content stringlengths 7 1.05M | fixed_cases stringlengths 1 1.28M |
|---|---|
'''
config file
'''
n_one_hot_slot = 6 # 0 - user_id, 1 - movie_id, 2 - gender, 3 - age, 4 - occ, 5 - release year
n_mul_hot_slot = 2 # 6 - title (mul-hot), 7 - genres (mul-hot)
max_len_per_slot = 5 # max num of fts in one mul-hot slot
num_csv_col_warm = 17
num_csv_col_w_ngb = 17 + 160 # num of cols in the csv file (w ngb)
layer_dim = [256, 128, 1]
# for ngb
n_one_hot_slot_ngb = 6
n_mul_hot_slot_ngb = 2
max_len_per_slot_ngb = 5
max_n_ngb_ori = 10 # num of ngbs in data file
max_n_ngb = 10 # num of ngbs to use in model, <= max_n_ngb_ori
pre = './data/'
suf = '.tfrecord'
# a, b - used for meta learning
train_file_name_a = [pre+'train_oneshot_a_w_ngb'+suf, pre+'train_oneshot_b_w_ngb'+suf] #, pre+'train_oneshot_c_w_ngb'+suf]
train_file_name_b = [pre+'train_oneshot_b_w_ngb'+suf, pre+'train_oneshot_c_w_ngb'+suf] #, pre+'train_oneshot_a_w_ngb'+suf]
# warm, warm_2 - used for warm-up training
train_file_name_warm = [pre+'test_oneshot_a'+suf]
train_file_name_warm_2 = [pre+'test_oneshot_b'+suf]
# you can use 'test_oneshot_a_w_ngb' for validation
test_file_name = [pre+'test_test_w_ngb'+suf]
# the following are indices for features (excluding label)
# 0 - user_id, 1 - movie_id, 2 - gender, 3 - age, 4 - occ, 5 - release year, 6 - title (mul-hot), 7 - genres (mul-hot)
# tar_idx - whose emb to be generated
# attr_idx - which are intrinsic item attributes
tar_idx = [1]
# must be from small to large
attr_idx = [5,6,7]
n_ft = 11134
input_format = 'tfrecord' #'csv'
time_style = '%Y-%m-%d %H:%M:%S'
rnd_seed = 123 # random seed (different seeds lead to different results)
att_dim = 10*len(attr_idx)
batch_size = 128 # used for warm up training
# meta_mode: self - use the new ad's own attributes
# ngb - use ngbs' pre-trained ID embs.
meta_mode = 'GME-A' # 'self', 'ngb', 'GME-P', 'GME-G', 'GME-A'
meta_batch_size_range = [60]
# learning rate for getting a new adapted embedding
cold_eta_range = [1e-4] # [0.05, 0.1]
# learning rate for meta learning
meta_eta_range = [5e-3] # [1e-4, 5e-4, 1e-3, 5e-3, 1e-2]
# learning rate for warm-up training
eta_range = [1e-3]
n_epoch = 1 # number of times to loop over the warm-up training data set
n_epoch_meta = 1 # number of times to loop over the meta training data set
alpha = 0.1
gamma = 1.0
test_batch_size = 128
# whether to perform warm up training
# only valid for 'gme_all_in_one_warm_up.py'
warm_up_bool = False # True
#################
save_model_ind = 0
# load emb and FC layer weights from a pre-trained DNN model
model_loading_addr = './tmp/dnn_1011_1705/'
output_file_name = '0801_0900'
k = 10 # embedding size / number of latent factors
opt_alg = 'Adam' # 'Adagrad'
kp_prob = 1.0
record_step_size = 200 # record the loss and auc after xx steps
| """
config file
"""
n_one_hot_slot = 6
n_mul_hot_slot = 2
max_len_per_slot = 5
num_csv_col_warm = 17
num_csv_col_w_ngb = 17 + 160
layer_dim = [256, 128, 1]
n_one_hot_slot_ngb = 6
n_mul_hot_slot_ngb = 2
max_len_per_slot_ngb = 5
max_n_ngb_ori = 10
max_n_ngb = 10
pre = './data/'
suf = '.tfrecord'
train_file_name_a = [pre + 'train_oneshot_a_w_ngb' + suf, pre + 'train_oneshot_b_w_ngb' + suf]
train_file_name_b = [pre + 'train_oneshot_b_w_ngb' + suf, pre + 'train_oneshot_c_w_ngb' + suf]
train_file_name_warm = [pre + 'test_oneshot_a' + suf]
train_file_name_warm_2 = [pre + 'test_oneshot_b' + suf]
test_file_name = [pre + 'test_test_w_ngb' + suf]
tar_idx = [1]
attr_idx = [5, 6, 7]
n_ft = 11134
input_format = 'tfrecord'
time_style = '%Y-%m-%d %H:%M:%S'
rnd_seed = 123
att_dim = 10 * len(attr_idx)
batch_size = 128
meta_mode = 'GME-A'
meta_batch_size_range = [60]
cold_eta_range = [0.0001]
meta_eta_range = [0.005]
eta_range = [0.001]
n_epoch = 1
n_epoch_meta = 1
alpha = 0.1
gamma = 1.0
test_batch_size = 128
warm_up_bool = False
save_model_ind = 0
model_loading_addr = './tmp/dnn_1011_1705/'
output_file_name = '0801_0900'
k = 10
opt_alg = 'Adam'
kp_prob = 1.0
record_step_size = 200 |
first_num_elements, second_num_elements2 = [int(num) for num in input().split()]
first_set = {input() for _ in range(first_num_elements)}
second_set = {input() for _ in range(second_num_elements2)}
print(*first_set.intersection(second_set), sep='\n')
# 4 3
# 1
# 3
# 5
# 7
# 3
# 4
# 5 | (first_num_elements, second_num_elements2) = [int(num) for num in input().split()]
first_set = {input() for _ in range(first_num_elements)}
second_set = {input() for _ in range(second_num_elements2)}
print(*first_set.intersection(second_set), sep='\n') |
def decode_index(index: int) -> str:
return {0: "ham", 1: "spam"}[index]
def probability_to_index(prediction: list) -> int:
return 0 if prediction[0] > prediction[1] else 1
| def decode_index(index: int) -> str:
return {0: 'ham', 1: 'spam'}[index]
def probability_to_index(prediction: list) -> int:
return 0 if prediction[0] > prediction[1] else 1 |
a = []
impar = []
par = []
while True:
n1 = int(input("Digite um valor: "))
a.append(n1)
if n1 % 2 == 0:
par.append(n1)
elif n1 % 2 != 0:
impar.append(n1)
s = str(input("Deseja continuar? [S/N]"))
if s in 'Nn':
break
print(f"Lista geral {a}")
print(f"Lista dos pares {par}")
print(f"Lista dos impares {impar}")
| a = []
impar = []
par = []
while True:
n1 = int(input('Digite um valor: '))
a.append(n1)
if n1 % 2 == 0:
par.append(n1)
elif n1 % 2 != 0:
impar.append(n1)
s = str(input('Deseja continuar? [S/N]'))
if s in 'Nn':
break
print(f'Lista geral {a}')
print(f'Lista dos pares {par}')
print(f'Lista dos impares {impar}') |
# Definition for a binary tree node.
# class TreeNode(object):
# def __init__(self, x):
# self.val = x
# self.left = None
# self.right = None
class Solution(object):
def findTilt(self, root):
def travel(node, tiles):
if node is None:
return 0
sum_left = travel(node.left, tiles)
sum_right = travel(node.right, tiles)
diff = abs(sum_left - sum_right)
tiles.append(diff)
sum_all = node.val + sum_left + sum_right
return sum_all
tiles = []
travel(root, tiles)
return sum(tiles)
| class Solution(object):
def find_tilt(self, root):
def travel(node, tiles):
if node is None:
return 0
sum_left = travel(node.left, tiles)
sum_right = travel(node.right, tiles)
diff = abs(sum_left - sum_right)
tiles.append(diff)
sum_all = node.val + sum_left + sum_right
return sum_all
tiles = []
travel(root, tiles)
return sum(tiles) |
class Triangle:
def __init__(self,a,b,c):
self.a=a
self.b=b
self.c=c
def is_valid(self):
if (self.a+self.b>self.c) and (self.a+self.c>self.b) and (self.b+self.c>self.a):
return 'Valid'
else:
return 'Invalid'
def Side_Classification(self):
if self.is_valid()=='Valid':
if (self.a==self.b and self.b==self.c):
return 'Equilateral'
elif (self.a==self.b or self.b==self.c or self.a==self.c):
return 'Isosceles'
else:
return 'Scalene'
else:
return 'Invalid'
def Angle_Classification(self):
if self.is_valid()=='Valid':
l=sorted([self.a,self.b,self.c])
a,b,c=l
if ((a)**2+(b)**2 >(c)**2):
return 'Acute'
elif ((a)**2+(b)**2 ==(c)**2):
return 'Right'
else:
return 'Obtuse'
else:
return 'Invalid'
def Area(self):
if self.is_valid()=='Valid':
a,b,c=[self.a,self.b,self.c]
s=(a+b+c)/2
area=(s*(s-a)*(s-b)*(s-c))**0.5
return area
else:
return 'Invalid'
a=int(input())
b=int(input())
c=int(input())
T=Triangle(a,b,c)
print(T.is_valid())
print(T.Side_Classification())
print(T.Angle_Classification())
print(T.Area())
| class Triangle:
def __init__(self, a, b, c):
self.a = a
self.b = b
self.c = c
def is_valid(self):
if self.a + self.b > self.c and self.a + self.c > self.b and (self.b + self.c > self.a):
return 'Valid'
else:
return 'Invalid'
def side__classification(self):
if self.is_valid() == 'Valid':
if self.a == self.b and self.b == self.c:
return 'Equilateral'
elif self.a == self.b or self.b == self.c or self.a == self.c:
return 'Isosceles'
else:
return 'Scalene'
else:
return 'Invalid'
def angle__classification(self):
if self.is_valid() == 'Valid':
l = sorted([self.a, self.b, self.c])
(a, b, c) = l
if a ** 2 + b ** 2 > c ** 2:
return 'Acute'
elif a ** 2 + b ** 2 == c ** 2:
return 'Right'
else:
return 'Obtuse'
else:
return 'Invalid'
def area(self):
if self.is_valid() == 'Valid':
(a, b, c) = [self.a, self.b, self.c]
s = (a + b + c) / 2
area = (s * (s - a) * (s - b) * (s - c)) ** 0.5
return area
else:
return 'Invalid'
a = int(input())
b = int(input())
c = int(input())
t = triangle(a, b, c)
print(T.is_valid())
print(T.Side_Classification())
print(T.Angle_Classification())
print(T.Area()) |
def main(app_config=None, q1=0, q2=2):
some_var = {'key': 'value'}
if q1 > 9:
return {
"dict_return": 1,
}
return some_var
if __name__ == "__main__":
main()
| def main(app_config=None, q1=0, q2=2):
some_var = {'key': 'value'}
if q1 > 9:
return {'dict_return': 1}
return some_var
if __name__ == '__main__':
main() |
#!/usr/bin/env python
# -*- encoding: utf-8 -*-
# Copyright (c) 2002-2018 "Neo Technology,"
# Network Engine for Objects in Lund AB [http://neotechnology.com]
#
# This file is part of Neo4j.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
class Structure(list):
def __init__(self, capacity, signature):
self.capacity = capacity
self.signature = signature
def __repr__(self):
return repr(tuple(iter(self)))
def __eq__(self, other):
return list(self) == list(other)
def __ne__(self, other):
return not self.__eq__(other)
def __iter__(self):
yield self.signature
yield tuple(super(Structure, self).__iter__())
| class Structure(list):
def __init__(self, capacity, signature):
self.capacity = capacity
self.signature = signature
def __repr__(self):
return repr(tuple(iter(self)))
def __eq__(self, other):
return list(self) == list(other)
def __ne__(self, other):
return not self.__eq__(other)
def __iter__(self):
yield self.signature
yield tuple(super(Structure, self).__iter__()) |
# Python3 program to find the numbers
# of non negative integral solutions
# return number of non negative
# integral solutions
def countSolutions(n, val,indent):
print(indent+"countSolutions(",n,val,")")
# initialize total = 0
total = 0
# Base Case if n = 1 and val >= 0
# then it should return 1
if n == 1 and val >= 0:
return 1
# iterate the loop till equal the val
for i in range(val + 1):
# total solution of of equations
# and again call the recursive
# function Solutions(variable,value)
total += countSolutions(n - 1, val - i,indent+" ")
# return the total no possible solution
return total
# driver code
n = 4
val = 2
print(countSolutions(n, val,"")) | def count_solutions(n, val, indent):
print(indent + 'countSolutions(', n, val, ')')
total = 0
if n == 1 and val >= 0:
return 1
for i in range(val + 1):
total += count_solutions(n - 1, val - i, indent + ' ')
return total
n = 4
val = 2
print(count_solutions(n, val, '')) |
# -*- coding: utf-8 -*-
DATABASE_MAPPING = {
'database_list': {
'resource': 'database/',
'docs': '',
'methods': ['GET'],
},
'database_get': {
'resource': 'database/{id}/',
'docs': '',
'methods': ['GET'],
},
'database_create': {
'resource': 'database/',
'docs': '',
'methods': ['POST'],
},
'database_update': {
'resource': 'database/{id}/',
'docs': '',
'methods': ['PUT'],
},
'database_delete': {
'resource': 'database/{id}/',
'docs': '',
'methods': ['DELETE'],
},
}
| database_mapping = {'database_list': {'resource': 'database/', 'docs': '', 'methods': ['GET']}, 'database_get': {'resource': 'database/{id}/', 'docs': '', 'methods': ['GET']}, 'database_create': {'resource': 'database/', 'docs': '', 'methods': ['POST']}, 'database_update': {'resource': 'database/{id}/', 'docs': '', 'methods': ['PUT']}, 'database_delete': {'resource': 'database/{id}/', 'docs': '', 'methods': ['DELETE']}} |
def is_abundant(number):
mysum = 1 # Can always divide by 1, so start looking at divisor 2
for divisor in range(2, int(round(number / 2 + 1))):
if number % divisor == 0:
mysum += divisor
if mysum > number:
return True
else:
return False
| def is_abundant(number):
mysum = 1
for divisor in range(2, int(round(number / 2 + 1))):
if number % divisor == 0:
mysum += divisor
if mysum > number:
return True
else:
return False |
# Copyright European Organization for Nuclear Research (CERN)
#
# Licensed under the Apache License, Version 2.0 (the "License");
# You may not use this file except in compliance with the License.
# You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0
#
# Authors:
# - Muhammad Aditya Hilmy, <mhilmy@hey.com>, 2020
class DIDNotAvailableException(BaseException):
def __init__(self):
super().__init__("DID is not yet available.")
class MultipleItemDID(list): # pragma: no cover
def __init__(self, items, did_available=True):
super(MultipleItemDID, self).__init__(items)
self.items = items
self.did_available = did_available
def __str__(self):
if not self.did_available:
raise DIDNotAvailableException()
return super().__str__()
def __repr__(self):
if not self.did_available:
raise DIDNotAvailableException()
return super().__repr__()
def __getitem__(self, key):
if not self.did_available:
raise DIDNotAvailableException()
return super().__getitem__(key)
def __iter__(self):
if not self.did_available:
raise DIDNotAvailableException()
return super().__iter__()
class SingleItemDID(str): # pragma: no cover
def __init__(self, path):
super(SingleItemDID, self).__init__()
self.path = path
self.did_available = path is not None
def __str__(self):
if not self.did_available:
raise DIDNotAvailableException()
return self.path
def __repr__(self):
if not self.did_available:
raise DIDNotAvailableException()
return self.path
def __getitem__(self, key):
if not self.did_available:
raise DIDNotAvailableException()
return super().__getitem__(key)
def __iter__(self):
if not self.did_available:
raise DIDNotAvailableException()
return super().__iter__()
| class Didnotavailableexception(BaseException):
def __init__(self):
super().__init__('DID is not yet available.')
class Multipleitemdid(list):
def __init__(self, items, did_available=True):
super(MultipleItemDID, self).__init__(items)
self.items = items
self.did_available = did_available
def __str__(self):
if not self.did_available:
raise did_not_available_exception()
return super().__str__()
def __repr__(self):
if not self.did_available:
raise did_not_available_exception()
return super().__repr__()
def __getitem__(self, key):
if not self.did_available:
raise did_not_available_exception()
return super().__getitem__(key)
def __iter__(self):
if not self.did_available:
raise did_not_available_exception()
return super().__iter__()
class Singleitemdid(str):
def __init__(self, path):
super(SingleItemDID, self).__init__()
self.path = path
self.did_available = path is not None
def __str__(self):
if not self.did_available:
raise did_not_available_exception()
return self.path
def __repr__(self):
if not self.did_available:
raise did_not_available_exception()
return self.path
def __getitem__(self, key):
if not self.did_available:
raise did_not_available_exception()
return super().__getitem__(key)
def __iter__(self):
if not self.did_available:
raise did_not_available_exception()
return super().__iter__() |
def ispow2(n):
'''
True if n is a power of 2, False otherwise
>>> ispow2(5)
False
>>> ispow2(4)
True
'''
return (n & (n-1)) == 0
def nextpow2(n):
'''
Given n, return the nearest power of two that is >= n
>>> nextpow2(1)
1
>>> nextpow2(2)
2
>>> nextpow2(5)
8
>>> nextpow2(17)
32
'''
if ispow2(n):
return n
count = 0
while n != 0:
n = n >> 1
count += 1
return 1 << count
class SamplingRateError(ValueError):
'''
Indicates that the conversion of frequency to sampling rate could not be
performed.
'''
def __init__(self, fs, requested_fs):
self.fs = fs
self.requested_fs = requested_fs
def __str__(self):
mesg = 'The requested sampling rate, %f Hz, is greater than ' + \
'the DSP clock frequency of %f Hz.'
return mesg % (self.requested_fs, self.fs)
def convert(src_unit, dest_unit, value, dsp_fs):
'''
Converts value to desired unit give the sampling frequency of the DSP.
Parameters specified in paradigms are typically expressed as
frequency and time while many DSP parameters are expressed in number of
samples (referenced to the DSP sampling frequency). This function provides
a convenience method for converting between conventional values and the
'digital' values used by the DSP.
Note that for converting units of time/frequency to n/nPer, we have to
coerce the value to a multiple of the DSP period (e.g. the number of
'ticks' of the DSP clock).
Appropriate strings for the unit types:
fs
sampling frequency
nPer
number of samples per period
n
number of samples
s
seconds
ms
milliseconds
nPow2
number of samples, coerced to the next greater power of 2 (used for
ensuring efficient FFT computation)
>>> convert('s', 'n', 0.5, 10000)
5000
>>> convert('fs', 'nPer', 500, 10000)
20
>>> convert('s', 'nPow2', 5, 97.5e3)
524288
Parameters
----------
src_unit: string
dest_unit: string
Destination unit
value: numerical (e.g. integer or float)
Value to be converted
Returns
-------
converted unit : numerical value
'''
def fs_to_nPer(req_fs, dsp_fs):
if dsp_fs < req_fs:
raise SamplingRateError(dsp_fs, req_fs)
return int(dsp_fs/req_fs)
def nPer_to_fs(nPer, dsp_fs):
return dsp_fs/nPer
def n_to_s(n, dsp_fs):
return n/dsp_fs
def s_to_n(s, dsp_fs):
return int(s*dsp_fs)
def ms_to_n(ms, dsp_fs):
return int(ms*1e-3*dsp_fs)
def n_to_ms(n, dsp_fs):
return n/dsp_fs*1e3
def s_to_nPow2(s, dsp_fs):
return nextpow2(s_to_n(s, dsp_fs))
fun = '%s_to_%s' % (src_unit, dest_unit)
return locals()[fun](value, dsp_fs)
| def ispow2(n):
"""
True if n is a power of 2, False otherwise
>>> ispow2(5)
False
>>> ispow2(4)
True
"""
return n & n - 1 == 0
def nextpow2(n):
"""
Given n, return the nearest power of two that is >= n
>>> nextpow2(1)
1
>>> nextpow2(2)
2
>>> nextpow2(5)
8
>>> nextpow2(17)
32
"""
if ispow2(n):
return n
count = 0
while n != 0:
n = n >> 1
count += 1
return 1 << count
class Samplingrateerror(ValueError):
"""
Indicates that the conversion of frequency to sampling rate could not be
performed.
"""
def __init__(self, fs, requested_fs):
self.fs = fs
self.requested_fs = requested_fs
def __str__(self):
mesg = 'The requested sampling rate, %f Hz, is greater than ' + 'the DSP clock frequency of %f Hz.'
return mesg % (self.requested_fs, self.fs)
def convert(src_unit, dest_unit, value, dsp_fs):
"""
Converts value to desired unit give the sampling frequency of the DSP.
Parameters specified in paradigms are typically expressed as
frequency and time while many DSP parameters are expressed in number of
samples (referenced to the DSP sampling frequency). This function provides
a convenience method for converting between conventional values and the
'digital' values used by the DSP.
Note that for converting units of time/frequency to n/nPer, we have to
coerce the value to a multiple of the DSP period (e.g. the number of
'ticks' of the DSP clock).
Appropriate strings for the unit types:
fs
sampling frequency
nPer
number of samples per period
n
number of samples
s
seconds
ms
milliseconds
nPow2
number of samples, coerced to the next greater power of 2 (used for
ensuring efficient FFT computation)
>>> convert('s', 'n', 0.5, 10000)
5000
>>> convert('fs', 'nPer', 500, 10000)
20
>>> convert('s', 'nPow2', 5, 97.5e3)
524288
Parameters
----------
src_unit: string
dest_unit: string
Destination unit
value: numerical (e.g. integer or float)
Value to be converted
Returns
-------
converted unit : numerical value
"""
def fs_to_n_per(req_fs, dsp_fs):
if dsp_fs < req_fs:
raise sampling_rate_error(dsp_fs, req_fs)
return int(dsp_fs / req_fs)
def n_per_to_fs(nPer, dsp_fs):
return dsp_fs / nPer
def n_to_s(n, dsp_fs):
return n / dsp_fs
def s_to_n(s, dsp_fs):
return int(s * dsp_fs)
def ms_to_n(ms, dsp_fs):
return int(ms * 0.001 * dsp_fs)
def n_to_ms(n, dsp_fs):
return n / dsp_fs * 1000.0
def s_to_n_pow2(s, dsp_fs):
return nextpow2(s_to_n(s, dsp_fs))
fun = '%s_to_%s' % (src_unit, dest_unit)
return locals()[fun](value, dsp_fs) |
# Complete the fibonacciModified function below.
def fibonacciModified(t1, t2, n):
term = 3
while term <= n:
actual_number = t1 + t2**2
t1 = t2
t2 = actual_number
term += 1
return actual_number
| def fibonacci_modified(t1, t2, n):
term = 3
while term <= n:
actual_number = t1 + t2 ** 2
t1 = t2
t2 = actual_number
term += 1
return actual_number |
a=1;
b=2;
c=a+b;
print("hello world")
121213 | a = 1
b = 2
c = a + b
print('hello world')
121213 |
name = input()
age = int(input())
while name != 'Anton':
print(name)
name = input()
age = input()
print(f'I am Anton') | name = input()
age = int(input())
while name != 'Anton':
print(name)
name = input()
age = input()
print(f'I am Anton') |
class Task(object):
def __init__(self, name, description="", task_id=None):
self.id = task_id
self.name = name
self.description = description
def serialize(self):
return {
"id": self.id,
"name": self.name,
"description": self.description
}
@staticmethod
def serialize_multiple(tasks):
return [task.serialize() for task in tasks]
| class Task(object):
def __init__(self, name, description='', task_id=None):
self.id = task_id
self.name = name
self.description = description
def serialize(self):
return {'id': self.id, 'name': self.name, 'description': self.description}
@staticmethod
def serialize_multiple(tasks):
return [task.serialize() for task in tasks] |
# -*- coding: utf-8 -*-
_available_examples = ["ex_001_Molecule_Hamiltonian.py",
"ex_002_Molecule_Aggregate.py",
"ex_003_CorrFcnSpectDens.py",
"ex_004_SpectDensDatabase.py",
"ex_005_UnitsManagementHamiltonian.py",
"ex_006_Absorption_1.py",
"ex_010_RedfieldTheory_1.py",
"ex_011_LindbladForm_1.py",
"ex_012_Integrodiff.py",
"ex_013_HEOM.py",
"ex_014_HEOM_rates.py",
"ex_015_RedfieldTheory_2.py",
"ex_016_FoersterTheory_1.py",
"ex_020_EvolutionSuperOperator_1.py",
"ex_050_PDB_FMO1.py",
"ex_300_ParallelIterators.py",
"ex_800_DiagProblem.py",
"ex_853_RC.py",
"ex_854_2DSpectrum_DimerDisorder.py"]
_available_data = ["data_050_3eni.pdb",
"data_050_3eoj.pdb",
"ex_853_RC.yaml",
"ex_854_2DSpectrum_DimerDisorder.yaml"]
| _available_examples = ['ex_001_Molecule_Hamiltonian.py', 'ex_002_Molecule_Aggregate.py', 'ex_003_CorrFcnSpectDens.py', 'ex_004_SpectDensDatabase.py', 'ex_005_UnitsManagementHamiltonian.py', 'ex_006_Absorption_1.py', 'ex_010_RedfieldTheory_1.py', 'ex_011_LindbladForm_1.py', 'ex_012_Integrodiff.py', 'ex_013_HEOM.py', 'ex_014_HEOM_rates.py', 'ex_015_RedfieldTheory_2.py', 'ex_016_FoersterTheory_1.py', 'ex_020_EvolutionSuperOperator_1.py', 'ex_050_PDB_FMO1.py', 'ex_300_ParallelIterators.py', 'ex_800_DiagProblem.py', 'ex_853_RC.py', 'ex_854_2DSpectrum_DimerDisorder.py']
_available_data = ['data_050_3eni.pdb', 'data_050_3eoj.pdb', 'ex_853_RC.yaml', 'ex_854_2DSpectrum_DimerDisorder.yaml'] |
def recursive_multiply(x, y):
if (x < y):
return recursive_multiply(y, x)
elif (y != 0):
return (x + recursive_multiply(x, y-1))
else:
return 0
x = int(input("Enter x"))
y = int(input("Enter y"))
print(recursive_multiply(x, y)) | def recursive_multiply(x, y):
if x < y:
return recursive_multiply(y, x)
elif y != 0:
return x + recursive_multiply(x, y - 1)
else:
return 0
x = int(input('Enter x'))
y = int(input('Enter y'))
print(recursive_multiply(x, y)) |
DEFAULT_STACK_SIZE = 8
class PcStack(object):
def __init__(self, programCounter, size: int=DEFAULT_STACK_SIZE):
self._programCounter = programCounter
self._size = size
self._stack = [0]*size
self._stackPointer = 0
@property
def programCounter(self):
return self._programCounter
@property
def size(self) -> int:
return self._size
@property
def stack(self):
return self._stack
@property
def stackPointer(self) -> int:
return self._stackPointer
@stackPointer.setter
def stackPointer(self, value: int):
self._stackPointer = value
@property
def current(self):
return self.stack[self.stackPointer]
@current.setter
def current(self, value: int):
self.stack[self.stackPointer] = value
def incStackPointer(self):
self._stackPointer = (self.stackPointer + 1) % self.size
def decStackPointer(self):
if self.stackPointer == 0:
self.stackPointer = self.size - 1
else:
self.stackPointer = self.stackPointer - 1
def push(self, address):
self.current = self.programCounter.address + 1
self.incStackPointer()
self.programCounter.address = address
def pop(self):
self.decStackPointer()
self.programCounter.address = self.current
| default_stack_size = 8
class Pcstack(object):
def __init__(self, programCounter, size: int=DEFAULT_STACK_SIZE):
self._programCounter = programCounter
self._size = size
self._stack = [0] * size
self._stackPointer = 0
@property
def program_counter(self):
return self._programCounter
@property
def size(self) -> int:
return self._size
@property
def stack(self):
return self._stack
@property
def stack_pointer(self) -> int:
return self._stackPointer
@stackPointer.setter
def stack_pointer(self, value: int):
self._stackPointer = value
@property
def current(self):
return self.stack[self.stackPointer]
@current.setter
def current(self, value: int):
self.stack[self.stackPointer] = value
def inc_stack_pointer(self):
self._stackPointer = (self.stackPointer + 1) % self.size
def dec_stack_pointer(self):
if self.stackPointer == 0:
self.stackPointer = self.size - 1
else:
self.stackPointer = self.stackPointer - 1
def push(self, address):
self.current = self.programCounter.address + 1
self.incStackPointer()
self.programCounter.address = address
def pop(self):
self.decStackPointer()
self.programCounter.address = self.current |
# -*- coding: utf-8 -*-
user_schema = {
'username': {
'type': 'string',
'minlength': 1,
'maxlength': 64,
'required': True,
'unique': True
},
'email': {
'type': 'string',
'regex': '^\S+@\S+.\S+',
'required': True,
'unique': True
},
'password': {
'type': 'string',
'minlength': 1,
'maxlength': 64,
'required': True
},
}
user = {
'item_title': 'user',
'additional_lookup': {
'url': 'regex("[\w]+")',
'field': 'username'
},
'cache_control': 'max-age=10,must-revalidate',
'cache_expires': 10,
'resource_methods': ['GET', 'POST'],
'schema': user_schema
}
todolist_schema = {
'title': {
'type': 'string',
'minlength': 1,
'maxlength': 128,
'required': True
},
'creator': {
'type': 'string'
},
'todos': {},
}
todolist = {
'item_title': 'todolist',
'additional_lookup': {
'url': 'regex("[\w]+")',
# 'field': '_id'
'field': 'title'
},
'cache_control': 'max-age=10,must-revalidate',
'cache_expires': 10,
'resource_methods': ['GET', 'POST', 'DELETE'],
'schema': todolist_schema
}
todo_schema = {
'description': {
'type': 'string',
'minlength': 1,
'maxlength': 128,
'required': True
},
'creator': {
'type': 'string'
},
'todolist': {},
}
todo = {
'item_title': 'todo',
'additional_lookup': {
'url': 'regex("[\w]+")',
# 'field': '_id'
'field': 'description'
},
'cache_control': 'max-age=10,must-revalidate',
'cache_expires': 10,
'resource_methods': ['GET', 'POST', 'DELETE'],
'schema': todo_schema
}
DOMAIN = {
'users': user,
'todolists': todolist,
'todos': todo
}
# mongo db settings
MONGO_HOST = 'localhost'
MONGO_PORT = 27017
MONGO_USERNAME = ''
MONGO_PASSWORD = ''
MONGO_DBNAME = 'apitest'
| user_schema = {'username': {'type': 'string', 'minlength': 1, 'maxlength': 64, 'required': True, 'unique': True}, 'email': {'type': 'string', 'regex': '^\\S+@\\S+.\\S+', 'required': True, 'unique': True}, 'password': {'type': 'string', 'minlength': 1, 'maxlength': 64, 'required': True}}
user = {'item_title': 'user', 'additional_lookup': {'url': 'regex("[\\w]+")', 'field': 'username'}, 'cache_control': 'max-age=10,must-revalidate', 'cache_expires': 10, 'resource_methods': ['GET', 'POST'], 'schema': user_schema}
todolist_schema = {'title': {'type': 'string', 'minlength': 1, 'maxlength': 128, 'required': True}, 'creator': {'type': 'string'}, 'todos': {}}
todolist = {'item_title': 'todolist', 'additional_lookup': {'url': 'regex("[\\w]+")', 'field': 'title'}, 'cache_control': 'max-age=10,must-revalidate', 'cache_expires': 10, 'resource_methods': ['GET', 'POST', 'DELETE'], 'schema': todolist_schema}
todo_schema = {'description': {'type': 'string', 'minlength': 1, 'maxlength': 128, 'required': True}, 'creator': {'type': 'string'}, 'todolist': {}}
todo = {'item_title': 'todo', 'additional_lookup': {'url': 'regex("[\\w]+")', 'field': 'description'}, 'cache_control': 'max-age=10,must-revalidate', 'cache_expires': 10, 'resource_methods': ['GET', 'POST', 'DELETE'], 'schema': todo_schema}
domain = {'users': user, 'todolists': todolist, 'todos': todo}
mongo_host = 'localhost'
mongo_port = 27017
mongo_username = ''
mongo_password = ''
mongo_dbname = 'apitest' |
'''
https://www.geeksforgeeks.org/find-count-number-given-string-present-2d-character-array/
Given a 2-Dimensional character array and a string, we need to find the given string in 2-dimensional character array such that individual characters can be present left to right, right to left, top to down or down to top.
Examples:
In case you wish to attend live classes with experts, please refer DSA Live Classes for Working Professionals and Competitive Programming Live for Students.
Input : a ={
{D,D,D,G,D,D},
{B,B,D,E,B,S},
{B,S,K,E,B,K},
{D,D,D,D,D,E},
{D,D,D,D,D,E},
{D,D,D,D,D,G}
}
str= "GEEKS"
Output :2
Input : a = {
{B,B,M,B,B,B},
{C,B,A,B,B,B},
{I,B,G,B,B,B},
{G,B,I,B,B,B},
{A,B,C,B,B,B},
{M,C,I,G,A,M}
}
str= "MAGIC"
Output :3
We have discussed simpler problem to find if a word exists or not in a matrix.
To count all occurrences, we follow simple brute force approach. Traverse through each character of the matrix and taking each character as start of the string to be found, try to search in all the possible directions. Whenever, a word is found, increase the count, and after traversing the matrix what ever will be the value of count will be number of times string exists in character matrix.
Algorithm :
1- Traverse matrix character by character and take one character as string start
2- For each character find the string in all the four directions recursively
3- If a string found, we increase the count
4- When we are done with one character as start, we repeat the same process for the next character
5- Calculate the sum of count for each character
6- Final count will be the answer'''
# Python code for finding count
# of string in a given 2D
# character array.
# utility function to search
# complete string from any
# given index of 2d array
def internalSearch(ii, needle, row, col, hay,
row_max, col_max):
found = 0
if (row >= 0 and row <= row_max and
col >= 0 and col <= col_max and
needle[ii] == hay[row][col]):
match = needle[ii]
ii += 1
hay[row][col] = 0
if (ii == len(needle)):
found = 1
else:
# through Backtrack searching
# in every directions
found += internalSearch(ii, needle, row,
col + 1, hay, row_max, col_max)
found += internalSearch(ii, needle, row,
col - 1, hay, row_max, col_max)
found += internalSearch(ii, needle, row + 1,
col, hay, row_max, col_max)
found += internalSearch(ii, needle, row - 1,
col, hay, row_max, col_max)
hay[row][col] = match
return found
# Function to search the string in 2d array
def searchString(needle, row, col, strr,
row_count, col_count):
found = 0
for r in range(row_count):
for c in range(col_count):
found += internalSearch(0, needle, r, c,
strr, row_count - 1, col_count - 1)
return found
# Driver code
needle = "MAGIC"
inputt = ["BBABBM", "CBMBBA", "IBABBG",
"GOZBBI", "ABBBBC", "MCIGAM"]
strr = [0] * len(inputt)
for i in range(len(inputt)):
strr[i] = list(inputt[i])
print("count: ", searchString(needle, 0, 0, strr,
len(strr), len(strr[0])))
| """
https://www.geeksforgeeks.org/find-count-number-given-string-present-2d-character-array/
Given a 2-Dimensional character array and a string, we need to find the given string in 2-dimensional character array such that individual characters can be present left to right, right to left, top to down or down to top.
Examples:
In case you wish to attend live classes with experts, please refer DSA Live Classes for Working Professionals and Competitive Programming Live for Students.
Input : a ={
{D,D,D,G,D,D},
{B,B,D,E,B,S},
{B,S,K,E,B,K},
{D,D,D,D,D,E},
{D,D,D,D,D,E},
{D,D,D,D,D,G}
}
str= "GEEKS"
Output :2
Input : a = {
{B,B,M,B,B,B},
{C,B,A,B,B,B},
{I,B,G,B,B,B},
{G,B,I,B,B,B},
{A,B,C,B,B,B},
{M,C,I,G,A,M}
}
str= "MAGIC"
Output :3
We have discussed simpler problem to find if a word exists or not in a matrix.
To count all occurrences, we follow simple brute force approach. Traverse through each character of the matrix and taking each character as start of the string to be found, try to search in all the possible directions. Whenever, a word is found, increase the count, and after traversing the matrix what ever will be the value of count will be number of times string exists in character matrix.
Algorithm :
1- Traverse matrix character by character and take one character as string start
2- For each character find the string in all the four directions recursively
3- If a string found, we increase the count
4- When we are done with one character as start, we repeat the same process for the next character
5- Calculate the sum of count for each character
6- Final count will be the answer"""
def internal_search(ii, needle, row, col, hay, row_max, col_max):
found = 0
if row >= 0 and row <= row_max and (col >= 0) and (col <= col_max) and (needle[ii] == hay[row][col]):
match = needle[ii]
ii += 1
hay[row][col] = 0
if ii == len(needle):
found = 1
else:
found += internal_search(ii, needle, row, col + 1, hay, row_max, col_max)
found += internal_search(ii, needle, row, col - 1, hay, row_max, col_max)
found += internal_search(ii, needle, row + 1, col, hay, row_max, col_max)
found += internal_search(ii, needle, row - 1, col, hay, row_max, col_max)
hay[row][col] = match
return found
def search_string(needle, row, col, strr, row_count, col_count):
found = 0
for r in range(row_count):
for c in range(col_count):
found += internal_search(0, needle, r, c, strr, row_count - 1, col_count - 1)
return found
needle = 'MAGIC'
inputt = ['BBABBM', 'CBMBBA', 'IBABBG', 'GOZBBI', 'ABBBBC', 'MCIGAM']
strr = [0] * len(inputt)
for i in range(len(inputt)):
strr[i] = list(inputt[i])
print('count: ', search_string(needle, 0, 0, strr, len(strr), len(strr[0]))) |
#
# PHASE: jvm flags
#
# DOCUMENT THIS
#
def phase_jvm_flags(ctx, p):
if ctx.attr.tests_from:
archives = _get_test_archive_jars(ctx, ctx.attr.tests_from)
else:
archives = p.compile.merged_provider.runtime_output_jars
serialized_archives = _serialize_archives_short_path(archives)
test_suite = _gen_test_suite_flags_based_on_prefixes_and_suffixes(
ctx,
serialized_archives,
)
return [
"-ea",
test_suite.archiveFlag,
test_suite.prefixesFlag,
test_suite.suffixesFlag,
test_suite.printFlag,
test_suite.testSuiteFlag,
]
def _gen_test_suite_flags_based_on_prefixes_and_suffixes(ctx, archives):
return struct(
archiveFlag = "-Dbazel.discover.classes.archives.file.paths=%s" %
archives,
prefixesFlag = "-Dbazel.discover.classes.prefixes=%s" % ",".join(
ctx.attr.prefixes,
),
printFlag = "-Dbazel.discover.classes.print.discovered=%s" %
ctx.attr.print_discovered_classes,
suffixesFlag = "-Dbazel.discover.classes.suffixes=%s" % ",".join(
ctx.attr.suffixes,
),
testSuiteFlag = "-Dbazel.test_suite=%s" % ctx.attr.suite_class,
)
def _serialize_archives_short_path(archives):
archives_short_path = ""
for archive in archives:
archives_short_path += archive.short_path + ","
return archives_short_path[:-1] #remove redundant comma
def _get_test_archive_jars(ctx, test_archives):
flattened_list = []
for archive in test_archives:
class_jars = [java_output.class_jar for java_output in archive[JavaInfo].outputs.jars]
flattened_list.extend(class_jars)
return flattened_list
| def phase_jvm_flags(ctx, p):
if ctx.attr.tests_from:
archives = _get_test_archive_jars(ctx, ctx.attr.tests_from)
else:
archives = p.compile.merged_provider.runtime_output_jars
serialized_archives = _serialize_archives_short_path(archives)
test_suite = _gen_test_suite_flags_based_on_prefixes_and_suffixes(ctx, serialized_archives)
return ['-ea', test_suite.archiveFlag, test_suite.prefixesFlag, test_suite.suffixesFlag, test_suite.printFlag, test_suite.testSuiteFlag]
def _gen_test_suite_flags_based_on_prefixes_and_suffixes(ctx, archives):
return struct(archiveFlag='-Dbazel.discover.classes.archives.file.paths=%s' % archives, prefixesFlag='-Dbazel.discover.classes.prefixes=%s' % ','.join(ctx.attr.prefixes), printFlag='-Dbazel.discover.classes.print.discovered=%s' % ctx.attr.print_discovered_classes, suffixesFlag='-Dbazel.discover.classes.suffixes=%s' % ','.join(ctx.attr.suffixes), testSuiteFlag='-Dbazel.test_suite=%s' % ctx.attr.suite_class)
def _serialize_archives_short_path(archives):
archives_short_path = ''
for archive in archives:
archives_short_path += archive.short_path + ','
return archives_short_path[:-1]
def _get_test_archive_jars(ctx, test_archives):
flattened_list = []
for archive in test_archives:
class_jars = [java_output.class_jar for java_output in archive[JavaInfo].outputs.jars]
flattened_list.extend(class_jars)
return flattened_list |
METADATA = 'metadata'
CONTENT = 'content'
FILENAME = 'filename'
PARAM_CREATION_DATE = '_audit_creation_date'
PARAM_R1 = '_diffrn_reflns_av_R_equivalents'
PARAM_SIGMI_NETI = '_diffrn_reflns_av_sigmaI/netI'
PARAM_COMPLETENESS = '_reflns_odcompleteness_completeness'
PARAM_SPACEGROUP = '_space_group_name_H-M_alt'
PARAM_SPACEGROUP_NUM = '_space_group_IT_number'
PARAM_CONST_CELLA = '_cell_length_a'
PARAM_CONST_CELLB = '_cell_length_b'
PARAM_CONST_CELLC = '_cell_length_c'
PARAM_CONST_AL = '_cell_angle_alpha'
PARAM_CONST_BE = '_cell_angle_beta'
PARAM_CONST_GA = '_cell_angle_gamma'
PARAM_CONST_VOL = '_cell_volume'
PARAM_REFLECTIONS = '_cell_measurement_reflns_used'
PARAM_WAVELENGTH = '_diffrn_radiation_wavelength'
PARAM_CELLA = '_cell_oxdiff_length_a'
PARAM_CELLB = '_cell_oxdiff_length_b'
PARAM_CELLC = '_cell_oxdiff_length_c'
PARAM_AL = '_cell_oxdiff_angle_alpha'
PARAM_BE = '_cell_oxdiff_angle_beta'
PARAM_GA = '_cell_oxdiff_angle_gamma'
PARAM_VOL = '_cell_oxdiff_volume'
PARAM_UB11 = '_diffrn_orient_matrix_UB_11'
PARAM_UB12 = '_diffrn_orient_matrix_UB_12'
PARAM_UB13 = '_diffrn_orient_matrix_UB_13'
PARAM_UB21 = '_diffrn_orient_matrix_UB_21'
PARAM_UB22 = '_diffrn_orient_matrix_UB_22'
PARAM_UB23 = '_diffrn_orient_matrix_UB_23'
PARAM_UB31 = '_diffrn_orient_matrix_UB_31'
PARAM_UB32 = '_diffrn_orient_matrix_UB_32'
PARAM_UB33 = '_diffrn_orient_matrix_UB_33'
PARAM_2THETA_MIN = '_cell_measurement_theta_min'
PARAM_2THETA_MAX = '_cell_measurement_theta_max'
| metadata = 'metadata'
content = 'content'
filename = 'filename'
param_creation_date = '_audit_creation_date'
param_r1 = '_diffrn_reflns_av_R_equivalents'
param_sigmi_neti = '_diffrn_reflns_av_sigmaI/netI'
param_completeness = '_reflns_odcompleteness_completeness'
param_spacegroup = '_space_group_name_H-M_alt'
param_spacegroup_num = '_space_group_IT_number'
param_const_cella = '_cell_length_a'
param_const_cellb = '_cell_length_b'
param_const_cellc = '_cell_length_c'
param_const_al = '_cell_angle_alpha'
param_const_be = '_cell_angle_beta'
param_const_ga = '_cell_angle_gamma'
param_const_vol = '_cell_volume'
param_reflections = '_cell_measurement_reflns_used'
param_wavelength = '_diffrn_radiation_wavelength'
param_cella = '_cell_oxdiff_length_a'
param_cellb = '_cell_oxdiff_length_b'
param_cellc = '_cell_oxdiff_length_c'
param_al = '_cell_oxdiff_angle_alpha'
param_be = '_cell_oxdiff_angle_beta'
param_ga = '_cell_oxdiff_angle_gamma'
param_vol = '_cell_oxdiff_volume'
param_ub11 = '_diffrn_orient_matrix_UB_11'
param_ub12 = '_diffrn_orient_matrix_UB_12'
param_ub13 = '_diffrn_orient_matrix_UB_13'
param_ub21 = '_diffrn_orient_matrix_UB_21'
param_ub22 = '_diffrn_orient_matrix_UB_22'
param_ub23 = '_diffrn_orient_matrix_UB_23'
param_ub31 = '_diffrn_orient_matrix_UB_31'
param_ub32 = '_diffrn_orient_matrix_UB_32'
param_ub33 = '_diffrn_orient_matrix_UB_33'
param_2_theta_min = '_cell_measurement_theta_min'
param_2_theta_max = '_cell_measurement_theta_max' |
class cves():
cve_url = "https://services.nvd.nist.gov/rest/json/cves/1.0?pubStartDate=2021-09-01T00:00:00:000+UTC-00:00&resultsPerPage=100&keyword="
keywords = ["RHCS", "RHEL", "Thales", "nShield", "Certificate+Authority&isExactMatch=true", "NSS", "tomcat", "TLS"]
| class Cves:
cve_url = 'https://services.nvd.nist.gov/rest/json/cves/1.0?pubStartDate=2021-09-01T00:00:00:000+UTC-00:00&resultsPerPage=100&keyword='
keywords = ['RHCS', 'RHEL', 'Thales', 'nShield', 'Certificate+Authority&isExactMatch=true', 'NSS', 'tomcat', 'TLS'] |
#!/usr/local/bin/python3
class Object(object):
def __init__(self, id):
self.id = id
self.children = []
root = Object("COM")
objects = {"COM": root}
def get_object(id):
if id not in objects:
objects[id] = Object(id)
return objects[id]
with open("input.txt") as f:
for line in f.readlines():
parent, child = map(get_object, line.strip().split(")"))
parent.children.append(child)
checksum = 0
def traverse(node, distance):
global checksum
checksum += distance
for child in node.children:
traverse(child, distance + 1)
traverse(root, 0)
print("checksum: %d" % checksum)
| class Object(object):
def __init__(self, id):
self.id = id
self.children = []
root = object('COM')
objects = {'COM': root}
def get_object(id):
if id not in objects:
objects[id] = object(id)
return objects[id]
with open('input.txt') as f:
for line in f.readlines():
(parent, child) = map(get_object, line.strip().split(')'))
parent.children.append(child)
checksum = 0
def traverse(node, distance):
global checksum
checksum += distance
for child in node.children:
traverse(child, distance + 1)
traverse(root, 0)
print('checksum: %d' % checksum) |
key = {'f':'l', 'd': 'l','j':'r', 'k':'r'}
words = {}
for _ in range(int(input())):
n = int(input())
for _ in range(n):
s = input()
if words.get(s): words[s] += 1
else : words[s] = 1
# print(words)
final_ans = 0
for i in words:
c_word_ans = 0.2
pre = key[i[0]]
for j in i[1::]:
if(key[j] == pre):c_word_ans += 0.4
else: c_word_ans += 0.2
pre = key[j]
final_ans += c_word_ans + ((words[i] - 1) * c_word_ans / 2)
print(int(final_ans * 10)) | key = {'f': 'l', 'd': 'l', 'j': 'r', 'k': 'r'}
words = {}
for _ in range(int(input())):
n = int(input())
for _ in range(n):
s = input()
if words.get(s):
words[s] += 1
else:
words[s] = 1
final_ans = 0
for i in words:
c_word_ans = 0.2
pre = key[i[0]]
for j in i[1:]:
if key[j] == pre:
c_word_ans += 0.4
else:
c_word_ans += 0.2
pre = key[j]
final_ans += c_word_ans + (words[i] - 1) * c_word_ans / 2
print(int(final_ans * 10)) |
# Copyright (c) Microsoft Corporation.
# Licensed under the MIT license.
class PotentialEdgeColumnPair:
def __init__(self, source, destination, score):
self._source = source
self._destination = destination
self._score = score
def source(self):
return self._source
def destination(self):
return self._destination
def score(self):
return self._score
| class Potentialedgecolumnpair:
def __init__(self, source, destination, score):
self._source = source
self._destination = destination
self._score = score
def source(self):
return self._source
def destination(self):
return self._destination
def score(self):
return self._score |
class ModelOutput:
# Class that defines model output structure
def __init__(self, arg_type, arg_size, is_spacial):
self.arg_type = arg_type
self.arg_size = arg_size
self.is_spacial = is_spacial
| class Modeloutput:
def __init__(self, arg_type, arg_size, is_spacial):
self.arg_type = arg_type
self.arg_size = arg_size
self.is_spacial = is_spacial |
class DateGetter:
'''Parse a date using the datetime format string defined in
the current jxn's config.
'''
def _get_date(self, label_text):
fmt = self.get_config_value('datetime_format')
text = self.get_field_text(label_text)
if text is not None:
dt = datetime.strptime(text, fmt)
dt = self.cfg.datetime_add_tz(dt)
return dt
class BillsFields(FieldAggregator, DateGetter):
text_fields = (
'law_number', 'type', 'status',
'name', 'version', 'sponsor_office')
def get_intro_data(self):
return self._get_date('intro_date')
def get_file_created(self):
return self._get_date('file_created')
def gen_sources(self):
grouped = collections.defaultdict(set)
for note, url in self.chainmap['sources'].items():
grouped[url].add(note)
for url, notes in grouped.items():
yield dict(url=url, note=', '.join(sorted(notes)))
class BillsSearchForm(FirefoxForm):
'''Model the legistar "Legislation" search form.
'''
sources_note = 'bill search table'
def is_advanced_search(self):
switch_el_id = self.cfg.BILL_SEARCH_SWITCH_EL_ID
switch_el = self.firefox.find_element_by_id(switch_el_id)
switch_el_text = switch_el.text.lower()
if self.cfg.BILL_SEARCH_SWITCH_SIMPLE in switch_el_text:
return True
return False
def switch_to_advanced_search(self):
switch_el_id = self.cfg.BILL_SEARCH_SWITCH_EL_ID
switch_el = self.firefox.find_element_by_id(switch_el_id)
switch_el.click()
def fill_out_form(self):
if not self.is_advanced_search():
self.switch_to_advanced_search()
max_results_id = "ctl00_ContentPlaceHolder1_lstMax"
self.set_dropdown(max_results_id, 'All')
years_id = "ctl00_ContentPlaceHolder1_lstYearsAdvanced"
self.set_dropdown(years_id, 'This Year')
class BillsDetailView(DetailView, BillsFields):
sources_note = 'bill detail'
text_fields = ('version', 'name')
def get_file_number(self):
return self.get_field_text('file_number')
def get_title(self):
title = self.get_field_text('title')
# If no title, re-use type (i.e., "Resolution")
if not title:
title = self.get_field_text('type')
return title
def get_agenda_date(self):
return self._get_date('agenda')
def get_enactment_date(self):
return self._get_date('enactment_date')
def get_final_action(self):
return self._get_date('final_action')
def gen_sponsors(self):
sponsors = self.get_field_text('sponsors')
for name in re.split(r',\s+', sponsors):
name = name.strip()
if name:
yield dict(name=name)
def gen_documents(self):
for el in self.xpath('attachments', './/a'):
data = ElementAccessor(el)
url = data.get_url()
media_type = 'application/pdf'
yield dict(
name=data.get_text(),
links=[dict(
url=data.get_url(),
media_type=media_type)])
def gen_action(self):
yield from self.Form(self)
def gen_identifiers(self):
'''Yield out the internal legistar bill id and guid found
in the detail page url.
'''
detail_url = self.chainmap['sources'][self.sources_note]
url = urlparse(detail_url)
for idtype, ident in parse_qsl(url.query):
if idtype == 'options' or ident == 'Advanced':
continue
yield dict(
scheme="legistar_" + idtype.lower(),
identifier=ident)
def get_legislative_session(self):
dates = []
labels = ('agenda', 'created')
for label in labels:
labeltext = self.get_label_text(label, skipitem=False)
if labeltext not in self.field_data.keys():
continue
if not self.field_data[labeltext]:
continue
data = self.field_data[labeltext][0]
fmt = self.get_config_value('datetime_format')
text = data.get_text()
if text is not None:
dt = datetime.strptime(text, fmt)
dt = self.cfg.datetime_add_tz(dt)
dates.append(dt)
_, actions = self.gen_action()
for action in actions:
dates.append(action['date'])
if dates:
return str(max(dates).year)
self.critical('Need session date.')
class BillsDetailTableRow(TableRow, FieldAggregator, DateGetter):
sources_node = 'bill action table'
disable_aggregator_funcs = True
text_fields = (
('action_by', 'organization'),
('action', 'text'),
'version',
'result',
'journal_page',
)
def get_detail_viewtype(self):
return BillsDetailAction
def get_detail_url(self):
return self.get_media_url('action_details')
def get_date(self):
return self._get_date('date')
def _get_media(self, label):
'''Given a field label, get it's url (if any) and send a head
request to determine the content_type. Return a dict.
'''
data = self.get_field_data(label)
url = data.get_url()
if url is None:
raise self.SkipItem()
self.info('Sending HEAD request for %r' % url)
media_type = 'application/pdf'
return dict(
name=data.get_text(),
links=[dict(
url=data.get_url(),
media_type=media_type)])
@make_item('media', wrapwith=list)
def gen_media(self):
for label in self.get_config_value('pupa_media'):
try:
yield self._get_media(label)
except self.SkipItem:
continue
class BillsDetailAction(DetailView, ActionBase):
sources_note = 'bill action detail'
text_fields = (
'file_number', 'type', 'title', 'mover', 'seconder',
'result', 'agenda_note', 'minutes_note', 'action',
'action_text')
@make_item('votes', wrapwith=list)
def gen_votes(self):
table_path = self.get_config_value('table_class')
Table = resolve_name(table_path)
yield from self.make_child(Table, self)
@make_item('sources', wrapwith=list)
def gen_sources(self):
yield dict(url=self.url, note='action detail')
class BillsDetailActionTable(Table, ActionBase):
sources_note = 'bill action detail table'
def get_table_cell_type(self):
path = self.get_config_value('tablecell_class')
return resolve_name(path)
def get_table_row_type(self):
path = self.get_config_value('tablerow_class')
return resolve_name(path)
class BillsDetailActionTableRow(TableRow, ActionBase):
sources_node = 'bill action detail table'
text_fields = ('person', 'vote')
def _get_date(date):
if isinstance(date, datetime.datetime):
return date.strftime('%Y-%m-%d')
else:
return date
class ActionAdapter(Adapter):
aliases = [('text', 'description')]
extras_keys = ['version', 'media', 'result']
drop_keys = ['sources', 'journal_page']
#make_item('date')
def get_date(self):
return _get_date(self.data['date'])
class VoteAdapter(Adapter):
pupa_model = pupa.scrape.Vote
text_fields = ['organization']
aliases = [
('text', 'motion_text'),
]
drop_keys = ['date']
extras_keys = ['version', 'media', 'journal_page']
#make_item('identifier')
def get_identifier(self):
'''The internal legistar bill id and guid found
in the detail page url.
'''
i = self.data.pop('i')
for source in self.data['sources']:
if not 'historydetail' in source['url'].lower():
continue
url = urlparse(source['url'])
ids = {}
for idtype, ident in parse_qsl(url.query):
if idtype == 'options':
continue
ids[idtype.lower()] = ident
return ids['guid']
# The vote has no "action details" page, thus no identifier.
# Fudge one based on the bill's guid.
for source in self.bill_adapter.data['identifiers']:
if source['scheme'] != 'legistar_guid':
continue
return '%s-vote%d' % (source['identifier'], i)
#make_item('start_date')
def get_date(self):
return _get_date(self.data.get('date'))
#make_item('result')
def get_result(self):
if not self.data['result']:
raise self.SkipItem()
result = self.get_vote_result(self.data['result'])
return result
#make_item('votes', wrapwith=list)
def gen_votes(self):
for data in self.data['votes']:
if not data:
continue
res = {}
res['option'] = self.get_vote_option(data['vote'])
res['note'] = data['vote']
res['voter'] = data['person']
yield res
def get_instance(self, **extra_instance_data):
data = self.get_instance_data()
data.update(extra_instance_data)
motion_text = data['motion_text']
data['classification'] = self.classify_motion_text(motion_text)
# Drop the org if necessary. When org is the top-level org, omit.
if self.should_drop_organization(data):
data.pop('organization', None)
vote_data_list = data.pop('votes')
extras = data.pop('extras')
sources = data.pop('sources')
data.pop('i', None)
vote = self.pupa_model(**data)
counts = collections.Counter()
for vote_data in vote_data_list:
counts[vote_data['option']] += 1
vote.vote(**vote_data)
for option, value in counts.items():
vote.set_count(option, value)
for source in sources:
vote.add_source(**source)
vote.extras.update(extras)
# Skip no-result "votes"
# https://sfgov.legistar.com/LegislationDetail.aspx?ID=1866659&GUID=A23A12AB-C833-4235-81A1-02AD7B8E7CF0&Options=Advanced&Search
if vote.result is None:
return
return vote
# ------------------------------------------------------------------------
# Overridables
# ------------------------------------------------------------------------
def get_vote_result(self, result):
'''Noramalizes the vote result value using the default values on
Config base, possibly overridded by jxn.BILL_VOTE_RESULT_MAP.
'''
result = result.replace('-', ' ').lower()
result = self.cfg._BILL_VOTE_RESULT_MAP[result]
return result
def get_vote_option(self, option_text):
'''Noramalizes the vote option value using the default values on
Config base, possibly overridded by jxn.BILL_VOTE_OPTION_MAP.
'''
option_text = option_text.replace('-', ' ').lower()
return self.cfg._BILL_VOTE_OPTION_MAP[option_text]
def should_drop_organization(self, data):
'''If this function returns True, the org is dropped from the vote obj.
XXX: Right now, always drops the org.
'''
return True
def classify_motion_text(self, motion_text):
'''Jurisdiction configs can override this to determine how
vote motions will be classified.
'''
return []
class BillsAdapter(Adapter):
pupa_model = pupa.scrape.Bill
aliases = [
('file_number', 'identifier'),
]
extras_keys = [
'law_number', 'status']
#make_item('classification')
def get_classn(self):
return self.get_bill_classification(self.data.pop('type'))
#make_item('actions', wrapwith=list)
def gen_actions(self):
for data in self.data.get('actions'):
data = dict(data)
data.pop('votes')
action = self.make_child(ActionAdapter, data).get_instance_data()
if action['description'] is None:
action['description'] = ''
yield action
#make_item('sponsorships')
def get_sponsorships(self):
return self.data.get('sponsors', [])
#make_item('votes', wrapwith=list)
def gen_votes(self):
for i, data in enumerate(self.data.get('actions')):
data['i'] = i
converter = self.make_child(VoteAdapter, data)
converter.bill_adapter = self
more_data = dict(
legislative_session=self.data['legislative_session'])
vote = converter.get_instance(**more_data)
if vote is not None and vote.votes:
yield vote
#make_item('subject')
def _gen_subjects(self, wrapwith=list):
yield from self.gen_subjects()
def get_instance(self):
'''Build a pupa instance from the data.
'''
data = self.get_instance_data()
data_copy = dict(data)
# Allow jxns to define what bills get dropped.
if self.should_drop_bill(data_copy):
return
bill = pupa.scrape.Bill(
identifier=data['identifier'],
legislative_session=data['legislative_session'],
classification=data.get('classification', []),
title=data['title'],
)
for action in data.pop('actions'):
action.pop('extras')
self.drop_action_organization(action)
bill.add_action(**action)
for sponsorship in data.pop('sponsorships'):
if not self.should_drop_sponsor(sponsorship):
kwargs = dict(
classification=self.get_sponsor_classification(sponsorship),
entity_type=self.get_sponsor_entity_type(sponsorship),
primary=self.get_sponsor_primary(sponsorship))
kwargs.update(sponsorship)
bill.add_sponsorship(**kwargs)
for source in data.pop('sources'):
bill.add_source(**source)
bill.extras.update(data.pop('extras'))
for identifier in data.pop('identifiers'):
bill.add_identifier(**identifier)
if bill.title is None:
bill.title = ''
yield bill
for vote in data.pop('votes'):
vote.set_bill(bill)
self.vote_cache[vote.identifier] = vote
yield vote
@CachedAttr
def vote_cache(self):
'''So we don't dupe any votes. Maps identifier to vote obj.
'''
return {}
# ------------------------------------------------------------------------
# Overridables: sponsorships
# ------------------------------------------------------------------------
def should_drop_sponsor(self, data):
'''If this function retruns True, the sponsor is dropped.
'''
return False
def get_sponsor_classification(self, data):
'''Return the sponsor's pupa classification. Legistar generally
doesn't provide any info like this, so we just return "".
'''
return 'sponsor'
def get_sponsor_entity_type(self, data):
'''Return the sponsor's pupa entity type.
'''
return 'person'
def get_sponsor_primary(self, data):
'''Return whether the sponsor is primary. Legistar generally doesn't
provide this.
'''
return False
# ------------------------------------------------------------------------
# Overridables: actions
# ------------------------------------------------------------------------
def drop_action_organization(self, data):
'''
XXX: This temporarily drops the action['organization'] from all
actions. See pupa issue #105 https://github.com/opencivicdata/pupa/issues/105/
When the organization is the top-level org, it doesn't get set
on the action.
'''
data.pop('organization', None)
# ------------------------------------------------------------------------
# Overridables: miscellaneous
# ------------------------------------------------------------------------
def get_bill_classification(self, billtype):
'''Convert the legistar bill `type` column into
a pupa classification array.
'''
# Try to get the classn from the subtype.
classn = getattr(self, '_BILL_CLASSIFICATIONS', {})
classn = dict(classn).get(billtype)
if classn is not None:
return [classn]
# Bah, no matches--try to guess it.
type_lower = billtype.lower()
for classn in dict(ocd_common.BILL_CLASSIFICATION_CHOICES):
if classn in type_lower:
return [classn]
# None found; return emtpy array.
return []
| class Dategetter:
"""Parse a date using the datetime format string defined in
the current jxn's config.
"""
def _get_date(self, label_text):
fmt = self.get_config_value('datetime_format')
text = self.get_field_text(label_text)
if text is not None:
dt = datetime.strptime(text, fmt)
dt = self.cfg.datetime_add_tz(dt)
return dt
class Billsfields(FieldAggregator, DateGetter):
text_fields = ('law_number', 'type', 'status', 'name', 'version', 'sponsor_office')
def get_intro_data(self):
return self._get_date('intro_date')
def get_file_created(self):
return self._get_date('file_created')
def gen_sources(self):
grouped = collections.defaultdict(set)
for (note, url) in self.chainmap['sources'].items():
grouped[url].add(note)
for (url, notes) in grouped.items():
yield dict(url=url, note=', '.join(sorted(notes)))
class Billssearchform(FirefoxForm):
"""Model the legistar "Legislation" search form.
"""
sources_note = 'bill search table'
def is_advanced_search(self):
switch_el_id = self.cfg.BILL_SEARCH_SWITCH_EL_ID
switch_el = self.firefox.find_element_by_id(switch_el_id)
switch_el_text = switch_el.text.lower()
if self.cfg.BILL_SEARCH_SWITCH_SIMPLE in switch_el_text:
return True
return False
def switch_to_advanced_search(self):
switch_el_id = self.cfg.BILL_SEARCH_SWITCH_EL_ID
switch_el = self.firefox.find_element_by_id(switch_el_id)
switch_el.click()
def fill_out_form(self):
if not self.is_advanced_search():
self.switch_to_advanced_search()
max_results_id = 'ctl00_ContentPlaceHolder1_lstMax'
self.set_dropdown(max_results_id, 'All')
years_id = 'ctl00_ContentPlaceHolder1_lstYearsAdvanced'
self.set_dropdown(years_id, 'This Year')
class Billsdetailview(DetailView, BillsFields):
sources_note = 'bill detail'
text_fields = ('version', 'name')
def get_file_number(self):
return self.get_field_text('file_number')
def get_title(self):
title = self.get_field_text('title')
if not title:
title = self.get_field_text('type')
return title
def get_agenda_date(self):
return self._get_date('agenda')
def get_enactment_date(self):
return self._get_date('enactment_date')
def get_final_action(self):
return self._get_date('final_action')
def gen_sponsors(self):
sponsors = self.get_field_text('sponsors')
for name in re.split(',\\s+', sponsors):
name = name.strip()
if name:
yield dict(name=name)
def gen_documents(self):
for el in self.xpath('attachments', './/a'):
data = element_accessor(el)
url = data.get_url()
media_type = 'application/pdf'
yield dict(name=data.get_text(), links=[dict(url=data.get_url(), media_type=media_type)])
def gen_action(self):
yield from self.Form(self)
def gen_identifiers(self):
"""Yield out the internal legistar bill id and guid found
in the detail page url.
"""
detail_url = self.chainmap['sources'][self.sources_note]
url = urlparse(detail_url)
for (idtype, ident) in parse_qsl(url.query):
if idtype == 'options' or ident == 'Advanced':
continue
yield dict(scheme='legistar_' + idtype.lower(), identifier=ident)
def get_legislative_session(self):
dates = []
labels = ('agenda', 'created')
for label in labels:
labeltext = self.get_label_text(label, skipitem=False)
if labeltext not in self.field_data.keys():
continue
if not self.field_data[labeltext]:
continue
data = self.field_data[labeltext][0]
fmt = self.get_config_value('datetime_format')
text = data.get_text()
if text is not None:
dt = datetime.strptime(text, fmt)
dt = self.cfg.datetime_add_tz(dt)
dates.append(dt)
(_, actions) = self.gen_action()
for action in actions:
dates.append(action['date'])
if dates:
return str(max(dates).year)
self.critical('Need session date.')
class Billsdetailtablerow(TableRow, FieldAggregator, DateGetter):
sources_node = 'bill action table'
disable_aggregator_funcs = True
text_fields = (('action_by', 'organization'), ('action', 'text'), 'version', 'result', 'journal_page')
def get_detail_viewtype(self):
return BillsDetailAction
def get_detail_url(self):
return self.get_media_url('action_details')
def get_date(self):
return self._get_date('date')
def _get_media(self, label):
"""Given a field label, get it's url (if any) and send a head
request to determine the content_type. Return a dict.
"""
data = self.get_field_data(label)
url = data.get_url()
if url is None:
raise self.SkipItem()
self.info('Sending HEAD request for %r' % url)
media_type = 'application/pdf'
return dict(name=data.get_text(), links=[dict(url=data.get_url(), media_type=media_type)])
@make_item('media', wrapwith=list)
def gen_media(self):
for label in self.get_config_value('pupa_media'):
try:
yield self._get_media(label)
except self.SkipItem:
continue
class Billsdetailaction(DetailView, ActionBase):
sources_note = 'bill action detail'
text_fields = ('file_number', 'type', 'title', 'mover', 'seconder', 'result', 'agenda_note', 'minutes_note', 'action', 'action_text')
@make_item('votes', wrapwith=list)
def gen_votes(self):
table_path = self.get_config_value('table_class')
table = resolve_name(table_path)
yield from self.make_child(Table, self)
@make_item('sources', wrapwith=list)
def gen_sources(self):
yield dict(url=self.url, note='action detail')
class Billsdetailactiontable(Table, ActionBase):
sources_note = 'bill action detail table'
def get_table_cell_type(self):
path = self.get_config_value('tablecell_class')
return resolve_name(path)
def get_table_row_type(self):
path = self.get_config_value('tablerow_class')
return resolve_name(path)
class Billsdetailactiontablerow(TableRow, ActionBase):
sources_node = 'bill action detail table'
text_fields = ('person', 'vote')
def _get_date(date):
if isinstance(date, datetime.datetime):
return date.strftime('%Y-%m-%d')
else:
return date
class Actionadapter(Adapter):
aliases = [('text', 'description')]
extras_keys = ['version', 'media', 'result']
drop_keys = ['sources', 'journal_page']
def get_date(self):
return _get_date(self.data['date'])
class Voteadapter(Adapter):
pupa_model = pupa.scrape.Vote
text_fields = ['organization']
aliases = [('text', 'motion_text')]
drop_keys = ['date']
extras_keys = ['version', 'media', 'journal_page']
def get_identifier(self):
"""The internal legistar bill id and guid found
in the detail page url.
"""
i = self.data.pop('i')
for source in self.data['sources']:
if not 'historydetail' in source['url'].lower():
continue
url = urlparse(source['url'])
ids = {}
for (idtype, ident) in parse_qsl(url.query):
if idtype == 'options':
continue
ids[idtype.lower()] = ident
return ids['guid']
for source in self.bill_adapter.data['identifiers']:
if source['scheme'] != 'legistar_guid':
continue
return '%s-vote%d' % (source['identifier'], i)
def get_date(self):
return _get_date(self.data.get('date'))
def get_result(self):
if not self.data['result']:
raise self.SkipItem()
result = self.get_vote_result(self.data['result'])
return result
def gen_votes(self):
for data in self.data['votes']:
if not data:
continue
res = {}
res['option'] = self.get_vote_option(data['vote'])
res['note'] = data['vote']
res['voter'] = data['person']
yield res
def get_instance(self, **extra_instance_data):
data = self.get_instance_data()
data.update(extra_instance_data)
motion_text = data['motion_text']
data['classification'] = self.classify_motion_text(motion_text)
if self.should_drop_organization(data):
data.pop('organization', None)
vote_data_list = data.pop('votes')
extras = data.pop('extras')
sources = data.pop('sources')
data.pop('i', None)
vote = self.pupa_model(**data)
counts = collections.Counter()
for vote_data in vote_data_list:
counts[vote_data['option']] += 1
vote.vote(**vote_data)
for (option, value) in counts.items():
vote.set_count(option, value)
for source in sources:
vote.add_source(**source)
vote.extras.update(extras)
if vote.result is None:
return
return vote
def get_vote_result(self, result):
"""Noramalizes the vote result value using the default values on
Config base, possibly overridded by jxn.BILL_VOTE_RESULT_MAP.
"""
result = result.replace('-', ' ').lower()
result = self.cfg._BILL_VOTE_RESULT_MAP[result]
return result
def get_vote_option(self, option_text):
"""Noramalizes the vote option value using the default values on
Config base, possibly overridded by jxn.BILL_VOTE_OPTION_MAP.
"""
option_text = option_text.replace('-', ' ').lower()
return self.cfg._BILL_VOTE_OPTION_MAP[option_text]
def should_drop_organization(self, data):
"""If this function returns True, the org is dropped from the vote obj.
XXX: Right now, always drops the org.
"""
return True
def classify_motion_text(self, motion_text):
"""Jurisdiction configs can override this to determine how
vote motions will be classified.
"""
return []
class Billsadapter(Adapter):
pupa_model = pupa.scrape.Bill
aliases = [('file_number', 'identifier')]
extras_keys = ['law_number', 'status']
def get_classn(self):
return self.get_bill_classification(self.data.pop('type'))
def gen_actions(self):
for data in self.data.get('actions'):
data = dict(data)
data.pop('votes')
action = self.make_child(ActionAdapter, data).get_instance_data()
if action['description'] is None:
action['description'] = ''
yield action
def get_sponsorships(self):
return self.data.get('sponsors', [])
def gen_votes(self):
for (i, data) in enumerate(self.data.get('actions')):
data['i'] = i
converter = self.make_child(VoteAdapter, data)
converter.bill_adapter = self
more_data = dict(legislative_session=self.data['legislative_session'])
vote = converter.get_instance(**more_data)
if vote is not None and vote.votes:
yield vote
def _gen_subjects(self, wrapwith=list):
yield from self.gen_subjects()
def get_instance(self):
"""Build a pupa instance from the data.
"""
data = self.get_instance_data()
data_copy = dict(data)
if self.should_drop_bill(data_copy):
return
bill = pupa.scrape.Bill(identifier=data['identifier'], legislative_session=data['legislative_session'], classification=data.get('classification', []), title=data['title'])
for action in data.pop('actions'):
action.pop('extras')
self.drop_action_organization(action)
bill.add_action(**action)
for sponsorship in data.pop('sponsorships'):
if not self.should_drop_sponsor(sponsorship):
kwargs = dict(classification=self.get_sponsor_classification(sponsorship), entity_type=self.get_sponsor_entity_type(sponsorship), primary=self.get_sponsor_primary(sponsorship))
kwargs.update(sponsorship)
bill.add_sponsorship(**kwargs)
for source in data.pop('sources'):
bill.add_source(**source)
bill.extras.update(data.pop('extras'))
for identifier in data.pop('identifiers'):
bill.add_identifier(**identifier)
if bill.title is None:
bill.title = ''
yield bill
for vote in data.pop('votes'):
vote.set_bill(bill)
self.vote_cache[vote.identifier] = vote
yield vote
@CachedAttr
def vote_cache(self):
"""So we don't dupe any votes. Maps identifier to vote obj.
"""
return {}
def should_drop_sponsor(self, data):
"""If this function retruns True, the sponsor is dropped.
"""
return False
def get_sponsor_classification(self, data):
"""Return the sponsor's pupa classification. Legistar generally
doesn't provide any info like this, so we just return "".
"""
return 'sponsor'
def get_sponsor_entity_type(self, data):
"""Return the sponsor's pupa entity type.
"""
return 'person'
def get_sponsor_primary(self, data):
"""Return whether the sponsor is primary. Legistar generally doesn't
provide this.
"""
return False
def drop_action_organization(self, data):
"""
XXX: This temporarily drops the action['organization'] from all
actions. See pupa issue #105 https://github.com/opencivicdata/pupa/issues/105/
When the organization is the top-level org, it doesn't get set
on the action.
"""
data.pop('organization', None)
def get_bill_classification(self, billtype):
"""Convert the legistar bill `type` column into
a pupa classification array.
"""
classn = getattr(self, '_BILL_CLASSIFICATIONS', {})
classn = dict(classn).get(billtype)
if classn is not None:
return [classn]
type_lower = billtype.lower()
for classn in dict(ocd_common.BILL_CLASSIFICATION_CHOICES):
if classn in type_lower:
return [classn]
return [] |
n = int(input())
alph = ["A",'B','C','D','E','F','G','H','I','J','K','L','M','N','O','P','Q','R','S','T','U','V','Q','X','Y','Z']
boxes = []
for x in range(n):
box = []
length = int(input())
for y in range(length):
box.append([])
for i in range(length):
box[y].append(".")
boxes.append(box)
letter = int((length - 1)/2)
for i in range(letter+1):
for x in range(length-(i*2)):
for y in range(length-(i*2)):
box[x+i][y+i] = alph[letter-i]
c = 0
for box in boxes:
c += 1
for x in box:
for y in x:
print(y, end="")
print()
if c < len(boxes):
print()
| n = int(input())
alph = ['A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M', 'N', 'O', 'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'Q', 'X', 'Y', 'Z']
boxes = []
for x in range(n):
box = []
length = int(input())
for y in range(length):
box.append([])
for i in range(length):
box[y].append('.')
boxes.append(box)
letter = int((length - 1) / 2)
for i in range(letter + 1):
for x in range(length - i * 2):
for y in range(length - i * 2):
box[x + i][y + i] = alph[letter - i]
c = 0
for box in boxes:
c += 1
for x in box:
for y in x:
print(y, end='')
print()
if c < len(boxes):
print() |
PROCESS_CREATE = 0
PROCESS_EDIT = 1
PROCESS_VIEW = 2
PROCESS_DELETE = 3
PROCESS_EDIT_DELETE = 4 # Edit with delete button
PROCESS_VIEW_EDIT = 5 # View with edit button
PERMISSION_DISABLE = 2
PERMISSION_ON = 1
PERMISSION_OFF = 0
PERMISSION_AUTHENTICATED = 3
PERMISSION_STAFF = 4
PERMISSION_METHOD = 5
class ProcessSetup:
def __init__(self, modal_title, django_permission, class_attribute, fallback):
self.modal_title = modal_title
self.django_permission = django_permission
self.class_attribute = class_attribute
self.fallback = fallback
process_data = {
PROCESS_CREATE: ProcessSetup('New', ['add'], 'permission_create', None),
PROCESS_EDIT: ProcessSetup('Edit', ['change'], 'permission_edit', PROCESS_VIEW),
PROCESS_VIEW: ProcessSetup('View', ['view'], 'permission_view', None),
PROCESS_DELETE: ProcessSetup('Delete', ['delete'], 'permission_delete', None),
PROCESS_EDIT_DELETE: ProcessSetup('Edit', ['delete', 'change'], 'permission_delete', PROCESS_EDIT),
PROCESS_VIEW_EDIT: ProcessSetup('View', ['change'], 'permission_edit', PROCESS_VIEW),
}
modal_url_type = {
'view': PROCESS_VIEW,
'viewedit': PROCESS_VIEW_EDIT,
'edit': PROCESS_EDIT,
'editdelete': PROCESS_EDIT_DELETE,
'delete': PROCESS_DELETE,
}
| process_create = 0
process_edit = 1
process_view = 2
process_delete = 3
process_edit_delete = 4
process_view_edit = 5
permission_disable = 2
permission_on = 1
permission_off = 0
permission_authenticated = 3
permission_staff = 4
permission_method = 5
class Processsetup:
def __init__(self, modal_title, django_permission, class_attribute, fallback):
self.modal_title = modal_title
self.django_permission = django_permission
self.class_attribute = class_attribute
self.fallback = fallback
process_data = {PROCESS_CREATE: process_setup('New', ['add'], 'permission_create', None), PROCESS_EDIT: process_setup('Edit', ['change'], 'permission_edit', PROCESS_VIEW), PROCESS_VIEW: process_setup('View', ['view'], 'permission_view', None), PROCESS_DELETE: process_setup('Delete', ['delete'], 'permission_delete', None), PROCESS_EDIT_DELETE: process_setup('Edit', ['delete', 'change'], 'permission_delete', PROCESS_EDIT), PROCESS_VIEW_EDIT: process_setup('View', ['change'], 'permission_edit', PROCESS_VIEW)}
modal_url_type = {'view': PROCESS_VIEW, 'viewedit': PROCESS_VIEW_EDIT, 'edit': PROCESS_EDIT, 'editdelete': PROCESS_EDIT_DELETE, 'delete': PROCESS_DELETE} |
# Copyright (c) 2020 Greg Dubicki
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
#
# See the License for the specific language governing permissions and
# limitations under the License.
#
# MIT License
#
# Copyright (c) 2018 Shane Wang
#
# Permission is hereby granted, free of charge, to any person obtaining a copy
# of this software and associated documentation files (the "Software"), to deal
# in the Software without restriction, including without limitation the rights
# to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
# copies of the Software, and to permit persons to whom the Software is
# furnished to do so, subject to the following conditions:
#
# The above copyright notice and this permission notice shall be included in all
# copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
# SOFTWARE.
# -*- coding: utf-8 -*-
class CacheNode(object):
def __init__(self, key, value, freq_node, pre, nxt):
self.key = key
self.value = value
self.freq_node = freq_node
self.pre = pre # previous CacheNode
self.nxt = nxt # next CacheNode
def free_myself(self):
if self.freq_node.cache_head == self.freq_node.cache_tail:
self.freq_node.cache_head = self.freq_node.cache_tail = None
elif self.freq_node.cache_head == self:
self.nxt.pre = None
self.freq_node.cache_head = self.nxt
elif self.freq_node.cache_tail == self:
self.pre.nxt = None
self.freq_node.cache_tail = self.pre
else:
self.pre.nxt = self.nxt
self.nxt.pre = self.pre
self.pre = None
self.nxt = None
self.freq_node = None
class FreqNode(object):
def __init__(self, freq, pre, nxt):
self.freq = freq
self.pre = pre # previous FreqNode
self.nxt = nxt # next FreqNode
self.cache_head = None # CacheNode head under this FreqNode
self.cache_tail = None # CacheNode tail under this FreqNode
def count_caches(self):
if self.cache_head is None and self.cache_tail is None:
return 0
elif self.cache_head == self.cache_tail:
return 1
else:
return "2+"
def remove(self):
if self.pre is not None:
self.pre.nxt = self.nxt
if self.nxt is not None:
self.nxt.pre = self.pre
pre = self.pre
nxt = self.nxt
self.pre = self.nxt = self.cache_head = self.cache_tail = None
return (pre, nxt)
def pop_head_cache(self):
if self.cache_head is None and self.cache_tail is None:
return None
elif self.cache_head == self.cache_tail:
cache_head = self.cache_head
self.cache_head = self.cache_tail = None
return cache_head
else:
cache_head = self.cache_head
self.cache_head.nxt.pre = None
self.cache_head = self.cache_head.nxt
return cache_head
def append_cache_to_tail(self, cache_node):
cache_node.freq_node = self
if self.cache_head is None and self.cache_tail is None:
self.cache_head = self.cache_tail = cache_node
else:
cache_node.pre = self.cache_tail
cache_node.nxt = None
self.cache_tail.nxt = cache_node
self.cache_tail = cache_node
def insert_after_me(self, freq_node):
freq_node.pre = self
freq_node.nxt = self.nxt
if self.nxt is not None:
self.nxt.pre = freq_node
self.nxt = freq_node
def insert_before_me(self, freq_node):
if self.pre is not None:
self.pre.nxt = freq_node
freq_node.pre = self.pre
freq_node.nxt = self
self.pre = freq_node
class LFUCache(object):
def __init__(self, capacity):
self.cache = {} # {key: cache_node}
self.capacity = capacity
self.freq_link_head = None
def get(self, key):
if key in self.cache:
cache_node = self.cache[key]
freq_node = cache_node.freq_node
value = cache_node.value
self.move_forward(cache_node, freq_node)
return value
else:
return -1
def set(self, key, value):
if self.capacity <= 0:
return -1
if key not in self.cache:
if len(self.cache) >= self.capacity:
self.dump_cache()
self.create_cache(key, value)
else:
cache_node = self.cache[key]
freq_node = cache_node.freq_node
cache_node.value = value
self.move_forward(cache_node, freq_node)
def move_forward(self, cache_node, freq_node):
if freq_node.nxt is None or freq_node.nxt.freq != freq_node.freq + 1:
target_freq_node = FreqNode(freq_node.freq + 1, None, None)
target_empty = True
else:
target_freq_node = freq_node.nxt
target_empty = False
cache_node.free_myself()
target_freq_node.append_cache_to_tail(cache_node)
if target_empty:
freq_node.insert_after_me(target_freq_node)
if freq_node.count_caches() == 0:
if self.freq_link_head == freq_node:
self.freq_link_head = target_freq_node
freq_node.remove()
def dump_cache(self):
head_freq_node = self.freq_link_head
# close the session when removing it from cache
session = self.cache.pop(head_freq_node.cache_head.key)
session.close()
head_freq_node.pop_head_cache()
if head_freq_node.count_caches() == 0:
self.freq_link_head = head_freq_node.nxt
head_freq_node.remove()
def create_cache(self, key, value):
cache_node = CacheNode(key, value, None, None, None)
self.cache[key] = cache_node
if self.freq_link_head is None or self.freq_link_head.freq != 0:
new_freq_node = FreqNode(0, None, None)
new_freq_node.append_cache_to_tail(cache_node)
if self.freq_link_head is not None:
self.freq_link_head.insert_before_me(new_freq_node)
self.freq_link_head = new_freq_node
else:
self.freq_link_head.append_cache_to_tail(cache_node)
| class Cachenode(object):
def __init__(self, key, value, freq_node, pre, nxt):
self.key = key
self.value = value
self.freq_node = freq_node
self.pre = pre
self.nxt = nxt
def free_myself(self):
if self.freq_node.cache_head == self.freq_node.cache_tail:
self.freq_node.cache_head = self.freq_node.cache_tail = None
elif self.freq_node.cache_head == self:
self.nxt.pre = None
self.freq_node.cache_head = self.nxt
elif self.freq_node.cache_tail == self:
self.pre.nxt = None
self.freq_node.cache_tail = self.pre
else:
self.pre.nxt = self.nxt
self.nxt.pre = self.pre
self.pre = None
self.nxt = None
self.freq_node = None
class Freqnode(object):
def __init__(self, freq, pre, nxt):
self.freq = freq
self.pre = pre
self.nxt = nxt
self.cache_head = None
self.cache_tail = None
def count_caches(self):
if self.cache_head is None and self.cache_tail is None:
return 0
elif self.cache_head == self.cache_tail:
return 1
else:
return '2+'
def remove(self):
if self.pre is not None:
self.pre.nxt = self.nxt
if self.nxt is not None:
self.nxt.pre = self.pre
pre = self.pre
nxt = self.nxt
self.pre = self.nxt = self.cache_head = self.cache_tail = None
return (pre, nxt)
def pop_head_cache(self):
if self.cache_head is None and self.cache_tail is None:
return None
elif self.cache_head == self.cache_tail:
cache_head = self.cache_head
self.cache_head = self.cache_tail = None
return cache_head
else:
cache_head = self.cache_head
self.cache_head.nxt.pre = None
self.cache_head = self.cache_head.nxt
return cache_head
def append_cache_to_tail(self, cache_node):
cache_node.freq_node = self
if self.cache_head is None and self.cache_tail is None:
self.cache_head = self.cache_tail = cache_node
else:
cache_node.pre = self.cache_tail
cache_node.nxt = None
self.cache_tail.nxt = cache_node
self.cache_tail = cache_node
def insert_after_me(self, freq_node):
freq_node.pre = self
freq_node.nxt = self.nxt
if self.nxt is not None:
self.nxt.pre = freq_node
self.nxt = freq_node
def insert_before_me(self, freq_node):
if self.pre is not None:
self.pre.nxt = freq_node
freq_node.pre = self.pre
freq_node.nxt = self
self.pre = freq_node
class Lfucache(object):
def __init__(self, capacity):
self.cache = {}
self.capacity = capacity
self.freq_link_head = None
def get(self, key):
if key in self.cache:
cache_node = self.cache[key]
freq_node = cache_node.freq_node
value = cache_node.value
self.move_forward(cache_node, freq_node)
return value
else:
return -1
def set(self, key, value):
if self.capacity <= 0:
return -1
if key not in self.cache:
if len(self.cache) >= self.capacity:
self.dump_cache()
self.create_cache(key, value)
else:
cache_node = self.cache[key]
freq_node = cache_node.freq_node
cache_node.value = value
self.move_forward(cache_node, freq_node)
def move_forward(self, cache_node, freq_node):
if freq_node.nxt is None or freq_node.nxt.freq != freq_node.freq + 1:
target_freq_node = freq_node(freq_node.freq + 1, None, None)
target_empty = True
else:
target_freq_node = freq_node.nxt
target_empty = False
cache_node.free_myself()
target_freq_node.append_cache_to_tail(cache_node)
if target_empty:
freq_node.insert_after_me(target_freq_node)
if freq_node.count_caches() == 0:
if self.freq_link_head == freq_node:
self.freq_link_head = target_freq_node
freq_node.remove()
def dump_cache(self):
head_freq_node = self.freq_link_head
session = self.cache.pop(head_freq_node.cache_head.key)
session.close()
head_freq_node.pop_head_cache()
if head_freq_node.count_caches() == 0:
self.freq_link_head = head_freq_node.nxt
head_freq_node.remove()
def create_cache(self, key, value):
cache_node = cache_node(key, value, None, None, None)
self.cache[key] = cache_node
if self.freq_link_head is None or self.freq_link_head.freq != 0:
new_freq_node = freq_node(0, None, None)
new_freq_node.append_cache_to_tail(cache_node)
if self.freq_link_head is not None:
self.freq_link_head.insert_before_me(new_freq_node)
self.freq_link_head = new_freq_node
else:
self.freq_link_head.append_cache_to_tail(cache_node) |
def solution(clothes):
answer = {}
for i in clothes:
if i[1] in answer: answer[i[1]]+=1
else: answer[i[1]] = 1
cnt = 1
for i in answer.values():
cnt *= (i+1)
return cnt - 1 | def solution(clothes):
answer = {}
for i in clothes:
if i[1] in answer:
answer[i[1]] += 1
else:
answer[i[1]] = 1
cnt = 1
for i in answer.values():
cnt *= i + 1
return cnt - 1 |
# Request Link and Long Polling Use
TELEGRAM_TOKEN = ''
WEBHOOK_URL = ''
TELEGRAM_BASE = f'https://api.telegram.org/bot{TELEGRAM_TOKEN}'
TELEGRAM_WEBHOOK_URL = TELEGRAM_BASE + f'/setWebhook?url={WEBHOOK_URL}/hook'
FUGLE_API_TOKEN = ''
# Other Chatbot Token
EXAMPLE_TOKEN = ''
# WEBHOOK_URL = ''
| telegram_token = ''
webhook_url = ''
telegram_base = f'https://api.telegram.org/bot{TELEGRAM_TOKEN}'
telegram_webhook_url = TELEGRAM_BASE + f'/setWebhook?url={WEBHOOK_URL}/hook'
fugle_api_token = ''
example_token = '' |
# Speed Fine Problem
# input
limit = int(input('Enter the speed limit: '))
speed = int(input('Enter the recorded speed of the car: '))
# processing & output
if speed <= limit:
print('Congratulations, you are within the speed limit!')
else:
difference = speed - limit
if difference > 30:
print('You are speeding and your fine is $500.')
elif difference > 20:
print('You are speeding and your fine is $270.')
else:
print('You are speeding and your fine is $100.') | limit = int(input('Enter the speed limit: '))
speed = int(input('Enter the recorded speed of the car: '))
if speed <= limit:
print('Congratulations, you are within the speed limit!')
else:
difference = speed - limit
if difference > 30:
print('You are speeding and your fine is $500.')
elif difference > 20:
print('You are speeding and your fine is $270.')
else:
print('You are speeding and your fine is $100.') |
#
# PySNMP MIB module DEVICE (http://snmplabs.com/pysmi)
# ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/DEVICE
# Produced by pysmi-0.3.4 at Mon Apr 29 18:26:39 2019
# On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4
# Using Python version 3.7.3 (default, Mar 27 2019, 09:23:15)
#
ObjectIdentifier, OctetString, Integer = mibBuilder.importSymbols("ASN1", "ObjectIdentifier", "OctetString", "Integer")
NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues")
ValueRangeConstraint, ValueSizeConstraint, SingleValueConstraint, ConstraintsUnion, ConstraintsIntersection = mibBuilder.importSymbols("ASN1-REFINEMENT", "ValueRangeConstraint", "ValueSizeConstraint", "SingleValueConstraint", "ConstraintsUnion", "ConstraintsIntersection")
ObjectGroup, ModuleCompliance, NotificationGroup = mibBuilder.importSymbols("SNMPv2-CONF", "ObjectGroup", "ModuleCompliance", "NotificationGroup")
IpAddress, Unsigned32, ObjectIdentity, iso, ModuleIdentity, Counter64, MibScalar, MibTable, MibTableRow, MibTableColumn, Bits, MibIdentifier, NotificationType, Integer32, enterprises, Counter32, Gauge32, TimeTicks = mibBuilder.importSymbols("SNMPv2-SMI", "IpAddress", "Unsigned32", "ObjectIdentity", "iso", "ModuleIdentity", "Counter64", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "Bits", "MibIdentifier", "NotificationType", "Integer32", "enterprises", "Counter32", "Gauge32", "TimeTicks")
DisplayString, MacAddress, RowStatus, TruthValue, TextualConvention = mibBuilder.importSymbols("SNMPv2-TC", "DisplayString", "MacAddress", "RowStatus", "TruthValue", "TextualConvention")
pepwave = MibIdentifier((1, 3, 6, 1, 4, 1, 27662))
productMib = MibIdentifier((1, 3, 6, 1, 4, 1, 27662, 200))
generalMib = MibIdentifier((1, 3, 6, 1, 4, 1, 27662, 200, 1))
deviceMib = MibIdentifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1))
deviceInfo = ModuleIdentity((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1))
if mibBuilder.loadTexts: deviceInfo.setLastUpdated('201305210000Z')
if mibBuilder.loadTexts: deviceInfo.setOrganization('PEPWAVE')
deviceInfoSystem = MibIdentifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1))
deviceModel = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1, 1), OctetString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceModel.setStatus('current')
deviceSerialNumber = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1, 2), OctetString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceSerialNumber.setStatus('current')
deviceFirmwareVersion = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1, 3), OctetString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceFirmwareVersion.setStatus('current')
deviceInfoTime = MibIdentifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 2))
deviceSystemTime = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 2, 1), OctetString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceSystemTime.setStatus('current')
deviceSystemUpTime = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 2, 2), OctetString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceSystemUpTime.setStatus('current')
deviceInfoUsage = MibIdentifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3))
deviceCpuLoad = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 100))).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceCpuLoad.setStatus('current')
deviceTotalMemory = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3, 2), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceTotalMemory.setStatus('current')
deviceMemoryUsage = MibScalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3, 3), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: deviceMemoryUsage.setStatus('current')
mibBuilder.exportSymbols("DEVICE", deviceInfoTime=deviceInfoTime, deviceCpuLoad=deviceCpuLoad, deviceSerialNumber=deviceSerialNumber, deviceInfoSystem=deviceInfoSystem, pepwave=pepwave, deviceInfo=deviceInfo, deviceModel=deviceModel, deviceFirmwareVersion=deviceFirmwareVersion, deviceTotalMemory=deviceTotalMemory, PYSNMP_MODULE_ID=deviceInfo, productMib=productMib, deviceSystemTime=deviceSystemTime, deviceInfoUsage=deviceInfoUsage, generalMib=generalMib, deviceSystemUpTime=deviceSystemUpTime, deviceMib=deviceMib, deviceMemoryUsage=deviceMemoryUsage)
| (object_identifier, octet_string, integer) = mibBuilder.importSymbols('ASN1', 'ObjectIdentifier', 'OctetString', 'Integer')
(named_values,) = mibBuilder.importSymbols('ASN1-ENUMERATION', 'NamedValues')
(value_range_constraint, value_size_constraint, single_value_constraint, constraints_union, constraints_intersection) = mibBuilder.importSymbols('ASN1-REFINEMENT', 'ValueRangeConstraint', 'ValueSizeConstraint', 'SingleValueConstraint', 'ConstraintsUnion', 'ConstraintsIntersection')
(object_group, module_compliance, notification_group) = mibBuilder.importSymbols('SNMPv2-CONF', 'ObjectGroup', 'ModuleCompliance', 'NotificationGroup')
(ip_address, unsigned32, object_identity, iso, module_identity, counter64, mib_scalar, mib_table, mib_table_row, mib_table_column, bits, mib_identifier, notification_type, integer32, enterprises, counter32, gauge32, time_ticks) = mibBuilder.importSymbols('SNMPv2-SMI', 'IpAddress', 'Unsigned32', 'ObjectIdentity', 'iso', 'ModuleIdentity', 'Counter64', 'MibScalar', 'MibTable', 'MibTableRow', 'MibTableColumn', 'Bits', 'MibIdentifier', 'NotificationType', 'Integer32', 'enterprises', 'Counter32', 'Gauge32', 'TimeTicks')
(display_string, mac_address, row_status, truth_value, textual_convention) = mibBuilder.importSymbols('SNMPv2-TC', 'DisplayString', 'MacAddress', 'RowStatus', 'TruthValue', 'TextualConvention')
pepwave = mib_identifier((1, 3, 6, 1, 4, 1, 27662))
product_mib = mib_identifier((1, 3, 6, 1, 4, 1, 27662, 200))
general_mib = mib_identifier((1, 3, 6, 1, 4, 1, 27662, 200, 1))
device_mib = mib_identifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1))
device_info = module_identity((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1))
if mibBuilder.loadTexts:
deviceInfo.setLastUpdated('201305210000Z')
if mibBuilder.loadTexts:
deviceInfo.setOrganization('PEPWAVE')
device_info_system = mib_identifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1))
device_model = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1, 1), octet_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceModel.setStatus('current')
device_serial_number = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1, 2), octet_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceSerialNumber.setStatus('current')
device_firmware_version = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 1, 3), octet_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceFirmwareVersion.setStatus('current')
device_info_time = mib_identifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 2))
device_system_time = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 2, 1), octet_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceSystemTime.setStatus('current')
device_system_up_time = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 2, 2), octet_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceSystemUpTime.setStatus('current')
device_info_usage = mib_identifier((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3))
device_cpu_load = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 100))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceCpuLoad.setStatus('current')
device_total_memory = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3, 2), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceTotalMemory.setStatus('current')
device_memory_usage = mib_scalar((1, 3, 6, 1, 4, 1, 27662, 200, 1, 1, 1, 3, 3), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
deviceMemoryUsage.setStatus('current')
mibBuilder.exportSymbols('DEVICE', deviceInfoTime=deviceInfoTime, deviceCpuLoad=deviceCpuLoad, deviceSerialNumber=deviceSerialNumber, deviceInfoSystem=deviceInfoSystem, pepwave=pepwave, deviceInfo=deviceInfo, deviceModel=deviceModel, deviceFirmwareVersion=deviceFirmwareVersion, deviceTotalMemory=deviceTotalMemory, PYSNMP_MODULE_ID=deviceInfo, productMib=productMib, deviceSystemTime=deviceSystemTime, deviceInfoUsage=deviceInfoUsage, generalMib=generalMib, deviceSystemUpTime=deviceSystemUpTime, deviceMib=deviceMib, deviceMemoryUsage=deviceMemoryUsage) |
# Question
# 17. Write a menu driven program to find the area of circle, square, rectangle & triangle.
# Code
types = ["circle", "square", "rectangle", "triangle"]
print("-"*15) # 15 is length of Area Calculator. not intentional though it was a random rumber
print("Area Calculator")
print("-"*15)
print()
print("Please enter the following numbers according to the shape you want to calculate the area of.")
print()
for i, type in enumerate(types): print(i, ":", types[i])
print()
shape = int(input())
if types[shape] == "circle":
r = float(input("Randius:\n"))
print("Area:", 22 / 7 * r * r)
elif types[shape] == "square":
a = float(input("Side length pls:\n"))
print("Area:", a**2)
elif types[shape] == "rectangle":
s1 = float(input("Side 1:\n"))
s2 = float(input("Side 2:\n"))
print("Area:",s1*s2)
elif types[shape] == "triangle":
s1 = float(input("Side 1:\n"))
s2 = float(input("Side 2:\n"))
s3 = float(input("Side 3:\n"))
s = (s1 + s2 + s3) / 2
print(s)
print(s * (s-s1) * (s-s2) * (s-s3) )
print("Area:", ( s * (s-s1) * (s-s2) * (s-s3) ) ** 0.5 )
# Output
#
# ---------------
# Area Calculator
# ---------------
#
# Please enter the following numbers according to the shape you want to calculate the area of.
#
# 0 : circle
# 1 : square
# 2 : rectangle
# 3 : triangle
#
# 3
# Side 1:
# 5
# Side 2:
# 5
# Side 3:
# 3
# 6.5
# 51.1875
# Area: 7.1545440106270926
# Additional Comments:
# None | types = ['circle', 'square', 'rectangle', 'triangle']
print('-' * 15)
print('Area Calculator')
print('-' * 15)
print()
print('Please enter the following numbers according to the shape you want to calculate the area of.')
print()
for (i, type) in enumerate(types):
print(i, ':', types[i])
print()
shape = int(input())
if types[shape] == 'circle':
r = float(input('Randius:\n'))
print('Area:', 22 / 7 * r * r)
elif types[shape] == 'square':
a = float(input('Side length pls:\n'))
print('Area:', a ** 2)
elif types[shape] == 'rectangle':
s1 = float(input('Side 1:\n'))
s2 = float(input('Side 2:\n'))
print('Area:', s1 * s2)
elif types[shape] == 'triangle':
s1 = float(input('Side 1:\n'))
s2 = float(input('Side 2:\n'))
s3 = float(input('Side 3:\n'))
s = (s1 + s2 + s3) / 2
print(s)
print(s * (s - s1) * (s - s2) * (s - s3))
print('Area:', (s * (s - s1) * (s - s2) * (s - s3)) ** 0.5) |
#######################
# Login configuration #
#######################
weblab_db_username = 'weblab'
weblab_db_password = 'weblab'
########################################
# User Processing Server configuration #
########################################
core_session_type = 'Memory'
core_coordinator_db_username = 'weblab'
core_coordinator_db_password = 'weblab'
core_coordinator_laboratory_servers = {
"laboratory:lab_and_experiment1@main_machine" : {
"exp1|ud-dummy|Dummy experiments" : "dummy1@ud-dummy",
"exp2|ud-dummy|Dummy experiments" : "dummy2@ud-dummy",
"exp3|ud-dummy|Dummy experiments" : "dummy3@ud-dummy",
"exp4|ud-dummy|Dummy experiments" : "dummy4@ud-dummy",
"exp5|ud-dummy|Dummy experiments" : "dummy5@ud-dummy",
"exp6|ud-dummy|Dummy experiments" : "dummy6@ud-dummy",
"exp7|ud-dummy|Dummy experiments" : "dummy7@ud-dummy",
"exp8|ud-dummy|Dummy experiments" : "dummy8@ud-dummy",
"exp9|ud-dummy|Dummy experiments" : "dummy9@ud-dummy",
"exp10|ud-dummy|Dummy experiments" : "dummy10@ud-dummy",
"exp11|ud-dummy|Dummy experiments" : "dummy11@ud-dummy",
"exp12|ud-dummy|Dummy experiments" : "dummy12@ud-dummy",
"exp13|ud-dummy|Dummy experiments" : "dummy13@ud-dummy",
"exp14|ud-dummy|Dummy experiments" : "dummy14@ud-dummy",
"exp15|ud-dummy|Dummy experiments" : "dummy15@ud-dummy",
"exp16|ud-dummy|Dummy experiments" : "dummy16@ud-dummy",
"exp17|ud-dummy|Dummy experiments" : "dummy17@ud-dummy",
"exp18|ud-dummy|Dummy experiments" : "dummy18@ud-dummy",
"exp19|ud-dummy|Dummy experiments" : "dummy19@ud-dummy",
"exp20|ud-dummy|Dummy experiments" : "dummy20@ud-dummy",
"exp21|ud-dummy|Dummy experiments" : "dummy21@ud-dummy",
"exp22|ud-dummy|Dummy experiments" : "dummy22@ud-dummy",
"exp23|ud-dummy|Dummy experiments" : "dummy23@ud-dummy",
"exp24|ud-dummy|Dummy experiments" : "dummy24@ud-dummy",
"exp25|ud-dummy|Dummy experiments" : "dummy25@ud-dummy",
"exp26|ud-dummy|Dummy experiments" : "dummy26@ud-dummy",
"exp27|ud-dummy|Dummy experiments" : "dummy27@ud-dummy",
"exp28|ud-dummy|Dummy experiments" : "dummy28@ud-dummy",
"exp29|ud-dummy|Dummy experiments" : "dummy29@ud-dummy",
"exp30|ud-dummy|Dummy experiments" : "dummy30@ud-dummy",
"exp31|ud-dummy|Dummy experiments" : "dummy31@ud-dummy",
"exp32|ud-dummy|Dummy experiments" : "dummy32@ud-dummy",
"exp33|ud-dummy|Dummy experiments" : "dummy33@ud-dummy",
"exp34|ud-dummy|Dummy experiments" : "dummy34@ud-dummy",
"exp35|ud-dummy|Dummy experiments" : "dummy35@ud-dummy",
"exp36|ud-dummy|Dummy experiments" : "dummy36@ud-dummy",
"exp37|ud-dummy|Dummy experiments" : "dummy37@ud-dummy",
"exp38|ud-dummy|Dummy experiments" : "dummy38@ud-dummy",
"exp39|ud-dummy|Dummy experiments" : "dummy39@ud-dummy",
"exp40|ud-dummy|Dummy experiments" : "dummy40@ud-dummy",
},
"laboratory:lab_and_experiment2@main_machine" : {
"exp41|ud-dummy|Dummy experiments" : "dummy41@ud-dummy",
"exp42|ud-dummy|Dummy experiments" : "dummy42@ud-dummy",
"exp43|ud-dummy|Dummy experiments" : "dummy43@ud-dummy",
"exp44|ud-dummy|Dummy experiments" : "dummy44@ud-dummy",
"exp45|ud-dummy|Dummy experiments" : "dummy45@ud-dummy",
"exp46|ud-dummy|Dummy experiments" : "dummy46@ud-dummy",
"exp47|ud-dummy|Dummy experiments" : "dummy47@ud-dummy",
"exp48|ud-dummy|Dummy experiments" : "dummy48@ud-dummy",
"exp49|ud-dummy|Dummy experiments" : "dummy49@ud-dummy",
"exp50|ud-dummy|Dummy experiments" : "dummy50@ud-dummy",
"exp51|ud-dummy|Dummy experiments" : "dummy51@ud-dummy",
"exp52|ud-dummy|Dummy experiments" : "dummy52@ud-dummy",
"exp53|ud-dummy|Dummy experiments" : "dummy53@ud-dummy",
"exp54|ud-dummy|Dummy experiments" : "dummy54@ud-dummy",
"exp55|ud-dummy|Dummy experiments" : "dummy55@ud-dummy",
"exp56|ud-dummy|Dummy experiments" : "dummy56@ud-dummy",
"exp57|ud-dummy|Dummy experiments" : "dummy57@ud-dummy",
"exp58|ud-dummy|Dummy experiments" : "dummy58@ud-dummy",
"exp59|ud-dummy|Dummy experiments" : "dummy59@ud-dummy",
"exp60|ud-dummy|Dummy experiments" : "dummy60@ud-dummy",
"exp61|ud-dummy|Dummy experiments" : "dummy61@ud-dummy",
"exp62|ud-dummy|Dummy experiments" : "dummy62@ud-dummy",
"exp63|ud-dummy|Dummy experiments" : "dummy63@ud-dummy",
"exp64|ud-dummy|Dummy experiments" : "dummy64@ud-dummy",
"exp65|ud-dummy|Dummy experiments" : "dummy65@ud-dummy",
"exp66|ud-dummy|Dummy experiments" : "dummy66@ud-dummy",
"exp67|ud-dummy|Dummy experiments" : "dummy67@ud-dummy",
"exp68|ud-dummy|Dummy experiments" : "dummy68@ud-dummy",
"exp69|ud-dummy|Dummy experiments" : "dummy69@ud-dummy",
"exp70|ud-dummy|Dummy experiments" : "dummy70@ud-dummy",
"exp71|ud-dummy|Dummy experiments" : "dummy71@ud-dummy",
"exp72|ud-dummy|Dummy experiments" : "dummy72@ud-dummy",
"exp73|ud-dummy|Dummy experiments" : "dummy73@ud-dummy",
"exp74|ud-dummy|Dummy experiments" : "dummy74@ud-dummy",
"exp75|ud-dummy|Dummy experiments" : "dummy75@ud-dummy",
"exp76|ud-dummy|Dummy experiments" : "dummy76@ud-dummy",
"exp77|ud-dummy|Dummy experiments" : "dummy77@ud-dummy",
"exp78|ud-dummy|Dummy experiments" : "dummy78@ud-dummy",
"exp79|ud-dummy|Dummy experiments" : "dummy79@ud-dummy",
"exp80|ud-dummy|Dummy experiments" : "dummy80@ud-dummy",
}
}
core_scheduling_systems = {
"ud-dummy" : ("PRIORITY_QUEUE", {}),
}
##########################
# Database configuration #
##########################
db_host = "localhost"
db_database = "WebLabTests"
core_universal_identifier = 'da2579d6-e3b2-11e0-a66a-00216a5807c8'
core_universal_identifier_human = 'server X at Sample University'
core_server_url = 'http://localhost/weblab/'
| weblab_db_username = 'weblab'
weblab_db_password = 'weblab'
core_session_type = 'Memory'
core_coordinator_db_username = 'weblab'
core_coordinator_db_password = 'weblab'
core_coordinator_laboratory_servers = {'laboratory:lab_and_experiment1@main_machine': {'exp1|ud-dummy|Dummy experiments': 'dummy1@ud-dummy', 'exp2|ud-dummy|Dummy experiments': 'dummy2@ud-dummy', 'exp3|ud-dummy|Dummy experiments': 'dummy3@ud-dummy', 'exp4|ud-dummy|Dummy experiments': 'dummy4@ud-dummy', 'exp5|ud-dummy|Dummy experiments': 'dummy5@ud-dummy', 'exp6|ud-dummy|Dummy experiments': 'dummy6@ud-dummy', 'exp7|ud-dummy|Dummy experiments': 'dummy7@ud-dummy', 'exp8|ud-dummy|Dummy experiments': 'dummy8@ud-dummy', 'exp9|ud-dummy|Dummy experiments': 'dummy9@ud-dummy', 'exp10|ud-dummy|Dummy experiments': 'dummy10@ud-dummy', 'exp11|ud-dummy|Dummy experiments': 'dummy11@ud-dummy', 'exp12|ud-dummy|Dummy experiments': 'dummy12@ud-dummy', 'exp13|ud-dummy|Dummy experiments': 'dummy13@ud-dummy', 'exp14|ud-dummy|Dummy experiments': 'dummy14@ud-dummy', 'exp15|ud-dummy|Dummy experiments': 'dummy15@ud-dummy', 'exp16|ud-dummy|Dummy experiments': 'dummy16@ud-dummy', 'exp17|ud-dummy|Dummy experiments': 'dummy17@ud-dummy', 'exp18|ud-dummy|Dummy experiments': 'dummy18@ud-dummy', 'exp19|ud-dummy|Dummy experiments': 'dummy19@ud-dummy', 'exp20|ud-dummy|Dummy experiments': 'dummy20@ud-dummy', 'exp21|ud-dummy|Dummy experiments': 'dummy21@ud-dummy', 'exp22|ud-dummy|Dummy experiments': 'dummy22@ud-dummy', 'exp23|ud-dummy|Dummy experiments': 'dummy23@ud-dummy', 'exp24|ud-dummy|Dummy experiments': 'dummy24@ud-dummy', 'exp25|ud-dummy|Dummy experiments': 'dummy25@ud-dummy', 'exp26|ud-dummy|Dummy experiments': 'dummy26@ud-dummy', 'exp27|ud-dummy|Dummy experiments': 'dummy27@ud-dummy', 'exp28|ud-dummy|Dummy experiments': 'dummy28@ud-dummy', 'exp29|ud-dummy|Dummy experiments': 'dummy29@ud-dummy', 'exp30|ud-dummy|Dummy experiments': 'dummy30@ud-dummy', 'exp31|ud-dummy|Dummy experiments': 'dummy31@ud-dummy', 'exp32|ud-dummy|Dummy experiments': 'dummy32@ud-dummy', 'exp33|ud-dummy|Dummy experiments': 'dummy33@ud-dummy', 'exp34|ud-dummy|Dummy experiments': 'dummy34@ud-dummy', 'exp35|ud-dummy|Dummy experiments': 'dummy35@ud-dummy', 'exp36|ud-dummy|Dummy experiments': 'dummy36@ud-dummy', 'exp37|ud-dummy|Dummy experiments': 'dummy37@ud-dummy', 'exp38|ud-dummy|Dummy experiments': 'dummy38@ud-dummy', 'exp39|ud-dummy|Dummy experiments': 'dummy39@ud-dummy', 'exp40|ud-dummy|Dummy experiments': 'dummy40@ud-dummy'}, 'laboratory:lab_and_experiment2@main_machine': {'exp41|ud-dummy|Dummy experiments': 'dummy41@ud-dummy', 'exp42|ud-dummy|Dummy experiments': 'dummy42@ud-dummy', 'exp43|ud-dummy|Dummy experiments': 'dummy43@ud-dummy', 'exp44|ud-dummy|Dummy experiments': 'dummy44@ud-dummy', 'exp45|ud-dummy|Dummy experiments': 'dummy45@ud-dummy', 'exp46|ud-dummy|Dummy experiments': 'dummy46@ud-dummy', 'exp47|ud-dummy|Dummy experiments': 'dummy47@ud-dummy', 'exp48|ud-dummy|Dummy experiments': 'dummy48@ud-dummy', 'exp49|ud-dummy|Dummy experiments': 'dummy49@ud-dummy', 'exp50|ud-dummy|Dummy experiments': 'dummy50@ud-dummy', 'exp51|ud-dummy|Dummy experiments': 'dummy51@ud-dummy', 'exp52|ud-dummy|Dummy experiments': 'dummy52@ud-dummy', 'exp53|ud-dummy|Dummy experiments': 'dummy53@ud-dummy', 'exp54|ud-dummy|Dummy experiments': 'dummy54@ud-dummy', 'exp55|ud-dummy|Dummy experiments': 'dummy55@ud-dummy', 'exp56|ud-dummy|Dummy experiments': 'dummy56@ud-dummy', 'exp57|ud-dummy|Dummy experiments': 'dummy57@ud-dummy', 'exp58|ud-dummy|Dummy experiments': 'dummy58@ud-dummy', 'exp59|ud-dummy|Dummy experiments': 'dummy59@ud-dummy', 'exp60|ud-dummy|Dummy experiments': 'dummy60@ud-dummy', 'exp61|ud-dummy|Dummy experiments': 'dummy61@ud-dummy', 'exp62|ud-dummy|Dummy experiments': 'dummy62@ud-dummy', 'exp63|ud-dummy|Dummy experiments': 'dummy63@ud-dummy', 'exp64|ud-dummy|Dummy experiments': 'dummy64@ud-dummy', 'exp65|ud-dummy|Dummy experiments': 'dummy65@ud-dummy', 'exp66|ud-dummy|Dummy experiments': 'dummy66@ud-dummy', 'exp67|ud-dummy|Dummy experiments': 'dummy67@ud-dummy', 'exp68|ud-dummy|Dummy experiments': 'dummy68@ud-dummy', 'exp69|ud-dummy|Dummy experiments': 'dummy69@ud-dummy', 'exp70|ud-dummy|Dummy experiments': 'dummy70@ud-dummy', 'exp71|ud-dummy|Dummy experiments': 'dummy71@ud-dummy', 'exp72|ud-dummy|Dummy experiments': 'dummy72@ud-dummy', 'exp73|ud-dummy|Dummy experiments': 'dummy73@ud-dummy', 'exp74|ud-dummy|Dummy experiments': 'dummy74@ud-dummy', 'exp75|ud-dummy|Dummy experiments': 'dummy75@ud-dummy', 'exp76|ud-dummy|Dummy experiments': 'dummy76@ud-dummy', 'exp77|ud-dummy|Dummy experiments': 'dummy77@ud-dummy', 'exp78|ud-dummy|Dummy experiments': 'dummy78@ud-dummy', 'exp79|ud-dummy|Dummy experiments': 'dummy79@ud-dummy', 'exp80|ud-dummy|Dummy experiments': 'dummy80@ud-dummy'}}
core_scheduling_systems = {'ud-dummy': ('PRIORITY_QUEUE', {})}
db_host = 'localhost'
db_database = 'WebLabTests'
core_universal_identifier = 'da2579d6-e3b2-11e0-a66a-00216a5807c8'
core_universal_identifier_human = 'server X at Sample University'
core_server_url = 'http://localhost/weblab/' |
# DomirScire
def get_final_line(filename):
final_line = ''
for current_line in open(filename):
final_line = current_line
return final_line
if __name__ == "__main__":
print(get_final_line('./'))
| def get_final_line(filename):
final_line = ''
for current_line in open(filename):
final_line = current_line
return final_line
if __name__ == '__main__':
print(get_final_line('./')) |
class Solution:
def makeString(self, s: str) -> str:
result = []
for c in s:
if c != '#':
result.append(c)
elif len(result) > 0:
result.pop()
return str(result)
def backspaceCompare(self, s: str, t: str) -> bool:
return self.makeString(s) == self.makeString(t)
s = Solution()
print(s.backspaceCompare("ab#c", "ad#c"))
print(s.backspaceCompare("ab##", "c#d#"))
print(s.backspaceCompare("a##c", "#a#c"))
print(s.backspaceCompare("a#c", "b"))
| class Solution:
def make_string(self, s: str) -> str:
result = []
for c in s:
if c != '#':
result.append(c)
elif len(result) > 0:
result.pop()
return str(result)
def backspace_compare(self, s: str, t: str) -> bool:
return self.makeString(s) == self.makeString(t)
s = solution()
print(s.backspaceCompare('ab#c', 'ad#c'))
print(s.backspaceCompare('ab##', 'c#d#'))
print(s.backspaceCompare('a##c', '#a#c'))
print(s.backspaceCompare('a#c', 'b')) |
# Get frequencies of attributes
def get_frequencies(plant_dict):
frequencies = {} # First keep count of how many times an attribute appears
count = 0 # Keep track of the number of plants
for plant in plant_dict:
plant_attributes = set() # Don't count duplicate attributes (such as a flower having 2 colors)
plant_tuples = plant_dict[plant]
for tup in plant_tuples:
attribute = tup[0]
if attribute in plant_attributes:
continue
if attribute not in frequencies:
frequencies[attribute] = 1
else:
frequencies[attribute] += 1
plant_attributes.add(attribute)
count += 1
# Then divide by count to get a percentage
for attribute in frequencies:
frequencies[attribute] /= float(count)/100
return frequencies
# Nicely print the attribute frequencies
def print_frequencies(frequencies):
for k, v in frequencies.items():
print("{}: {}%".format(k, str(v)))
# Print the attributes for each plant
def print_attributes(plant_dict):
for plant in plant_dict:
print("{} has the following features:".format(plant))
for t in plant_dict[plant]:
print(t)
print('')
| def get_frequencies(plant_dict):
frequencies = {}
count = 0
for plant in plant_dict:
plant_attributes = set()
plant_tuples = plant_dict[plant]
for tup in plant_tuples:
attribute = tup[0]
if attribute in plant_attributes:
continue
if attribute not in frequencies:
frequencies[attribute] = 1
else:
frequencies[attribute] += 1
plant_attributes.add(attribute)
count += 1
for attribute in frequencies:
frequencies[attribute] /= float(count) / 100
return frequencies
def print_frequencies(frequencies):
for (k, v) in frequencies.items():
print('{}: {}%'.format(k, str(v)))
def print_attributes(plant_dict):
for plant in plant_dict:
print('{} has the following features:'.format(plant))
for t in plant_dict[plant]:
print(t)
print('') |
squares = []
for value in range(1,11):
squares.append(value **2)
print(squares)
digits = [1, 2, 3, 4, 5, 6, 7, 8, 9, 0]
print(min(digits))
print(max(digits))
print(sum(digits))
squares = [value**2 for value in range(1,11)]
print(squares)
odd_numbers = list(range(1,20,1))
print(odd_numbers)
cars = ['audi', 'bmw', 'subaru', 'toyota']
for car in cars:
if car == 'bmw':
print(car.upper())
else:
print(car.title())
| squares = []
for value in range(1, 11):
squares.append(value ** 2)
print(squares)
digits = [1, 2, 3, 4, 5, 6, 7, 8, 9, 0]
print(min(digits))
print(max(digits))
print(sum(digits))
squares = [value ** 2 for value in range(1, 11)]
print(squares)
odd_numbers = list(range(1, 20, 1))
print(odd_numbers)
cars = ['audi', 'bmw', 'subaru', 'toyota']
for car in cars:
if car == 'bmw':
print(car.upper())
else:
print(car.title()) |
# Stub only, D support was broken with Python2.6 and unnecessary to Nuitka
def generate(env):
return
def exists(env):
return False
| def generate(env):
return
def exists(env):
return False |
class Base:
def __init__(self, x=0):
self.x = x
class Slave(Base):
def __init__(self, x):
super(Slave, self).__init__()
self.x = x
s1 = Slave(x=2)
print(s1.x) | class Base:
def __init__(self, x=0):
self.x = x
class Slave(Base):
def __init__(self, x):
super(Slave, self).__init__()
self.x = x
s1 = slave(x=2)
print(s1.x) |
def strStr(haystack: str, needle: str) -> int:
i = 0
j = 0
len1 = len(haystack)
len2 = len(needle)
while i < len1 and j < len2:
if haystack[i] == needle[j]:
i += 1
j += 1
else:
i = i - (j - 1)
j = 0
if j == len2:
return i-j
else:
return -1
print(strStr("abcdeabc", "bcd")) | def str_str(haystack: str, needle: str) -> int:
i = 0
j = 0
len1 = len(haystack)
len2 = len(needle)
while i < len1 and j < len2:
if haystack[i] == needle[j]:
i += 1
j += 1
else:
i = i - (j - 1)
j = 0
if j == len2:
return i - j
else:
return -1
print(str_str('abcdeabc', 'bcd')) |
'''
Program to count number of trees in a forest.
Approach:
The idea is to apply Depth First Search on every node.
If every connected node is visited from one source then increment count by one.
If some nodes yet not visited again perform DFS traversal.
Return the count.
Example:
Input : edges[] = {0, 1}, {0, 2}, {3, 4}
Output : 2
Explanation : There are 2 trees
0 3
/ \ \
1 2 4
Input : edges[] = {0, 1}, {0, 2}, {3, 4}, {5, 6}
Output : 3
Explanation : There are 3 trees
0 3 5
/ \ \ \
1 2 4 6
'''
def Insert_Edge(Graph, u, v):
Graph[u].append(v)
Graph[v].append(u)
def Depth_First_Search_Traversal(u, Graph, Check_visited):
Check_visited[u] = True
for i in range(len(Graph[u])):
if (Check_visited[Graph[u][i]] == False):
Depth_First_Search_Traversal(Graph[u][i], Graph, Check_visited)
def Count_Tree(Graph, V):
Check_visited = [False] * V
res = 0
for u in range(V):
if (Check_visited[u] == False):
Depth_First_Search_Traversal(u, Graph, Check_visited)
res += 1
return res
# Driver code
if __name__ == '__main__':
V = 7
Graph = [[] for i in range(V)]
Insert_Edge(Graph, 0, 1)
Insert_Edge(Graph, 0, 2)
Insert_Edge(Graph, 3, 4)
Insert_Edge(Graph, 5, 6)
print(Count_Tree(Graph, V)) | """
Program to count number of trees in a forest.
Approach:
The idea is to apply Depth First Search on every node.
If every connected node is visited from one source then increment count by one.
If some nodes yet not visited again perform DFS traversal.
Return the count.
Example:
Input : edges[] = {0, 1}, {0, 2}, {3, 4}
Output : 2
Explanation : There are 2 trees
0 3
/ \\ 1 2 4
Input : edges[] = {0, 1}, {0, 2}, {3, 4}, {5, 6}
Output : 3
Explanation : There are 3 trees
0 3 5
/ \\ \\ 1 2 4 6
"""
def insert__edge(Graph, u, v):
Graph[u].append(v)
Graph[v].append(u)
def depth__first__search__traversal(u, Graph, Check_visited):
Check_visited[u] = True
for i in range(len(Graph[u])):
if Check_visited[Graph[u][i]] == False:
depth__first__search__traversal(Graph[u][i], Graph, Check_visited)
def count__tree(Graph, V):
check_visited = [False] * V
res = 0
for u in range(V):
if Check_visited[u] == False:
depth__first__search__traversal(u, Graph, Check_visited)
res += 1
return res
if __name__ == '__main__':
v = 7
graph = [[] for i in range(V)]
insert__edge(Graph, 0, 1)
insert__edge(Graph, 0, 2)
insert__edge(Graph, 3, 4)
insert__edge(Graph, 5, 6)
print(count__tree(Graph, V)) |
def reverseInput(word):
# str[start:stop:step]
return word[::-1]
def reverseInput2(word):
new_word = ""
for char in word:
new_word = char + new_word
return new_word
if __name__ == "__main__":
word = input("Enter the word: ")
print(reverseInput(word))
print(reverseInput2(word))
| def reverse_input(word):
return word[::-1]
def reverse_input2(word):
new_word = ''
for char in word:
new_word = char + new_word
return new_word
if __name__ == '__main__':
word = input('Enter the word: ')
print(reverse_input(word))
print(reverse_input2(word)) |
EXAMPLE = '''\
|+1|-1|+2|-2|+3|-3|+sg|+pl|-sg|-pl|
1sg| X| | | X| | X| X| | | X|
1pl| X| | | X| | X| | X| X| |
2sg| | X| X| | | X| X| | | X|
2pl| | X| X| | | X| | X| X| |
3sg| | X| | X| X| | X| | | X|
3pl| | X| | X| X| | | X| X| |
'''
| example = ' |+1|-1|+2|-2|+3|-3|+sg|+pl|-sg|-pl|\n1sg| X| | | X| | X| X| | | X|\n1pl| X| | | X| | X| | X| X| |\n2sg| | X| X| | | X| X| | | X|\n2pl| | X| X| | | X| | X| X| |\n3sg| | X| | X| X| | X| | | X|\n3pl| | X| | X| X| | | X| X| |\n' |
def is_valid_row_col(next_r, next_c):
if 0 <= next_r < 8 and 0 <= next_c < 8:
return True
return False
matrix = []
queens = []
for _ in range(8):
data = input().split(" ")
matrix.append(data)
row_king = int
col_king = int
for row in range(8):
for column in range(8):
if matrix[row][column] == "K":
row_king = row
col_king = column
rotations = {
"up": (-1, 0),
"down": (1, 0),
"left": (0, -1),
"right": (0, 1),
"up_left": (-1, -1),
"up_right": (-1, 1),
"down_left": (1, -1),
"down_right": (1, 1)
}
for rotation in rotations:
next_row = row_king + rotations[rotation][0]
next_col = col_king + rotations[rotation][1]
while is_valid_row_col(next_row, next_col):
if matrix[next_row][next_col] == "Q":
queens.append([next_row, next_col])
break
next_row += rotations[rotation][0]
next_col += rotations[rotation][1]
if queens:
[print(q) for q in queens]
else:
print("The king is safe!")
| def is_valid_row_col(next_r, next_c):
if 0 <= next_r < 8 and 0 <= next_c < 8:
return True
return False
matrix = []
queens = []
for _ in range(8):
data = input().split(' ')
matrix.append(data)
row_king = int
col_king = int
for row in range(8):
for column in range(8):
if matrix[row][column] == 'K':
row_king = row
col_king = column
rotations = {'up': (-1, 0), 'down': (1, 0), 'left': (0, -1), 'right': (0, 1), 'up_left': (-1, -1), 'up_right': (-1, 1), 'down_left': (1, -1), 'down_right': (1, 1)}
for rotation in rotations:
next_row = row_king + rotations[rotation][0]
next_col = col_king + rotations[rotation][1]
while is_valid_row_col(next_row, next_col):
if matrix[next_row][next_col] == 'Q':
queens.append([next_row, next_col])
break
next_row += rotations[rotation][0]
next_col += rotations[rotation][1]
if queens:
[print(q) for q in queens]
else:
print('The king is safe!') |
# O(n) time and O(log n) space
def max_path_sum(tree):
_, max_path_sum = max_path_sum_helper(tree)
return max_path_sum
def max_path_sum_helper(tree):
if not tree:
# Base case of not a node
return (0, 0)
# Depth first bottom up approach to calculate the max path sum
left_branch_sum, left_triangle_sum = max_path_sum_helper(tree.left)
right_branch_sum, right_triangle_sum = max_path_sum_helper(tree.right)
# Using node label instead of tree seems to be more appropriate
node_value = tree.value
# The max between left or right
child_branch_sum = max(left_branch_sum, right_branch_sum)
# The max from either node, node + left, or node + right
node_child_sum = max(node_value + child_branch_sum, node_value)
# The max sum may comes a triangle (left - Node - right)
# or either node or node - left or node - right
triangle_sum = max(node_child_sum, left_branch_sum + node_value + right_branch_sum)
# Only one triangle is allowed since maximum connection between a node is two.
# Since the maximum path sum can only exist one triangle being formed, then
# the triangle might come from the current node triangle, left triangle, or right triangle.
max_path_sum = max(triangle_sum, left_triangle_sum, right_triangle_sum)
# Returns to the parent node in order to compute a valid path to avoid multiple triangles.
# That is, return (max sum that does not form a triangle, max sum possibly formed by a triangle)
return node_child_sum, max_path_sum
| def max_path_sum(tree):
(_, max_path_sum) = max_path_sum_helper(tree)
return max_path_sum
def max_path_sum_helper(tree):
if not tree:
return (0, 0)
(left_branch_sum, left_triangle_sum) = max_path_sum_helper(tree.left)
(right_branch_sum, right_triangle_sum) = max_path_sum_helper(tree.right)
node_value = tree.value
child_branch_sum = max(left_branch_sum, right_branch_sum)
node_child_sum = max(node_value + child_branch_sum, node_value)
triangle_sum = max(node_child_sum, left_branch_sum + node_value + right_branch_sum)
max_path_sum = max(triangle_sum, left_triangle_sum, right_triangle_sum)
return (node_child_sum, max_path_sum) |
#
# PySNMP MIB module SW-MIB (http://snmplabs.com/pysmi)
# ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/SW-MIB
# Produced by pysmi-0.3.4 at Wed May 1 11:36:37 2019
# On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4
# Using Python version 3.7.3 (default, Mar 27 2019, 09:23:15)
#
Integer, OctetString, ObjectIdentifier = mibBuilder.importSymbols("ASN1", "Integer", "OctetString", "ObjectIdentifier")
NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues")
ValueSizeConstraint, ConstraintsUnion, ValueRangeConstraint, ConstraintsIntersection, SingleValueConstraint = mibBuilder.importSymbols("ASN1-REFINEMENT", "ValueSizeConstraint", "ConstraintsUnion", "ValueRangeConstraint", "ConstraintsIntersection", "SingleValueConstraint")
fcSwitch, bcsiModules = mibBuilder.importSymbols("Brocade-REG-MIB", "fcSwitch", "bcsiModules")
SwTrunkMaster, SwSensorIndex, SwDomainIndex, FcWwn, SwNbIndex, SwPortIndex = mibBuilder.importSymbols("Brocade-TC", "SwTrunkMaster", "SwSensorIndex", "SwDomainIndex", "FcWwn", "SwNbIndex", "SwPortIndex")
connUnitPortEntry, connUnitPortStatEntry = mibBuilder.importSymbols("FCMGMT-MIB", "connUnitPortEntry", "connUnitPortStatEntry")
NotificationGroup, ModuleCompliance = mibBuilder.importSymbols("SNMPv2-CONF", "NotificationGroup", "ModuleCompliance")
Bits, Unsigned32, Integer32, ModuleIdentity, NotificationType, Counter32, MibScalar, MibTable, MibTableRow, MibTableColumn, IpAddress, iso, TimeTicks, MibIdentifier, Counter64, Gauge32, ObjectIdentity = mibBuilder.importSymbols("SNMPv2-SMI", "Bits", "Unsigned32", "Integer32", "ModuleIdentity", "NotificationType", "Counter32", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "IpAddress", "iso", "TimeTicks", "MibIdentifier", "Counter64", "Gauge32", "ObjectIdentity")
TextualConvention, DisplayString, TruthValue = mibBuilder.importSymbols("SNMPv2-TC", "TextualConvention", "DisplayString", "TruthValue")
swMibModule = ModuleIdentity((1, 3, 6, 1, 4, 1, 1588, 3, 1, 3))
swMibModule.setRevisions(('2003-01-13 14:30', '2003-07-20 14:30', '2004-04-15 10:30', '2004-08-06 18:30', '2005-04-29 20:16', '2006-01-09 09:00', '2006-05-17 09:00', '2007-01-23 09:00', '2007-06-08 12:00', '2007-06-27 10:30', '2007-08-01 12:20', '2007-08-29 04:42', '2008-01-29 07:59', '2008-07-17 03:45', '2008-07-24 02:32', '2008-07-25 02:32', '2008-09-09 09:00', '2009-09-28 09:00', '2009-02-21 09:00', '2009-03-30 09:00', '2009-06-25 12:00', '2009-06-29 01:00', '2009-06-30 13:06', '2009-06-30 06:00', '2009-10-30 05:00', '2009-11-03 13:06', '2009-11-05 12:00', '2009-11-05 05:00', '2009-11-06 11:30', '2009-11-30 10:30', '2009-12-03 17:30', '2010-01-30 17:30', '2010-07-08 11:30', '2010-07-15 11:30', '2010-07-21 11:30', '2010-08-06 11:30', '2010-08-20 10:30', '2010-10-07 10:30', '2010-10-09 10:30', '2010-10-25 10:30', '2010-11-01 06:00', '2010-11-02 10:30', '2010-12-02 10:30', '2010-12-08 10:30', '2010-12-20 10:00', '2010-12-21 04:00', '2010-12-22 10:00', '2010-12-30 10:00', '2011-01-06 10:30', '2011-01-07 10:30', '2011-02-18 06:00', '2012-02-23 10:30', '2012-03-05 03:33', '2012-05-15 14:25', '2012-06-04 17:20', '2012-06-14 10:00', '2012-06-29 15:20', '2012-07-10 16:00', '2012-09-26 14:00', '2013-03-21 13:00', '2013-04-04 17:48', '2013-04-22 11:30', '2013-04-25 18:03', '2013-05-15 14:30', '2013-06-05 16:00', '2013-06-29 10:00', '2013-09-12 10:00', '2013-10-04 13:40',))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
if mibBuilder.loadTexts: swMibModule.setRevisionsDescriptions(('The initial version of this module.', 'Added swIDIDMode to the swFabric group.', 'Added object for Trap Severity Level, swFwLastSeverityLevel. Added the enumeration swFwResourceFlash for SwFwClassesAreas. Deprecated the mib object swEventTrapLevel. Updated the description of swGroupId and corrected the spell mistakes. Obsoleted the swFault Trap. Added enumerations four-GB for swFCPortSpeed and unknown, other for swFCPortType.', 'Added swFCPortSpecifier object to swFCPortTable.', 'Modified the #SUMMARY and #ARGUMENTS for swFabricWatchTrap', '1. Modified the description for swPortTrunked 2. Updated the SW Traps summary and description to remove the obsolete varbindings', 'Added swFCPortFlag object to swFCPortTable', 'Added enumerations eight-GB and ten-GB for swFCPortSpeed', 'Included swFCPortFlag as an additiional variable binding for trap SWFCPortScn', 'Added enumerations octuple and decuple for swNbBaudRate', 'Added the enumerations swFwEPortUtil and swFwEPortPktl for swFwClassAreaIndex', 'Added swFCPortBrcdType object to swFCPortTable', 'Added Toptalker support and swVfId to the swFabric group.', 'Added swIPv6ChangeTrap, swIPv6Address and swIPv6Status .', 'Added swModel to distiguish between 7500 and 7500E switch .', 'Added the enumerations swFwPortLr, swFwEPortLr, swFwEPortUtil, swFwEPortPktl, swFwFCUPortLr, swFwFOPPortLr for swFwClassAreaIndex.', 'Added swPmgrEventTrap information.', 'Added additional fabric watch threshold in SwFwActs.', 'Added port phy states.', 'Added swEventVfId in swEventTable.', "Removed the version information from Brocade's proprietary MIB file name.", 'Modified swVfid position at the last of swFabric table', 'Added swFwCPUMemUsage enumeration under swFwClassAreaIndex.', 'Updated the description of swCpuAction/swMemAction and access of swcpuormemoryusage objects and changed the type of swEndDeviceInvalidWord, swEndDeviceLinkFailure,swEndDeviceSyncLoss, swEndDeviceSigLoss, swEndDeviceProtoErr,swEndDeviceInvalidCRC from integer32 to counter32.', 'Added swFabricReconfigTrap and swFabricSegmentTrap.', 'Removed enum switchReboot from swAdmStatus.', 'Changed swFwCustUnit access to read-only', 'Added enums swFwEPortTrunkUtil,swFwFCUPortTrunkUtil and swFwFOPPortTrunkUtil in SwFwClassesAreas', 'Added swConnUnitExtensionTable and entries for 64 bit portstats.', 'Added swMemUsageLimit1 and swMemUsageLimit3 under swCpuOrMemoryUsage', 'Added swExttrap as internal trap.', 'Changed the descriptions for swConnUnitExtensionTable.', 'Obsoleted swGroupTable, swGroupMemTable from swGroup.', 'Added swFCPortWwn, swFCPortBrcdType in swFcPortScn and added swStateChangeTrap', 'Added trap swPortMoveTrap', 'Added trap portStats objects under SwConnUnitPortStatEntry', 'Added trap swBrcdGenericTrap', 'Added swVfName', 'Added swPortConfigTable', 'Added swFCPortPrevType in swFCPortScn', 'Added fifty filter classes under swFwClassAreaIndex', 'Updated the description of swBrcdTrapBitMask and swBrcdGenericTrap for Fapwwn Trap', 'Deprecated swAgtCmtyTable and provided support of standard mibs SnmpCommunityTable and snmpTargetParamsTable and snmpTargetAddrTable', 'Updated the datatype for swPortEncrypt and swPortCompression', 'Added enumeration sexdecuple for swNbBaudRate', 'Added a new value lowBufferCrsd(7) for swFwLastEvent', 'Changed the area name filter-fmcfg to filterFmCfg in SwFwClassesAreas', 'Included FDMI event case in swBrcdTrapBitMask', 'Added class3 discards error in SwConnUnitPortStatEntry', 'Moved swPortConfigTable, CiperMode and Encrypt/CompressStatus to faext.mib', 'Changed fportmode(2) to portmode(2) for object swTopTalkerMntMode.', 'Added swauthProtocolPassword and swauthProtocolPassword for IBM DirectorServer applications', 'Added new enum noSigDet(14) for object swFCPortPhyState', 'Changed the syntax of swCpuAction and swMemAction objects.', 'Added PCS block errors in swConnUnitPortStatEntry', 'Added swDeviceStatus and swDeviceStatusTrap', 'Added sixteenGB support to swFCPortSpeed and also deprecated teh same', 'Added an area filterFmCfg51 in the class SwFwClassesAreas', 'Removed the tab space and added the space key for swFCPortEntry 38 as this caused a crash in MIB browser', 'Added swFCPortDisableReason in SwFCPortEntry and swFCPortScn trap.', 'Added unroutable frame counter in swConnUnitPortStatEntry', 'Made the swFCPortSpeed obsolete', 'Changed the description for swVFName and swConnUnitPCSErrorCounter', 'Updated swFCPortCapacity description', 'Added swFwPowerOnHours in SwFwClassesAreas', 'Updated the description for swCpuUsageLimit, swCpuAction, swMemAction, swMemUsageLimit1 and swMemUsageLimit3.', 'Added FEC Counters swConnUnitFECCorrectedCounter, swConnUnitFECUnCorrectedCounter', 'Added swZoneConfigChangeTrap',))
if mibBuilder.loadTexts: swMibModule.setLastUpdated('201310041340Z')
if mibBuilder.loadTexts: swMibModule.setOrganization('Brocade Communications Systems, Inc.,')
if mibBuilder.loadTexts: swMibModule.setContactInfo('Customer Support Group Brocade Communications Systems, 1745 Technology Drive, San Jose, CA 95110 U.S.A Tel: +1-408-392-6061 Fax: +1-408-392-6656 Email: support@Brocade.COM WEB: www.brocade.com')
if mibBuilder.loadTexts: swMibModule.setDescription("The MIB module is for Brocade's Fibre Channel Switch. Copyright (c) 1996-2003 Brocade Communications Systems, Inc. All rights reserved.")
sw = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1))
if mibBuilder.loadTexts: sw.setStatus('current')
if mibBuilder.loadTexts: sw.setDescription("The OID sub-tree for Brocade's Silkworm Series of Fibre Channel Switches.")
sw28k = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 2))
if mibBuilder.loadTexts: sw28k.setStatus('current')
if mibBuilder.loadTexts: sw28k.setDescription("The OID for Brocade's Silkworm 2800 model Fibre Channel Switch.")
sw21kN24k = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 3))
if mibBuilder.loadTexts: sw21kN24k.setStatus('current')
if mibBuilder.loadTexts: sw21kN24k.setDescription("The OID for Brocade's Silkworm 2100 and 2400 series model Fibre Channel Switch.")
sw20x0 = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 4))
if mibBuilder.loadTexts: sw20x0.setStatus('current')
if mibBuilder.loadTexts: sw20x0.setDescription("The OID for Brocade's Silkworm 20x0 series model Fibre Channel Switch.")
class SwSevType(TextualConvention, Integer32):
description = "The event trap level in conjunction with the an event's severity level."
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4, 5))
namedValues = NamedValues(("none", 0), ("critical", 1), ("error", 2), ("warning", 3), ("informational", 4), ("debug", 5))
class FcPortFlag(TextualConvention, Bits):
description = 'Represents the port status for a FC Flag. Currently this will indicate if the port is virtual or physical.'
status = 'current'
namedValues = NamedValues(("physical", 0), ("virtual", 1))
swSystem = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1))
if mibBuilder.loadTexts: swSystem.setStatus('current')
if mibBuilder.loadTexts: swSystem.setDescription('The OID sub-tree for swSystem group.')
swFabric = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2))
if mibBuilder.loadTexts: swFabric.setStatus('current')
if mibBuilder.loadTexts: swFabric.setDescription('The OID sub-tree for swFabric group.')
swModule = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 3))
if mibBuilder.loadTexts: swModule.setStatus('current')
if mibBuilder.loadTexts: swModule.setDescription('The OID sub-tree for swModule group.')
swAgtCfg = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4))
if mibBuilder.loadTexts: swAgtCfg.setStatus('current')
if mibBuilder.loadTexts: swAgtCfg.setDescription('The OID sub-tree for swAgtCfg group.')
swFCport = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6))
if mibBuilder.loadTexts: swFCport.setStatus('current')
if mibBuilder.loadTexts: swFCport.setDescription('The OID sub-tree for swFCport group.')
swNs = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7))
if mibBuilder.loadTexts: swNs.setStatus('current')
if mibBuilder.loadTexts: swNs.setDescription('The OID sub-tree for swNs group.')
swEvent = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8))
if mibBuilder.loadTexts: swEvent.setStatus('current')
if mibBuilder.loadTexts: swEvent.setDescription('The OID sub-tree for swEvent group.')
swFwSystem = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10))
if mibBuilder.loadTexts: swFwSystem.setStatus('current')
if mibBuilder.loadTexts: swFwSystem.setDescription('The OID sub-tree for swFwSystem group.')
swEndDevice = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21))
if mibBuilder.loadTexts: swEndDevice.setStatus('current')
if mibBuilder.loadTexts: swEndDevice.setDescription('The OID sub-tree for swEndDevice group.')
swGroup = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22))
if mibBuilder.loadTexts: swGroup.setStatus('obsolete')
if mibBuilder.loadTexts: swGroup.setDescription('The OID sub-tree for swGroup group.')
swBlmPerfMnt = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23))
if mibBuilder.loadTexts: swBlmPerfMnt.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfMnt.setDescription('The OID sub-tree for swBlmPerfMnt (Bloom Performance Monitor) group.')
swTrunk = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24))
if mibBuilder.loadTexts: swTrunk.setStatus('current')
if mibBuilder.loadTexts: swTrunk.setDescription('The OID sub-tree for swTrunk group.')
swTopTalker = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25))
if mibBuilder.loadTexts: swTopTalker.setStatus('current')
if mibBuilder.loadTexts: swTopTalker.setDescription('The OID sub-tree for TopTalker group.')
swCpuOrMemoryUsage = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26))
if mibBuilder.loadTexts: swCpuOrMemoryUsage.setStatus('current')
if mibBuilder.loadTexts: swCpuOrMemoryUsage.setDescription('The OID sub-tree for cpu or memory usage group.')
swConnUnitPortStatExtentionTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27), )
if mibBuilder.loadTexts: swConnUnitPortStatExtentionTable.setStatus('current')
if mibBuilder.loadTexts: swConnUnitPortStatExtentionTable.setDescription('This represents the Conn unit Port Stats')
swCurrentDate = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 1), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swCurrentDate.setStatus('current')
if mibBuilder.loadTexts: swCurrentDate.setDescription('The current date information in displayable textual format.')
swBootDate = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 2), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBootDate.setStatus('current')
if mibBuilder.loadTexts: swBootDate.setDescription('The date and time when the system last booted, in displayable textual format.')
swFWLastUpdated = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 3), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFWLastUpdated.setStatus('current')
if mibBuilder.loadTexts: swFWLastUpdated.setDescription('The information indicates the date when the firmware was last updated, in displayable textual format.')
swFlashLastUpdated = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 4), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFlashLastUpdated.setStatus('current')
if mibBuilder.loadTexts: swFlashLastUpdated.setDescription('The information indicates the date when the FLASH was last updated, in displayable textual format.')
swBootPromLastUpdated = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 5), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBootPromLastUpdated.setStatus('current')
if mibBuilder.loadTexts: swBootPromLastUpdated.setDescription('The information indicates the date when the boot PROM was last updated, in displayable textual format.')
swFirmwareVersion = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 6), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 24))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFirmwareVersion.setStatus('current')
if mibBuilder.loadTexts: swFirmwareVersion.setDescription('The current version of the firwmare.')
swOperStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 7), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("online", 1), ("offline", 2), ("testing", 3), ("faulty", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swOperStatus.setStatus('current')
if mibBuilder.loadTexts: swOperStatus.setDescription('The current operational status of the switch. The states are as follow: o online(1) means the switch is accessible by an external Fibre Channel port; o offline(2) means the switch is not accessible; o testing(3) means the switch is in a built-in test mode and is not accessible by an external Fibre Channel port; o faulty(4) means the switch is not operational.')
swAdmStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 8), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6))).clone(namedValues=NamedValues(("online", 1), ("offline", 2), ("testing", 3), ("faulty", 4), ("reboot", 5), ("fastboot", 6)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swAdmStatus.setStatus('current')
if mibBuilder.loadTexts: swAdmStatus.setDescription("The desired administrative status of the switch. A management station may place the switch in a desired state by setting this object accordingly. The states are as follow: o online(1) means set the switch to be accessible by an external Fibre Channel port; o offline(2) means set the switch to be inaccessible; o testing(3) means set the switch to run the built-in test; o faulty(4) means set the switch to a 'soft' faulty condition; o reboot(5) means set the switch to reboot in 1 second. o fastboot(6) means set the switch to fastboot in 1 second. Fastboot would cause the switch to boot but skip over the POST. When the switch is in faulty state, only two states can be set: faulty and reboot/fastboot.")
swTelnetShellAdmStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 9), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1))).clone(namedValues=NamedValues(("unknown", 0), ("terminated", 1)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swTelnetShellAdmStatus.setStatus('current')
if mibBuilder.loadTexts: swTelnetShellAdmStatus.setDescription('The desired administrative status of the Telnet shell. By setting it to terminated(1), the current Telnet shell task is deleted. When this variable instance is read, it reports the value last set through SNMP.')
swSsn = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 10), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 128))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSsn.setStatus('current')
if mibBuilder.loadTexts: swSsn.setDescription('The soft serial number of the switch.')
swFlashDLOperStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 11), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4, 5))).clone(namedValues=NamedValues(("unknown", 0), ("swCurrent", 1), ("swFwUpgraded", 2), ("swCfUploaded", 3), ("swCfDownloaded", 4), ("swFwCorrupted", 5)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFlashDLOperStatus.setStatus('current')
if mibBuilder.loadTexts: swFlashDLOperStatus.setDescription('The operational status of the FLASH. The operational states are as follow: o swCurrent(1) indicates that the FLASH contains the current firmware image or config file; o swFwUpgraded(2) state indicates that it contains the image upgraded from the swFlashDLHost.0.; o swCfUploaded(3) state indicates that the switch configuration file has been uploaded to the host; and o swCfDownloaded(4) state indicates that the switch configuration file has been downloaded from the host. o swFwCorrupted (5) state indicates that the firmware in the FLASH of the switch is corrupted.')
swFlashDLAdmStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 12), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5))).clone(namedValues=NamedValues(("swCurrent", 1), ("swFwUpgrade", 2), ("swCfUpload", 3), ("swCfDownload", 4), ("swFwCorrupted", 5)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFlashDLAdmStatus.setStatus('current')
if mibBuilder.loadTexts: swFlashDLAdmStatus.setDescription('The desired state of the FLASH. A management station may place the FLASH in a desired state by setting this object accordingly: o swCurrent(1) indicates that the FLASH contains the current firmware image or config file; o swFwUpgrade(2) means that the firmware in the FLASH is to be upgraded from the host specified; o swCfUpload(3) means that the switch config file is to be uploaded to the host specified; or o swCfDownload(4) means that the switch config file is to be downloaded from the host specified. o swFwCorrupted(5) state indicates that the firmware in the FLASH is corrupted. This value is for informational purpose only. However, set of swFlashDLAdmStatus to this value is not allowed. The host is specified in swFlashDLHost.0. In addition, user name is specified in swFlashDLUser.0, and the file name specified in swFlashDLFile.0. Reference the user manual on the following commands, o firmwareDownload, o configUpload, and o configDownload.')
swFlashDLHost = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 13), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFlashDLHost.setStatus('current')
if mibBuilder.loadTexts: swFlashDLHost.setDescription('The name or IP address (in dot notation) of the host to download or upload a relevant file to the FLASH.')
swFlashDLUser = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 14), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFlashDLUser.setStatus('current')
if mibBuilder.loadTexts: swFlashDLUser.setDescription('The user name on the host to download or upload a relevant file to or from the FLASH.')
swFlashDLFile = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 15), DisplayString()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFlashDLFile.setStatus('current')
if mibBuilder.loadTexts: swFlashDLFile.setDescription('The name of the file to be downloaded or uploaded.')
swFlashDLPassword = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 16), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 100))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFlashDLPassword.setStatus('current')
if mibBuilder.loadTexts: swFlashDLPassword.setDescription('The password to be used in for FTP transfer of files in the download or upload operation.')
swBeaconOperStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 18), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("on", 1), ("off", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBeaconOperStatus.setStatus('current')
if mibBuilder.loadTexts: swBeaconOperStatus.setDescription('The current operational status of the switch beacon. When the beacon is on, the LEDs on the front panel of the switch run alternately from left to right and right to left. The color is yellow. When the beacon is off, each LED will be in their its regular status indicating color and state.')
swBeaconAdmStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 19), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("on", 1), ("off", 2)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swBeaconAdmStatus.setStatus('current')
if mibBuilder.loadTexts: swBeaconAdmStatus.setDescription('The desired status of the switch beacon. When the beacon is set to on, the LEDs on the front panel of the switch run alternately from left to right and right to left. The color is yellow. When the beacon is set to off, each LED will be in its regular status indicating color and state.')
swDiagResult = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 20), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("sw-ok", 1), ("sw-faulty", 2), ("sw-embedded-port-fault", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swDiagResult.setStatus('current')
if mibBuilder.loadTexts: swDiagResult.setDescription('The result of the power-on startup (POST) diagnostics.')
swNumSensors = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 21), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNumSensors.setStatus('current')
if mibBuilder.loadTexts: swNumSensors.setDescription('The number of sensors inside the switch.')
swSensorTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22), )
if mibBuilder.loadTexts: swSensorTable.setStatus('current')
if mibBuilder.loadTexts: swSensorTable.setDescription('The table of sensor entries.')
swSensorEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1), ).setIndexNames((0, "SW-MIB", "swSensorIndex"))
if mibBuilder.loadTexts: swSensorEntry.setStatus('current')
if mibBuilder.loadTexts: swSensorEntry.setDescription('An entry of the sensor information.')
swSensorIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 1), SwSensorIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSensorIndex.setStatus('current')
if mibBuilder.loadTexts: swSensorIndex.setDescription('This object identifies the sensor.')
swSensorType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 2), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("temperature", 1), ("fan", 2), ("power-supply", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSensorType.setStatus('current')
if mibBuilder.loadTexts: swSensorType.setDescription('This object identifies the sensor type.')
swSensorStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 3), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6))).clone(namedValues=NamedValues(("unknown", 1), ("faulty", 2), ("below-min", 3), ("nominal", 4), ("above-max", 5), ("absent", 6)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSensorStatus.setStatus('current')
if mibBuilder.loadTexts: swSensorStatus.setDescription('The current status of the sensor.')
swSensorValue = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 4), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSensorValue.setStatus('current')
if mibBuilder.loadTexts: swSensorValue.setDescription('The current value (reading) of the sensor. The value, -2147483648, represents an unknown quantity. It also means that the sensor does not have the capability to measure the actual value. In V2.0, the temperature sensor value will be in Celsius; the fan value will be in RPM (revolution per minute); and the power supply sensor reading will be unknown.')
swSensorInfo = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 5), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSensorInfo.setStatus('current')
if mibBuilder.loadTexts: swSensorInfo.setDescription("Additional displayable information on the sensor. In V2.x, it contains the sensor type and number in textual format. For example, 'Temp 3', 'Fan 6'.")
swTrackChangesInfo = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 23), DisplayString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrackChangesInfo.setStatus('current')
if mibBuilder.loadTexts: swTrackChangesInfo.setDescription('Track changes string. For trap only')
swID = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 24), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swID.setStatus('current')
if mibBuilder.loadTexts: swID.setDescription('The number of the logical switch (0/1)')
swEtherIPAddress = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 25), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEtherIPAddress.setStatus('current')
if mibBuilder.loadTexts: swEtherIPAddress.setDescription('The IP Address of the Ethernet interface of this logical switch.')
swEtherIPMask = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 26), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEtherIPMask.setStatus('current')
if mibBuilder.loadTexts: swEtherIPMask.setDescription('The IP Mask of the Ethernet interface of this logical switch.')
swFCIPAddress = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 27), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCIPAddress.setStatus('current')
if mibBuilder.loadTexts: swFCIPAddress.setDescription('The IP Address of the FC interface of this logical switch.')
swFCIPMask = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 28), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCIPMask.setStatus('current')
if mibBuilder.loadTexts: swFCIPMask.setDescription('The IP Mask of the FC interface of this logical switch.')
swIPv6Address = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 29), DisplayString())
if mibBuilder.loadTexts: swIPv6Address.setStatus('current')
if mibBuilder.loadTexts: swIPv6Address.setDescription('IPV6 address.')
swIPv6Status = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 30), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("tentative", 1), ("preferred", 2), ("ipdeprecated", 3), ("inactive", 4))))
if mibBuilder.loadTexts: swIPv6Status.setStatus('current')
if mibBuilder.loadTexts: swIPv6Status.setDescription('The current status of ipv6 address.')
swModel = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 31), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("switch7500", 1), ("switch7500E", 2), ("other", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swModel.setStatus('current')
if mibBuilder.loadTexts: swModel.setDescription('Indicates whether the switch is 7500 or 7500E .')
swTestString = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 32), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(1, 255)))
if mibBuilder.loadTexts: swTestString.setStatus('current')
if mibBuilder.loadTexts: swTestString.setDescription('presence of this string represents test trap.')
swPortList = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 33), OctetString())
if mibBuilder.loadTexts: swPortList.setStatus('current')
if mibBuilder.loadTexts: swPortList.setDescription('This string represents the list of ports and its WWN when ports moved from one switch to another.')
swBrcdTrapBitMask = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 34), Integer32())
if mibBuilder.loadTexts: swBrcdTrapBitMask.setStatus('current')
if mibBuilder.loadTexts: swBrcdTrapBitMask.setDescription('Type of notification will be represented by a single bit in this variable. 0x01 - Fabric change event 0x02 - Device change event 0x04 - Fapwwn change event 0x08 - FDMI events.')
swFCPortPrevType = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 35), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7))).clone(namedValues=NamedValues(("unknown", 1), ("other", 2), ("fl-port", 3), ("f-port", 4), ("e-port", 5), ("g-port", 6), ("ex-port", 7))))
if mibBuilder.loadTexts: swFCPortPrevType.setStatus('current')
if mibBuilder.loadTexts: swFCPortPrevType.setDescription('This represents port type of a port before it goes online/offline and it is valid only in swFcPortSCN trap')
swDeviceStatus = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 36), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("login", 1), ("logout", 2), ("unknown", 3))))
if mibBuilder.loadTexts: swDeviceStatus.setStatus('current')
if mibBuilder.loadTexts: swDeviceStatus.setDescription('This represents the attached device status. The status will change whenever port/node goes to online/offline')
swDomainID = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 1), SwDomainIndex()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swDomainID.setStatus('current')
if mibBuilder.loadTexts: swDomainID.setDescription('The current Fibre Channel domain ID of the switch. To set a new value, the switch (swAdmStatus) must be in offline or testing state.')
swPrincipalSwitch = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 2), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("yes", 1), ("no", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swPrincipalSwitch.setStatus('current')
if mibBuilder.loadTexts: swPrincipalSwitch.setDescription('This object indicates whether the switch is the Principal switch as per FC-SW.')
swNumNbs = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 8), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNumNbs.setStatus('current')
if mibBuilder.loadTexts: swNumNbs.setDescription('The number of Inter-Switch Links in the (immediate) neighborhood.')
swNbTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9), )
if mibBuilder.loadTexts: swNbTable.setStatus('current')
if mibBuilder.loadTexts: swNbTable.setDescription('This table contains the ISLs in the immediate neighborhood of the switch.')
swNbEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1), ).setIndexNames((0, "SW-MIB", "swNbIndex"))
if mibBuilder.loadTexts: swNbEntry.setStatus('current')
if mibBuilder.loadTexts: swNbEntry.setDescription('An entry containing each neighbor ISL parameters.')
swNbIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 1), SwNbIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbIndex.setStatus('current')
if mibBuilder.loadTexts: swNbIndex.setDescription('This object identifies the neighbor ISL entry.')
swNbMyPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 2), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbMyPort.setStatus('current')
if mibBuilder.loadTexts: swNbMyPort.setDescription('This is the port that has an ISL to another switch.')
swNbRemDomain = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 3), SwDomainIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbRemDomain.setStatus('current')
if mibBuilder.loadTexts: swNbRemDomain.setDescription('This is the Fibre Channel domain on the other end of the ISL.')
swNbRemPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 4), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbRemPort.setStatus('current')
if mibBuilder.loadTexts: swNbRemPort.setDescription('This is the port index on the other end of the ISL.')
swNbBaudRate = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 5), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 4, 8, 16, 32, 64, 128, 256, 512))).clone(namedValues=NamedValues(("other", 1), ("oneEighth", 2), ("quarter", 4), ("half", 8), ("full", 16), ("double", 32), ("quadruple", 64), ("octuple", 128), ("decuple", 256), ("sexdecuple", 512)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbBaudRate.setStatus('current')
if mibBuilder.loadTexts: swNbBaudRate.setDescription('The baud rate of the ISL.')
swNbIslState = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 6), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4, 5))).clone(namedValues=NamedValues(("sw-down", 0), ("sw-init", 1), ("sw-internal2", 2), ("sw-internal3", 3), ("sw-internal4", 4), ("sw-active", 5)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbIslState.setStatus('current')
if mibBuilder.loadTexts: swNbIslState.setDescription('The current state of the ISL. The swNbIslState will be 0 when ISL is in incompatible state or port is a slave port.')
swNbIslCost = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swNbIslCost.setStatus('current')
if mibBuilder.loadTexts: swNbIslCost.setDescription('The current link cost of the ISL.')
swNbRemPortName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 8), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNbRemPortName.setStatus('current')
if mibBuilder.loadTexts: swNbRemPortName.setDescription('The World_wide_Name of the remote port.')
swFabricMemTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10), )
if mibBuilder.loadTexts: swFabricMemTable.setStatus('current')
if mibBuilder.loadTexts: swFabricMemTable.setDescription('This table contains information on the member switches of a fabric. This may not be available on all versions of Fabric OS.')
swFabricMemEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1), ).setIndexNames((0, "SW-MIB", "swFabricMemWwn"))
if mibBuilder.loadTexts: swFabricMemEntry.setStatus('current')
if mibBuilder.loadTexts: swFabricMemEntry.setDescription('An entry containing each switch in the fabric.')
swFabricMemWwn = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 1), FcWwn()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemWwn.setStatus('current')
if mibBuilder.loadTexts: swFabricMemWwn.setDescription('This object identifies the World wide name of the member switch.')
swFabricMemDid = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 2), SwDomainIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemDid.setStatus('current')
if mibBuilder.loadTexts: swFabricMemDid.setDescription('This object identifies the domain id of the member switch.')
swFabricMemName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 3), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemName.setStatus('current')
if mibBuilder.loadTexts: swFabricMemName.setDescription('This object identifies the name of the member switch.')
swFabricMemEIP = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 4), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemEIP.setStatus('current')
if mibBuilder.loadTexts: swFabricMemEIP.setDescription('This object identifies the ethernet IP address of the member switch.')
swFabricMemFCIP = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 5), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemFCIP.setStatus('current')
if mibBuilder.loadTexts: swFabricMemFCIP.setDescription('This object identifies the Fibre Channel IP address of the member switch.')
swFabricMemGWIP = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 6), IpAddress()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemGWIP.setStatus('current')
if mibBuilder.loadTexts: swFabricMemGWIP.setDescription('This object identifies the Gateway IP address of the member switch.')
swFabricMemType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemType.setStatus('current')
if mibBuilder.loadTexts: swFabricMemType.setDescription('This object identifies the member switch type.')
swFabricMemShortVersion = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 8), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 24))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFabricMemShortVersion.setStatus('current')
if mibBuilder.loadTexts: swFabricMemShortVersion.setDescription('This object identifies Fabric OS version of the member switch.')
swIDIDMode = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 11), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("enabled", 1), ("disabled", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swIDIDMode.setStatus('current')
if mibBuilder.loadTexts: swIDIDMode.setDescription('Status of Insistent Domain ID (IDID) mode. Status indicating IDID mode is enabled or not.')
swPmgrEventType = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 12), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4, 6))).clone(namedValues=NamedValues(("create", 0), ("delete", 1), ("moveport", 2), ("fidchange", 3), ("basechange", 4), ("vfstatechange", 6))))
if mibBuilder.loadTexts: swPmgrEventType.setStatus('current')
if mibBuilder.loadTexts: swPmgrEventType.setDescription('Indicates Partition manager event type.')
swPmgrEventTime = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 13), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64)))
if mibBuilder.loadTexts: swPmgrEventTime.setStatus('current')
if mibBuilder.loadTexts: swPmgrEventTime.setDescription('This object identifies the date and time when this pmgr event occurred, in textual format.')
swPmgrEventDescr = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 14), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64)))
if mibBuilder.loadTexts: swPmgrEventDescr.setStatus('current')
if mibBuilder.loadTexts: swPmgrEventDescr.setDescription('This object identifies the textual description of the pmgr event.')
swVfId = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 15), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swVfId.setStatus('current')
if mibBuilder.loadTexts: swVfId.setDescription('The Virtual fabric id.')
swVfName = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 16), DisplayString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swVfName.setStatus('current')
if mibBuilder.loadTexts: swVfName.setDescription('This represents the virtual fabric name configured in the switch')
swAgtCmtyTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11), )
if mibBuilder.loadTexts: swAgtCmtyTable.setStatus('deprecated')
if mibBuilder.loadTexts: swAgtCmtyTable.setDescription('A table that contains, one entry for each Community, the access control and parameters of the Community.')
swauthProtocolPassword = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 12), OctetString().subtype(subtypeSpec=ValueSizeConstraint(1, 32))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swauthProtocolPassword.setStatus('current')
if mibBuilder.loadTexts: swauthProtocolPassword.setDescription('This entry is created specific to the Pharos switch to change the password for the auth protocol to reserved user DirectorServerSNMPv3User')
swprivProtocolPassword = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 13), OctetString().subtype(subtypeSpec=ValueSizeConstraint(1, 32))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swprivProtocolPassword.setStatus('current')
if mibBuilder.loadTexts: swprivProtocolPassword.setDescription('This entry is created specific to the Pharos switch to change the password for the priv protocol to reserved user DirectorServerSNMPv3User')
swAgtCmtyEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1), ).setIndexNames((0, "SW-MIB", "swAgtCmtyIdx"))
if mibBuilder.loadTexts: swAgtCmtyEntry.setStatus('deprecated')
if mibBuilder.loadTexts: swAgtCmtyEntry.setDescription('An entry containing the Community parameters.')
swAgtCmtyIdx = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 6))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swAgtCmtyIdx.setStatus('deprecated')
if mibBuilder.loadTexts: swAgtCmtyIdx.setDescription('This object identifies the SNMPv1 Community entry.')
swAgtCmtyStr = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 2), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(2, 16))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swAgtCmtyStr.setStatus('deprecated')
if mibBuilder.loadTexts: swAgtCmtyStr.setDescription('This is a Community string supported by the agent. If a new value is set successfully, it takes effect immediately.')
swAgtTrapRcp = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 3), IpAddress()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swAgtTrapRcp.setStatus('deprecated')
if mibBuilder.loadTexts: swAgtTrapRcp.setDescription('This is the trap recipient associated with the Community. If a new value is set successfully, it takes effect immediately.')
swAgtTrapSeverityLevel = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 4), SwSevType()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swAgtTrapSeverityLevel.setStatus('deprecated')
if mibBuilder.loadTexts: swAgtTrapSeverityLevel.setDescription("This is the trap severity level associated with the swAgtTrapRcp. The trap severity level in conjunction with the an event's severity level. When an event occurs and if its severity level is at or below the set value, the SNMP trap is sent to configured trap recipients. The severity level is limited to particular events. If a new value is set successfully, it takes effect immediately.")
swFCPortCapacity = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortCapacity.setStatus('current')
if mibBuilder.loadTexts: swFCPortCapacity.setDescription('The maximum number of of physical ports on the switch. This will include ports of the protocol: FC, FCIP(GE ports), VE(FCIP)...')
swFCPortTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2), )
if mibBuilder.loadTexts: swFCPortTable.setStatus('current')
if mibBuilder.loadTexts: swFCPortTable.setDescription('A table that contains, one entry for each switch port, configuration and service parameters of the port.')
swFCPortEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1), ).setIndexNames((0, "SW-MIB", "swFCPortIndex"))
if mibBuilder.loadTexts: swFCPortEntry.setStatus('current')
if mibBuilder.loadTexts: swFCPortEntry.setDescription('An entry containing the configuration and service parameters of the switch port.')
swFCPortIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 1), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortIndex.setStatus('current')
if mibBuilder.loadTexts: swFCPortIndex.setDescription('This object identifies the switch port index. Note that the value of a port index is 1 higher than the port number labeled on the front panel. E.g. port index 1 correspond to port number 0.')
swFCPortType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 2), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8))).clone(namedValues=NamedValues(("stitch", 1), ("flannel", 2), ("loom", 3), ("bloom", 4), ("rdbloom", 5), ("wormhole", 6), ("other", 7), ("unknown", 8)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortType.setStatus('current')
if mibBuilder.loadTexts: swFCPortType.setDescription('This object identifies the type of switch port. It may be of type stitch(1), flannel(2), loom(3) , bloom(4),rdbloom(5) or wormhole(6).')
swFCPortPhyState = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 3), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 14, 255))).clone(namedValues=NamedValues(("noCard", 1), ("noTransceiver", 2), ("laserFault", 3), ("noLight", 4), ("noSync", 5), ("inSync", 6), ("portFault", 7), ("diagFault", 8), ("lockRef", 9), ("validating", 10), ("invalidModule", 11), ("noSigDet", 14), ("unknown", 255)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortPhyState.setStatus('current')
if mibBuilder.loadTexts: swFCPortPhyState.setDescription('This object identifies the physical state of the port: noCard(1) no card present in this switch slot; noTransceiver(2) no Transceiver module in this port. noGbic(2) was used previously. Transceiver is the generic name for GBIC, SFP etc.; laserFault(3) the module is signaling a laser fault (defective Transceiver); noLight(4) the module is not receiving light; noSync(5) the module is receiving light but is out of sync; inSync(6) the module is receiving light and is in sync; portFault(7) the port is marked faulty (defective Transceiver, cable or device); diagFault(8) the port failed diagnostics (defective G_Port or FL_Port card or motherboard); lockRef(9) the port is locking to the reference signal. validating(10) Validation is in progress invalidModule(11) Invalid SFP unknown(255) unknown. ')
swFCPortOpStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 4), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4))).clone(namedValues=NamedValues(("unknown", 0), ("online", 1), ("offline", 2), ("testing", 3), ("faulty", 4)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortOpStatus.setStatus('current')
if mibBuilder.loadTexts: swFCPortOpStatus.setDescription('This object identifies the operational status of the port. The online(1) state indicates that user frames can be passed. The unknown(0) state indicates that likely the port module is physically absent (see swFCPortPhyState).')
swFCPortAdmStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 5), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4))).clone(namedValues=NamedValues(("online", 1), ("offline", 2), ("testing", 3), ("faulty", 4)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFCPortAdmStatus.setStatus('current')
if mibBuilder.loadTexts: swFCPortAdmStatus.setDescription('The desired state of the port. A management station may place the port in a desired state by setting this object accordingly. The testing(3) state indicates that no user frames can be passed. As the result of either explicit management action or per configuration information accessible by the switch, swFCPortAdmStatus is then changed to either the online(1) or testing(3) states, or remains in the offline(2) state.')
swFCPortLinkState = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 6), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3))).clone(namedValues=NamedValues(("enabled", 1), ("disabled", 2), ("loopback", 3)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFCPortLinkState.setStatus('current')
if mibBuilder.loadTexts: swFCPortLinkState.setDescription("This object indicates the link state of the port. The value may be: enabled(1) - port is allowed to participate in the FC-PH protocol with its attached port (or ports if it is in a FC-AL loop); disabled(2) - the port is not allowed to participate in the FC-PH protocol with its attached port(s); loopback(3) - the port may transmit frames through an internal path to verify the health of the transmitter and receiver path. Note that when the port's link state changes, its operational status (swFCPortOpStatus) will be affected.")
swFCPortTxType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 7), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5))).clone(namedValues=NamedValues(("unknown", 1), ("lw", 2), ("sw", 3), ("ld", 4), ("cu", 5)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortTxType.setStatus('current')
if mibBuilder.loadTexts: swFCPortTxType.setDescription('This object indicates the media transmitter type of the port. The value may be: unknown(1) cannot determined to the port driver lw(2) long wave laser sw(3) short wave laser ld(4) long wave LED cu(5) copper (electrical).')
swFCPortTxWords = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 11), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortTxWords.setStatus('current')
if mibBuilder.loadTexts: swFCPortTxWords.setDescription('This object counts the number of Fibre Channel words that the port has transmitted.')
swFCPortRxWords = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 12), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxWords.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxWords.setDescription('This object counts the number of Fibre Channel words that the port has received.')
swFCPortTxFrames = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 13), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortTxFrames.setStatus('current')
if mibBuilder.loadTexts: swFCPortTxFrames.setDescription('This object counts the number of (Fibre Channel) frames that the port has transmitted.')
swFCPortRxFrames = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 14), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxFrames.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxFrames.setDescription('This object counts the number of (Fibre Channel) frames that the port has received.')
swFCPortRxC2Frames = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 15), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxC2Frames.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxC2Frames.setDescription('This object counts the number of Class 2 frames that the port has received.')
swFCPortRxC3Frames = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 16), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxC3Frames.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxC3Frames.setDescription('This object counts the number of Class 3 frames that the port has received.')
swFCPortRxLCs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 17), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxLCs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxLCs.setDescription('This object counts the number of Link Control frames that the port has received.')
swFCPortRxMcasts = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 18), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxMcasts.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxMcasts.setDescription('This object counts the number of Multicast frames that the port has received.')
swFCPortTooManyRdys = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 19), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortTooManyRdys.setStatus('current')
if mibBuilder.loadTexts: swFCPortTooManyRdys.setDescription('This object counts the number of times when RDYs exceeds the frames received.')
swFCPortNoTxCredits = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 20), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortNoTxCredits.setStatus('current')
if mibBuilder.loadTexts: swFCPortNoTxCredits.setDescription('This object counts the number of times when the transmit credit has reached zero.')
swFCPortRxEncInFrs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 21), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxEncInFrs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxEncInFrs.setDescription('This object counts the number of encoding error or disparity error inside frames received.')
swFCPortRxCrcs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 22), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxCrcs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxCrcs.setDescription('This object counts the number of CRC errors detected for frames received.')
swFCPortRxTruncs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 23), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxTruncs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxTruncs.setDescription('This object counts the number of truncated frames that the port has received.')
swFCPortRxTooLongs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 24), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxTooLongs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxTooLongs.setDescription('This object counts the number of received frames that are too long.')
swFCPortRxBadEofs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 25), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxBadEofs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxBadEofs.setDescription('This object counts the number of received frames that have bad EOF delimiter.')
swFCPortRxEncOutFrs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 26), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxEncOutFrs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxEncOutFrs.setDescription('This object counts the number of encoding error or disparity error outside frames received.')
swFCPortRxBadOs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 27), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortRxBadOs.setStatus('current')
if mibBuilder.loadTexts: swFCPortRxBadOs.setDescription('This object counts the number of invalid Ordered Sets received.')
swFCPortC3Discards = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 28), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortC3Discards.setStatus('current')
if mibBuilder.loadTexts: swFCPortC3Discards.setDescription('This object counts the number of Class 3 frames that the port has discarded.')
swFCPortMcastTimedOuts = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 29), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortMcastTimedOuts.setStatus('current')
if mibBuilder.loadTexts: swFCPortMcastTimedOuts.setDescription('This object counts the number of Multicast frames that has been timed out.')
swFCPortTxMcasts = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 30), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortTxMcasts.setStatus('current')
if mibBuilder.loadTexts: swFCPortTxMcasts.setDescription('This object counts the number of Multicast frames that has been transmitted.')
swFCPortLipIns = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 31), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortLipIns.setStatus('current')
if mibBuilder.loadTexts: swFCPortLipIns.setDescription('This object counts the number of Loop Initializations that has been initiated by loop devices attached.')
swFCPortLipOuts = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 32), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortLipOuts.setStatus('current')
if mibBuilder.loadTexts: swFCPortLipOuts.setDescription('This object counts the number of Loop Initializations that has been initiated by the port.')
swFCPortLipLastAlpa = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 33), OctetString().subtype(subtypeSpec=ValueSizeConstraint(4, 4)).setFixedLength(4)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortLipLastAlpa.setStatus('current')
if mibBuilder.loadTexts: swFCPortLipLastAlpa.setDescription('This object indicates the Physical Address (AL_PA) of the loop device that initiated the last Loop Initialization.')
swFCPortWwn = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 34), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortWwn.setStatus('current')
if mibBuilder.loadTexts: swFCPortWwn.setDescription('The World_wide_Name of the Fibre Channel port. The contents of an instance are in the IEEE extended format as specified in FC-PH; the 12-bit port identifier represents the port number within the switch.')
swFCPortSpeed = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 35), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8))).clone(namedValues=NamedValues(("one-GB", 1), ("two-GB", 2), ("auto-Negotiate", 3), ("four-GB", 4), ("eight-GB", 5), ("ten-GB", 6), ("unknown", 7), ("sixteen-GB", 8)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFCPortSpeed.setStatus('obsolete')
if mibBuilder.loadTexts: swFCPortSpeed.setDescription('The desired baud rate for the port. It can have the values of 1GB (1), 2GB (2), Auto-Negotiate (3), 4GB (4), 8GB (5), 10GB (6), 16GB (8). Some of the above values may not be supported by all type of switches.')
swFCPortName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 36), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortName.setStatus('current')
if mibBuilder.loadTexts: swFCPortName.setDescription('A string indicates the name of the addressed port. The names should be persistent across switch reboots. Port names do not have to be unique within a switch or within a fabric.')
swFCPortSpecifier = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 37), DisplayString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortSpecifier.setStatus('current')
if mibBuilder.loadTexts: swFCPortSpecifier.setDescription("This string indicates the physical port number of the addressed port. The format of the string is: <slot>/port, where 'slot' being present only for bladed systems. ")
swFCPortFlag = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 38), FcPortFlag()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortFlag.setStatus('current')
if mibBuilder.loadTexts: swFCPortFlag.setDescription('A bit map of port status flags which includes the information of port type. Currently this will indicate if the port is virtual or physical.')
swFCPortBrcdType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 39), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7))).clone(namedValues=NamedValues(("unknown", 1), ("other", 2), ("fl-port", 3), ("f-port", 4), ("e-port", 5), ("g-port", 6), ("ex-port", 7)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFCPortBrcdType.setStatus('current')
if mibBuilder.loadTexts: swFCPortBrcdType.setDescription('The Brocade port type.')
swFCPortDisableReason = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 40), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152, 153, 154, 155, 156, 157, 158, 159, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 174, 175, 176, 177, 178, 179, 180, 181, 182, 183, 184, 185, 186, 187, 188, 189, 190, 191, 192, 193, 194, 195, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207, 208, 209, 210, 211, 212, 213, 214, 215, 216, 217, 218, 219, 220, 221, 222, 223, 224, 225, 226, 227, 228, 229, 230))).clone(namedValues=NamedValues(("r-recover-fail", 1), ("r-invalid-reason", 2), ("r-forced", 3), ("r-sw-disabled", 4), ("r-bl-disabled", 5), ("r-slot-off", 6), ("r-sw-enabled", 7), ("r-bl-enabled", 8), ("r-slot-on", 9), ("r-persistid", 10), ("r-sw-violation", 11), ("r-prv-dev-violation", 12), ("r-pub-dev-violation", 13), ("r-port-data-fail", 14), ("r-online-incomplete", 15), ("r-online-route-fail", 16), ("r-inconsistent", 17), ("r-set-vcc-fail", 18), ("r-ecp-in-testing", 19), ("r-elp-in-testing", 20), ("r-ecp-retries-exceeded", 21), ("r-invalid-ecp-state", 22), ("r-bad-ecp-rcvd", 23), ("r-send-rtmark-fail", 24), ("r-send-ecp-fail", 25), ("r-save-link-rtt-fail", 26), ("r-em-incnst", 27), ("r-pci-attach-fail", 28), ("r-buf-starv", 29), ("r-elp-fctl-mismatch", 30), ("r-eport-disabled", 31), ("r-trunk-with-vcxlt", 32), ("r-sw-fl-port-not-ready", 33), ("r-link-reinit", 34), ("r-domain-id-change", 35), ("r-auth-rejected", 36), ("r-auth-timeout", 37), ("r-auth-fail-retry", 38), ("r-fcr-conf-mismatch1", 39), ("r-fcr-conf-mismatch2", 40), ("r-fcr-port-ld-mode-mismatch", 41), ("r-fcr-ld-credit-mismatch", 42), ("r-fcr-set-vcc-failed", 43), ("r-fcr-set-rtc-failed", 44), ("r-fcr-elp-ver-inconsis", 45), ("r-fcr-elp-fctl-mismatch", 46), ("r-fcr-pid-mismatch", 47), ("r-fcr-tov-mismatch", 48), ("r-fcr-ld-incompat", 49), ("r-fcr-isolated", 50), ("r-elp-retries-exceeded", 51), ("r-fcr-exports-exceeded", 52), ("r-fcr-license", 53), ("r-fcr-conf-ex", 54), ("r-fcr-ftag-over", 55), ("r-fcr-ftag-conflict", 56), ("r-fcr-fowner-conflict", 57), ("r-fcr-zone-resource", 58), ("r-fcr-port-state-to", 59), ("r-fcr-authn-reject", 60), ("r-fcr-sec-fcs-list", 61), ("r-fcr-sec-failure", 62), ("r-fcr-incompatible-mode", 63), ("r-fcr-sec-scc-list", 64), ("r-fcr-generic", 65), ("r-sw-ex-port-not-ready", 66), ("r-fcr-class-f-incompat", 67), ("r-fcr-class-n-incompat", 68), ("r-fcr-invalid-flow-rcvd", 69), ("r-fcr-state-disabled", 70), ("r-fdd-strict-exist", 71), ("r-last-port-disable-msg", 72), ("r-sw-l-port-not-support", 73), ("r-peer-port-in-di-zone", 74), ("r-zone-incompat", 75), ("r-sw-config-l-port-not-support", 76), ("r-sw-port-mirror-configured", 77), ("r-nportlogin-inprogress", 78), ("r-nonpiv", 79), ("r-nomapping", 80), ("r-unknowntype", 81), ("r-nportoffline", 82), ("r-flogifailed", 83), ("r-nportbusy", 84), ("r-noflogi", 85), ("r-noflogiresp", 86), ("r-flogidupalpa", 87), ("r-loopcfg", 88), ("r-noenclicense", 89), ("r-nofiportmapping", 90), ("r-brcdfabconn", 91), ("r-port-reset", 92), ("r-floginport", 93), ("r-fdd-strict-conflict", 94), ("r-fdd-cfg-conflict", 95), ("r-fdd-cfg-conflict-na-neigh", 96), ("r-fcr-insistent-front-did-mismatch", 97), ("r-fcr-fabric-binding-failure", 98), ("r-fcr-non-standard-domain-offset", 99), ("r-area-in-use", 100), ("r-mstr-diff-pg", 101), ("r-mstr-diff-area", 102), ("r-ta-not-supported", 103), ("r-eport-not-supported", 104), ("r-fport-not-supported", 105), ("r-cfg-not-supported", 106), ("r-port-ll-th-exceeded", 107), ("r-port-synl-th-exceeded", 108), ("r-port-pe-th-exceeded", 109), ("f-port-disable-no-trk-lic", 110), ("r-port-inw-th-exceeded", 111), ("r-port-crc-th-exceeded", 112), ("f-port-tr-disable-speed-not-ok", 113), ("r-port-auto-disable", 114), ("r-fcr-export-in-non-base-sw", 115), ("r-base-switch-supports-no-device", 116), ("r-port-trunk-proto-error", 117), ("r-no-area-avail", 118), ("r-cannot-unbind-existing-area", 119), ("r-cannot-use-10bit-area", 120), ("r-authentication-required", 121), ("r-port-lr-th-exceeded", 122), ("r-fcr-export-lf-conflict", 123), ("r-incompat", 124), ("r-did-overlap", 125), ("r-zone-conflict", 126), ("r-eport-seg", 127), ("r-no-license", 128), ("r-platform-db", 129), ("r-sec-incompat", 130), ("r-sec-violation", 131), ("r-ecp-longdist", 132), ("r-dup-wwn", 133), ("r-eport-isolated", 134), ("r-ad", 135), ("r-esc-did-offset", 136), ("r-esc-etiz", 137), ("r-esc-fid", 138), ("r-safe-zone", 139), ("r-vf", 140), ("r-vf-bs-incompat", 141), ("r-pers-pid-on-lport", 142), ("r-pers-pid-portaddr-collision", 143), ("r-pers-pid-port-on-same-area", 144), ("r-pers-pid-port-addr-bnd", 145), ("r-msfr", 146), ("r-sw-halfbw-lic", 147), ("r-1g-mode-incompat", 148), ("r-10g-mode-incompat", 149), ("r-dual-mode-incompat", 150), ("r-implict-plt-service-block", 151), ("r-port-st-th-exceeded", 152), ("r-port-c3txto-th-exceeded", 153), ("r-eport-not-supported-def-sw", 154), ("r-eport-ll-th-exceeded", 155), ("r-eport-synl-th-exceeded", 156), ("r-eport-pe-th-exceeded", 157), ("r-eport-inw-th-exceeded", 158), ("r-eport-crc-th-exceeded", 159), ("r-eport-lr-th-exceeded", 160), ("r-eport-st-th-exceeded", 161), ("r-eport-c3txto-th-exceeded", 162), ("r-fopport-ll-th-exceeded", 163), ("r-fopport-synl-th-exceeded", 164), ("r-fopport-pe-th-exceeded", 165), ("r-fopport-inw-th-exceeded", 166), ("r-fopport-crc-th-exceeded", 167), ("r-fopport-lr-th-exceeded", 168), ("r-fopport-st-th-exceeded", 169), ("r-fopport-c3txto-th-exceeded", 170), ("r-fcuport-ll-th-exceeded", 171), ("r-fcuport-synl-th-exceeded", 172), ("r-fcuport-pe-th-exceeded", 173), ("r-fcuport-inw-th-exceeded", 174), ("r-fcuport-crc-th-exceeded", 175), ("r-fcuport-lr-th-exceeded", 176), ("r-fcuport-st-th-exceeded", 177), ("r-fcuport-c3txto-th-exceeded", 178), ("r-port-no-area-avail-pers-disable", 179), ("r-eport-locked", 180), ("r-enh-tizone", 181), ("r-sw-port-swap-not-supported", 182), ("r-fport-slow-drain-condition", 183), ("r-esc-vlanid", 184), ("r-port-recov-state", 185), ("r-port-auto-disable-losn", 186), ("r-port-auto-disable-losg", 187), ("r-port-auto-disable-ols", 188), ("r-port-auto-disable-nos", 189), ("r-port-auto-disable-lip", 190), ("r-port-compression", 191), ("r-port-encryption", 192), ("r-port-enccomp-res", 193), ("r-port-decommissioned", 194), ("r-port-dportmode", 195), ("r-port-dport-incompat", 196), ("r-port-enc-comp-mismatch", 197), ("r-non-rcs-rem-dom", 198), ("r-port-fips-comp-mismatch", 199), ("r-port-non-fips-comp-mismatch", 200), ("r-port-enc-auth-disabled", 201), ("r-port-disable-on-zeroize", 202), ("r-cfgspeed-not-supported", 203), ("r-fcr-ex-port-not-allowed", 204), ("r-port-duplicate-pwwn", 205), ("r-fcr-trunk-master-sfid-not-set", 206), ("r-nportistrunkmem", 207), ("r-policynotsupported", 208), ("r-no-icl-license", 209), ("r-no-ten-gig-license", 210), ("r-fdd-strict-scc-conflict", 211), ("r-fdd-strict-dcc-conflict", 212), ("r-fdd-strict-fcs-conflict", 213), ("r-fdd-strict-fabwide-conflict", 214), ("r-fdd-strict-pwd-conflict", 215), ("r-fcr-interop-conf", 216), ("r-port-enc-interop-conflict", 217), ("r-port-comp-interop-conflict", 218), ("r-no-port-open-rsp", 219), ("r-no-eicl-license", 220), ("r-eicl-license-limited", 221), ("r-esc-base-sw", 222), ("r-sw-cpu-overload", 223), ("r-no-icl-pod2-license", 224), ("r-port-area-mismatch-pers-disable", 225), ("r-unauthorized-device", 226), ("r-max-flogi-reached", 227), ("r-auth-not-supported-in-switch", 228), ("r-icl-ex-on-non-vf", 229), ("r-user-disabled-reason", 230))))
if mibBuilder.loadTexts: swFCPortDisableReason.setStatus('current')
if mibBuilder.loadTexts: swFCPortDisableReason.setDescription('It indicates the state change reason when port goes from online to offline')
swNsLocalNumEntry = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsLocalNumEntry.setStatus('current')
if mibBuilder.loadTexts: swNsLocalNumEntry.setDescription('The number of local Name Server entries.')
swNsLocalTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2), )
if mibBuilder.loadTexts: swNsLocalTable.setStatus('current')
if mibBuilder.loadTexts: swNsLocalTable.setDescription('The table of local Name Server entries.')
swNsLocalEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1), ).setIndexNames((0, "SW-MIB", "swNsEntryIndex"))
if mibBuilder.loadTexts: swNsLocalEntry.setStatus('current')
if mibBuilder.loadTexts: swNsLocalEntry.setDescription('An entry of the local Name Server database.')
swNsEntryIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsEntryIndex.setStatus('current')
if mibBuilder.loadTexts: swNsEntryIndex.setDescription('The object identifies the Name Server database entry.')
swNsPortID = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 2), OctetString().subtype(subtypeSpec=ValueSizeConstraint(4, 4)).setFixedLength(4)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsPortID.setStatus('current')
if mibBuilder.loadTexts: swNsPortID.setDescription('The object identifies the Fibre Channel port address ID of the entry.')
swNsPortType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 3), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("nPort", 1), ("nlPort", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsPortType.setStatus('current')
if mibBuilder.loadTexts: swNsPortType.setDescription('The object identifies the type of port: N_Port, NL_Port, etc., for this entry. The type is defined in FC-GS-2.')
swNsPortName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 4), FcWwn()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsPortName.setStatus('current')
if mibBuilder.loadTexts: swNsPortName.setDescription('The object identifies the Fibre Channel World_wide Name of the port entry.')
swNsPortSymb = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 5), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsPortSymb.setStatus('current')
if mibBuilder.loadTexts: swNsPortSymb.setDescription("The object identifies the contents of a Symbolic Name of the port entry. In FC-GS-2, a Symbolic Name consists of a byte array of 1 through 255 bytes, and the first byte of the array specifies the length of its 'contents'. This object variable corresponds to the 'contents' of the Symbolic Name, without the first byte.")
swNsNodeName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 6), FcWwn()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsNodeName.setStatus('current')
if mibBuilder.loadTexts: swNsNodeName.setDescription('The object identifies the Fibre Channel World_wide Name of the associated node as defined in FC-GS-2.')
swNsNodeSymb = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 7), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsNodeSymb.setStatus('current')
if mibBuilder.loadTexts: swNsNodeSymb.setDescription("The object identifies the contents of a Symbolic Name of the the node associated with the entry. In FC-GS-2, a Symbolic Name consists of a byte array of 1 through 255 bytes, and the first byte of the array specifies the length of its 'contents'. This object variable corresponds to the 'contents' of the Symbolic Name, without the first byte (specifying the length).")
swNsIPA = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 8), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsIPA.setStatus('current')
if mibBuilder.loadTexts: swNsIPA.setDescription('The object identifies the Initial Process Associator of the node for the entry as defined in FC-GS-2.')
swNsIpAddress = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 9), OctetString().subtype(subtypeSpec=ValueSizeConstraint(16, 16)).setFixedLength(16)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsIpAddress.setStatus('current')
if mibBuilder.loadTexts: swNsIpAddress.setDescription('The object identifies the IP address of the node for the entry as defined in FC-GS-2. The format of the address is in IPv6.')
swNsCos = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 10), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15))).clone(namedValues=NamedValues(("class-F", 1), ("class-1", 2), ("class-F-1", 3), ("class-2", 4), ("class-F-2", 5), ("class-1-2", 6), ("class-F-1-2", 7), ("class-3", 8), ("class-F-3", 9), ("class-1-3", 10), ("class-F-1-3", 11), ("class-2-3", 12), ("class-F-2-3", 13), ("class-1-2-3", 14), ("class-F-1-2-3", 15)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsCos.setStatus('current')
if mibBuilder.loadTexts: swNsCos.setDescription('The object identifies the class of services supported by the port. The value is a bit-map defined as follows: o bit 0 is class F, o bit 1 is class 1, o bit 2 is class 2, o bit 3 is class 3, o bit 4 is class 4, etc.')
swNsFc4 = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 11), OctetString().subtype(subtypeSpec=ValueSizeConstraint(32, 32)).setFixedLength(32)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsFc4.setStatus('current')
if mibBuilder.loadTexts: swNsFc4.setDescription('The object identifies the FC-4s supported by the port as defined in FC-GS-2.')
swNsIpNxPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 12), OctetString().subtype(subtypeSpec=ValueSizeConstraint(16, 16)).setFixedLength(16)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsIpNxPort.setStatus('current')
if mibBuilder.loadTexts: swNsIpNxPort.setDescription('The object identifies IpAddress of the Nx_port for the entry.')
swNsWwn = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 13), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsWwn.setStatus('current')
if mibBuilder.loadTexts: swNsWwn.setDescription('The object identifies the World Wide Name (WWN) of the Fx_port for the entry.')
swNsHardAddr = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 14), OctetString().subtype(subtypeSpec=ValueSizeConstraint(3, 3)).setFixedLength(3)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swNsHardAddr.setStatus('current')
if mibBuilder.loadTexts: swNsHardAddr.setDescription('The object identifies the 24-bit hard address of the node for the entry.')
swEventTrapLevel = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 1), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4, 5))).clone(namedValues=NamedValues(("none", 0), ("critical", 1), ("error", 2), ("warning", 3), ("informational", 4), ("debug", 5)))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swEventTrapLevel.setStatus('deprecated')
if mibBuilder.loadTexts: swEventTrapLevel.setDescription("swAgtTrapSeverityLevel, in absence of swEventTrapLevel, specifies the Trap Severity Level of each defined trap recipient host. This object specifies the swEventTrap level in conjunction with an event's severity level. When an event occurs and if its severity level is at or below the value specified by this object instance, the agent will send the associated swEventTrap to configured recipients.")
swEventNumEntries = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventNumEntries.setStatus('current')
if mibBuilder.loadTexts: swEventNumEntries.setDescription('The number of entries in the Event Table.')
swEventTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5), )
if mibBuilder.loadTexts: swEventTable.setStatus('current')
if mibBuilder.loadTexts: swEventTable.setDescription('The table of event entries.')
swEventEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1), ).setIndexNames((0, "SW-MIB", "swEventIndex"))
if mibBuilder.loadTexts: swEventEntry.setStatus('current')
if mibBuilder.loadTexts: swEventEntry.setDescription('An entry of the event table.')
swEventIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventIndex.setStatus('current')
if mibBuilder.loadTexts: swEventIndex.setDescription('This object identifies the event entry.')
swEventTimeInfo = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 2), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 64))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventTimeInfo.setStatus('current')
if mibBuilder.loadTexts: swEventTimeInfo.setDescription('This object identifies the date and time when this event occurred, in textual format.')
swEventLevel = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 3), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5))).clone(namedValues=NamedValues(("critical", 1), ("error", 2), ("warning", 3), ("informational", 4), ("debug", 5)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventLevel.setStatus('current')
if mibBuilder.loadTexts: swEventLevel.setDescription('This object identifies the severity level of this event entry.')
swEventRepeatCount = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventRepeatCount.setStatus('current')
if mibBuilder.loadTexts: swEventRepeatCount.setDescription('This object identifies how many times this particular event has occurred.')
swEventDescr = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 5), DisplayString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventDescr.setStatus('current')
if mibBuilder.loadTexts: swEventDescr.setDescription('This object identifies the textual description of the event.')
swEventVfId = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 6), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 255))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEventVfId.setStatus('current')
if mibBuilder.loadTexts: swEventVfId.setDescription('This object identifies the Virtual fabric id.')
class SwFwActs(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63))
namedValues = NamedValues(("swFwNoAction", 0), ("swFwErrlog", 1), ("swFwSnmptrap", 2), ("swFwErrlogSnmptrap", 3), ("swFwPortloglock", 4), ("swFwErrlogPortloglock", 5), ("swFwSnmptrapPortloglock", 6), ("swFwErrlogSnmptrapPortloglock", 7), ("swFwRn", 8), ("swFwElRn", 9), ("swFwStRn", 10), ("swFwElStRn", 11), ("swFwPlRn", 12), ("swFwElPlRn", 13), ("swFwStPlRn", 14), ("swFwElStPlRn", 15), ("swFwMailAlert", 16), ("swFwMailAlertErrlog", 17), ("swFwMailAlertSnmptrap", 18), ("swFwMailAlertErrlogSnmptrap", 19), ("swFwMailAlertPortloglock", 20), ("swFwMailAlertErrlogPortloglock", 21), ("swFwMailAlertSnmptrapPortloglock", 22), ("swFwMailAlertErrlogSnmptrapPortloglock", 23), ("swFwMailAlertRn", 24), ("swFwElMailAlertRn", 25), ("swFwMailAlertStRn", 26), ("swFwMailAlertElStRn", 27), ("swFwMailAlertPlRn", 28), ("swFwMailAlertElPlRn", 29), ("swFwMailAlertStPlRn", 30), ("swFwMailAlertElStPlRn", 31), ("swFwPf", 32), ("swFwElPf", 33), ("swFwStPf", 34), ("swFwElStPf", 35), ("swFwPlPf", 36), ("swFwElPlPf", 37), ("swFwStPlPf", 38), ("swFwElStPlPf", 39), ("swFwRnPf", 40), ("swFwElRnPf", 41), ("swFwStRnPf", 42), ("swFwElStRnPf", 43), ("swFwPlRnPf", 44), ("swFwElPlRnPf", 45), ("swFwStPlRnPf", 46), ("swFwElStPlRnPf", 47), ("swFwMailAlertPf", 48), ("swFwMailAlertElPf", 49), ("swFwMailAlertStPf", 50), ("swFwMailAlertElStPf", 51), ("swFwMailAlertPlPf", 52), ("swFwMailAlertElPlPf", 53), ("swFwMailAlertStPlPf", 54), ("swFwMailAlertElStPlPf", 55), ("swFwMailAlertRnPf", 56), ("swFwMailAlertElRnPf", 57), ("swFwMailAlertStRnPf", 58), ("swFwMailAlertElStRnPf", 59), ("swFwMailAlertPlRnPf", 60), ("swFwMailAlertElPlRnPf", 61), ("swFwMailAlertStPlRnPf", 62), ("swFwMailAlertElStPlRnPf", 63))
class SwFwLevels(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3))
namedValues = NamedValues(("swFwReserved", 1), ("swFwDefault", 2), ("swFwCustom", 3))
class SwFwClassesAreas(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152))
namedValues = NamedValues(("swFwEnvTemp", 1), ("swFwEnvFan", 2), ("swFwEnvPs", 3), ("swFwTransceiverTemp", 4), ("swFwTransceiverRxp", 5), ("swFwTransceiverTxp", 6), ("swFwTransceiverCurrent", 7), ("swFwPortLink", 8), ("swFwPortSync", 9), ("swFwPortSignal", 10), ("swFwPortPe", 11), ("swFwPortWords", 12), ("swFwPortCrcs", 13), ("swFwPortRXPerf", 14), ("swFwPortTXPerf", 15), ("swFwPortState", 16), ("swFwFabricEd", 17), ("swFwFabricFr", 18), ("swFwFabricDi", 19), ("swFwFabricSc", 20), ("swFwFabricZc", 21), ("swFwFabricFq", 22), ("swFwFabricFl", 23), ("swFwFabricGs", 24), ("swFwEPortLink", 25), ("swFwEPortSync", 26), ("swFwEPortSignal", 27), ("swFwEPortPe", 28), ("swFwEPortWords", 29), ("swFwEPortCrcs", 30), ("swFwEPortRXPerf", 31), ("swFwEPortTXPerf", 32), ("swFwEPortState", 33), ("swFwFCUPortLink", 34), ("swFwFCUPortSync", 35), ("swFwFCUPortSignal", 36), ("swFwFCUPortPe", 37), ("swFwFCUPortWords", 38), ("swFwFCUPortCrcs", 39), ("swFwFCUPortRXPerf", 40), ("swFwFCUPortTXPerf", 41), ("swFwFCUPortState", 42), ("swFwFOPPortLink", 43), ("swFwFOPPortSync", 44), ("swFwFOPPortSignal", 45), ("swFwFOPPortPe", 46), ("swFwFOPPortWords", 47), ("swFwFOPPortCrcs", 48), ("swFwFOPPortRXPerf", 49), ("swFwFOPPortTXPerf", 50), ("swFwFOPPortState", 51), ("swFwPerfALPACRC", 52), ("swFwPerfEToECRC", 53), ("swFwPerfEToERxCnt", 54), ("swFwPerfEToETxCnt", 55), ("swFwPerffltCusDef", 56), ("swFwTransceiverVoltage", 57), ("swFwSecTelnetViolations", 58), ("swFwSecHTTPViolations", 59), ("swFwSecAPIViolations", 60), ("swFwSecRSNMPViolations", 61), ("swFwSecWSNMPViolations", 62), ("swFwSecSESViolations", 63), ("swFwSecMSViolations", 64), ("swFwSecSerialViolations", 65), ("swFwSecFPViolations", 66), ("swFwSecSCCViolations", 67), ("swFwSecDCCViolations", 68), ("swFwSecLoginViolations", 69), ("swFwSecInvalidTS", 70), ("swFwSecInvalidSign", 71), ("swFwSecInvalidCert", 72), ("swFwSecSlapFail", 73), ("swFwSecSlapBadPkt", 74), ("swFwSecTSOutSync", 75), ("swFwSecNoFcs", 76), ("swFwSecIncompDB", 77), ("swFwSecIllegalCmd", 78), ("swFwSAMTotalDownTime", 79), ("swFwSAMTotalUpTime", 80), ("swFwSAMDurationOfOccur", 81), ("swFwSAMFreqOfOccur", 82), ("swFwResourceFlash", 83), ("swFwEPortUtil", 84), ("swFwEPortPktl", 85), ("swFwPortLr", 86), ("swFwEPortLr", 87), ("swFwFCUPortLr", 88), ("swFwFOPPortLr", 89), ("swFwPortC3Discard", 90), ("swFwEPortC3Discard", 91), ("swFwFCUPortC3Discard", 92), ("swFwFOPPortC3Discard", 93), ("swFwVEPortStateChange", 94), ("swFwVEPortUtil", 95), ("swFwVEPortPktLoss", 96), ("swFwEPortTrunkUtil", 97), ("swFwFCUPortTrunkUtil", 98), ("swFwFOPPortTrunkUtil", 99), ("swFwCPUMemUsage", 100), ("filterFmCfg1", 101), ("filterFmCfg2", 102), ("filterFmCfg3", 103), ("filterFmCfg4", 104), ("filterFmCfg5", 105), ("filterFmCfg6", 106), ("filterFmCfg7", 107), ("filterFmCfg8", 108), ("filterFmCfg9", 109), ("filterFmCfg10", 110), ("filterFmCfg11", 111), ("filterFmCfg12", 112), ("filterFmCfg13", 113), ("filterFmCfg14", 114), ("filterFmCfg15", 115), ("filterFmCfg16", 116), ("filterFmCfg17", 117), ("filterFmCfg18", 118), ("filterFmCfg19", 119), ("filterFmCfg20", 120), ("filterFmCfg21", 121), ("filterFmCfg22", 122), ("filterFmCfg23", 123), ("filterFmCfg24", 124), ("filterFmCfg25", 125), ("filterFmCfg26", 126), ("filterFmCfg27", 127), ("filterFmCfg28", 128), ("filterFmCfg29", 129), ("filterFmCfg30", 130), ("filterFmCfg31", 131), ("filterFmCfg32", 132), ("filterFmCfg33", 133), ("filterFmCfg34", 134), ("filterFmCfg35", 135), ("filterFmCfg36", 136), ("filterFmCfg37", 137), ("filterFmCfg38", 138), ("filterFmCfg39", 139), ("filterFmCfg40", 140), ("filterFmCfg41", 141), ("filterFmCfg42", 142), ("filterFmCfg43", 143), ("filterFmCfg44", 144), ("filterFmCfg45", 145), ("filterFmCfg46", 146), ("filterFmCfg47", 147), ("filterFmCfg48", 148), ("filterFmCfg49", 149), ("filterFmCfg50", 150), ("filterFmCfg51", 151), ("swFwPowerOnHours", 152))
class SwFwWriteVals(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2))
namedValues = NamedValues(("swFwCancelWrite", 1), ("swFwApplyWrite", 2))
class SwFwTimebase(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5))
namedValues = NamedValues(("swFwTbNone", 1), ("swFwTbSec", 2), ("swFwTbMin", 3), ("swFwTbHour", 4), ("swFwTbDay", 5))
class SwFwStatus(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2))
namedValues = NamedValues(("disabled", 1), ("enabled", 2))
class SwFwEvent(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7))
namedValues = NamedValues(("started", 1), ("changed", 2), ("exceeded", 3), ("below", 4), ("above", 5), ("inBetween", 6), ("lowBufferCrsd", 7))
class SwFwBehavior(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2))
namedValues = NamedValues(("triggered", 1), ("continuous", 2))
class SwFwState(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3))
namedValues = NamedValues(("swFwInformative", 1), ("swFwNormal", 2), ("swFwFaulty", 3))
class SwFwLicense(Integer32):
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2))
namedValues = NamedValues(("swFwLicensed", 1), ("swFwNotLicensed", 2))
swFwFabricWatchLicense = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 1), SwFwLicense()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwFabricWatchLicense.setStatus('current')
if mibBuilder.loadTexts: swFwFabricWatchLicense.setDescription('tells if licensed or not.')
swFwClassAreaTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2), )
if mibBuilder.loadTexts: swFwClassAreaTable.setStatus('current')
if mibBuilder.loadTexts: swFwClassAreaTable.setDescription('The table of classes and areas.')
swFwClassAreaEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1), ).setIndexNames((0, "SW-MIB", "swFwClassAreaIndex"))
if mibBuilder.loadTexts: swFwClassAreaEntry.setStatus('current')
if mibBuilder.loadTexts: swFwClassAreaEntry.setDescription('An entry of the classes and areas.')
swFwClassAreaIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 1), SwFwClassesAreas()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwClassAreaIndex.setStatus('current')
if mibBuilder.loadTexts: swFwClassAreaIndex.setDescription('This object identifies the class type.')
swFwWriteThVals = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 2), SwFwWriteVals()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwWriteThVals.setStatus('current')
if mibBuilder.loadTexts: swFwWriteThVals.setDescription('This object is set to apply the value changes.')
swFwDefaultUnit = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 3), DisplayString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultUnit.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultUnit.setDescription('A Default unit string name for a threshold area.')
swFwDefaultTimebase = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 4), SwFwTimebase()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultTimebase.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultTimebase.setDescription('A Default timebase for the current threshold counter.')
swFwDefaultLow = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultLow.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultLow.setDescription('A Default low threshold value.')
swFwDefaultHigh = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 6), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultHigh.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultHigh.setDescription('A Default high threshold value.')
swFwDefaultBufSize = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultBufSize.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultBufSize.setDescription('A Default buffer size value.')
swFwCustUnit = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 8), DisplayString()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwCustUnit.setStatus('current')
if mibBuilder.loadTexts: swFwCustUnit.setDescription('A custom unit string name for a threshold area.')
swFwCustTimebase = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 9), SwFwTimebase()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustTimebase.setStatus('current')
if mibBuilder.loadTexts: swFwCustTimebase.setDescription('A custom timebase for the current threshold counter.')
swFwCustLow = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 10), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustLow.setStatus('current')
if mibBuilder.loadTexts: swFwCustLow.setDescription('A custom low threshold value.')
swFwCustHigh = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 11), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustHigh.setStatus('current')
if mibBuilder.loadTexts: swFwCustHigh.setDescription('A custom high threshold value.')
swFwCustBufSize = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 12), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustBufSize.setStatus('current')
if mibBuilder.loadTexts: swFwCustBufSize.setDescription('A custom buffer size value.')
swFwThLevel = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 13), SwFwLevels()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwThLevel.setStatus('current')
if mibBuilder.loadTexts: swFwThLevel.setDescription('A level where all the threshold values are set at.')
swFwWriteActVals = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 14), SwFwWriteVals()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwWriteActVals.setStatus('current')
if mibBuilder.loadTexts: swFwWriteActVals.setDescription('This object is set to apply act value changes.')
swFwDefaultChangedActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 15), SwFwActs()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultChangedActs.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultChangedActs.setDescription('Default action matrix for changed event.')
swFwDefaultExceededActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 16), SwFwActs()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultExceededActs.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultExceededActs.setDescription('Default action matrix for exceeded event.')
swFwDefaultBelowActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 17), SwFwActs()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultBelowActs.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultBelowActs.setDescription('Default action matrix for below event.')
swFwDefaultAboveActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 18), SwFwActs()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultAboveActs.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultAboveActs.setDescription('Default action matrix for above event.')
swFwDefaultInBetweenActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 19), SwFwActs()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwDefaultInBetweenActs.setStatus('current')
if mibBuilder.loadTexts: swFwDefaultInBetweenActs.setDescription('Default action matrix for in-between event.')
swFwCustChangedActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 20), SwFwActs()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustChangedActs.setStatus('current')
if mibBuilder.loadTexts: swFwCustChangedActs.setDescription('custom action matrix for changed event.')
swFwCustExceededActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 21), SwFwActs()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustExceededActs.setStatus('current')
if mibBuilder.loadTexts: swFwCustExceededActs.setDescription('custom action matrix for exceeded event.')
swFwCustBelowActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 22), SwFwActs()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustBelowActs.setStatus('current')
if mibBuilder.loadTexts: swFwCustBelowActs.setDescription('custom action matrix for below event.')
swFwCustAboveActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 23), SwFwActs()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustAboveActs.setStatus('current')
if mibBuilder.loadTexts: swFwCustAboveActs.setDescription('custom action matrix for above event.')
swFwCustInBetweenActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 24), SwFwActs()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwCustInBetweenActs.setStatus('current')
if mibBuilder.loadTexts: swFwCustInBetweenActs.setDescription('custom action matrix for in-between event.')
swFwValidActs = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 25), SwFwActs()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwValidActs.setStatus('current')
if mibBuilder.loadTexts: swFwValidActs.setDescription('matrix of valid acts for an class/area.')
swFwActLevel = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 26), SwFwLevels()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwActLevel.setStatus('current')
if mibBuilder.loadTexts: swFwActLevel.setDescription('A level where all the actions are set at.')
swFwThresholdTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3), )
if mibBuilder.loadTexts: swFwThresholdTable.setStatus('current')
if mibBuilder.loadTexts: swFwThresholdTable.setDescription('The table of individual thresholds.')
swFwThresholdEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1), ).setIndexNames((0, "SW-MIB", "swFwClassAreaIndex"), (0, "SW-MIB", "swFwThresholdIndex"))
if mibBuilder.loadTexts: swFwThresholdEntry.setStatus('current')
if mibBuilder.loadTexts: swFwThresholdEntry.setDescription('An entry of an individual threshold.')
swFwThresholdIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwThresholdIndex.setStatus('current')
if mibBuilder.loadTexts: swFwThresholdIndex.setDescription('This object identifies the element index of an threshold.')
swFwStatus = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 2), SwFwStatus()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwStatus.setStatus('current')
if mibBuilder.loadTexts: swFwStatus.setDescription('This object identifies if an threshold is enabled or disabled.')
swFwName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 3), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwName.setStatus('current')
if mibBuilder.loadTexts: swFwName.setDescription('This object is a name of the threshold.')
swFwLabel = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 4), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 70))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwLabel.setStatus('current')
if mibBuilder.loadTexts: swFwLabel.setDescription('This object is a label of the threshold.')
swFwCurVal = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwCurVal.setStatus('current')
if mibBuilder.loadTexts: swFwCurVal.setDescription('This object is a current counter of the threshold.')
swFwLastEvent = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 6), SwFwEvent()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwLastEvent.setStatus('current')
if mibBuilder.loadTexts: swFwLastEvent.setDescription('This object is a last event type of the threshold.')
swFwLastEventVal = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwLastEventVal.setStatus('current')
if mibBuilder.loadTexts: swFwLastEventVal.setDescription('This object is a last event value of the threshold.')
swFwLastEventTime = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 8), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwLastEventTime.setStatus('current')
if mibBuilder.loadTexts: swFwLastEventTime.setDescription('This object is a last event time of the threshold.')
swFwLastState = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 9), SwFwState()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwLastState.setStatus('current')
if mibBuilder.loadTexts: swFwLastState.setDescription('This object is a last event state of the threshold.')
swFwBehaviorType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 10), SwFwBehavior()).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwBehaviorType.setStatus('current')
if mibBuilder.loadTexts: swFwBehaviorType.setDescription('A behavior of which the thresholds generate event.')
swFwBehaviorInt = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 11), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readwrite")
if mibBuilder.loadTexts: swFwBehaviorInt.setStatus('current')
if mibBuilder.loadTexts: swFwBehaviorInt.setDescription('A integer of which the thresholds generate continuous event.')
swFwLastSeverityLevel = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 12), SwSevType()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swFwLastSeverityLevel.setStatus('current')
if mibBuilder.loadTexts: swFwLastSeverityLevel.setDescription('This object is a last event severity level of the threshold.')
swEndDeviceRlsTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1), )
if mibBuilder.loadTexts: swEndDeviceRlsTable.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceRlsTable.setDescription("The table of individual end devices' rls.")
swEndDeviceRlsEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1), ).setIndexNames((0, "SW-MIB", "swEndDevicePort"), (0, "SW-MIB", "swEndDeviceAlpa"))
if mibBuilder.loadTexts: swEndDeviceRlsEntry.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceRlsEntry.setDescription("An entry of an individual end devices' rls.")
swEndDevicePort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647)))
if mibBuilder.loadTexts: swEndDevicePort.setStatus('current')
if mibBuilder.loadTexts: swEndDevicePort.setDescription('This object identifies the port of the end device.')
swEndDeviceAlpa = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647)))
if mibBuilder.loadTexts: swEndDeviceAlpa.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceAlpa.setDescription('This object identifies the alpa of the end device.')
swEndDevicePortID = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 3), OctetString().subtype(subtypeSpec=ValueSizeConstraint(4, 4)).setFixedLength(4)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDevicePortID.setStatus('current')
if mibBuilder.loadTexts: swEndDevicePortID.setDescription('The object identifies the Fibre Channel port address ID of the entry.')
swEndDeviceLinkFailure = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 4), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDeviceLinkFailure.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceLinkFailure.setDescription('Link failure count for the end device.')
swEndDeviceSyncLoss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 5), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDeviceSyncLoss.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceSyncLoss.setDescription('Sync loss count for the end device.')
swEndDeviceSigLoss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 6), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDeviceSigLoss.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceSigLoss.setDescription('Sig loss count for the end device.')
swEndDeviceProtoErr = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 7), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDeviceProtoErr.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceProtoErr.setDescription('Protocol err count for the end device.')
swEndDeviceInvalidWord = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 8), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDeviceInvalidWord.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceInvalidWord.setDescription('Invalid word count for the end device.')
swEndDeviceInvalidCRC = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 9), Counter32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swEndDeviceInvalidCRC.setStatus('current')
if mibBuilder.loadTexts: swEndDeviceInvalidCRC.setDescription('Invalid CRC count for the end device.')
swGroupTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1), )
if mibBuilder.loadTexts: swGroupTable.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupTable.setDescription('The table of groups. This may not be available on all versions of Fabric OS.')
swGroupEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1), ).setIndexNames((0, "SW-MIB", "swGroupIndex"))
if mibBuilder.loadTexts: swGroupEntry.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupEntry.setDescription('An entry of table of groups.')
swGroupIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swGroupIndex.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupIndex.setDescription('This object is the group index starting from 1.')
swGroupName = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1, 2), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swGroupName.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupName.setDescription('This object identifies the name of the group.')
swGroupType = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1, 3), OctetString().subtype(subtypeSpec=ValueSizeConstraint(0, 15))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swGroupType.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupType.setDescription('This object identifies the type of the group.')
swGroupMemTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2), )
if mibBuilder.loadTexts: swGroupMemTable.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupMemTable.setDescription('The table of members of all groups. This may not be available on all versions of Fabric OS.')
swGroupMemEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1), ).setIndexNames((0, "SW-MIB", "swGroupId"), (0, "SW-MIB", "swGroupMemWwn"))
if mibBuilder.loadTexts: swGroupMemEntry.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupMemEntry.setDescription('An entry for a member of a group.')
swGroupId = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swGroupId.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupId.setDescription('This object identifies the Group Id of the member switch.')
swGroupMemWwn = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1, 2), FcWwn()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swGroupMemWwn.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupMemWwn.setDescription('This object identifies the WWN of the member switch.')
swGroupMemPos = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swGroupMemPos.setStatus('obsolete')
if mibBuilder.loadTexts: swGroupMemPos.setDescription('This object identifies position of the member switch in the group. This is based on the order that the switches were added in the group.')
swBlmPerfALPAMntTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1), )
if mibBuilder.loadTexts: swBlmPerfALPAMntTable.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfALPAMntTable.setDescription('ALPA monitoring counter Table. ')
swBlmPerfALPAMntEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1), ).setIndexNames((0, "SW-MIB", "swBlmPerfAlpaPort"), (0, "SW-MIB", "swBlmPerfAlpaIndx"))
if mibBuilder.loadTexts: swBlmPerfALPAMntEntry.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfALPAMntEntry.setDescription(' ALPA monitoring counter for given ALPA.')
swBlmPerfAlpaPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 1), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfAlpaPort.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfAlpaPort.setDescription(' This Object identifies the port index of the switch.')
swBlmPerfAlpaIndx = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 126))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfAlpaIndx.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfAlpaIndx.setDescription(' This Object identifies the ALPA index. There can be 126 ALPA values')
swBlmPerfAlpa = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfAlpa.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfAlpa.setDescription(" This Object identifies the ALPA values. These values range between x'01' and x'EF'(1 to 239). ALPA value x'00' is reserved for FL_Port If Alpa device is invalid, then it will have -1 value. ")
swBlmPerfAlpaCRCCnt = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 4), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfAlpaCRCCnt.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfAlpaCRCCnt.setDescription('Get CRC count for given ALPA and port. This monitoring provides information on the number of CRC errors occurred on the frames destined to each possible ALPA attached to a specific port.')
swBlmPerfEEMntTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2), )
if mibBuilder.loadTexts: swBlmPerfEEMntTable.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEEMntTable.setDescription(' End-to-End monitoring counter Table')
swBlmPerfEEMntEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1), ).setIndexNames((0, "SW-MIB", "swBlmPerfEEPort"), (0, "SW-MIB", "swBlmPerfEERefKey"))
if mibBuilder.loadTexts: swBlmPerfEEMntEntry.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEEMntEntry.setDescription('End-to-End monitoring counter for given port.')
swBlmPerfEEPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 1), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEEPort.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEEPort.setDescription(' This object identifies the port number of the switch.')
swBlmPerfEERefKey = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 8))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEERefKey.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEERefKey.setDescription('This object identifies the reference number of the counter. This reference is number assigned when a filter is created. In SNMP Index start one instead of 0, add one to actual ref key')
swBlmPerfEECRC = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 3), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEECRC.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEECRC.setDescription(' Get End to End CRC error for the frames that matched the SID-DID pair.')
swBlmPerfEEFCWRx = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 4), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEEFCWRx.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEEFCWRx.setDescription('Get End to End count of Fibre Channel words (FCW), received by the port, that matched the SID-DID pair. ')
swBlmPerfEEFCWTx = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 5), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEEFCWTx.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEEFCWTx.setDescription('Get End to End count of Fibre Channel words (FCW), transmitted by the port, that matched the SID-DID pair. ')
swBlmPerfEESid = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 6), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEESid.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEESid.setDescription(' Gets SID info by reference number. SID (Source Identifier) is a 3-byte field in the frame header used to indicate the address identifier of the N-Port from which the frame was sent.')
swBlmPerfEEDid = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfEEDid.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfEEDid.setDescription('Gets DID info by reference number. DID (Destination Identifier) is a 3-byte field in the frame header used to indicate the address identifier of the N-Port to which the frame was sent.')
swBlmPerfFltMntTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3), )
if mibBuilder.loadTexts: swBlmPerfFltMntTable.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfFltMntTable.setDescription('Filter based monitoring counter.')
swBlmPerfFltMntEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1), ).setIndexNames((0, "SW-MIB", "swBlmPerfFltPort"), (0, "SW-MIB", "swBlmPerfFltRefkey"))
if mibBuilder.loadTexts: swBlmPerfFltMntEntry.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfFltMntEntry.setDescription(' Filter base monitoring counter for given port.')
swBlmPerfFltPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 1), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfFltPort.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfFltPort.setDescription('This object identifies the port number of the switch.')
swBlmPerfFltRefkey = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 8))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfFltRefkey.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfFltRefkey.setDescription(' This object identifies the reference number of the filter. This reference number is assigned when a filter is created. In SNMP Index start one instead of 0, add one to actual ref key')
swBlmPerfFltCnt = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 3), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfFltCnt.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfFltCnt.setDescription('Get statistics of filter based monitor. Filter based monitoring provides information about a filter hit count such as 1. Read command 2. SCSI or IP traffic 3. SCSI Read/Write')
swBlmPerfFltAlias = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 4), DisplayString().subtype(subtypeSpec=ValueSizeConstraint(0, 20))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swBlmPerfFltAlias.setStatus('current')
if mibBuilder.loadTexts: swBlmPerfFltAlias.setDescription(' Alias name for the filter.')
swSwitchTrunkable = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 1), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(8, 0))).clone(namedValues=NamedValues(("yes", 8), ("no", 0)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swSwitchTrunkable.setStatus('current')
if mibBuilder.loadTexts: swSwitchTrunkable.setDescription('The trunking status of the switch - whether the switch supports the trunking feature or not. The values are yes(8) - the trunking feature is supported no(0). - the trunking feature is not supported. ')
swTrunkTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2), )
if mibBuilder.loadTexts: swTrunkTable.setStatus('current')
if mibBuilder.loadTexts: swTrunkTable.setDescription(' Table to display trunking information for the switch. ')
swTrunkEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1), ).setIndexNames((0, "SW-MIB", "swTrunkPortIndex"))
if mibBuilder.loadTexts: swTrunkEntry.setStatus('current')
if mibBuilder.loadTexts: swTrunkEntry.setDescription('Entry for the trunking table.')
swTrunkPortIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 1), SwPortIndex()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkPortIndex.setStatus('current')
if mibBuilder.loadTexts: swTrunkPortIndex.setDescription('This object identifies the switch port index. Note that the value of a port index is 1 higher than the port number labeled on the front panel. e.g. port index 1 correspond to port number 0. ')
swTrunkGroupNumber = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkGroupNumber.setStatus('current')
if mibBuilder.loadTexts: swTrunkGroupNumber.setDescription('This object is a logical entity which specifies the Group Number to which the port belongs to. If this value is Zero it means the port is not Trunked.')
swTrunkMaster = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 3), SwTrunkMaster()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkMaster.setStatus('current')
if mibBuilder.loadTexts: swTrunkMaster.setDescription('Port number that is the trunk master of the group. The trunk master implicitly defines the group. All ports with the same master are considered to be part of the same group.')
swPortTrunked = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 4), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1))).clone(namedValues=NamedValues(("disabled", 0), ("enabled", 1)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swPortTrunked.setStatus('current')
if mibBuilder.loadTexts: swPortTrunked.setDescription('The active trunk status for a member port. Values are enabled(1) or disabled(0).')
swTrunkGrpTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3), )
if mibBuilder.loadTexts: swTrunkGrpTable.setStatus('current')
if mibBuilder.loadTexts: swTrunkGrpTable.setDescription('Table to display trunking Performance information for the switch.')
swTrunkGrpEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1), ).setIndexNames((0, "SW-MIB", "swTrunkGrpNumber"))
if mibBuilder.loadTexts: swTrunkGrpEntry.setStatus('current')
if mibBuilder.loadTexts: swTrunkGrpEntry.setDescription('Entry for the trunking Group table.')
swTrunkGrpNumber = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 2147483647))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkGrpNumber.setStatus('current')
if mibBuilder.loadTexts: swTrunkGrpNumber.setDescription('This object is a logical entity which specifies the Group Number to which port belongs to.')
swTrunkGrpMaster = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 2), SwTrunkMaster()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkGrpMaster.setStatus('current')
if mibBuilder.loadTexts: swTrunkGrpMaster.setDescription('This object gives the master port id for the TrunkGroup.')
swTrunkGrpTx = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 3), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkGrpTx.setStatus('current')
if mibBuilder.loadTexts: swTrunkGrpTx.setDescription('Gives the aggregate value of the transmitted words from this TrunkGroup.')
swTrunkGrpRx = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 4), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTrunkGrpRx.setStatus('current')
if mibBuilder.loadTexts: swTrunkGrpRx.setDescription('Gives the aggregate value of the received words by this TrunkGroup.')
swTopTalkerMntMode = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 1), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(1, 2))).clone(namedValues=NamedValues(("fabricmode", 1), ("portmode", 2)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntMode.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntMode.setDescription('Gives the mode in which toptalker is installed')
swTopTalkerMntNumEntries = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntNumEntries.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntNumEntries.setDescription('Gives the number of toptalking flows')
swTopTalkerMntTable = MibTable((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3), )
if mibBuilder.loadTexts: swTopTalkerMntTable.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntTable.setDescription('Table to display toptalkingflows')
swTopTalkerMntEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1), ).setIndexNames((0, "SW-MIB", "swTopTalkerMntIndex"))
if mibBuilder.loadTexts: swTopTalkerMntEntry.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntEntry.setDescription('Entry for the toptalker table')
swTopTalkerMntIndex = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntIndex.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntIndex.setDescription('This object identifies the list/object entry')
swTopTalkerMntPort = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntPort.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntPort.setDescription('This object identifies the switch port number on which the f-port mode toptalker is added.')
swTopTalkerMntSpid = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntSpid.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntSpid.setDescription('This object identifies the SID of the host')
swTopTalkerMntDpid = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntDpid.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntDpid.setDescription('This object identifies the DID of the SID-DID pair')
swTopTalkerMntflow = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 32))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntflow.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntflow.setDescription('This object identifies the traffic flow in MB/sec')
swTopTalkerMntSwwn = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 6), FcWwn()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntSwwn.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntSwwn.setDescription('This object identifies the SID in WWN format of the host')
swTopTalkerMntDwwn = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 7), FcWwn()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swTopTalkerMntDwwn.setStatus('current')
if mibBuilder.loadTexts: swTopTalkerMntDwwn.setDescription('This object identifies the DID in WWN format of the SID-DID pair')
swCpuUsage = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 100))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swCpuUsage.setStatus('current')
if mibBuilder.loadTexts: swCpuUsage.setDescription("System's cpu usage.")
swCpuNoOfRetries = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 100))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swCpuNoOfRetries.setStatus('current')
if mibBuilder.loadTexts: swCpuNoOfRetries.setDescription('Number of times system should take cpu utilization sample before sending the CPU utilization trap.')
swCpuUsageLimit = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(1, 100))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swCpuUsageLimit.setStatus('current')
if mibBuilder.loadTexts: swCpuUsageLimit.setDescription('CPU usage limit. If MAPS is enabled, then this object is not supported and return 0 value.')
swCpuPollingInterval = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(10, 3600))).setUnits('seconds').setMaxAccess("readonly")
if mibBuilder.loadTexts: swCpuPollingInterval.setStatus('current')
if mibBuilder.loadTexts: swCpuPollingInterval.setDescription('Time interval between two memory samples.')
swCpuAction = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 5), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3))).clone(namedValues=NamedValues(("none", 0), ("raslog", 1), ("snmp", 2), ("raslogandSnmp", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swCpuAction.setStatus('current')
if mibBuilder.loadTexts: swCpuAction.setDescription('Specifies the actions to be taken if system resources exceed the specified threshold. If MAPS is enabled, then this object is not supported and return 0 value.')
swMemUsage = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 6), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemUsage.setStatus('current')
if mibBuilder.loadTexts: swMemUsage.setDescription("System's memory usage.")
swMemNoOfRetries = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 7), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemNoOfRetries.setStatus('current')
if mibBuilder.loadTexts: swMemNoOfRetries.setDescription('Number of times system should take memory usage sample before sending the memory usage trap.')
swMemUsageLimit = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 8), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemUsageLimit.setStatus('current')
if mibBuilder.loadTexts: swMemUsageLimit.setDescription('Memory usage limit')
swMemPollingInterval = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 9), Integer32().subtype(subtypeSpec=ValueRangeConstraint(10, 3600))).setUnits('seconds').setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemPollingInterval.setStatus('current')
if mibBuilder.loadTexts: swMemPollingInterval.setDescription('Time interval between two memory samples.')
swMemAction = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 10), Integer32().subtype(subtypeSpec=ConstraintsUnion(SingleValueConstraint(0, 1, 2, 3))).clone(namedValues=NamedValues(("none", 0), ("raslog", 1), ("snmp", 2), ("raslogandSnmp", 3)))).setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemAction.setStatus('current')
if mibBuilder.loadTexts: swMemAction.setDescription('Specifies the actions to be taken if system resources exceed the specified threshold. If MAPS is enabled, then this object is not supported and return 0 value.')
swMemUsageLimit1 = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 11), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemUsageLimit1.setStatus('current')
if mibBuilder.loadTexts: swMemUsageLimit1.setDescription('Low memory usage limit. If MAPS is enabled, then this object is not supported and return 0 value.')
swMemUsageLimit3 = MibScalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 12), Integer32()).setMaxAccess("readonly")
if mibBuilder.loadTexts: swMemUsageLimit3.setStatus('current')
if mibBuilder.loadTexts: swMemUsageLimit3.setDescription('High memory usage limit. If MAPS is enabled, then this object is not supported and return 0 value.')
swConnUnitPortStatEntry = MibTableRow((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1), )
connUnitPortStatEntry.registerAugmentions(("SW-MIB", "swConnUnitPortStatEntry"))
swConnUnitPortStatEntry.setIndexNames(*connUnitPortStatEntry.getIndexNames())
if mibBuilder.loadTexts: swConnUnitPortStatEntry.setStatus('current')
if mibBuilder.loadTexts: swConnUnitPortStatEntry.setDescription('This represents the Conn unit Port Stats')
swConnUnitCRCWithBadEOF = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 1), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitCRCWithBadEOF.setStatus('current')
if mibBuilder.loadTexts: swConnUnitCRCWithBadEOF.setDescription('The number of frames with CRC error with Bad EOF.')
swConnUnitZeroTenancy = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 2), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitZeroTenancy.setStatus('current')
if mibBuilder.loadTexts: swConnUnitZeroTenancy.setDescription('This counter is incremented when the FL_port acquires the loop but does not transmit a frame.')
swConnUnitFLNumOfTenancy = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 3), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitFLNumOfTenancy.setStatus('current')
if mibBuilder.loadTexts: swConnUnitFLNumOfTenancy.setDescription('This counter is incremented when the FL_port acquires the loop.')
swConnUnitNLNumOfTenancy = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 4), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitNLNumOfTenancy.setStatus('current')
if mibBuilder.loadTexts: swConnUnitNLNumOfTenancy.setDescription('This counter is incremented when the NL_port acquires the loop.')
swConnUnitStopTenancyStarVation = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 5), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitStopTenancyStarVation.setStatus('current')
if mibBuilder.loadTexts: swConnUnitStopTenancyStarVation.setDescription('This counter is incremented when the FL_port can not transmit a frame because of lack of credit.')
swConnUnitOpend = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 6), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitOpend.setStatus('current')
if mibBuilder.loadTexts: swConnUnitOpend.setDescription('The number of times FC port entered OPENED state.')
swConnUnitTransferConnection = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 7), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitTransferConnection.setStatus('current')
if mibBuilder.loadTexts: swConnUnitTransferConnection.setDescription('The number of times FC port entered TRANSFER state.')
swConnUnitOpen = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 8), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitOpen.setStatus('current')
if mibBuilder.loadTexts: swConnUnitOpen.setDescription('The number of times FC port entered OPEN state.')
swConnUnitInvalidARB = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 9), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitInvalidARB.setStatus('current')
if mibBuilder.loadTexts: swConnUnitInvalidARB.setDescription('The number of times FC port received invalid ARB.')
swConnUnitFTB1Miss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 10), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitFTB1Miss.setStatus('current')
if mibBuilder.loadTexts: swConnUnitFTB1Miss.setDescription('This counter is incremented when the port receives a frame with a DID that can not be routed by FCR.. Applicable to 8G platforms only.')
swConnUnitFTB2Miss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 11), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitFTB2Miss.setStatus('current')
if mibBuilder.loadTexts: swConnUnitFTB2Miss.setDescription('This counter is incremented when the port receives a frame with an SID/DID combination that can not be routed by the VF module.Applicable to 8G platforms only.')
swConnUnitFTB6Miss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 12), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitFTB6Miss.setStatus('current')
if mibBuilder.loadTexts: swConnUnitFTB6Miss.setDescription('This counter is incremented when port receives a frame with an SID that can not be routed by FCR. Applicable to 8G platforms.')
swConnUnitZoneMiss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 13), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitZoneMiss.setStatus('current')
if mibBuilder.loadTexts: swConnUnitZoneMiss.setDescription('This counter is incremented when the port receives a frame with an SID and DID that are not zoned together.')
swConnUnitLunZoneMiss = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 14), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitLunZoneMiss.setStatus('current')
if mibBuilder.loadTexts: swConnUnitLunZoneMiss.setDescription('This counter is incremented when the port receives a frame with an SID, DID and LUN that are not zoned together( This is not currently used ).')
swConnUnitBadEOF = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 15), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitBadEOF.setStatus('current')
if mibBuilder.loadTexts: swConnUnitBadEOF.setDescription('The number of frames with bad end-of-frame.')
swConnUnitLCRX = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 16), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitLCRX.setStatus('current')
if mibBuilder.loadTexts: swConnUnitLCRX.setDescription('The number of link control frames received.')
swConnUnitRDYPriority = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 17), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitRDYPriority.setStatus('current')
if mibBuilder.loadTexts: swConnUnitRDYPriority.setDescription('The number of times that sending R_RDY or VC_RDY primitive signals was a higher priority than sending frames, due to diminishing credit reserves in the transmitter at the other end of the fibre.')
swConnUnitLli = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 18), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitLli.setStatus('current')
if mibBuilder.loadTexts: swConnUnitLli.setDescription('The number low level interrupts generated by the physical and link layer.')
swConnUnitInterrupts = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 19), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitInterrupts.setStatus('current')
if mibBuilder.loadTexts: swConnUnitInterrupts.setDescription(' This represents all the interrupts received on a port. Includes LLI, unknown etc')
swConnUnitUnknownInterrupts = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 20), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitUnknownInterrupts.setStatus('current')
if mibBuilder.loadTexts: swConnUnitUnknownInterrupts.setDescription(' Represents all the unknown interrupts received on a port.')
swConnUnitTimedOut = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 21), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitTimedOut.setStatus('current')
if mibBuilder.loadTexts: swConnUnitTimedOut.setDescription('Represents number of timed out frames due to any reason.')
swConnUnitProcRequired = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 22), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitProcRequired.setStatus('current')
if mibBuilder.loadTexts: swConnUnitProcRequired.setDescription('Represents number of frames trapped by CPU.')
swConnUnitTxBufferUnavailable = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 23), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitTxBufferUnavailable.setStatus('current')
if mibBuilder.loadTexts: swConnUnitTxBufferUnavailable.setDescription('Number of times port failed to transmit frames .')
swConnUnitStateChange = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 24), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitStateChange.setStatus('current')
if mibBuilder.loadTexts: swConnUnitStateChange.setDescription(' Number of times port has gone to offline, online, and faulty state.')
swConnUnitC3DiscardDueToRXTimeout = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 25), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitC3DiscardDueToRXTimeout.setStatus('current')
if mibBuilder.loadTexts: swConnUnitC3DiscardDueToRXTimeout.setDescription('Number of Class 3 receive frames discarded due to timeout.')
swConnUnitC3DiscardDueToDestUnreachable = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 26), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitC3DiscardDueToDestUnreachable.setStatus('current')
if mibBuilder.loadTexts: swConnUnitC3DiscardDueToDestUnreachable.setDescription('Number of Class 3 frames discarded due to destination unreachable.')
swConnUnitC3DiscardDueToTXTimeout = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 27), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitC3DiscardDueToTXTimeout.setStatus('current')
if mibBuilder.loadTexts: swConnUnitC3DiscardDueToTXTimeout.setDescription('Number of Class 3 transmit frames discarded due to timeout.')
swConnUnitC3DiscardOther = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 28), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitC3DiscardOther.setStatus('current')
if mibBuilder.loadTexts: swConnUnitC3DiscardOther.setDescription('Number of Class 3 frames discarded due to unknow reasons.')
swConnUnitPCSErrorCounter = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 29), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitPCSErrorCounter.setStatus('current')
if mibBuilder.loadTexts: swConnUnitPCSErrorCounter.setDescription('Number of Physical coding sublayer(PCS) block errors. It records the encoding violations on 10G or 16Gbps port.')
swConnUnitUnroutableFrameCounter = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 30), OctetString().subtype(subtypeSpec=ValueSizeConstraint(8, 8)).setFixedLength(8)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitUnroutableFrameCounter.setStatus('current')
if mibBuilder.loadTexts: swConnUnitUnroutableFrameCounter.setDescription('It indicates unroutable frame counter')
swConnUnitFECCorrectedCounter = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 31), OctetString().subtype(subtypeSpec=ValueSizeConstraint(64, 64)).setFixedLength(64)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitFECCorrectedCounter.setStatus('current')
if mibBuilder.loadTexts: swConnUnitFECCorrectedCounter.setDescription('It indicates Forward Error Correction Corrected Blocks count.FEC feature is only applicable to 10G/16G platforms.')
swConnUnitFECUnCorrectedCounter = MibTableColumn((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 32), OctetString().subtype(subtypeSpec=ValueSizeConstraint(64, 64)).setFixedLength(64)).setMaxAccess("readonly")
if mibBuilder.loadTexts: swConnUnitFECUnCorrectedCounter.setStatus('current')
if mibBuilder.loadTexts: swConnUnitFECUnCorrectedCounter.setDescription('It indicates Forward Error Correction UnCorrected Blocks count.FEC feature is only applicable to 10G/16G platforms.')
swTrapsV2 = ObjectIdentity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0))
if mibBuilder.loadTexts: swTrapsV2.setStatus('current')
if mibBuilder.loadTexts: swTrapsV2.setDescription("The Traps for Brocade's Fibre Channel Switch.")
swFault = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 1)).setObjects(("SW-MIB", "swDiagResult"), ("SW-MIB", "swSsn"))
if mibBuilder.loadTexts: swFault.setStatus('obsolete')
if mibBuilder.loadTexts: swFault.setDescription("Obsoleted this trap as firmware doesn't support this trap. A swFault(1) is generated whenever the diagnostics detects a fault with the switch.")
swSensorScn = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 2)).setObjects(("SW-MIB", "swSensorStatus"), ("SW-MIB", "swSensorIndex"), ("SW-MIB", "swSensorType"), ("SW-MIB", "swSensorValue"), ("SW-MIB", "swSensorInfo"), ("SW-MIB", "swSsn"))
if mibBuilder.loadTexts: swSensorScn.setStatus('current')
if mibBuilder.loadTexts: swSensorScn.setDescription('A swSensorScn(2) is generated whenever an environment sensor changes its operational state. For instance, a fan stop working. The VarBind in the Trap Data Unit shall contain the corresponding instance of the sensor status, sensor index, sensor type, sensor value (reading) and sensor information. Note that the sensor information contains the type of sensor and its number in textual format.')
swFCPortScn = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 3)).setObjects(("SW-MIB", "swFCPortOpStatus"), ("SW-MIB", "swFCPortIndex"), ("SW-MIB", "swFCPortName"), ("SW-MIB", "swFCPortWwn"), ("SW-MIB", "swFCPortPrevType"), ("SW-MIB", "swFCPortBrcdType"), ("SW-MIB", "swSsn"), ("SW-MIB", "swFCPortFlag"), ("SW-MIB", "swFCPortDisableReason"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swFCPortScn.setStatus('current')
if mibBuilder.loadTexts: swFCPortScn.setDescription('This trap is sent whenever an FC port operational status or its type changed. The events that trigger this trap are port goes to online/offline, port type changed to E-port/F-port/FL-port. swFCPortName and swSsn are optional varbind in the trap PDU')
swEventTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 4)).setObjects(("SW-MIB", "swEventIndex"), ("SW-MIB", "swEventTimeInfo"), ("SW-MIB", "swEventLevel"), ("SW-MIB", "swEventRepeatCount"), ("SW-MIB", "swEventDescr"), ("SW-MIB", "swSsn"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swEventTrap.setStatus('current')
if mibBuilder.loadTexts: swEventTrap.setDescription('This trap is generated when an event whose level at or below swEventTrapLevel occurs.')
swFabricWatchTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 5)).setObjects(("SW-MIB", "swFwClassAreaIndex"), ("SW-MIB", "swFwThresholdIndex"), ("SW-MIB", "swFwName"), ("SW-MIB", "swFwLabel"), ("SW-MIB", "swFwLastEventVal"), ("SW-MIB", "swFwLastEventTime"), ("SW-MIB", "swFwLastEvent"), ("SW-MIB", "swFwLastState"), ("SW-MIB", "swFwLastSeverityLevel"), ("SW-MIB", "swSsn"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swFabricWatchTrap.setStatus('current')
if mibBuilder.loadTexts: swFabricWatchTrap.setDescription('trap to be sent by Fabric Watch to notify of an event.')
swTrackChangesTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 6)).setObjects(("SW-MIB", "swTrackChangesInfo"), ("SW-MIB", "swSsn"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swTrackChangesTrap.setStatus('current')
if mibBuilder.loadTexts: swTrackChangesTrap.setDescription('trap to be sent for tracking login/logout/config changes.')
swIPv6ChangeTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 7)).setObjects(("SW-MIB", "swIPv6Address"), ("SW-MIB", "swIPv6Status"))
if mibBuilder.loadTexts: swIPv6ChangeTrap.setStatus('current')
if mibBuilder.loadTexts: swIPv6ChangeTrap.setDescription('This trap is generated when an ipv6 address status change event occurs.')
swPmgrEventTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 8)).setObjects(("SW-MIB", "swPmgrEventType"), ("SW-MIB", "swPmgrEventTime"), ("SW-MIB", "swPmgrEventDescr"), ("SW-MIB", "swSsn"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swPmgrEventTrap.setStatus('current')
if mibBuilder.loadTexts: swPmgrEventTrap.setDescription('This trap is generated when any partition manager change happens.')
swFabricReconfigTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 9)).setObjects(("SW-MIB", "swDomainID"))
if mibBuilder.loadTexts: swFabricReconfigTrap.setStatus('current')
if mibBuilder.loadTexts: swFabricReconfigTrap.setDescription('trap to be sent for tracking fabric reconfiguration')
swFabricSegmentTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 10)).setObjects(("SW-MIB", "swFCPortIndex"), ("SW-MIB", "swFCPortName"), ("SW-MIB", "swSsn"), ("SW-MIB", "swFCPortFlag"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swFabricSegmentTrap.setStatus('current')
if mibBuilder.loadTexts: swFabricSegmentTrap.setDescription('trap to be sent for tracking segmentation')
swExtTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 11))
if mibBuilder.loadTexts: swExtTrap.setStatus('current')
if mibBuilder.loadTexts: swExtTrap.setDescription('THIS IS INTERNAL TRAP')
swStateChangeTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 12)).setObjects(("SW-MIB", "swOperStatus"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swStateChangeTrap.setStatus('current')
if mibBuilder.loadTexts: swStateChangeTrap.setDescription('This trap is sent whenever switch state changes to online/offline')
swPortMoveTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 13)).setObjects(("SW-MIB", "swPortList"), ("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swPortMoveTrap.setStatus('current')
if mibBuilder.loadTexts: swPortMoveTrap.setDescription('This trap is sent when ports are moved from one switch to another')
swBrcdGenericTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 14)).setObjects(("SW-MIB", "swBrcdTrapBitMask"))
if mibBuilder.loadTexts: swBrcdGenericTrap.setStatus('current')
if mibBuilder.loadTexts: swBrcdGenericTrap.setDescription("This trap is sent when there is any one of the following event occured. 1. fabric change 2. device change 3. Fapwwn change 4. fdmi event This Trap is strictly for brocade's internal usage.")
swDeviceStatusTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 15)).setObjects(("SW-MIB", "swFCPortSpecifier"), ("SW-MIB", "swDeviceStatus"), ("SW-MIB", "swEndDevicePortID"), ("SW-MIB", "swNsNodeName"))
if mibBuilder.loadTexts: swDeviceStatusTrap.setStatus('current')
if mibBuilder.loadTexts: swDeviceStatusTrap.setDescription('This trap is sent whenever there is a device login or logout')
swZoneConfigChangeTrap = NotificationType((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 16)).setObjects(("SW-MIB", "swVfId"))
if mibBuilder.loadTexts: swZoneConfigChangeTrap.setStatus('current')
if mibBuilder.loadTexts: swZoneConfigChangeTrap.setDescription('This trap is sent whenever there is change in local zone database.')
mibBuilder.exportSymbols("SW-MIB", swFwCustUnit=swFwCustUnit, swIDIDMode=swIDIDMode, swSensorValue=swSensorValue, swFabric=swFabric, swTrunkMaster=swTrunkMaster, swDeviceStatusTrap=swDeviceStatusTrap, swTrunkGrpMaster=swTrunkGrpMaster, swFabricMemName=swFabricMemName, swSensorType=swSensorType, sw20x0=sw20x0, swTrunkPortIndex=swTrunkPortIndex, swGroupTable=swGroupTable, swFwClassAreaEntry=swFwClassAreaEntry, swNsWwn=swNsWwn, swBlmPerfEESid=swBlmPerfEESid, swFCPortAdmStatus=swFCPortAdmStatus, swGroupName=swGroupName, swFwValidActs=swFwValidActs, swTrunkGrpNumber=swTrunkGrpNumber, swEventTable=swEventTable, swConnUnitTxBufferUnavailable=swConnUnitTxBufferUnavailable, swFCPortType=swFCPortType, swTrackChangesInfo=swTrackChangesInfo, swTopTalkerMntNumEntries=swTopTalkerMntNumEntries, swFCPortTooManyRdys=swFCPortTooManyRdys, swTopTalkerMntDwwn=swTopTalkerMntDwwn, swSensorInfo=swSensorInfo, swVfName=swVfName, swEventTrapLevel=swEventTrapLevel, swFwDefaultBelowActs=swFwDefaultBelowActs, swGroupEntry=swGroupEntry, swFabricSegmentTrap=swFabricSegmentTrap, swGroup=swGroup, swEndDevicePortID=swEndDevicePortID, SwFwWriteVals=SwFwWriteVals, swFCPortPhyState=swFCPortPhyState, swTopTalkerMntSwwn=swTopTalkerMntSwwn, swTrunkTable=swTrunkTable, swVfId=swVfId, SwFwClassesAreas=SwFwClassesAreas, swSwitchTrunkable=swSwitchTrunkable, swFwCustHigh=swFwCustHigh, swFwLastEventTime=swFwLastEventTime, swFlashDLPassword=swFlashDLPassword, swBlmPerfAlpa=swBlmPerfAlpa, swFCPortMcastTimedOuts=swFCPortMcastTimedOuts, swConnUnitC3DiscardDueToRXTimeout=swConnUnitC3DiscardDueToRXTimeout, swTopTalkerMntflow=swTopTalkerMntflow, swExtTrap=swExtTrap, swFCPortLipIns=swFCPortLipIns, swBlmPerfEEDid=swBlmPerfEEDid, swNsPortName=swNsPortName, PYSNMP_MODULE_ID=swMibModule, swEventIndex=swEventIndex, swNsPortID=swNsPortID, swCpuUsageLimit=swCpuUsageLimit, swPortMoveTrap=swPortMoveTrap, swFwClassAreaTable=swFwClassAreaTable, swFCPortRxBadEofs=swFCPortRxBadEofs, swBlmPerfMnt=swBlmPerfMnt, swFCPortLipLastAlpa=swFCPortLipLastAlpa, swFwSystem=swFwSystem, swBlmPerfFltMntEntry=swBlmPerfFltMntEntry, swFCPortRxCrcs=swFCPortRxCrcs, swTopTalkerMntPort=swTopTalkerMntPort, swEndDeviceSyncLoss=swEndDeviceSyncLoss, swBlmPerfEEPort=swBlmPerfEEPort, swFlashDLFile=swFlashDLFile, swConnUnitUnknownInterrupts=swConnUnitUnknownInterrupts, swNumSensors=swNumSensors, swFlashDLOperStatus=swFlashDLOperStatus, swTopTalkerMntSpid=swTopTalkerMntSpid, swConnUnitC3DiscardDueToDestUnreachable=swConnUnitC3DiscardDueToDestUnreachable, swFault=swFault, swFCPortTable=swFCPortTable, swBlmPerfAlpaPort=swBlmPerfAlpaPort, swFwDefaultUnit=swFwDefaultUnit, swConnUnitLCRX=swConnUnitLCRX, swFCIPMask=swFCIPMask, swConnUnitRDYPriority=swConnUnitRDYPriority, swFCport=swFCport, swConnUnitTransferConnection=swConnUnitTransferConnection, swNsCos=swNsCos, swEventNumEntries=swEventNumEntries, swBlmPerfEERefKey=swBlmPerfEERefKey, swTopTalkerMntMode=swTopTalkerMntMode, swGroupIndex=swGroupIndex, swConnUnitZeroTenancy=swConnUnitZeroTenancy, swFabricWatchTrap=swFabricWatchTrap, swNsIpAddress=swNsIpAddress, swBlmPerfFltMntTable=swBlmPerfFltMntTable, swMemNoOfRetries=swMemNoOfRetries, swNsPortSymb=swNsPortSymb, swNsIpNxPort=swNsIpNxPort, swIPv6ChangeTrap=swIPv6ChangeTrap, swTrunk=swTrunk, swBlmPerfAlpaIndx=swBlmPerfAlpaIndx, swBlmPerfEEMntTable=swBlmPerfEEMntTable, swConnUnitPortStatEntry=swConnUnitPortStatEntry, swEndDevicePort=swEndDevicePort, swFCPortRxC2Frames=swFCPortRxC2Frames, swDomainID=swDomainID, swAdmStatus=swAdmStatus, swGroupMemWwn=swGroupMemWwn, swMemAction=swMemAction, SwFwState=SwFwState, swNbEntry=swNbEntry, swFabricMemEntry=swFabricMemEntry, swFabricMemDid=swFabricMemDid, FcPortFlag=FcPortFlag, swFwCustLow=swFwCustLow, swFCPortSpeed=swFCPortSpeed, swTelnetShellAdmStatus=swTelnetShellAdmStatus, swFwStatus=swFwStatus, swConnUnitUnroutableFrameCounter=swConnUnitUnroutableFrameCounter, swNsEntryIndex=swNsEntryIndex, swFCPortRxFrames=swFCPortRxFrames, swConnUnitBadEOF=swConnUnitBadEOF, swEndDeviceInvalidWord=swEndDeviceInvalidWord, swSensorEntry=swSensorEntry, swConnUnitPCSErrorCounter=swConnUnitPCSErrorCounter, SwFwLicense=SwFwLicense, swSensorStatus=swSensorStatus, swNs=swNs, swMemUsage=swMemUsage, swAgtCmtyIdx=swAgtCmtyIdx, swFwDefaultLow=swFwDefaultLow, swNbMyPort=swNbMyPort, swFCPortIndex=swFCPortIndex, swSsn=swSsn, swConnUnitInvalidARB=swConnUnitInvalidARB, swConnUnitFTB1Miss=swConnUnitFTB1Miss, swNsHardAddr=swNsHardAddr, swEventEntry=swEventEntry, swModel=swModel, swFCIPAddress=swFCIPAddress, swFCPortTxFrames=swFCPortTxFrames, swEndDevice=swEndDevice, swEventVfId=swEventVfId, swFWLastUpdated=swFWLastUpdated, swConnUnitInterrupts=swConnUnitInterrupts, swFwWriteActVals=swFwWriteActVals, swFlashDLAdmStatus=swFlashDLAdmStatus, swEvent=swEvent, swEtherIPMask=swEtherIPMask, SwFwActs=SwFwActs, swFwThLevel=swFwThLevel, swFwCustBelowActs=swFwCustBelowActs, sw=sw, swCpuPollingInterval=swCpuPollingInterval, swBlmPerfFltCnt=swBlmPerfFltCnt, swFwFabricWatchLicense=swFwFabricWatchLicense, swAgtTrapSeverityLevel=swAgtTrapSeverityLevel, swPortTrunked=swPortTrunked, swEventLevel=swEventLevel, swSensorTable=swSensorTable, swPmgrEventTrap=swPmgrEventTrap, swTrunkEntry=swTrunkEntry, swFwLastSeverityLevel=swFwLastSeverityLevel, swNumNbs=swNumNbs, swGroupMemEntry=swGroupMemEntry, SwFwLevels=SwFwLevels, swBlmPerfAlpaCRCCnt=swBlmPerfAlpaCRCCnt, swFlashLastUpdated=swFlashLastUpdated, swZoneConfigChangeTrap=swZoneConfigChangeTrap, swBootPromLastUpdated=swBootPromLastUpdated, swNsLocalEntry=swNsLocalEntry, swFwLastEvent=swFwLastEvent, swFwClassAreaIndex=swFwClassAreaIndex, swBlmPerfEEFCWRx=swBlmPerfEEFCWRx, swConnUnitOpen=swConnUnitOpen, swBlmPerfEEFCWTx=swBlmPerfEEFCWTx, swFwCustAboveActs=swFwCustAboveActs, swNbTable=swNbTable, swNsPortType=swNsPortType, swConnUnitStopTenancyStarVation=swConnUnitStopTenancyStarVation, swFwThresholdEntry=swFwThresholdEntry, swMibModule=swMibModule, swConnUnitFTB2Miss=swConnUnitFTB2Miss, swAgtCmtyStr=swAgtCmtyStr, swFCPortRxC3Frames=swFCPortRxC3Frames, swID=swID, swDeviceStatus=swDeviceStatus, swBlmPerfALPAMntTable=swBlmPerfALPAMntTable, swFCPortCapacity=swFCPortCapacity, swBrcdTrapBitMask=swBrcdTrapBitMask, swNsNodeName=swNsNodeName, swFwBehaviorInt=swFwBehaviorInt, swFCPortBrcdType=swFCPortBrcdType, swFabricMemTable=swFabricMemTable, swFCPortEntry=swFCPortEntry, swTrunkGroupNumber=swTrunkGroupNumber, swTopTalkerMntDpid=swTopTalkerMntDpid, swprivProtocolPassword=swprivProtocolPassword, swFwWriteThVals=swFwWriteThVals, swConnUnitZoneMiss=swConnUnitZoneMiss, swFCPortRxEncOutFrs=swFCPortRxEncOutFrs, swBootDate=swBootDate, swFCPortLipOuts=swFCPortLipOuts, swGroupMemPos=swGroupMemPos, swTrackChangesTrap=swTrackChangesTrap, swConnUnitNLNumOfTenancy=swConnUnitNLNumOfTenancy, swFCPortRxEncInFrs=swFCPortRxEncInFrs, swBeaconAdmStatus=swBeaconAdmStatus, swBlmPerfEEMntEntry=swBlmPerfEEMntEntry, swEventDescr=swEventDescr, swNbIslCost=swNbIslCost, swConnUnitC3DiscardDueToTXTimeout=swConnUnitC3DiscardDueToTXTimeout, swFwCustExceededActs=swFwCustExceededActs, swEventRepeatCount=swEventRepeatCount, swFCPortTxMcasts=swFCPortTxMcasts, swConnUnitOpend=swConnUnitOpend, swOperStatus=swOperStatus, swBlmPerfALPAMntEntry=swBlmPerfALPAMntEntry, swFwDefaultInBetweenActs=swFwDefaultInBetweenActs, sw21kN24k=sw21kN24k, swFwDefaultExceededActs=swFwDefaultExceededActs, swModule=swModule, swBlmPerfEECRC=swBlmPerfEECRC, swNbRemDomain=swNbRemDomain, swCpuOrMemoryUsage=swCpuOrMemoryUsage, swAgtCmtyEntry=swAgtCmtyEntry, swFCPortRxTooLongs=swFCPortRxTooLongs, swIPv6Address=swIPv6Address, swTopTalkerMntEntry=swTopTalkerMntEntry, swFwLastState=swFwLastState, swMemUsageLimit1=swMemUsageLimit1, swTrunkGrpTable=swTrunkGrpTable, swSystem=swSystem, swFwThresholdIndex=swFwThresholdIndex, swPortList=swPortList, swFCPortNoTxCredits=swFCPortNoTxCredits, swFCPortC3Discards=swFCPortC3Discards, swEndDeviceAlpa=swEndDeviceAlpa, swFirmwareVersion=swFirmwareVersion, swGroupType=swGroupType, swEndDeviceSigLoss=swEndDeviceSigLoss, swTrapsV2=swTrapsV2, swMemUsageLimit=swMemUsageLimit, swConnUnitFECCorrectedCounter=swConnUnitFECCorrectedCounter, swTopTalker=swTopTalker, swFabricReconfigTrap=swFabricReconfigTrap, swConnUnitC3DiscardOther=swConnUnitC3DiscardOther, swFlashDLUser=swFlashDLUser, swauthProtocolPassword=swauthProtocolPassword, swCpuNoOfRetries=swCpuNoOfRetries, SwSevType=SwSevType, swFwName=swFwName, swFwDefaultChangedActs=swFwDefaultChangedActs, swFwCustTimebase=swFwCustTimebase, swTrunkGrpEntry=swTrunkGrpEntry, swAgtTrapRcp=swAgtTrapRcp, swCpuUsage=swCpuUsage, swEndDeviceRlsEntry=swEndDeviceRlsEntry)
mibBuilder.exportSymbols("SW-MIB", swFwCustInBetweenActs=swFwCustInBetweenActs, swFabricMemWwn=swFabricMemWwn, swFCPortTxWords=swFCPortTxWords, swConnUnitPortStatExtentionTable=swConnUnitPortStatExtentionTable, swConnUnitTimedOut=swConnUnitTimedOut, swTrunkGrpTx=swTrunkGrpTx, swNbIndex=swNbIndex, swNbIslState=swNbIslState, swBlmPerfFltAlias=swBlmPerfFltAlias, swMemPollingInterval=swMemPollingInterval, swIPv6Status=swIPv6Status, swFabricMemType=swFabricMemType, swFwCustBufSize=swFwCustBufSize, swFCPortWwn=swFCPortWwn, swFCPortLinkState=swFCPortLinkState, swEventTrap=swEventTrap, swFCPortFlag=swFCPortFlag, swConnUnitStateChange=swConnUnitStateChange, swFwDefaultBufSize=swFwDefaultBufSize, swNsIPA=swNsIPA, swDiagResult=swDiagResult, swNbBaudRate=swNbBaudRate, swFwDefaultHigh=swFwDefaultHigh, swNsLocalTable=swNsLocalTable, swConnUnitProcRequired=swConnUnitProcRequired, swAgtCfg=swAgtCfg, swFCPortOpStatus=swFCPortOpStatus, swFabricMemGWIP=swFabricMemGWIP, swAgtCmtyTable=swAgtCmtyTable, swFCPortRxLCs=swFCPortRxLCs, swFwCurVal=swFwCurVal, swFabricMemEIP=swFabricMemEIP, swConnUnitLli=swConnUnitLli, swPmgrEventDescr=swPmgrEventDescr, SwFwStatus=SwFwStatus, swTopTalkerMntTable=swTopTalkerMntTable, swGroupMemTable=swGroupMemTable, swPmgrEventType=swPmgrEventType, swFwThresholdTable=swFwThresholdTable, swFabricMemShortVersion=swFabricMemShortVersion, swCpuAction=swCpuAction, swFwBehaviorType=swFwBehaviorType, swFwActLevel=swFwActLevel, swTestString=swTestString, swFCPortRxWords=swFCPortRxWords, swNbRemPort=swNbRemPort, swCurrentDate=swCurrentDate, swFCPortRxTruncs=swFCPortRxTruncs, swStateChangeTrap=swStateChangeTrap, swSensorScn=swSensorScn, swNsLocalNumEntry=swNsLocalNumEntry, swEtherIPAddress=swEtherIPAddress, swFwDefaultAboveActs=swFwDefaultAboveActs, swEndDeviceProtoErr=swEndDeviceProtoErr, swEventTimeInfo=swEventTimeInfo, swConnUnitFTB6Miss=swConnUnitFTB6Miss, swPrincipalSwitch=swPrincipalSwitch, SwFwBehavior=SwFwBehavior, swFwLabel=swFwLabel, swFCPortName=swFCPortName, swEndDeviceLinkFailure=swEndDeviceLinkFailure, swFlashDLHost=swFlashDLHost, swFCPortTxType=swFCPortTxType, swTrunkGrpRx=swTrunkGrpRx, swFwDefaultTimebase=swFwDefaultTimebase, swNsFc4=swNsFc4, swBlmPerfFltRefkey=swBlmPerfFltRefkey, swFCPortRxMcasts=swFCPortRxMcasts, swBrcdGenericTrap=swBrcdGenericTrap, swTopTalkerMntIndex=swTopTalkerMntIndex, swNsNodeSymb=swNsNodeSymb, swBlmPerfFltPort=swBlmPerfFltPort, swFabricMemFCIP=swFabricMemFCIP, swFCPortPrevType=swFCPortPrevType, swMemUsageLimit3=swMemUsageLimit3, swConnUnitFECUnCorrectedCounter=swConnUnitFECUnCorrectedCounter, swPmgrEventTime=swPmgrEventTime, swConnUnitLunZoneMiss=swConnUnitLunZoneMiss, SwFwTimebase=SwFwTimebase, swNbRemPortName=swNbRemPortName, swEndDeviceInvalidCRC=swEndDeviceInvalidCRC, swConnUnitFLNumOfTenancy=swConnUnitFLNumOfTenancy, sw28k=sw28k, swBeaconOperStatus=swBeaconOperStatus, swFCPortScn=swFCPortScn, swFCPortDisableReason=swFCPortDisableReason, swGroupId=swGroupId, swFCPortSpecifier=swFCPortSpecifier, swFCPortRxBadOs=swFCPortRxBadOs, swSensorIndex=swSensorIndex, swFwCustChangedActs=swFwCustChangedActs, SwFwEvent=SwFwEvent, swConnUnitCRCWithBadEOF=swConnUnitCRCWithBadEOF, swEndDeviceRlsTable=swEndDeviceRlsTable, swFwLastEventVal=swFwLastEventVal)
| (integer, octet_string, object_identifier) = mibBuilder.importSymbols('ASN1', 'Integer', 'OctetString', 'ObjectIdentifier')
(named_values,) = mibBuilder.importSymbols('ASN1-ENUMERATION', 'NamedValues')
(value_size_constraint, constraints_union, value_range_constraint, constraints_intersection, single_value_constraint) = mibBuilder.importSymbols('ASN1-REFINEMENT', 'ValueSizeConstraint', 'ConstraintsUnion', 'ValueRangeConstraint', 'ConstraintsIntersection', 'SingleValueConstraint')
(fc_switch, bcsi_modules) = mibBuilder.importSymbols('Brocade-REG-MIB', 'fcSwitch', 'bcsiModules')
(sw_trunk_master, sw_sensor_index, sw_domain_index, fc_wwn, sw_nb_index, sw_port_index) = mibBuilder.importSymbols('Brocade-TC', 'SwTrunkMaster', 'SwSensorIndex', 'SwDomainIndex', 'FcWwn', 'SwNbIndex', 'SwPortIndex')
(conn_unit_port_entry, conn_unit_port_stat_entry) = mibBuilder.importSymbols('FCMGMT-MIB', 'connUnitPortEntry', 'connUnitPortStatEntry')
(notification_group, module_compliance) = mibBuilder.importSymbols('SNMPv2-CONF', 'NotificationGroup', 'ModuleCompliance')
(bits, unsigned32, integer32, module_identity, notification_type, counter32, mib_scalar, mib_table, mib_table_row, mib_table_column, ip_address, iso, time_ticks, mib_identifier, counter64, gauge32, object_identity) = mibBuilder.importSymbols('SNMPv2-SMI', 'Bits', 'Unsigned32', 'Integer32', 'ModuleIdentity', 'NotificationType', 'Counter32', 'MibScalar', 'MibTable', 'MibTableRow', 'MibTableColumn', 'IpAddress', 'iso', 'TimeTicks', 'MibIdentifier', 'Counter64', 'Gauge32', 'ObjectIdentity')
(textual_convention, display_string, truth_value) = mibBuilder.importSymbols('SNMPv2-TC', 'TextualConvention', 'DisplayString', 'TruthValue')
sw_mib_module = module_identity((1, 3, 6, 1, 4, 1, 1588, 3, 1, 3))
swMibModule.setRevisions(('2003-01-13 14:30', '2003-07-20 14:30', '2004-04-15 10:30', '2004-08-06 18:30', '2005-04-29 20:16', '2006-01-09 09:00', '2006-05-17 09:00', '2007-01-23 09:00', '2007-06-08 12:00', '2007-06-27 10:30', '2007-08-01 12:20', '2007-08-29 04:42', '2008-01-29 07:59', '2008-07-17 03:45', '2008-07-24 02:32', '2008-07-25 02:32', '2008-09-09 09:00', '2009-09-28 09:00', '2009-02-21 09:00', '2009-03-30 09:00', '2009-06-25 12:00', '2009-06-29 01:00', '2009-06-30 13:06', '2009-06-30 06:00', '2009-10-30 05:00', '2009-11-03 13:06', '2009-11-05 12:00', '2009-11-05 05:00', '2009-11-06 11:30', '2009-11-30 10:30', '2009-12-03 17:30', '2010-01-30 17:30', '2010-07-08 11:30', '2010-07-15 11:30', '2010-07-21 11:30', '2010-08-06 11:30', '2010-08-20 10:30', '2010-10-07 10:30', '2010-10-09 10:30', '2010-10-25 10:30', '2010-11-01 06:00', '2010-11-02 10:30', '2010-12-02 10:30', '2010-12-08 10:30', '2010-12-20 10:00', '2010-12-21 04:00', '2010-12-22 10:00', '2010-12-30 10:00', '2011-01-06 10:30', '2011-01-07 10:30', '2011-02-18 06:00', '2012-02-23 10:30', '2012-03-05 03:33', '2012-05-15 14:25', '2012-06-04 17:20', '2012-06-14 10:00', '2012-06-29 15:20', '2012-07-10 16:00', '2012-09-26 14:00', '2013-03-21 13:00', '2013-04-04 17:48', '2013-04-22 11:30', '2013-04-25 18:03', '2013-05-15 14:30', '2013-06-05 16:00', '2013-06-29 10:00', '2013-09-12 10:00', '2013-10-04 13:40'))
if getattr(mibBuilder, 'version', (0, 0, 0)) > (4, 4, 0):
if mibBuilder.loadTexts:
swMibModule.setRevisionsDescriptions(('The initial version of this module.', 'Added swIDIDMode to the swFabric group.', 'Added object for Trap Severity Level, swFwLastSeverityLevel. Added the enumeration swFwResourceFlash for SwFwClassesAreas. Deprecated the mib object swEventTrapLevel. Updated the description of swGroupId and corrected the spell mistakes. Obsoleted the swFault Trap. Added enumerations four-GB for swFCPortSpeed and unknown, other for swFCPortType.', 'Added swFCPortSpecifier object to swFCPortTable.', 'Modified the #SUMMARY and #ARGUMENTS for swFabricWatchTrap', '1. Modified the description for swPortTrunked 2. Updated the SW Traps summary and description to remove the obsolete varbindings', 'Added swFCPortFlag object to swFCPortTable', 'Added enumerations eight-GB and ten-GB for swFCPortSpeed', 'Included swFCPortFlag as an additiional variable binding for trap SWFCPortScn', 'Added enumerations octuple and decuple for swNbBaudRate', 'Added the enumerations swFwEPortUtil and swFwEPortPktl for swFwClassAreaIndex', 'Added swFCPortBrcdType object to swFCPortTable', 'Added Toptalker support and swVfId to the swFabric group.', 'Added swIPv6ChangeTrap, swIPv6Address and swIPv6Status .', 'Added swModel to distiguish between 7500 and 7500E switch .', 'Added the enumerations swFwPortLr, swFwEPortLr, swFwEPortUtil, swFwEPortPktl, swFwFCUPortLr, swFwFOPPortLr for swFwClassAreaIndex.', 'Added swPmgrEventTrap information.', 'Added additional fabric watch threshold in SwFwActs.', 'Added port phy states.', 'Added swEventVfId in swEventTable.', "Removed the version information from Brocade's proprietary MIB file name.", 'Modified swVfid position at the last of swFabric table', 'Added swFwCPUMemUsage enumeration under swFwClassAreaIndex.', 'Updated the description of swCpuAction/swMemAction and access of swcpuormemoryusage objects and changed the type of swEndDeviceInvalidWord, swEndDeviceLinkFailure,swEndDeviceSyncLoss, swEndDeviceSigLoss, swEndDeviceProtoErr,swEndDeviceInvalidCRC from integer32 to counter32.', 'Added swFabricReconfigTrap and swFabricSegmentTrap.', 'Removed enum switchReboot from swAdmStatus.', 'Changed swFwCustUnit access to read-only', 'Added enums swFwEPortTrunkUtil,swFwFCUPortTrunkUtil and swFwFOPPortTrunkUtil in SwFwClassesAreas', 'Added swConnUnitExtensionTable and entries for 64 bit portstats.', 'Added swMemUsageLimit1 and swMemUsageLimit3 under swCpuOrMemoryUsage', 'Added swExttrap as internal trap.', 'Changed the descriptions for swConnUnitExtensionTable.', 'Obsoleted swGroupTable, swGroupMemTable from swGroup.', 'Added swFCPortWwn, swFCPortBrcdType in swFcPortScn and added swStateChangeTrap', 'Added trap swPortMoveTrap', 'Added trap portStats objects under SwConnUnitPortStatEntry', 'Added trap swBrcdGenericTrap', 'Added swVfName', 'Added swPortConfigTable', 'Added swFCPortPrevType in swFCPortScn', 'Added fifty filter classes under swFwClassAreaIndex', 'Updated the description of swBrcdTrapBitMask and swBrcdGenericTrap for Fapwwn Trap', 'Deprecated swAgtCmtyTable and provided support of standard mibs SnmpCommunityTable and snmpTargetParamsTable and snmpTargetAddrTable', 'Updated the datatype for swPortEncrypt and swPortCompression', 'Added enumeration sexdecuple for swNbBaudRate', 'Added a new value lowBufferCrsd(7) for swFwLastEvent', 'Changed the area name filter-fmcfg to filterFmCfg in SwFwClassesAreas', 'Included FDMI event case in swBrcdTrapBitMask', 'Added class3 discards error in SwConnUnitPortStatEntry', 'Moved swPortConfigTable, CiperMode and Encrypt/CompressStatus to faext.mib', 'Changed fportmode(2) to portmode(2) for object swTopTalkerMntMode.', 'Added swauthProtocolPassword and swauthProtocolPassword for IBM DirectorServer applications', 'Added new enum noSigDet(14) for object swFCPortPhyState', 'Changed the syntax of swCpuAction and swMemAction objects.', 'Added PCS block errors in swConnUnitPortStatEntry', 'Added swDeviceStatus and swDeviceStatusTrap', 'Added sixteenGB support to swFCPortSpeed and also deprecated teh same', 'Added an area filterFmCfg51 in the class SwFwClassesAreas', 'Removed the tab space and added the space key for swFCPortEntry 38 as this caused a crash in MIB browser', 'Added swFCPortDisableReason in SwFCPortEntry and swFCPortScn trap.', 'Added unroutable frame counter in swConnUnitPortStatEntry', 'Made the swFCPortSpeed obsolete', 'Changed the description for swVFName and swConnUnitPCSErrorCounter', 'Updated swFCPortCapacity description', 'Added swFwPowerOnHours in SwFwClassesAreas', 'Updated the description for swCpuUsageLimit, swCpuAction, swMemAction, swMemUsageLimit1 and swMemUsageLimit3.', 'Added FEC Counters swConnUnitFECCorrectedCounter, swConnUnitFECUnCorrectedCounter', 'Added swZoneConfigChangeTrap'))
if mibBuilder.loadTexts:
swMibModule.setLastUpdated('201310041340Z')
if mibBuilder.loadTexts:
swMibModule.setOrganization('Brocade Communications Systems, Inc.,')
if mibBuilder.loadTexts:
swMibModule.setContactInfo('Customer Support Group Brocade Communications Systems, 1745 Technology Drive, San Jose, CA 95110 U.S.A Tel: +1-408-392-6061 Fax: +1-408-392-6656 Email: support@Brocade.COM WEB: www.brocade.com')
if mibBuilder.loadTexts:
swMibModule.setDescription("The MIB module is for Brocade's Fibre Channel Switch. Copyright (c) 1996-2003 Brocade Communications Systems, Inc. All rights reserved.")
sw = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1))
if mibBuilder.loadTexts:
sw.setStatus('current')
if mibBuilder.loadTexts:
sw.setDescription("The OID sub-tree for Brocade's Silkworm Series of Fibre Channel Switches.")
sw28k = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 2))
if mibBuilder.loadTexts:
sw28k.setStatus('current')
if mibBuilder.loadTexts:
sw28k.setDescription("The OID for Brocade's Silkworm 2800 model Fibre Channel Switch.")
sw21k_n24k = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 3))
if mibBuilder.loadTexts:
sw21kN24k.setStatus('current')
if mibBuilder.loadTexts:
sw21kN24k.setDescription("The OID for Brocade's Silkworm 2100 and 2400 series model Fibre Channel Switch.")
sw20x0 = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 4))
if mibBuilder.loadTexts:
sw20x0.setStatus('current')
if mibBuilder.loadTexts:
sw20x0.setDescription("The OID for Brocade's Silkworm 20x0 series model Fibre Channel Switch.")
class Swsevtype(TextualConvention, Integer32):
description = "The event trap level in conjunction with the an event's severity level."
status = 'current'
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(0, 1, 2, 3, 4, 5))
named_values = named_values(('none', 0), ('critical', 1), ('error', 2), ('warning', 3), ('informational', 4), ('debug', 5))
class Fcportflag(TextualConvention, Bits):
description = 'Represents the port status for a FC Flag. Currently this will indicate if the port is virtual or physical.'
status = 'current'
named_values = named_values(('physical', 0), ('virtual', 1))
sw_system = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1))
if mibBuilder.loadTexts:
swSystem.setStatus('current')
if mibBuilder.loadTexts:
swSystem.setDescription('The OID sub-tree for swSystem group.')
sw_fabric = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2))
if mibBuilder.loadTexts:
swFabric.setStatus('current')
if mibBuilder.loadTexts:
swFabric.setDescription('The OID sub-tree for swFabric group.')
sw_module = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 3))
if mibBuilder.loadTexts:
swModule.setStatus('current')
if mibBuilder.loadTexts:
swModule.setDescription('The OID sub-tree for swModule group.')
sw_agt_cfg = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4))
if mibBuilder.loadTexts:
swAgtCfg.setStatus('current')
if mibBuilder.loadTexts:
swAgtCfg.setDescription('The OID sub-tree for swAgtCfg group.')
sw_f_cport = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6))
if mibBuilder.loadTexts:
swFCport.setStatus('current')
if mibBuilder.loadTexts:
swFCport.setDescription('The OID sub-tree for swFCport group.')
sw_ns = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7))
if mibBuilder.loadTexts:
swNs.setStatus('current')
if mibBuilder.loadTexts:
swNs.setDescription('The OID sub-tree for swNs group.')
sw_event = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8))
if mibBuilder.loadTexts:
swEvent.setStatus('current')
if mibBuilder.loadTexts:
swEvent.setDescription('The OID sub-tree for swEvent group.')
sw_fw_system = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10))
if mibBuilder.loadTexts:
swFwSystem.setStatus('current')
if mibBuilder.loadTexts:
swFwSystem.setDescription('The OID sub-tree for swFwSystem group.')
sw_end_device = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21))
if mibBuilder.loadTexts:
swEndDevice.setStatus('current')
if mibBuilder.loadTexts:
swEndDevice.setDescription('The OID sub-tree for swEndDevice group.')
sw_group = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22))
if mibBuilder.loadTexts:
swGroup.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroup.setDescription('The OID sub-tree for swGroup group.')
sw_blm_perf_mnt = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23))
if mibBuilder.loadTexts:
swBlmPerfMnt.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfMnt.setDescription('The OID sub-tree for swBlmPerfMnt (Bloom Performance Monitor) group.')
sw_trunk = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24))
if mibBuilder.loadTexts:
swTrunk.setStatus('current')
if mibBuilder.loadTexts:
swTrunk.setDescription('The OID sub-tree for swTrunk group.')
sw_top_talker = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25))
if mibBuilder.loadTexts:
swTopTalker.setStatus('current')
if mibBuilder.loadTexts:
swTopTalker.setDescription('The OID sub-tree for TopTalker group.')
sw_cpu_or_memory_usage = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26))
if mibBuilder.loadTexts:
swCpuOrMemoryUsage.setStatus('current')
if mibBuilder.loadTexts:
swCpuOrMemoryUsage.setDescription('The OID sub-tree for cpu or memory usage group.')
sw_conn_unit_port_stat_extention_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27))
if mibBuilder.loadTexts:
swConnUnitPortStatExtentionTable.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitPortStatExtentionTable.setDescription('This represents the Conn unit Port Stats')
sw_current_date = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 1), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swCurrentDate.setStatus('current')
if mibBuilder.loadTexts:
swCurrentDate.setDescription('The current date information in displayable textual format.')
sw_boot_date = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 2), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBootDate.setStatus('current')
if mibBuilder.loadTexts:
swBootDate.setDescription('The date and time when the system last booted, in displayable textual format.')
sw_fw_last_updated = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 3), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFWLastUpdated.setStatus('current')
if mibBuilder.loadTexts:
swFWLastUpdated.setDescription('The information indicates the date when the firmware was last updated, in displayable textual format.')
sw_flash_last_updated = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 4), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFlashLastUpdated.setStatus('current')
if mibBuilder.loadTexts:
swFlashLastUpdated.setDescription('The information indicates the date when the FLASH was last updated, in displayable textual format.')
sw_boot_prom_last_updated = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 5), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBootPromLastUpdated.setStatus('current')
if mibBuilder.loadTexts:
swBootPromLastUpdated.setDescription('The information indicates the date when the boot PROM was last updated, in displayable textual format.')
sw_firmware_version = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 6), display_string().subtype(subtypeSpec=value_size_constraint(0, 24))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFirmwareVersion.setStatus('current')
if mibBuilder.loadTexts:
swFirmwareVersion.setDescription('The current version of the firwmare.')
sw_oper_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 7), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4))).clone(namedValues=named_values(('online', 1), ('offline', 2), ('testing', 3), ('faulty', 4)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swOperStatus.setStatus('current')
if mibBuilder.loadTexts:
swOperStatus.setDescription('The current operational status of the switch. The states are as follow: o online(1) means the switch is accessible by an external Fibre Channel port; o offline(2) means the switch is not accessible; o testing(3) means the switch is in a built-in test mode and is not accessible by an external Fibre Channel port; o faulty(4) means the switch is not operational.')
sw_adm_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 8), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6))).clone(namedValues=named_values(('online', 1), ('offline', 2), ('testing', 3), ('faulty', 4), ('reboot', 5), ('fastboot', 6)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swAdmStatus.setStatus('current')
if mibBuilder.loadTexts:
swAdmStatus.setDescription("The desired administrative status of the switch. A management station may place the switch in a desired state by setting this object accordingly. The states are as follow: o online(1) means set the switch to be accessible by an external Fibre Channel port; o offline(2) means set the switch to be inaccessible; o testing(3) means set the switch to run the built-in test; o faulty(4) means set the switch to a 'soft' faulty condition; o reboot(5) means set the switch to reboot in 1 second. o fastboot(6) means set the switch to fastboot in 1 second. Fastboot would cause the switch to boot but skip over the POST. When the switch is in faulty state, only two states can be set: faulty and reboot/fastboot.")
sw_telnet_shell_adm_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 9), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1))).clone(namedValues=named_values(('unknown', 0), ('terminated', 1)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swTelnetShellAdmStatus.setStatus('current')
if mibBuilder.loadTexts:
swTelnetShellAdmStatus.setDescription('The desired administrative status of the Telnet shell. By setting it to terminated(1), the current Telnet shell task is deleted. When this variable instance is read, it reports the value last set through SNMP.')
sw_ssn = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 10), display_string().subtype(subtypeSpec=value_size_constraint(0, 128))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSsn.setStatus('current')
if mibBuilder.loadTexts:
swSsn.setDescription('The soft serial number of the switch.')
sw_flash_dl_oper_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 11), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3, 4, 5))).clone(namedValues=named_values(('unknown', 0), ('swCurrent', 1), ('swFwUpgraded', 2), ('swCfUploaded', 3), ('swCfDownloaded', 4), ('swFwCorrupted', 5)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFlashDLOperStatus.setStatus('current')
if mibBuilder.loadTexts:
swFlashDLOperStatus.setDescription('The operational status of the FLASH. The operational states are as follow: o swCurrent(1) indicates that the FLASH contains the current firmware image or config file; o swFwUpgraded(2) state indicates that it contains the image upgraded from the swFlashDLHost.0.; o swCfUploaded(3) state indicates that the switch configuration file has been uploaded to the host; and o swCfDownloaded(4) state indicates that the switch configuration file has been downloaded from the host. o swFwCorrupted (5) state indicates that the firmware in the FLASH of the switch is corrupted.')
sw_flash_dl_adm_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 12), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5))).clone(namedValues=named_values(('swCurrent', 1), ('swFwUpgrade', 2), ('swCfUpload', 3), ('swCfDownload', 4), ('swFwCorrupted', 5)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFlashDLAdmStatus.setStatus('current')
if mibBuilder.loadTexts:
swFlashDLAdmStatus.setDescription('The desired state of the FLASH. A management station may place the FLASH in a desired state by setting this object accordingly: o swCurrent(1) indicates that the FLASH contains the current firmware image or config file; o swFwUpgrade(2) means that the firmware in the FLASH is to be upgraded from the host specified; o swCfUpload(3) means that the switch config file is to be uploaded to the host specified; or o swCfDownload(4) means that the switch config file is to be downloaded from the host specified. o swFwCorrupted(5) state indicates that the firmware in the FLASH is corrupted. This value is for informational purpose only. However, set of swFlashDLAdmStatus to this value is not allowed. The host is specified in swFlashDLHost.0. In addition, user name is specified in swFlashDLUser.0, and the file name specified in swFlashDLFile.0. Reference the user manual on the following commands, o firmwareDownload, o configUpload, and o configDownload.')
sw_flash_dl_host = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 13), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFlashDLHost.setStatus('current')
if mibBuilder.loadTexts:
swFlashDLHost.setDescription('The name or IP address (in dot notation) of the host to download or upload a relevant file to the FLASH.')
sw_flash_dl_user = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 14), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFlashDLUser.setStatus('current')
if mibBuilder.loadTexts:
swFlashDLUser.setDescription('The user name on the host to download or upload a relevant file to or from the FLASH.')
sw_flash_dl_file = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 15), display_string()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFlashDLFile.setStatus('current')
if mibBuilder.loadTexts:
swFlashDLFile.setDescription('The name of the file to be downloaded or uploaded.')
sw_flash_dl_password = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 16), display_string().subtype(subtypeSpec=value_size_constraint(0, 100))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFlashDLPassword.setStatus('current')
if mibBuilder.loadTexts:
swFlashDLPassword.setDescription('The password to be used in for FTP transfer of files in the download or upload operation.')
sw_beacon_oper_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 18), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2))).clone(namedValues=named_values(('on', 1), ('off', 2)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBeaconOperStatus.setStatus('current')
if mibBuilder.loadTexts:
swBeaconOperStatus.setDescription('The current operational status of the switch beacon. When the beacon is on, the LEDs on the front panel of the switch run alternately from left to right and right to left. The color is yellow. When the beacon is off, each LED will be in their its regular status indicating color and state.')
sw_beacon_adm_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 19), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2))).clone(namedValues=named_values(('on', 1), ('off', 2)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swBeaconAdmStatus.setStatus('current')
if mibBuilder.loadTexts:
swBeaconAdmStatus.setDescription('The desired status of the switch beacon. When the beacon is set to on, the LEDs on the front panel of the switch run alternately from left to right and right to left. The color is yellow. When the beacon is set to off, each LED will be in its regular status indicating color and state.')
sw_diag_result = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 20), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3))).clone(namedValues=named_values(('sw-ok', 1), ('sw-faulty', 2), ('sw-embedded-port-fault', 3)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swDiagResult.setStatus('current')
if mibBuilder.loadTexts:
swDiagResult.setDescription('The result of the power-on startup (POST) diagnostics.')
sw_num_sensors = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 21), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNumSensors.setStatus('current')
if mibBuilder.loadTexts:
swNumSensors.setDescription('The number of sensors inside the switch.')
sw_sensor_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22))
if mibBuilder.loadTexts:
swSensorTable.setStatus('current')
if mibBuilder.loadTexts:
swSensorTable.setDescription('The table of sensor entries.')
sw_sensor_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1)).setIndexNames((0, 'SW-MIB', 'swSensorIndex'))
if mibBuilder.loadTexts:
swSensorEntry.setStatus('current')
if mibBuilder.loadTexts:
swSensorEntry.setDescription('An entry of the sensor information.')
sw_sensor_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 1), sw_sensor_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSensorIndex.setStatus('current')
if mibBuilder.loadTexts:
swSensorIndex.setDescription('This object identifies the sensor.')
sw_sensor_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 2), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3))).clone(namedValues=named_values(('temperature', 1), ('fan', 2), ('power-supply', 3)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSensorType.setStatus('current')
if mibBuilder.loadTexts:
swSensorType.setDescription('This object identifies the sensor type.')
sw_sensor_status = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 3), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6))).clone(namedValues=named_values(('unknown', 1), ('faulty', 2), ('below-min', 3), ('nominal', 4), ('above-max', 5), ('absent', 6)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSensorStatus.setStatus('current')
if mibBuilder.loadTexts:
swSensorStatus.setDescription('The current status of the sensor.')
sw_sensor_value = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 4), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSensorValue.setStatus('current')
if mibBuilder.loadTexts:
swSensorValue.setDescription('The current value (reading) of the sensor. The value, -2147483648, represents an unknown quantity. It also means that the sensor does not have the capability to measure the actual value. In V2.0, the temperature sensor value will be in Celsius; the fan value will be in RPM (revolution per minute); and the power supply sensor reading will be unknown.')
sw_sensor_info = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 22, 1, 5), display_string().subtype(subtypeSpec=value_size_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSensorInfo.setStatus('current')
if mibBuilder.loadTexts:
swSensorInfo.setDescription("Additional displayable information on the sensor. In V2.x, it contains the sensor type and number in textual format. For example, 'Temp 3', 'Fan 6'.")
sw_track_changes_info = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 23), display_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrackChangesInfo.setStatus('current')
if mibBuilder.loadTexts:
swTrackChangesInfo.setDescription('Track changes string. For trap only')
sw_id = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 24), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swID.setStatus('current')
if mibBuilder.loadTexts:
swID.setDescription('The number of the logical switch (0/1)')
sw_ether_ip_address = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 25), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEtherIPAddress.setStatus('current')
if mibBuilder.loadTexts:
swEtherIPAddress.setDescription('The IP Address of the Ethernet interface of this logical switch.')
sw_ether_ip_mask = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 26), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEtherIPMask.setStatus('current')
if mibBuilder.loadTexts:
swEtherIPMask.setDescription('The IP Mask of the Ethernet interface of this logical switch.')
sw_fcip_address = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 27), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCIPAddress.setStatus('current')
if mibBuilder.loadTexts:
swFCIPAddress.setDescription('The IP Address of the FC interface of this logical switch.')
sw_fcip_mask = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 28), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCIPMask.setStatus('current')
if mibBuilder.loadTexts:
swFCIPMask.setDescription('The IP Mask of the FC interface of this logical switch.')
sw_i_pv6_address = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 29), display_string())
if mibBuilder.loadTexts:
swIPv6Address.setStatus('current')
if mibBuilder.loadTexts:
swIPv6Address.setDescription('IPV6 address.')
sw_i_pv6_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 30), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4))).clone(namedValues=named_values(('tentative', 1), ('preferred', 2), ('ipdeprecated', 3), ('inactive', 4))))
if mibBuilder.loadTexts:
swIPv6Status.setStatus('current')
if mibBuilder.loadTexts:
swIPv6Status.setDescription('The current status of ipv6 address.')
sw_model = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 31), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3))).clone(namedValues=named_values(('switch7500', 1), ('switch7500E', 2), ('other', 3)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swModel.setStatus('current')
if mibBuilder.loadTexts:
swModel.setDescription('Indicates whether the switch is 7500 or 7500E .')
sw_test_string = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 32), display_string().subtype(subtypeSpec=value_size_constraint(1, 255)))
if mibBuilder.loadTexts:
swTestString.setStatus('current')
if mibBuilder.loadTexts:
swTestString.setDescription('presence of this string represents test trap.')
sw_port_list = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 33), octet_string())
if mibBuilder.loadTexts:
swPortList.setStatus('current')
if mibBuilder.loadTexts:
swPortList.setDescription('This string represents the list of ports and its WWN when ports moved from one switch to another.')
sw_brcd_trap_bit_mask = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 34), integer32())
if mibBuilder.loadTexts:
swBrcdTrapBitMask.setStatus('current')
if mibBuilder.loadTexts:
swBrcdTrapBitMask.setDescription('Type of notification will be represented by a single bit in this variable. 0x01 - Fabric change event 0x02 - Device change event 0x04 - Fapwwn change event 0x08 - FDMI events.')
sw_fc_port_prev_type = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 35), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7))).clone(namedValues=named_values(('unknown', 1), ('other', 2), ('fl-port', 3), ('f-port', 4), ('e-port', 5), ('g-port', 6), ('ex-port', 7))))
if mibBuilder.loadTexts:
swFCPortPrevType.setStatus('current')
if mibBuilder.loadTexts:
swFCPortPrevType.setDescription('This represents port type of a port before it goes online/offline and it is valid only in swFcPortSCN trap')
sw_device_status = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 1, 36), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3))).clone(namedValues=named_values(('login', 1), ('logout', 2), ('unknown', 3))))
if mibBuilder.loadTexts:
swDeviceStatus.setStatus('current')
if mibBuilder.loadTexts:
swDeviceStatus.setDescription('This represents the attached device status. The status will change whenever port/node goes to online/offline')
sw_domain_id = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 1), sw_domain_index()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swDomainID.setStatus('current')
if mibBuilder.loadTexts:
swDomainID.setDescription('The current Fibre Channel domain ID of the switch. To set a new value, the switch (swAdmStatus) must be in offline or testing state.')
sw_principal_switch = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 2), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2))).clone(namedValues=named_values(('yes', 1), ('no', 2)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swPrincipalSwitch.setStatus('current')
if mibBuilder.loadTexts:
swPrincipalSwitch.setDescription('This object indicates whether the switch is the Principal switch as per FC-SW.')
sw_num_nbs = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 8), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNumNbs.setStatus('current')
if mibBuilder.loadTexts:
swNumNbs.setDescription('The number of Inter-Switch Links in the (immediate) neighborhood.')
sw_nb_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9))
if mibBuilder.loadTexts:
swNbTable.setStatus('current')
if mibBuilder.loadTexts:
swNbTable.setDescription('This table contains the ISLs in the immediate neighborhood of the switch.')
sw_nb_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1)).setIndexNames((0, 'SW-MIB', 'swNbIndex'))
if mibBuilder.loadTexts:
swNbEntry.setStatus('current')
if mibBuilder.loadTexts:
swNbEntry.setDescription('An entry containing each neighbor ISL parameters.')
sw_nb_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 1), sw_nb_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbIndex.setStatus('current')
if mibBuilder.loadTexts:
swNbIndex.setDescription('This object identifies the neighbor ISL entry.')
sw_nb_my_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 2), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbMyPort.setStatus('current')
if mibBuilder.loadTexts:
swNbMyPort.setDescription('This is the port that has an ISL to another switch.')
sw_nb_rem_domain = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 3), sw_domain_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbRemDomain.setStatus('current')
if mibBuilder.loadTexts:
swNbRemDomain.setDescription('This is the Fibre Channel domain on the other end of the ISL.')
sw_nb_rem_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 4), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbRemPort.setStatus('current')
if mibBuilder.loadTexts:
swNbRemPort.setDescription('This is the port index on the other end of the ISL.')
sw_nb_baud_rate = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 5), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 4, 8, 16, 32, 64, 128, 256, 512))).clone(namedValues=named_values(('other', 1), ('oneEighth', 2), ('quarter', 4), ('half', 8), ('full', 16), ('double', 32), ('quadruple', 64), ('octuple', 128), ('decuple', 256), ('sexdecuple', 512)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbBaudRate.setStatus('current')
if mibBuilder.loadTexts:
swNbBaudRate.setDescription('The baud rate of the ISL.')
sw_nb_isl_state = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 6), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3, 4, 5))).clone(namedValues=named_values(('sw-down', 0), ('sw-init', 1), ('sw-internal2', 2), ('sw-internal3', 3), ('sw-internal4', 4), ('sw-active', 5)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbIslState.setStatus('current')
if mibBuilder.loadTexts:
swNbIslState.setDescription('The current state of the ISL. The swNbIslState will be 0 when ISL is in incompatible state or port is a slave port.')
sw_nb_isl_cost = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 7), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swNbIslCost.setStatus('current')
if mibBuilder.loadTexts:
swNbIslCost.setDescription('The current link cost of the ISL.')
sw_nb_rem_port_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 9, 1, 8), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNbRemPortName.setStatus('current')
if mibBuilder.loadTexts:
swNbRemPortName.setDescription('The World_wide_Name of the remote port.')
sw_fabric_mem_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10))
if mibBuilder.loadTexts:
swFabricMemTable.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemTable.setDescription('This table contains information on the member switches of a fabric. This may not be available on all versions of Fabric OS.')
sw_fabric_mem_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1)).setIndexNames((0, 'SW-MIB', 'swFabricMemWwn'))
if mibBuilder.loadTexts:
swFabricMemEntry.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemEntry.setDescription('An entry containing each switch in the fabric.')
sw_fabric_mem_wwn = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 1), fc_wwn()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemWwn.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemWwn.setDescription('This object identifies the World wide name of the member switch.')
sw_fabric_mem_did = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 2), sw_domain_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemDid.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemDid.setDescription('This object identifies the domain id of the member switch.')
sw_fabric_mem_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 3), display_string().subtype(subtypeSpec=value_size_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemName.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemName.setDescription('This object identifies the name of the member switch.')
sw_fabric_mem_eip = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 4), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemEIP.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemEIP.setDescription('This object identifies the ethernet IP address of the member switch.')
sw_fabric_mem_fcip = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 5), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemFCIP.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemFCIP.setDescription('This object identifies the Fibre Channel IP address of the member switch.')
sw_fabric_mem_gwip = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 6), ip_address()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemGWIP.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemGWIP.setDescription('This object identifies the Gateway IP address of the member switch.')
sw_fabric_mem_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 7), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemType.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemType.setDescription('This object identifies the member switch type.')
sw_fabric_mem_short_version = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 10, 1, 8), octet_string().subtype(subtypeSpec=value_size_constraint(0, 24))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFabricMemShortVersion.setStatus('current')
if mibBuilder.loadTexts:
swFabricMemShortVersion.setDescription('This object identifies Fabric OS version of the member switch.')
sw_idid_mode = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 11), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2))).clone(namedValues=named_values(('enabled', 1), ('disabled', 2)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swIDIDMode.setStatus('current')
if mibBuilder.loadTexts:
swIDIDMode.setDescription('Status of Insistent Domain ID (IDID) mode. Status indicating IDID mode is enabled or not.')
sw_pmgr_event_type = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 12), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3, 4, 6))).clone(namedValues=named_values(('create', 0), ('delete', 1), ('moveport', 2), ('fidchange', 3), ('basechange', 4), ('vfstatechange', 6))))
if mibBuilder.loadTexts:
swPmgrEventType.setStatus('current')
if mibBuilder.loadTexts:
swPmgrEventType.setDescription('Indicates Partition manager event type.')
sw_pmgr_event_time = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 13), display_string().subtype(subtypeSpec=value_size_constraint(0, 64)))
if mibBuilder.loadTexts:
swPmgrEventTime.setStatus('current')
if mibBuilder.loadTexts:
swPmgrEventTime.setDescription('This object identifies the date and time when this pmgr event occurred, in textual format.')
sw_pmgr_event_descr = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 14), display_string().subtype(subtypeSpec=value_size_constraint(0, 64)))
if mibBuilder.loadTexts:
swPmgrEventDescr.setStatus('current')
if mibBuilder.loadTexts:
swPmgrEventDescr.setDescription('This object identifies the textual description of the pmgr event.')
sw_vf_id = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 15), integer32().subtype(subtypeSpec=value_range_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swVfId.setStatus('current')
if mibBuilder.loadTexts:
swVfId.setDescription('The Virtual fabric id.')
sw_vf_name = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 2, 16), display_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swVfName.setStatus('current')
if mibBuilder.loadTexts:
swVfName.setDescription('This represents the virtual fabric name configured in the switch')
sw_agt_cmty_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11))
if mibBuilder.loadTexts:
swAgtCmtyTable.setStatus('deprecated')
if mibBuilder.loadTexts:
swAgtCmtyTable.setDescription('A table that contains, one entry for each Community, the access control and parameters of the Community.')
swauth_protocol_password = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 12), octet_string().subtype(subtypeSpec=value_size_constraint(1, 32))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swauthProtocolPassword.setStatus('current')
if mibBuilder.loadTexts:
swauthProtocolPassword.setDescription('This entry is created specific to the Pharos switch to change the password for the auth protocol to reserved user DirectorServerSNMPv3User')
swpriv_protocol_password = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 13), octet_string().subtype(subtypeSpec=value_size_constraint(1, 32))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swprivProtocolPassword.setStatus('current')
if mibBuilder.loadTexts:
swprivProtocolPassword.setDescription('This entry is created specific to the Pharos switch to change the password for the priv protocol to reserved user DirectorServerSNMPv3User')
sw_agt_cmty_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1)).setIndexNames((0, 'SW-MIB', 'swAgtCmtyIdx'))
if mibBuilder.loadTexts:
swAgtCmtyEntry.setStatus('deprecated')
if mibBuilder.loadTexts:
swAgtCmtyEntry.setDescription('An entry containing the Community parameters.')
sw_agt_cmty_idx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(1, 6))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swAgtCmtyIdx.setStatus('deprecated')
if mibBuilder.loadTexts:
swAgtCmtyIdx.setDescription('This object identifies the SNMPv1 Community entry.')
sw_agt_cmty_str = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 2), display_string().subtype(subtypeSpec=value_size_constraint(2, 16))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swAgtCmtyStr.setStatus('deprecated')
if mibBuilder.loadTexts:
swAgtCmtyStr.setDescription('This is a Community string supported by the agent. If a new value is set successfully, it takes effect immediately.')
sw_agt_trap_rcp = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 3), ip_address()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swAgtTrapRcp.setStatus('deprecated')
if mibBuilder.loadTexts:
swAgtTrapRcp.setDescription('This is the trap recipient associated with the Community. If a new value is set successfully, it takes effect immediately.')
sw_agt_trap_severity_level = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 4, 11, 1, 4), sw_sev_type()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swAgtTrapSeverityLevel.setStatus('deprecated')
if mibBuilder.loadTexts:
swAgtTrapSeverityLevel.setDescription("This is the trap severity level associated with the swAgtTrapRcp. The trap severity level in conjunction with the an event's severity level. When an event occurs and if its severity level is at or below the set value, the SNMP trap is sent to configured trap recipients. The severity level is limited to particular events. If a new value is set successfully, it takes effect immediately.")
sw_fc_port_capacity = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortCapacity.setStatus('current')
if mibBuilder.loadTexts:
swFCPortCapacity.setDescription('The maximum number of of physical ports on the switch. This will include ports of the protocol: FC, FCIP(GE ports), VE(FCIP)...')
sw_fc_port_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2))
if mibBuilder.loadTexts:
swFCPortTable.setStatus('current')
if mibBuilder.loadTexts:
swFCPortTable.setDescription('A table that contains, one entry for each switch port, configuration and service parameters of the port.')
sw_fc_port_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1)).setIndexNames((0, 'SW-MIB', 'swFCPortIndex'))
if mibBuilder.loadTexts:
swFCPortEntry.setStatus('current')
if mibBuilder.loadTexts:
swFCPortEntry.setDescription('An entry containing the configuration and service parameters of the switch port.')
sw_fc_port_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 1), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortIndex.setStatus('current')
if mibBuilder.loadTexts:
swFCPortIndex.setDescription('This object identifies the switch port index. Note that the value of a port index is 1 higher than the port number labeled on the front panel. E.g. port index 1 correspond to port number 0.')
sw_fc_port_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 2), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7, 8))).clone(namedValues=named_values(('stitch', 1), ('flannel', 2), ('loom', 3), ('bloom', 4), ('rdbloom', 5), ('wormhole', 6), ('other', 7), ('unknown', 8)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortType.setStatus('current')
if mibBuilder.loadTexts:
swFCPortType.setDescription('This object identifies the type of switch port. It may be of type stitch(1), flannel(2), loom(3) , bloom(4),rdbloom(5) or wormhole(6).')
sw_fc_port_phy_state = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 3), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 14, 255))).clone(namedValues=named_values(('noCard', 1), ('noTransceiver', 2), ('laserFault', 3), ('noLight', 4), ('noSync', 5), ('inSync', 6), ('portFault', 7), ('diagFault', 8), ('lockRef', 9), ('validating', 10), ('invalidModule', 11), ('noSigDet', 14), ('unknown', 255)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortPhyState.setStatus('current')
if mibBuilder.loadTexts:
swFCPortPhyState.setDescription('This object identifies the physical state of the port: noCard(1) no card present in this switch slot; noTransceiver(2) no Transceiver module in this port. noGbic(2) was used previously. Transceiver is the generic name for GBIC, SFP etc.; laserFault(3) the module is signaling a laser fault (defective Transceiver); noLight(4) the module is not receiving light; noSync(5) the module is receiving light but is out of sync; inSync(6) the module is receiving light and is in sync; portFault(7) the port is marked faulty (defective Transceiver, cable or device); diagFault(8) the port failed diagnostics (defective G_Port or FL_Port card or motherboard); lockRef(9) the port is locking to the reference signal. validating(10) Validation is in progress invalidModule(11) Invalid SFP unknown(255) unknown. ')
sw_fc_port_op_status = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 4), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3, 4))).clone(namedValues=named_values(('unknown', 0), ('online', 1), ('offline', 2), ('testing', 3), ('faulty', 4)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortOpStatus.setStatus('current')
if mibBuilder.loadTexts:
swFCPortOpStatus.setDescription('This object identifies the operational status of the port. The online(1) state indicates that user frames can be passed. The unknown(0) state indicates that likely the port module is physically absent (see swFCPortPhyState).')
sw_fc_port_adm_status = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 5), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4))).clone(namedValues=named_values(('online', 1), ('offline', 2), ('testing', 3), ('faulty', 4)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFCPortAdmStatus.setStatus('current')
if mibBuilder.loadTexts:
swFCPortAdmStatus.setDescription('The desired state of the port. A management station may place the port in a desired state by setting this object accordingly. The testing(3) state indicates that no user frames can be passed. As the result of either explicit management action or per configuration information accessible by the switch, swFCPortAdmStatus is then changed to either the online(1) or testing(3) states, or remains in the offline(2) state.')
sw_fc_port_link_state = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 6), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3))).clone(namedValues=named_values(('enabled', 1), ('disabled', 2), ('loopback', 3)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFCPortLinkState.setStatus('current')
if mibBuilder.loadTexts:
swFCPortLinkState.setDescription("This object indicates the link state of the port. The value may be: enabled(1) - port is allowed to participate in the FC-PH protocol with its attached port (or ports if it is in a FC-AL loop); disabled(2) - the port is not allowed to participate in the FC-PH protocol with its attached port(s); loopback(3) - the port may transmit frames through an internal path to verify the health of the transmitter and receiver path. Note that when the port's link state changes, its operational status (swFCPortOpStatus) will be affected.")
sw_fc_port_tx_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 7), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5))).clone(namedValues=named_values(('unknown', 1), ('lw', 2), ('sw', 3), ('ld', 4), ('cu', 5)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortTxType.setStatus('current')
if mibBuilder.loadTexts:
swFCPortTxType.setDescription('This object indicates the media transmitter type of the port. The value may be: unknown(1) cannot determined to the port driver lw(2) long wave laser sw(3) short wave laser ld(4) long wave LED cu(5) copper (electrical).')
sw_fc_port_tx_words = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 11), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortTxWords.setStatus('current')
if mibBuilder.loadTexts:
swFCPortTxWords.setDescription('This object counts the number of Fibre Channel words that the port has transmitted.')
sw_fc_port_rx_words = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 12), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxWords.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxWords.setDescription('This object counts the number of Fibre Channel words that the port has received.')
sw_fc_port_tx_frames = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 13), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortTxFrames.setStatus('current')
if mibBuilder.loadTexts:
swFCPortTxFrames.setDescription('This object counts the number of (Fibre Channel) frames that the port has transmitted.')
sw_fc_port_rx_frames = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 14), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxFrames.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxFrames.setDescription('This object counts the number of (Fibre Channel) frames that the port has received.')
sw_fc_port_rx_c2_frames = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 15), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxC2Frames.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxC2Frames.setDescription('This object counts the number of Class 2 frames that the port has received.')
sw_fc_port_rx_c3_frames = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 16), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxC3Frames.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxC3Frames.setDescription('This object counts the number of Class 3 frames that the port has received.')
sw_fc_port_rx_l_cs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 17), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxLCs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxLCs.setDescription('This object counts the number of Link Control frames that the port has received.')
sw_fc_port_rx_mcasts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 18), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxMcasts.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxMcasts.setDescription('This object counts the number of Multicast frames that the port has received.')
sw_fc_port_too_many_rdys = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 19), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortTooManyRdys.setStatus('current')
if mibBuilder.loadTexts:
swFCPortTooManyRdys.setDescription('This object counts the number of times when RDYs exceeds the frames received.')
sw_fc_port_no_tx_credits = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 20), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortNoTxCredits.setStatus('current')
if mibBuilder.loadTexts:
swFCPortNoTxCredits.setDescription('This object counts the number of times when the transmit credit has reached zero.')
sw_fc_port_rx_enc_in_frs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 21), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxEncInFrs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxEncInFrs.setDescription('This object counts the number of encoding error or disparity error inside frames received.')
sw_fc_port_rx_crcs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 22), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxCrcs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxCrcs.setDescription('This object counts the number of CRC errors detected for frames received.')
sw_fc_port_rx_truncs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 23), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxTruncs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxTruncs.setDescription('This object counts the number of truncated frames that the port has received.')
sw_fc_port_rx_too_longs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 24), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxTooLongs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxTooLongs.setDescription('This object counts the number of received frames that are too long.')
sw_fc_port_rx_bad_eofs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 25), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxBadEofs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxBadEofs.setDescription('This object counts the number of received frames that have bad EOF delimiter.')
sw_fc_port_rx_enc_out_frs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 26), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxEncOutFrs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxEncOutFrs.setDescription('This object counts the number of encoding error or disparity error outside frames received.')
sw_fc_port_rx_bad_os = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 27), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortRxBadOs.setStatus('current')
if mibBuilder.loadTexts:
swFCPortRxBadOs.setDescription('This object counts the number of invalid Ordered Sets received.')
sw_fc_port_c3_discards = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 28), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortC3Discards.setStatus('current')
if mibBuilder.loadTexts:
swFCPortC3Discards.setDescription('This object counts the number of Class 3 frames that the port has discarded.')
sw_fc_port_mcast_timed_outs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 29), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortMcastTimedOuts.setStatus('current')
if mibBuilder.loadTexts:
swFCPortMcastTimedOuts.setDescription('This object counts the number of Multicast frames that has been timed out.')
sw_fc_port_tx_mcasts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 30), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortTxMcasts.setStatus('current')
if mibBuilder.loadTexts:
swFCPortTxMcasts.setDescription('This object counts the number of Multicast frames that has been transmitted.')
sw_fc_port_lip_ins = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 31), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortLipIns.setStatus('current')
if mibBuilder.loadTexts:
swFCPortLipIns.setDescription('This object counts the number of Loop Initializations that has been initiated by loop devices attached.')
sw_fc_port_lip_outs = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 32), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortLipOuts.setStatus('current')
if mibBuilder.loadTexts:
swFCPortLipOuts.setDescription('This object counts the number of Loop Initializations that has been initiated by the port.')
sw_fc_port_lip_last_alpa = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 33), octet_string().subtype(subtypeSpec=value_size_constraint(4, 4)).setFixedLength(4)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortLipLastAlpa.setStatus('current')
if mibBuilder.loadTexts:
swFCPortLipLastAlpa.setDescription('This object indicates the Physical Address (AL_PA) of the loop device that initiated the last Loop Initialization.')
sw_fc_port_wwn = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 34), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortWwn.setStatus('current')
if mibBuilder.loadTexts:
swFCPortWwn.setDescription('The World_wide_Name of the Fibre Channel port. The contents of an instance are in the IEEE extended format as specified in FC-PH; the 12-bit port identifier represents the port number within the switch.')
sw_fc_port_speed = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 35), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7, 8))).clone(namedValues=named_values(('one-GB', 1), ('two-GB', 2), ('auto-Negotiate', 3), ('four-GB', 4), ('eight-GB', 5), ('ten-GB', 6), ('unknown', 7), ('sixteen-GB', 8)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFCPortSpeed.setStatus('obsolete')
if mibBuilder.loadTexts:
swFCPortSpeed.setDescription('The desired baud rate for the port. It can have the values of 1GB (1), 2GB (2), Auto-Negotiate (3), 4GB (4), 8GB (5), 10GB (6), 16GB (8). Some of the above values may not be supported by all type of switches.')
sw_fc_port_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 36), display_string().subtype(subtypeSpec=value_size_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortName.setStatus('current')
if mibBuilder.loadTexts:
swFCPortName.setDescription('A string indicates the name of the addressed port. The names should be persistent across switch reboots. Port names do not have to be unique within a switch or within a fabric.')
sw_fc_port_specifier = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 37), display_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortSpecifier.setStatus('current')
if mibBuilder.loadTexts:
swFCPortSpecifier.setDescription("This string indicates the physical port number of the addressed port. The format of the string is: <slot>/port, where 'slot' being present only for bladed systems. ")
sw_fc_port_flag = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 38), fc_port_flag()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortFlag.setStatus('current')
if mibBuilder.loadTexts:
swFCPortFlag.setDescription('A bit map of port status flags which includes the information of port type. Currently this will indicate if the port is virtual or physical.')
sw_fc_port_brcd_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 39), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7))).clone(namedValues=named_values(('unknown', 1), ('other', 2), ('fl-port', 3), ('f-port', 4), ('e-port', 5), ('g-port', 6), ('ex-port', 7)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFCPortBrcdType.setStatus('current')
if mibBuilder.loadTexts:
swFCPortBrcdType.setDescription('The Brocade port type.')
sw_fc_port_disable_reason = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 6, 2, 1, 40), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152, 153, 154, 155, 156, 157, 158, 159, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 174, 175, 176, 177, 178, 179, 180, 181, 182, 183, 184, 185, 186, 187, 188, 189, 190, 191, 192, 193, 194, 195, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207, 208, 209, 210, 211, 212, 213, 214, 215, 216, 217, 218, 219, 220, 221, 222, 223, 224, 225, 226, 227, 228, 229, 230))).clone(namedValues=named_values(('r-recover-fail', 1), ('r-invalid-reason', 2), ('r-forced', 3), ('r-sw-disabled', 4), ('r-bl-disabled', 5), ('r-slot-off', 6), ('r-sw-enabled', 7), ('r-bl-enabled', 8), ('r-slot-on', 9), ('r-persistid', 10), ('r-sw-violation', 11), ('r-prv-dev-violation', 12), ('r-pub-dev-violation', 13), ('r-port-data-fail', 14), ('r-online-incomplete', 15), ('r-online-route-fail', 16), ('r-inconsistent', 17), ('r-set-vcc-fail', 18), ('r-ecp-in-testing', 19), ('r-elp-in-testing', 20), ('r-ecp-retries-exceeded', 21), ('r-invalid-ecp-state', 22), ('r-bad-ecp-rcvd', 23), ('r-send-rtmark-fail', 24), ('r-send-ecp-fail', 25), ('r-save-link-rtt-fail', 26), ('r-em-incnst', 27), ('r-pci-attach-fail', 28), ('r-buf-starv', 29), ('r-elp-fctl-mismatch', 30), ('r-eport-disabled', 31), ('r-trunk-with-vcxlt', 32), ('r-sw-fl-port-not-ready', 33), ('r-link-reinit', 34), ('r-domain-id-change', 35), ('r-auth-rejected', 36), ('r-auth-timeout', 37), ('r-auth-fail-retry', 38), ('r-fcr-conf-mismatch1', 39), ('r-fcr-conf-mismatch2', 40), ('r-fcr-port-ld-mode-mismatch', 41), ('r-fcr-ld-credit-mismatch', 42), ('r-fcr-set-vcc-failed', 43), ('r-fcr-set-rtc-failed', 44), ('r-fcr-elp-ver-inconsis', 45), ('r-fcr-elp-fctl-mismatch', 46), ('r-fcr-pid-mismatch', 47), ('r-fcr-tov-mismatch', 48), ('r-fcr-ld-incompat', 49), ('r-fcr-isolated', 50), ('r-elp-retries-exceeded', 51), ('r-fcr-exports-exceeded', 52), ('r-fcr-license', 53), ('r-fcr-conf-ex', 54), ('r-fcr-ftag-over', 55), ('r-fcr-ftag-conflict', 56), ('r-fcr-fowner-conflict', 57), ('r-fcr-zone-resource', 58), ('r-fcr-port-state-to', 59), ('r-fcr-authn-reject', 60), ('r-fcr-sec-fcs-list', 61), ('r-fcr-sec-failure', 62), ('r-fcr-incompatible-mode', 63), ('r-fcr-sec-scc-list', 64), ('r-fcr-generic', 65), ('r-sw-ex-port-not-ready', 66), ('r-fcr-class-f-incompat', 67), ('r-fcr-class-n-incompat', 68), ('r-fcr-invalid-flow-rcvd', 69), ('r-fcr-state-disabled', 70), ('r-fdd-strict-exist', 71), ('r-last-port-disable-msg', 72), ('r-sw-l-port-not-support', 73), ('r-peer-port-in-di-zone', 74), ('r-zone-incompat', 75), ('r-sw-config-l-port-not-support', 76), ('r-sw-port-mirror-configured', 77), ('r-nportlogin-inprogress', 78), ('r-nonpiv', 79), ('r-nomapping', 80), ('r-unknowntype', 81), ('r-nportoffline', 82), ('r-flogifailed', 83), ('r-nportbusy', 84), ('r-noflogi', 85), ('r-noflogiresp', 86), ('r-flogidupalpa', 87), ('r-loopcfg', 88), ('r-noenclicense', 89), ('r-nofiportmapping', 90), ('r-brcdfabconn', 91), ('r-port-reset', 92), ('r-floginport', 93), ('r-fdd-strict-conflict', 94), ('r-fdd-cfg-conflict', 95), ('r-fdd-cfg-conflict-na-neigh', 96), ('r-fcr-insistent-front-did-mismatch', 97), ('r-fcr-fabric-binding-failure', 98), ('r-fcr-non-standard-domain-offset', 99), ('r-area-in-use', 100), ('r-mstr-diff-pg', 101), ('r-mstr-diff-area', 102), ('r-ta-not-supported', 103), ('r-eport-not-supported', 104), ('r-fport-not-supported', 105), ('r-cfg-not-supported', 106), ('r-port-ll-th-exceeded', 107), ('r-port-synl-th-exceeded', 108), ('r-port-pe-th-exceeded', 109), ('f-port-disable-no-trk-lic', 110), ('r-port-inw-th-exceeded', 111), ('r-port-crc-th-exceeded', 112), ('f-port-tr-disable-speed-not-ok', 113), ('r-port-auto-disable', 114), ('r-fcr-export-in-non-base-sw', 115), ('r-base-switch-supports-no-device', 116), ('r-port-trunk-proto-error', 117), ('r-no-area-avail', 118), ('r-cannot-unbind-existing-area', 119), ('r-cannot-use-10bit-area', 120), ('r-authentication-required', 121), ('r-port-lr-th-exceeded', 122), ('r-fcr-export-lf-conflict', 123), ('r-incompat', 124), ('r-did-overlap', 125), ('r-zone-conflict', 126), ('r-eport-seg', 127), ('r-no-license', 128), ('r-platform-db', 129), ('r-sec-incompat', 130), ('r-sec-violation', 131), ('r-ecp-longdist', 132), ('r-dup-wwn', 133), ('r-eport-isolated', 134), ('r-ad', 135), ('r-esc-did-offset', 136), ('r-esc-etiz', 137), ('r-esc-fid', 138), ('r-safe-zone', 139), ('r-vf', 140), ('r-vf-bs-incompat', 141), ('r-pers-pid-on-lport', 142), ('r-pers-pid-portaddr-collision', 143), ('r-pers-pid-port-on-same-area', 144), ('r-pers-pid-port-addr-bnd', 145), ('r-msfr', 146), ('r-sw-halfbw-lic', 147), ('r-1g-mode-incompat', 148), ('r-10g-mode-incompat', 149), ('r-dual-mode-incompat', 150), ('r-implict-plt-service-block', 151), ('r-port-st-th-exceeded', 152), ('r-port-c3txto-th-exceeded', 153), ('r-eport-not-supported-def-sw', 154), ('r-eport-ll-th-exceeded', 155), ('r-eport-synl-th-exceeded', 156), ('r-eport-pe-th-exceeded', 157), ('r-eport-inw-th-exceeded', 158), ('r-eport-crc-th-exceeded', 159), ('r-eport-lr-th-exceeded', 160), ('r-eport-st-th-exceeded', 161), ('r-eport-c3txto-th-exceeded', 162), ('r-fopport-ll-th-exceeded', 163), ('r-fopport-synl-th-exceeded', 164), ('r-fopport-pe-th-exceeded', 165), ('r-fopport-inw-th-exceeded', 166), ('r-fopport-crc-th-exceeded', 167), ('r-fopport-lr-th-exceeded', 168), ('r-fopport-st-th-exceeded', 169), ('r-fopport-c3txto-th-exceeded', 170), ('r-fcuport-ll-th-exceeded', 171), ('r-fcuport-synl-th-exceeded', 172), ('r-fcuport-pe-th-exceeded', 173), ('r-fcuport-inw-th-exceeded', 174), ('r-fcuport-crc-th-exceeded', 175), ('r-fcuport-lr-th-exceeded', 176), ('r-fcuport-st-th-exceeded', 177), ('r-fcuport-c3txto-th-exceeded', 178), ('r-port-no-area-avail-pers-disable', 179), ('r-eport-locked', 180), ('r-enh-tizone', 181), ('r-sw-port-swap-not-supported', 182), ('r-fport-slow-drain-condition', 183), ('r-esc-vlanid', 184), ('r-port-recov-state', 185), ('r-port-auto-disable-losn', 186), ('r-port-auto-disable-losg', 187), ('r-port-auto-disable-ols', 188), ('r-port-auto-disable-nos', 189), ('r-port-auto-disable-lip', 190), ('r-port-compression', 191), ('r-port-encryption', 192), ('r-port-enccomp-res', 193), ('r-port-decommissioned', 194), ('r-port-dportmode', 195), ('r-port-dport-incompat', 196), ('r-port-enc-comp-mismatch', 197), ('r-non-rcs-rem-dom', 198), ('r-port-fips-comp-mismatch', 199), ('r-port-non-fips-comp-mismatch', 200), ('r-port-enc-auth-disabled', 201), ('r-port-disable-on-zeroize', 202), ('r-cfgspeed-not-supported', 203), ('r-fcr-ex-port-not-allowed', 204), ('r-port-duplicate-pwwn', 205), ('r-fcr-trunk-master-sfid-not-set', 206), ('r-nportistrunkmem', 207), ('r-policynotsupported', 208), ('r-no-icl-license', 209), ('r-no-ten-gig-license', 210), ('r-fdd-strict-scc-conflict', 211), ('r-fdd-strict-dcc-conflict', 212), ('r-fdd-strict-fcs-conflict', 213), ('r-fdd-strict-fabwide-conflict', 214), ('r-fdd-strict-pwd-conflict', 215), ('r-fcr-interop-conf', 216), ('r-port-enc-interop-conflict', 217), ('r-port-comp-interop-conflict', 218), ('r-no-port-open-rsp', 219), ('r-no-eicl-license', 220), ('r-eicl-license-limited', 221), ('r-esc-base-sw', 222), ('r-sw-cpu-overload', 223), ('r-no-icl-pod2-license', 224), ('r-port-area-mismatch-pers-disable', 225), ('r-unauthorized-device', 226), ('r-max-flogi-reached', 227), ('r-auth-not-supported-in-switch', 228), ('r-icl-ex-on-non-vf', 229), ('r-user-disabled-reason', 230))))
if mibBuilder.loadTexts:
swFCPortDisableReason.setStatus('current')
if mibBuilder.loadTexts:
swFCPortDisableReason.setDescription('It indicates the state change reason when port goes from online to offline')
sw_ns_local_num_entry = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsLocalNumEntry.setStatus('current')
if mibBuilder.loadTexts:
swNsLocalNumEntry.setDescription('The number of local Name Server entries.')
sw_ns_local_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2))
if mibBuilder.loadTexts:
swNsLocalTable.setStatus('current')
if mibBuilder.loadTexts:
swNsLocalTable.setDescription('The table of local Name Server entries.')
sw_ns_local_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1)).setIndexNames((0, 'SW-MIB', 'swNsEntryIndex'))
if mibBuilder.loadTexts:
swNsLocalEntry.setStatus('current')
if mibBuilder.loadTexts:
swNsLocalEntry.setDescription('An entry of the local Name Server database.')
sw_ns_entry_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsEntryIndex.setStatus('current')
if mibBuilder.loadTexts:
swNsEntryIndex.setDescription('The object identifies the Name Server database entry.')
sw_ns_port_id = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 2), octet_string().subtype(subtypeSpec=value_size_constraint(4, 4)).setFixedLength(4)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsPortID.setStatus('current')
if mibBuilder.loadTexts:
swNsPortID.setDescription('The object identifies the Fibre Channel port address ID of the entry.')
sw_ns_port_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 3), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2))).clone(namedValues=named_values(('nPort', 1), ('nlPort', 2)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsPortType.setStatus('current')
if mibBuilder.loadTexts:
swNsPortType.setDescription('The object identifies the type of port: N_Port, NL_Port, etc., for this entry. The type is defined in FC-GS-2.')
sw_ns_port_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 4), fc_wwn()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsPortName.setStatus('current')
if mibBuilder.loadTexts:
swNsPortName.setDescription('The object identifies the Fibre Channel World_wide Name of the port entry.')
sw_ns_port_symb = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 5), octet_string().subtype(subtypeSpec=value_size_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsPortSymb.setStatus('current')
if mibBuilder.loadTexts:
swNsPortSymb.setDescription("The object identifies the contents of a Symbolic Name of the port entry. In FC-GS-2, a Symbolic Name consists of a byte array of 1 through 255 bytes, and the first byte of the array specifies the length of its 'contents'. This object variable corresponds to the 'contents' of the Symbolic Name, without the first byte.")
sw_ns_node_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 6), fc_wwn()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsNodeName.setStatus('current')
if mibBuilder.loadTexts:
swNsNodeName.setDescription('The object identifies the Fibre Channel World_wide Name of the associated node as defined in FC-GS-2.')
sw_ns_node_symb = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 7), octet_string().subtype(subtypeSpec=value_size_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsNodeSymb.setStatus('current')
if mibBuilder.loadTexts:
swNsNodeSymb.setDescription("The object identifies the contents of a Symbolic Name of the the node associated with the entry. In FC-GS-2, a Symbolic Name consists of a byte array of 1 through 255 bytes, and the first byte of the array specifies the length of its 'contents'. This object variable corresponds to the 'contents' of the Symbolic Name, without the first byte (specifying the length).")
sw_ns_ipa = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 8), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsIPA.setStatus('current')
if mibBuilder.loadTexts:
swNsIPA.setDescription('The object identifies the Initial Process Associator of the node for the entry as defined in FC-GS-2.')
sw_ns_ip_address = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 9), octet_string().subtype(subtypeSpec=value_size_constraint(16, 16)).setFixedLength(16)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsIpAddress.setStatus('current')
if mibBuilder.loadTexts:
swNsIpAddress.setDescription('The object identifies the IP address of the node for the entry as defined in FC-GS-2. The format of the address is in IPv6.')
sw_ns_cos = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 10), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15))).clone(namedValues=named_values(('class-F', 1), ('class-1', 2), ('class-F-1', 3), ('class-2', 4), ('class-F-2', 5), ('class-1-2', 6), ('class-F-1-2', 7), ('class-3', 8), ('class-F-3', 9), ('class-1-3', 10), ('class-F-1-3', 11), ('class-2-3', 12), ('class-F-2-3', 13), ('class-1-2-3', 14), ('class-F-1-2-3', 15)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsCos.setStatus('current')
if mibBuilder.loadTexts:
swNsCos.setDescription('The object identifies the class of services supported by the port. The value is a bit-map defined as follows: o bit 0 is class F, o bit 1 is class 1, o bit 2 is class 2, o bit 3 is class 3, o bit 4 is class 4, etc.')
sw_ns_fc4 = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 11), octet_string().subtype(subtypeSpec=value_size_constraint(32, 32)).setFixedLength(32)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsFc4.setStatus('current')
if mibBuilder.loadTexts:
swNsFc4.setDescription('The object identifies the FC-4s supported by the port as defined in FC-GS-2.')
sw_ns_ip_nx_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 12), octet_string().subtype(subtypeSpec=value_size_constraint(16, 16)).setFixedLength(16)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsIpNxPort.setStatus('current')
if mibBuilder.loadTexts:
swNsIpNxPort.setDescription('The object identifies IpAddress of the Nx_port for the entry.')
sw_ns_wwn = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 13), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsWwn.setStatus('current')
if mibBuilder.loadTexts:
swNsWwn.setDescription('The object identifies the World Wide Name (WWN) of the Fx_port for the entry.')
sw_ns_hard_addr = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 7, 2, 1, 14), octet_string().subtype(subtypeSpec=value_size_constraint(3, 3)).setFixedLength(3)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swNsHardAddr.setStatus('current')
if mibBuilder.loadTexts:
swNsHardAddr.setDescription('The object identifies the 24-bit hard address of the node for the entry.')
sw_event_trap_level = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 1), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3, 4, 5))).clone(namedValues=named_values(('none', 0), ('critical', 1), ('error', 2), ('warning', 3), ('informational', 4), ('debug', 5)))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swEventTrapLevel.setStatus('deprecated')
if mibBuilder.loadTexts:
swEventTrapLevel.setDescription("swAgtTrapSeverityLevel, in absence of swEventTrapLevel, specifies the Trap Severity Level of each defined trap recipient host. This object specifies the swEventTrap level in conjunction with an event's severity level. When an event occurs and if its severity level is at or below the value specified by this object instance, the agent will send the associated swEventTrap to configured recipients.")
sw_event_num_entries = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 4), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventNumEntries.setStatus('current')
if mibBuilder.loadTexts:
swEventNumEntries.setDescription('The number of entries in the Event Table.')
sw_event_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5))
if mibBuilder.loadTexts:
swEventTable.setStatus('current')
if mibBuilder.loadTexts:
swEventTable.setDescription('The table of event entries.')
sw_event_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1)).setIndexNames((0, 'SW-MIB', 'swEventIndex'))
if mibBuilder.loadTexts:
swEventEntry.setStatus('current')
if mibBuilder.loadTexts:
swEventEntry.setDescription('An entry of the event table.')
sw_event_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventIndex.setStatus('current')
if mibBuilder.loadTexts:
swEventIndex.setDescription('This object identifies the event entry.')
sw_event_time_info = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 2), display_string().subtype(subtypeSpec=value_size_constraint(0, 64))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventTimeInfo.setStatus('current')
if mibBuilder.loadTexts:
swEventTimeInfo.setDescription('This object identifies the date and time when this event occurred, in textual format.')
sw_event_level = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 3), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2, 3, 4, 5))).clone(namedValues=named_values(('critical', 1), ('error', 2), ('warning', 3), ('informational', 4), ('debug', 5)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventLevel.setStatus('current')
if mibBuilder.loadTexts:
swEventLevel.setDescription('This object identifies the severity level of this event entry.')
sw_event_repeat_count = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 4), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventRepeatCount.setStatus('current')
if mibBuilder.loadTexts:
swEventRepeatCount.setDescription('This object identifies how many times this particular event has occurred.')
sw_event_descr = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 5), display_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventDescr.setStatus('current')
if mibBuilder.loadTexts:
swEventDescr.setDescription('This object identifies the textual description of the event.')
sw_event_vf_id = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 8, 5, 1, 6), integer32().subtype(subtypeSpec=value_range_constraint(0, 255))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEventVfId.setStatus('current')
if mibBuilder.loadTexts:
swEventVfId.setDescription('This object identifies the Virtual fabric id.')
class Swfwacts(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63))
named_values = named_values(('swFwNoAction', 0), ('swFwErrlog', 1), ('swFwSnmptrap', 2), ('swFwErrlogSnmptrap', 3), ('swFwPortloglock', 4), ('swFwErrlogPortloglock', 5), ('swFwSnmptrapPortloglock', 6), ('swFwErrlogSnmptrapPortloglock', 7), ('swFwRn', 8), ('swFwElRn', 9), ('swFwStRn', 10), ('swFwElStRn', 11), ('swFwPlRn', 12), ('swFwElPlRn', 13), ('swFwStPlRn', 14), ('swFwElStPlRn', 15), ('swFwMailAlert', 16), ('swFwMailAlertErrlog', 17), ('swFwMailAlertSnmptrap', 18), ('swFwMailAlertErrlogSnmptrap', 19), ('swFwMailAlertPortloglock', 20), ('swFwMailAlertErrlogPortloglock', 21), ('swFwMailAlertSnmptrapPortloglock', 22), ('swFwMailAlertErrlogSnmptrapPortloglock', 23), ('swFwMailAlertRn', 24), ('swFwElMailAlertRn', 25), ('swFwMailAlertStRn', 26), ('swFwMailAlertElStRn', 27), ('swFwMailAlertPlRn', 28), ('swFwMailAlertElPlRn', 29), ('swFwMailAlertStPlRn', 30), ('swFwMailAlertElStPlRn', 31), ('swFwPf', 32), ('swFwElPf', 33), ('swFwStPf', 34), ('swFwElStPf', 35), ('swFwPlPf', 36), ('swFwElPlPf', 37), ('swFwStPlPf', 38), ('swFwElStPlPf', 39), ('swFwRnPf', 40), ('swFwElRnPf', 41), ('swFwStRnPf', 42), ('swFwElStRnPf', 43), ('swFwPlRnPf', 44), ('swFwElPlRnPf', 45), ('swFwStPlRnPf', 46), ('swFwElStPlRnPf', 47), ('swFwMailAlertPf', 48), ('swFwMailAlertElPf', 49), ('swFwMailAlertStPf', 50), ('swFwMailAlertElStPf', 51), ('swFwMailAlertPlPf', 52), ('swFwMailAlertElPlPf', 53), ('swFwMailAlertStPlPf', 54), ('swFwMailAlertElStPlPf', 55), ('swFwMailAlertRnPf', 56), ('swFwMailAlertElRnPf', 57), ('swFwMailAlertStRnPf', 58), ('swFwMailAlertElStRnPf', 59), ('swFwMailAlertPlRnPf', 60), ('swFwMailAlertElPlRnPf', 61), ('swFwMailAlertStPlRnPf', 62), ('swFwMailAlertElStPlRnPf', 63))
class Swfwlevels(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2, 3))
named_values = named_values(('swFwReserved', 1), ('swFwDefault', 2), ('swFwCustom', 3))
class Swfwclassesareas(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79, 80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 127, 128, 129, 130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141, 142, 143, 144, 145, 146, 147, 148, 149, 150, 151, 152))
named_values = named_values(('swFwEnvTemp', 1), ('swFwEnvFan', 2), ('swFwEnvPs', 3), ('swFwTransceiverTemp', 4), ('swFwTransceiverRxp', 5), ('swFwTransceiverTxp', 6), ('swFwTransceiverCurrent', 7), ('swFwPortLink', 8), ('swFwPortSync', 9), ('swFwPortSignal', 10), ('swFwPortPe', 11), ('swFwPortWords', 12), ('swFwPortCrcs', 13), ('swFwPortRXPerf', 14), ('swFwPortTXPerf', 15), ('swFwPortState', 16), ('swFwFabricEd', 17), ('swFwFabricFr', 18), ('swFwFabricDi', 19), ('swFwFabricSc', 20), ('swFwFabricZc', 21), ('swFwFabricFq', 22), ('swFwFabricFl', 23), ('swFwFabricGs', 24), ('swFwEPortLink', 25), ('swFwEPortSync', 26), ('swFwEPortSignal', 27), ('swFwEPortPe', 28), ('swFwEPortWords', 29), ('swFwEPortCrcs', 30), ('swFwEPortRXPerf', 31), ('swFwEPortTXPerf', 32), ('swFwEPortState', 33), ('swFwFCUPortLink', 34), ('swFwFCUPortSync', 35), ('swFwFCUPortSignal', 36), ('swFwFCUPortPe', 37), ('swFwFCUPortWords', 38), ('swFwFCUPortCrcs', 39), ('swFwFCUPortRXPerf', 40), ('swFwFCUPortTXPerf', 41), ('swFwFCUPortState', 42), ('swFwFOPPortLink', 43), ('swFwFOPPortSync', 44), ('swFwFOPPortSignal', 45), ('swFwFOPPortPe', 46), ('swFwFOPPortWords', 47), ('swFwFOPPortCrcs', 48), ('swFwFOPPortRXPerf', 49), ('swFwFOPPortTXPerf', 50), ('swFwFOPPortState', 51), ('swFwPerfALPACRC', 52), ('swFwPerfEToECRC', 53), ('swFwPerfEToERxCnt', 54), ('swFwPerfEToETxCnt', 55), ('swFwPerffltCusDef', 56), ('swFwTransceiverVoltage', 57), ('swFwSecTelnetViolations', 58), ('swFwSecHTTPViolations', 59), ('swFwSecAPIViolations', 60), ('swFwSecRSNMPViolations', 61), ('swFwSecWSNMPViolations', 62), ('swFwSecSESViolations', 63), ('swFwSecMSViolations', 64), ('swFwSecSerialViolations', 65), ('swFwSecFPViolations', 66), ('swFwSecSCCViolations', 67), ('swFwSecDCCViolations', 68), ('swFwSecLoginViolations', 69), ('swFwSecInvalidTS', 70), ('swFwSecInvalidSign', 71), ('swFwSecInvalidCert', 72), ('swFwSecSlapFail', 73), ('swFwSecSlapBadPkt', 74), ('swFwSecTSOutSync', 75), ('swFwSecNoFcs', 76), ('swFwSecIncompDB', 77), ('swFwSecIllegalCmd', 78), ('swFwSAMTotalDownTime', 79), ('swFwSAMTotalUpTime', 80), ('swFwSAMDurationOfOccur', 81), ('swFwSAMFreqOfOccur', 82), ('swFwResourceFlash', 83), ('swFwEPortUtil', 84), ('swFwEPortPktl', 85), ('swFwPortLr', 86), ('swFwEPortLr', 87), ('swFwFCUPortLr', 88), ('swFwFOPPortLr', 89), ('swFwPortC3Discard', 90), ('swFwEPortC3Discard', 91), ('swFwFCUPortC3Discard', 92), ('swFwFOPPortC3Discard', 93), ('swFwVEPortStateChange', 94), ('swFwVEPortUtil', 95), ('swFwVEPortPktLoss', 96), ('swFwEPortTrunkUtil', 97), ('swFwFCUPortTrunkUtil', 98), ('swFwFOPPortTrunkUtil', 99), ('swFwCPUMemUsage', 100), ('filterFmCfg1', 101), ('filterFmCfg2', 102), ('filterFmCfg3', 103), ('filterFmCfg4', 104), ('filterFmCfg5', 105), ('filterFmCfg6', 106), ('filterFmCfg7', 107), ('filterFmCfg8', 108), ('filterFmCfg9', 109), ('filterFmCfg10', 110), ('filterFmCfg11', 111), ('filterFmCfg12', 112), ('filterFmCfg13', 113), ('filterFmCfg14', 114), ('filterFmCfg15', 115), ('filterFmCfg16', 116), ('filterFmCfg17', 117), ('filterFmCfg18', 118), ('filterFmCfg19', 119), ('filterFmCfg20', 120), ('filterFmCfg21', 121), ('filterFmCfg22', 122), ('filterFmCfg23', 123), ('filterFmCfg24', 124), ('filterFmCfg25', 125), ('filterFmCfg26', 126), ('filterFmCfg27', 127), ('filterFmCfg28', 128), ('filterFmCfg29', 129), ('filterFmCfg30', 130), ('filterFmCfg31', 131), ('filterFmCfg32', 132), ('filterFmCfg33', 133), ('filterFmCfg34', 134), ('filterFmCfg35', 135), ('filterFmCfg36', 136), ('filterFmCfg37', 137), ('filterFmCfg38', 138), ('filterFmCfg39', 139), ('filterFmCfg40', 140), ('filterFmCfg41', 141), ('filterFmCfg42', 142), ('filterFmCfg43', 143), ('filterFmCfg44', 144), ('filterFmCfg45', 145), ('filterFmCfg46', 146), ('filterFmCfg47', 147), ('filterFmCfg48', 148), ('filterFmCfg49', 149), ('filterFmCfg50', 150), ('filterFmCfg51', 151), ('swFwPowerOnHours', 152))
class Swfwwritevals(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2))
named_values = named_values(('swFwCancelWrite', 1), ('swFwApplyWrite', 2))
class Swfwtimebase(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2, 3, 4, 5))
named_values = named_values(('swFwTbNone', 1), ('swFwTbSec', 2), ('swFwTbMin', 3), ('swFwTbHour', 4), ('swFwTbDay', 5))
class Swfwstatus(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2))
named_values = named_values(('disabled', 1), ('enabled', 2))
class Swfwevent(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2, 3, 4, 5, 6, 7))
named_values = named_values(('started', 1), ('changed', 2), ('exceeded', 3), ('below', 4), ('above', 5), ('inBetween', 6), ('lowBufferCrsd', 7))
class Swfwbehavior(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2))
named_values = named_values(('triggered', 1), ('continuous', 2))
class Swfwstate(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2, 3))
named_values = named_values(('swFwInformative', 1), ('swFwNormal', 2), ('swFwFaulty', 3))
class Swfwlicense(Integer32):
subtype_spec = Integer32.subtypeSpec + constraints_union(single_value_constraint(1, 2))
named_values = named_values(('swFwLicensed', 1), ('swFwNotLicensed', 2))
sw_fw_fabric_watch_license = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 1), sw_fw_license()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwFabricWatchLicense.setStatus('current')
if mibBuilder.loadTexts:
swFwFabricWatchLicense.setDescription('tells if licensed or not.')
sw_fw_class_area_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2))
if mibBuilder.loadTexts:
swFwClassAreaTable.setStatus('current')
if mibBuilder.loadTexts:
swFwClassAreaTable.setDescription('The table of classes and areas.')
sw_fw_class_area_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1)).setIndexNames((0, 'SW-MIB', 'swFwClassAreaIndex'))
if mibBuilder.loadTexts:
swFwClassAreaEntry.setStatus('current')
if mibBuilder.loadTexts:
swFwClassAreaEntry.setDescription('An entry of the classes and areas.')
sw_fw_class_area_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 1), sw_fw_classes_areas()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwClassAreaIndex.setStatus('current')
if mibBuilder.loadTexts:
swFwClassAreaIndex.setDescription('This object identifies the class type.')
sw_fw_write_th_vals = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 2), sw_fw_write_vals()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwWriteThVals.setStatus('current')
if mibBuilder.loadTexts:
swFwWriteThVals.setDescription('This object is set to apply the value changes.')
sw_fw_default_unit = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 3), display_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultUnit.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultUnit.setDescription('A Default unit string name for a threshold area.')
sw_fw_default_timebase = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 4), sw_fw_timebase()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultTimebase.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultTimebase.setDescription('A Default timebase for the current threshold counter.')
sw_fw_default_low = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 5), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultLow.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultLow.setDescription('A Default low threshold value.')
sw_fw_default_high = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 6), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultHigh.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultHigh.setDescription('A Default high threshold value.')
sw_fw_default_buf_size = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 7), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultBufSize.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultBufSize.setDescription('A Default buffer size value.')
sw_fw_cust_unit = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 8), display_string()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwCustUnit.setStatus('current')
if mibBuilder.loadTexts:
swFwCustUnit.setDescription('A custom unit string name for a threshold area.')
sw_fw_cust_timebase = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 9), sw_fw_timebase()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustTimebase.setStatus('current')
if mibBuilder.loadTexts:
swFwCustTimebase.setDescription('A custom timebase for the current threshold counter.')
sw_fw_cust_low = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 10), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustLow.setStatus('current')
if mibBuilder.loadTexts:
swFwCustLow.setDescription('A custom low threshold value.')
sw_fw_cust_high = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 11), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustHigh.setStatus('current')
if mibBuilder.loadTexts:
swFwCustHigh.setDescription('A custom high threshold value.')
sw_fw_cust_buf_size = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 12), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustBufSize.setStatus('current')
if mibBuilder.loadTexts:
swFwCustBufSize.setDescription('A custom buffer size value.')
sw_fw_th_level = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 13), sw_fw_levels()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwThLevel.setStatus('current')
if mibBuilder.loadTexts:
swFwThLevel.setDescription('A level where all the threshold values are set at.')
sw_fw_write_act_vals = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 14), sw_fw_write_vals()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwWriteActVals.setStatus('current')
if mibBuilder.loadTexts:
swFwWriteActVals.setDescription('This object is set to apply act value changes.')
sw_fw_default_changed_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 15), sw_fw_acts()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultChangedActs.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultChangedActs.setDescription('Default action matrix for changed event.')
sw_fw_default_exceeded_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 16), sw_fw_acts()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultExceededActs.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultExceededActs.setDescription('Default action matrix for exceeded event.')
sw_fw_default_below_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 17), sw_fw_acts()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultBelowActs.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultBelowActs.setDescription('Default action matrix for below event.')
sw_fw_default_above_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 18), sw_fw_acts()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultAboveActs.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultAboveActs.setDescription('Default action matrix for above event.')
sw_fw_default_in_between_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 19), sw_fw_acts()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwDefaultInBetweenActs.setStatus('current')
if mibBuilder.loadTexts:
swFwDefaultInBetweenActs.setDescription('Default action matrix for in-between event.')
sw_fw_cust_changed_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 20), sw_fw_acts()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustChangedActs.setStatus('current')
if mibBuilder.loadTexts:
swFwCustChangedActs.setDescription('custom action matrix for changed event.')
sw_fw_cust_exceeded_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 21), sw_fw_acts()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustExceededActs.setStatus('current')
if mibBuilder.loadTexts:
swFwCustExceededActs.setDescription('custom action matrix for exceeded event.')
sw_fw_cust_below_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 22), sw_fw_acts()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustBelowActs.setStatus('current')
if mibBuilder.loadTexts:
swFwCustBelowActs.setDescription('custom action matrix for below event.')
sw_fw_cust_above_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 23), sw_fw_acts()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustAboveActs.setStatus('current')
if mibBuilder.loadTexts:
swFwCustAboveActs.setDescription('custom action matrix for above event.')
sw_fw_cust_in_between_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 24), sw_fw_acts()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwCustInBetweenActs.setStatus('current')
if mibBuilder.loadTexts:
swFwCustInBetweenActs.setDescription('custom action matrix for in-between event.')
sw_fw_valid_acts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 25), sw_fw_acts()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwValidActs.setStatus('current')
if mibBuilder.loadTexts:
swFwValidActs.setDescription('matrix of valid acts for an class/area.')
sw_fw_act_level = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 2, 1, 26), sw_fw_levels()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwActLevel.setStatus('current')
if mibBuilder.loadTexts:
swFwActLevel.setDescription('A level where all the actions are set at.')
sw_fw_threshold_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3))
if mibBuilder.loadTexts:
swFwThresholdTable.setStatus('current')
if mibBuilder.loadTexts:
swFwThresholdTable.setDescription('The table of individual thresholds.')
sw_fw_threshold_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1)).setIndexNames((0, 'SW-MIB', 'swFwClassAreaIndex'), (0, 'SW-MIB', 'swFwThresholdIndex'))
if mibBuilder.loadTexts:
swFwThresholdEntry.setStatus('current')
if mibBuilder.loadTexts:
swFwThresholdEntry.setDescription('An entry of an individual threshold.')
sw_fw_threshold_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwThresholdIndex.setStatus('current')
if mibBuilder.loadTexts:
swFwThresholdIndex.setDescription('This object identifies the element index of an threshold.')
sw_fw_status = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 2), sw_fw_status()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwStatus.setStatus('current')
if mibBuilder.loadTexts:
swFwStatus.setDescription('This object identifies if an threshold is enabled or disabled.')
sw_fw_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 3), display_string().subtype(subtypeSpec=value_size_constraint(0, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwName.setStatus('current')
if mibBuilder.loadTexts:
swFwName.setDescription('This object is a name of the threshold.')
sw_fw_label = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 4), display_string().subtype(subtypeSpec=value_size_constraint(0, 70))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwLabel.setStatus('current')
if mibBuilder.loadTexts:
swFwLabel.setDescription('This object is a label of the threshold.')
sw_fw_cur_val = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 5), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwCurVal.setStatus('current')
if mibBuilder.loadTexts:
swFwCurVal.setDescription('This object is a current counter of the threshold.')
sw_fw_last_event = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 6), sw_fw_event()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwLastEvent.setStatus('current')
if mibBuilder.loadTexts:
swFwLastEvent.setDescription('This object is a last event type of the threshold.')
sw_fw_last_event_val = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 7), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwLastEventVal.setStatus('current')
if mibBuilder.loadTexts:
swFwLastEventVal.setDescription('This object is a last event value of the threshold.')
sw_fw_last_event_time = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 8), display_string().subtype(subtypeSpec=value_size_constraint(0, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwLastEventTime.setStatus('current')
if mibBuilder.loadTexts:
swFwLastEventTime.setDescription('This object is a last event time of the threshold.')
sw_fw_last_state = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 9), sw_fw_state()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwLastState.setStatus('current')
if mibBuilder.loadTexts:
swFwLastState.setDescription('This object is a last event state of the threshold.')
sw_fw_behavior_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 10), sw_fw_behavior()).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwBehaviorType.setStatus('current')
if mibBuilder.loadTexts:
swFwBehaviorType.setDescription('A behavior of which the thresholds generate event.')
sw_fw_behavior_int = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 11), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readwrite')
if mibBuilder.loadTexts:
swFwBehaviorInt.setStatus('current')
if mibBuilder.loadTexts:
swFwBehaviorInt.setDescription('A integer of which the thresholds generate continuous event.')
sw_fw_last_severity_level = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 10, 3, 1, 12), sw_sev_type()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swFwLastSeverityLevel.setStatus('current')
if mibBuilder.loadTexts:
swFwLastSeverityLevel.setDescription('This object is a last event severity level of the threshold.')
sw_end_device_rls_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1))
if mibBuilder.loadTexts:
swEndDeviceRlsTable.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceRlsTable.setDescription("The table of individual end devices' rls.")
sw_end_device_rls_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1)).setIndexNames((0, 'SW-MIB', 'swEndDevicePort'), (0, 'SW-MIB', 'swEndDeviceAlpa'))
if mibBuilder.loadTexts:
swEndDeviceRlsEntry.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceRlsEntry.setDescription("An entry of an individual end devices' rls.")
sw_end_device_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647)))
if mibBuilder.loadTexts:
swEndDevicePort.setStatus('current')
if mibBuilder.loadTexts:
swEndDevicePort.setDescription('This object identifies the port of the end device.')
sw_end_device_alpa = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 2), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647)))
if mibBuilder.loadTexts:
swEndDeviceAlpa.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceAlpa.setDescription('This object identifies the alpa of the end device.')
sw_end_device_port_id = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 3), octet_string().subtype(subtypeSpec=value_size_constraint(4, 4)).setFixedLength(4)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDevicePortID.setStatus('current')
if mibBuilder.loadTexts:
swEndDevicePortID.setDescription('The object identifies the Fibre Channel port address ID of the entry.')
sw_end_device_link_failure = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 4), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDeviceLinkFailure.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceLinkFailure.setDescription('Link failure count for the end device.')
sw_end_device_sync_loss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 5), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDeviceSyncLoss.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceSyncLoss.setDescription('Sync loss count for the end device.')
sw_end_device_sig_loss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 6), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDeviceSigLoss.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceSigLoss.setDescription('Sig loss count for the end device.')
sw_end_device_proto_err = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 7), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDeviceProtoErr.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceProtoErr.setDescription('Protocol err count for the end device.')
sw_end_device_invalid_word = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 8), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDeviceInvalidWord.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceInvalidWord.setDescription('Invalid word count for the end device.')
sw_end_device_invalid_crc = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 21, 1, 1, 9), counter32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swEndDeviceInvalidCRC.setStatus('current')
if mibBuilder.loadTexts:
swEndDeviceInvalidCRC.setDescription('Invalid CRC count for the end device.')
sw_group_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1))
if mibBuilder.loadTexts:
swGroupTable.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupTable.setDescription('The table of groups. This may not be available on all versions of Fabric OS.')
sw_group_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1)).setIndexNames((0, 'SW-MIB', 'swGroupIndex'))
if mibBuilder.loadTexts:
swGroupEntry.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupEntry.setDescription('An entry of table of groups.')
sw_group_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swGroupIndex.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupIndex.setDescription('This object is the group index starting from 1.')
sw_group_name = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1, 2), octet_string().subtype(subtypeSpec=value_size_constraint(0, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swGroupName.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupName.setDescription('This object identifies the name of the group.')
sw_group_type = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 1, 1, 3), octet_string().subtype(subtypeSpec=value_size_constraint(0, 15))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swGroupType.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupType.setDescription('This object identifies the type of the group.')
sw_group_mem_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2))
if mibBuilder.loadTexts:
swGroupMemTable.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupMemTable.setDescription('The table of members of all groups. This may not be available on all versions of Fabric OS.')
sw_group_mem_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1)).setIndexNames((0, 'SW-MIB', 'swGroupId'), (0, 'SW-MIB', 'swGroupMemWwn'))
if mibBuilder.loadTexts:
swGroupMemEntry.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupMemEntry.setDescription('An entry for a member of a group.')
sw_group_id = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swGroupId.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupId.setDescription('This object identifies the Group Id of the member switch.')
sw_group_mem_wwn = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1, 2), fc_wwn()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swGroupMemWwn.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupMemWwn.setDescription('This object identifies the WWN of the member switch.')
sw_group_mem_pos = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 22, 2, 1, 3), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swGroupMemPos.setStatus('obsolete')
if mibBuilder.loadTexts:
swGroupMemPos.setDescription('This object identifies position of the member switch in the group. This is based on the order that the switches were added in the group.')
sw_blm_perf_alpa_mnt_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1))
if mibBuilder.loadTexts:
swBlmPerfALPAMntTable.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfALPAMntTable.setDescription('ALPA monitoring counter Table. ')
sw_blm_perf_alpa_mnt_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1)).setIndexNames((0, 'SW-MIB', 'swBlmPerfAlpaPort'), (0, 'SW-MIB', 'swBlmPerfAlpaIndx'))
if mibBuilder.loadTexts:
swBlmPerfALPAMntEntry.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfALPAMntEntry.setDescription(' ALPA monitoring counter for given ALPA.')
sw_blm_perf_alpa_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 1), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfAlpaPort.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfAlpaPort.setDescription(' This Object identifies the port index of the switch.')
sw_blm_perf_alpa_indx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 2), integer32().subtype(subtypeSpec=value_range_constraint(1, 126))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfAlpaIndx.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfAlpaIndx.setDescription(' This Object identifies the ALPA index. There can be 126 ALPA values')
sw_blm_perf_alpa = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 3), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfAlpa.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfAlpa.setDescription(" This Object identifies the ALPA values. These values range between x'01' and x'EF'(1 to 239). ALPA value x'00' is reserved for FL_Port If Alpa device is invalid, then it will have -1 value. ")
sw_blm_perf_alpa_crc_cnt = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 1, 1, 4), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfAlpaCRCCnt.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfAlpaCRCCnt.setDescription('Get CRC count for given ALPA and port. This monitoring provides information on the number of CRC errors occurred on the frames destined to each possible ALPA attached to a specific port.')
sw_blm_perf_ee_mnt_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2))
if mibBuilder.loadTexts:
swBlmPerfEEMntTable.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEEMntTable.setDescription(' End-to-End monitoring counter Table')
sw_blm_perf_ee_mnt_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1)).setIndexNames((0, 'SW-MIB', 'swBlmPerfEEPort'), (0, 'SW-MIB', 'swBlmPerfEERefKey'))
if mibBuilder.loadTexts:
swBlmPerfEEMntEntry.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEEMntEntry.setDescription('End-to-End monitoring counter for given port.')
sw_blm_perf_ee_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 1), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEEPort.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEEPort.setDescription(' This object identifies the port number of the switch.')
sw_blm_perf_ee_ref_key = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 2), integer32().subtype(subtypeSpec=value_range_constraint(1, 8))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEERefKey.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEERefKey.setDescription('This object identifies the reference number of the counter. This reference is number assigned when a filter is created. In SNMP Index start one instead of 0, add one to actual ref key')
sw_blm_perf_eecrc = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 3), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEECRC.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEECRC.setDescription(' Get End to End CRC error for the frames that matched the SID-DID pair.')
sw_blm_perf_eefcw_rx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 4), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEEFCWRx.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEEFCWRx.setDescription('Get End to End count of Fibre Channel words (FCW), received by the port, that matched the SID-DID pair. ')
sw_blm_perf_eefcw_tx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 5), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEEFCWTx.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEEFCWTx.setDescription('Get End to End count of Fibre Channel words (FCW), transmitted by the port, that matched the SID-DID pair. ')
sw_blm_perf_ee_sid = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 6), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEESid.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEESid.setDescription(' Gets SID info by reference number. SID (Source Identifier) is a 3-byte field in the frame header used to indicate the address identifier of the N-Port from which the frame was sent.')
sw_blm_perf_ee_did = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 2, 1, 7), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfEEDid.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfEEDid.setDescription('Gets DID info by reference number. DID (Destination Identifier) is a 3-byte field in the frame header used to indicate the address identifier of the N-Port to which the frame was sent.')
sw_blm_perf_flt_mnt_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3))
if mibBuilder.loadTexts:
swBlmPerfFltMntTable.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfFltMntTable.setDescription('Filter based monitoring counter.')
sw_blm_perf_flt_mnt_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1)).setIndexNames((0, 'SW-MIB', 'swBlmPerfFltPort'), (0, 'SW-MIB', 'swBlmPerfFltRefkey'))
if mibBuilder.loadTexts:
swBlmPerfFltMntEntry.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfFltMntEntry.setDescription(' Filter base monitoring counter for given port.')
sw_blm_perf_flt_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 1), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfFltPort.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfFltPort.setDescription('This object identifies the port number of the switch.')
sw_blm_perf_flt_refkey = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 2), integer32().subtype(subtypeSpec=value_range_constraint(1, 8))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfFltRefkey.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfFltRefkey.setDescription(' This object identifies the reference number of the filter. This reference number is assigned when a filter is created. In SNMP Index start one instead of 0, add one to actual ref key')
sw_blm_perf_flt_cnt = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 3), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfFltCnt.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfFltCnt.setDescription('Get statistics of filter based monitor. Filter based monitoring provides information about a filter hit count such as 1. Read command 2. SCSI or IP traffic 3. SCSI Read/Write')
sw_blm_perf_flt_alias = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 23, 3, 1, 4), display_string().subtype(subtypeSpec=value_size_constraint(0, 20))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swBlmPerfFltAlias.setStatus('current')
if mibBuilder.loadTexts:
swBlmPerfFltAlias.setDescription(' Alias name for the filter.')
sw_switch_trunkable = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 1), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(8, 0))).clone(namedValues=named_values(('yes', 8), ('no', 0)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swSwitchTrunkable.setStatus('current')
if mibBuilder.loadTexts:
swSwitchTrunkable.setDescription('The trunking status of the switch - whether the switch supports the trunking feature or not. The values are yes(8) - the trunking feature is supported no(0). - the trunking feature is not supported. ')
sw_trunk_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2))
if mibBuilder.loadTexts:
swTrunkTable.setStatus('current')
if mibBuilder.loadTexts:
swTrunkTable.setDescription(' Table to display trunking information for the switch. ')
sw_trunk_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1)).setIndexNames((0, 'SW-MIB', 'swTrunkPortIndex'))
if mibBuilder.loadTexts:
swTrunkEntry.setStatus('current')
if mibBuilder.loadTexts:
swTrunkEntry.setDescription('Entry for the trunking table.')
sw_trunk_port_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 1), sw_port_index()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkPortIndex.setStatus('current')
if mibBuilder.loadTexts:
swTrunkPortIndex.setDescription('This object identifies the switch port index. Note that the value of a port index is 1 higher than the port number labeled on the front panel. e.g. port index 1 correspond to port number 0. ')
sw_trunk_group_number = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 2), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkGroupNumber.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGroupNumber.setDescription('This object is a logical entity which specifies the Group Number to which the port belongs to. If this value is Zero it means the port is not Trunked.')
sw_trunk_master = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 3), sw_trunk_master()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkMaster.setStatus('current')
if mibBuilder.loadTexts:
swTrunkMaster.setDescription('Port number that is the trunk master of the group. The trunk master implicitly defines the group. All ports with the same master are considered to be part of the same group.')
sw_port_trunked = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 2, 1, 4), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1))).clone(namedValues=named_values(('disabled', 0), ('enabled', 1)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swPortTrunked.setStatus('current')
if mibBuilder.loadTexts:
swPortTrunked.setDescription('The active trunk status for a member port. Values are enabled(1) or disabled(0).')
sw_trunk_grp_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3))
if mibBuilder.loadTexts:
swTrunkGrpTable.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGrpTable.setDescription('Table to display trunking Performance information for the switch.')
sw_trunk_grp_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1)).setIndexNames((0, 'SW-MIB', 'swTrunkGrpNumber'))
if mibBuilder.loadTexts:
swTrunkGrpEntry.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGrpEntry.setDescription('Entry for the trunking Group table.')
sw_trunk_grp_number = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 2147483647))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkGrpNumber.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGrpNumber.setDescription('This object is a logical entity which specifies the Group Number to which port belongs to.')
sw_trunk_grp_master = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 2), sw_trunk_master()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkGrpMaster.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGrpMaster.setDescription('This object gives the master port id for the TrunkGroup.')
sw_trunk_grp_tx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 3), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkGrpTx.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGrpTx.setDescription('Gives the aggregate value of the transmitted words from this TrunkGroup.')
sw_trunk_grp_rx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 24, 3, 1, 4), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTrunkGrpRx.setStatus('current')
if mibBuilder.loadTexts:
swTrunkGrpRx.setDescription('Gives the aggregate value of the received words by this TrunkGroup.')
sw_top_talker_mnt_mode = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 1), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(1, 2))).clone(namedValues=named_values(('fabricmode', 1), ('portmode', 2)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntMode.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntMode.setDescription('Gives the mode in which toptalker is installed')
sw_top_talker_mnt_num_entries = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 2), integer32().subtype(subtypeSpec=value_range_constraint(1, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntNumEntries.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntNumEntries.setDescription('Gives the number of toptalking flows')
sw_top_talker_mnt_table = mib_table((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3))
if mibBuilder.loadTexts:
swTopTalkerMntTable.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntTable.setDescription('Table to display toptalkingflows')
sw_top_talker_mnt_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1)).setIndexNames((0, 'SW-MIB', 'swTopTalkerMntIndex'))
if mibBuilder.loadTexts:
swTopTalkerMntEntry.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntEntry.setDescription('Entry for the toptalker table')
sw_top_talker_mnt_index = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 1), integer32().subtype(subtypeSpec=value_range_constraint(1, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntIndex.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntIndex.setDescription('This object identifies the list/object entry')
sw_top_talker_mnt_port = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 2), integer32().subtype(subtypeSpec=value_range_constraint(1, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntPort.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntPort.setDescription('This object identifies the switch port number on which the f-port mode toptalker is added.')
sw_top_talker_mnt_spid = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 3), integer32().subtype(subtypeSpec=value_range_constraint(1, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntSpid.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntSpid.setDescription('This object identifies the SID of the host')
sw_top_talker_mnt_dpid = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 4), integer32().subtype(subtypeSpec=value_range_constraint(1, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntDpid.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntDpid.setDescription('This object identifies the DID of the SID-DID pair')
sw_top_talker_mntflow = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 5), integer32().subtype(subtypeSpec=value_range_constraint(1, 32))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntflow.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntflow.setDescription('This object identifies the traffic flow in MB/sec')
sw_top_talker_mnt_swwn = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 6), fc_wwn()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntSwwn.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntSwwn.setDescription('This object identifies the SID in WWN format of the host')
sw_top_talker_mnt_dwwn = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 25, 3, 1, 7), fc_wwn()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swTopTalkerMntDwwn.setStatus('current')
if mibBuilder.loadTexts:
swTopTalkerMntDwwn.setDescription('This object identifies the DID in WWN format of the SID-DID pair')
sw_cpu_usage = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 1), integer32().subtype(subtypeSpec=value_range_constraint(0, 100))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swCpuUsage.setStatus('current')
if mibBuilder.loadTexts:
swCpuUsage.setDescription("System's cpu usage.")
sw_cpu_no_of_retries = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 2), integer32().subtype(subtypeSpec=value_range_constraint(1, 100))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swCpuNoOfRetries.setStatus('current')
if mibBuilder.loadTexts:
swCpuNoOfRetries.setDescription('Number of times system should take cpu utilization sample before sending the CPU utilization trap.')
sw_cpu_usage_limit = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 3), integer32().subtype(subtypeSpec=value_range_constraint(1, 100))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swCpuUsageLimit.setStatus('current')
if mibBuilder.loadTexts:
swCpuUsageLimit.setDescription('CPU usage limit. If MAPS is enabled, then this object is not supported and return 0 value.')
sw_cpu_polling_interval = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 4), integer32().subtype(subtypeSpec=value_range_constraint(10, 3600))).setUnits('seconds').setMaxAccess('readonly')
if mibBuilder.loadTexts:
swCpuPollingInterval.setStatus('current')
if mibBuilder.loadTexts:
swCpuPollingInterval.setDescription('Time interval between two memory samples.')
sw_cpu_action = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 5), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3))).clone(namedValues=named_values(('none', 0), ('raslog', 1), ('snmp', 2), ('raslogandSnmp', 3)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swCpuAction.setStatus('current')
if mibBuilder.loadTexts:
swCpuAction.setDescription('Specifies the actions to be taken if system resources exceed the specified threshold. If MAPS is enabled, then this object is not supported and return 0 value.')
sw_mem_usage = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 6), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemUsage.setStatus('current')
if mibBuilder.loadTexts:
swMemUsage.setDescription("System's memory usage.")
sw_mem_no_of_retries = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 7), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemNoOfRetries.setStatus('current')
if mibBuilder.loadTexts:
swMemNoOfRetries.setDescription('Number of times system should take memory usage sample before sending the memory usage trap.')
sw_mem_usage_limit = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 8), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemUsageLimit.setStatus('current')
if mibBuilder.loadTexts:
swMemUsageLimit.setDescription('Memory usage limit')
sw_mem_polling_interval = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 9), integer32().subtype(subtypeSpec=value_range_constraint(10, 3600))).setUnits('seconds').setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemPollingInterval.setStatus('current')
if mibBuilder.loadTexts:
swMemPollingInterval.setDescription('Time interval between two memory samples.')
sw_mem_action = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 10), integer32().subtype(subtypeSpec=constraints_union(single_value_constraint(0, 1, 2, 3))).clone(namedValues=named_values(('none', 0), ('raslog', 1), ('snmp', 2), ('raslogandSnmp', 3)))).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemAction.setStatus('current')
if mibBuilder.loadTexts:
swMemAction.setDescription('Specifies the actions to be taken if system resources exceed the specified threshold. If MAPS is enabled, then this object is not supported and return 0 value.')
sw_mem_usage_limit1 = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 11), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemUsageLimit1.setStatus('current')
if mibBuilder.loadTexts:
swMemUsageLimit1.setDescription('Low memory usage limit. If MAPS is enabled, then this object is not supported and return 0 value.')
sw_mem_usage_limit3 = mib_scalar((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 26, 12), integer32()).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swMemUsageLimit3.setStatus('current')
if mibBuilder.loadTexts:
swMemUsageLimit3.setDescription('High memory usage limit. If MAPS is enabled, then this object is not supported and return 0 value.')
sw_conn_unit_port_stat_entry = mib_table_row((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1))
connUnitPortStatEntry.registerAugmentions(('SW-MIB', 'swConnUnitPortStatEntry'))
swConnUnitPortStatEntry.setIndexNames(*connUnitPortStatEntry.getIndexNames())
if mibBuilder.loadTexts:
swConnUnitPortStatEntry.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitPortStatEntry.setDescription('This represents the Conn unit Port Stats')
sw_conn_unit_crc_with_bad_eof = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 1), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitCRCWithBadEOF.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitCRCWithBadEOF.setDescription('The number of frames with CRC error with Bad EOF.')
sw_conn_unit_zero_tenancy = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 2), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitZeroTenancy.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitZeroTenancy.setDescription('This counter is incremented when the FL_port acquires the loop but does not transmit a frame.')
sw_conn_unit_fl_num_of_tenancy = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 3), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitFLNumOfTenancy.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitFLNumOfTenancy.setDescription('This counter is incremented when the FL_port acquires the loop.')
sw_conn_unit_nl_num_of_tenancy = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 4), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitNLNumOfTenancy.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitNLNumOfTenancy.setDescription('This counter is incremented when the NL_port acquires the loop.')
sw_conn_unit_stop_tenancy_star_vation = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 5), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitStopTenancyStarVation.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitStopTenancyStarVation.setDescription('This counter is incremented when the FL_port can not transmit a frame because of lack of credit.')
sw_conn_unit_opend = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 6), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitOpend.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitOpend.setDescription('The number of times FC port entered OPENED state.')
sw_conn_unit_transfer_connection = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 7), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitTransferConnection.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitTransferConnection.setDescription('The number of times FC port entered TRANSFER state.')
sw_conn_unit_open = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 8), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitOpen.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitOpen.setDescription('The number of times FC port entered OPEN state.')
sw_conn_unit_invalid_arb = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 9), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitInvalidARB.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitInvalidARB.setDescription('The number of times FC port received invalid ARB.')
sw_conn_unit_ftb1_miss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 10), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitFTB1Miss.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitFTB1Miss.setDescription('This counter is incremented when the port receives a frame with a DID that can not be routed by FCR.. Applicable to 8G platforms only.')
sw_conn_unit_ftb2_miss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 11), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitFTB2Miss.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitFTB2Miss.setDescription('This counter is incremented when the port receives a frame with an SID/DID combination that can not be routed by the VF module.Applicable to 8G platforms only.')
sw_conn_unit_ftb6_miss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 12), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitFTB6Miss.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitFTB6Miss.setDescription('This counter is incremented when port receives a frame with an SID that can not be routed by FCR. Applicable to 8G platforms.')
sw_conn_unit_zone_miss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 13), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitZoneMiss.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitZoneMiss.setDescription('This counter is incremented when the port receives a frame with an SID and DID that are not zoned together.')
sw_conn_unit_lun_zone_miss = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 14), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitLunZoneMiss.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitLunZoneMiss.setDescription('This counter is incremented when the port receives a frame with an SID, DID and LUN that are not zoned together( This is not currently used ).')
sw_conn_unit_bad_eof = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 15), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitBadEOF.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitBadEOF.setDescription('The number of frames with bad end-of-frame.')
sw_conn_unit_lcrx = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 16), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitLCRX.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitLCRX.setDescription('The number of link control frames received.')
sw_conn_unit_rdy_priority = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 17), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitRDYPriority.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitRDYPriority.setDescription('The number of times that sending R_RDY or VC_RDY primitive signals was a higher priority than sending frames, due to diminishing credit reserves in the transmitter at the other end of the fibre.')
sw_conn_unit_lli = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 18), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitLli.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitLli.setDescription('The number low level interrupts generated by the physical and link layer.')
sw_conn_unit_interrupts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 19), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitInterrupts.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitInterrupts.setDescription(' This represents all the interrupts received on a port. Includes LLI, unknown etc')
sw_conn_unit_unknown_interrupts = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 20), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitUnknownInterrupts.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitUnknownInterrupts.setDescription(' Represents all the unknown interrupts received on a port.')
sw_conn_unit_timed_out = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 21), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitTimedOut.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitTimedOut.setDescription('Represents number of timed out frames due to any reason.')
sw_conn_unit_proc_required = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 22), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitProcRequired.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitProcRequired.setDescription('Represents number of frames trapped by CPU.')
sw_conn_unit_tx_buffer_unavailable = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 23), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitTxBufferUnavailable.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitTxBufferUnavailable.setDescription('Number of times port failed to transmit frames .')
sw_conn_unit_state_change = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 24), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitStateChange.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitStateChange.setDescription(' Number of times port has gone to offline, online, and faulty state.')
sw_conn_unit_c3_discard_due_to_rx_timeout = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 25), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitC3DiscardDueToRXTimeout.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitC3DiscardDueToRXTimeout.setDescription('Number of Class 3 receive frames discarded due to timeout.')
sw_conn_unit_c3_discard_due_to_dest_unreachable = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 26), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitC3DiscardDueToDestUnreachable.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitC3DiscardDueToDestUnreachable.setDescription('Number of Class 3 frames discarded due to destination unreachable.')
sw_conn_unit_c3_discard_due_to_tx_timeout = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 27), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitC3DiscardDueToTXTimeout.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitC3DiscardDueToTXTimeout.setDescription('Number of Class 3 transmit frames discarded due to timeout.')
sw_conn_unit_c3_discard_other = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 28), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitC3DiscardOther.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitC3DiscardOther.setDescription('Number of Class 3 frames discarded due to unknow reasons.')
sw_conn_unit_pcs_error_counter = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 29), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitPCSErrorCounter.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitPCSErrorCounter.setDescription('Number of Physical coding sublayer(PCS) block errors. It records the encoding violations on 10G or 16Gbps port.')
sw_conn_unit_unroutable_frame_counter = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 30), octet_string().subtype(subtypeSpec=value_size_constraint(8, 8)).setFixedLength(8)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitUnroutableFrameCounter.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitUnroutableFrameCounter.setDescription('It indicates unroutable frame counter')
sw_conn_unit_fec_corrected_counter = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 31), octet_string().subtype(subtypeSpec=value_size_constraint(64, 64)).setFixedLength(64)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitFECCorrectedCounter.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitFECCorrectedCounter.setDescription('It indicates Forward Error Correction Corrected Blocks count.FEC feature is only applicable to 10G/16G platforms.')
sw_conn_unit_fec_un_corrected_counter = mib_table_column((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 27, 1, 32), octet_string().subtype(subtypeSpec=value_size_constraint(64, 64)).setFixedLength(64)).setMaxAccess('readonly')
if mibBuilder.loadTexts:
swConnUnitFECUnCorrectedCounter.setStatus('current')
if mibBuilder.loadTexts:
swConnUnitFECUnCorrectedCounter.setDescription('It indicates Forward Error Correction UnCorrected Blocks count.FEC feature is only applicable to 10G/16G platforms.')
sw_traps_v2 = object_identity((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0))
if mibBuilder.loadTexts:
swTrapsV2.setStatus('current')
if mibBuilder.loadTexts:
swTrapsV2.setDescription("The Traps for Brocade's Fibre Channel Switch.")
sw_fault = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 1)).setObjects(('SW-MIB', 'swDiagResult'), ('SW-MIB', 'swSsn'))
if mibBuilder.loadTexts:
swFault.setStatus('obsolete')
if mibBuilder.loadTexts:
swFault.setDescription("Obsoleted this trap as firmware doesn't support this trap. A swFault(1) is generated whenever the diagnostics detects a fault with the switch.")
sw_sensor_scn = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 2)).setObjects(('SW-MIB', 'swSensorStatus'), ('SW-MIB', 'swSensorIndex'), ('SW-MIB', 'swSensorType'), ('SW-MIB', 'swSensorValue'), ('SW-MIB', 'swSensorInfo'), ('SW-MIB', 'swSsn'))
if mibBuilder.loadTexts:
swSensorScn.setStatus('current')
if mibBuilder.loadTexts:
swSensorScn.setDescription('A swSensorScn(2) is generated whenever an environment sensor changes its operational state. For instance, a fan stop working. The VarBind in the Trap Data Unit shall contain the corresponding instance of the sensor status, sensor index, sensor type, sensor value (reading) and sensor information. Note that the sensor information contains the type of sensor and its number in textual format.')
sw_fc_port_scn = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 3)).setObjects(('SW-MIB', 'swFCPortOpStatus'), ('SW-MIB', 'swFCPortIndex'), ('SW-MIB', 'swFCPortName'), ('SW-MIB', 'swFCPortWwn'), ('SW-MIB', 'swFCPortPrevType'), ('SW-MIB', 'swFCPortBrcdType'), ('SW-MIB', 'swSsn'), ('SW-MIB', 'swFCPortFlag'), ('SW-MIB', 'swFCPortDisableReason'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swFCPortScn.setStatus('current')
if mibBuilder.loadTexts:
swFCPortScn.setDescription('This trap is sent whenever an FC port operational status or its type changed. The events that trigger this trap are port goes to online/offline, port type changed to E-port/F-port/FL-port. swFCPortName and swSsn are optional varbind in the trap PDU')
sw_event_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 4)).setObjects(('SW-MIB', 'swEventIndex'), ('SW-MIB', 'swEventTimeInfo'), ('SW-MIB', 'swEventLevel'), ('SW-MIB', 'swEventRepeatCount'), ('SW-MIB', 'swEventDescr'), ('SW-MIB', 'swSsn'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swEventTrap.setStatus('current')
if mibBuilder.loadTexts:
swEventTrap.setDescription('This trap is generated when an event whose level at or below swEventTrapLevel occurs.')
sw_fabric_watch_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 5)).setObjects(('SW-MIB', 'swFwClassAreaIndex'), ('SW-MIB', 'swFwThresholdIndex'), ('SW-MIB', 'swFwName'), ('SW-MIB', 'swFwLabel'), ('SW-MIB', 'swFwLastEventVal'), ('SW-MIB', 'swFwLastEventTime'), ('SW-MIB', 'swFwLastEvent'), ('SW-MIB', 'swFwLastState'), ('SW-MIB', 'swFwLastSeverityLevel'), ('SW-MIB', 'swSsn'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swFabricWatchTrap.setStatus('current')
if mibBuilder.loadTexts:
swFabricWatchTrap.setDescription('trap to be sent by Fabric Watch to notify of an event.')
sw_track_changes_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 6)).setObjects(('SW-MIB', 'swTrackChangesInfo'), ('SW-MIB', 'swSsn'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swTrackChangesTrap.setStatus('current')
if mibBuilder.loadTexts:
swTrackChangesTrap.setDescription('trap to be sent for tracking login/logout/config changes.')
sw_i_pv6_change_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 7)).setObjects(('SW-MIB', 'swIPv6Address'), ('SW-MIB', 'swIPv6Status'))
if mibBuilder.loadTexts:
swIPv6ChangeTrap.setStatus('current')
if mibBuilder.loadTexts:
swIPv6ChangeTrap.setDescription('This trap is generated when an ipv6 address status change event occurs.')
sw_pmgr_event_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 8)).setObjects(('SW-MIB', 'swPmgrEventType'), ('SW-MIB', 'swPmgrEventTime'), ('SW-MIB', 'swPmgrEventDescr'), ('SW-MIB', 'swSsn'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swPmgrEventTrap.setStatus('current')
if mibBuilder.loadTexts:
swPmgrEventTrap.setDescription('This trap is generated when any partition manager change happens.')
sw_fabric_reconfig_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 9)).setObjects(('SW-MIB', 'swDomainID'))
if mibBuilder.loadTexts:
swFabricReconfigTrap.setStatus('current')
if mibBuilder.loadTexts:
swFabricReconfigTrap.setDescription('trap to be sent for tracking fabric reconfiguration')
sw_fabric_segment_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 10)).setObjects(('SW-MIB', 'swFCPortIndex'), ('SW-MIB', 'swFCPortName'), ('SW-MIB', 'swSsn'), ('SW-MIB', 'swFCPortFlag'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swFabricSegmentTrap.setStatus('current')
if mibBuilder.loadTexts:
swFabricSegmentTrap.setDescription('trap to be sent for tracking segmentation')
sw_ext_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 11))
if mibBuilder.loadTexts:
swExtTrap.setStatus('current')
if mibBuilder.loadTexts:
swExtTrap.setDescription('THIS IS INTERNAL TRAP')
sw_state_change_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 12)).setObjects(('SW-MIB', 'swOperStatus'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swStateChangeTrap.setStatus('current')
if mibBuilder.loadTexts:
swStateChangeTrap.setDescription('This trap is sent whenever switch state changes to online/offline')
sw_port_move_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 13)).setObjects(('SW-MIB', 'swPortList'), ('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swPortMoveTrap.setStatus('current')
if mibBuilder.loadTexts:
swPortMoveTrap.setDescription('This trap is sent when ports are moved from one switch to another')
sw_brcd_generic_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 14)).setObjects(('SW-MIB', 'swBrcdTrapBitMask'))
if mibBuilder.loadTexts:
swBrcdGenericTrap.setStatus('current')
if mibBuilder.loadTexts:
swBrcdGenericTrap.setDescription("This trap is sent when there is any one of the following event occured. 1. fabric change 2. device change 3. Fapwwn change 4. fdmi event This Trap is strictly for brocade's internal usage.")
sw_device_status_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 15)).setObjects(('SW-MIB', 'swFCPortSpecifier'), ('SW-MIB', 'swDeviceStatus'), ('SW-MIB', 'swEndDevicePortID'), ('SW-MIB', 'swNsNodeName'))
if mibBuilder.loadTexts:
swDeviceStatusTrap.setStatus('current')
if mibBuilder.loadTexts:
swDeviceStatusTrap.setDescription('This trap is sent whenever there is a device login or logout')
sw_zone_config_change_trap = notification_type((1, 3, 6, 1, 4, 1, 1588, 2, 1, 1, 1, 0, 16)).setObjects(('SW-MIB', 'swVfId'))
if mibBuilder.loadTexts:
swZoneConfigChangeTrap.setStatus('current')
if mibBuilder.loadTexts:
swZoneConfigChangeTrap.setDescription('This trap is sent whenever there is change in local zone database.')
mibBuilder.exportSymbols('SW-MIB', swFwCustUnit=swFwCustUnit, swIDIDMode=swIDIDMode, swSensorValue=swSensorValue, swFabric=swFabric, swTrunkMaster=swTrunkMaster, swDeviceStatusTrap=swDeviceStatusTrap, swTrunkGrpMaster=swTrunkGrpMaster, swFabricMemName=swFabricMemName, swSensorType=swSensorType, sw20x0=sw20x0, swTrunkPortIndex=swTrunkPortIndex, swGroupTable=swGroupTable, swFwClassAreaEntry=swFwClassAreaEntry, swNsWwn=swNsWwn, swBlmPerfEESid=swBlmPerfEESid, swFCPortAdmStatus=swFCPortAdmStatus, swGroupName=swGroupName, swFwValidActs=swFwValidActs, swTrunkGrpNumber=swTrunkGrpNumber, swEventTable=swEventTable, swConnUnitTxBufferUnavailable=swConnUnitTxBufferUnavailable, swFCPortType=swFCPortType, swTrackChangesInfo=swTrackChangesInfo, swTopTalkerMntNumEntries=swTopTalkerMntNumEntries, swFCPortTooManyRdys=swFCPortTooManyRdys, swTopTalkerMntDwwn=swTopTalkerMntDwwn, swSensorInfo=swSensorInfo, swVfName=swVfName, swEventTrapLevel=swEventTrapLevel, swFwDefaultBelowActs=swFwDefaultBelowActs, swGroupEntry=swGroupEntry, swFabricSegmentTrap=swFabricSegmentTrap, swGroup=swGroup, swEndDevicePortID=swEndDevicePortID, SwFwWriteVals=SwFwWriteVals, swFCPortPhyState=swFCPortPhyState, swTopTalkerMntSwwn=swTopTalkerMntSwwn, swTrunkTable=swTrunkTable, swVfId=swVfId, SwFwClassesAreas=SwFwClassesAreas, swSwitchTrunkable=swSwitchTrunkable, swFwCustHigh=swFwCustHigh, swFwLastEventTime=swFwLastEventTime, swFlashDLPassword=swFlashDLPassword, swBlmPerfAlpa=swBlmPerfAlpa, swFCPortMcastTimedOuts=swFCPortMcastTimedOuts, swConnUnitC3DiscardDueToRXTimeout=swConnUnitC3DiscardDueToRXTimeout, swTopTalkerMntflow=swTopTalkerMntflow, swExtTrap=swExtTrap, swFCPortLipIns=swFCPortLipIns, swBlmPerfEEDid=swBlmPerfEEDid, swNsPortName=swNsPortName, PYSNMP_MODULE_ID=swMibModule, swEventIndex=swEventIndex, swNsPortID=swNsPortID, swCpuUsageLimit=swCpuUsageLimit, swPortMoveTrap=swPortMoveTrap, swFwClassAreaTable=swFwClassAreaTable, swFCPortRxBadEofs=swFCPortRxBadEofs, swBlmPerfMnt=swBlmPerfMnt, swFCPortLipLastAlpa=swFCPortLipLastAlpa, swFwSystem=swFwSystem, swBlmPerfFltMntEntry=swBlmPerfFltMntEntry, swFCPortRxCrcs=swFCPortRxCrcs, swTopTalkerMntPort=swTopTalkerMntPort, swEndDeviceSyncLoss=swEndDeviceSyncLoss, swBlmPerfEEPort=swBlmPerfEEPort, swFlashDLFile=swFlashDLFile, swConnUnitUnknownInterrupts=swConnUnitUnknownInterrupts, swNumSensors=swNumSensors, swFlashDLOperStatus=swFlashDLOperStatus, swTopTalkerMntSpid=swTopTalkerMntSpid, swConnUnitC3DiscardDueToDestUnreachable=swConnUnitC3DiscardDueToDestUnreachable, swFault=swFault, swFCPortTable=swFCPortTable, swBlmPerfAlpaPort=swBlmPerfAlpaPort, swFwDefaultUnit=swFwDefaultUnit, swConnUnitLCRX=swConnUnitLCRX, swFCIPMask=swFCIPMask, swConnUnitRDYPriority=swConnUnitRDYPriority, swFCport=swFCport, swConnUnitTransferConnection=swConnUnitTransferConnection, swNsCos=swNsCos, swEventNumEntries=swEventNumEntries, swBlmPerfEERefKey=swBlmPerfEERefKey, swTopTalkerMntMode=swTopTalkerMntMode, swGroupIndex=swGroupIndex, swConnUnitZeroTenancy=swConnUnitZeroTenancy, swFabricWatchTrap=swFabricWatchTrap, swNsIpAddress=swNsIpAddress, swBlmPerfFltMntTable=swBlmPerfFltMntTable, swMemNoOfRetries=swMemNoOfRetries, swNsPortSymb=swNsPortSymb, swNsIpNxPort=swNsIpNxPort, swIPv6ChangeTrap=swIPv6ChangeTrap, swTrunk=swTrunk, swBlmPerfAlpaIndx=swBlmPerfAlpaIndx, swBlmPerfEEMntTable=swBlmPerfEEMntTable, swConnUnitPortStatEntry=swConnUnitPortStatEntry, swEndDevicePort=swEndDevicePort, swFCPortRxC2Frames=swFCPortRxC2Frames, swDomainID=swDomainID, swAdmStatus=swAdmStatus, swGroupMemWwn=swGroupMemWwn, swMemAction=swMemAction, SwFwState=SwFwState, swNbEntry=swNbEntry, swFabricMemEntry=swFabricMemEntry, swFabricMemDid=swFabricMemDid, FcPortFlag=FcPortFlag, swFwCustLow=swFwCustLow, swFCPortSpeed=swFCPortSpeed, swTelnetShellAdmStatus=swTelnetShellAdmStatus, swFwStatus=swFwStatus, swConnUnitUnroutableFrameCounter=swConnUnitUnroutableFrameCounter, swNsEntryIndex=swNsEntryIndex, swFCPortRxFrames=swFCPortRxFrames, swConnUnitBadEOF=swConnUnitBadEOF, swEndDeviceInvalidWord=swEndDeviceInvalidWord, swSensorEntry=swSensorEntry, swConnUnitPCSErrorCounter=swConnUnitPCSErrorCounter, SwFwLicense=SwFwLicense, swSensorStatus=swSensorStatus, swNs=swNs, swMemUsage=swMemUsage, swAgtCmtyIdx=swAgtCmtyIdx, swFwDefaultLow=swFwDefaultLow, swNbMyPort=swNbMyPort, swFCPortIndex=swFCPortIndex, swSsn=swSsn, swConnUnitInvalidARB=swConnUnitInvalidARB, swConnUnitFTB1Miss=swConnUnitFTB1Miss, swNsHardAddr=swNsHardAddr, swEventEntry=swEventEntry, swModel=swModel, swFCIPAddress=swFCIPAddress, swFCPortTxFrames=swFCPortTxFrames, swEndDevice=swEndDevice, swEventVfId=swEventVfId, swFWLastUpdated=swFWLastUpdated, swConnUnitInterrupts=swConnUnitInterrupts, swFwWriteActVals=swFwWriteActVals, swFlashDLAdmStatus=swFlashDLAdmStatus, swEvent=swEvent, swEtherIPMask=swEtherIPMask, SwFwActs=SwFwActs, swFwThLevel=swFwThLevel, swFwCustBelowActs=swFwCustBelowActs, sw=sw, swCpuPollingInterval=swCpuPollingInterval, swBlmPerfFltCnt=swBlmPerfFltCnt, swFwFabricWatchLicense=swFwFabricWatchLicense, swAgtTrapSeverityLevel=swAgtTrapSeverityLevel, swPortTrunked=swPortTrunked, swEventLevel=swEventLevel, swSensorTable=swSensorTable, swPmgrEventTrap=swPmgrEventTrap, swTrunkEntry=swTrunkEntry, swFwLastSeverityLevel=swFwLastSeverityLevel, swNumNbs=swNumNbs, swGroupMemEntry=swGroupMemEntry, SwFwLevels=SwFwLevels, swBlmPerfAlpaCRCCnt=swBlmPerfAlpaCRCCnt, swFlashLastUpdated=swFlashLastUpdated, swZoneConfigChangeTrap=swZoneConfigChangeTrap, swBootPromLastUpdated=swBootPromLastUpdated, swNsLocalEntry=swNsLocalEntry, swFwLastEvent=swFwLastEvent, swFwClassAreaIndex=swFwClassAreaIndex, swBlmPerfEEFCWRx=swBlmPerfEEFCWRx, swConnUnitOpen=swConnUnitOpen, swBlmPerfEEFCWTx=swBlmPerfEEFCWTx, swFwCustAboveActs=swFwCustAboveActs, swNbTable=swNbTable, swNsPortType=swNsPortType, swConnUnitStopTenancyStarVation=swConnUnitStopTenancyStarVation, swFwThresholdEntry=swFwThresholdEntry, swMibModule=swMibModule, swConnUnitFTB2Miss=swConnUnitFTB2Miss, swAgtCmtyStr=swAgtCmtyStr, swFCPortRxC3Frames=swFCPortRxC3Frames, swID=swID, swDeviceStatus=swDeviceStatus, swBlmPerfALPAMntTable=swBlmPerfALPAMntTable, swFCPortCapacity=swFCPortCapacity, swBrcdTrapBitMask=swBrcdTrapBitMask, swNsNodeName=swNsNodeName, swFwBehaviorInt=swFwBehaviorInt, swFCPortBrcdType=swFCPortBrcdType, swFabricMemTable=swFabricMemTable, swFCPortEntry=swFCPortEntry, swTrunkGroupNumber=swTrunkGroupNumber, swTopTalkerMntDpid=swTopTalkerMntDpid, swprivProtocolPassword=swprivProtocolPassword, swFwWriteThVals=swFwWriteThVals, swConnUnitZoneMiss=swConnUnitZoneMiss, swFCPortRxEncOutFrs=swFCPortRxEncOutFrs, swBootDate=swBootDate, swFCPortLipOuts=swFCPortLipOuts, swGroupMemPos=swGroupMemPos, swTrackChangesTrap=swTrackChangesTrap, swConnUnitNLNumOfTenancy=swConnUnitNLNumOfTenancy, swFCPortRxEncInFrs=swFCPortRxEncInFrs, swBeaconAdmStatus=swBeaconAdmStatus, swBlmPerfEEMntEntry=swBlmPerfEEMntEntry, swEventDescr=swEventDescr, swNbIslCost=swNbIslCost, swConnUnitC3DiscardDueToTXTimeout=swConnUnitC3DiscardDueToTXTimeout, swFwCustExceededActs=swFwCustExceededActs, swEventRepeatCount=swEventRepeatCount, swFCPortTxMcasts=swFCPortTxMcasts, swConnUnitOpend=swConnUnitOpend, swOperStatus=swOperStatus, swBlmPerfALPAMntEntry=swBlmPerfALPAMntEntry, swFwDefaultInBetweenActs=swFwDefaultInBetweenActs, sw21kN24k=sw21kN24k, swFwDefaultExceededActs=swFwDefaultExceededActs, swModule=swModule, swBlmPerfEECRC=swBlmPerfEECRC, swNbRemDomain=swNbRemDomain, swCpuOrMemoryUsage=swCpuOrMemoryUsage, swAgtCmtyEntry=swAgtCmtyEntry, swFCPortRxTooLongs=swFCPortRxTooLongs, swIPv6Address=swIPv6Address, swTopTalkerMntEntry=swTopTalkerMntEntry, swFwLastState=swFwLastState, swMemUsageLimit1=swMemUsageLimit1, swTrunkGrpTable=swTrunkGrpTable, swSystem=swSystem, swFwThresholdIndex=swFwThresholdIndex, swPortList=swPortList, swFCPortNoTxCredits=swFCPortNoTxCredits, swFCPortC3Discards=swFCPortC3Discards, swEndDeviceAlpa=swEndDeviceAlpa, swFirmwareVersion=swFirmwareVersion, swGroupType=swGroupType, swEndDeviceSigLoss=swEndDeviceSigLoss, swTrapsV2=swTrapsV2, swMemUsageLimit=swMemUsageLimit, swConnUnitFECCorrectedCounter=swConnUnitFECCorrectedCounter, swTopTalker=swTopTalker, swFabricReconfigTrap=swFabricReconfigTrap, swConnUnitC3DiscardOther=swConnUnitC3DiscardOther, swFlashDLUser=swFlashDLUser, swauthProtocolPassword=swauthProtocolPassword, swCpuNoOfRetries=swCpuNoOfRetries, SwSevType=SwSevType, swFwName=swFwName, swFwDefaultChangedActs=swFwDefaultChangedActs, swFwCustTimebase=swFwCustTimebase, swTrunkGrpEntry=swTrunkGrpEntry, swAgtTrapRcp=swAgtTrapRcp, swCpuUsage=swCpuUsage, swEndDeviceRlsEntry=swEndDeviceRlsEntry)
mibBuilder.exportSymbols('SW-MIB', swFwCustInBetweenActs=swFwCustInBetweenActs, swFabricMemWwn=swFabricMemWwn, swFCPortTxWords=swFCPortTxWords, swConnUnitPortStatExtentionTable=swConnUnitPortStatExtentionTable, swConnUnitTimedOut=swConnUnitTimedOut, swTrunkGrpTx=swTrunkGrpTx, swNbIndex=swNbIndex, swNbIslState=swNbIslState, swBlmPerfFltAlias=swBlmPerfFltAlias, swMemPollingInterval=swMemPollingInterval, swIPv6Status=swIPv6Status, swFabricMemType=swFabricMemType, swFwCustBufSize=swFwCustBufSize, swFCPortWwn=swFCPortWwn, swFCPortLinkState=swFCPortLinkState, swEventTrap=swEventTrap, swFCPortFlag=swFCPortFlag, swConnUnitStateChange=swConnUnitStateChange, swFwDefaultBufSize=swFwDefaultBufSize, swNsIPA=swNsIPA, swDiagResult=swDiagResult, swNbBaudRate=swNbBaudRate, swFwDefaultHigh=swFwDefaultHigh, swNsLocalTable=swNsLocalTable, swConnUnitProcRequired=swConnUnitProcRequired, swAgtCfg=swAgtCfg, swFCPortOpStatus=swFCPortOpStatus, swFabricMemGWIP=swFabricMemGWIP, swAgtCmtyTable=swAgtCmtyTable, swFCPortRxLCs=swFCPortRxLCs, swFwCurVal=swFwCurVal, swFabricMemEIP=swFabricMemEIP, swConnUnitLli=swConnUnitLli, swPmgrEventDescr=swPmgrEventDescr, SwFwStatus=SwFwStatus, swTopTalkerMntTable=swTopTalkerMntTable, swGroupMemTable=swGroupMemTable, swPmgrEventType=swPmgrEventType, swFwThresholdTable=swFwThresholdTable, swFabricMemShortVersion=swFabricMemShortVersion, swCpuAction=swCpuAction, swFwBehaviorType=swFwBehaviorType, swFwActLevel=swFwActLevel, swTestString=swTestString, swFCPortRxWords=swFCPortRxWords, swNbRemPort=swNbRemPort, swCurrentDate=swCurrentDate, swFCPortRxTruncs=swFCPortRxTruncs, swStateChangeTrap=swStateChangeTrap, swSensorScn=swSensorScn, swNsLocalNumEntry=swNsLocalNumEntry, swEtherIPAddress=swEtherIPAddress, swFwDefaultAboveActs=swFwDefaultAboveActs, swEndDeviceProtoErr=swEndDeviceProtoErr, swEventTimeInfo=swEventTimeInfo, swConnUnitFTB6Miss=swConnUnitFTB6Miss, swPrincipalSwitch=swPrincipalSwitch, SwFwBehavior=SwFwBehavior, swFwLabel=swFwLabel, swFCPortName=swFCPortName, swEndDeviceLinkFailure=swEndDeviceLinkFailure, swFlashDLHost=swFlashDLHost, swFCPortTxType=swFCPortTxType, swTrunkGrpRx=swTrunkGrpRx, swFwDefaultTimebase=swFwDefaultTimebase, swNsFc4=swNsFc4, swBlmPerfFltRefkey=swBlmPerfFltRefkey, swFCPortRxMcasts=swFCPortRxMcasts, swBrcdGenericTrap=swBrcdGenericTrap, swTopTalkerMntIndex=swTopTalkerMntIndex, swNsNodeSymb=swNsNodeSymb, swBlmPerfFltPort=swBlmPerfFltPort, swFabricMemFCIP=swFabricMemFCIP, swFCPortPrevType=swFCPortPrevType, swMemUsageLimit3=swMemUsageLimit3, swConnUnitFECUnCorrectedCounter=swConnUnitFECUnCorrectedCounter, swPmgrEventTime=swPmgrEventTime, swConnUnitLunZoneMiss=swConnUnitLunZoneMiss, SwFwTimebase=SwFwTimebase, swNbRemPortName=swNbRemPortName, swEndDeviceInvalidCRC=swEndDeviceInvalidCRC, swConnUnitFLNumOfTenancy=swConnUnitFLNumOfTenancy, sw28k=sw28k, swBeaconOperStatus=swBeaconOperStatus, swFCPortScn=swFCPortScn, swFCPortDisableReason=swFCPortDisableReason, swGroupId=swGroupId, swFCPortSpecifier=swFCPortSpecifier, swFCPortRxBadOs=swFCPortRxBadOs, swSensorIndex=swSensorIndex, swFwCustChangedActs=swFwCustChangedActs, SwFwEvent=SwFwEvent, swConnUnitCRCWithBadEOF=swConnUnitCRCWithBadEOF, swEndDeviceRlsTable=swEndDeviceRlsTable, swFwLastEventVal=swFwLastEventVal) |
text = '''aaaaaa aaaaaa aaaa aaaa a aa aa a aa0
bbbbbb bbbbbb bbbbbbbbbb.ccc ccccc c0
dddd ddddd ddddd.eeeee eeeeeee.fffff0
fffff fff ffffff.ggg ggg gg g.eeefaa0.'''
lines = list(text.split('\n'))
words = list(text.split(' '))
sentenses = list(text.split('.'))
print(len(lines), lines, '\n')
print(len(words), words, '\n')
print(len(sentenses), sentenses, '\n')
print(len(text))
| text = 'aaaaaa aaaaaa aaaa aaaa a aa aa a aa0\nbbbbbb bbbbbb bbbbbbbbbb.ccc ccccc c0\ndddd ddddd ddddd.eeeee eeeeeee.fffff0\nfffff fff ffffff.ggg ggg gg g.eeefaa0.'
lines = list(text.split('\n'))
words = list(text.split(' '))
sentenses = list(text.split('.'))
print(len(lines), lines, '\n')
print(len(words), words, '\n')
print(len(sentenses), sentenses, '\n')
print(len(text)) |
class BinaryTree:
def __init__(self, rootValue):
self.value = rootValue
self.left = None
self.right = None
def addLeftChild(self, val):
newNode = BinaryTree(val)
self.left = newNode
def addRightChild(self, val):
newNode = BinaryTree(val)
self.right = newNode
def setLeftChild(self, child):
self.left = child
def setRightChild(self, child):
self.right = child
| class Binarytree:
def __init__(self, rootValue):
self.value = rootValue
self.left = None
self.right = None
def add_left_child(self, val):
new_node = binary_tree(val)
self.left = newNode
def add_right_child(self, val):
new_node = binary_tree(val)
self.right = newNode
def set_left_child(self, child):
self.left = child
def set_right_child(self, child):
self.right = child |
#a = 3
#b = 4
#c = a ** b
#print (c)
#x = 5
#print(x)
#x = 5
#x += 3
#
#print(x)
#x = 5
#x -= 3
#
#print(x)
#x = 5
#x *= 3
#print(x)
#x = 5
#x /= 3
#print(x)
#x = 5
#x%=3
#print(x)
# comparisin opperraters
#x = 5
#y = 3
#
#print(x == y)
#
# returns False because 5 is not equal to 3
#x = 5
#y = 3
#
#print(x != y)
#x = 5
#y = 3
#
#print(x >= y)
#
# returns True because five is greater, or equal, to 3
x = 5
y = 3
print(x <= y)
# returns False because 5 is neither less than or equal to 3 | x = 5
y = 3
print(x <= y) |
fruit = ["apple", "banana", "peach"]
fruit
# outputs
# >>> ['apple', 'banana', 'peach']
| fruit = ['apple', 'banana', 'peach']
fruit |
#!/usr/bin/env python
#--- Day 6: Universal Orbit Map ---
#You've landed at the Universal Orbit Map facility on Mercury. Because navigation in space often involves transferring between orbits, the orbit maps here are useful for finding efficient routes between, for example, you and Santa. You download a map of the local orbits (your puzzle input).
#Except for the universal Center of Mass (COM), every object in space is in orbit around exactly one other object. An orbit looks roughly like this:
# \
# \
# |
# |
#AAA--> o o <--BBB
# |
# |
# /
# /
#In this diagram, the object BBB is in orbit around AAA. The path that BBB takes around AAA (drawn with lines) is only partly shown. In the map data, this orbital relationship is written AAA)BBB, which means "BBB is in orbit around AAA".
#Before you use your map data to plot a course, you need to make sure it wasn't corrupted during the download. To verify maps, the Universal Orbit Map facility uses orbit count checksums - the total number of direct orbits (like the one shown above) and indirect orbits.
#Whenever A orbits B and B orbits C, then A indirectly orbits C. This chain can be any number of objects long: if A orbits B, B orbits C, and C orbits D, then A indirectly orbits D.
#For example, suppose you have the following map:
#COM)B
#B)C
#C)D
#D)E
#E)F
#B)G
#G)H
#D)I
#E)J
#J)K
#K)L
#Visually, the above map of orbits looks like this:
# G - H J - K - L
# / /
#COM - B - C - D - E - F
# \
# I
#In this visual representation, when two objects are connected by a line, the one on the right directly orbits the one on the left.
#Here, we can count the total number of orbits as follows:
#* D directly orbits C and indirectly orbits B and COM, a total of 3 orbits.
#* L directly orbits K and indirectly orbits J, E, D, C, B, and COM, a total of 7 orbits.
#* COM orbits nothing.
#The total number of direct and indirect orbits in this example is 42.
#What is the total number of direct and indirect orbits in your map data?
puzzle_input = []
# 1) read input
with open("day06.txt", "r") as file:
### DEBUG INPUT
#with open("day06-test.txt", "r") as file:
for entry in file.readlines():
puzzle_input.append(entry.rstrip().split(")"))
# 1.1) check whether it would be a binary tree or not
#checklist = [x[0] for x in split_input]
#for x in checklist:
# if checklist.count(x) > 2:
# print("not binary,", x, "contained more than twice!")
## damn it: not binary, 7LD contained more than twice!
## okay. Let's build a ternary tree...
# 2) build a tree from the input data
# After having read through some reddit posts looking for help on this one (Python has no native tree structure, I was not able to get anytree do what I wanted it to do, I was not able to get my input into any reasonable structure, ...), I'm afraid I have to take a look at dictionaries again. At least, I already was at the right way of counting things, but without knowledge about how dictionaries work, I couldn't possibly figure out how to set it up properly (and my trials with doing it with lists of lists of lists of lists etc. etc. failed).
# every object is key with value being the object that they orbit
orbit_dict = {key: value for value, key in puzzle_input}
# now, for every object=key, count how many "parents" there are, i.e. look-up the key's value in the keys until COM is reached - and COM is no key, so this will stop the while loop
calc_orbits = 0
for obj in orbit_dict.keys():
obj_tmp = obj
while obj_tmp in orbit_dict:
calc_orbits += 1
obj_tmp = orbit_dict[obj_tmp]
print(calc_orbits)
### DEBUG OUTPUT
print(puzzle_input[0:5])
#print(orbit_dict)
| puzzle_input = []
with open('day06.txt', 'r') as file:
for entry in file.readlines():
puzzle_input.append(entry.rstrip().split(')'))
orbit_dict = {key: value for (value, key) in puzzle_input}
calc_orbits = 0
for obj in orbit_dict.keys():
obj_tmp = obj
while obj_tmp in orbit_dict:
calc_orbits += 1
obj_tmp = orbit_dict[obj_tmp]
print(calc_orbits)
print(puzzle_input[0:5]) |
def print_name(prefix):
print("searchingname with" + prefix)
try:
while True:
name = (yield)
if prefix in name:
print(name)
except GeneratorExit as identifier:
print("Coroutine Exited")
corou = print_name("Dear")
corou.__next__()
corou.send("Atul")
corou.send("Dear Atul")
corou.close() | def print_name(prefix):
print('searchingname with' + prefix)
try:
while True:
name = (yield)
if prefix in name:
print(name)
except GeneratorExit as identifier:
print('Coroutine Exited')
corou = print_name('Dear')
corou.__next__()
corou.send('Atul')
corou.send('Dear Atul')
corou.close() |
n = int(input())
s = [1 if element == 'U' else -1 for element in input()]
counter = 0
status = 0
step = 0
while step < n:
if status == 0 and s[step] == -1:
status = 1
start_pt = step
step += 1
sum_val = -1
while step < n and status != 0:
sum_val += s[step]
if sum_val == 0:
counter += 1
status = 0
step += 1
elif status == 0 and s[step] == 1:
status = -1
start_pt = step
step += 1
sum_val = 1
while step < n and status != 0:
sum_val += s[step]
if sum_val == 0:
status = 0
step += 1
print (counter) | n = int(input())
s = [1 if element == 'U' else -1 for element in input()]
counter = 0
status = 0
step = 0
while step < n:
if status == 0 and s[step] == -1:
status = 1
start_pt = step
step += 1
sum_val = -1
while step < n and status != 0:
sum_val += s[step]
if sum_val == 0:
counter += 1
status = 0
step += 1
elif status == 0 and s[step] == 1:
status = -1
start_pt = step
step += 1
sum_val = 1
while step < n and status != 0:
sum_val += s[step]
if sum_val == 0:
status = 0
step += 1
print(counter) |
'''
Author: tusikalanse
Date: 2021-07-10 18:07:33
LastEditTime: 2021-07-10 18:10:07
LastEditors: tusikalanse
Description:
'''
cnt = 0
def gao(i: int) -> int:
for _ in range(50):
i = i + int(str(i)[::-1])
if str(i) == str(i)[::-1]:
return 0
return 1
for i in range(10000):
cnt += gao(i)
print(cnt) | """
Author: tusikalanse
Date: 2021-07-10 18:07:33
LastEditTime: 2021-07-10 18:10:07
LastEditors: tusikalanse
Description:
"""
cnt = 0
def gao(i: int) -> int:
for _ in range(50):
i = i + int(str(i)[::-1])
if str(i) == str(i)[::-1]:
return 0
return 1
for i in range(10000):
cnt += gao(i)
print(cnt) |
# To demonstrate, we insert the number 8 to specify the available space for the value.
# Use "=" to place the plus/minus sign at the left most position:
txt = "The temperature is {:=8} degrees celsius."
print(txt.format(-5))
| txt = 'The temperature is {:=8} degrees celsius.'
print(txt.format(-5)) |
'''
Flask config.
'''
display = {}
CREDS_PATH = "app/creds.txt"
TEMPLATES_AUTO_RELOAD = True | """
Flask config.
"""
display = {}
creds_path = 'app/creds.txt'
templates_auto_reload = True |
# equation constants
# gas diffusivity
CONST_EQ_GAS_DIFFUSIVITY = {
"Chapman-Enskog": 1,
"Wilke-Lee": 2
}
# gas viscosity
CONST_EQ_GAS_VISCOSITY = {
"eq1": 1,
"eq2": 2
}
# sherwood number
CONST_EQ_Sh = {
"Frossling": 1,
"Rosner": 2,
"Garner-and-Keey": 3
}
# thermal conductivity
CONST_EQ_GAS_THERMAL_CONDUCTIVITY = {
"eq1": 1,
"eq2": 2
}
| const_eq_gas_diffusivity = {'Chapman-Enskog': 1, 'Wilke-Lee': 2}
const_eq_gas_viscosity = {'eq1': 1, 'eq2': 2}
const_eq__sh = {'Frossling': 1, 'Rosner': 2, 'Garner-and-Keey': 3}
const_eq_gas_thermal_conductivity = {'eq1': 1, 'eq2': 2} |
a = [1, 1, 2, 3, 5, 8, 13, 21, 34, 55, 89]
list = []
num = int(input('check wich number is smaller than : '))
for x in a:
if x < num:
list.append(x)
# print(x)
print(list)
| a = [1, 1, 2, 3, 5, 8, 13, 21, 34, 55, 89]
list = []
num = int(input('check wich number is smaller than : '))
for x in a:
if x < num:
list.append(x)
print(list) |
# Write a function named combine_sort that has two parameters named lst1 and lst2.
# The function should combine these two lists into one new list and sort the result. Return the new sorted list.
#print(combine_sort([4, 10, 2, 5], [-10, 2, 5, 10]))
def combine_sort(lst1, lst2):
new_lst = lst1 + lst2
return sorted(new_lst)
print(combine_sort([4, 10, 2, 5], [-10, 2, 5, 10]))
| def combine_sort(lst1, lst2):
new_lst = lst1 + lst2
return sorted(new_lst)
print(combine_sort([4, 10, 2, 5], [-10, 2, 5, 10])) |
# Allows for easier debugging and unit testing. For example in dev mode functions don't expect a Flask request input.
DEV_MODE = False
KEYFILE = 'keyfile.json'
| dev_mode = False
keyfile = 'keyfile.json' |
elements = [23, 14, 56, 12, 19, 9, 15, 25, 31, 42, 43]
l=len(elements)
i=0
sum_even=0
sum_odd=0
average_even=0
average_odd=0
while i<l:
if elements[i]%2==0:
sum_even=sum_even+elements[i]
average_even+=1
else:
sum_odd=sum_odd+elements[i]
average_odd+=1
i+=1
print(sum_even//average_even)
print(sum_odd//average_odd)
| elements = [23, 14, 56, 12, 19, 9, 15, 25, 31, 42, 43]
l = len(elements)
i = 0
sum_even = 0
sum_odd = 0
average_even = 0
average_odd = 0
while i < l:
if elements[i] % 2 == 0:
sum_even = sum_even + elements[i]
average_even += 1
else:
sum_odd = sum_odd + elements[i]
average_odd += 1
i += 1
print(sum_even // average_even)
print(sum_odd // average_odd) |
# for local
# It's probably helpful for us to demonstrate what the URL should be, etc.
SECRET_KEY = b'keycloak'
# http, not https for some reason
SERVER_URL = "http://keycloak-idp:8080/auth/"
ADMIN_USERNAME = "admin"
ADMIN_PASS = "admin"
REALM_NAME = "master"
# created in keycloak per https://github.com/keycloak/keycloak-documentation/blob/main/securing_apps/topics/client-registration/client-registration-cli.adoc
CLIENT_ID = "keycloak-flask"
# set access-type to confidential, save, reload, will see a credentials tab where you can set this
CLIENT_SECRET = "2da4a9a4-f6f0-48d9-82f6-12012402f03a"
# You'll probably have to tell docker this is OK on a Mac
INGRESS_HOST = "http://www.google.com/"
| secret_key = b'keycloak'
server_url = 'http://keycloak-idp:8080/auth/'
admin_username = 'admin'
admin_pass = 'admin'
realm_name = 'master'
client_id = 'keycloak-flask'
client_secret = '2da4a9a4-f6f0-48d9-82f6-12012402f03a'
ingress_host = 'http://www.google.com/' |
# This is a sample Python script.
# Press Shift+F10 to execute it or replace it with your code.
# Press Double Shift to search everywhere for classes, files, tool windows, actions, and settings.
def print_hi(iname):
# Use a breakpoint in the code line below to debug your script.
print(f'Hi, {iname}') # Press Ctrl+F8 to toggle the breakpoint.
print_hi("hi pycharm")
def days_to_hour(num_of_days):
calc_to_units = 24
name_of_units = 'hours'
return f"{num_of_days} days to {name_of_units} are {num_of_days*calc_to_units} {name_of_units}"
def validate_user_input():
try:
user_input_days = int(user_input)
if user_input_days > 0:
results = days_to_hour(user_input_days)
print(results)
elif user_input_days == 0:
print("please enter valid positive number, 0 can not be converted")
else:
print("negative number not allowed")
except ValueError:
print("your input is not a valid number")
user_input = ""
while user_input != 'exit':
user_input = (input("provide number of day to convert!\n"))
validate_user_input()
# Press the green button in the gutter to run the script.
# See PyCharm help at https://www.jetbrains.com/help/pycharm/ | def print_hi(iname):
print(f'Hi, {iname}')
print_hi('hi pycharm')
def days_to_hour(num_of_days):
calc_to_units = 24
name_of_units = 'hours'
return f'{num_of_days} days to {name_of_units} are {num_of_days * calc_to_units} {name_of_units}'
def validate_user_input():
try:
user_input_days = int(user_input)
if user_input_days > 0:
results = days_to_hour(user_input_days)
print(results)
elif user_input_days == 0:
print('please enter valid positive number, 0 can not be converted')
else:
print('negative number not allowed')
except ValueError:
print('your input is not a valid number')
user_input = ''
while user_input != 'exit':
user_input = input('provide number of day to convert!\n')
validate_user_input() |
pi=22/7
r=float(input("enter radius of circle"))
Area=pi*r*r
print("Area of circle:%f",Area)
| pi = 22 / 7
r = float(input('enter radius of circle'))
area = pi * r * r
print('Area of circle:%f', Area) |
def upload(task_id, file_id, remote_path):
global responses
remote_path = remote_path.replace("\\", "")
upload = {
'action': "upload",
'file_id': file_id,
'chunk_size': 512000,
'chunk_num': 1,
'full_path': "",
'task_id': task_id,
}
res = send(upload, agent.get_UUID())
res = res['chunk_data']
response_bytes = res.encode('utf-8')
response_decode = base64.b64decode(response_bytes)
code = response_decode.decode('utf-8')
f = open(remote_path, "w")
f.write(code)
f.close()
response = {
'task_id': task_id,
"user_output": "File Uploaded",
'completed': True
}
responses.append(response)
print("\t- Upload Done")
return | def upload(task_id, file_id, remote_path):
global responses
remote_path = remote_path.replace('\\', '')
upload = {'action': 'upload', 'file_id': file_id, 'chunk_size': 512000, 'chunk_num': 1, 'full_path': '', 'task_id': task_id}
res = send(upload, agent.get_UUID())
res = res['chunk_data']
response_bytes = res.encode('utf-8')
response_decode = base64.b64decode(response_bytes)
code = response_decode.decode('utf-8')
f = open(remote_path, 'w')
f.write(code)
f.close()
response = {'task_id': task_id, 'user_output': 'File Uploaded', 'completed': True}
responses.append(response)
print('\t- Upload Done')
return |
#!/usr/bin/env python
def constructCDS(features, coordinates):
exonCoordinates = [coordinates[featureIndex] for featureIndex in range(len(features)) if features[featureIndex][1] == "e"]
cdsMap = {}
cdsStart = 1
for exonCoord in exonCoordinates:
exonStart, exonEnd = exonCoord
cdsEnd = cdsStart + (exonEnd - exonStart)
cdsMap[(exonStart, exonEnd)] = (cdsStart,cdsEnd)
cdsStart = cdsEnd + 1
return cdsMap
def transformPos(pos_orig, cdsMap, sum_deletes_before, sum_inserts_before, sum_cds_deletes_before, sum_cds_inserts_before):
pos = pos_orig - sum_deletes_before
cdsRegions = list(cdsMap.keys())
cdsRegions.sort()
for region in cdsRegions:
if (pos >= region[0]) and (pos <= region[1]):
newRegion = cdsMap[region]
newPosition = newRegion[0] + (pos - region[0]) - sum_cds_inserts_before + sum_cds_deletes_before
codonIndex = newPosition / 3 # codon length = 3
return (newPosition, codonIndex)
return (pos_orig - sum_inserts_before, None)
def changeToImgtCoords(features, coordinates, differences, utr5Length = 0):
cdsMap = constructCDS(features, coordinates)
imgtDifferences = {}
imgtCoordinates = []
for key in ["deletionPositions", "insertionPositions", "mismatchPositions"]:
imgtDifferences[key] = []
utr5Index = features.index("utr5")
utr5Start, utr5End = coordinates[utr5Index][0], coordinates[utr5Index][1]
utr5Length = utr5End - utr5Start + 1
for featureIndex in range(len(features)):
feature = features[featureIndex]
if feature == "utr5":
ft_start = coordinates[featureIndex][0] - (utr5Length + 1)
ft_end = coordinates[featureIndex][1] - (utr5Length + 1)
else:
ft_start = coordinates[featureIndex][0] - utr5Length
ft_end = coordinates[featureIndex][1] - utr5Length
imgtCoordinates.append((ft_start, ft_end))
# shift positions for preceding inDels:
ins_in_cds = []
del_in_cds = []
for key in ["deletionPositions", "insertionPositions", "mismatchPositions"]:
imgtDifferences[key] = []
new_diff = []
for pos in differences[key]:
sum_deletes_before = sum([1 for posx in differences["deletionPositions"] if posx < pos])
sum_cds_deletes_before = sum([1 for posx in differences["deletionPositions"] if posx < pos and posx in del_in_cds])
sum_inserts_before = sum([1 for posx in differences["insertionPositions"] if posx < pos])
sum_cds_inserts_before = sum([1 for posx in differences["insertionPositions"] if posx < pos and posx in ins_in_cds])
newpos = transformPos(pos, cdsMap, sum_deletes_before, sum_inserts_before, sum_cds_deletes_before, sum_cds_inserts_before)
imgtDifferences[key].append(newpos)
# print(key, pos, sum_inserts_before, sum_deletes_before, sum_cds_deletes_before, sum_cds_inserts_before, newpos)
# adjust differences[key] for preceding insertions:
if newpos[1]: # if change located in CDS
new_diff.append(pos)
if key == "insertionPositions":
ins_in_cds.append(pos)
elif key == "deletionPositions":
del_in_cds.append(pos)
else:
new_diff.append(newpos[0])
differences[key] = new_diff
for key in ["mismatches", "insertions", "deletions"]:
imgtDifferences[key] = differences[key]
return (imgtCoordinates, imgtDifferences, cdsMap)
| def construct_cds(features, coordinates):
exon_coordinates = [coordinates[featureIndex] for feature_index in range(len(features)) if features[featureIndex][1] == 'e']
cds_map = {}
cds_start = 1
for exon_coord in exonCoordinates:
(exon_start, exon_end) = exonCoord
cds_end = cdsStart + (exonEnd - exonStart)
cdsMap[exonStart, exonEnd] = (cdsStart, cdsEnd)
cds_start = cdsEnd + 1
return cdsMap
def transform_pos(pos_orig, cdsMap, sum_deletes_before, sum_inserts_before, sum_cds_deletes_before, sum_cds_inserts_before):
pos = pos_orig - sum_deletes_before
cds_regions = list(cdsMap.keys())
cdsRegions.sort()
for region in cdsRegions:
if pos >= region[0] and pos <= region[1]:
new_region = cdsMap[region]
new_position = newRegion[0] + (pos - region[0]) - sum_cds_inserts_before + sum_cds_deletes_before
codon_index = newPosition / 3
return (newPosition, codonIndex)
return (pos_orig - sum_inserts_before, None)
def change_to_imgt_coords(features, coordinates, differences, utr5Length=0):
cds_map = construct_cds(features, coordinates)
imgt_differences = {}
imgt_coordinates = []
for key in ['deletionPositions', 'insertionPositions', 'mismatchPositions']:
imgtDifferences[key] = []
utr5_index = features.index('utr5')
(utr5_start, utr5_end) = (coordinates[utr5Index][0], coordinates[utr5Index][1])
utr5_length = utr5End - utr5Start + 1
for feature_index in range(len(features)):
feature = features[featureIndex]
if feature == 'utr5':
ft_start = coordinates[featureIndex][0] - (utr5Length + 1)
ft_end = coordinates[featureIndex][1] - (utr5Length + 1)
else:
ft_start = coordinates[featureIndex][0] - utr5Length
ft_end = coordinates[featureIndex][1] - utr5Length
imgtCoordinates.append((ft_start, ft_end))
ins_in_cds = []
del_in_cds = []
for key in ['deletionPositions', 'insertionPositions', 'mismatchPositions']:
imgtDifferences[key] = []
new_diff = []
for pos in differences[key]:
sum_deletes_before = sum([1 for posx in differences['deletionPositions'] if posx < pos])
sum_cds_deletes_before = sum([1 for posx in differences['deletionPositions'] if posx < pos and posx in del_in_cds])
sum_inserts_before = sum([1 for posx in differences['insertionPositions'] if posx < pos])
sum_cds_inserts_before = sum([1 for posx in differences['insertionPositions'] if posx < pos and posx in ins_in_cds])
newpos = transform_pos(pos, cdsMap, sum_deletes_before, sum_inserts_before, sum_cds_deletes_before, sum_cds_inserts_before)
imgtDifferences[key].append(newpos)
if newpos[1]:
new_diff.append(pos)
if key == 'insertionPositions':
ins_in_cds.append(pos)
elif key == 'deletionPositions':
del_in_cds.append(pos)
else:
new_diff.append(newpos[0])
differences[key] = new_diff
for key in ['mismatches', 'insertions', 'deletions']:
imgtDifferences[key] = differences[key]
return (imgtCoordinates, imgtDifferences, cdsMap) |
class CodeParser():
#Parsing variables
SPEED = 0
ANGLE = 0
lineNum = 0
#Parsing libraries (or "keywords")
PORTS = ["THROTTLE", "TURN"]
#Initialize the CodeParser
def __init__(self, path):
self.SPEED = 0
self.ANGLE = 0
#Open racer file
racer = open(path, "r")
#Read lines in
self.code = racer.readlines()
racer.close()
#Remove whitespace from file
line = 0
while line < len(self.code):
terms = self.code[line].split()
if len(terms) == 0:
self.code.pop(line)
else:
line += 1
#Analyze
def analyzer(self):
#Keep reading lines until you run out of lines
while self.lineNum < len(self.code):
#Split code line into terms
terms = self.code[self.lineNum].split()
#Go to add function
if terms[0] == "add":
self.addPort(terms)
elif terms[0] == "sub":
self.subPort(terms)
elif terms[0] == "mpy":
self.mpyPort(terms)
elif terms[0] == "div":
self.divPort(terms)
elif terms[0] == "set":
self.setPort(terms)
elif terms[0] == "jmp":
self.jump(terms)
elif terms[0] == "lst":
self.lstJump(terms)
elif terms[0] == "lte":
self.lteJump(terms)
elif terms[0] == "grt":
self.grtJump(terms)
elif terms[0] == "gte":
self.gteJump(terms)
elif terms[0] == "eqt":
self.eqtJump(terms)
elif terms[0] == "nte":
self.nteJump(terms)
#Print speed and angle after each line read
#print("Speed:", self.SPEED)
#print("Angle:", self.ANGLE)
self.lineNum += 1
#Function to add number to port
def addPort(self, terms):
if terms[1] == "THROTTLE":
self.SPEED = self.SPEED + int(terms[2])
elif terms[1] == "TURN":
self.ANGLE = self.ANGLE + int(terms[2])
#Function to subtract number from port
def subPort(self, terms):
if terms[1] == "THROTTLE":
self.SPEED = self.SPEED - int(terms[2])
elif terms[1] == "TURN":
self.ANGLE = self.ANGLE - int(terms[2])
#Function to multply port by number
def mpyPort(self, terms):
if terms[1] == "THROTTLE":
self.SPEED = self.SPEED * int(terms[2])
elif terms[1] == "TURN":
self.ANGLE = self.ANGLE * int(terms[2])
#Function to divide port by number
def divPort(self, terms):
if terms[1] == "THROTTLE":
self.SPEED = self.SPEED / int(terms[2])
elif terms[1] == "TURN":
self.ANGLE = self.ANGLE / int(terms[2])
#Function to set port to number
def setPort(self, terms):
if terms[1] == "THROTTLE":
self.SPEED = int(terms[2])
elif terms[1] == "TURN":
self.ANGLE = int(terms[2])
#Function to jump to spcific line
def jump(self, terms):
#Find the function to jump to and then set lineNum to where it is in the txt file
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[1]:
self.lineNum = num
return
#Function to change port to number
def portToNum(self, terms):
for i, _ in enumerate(terms):
if terms[i] == "THROTTLE":
terms[i] = self.SPEED
if terms[i] == "TURN":
terms[i] = self.ANGLE
#Function to jump if comparison is less than
def lstJump(self, terms):
self.portToNum(terms)
if int(terms[1]) < int(terms[2]):
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
#Function to jump if comparison is less than or equal to
def lteJump(self, terms):
self.portToNum(terms)
if int(terms[1]) <= int(terms[2]):
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
#Function to jump if comparison is greater than
def grtJump(self, terms):
self.portToNum(terms)
if int(terms[1]) > int(terms[2]):
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
#Function to jump if comparison is less than or equal to
def gteJump(self, terms):
self.portToNum(terms)
if int(terms[1]) >= int(terms[2]):
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
#Function to jump if comparison is equal to
def eqtJump(self, terms):
self.portToNum(terms)
if int(terms[1]) == int(terms[2]):
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
#Function to jump if comparison is not equal to
def nteJump(self, terms):
self.portToNum(terms)
if int(terms[1]) != int(terms[2]):
for num, i in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
#This is just for testing and running the code
#CodeParser.analyze()
| class Codeparser:
speed = 0
angle = 0
line_num = 0
ports = ['THROTTLE', 'TURN']
def __init__(self, path):
self.SPEED = 0
self.ANGLE = 0
racer = open(path, 'r')
self.code = racer.readlines()
racer.close()
line = 0
while line < len(self.code):
terms = self.code[line].split()
if len(terms) == 0:
self.code.pop(line)
else:
line += 1
def analyzer(self):
while self.lineNum < len(self.code):
terms = self.code[self.lineNum].split()
if terms[0] == 'add':
self.addPort(terms)
elif terms[0] == 'sub':
self.subPort(terms)
elif terms[0] == 'mpy':
self.mpyPort(terms)
elif terms[0] == 'div':
self.divPort(terms)
elif terms[0] == 'set':
self.setPort(terms)
elif terms[0] == 'jmp':
self.jump(terms)
elif terms[0] == 'lst':
self.lstJump(terms)
elif terms[0] == 'lte':
self.lteJump(terms)
elif terms[0] == 'grt':
self.grtJump(terms)
elif terms[0] == 'gte':
self.gteJump(terms)
elif terms[0] == 'eqt':
self.eqtJump(terms)
elif terms[0] == 'nte':
self.nteJump(terms)
self.lineNum += 1
def add_port(self, terms):
if terms[1] == 'THROTTLE':
self.SPEED = self.SPEED + int(terms[2])
elif terms[1] == 'TURN':
self.ANGLE = self.ANGLE + int(terms[2])
def sub_port(self, terms):
if terms[1] == 'THROTTLE':
self.SPEED = self.SPEED - int(terms[2])
elif terms[1] == 'TURN':
self.ANGLE = self.ANGLE - int(terms[2])
def mpy_port(self, terms):
if terms[1] == 'THROTTLE':
self.SPEED = self.SPEED * int(terms[2])
elif terms[1] == 'TURN':
self.ANGLE = self.ANGLE * int(terms[2])
def div_port(self, terms):
if terms[1] == 'THROTTLE':
self.SPEED = self.SPEED / int(terms[2])
elif terms[1] == 'TURN':
self.ANGLE = self.ANGLE / int(terms[2])
def set_port(self, terms):
if terms[1] == 'THROTTLE':
self.SPEED = int(terms[2])
elif terms[1] == 'TURN':
self.ANGLE = int(terms[2])
def jump(self, terms):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[1]:
self.lineNum = num
return
def port_to_num(self, terms):
for (i, _) in enumerate(terms):
if terms[i] == 'THROTTLE':
terms[i] = self.SPEED
if terms[i] == 'TURN':
terms[i] = self.ANGLE
def lst_jump(self, terms):
self.portToNum(terms)
if int(terms[1]) < int(terms[2]):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
def lte_jump(self, terms):
self.portToNum(terms)
if int(terms[1]) <= int(terms[2]):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
def grt_jump(self, terms):
self.portToNum(terms)
if int(terms[1]) > int(terms[2]):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
def gte_jump(self, terms):
self.portToNum(terms)
if int(terms[1]) >= int(terms[2]):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
def eqt_jump(self, terms):
self.portToNum(terms)
if int(terms[1]) == int(terms[2]):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return
def nte_jump(self, terms):
self.portToNum(terms)
if int(terms[1]) != int(terms[2]):
for (num, i) in enumerate(self.code):
i = self.code[num].split()
if i[0] == terms[4]:
self.lineNum = num
return |
# If we want to find the shortest path or any path between 2 nodes
# BFS works better
# Breadth-First search needs a Queue
class Node:
def __init__(self, val):
self.val = val
self.left = None
self.right = None
def __str__(self):
return "Node: {} Left: {} Right:{}".format(self.val, self.left, self.right)
def visit(self):
print(self.val, end='')
# Time: O(n) Space: O(n)
# where n == number of nodes
def breadth_first_traversal(root):
queue = [root]
while len(queue) > 0:
curr = queue.pop(0)
curr.visit()
if curr.left is not None:
queue.append(curr.left)
if curr.right is not None:
queue.append(curr.right)
# Time: O(n) Space: O(n)
# where n == number of nodes
def breadth_first_search(root, target):
queue = [root]
while len(queue) > 0:
curr = queue.pop(0)
# curr.visit()
if curr.val == target:
return True
if curr.left is not None:
queue.append(curr.left)
if curr.right is not None:
queue.append(curr.right)
return False
#
# a
# / \
# b c
# / \ \
# d e f
a = Node('a')
b = Node('b')
c = Node('c')
d = Node('d')
e = Node('e')
f = Node('f')
a.left = b
a.right = c
b.left = d
b.right = e
c.right = f
breadth_first_traversal(a)
print("Does the tree contein 'e'? ", end='')
print(breadth_first_search(a, 'e'))
print("Does the tree contein 'z'? ", end='')
print(breadth_first_search(a, 'z')) | class Node:
def __init__(self, val):
self.val = val
self.left = None
self.right = None
def __str__(self):
return 'Node: {} Left: {} Right:{}'.format(self.val, self.left, self.right)
def visit(self):
print(self.val, end='')
def breadth_first_traversal(root):
queue = [root]
while len(queue) > 0:
curr = queue.pop(0)
curr.visit()
if curr.left is not None:
queue.append(curr.left)
if curr.right is not None:
queue.append(curr.right)
def breadth_first_search(root, target):
queue = [root]
while len(queue) > 0:
curr = queue.pop(0)
if curr.val == target:
return True
if curr.left is not None:
queue.append(curr.left)
if curr.right is not None:
queue.append(curr.right)
return False
a = node('a')
b = node('b')
c = node('c')
d = node('d')
e = node('e')
f = node('f')
a.left = b
a.right = c
b.left = d
b.right = e
c.right = f
breadth_first_traversal(a)
print("Does the tree contein 'e'? ", end='')
print(breadth_first_search(a, 'e'))
print("Does the tree contein 'z'? ", end='')
print(breadth_first_search(a, 'z')) |
testcases = int(input().strip())
for test in range(testcases):
string = input().strip()
length = len(string)
half_length = length // 2
if length % 2:
print(-1)
continue
letters1 = [0] * 26
letters2 = [0] * 26
ascii_a = ord('a')
ascii_string = [ord(c) - ascii_a for c in string]
for i in range(half_length):
letters1[ascii_string[i]] += 1
letters2[ascii_string[half_length + i]] += 1
counter = 0
for i in range(26):
if letters1[i] > letters2[i]:
counter += letters1[i] - letters2[i]
print(counter)
| testcases = int(input().strip())
for test in range(testcases):
string = input().strip()
length = len(string)
half_length = length // 2
if length % 2:
print(-1)
continue
letters1 = [0] * 26
letters2 = [0] * 26
ascii_a = ord('a')
ascii_string = [ord(c) - ascii_a for c in string]
for i in range(half_length):
letters1[ascii_string[i]] += 1
letters2[ascii_string[half_length + i]] += 1
counter = 0
for i in range(26):
if letters1[i] > letters2[i]:
counter += letters1[i] - letters2[i]
print(counter) |
w, h, k = list(map(int, input().split()))
c=0
for i in range(k):
c = c+ ( (h-4*i)*2 +( w - 2-4*i)*2)
print(c)
| (w, h, k) = list(map(int, input().split()))
c = 0
for i in range(k):
c = c + ((h - 4 * i) * 2 + (w - 2 - 4 * i) * 2)
print(c) |
t = int(input())
h = (t // 3600) % 24
m1 = t // 60 % 60 // 10
m2 = t // 60 % 60 % 10
s1 = t % 60 // 10
s2 = t % 10
print(h, ":", m1, m2, ":", s1, s2, sep="")
| t = int(input())
h = t // 3600 % 24
m1 = t // 60 % 60 // 10
m2 = t // 60 % 60 % 10
s1 = t % 60 // 10
s2 = t % 10
print(h, ':', m1, m2, ':', s1, s2, sep='') |
class Solution:
def sumRootToLeaf(self, root: TreeNode) -> int:
def sumRootToLeaf(r, s):
li, x = [n for n in [r.left, r.right] if n], (s << 1) + r.val
return x if not li else sum(sumRootToLeaf(n, x) for n in li)
return sumRootToLeaf(root, 0) | class Solution:
def sum_root_to_leaf(self, root: TreeNode) -> int:
def sum_root_to_leaf(r, s):
(li, x) = ([n for n in [r.left, r.right] if n], (s << 1) + r.val)
return x if not li else sum((sum_root_to_leaf(n, x) for n in li))
return sum_root_to_leaf(root, 0) |
class SymbolTable:
def __init__(self):
self.table = {'SP': 0, 'LCL': 1, 'ARG': 2, 'THIS': 3, 'THAT': 4, 'R0': 0,
'R1': 1, 'R2': 2, 'R3': 3, 'R4': 4, 'R5': 5, 'R6': 6, 'R7': 7,
'R8': 8, 'R9': 9, 'R10': 10, 'R11': 11, 'R12': 12, 'R13': 13, 'R14': 14,
'R15': 15, 'SCREEN': 16384, 'KBD': 24576}
def addEntry(self, symbol, address):
self.table[symbol] = address
def contains(self, symbol):
return symbol in self.table
def getAddress(self, symbol):
return self.table[symbol]
| class Symboltable:
def __init__(self):
self.table = {'SP': 0, 'LCL': 1, 'ARG': 2, 'THIS': 3, 'THAT': 4, 'R0': 0, 'R1': 1, 'R2': 2, 'R3': 3, 'R4': 4, 'R5': 5, 'R6': 6, 'R7': 7, 'R8': 8, 'R9': 9, 'R10': 10, 'R11': 11, 'R12': 12, 'R13': 13, 'R14': 14, 'R15': 15, 'SCREEN': 16384, 'KBD': 24576}
def add_entry(self, symbol, address):
self.table[symbol] = address
def contains(self, symbol):
return symbol in self.table
def get_address(self, symbol):
return self.table[symbol] |
A,B = map(int, input().split())
#A,B = 4, 10
if A > B :
print('>')
elif A < B :
print('<')
else:
print('==')
| (a, b) = map(int, input().split())
if A > B:
print('>')
elif A < B:
print('<')
else:
print('==') |
# @Time: 2022/4/13 11:29
# @Author: chang liu
# @Email: chang_liu_tamu@gmail.com
# @File:LFU.py
class Node:
def __init__(self, key=None, val=None):
self.val = val
self.key = key
self.f = 1
self.left = None
self.right = None
class DLL:
def __init__(self):
self.size = 0
self.head = Node()
self.tail = Node()
self.head.left = self.tail
self.tail.right = self.head
def remove_node(self, node):
node.left.right = node.right
node.right.left = node.left
self.size -= 1
def add_head(self, node):
self.head.left.right = node
node.left = self.head.left
self.head.left = node
node.right = self.head
self.size += 1
def remove_tail(self):
tail = self.tail.right
self.remove_node(tail)
return tail
class LFUCache:
'''
referring to discuss board,
thanks, stranger
'''
def __init__(self, capacity: int):
self.capacity = capacity
self.cache = {}
self.freq_map = {}
self.min_freq = None
def get(self, key: object) -> object:
# print(self.cache)
# print(self.freq_map)
if key not in self.cache:
return -1
val = self.cache[key].val
self.update(key, val)
return val
def put(self, key: int, value: object) -> None:
# print(self.freq_map)
if self.capacity == 0:
return
if key in self.cache:
self.update(key, value)
else:
if len(self.cache) == self.capacity:
removed = self.freq_map[self.min_freq].remove_tail()
del self.cache[removed.key]
self.min_freq = 1
new = Node(key, value)
if 1 not in self.freq_map:
self.freq_map[1] = DLL()
self.cache[key] = new
self.freq_map[1].add_head(new)
def update(self, key, val):
ptr = self.cache[key]
ptr.val = val
f = ptr.f
ptr.f += 1
if f + 1 not in self.freq_map:
self.freq_map[f + 1] = DLL()
self.freq_map[f].remove_node(ptr)
self.freq_map[f + 1].add_head(ptr)
if self.freq_map[f].size == 0 and self.min_freq == f:
self.min_freq += 1
# Your LFUCache object will be instantiated and called as such:
# obj = LFUCache(capacity)
# param_1 = obj.get(key)
# obj.put(key,value)
class MyObj:
def __init__(self, name):
self.name = name
def __str__(self):
return self.name
if __name__ == "__main__":
x, y, z = MyObj("x"), MyObj("y"), MyObj("z")
assert x is not y and y is not z
lfu = LFUCache(2)
print(lfu.get(1))
lfu.put(1, x)
lfu.put(2, y)
print(lfu.get(1))
print(lfu.get(2))
lfu.put(3, z)
print(lfu.get(1))
print(lfu.get(3))
| class Node:
def __init__(self, key=None, val=None):
self.val = val
self.key = key
self.f = 1
self.left = None
self.right = None
class Dll:
def __init__(self):
self.size = 0
self.head = node()
self.tail = node()
self.head.left = self.tail
self.tail.right = self.head
def remove_node(self, node):
node.left.right = node.right
node.right.left = node.left
self.size -= 1
def add_head(self, node):
self.head.left.right = node
node.left = self.head.left
self.head.left = node
node.right = self.head
self.size += 1
def remove_tail(self):
tail = self.tail.right
self.remove_node(tail)
return tail
class Lfucache:
"""
referring to discuss board,
thanks, stranger
"""
def __init__(self, capacity: int):
self.capacity = capacity
self.cache = {}
self.freq_map = {}
self.min_freq = None
def get(self, key: object) -> object:
if key not in self.cache:
return -1
val = self.cache[key].val
self.update(key, val)
return val
def put(self, key: int, value: object) -> None:
if self.capacity == 0:
return
if key in self.cache:
self.update(key, value)
else:
if len(self.cache) == self.capacity:
removed = self.freq_map[self.min_freq].remove_tail()
del self.cache[removed.key]
self.min_freq = 1
new = node(key, value)
if 1 not in self.freq_map:
self.freq_map[1] = dll()
self.cache[key] = new
self.freq_map[1].add_head(new)
def update(self, key, val):
ptr = self.cache[key]
ptr.val = val
f = ptr.f
ptr.f += 1
if f + 1 not in self.freq_map:
self.freq_map[f + 1] = dll()
self.freq_map[f].remove_node(ptr)
self.freq_map[f + 1].add_head(ptr)
if self.freq_map[f].size == 0 and self.min_freq == f:
self.min_freq += 1
class Myobj:
def __init__(self, name):
self.name = name
def __str__(self):
return self.name
if __name__ == '__main__':
(x, y, z) = (my_obj('x'), my_obj('y'), my_obj('z'))
assert x is not y and y is not z
lfu = lfu_cache(2)
print(lfu.get(1))
lfu.put(1, x)
lfu.put(2, y)
print(lfu.get(1))
print(lfu.get(2))
lfu.put(3, z)
print(lfu.get(1))
print(lfu.get(3)) |
# -*- coding: utf-8 -*-
# @Time: 2020/7/16 11:36
# @Author: GraceKoo
# @File: interview_7.py
# @Desc: https://www.nowcoder.com/practice/c6c7742f5ba7442aada113136ddea0c3?tpId=13&rp=1&ru=%2Fta%2Fcoding-interviews&qr
# u=%2Fta%2Fcoding-interviews%2Fquestion-ranking
class Solution:
def fib(self, N: int) -> int:
if N <= 1:
return N
f_dict = {0: 0, 1: 1}
for i in range(2, N):
f_dict[i] = f_dict[i - 1] + f_dict[i - 2]
return f_dict[N - 1]
so = Solution()
print(so.fib(4))
| class Solution:
def fib(self, N: int) -> int:
if N <= 1:
return N
f_dict = {0: 0, 1: 1}
for i in range(2, N):
f_dict[i] = f_dict[i - 1] + f_dict[i - 2]
return f_dict[N - 1]
so = solution()
print(so.fib(4)) |
#!/usr/bin/python3
def square_matrix_simple(matrix=[]):
if matrix:
new = []
for rows in matrix:
new.append([n ** 2 for n in rows])
return new
| def square_matrix_simple(matrix=[]):
if matrix:
new = []
for rows in matrix:
new.append([n ** 2 for n in rows])
return new |
# Adaptive Card Design Schema for a sample form.
# To learn more about designing and working with buttons and cards,
# checkout https://developer.webex.com/docs/api/guides/cards
BUSY_CARD_CONTENT = {
"$schema": "http://adaptivecards.io/schemas/adaptive-card.json",
"type": "AdaptiveCard",
"version": "1.2",
"body": [
{
"type": "ColumnSet",
"columns": [
{
"type": "Column",
"width": 1,
"items": [
{
"type": "Image",
"url": "https://i.postimg.cc/2jMv5kqt/AS89975.jpg",
"size": "Stretch"
}
]
},
{
"type": "Column",
"width": 1,
"items": [
{
"type": "TextBlock",
"text": "Working on it....",
"color": "Dark",
"weight": "Bolder",
"wrap": True,
"size": "default",
"horizontalAlignment": "Center"
},
{
"type": "TextBlock",
"text": "I am busy working on your request. Please continue to look busy while I do your work.",
"color": "Dark",
"height": "stretch",
"wrap": True
}
]
}
]
}
]
}
| busy_card_content = {'$schema': 'http://adaptivecards.io/schemas/adaptive-card.json', 'type': 'AdaptiveCard', 'version': '1.2', 'body': [{'type': 'ColumnSet', 'columns': [{'type': 'Column', 'width': 1, 'items': [{'type': 'Image', 'url': 'https://i.postimg.cc/2jMv5kqt/AS89975.jpg', 'size': 'Stretch'}]}, {'type': 'Column', 'width': 1, 'items': [{'type': 'TextBlock', 'text': 'Working on it....', 'color': 'Dark', 'weight': 'Bolder', 'wrap': True, 'size': 'default', 'horizontalAlignment': 'Center'}, {'type': 'TextBlock', 'text': 'I am busy working on your request. Please continue to look busy while I do your work.', 'color': 'Dark', 'height': 'stretch', 'wrap': True}]}]}]} |
# Map by afffsdd
# A map with four corners, with bots spawning in each of them.
# flake8: noqa
# TODO: Format this file.
{'spawn': [(1, 1), (14, 1), (15, 1), (16, 1), (17, 1), (1, 2), (1, 3), (1, 4), (17, 14), (17, 15), (17, 16), (1, 17), (2, 17), (3, 17), (4, 17), (17, 17)], 'obstacle': [(0, 0), (1, 0), (2, 0), (3, 0), (4, 0), (5, 0), (6, 0), (7, 0), (8, 0), (9, 0), (10, 0), (11, 0), (12, 0), (13, 0), (14, 0), (15, 0), (16, 0), (17, 0), (18, 0), (0, 1), (13, 1), (18, 1), (0, 2), (13, 2), (18, 2), (0, 3), (13, 3), (18, 3), (0, 4), (13, 4), (18, 4), (0, 5), (1, 5), (2, 5), (3, 5), (4, 5), (18, 5), (0, 6), (18, 6), (0, 7), (18, 7), (0, 8), (18, 8), (0, 9), (18, 9), (0, 10), (18, 10), (0, 11), (18, 11), (0, 12), (18, 12), (0, 13), (14, 13), (15, 13), (16, 13), (17, 13), (18, 13), (0, 14), (5, 14), (18, 14), (0, 15), (5, 15), (18, 15), (0, 16), (5, 16), (18, 16), (0, 17), (5, 17), (18, 17), (0, 18), (1, 18), (2, 18), (3, 18), (4, 18), (5, 18), (6, 18), (7, 18), (8, 18), (9, 18), (10, 18), (11, 18), (12, 18), (13, 18), (14, 18), (15, 18), (16, 18), (17, 18), (18, 18)]}
| {'spawn': [(1, 1), (14, 1), (15, 1), (16, 1), (17, 1), (1, 2), (1, 3), (1, 4), (17, 14), (17, 15), (17, 16), (1, 17), (2, 17), (3, 17), (4, 17), (17, 17)], 'obstacle': [(0, 0), (1, 0), (2, 0), (3, 0), (4, 0), (5, 0), (6, 0), (7, 0), (8, 0), (9, 0), (10, 0), (11, 0), (12, 0), (13, 0), (14, 0), (15, 0), (16, 0), (17, 0), (18, 0), (0, 1), (13, 1), (18, 1), (0, 2), (13, 2), (18, 2), (0, 3), (13, 3), (18, 3), (0, 4), (13, 4), (18, 4), (0, 5), (1, 5), (2, 5), (3, 5), (4, 5), (18, 5), (0, 6), (18, 6), (0, 7), (18, 7), (0, 8), (18, 8), (0, 9), (18, 9), (0, 10), (18, 10), (0, 11), (18, 11), (0, 12), (18, 12), (0, 13), (14, 13), (15, 13), (16, 13), (17, 13), (18, 13), (0, 14), (5, 14), (18, 14), (0, 15), (5, 15), (18, 15), (0, 16), (5, 16), (18, 16), (0, 17), (5, 17), (18, 17), (0, 18), (1, 18), (2, 18), (3, 18), (4, 18), (5, 18), (6, 18), (7, 18), (8, 18), (9, 18), (10, 18), (11, 18), (12, 18), (13, 18), (14, 18), (15, 18), (16, 18), (17, 18), (18, 18)]} |
# MACRO - calculate precision and recall for every class,
# then take their weigted sum and calculate ONE f1 score
# MICRO - calculate f1 scores for each class and take their weighted sum
def f1_score(precision, recall):
f = 0 if precision + recall == 0 \
else 2 * precision * recall / (precision + recall)
return f
def main(k, confusion_matrix):
num_samples = [sum(confusion_matrix[idx]) for idx in range(k)]
weights = [s / sum(num_samples) for s in num_samples]
precisions = []
recalls = []
for cls_idx in range(k):
tp = confusion_matrix[cls_idx][cls_idx]
fp = sum([confusion_matrix[idx][cls_idx] for idx in range(k)]) - tp
fn = sum([confusion_matrix[cls_idx][idx] for idx in range(k)]) - tp
precision = 0 if tp + fp == 0 else tp / (tp + fp)
recall = 0 if tp + fn == 0 else tp / (tp + fn)
precisions.append(precision)
recalls.append(recall)
weighted_precision = sum([
weights[idx] * precisions[idx] for idx in range(k)
])
weighted_recall = sum([
weights[idx] * recalls[idx] for idx in range(k)
])
macro_f1 = f1_score(weighted_precision, weighted_recall)
f1_scores = [f1_score(precisions[idx], recalls[idx]) for idx in range(k)]
micro_f1 = sum([
weights[idx] * f1_scores[idx] for idx in range(k)
])
print(macro_f1)
print(micro_f1)
if __name__ == '__main__':
k = int(input())
confusion_matrix = []
for _ in range(k):
values = list(map(int, input().split()))
confusion_matrix.append(values)
main(k, confusion_matrix)
| def f1_score(precision, recall):
f = 0 if precision + recall == 0 else 2 * precision * recall / (precision + recall)
return f
def main(k, confusion_matrix):
num_samples = [sum(confusion_matrix[idx]) for idx in range(k)]
weights = [s / sum(num_samples) for s in num_samples]
precisions = []
recalls = []
for cls_idx in range(k):
tp = confusion_matrix[cls_idx][cls_idx]
fp = sum([confusion_matrix[idx][cls_idx] for idx in range(k)]) - tp
fn = sum([confusion_matrix[cls_idx][idx] for idx in range(k)]) - tp
precision = 0 if tp + fp == 0 else tp / (tp + fp)
recall = 0 if tp + fn == 0 else tp / (tp + fn)
precisions.append(precision)
recalls.append(recall)
weighted_precision = sum([weights[idx] * precisions[idx] for idx in range(k)])
weighted_recall = sum([weights[idx] * recalls[idx] for idx in range(k)])
macro_f1 = f1_score(weighted_precision, weighted_recall)
f1_scores = [f1_score(precisions[idx], recalls[idx]) for idx in range(k)]
micro_f1 = sum([weights[idx] * f1_scores[idx] for idx in range(k)])
print(macro_f1)
print(micro_f1)
if __name__ == '__main__':
k = int(input())
confusion_matrix = []
for _ in range(k):
values = list(map(int, input().split()))
confusion_matrix.append(values)
main(k, confusion_matrix) |
name = "harry"
print(name[0])
# List
names = ["Harry", "Ron", "Hermione"]
print(names[0])
# Tuples
coordinateX = 10.0
coordinateY = 20.0
coordinate = (10.0,20.0)
print(coordinate) | name = 'harry'
print(name[0])
names = ['Harry', 'Ron', 'Hermione']
print(names[0])
coordinate_x = 10.0
coordinate_y = 20.0
coordinate = (10.0, 20.0)
print(coordinate) |
#!/usr/bin/env python
print (' ')
nome = input('Digite seu nome: ')
#Mensagem
print (' ')
print (f'Seja bem-vindo Sr(a) {nome}, Obrigado por vir!')
print (' ')
| print(' ')
nome = input('Digite seu nome: ')
print(' ')
print(f'Seja bem-vindo Sr(a) {nome}, Obrigado por vir!')
print(' ') |
#latin square
num=int(input("Enter the number of rows:="))
for i in range(1,num+1):
r=i #set the first roew element
for j in range(1,num+1):
print(r,end='\t')
if r==num:
r=1
else:
r=r+1
print()
| num = int(input('Enter the number of rows:='))
for i in range(1, num + 1):
r = i
for j in range(1, num + 1):
print(r, end='\t')
if r == num:
r = 1
else:
r = r + 1
print() |
if (isWindVpDefined == 1):
evapoTranspiration = evapoTranspirationPenman
else:
evapoTranspiration = evapoTranspirationPriestlyTaylor
| if isWindVpDefined == 1:
evapo_transpiration = evapoTranspirationPenman
else:
evapo_transpiration = evapoTranspirationPriestlyTaylor |
def add_time(start: str, duration: str, day: str = None) -> str:
days = ('Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday', 'Sunday')
start_lst = list(map(int, start[:-3].split(':')))
duration_lst = list(map(int, duration.split(':')))
total_min = start_lst[1] + duration_lst[1]
extra_hours = total_min // 60
total_hours = start_lst[0] + duration_lst[0] + extra_hours
if 'PM' in start:
total_hours += 12
ans_minutes = total_min % 60
ans_hours = total_hours % 12
num_of_days = total_hours // 24
ans_minutes = str(ans_minutes).rjust(2, '0')
ans_hours = '12' if ans_hours == 0 else str(ans_hours)
period = 'AM' if (total_hours % 24) < 12 else 'PM'
new_time = f'{ans_hours}:{ans_minutes} {period}'
if day is not None:
day = day.lower().capitalize()
days = days[days.index(day):] + days[:days.index(day)] # from what day to start
new_time += f', {days[num_of_days % 7]}'
if num_of_days == 1:
new_time += ' (next day)'
elif num_of_days > 1:
new_time += f' ({num_of_days} days later)'
return new_time
| def add_time(start: str, duration: str, day: str=None) -> str:
days = ('Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday', 'Sunday')
start_lst = list(map(int, start[:-3].split(':')))
duration_lst = list(map(int, duration.split(':')))
total_min = start_lst[1] + duration_lst[1]
extra_hours = total_min // 60
total_hours = start_lst[0] + duration_lst[0] + extra_hours
if 'PM' in start:
total_hours += 12
ans_minutes = total_min % 60
ans_hours = total_hours % 12
num_of_days = total_hours // 24
ans_minutes = str(ans_minutes).rjust(2, '0')
ans_hours = '12' if ans_hours == 0 else str(ans_hours)
period = 'AM' if total_hours % 24 < 12 else 'PM'
new_time = f'{ans_hours}:{ans_minutes} {period}'
if day is not None:
day = day.lower().capitalize()
days = days[days.index(day):] + days[:days.index(day)]
new_time += f', {days[num_of_days % 7]}'
if num_of_days == 1:
new_time += ' (next day)'
elif num_of_days > 1:
new_time += f' ({num_of_days} days later)'
return new_time |
#! /usr/bin/env python3
# Type of variable: Number
a, b = 5, 10
print(a, b)
a, b = b, a
print(a, b)
# Type of variable: List
myList = [1, 2, 3, 4, 5]
print("Initial Array :", myList)
myList[0], myList[1] = myList[1], myList[0]
print("Swapped Array :", myList)
| (a, b) = (5, 10)
print(a, b)
(a, b) = (b, a)
print(a, b)
my_list = [1, 2, 3, 4, 5]
print('Initial Array :', myList)
(myList[0], myList[1]) = (myList[1], myList[0])
print('Swapped Array :', myList) |
def up_egcd(m,n):
#Assume m>n
if n>m:
m,n=n,m
if m%n==0:
return n
else:
return up_egcd(n,m%n)
print(up_egcd(int(input('Number 1\n')),int(input('Number 2\n'))))
| def up_egcd(m, n):
if n > m:
(m, n) = (n, m)
if m % n == 0:
return n
else:
return up_egcd(n, m % n)
print(up_egcd(int(input('Number 1\n')), int(input('Number 2\n')))) |
inp = open('input.txt').read().split(", ") # Reading file
coord = (0, 0) # Setting original coordinates
p_dir = 0 # Setting original direction (north)
seen = set()
for instr in inp:
dir = instr[0]
step = int(instr[1:])
if dir == "R":
p_dir = p_dir + 1
if p_dir == 4:
p_dir = 0
elif dir == "L":
if p_dir == 0:
p_dir = 4
p_dir = p_dir - 1
for step in range(step):
if p_dir == 0:
coord = (coord[0], coord[1] + 1)
elif p_dir == 1:
coord = (coord[0] + 1, coord[1])
elif p_dir == 2:
coord = (coord[0], coord[1] - 1)
elif p_dir == 3:
coord = (coord[0] - 1, coord[1])
if coord in seen:
dist = abs(coord[0]) + abs(coord[1])
print(dist)
exit()
seen.add(coord)
| inp = open('input.txt').read().split(', ')
coord = (0, 0)
p_dir = 0
seen = set()
for instr in inp:
dir = instr[0]
step = int(instr[1:])
if dir == 'R':
p_dir = p_dir + 1
if p_dir == 4:
p_dir = 0
elif dir == 'L':
if p_dir == 0:
p_dir = 4
p_dir = p_dir - 1
for step in range(step):
if p_dir == 0:
coord = (coord[0], coord[1] + 1)
elif p_dir == 1:
coord = (coord[0] + 1, coord[1])
elif p_dir == 2:
coord = (coord[0], coord[1] - 1)
elif p_dir == 3:
coord = (coord[0] - 1, coord[1])
if coord in seen:
dist = abs(coord[0]) + abs(coord[1])
print(dist)
exit()
seen.add(coord) |
class Human(object):
def __init__(self, world=None, age=20):
self.maxAge = 50
self.age = age
self.alive = True
self.world = world
def update(self):
self.age += 1
if self.age > self.maxAge:
self.alive = False
def get_age(self):
return self.age
def is_alive(self):
return self.alive | class Human(object):
def __init__(self, world=None, age=20):
self.maxAge = 50
self.age = age
self.alive = True
self.world = world
def update(self):
self.age += 1
if self.age > self.maxAge:
self.alive = False
def get_age(self):
return self.age
def is_alive(self):
return self.alive |
answerDict = {
"New York" : "albany",
"California" : "sacramento",
"Alabama" : "montgomery",
"Ohio": "columbus",
"Utah": "salt lake city"
}
def checkAnswer(answer):
resultsDict = {}
for k,v in answer.items():
if answerDict[k] == v:
resultsDict[k] = True
else:
resultsDict[k] = False
return resultsDict
#print(checkAnswer({"New York": "albany","Utah": "salt lake city"})) | answer_dict = {'New York': 'albany', 'California': 'sacramento', 'Alabama': 'montgomery', 'Ohio': 'columbus', 'Utah': 'salt lake city'}
def check_answer(answer):
results_dict = {}
for (k, v) in answer.items():
if answerDict[k] == v:
resultsDict[k] = True
else:
resultsDict[k] = False
return resultsDict |
# this will create a 60 GB dummy asset file for testing the upload via
# the admin GUI.
LARGE_FILE_SIZE = 60 * 1024**3 # this is 60 GB
with open("xxxxxxl_asset_file.zip", "wb") as dummy_file:
dummy_file.seek(int(LARGE_FILE_SIZE) - 1)
dummy_file.write(b"\0")
| large_file_size = 60 * 1024 ** 3
with open('xxxxxxl_asset_file.zip', 'wb') as dummy_file:
dummy_file.seek(int(LARGE_FILE_SIZE) - 1)
dummy_file.write(b'\x00') |
class Solution:
def calculate(self, s: str) -> int:
stack = []
zero = ord('0')
operand = 0
res = 0
sign = 1
for ch in s:
if ch.isdigit():
operand = operand * 10 + ord(ch) - zero
elif ch == '+':
res += sign * operand
sign = 1
operand = 0
elif ch == '-':
res += sign * operand
sign = -1
operand = 0
elif ch == '(':
stack.append((sign, res))
sign = 1
res = 0
elif ch == ')':
prev_sign, prev_res = stack.pop()
res = prev_sign * (res + sign * operand) + prev_res
operand = 0
return res + sign * operand
| class Solution:
def calculate(self, s: str) -> int:
stack = []
zero = ord('0')
operand = 0
res = 0
sign = 1
for ch in s:
if ch.isdigit():
operand = operand * 10 + ord(ch) - zero
elif ch == '+':
res += sign * operand
sign = 1
operand = 0
elif ch == '-':
res += sign * operand
sign = -1
operand = 0
elif ch == '(':
stack.append((sign, res))
sign = 1
res = 0
elif ch == ')':
(prev_sign, prev_res) = stack.pop()
res = prev_sign * (res + sign * operand) + prev_res
operand = 0
return res + sign * operand |
#!/usr/bin/env python
# -*- coding: utf-8 -*-
# Requires python 3.6+
#######################################################################################################################
# Global variables
# Can be reassigned by the settings from the configuration file
#######################################################################################################################
CONFIG_PATH = 'gitmon.conf' # main configuration file
DATA_PATH = 'data.json' # where to save data
UPDATE_INTERVAL = 0 # data check interval in minutes. '0' == one time only
GITHUB_BASE_URL = 'https://api.github.com/repos' # github base url
APP_LOGS_TYPE = 'console' # app logs type: none, file, console
APP_LOGS_FILE = 'gitmon.log' # app logs file
LOGGER = None # logger object. See setup.setup_log()
OPTIONS = {} # options, loaded from configuration file
| config_path = 'gitmon.conf'
data_path = 'data.json'
update_interval = 0
github_base_url = 'https://api.github.com/repos'
app_logs_type = 'console'
app_logs_file = 'gitmon.log'
logger = None
options = {} |
def swap(i, j, arr):
temp = arr[i]
arr[i] = arr[j]
arr[j] = temp
def quicksort(arr, low, high):
if(low < high):
p = partition(arr, low, high);
quicksort(arr, low, p-1);
quicksort(arr, p+1, high);
def partition(arr, low, high):
pivot = arr[low]
i = low
j = high
while(i < j):
while(arr[i] <= pivot and i < high):
i += 1
while(arr[j] > pivot):
j -= 1
if i < j:
swap(i, j, arr)
swap(low, j, arr)
return j
arr = [65, 70, 75, 80, 85, 60, 55, 50, 45]
quicksort(arr, 0, len(arr)-1)
print(arr)
| def swap(i, j, arr):
temp = arr[i]
arr[i] = arr[j]
arr[j] = temp
def quicksort(arr, low, high):
if low < high:
p = partition(arr, low, high)
quicksort(arr, low, p - 1)
quicksort(arr, p + 1, high)
def partition(arr, low, high):
pivot = arr[low]
i = low
j = high
while i < j:
while arr[i] <= pivot and i < high:
i += 1
while arr[j] > pivot:
j -= 1
if i < j:
swap(i, j, arr)
swap(low, j, arr)
return j
arr = [65, 70, 75, 80, 85, 60, 55, 50, 45]
quicksort(arr, 0, len(arr) - 1)
print(arr) |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.