__(self, kernel_size=7): super(SpatialAttention, self).__init__() assert kernel_size in (3, 7), 'kernel size must be 3 or 7' padding = 3 if kernel_size == 7 else 1 self.conv1 = nn.Conv2d(2, 1, kernel_size, padding=padding, bias=False) self.sigmoid = nn.Sigmoid() def forward(self, x): avg_out = torch.mean(x, dim=1, keepdim=True) max_out, _ = torch.max(x, dim=1, keepdim=True) x = torch.cat([avg_out, max_out], dim=1) x = self.conv1(x) return self.sigmoid(x) class ConvolutionalBlockAttentionModule(nn.Module): def __init__(self, in_planes, ratio=16, kernel_size=7): super(ConvolutionalBlockAttentionModule, self).__init__() self.ca = ChannelAttention(in_planes, ratio) self.sa = SpatialAttention(kernel_size) def forward(self, input): out = self.ca(input) * input out = self.sa(out) * out return out class ConvBlock(nn.Module): def __init__(self, in_channels, out_channels): super().__init__() self.conv1 = nn.Sequential( nn.Conv2d(in_channels, out_channels, 3, 1, 1, bias=False), nn.BatchNorm2d(out_channels), nn.ReLU(), ) self.conv2 = nn.Sequential( nn.Conv2d(out_channels, out_channels, 3, 1, 1, bias=False), nn.BatchNorm2d(out_channels), nn.ReLU(), ) self._init_weights() def _init_weights(self): for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight) if m.bias is not None: nn.init.zeros_(m.bias) elif isinstance(m, nn.BatchNorm2d): nn.init.constant_(m.weight, 1) nn.init.zeros_(m.bias) def forward(self, x): x = self.conv1(x) x = self.conv2(x) x = F.avg_pool2d(x, 2) return x class SkipBlock(nn.Module): def __init__(self, in_channels, out_channels, scale_factor=2): super(SkipBlock, self).__init__() self.conv = nn.Conv2d(in_channels, out_channels, 3, 1, 1, bias=False) self.bn = nn.BatchNorm2d(out_channels) self.relu = nn.ReLU(inplace=True) self.scale_factor = scale_factor def forward(self, x): if self.scale_factor >= 2: x = F.avg_pool2d(x, self.scale_factor) x = self.conv(x) x = self.bn(x) x = self.relu(x) return x class SkipAttention(nn.Module): def __init__(self, num_classes, base_size=64, dropout=0.2, ratio=16, kernel_size=7, last_filters=8, last_fc=2): super().__init__() self.conv1 = ConvBlock(in_channels=3, out_channels=base_size) self.skip1 = SkipBlock(in_channels=base_size, out_channels=base_size*8, scale_factor=8) self.conv2 = ConvBlock(in_channels=base_size, out_channels=base_size*2) self.skip2 = SkipBlock(in_channels=base_size * 2, out_channels=base_size*8, scale_factor=4) self.conv3 = ConvBlock(in_channels=base_size*2, out_channels=base_size*4) self.skip3 = SkipBlock(in_channels=base_size*4, out_channels=base_size*8, scale_factor=2) self.conv4 = ConvBlock(in_channels=base_size*4, out_channels=base_size*8) self.attention = ConvolutionalBlockAttentionModule(base_size*8*4, ratio=ratio, kernel_size=kernel_size) self.merge = SkipBlock(base_size*8*4, base_size*last_filters, 1) self.avg_pool = nn.AdaptiveAvgPool2d(1) self.fc = nn.Sequential( nn.Dropout(dropout), nn.Linear(base_size*last_filters, base_size*last_fc), nn.PReLU(), nn.BatchNorm1d(base_size*last_fc), nn.Dropout(dropout/2), nn.Linear(base_size*last_fc, num_classes), ) def forward(self, x): x = self.conv1(x) skip1 = self.skip1(x) x = self.conv2(x) skip2 = self.skip2(x) x = self.conv3(x) skip3 = self.skip3(x) x = self.conv4(x) x = torch.cat([x, skip1, skip2, skip3], dim=1) x = self.attention(x) x = self.merge(x) x = self.avg_pool(x) x = x.view(x.size(0), -1) x = self.fc(x) return x
<filename>src/wikidated/_utils/seven_zip_archive.py # # Copyright 2021-2022 <NAME> # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # from __future__ import annotations from contextlib import contextmanager from logging import getLogger from os.path import relpath from pathlib import Path from shutil import rmtree from subprocess import DEVNULL, PIPE from typing import IO, Any, Callable, Iterator, Optional from typing_extensions import Final, Protocol from wikidated._utils.misc import external_process _LOGGER = getLogger(__name__) class _SupportsLessThan(Protocol): def __lt__(self, __other: Any) -> bool: ... class SevenZipArchive: def __init__(self, path: Path) -> None: self.path: Final = path @classmethod def from_dir(cls, dir_: Path, path: Path) -> SevenZipArchive: tmp_path = path.parent / (".tmp." + path.name) _LOGGER.debug(f"Creating 7z archive {path} from directory {dir_}.") if tmp_path.exists(): tmp_path.unlink() with external_process( ("7z", "a", "-ms=off", relpath(tmp_path, dir_), "."), stdin=DEVNULL, stdout=PIPE, stderr=PIPE, cwd=dir_, exhaust_stdout_to_log=True, exhaust_stderr_to_log=True, check_return_code_zero=True, ) as _: pass tmp_path.rename(path) return SevenZipArchive(path) @classmethod def from_dir_with_order( cls, dir_: Path, path: Path, key: Callable[[Path], _SupportsLessThan] ) -> SevenZipArchive: tmp_path = path.parent / f".tmp.{path.name}" tmp_dir = path.parent / f".tmp.{path.name}.contents" listfile_rename = path.parent / f".tmp.{path.name}.listfile-rename" _LOGGER.debug(f"Creating ordered 7z archive {path} from directory {dir_}.") files = list(dir_.iterdir()) files.sort(key=key) ordered_filename_num_digits = len(str(len(files) - 1)) tmp_dir.mkdir(exist_ok=False, parents=True) with listfile_rename.open("w", encoding="UTF-8") as fout: for i, file in enumerate(files): ordered_filename = f"{i:0{ordered_filename_num_digits}d}" fout.write(f"{ordered_filename}\n{file.name}\n") (tmp_dir / ordered_filename).symlink_to(file.resolve()) if tmp_path.exists(): tmp_path.unlink() with external_process( ("7z", "a", "-l", "-ms=off", relpath(tmp_path, tmp_dir), "."), stdin=DEVNULL, stdout=PIPE, stderr=PIPE, cwd=tmp_dir, exhaust_stdout_to_log=True, exhaust_stderr_to_log=True, check_return_code_zero=True, ) as _: pass rmtree(tmp_dir) with external_process( ("7z", "rn", f"{tmp_path}", f"@{listfile_rename}"), stdin=DEVNULL, stdout=PIPE, stderr=PIPE, exhaust_stdout_to_log=True, exhaust_stderr_to_log=True, check_return_code_zero=True, ) as _: pass listfile_rename.unlink() tmp_path.rename(path) return SevenZipArchive(path) @contextmanager def write(self, file_name: Optional[Path] = None) -> Iterator[IO[str]]: # This method seems to take longer the more file already exist in the archive. # If you plan want to create archives with many files, it is better to just # create a directory with all files in it as you need them, and then to convert # that to an archive using SevenZipArchive.from_dir(). if file_name: _LOGGER.debug(f"Writing file {file_name} to 7z archive {self.path}.") else: _LOGGER.debug(f"Writing to 7z archive {self.path}.") file_name_str = str(file_name) if file_name else "" with external_process( ("7z", "a", "-bd", "-bso0", f"-si{file_name_str}", str(self.path)), stdin=PIPE, stdout=PIPE, stderr=PIPE, exhaust_stdout_to_log=True, exhaust_stderr_to_log=True, check_return_code_zero=True, ) as seven_zip_process: assert seven_zip_process.stdin is not None yield seven_zip_process.stdin @contextmanager def read(self, file_name: Optional[Path] = None) -> Iterator[IO[str]]: if file_name: _LOGGER.debug(f"Reading file {file_name} from 7z archive {self.path}.") else: _LOGGER.debug(f"Reading from 7z archive {self.path}.") file_name_str = str(file_name) if file_name else "" # Not sure how to check for errors here (particularly, if one wants to end # processing output from stdout, before the full archive if depleted). Waiting # for output on stderr stalls the process. Terminating while output in stdout is # still being generated results in a -15 return code. with external_process( ("7z", "x", "-so", str(self.path), file_name_str), stdin=DEVNULL, stdout=PIPE, stderr=PIPE, ) as seven_zip_process: assert seven_zip_process.stdout is not None yield seven_zip_process.stdout def iter_file_names(self) -> Iterator[Path]: _LOGGER.debug(f"Iterating file names in 7z archive {self.path}.") with external_process( ("7z", "l", "-ba", "-slt", str(self.path)), stdin=DEVNULL, stdout=PIPE, stderr=PIPE, ) as seven_zip_process: assert seven_zip_process.stdout is not None for line in seven_zip_process.stdout: if line.startswith("Path = "): yield Path(line[len("Path = ") : -len("\n")])
<reponame>NeoBryant/Brain_Image_Segmentation import torch import torch.nn as nn from torch.autograd import Variable import torch.nn.functional as F import matplotlib.pyplot as plt import numpy as np #%matplotlib inline import matplotlib.pyplot as plt import matplotlib def truncated_normal_(tensor, mean=0, std=1): size = tensor.shape tmp = tensor.new_empty(size + (4,)).normal_() valid = (tmp < 2) & (tmp > -2) ind = valid.max(-1, keepdim=True)[1] tensor.data.copy_(tmp.gather(-1, ind).squeeze(-1)) tensor.data.mul_(std).add_(mean) def init_weights(m): if type(m) == nn.Conv2d or type(m) == nn.ConvTranspose2d: nn.init.kaiming_normal_(m.weight, mode='fan_in', nonlinearity='relu') #nn.init.normal_(m.weight, std=0.001) #nn.init.normal_(m.bias, std=0.001) truncated_normal_(m.bias, mean=0, std=0.001) def init_weights_orthogonal_normal(m): if type(m) == nn.Conv2d or type(m) == nn.ConvTranspose2d: nn.init.orthogonal_(m.weight) truncated_normal_(m.bias, mean=0, std=0.001) #nn.init.normal_(m.bias, std=0.001) def l2_regularisation(m): l2_reg = None for W in m.parameters(): if l2_reg is None: l2_reg = W.norm(2) else: l2_reg = l2_reg + W.norm(2) return l2_reg def save_mask_prediction_example(mask, pred, iter): plt.imshow(pred[0,:,:],cmap='Greys') plt.savefig('images/'+str(iter)+"_prediction.png") plt.imshow(mask[0,:,:],cmap='Greys') plt.savefig('images/'+str(iter)+"_mask.png") def label2multichannel(mask, class_num=9): """将单通道(元素值1-9)变为多通道(元素值0-1) 输入为torch 输出为torch mask.shape: batch_size,1,240,240 """ mask = mask.numpy() batch_size = mask.shape[0] h, w = mask.shape[2], mask.shape[3] # mask = mask.reshape((240, 240)) label = np.zeros((batch_size,class_num, 240, 240)) for b in range(batch_size): for i in range(class_num): for x in range(h): for y in range(w): if int(mask[b,0,x,y]) == i+1: label[b,i,x,y] = 1 label = torch.from_numpy(label) label = label.type(torch.FloatTensor) return label def mask2rgb(mask): """单通道变rgb图 输入numpy,输出numpy mask: numpy mask.shape (240,240) """ mask = mask.reshape((240,240)) # 颜色rgb (黑,红,绿,蓝,黄,淡紫,青,紫,白) color = [(0,0,0),(255,0,0),(0,255,0),(0,0,255),(255,255,0), (255,0,255),(0,255,255),(128,0,128),(255,255,255)] img = np.zeros((240, 240, 3)) for c in range(9): for x in range(240): for y in range(240): if int(mask[x,y]) == c: img[x,y,0] = color[c][0] img[x,y,1] = color[c][1] img[x,y,2] = color[c][2] img /= 255 return img def show_curve(y1s, title='loss'): """ plot curlve for Loss and Accuacy\\ Args:\\ ys: loss or acc list\\ title: loss or accuracy """ x = np.array(range(len(y1s))) y1 = np.array(y1s) plt.plot(x, y1, label='train') plt.axis() plt.title('{} curve'.format(title)) plt.xlabel('epoch') plt.ylabel('{}'.format(title)) plt.legend(loc='best') #plt.show() plt.savefig("picture/{}.png".format(title)) plt.show() plt.close() print('Saved figure: picture/{}.png'.format(title)) # def bayes_uncertain(image_np, label_np, results, count, the_class): # """ # Keyword arguments: # image_np -- 原图 # label_np -- 标签 # results -- 同一张图片的不同预测结果 # Return: 预测结果的均值和方差 # """ # results = np.array(results) # list->numpy # shape = results.shape # # mean_result # # variance_result # mean_result = np.zeros((shape[1], shape[2])) # 均值 # variance_result = np.zeros((shape[1], shape[2])) # 方差 # # 计算均值 # for i in range(shape[0]): # mean_result += results[i] # mean_result /= shape[0] # # 计算方差 # for i in range(shape[0]): # variance_result += np.square(mean_result-results[i]) # variance_result /= shape[0] # # 显示保存图片 # fig, ax = plt.subplots(2,2, sharey=True, figsize=(14,12)) # ax[0][0].set_title("Original data") # ax[0][1].set_title("Ground Truth") # ax[1][0].set_title("mean predicted result") # ax[1][1].set_title("variance") # ax00 = ax[0][0].imshow(image_np, aspect="auto", cmap="gray") # ax01 = ax[0][1].imshow(label_np, aspect="auto") # ax10 = ax[1][0].imshow(mean_result, aspect="auto") # ax11 = ax[1][1].imshow(variance_result, aspect="auto") # fig.colorbar(ax00, ax=ax[0][0]) # fig.colorbar(ax01, ax=ax[0][1]) # fig.colorbar(ax10, ax=ax[1][0]) # fig.colorbar(ax11, ax=ax[1][1]) # # 保存 # plt.savefig('picture/class_{}_mean_variance_threshold_{}.jpg'.format(the_class, count)) def bayes_uncertain(image_np, label_np, results, count, class_num): """ Keyword arguments: image_np -- 原图 label_np -- 标签 results -- 同一张图片的不同预测结果, 8通道 Return: 预测结果的均值和方差 """ results = np.array(results) # list->numpy shape = results.shape result = results.reshape((9,240,240)) # # mean_result # # variance_result # mean_result = np.zeros((shape[1], shape[2])) # 均值 # variance_result = np.zeros((shape[1], shape[2])) # 方差 # # 显示保存图片 fig, ax = plt.subplots(6, 2, sharey=True, figsize=(14, 36)) ax[0][0].set_title("Original") ax[0][1].set_title("Ground Truth") ax[1][0].set_title("class 1") ax[1][1].set_title("class 2") ax[2][0].set_title("class 3") ax[2][1].set_title("class 4") ax[3][0].set_title("class 5") ax[3][1].set_title("class 6") ax[4][0].set_title("class 7") ax[4][1].set_title("class 8") ax[5][0].set_title("class 9") # ax00 = ax[0][0].imshow(image_np, aspect="auto", cmap="gray") ax00 = ax[0][0].imshow(image_np, aspect="auto", cmap="gray") ax01 = ax[0][1].imshow(label_np, aspect="auto") ax10 = ax[1][0].imshow(result[0], aspect="auto") ax11 = ax[1][1].imshow(result[1], aspect="auto") ax20 = ax[2][0].imshow(result[2], aspect="auto") ax21 = ax[2][1].imshow(result[3], aspect="auto") ax30 = ax[3][0].imshow(result[4], aspect="auto") ax31 = ax[3][1].imshow(result[5], aspect="auto") ax40 = ax[4][0].imshow(result[6], aspect="auto") ax41 = ax[4][1].imshow(result[7], aspect="auto") ax50 = ax[5][0].imshow(result[8], aspect="auto") fig.colorbar(ax00, ax=ax[0][0]) fig.colorbar(ax01, ax=ax[0][1]) fig.colorbar(ax10, ax=ax[1][0]) fig.colorbar(ax11, ax=ax[1][1]) fig.colorbar(ax20, ax=ax[2][0]) fig.colorbar(ax21, ax=ax[2][1]) fig.colorbar(ax30, ax=ax[3][0]) fig.colorbar(ax31, ax=ax[3][1]) fig.colorbar(ax40, ax=ax[4][0]) fig.colorbar(ax41, ax=ax[4][1]) fig.colorbar(ax50, ax=ax[5][0]) # 保存 plt.savefig( 'picture/class_{}_{}.jpg'.format(class_num, count)) def save_result_img(orig, mask, pred,step): """保存原图、标签、预测结果进行对比""" fig, ax = plt.subplots(2, 2, sharey=True, figsize=(14, 12)) ax[0][0].set_title("Original") ax[0][1].set_title("Ground Truth") ax[1][0].set_title("predict") ax00 = ax[0][0].imshow(orig, aspect="auto", cmap="gray") ax01 = ax[0][1].imshow(mask, aspect="auto") ax10 = ax[1][0].imshow(pred, aspect="auto") fig.colorbar(ax00, ax=ax[0][0]) fig.colorbar(ax01, ax=ax[0][1]) fig.colorbar(ax10, ax=ax[1][0]) plt.savefig('picture/compare_{}.jpg'.format(step)) return
<reponame>doubleDragon/quantApi # coding=utf-8 import requests import hmac import time import urllib import hashlib class Client(object): """Represents a Poloniex exchange""" base_url = 'https://poloniex.com/' def __init__(self, api_key=None, secret=None): """ Args: api_key (str): Optional API Key secret (str): Option Secret """ assert isinstance(api_key, (str, type(None))) assert isinstance(secret, (str, type(None))) assert ((api_key is not None and secret is not None) or (api_key is None and secret is None)) self._api_key = api_key self._secret = secret @property def _nonce(self): """ Returns a nonce Used in authentication """ # return str(int(round(time.time() * 10000))) return int(round(time.time() * 1000000)) def _get(self, path): """ Args: path (unicode) Returns: dict """ assert isinstance(path, unicode) req = requests.get(self.base_url + path) data = req.json() return data def _post(self, command, data): """ Args: command (str) data (dict) Returns: dict """ assert isinstance(command, str) assert isinstance(data, dict) data['command'] = command # data['nonce'] = int(time.time() * 1000) data['nonce'] = self._nonce encoded_data = urllib.urlencode(data) sign = hmac.new(self._secret, encoded_data, hashlib.sha512).hexdigest() headers = { 'Key': self._api_key, 'Sign': sign } url = self.base_url + 'tradingApi' print('url= ' + url) req = requests.post(url, data=data, headers=headers) print('request= ' + str(req.content)) response = req.json() return response # symbol为必须是大写, example: symbol=LTC def ticker(self, symbol): return self._get(u'public?command=returnTicker&currency=' + symbol.upper()) # symbol为必须是大写, example: symbol=BTC_LTC def depth(self, symbol): """ :param symbol: such as 'BTC_LTC' :return: json """ path = u'public?command=returnOrderBook&currencyPair={}&depth={}'.format(symbol.upper(), 5) return self._get(path) def buy(self, symbol, rate, amount): """ :param symbol: EXAMPLE 'BTC_LTC' :param rate: the price of the order :param amount: amount of the order :return: the order id """ command = 'buy' data = { 'currencyPair': str(symbol), 'rate': str(rate), 'amount': str(amount) } resp = self._post(command, data) if u'orderNumber' in resp: return resp[u'orderNumber'] def sell(self, symbol, rate, amount): """ the same as function buy """ command = 'sell' data = { 'currencyPair': str(symbol), 'rate': str(rate), 'amount': str(amount) } resp = self._post(command, data) if u'orderNumber' in resp: return resp[u'orderNumber'] def margin_buy(self, symbol, rate, amount, lending_rate=2): """ :param symbol: such as BTC_LTC :param amount: the amount of order and cannot be greater than 5% :param rate: the price of order :param lending_rate: option rate :return: the order number """ command = 'marginBuy' data = { 'currencyPair': str(symbol.upper()), 'amount': str(amount), 'rate': rate, 'lendingRate': str(lending_rate) } print('data: ' + str(data)) resp = self._post(command, data) print('marginSell resp: ' + str(resp)) if (u'success' in resp) and resp[u'success'] == 1: order_id = resp[u'orderNumber'] else: order_id = None return order_id def margin_sell(self, symbol, rate, amount, lending_rate=2): """ same as margin_buy """ command = 'marginSell' data = { 'currencyPair': str(symbol.upper()), 'amount': str(amount), 'rate': repr(rate), 'lendingRate': str(lending_rate) } print('data: ' + str(data)) resp = self._post(command, data) print('marginSell resp: ' + str(resp)) if (u'success' in resp) and resp[u'success'] == 1: order_id = resp[u'orderNumber'] else: order_id = None return order_id def view_active_orders(self, symbol): command = 'returnOpenOrders' data = { 'currencyPair': str(symbol.upper()) } return self._post(command, data) def view_margin_position(self, symbol): command = 'getMarginPosition' data = { 'currencyPair': symbol } return self._post(command, data) # def get_max_demand_rate(self): # """ # Returns: # float: The maximum loan rate asked for BTC # """ # data = self._get(u'public?command=returnLoanOrders&currency=BTC') # # demand_rates = set() # for demand in data['demands']: # demand_rates.add(float(demand['rate'])) # # max_demand = max(demand_rates) # # return max_demand # # def get_min_offer_rate(self, min_amount=0.0): # """ # Args: # min_amount (float): Minimum amount of BTC offered. If not offer is # proposing the given amount, returns the # maximum known offer. # Returns: # float: The minimum loan rate offered for BTC, or None if no offer # is providing min_amount BTC. # """ # assert isinstance(min_amount, float) # # data = self._get(u'public?command=returnLoanOrders&currency=BTC') # # offer_rates = set() # # # Filter the offers based on the min_amount, if any # for offer in data['offers']: # if float(offer['amount']) >= min_amount: # rate = float(offer['rate']) # offer_rates.add(rate) # # # If we have valid offers, get the lowest one # if offer_rates: # min_offer = min(offer_rates) # # If we have no valid offer, get the largest unfiltered offer, as the # # API won't let us get more offers # else: # for offer in data['offers']: # rate = float(offer['rate']) # offer_rates.add(rate) # min_offer = max(offer_rates) # # return min_offer # # def get_unused(self): # """ # Returns: # float: Amount of BTC available in the lending wallet. # """ # data = { # 'account': 'lending' # } # response = self._post('returnAvailableAccountBalances', data) # if u'BTC' in response[u'lending']: # unused_btc = float(response[u'lending'][u'BTC']) # else: # unused_btc = 0.0 # # return unused_btc # # def offer_btc_loan(self, rate, amount, duration): # """ # Args: # rate (float) # amount (float) # duration (int): Duration of the loan, in days (2-60). # # Returns: # int or None: Order ID if successful # """ # assert isinstance(rate, float) # assert isinstance(amount, float) # assert isinstance(duration, int) # # data = { # 'currency': 'BTC', # 'amount': amount, # 'duration': duration, # 'autoRenew': 0, # 'lendingRate': rate # } # resp = self._post('createLoanOffer', data) # # if resp[u'success'] == 1: # order_id = resp[u'orderID'] # else: # order_id = None # # return order_id
<filename>WassersteinGAN/src/utils/data_utils.py import cv2 import glob import h5py import imageio import matplotlib.pylab as plt import matplotlib.gridspec as gridspec import numpy as np import os from scipy import stats from keras.datasets import mnist, cifar10 from keras.optimizers import Adam, SGD, RMSprop from keras.preprocessing.image import ImageDataGenerator from keras.utils import np_utils def normalization(X, image_data_format="channels_last"): X = X / 255. if image_data_format == "channels_last": X = (X - 0.5) / 0.5 else: X = (X - 0.5) / 0.5 return X def inverse_normalization(X): return ((X * 0.5 + 0.5) * 255.).astype(np.uint8) def load_mnist(image_data_format): (X_train, y_train), (X_test, y_test) = mnist.load_data() if image_data_format == 'channels_first': X_train = X_train.reshape(X_train.shape[0], 1, 28, 28) X_test = X_test.reshape(X_test.shape[0], 1, 28, 28) else: X_train = X_train.reshape(X_train.shape[0], 28, 28, 1) X_test = X_test.reshape(X_test.shape[0], 28, 28, 1) X_train = X_train.astype('float32') X_test = X_test.astype('float32') X_train = normalization(X_train, image_data_format) X_test = normalization(X_test, image_data_format) nb_classes = len(np.unique(np.hstack((y_train, y_test)))) Y_train = np_utils.to_categorical(y_train, nb_classes) Y_test = np_utils.to_categorical(y_test, nb_classes) return X_train, Y_train, X_test, Y_test def load_cifar10(image_data_format): (X_train, y_train), (X_test, y_test) = cifar10.load_data() if image_data_format == 'channels_first': X_train = X_train.reshape(X_train.shape[0], 3, 32, 32) X_test = X_test.reshape(X_test.shape[0], 3, 32, 32) else: X_train = X_train.reshape(X_train.shape[0], 32, 32, 3) X_test = X_test.reshape(X_test.shape[0], 32, 32, 3) X_train = X_train.astype('float32') X_test = X_test.astype('float32') X_train = normalization(X_train, image_data_format) X_test = normalization(X_test, image_data_format) nb_classes = len(np.unique(np.vstack((y_train, y_test)))) Y_train = np_utils.to_categorical(y_train, nb_classes) Y_test = np_utils.to_categorical(y_test, nb_classes) return X_train, Y_train, X_test, Y_test def load_celebA(img_dim, image_data_format): with h5py.File("../../data/processed/CelebA_%s_data.h5" % img_dim, "r") as hf: X_real_train = hf["data"][:].astype(np.float32) X_real_train = normalization(X_real_train, image_data_format) if image_data_format == "channels_last": X_real_train = X_real_train.transpose(0, 2, 3, 1) return X_real_train def load_image_dataset(dset, img_dim, image_data_format, batch_size): X_batch_gen = None if dset == "celebA": X_real_train = load_celebA(img_dim, image_data_format) elif dset == "mnist": X_real_train, _, _, _ = load_mnist(image_data_format) elif dset == "cifar10": X_real_train, _, _, _ = load_cifar10(image_data_format) else: X_batch_gen = data_generator_from_dir(dset, (img_dim, img_dim), batch_size, image_data_format) X_real_train = next(X_batch_gen) return X_real_train, X_batch_gen def data_generator_from_dir(data_dir, target_size, batch_size, image_data_format="channels_last"): # data_gen args print("Loading data from", data_dir) # Check if number of files in data_dir is a multiple of batch_size number_of_images = sum([len(files) for r, d, files in os.walk(data_dir)]) if number_of_images % batch_size != 0: raise ValueError("ERROR: # of images in " + str(data_dir) + " found by keras.ImageDataGenerator is not a multiple of the batch_size ( " + str(batch_size) + " )!\nFound " + str(number_of_images) + " images. Add " + str(batch_size - number_of_images % batch_size) + " more image(s), or delete " + str(number_of_images % batch_size) + " image(s).") # datagens data_generator_args = dict(preprocessing_function=normalization) image_datagen = ImageDataGenerator(**data_generator_args) # Image generators image_data_generator = image_datagen.flow_from_directory(data_dir, target_size=target_size, batch_size=batch_size, class_mode=None, seed=29) if len(image_data_generator) == 0: raise ValueError("ERROR: # of images found by keras.ImageDataGenerator is 0!\nPlease save the images in the data_dir into at least one modre directory, preferably into classes. Given data_dir:", data_dir) return image_data_generator def load_toy(n_mixture=8, std=0.01, radius=1.0, pts_per_mixture=5000): thetas = np.linspace(0, 2 * np.pi, n_mixture + 1)[:-1] xs, ys = radius * np.sin(thetas), radius * np.cos(thetas) cov = std * np.eye(2) X = np.zeros((n_mixture * pts_per_mixture, 2)) for i in range(n_mixture): mean = np.array([xs[i], ys[i]]) pts = np.random.multivariate_normal(mean, cov, pts_per_mixture) X[i * pts_per_mixture: (i + 1) * pts_per_mixture, :] = pts return X def get_optimizer(opt, lr): if opt == "SGD": return SGD(lr=lr) elif opt == "RMSprop": return RMSprop(lr=lr) elif opt == "Adam": return Adam(lr=lr, beta1=0.5) def gen_batch(X, X_batch_gen, batch_size): while True: if X_batch_gen is None: idx = np.random.choice(X.shape[0], batch_size, replace=False) yield X[idx] else: yield next(X_batch_gen) def sample_noise(noise_scale, batch_size, noise_dim): return np.random.normal(scale=noise_scale, size=(batch_size, noise_dim[0])) def get_disc_batch(X_real_batch, generator_model, batch_counter, batch_size, noise_dim, noise_scale=0.5): # Pass noise to the generator noise_input = sample_noise(noise_scale, batch_size, noise_dim) # Produce an output X_disc_gen = generator_model.predict(noise_input, batch_size=batch_size) X_disc_real = X_real_batch[:batch_size] return X_disc_real, X_disc_gen def save_model_weights(generator_model, discriminator_model, DCGAN_model, e, save_weights_every_n_epochs=5, save_only_last_n_weights=10, model_name="WGAN"): purge_weights(generator_model, discriminator_model, DCGAN_model, save_only_last_n_weights, model_name) model_path = os.path.join("../../models", model_name) if (e + 1) % save_weights_every_n_epochs == 0: print("Saving weight...") gen_weights_path = os.path.join(model_path, '%s_epoch%5d.h5' % (generator_model.name, e)) generator_model.save_weights(gen_weights_path, overwrite=True) disc_weights_path = os.path.join(model_path, '%s_epoch%5d.h5' % (discriminator_model.name, e)) discriminator_model.save_weights(disc_weights_path, overwrite=True) DCGAN_weights_path = os.path.join(model_path, '%s_epoch%5d.h5' % (DCGAN_model.name, e)) DCGAN_model.save_weights(DCGAN_weights_path, overwrite=True) def purge_weights(generator_model, discriminator_model, DCGAN_model, n, model_name): gen_weight_files = sorted(glob.glob('../../models/%s/%s*' % (model_name, generator_model.name))) for gen_weight_file in gen_weight_files[:-n]: os.remove(os.path.realpath(gen_weight_file)) disc_weight_files = sorted(glob.glob('../../models/%s/%s*' % (model_name, discriminator_model.name))) for disc_weight_file in disc_weight_files[:-n]: os.remove(os.path.realpath(disc_weight_file)) DCGAN_weight_files = sorted(glob.glob('../../models/%s/%s*' % (model_name, DCGAN_model.name))) for DCGAN_weight_file in DCGAN_weight_files[:-n]: os.remove(os.path.realpath(DCGAN_weight_file)) def plot_generated_batch(X_real, generator_model, epoch_number, batch_size, noise_dim, image_data_format, model_name, noise_scale=0.5, suffix='training', MAX_FRAMES_PER_GIF=100): # Generate images X_gen = sample_noise(noise_scale, batch_size, noise_dim) X_gen = generator_model.predict(X_gen) X_real = inverse_normalization(X_real) X_gen = inverse_normalization(X_gen) Xg = X_gen[:8] Xr = X_real[:8] if image_data_format == "channels_last": X = np.concatenate((Xg, Xr), axis=0) list_rows = [] for i in range(int(X.shape[0] / 4)): Xr = np.concatenate([X[k] for k in range(4 * i, 4 * (i + 1))], axis=1) list_rows.append(Xr) Xr = np.concatenate(list_rows, axis=0) if image_data_format == "channels_first": X = np.concatenate((Xg, Xr), axis=0) list_rows = [] for i in range(int(X.shape[0] / 4)): Xr = np.concatenate([X[k] for k in range(4 * i, 4 * (i + 1))], axis=2) list_rows.append(Xr) Xr = np.concatenate(list_rows, axis=1) Xr = Xr.transpose(1,2,0) # Make iter text text_image = cv2.putText(np.zeros((32, Xr.shape[1], Xr.shape[2])), '%s epoch' % str(epoch_number), (10, 10), cv2.FONT_HERSHEY_SIMPLEX, .4, (255, 255, 255), 1, cv2.LINE_AA).astype('uint8') image = np.vstack((text_image, Xr)) # if Xr.shape[-1] == 1: # plt.imshow(Xr[:, :, 0], cmap="gray") # else: # plt.imshow(Xr) # plt.savefig("../../figures/current_batch.png") # plt.clf() # plt.close() imageio.imsave(os.path.join("../../figures", model_name, model_name + "_current_batch_%s.png" % suffix), image) # Make gif gif_frames = [] # Read old gif frames try: gif_frames_reader = imageio.get_reader(os.path.join("../../figures", model_name, model_name + "_%s.gif" % suffix)) for frame in gif_frames_reader: gif_frames.append(frame[:, :, :3]) except: pass # Append new frame im = cv2.putText(np.concatenate((np.zeros((32, Xg[0].shape[1], Xg[0].shape[2])), Xg[0]), axis=0), '%s epoch' % str(epoch_number), (10, 10), cv2.FONT_HERSHEY_SIMPLEX, .4, (255, 255, 255), 1, cv2.LINE_AA).astype('uint8') gif_frames.append(im) # If frames exceeds, save as different file if len(gif_frames) > MAX_FRAMES_PER_GIF: print("Splitting the GIF...") gif_frames_00 = gif_frames[:MAX_FRAMES_PER_GIF] num_of_gifs_already_saved = len(glob.glob(os.path.join("../../figures", model_name, model_name + "_%s_*.gif" % suffix))) print("Saving", os.path.join("../../figures", model_name, model_name + "_%s_%03d.gif" % (suffix, num_of_gifs_already_saved))) imageio.mimsave(os.path.join("../../figures", model_name, model_name + "_%s_%03d.gif" % (suffix, num_of_gifs_already_saved)), gif_frames_00) gif_frames = gif_frames[MAX_FRAMES_PER_GIF:] # Save gif print("Saving", os.path.join("../../figures", model_name, model_name + "_%s.gif" % suffix)) imageio.mimsave(os.path.join("../../figures", model_name, model_name + "_%s.gif" % suffix), gif_frames) def plot_losses(disc_losses, disc_losses_real, disc_losses_gen, gen_losses, model_name, init_epoch=0): epochs = np.arange(len(disc_losses)) + init_epoch fig = plt.figure() plt.plot(epochs, disc_losses, linewidth=2, label='D') plt.plot(epochs, disc_losses_real, linewidth=1, label='D_real') plt.plot(epochs, disc_losses_gen, linewidth=1, label='D_gen') plt.plot(epochs, gen_losses, linewidth=2, label='G') plt.legend() plt.title("Losses") plt.xlabel("Epochs") plt.savefig(os.path.join("../../figures", model_name, model_name + "_losses.png"), bbox_inches='tight') plt.clf() plt.close() def plot_generated_toy_batch(X_real, generator_model, discriminator_model, noise_dim, gen_iter, noise_scale=0.5): # Generate images X_gen = sample_noise(noise_scale, 10000, noise_dim) X_gen = generator_model.predict(X_gen) # Get some toy data to plot KDE of real data data = load_toy(pts_per_mixture=200) x = data[:, 0] y = data[:, 1] xmin, xmax = -1.5, 1.5 ymin, ymax = -1.5, 1.5 # Peform the kernel density estimate xx, yy = np.mgrid[xmin:xmax:100j, ymin:ymax:100j] positions = np.vstack([xx.ravel(), yy.ravel()]) values = np.vstack([x, y]) kernel = stats.gaussian_kde(values) f = np.reshape(kernel(positions).T, xx.shape) # Plot the contour fig = plt.figure(figsize=(10,10)) plt.suptitle("Generator iteration %s" % gen_iter, fontweight="bold", fontsize=22) ax = fig.gca() ax.contourf(xx, yy, f, cmap='Blues', vmin=np.percentile(f,80), vmax=np.max(f), levels=np.linspace(0.25, 0.85, 30)) # Also plot the contour of the discriminator delta = 0.025 xmin, xmax = -1.5, 1.5 ymin, ymax = -1.5, 1.5 # Create mesh XX, YY = np.meshgrid(np.arange(xmin, xmax, delta), np.arange(ymin, ymax, delta)) arr_pos = np.vstack((np.ravel(XX), np.ravel(YY))).T # Get Z = predictions ZZ = discriminator_model.predict(arr_pos) ZZ = ZZ.reshape(XX.shape) # Plot contour ax.contour(XX, YY, ZZ, cmap="Blues", levels=np.linspace(0.25, 0.85, 10)) dy, dx = np.gradient(ZZ) # Add streamlines # plt.streamplot(XX, YY, dx, dy, linewidth=0.5, cmap="magma", density=1, arrowsize=1) # Scatter generated data plt.scatter(X_gen[:1000, 0], X_gen[:1000, 1], s=20, color="coral", marker="o") l_gen = plt.Line2D((0,1),(0,0), color='coral', marker='o', linestyle='', markersize=20) l_D = plt.Line2D((0,1),(0,0), color='steelblue', linewidth=3) l_real = plt.Rectangle((0, 0), 1, 1, fc="steelblue") # Create legend from custom artist/label lists # bbox_to_anchor = (0.4, 1) ax.legend([l_real, l_D, l_gen], ['Real data KDE', 'Discriminator contour', 'Generated data'], fontsize=18, loc="upper left") ax.set_xlim(xmin, xmax) ax.set_ylim(ymin, ymax + 0.8) plt.savefig("../../figures/toy_dataset_iter%s.jpg" % gen_iter) plt.clf() plt.close() if __name__ == '__main__': data = load_toy(pts_per_mixture=200) x = data[:, 0] y = data[:, 1] xmin, xmax = -1.5, 1.5 ymin, ymax = -1.5, 1.5 # Peform the kernel density estimate xx, yy = np.mgrid[xmin:xmax:100j, ymin:ymax:100j] positions = np.vstack([xx.ravel(), yy.ravel()]) values = np.vstack([x, y]) kernel = stats.gaussian_kde(values) f = np.reshape(kernel(positions).T, xx.shape) fig = plt.figure() gen_it = 5 plt.suptitle("Generator iteration %s" % gen_it, fontweight="bold") ax = fig.gca() ax.set_xlim(xmin, xmax) ax.set_ylim(ymin, ymax) # Contourf plot cfset = ax.contourf(xx, yy, f, cmap='Blues', vmin=np.percentile(f,90), vmax=np.max(f), levels=np.linspace(0.25, 0.85, 30)) # cfset = ax.contour(xx, yy, f, color="k", levels=np.linspace(0.25, 0.85, 30), label="roger") plt.legend() plt.show()
import socketserver import os import threading import time import datetime import sqlite3 as lite import sys import random import string HOST ='192.168.53.12' PORT = 5050 class MyTCPHandler(socketserver.StreamRequestHandler): #id = 0 #def readline(self): # server.request_line= self.rfile.readline().rstrip('\r\n') def handle(self): #clientsocket,addr = self.accept() #print("Got a connection from %s" % str(addr)) while True: self.data = self.rfile.readline().decode('utf-8') if not self.data: print('DISCONNECTED') break data = str(self.data) print(len(data)) if (len(data) == 16): usr = data[0:15] print ("got connection from id: %s"% usr) #out = data[0:15] elif(len(data)>4 and len(data)<16): usr= str(self.data) usr= usr[:-1] con=lite.connect('recdb/grannylist.db') cur=con.cursor() cur.execute("SELECT Uid FROM Grannys WHERE Username = '%s' OR Uid = '%s'"% (usr, usr)) row = cur.fetchone() print(row) if row: out=','.join(map(str, row)) else: print('got none type') print(row) break #out = '5L7VDF04SZ6MTQJ' #print(out) if out == 'None': #self.id_generator() id = ''.join(random.choice(string.ascii_uppercase + string.digits) for _ in range(15)) cur.execute("UPDATE Grannys SET Uid = '%s' WHERE Username='%s'" % (id, usr)) con.commit() connect = False self.wfile.write(id.encode('ascii')) os.makedirs('/var/www/html/recdb/%s'% id) elif (len(data) < 4): print ("latest action id is %s"% data) if (int(data[0:2]) == 12): date = datetime.datetime.strftime(datetime.datetime.now(), '%Y-%m-%d') f= open('recdb/%s/%s_%s_sleep.db'% (usr,usr,date),'wb') #id= clientsocket.recv(1024).decode l = self.rfile.read(1024) while l: print ("getting some data...") f.write(l) l = self.rfile.read(1024) print("all done here!(sleep data)") f.close() db_a = lite.connect('recdb/%s/%s_sleep.db'% (usr,usr)) db_b = lite.connect('recdb/%s/%s_%s_sleep.db'% (usr,usr,date)) b_cursor = db_b.cursor() b_cursor.execute('SELECT * FROM Sleep') #output = b_cursor.fetchall() # Returns the results as a list. #b_cursor.close() # Insert those contents into another table. a_cursor = db_a.cursor() a_cursor.execute('CREATE TABLE IF NOT EXISTS Sleep(Id INTEGER PRIMARY KEY, Time DATETIME, X NUMERIC, Y NUMERIC, Z NUMERIC)') for row in b_cursor.fetchall(): #time=row["Time"] #x =row["X"] #y =row["Y"] #z =row["Z"] #print(row["Time"]) id, time, x, y, z = row print("----------------------------------------------------------") print("Time: %s, X:%s, Y:%s, Z:%s"% (time, x, y, z)) print("----------------------------------------------------------") a_cursor.execute("INSERT INTO Sleep (Time, X, Y, Z) VALUES ('%s','%s','%s','%s')"% (time, x, y, z)) db_a.commit() a_cursor.close() b_cursor.close() elif (int(data[0:2]) == 3 or int(data[0:2]) == 4 or int(data[0:2]) == 5): date = datetime.datetime.strftime(datetime.datetime.now(), '%Y-%m-%d-%H:%M') f= open('recdb/%s/%s_%s_pic.png'% (usr,usr,date),'wb') #id= clientsocket.recv(1024).decode l = self.rfile.read(1024) while l: print ("getting some data...") f.write(l) l = self.rfile.read(1024) print("all done here!(naked pictures)") f.close() else: f= open('recdb/%s/%s_Actions.db'% (usr,usr),'wb') #id= clientsocket.recv(1024).decode l = self.rfile.read(1024) while l: print ("getting some data...") f.write(l) l = self.rfile.read(1024) f.close() print ("all done here!(action data)") self.data = self.rfile.readline().decode('utf-8') msg = str(self.data) print(msg) def id_generator(size=15, chars=string.ascii_uppercase + string.digits): self.id = ''.join(random.choice(chars) for _ in range(size)) server = socketserver.TCPServer((HOST, PORT), MyTCPHandler) server.allow_reuse_address = True server.serve_forever()