content
stringlengths
7
1.05M
fixed_cases
stringlengths
1
1.28M
"""Shared Memory for ShadMem program""" class ShadBaseSharedMemory(Exception): """Base exception class for Shared Memory.""" pass class ShadSharedMemory(ShadBaseSharedMemory): """Shared memory class""" errno = None def __init__(self,shrdmm=None,verbse=False): self.sharedmemory = shrdmm ...
"""Shared Memory for ShadMem program""" class Shadbasesharedmemory(Exception): """Base exception class for Shared Memory.""" pass class Shadsharedmemory(ShadBaseSharedMemory): """Shared memory class""" errno = None def __init__(self, shrdmm=None, verbse=False): self.sharedmemory = shrdmm ...
#!/usr/bin/env python # coding: utf-8 # In[9]: ############################################################################################################################## ### Hassan Shahzad ### CS-D ### Artificial Intelligence Lab (Lab # 9) ### FAST-NUCES ### chhxnshah@gmai...
variables = ['A', 'B', 'C', 'D', 'E', 'F', 'G'] constraints = [('A', 'B'), ('A', 'C'), ('B', 'C'), ('B', 'D'), ('B', 'E'), ('C', 'E'), ('C', 'F'), ('D', 'E'), ('E', 'F'), ('E', 'G'), ('F', 'G')] domain_values = ['Monday', 'Tuesday', 'Wednesday'] def backtrack(assignment): if len(assignment) == len(VARIABLES): ...
clearText = pow(0x025051c6c4e82266e0b9e8a47266531a01d484b0dc7ee629fb5a0588f15bf50281f46cf08be71e067ac7166580f144a6bdcc83a90206681c2409404e92474b37de67d92fd2fa4bc4bd119372b6d50c0377758fc8e946d203a040e04d6bfe41dfb898cd4e36e582f16ad475915ac2c6586d874dd397e7ed1cb2d3f2003586c257, 89508186630638564513494386415865407147609702...
clear_text = pow(162476896597824412221838491544025994977362305261910926538496052420409924140550933429821701207357424524014097582331265916084704503513250153693909608961907792999825125123678359025556295112989730272506765528550349367618606269335047048224712459876653375502744041871339850956618923981561391666298788102929427...
# File: awswaf_consts.py # # Copyright (c) 2019-2021 Splunk Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by appl...
awswaf_access_key = 'access_key_id' awswaf_secret_key = 'access_key_secret' awswaf_region = 'region' awswaf_default_limit = 100 awswaf_insufficient_param = 'Insufficient parameters. Please provide either ip_set_name or ip_set_id' awswaf_err_token = 'Error in connection while getting the token' awswaf_err_create_ipset =...
# Copyright 2019 Axis Communications AB. # # For a full list of individual contributors, please see the commit history. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apac...
follow_my_commit = '{\n sourceChangeCreated(search: "{\'data.gitIdentifier.commitId\': \'c9ea15d2d0d3bcfa2856416be4add5a5919764f4\'}") {\n edges {\n node {\n reverse {\n edges {\n node {\n ... on SourceChangeSubmitted {\n reverse {\n edges...
#Printing Stars in 'F' Shape ! ''' * * * * * * * * * * * * * * ''' for row in range(7): for col in range(5): if (col==0)or((row==0) and (col>0) or (row==3)and(col>0 and col<4)): print('*',end=' ') else: print(end=' ') print()
""" * * * * * * * * * * * * * * """ for row in range(7): for col in range(5): if col == 0 or (row == 0 and col > 0 or (row == 3 and (col > 0 and col < 4))): print('*', end=' ') else: print(end=' ') print()
print("hello") print('hello') welcome_message = "Hello, welcome to Udacity!" print(welcome_message) # pet_halibut = "Why should I be tarred with the epithet "loony" merely because I have a pet halibut?"" # SyntaxError: invalid syntax pet_halibut = 'Why should I be tarred with the epithet "loony" merely because I hav...
print('hello') print('hello') welcome_message = 'Hello, welcome to Udacity!' print(welcome_message) pet_halibut = 'Why should I be tarred with the epithet "loony" merely because I have a pet halibut?' salesman = '"I think you\'re an encyclopedia salesman"' this_string = "Simon's skateboard is in the garage." print(this...
# Hyperparameters to evaluate: For each, hyperparameter, provide a LIST of options to evaluate. A paramter grid will be generated so all combinations of these hyperparameters will be evaluated. hyperparams = {"epochs": [200], \ "nonlinearity": ["relu"], \ "hidden_sizes_shared": [[500,10...
hyperparams = {'epochs': [200], 'nonlinearity': ['relu'], 'hidden_sizes_shared': [[500, 100]], 'hidden_sizes_separate': [[50, 10]], 'dropout': [0.1], 'k_reg': [1e-05, 0.001], 'learning_rate': [0.0001, 0.001], 'loss_weights': [[1, 1]], 'grad_clip_norm': [0.01, 0.1], 'batch_size': [20]} specific_folder = 'origGE' phenoty...
# http://ipset.netfilter.org/iptables-extensions.man.html#lbBK class Mark(object): def __init__(self, raw): self.value = 0 self.mask = 0xFFFFFFFF self.invert = False fields = raw.split() for i in range(len(fields)): if fields[i] == "--mark": if f...
class Mark(object): def __init__(self, raw): self.value = 0 self.mask = 4294967295 self.invert = False fields = raw.split() for i in range(len(fields)): if fields[i] == '--mark': if fields[i - 1] == '!': self.invert = True ...
{ "targets": [ { "includes": [ "auto.gypi" ], "sources": [ "src/run.cpp" ], "link_settings":{ "ldflags": [ "-L<(module_root_dir)/src/target/release -lbinarytrees", "-Wl,-rpath=<(module_root_dir)/src/target/release" ] } } ...
{'targets': [{'includes': ['auto.gypi'], 'sources': ['src/run.cpp'], 'link_settings': {'ldflags': ['-L<(module_root_dir)/src/target/release -lbinarytrees', '-Wl,-rpath=<(module_root_dir)/src/target/release']}}], 'includes': ['auto-top.gypi']}
for i in range(1,101): print(i,end="") divisores=[] if i % 2 == 0: divisores.append(2) if i % 3 == 0: divisores.append(3) if i % 5 == 0: divisores.append(5) if len(divisores) == 0 : divisores = "" else : divisores=" "+str(tuple(divisores)).replace(",)"...
for i in range(1, 101): print(i, end='') divisores = [] if i % 2 == 0: divisores.append(2) if i % 3 == 0: divisores.append(3) if i % 5 == 0: divisores.append(5) if len(divisores) == 0: divisores = '' else: divisores = ' ' + str(tuple(divisores)).replac...
# # @lc app=leetcode id=1239 lang=python3 # # [1239] Maximum Length of a Concatenated String with Unique Characters # # @lc code=start class Solution: def maxLength(self, arr: List[str]) -> int: filtered = [set(str) for str in arr if len(str) == len(set(str))] found = [set()] for s1 in fil...
class Solution: def max_length(self, arr: List[str]) -> int: filtered = [set(str) for str in arr if len(str) == len(set(str))] found = [set()] for s1 in filtered: for s2 in found: if not s1 & s2: found.append(s1 | s2) return max([len(i...
class Rat: def __init__(self, game): self.game = game self.attack = 1 game.rat_enters.append(self.rat_enters) game.notify_rat.append(self.notify_rat) game.rat_dies.append(self.rat_dies) self.game.rat_enters(self) def __enter__(self): return self de...
class Rat: def __init__(self, game): self.game = game self.attack = 1 game.rat_enters.append(self.rat_enters) game.notify_rat.append(self.notify_rat) game.rat_dies.append(self.rat_dies) self.game.rat_enters(self) def __enter__(self): return self def...
class MyQueue: def __init__(self): """ Initialize your data structure here. """ self.queue=[] def push(self, x: int) -> None: """ Push element x to the back of queue. """ self.queue.append(x) def pop(self) -> int: """ Removes...
class Myqueue: def __init__(self): """ Initialize your data structure here. """ self.queue = [] def push(self, x: int) -> None: """ Push element x to the back of queue. """ self.queue.append(x) def pop(self) -> int: """ Remov...
INDEX_INFO = { "robust04": { "description": "TREC Disks 4 & 5 (minus Congressional Records), used in the TREC 2004 Robust Track", "urls": [ "https://www.dropbox.com/s/s91388puqbxh176/index-robust04-20191213.tar.gz?dl=1", "https://git.uwaterloo.ca/jimmylin/anserini-indexes/raw...
index_info = {'robust04': {'description': 'TREC Disks 4 & 5 (minus Congressional Records), used in the TREC 2004 Robust Track', 'urls': ['https://www.dropbox.com/s/s91388puqbxh176/index-robust04-20191213.tar.gz?dl=1', 'https://git.uwaterloo.ca/jimmylin/anserini-indexes/raw/master/index-robust04-20191213.tar.gz'], 'md5'...
def compress(image, b): ''' Function to compress images Parameters: image, a 3d array representation of the image like the one returned by plt.imread(image) b, the number of bits used in each entry in the array integer from 1 to 8 1 = maximum compression ...
def compress(image, b): """ Function to compress images Parameters: image, a 3d array representation of the image like the one returned by plt.imread(image) b, the number of bits used in each entry in the array integer from 1 to 8 1 = maximum compression ...
#OOPR-Assgn-5 #Start writing your code here def check_type(type): vehicle_type=['Two Wheeler', 'Four Wheeler'] if type not in vehicle_type: return 0 return 1 class Vehicle: def __init__(self): self.__vehicle_cost=None self.__vehicle_id=None self.__vehicle_type=None ...
def check_type(type): vehicle_type = ['Two Wheeler', 'Four Wheeler'] if type not in vehicle_type: return 0 return 1 class Vehicle: def __init__(self): self.__vehicle_cost = None self.__vehicle_id = None self.__vehicle_type = None self.__premium_amount = None ...
friction = 0.02 # higher value = points slow down faster after force is applied gravity = 0.05 # constant downard force on all points bounce = 0.5 # multiple of inverse force applied to point when out of bounds rigidity = 5 # accuracy; elasticity class Rag: def __init__(self, rag): self.points = [p ...
friction = 0.02 gravity = 0.05 bounce = 0.5 rigidity = 5 class Rag: def __init__(self, rag): self.points = [p + p for p in rag['points']] self.statics = [s for s in rag['statics']] self.sticks = [s for s in rag['sticks']] for s in self.sticks: p0 = self.points[s[0]] ...
# Programa 12 c = 7 + 5*1.2 b = c - 4 if (b > 9): if (c == 10): a = b + 3 elif (b == 6): a = c*3 print(a - c) elif (c >= 13): a = b + 1 else: a = c / 7 print(a**b) if (a < b): a = c - b c = c - a
c = 7 + 5 * 1.2 b = c - 4 if b > 9: if c == 10: a = b + 3 elif b == 6: a = c * 3 print(a - c) elif c >= 13: a = b + 1 else: a = c / 7 print(a ** b) if a < b: a = c - b c = c - a
PACKAGE_NAME = 'chatbridge' VERSION_PYPI = '2.0.0-a1' SERVER_NAME = '#SERVER'
package_name = 'chatbridge' version_pypi = '2.0.0-a1' server_name = '#SERVER'
# # Copyright 2016 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or...
{'includes': ['../common.gypi'], 'variables': {'icu_src_dir': '<(root_dir)/third_party/icu/icu4c'}, 'targets': [{'target_name': 'ionicu', 'type': 'static_library', 'all_dependent_settings': {'include_dirs': ['<(icu_src_dir)/source/common'], 'defines': ['U_DISABLE_RENAMING']}, 'include_dirs': ['<(root_dir)/', '<(icu_src...
# -- Configuration Version -- config_version = 1 # -- Solver configuration -- f_to_calculate = [16., 31.5, 63., 125., 250., 500., 1000., 2000., 4000., 8000.] f_to_plot = [250., 1000., 4000.] order = 1 absorbing_layer = True # -- Results Files configuration -- should_delete_old_results = False results_directory = '...
config_version = 1 f_to_calculate = [16.0, 31.5, 63.0, 125.0, 250.0, 500.0, 1000.0, 2000.0, 4000.0, 8000.0] f_to_plot = [250.0, 1000.0, 4000.0] order = 1 absorbing_layer = True should_delete_old_results = False results_directory = '../results/config{}'.format(config_version) results_dir_with_absorbing_layer = '{}/with_...
PLUGIN_AUTHOR_NAME = 'Your name' PLUGIN_AUTHOR_EMAIL = 'your@email' PLUGIN_AUTHOR_WEBSITE = 'https://yourwebsite' HOOK_BEFORE_CREATE_PLUGIN = '' HOOK_AFTER_CREATE_PLUGIN = '' STORAGE_DIR = 'storage' PERMISSIONS_TREE = { 'root': ['admin'], 'admin': ['execution'], 'execution': [] } PROTOCOLS = [ ] PLUGINS...
plugin_author_name = 'Your name' plugin_author_email = 'your@email' plugin_author_website = 'https://yourwebsite' hook_before_create_plugin = '' hook_after_create_plugin = '' storage_dir = 'storage' permissions_tree = {'root': ['admin'], 'admin': ['execution'], 'execution': []} protocols = [] plugins = ['bot', 'hello']...
class Solution: def isValid(self, s: str) -> bool: dic = {'(': ')', '{': '}', '[': ']', '!': '!'} stack = ['!'] for c in s: if c in dic: stack.append(c) elif dic[stack.pop()] != c: return False return len(stack) == 1
class Solution: def is_valid(self, s: str) -> bool: dic = {'(': ')', '{': '}', '[': ']', '!': '!'} stack = ['!'] for c in s: if c in dic: stack.append(c) elif dic[stack.pop()] != c: return False return len(stack) == 1
# # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # ...
spool_template = '\nheat_template_version: 2015-04-30\ndescription: Template to test subnetpool Neutron resource\nresources:\n sub_pool:\n type: OS::Neutron::SubnetPool\n properties:\n name: the_sp\n prefixes:\n - 10.1.0.0/16\n address_scope: test\n default_quota: 2\n default_pref...
print('Pick an operation') operation=input() print('enter your first number') number_1 = int(input()) print('enter your second number') number_2 = int(input()) if operation == '+': print(number_1 + number_2) else: print(number_1 - number_2)
print('Pick an operation') operation = input() print('enter your first number') number_1 = int(input()) print('enter your second number') number_2 = int(input()) if operation == '+': print(number_1 + number_2) else: print(number_1 - number_2)
class Solution: def findSubstringInWraproundString(self, p: str) -> int: dp = [0] * 26 curr = 1 expected_code = None for i, c in enumerate(p): char_code = ord(c) - ord('a') if char_code == expected_code: curr += 1 else: ...
class Solution: def find_substring_in_wrapround_string(self, p: str) -> int: dp = [0] * 26 curr = 1 expected_code = None for (i, c) in enumerate(p): char_code = ord(c) - ord('a') if char_code == expected_code: curr += 1 else: ...
# link: https://leetcode.com/problems/friend-circles/ class Solution(object): def findCircleNum(self, M): """ :type M: List[List[int]] :rtype: int """ # first create a adjacancy list nodes= len(M) visited = [0]*nodes result=0 for node in range...
class Solution(object): def find_circle_num(self, M): """ :type M: List[List[int]] :rtype: int """ nodes = len(M) visited = [0] * nodes result = 0 for node in range(nodes): if visited[node] == 0: self.dfs(M, node, visited) ...
# File: symantecatp_view.py # # Copyright (c) 2017-2019 Splunk Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by a...
def get_ctx_result(result): ctx_result = {} param = result.get_param() summary = result.get_summary() data = result.get_data() ctx_result['param'] = param if summary: ctx_result['summary'] = summary if not data: ctx_result['data'] = {} return ctx_result ctx_result...
# import re def replaceVogais(txt): for i in 'aeiouAEIOU': txt = txt.replace(i, '') return txt lista = [] for i in range(3): palavra = input('Digite uma palavra:') lista.append(palavra) for index, palavra in enumerate(lista): match index: case 0: lista[0] = lista[0...
def replace_vogais(txt): for i in 'aeiouAEIOU': txt = txt.replace(i, '') return txt lista = [] for i in range(3): palavra = input('Digite uma palavra:') lista.append(palavra) for (index, palavra) in enumerate(lista): match index: case 0: lista[0] = lista[0].upper() ...
_DEFAULT_SAMPLE_RATE = 22050 SOUNDFONTS = { "salamander": "../soundfonts/salamander/SalamanderGrandPiano.sf2", "fluidR3": "../soundfonts/fluid/FluidR3_GM.sf2", "musescore": "../soundfonts/musescore/musescore_general.sf3", "rhodes": "../soundfonts/rhodes/RhodesEPsPlus_2.3.sf2" }
_default_sample_rate = 22050 soundfonts = {'salamander': '../soundfonts/salamander/SalamanderGrandPiano.sf2', 'fluidR3': '../soundfonts/fluid/FluidR3_GM.sf2', 'musescore': '../soundfonts/musescore/musescore_general.sf3', 'rhodes': '../soundfonts/rhodes/RhodesEPsPlus_2.3.sf2'}
""" Write an algorithm to determine if a number is "happy". A happy number is a number defined by the following process: Starting with any positive integer, replace the number by the sum of the squares of its digits, and repeat the process until the number equals 1 (where it will stay), or it loops endlessly in a cycl...
""" Write an algorithm to determine if a number is "happy". A happy number is a number defined by the following process: Starting with any positive integer, replace the number by the sum of the squares of its digits, and repeat the process until the number equals 1 (where it will stay), or it loops endlessly in a cycl...
n, k = [int(x) for x in input().split()] nm = [] for g in range(n): nm.append(input()) print(sorted(nm)[k-1])
(n, k) = [int(x) for x in input().split()] nm = [] for g in range(n): nm.append(input()) print(sorted(nm)[k - 1])
#!usr/bin/env python # -*- coding: utf-8 -*- # This function checks if the status code of a REST request is 200/201, # signifying a successful request. If not, the program exits with a log message. def checkStatusCode(status_code, URL): # Status codes 200 and 201 represent a successful request, so the function # s...
def check_status_code(status_code, URL): if status_code == 200 or status_code == 201: return else: print('Call to URL {0} failed with status code {1}'.format(URL, status_code)) print('Exiting') exit(1)
""" Permutar los valores de estas dos tuplas: tuple_one = (23, 34) tuple_two = (34, 45) Final: tuple_one = (34, 45) tuple_two = (23, 34) """ tuple_one = (23, 34) tuple_two = (34, 45) print("Inicio") print(tuple_one, tuple_two) tuple_one, tuple_two = tuple_two, tuple_one print("Final") print(tuple_one, tuple_two)
""" Permutar los valores de estas dos tuplas: tuple_one = (23, 34) tuple_two = (34, 45) Final: tuple_one = (34, 45) tuple_two = (23, 34) """ tuple_one = (23, 34) tuple_two = (34, 45) print('Inicio') print(tuple_one, tuple_two) (tuple_one, tuple_two) = (tuple_two, tuple_one) print('Final') print(tuple_one, tuple_two)
class CompositionalRule(object): def __and__(self, other): return And(self, other) def __invert__(self): return Not(self) def __or__(self, other): return Or(self, other) def __ne__(self, other): return Not(self.__eq__(other)) def accepts(self, anObject): r...
class Compositionalrule(object): def __and__(self, other): return and(self, other) def __invert__(self): return not(self) def __or__(self, other): return or(self, other) def __ne__(self, other): return not(self.__eq__(other)) def accepts(self, anObject): ...
class Args(list): def __init__(self, raw_args): super().__init__() self._raw_args = raw_args def __setitem__(self, index, data): self._raw_args[index] = data def __getitem__(self, index): return self._raw_args[index] def __len__(self): return len(self._raw_arg...
class Args(list): def __init__(self, raw_args): super().__init__() self._raw_args = raw_args def __setitem__(self, index, data): self._raw_args[index] = data def __getitem__(self, index): return self._raw_args[index] def __len__(self): return len(self._raw_arg...
class ParsingError(Exception): """ This exception gets raised when there is a parsing error during logical form processing. This might happen because you're not handling the full set of possible logical forms, for instance, and having this error provides a consistent way to catch those errors and log h...
class Parsingerror(Exception): """ This exception gets raised when there is a parsing error during logical form processing. This might happen because you're not handling the full set of possible logical forms, for instance, and having this error provides a consistent way to catch those errors and log h...
# -*- coding: utf-8 -*- """ meraki This file was automatically generated for meraki by APIMATIC v2.0 ( https://apimatic.io ). """ class V3PrivModeEnum(object): """Implementation of the 'V3PrivMode' enum. The SNMP version 3 privacy mode. Can be either 'DES' or 'AES128'. Attributes...
""" meraki This file was automatically generated for meraki by APIMATIC v2.0 ( https://apimatic.io ). """ class V3Privmodeenum(object): """Implementation of the 'V3PrivMode' enum. The SNMP version 3 privacy mode. Can be either 'DES' or 'AES128'. Attributes: DES: TODO: type description he...
# Areas list areas = [ "hallway", 14.35, "kitchen", 15.0, "living room", 19.0, "bedroom", 12.5, "bathroom", 8.75 ] # Add garage and garden data all_areas = areas + ["garage", 20.0,"garden", 17.0] # Print out all_areas print(all_areas)
areas = ['hallway', 14.35, 'kitchen', 15.0, 'living room', 19.0, 'bedroom', 12.5, 'bathroom', 8.75] all_areas = areas + ['garage', 20.0, 'garden', 17.0] print(all_areas)
with open("input.txt", "r") as f: lines = f.readlines() isFirst = True cValue = 0 counter = 0 for line in lines: line = line.strip() if isFirst: isFirst = False else: if cValue < int(line) : counter +=1 cValue = int(line) ...
with open('input.txt', 'r') as f: lines = f.readlines() is_first = True c_value = 0 counter = 0 for line in lines: line = line.strip() if isFirst: is_first = False elif cValue < int(line): counter += 1 c_value = int(line) print('Total incre...
# print(*input().split('WUB')) # And I thought regex is going to beat me... # Wait.... the checker doesn't care about double space...................... # Now I stand by my solution, even thought it would replace "WUBWWUBUWUBBWUB" with "" def l(a): for b in ['WUB',' ']:a=a.replace(b,' ') return a w=input() while w!=...
def l(a): for b in ['WUB', ' ']: a = a.replace(b, ' ') return a w = input() while w != l(w): w = l(w) print(w.strip())
class Location: def __init__(self, x, y, value): self.x = x self.y = y self.value = value def intersection(node, x, y): pass class QuadTreeNode: def __init__(self, top_left, top_right, bottom_left, bottom_right): self.top_left = top_left self.top_right = top_right...
class Location: def __init__(self, x, y, value): self.x = x self.y = y self.value = value def intersection(node, x, y): pass class Quadtreenode: def __init__(self, top_left, top_right, bottom_left, bottom_right): self.top_left = top_left self.top_right = top_right...
# Copyright (c) 2010-2021 openpyxl class IndexedList(list): """ List with optimised access by value Based on Alex Martelli's recipe http://code.activestate.com/recipes/52303-the-auxiliary-dictionary-idiom-for-sequences-with-/ """ _dict = {} def __init__(self, iterable=None): sel...
class Indexedlist(list): """ List with optimised access by value Based on Alex Martelli's recipe http://code.activestate.com/recipes/52303-the-auxiliary-dictionary-idiom-for-sequences-with-/ """ _dict = {} def __init__(self, iterable=None): self.clean = True self._dict = {}...
"""Custom report symbols for pass/fail/skip""" names = "passed xpassed failed xfailed skipped error".split() defaults = dict(zip(names, ".XFxsE")) help = """ symbol to use in the report when a test has passed (default {passed}) symbol to use when a test is marked as an expected failure, but it doesn't fail (default {x...
"""Custom report symbols for pass/fail/skip""" names = 'passed xpassed failed xfailed skipped error'.split() defaults = dict(zip(names, '.XFxsE')) help = "\nsymbol to use in the report when a test has passed (default {passed})\nsymbol to use when a test is marked as an expected failure, but it doesn't fail (default {xp...
# test basic complex number functionality # convert bignum to complex on rhs ans = 1j + (1 << 70) print("%.5g %.5g" % (ans.real, ans.imag))
ans = 1j + (1 << 70) print('%.5g %.5g' % (ans.real, ans.imag))
with open("day8_input.txt") as f: lines = map(str.strip, f.readlines()) count = 0 for signals, outputs in [(x.split(), y.split()) for x, y in [line.split("|") for line in lines]]: count += sum(1 for output in outputs if len(output) in [2, 4, 3, 7]) print(f"{count=}")
with open('day8_input.txt') as f: lines = map(str.strip, f.readlines()) count = 0 for (signals, outputs) in [(x.split(), y.split()) for (x, y) in [line.split('|') for line in lines]]: count += sum((1 for output in outputs if len(output) in [2, 4, 3, 7])) print(f'count={count!r}')
# -*-coding:utf-8-*- # A password is considered strong if below conditions are all met: # It has at least 6 characters and at most 20 characters. # It must contain at least one lowercase letter, at least one uppercase letter, and at least one digit. # It must NOT contain three repeating characters in a row ("...aaa.....
___author = 'BONFY' class Solution: def strong_password_checker(self, s): """ :type s: str :rtype: int """ missing_type = 3 if any((c.islower() for c in s)): missing_type -= 1 if any((c.isupper() for c in s)): missing_type -= 1 ...
print('Welcome to Number Guessing Mania - Game in Python') while(True): n = int(input('Enter a number :\n')) if n == 18: print('Yes you got it !!! \n') break elif n > 30: print(f'Sorry, your entered number {n} is greater than expected.') continue elif n < ...
print('Welcome to Number Guessing Mania - Game in Python') while True: n = int(input('Enter a number :\n')) if n == 18: print('Yes you got it !!! \n') break elif n > 30: print(f'Sorry, your entered number {n} is greater than expected.') continue elif n < 15: prin...
df = pd.DataFrame( np.random.randint(1, 7, 6000), columns = ['one']) df['two'] = df['one'] + np.random.randint(1, 7, 6000) ax = df.plot.hist(bins=12, alpha=0.5)
df = pd.DataFrame(np.random.randint(1, 7, 6000), columns=['one']) df['two'] = df['one'] + np.random.randint(1, 7, 6000) ax = df.plot.hist(bins=12, alpha=0.5)
_options = { "cpp_std": "c++11", "optimize": "3", } def set_option(name, value): global _options _options[name] = value def get_option(name, default=None): global _options return _options.get(name, default)
_options = {'cpp_std': 'c++11', 'optimize': '3'} def set_option(name, value): global _options _options[name] = value def get_option(name, default=None): global _options return _options.get(name, default)
load( "@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive", "http_file", ) load("@com_google_protobuf//:protobuf_deps.bzl", "protobuf_deps") ######################################## # bazel_toolchains_repositories ######################################## # # This rule configures the following rep...
load('@bazel_tools//tools/build_defs/repo:http.bzl', 'http_archive', 'http_file') load('@com_google_protobuf//:protobuf_deps.bzl', 'protobuf_deps') load('@bazel_toolchains//repositories:repositories.bzl', bazel_toolchains_repositories='repositories') def stage2(): bazel_toolchains_repositories() protobuf_deps(...
# Definition for a binary tree node. # class TreeNode(object): # def __init__(self, x): # self.val = x # self.left = None # self.right = None """ Pre-order DFS O(N) time and O(N) space """ class Codec: def serialize(self, root): """Encodes a tree to a single string. :t...
""" Pre-order DFS O(N) time and O(N) space """ class Codec: def serialize(self, root): """Encodes a tree to a single string. :type root: TreeNode :rtype: str """ def rserialize(root, string): """ a recursive helper function for the serialize() function.""" ...
class Solution(object): def convertToTitle(self, n): """ :type n: int :rtype: str """ result = "" base = 26 digits = 1 while n > base: n -= base base = base * 26 digits += 1 n = n - 1 for i in range(...
class Solution(object): def convert_to_title(self, n): """ :type n: int :rtype: str """ result = '' base = 26 digits = 1 while n > base: n -= base base = base * 26 digits += 1 n = n - 1 for i in rang...
class Repeater: def __init__(self, value): if callable(value): self._value = value else: self._value = lambda: value def __iter__(self): return self def __next__(self): return self._value()
class Repeater: def __init__(self, value): if callable(value): self._value = value else: self._value = lambda : value def __iter__(self): return self def __next__(self): return self._value()
while True: command = input(">") if command == 'help': print("1) start") print("2) stop") print("3) quiet") elif command == 'start': print("Car started....Ready to Go") elif command == 'stop': print("Car stopped") elif command == 'quiet': print("Car te...
while True: command = input('>') if command == 'help': print('1) start') print('2) stop') print('3) quiet') elif command == 'start': print('Car started....Ready to Go') elif command == 'stop': print('Car stopped') elif command == 'quiet': print('Car te...
def hcf(x, y): divisor = 1 if x > y: smaller = y else: smaller = x for i in range(1, smaller + 1): if (x % i == 0) and (y % i == 0): divisor = i return divisor num1 = int(input('Enter the first number: ')) num2 = int(input("Enter the second number: ")) print(nu...
def hcf(x, y): divisor = 1 if x > y: smaller = y else: smaller = x for i in range(1, smaller + 1): if x % i == 0 and y % i == 0: divisor = i return divisor num1 = int(input('Enter the first number: ')) num2 = int(input('Enter the second number: ')) print(num1, ' a...
class DiscordanceReportResolution: ONGOING = None CONCORDANT = 'C' CONTINUED_DISCORDANCE = 'D' CHOICES = ( (CONCORDANT, 'Concordant'), (CONTINUED_DISCORDANCE, 'Continued Discordance') ) class ContinuedDiscordanceReason: UNRESPONSIVE = 'U' DIFFERENT_CURATION_METHODS = 'D' ...
class Discordancereportresolution: ongoing = None concordant = 'C' continued_discordance = 'D' choices = ((CONCORDANT, 'Concordant'), (CONTINUED_DISCORDANCE, 'Continued Discordance')) class Continueddiscordancereason: unresponsive = 'U' different_curation_methods = 'D' choices = ((UNRESPONS...
if __name__ == '__main__': x = int(input()) y = int(input()) z = int(input()) n = int(input()) L = [[a,b,c] for a in range(x+1) for b in range(y+1) for c in range(z+1)] L = list(filter(lambda x : sum(x) != n, L)) print(L)
if __name__ == '__main__': x = int(input()) y = int(input()) z = int(input()) n = int(input()) l = [[a, b, c] for a in range(x + 1) for b in range(y + 1) for c in range(z + 1)] l = list(filter(lambda x: sum(x) != n, L)) print(L)
#Parameters def say_hello(name, age): print(f'Hello, I am {name} and I am {age} years old.') #Default Parameters def say_something(name='Andrei', age=20): print(f'Hello, I am {name} and I am not {age} years old.') say_something() #Positional Arguments say_hello('Elena', 14) say_hello('John', 10) #Keyword Ar...
def say_hello(name, age): print(f'Hello, I am {name} and I am {age} years old.') def say_something(name='Andrei', age=20): print(f'Hello, I am {name} and I am not {age} years old.') say_something() say_hello('Elena', 14) say_hello('John', 10) say_hello(name='Peter', age=20) say_hello(age=10, name='Ana')
def find_numbers(lst, test): numbers = [] for x in lst: if test(x): numbers.append(x) return numbers def is_even(n): return n % 2 == 0 def is_big(n): return n > 500 numbers = [2, 1, 3, 4, 1000, 10001, 1002, 100, -5, -101, -1] print(find_numbers(numbers, is_big)) def negate(...
def find_numbers(lst, test): numbers = [] for x in lst: if test(x): numbers.append(x) return numbers def is_even(n): return n % 2 == 0 def is_big(n): return n > 500 numbers = [2, 1, 3, 4, 1000, 10001, 1002, 100, -5, -101, -1] print(find_numbers(numbers, is_big)) def negate(n):...
'''import requests # IDs of the datasets we want to query --> TODO: complete, maybe list in separate file? datasets_interesting = ['S1084_80_2_409', 'S2060_83_4_435_ENG', 'S2140_87_1_459_ENG', 'S2212_91_3_490_ENG'] # Directory for output/RDF data dir_processed_eb_rdf = 'data/processed_data/special_eb/metadata/' def...
"""import requests # IDs of the datasets we want to query --> TODO: complete, maybe list in separate file? datasets_interesting = ['S1084_80_2_409', 'S2060_83_4_435_ENG', 'S2140_87_1_459_ENG', 'S2212_91_3_490_ENG'] # Directory for output/RDF data dir_processed_eb_rdf = 'data/processed_data/special_eb/metadata/' def...
N, T, *A = map(int, open(0).read().split()) t = 10 ** 9 + 1 d = {} for a in A: t = min(t, a) d.setdefault(a - t, 0) d[a - t] += 1 print(d[max(d)])
(n, t, *a) = map(int, open(0).read().split()) t = 10 ** 9 + 1 d = {} for a in A: t = min(t, a) d.setdefault(a - t, 0) d[a - t] += 1 print(d[max(d)])
mondey_temparature = [9.1, 8.8, 7.6] for temparature in mondey_temparature: print(round(temparature)) for letter in "helllo": print(letter)
mondey_temparature = [9.1, 8.8, 7.6] for temparature in mondey_temparature: print(round(temparature)) for letter in 'helllo': print(letter)
def checkdata(b): clear_output() display(button0) print('Initial Data Condition:') #checkdata = pd.read_excel('story_'+ story.value+'/story'+ story.value+'.xlsx', sheet_name='sample') checkdata = pd.read_excel('story_0/story0'+'.xlsx', sheet_name='sample') checkdata['FC_Start_Date'] = checkdata[...
def checkdata(b): clear_output() display(button0) print('Initial Data Condition:') checkdata = pd.read_excel('story_0/story0' + '.xlsx', sheet_name='sample') checkdata['FC_Start_Date'] = checkdata['Arrival_Date'] + pd.to_timedelta(1, unit='D') checkdata['demanddays'] = np.ceil(checkdata.Demand_Q...
major = 1 minor = 3 build = 6 version = f"{major}.{minor}.{build}"
major = 1 minor = 3 build = 6 version = f'{major}.{minor}.{build}'
def sortPositions(positions): sorted_positions = {} for eachposition in positions: chromosome=eachposition.split(".")[0] start,end = eachposition.split(":")[-1].split("-") start,end=int(start),int(end) sorted_positions[chromosome] = [start,end] sorted_positions_new={} ...
def sort_positions(positions): sorted_positions = {} for eachposition in positions: chromosome = eachposition.split('.')[0] (start, end) = eachposition.split(':')[-1].split('-') (start, end) = (int(start), int(end)) sorted_positions[chromosome] = [start, end] sorted_positions...
"""Buffer module to store constants and settings.""" DISP_MSEC = 50 # Delay between display cycles CAMERA_NUM = 1 GPIO_UV_LED = 32 GPIO_COLOR_LED = 18 COLOR_LED_NUM = 40 CAMERA_RESOLUTION = (3040, 3040) DISPLAY_RESOLUTION = (480, 480) RED_GAIN = 4575 BLUE_GAIN = 918 TEST_IMAGE_NAME = "testImag...
"""Buffer module to store constants and settings.""" disp_msec = 50 camera_num = 1 gpio_uv_led = 32 gpio_color_led = 18 color_led_num = 40 camera_resolution = (3040, 3040) display_resolution = (480, 480) red_gain = 4575 blue_gain = 918 test_image_name = 'testImage.tiff' settings = {}
def array_advance(A): furthest_reached = 0 i=0 lastIndex = len(A)-1 # If furthest reach still has range and we have not reached goal while i <= furthest_reached and furthest_reached < lastIndex: furthest_reached = max(furthest_reached, A[i]+i) i += 1 return furthest_reached >= ...
def array_advance(A): furthest_reached = 0 i = 0 last_index = len(A) - 1 while i <= furthest_reached and furthest_reached < lastIndex: furthest_reached = max(furthest_reached, A[i] + i) i += 1 return furthest_reached >= lastIndex a = [3, 3, 1, 0, 2, 0, 1] print(array_advance(A)) a = ...
class ComputeRank(object): def __init__(self, var_name): self.var_name = var_name def __call__(self, documents): for i, document in enumerate(documents, 1): document[self.var_name] = i return documents
class Computerank(object): def __init__(self, var_name): self.var_name = var_name def __call__(self, documents): for (i, document) in enumerate(documents, 1): document[self.var_name] = i return documents
class Statistics: """ Represents the state of some players statistics. Abstracts stat modifications (such as dealing damage). """ MAX_HP = 100.0 INITIAL_ARMOUR = 0.0 MAX_ARMOUR = 20.0 def __init__(self): self.hp = self.MAX_HP self.armour = self.INITIAL_ARMOUR def de...
class Statistics: """ Represents the state of some players statistics. Abstracts stat modifications (such as dealing damage). """ max_hp = 100.0 initial_armour = 0.0 max_armour = 20.0 def __init__(self): self.hp = self.MAX_HP self.armour = self.INITIAL_ARMOUR def de...
""" URLify: Write a method to replace all spaces in a string with '%20: You may assume that the string has sufficient space at the end to hold the additional characters, and that you are given the "true" length of the string. (Note: If implementing in Java, please use a character array so that you can perform this o...
""" URLify: Write a method to replace all spaces in a string with '%20: You may assume that the string has sufficient space at the end to hold the additional characters, and that you are given the "true" length of the string. (Note: If implementing in Java, please use a character array so that you can perform this o...
"""Module containing dummy code objects for testing the Squirrel program with. """ def dummyfunc(word: str): """I do things""" print(f'Hello {word}!') return 0 class DummyClass(): def __init__(self, a, b, c): self.a = a self.b = b self.c = c def __str__(self): ret...
"""Module containing dummy code objects for testing the Squirrel program with. """ def dummyfunc(word: str): """I do things""" print(f'Hello {word}!') return 0 class Dummyclass: def __init__(self, a, b, c): self.a = a self.b = b self.c = c def __str__(self): retur...
output = """ [DEFAULT] # the DEFAULT section is where you create variables # that can be used in later sections control_network = 192.168.10 test_network = 192.168.20 [TEST] output_folder = data_{t} # The data files will be appended with .iperf data_file = %(output_folder)s # This is the number of times to repeat the ...
output = "\n[DEFAULT]\n# the DEFAULT section is where you create variables\n# that can be used in later sections\ncontrol_network = 192.168.10\ntest_network = 192.168.20\n\n[TEST]\noutput_folder = data_{t}\n# The data files will be appended with .iperf\ndata_file = %(output_folder)s\n# This is the number of times to re...
# Description: Functions in Python # Defining a function # 1. The keyword def introduces a function definition, followed by a function name. # 2. The body of the function MUST start at the next line, and MUST be indented. # 3. The first statement of the function body can OPTIONALLY be a string literal to describe the ...
def fibonacci(n): """Print a Fibonacci series up to n.""" (a, b) = (0, 1) while a < n: print(a, ' ') (a, b) = (b, a + b) print() fibonacci(20) print(fibonacci(20)) recursive_function = fibonacci(20) print(recursive_function) recursive_function = fibonacci print(recursive_function) re...
stocks = pd.read_csv('all_stocks_SP500.csv') stocks = stocks.T stocks.columns = stocks.iloc[0] stocks = stocks[1:] stocks['condition1'] = (stocks['price'] > stocks['200 MA']) & (stocks['price'] > stocks['150 MA']) stocks['condition2'] = stocks['150 MA'] > stocks['200 MA'] #3 The 200-day moving average line is trending...
stocks = pd.read_csv('all_stocks_SP500.csv') stocks = stocks.T stocks.columns = stocks.iloc[0] stocks = stocks[1:] stocks['condition1'] = (stocks['price'] > stocks['200 MA']) & (stocks['price'] > stocks['150 MA']) stocks['condition2'] = stocks['150 MA'] > stocks['200 MA'] stocks['condition3'] = stocks['200 MA'] > stock...
"""PodmanPy Tests.""" # Do not auto-update these from version.py, # as test code should be changed to reflect changes in Podman API versions BASE_SOCK = "unix:///run/api.sock" LIBPOD_URL = "http://%2Frun%2Fapi.sock/v3.2.1/libpod" COMPATIBLE_URL = "http://%2Frun%2Fapi.sock/v1.40"
"""PodmanPy Tests.""" base_sock = 'unix:///run/api.sock' libpod_url = 'http://%2Frun%2Fapi.sock/v3.2.1/libpod' compatible_url = 'http://%2Frun%2Fapi.sock/v1.40'
# pylint: disable=missing-docstring, unused-variable, pointless-statement, too-few-public-methods, useless-object-inheritance class WrapperClass(object): def method(self): var = +4294967296 self.method.__code__.co_consts
class Wrapperclass(object): def method(self): var = +4294967296 self.method.__code__.co_consts
# Copyright lowRISC contributors. # Licensed under the Apache License, Version 2.0, see LICENSE for details. # SPDX-License-Identifier: Apache-2.0 # Version requirements for various tools. Checked by tooling (e.g. fusesoc), # and inserted into the documentation. # # Entries are keyed by tool name. The value is either ...
__tool_requirements__ = {'edalize': '0.2.0', 'ninja': {'min_version': '1.8.2', 'as_needed': True}, 'verilator': {'min_version': '4.210', 'as_needed': True}, 'hugo_extended': {'min_version': '0.82.0', 'as_needed': True}, 'verible': {'min_version': 'v0.0-2135-gb534c1fe', 'as_needed': True}, 'vcs': {'min_version': '2020.1...
# physical constants in cgs # Fundamental constants taken from NIST's 2010 CODATA recommended values c = 2.99792458e10 # speed of light h = 6.62606957e-27 # Planck constant hbar = 1.054571726e-27 # G = 6.67428e-8 # Gravitational constant e = 4.80320451e-10 # Electron charge ...
c = 29979245800.0 h = 6.62606957e-27 hbar = 1.054571726e-27 g = 6.67428e-08 e = 4.80320451e-10 me = 9.10938291e-28 mp = 1.672621777e-24 na = 6.02214129e+23 k = 1.3806488e-16 r = 83144621.45468952 sigma = 5.670373e-05 sigma_t = 6.652458734e-25 a = 7.565731356724124e-15 e_v = 1.602176487e-12 j = 10000000.0 n = 100000.0 a...
# # PySNMP MIB module NOKIA-ALCHEMYOS-HARDWARE-MIB (http://snmplabs.com/pysmi) # ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/NOKIA-ALCHEMYOS-HARDWARE-MIB # Produced by pysmi-0.3.4 at Wed May 1 14:23:17 2019 # On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4 # Using Python vers...
(object_identifier, integer, octet_string) = mibBuilder.importSymbols('ASN1', 'ObjectIdentifier', 'Integer', 'OctetString') (named_values,) = mibBuilder.importSymbols('ASN1-ENUMERATION', 'NamedValues') (single_value_constraint, value_range_constraint, constraints_intersection, constraints_union, value_size_constraint) ...
# Input contains a number of pairs of parentheses, extract each group seperately stack = [] pairs = [] s = "Outer (First inner (first nested group) group) parentheses (another group)" for i, char in enumerate(s): if char == "(": stack.append(i) elif char == ")": pairs.append((stack.pop(), i))...
stack = [] pairs = [] s = 'Outer (First inner (first nested group) group) parentheses (another group)' for (i, char) in enumerate(s): if char == '(': stack.append(i) elif char == ')': pairs.append((stack.pop(), i)) for pair in pairs: print(s[pair[0]:pair[1] + 1]) def get_group(ii, s): s...
# TODO: Add import statements # Assign the data to predictor and outcome variables # TODO: Load the data train_data = None X = None y = None # Create polynomial features # TODO: Create a PolynomialFeatures object, then fit and transform the # predictor feature poly_feat = None X_poly = None # Make and fit the polyno...
train_data = None x = None y = None poly_feat = None x_poly = None poly_model = None
# # @lc app=leetcode id=53 lang=python # # [53] Maximum Subarray # # https://leetcode.com/problems/maximum-subarray/description/ # # algorithms # Easy (42.84%) # Total Accepted: 471.5K # Total Submissions: 1.1M # Testcase Example: '[-2,1,-3,4,-1,2,1,-5,4]' # # Given an integer array nums, find the contiguous subarr...
''' class Solution(object): max_sum = 0 max_lst = [] sum_lst = [] visited = [] def solver(self, nums, head, tail, sum_res): if head > tail or head >= len(nums): return if self.visited[head] != -1 and self.visited[tail] != -1: return if sum_res >= self....
DB_VALUE_PREPROCESSING = "Calls or returns the specified input value's attribute when saved to the database" FIXED_KWARGS = "Fixed run method keyword arguments" IS_CONFIGURATION = "Whether this definition represents a configuration of the analysis (rather than data input)" MAX_PARALLEL = "Maximal number of parallel exe...
db_value_preprocessing = "Calls or returns the specified input value's attribute when saved to the database" fixed_kwargs = 'Fixed run method keyword arguments' is_configuration = 'Whether this definition represents a configuration of the analysis (rather than data input)' max_parallel = 'Maximal number of parallel exe...
# Title : Print Prime Number till the specified limit # Author : Kiran raj R. # Date : 16:10:2020 userInput = int(input("Enter the limit of the prime number : ")) def primeLimit(limit): for num in range(2, limit): for i in range(2, num): if num % i == 0: break else...
user_input = int(input('Enter the limit of the prime number : ')) def prime_limit(limit): for num in range(2, limit): for i in range(2, num): if num % i == 0: break else: print(num) prime_limit(userInput)
built_modules = list(name for name in "Core;Gui;Widgets;PrintSupport;Sql;Network;Test;Concurrent;WinExtras;Xml;XmlPatterns;Help;Multimedia;MultimediaWidgets;OpenGL;OpenGLFunctions;Positioning;Location;Qml;Quick;QuickControls2;QuickWidgets;RemoteObjects;Scxml;Script;ScriptTools;Sensors;SerialPort;TextToSpeech;Charts...
built_modules = list((name for name in 'Core;Gui;Widgets;PrintSupport;Sql;Network;Test;Concurrent;WinExtras;Xml;XmlPatterns;Help;Multimedia;MultimediaWidgets;OpenGL;OpenGLFunctions;Positioning;Location;Qml;Quick;QuickControls2;QuickWidgets;RemoteObjects;Scxml;Script;ScriptTools;Sensors;SerialPort;TextToSpeech;Charts;Sv...
class DelegateFake(object): """ DelegateFake() """ def EditMacro(self,FileName): """ EditMacro(self: DelegateFake,FileName: str) -> int """ pass def ExplodeBentPlate(self,partId): """ ExplodeBentPlate(self: DelegateFake,partId: int) -> int """ pass def ExportAddComponentAttributeToStack(self,pAttr): """ E...
class Delegatefake(object): """ DelegateFake() """ def edit_macro(self, FileName): """ EditMacro(self: DelegateFake,FileName: str) -> int """ pass def explode_bent_plate(self, partId): """ ExplodeBentPlate(self: DelegateFake,partId: int) -> int """ pass def export_add_...
# Collaborators: none # # Write a program that asks for the user's name and another piece of information.Then prints a response using both of the inputs. x= input("Your name: ") print ("Hello there, " + x + "!") y= input("How are you, " + x + "?: ") print (y + " huh, okay thank you " + x + ", for letting me know!")
x = input('Your name: ') print('Hello there, ' + x + '!') y = input('How are you, ' + x + '?: ') print(y + ' huh, okay thank you ' + x + ', for letting me know!')
class Solution: def isMonotonic(self, A): """ :type A: List[int] :rtype: bool """ is_asc = True is_desc = True for i in range(1, len(A)): if A[i-1] < A[i]: is_asc = False if A[i-1] > A[i]: is_des...
class Solution: def is_monotonic(self, A): """ :type A: List[int] :rtype: bool """ is_asc = True is_desc = True for i in range(1, len(A)): if A[i - 1] < A[i]: is_asc = False if A[i - 1] > A[i]: is_desc =...
#!/usr/bin/constants """ Collection of physical constants Main source: http://physics.nist.gov/cuu/Constants/index.html """ def AMU(): """ Atomic mass unit, kg """ return 1.660538782e-27 def AVOGADRO(): """ Avogadro constant, mol^-1 """ return 6.02214179e23 def BOLTZMANN(): """ Boltzmann constan...
""" Collection of physical constants Main source: http://physics.nist.gov/cuu/Constants/index.html """ def amu(): """ Atomic mass unit, kg """ return 1.660538782e-27 def avogadro(): """ Avogadro constant, mol^-1 """ return 6.02214179e+23 def boltzmann(): """ Boltzmann constant, J K^-1 """ re...
t = int(input()) for _ in range(t): l = list(map(str, input().split())) for i in range(len(l) - 1): l[i] = l[i][0].upper() + "." l[len(l) - 1] = l[len(l) - 1][0].upper() + l[len(l) - 1][1:].lower() print(" ".join(l))
t = int(input()) for _ in range(t): l = list(map(str, input().split())) for i in range(len(l) - 1): l[i] = l[i][0].upper() + '.' l[len(l) - 1] = l[len(l) - 1][0].upper() + l[len(l) - 1][1:].lower() print(' '.join(l))
# Time complexity: ? # Space Complexity: ? def newman_conway(num): """ Returns a list of the Newman Conway numbers for the given value. Time Complexity: O(n^2) Space Complexity: O(n) """ if num == 0: raise ValueError("ValueError") if num == 1: return '1' s='1 1' ...
def newman_conway(num): """ Returns a list of the Newman Conway numbers for the given value. Time Complexity: O(n^2) Space Complexity: O(n) """ if num == 0: raise value_error('ValueError') if num == 1: return '1' s = '1 1' arr = [0, 1, 1] for num in range(3, n...
num = 10 if num < 10: print("number is less than 10") elif num > 10: print("number is greater than 10") else: print("the number is equal to 10")
num = 10 if num < 10: print('number is less than 10') elif num > 10: print('number is greater than 10') else: print('the number is equal to 10')
"""Definition of chips.""" AM33XX = "AM33XX" DRA74X = "DRA74X" IMX6ULL = "IMX6ULL" IMX8MX = "IMX8MX" BCM2XXX = "BCM2XXX" ESP8266 = "ESP8266" EXYNOS5422 = "EXYNOS5422" RYZEN_V1202B = "RYZEN_V1202B" RYZEN_V1605B = "RYZEN_V1605B" SAMD21 = "SAMD21" SUN8I = "SUN8I" S805 = "S805" S905 = "S905" S905X3 = "S905X3" S922X = "S922...
"""Definition of chips.""" am33_xx = 'AM33XX' dra74_x = 'DRA74X' imx6_ull = 'IMX6ULL' imx8_mx = 'IMX8MX' bcm2_xxx = 'BCM2XXX' esp8266 = 'ESP8266' exynos5422 = 'EXYNOS5422' ryzen_v1202_b = 'RYZEN_V1202B' ryzen_v1605_b = 'RYZEN_V1605B' samd21 = 'SAMD21' sun8_i = 'SUN8I' s805 = 'S805' s905 = 'S905' s905_x3 = 'S905X3' s922...
class Action(object): def __init__(self, actionroot): self.name = actionroot.find('./name').text argumentLists = None if len(actionroot.findall('./argumentList/argument')) > 0: argumentLists = actionroot.findall('./argumentList/argument') else: argumentLists ...
class Action(object): def __init__(self, actionroot): self.name = actionroot.find('./name').text argument_lists = None if len(actionroot.findall('./argumentList/argument')) > 0: argument_lists = actionroot.findall('./argumentList/argument') else: argument_lis...
description = 'detector setup' group = 'lowlevel' devices = dict( monitor = device('nicos.devices.generic.VirtualCounter', description = 'simulated monitor', fmtstr = '%d', type = 'monitor', visibility = (), ), timer = device('nicos.devices.generic.VirtualTimer', de...
description = 'detector setup' group = 'lowlevel' devices = dict(monitor=device('nicos.devices.generic.VirtualCounter', description='simulated monitor', fmtstr='%d', type='monitor', visibility=()), timer=device('nicos.devices.generic.VirtualTimer', description='simulated timer', fmtstr='%.2f', visibility=()), image=dev...
class Solution: def maxSlidingWindow(self, nums: List[int], k: int) -> List[int]: ''' T: O(n log k) and S: O(k) result = [] for i in range(len(nums) - k + 1): numsK = nums[i: i + k] heapq._heapify_max(numsK) result.append(numsK[0]) ...
class Solution: def max_sliding_window(self, nums: List[int], k: int) -> List[int]: """ T: O(n log k) and S: O(k) result = [] for i in range(len(nums) - k + 1): numsK = nums[i: i + k] heapq._heapify_max(numsK) result.append(numsK[0]) ...
# Marc's Cakewalk # Developer: Murillo Grubler # Link: https://www.hackerrank.com/challenges/marcs-cakewalk/problem # Function O(n) def must_walk(n, arr): count = 0 for i in range(n): count = count + (arr[i] * (2 ** i)) return count n = int(input().strip()) calories = sorted(list(map(int, inpu...
def must_walk(n, arr): count = 0 for i in range(n): count = count + arr[i] * 2 ** i return count n = int(input().strip()) calories = sorted(list(map(int, input().strip().split(' '))), reverse=True) print(must_walk(n, calories))
class LinkedListException(Exception): pass class Node(object): def __init__(self, value, next_node, previous_node=None): self.value = value self.next_node = next_node self.previous_node = previous_node class _LinkedList(object): def __init__(self): self.last_nod...
class Linkedlistexception(Exception): pass class Node(object): def __init__(self, value, next_node, previous_node=None): self.value = value self.next_node = next_node self.previous_node = previous_node class _Linkedlist(object): def __init__(self): self.last_node = None ...