content stringlengths 7 1.05M | fixed_cases stringlengths 1 1.28M |
|---|---|
load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive")
def load_framework_dependencies():
http_archive(
name = "TensorFlowLiteC",
url = "https://dl.google.com/dl/cpdc/3895e5bf508673ae/TensorFlowLiteC-2.6.0.tar.gz",
sha256 = "a28ce764da496830c0a145b46e5403fb486b5b6231c72337aaa8eaf3d762cc8d",
build_file = "@//tests/ios/unit-test/test-imports-app:BUILD.TensorFlowLiteC",
strip_prefix = "TensorFlowLiteC-2.6.0",
)
http_archive(
name = "GoogleMobileAdsSDK",
url = "https://dl.google.com/dl/cpdc/e0dda986a9f84d14/Google-Mobile-Ads-SDK-8.10.0.tar.gz",
sha256 = "0726df5d92165912c9e60a79504a159ad9b7231dda851abede8f8792b266dba5",
build_file = "@//tests/ios/unit-test/test-imports-app:BUILD.GoogleMobileAds",
)
| load('@bazel_tools//tools/build_defs/repo:http.bzl', 'http_archive')
def load_framework_dependencies():
http_archive(name='TensorFlowLiteC', url='https://dl.google.com/dl/cpdc/3895e5bf508673ae/TensorFlowLiteC-2.6.0.tar.gz', sha256='a28ce764da496830c0a145b46e5403fb486b5b6231c72337aaa8eaf3d762cc8d', build_file='@//tests/ios/unit-test/test-imports-app:BUILD.TensorFlowLiteC', strip_prefix='TensorFlowLiteC-2.6.0')
http_archive(name='GoogleMobileAdsSDK', url='https://dl.google.com/dl/cpdc/e0dda986a9f84d14/Google-Mobile-Ads-SDK-8.10.0.tar.gz', sha256='0726df5d92165912c9e60a79504a159ad9b7231dda851abede8f8792b266dba5', build_file='@//tests/ios/unit-test/test-imports-app:BUILD.GoogleMobileAds') |
def initials(name):
names = name.title().split()
length = len(names) - 1
return '.'.join(a[0] if length != i else a for i, a in enumerate(names))
| def initials(name):
names = name.title().split()
length = len(names) - 1
return '.'.join((a[0] if length != i else a for (i, a) in enumerate(names))) |
class Infinite_memory(list):
def __init__(self,*args):
list.__init__(self,*args)
def __getitem__(self, index):
if index>=len(self):
for _ in range((index-len(self))+1):
self.append(0)
return super().__getitem__(index)
def __setitem__(self, key, value):
if key>=len(self):
for _ in range((key-len(self))+1):
self.append(0)
return super().__setitem__(key, value)
def run_intcode(memory,input_stream=None,output_l=None):
global relative_base
relative_base=0
def suma(args):
memory[args[2]]=args[0]+args[1]
def mult(args):
memory[args[2]]=args[0]*args[1]
def inpt(args):
if input_stream:
memory[args[0]]=input_stream.pop(0)
else:
memory[args[0]]=int(input("escribe un numero, puto (1 para parte 1 2 para parte 2):"))
def output(args):
if output_l==None:
print(args[0])
else:
output_l.append(args[0])
def j_if_t(args):
if args[0]!=0:
return args[1]
def j_if_f(args):
if args[0]==0:
return args[1]
def less_than(args):
memory[args[2]]=int(args[0]<args[1])
def equals(args):
memory[args[2]]=int(args[0]==args[1])
def inc_rel_base(args):
global relative_base
relative_base+=args[0]
func_dict={1:suma,2:mult,3:inpt,4:output,5:j_if_t,6:j_if_f,7:less_than,8:equals,9:inc_rel_base}
writes_to_mem=[1,2,3,7,8]#instructions that write to memory
inc_dict={1:4,2:4,3:2,4:2,5:3,6:3,7:4,8:4,9:2}
i=0
while True:
opcode=str(memory[i])
param_bits=list(opcode[:-2])
opcode=int(opcode[-2:])
if opcode==99:
break
params=[]
for p in range(1,inc_dict[opcode]):
bit=0
if len(param_bits)>0:
bit=int(param_bits.pop())
if bit==2:
if (p==inc_dict[opcode]-1 and opcode in writes_to_mem): #write relative
params.append(relative_base+memory[i+p])
else: #read relative
params.append(memory[relative_base+memory[i+p]])
elif (p==inc_dict[opcode]-1 and opcode in writes_to_mem) or (bit==1): #read immediate or write positional
params.append(memory[i+p])
else: #default read positional
params.append(memory[memory[i+p]])
instruction=func_dict[opcode](params)
if instruction:
i=instruction
else:
i+=inc_dict[opcode]
with open("input1.txt","r") as f:
code=Infinite_memory(map(int,f.readline().split(",")))
out=[]
run_intcode(code,output_l=out)
print(len([out[i] for i in range(2,len(out),3) if out[i]==2])) | class Infinite_Memory(list):
def __init__(self, *args):
list.__init__(self, *args)
def __getitem__(self, index):
if index >= len(self):
for _ in range(index - len(self) + 1):
self.append(0)
return super().__getitem__(index)
def __setitem__(self, key, value):
if key >= len(self):
for _ in range(key - len(self) + 1):
self.append(0)
return super().__setitem__(key, value)
def run_intcode(memory, input_stream=None, output_l=None):
global relative_base
relative_base = 0
def suma(args):
memory[args[2]] = args[0] + args[1]
def mult(args):
memory[args[2]] = args[0] * args[1]
def inpt(args):
if input_stream:
memory[args[0]] = input_stream.pop(0)
else:
memory[args[0]] = int(input('escribe un numero, puto (1 para parte 1 2 para parte 2):'))
def output(args):
if output_l == None:
print(args[0])
else:
output_l.append(args[0])
def j_if_t(args):
if args[0] != 0:
return args[1]
def j_if_f(args):
if args[0] == 0:
return args[1]
def less_than(args):
memory[args[2]] = int(args[0] < args[1])
def equals(args):
memory[args[2]] = int(args[0] == args[1])
def inc_rel_base(args):
global relative_base
relative_base += args[0]
func_dict = {1: suma, 2: mult, 3: inpt, 4: output, 5: j_if_t, 6: j_if_f, 7: less_than, 8: equals, 9: inc_rel_base}
writes_to_mem = [1, 2, 3, 7, 8]
inc_dict = {1: 4, 2: 4, 3: 2, 4: 2, 5: 3, 6: 3, 7: 4, 8: 4, 9: 2}
i = 0
while True:
opcode = str(memory[i])
param_bits = list(opcode[:-2])
opcode = int(opcode[-2:])
if opcode == 99:
break
params = []
for p in range(1, inc_dict[opcode]):
bit = 0
if len(param_bits) > 0:
bit = int(param_bits.pop())
if bit == 2:
if p == inc_dict[opcode] - 1 and opcode in writes_to_mem:
params.append(relative_base + memory[i + p])
else:
params.append(memory[relative_base + memory[i + p]])
elif p == inc_dict[opcode] - 1 and opcode in writes_to_mem or bit == 1:
params.append(memory[i + p])
else:
params.append(memory[memory[i + p]])
instruction = func_dict[opcode](params)
if instruction:
i = instruction
else:
i += inc_dict[opcode]
with open('input1.txt', 'r') as f:
code = infinite_memory(map(int, f.readline().split(',')))
out = []
run_intcode(code, output_l=out)
print(len([out[i] for i in range(2, len(out), 3) if out[i] == 2])) |
# Python function to compute GCD of two numbers using recursion
def gcd(a,b):
if(b==0): # Base case
return a
else:
return gcd(b,a%b) # Recursive call
# Tester code
a=int(input("Enter first number:"))
b=int(input("Enter second number:"))
GCD=gcd(a,b)
print("GCD is: ")
print(GCD) | def gcd(a, b):
if b == 0:
return a
else:
return gcd(b, a % b)
a = int(input('Enter first number:'))
b = int(input('Enter second number:'))
gcd = gcd(a, b)
print('GCD is: ')
print(GCD) |
def dpMakeChange(coinValueList,change,minCoins,coinsUsed):
for cents in range(change+1):
coinCount = cents
newCoin = 1
for j in [c for c in coinValueList if c <= cents]:
if minCoins[cents-j] + 1 < coinCount:
coinCount = minCoins[cents-j]+1
newCoin = j
minCoins[cents] = coinCount
coinsUsed[cents] = newCoin
return minCoins[change]
def printCoins(coinsUsed,change):
coin = change
while coin > 0:
thisCoin = coinsUsed[coin]
print(thisCoin)
coin = coin - thisCoin
def main():
amnt = 63
clist = [1,5,10,21,25]
coinsUsed = [0]*(amnt+1)
coinCount = [0]*(amnt+1)
print("Making change for",amnt,"requires")
print(dpMakeChange(clist,amnt,coinCount,coinsUsed),"coins")
print("They are:")
printCoins(coinsUsed,amnt)
print("The used list is as follows:")
print(coinsUsed)
main()
| def dp_make_change(coinValueList, change, minCoins, coinsUsed):
for cents in range(change + 1):
coin_count = cents
new_coin = 1
for j in [c for c in coinValueList if c <= cents]:
if minCoins[cents - j] + 1 < coinCount:
coin_count = minCoins[cents - j] + 1
new_coin = j
minCoins[cents] = coinCount
coinsUsed[cents] = newCoin
return minCoins[change]
def print_coins(coinsUsed, change):
coin = change
while coin > 0:
this_coin = coinsUsed[coin]
print(thisCoin)
coin = coin - thisCoin
def main():
amnt = 63
clist = [1, 5, 10, 21, 25]
coins_used = [0] * (amnt + 1)
coin_count = [0] * (amnt + 1)
print('Making change for', amnt, 'requires')
print(dp_make_change(clist, amnt, coinCount, coinsUsed), 'coins')
print('They are:')
print_coins(coinsUsed, amnt)
print('The used list is as follows:')
print(coinsUsed)
main() |
DEBUG = True
DATABASES = {
'default': {
'ENGINE': 'django.db.backends.sqlite3', # Add 'postgresql_psycopg2', 'mysql', 'sqlite3' or 'oracle'.
'NAME': 'db.sqlite3', # Or path to database file if using sqlite3.
}
}
# Make this unique, and don't share it with anybody.
SECRET_KEY = '^n4-$%m-w((n4=7g4j!(x3%=l68t=__j!24-3)0%bjd8i2e5th'
MIDDLEWARE_CLASSES = (
'django.middleware.common.CommonMiddleware',
'django.contrib.sessions.middleware.SessionMiddleware',
'django.middleware.csrf.CsrfViewMiddleware',
'django.contrib.auth.middleware.AuthenticationMiddleware',
'django.contrib.messages.middleware.MessageMiddleware',
)
ROOT_URLCONF = 'hostproof_auth.urls'
INSTALLED_APPS = (
'django.contrib.auth',
'django.contrib.contenttypes',
'django.contrib.sessions',
'django.contrib.sites',
'django.contrib.messages',
'hostproof_auth',
)
AUTH_USER_MODEL = 'hostproof_auth.User'
AUTHENTICATION_BACKENDS = (
'hostproof_auth.auth.ModelBackend',
)
| debug = True
databases = {'default': {'ENGINE': 'django.db.backends.sqlite3', 'NAME': 'db.sqlite3'}}
secret_key = '^n4-$%m-w((n4=7g4j!(x3%=l68t=__j!24-3)0%bjd8i2e5th'
middleware_classes = ('django.middleware.common.CommonMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware')
root_urlconf = 'hostproof_auth.urls'
installed_apps = ('django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.sites', 'django.contrib.messages', 'hostproof_auth')
auth_user_model = 'hostproof_auth.User'
authentication_backends = ('hostproof_auth.auth.ModelBackend',) |
x,y = input().split()
x,y = [float(x),float(y)]
if x == y == 0:
print("Origem")
elif x == 0:
print("Eixo Y")
elif y == 0:
print("Eixo X")
elif x > 0 and y > 0:
print("Q1")
elif x < 0 and y > 0:
print("Q2")
elif x < 0 and y < 0:
print("Q3")
else:
print("Q4")
| (x, y) = input().split()
(x, y) = [float(x), float(y)]
if x == y == 0:
print('Origem')
elif x == 0:
print('Eixo Y')
elif y == 0:
print('Eixo X')
elif x > 0 and y > 0:
print('Q1')
elif x < 0 and y > 0:
print('Q2')
elif x < 0 and y < 0:
print('Q3')
else:
print('Q4') |
"""
Good morning! Here's your coding interview problem for today.
This problem was asked by Apple.
Implement a queue using two stacks. Recall that a queue is a FIFO (first-in, first-out) data structure with the following methods: enqueue, which inserts an element into the queue, and dequeue, which removes it.
https://www.youtube.com/watch?v=AN0axYeLue0
https://www.geeksforgeeks.org/queue-using-stacks/
https://coderbyte.com/algorithm/implement-queue-using-two-stacks
"""
# implement stacks using plain lists with push and pop functions
stack1 = []
stack2 = []
# implement enqueue method by using only stacks
# and the append and pop functions
def enqueue(element):
stack1.append(element)
# implement dequeue method by pushing all elements
# from stack 1 into stack 2, which reverses the order
# and then popping from stack 2
def dequeue():
if len(stack2) == 0:
if len(stack1) == 0:
return 'Cannot dequeue because queue is empty'
while len(stack1) > 0:
stack2.append(stack1.pop())
return stack2.pop()
enqueue('a')
enqueue('b')
enqueue('c')
print(dequeue())
print(dequeue())
| """
Good morning! Here's your coding interview problem for today.
This problem was asked by Apple.
Implement a queue using two stacks. Recall that a queue is a FIFO (first-in, first-out) data structure with the following methods: enqueue, which inserts an element into the queue, and dequeue, which removes it.
https://www.youtube.com/watch?v=AN0axYeLue0
https://www.geeksforgeeks.org/queue-using-stacks/
https://coderbyte.com/algorithm/implement-queue-using-two-stacks
"""
stack1 = []
stack2 = []
def enqueue(element):
stack1.append(element)
def dequeue():
if len(stack2) == 0:
if len(stack1) == 0:
return 'Cannot dequeue because queue is empty'
while len(stack1) > 0:
stack2.append(stack1.pop())
return stack2.pop()
enqueue('a')
enqueue('b')
enqueue('c')
print(dequeue())
print(dequeue()) |
class Solution:
def countOrders(self, n: int) -> int:
kMod = int(1e9) + 7
ans = 1
for i in range(1, n + 1):
ans = ans * i * (i * 2 - 1) % kMod
return ans
| class Solution:
def count_orders(self, n: int) -> int:
k_mod = int(1000000000.0) + 7
ans = 1
for i in range(1, n + 1):
ans = ans * i * (i * 2 - 1) % kMod
return ans |
#########################################
# InMoovArm.py
# more info @: http://myrobotlab.org/service/InMoovArm
#########################################
# this script is provided as a basic scripting guide
# most parts can be run by uncommenting them
# InMoov now can be started in modular pieces through the .config files from full script
# although this script is very short you can still
# do voice control of a InMoov head
# It uses WebkitSpeechRecognition, so you need to use Chrome as your default browser for this script t
#leftPort = "COM20" #modify port according to your board
rightPort = "COM7" #modify port according to your board
# start optional virtual arduino service, used for internal test and virtual inmoov
# virtual=True
if ('virtual' in globals() and virtual):
virtualArduinoRight = Runtime.start("virtualArduinoRight", "VirtualArduino")
virtualArduinoRight.connect(rightPort)
# end used for internal test
#to tweak the default voice
Voice="cmu-bdl-hsmm" #Male US voice
#Voice="cmu-slt-hsmm" #Default female for MarySpeech
mouth = Runtime.createAndStart("i01.mouth", "MarySpeech")
#mouth.installComponentsAcceptLicense(Voice)
mouth.setVoice(Voice)
##############
# starting InMoov service
i01 = Runtime.create("i01", "InMoov")
#Force Arduino to connect (fix Todo)
#left = Runtime.createAndStart("i01.left", "Arduino")
#left.connect(leftPort)
right = Runtime.createAndStart("i01.right", "Arduino")
right.connect(rightPort)
##############
# starting parts
i01.startEar()
# Start the webgui service without starting the browser
webgui = Runtime.create("WebGui","WebGui")
webgui.autoStartBrowser(False)
webgui.startService()
# Then start the browsers and show the WebkitSpeechRecognition service named i01.ear
webgui.startBrowser("http://localhost:8888/#/service/i01.ear")
# As an alternative you can use the line below to show all services in the browser. In that case you should comment out all lines above that starts with webgui.
# webgui = Runtime.createAndStart("webgui","WebGui")
i01.startMouth()
##############
#leftArm = Runtime.create("i01.leftArm","InMoovArm")
#tweak defaults LeftArm
#Velocity
#leftArm.bicep.setVelocity(-1)
#leftArm.rotate.setVelocity(-1)
#leftArm.shoulder.setVelocity(-1)
#leftArm.omoplate.setVelocity(-1)
#Mapping
#leftArm.bicep.map(0,90,45,96)
#leftArm.rotate.map(40,180,60,142)
#leftArm.shoulder.map(0,180,44,150)
#leftArm.omoplate.map(10,80,42,80)
#Rest position
#leftArm.bicep.setRest(5)
#leftArm.rotate.setRest(90)
#leftArm.shoulder.setRest(30)
#leftArm.omoplate.setRest(10)
#################
rightArm = Runtime.create("i01.rightArm","InMoovArm")
# tweak default RightArm
#Velocity
rightArm.bicep.setVelocity(-1)
rightArm.rotate.setVelocity(-1)
rightArm.shoulder.setVelocity(-1)
rightArm.omoplate.setVelocity(-1)
#Mapping
rightArm.bicep.map(0,90,45,96)
rightArm.rotate.map(40,180,75,130)
rightArm.shoulder.map(0,180,44,150)
rightArm.omoplate.map(10,80,43,80)
#Rest position
rightArm.bicep.setRest(5)
rightArm.rotate.setRest(90)
rightArm.shoulder.setRest(30)
rightArm.omoplate.setRest(10)
#################
i01 = Runtime.start("i01","InMoov")
#################
#i01.startLeftArm(leftPort)
i01.startRightArm(rightPort)
#################
#i01.leftArm.setAutoDisable(True)
i01.rightArm.setAutoDisable(True)
#################
# verbal commands
ear = i01.ear
ear.addCommand("attach everything", "i01", "enable")
ear.addCommand("disconnect everything", "i01", "disable")
ear.addCommand("attach left arm", "i01.leftArm", "enable")
ear.addCommand("disconnect left arm", "i01.leftArm", "disable")
ear.addCommand("attach right arm", "i01.rightArm", "enable")
ear.addCommand("disconnect right arm", "i01.rightArm", "disable")
ear.addCommand("rest", "python", "rest")
ear.addCommand("full speed", "python", "fullspeed")
ear.addCommand("arms front", "python", "armsFront")
ear.addCommand("da vinci", "python", "daVinci")
ear.addCommand("capture gesture", ear.getName(), "captureGesture")
ear.addCommand("manual", ear.getName(), "lockOutAllGrammarExcept", "voice control")
ear.addCommand("voice control", ear.getName(), "clearLock")
# Confirmations and Negations are not supported yet in WebkitSpeechRecognition
# So commands will execute immediatley
ear.addComfirmations("yes","correct","ya","yeah", "yes please", "yes of course")
ear.addNegations("no","wrong","nope","nah","no thank you", "no thanks")
############
ear.startListening()
def rest():
#i01.setArmVelocity("left", -1, -1, -1, -1)
i01.setArmVelocity("right", -1, -1, -1, -1)
#i01.moveArm("left",5,90,30,10)
i01.moveArm("right",5,90,30,10)
i01.mouth.speak("Ok, taking rest")
def fullspeed():
#i01.setArmVelocity("left", -1, -1, -1, -1)
i01.setArmVelocity("right", -1, -1, -1, -1)
i01.mouth.speak("All my servos are set to full speed")
def armsFront():
#i01.moveArm("left",13,115,100,20)
i01.moveArm("right",13,115,100,20)
i01.mouth.speak("Moving my arms in front of me")
def daVinci():
i01.startedGesture()
#i01.setArmSpeed("left", 0.80, 0.80, 0.80, 0.80)
i01.setArmVelocity("right", 40, 40, 40, 40)
#i01.moveArm("left",0,118,29,74)
i01.moveArm("right",0,118,29,74)
i01.mouth.speak("This is the pose of Leonardo Da Vinci")
sleep(10)
i01.finishedGesture()
#i01.setArmSpeed("left", 0.70, 0.70, 0.70, 0.70)
i01.setArmSpeed("right", 30, 30, 30, 30)
#i01.moveArm("left",5,90,30,10)
i01.moveArm("right",5,90,30,10) | right_port = 'COM7'
if 'virtual' in globals() and virtual:
virtual_arduino_right = Runtime.start('virtualArduinoRight', 'VirtualArduino')
virtualArduinoRight.connect(rightPort)
voice = 'cmu-bdl-hsmm'
mouth = Runtime.createAndStart('i01.mouth', 'MarySpeech')
mouth.setVoice(Voice)
i01 = Runtime.create('i01', 'InMoov')
right = Runtime.createAndStart('i01.right', 'Arduino')
right.connect(rightPort)
i01.startEar()
webgui = Runtime.create('WebGui', 'WebGui')
webgui.autoStartBrowser(False)
webgui.startService()
webgui.startBrowser('http://localhost:8888/#/service/i01.ear')
i01.startMouth()
right_arm = Runtime.create('i01.rightArm', 'InMoovArm')
rightArm.bicep.setVelocity(-1)
rightArm.rotate.setVelocity(-1)
rightArm.shoulder.setVelocity(-1)
rightArm.omoplate.setVelocity(-1)
rightArm.bicep.map(0, 90, 45, 96)
rightArm.rotate.map(40, 180, 75, 130)
rightArm.shoulder.map(0, 180, 44, 150)
rightArm.omoplate.map(10, 80, 43, 80)
rightArm.bicep.setRest(5)
rightArm.rotate.setRest(90)
rightArm.shoulder.setRest(30)
rightArm.omoplate.setRest(10)
i01 = Runtime.start('i01', 'InMoov')
i01.startRightArm(rightPort)
i01.rightArm.setAutoDisable(True)
ear = i01.ear
ear.addCommand('attach everything', 'i01', 'enable')
ear.addCommand('disconnect everything', 'i01', 'disable')
ear.addCommand('attach left arm', 'i01.leftArm', 'enable')
ear.addCommand('disconnect left arm', 'i01.leftArm', 'disable')
ear.addCommand('attach right arm', 'i01.rightArm', 'enable')
ear.addCommand('disconnect right arm', 'i01.rightArm', 'disable')
ear.addCommand('rest', 'python', 'rest')
ear.addCommand('full speed', 'python', 'fullspeed')
ear.addCommand('arms front', 'python', 'armsFront')
ear.addCommand('da vinci', 'python', 'daVinci')
ear.addCommand('capture gesture', ear.getName(), 'captureGesture')
ear.addCommand('manual', ear.getName(), 'lockOutAllGrammarExcept', 'voice control')
ear.addCommand('voice control', ear.getName(), 'clearLock')
ear.addComfirmations('yes', 'correct', 'ya', 'yeah', 'yes please', 'yes of course')
ear.addNegations('no', 'wrong', 'nope', 'nah', 'no thank you', 'no thanks')
ear.startListening()
def rest():
i01.setArmVelocity('right', -1, -1, -1, -1)
i01.moveArm('right', 5, 90, 30, 10)
i01.mouth.speak('Ok, taking rest')
def fullspeed():
i01.setArmVelocity('right', -1, -1, -1, -1)
i01.mouth.speak('All my servos are set to full speed')
def arms_front():
i01.moveArm('right', 13, 115, 100, 20)
i01.mouth.speak('Moving my arms in front of me')
def da_vinci():
i01.startedGesture()
i01.setArmVelocity('right', 40, 40, 40, 40)
i01.moveArm('right', 0, 118, 29, 74)
i01.mouth.speak('This is the pose of Leonardo Da Vinci')
sleep(10)
i01.finishedGesture()
i01.setArmSpeed('right', 30, 30, 30, 30)
i01.moveArm('right', 5, 90, 30, 10) |
MODE_PLANNING = "Planning"
MODE_NLP = "NLP"
ROWS = 8 # rows in maze
COLS = 8 # columns in maze
GRID_DX = 20.0#20.0 # x-dimension of the grid world
GRID_DY = 10.0#20.0 # y-dimension of the grid world
GRID_DZ = 3.0 * .75 * .5# z-dimension of the grid world
MAX_STEPS = ROWS * COLS * 2 * 90# max number of steps - no need to visit each cell more then twice!
STEP_DELAY = 3.0 # number of seconds to wait between the sense-act-step repeats
NUDGE_X = -5.0 # shift the island in +x by ...
NUDGE_Y = -5.0 # shift the island in +y by ...
WALL_TEMPLATE = "data/shapes/wall/BrickWall.xml"
HISTORY_LENGTH = 5 # number of state-action pairs used to determine if the agent is stuck
OBSTACLE_MASK = 1 #0b0001
AGENT_MASK = 2 #0b0010
| mode_planning = 'Planning'
mode_nlp = 'NLP'
rows = 8
cols = 8
grid_dx = 20.0
grid_dy = 10.0
grid_dz = 3.0 * 0.75 * 0.5
max_steps = ROWS * COLS * 2 * 90
step_delay = 3.0
nudge_x = -5.0
nudge_y = -5.0
wall_template = 'data/shapes/wall/BrickWall.xml'
history_length = 5
obstacle_mask = 1
agent_mask = 2 |
"""
"""
class Order:
pass | """
"""
class Order:
pass |
# Copyright (C) 2016 Goban authors
#
# This software may be modified and distributed under the terms
# of the MIT license. See the LICENSE file for details.
class ColoredStone:
def __init__(self, color):
if color < 0:
raise Exception("invalid stone color")
self.__color = color
def get_color(self):
return self.__color
def set_color(self, color):
if color < 0:
raise Exception("invalid stone color")
self.__color = color
| class Coloredstone:
def __init__(self, color):
if color < 0:
raise exception('invalid stone color')
self.__color = color
def get_color(self):
return self.__color
def set_color(self, color):
if color < 0:
raise exception('invalid stone color')
self.__color = color |
# MULTIPLY STRINGS LEETCODE SOLUTION:
# creating a class.
class Solution(object):
# creating a function to solve the problem.
def multiply(self, num1, num2):
# converting the given strings to integers.
num1 = int(num1)
num2 = int(num2)
# code to find the product of the integers.
product = num1 * num2
# returning the product as a string.
return str(product) | class Solution(object):
def multiply(self, num1, num2):
num1 = int(num1)
num2 = int(num2)
product = num1 * num2
return str(product) |
def fibonacci(N):
"""Return all fibonacci numbers up to N. """
yield 0
if N == 0:
return
a = 0
b = 1
while b <= N:
yield b
a, b = b, a + b
print(list(fibonacci(0))) # [0]
print(list(fibonacci(1))) # [0, 1, 1]
print(list(fibonacci(50))) # [0, 1, 1, 2, 3, 5, 8, 13, 21, 34]
| def fibonacci(N):
"""Return all fibonacci numbers up to N. """
yield 0
if N == 0:
return
a = 0
b = 1
while b <= N:
yield b
(a, b) = (b, a + b)
print(list(fibonacci(0)))
print(list(fibonacci(1)))
print(list(fibonacci(50))) |
def stream_audio(p, chunk, job):
wf = wave.open(job, 'rb')
stream = p.open(format=p.get_format_from_width(wf.getsampwidth()),
channels=wf.getnchannels(),
rate=wf.getframerate(),
output=True)
data = wf.readframes(chunk)
while data != b'':
print(calculate_position_percent(wf.tell(), wf.getnframes()))
stream.write(data)
data = wf.readframes(chunk)
# Check queue and load next element
# stop stream (6)
stream.stop_stream()
stream.close()
wf.close()
return True
def check_audio_device(p):
p.get_default_output_device_info()
device_count = p.get_device_count()
for i in range(0, device_count):
yield p.get_device_info_by_index(i)["name"],p.get_device_info_by_index(i)["index"]
| def stream_audio(p, chunk, job):
wf = wave.open(job, 'rb')
stream = p.open(format=p.get_format_from_width(wf.getsampwidth()), channels=wf.getnchannels(), rate=wf.getframerate(), output=True)
data = wf.readframes(chunk)
while data != b'':
print(calculate_position_percent(wf.tell(), wf.getnframes()))
stream.write(data)
data = wf.readframes(chunk)
stream.stop_stream()
stream.close()
wf.close()
return True
def check_audio_device(p):
p.get_default_output_device_info()
device_count = p.get_device_count()
for i in range(0, device_count):
yield (p.get_device_info_by_index(i)['name'], p.get_device_info_by_index(i)['index']) |
# i = 1
#
# while i <= 5:
# print(i)
# i = i + 1
#
# print("Done")
secret_number = 9
guess_count = 0
guess_limit = 3
while guess_count < guess_limit:
guess = int(input('Guess: '))
guess_count += 1
if guess == secret_number:
print('You won!')
break
else:
print("Sorry, you failed to guess the number")
| secret_number = 9
guess_count = 0
guess_limit = 3
while guess_count < guess_limit:
guess = int(input('Guess: '))
guess_count += 1
if guess == secret_number:
print('You won!')
break
else:
print('Sorry, you failed to guess the number') |
# Tic-Tac-Toe
CROSS = "X"
CIRCLE = "O"
def make_grid():
return list(range(1, 10))
def print_start():
print("Welcome to tic-tac-toe!!!!")
def print_end(winner):
print(winner, "was the winner!!!")
def three_horizontal(grid, player):
for i in range(0,9,3):
if grid[i] == player and grid[i + 1] == player and grid[i + 2] == player:
return True
return False
def three_vertical(grid, player):
for i in range(3):
if grid[i] == player and grid[i + 3] == player and grid[i + 6] == player:
return True
return False
def three_diagonal(grid, player):
first_diagonal = grid[0] == player and grid[4] == player and grid[8] == player
second_diagonal = grid[2] == player and grid[4] == player and grid[6] == player
return first_diagonal or second_diagonal
def is_win(grid, player):
return (three_vertical(grid, player) or
three_horizontal(grid, player) or
three_diagonal(grid, player))
def is_tie(grid):
for i in grid:
if i is not CROSS and i is not CIRCLE:
return False
return True
def draw_grid(grid):
for i in range(0,9,3):
print(str(grid[i]) + "|" + str(grid[i + 1]) + "|" + str(grid[i + 2]))
if i < 6:
print("-----")
print("")
def is_empty(grid, location):
if str(grid[location]) not in CROSS + CIRCLE:
return True
return False
def input_step(player, board):
location = int(input("Where do you want to put your token? "))
if location < 1 or location > 9 or not is_empty(grid, location - 1):
print("Your input was not valid!")
input_step(player, board)
else:
set_board_value(board, player, location - 1)
def set_board_value(board, value, index):
board[index] = value
def change_players(player):
if player == CROSS:
return CIRCLE
else:
return CROSS
grid = make_grid()
current_player = CROSS
print_start()
while not (is_win(grid, change_players(current_player)) or is_tie(grid)):
draw_grid(grid)
input_step(current_player, grid)
current_player = change_players(current_player)
draw_grid(grid)
print_end(change_players(current_player))
| cross = 'X'
circle = 'O'
def make_grid():
return list(range(1, 10))
def print_start():
print('Welcome to tic-tac-toe!!!!')
def print_end(winner):
print(winner, 'was the winner!!!')
def three_horizontal(grid, player):
for i in range(0, 9, 3):
if grid[i] == player and grid[i + 1] == player and (grid[i + 2] == player):
return True
return False
def three_vertical(grid, player):
for i in range(3):
if grid[i] == player and grid[i + 3] == player and (grid[i + 6] == player):
return True
return False
def three_diagonal(grid, player):
first_diagonal = grid[0] == player and grid[4] == player and (grid[8] == player)
second_diagonal = grid[2] == player and grid[4] == player and (grid[6] == player)
return first_diagonal or second_diagonal
def is_win(grid, player):
return three_vertical(grid, player) or three_horizontal(grid, player) or three_diagonal(grid, player)
def is_tie(grid):
for i in grid:
if i is not CROSS and i is not CIRCLE:
return False
return True
def draw_grid(grid):
for i in range(0, 9, 3):
print(str(grid[i]) + '|' + str(grid[i + 1]) + '|' + str(grid[i + 2]))
if i < 6:
print('-----')
print('')
def is_empty(grid, location):
if str(grid[location]) not in CROSS + CIRCLE:
return True
return False
def input_step(player, board):
location = int(input('Where do you want to put your token? '))
if location < 1 or location > 9 or (not is_empty(grid, location - 1)):
print('Your input was not valid!')
input_step(player, board)
else:
set_board_value(board, player, location - 1)
def set_board_value(board, value, index):
board[index] = value
def change_players(player):
if player == CROSS:
return CIRCLE
else:
return CROSS
grid = make_grid()
current_player = CROSS
print_start()
while not (is_win(grid, change_players(current_player)) or is_tie(grid)):
draw_grid(grid)
input_step(current_player, grid)
current_player = change_players(current_player)
draw_grid(grid)
print_end(change_players(current_player)) |
# https://leetcode.com/problems/longest-word-in-dictionary-through-deleting/
# Given a string s and a string array dictionary, return the longest string in the
# dictionary that can be formed by deleting some of the given string characters.
# If there is more than one possible result, return the longest word with the
# smallest lexicographical order. If there is no possible result, return the empty
# string.
################################################################################
# sort dict and check if key can be substr
class Solution:
def findLongestWord(self, s: str, dictionary: List[str]) -> str:
dictionary.sort(key=lambda x: (-len(x), x))
for key in dictionary:
# if key is a substr of s
if self.is_substr(key, s):
return key
return ''
def is_substr(self, substr, s):
i = j = 0
while i < len(substr) and j < len(s):
if substr[i] == s[j]: # move i only when there is a match
i += 1
j += 1
return i == len(substr)
| class Solution:
def find_longest_word(self, s: str, dictionary: List[str]) -> str:
dictionary.sort(key=lambda x: (-len(x), x))
for key in dictionary:
if self.is_substr(key, s):
return key
return ''
def is_substr(self, substr, s):
i = j = 0
while i < len(substr) and j < len(s):
if substr[i] == s[j]:
i += 1
j += 1
return i == len(substr) |
# Copyright 2015 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
class Failure(Exception):
"""StoryTest Exception raised when an undesired but designed-for problem."""
class StoryTest(object):
"""A class for creating story tests.
The overall test run control flow follows this order:
test.WillRunStory
state.WillRunStory
state.RunStory
test.Measure
state.DidRunStory
test.DidRunStory
"""
def WillRunStory(self, platform):
"""Override to do any action before running the story.
This is run before state.WillRunStory.
Args:
platform: The platform that the story will run on.
"""
raise NotImplementedError()
def Measure(self, platform, results):
"""Override to take the measurement.
This is run only if state.RunStory is successful.
Args:
platform: The platform that the story will run on.
results: The results of running the story.
"""
raise NotImplementedError()
def DidRunStory(self, platform, results):
"""Override to do any action after running the story, e.g., clean up.
This is run after state.DidRunStory. And this is always called even if the
test run failed. The |results| object can be used to stored debugging info
related to run.
Args:
platform: The platform that the story will run on.
results: The results of running the story.
"""
raise NotImplementedError()
| class Failure(Exception):
"""StoryTest Exception raised when an undesired but designed-for problem."""
class Storytest(object):
"""A class for creating story tests.
The overall test run control flow follows this order:
test.WillRunStory
state.WillRunStory
state.RunStory
test.Measure
state.DidRunStory
test.DidRunStory
"""
def will_run_story(self, platform):
"""Override to do any action before running the story.
This is run before state.WillRunStory.
Args:
platform: The platform that the story will run on.
"""
raise not_implemented_error()
def measure(self, platform, results):
"""Override to take the measurement.
This is run only if state.RunStory is successful.
Args:
platform: The platform that the story will run on.
results: The results of running the story.
"""
raise not_implemented_error()
def did_run_story(self, platform, results):
"""Override to do any action after running the story, e.g., clean up.
This is run after state.DidRunStory. And this is always called even if the
test run failed. The |results| object can be used to stored debugging info
related to run.
Args:
platform: The platform that the story will run on.
results: The results of running the story.
"""
raise not_implemented_error() |
def process_bike_count_data(df):
"""
Process the provided dataframe: parse datetimes and rename columns.
"""
df.index = pd.to_datetime(df['dag'] + ' ' + df['tijdstip'], format="%d.%m.%y %H:%M:%S")
df = df.drop(['dag', 'tijdstip'], axis=1)
df = df.rename(columns={'noord': 'north', 'zuid':'south', 'actief': 'active'})
return df | def process_bike_count_data(df):
"""
Process the provided dataframe: parse datetimes and rename columns.
"""
df.index = pd.to_datetime(df['dag'] + ' ' + df['tijdstip'], format='%d.%m.%y %H:%M:%S')
df = df.drop(['dag', 'tijdstip'], axis=1)
df = df.rename(columns={'noord': 'north', 'zuid': 'south', 'actief': 'active'})
return df |
def print_function(args, fun):
for x in args:
print('f(', x,')=', fun(x), sep='')
def poly(x):
return 2 * x**2 - 4 * x + 2
print_function([x for x in range(-2, 3)], poly)
# [-2, -1, 0, 1, 2] | def print_function(args, fun):
for x in args:
print('f(', x, ')=', fun(x), sep='')
def poly(x):
return 2 * x ** 2 - 4 * x + 2
print_function([x for x in range(-2, 3)], poly) |
def staircase(size: int = 0) -> str:
"""Generates a staircase of '#', ascending to the right
Args:
size: Width and height of staircase.
Returns:
A string composed of '#' and ' ', separated by '\n'. When printed to
console, renders the following (given 'size' of 5).
#
##
###
####
#####
"""
result = []
for num in range(1, size + 1):
result.append(' ' * (size - num) + '#' * num)
return '\n'.join(result)
| def staircase(size: int=0) -> str:
"""Generates a staircase of '#', ascending to the right
Args:
size: Width and height of staircase.
Returns:
A string composed of '#' and ' ', separated by '
'. When printed to
console, renders the following (given 'size' of 5).
#
##
###
####
#####
"""
result = []
for num in range(1, size + 1):
result.append(' ' * (size - num) + '#' * num)
return '\n'.join(result) |
class ObjDiff(object):
"""Represents a difference between two `CopyDiff` objects.
Contains a list of `DiffField` objects that represent the changes to each
field in the object.
Also contains the `children` field which may be be a `ChildListField`.
"""
def __init__(self, old, new, changes, children=None):
self.old = old
self.new = new
self.changes = changes
self.children = children
def get(self, name):
"""Gets a scalar field with the given name."""
for field in self.changes:
if field.name == name: return field
return None
class DiffField(object):
"""Represents a generic field in a diff."""
def __init__(self, name):
self.name = name
class ScalarField(DiffField):
"""Represents a change to a scalar field (i.e., not a list or dict)"""
def __init__(self, name, old, new):
super().__init__(name)
self.new = new
self.old = old
class ChildListField(DiffField):
"""Represents a change to a list of child objects whose changes are also tracked."""
def __init__(self, name, added, removed, changed):
super().__init__(name)
self.added = added
self.removed = removed
self.changed = changed
class CopyDiff(object):
"""Base class providing copy and diff functions"""
def copy(self, **kwargs):
copy = self.blank(**kwargs)
copy.copy_from(self)
return copy
def copy_from(self, other):
"""Copies changes from `other` to this object."""
# Copy changes to this object
for f in self.copydiff_fields():
setattr(self, f, getattr(other, f))
# Remove children deleted in other
for schild in self.get_children():
if not any(map(lambda o: o.same_as(schild), other.get_children())):
self.rm_child(schild)
# Copy children and add new children to self
for ochild in other.get_children():
# Find a matching child in this object
schild = next(filter(lambda s: ochild.same_as(s), self.get_children()), None)
if schild:
schild.copy_from(ochild)
else:
newchild = self.blank_child()
newchild.copy_from(ochild)
self.add_child(newchild)
def diff(self, new, prefix=[]):
"""
Returns a dict representing the differences between this mod and `new`.
Return value is an `ObjDiff` representing the differences between the objects.
Note: At the moment tracked children are always represented by a field
called `children` and there can only be one. This can be fixed later,
but it's not really needed.
"""
changes = []
for f in self.copydiff_fields():
o = getattr(self, f)
n = getattr(new, f)
if o != n:
changes.append(ScalarField(f, old=o, new=n))
# List removed children
added = []
removed = []
changed = []
# List removed children.
for schild in self.get_children():
if not any(map(lambda n: n.same_as(schild), new.get_children())):
removed.append(schild)
# List added and changed children
for nchild in new.get_children():
# Find a matching child in the old object
ochild = next(filter(lambda s: nchild.same_as(s), self.get_children()), None)
if ochild:
chdiff = ochild.diff(nchild)
if len(chdiff.changes) > 0:
changed.append(chdiff)
else:
added.append(nchild)
# If children changed, add a `ChildListField` to the diff.
if len(added) > 0 or len(removed) > 0 or len(changed) > 0:
children = ChildListField('children', added, removed, changed)
else:
children = None
print(changes)
return ObjDiff(self, new, changes, children)
def blank(self, **kwargs):
"""Creates an "empty" instance of this object"""
raise NotImplementedError
def blank_child(self, **kwargs):
"""Creates an "empty" instance of a child of this object.
None if this object can't have children"""
return None
def copydiff_fields(self):
"""Returns a list of fields to be copied or diffed"""
return []
def same_as(self, other):
scur = hasattr(self, 'cur_id')
ocur = hasattr(other, 'cur_id')
if self.id == other.id: return True
if scur and ocur: return self.cur_id == other.cur_id
elif scur: return self.cur_id == other.id
elif ocur: return other.cur_id == self.id
else: return False
def get_children(self): raise NotImplementedError
def add_child(self, ch): raise NotImplementedError
def rm_child(self, ch): raise NotImplementedError
| class Objdiff(object):
"""Represents a difference between two `CopyDiff` objects.
Contains a list of `DiffField` objects that represent the changes to each
field in the object.
Also contains the `children` field which may be be a `ChildListField`.
"""
def __init__(self, old, new, changes, children=None):
self.old = old
self.new = new
self.changes = changes
self.children = children
def get(self, name):
"""Gets a scalar field with the given name."""
for field in self.changes:
if field.name == name:
return field
return None
class Difffield(object):
"""Represents a generic field in a diff."""
def __init__(self, name):
self.name = name
class Scalarfield(DiffField):
"""Represents a change to a scalar field (i.e., not a list or dict)"""
def __init__(self, name, old, new):
super().__init__(name)
self.new = new
self.old = old
class Childlistfield(DiffField):
"""Represents a change to a list of child objects whose changes are also tracked."""
def __init__(self, name, added, removed, changed):
super().__init__(name)
self.added = added
self.removed = removed
self.changed = changed
class Copydiff(object):
"""Base class providing copy and diff functions"""
def copy(self, **kwargs):
copy = self.blank(**kwargs)
copy.copy_from(self)
return copy
def copy_from(self, other):
"""Copies changes from `other` to this object."""
for f in self.copydiff_fields():
setattr(self, f, getattr(other, f))
for schild in self.get_children():
if not any(map(lambda o: o.same_as(schild), other.get_children())):
self.rm_child(schild)
for ochild in other.get_children():
schild = next(filter(lambda s: ochild.same_as(s), self.get_children()), None)
if schild:
schild.copy_from(ochild)
else:
newchild = self.blank_child()
newchild.copy_from(ochild)
self.add_child(newchild)
def diff(self, new, prefix=[]):
"""
Returns a dict representing the differences between this mod and `new`.
Return value is an `ObjDiff` representing the differences between the objects.
Note: At the moment tracked children are always represented by a field
called `children` and there can only be one. This can be fixed later,
but it's not really needed.
"""
changes = []
for f in self.copydiff_fields():
o = getattr(self, f)
n = getattr(new, f)
if o != n:
changes.append(scalar_field(f, old=o, new=n))
added = []
removed = []
changed = []
for schild in self.get_children():
if not any(map(lambda n: n.same_as(schild), new.get_children())):
removed.append(schild)
for nchild in new.get_children():
ochild = next(filter(lambda s: nchild.same_as(s), self.get_children()), None)
if ochild:
chdiff = ochild.diff(nchild)
if len(chdiff.changes) > 0:
changed.append(chdiff)
else:
added.append(nchild)
if len(added) > 0 or len(removed) > 0 or len(changed) > 0:
children = child_list_field('children', added, removed, changed)
else:
children = None
print(changes)
return obj_diff(self, new, changes, children)
def blank(self, **kwargs):
"""Creates an "empty" instance of this object"""
raise NotImplementedError
def blank_child(self, **kwargs):
"""Creates an "empty" instance of a child of this object.
None if this object can't have children"""
return None
def copydiff_fields(self):
"""Returns a list of fields to be copied or diffed"""
return []
def same_as(self, other):
scur = hasattr(self, 'cur_id')
ocur = hasattr(other, 'cur_id')
if self.id == other.id:
return True
if scur and ocur:
return self.cur_id == other.cur_id
elif scur:
return self.cur_id == other.id
elif ocur:
return other.cur_id == self.id
else:
return False
def get_children(self):
raise NotImplementedError
def add_child(self, ch):
raise NotImplementedError
def rm_child(self, ch):
raise NotImplementedError |
{
"targets": [
{
"target_name": "memcpy",
"sources": [ "src/memcpy.cc" ],
"include_dirs" : [
"<!(node -e \"require('nan')\")",
"<!(node -e \"require('node-arraybuffer')\")"
]
}
]
} | {'targets': [{'target_name': 'memcpy', 'sources': ['src/memcpy.cc'], 'include_dirs': ['<!(node -e "require(\'nan\')")', '<!(node -e "require(\'node-arraybuffer\')")']}]} |
# extracting filter information
c_ang = 2.99792458e18 # speed of light in Angstroms/s
# galex filters
ffuv = open('splash/filters/galex1500.res','r')
fuv_band = array([])
fuv_band_sens = array([])
for line in ffuv:
columns = line.strip().split()
columns = array(columns).astype(float)
fuv_band = append(fuv_band,columns[0])
fuv_band_sens = append(fuv_band_sens,columns[1])
ffuv.close()
#ln_band_nu = numpy.log(c_ang/fuv_band)
#ln_band = numpy.log(fuv_band)
#upper = trapz(ln_band*fuv_band_sens,ln_band_nu)
#lower = trapz(fuv_band_sens,ln_band_nu)
#lambda_eff = exp(upper/lower)
fnuv = open('splash/filters/galex2500.res','r')
nuv_band = array([])
nuv_band_sens = array([])
for line in fnuv:
columns = line.strip().split()
columns = array(columns).astype(float)
nuv_band = append(nuv_band,columns[0])
nuv_band_sens = append(nuv_band_sens,columns[1])
fnuv.close()
# hubble filter
f = open('splash/filters/ACS_F814W.res','r')
f814w_band = array([])
f814w_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
f814w_band = append(f814w_band,columns[0])
f814w_band_sens = append(f814w_band_sens,columns[1])
f.close()
# CFHT
fu = open('splash/filters/u_megaprime_sagem.res','r')
u_band = array([])
u_band_sens = array([])
for line in fu:
columns = line.strip().split()
columns = array(columns).astype(float)
u_band = append(u_band,columns[0])
u_band_sens = append(u_band_sens,columns[1])
fu.close()
# subaru
fb = open('splash/filters/B_subaru.res','r')
bp_band = array([])
bp_band_sens = array([])
for line in fb:
columns = line.strip().split()
columns = array(columns).astype(float)
bp_band = append(bp_band,columns[0])
bp_band_sens = append(bp_band_sens,columns[1])
fb.close()
fv = open('splash/filters/V_subaru.res','r')
vp_band = array([])
vp_band_sens = array([])
for line in fv:
columns = line.strip().split()
columns = array(columns).astype(float)
vp_band = append(vp_band,columns[0])
vp_band_sens = append(vp_band_sens,columns[1])
fv.close()
fg = open('splash/filters/g_subaru.res','r')
gp_band = array([])
gp_band_sens = array([])
for line in fg:
columns = line.strip().split()
columns = array(columns).astype(float)
gp_band = append(gp_band,columns[0])
gp_band_sens = append(gp_band_sens,columns[1])
fg.close()
fr = open('splash/filters/r_subaru.res','r')
rp_band = array([])
rp_band_sens = array([])
for line in fr:
columns = line.strip().split()
columns = array(columns).astype(float)
rp_band = append(rp_band,columns[0])
rp_band_sens = append(rp_band_sens,columns[1])
fr.close()
fi = open('splash/filters/i_subaru.res','r')
ip_band = array([])
ip_band_sens = array([])
for line in fi:
columns = line.strip().split()
columns = array(columns).astype(float)
ip_band = append(ip_band,columns[0])
ip_band_sens = append(ip_band_sens,columns[1])
fi.close()
fi = open('splash/filters/i_subaru.res','r')
ic_band = array([])
ic_band_sens = array([])
for line in fi:
columns = line.strip().split()
columns = array(columns).astype(float)
ic_band = append(ic_band,columns[0])
ic_band_sens = append(ic_band_sens,columns[1])
fi.close()
f = open('splash/filters/z_subaru.res','r')
zp_band = array([])
zp_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
zp_band = append(zp_band,columns[0])
zp_band_sens = append(zp_band_sens,columns[1])
f.close()
fz = open('splash/filters/suprime_FDCCD_z.res','r')
zpp_band = array([])
zpp_band_sens = array([])
for line in fz:
columns = line.strip().split()
columns = array(columns).astype(float)
zpp_band = append(zpp_band,columns[0])
zpp_band_sens = append(zpp_band_sens,columns[1])
fz.close()
# CFHT/UKIRT WFcam/wircam or whatever
fj = open('splash/filters/J_wfcam.res','r')
j_band = array([])
j_band_sens = array([])
for line in fj:
columns = line.strip().split()
columns = array(columns).astype(float)
j_band = append(j_band,columns[0])
j_band_sens = append(j_band_sens,columns[1])
fj.close()
fh = open('splash/filters/wircam_H.res','r')
h_band = array([])
h_band_sens = array([])
for line in fh:
columns = line.strip().split()
columns = array(columns).astype(float)
h_band = append(h_band,columns[0])
h_band_sens = append(h_band_sens,columns[1])
fh.close()
fk = open('splash/filters/flamingos_Ks.res','r')
ks_band = array([])
ks_band_sens = array([])
for line in fk:
columns = line.strip().split()
columns = array(columns).astype(float)
ks_band = append(ks_band,columns[0])
ks_band_sens = append(ks_band_sens,columns[1])
fk.close()
fk = open('splash/filters/wircam_Ks.res','r')
kc_band = array([])
kc_band_sens = array([])
for line in fk:
columns = line.strip().split()
columns = array(columns).astype(float)
kc_band = append(kc_band,columns[0])
kc_band_sens = append(kc_band_sens,columns[1])
fk.close()
# ultravista
f = open('splash/filters/Y_uv.res','r')
y_uv_band = array([])
y_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
y_uv_band = append(y_uv_band,columns[0])
y_uv_band_sens = append(y_uv_band_sens,columns[1])
f.close()
f = open('splash/filters/J_uv.res','r')
j_uv_band = array([])
j_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j_uv_band = append(j_uv_band,columns[0])
j_uv_band_sens = append(j_uv_band_sens,columns[1])
f.close()
f = open('splash/filters/H_uv.res','r')
h_uv_band = array([])
h_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
h_uv_band = append(h_uv_band,columns[0])
h_uv_band_sens = append(h_uv_band_sens,columns[1])
f.close()
f = open('splash/filters/K_uv.res','r')
k_uv_band = array([])
k_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
k_uv_band = append(k_uv_band,columns[0])
k_uv_band_sens = append(k_uv_band_sens,columns[1])
f.close()
# sloan data
f = open('splash/filters/u_SDSS.res','r')
u_s_band = array([])
u_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
u_s_band = append(u_s_band,columns[0])
u_s_band_sens = append(u_s_band_sens,columns[1])
f.close()
f = open('splash/filters/g_SDSS.res','r')
g_s_band = array([])
g_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
g_s_band = append(g_s_band,columns[0])
g_s_band_sens = append(g_s_band_sens,columns[1])
f.close()
f = open('splash/filters/r_SDSS.res','r')
r_s_band = array([])
r_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
r_s_band = append(r_s_band,columns[0])
r_s_band_sens = append(r_s_band_sens,columns[1])
f.close()
f = open('splash/filters/i_SDSS.res','r')
i_s_band = array([])
i_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
i_s_band = append(i_s_band,columns[0])
i_s_band_sens = append(i_s_band_sens,columns[1])
f.close()
f = open('splash/filters/z_SDSS.res','r')
z_s_band = array([])
z_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
z_s_band = append(z_s_band,columns[0])
z_s_band_sens = append(z_s_band_sens,columns[1])
f.close()
# subaru intermediate bands
f = open('splash/filters/IB427.SuprimeCam.pb','r')
IB427_band = array([])
IB427_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB427_band = append(IB427_band,columns[0])
IB427_band_sens = append(IB427_band_sens,columns[1])
f.close()
f = open('splash/filters/IB464.SuprimeCam.pb','r')
IB464_band = array([])
IB464_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB464_band = append(IB464_band,columns[0])
IB464_band_sens = append(IB464_band_sens,columns[1])
f.close()
f = open('splash/filters/IB484.SuprimeCam.pb','r')
IB484_band = array([])
IB484_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB484_band = append(IB484_band,columns[0])
IB484_band_sens = append(IB484_band_sens,columns[1])
f.close()
f = open('splash/filters/IB505.SuprimeCam.pb','r')
IB505_band = array([])
IB505_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB505_band = append(IB505_band,columns[0])
IB505_band_sens = append(IB505_band_sens,columns[1])
f.close()
f = open('splash/filters/IB527.SuprimeCam.pb','r')
IB527_band = array([])
IB527_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB527_band = append(IB527_band,columns[0])
IB527_band_sens = append(IB527_band_sens,columns[1])
f.close()
f = open('splash/filters/IB574.SuprimeCam.pb','r')
IB574_band = array([])
IB574_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB574_band = append(IB574_band,columns[0])
IB574_band_sens = append(IB574_band_sens,columns[1])
f.close()
f = open('splash/filters/IB624.SuprimeCam.pb','r')
IB624_band = array([])
IB624_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB624_band = append(IB624_band,columns[0])
IB624_band_sens = append(IB624_band_sens,columns[1])
f.close()
f = open('splash/filters/IB679.SuprimeCam.pb','r')
IB679_band = array([])
IB679_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB679_band = append(IB679_band,columns[0])
IB679_band_sens = append(IB679_band_sens,columns[1])
f.close()
f = open('splash/filters/IB709.SuprimeCam.pb','r')
IB709_band = array([])
IB709_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB709_band = append(IB709_band,columns[0])
IB709_band_sens = append(IB709_band_sens,columns[1])
f.close()
f = open('splash/filters/IB738.SuprimeCam.pb','r')
IB738_band = array([])
IB738_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB738_band = append(IB738_band,columns[0])
IB738_band_sens = append(IB738_band_sens,columns[1])
f.close()
f = open('splash/filters/IB767.SuprimeCam.pb','r')
IB767_band = array([])
IB767_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB767_band = append(IB767_band,columns[0])
IB767_band_sens = append(IB767_band_sens,columns[1])
f.close()
f = open('splash/filters/IB827.SuprimeCam.pb','r')
IB827_band = array([])
IB827_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
IB827_band = append(IB827_band,columns[0])
IB827_band_sens = append(IB827_band_sens,columns[1])
f.close()
# newfirm bands
f = open('splash/filters/J1.res','r')
j1_band = array([])
j1_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j1_band = append(j1_band,columns[0])
j1_band_sens = append(j1_band_sens,columns[1])
f.close()
f = open('splash/filters/J2.res','r')
j2_band = array([])
j2_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j2_band = append(j2_band,columns[0])
j2_band_sens = append(j2_band_sens,columns[1])
f.close()
f = open('splash/filters/J3.res','r')
j3_band = array([])
j3_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j3_band = append(j3_band,columns[0])
j3_band_sens = append(j3_band_sens,columns[1])
f.close()
f = open('splash/filters/H1.res','r')
h1_band = array([])
h1_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
h1_band = append(h1_band,columns[0])
h1_band_sens = append(h1_band_sens,columns[1])
f.close()
f = open('splash/filters/H2.res','r')
h2_band = array([])
h2_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
h2_band = append(h2_band,columns[0])
h2_band_sens = append(h2_band_sens,columns[1])
f.close()
f = open('splash/filters/Ks_newfirm.res','r')
knf_band = array([])
knf_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
knf_band = append(knf_band,columns[0])
knf_band_sens = append(knf_band_sens,columns[1])
f.close()
# subaru narrow bands
f = open('splash/filters/NB711.SuprimeCam.pb','r')
NB711_band = array([])
NB711_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
NB711_band = append(NB711_band,columns[0])
NB711_band_sens = append(NB711_band_sens,columns[1])
f.close()
f = open('splash/filters/NB816.SuprimeCam.pb','r')
NB816_band = array([])
NB816_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
NB816_band = append(NB816_band,columns[0])
NB816_band_sens = append(NB816_band_sens,columns[1])
f.close()
# spitzer bands
fch1 = open('splash/filters/irac_ch1.res','r')
ch1_band = array([])
ch1_band_sens = array([])
for line in fch1:
columns = line.strip().split()
columns = array(columns).astype(float)
ch1_band = append(ch1_band,columns[0])
ch1_band_sens = append(ch1_band_sens,columns[1])
fch1.close()
fch2 = open('splash/filters/irac_ch2.res','r')
ch2_band = array([])
ch2_band_sens = array([])
for line in fch2:
columns = line.strip().split()
columns = array(columns).astype(float)
ch2_band = append(ch2_band,columns[0])
ch2_band_sens = append(ch2_band_sens,columns[1])
fch2.close()
fch3 = open('splash/filters/irac_ch3.res','r')
ch3_band = array([])
ch3_band_sens = array([])
for line in fch3:
columns = line.strip().split()
columns = array(columns).astype(float)
ch3_band = append(ch3_band,columns[0])
ch3_band_sens = append(ch3_band_sens,columns[1])
fch3.close()
fch4 = open('splash/filters/irac_ch4.res','r')
ch4_band = array([])
ch4_band_sens = array([])
for line in fch4:
columns = line.strip().split()
columns = array(columns).astype(float)
ch4_band = append(ch4_band,columns[0])
ch4_band_sens = append(ch4_band_sens,columns[1])
fch4.close()
##### Extracting filter effective band centers
# centers of the relevant bands (taken from Olivier+09, VISTA filter page,
# Fukugita+96, newfirm filter doc, and stsci WFC3 handbook c06_uvis06 table 6.2)
# Includes:
# Galex
# u (CFHT), b-z (subaru), zpp (subaru - calculated, but might be a bit off)
# IB,NB subaru
# i (CFHT)
# wfcam (J), wircam (H,Kc), flamingos (Ks)
# spitzer
# ultravista
# sloan
# newfirm
# hubble f814w
## ALL OF THESE HAVE BEEN PAINSTAKINGLY ORDERED - KEEP THEM THIS WAY
fuv_cent = 1551.3
nuv_cent = 2306.5
u_s_cent = 3540.0
u_cent = 3911.0
ib427_cent = 4256.3
b_cent = 4439.6
ib464_cent = 4633.3
gp_cent = 4728.3
g_s_cent = 4770.0
ib484_cent = 4845.9
ib505_cent = 5060.7
ib527_cent = 5258.9
vp_cent = 5448.9
ib574_cent = 5762.1
r_s_cent = 6222.0
ib624_cent = 6230.0
rp_cent = 6231.8
ib679_cent = 6778.8
ib709_cent = 7070.7
nb711_cent = 7119.6
ib738_cent = 7358.7
ic_cent = 7628.9
ip_cent = 7629.1
i_s_cent = 7632.0
ib767_cent = 7681.2
f814w_cent = 8024
nb816_cent = 8149.0
ib827_cent = 8240.9
zp_cent = 9021.6
z_s_cent = 9049.0
zpp_cent = 9077.4
y_uv_cent = 10210.0
j1_cent = 10484.0
j2_cent = 11903.0
j_cent = 12444.1
j_uv_cent = 12540.0
j3_cent = 12837.0
h1_cent = 15557.0
h_uv_cent = 16460.0
h2_cent = 17059.0
ks_cent = 21434.8
kc_cent = 21480.2
k_uv_cent = 21490.0
knf_cent = 21500.0
ch1_cent = 35262.5
ch2_cent = 44606.7
ch3_cent = 56762.4
ch4_cent = 77030.1
| c_ang = 2.99792458e+18
ffuv = open('splash/filters/galex1500.res', 'r')
fuv_band = array([])
fuv_band_sens = array([])
for line in ffuv:
columns = line.strip().split()
columns = array(columns).astype(float)
fuv_band = append(fuv_band, columns[0])
fuv_band_sens = append(fuv_band_sens, columns[1])
ffuv.close()
fnuv = open('splash/filters/galex2500.res', 'r')
nuv_band = array([])
nuv_band_sens = array([])
for line in fnuv:
columns = line.strip().split()
columns = array(columns).astype(float)
nuv_band = append(nuv_band, columns[0])
nuv_band_sens = append(nuv_band_sens, columns[1])
fnuv.close()
f = open('splash/filters/ACS_F814W.res', 'r')
f814w_band = array([])
f814w_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
f814w_band = append(f814w_band, columns[0])
f814w_band_sens = append(f814w_band_sens, columns[1])
f.close()
fu = open('splash/filters/u_megaprime_sagem.res', 'r')
u_band = array([])
u_band_sens = array([])
for line in fu:
columns = line.strip().split()
columns = array(columns).astype(float)
u_band = append(u_band, columns[0])
u_band_sens = append(u_band_sens, columns[1])
fu.close()
fb = open('splash/filters/B_subaru.res', 'r')
bp_band = array([])
bp_band_sens = array([])
for line in fb:
columns = line.strip().split()
columns = array(columns).astype(float)
bp_band = append(bp_band, columns[0])
bp_band_sens = append(bp_band_sens, columns[1])
fb.close()
fv = open('splash/filters/V_subaru.res', 'r')
vp_band = array([])
vp_band_sens = array([])
for line in fv:
columns = line.strip().split()
columns = array(columns).astype(float)
vp_band = append(vp_band, columns[0])
vp_band_sens = append(vp_band_sens, columns[1])
fv.close()
fg = open('splash/filters/g_subaru.res', 'r')
gp_band = array([])
gp_band_sens = array([])
for line in fg:
columns = line.strip().split()
columns = array(columns).astype(float)
gp_band = append(gp_band, columns[0])
gp_band_sens = append(gp_band_sens, columns[1])
fg.close()
fr = open('splash/filters/r_subaru.res', 'r')
rp_band = array([])
rp_band_sens = array([])
for line in fr:
columns = line.strip().split()
columns = array(columns).astype(float)
rp_band = append(rp_band, columns[0])
rp_band_sens = append(rp_band_sens, columns[1])
fr.close()
fi = open('splash/filters/i_subaru.res', 'r')
ip_band = array([])
ip_band_sens = array([])
for line in fi:
columns = line.strip().split()
columns = array(columns).astype(float)
ip_band = append(ip_band, columns[0])
ip_band_sens = append(ip_band_sens, columns[1])
fi.close()
fi = open('splash/filters/i_subaru.res', 'r')
ic_band = array([])
ic_band_sens = array([])
for line in fi:
columns = line.strip().split()
columns = array(columns).astype(float)
ic_band = append(ic_band, columns[0])
ic_band_sens = append(ic_band_sens, columns[1])
fi.close()
f = open('splash/filters/z_subaru.res', 'r')
zp_band = array([])
zp_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
zp_band = append(zp_band, columns[0])
zp_band_sens = append(zp_band_sens, columns[1])
f.close()
fz = open('splash/filters/suprime_FDCCD_z.res', 'r')
zpp_band = array([])
zpp_band_sens = array([])
for line in fz:
columns = line.strip().split()
columns = array(columns).astype(float)
zpp_band = append(zpp_band, columns[0])
zpp_band_sens = append(zpp_band_sens, columns[1])
fz.close()
fj = open('splash/filters/J_wfcam.res', 'r')
j_band = array([])
j_band_sens = array([])
for line in fj:
columns = line.strip().split()
columns = array(columns).astype(float)
j_band = append(j_band, columns[0])
j_band_sens = append(j_band_sens, columns[1])
fj.close()
fh = open('splash/filters/wircam_H.res', 'r')
h_band = array([])
h_band_sens = array([])
for line in fh:
columns = line.strip().split()
columns = array(columns).astype(float)
h_band = append(h_band, columns[0])
h_band_sens = append(h_band_sens, columns[1])
fh.close()
fk = open('splash/filters/flamingos_Ks.res', 'r')
ks_band = array([])
ks_band_sens = array([])
for line in fk:
columns = line.strip().split()
columns = array(columns).astype(float)
ks_band = append(ks_band, columns[0])
ks_band_sens = append(ks_band_sens, columns[1])
fk.close()
fk = open('splash/filters/wircam_Ks.res', 'r')
kc_band = array([])
kc_band_sens = array([])
for line in fk:
columns = line.strip().split()
columns = array(columns).astype(float)
kc_band = append(kc_band, columns[0])
kc_band_sens = append(kc_band_sens, columns[1])
fk.close()
f = open('splash/filters/Y_uv.res', 'r')
y_uv_band = array([])
y_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
y_uv_band = append(y_uv_band, columns[0])
y_uv_band_sens = append(y_uv_band_sens, columns[1])
f.close()
f = open('splash/filters/J_uv.res', 'r')
j_uv_band = array([])
j_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j_uv_band = append(j_uv_band, columns[0])
j_uv_band_sens = append(j_uv_band_sens, columns[1])
f.close()
f = open('splash/filters/H_uv.res', 'r')
h_uv_band = array([])
h_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
h_uv_band = append(h_uv_band, columns[0])
h_uv_band_sens = append(h_uv_band_sens, columns[1])
f.close()
f = open('splash/filters/K_uv.res', 'r')
k_uv_band = array([])
k_uv_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
k_uv_band = append(k_uv_band, columns[0])
k_uv_band_sens = append(k_uv_band_sens, columns[1])
f.close()
f = open('splash/filters/u_SDSS.res', 'r')
u_s_band = array([])
u_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
u_s_band = append(u_s_band, columns[0])
u_s_band_sens = append(u_s_band_sens, columns[1])
f.close()
f = open('splash/filters/g_SDSS.res', 'r')
g_s_band = array([])
g_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
g_s_band = append(g_s_band, columns[0])
g_s_band_sens = append(g_s_band_sens, columns[1])
f.close()
f = open('splash/filters/r_SDSS.res', 'r')
r_s_band = array([])
r_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
r_s_band = append(r_s_band, columns[0])
r_s_band_sens = append(r_s_band_sens, columns[1])
f.close()
f = open('splash/filters/i_SDSS.res', 'r')
i_s_band = array([])
i_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
i_s_band = append(i_s_band, columns[0])
i_s_band_sens = append(i_s_band_sens, columns[1])
f.close()
f = open('splash/filters/z_SDSS.res', 'r')
z_s_band = array([])
z_s_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
z_s_band = append(z_s_band, columns[0])
z_s_band_sens = append(z_s_band_sens, columns[1])
f.close()
f = open('splash/filters/IB427.SuprimeCam.pb', 'r')
ib427_band = array([])
ib427_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib427_band = append(IB427_band, columns[0])
ib427_band_sens = append(IB427_band_sens, columns[1])
f.close()
f = open('splash/filters/IB464.SuprimeCam.pb', 'r')
ib464_band = array([])
ib464_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib464_band = append(IB464_band, columns[0])
ib464_band_sens = append(IB464_band_sens, columns[1])
f.close()
f = open('splash/filters/IB484.SuprimeCam.pb', 'r')
ib484_band = array([])
ib484_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib484_band = append(IB484_band, columns[0])
ib484_band_sens = append(IB484_band_sens, columns[1])
f.close()
f = open('splash/filters/IB505.SuprimeCam.pb', 'r')
ib505_band = array([])
ib505_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib505_band = append(IB505_band, columns[0])
ib505_band_sens = append(IB505_band_sens, columns[1])
f.close()
f = open('splash/filters/IB527.SuprimeCam.pb', 'r')
ib527_band = array([])
ib527_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib527_band = append(IB527_band, columns[0])
ib527_band_sens = append(IB527_band_sens, columns[1])
f.close()
f = open('splash/filters/IB574.SuprimeCam.pb', 'r')
ib574_band = array([])
ib574_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib574_band = append(IB574_band, columns[0])
ib574_band_sens = append(IB574_band_sens, columns[1])
f.close()
f = open('splash/filters/IB624.SuprimeCam.pb', 'r')
ib624_band = array([])
ib624_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib624_band = append(IB624_band, columns[0])
ib624_band_sens = append(IB624_band_sens, columns[1])
f.close()
f = open('splash/filters/IB679.SuprimeCam.pb', 'r')
ib679_band = array([])
ib679_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib679_band = append(IB679_band, columns[0])
ib679_band_sens = append(IB679_band_sens, columns[1])
f.close()
f = open('splash/filters/IB709.SuprimeCam.pb', 'r')
ib709_band = array([])
ib709_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib709_band = append(IB709_band, columns[0])
ib709_band_sens = append(IB709_band_sens, columns[1])
f.close()
f = open('splash/filters/IB738.SuprimeCam.pb', 'r')
ib738_band = array([])
ib738_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib738_band = append(IB738_band, columns[0])
ib738_band_sens = append(IB738_band_sens, columns[1])
f.close()
f = open('splash/filters/IB767.SuprimeCam.pb', 'r')
ib767_band = array([])
ib767_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib767_band = append(IB767_band, columns[0])
ib767_band_sens = append(IB767_band_sens, columns[1])
f.close()
f = open('splash/filters/IB827.SuprimeCam.pb', 'r')
ib827_band = array([])
ib827_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
ib827_band = append(IB827_band, columns[0])
ib827_band_sens = append(IB827_band_sens, columns[1])
f.close()
f = open('splash/filters/J1.res', 'r')
j1_band = array([])
j1_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j1_band = append(j1_band, columns[0])
j1_band_sens = append(j1_band_sens, columns[1])
f.close()
f = open('splash/filters/J2.res', 'r')
j2_band = array([])
j2_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j2_band = append(j2_band, columns[0])
j2_band_sens = append(j2_band_sens, columns[1])
f.close()
f = open('splash/filters/J3.res', 'r')
j3_band = array([])
j3_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
j3_band = append(j3_band, columns[0])
j3_band_sens = append(j3_band_sens, columns[1])
f.close()
f = open('splash/filters/H1.res', 'r')
h1_band = array([])
h1_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
h1_band = append(h1_band, columns[0])
h1_band_sens = append(h1_band_sens, columns[1])
f.close()
f = open('splash/filters/H2.res', 'r')
h2_band = array([])
h2_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
h2_band = append(h2_band, columns[0])
h2_band_sens = append(h2_band_sens, columns[1])
f.close()
f = open('splash/filters/Ks_newfirm.res', 'r')
knf_band = array([])
knf_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
knf_band = append(knf_band, columns[0])
knf_band_sens = append(knf_band_sens, columns[1])
f.close()
f = open('splash/filters/NB711.SuprimeCam.pb', 'r')
nb711_band = array([])
nb711_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
nb711_band = append(NB711_band, columns[0])
nb711_band_sens = append(NB711_band_sens, columns[1])
f.close()
f = open('splash/filters/NB816.SuprimeCam.pb', 'r')
nb816_band = array([])
nb816_band_sens = array([])
for line in f:
columns = line.strip().split()
columns = array(columns).astype(float)
nb816_band = append(NB816_band, columns[0])
nb816_band_sens = append(NB816_band_sens, columns[1])
f.close()
fch1 = open('splash/filters/irac_ch1.res', 'r')
ch1_band = array([])
ch1_band_sens = array([])
for line in fch1:
columns = line.strip().split()
columns = array(columns).astype(float)
ch1_band = append(ch1_band, columns[0])
ch1_band_sens = append(ch1_band_sens, columns[1])
fch1.close()
fch2 = open('splash/filters/irac_ch2.res', 'r')
ch2_band = array([])
ch2_band_sens = array([])
for line in fch2:
columns = line.strip().split()
columns = array(columns).astype(float)
ch2_band = append(ch2_band, columns[0])
ch2_band_sens = append(ch2_band_sens, columns[1])
fch2.close()
fch3 = open('splash/filters/irac_ch3.res', 'r')
ch3_band = array([])
ch3_band_sens = array([])
for line in fch3:
columns = line.strip().split()
columns = array(columns).astype(float)
ch3_band = append(ch3_band, columns[0])
ch3_band_sens = append(ch3_band_sens, columns[1])
fch3.close()
fch4 = open('splash/filters/irac_ch4.res', 'r')
ch4_band = array([])
ch4_band_sens = array([])
for line in fch4:
columns = line.strip().split()
columns = array(columns).astype(float)
ch4_band = append(ch4_band, columns[0])
ch4_band_sens = append(ch4_band_sens, columns[1])
fch4.close()
fuv_cent = 1551.3
nuv_cent = 2306.5
u_s_cent = 3540.0
u_cent = 3911.0
ib427_cent = 4256.3
b_cent = 4439.6
ib464_cent = 4633.3
gp_cent = 4728.3
g_s_cent = 4770.0
ib484_cent = 4845.9
ib505_cent = 5060.7
ib527_cent = 5258.9
vp_cent = 5448.9
ib574_cent = 5762.1
r_s_cent = 6222.0
ib624_cent = 6230.0
rp_cent = 6231.8
ib679_cent = 6778.8
ib709_cent = 7070.7
nb711_cent = 7119.6
ib738_cent = 7358.7
ic_cent = 7628.9
ip_cent = 7629.1
i_s_cent = 7632.0
ib767_cent = 7681.2
f814w_cent = 8024
nb816_cent = 8149.0
ib827_cent = 8240.9
zp_cent = 9021.6
z_s_cent = 9049.0
zpp_cent = 9077.4
y_uv_cent = 10210.0
j1_cent = 10484.0
j2_cent = 11903.0
j_cent = 12444.1
j_uv_cent = 12540.0
j3_cent = 12837.0
h1_cent = 15557.0
h_uv_cent = 16460.0
h2_cent = 17059.0
ks_cent = 21434.8
kc_cent = 21480.2
k_uv_cent = 21490.0
knf_cent = 21500.0
ch1_cent = 35262.5
ch2_cent = 44606.7
ch3_cent = 56762.4
ch4_cent = 77030.1 |
class Move:
""" A Player where the user chooses its moves.
=== Public Attributes ===
row:
The row that move takes place.
col:
The column that move takes place.
"""
row: int
col: int
def __init__(self, row: int, col: int) -> None:
""" Creates Move with <row> row and <col> column.
"""
self.row = row
self.col = col
def get_row(self) -> int:
""" Returns the row.
"""
return self.row
def get_col(self) -> int:
""" Returns the column.
"""
return self.col
def to_string(self) -> str:
""" Returns the string representation of Move in (row, column).
"""
return "(" + str(self.row) + "," + str(self.col) + ")"
| class Move:
""" A Player where the user chooses its moves.
=== Public Attributes ===
row:
The row that move takes place.
col:
The column that move takes place.
"""
row: int
col: int
def __init__(self, row: int, col: int) -> None:
""" Creates Move with <row> row and <col> column.
"""
self.row = row
self.col = col
def get_row(self) -> int:
""" Returns the row.
"""
return self.row
def get_col(self) -> int:
""" Returns the column.
"""
return self.col
def to_string(self) -> str:
""" Returns the string representation of Move in (row, column).
"""
return '(' + str(self.row) + ',' + str(self.col) + ')' |
def calculate_subsidy(income, children_count):
if 30_000 <= income < 40_000 and children_count >= 3:
return 1000 * children_count
elif 20_000 <= income < 30_000 and children_count >= 2:
return 1500 * children_count
elif income < 20_000:
return 2000 * children_count
return 0
income = float(input("Inserire il reddito annuo (-1 per uscire): "))
while income >= 0:
children = int(input("Inserire il numero di figli: "))
subsidy = round(calculate_subsidy(income, children), 2)
if subsidy == 0:
print("La famiglia non ha diritto ad un sussidio annuo.")
else:
print(f"La famiglia ha diritto a {subsidy}$ di sussidio annuo.")
income = float(input("Inserire il reddito annuo (-1 per uscire): "))
| def calculate_subsidy(income, children_count):
if 30000 <= income < 40000 and children_count >= 3:
return 1000 * children_count
elif 20000 <= income < 30000 and children_count >= 2:
return 1500 * children_count
elif income < 20000:
return 2000 * children_count
return 0
income = float(input('Inserire il reddito annuo (-1 per uscire): '))
while income >= 0:
children = int(input('Inserire il numero di figli: '))
subsidy = round(calculate_subsidy(income, children), 2)
if subsidy == 0:
print('La famiglia non ha diritto ad un sussidio annuo.')
else:
print(f'La famiglia ha diritto a {subsidy}$ di sussidio annuo.')
income = float(input('Inserire il reddito annuo (-1 per uscire): ')) |
#Let's teach the Robots to distinguish words and numbers.
#You are given a string with words and numbers separated by whitespaces (one space).
#The words contains only letters. You should check if the string contains three words in succession.
#For example, the string "start 5 one two three 7 end" contains three words in succession.
def checkio(string):
string = string.split()
lista = []
for c in string:
if c.isalpha():
lista.append(c)
if len(lista)==3:
break
else:
lista.clear()
if len(lista)==3:
return True
else:
return False
if __name__ == '__main__':
print('Example:')
print(checkio("Hello World hello"))
print(checkio("haaas h366lo hello"))
print(checkio('o 111 rato roeu a 111roupa do rei de roma'))
print(checkio('he is 123 man'))
print(checkio('one two 3 four five six 7 eight 9 ten eleven 12')) | def checkio(string):
string = string.split()
lista = []
for c in string:
if c.isalpha():
lista.append(c)
if len(lista) == 3:
break
else:
lista.clear()
if len(lista) == 3:
return True
else:
return False
if __name__ == '__main__':
print('Example:')
print(checkio('Hello World hello'))
print(checkio('haaas h366lo hello'))
print(checkio('o 111 rato roeu a 111roupa do rei de roma'))
print(checkio('he is 123 man'))
print(checkio('one two 3 four five six 7 eight 9 ten eleven 12')) |
# Time: O(logn)
# Space: O(1)
class Solution(object):
def singleNonDuplicate(self, nums):
"""
:type nums: List[int]
:rtype: int
"""
left, right = 0, len(nums)-1
while left <= right:
mid = left + (right - left) / 2
if not (mid%2 == 0 and mid+1 < len(nums) and \
nums[mid] == nums[mid+1]) and \
not (mid%2 == 1 and nums[mid] == nums[mid-1]):
right = mid-1
else:
left = mid+1
return nums[left]
| class Solution(object):
def single_non_duplicate(self, nums):
"""
:type nums: List[int]
:rtype: int
"""
(left, right) = (0, len(nums) - 1)
while left <= right:
mid = left + (right - left) / 2
if not (mid % 2 == 0 and mid + 1 < len(nums) and (nums[mid] == nums[mid + 1])) and (not (mid % 2 == 1 and nums[mid] == nums[mid - 1])):
right = mid - 1
else:
left = mid + 1
return nums[left] |
class resolutions(object):
res_1080p = '1080p'
res_720p = '720p'
res_1080i = '1080i'
res_1024x768 = '1024x768'
res_1360x768 = '1360x768'
class modes(object):
single = 'single'
pip = 'pip'
side_full = 'side_full'
side_scale = 'side_scale'
class ports(object):
port_1 = '1'
port_2 = '2'
class pip_positions(object):
top_left = 'top_left'
top_right = 'top_right'
bottom_left = 'bottom_left'
bottom_right = 'bottom_right'
class pip_sizes(object):
small = 'small'
medium = 'medium'
large = 'large'
class pip_borders(object):
show = 'show'
hide = 'hide'
| class Resolutions(object):
res_1080p = '1080p'
res_720p = '720p'
res_1080i = '1080i'
res_1024x768 = '1024x768'
res_1360x768 = '1360x768'
class Modes(object):
single = 'single'
pip = 'pip'
side_full = 'side_full'
side_scale = 'side_scale'
class Ports(object):
port_1 = '1'
port_2 = '2'
class Pip_Positions(object):
top_left = 'top_left'
top_right = 'top_right'
bottom_left = 'bottom_left'
bottom_right = 'bottom_right'
class Pip_Sizes(object):
small = 'small'
medium = 'medium'
large = 'large'
class Pip_Borders(object):
show = 'show'
hide = 'hide' |
#!/usr/bin/env python
# -*- coding: utf-8 -*-
"""
:Purpose: This module contains various low-level conversion functions.
:Platform: Linux/Windows | Python 3.8
:Developer: J Berendt
:Email: development@s3dev.uk
:Comments: These functions are designed to be as close to core Python,
or a C-esque implementation, as possible.
"""
# TODO: Move repeated messages into a central messaging class.
def ascii2bin(asciistring: str) -> str:
"""Convert an ASCII string into a binary string representation.
Args:
asciistring (str): ASCII string to be converted.
Returns:
str: A binary string representation for the passed ASCII text.
"""
return ''.join(map(int2bin, ascii2int(asciistring)))
def ascii2hex(asciistring: str) -> str:
"""Convert an ASCII string into a hexidecimal string.
Args:
asciistring (str): ASCII string to be converted.
Returns:
str: A hexidecimal string representation of the passed ASCII
text.
"""
return ''.join(map(int2hex, ascii2int(asciistring)))
def ascii2int(asciistring: str) -> list:
"""Convert an ASCII string to a list of integers.
Args:
asciistring (str): ASCII string to be converted.
Returns:
list: A list of integers, as converted from he ASCII string.
"""
return [ord(i) for i in asciistring]
def bin2ascii(binstring: str, bits: int=8) -> str:
"""Convert a binary string representation into ASCII text.
Args:
binstring (str): Binary string to be converted.
bits (int, optional): Bit chunks into which the binary string is
broken for conversion. Defaults to 8.
Returns:
str: An ASCII string representation of the passed binary string.
"""
if len(binstring) % bits:
raise ValueError('The string length cannot be broken into '
f'{bits}-bit chunks.')
ints = []
for chunk in range(0, len(binstring), bits):
byte_ = binstring[chunk:chunk+bits]
ints.append(bin2int(byte_, bits=bits)[0])
text = ''.join(map(int2ascii, ints))
return text
def bin2int(binstring: str, bits: int=8) -> int:
"""Convert a binary string representation into an integer.
Args:
binstring (str): Binary string to be converted.
bits (int, optional): Bit chunks into which the binary string is
broken for conversion. Defaults to 8.
Returns:
int: Integer value from the binary string.
"""
if len(binstring) % bits:
raise ValueError('The string length cannot be broken into '
f'{bits}-bit chunks.')
ints = []
for chunk in range(0, len(binstring), bits):
int_ = 0
s = 0
byte = binstring[chunk:chunk+bits]
for b in range(len(byte)-1, -1, -1):
int_ += int(byte[b]) << s
s += 1
ints.append(int_)
return ints
def bin2hex(binstring: str, bits: int=8) -> str:
"""Convert a binary string representation into a hex string.
Args:
binstring (str): Binary string to be converted.
bits (int, optional): Bit chunks into which the binary string is
broken for conversion. Defaults to 8.
Returns:
A hexidecimal string representation of the passed binary string.
"""
if len(binstring) % bits:
raise ValueError('The string length cannot be broken into '
f'{bits}-bit chunks.')
return ''.join(int2hex(i) for i in bin2int(binstring, bits=bits))
def hex2ascii(hexstring: str) -> str:
"""Convert a hexidecimal string to ASCII text.
Args:
hexstring (str): Hex string to be converted.
Returns:
str: An ASCII string representation for the passed hex string.
"""
return ''.join(map(int2ascii, hex2int(hexstring)))
def hex2bin(hexstring: str) -> str:
"""Convert a hexidecimal string into a binary string representation.
Args:
hexstring (str): Hex string to be converted.
Returns:
str: A binary string representation of the passed hex string.
"""
return ''.join(map(int2bin, hex2int(hexstring)))
def hex2int(hexstring: str, nbytes: int=1) -> int:
"""Convert a hexidecimal string to an integer.
Args:
hexstring (str): Hex string to be converted.
nbytes (int, optional): Number of bytes to consider for each
decimal value. Defaults to 1.
:Examples:
Example usage::
hex2int(hexstring='c0ffee', nbytes=1)
>>> [192, 255, 238]
hex2int(hexstring='c0ffee', nbytes=2)
>>> [49407, 238]
hex2int(hexstring='c0ffee', nbytes=3)
>>> [12648430]
Returns:
list: A list of decimal values, as converted from the hex string.
"""
nbytes *= 2
out = []
# Split hex string into (n)-byte size chunks.
for chunk in range(0, len(hexstring), nbytes):
i = 0
for char in hexstring[chunk:nbytes+chunk]:
if (char >= '0') & (char <= '9'): nib = ord(char)
if (char >= 'a') & (char <= 'f'): nib = ord(char) + 9
if (char >= 'A') & (char <= 'F'): nib = ord(char) + 9
i = (i << 4) | (nib & 0xf)
out.append(i)
return out
def int2ascii(i: int) -> str:
"""Convert an integer to an ASCII character.
Args:
i (int): Integer value to be converted to ASCII text.
Note:
The passed integer value must be <= 127.
Raises:
ValueError: If the passed integer is > 127.
Returns:
str: The ASCII character associated to the passed integer.
"""
if i > 127:
raise ValueError('The passed integer value must be <= 127.')
return chr(i)
def int2bin(i: int) -> str:
"""Convert an 8-bit integer to a binary string.
Args:
i (int): Integer value to be converted.
Note:
The passed integer value must be <= 255.
Raises:
ValueError: If the passed integer is > 255.
Returns:
str: A binary string representation of the passed integer.
"""
if i > 255: # Limited to 1 byte.
raise ValueError(f'Passed value exceeds 1 byte: {i=}')
return ''.join(str((i >> shift) & 1) for shift in range(7, -1, -1))
def int2hex(i: int) -> str:
"""Convert an integer into a hexidecimal string.
Args:
i (int): Integer value to be converted.
Returns:
str: A two character hexidecimal string for the passed integer
value.
"""
chars = '0123456789abcdef'
out = ''
out_ = ''
while i > 0:
out_ += chars[i % 16]
i //= 16
# Output string must be reversed.
for x in range(len(out_)-1, -1, -1):
out += out_[x]
# Pad so all hex values are two characters.
if len(out) < 2:
out = '0' + out
return out
| """
:Purpose: This module contains various low-level conversion functions.
:Platform: Linux/Windows | Python 3.8
:Developer: J Berendt
:Email: development@s3dev.uk
:Comments: These functions are designed to be as close to core Python,
or a C-esque implementation, as possible.
"""
def ascii2bin(asciistring: str) -> str:
"""Convert an ASCII string into a binary string representation.
Args:
asciistring (str): ASCII string to be converted.
Returns:
str: A binary string representation for the passed ASCII text.
"""
return ''.join(map(int2bin, ascii2int(asciistring)))
def ascii2hex(asciistring: str) -> str:
"""Convert an ASCII string into a hexidecimal string.
Args:
asciistring (str): ASCII string to be converted.
Returns:
str: A hexidecimal string representation of the passed ASCII
text.
"""
return ''.join(map(int2hex, ascii2int(asciistring)))
def ascii2int(asciistring: str) -> list:
"""Convert an ASCII string to a list of integers.
Args:
asciistring (str): ASCII string to be converted.
Returns:
list: A list of integers, as converted from he ASCII string.
"""
return [ord(i) for i in asciistring]
def bin2ascii(binstring: str, bits: int=8) -> str:
"""Convert a binary string representation into ASCII text.
Args:
binstring (str): Binary string to be converted.
bits (int, optional): Bit chunks into which the binary string is
broken for conversion. Defaults to 8.
Returns:
str: An ASCII string representation of the passed binary string.
"""
if len(binstring) % bits:
raise value_error(f'The string length cannot be broken into {bits}-bit chunks.')
ints = []
for chunk in range(0, len(binstring), bits):
byte_ = binstring[chunk:chunk + bits]
ints.append(bin2int(byte_, bits=bits)[0])
text = ''.join(map(int2ascii, ints))
return text
def bin2int(binstring: str, bits: int=8) -> int:
"""Convert a binary string representation into an integer.
Args:
binstring (str): Binary string to be converted.
bits (int, optional): Bit chunks into which the binary string is
broken for conversion. Defaults to 8.
Returns:
int: Integer value from the binary string.
"""
if len(binstring) % bits:
raise value_error(f'The string length cannot be broken into {bits}-bit chunks.')
ints = []
for chunk in range(0, len(binstring), bits):
int_ = 0
s = 0
byte = binstring[chunk:chunk + bits]
for b in range(len(byte) - 1, -1, -1):
int_ += int(byte[b]) << s
s += 1
ints.append(int_)
return ints
def bin2hex(binstring: str, bits: int=8) -> str:
"""Convert a binary string representation into a hex string.
Args:
binstring (str): Binary string to be converted.
bits (int, optional): Bit chunks into which the binary string is
broken for conversion. Defaults to 8.
Returns:
A hexidecimal string representation of the passed binary string.
"""
if len(binstring) % bits:
raise value_error(f'The string length cannot be broken into {bits}-bit chunks.')
return ''.join((int2hex(i) for i in bin2int(binstring, bits=bits)))
def hex2ascii(hexstring: str) -> str:
"""Convert a hexidecimal string to ASCII text.
Args:
hexstring (str): Hex string to be converted.
Returns:
str: An ASCII string representation for the passed hex string.
"""
return ''.join(map(int2ascii, hex2int(hexstring)))
def hex2bin(hexstring: str) -> str:
"""Convert a hexidecimal string into a binary string representation.
Args:
hexstring (str): Hex string to be converted.
Returns:
str: A binary string representation of the passed hex string.
"""
return ''.join(map(int2bin, hex2int(hexstring)))
def hex2int(hexstring: str, nbytes: int=1) -> int:
"""Convert a hexidecimal string to an integer.
Args:
hexstring (str): Hex string to be converted.
nbytes (int, optional): Number of bytes to consider for each
decimal value. Defaults to 1.
:Examples:
Example usage::
hex2int(hexstring='c0ffee', nbytes=1)
>>> [192, 255, 238]
hex2int(hexstring='c0ffee', nbytes=2)
>>> [49407, 238]
hex2int(hexstring='c0ffee', nbytes=3)
>>> [12648430]
Returns:
list: A list of decimal values, as converted from the hex string.
"""
nbytes *= 2
out = []
for chunk in range(0, len(hexstring), nbytes):
i = 0
for char in hexstring[chunk:nbytes + chunk]:
if (char >= '0') & (char <= '9'):
nib = ord(char)
if (char >= 'a') & (char <= 'f'):
nib = ord(char) + 9
if (char >= 'A') & (char <= 'F'):
nib = ord(char) + 9
i = i << 4 | nib & 15
out.append(i)
return out
def int2ascii(i: int) -> str:
"""Convert an integer to an ASCII character.
Args:
i (int): Integer value to be converted to ASCII text.
Note:
The passed integer value must be <= 127.
Raises:
ValueError: If the passed integer is > 127.
Returns:
str: The ASCII character associated to the passed integer.
"""
if i > 127:
raise value_error('The passed integer value must be <= 127.')
return chr(i)
def int2bin(i: int) -> str:
"""Convert an 8-bit integer to a binary string.
Args:
i (int): Integer value to be converted.
Note:
The passed integer value must be <= 255.
Raises:
ValueError: If the passed integer is > 255.
Returns:
str: A binary string representation of the passed integer.
"""
if i > 255:
raise value_error(f'Passed value exceeds 1 byte: i={i!r}')
return ''.join((str(i >> shift & 1) for shift in range(7, -1, -1)))
def int2hex(i: int) -> str:
"""Convert an integer into a hexidecimal string.
Args:
i (int): Integer value to be converted.
Returns:
str: A two character hexidecimal string for the passed integer
value.
"""
chars = '0123456789abcdef'
out = ''
out_ = ''
while i > 0:
out_ += chars[i % 16]
i //= 16
for x in range(len(out_) - 1, -1, -1):
out += out_[x]
if len(out) < 2:
out = '0' + out
return out |
# Please complete the following exercise this week. Write a Python script containing a function called factorial()
# that takes a single input/argument (x) which is a positive integer and returns its factorial.
# The factorial of a number is that number multiplied by all of the positive numbers less than it.
# For example, the factorial of 5 is 5x4x3x2x1 which equals 120.
# You should, in your script, test the function by calling it with the values 5, 7, and 10.
# First define function factorial(x) returning factorial of input x
def factorial(x):
result = x
for a in range(x-1,1,-1):
result = result * a
return result
# Test for numbers 5,7,10
for x in (5,7,10):
print(f"{x}! = ",factorial(x))
# Results checked using scientifict calculator factorial function | def factorial(x):
result = x
for a in range(x - 1, 1, -1):
result = result * a
return result
for x in (5, 7, 10):
print(f'{x}! = ', factorial(x)) |
class Generic:
def __init__(self, **kwargs):
self.__dict__.update(kwargs) | class Generic:
def __init__(self, **kwargs):
self.__dict__.update(kwargs) |
while True:
if hero.canCast("regen"):
bernardDistance = hero.distanceTo("Bernard")
if bernardDistance < 10:
hero.cast("regen", "Bernard")
chandraDistance = hero.distanceTo("Chandra")
if chandraDistance < 10:
hero.cast("regen", "Chandra")
else:
enemy = hero.findNearestEnemy()
if enemy and hero.distanceTo(enemy) <= hero.attackRange:
hero.attack(enemy);
| while True:
if hero.canCast('regen'):
bernard_distance = hero.distanceTo('Bernard')
if bernardDistance < 10:
hero.cast('regen', 'Bernard')
chandra_distance = hero.distanceTo('Chandra')
if chandraDistance < 10:
hero.cast('regen', 'Chandra')
else:
enemy = hero.findNearestEnemy()
if enemy and hero.distanceTo(enemy) <= hero.attackRange:
hero.attack(enemy) |
m=0
n=120120
while 1:
c=0
for i in range(1,n+1):
if (n*n)%i==0:
#print("--------",i,(n*n)%i,(n*(n+i))%i)
c+=1
if c>m:
m=c
print(n,m)
if(m>=1000):
break
else:
n+=20 | m = 0
n = 120120
while 1:
c = 0
for i in range(1, n + 1):
if n * n % i == 0:
c += 1
if c > m:
m = c
print(n, m)
if m >= 1000:
break
else:
n += 20 |
"""Configuration File for pyCon server and client"""
HOST = '127.0.0.1'
PORT = 8000
SERVER_ADDRESS = 'http://127.0.0.1:8000' | """Configuration File for pyCon server and client"""
host = '127.0.0.1'
port = 8000
server_address = 'http://127.0.0.1:8000' |
# 3Sum fixes one number and uses either the two pointers pattern or a hash set to find complementary pairs. Thus, the time complexity is O(N^2)
# Two Pointers
class Solution:
def threeSumClosest(self, nums: List[int], target: int) -> int:
diff = float('inf')
nums.sort()
for i in range(len(nums)):
# set up two pointers
lo, hi = i+1,len(nums)-1
while (lo<hi):
sum = nums[i]+nums[lo]+nums[hi]
if abs(target - sum) < abs(diff):
diff = target - sum
if sum < target:
lo+=1
else:
hi-=1
if diff == 0:
break
return target - diff
# Time: O(N^2): O(NlogN + N^2)
# Space:O(logN) to O(N) | class Solution:
def three_sum_closest(self, nums: List[int], target: int) -> int:
diff = float('inf')
nums.sort()
for i in range(len(nums)):
(lo, hi) = (i + 1, len(nums) - 1)
while lo < hi:
sum = nums[i] + nums[lo] + nums[hi]
if abs(target - sum) < abs(diff):
diff = target - sum
if sum < target:
lo += 1
else:
hi -= 1
if diff == 0:
break
return target - diff |
# mypy: allow-untyped-defs
class EventListener:
def __init__(self, dispatcher_token):
super().__init__()
self.dispatcher_token = dispatcher_token
self.token = None
def send_message(self, message):
raise Exception("Client.send_message(message) not implemented!")
| class Eventlistener:
def __init__(self, dispatcher_token):
super().__init__()
self.dispatcher_token = dispatcher_token
self.token = None
def send_message(self, message):
raise exception('Client.send_message(message) not implemented!') |
class SkuItem():
def __init__(self, id, lookup, other_offers=None) -> None:
self._id = id
self._lookup = lookup
self._unrelated_offers = other_offers if other_offers is not None else {}
def _calc_free_unrealted_items(self, count):
res = {}
for other_id, other_count in self._unrelated_offers.items():
if other_id == self._id:
continue
# count how many free there should be
res[other_id] = count//other_count
return res
def calculate_cost(self, items_count: int) -> int:
items_cost = 0
if self._id in self._unrelated_offers:
# check how many free Fs by checking groups of (2+1)
offer_counts = items_count // (self._unrelated_offers[self._id] + 1)
# apply cost with reduced effective count
items_cost += self._lookup[1]*(items_count - offer_counts)
else:
remaining_count = items_count
offer_amounts = list(self._lookup.keys())
offer_amounts.sort(reverse=True)
for offer_units in offer_amounts:
offer_collection_price = self._lookup[offer_units]
speacials_count = remaining_count // offer_units
remaining_count = remaining_count % offer_units
items_cost += speacials_count*offer_collection_price
assert remaining_count == 0
return items_cost, self._calc_free_unrealted_items(items_count)
| class Skuitem:
def __init__(self, id, lookup, other_offers=None) -> None:
self._id = id
self._lookup = lookup
self._unrelated_offers = other_offers if other_offers is not None else {}
def _calc_free_unrealted_items(self, count):
res = {}
for (other_id, other_count) in self._unrelated_offers.items():
if other_id == self._id:
continue
res[other_id] = count // other_count
return res
def calculate_cost(self, items_count: int) -> int:
items_cost = 0
if self._id in self._unrelated_offers:
offer_counts = items_count // (self._unrelated_offers[self._id] + 1)
items_cost += self._lookup[1] * (items_count - offer_counts)
else:
remaining_count = items_count
offer_amounts = list(self._lookup.keys())
offer_amounts.sort(reverse=True)
for offer_units in offer_amounts:
offer_collection_price = self._lookup[offer_units]
speacials_count = remaining_count // offer_units
remaining_count = remaining_count % offer_units
items_cost += speacials_count * offer_collection_price
assert remaining_count == 0
return (items_cost, self._calc_free_unrealted_items(items_count)) |
n = int(input())
values = [int(input()) for _ in range(n)]
values_10_20 = [value for value in values if value >= 10 and value <= 20]
print('{} in'.format(len(values_10_20)))
print('{} out'.format(len(values) - len(values_10_20)))
| n = int(input())
values = [int(input()) for _ in range(n)]
values_10_20 = [value for value in values if value >= 10 and value <= 20]
print('{} in'.format(len(values_10_20)))
print('{} out'.format(len(values) - len(values_10_20))) |
class SessionHelper:
def __init__(self, app):
self.app = app
def login(self, username, password):
driver = self.app.driver
self.app.open_page()
driver.find_element_by_name("username").click()
driver.find_element_by_name("username").clear()
driver.find_element_by_name("username").send_keys(username)
driver.find_element_by_xpath("//div/div").click()
driver.find_element_by_name("password").click()
driver.find_element_by_name("password").clear()
driver.find_element_by_name("password").send_keys(password)
driver.find_element_by_xpath("//button[@type='submit']").click()
def logout(self):
driver = self.app.driver
driver.find_element_by_xpath("//div[@id='app']/aside/div[2]/div/div[2]/div/div/div/div").click()
driver.find_element_by_xpath("//button[@type='submit']").click()
def is_logged_in(self):
driver = self.app.driver
return len(driver.find_elements_by_xpath("//button[@type='submit']")) > 0
def is_logged_in_as(self, username):
driver = self.app.driver
return driver.find_element_by_xpath("//div[@id='app']/aside/div[2]/div/div[2]/div/div/div/div").text == username
def ensure_logout(self):
driver = self.app.driver
if self.is_logged_in():
self.logout()
def ensure_login(self, username, password):
driver = self.app.driver
if self.is_logged_in():
if self.is_logged_in_as(username):
return
else:
self.logout()
self.login(username, password)
| class Sessionhelper:
def __init__(self, app):
self.app = app
def login(self, username, password):
driver = self.app.driver
self.app.open_page()
driver.find_element_by_name('username').click()
driver.find_element_by_name('username').clear()
driver.find_element_by_name('username').send_keys(username)
driver.find_element_by_xpath('//div/div').click()
driver.find_element_by_name('password').click()
driver.find_element_by_name('password').clear()
driver.find_element_by_name('password').send_keys(password)
driver.find_element_by_xpath("//button[@type='submit']").click()
def logout(self):
driver = self.app.driver
driver.find_element_by_xpath("//div[@id='app']/aside/div[2]/div/div[2]/div/div/div/div").click()
driver.find_element_by_xpath("//button[@type='submit']").click()
def is_logged_in(self):
driver = self.app.driver
return len(driver.find_elements_by_xpath("//button[@type='submit']")) > 0
def is_logged_in_as(self, username):
driver = self.app.driver
return driver.find_element_by_xpath("//div[@id='app']/aside/div[2]/div/div[2]/div/div/div/div").text == username
def ensure_logout(self):
driver = self.app.driver
if self.is_logged_in():
self.logout()
def ensure_login(self, username, password):
driver = self.app.driver
if self.is_logged_in():
if self.is_logged_in_as(username):
return
else:
self.logout()
self.login(username, password) |
# Definition for a binary tree node.
# class TreeNode(object):
# def __init__(self, x):
# self.val = x
# self.left = None
# self.right = None
"""
timecomplexity= O(n) spacecomplexity = O(n)
serialize
construct recusive function to covert tree into string replace None by '# ' and use ' ' to separate each node
deserialize
At first, define a list which element is from the string split ' ', then check special tase if len is 0 or only '#' in the List
construct recusive function to get tree node from the List by pop the [0] from it.
"""
class Codec:
def serialize(self, root):
"""Encodes a tree to a single string.
:type root: TreeNode
:rtype: str
"""
def rserialize(root,string):
if root == None:
string += '# '
else:
string += str(root.val) + ' '
string = rserialize(root.left,string)
string = rserialize(root.right, string)
return string
string = rserialize(root, '')
return string
def deserialize(self, data):
"""Decodes your encoded data to tree.
:type data: str
:rtype: TreeNode
"""
def rdeserialize(l):
if len(l) == 0:
return
if l[0] == '#':
l.pop(0)
return None
root = TreeNode(l[0])
l.pop(0)
root.left = rdeserialize(l)
root.right = rdeserialize(l)
return root
data_list = data.split(' ')
return rdeserialize(data_list)
# Your Codec object will be instantiated and called as such:
# codec = Codec()
# codec.deserialize(codec.serialize(root))
| """
timecomplexity= O(n) spacecomplexity = O(n)
serialize
construct recusive function to covert tree into string replace None by '# ' and use ' ' to separate each node
deserialize
At first, define a list which element is from the string split ' ', then check special tase if len is 0 or only '#' in the List
construct recusive function to get tree node from the List by pop the [0] from it.
"""
class Codec:
def serialize(self, root):
"""Encodes a tree to a single string.
:type root: TreeNode
:rtype: str
"""
def rserialize(root, string):
if root == None:
string += '# '
else:
string += str(root.val) + ' '
string = rserialize(root.left, string)
string = rserialize(root.right, string)
return string
string = rserialize(root, '')
return string
def deserialize(self, data):
"""Decodes your encoded data to tree.
:type data: str
:rtype: TreeNode
"""
def rdeserialize(l):
if len(l) == 0:
return
if l[0] == '#':
l.pop(0)
return None
root = tree_node(l[0])
l.pop(0)
root.left = rdeserialize(l)
root.right = rdeserialize(l)
return root
data_list = data.split(' ')
return rdeserialize(data_list) |
# -*- coding: utf-8 -*-
__version__ = '0.0.2'
__author__ = 'matteo vezzola <matteo@studioripiu.it>'
default_app_config = 'ripiu.cmsplugin_vivus.apps.VivusConfig'
| __version__ = '0.0.2'
__author__ = 'matteo vezzola <matteo@studioripiu.it>'
default_app_config = 'ripiu.cmsplugin_vivus.apps.VivusConfig' |
'''
Given an array of integers heights representing the histogram's bar
height where the width of each bar is 1, return the area of the
largest rectangle in the histogram.
Time Complexity : O(N^2)
'''
def Largest_Rectangle_In_Histogram(height):
height.append(0)
res = 0
st = [-1]
for i in range(len(height)):
# store the heights in increasing order in the stack
while height[i]<height[st[-1]]:
h = height[st.pop()]
w = i - st[-1] - 1
res = max(res,h*w)
st.append(i)
height.pop()
return res
height = [2,1,5,6,2,3]
print(Largest_Rectangle_In_Histogram(height))
| """
Given an array of integers heights representing the histogram's bar
height where the width of each bar is 1, return the area of the
largest rectangle in the histogram.
Time Complexity : O(N^2)
"""
def largest__rectangle__in__histogram(height):
height.append(0)
res = 0
st = [-1]
for i in range(len(height)):
while height[i] < height[st[-1]]:
h = height[st.pop()]
w = i - st[-1] - 1
res = max(res, h * w)
st.append(i)
height.pop()
return res
height = [2, 1, 5, 6, 2, 3]
print(largest__rectangle__in__histogram(height)) |
"""Gazebo colors.
https://bitbucket.org/osrf/gazebo/src/default/media/materials/scripts/gazebo.material?fileviewer=file-view-default#gazebo.material-129
"""
materials = {
'Gazebo/Grey': {
'ambient': [0.3, 0.3, 0.3, 1.0],
'diffuse': [0.7, 0.7, 0.7, 1.0],
'specular': [0.01, 0.01, 0.01, 1.0]
},
'Gazebo/Gray': {
'ambient': [0.3, 0.3, 0.3, 1.0],
'diffuse': [0.7, 0.7, 0.7, 1.0],
'specular': [0.01, 0.01, 0.01, 1.0]
},
'Gazebo/DarkGrey': {
'ambient': [0.175, 0.175, 0.175, 1.0],
'diffuse': [0.175, 0.175, 0.175, 1.0],
'specular': [0.175, 0.175, 0.175, 1.0]
},
'Gazebo/DarkGray': {
'ambient': [0.175, 0.175, 0.175, 1.0],
'diffuse': [0.175, 0.175, 0.175, 1.0],
'specular': [0.175, 0.175, 0.175, 1.0]
},
'Gazebo/White': {
'ambient': [1, 1, 1, 1],
'diffuse': [1, 1, 1, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/FlatBlack': {
'ambient': [0.1, 0.1, 0.1, 1],
'diffuse': [0.1, 0.1, 0.1, 1],
'specular': [0.01, 0.01, 0.01, 1.0]
},
'Gazebo/Black': {
'ambient': [0, 0, 0, 1],
'diffuse': [0, 0, 0, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/Red': {
'ambient': [1, 0, 0, 1],
'diffuse': [1, 0, 0, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/RedBright': {
'ambient': [0.87, 0.26, 0.07, 1],
'diffuse': [0.87, 0.26, 0.07, 1],
'specular': [0.87, 0.26, 0.07, 1]
},
'Gazebo/Green': {
'ambient': [0, 1, 0, 1],
'diffuse': [0, 1, 0, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/Blue': {
'ambient': [0, 0, 1, 1],
'diffuse': [0, 0, 1, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/SkyBlue': {
'ambient': [0.13, 0.44, 0.70, 1],
'diffuse': [0, 0, 1, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/Yellow': {
'ambient': [1, 1, 0, 1],
'diffuse': [1, 1, 0, 1],
'specular': [0, 0, 0, 1]
},
'Gazebo/ZincYellow': {
'ambient': [0.9725, 0.9529, 0.2078, 1],
'diffuse': [0.9725, 0.9529, 0.2078, 1],
'specular': [0.9725, 0.9529, 0.2078, 1]
},
'Gazebo/DarkYellow': {
'ambient': [0.7, 0.7, 0, 1],
'diffuse': [0.7, 0.7, 0, 1],
'specular': [0, 0, 0, 1]
},
'Gazebo/Purple': {
'ambient': [1, 0, 1, 1],
'diffuse': [1, 0, 1, 1],
'emissive': [1, 0, 1, 1]
},
'Gazebo/Turquoise': {
'ambient': [0, 1, 1, 1],
'diffuse': [0, 1, 1, 1],
'specular': [0.1, 0.1, 0.1, 1]
},
'Gazebo/Orange': {
'ambient': [1, 0.5088, 0.0468, 1],
'diffuse': [1, 0.5088, 0.0468, 1],
'specular': [0.5, 0.5, 0.5, 1]
},
'Gazebo/Indigo': {
'ambient': [0.33, 0.0, 0.5, 1],
'diffuse': [0.33, 0.0, 0.5, 1],
'specular': [0.1, 0.1, 0.1, 1]
}
}
| """Gazebo colors.
https://bitbucket.org/osrf/gazebo/src/default/media/materials/scripts/gazebo.material?fileviewer=file-view-default#gazebo.material-129
"""
materials = {'Gazebo/Grey': {'ambient': [0.3, 0.3, 0.3, 1.0], 'diffuse': [0.7, 0.7, 0.7, 1.0], 'specular': [0.01, 0.01, 0.01, 1.0]}, 'Gazebo/Gray': {'ambient': [0.3, 0.3, 0.3, 1.0], 'diffuse': [0.7, 0.7, 0.7, 1.0], 'specular': [0.01, 0.01, 0.01, 1.0]}, 'Gazebo/DarkGrey': {'ambient': [0.175, 0.175, 0.175, 1.0], 'diffuse': [0.175, 0.175, 0.175, 1.0], 'specular': [0.175, 0.175, 0.175, 1.0]}, 'Gazebo/DarkGray': {'ambient': [0.175, 0.175, 0.175, 1.0], 'diffuse': [0.175, 0.175, 0.175, 1.0], 'specular': [0.175, 0.175, 0.175, 1.0]}, 'Gazebo/White': {'ambient': [1, 1, 1, 1], 'diffuse': [1, 1, 1, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/FlatBlack': {'ambient': [0.1, 0.1, 0.1, 1], 'diffuse': [0.1, 0.1, 0.1, 1], 'specular': [0.01, 0.01, 0.01, 1.0]}, 'Gazebo/Black': {'ambient': [0, 0, 0, 1], 'diffuse': [0, 0, 0, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/Red': {'ambient': [1, 0, 0, 1], 'diffuse': [1, 0, 0, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/RedBright': {'ambient': [0.87, 0.26, 0.07, 1], 'diffuse': [0.87, 0.26, 0.07, 1], 'specular': [0.87, 0.26, 0.07, 1]}, 'Gazebo/Green': {'ambient': [0, 1, 0, 1], 'diffuse': [0, 1, 0, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/Blue': {'ambient': [0, 0, 1, 1], 'diffuse': [0, 0, 1, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/SkyBlue': {'ambient': [0.13, 0.44, 0.7, 1], 'diffuse': [0, 0, 1, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/Yellow': {'ambient': [1, 1, 0, 1], 'diffuse': [1, 1, 0, 1], 'specular': [0, 0, 0, 1]}, 'Gazebo/ZincYellow': {'ambient': [0.9725, 0.9529, 0.2078, 1], 'diffuse': [0.9725, 0.9529, 0.2078, 1], 'specular': [0.9725, 0.9529, 0.2078, 1]}, 'Gazebo/DarkYellow': {'ambient': [0.7, 0.7, 0, 1], 'diffuse': [0.7, 0.7, 0, 1], 'specular': [0, 0, 0, 1]}, 'Gazebo/Purple': {'ambient': [1, 0, 1, 1], 'diffuse': [1, 0, 1, 1], 'emissive': [1, 0, 1, 1]}, 'Gazebo/Turquoise': {'ambient': [0, 1, 1, 1], 'diffuse': [0, 1, 1, 1], 'specular': [0.1, 0.1, 0.1, 1]}, 'Gazebo/Orange': {'ambient': [1, 0.5088, 0.0468, 1], 'diffuse': [1, 0.5088, 0.0468, 1], 'specular': [0.5, 0.5, 0.5, 1]}, 'Gazebo/Indigo': {'ambient': [0.33, 0.0, 0.5, 1], 'diffuse': [0.33, 0.0, 0.5, 1], 'specular': [0.1, 0.1, 0.1, 1]}} |
class SetSettings:
def __init__(self, token: str, version: int = 1):
self.token: str = token
self.version: int = version
self.headers: dict = dict(Authorization=self.token)
self.url: str = 'http://devapi.set.uz'
self.main_api: str = f'{self.url}/api/v{self.version}/integration'
| class Setsettings:
def __init__(self, token: str, version: int=1):
self.token: str = token
self.version: int = version
self.headers: dict = dict(Authorization=self.token)
self.url: str = 'http://devapi.set.uz'
self.main_api: str = f'{self.url}/api/v{self.version}/integration' |
#!/usr/bin/env python
# -*- coding:utf-8 -*-
# file:__init__.py.py
# author:PigKinght
# datetime:2021/8/26 15:26
# software: PyCharm
"""
this is function description
"""
| """
this is function description
""" |
def trailingZeroes(n):
res = 0
i = 5
while i <= n:
res+= n//i
i*=5
return res
n = 30
print("Number of Zeros in factorial of {0} is ".format(n),trailingZeroes(n)) | def trailing_zeroes(n):
res = 0
i = 5
while i <= n:
res += n // i
i *= 5
return res
n = 30
print('Number of Zeros in factorial of {0} is '.format(n), trailing_zeroes(n)) |
# Given the names and grades for each student in a Physics class of N students,
# store them in a nested list and print the name(s) of any student(s) having the second lowest grade.
# Note: If there are multiple students with the same grade, order their names alphabetically
# and print each name on a new line.
#
# Input Format
# The first line contains an integer, N, the number of students.
# The 2N subsequent lines describe each student over 2 lines;
# the first line contains a student's name, and the second line contains their grade.
#
# Constraints
# 2 <= N <= 5
# There will always be one or more students having the second lowest grade.
# Output Format
# Print the name(s) of any student(s) having the second lowest grade in Physics;
# if there are multiple students, order their names alphabetically and print each one on a new line.
#
# Sample Input
# 5
# Harry
# 37.21
# Berry
# 37.21
# Tina
# 37.2
# Akriti
# 41
# Harsh
# 39
#
# Sample Output
# Berry
# Harry
# inputs
students_quantity = int(input())
students = [[str(input()), float(input())] for i in range(students_quantity)]
# get the lowest grade and remove all occurences of it from the list of grades
lowest_grade = min([grade for name, grade in students])
grades = [grade for name, grade in students]
lowest_grade_count = grades.count(lowest_grade)
for i in range(lowest_grade_count):
grades.remove(lowest_grade)
# get the second lowest grade and
# check which students have this grade
second_lowest_grade = min(grades)
second_lowest_grade_students = [name for name, grade in students if grade == second_lowest_grade]
second_lowest_grade_students.sort()
# print in alphabetical order the students names
for student_name in second_lowest_grade_students:
print(student_name)
| students_quantity = int(input())
students = [[str(input()), float(input())] for i in range(students_quantity)]
lowest_grade = min([grade for (name, grade) in students])
grades = [grade for (name, grade) in students]
lowest_grade_count = grades.count(lowest_grade)
for i in range(lowest_grade_count):
grades.remove(lowest_grade)
second_lowest_grade = min(grades)
second_lowest_grade_students = [name for (name, grade) in students if grade == second_lowest_grade]
second_lowest_grade_students.sort()
for student_name in second_lowest_grade_students:
print(student_name) |
class Joueur():
def __init__(self, tour):
self._score = 0
self._tour = tour
self.listeCouleurs = []
def getScore(self):
return self._score
def ajouterScore(self, valeur):
self._score += valeur
def getTour(self):
return self._tour
def setTour(self, tour):
self._tour = tour
def getCouleurs(self):
return self.listeCouleurs
def ajouterCouleur(self, couleur):
self.listeCouleurs.append(couleur)
def getNombreCouleurs(self):
return len(self.listeCouleurs) | class Joueur:
def __init__(self, tour):
self._score = 0
self._tour = tour
self.listeCouleurs = []
def get_score(self):
return self._score
def ajouter_score(self, valeur):
self._score += valeur
def get_tour(self):
return self._tour
def set_tour(self, tour):
self._tour = tour
def get_couleurs(self):
return self.listeCouleurs
def ajouter_couleur(self, couleur):
self.listeCouleurs.append(couleur)
def get_nombre_couleurs(self):
return len(self.listeCouleurs) |
__all__ = [
'base_controller',
'mail_send_controller',
'events_controller',
'stats_controller',
'subaccounts_controller',
'subaccounts_delete_controller',
'subaccounts_get_sub_accounts_controller',
'setrecurringcreditddetails_controller',
'subaccounts_setsubaccountcredit_controller',
'subaccounts_update_subaccount_controller',
'subaccounts_create_subaccount_controller',
'suppression_controller',
'domain_delete_controller',
'domain_controller',
] | __all__ = ['base_controller', 'mail_send_controller', 'events_controller', 'stats_controller', 'subaccounts_controller', 'subaccounts_delete_controller', 'subaccounts_get_sub_accounts_controller', 'setrecurringcreditddetails_controller', 'subaccounts_setsubaccountcredit_controller', 'subaccounts_update_subaccount_controller', 'subaccounts_create_subaccount_controller', 'suppression_controller', 'domain_delete_controller', 'domain_controller'] |
def upper_case_name(name):
return name.upper()
if __name__ == "__main__":
name = "Nina"
name_upper = upper_case_name(name)
print(f"Upper case name is {name_upper}")
print("dunder name", __name__) | def upper_case_name(name):
return name.upper()
if __name__ == '__main__':
name = 'Nina'
name_upper = upper_case_name(name)
print(f'Upper case name is {name_upper}')
print('dunder name', __name__) |
# Source : https://leetcode.com/problems/find-all-the-lonely-nodes/
# Author : foxfromworld
# Date : 13/11/2021
# First attempt
# Definition for a binary tree node.
# class TreeNode:
# def __init__(self, val=0, left=None, right=None):
# self.val = val
# self.left = left
# self.right = right
class Solution:
def getLonelyNodes(self, root: Optional[TreeNode]) -> List[int]:
def help(node, ret):
if not node:
return
if not node.left and node.right:
ret.append(node.right.val)
if not node.right and node.left:
ret.append(node.left.val)
help(node.left, ret)
help(node.right, ret)
ret = []
help(root, ret)
return ret
| class Solution:
def get_lonely_nodes(self, root: Optional[TreeNode]) -> List[int]:
def help(node, ret):
if not node:
return
if not node.left and node.right:
ret.append(node.right.val)
if not node.right and node.left:
ret.append(node.left.val)
help(node.left, ret)
help(node.right, ret)
ret = []
help(root, ret)
return ret |
class Solution:
def numSquareSum(self, n):
squareSum = 0
while(n):
squareSum += (n % 10) * (n % 10)
n = int(n / 10)
return squareSum
def isHappy(self, n: int) -> bool:
# initialize slow
# and fast by n
slow, fast = n
while(True):
# move slow number
# by one iteration
slow = self.numSquareSum(slow)
# move fast number
# by two iteration
fast = self.numSquareSum(self.numSquareSum(fast))
if(slow != fast):
continue
else:
break
# if both number meet at 1,
# then return true
return (slow == 1) | class Solution:
def num_square_sum(self, n):
square_sum = 0
while n:
square_sum += n % 10 * (n % 10)
n = int(n / 10)
return squareSum
def is_happy(self, n: int) -> bool:
(slow, fast) = n
while True:
slow = self.numSquareSum(slow)
fast = self.numSquareSum(self.numSquareSum(fast))
if slow != fast:
continue
else:
break
return slow == 1 |
# Patick Corcoran
# Chekc if a number is prime.
# The primes are 2, 3, 5, 7, 11, 13, ...
p = 347
isprime = True
for m in range(2, p-1):
if p % m == 0:
isprime = False
break
if isprime:
print(p, "is a prime number.")
else:
print(p, "is not prime,") | p = 347
isprime = True
for m in range(2, p - 1):
if p % m == 0:
isprime = False
break
if isprime:
print(p, 'is a prime number.')
else:
print(p, 'is not prime,') |
# Leo colorizer control file for yaml mode.
# This file is in the public domain.
# Properties for yaml mode.
properties = {
"indentNextLines": "\\s*([^\\s]+\\s*:|-)\\s*$",
"indentSize": "2",
"noTabs": "true",
"tabSize": "2",
"lineComment": "#",
}
# Attributes dict for yaml_main ruleset.
yaml_main_attributes_dict = {
"default": "null",
"digit_re": "",
"escape": "",
"highlight_digits": "true",
"ignore_case": "true",
"no_word_sep": "",
}
# Dictionary of attributes dictionaries for yaml mode.
attributesDictDict = {
"yaml_main": yaml_main_attributes_dict,
}
# Keywords dict for yaml_main ruleset.
yaml_main_keywords_dict = {}
# Dictionary of keywords dictionaries for yaml mode.
keywordsDictDict = {
"yaml_main": yaml_main_keywords_dict,
}
# Rules for yaml_main ruleset.
def yaml_rule0(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="comment1", regexp="\\s*#.*$",
at_line_start=True, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule1(colorer, s, i):
return colorer.match_seq(s, i, kind="label", seq="---",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule2(colorer, s, i):
return colorer.match_seq(s, i, kind="label", seq="...",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule3(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="]",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule4(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="[",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule5(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="{",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule6(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="}",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule7(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="-",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule8(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="+",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule9(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq="|",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule10(colorer, s, i):
return colorer.match_seq(s, i, kind="operator", seq=">",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule11(colorer, s, i):
return colorer.match_mark_following(s, i, kind="keyword2", pattern="&",
at_line_start=False, at_whitespace_end=False, at_word_start=False, exclude_match=False)
def yaml_rule12(colorer, s, i):
return colorer.match_mark_following(s, i, kind="keyword2", pattern="*",
at_line_start=False, at_whitespace_end=False, at_word_start=False, exclude_match=False)
def yaml_rule13(colorer, s, i):
# Fix #1082:
# Old: regexp="\\s*(-|)?\\s*[^\\s]+\\s*:(\\s|$)"
# Old: at_line_start=True.
return colorer.match_seq_regexp(s, i, kind="keyword1", regexp=r"\s*-?\s*\w+:",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule14(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+~\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule15(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+null\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule16(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+true\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule17(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+false\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule18(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+yes\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule19(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+no\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule20(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+on\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule21(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="literal2", regexp="\\s+off\\s*$",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule22(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="keyword2", regexp="!!(map|seq|str|set|omap|binary)",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule23(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="keyword3", regexp="!![^\\s]+",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
def yaml_rule24(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind="keyword4", regexp="![^\\s]+",
at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate="")
# Rules dict for yaml_main ruleset.
rulesDict1 = {
# EKR: \\s represents [\t\n\r\f\v], so the whitespace characters themselves, rather than a backspace, must be the leadin characters!
# This is a bug in jEdit2py.
"\t":[yaml_rule13,yaml_rule14,yaml_rule15,yaml_rule16,yaml_rule17,yaml_rule18,yaml_rule19,yaml_rule20,yaml_rule21,],
"\n":[yaml_rule13,yaml_rule14,yaml_rule15,yaml_rule16,yaml_rule17,yaml_rule18,yaml_rule19,yaml_rule20,yaml_rule21,],
" ": [yaml_rule13,yaml_rule14,yaml_rule15,yaml_rule16,yaml_rule17,yaml_rule18,yaml_rule19,yaml_rule20,yaml_rule21,],
"#":[yaml_rule0,],
"!": [yaml_rule22,yaml_rule23,yaml_rule24,],
"&": [yaml_rule11,],
"*": [yaml_rule12,],
"+": [yaml_rule8,],
"-": [yaml_rule1,yaml_rule7,yaml_rule13],
# Fix #1082.
".": [yaml_rule2,],
">": [yaml_rule10,],
"[": [yaml_rule4,],
## "\\": [yaml_rule13,yaml_rule14,yaml_rule15,yaml_rule16,yaml_rule17,yaml_rule18,yaml_rule19,yaml_rule20,yaml_rule21,],
"]": [yaml_rule3,],
"{": [yaml_rule5,],
"|": [yaml_rule9,],
"}": [yaml_rule6,],
# Fix #1082.
"A": [yaml_rule13,],
"B": [yaml_rule13,],
"C": [yaml_rule13,],
"D": [yaml_rule13,],
"E": [yaml_rule13,],
"F": [yaml_rule13,],
"G": [yaml_rule13,],
"H": [yaml_rule13,],
"I": [yaml_rule13,],
"J": [yaml_rule13,],
"K": [yaml_rule13,],
"L": [yaml_rule13,],
"M": [yaml_rule13,],
"N": [yaml_rule13,],
"O": [yaml_rule13,],
"P": [yaml_rule13,],
"Q": [yaml_rule13,],
"R": [yaml_rule13,],
"S": [yaml_rule13,],
"T": [yaml_rule13,],
"U": [yaml_rule13,],
"V": [yaml_rule13,],
"W": [yaml_rule13,],
"X": [yaml_rule13,],
"Y": [yaml_rule13,],
"Z": [yaml_rule13,],
"_": [yaml_rule13,],
"a": [yaml_rule13,],
"b": [yaml_rule13,],
"c": [yaml_rule13,],
"d": [yaml_rule13,],
"e": [yaml_rule13,],
"f": [yaml_rule13,],
"g": [yaml_rule13,],
"h": [yaml_rule13,],
"i": [yaml_rule13,],
"j": [yaml_rule13,],
"k": [yaml_rule13,],
"l": [yaml_rule13,],
"m": [yaml_rule13,],
"n": [yaml_rule13,],
"o": [yaml_rule13,],
"p": [yaml_rule13,],
"q": [yaml_rule13,],
"r": [yaml_rule13,],
"s": [yaml_rule13,],
"t": [yaml_rule13,],
"u": [yaml_rule13,],
"v": [yaml_rule13,],
"w": [yaml_rule13,],
"x": [yaml_rule13,],
"y": [yaml_rule13,],
"z": [yaml_rule13,],
}
# x.rulesDictDict for yaml mode.
rulesDictDict = {
"yaml_main": rulesDict1,
}
# Import dict for yaml mode.
importDict = {}
| properties = {'indentNextLines': '\\s*([^\\s]+\\s*:|-)\\s*$', 'indentSize': '2', 'noTabs': 'true', 'tabSize': '2', 'lineComment': '#'}
yaml_main_attributes_dict = {'default': 'null', 'digit_re': '', 'escape': '', 'highlight_digits': 'true', 'ignore_case': 'true', 'no_word_sep': ''}
attributes_dict_dict = {'yaml_main': yaml_main_attributes_dict}
yaml_main_keywords_dict = {}
keywords_dict_dict = {'yaml_main': yaml_main_keywords_dict}
def yaml_rule0(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='comment1', regexp='\\s*#.*$', at_line_start=True, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule1(colorer, s, i):
return colorer.match_seq(s, i, kind='label', seq='---', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule2(colorer, s, i):
return colorer.match_seq(s, i, kind='label', seq='...', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule3(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq=']', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule4(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='[', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule5(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='{', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule6(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='}', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule7(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='-', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule8(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='+', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule9(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='|', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule10(colorer, s, i):
return colorer.match_seq(s, i, kind='operator', seq='>', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule11(colorer, s, i):
return colorer.match_mark_following(s, i, kind='keyword2', pattern='&', at_line_start=False, at_whitespace_end=False, at_word_start=False, exclude_match=False)
def yaml_rule12(colorer, s, i):
return colorer.match_mark_following(s, i, kind='keyword2', pattern='*', at_line_start=False, at_whitespace_end=False, at_word_start=False, exclude_match=False)
def yaml_rule13(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='keyword1', regexp='\\s*-?\\s*\\w+:', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule14(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+~\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule15(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+null\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule16(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+true\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule17(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+false\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule18(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+yes\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule19(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+no\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule20(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+on\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule21(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='literal2', regexp='\\s+off\\s*$', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule22(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='keyword2', regexp='!!(map|seq|str|set|omap|binary)', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule23(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='keyword3', regexp='!![^\\s]+', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
def yaml_rule24(colorer, s, i):
return colorer.match_seq_regexp(s, i, kind='keyword4', regexp='![^\\s]+', at_line_start=False, at_whitespace_end=False, at_word_start=False, delegate='')
rules_dict1 = {'\t': [yaml_rule13, yaml_rule14, yaml_rule15, yaml_rule16, yaml_rule17, yaml_rule18, yaml_rule19, yaml_rule20, yaml_rule21], '\n': [yaml_rule13, yaml_rule14, yaml_rule15, yaml_rule16, yaml_rule17, yaml_rule18, yaml_rule19, yaml_rule20, yaml_rule21], ' ': [yaml_rule13, yaml_rule14, yaml_rule15, yaml_rule16, yaml_rule17, yaml_rule18, yaml_rule19, yaml_rule20, yaml_rule21], '#': [yaml_rule0], '!': [yaml_rule22, yaml_rule23, yaml_rule24], '&': [yaml_rule11], '*': [yaml_rule12], '+': [yaml_rule8], '-': [yaml_rule1, yaml_rule7, yaml_rule13], '.': [yaml_rule2], '>': [yaml_rule10], '[': [yaml_rule4], ']': [yaml_rule3], '{': [yaml_rule5], '|': [yaml_rule9], '}': [yaml_rule6], 'A': [yaml_rule13], 'B': [yaml_rule13], 'C': [yaml_rule13], 'D': [yaml_rule13], 'E': [yaml_rule13], 'F': [yaml_rule13], 'G': [yaml_rule13], 'H': [yaml_rule13], 'I': [yaml_rule13], 'J': [yaml_rule13], 'K': [yaml_rule13], 'L': [yaml_rule13], 'M': [yaml_rule13], 'N': [yaml_rule13], 'O': [yaml_rule13], 'P': [yaml_rule13], 'Q': [yaml_rule13], 'R': [yaml_rule13], 'S': [yaml_rule13], 'T': [yaml_rule13], 'U': [yaml_rule13], 'V': [yaml_rule13], 'W': [yaml_rule13], 'X': [yaml_rule13], 'Y': [yaml_rule13], 'Z': [yaml_rule13], '_': [yaml_rule13], 'a': [yaml_rule13], 'b': [yaml_rule13], 'c': [yaml_rule13], 'd': [yaml_rule13], 'e': [yaml_rule13], 'f': [yaml_rule13], 'g': [yaml_rule13], 'h': [yaml_rule13], 'i': [yaml_rule13], 'j': [yaml_rule13], 'k': [yaml_rule13], 'l': [yaml_rule13], 'm': [yaml_rule13], 'n': [yaml_rule13], 'o': [yaml_rule13], 'p': [yaml_rule13], 'q': [yaml_rule13], 'r': [yaml_rule13], 's': [yaml_rule13], 't': [yaml_rule13], 'u': [yaml_rule13], 'v': [yaml_rule13], 'w': [yaml_rule13], 'x': [yaml_rule13], 'y': [yaml_rule13], 'z': [yaml_rule13]}
rules_dict_dict = {'yaml_main': rulesDict1}
import_dict = {} |
# https://adventofcode.com/2020/day/8
def execute_code(code_lines: list[str]):
"""
Execute program code
:param code_lines: code to execute given as lines of strings
:return: (True, accumulator) if execution terminates; (False, accumulator) if it goes into an infinite loop
"""
accumulator = 0
code_pointer = 0
lines_executed = []
while True:
if code_pointer in lines_executed:
return False, accumulator
if code_pointer == len(code_lines):
return True, accumulator
code_line = code_lines[code_pointer]
instruction = code_line[:3]
operand = int(code_line[4:])
lines_executed.append(code_pointer)
if instruction == 'nop':
code_pointer += 1
continue
if instruction == 'acc':
accumulator += operand
code_pointer += 1
continue
if instruction == 'jmp':
code_pointer += operand
continue
exit(-1)
infile = open('input.txt', 'r')
lines = infile.readlines()
infile.close()
for i in range(len(lines)):
line = lines[i]
line_instruction = line[:3]
if line_instruction == 'jmp':
lines[i] = 'nop' + line[4:]
execution_result, accumulator_result = execute_code(lines)
if execution_result:
print(accumulator_result)
exit(0)
lines[i] = line
continue
if line_instruction == 'nop':
lines[i] = 'jmp' + line[4:]
execution_result, accumulator_result = execute_code(lines)
if execution_result:
print(accumulator_result)
exit(0)
lines[i] = line
continue
exit(-1)
| def execute_code(code_lines: list[str]):
"""
Execute program code
:param code_lines: code to execute given as lines of strings
:return: (True, accumulator) if execution terminates; (False, accumulator) if it goes into an infinite loop
"""
accumulator = 0
code_pointer = 0
lines_executed = []
while True:
if code_pointer in lines_executed:
return (False, accumulator)
if code_pointer == len(code_lines):
return (True, accumulator)
code_line = code_lines[code_pointer]
instruction = code_line[:3]
operand = int(code_line[4:])
lines_executed.append(code_pointer)
if instruction == 'nop':
code_pointer += 1
continue
if instruction == 'acc':
accumulator += operand
code_pointer += 1
continue
if instruction == 'jmp':
code_pointer += operand
continue
exit(-1)
infile = open('input.txt', 'r')
lines = infile.readlines()
infile.close()
for i in range(len(lines)):
line = lines[i]
line_instruction = line[:3]
if line_instruction == 'jmp':
lines[i] = 'nop' + line[4:]
(execution_result, accumulator_result) = execute_code(lines)
if execution_result:
print(accumulator_result)
exit(0)
lines[i] = line
continue
if line_instruction == 'nop':
lines[i] = 'jmp' + line[4:]
(execution_result, accumulator_result) = execute_code(lines)
if execution_result:
print(accumulator_result)
exit(0)
lines[i] = line
continue
exit(-1) |
def maybeBuildTrap(x, y):
hero.moveXY(x, y)
item = hero.findNearestItem()
if item and item.type == "coin":
hero.buildXY("fire-trap", x, y)
while True:
maybeBuildTrap(12, 56)
maybeBuildTrap(68, 56)
maybeBuildTrap(68, 12)
maybeBuildTrap(12, 12)
| def maybe_build_trap(x, y):
hero.moveXY(x, y)
item = hero.findNearestItem()
if item and item.type == 'coin':
hero.buildXY('fire-trap', x, y)
while True:
maybe_build_trap(12, 56)
maybe_build_trap(68, 56)
maybe_build_trap(68, 12)
maybe_build_trap(12, 12) |
"""
*
* Author: Juarez Paulino(coderemite)
* Email: juarez.paulino@gmail.com
*
"""
n,m=map(int,input().split())
print(*[n//m]*(m-n%m)+[n//m+1]*(n%m)) | """
*
* Author: Juarez Paulino(coderemite)
* Email: juarez.paulino@gmail.com
*
"""
(n, m) = map(int, input().split())
print(*[n // m] * (m - n % m) + [n // m + 1] * (n % m)) |
# The minimal set of static libraries for basic Skia functionality.
{
'variables': {
'component_libs': [
'core.gyp:core',
'effects.gyp:effects',
'images.gyp:images',
'opts.gyp:opts',
'ports.gyp:ports',
'sfnt.gyp:sfnt',
'utils.gyp:utils',
],
'conditions': [
[ 'skia_arch_type == "x86" and skia_os != "android"', {
'component_libs': [
'opts.gyp:opts_ssse3',
],
}],
[ 'arm_neon == 1', {
'component_libs': [
'opts.gyp:opts_neon',
],
}],
[ 'skia_gpu', {
'component_libs': [
'gpu.gyp:skgpu',
],
}],
],
},
'targets': [
{
'target_name': 'skia_lib',
'conditions': [
[ 'skia_shared_lib', {
'conditions': [
[ 'skia_os == "android"', {
# The name skia will confuse the linker on android into using the system's libskia.so
# instead of the one packaged with the apk. We simply choose a different name to fix
# this.
'product_name': 'skia_android',
}, {
'product_name': 'skia',
}],
],
'type': 'shared_library',
}, {
'type': 'none',
}],
],
'dependencies': [
'<@(component_libs)',
],
'export_dependent_settings': [
'<@(component_libs)',
],
},
],
}
# Local Variables:
# tab-width:2
# indent-tabs-mode:nil
# End:
# vim: set expandtab tabstop=2 shiftwidth=2:
| {'variables': {'component_libs': ['core.gyp:core', 'effects.gyp:effects', 'images.gyp:images', 'opts.gyp:opts', 'ports.gyp:ports', 'sfnt.gyp:sfnt', 'utils.gyp:utils'], 'conditions': [['skia_arch_type == "x86" and skia_os != "android"', {'component_libs': ['opts.gyp:opts_ssse3']}], ['arm_neon == 1', {'component_libs': ['opts.gyp:opts_neon']}], ['skia_gpu', {'component_libs': ['gpu.gyp:skgpu']}]]}, 'targets': [{'target_name': 'skia_lib', 'conditions': [['skia_shared_lib', {'conditions': [['skia_os == "android"', {'product_name': 'skia_android'}, {'product_name': 'skia'}]], 'type': 'shared_library'}, {'type': 'none'}]], 'dependencies': ['<@(component_libs)'], 'export_dependent_settings': ['<@(component_libs)']}]} |
# Memory reference instructions
MRI = {"AND": ["0", "8"], "ADD": ["1", "9"], "LDA": ["2", "A"], "STA": ["3", "B"],
"BUN": ["4", "C"], "BSA": ["5", "D"], "ISZ": ["6", "E"]}
# Register reference instructions
NON_MRI = {"CLA": 0x7800, "CLE": 0x7400, "CMA": 0x7200, "CME": 0x7100, "CIR": 0x7080, "CIL": 0x7040, "INC": 0x7020,
"SPA": 0x7010, "SNA": 0x7008, "SZA": 0x7004, "SZE": 0x7002, "HLT": 0x7001, "INP": 0xF800, "OUT": 0xF400,
"SKI": 0xF200, "SKO": 0xF100, "ION": 0xF080, "IOF": 0xF040}
PSEUDO = ["ORG", "HEX", "DEC", "END"]
ALONE_IN_LINE = ["CLA", "CLE", "CMA", "CME", "CIR",
"CIL", "INC", "SPA", "SNA", "SZA",
"SZE", "HLT", "INP", "OUT", "SKI",
"SKO", "ION", "IOF", "END"]
| mri = {'AND': ['0', '8'], 'ADD': ['1', '9'], 'LDA': ['2', 'A'], 'STA': ['3', 'B'], 'BUN': ['4', 'C'], 'BSA': ['5', 'D'], 'ISZ': ['6', 'E']}
non_mri = {'CLA': 30720, 'CLE': 29696, 'CMA': 29184, 'CME': 28928, 'CIR': 28800, 'CIL': 28736, 'INC': 28704, 'SPA': 28688, 'SNA': 28680, 'SZA': 28676, 'SZE': 28674, 'HLT': 28673, 'INP': 63488, 'OUT': 62464, 'SKI': 61952, 'SKO': 61696, 'ION': 61568, 'IOF': 61504}
pseudo = ['ORG', 'HEX', 'DEC', 'END']
alone_in_line = ['CLA', 'CLE', 'CMA', 'CME', 'CIR', 'CIL', 'INC', 'SPA', 'SNA', 'SZA', 'SZE', 'HLT', 'INP', 'OUT', 'SKI', 'SKO', 'ION', 'IOF', 'END'] |
nome = "Cristiano"
for letra in nome:
print(letra)
| nome = 'Cristiano'
for letra in nome:
print(letra) |
def square(aList):
return map(lambda x: x**2, aList)
def merge(listOne, listTwo):
result = []
while listOne and listTwo: #while both the lists still have elements
if listOne[0] < listTwo[0]:
result.append(listOne.pop(0)) #pops the first element from listOne from listOne and adds it to result
else: #listOne[0] == listTwo[0] or listTwo[0] < listOne[0]
result.append(listTwo.pop(0))
#now one of the lists is empty and we can just add all the remaining contents of the nonempty list into result
if listOne:
result += listOne #concatenating lists is done with plus operator
if listTwo:
result += listTwo
return result
def get_break_index(aList):
index = 0 #this will be the index at which we break the list in two
for i in range(len(aList)):
if aList[i] > 0: #it's a positive number!
index = i #this is where the first positive number in the list is
break #we break here so that index remains the first positive number in the list
return index
def challenge9(aList):
break_index = get_break_index(aList)
listOne = aList[0:break_index] #we know this will be the negative half
listTwo = aList[break_index:]
a = square(listOne)[::-1] #we need to reverse this since [-3,-2,-1] --> square --> [9,4,1]
b = square(listTwo)
return merge(a,b)
# a = [-3,-2,0,3,4,6]
# print challenge9(a)
| def square(aList):
return map(lambda x: x ** 2, aList)
def merge(listOne, listTwo):
result = []
while listOne and listTwo:
if listOne[0] < listTwo[0]:
result.append(listOne.pop(0))
else:
result.append(listTwo.pop(0))
if listOne:
result += listOne
if listTwo:
result += listTwo
return result
def get_break_index(aList):
index = 0
for i in range(len(aList)):
if aList[i] > 0:
index = i
break
return index
def challenge9(aList):
break_index = get_break_index(aList)
list_one = aList[0:break_index]
list_two = aList[break_index:]
a = square(listOne)[::-1]
b = square(listTwo)
return merge(a, b) |
# Operators
print('Module', 10%3)
print('Exponential', 5**3)
print('Floor division', 9//2)
# Data types
print(type(5))
print(type("Luis"))
print(type(5.2))
# Condition
num1 = 5
num2 = 7
if num1 > num2:
print(num1, 'is bigger')
else:
print(num2, 'is bigger')
| print('Module', 10 % 3)
print('Exponential', 5 ** 3)
print('Floor division', 9 // 2)
print(type(5))
print(type('Luis'))
print(type(5.2))
num1 = 5
num2 = 7
if num1 > num2:
print(num1, 'is bigger')
else:
print(num2, 'is bigger') |
class BaseCommand():
def __init__(self):
self.pre_command()
self.exec_command()
self.post_command()
def pre_command(self):
return 0
def exec_command(self):
return 0
def post_command(self):
return 0
if __name__ == '__main__':
cmd = BaseCommand()
| class Basecommand:
def __init__(self):
self.pre_command()
self.exec_command()
self.post_command()
def pre_command(self):
return 0
def exec_command(self):
return 0
def post_command(self):
return 0
if __name__ == '__main__':
cmd = base_command() |
class MergeSort:
def __init__(self):
pass
def sort(self, arr):
self.mergesort(arr, 0, len(arr)-1)
def mergesort(self, arr, left, right):
if(left >= right):
return
mid = int((left+right)/2)
self.mergesort(arr, left, mid)
self.mergesort(arr, mid+1, right)
self.merge(arr,left, right, mid)
def merge(self, arr, left, right, mid):
i = left
j = mid+1
k = left
temp = [0 for i in range(right+1)]
while(i <= mid and j <= right):
if(arr[i] < arr[j]):
temp[k] = arr[i]
k += 1
i += 1
else:
temp[k] = arr[j]
k += 1
j += 1
while(i <= mid):
temp[k] = arr[i]
k += 1
i += 1
while(j <= right):
temp[k] = arr[j]
k += 1
j += 1
for i in range(left, right+1):
arr[i] = temp[i]
| class Mergesort:
def __init__(self):
pass
def sort(self, arr):
self.mergesort(arr, 0, len(arr) - 1)
def mergesort(self, arr, left, right):
if left >= right:
return
mid = int((left + right) / 2)
self.mergesort(arr, left, mid)
self.mergesort(arr, mid + 1, right)
self.merge(arr, left, right, mid)
def merge(self, arr, left, right, mid):
i = left
j = mid + 1
k = left
temp = [0 for i in range(right + 1)]
while i <= mid and j <= right:
if arr[i] < arr[j]:
temp[k] = arr[i]
k += 1
i += 1
else:
temp[k] = arr[j]
k += 1
j += 1
while i <= mid:
temp[k] = arr[i]
k += 1
i += 1
while j <= right:
temp[k] = arr[j]
k += 1
j += 1
for i in range(left, right + 1):
arr[i] = temp[i] |
# -*- coding: utf-8 -*-
__version__ = '1.2.5'
__author__ = 'G Adventures'
| __version__ = '1.2.5'
__author__ = 'G Adventures' |
class Solution:
def minDistance(self, word1, word2):
"""
:type word1: str
:type word2: str
:rtype: int
"""
m, n = len(word1)+1, len(word2)+1
dp = [[0 for _ in range(n)] for _ in range(m)]
for i in range(m):
dp[i][0] = i
for i in range(n):
dp[0][i] = i
for i in range(1, m):
for j in range(1, n):
dp[i][j] = min(dp[i-1][j]+1, dp[i][j-1]+1)
dp[i][j] = min(dp[i][j], dp[i-1][j-1] +
(0 if word1[i-1] == word2[j-1] else 1))
return dp[m-1][n-1]
if __name__ == "__main__":
print(Solution().minDistance("horse", "aaahorse"))
| class Solution:
def min_distance(self, word1, word2):
"""
:type word1: str
:type word2: str
:rtype: int
"""
(m, n) = (len(word1) + 1, len(word2) + 1)
dp = [[0 for _ in range(n)] for _ in range(m)]
for i in range(m):
dp[i][0] = i
for i in range(n):
dp[0][i] = i
for i in range(1, m):
for j in range(1, n):
dp[i][j] = min(dp[i - 1][j] + 1, dp[i][j - 1] + 1)
dp[i][j] = min(dp[i][j], dp[i - 1][j - 1] + (0 if word1[i - 1] == word2[j - 1] else 1))
return dp[m - 1][n - 1]
if __name__ == '__main__':
print(solution().minDistance('horse', 'aaahorse')) |
'''
Created on 2012. 8. 10.
@author: root
'''
class StaticTestingForm:
header=''
deviceConnection=''
def __init__(self):
self.header = '''import sys
# Imports the monkeyrunner modules used by this program
from com.android.monkeyrunner import MonkeyRunner, MonkeyDevice, MonkeyImage'''
self.deviceConnection = '''
# Connects to the current device, returning a MonkeyDevice object
device = MonkeyRunner.waitForConnection()
if not device:
print >> sys.stderr, "Couldn't get connection"
sys.exit(1)
'''
def header(self):
return self.header
def deviceConnection(self):
return self.deviceConnection
| """
Created on 2012. 8. 10.
@author: root
"""
class Statictestingform:
header = ''
device_connection = ''
def __init__(self):
self.header = 'import sys\n# Imports the monkeyrunner modules used by this program\nfrom com.android.monkeyrunner import MonkeyRunner, MonkeyDevice, MonkeyImage'
self.deviceConnection = '\n# Connects to the current device, returning a MonkeyDevice object\ndevice = MonkeyRunner.waitForConnection()\n\nif not device:\n print >> sys.stderr, "Couldn\'t get connection"\n sys.exit(1)\n '
def header(self):
return self.header
def device_connection(self):
return self.deviceConnection |
{
'name': 'prue01',
'description': 'Una aplicacion de facturacion.',
'author': 'Jose Antonio Duarte Perez',
'depends': ['mail'],
'application': True,
'data': ['views/contactos.xml']
} | {'name': 'prue01', 'description': 'Una aplicacion de facturacion.', 'author': 'Jose Antonio Duarte Perez', 'depends': ['mail'], 'application': True, 'data': ['views/contactos.xml']} |
stack = [3, 4, 5]
stack.append(6)
stack.append(7)
print(stack)
print(stack.pop())
print(stack)
print(stack.pop())
print(stack.pop())
print(stack)
| stack = [3, 4, 5]
stack.append(6)
stack.append(7)
print(stack)
print(stack.pop())
print(stack)
print(stack.pop())
print(stack.pop())
print(stack) |
print('hi')
s1 = input("input s1: ")
s2 = input("input s2: ")
print(s1)
print(s2)
shorter_length = 0
longer_s = ''
if (len(s1) > len(s2)):
shorter_length = len(s2)
longer_s = s1
else:
shorter_length = len(s1)
longer_s = s2
result_s = ''
for i in range(shorter_length):
result_s += s1[i] + s2[i]
for i in range(shorter_length, len(longer_s)):
result_s += longer_s[i]
print(result_s) | print('hi')
s1 = input('input s1: ')
s2 = input('input s2: ')
print(s1)
print(s2)
shorter_length = 0
longer_s = ''
if len(s1) > len(s2):
shorter_length = len(s2)
longer_s = s1
else:
shorter_length = len(s1)
longer_s = s2
result_s = ''
for i in range(shorter_length):
result_s += s1[i] + s2[i]
for i in range(shorter_length, len(longer_s)):
result_s += longer_s[i]
print(result_s) |
def a_function(x, y):
if isinstance(x, float):
if isinstance(y, float):
z = x + y
return z | def a_function(x, y):
if isinstance(x, float):
if isinstance(y, float):
z = x + y
return z |
# mm => make mask
dirty_imagename = "dirty/" + "RCrA_13CO_all_cube_dirty.image"
beamsize_major = 7.889
beamsize_minor = 4.887
pa = -77.412
# find the RMS of a line free channel
chanstat = imstat(imagename=dirty_imagename, chans="1")
rms1 = chanstat["rms"][0]
chanstat = imstat(imagename=dirty_imagename, chans="38")
rms2 = chanstat["rms"][0]
rms = 0.5 * (rms1 + rms2)
print("rms = " + str(rms) + "Jy/beam")
def make_mask(times_sigma):
immath(
imagename=dirty_imagename,
expr="iif(IM0>" + str(times_sigma * rms) + ",1,0)",
outfile="mask/" + str(times_sigma) + "sigma.im",
)
imsmooth(
imagename="mask/" + str(times_sigma) + "sigma.im",
major=str(2 * beamsize_major) + "arcsec",
minor=str(2 * beamsize_minor) + "arcsec",
pa=str(pa) + "deg",
outfile="mask/" + str(times_sigma) + "sigma.im.sm",
)
immath(
imagename="mask/" + str(times_sigma) + "sigma.im.sm",
expr="iif(IM0>0.2,1,0)",
outfile="mask/" + str(times_sigma) + "sigma_mask.im",
)
make_mask(10)
| dirty_imagename = 'dirty/' + 'RCrA_13CO_all_cube_dirty.image'
beamsize_major = 7.889
beamsize_minor = 4.887
pa = -77.412
chanstat = imstat(imagename=dirty_imagename, chans='1')
rms1 = chanstat['rms'][0]
chanstat = imstat(imagename=dirty_imagename, chans='38')
rms2 = chanstat['rms'][0]
rms = 0.5 * (rms1 + rms2)
print('rms = ' + str(rms) + 'Jy/beam')
def make_mask(times_sigma):
immath(imagename=dirty_imagename, expr='iif(IM0>' + str(times_sigma * rms) + ',1,0)', outfile='mask/' + str(times_sigma) + 'sigma.im')
imsmooth(imagename='mask/' + str(times_sigma) + 'sigma.im', major=str(2 * beamsize_major) + 'arcsec', minor=str(2 * beamsize_minor) + 'arcsec', pa=str(pa) + 'deg', outfile='mask/' + str(times_sigma) + 'sigma.im.sm')
immath(imagename='mask/' + str(times_sigma) + 'sigma.im.sm', expr='iif(IM0>0.2,1,0)', outfile='mask/' + str(times_sigma) + 'sigma_mask.im')
make_mask(10) |
# pseudo code taken from CLRS book
# vertices is list of vertex in graph : [0, 1, 2, 3 ...] (must be continuous)
# adjacencyList is the list whose 'i'th element is list of vertices adjacent to vertex i
time = 0;
class vertex:
def __init__(self, adjVertices, color='White', parent='None', discovery_time=float('inf'), finishing_time=float('inf')):
self.adjVertices = adjVertices;
self.color = color;
self.parent = parent;
self.discovery_time = discovery_time;
self.finishing_time = finishing_time;
def topological_sort(vertices, adjacencyList):
global time
topological_order=[]
vertices_objects = [ vertex(adjacencyList[v]) for v in vertices ]
time = 0
for vert in vertices:
if vertices_objects[vert].color == 'White':
DFS_Visit(vert, vertices_objects, adjacencyList, topological_order)
topological_order.reverse()
for i in range(9):
print (vertices_objects[i].discovery_time,vertices_objects[i].finishing_time)
return topological_order
def DFS_Visit(vertex, vertices, adjacencyList, topo_order):
vertex_object = vertices[vertex]
vertex_object.color = 'Gray' # Vertex just been discovered
global time
time = time + 1
vertex_object.discovery_time = time;
for vert in adjacencyList[vertex]:
if vertices[vert].color == 'White':
vertices[vert].parent = vertex
DFS_Visit(vert, vertices, adjacencyList, topo_order)
vertex_object.color = 'Black' # Discovery of this vertex has been finished
time = time + 1
vertex_object.finishing_time = time
topo_order.append(vertex)
| time = 0
class Vertex:
def __init__(self, adjVertices, color='White', parent='None', discovery_time=float('inf'), finishing_time=float('inf')):
self.adjVertices = adjVertices
self.color = color
self.parent = parent
self.discovery_time = discovery_time
self.finishing_time = finishing_time
def topological_sort(vertices, adjacencyList):
global time
topological_order = []
vertices_objects = [vertex(adjacencyList[v]) for v in vertices]
time = 0
for vert in vertices:
if vertices_objects[vert].color == 'White':
dfs__visit(vert, vertices_objects, adjacencyList, topological_order)
topological_order.reverse()
for i in range(9):
print(vertices_objects[i].discovery_time, vertices_objects[i].finishing_time)
return topological_order
def dfs__visit(vertex, vertices, adjacencyList, topo_order):
vertex_object = vertices[vertex]
vertex_object.color = 'Gray'
global time
time = time + 1
vertex_object.discovery_time = time
for vert in adjacencyList[vertex]:
if vertices[vert].color == 'White':
vertices[vert].parent = vertex
dfs__visit(vert, vertices, adjacencyList, topo_order)
vertex_object.color = 'Black'
time = time + 1
vertex_object.finishing_time = time
topo_order.append(vertex) |
# Time: O(min(n, h)), per operation
# Space: O(min(n, h))
class TrieNode(object):
# Initialize your data structure here.
def __init__(self):
self.is_string = False
self.leaves = {}
class WordDictionary(object):
def __init__(self):
self.root = TrieNode()
# @param {string} word
# @return {void}
# Adds a word into the data structure.
def addWord(self, word):
curr = self.root
for c in word:
if c not in curr.leaves:
curr.leaves[c] = TrieNode()
curr = curr.leaves[c]
curr.is_string = True
# @param {string} word
# @return {boolean}
# Returns if the word is in the data structure. A word could
# contain the dot character '.' to represent any one letter.
def search(self, word):
return self.searchHelper(word, 0, self.root)
def searchHelper(self, word, start, curr):
if start == len(word):
return curr.is_string
if word[start] in curr.leaves:
return self.searchHelper(word, start+1, curr.leaves[word[start]])
elif word[start] == '.':
for c in curr.leaves:
if self.searchHelper(word, start+1, curr.leaves[c]):
return True
return False
| class Trienode(object):
def __init__(self):
self.is_string = False
self.leaves = {}
class Worddictionary(object):
def __init__(self):
self.root = trie_node()
def add_word(self, word):
curr = self.root
for c in word:
if c not in curr.leaves:
curr.leaves[c] = trie_node()
curr = curr.leaves[c]
curr.is_string = True
def search(self, word):
return self.searchHelper(word, 0, self.root)
def search_helper(self, word, start, curr):
if start == len(word):
return curr.is_string
if word[start] in curr.leaves:
return self.searchHelper(word, start + 1, curr.leaves[word[start]])
elif word[start] == '.':
for c in curr.leaves:
if self.searchHelper(word, start + 1, curr.leaves[c]):
return True
return False |
"""
TESTS is a dict with all you tests.
Keys for this will be categories' names.
Each test is dict with
"input" -- input data for user function
"answer" -- your right answer
"explanation" -- not necessary key, it's using for additional info in animation.
"""
TESTS = {
"Basics": [
{
"input": ('d3', ('d6', 'b6', 'c8', 'g4', 'b8', 'g6')),
"answer": 5,
"explanation": ('d6', 'g6', 'b6', 'b8', 'c8')
},
{
"input": ('a2', ('f6', 'f2', 'a6', 'f8', 'h8', 'h6')),
"answer": 6,
"explanation": ('a6', 'f6', 'h6', 'h8', 'f8', 'f2')
},
{
"input": ('a2', ('f6', 'f8', 'f2', 'a6', 'h6')),
"answer": 4,
"explanation": ('a6', 'f6', 'f2', 'f8')
},
],
"Extra": [
{
"input": ('c5', ('h5',)),
"answer": 1,
"explanation": ('h5',)
},
{
"input": ('c5', ('e3', 'b6', 'e7', 'f2', 'd6', 'b4', 'g8', 'd4')),
"answer": 0,
"explanation": []
},
{
"input": ('e5', ('e8', 'e2', 'h8', 'h5', 'b5', 'h2', 'b2', 'b8')),
"answer": 8,
"explanation": ('b5', 'b8', 'b2', 'e2', 'h2', 'h5', 'h8', 'e8')
},
{
"input": ('c5', ('a5', 'd5', 'g5', 'h5', 'b5', 'e5', 'f5')),
"answer": 7,
"explanation": ('b5', 'd5', 'e5', 'f5', 'g5', 'h5', 'a5')
},
{
"input": ('e1', ('e8', 'h1', 'c2', 'h5', 'e4', 'a1', 'e6', 'a3')),
"answer": 3,
"explanation": ('a1', 'h1', 'h5')
},
{
"input": ('h1', ('a5', 'b6', 'e2', 'a2', 'h5', 'e4', 'e6', 'h7')),
"answer": 7,
"explanation": ('h5', 'a5', 'a2', 'e2', 'e4', 'e6', 'b6')
},
{
"input": ('c7', ('d5', 'f7', 'e6', 'e7', 'c5', 'd6', 'e5', 'c6')),
"answer": 8,
"explanation": ('c6', 'd6', 'd5', 'c5', 'e5', 'e6', 'e7', 'f7')
},
{
"input": ('c7', ('d5', 'f7', 'e7', 'c5', 'd6', 'd4', 'c6', 'c4')),
"answer": 6,
"explanation": ('c6', 'd6', 'd5', 'd4', 'c4', 'c5')
},
]
}
| """
TESTS is a dict with all you tests.
Keys for this will be categories' names.
Each test is dict with
"input" -- input data for user function
"answer" -- your right answer
"explanation" -- not necessary key, it's using for additional info in animation.
"""
tests = {'Basics': [{'input': ('d3', ('d6', 'b6', 'c8', 'g4', 'b8', 'g6')), 'answer': 5, 'explanation': ('d6', 'g6', 'b6', 'b8', 'c8')}, {'input': ('a2', ('f6', 'f2', 'a6', 'f8', 'h8', 'h6')), 'answer': 6, 'explanation': ('a6', 'f6', 'h6', 'h8', 'f8', 'f2')}, {'input': ('a2', ('f6', 'f8', 'f2', 'a6', 'h6')), 'answer': 4, 'explanation': ('a6', 'f6', 'f2', 'f8')}], 'Extra': [{'input': ('c5', ('h5',)), 'answer': 1, 'explanation': ('h5',)}, {'input': ('c5', ('e3', 'b6', 'e7', 'f2', 'd6', 'b4', 'g8', 'd4')), 'answer': 0, 'explanation': []}, {'input': ('e5', ('e8', 'e2', 'h8', 'h5', 'b5', 'h2', 'b2', 'b8')), 'answer': 8, 'explanation': ('b5', 'b8', 'b2', 'e2', 'h2', 'h5', 'h8', 'e8')}, {'input': ('c5', ('a5', 'd5', 'g5', 'h5', 'b5', 'e5', 'f5')), 'answer': 7, 'explanation': ('b5', 'd5', 'e5', 'f5', 'g5', 'h5', 'a5')}, {'input': ('e1', ('e8', 'h1', 'c2', 'h5', 'e4', 'a1', 'e6', 'a3')), 'answer': 3, 'explanation': ('a1', 'h1', 'h5')}, {'input': ('h1', ('a5', 'b6', 'e2', 'a2', 'h5', 'e4', 'e6', 'h7')), 'answer': 7, 'explanation': ('h5', 'a5', 'a2', 'e2', 'e4', 'e6', 'b6')}, {'input': ('c7', ('d5', 'f7', 'e6', 'e7', 'c5', 'd6', 'e5', 'c6')), 'answer': 8, 'explanation': ('c6', 'd6', 'd5', 'c5', 'e5', 'e6', 'e7', 'f7')}, {'input': ('c7', ('d5', 'f7', 'e7', 'c5', 'd6', 'd4', 'c6', 'c4')), 'answer': 6, 'explanation': ('c6', 'd6', 'd5', 'd4', 'c4', 'c5')}]} |
class Damage():
def __init__(self, skill:float=1, added:float=1, dealing:float=1):
self.__skill = skill
self.__added = added
self.__dealing = dealing
def get_dmg(self):
return (self.__skill, self.__added-1, self.__dealing)
if __name__ == '__main__':
dmg = Damage(1.15, 1.14, 1.18)
print(dmg.get_dmg()) | class Damage:
def __init__(self, skill: float=1, added: float=1, dealing: float=1):
self.__skill = skill
self.__added = added
self.__dealing = dealing
def get_dmg(self):
return (self.__skill, self.__added - 1, self.__dealing)
if __name__ == '__main__':
dmg = damage(1.15, 1.14, 1.18)
print(dmg.get_dmg()) |
class Animal:
def __init__(self, name):
self.name = name
self.fed_times = 0
self.groomed_times = 0
def feed(self, times):
print("Fed {}".format(times))
self.fed_times += times
return self.fed_times
def groom(self, times):
print("Groomed {} times".format(times))
self.groomed_times += times
return self.groomed_times
| class Animal:
def __init__(self, name):
self.name = name
self.fed_times = 0
self.groomed_times = 0
def feed(self, times):
print('Fed {}'.format(times))
self.fed_times += times
return self.fed_times
def groom(self, times):
print('Groomed {} times'.format(times))
self.groomed_times += times
return self.groomed_times |
def main ():
entry = int(input("Enter the number you want here : "))
prime = False #prime is defined as false and will change if entry number is a prime number.
if entry > 1 :
for numbers in range(2, entry):
if (entry % numbers) == 0: # Check if entry number has a factor
prime = True
break
if prime :
print(entry, 'is not prime number!')
else :
print(entry, 'is a prime number')
start = 0
finish = entry
print("All prime numbers between the 0 and the enterded value are : ")
for entry in range(start, finish + 1):
# all prime numbers are greater than 1
if entry > 1:
for numbers in range(2, entry):
if (entry % numbers) == 0:
break
else:
print(entry)
main()
| def main():
entry = int(input('Enter the number you want here : '))
prime = False
if entry > 1:
for numbers in range(2, entry):
if entry % numbers == 0:
prime = True
break
if prime:
print(entry, 'is not prime number!')
else:
print(entry, 'is a prime number')
start = 0
finish = entry
print('All prime numbers between the 0 and the enterded value are : ')
for entry in range(start, finish + 1):
if entry > 1:
for numbers in range(2, entry):
if entry % numbers == 0:
break
else:
print(entry)
main() |
#MaBe
nomes = []
massas = []
while True:
nome = input('Digite um nome: ').upper()
massa = int(input('Digite a massa: '))
nomes.append(nome)
massas.append(massa)
r = input('Quer continuar? [s/n] ').lower()
if r == 'n':
break
totcad = len(nomes)
pesomai = max(massas)
pesomin = min(massas)
print(nomes)
print(massas)
print(f'{totcad} pessoas cadastradas.')
print(f'O meior peso foi de {pesomai}kg. {nomes[massas.index(pesomai)]}.')
print(f'O menor peso foi de {pesomin}kg. {nomes[massas.index(pesomin)]}.')
| nomes = []
massas = []
while True:
nome = input('Digite um nome: ').upper()
massa = int(input('Digite a massa: '))
nomes.append(nome)
massas.append(massa)
r = input('Quer continuar? [s/n] ').lower()
if r == 'n':
break
totcad = len(nomes)
pesomai = max(massas)
pesomin = min(massas)
print(nomes)
print(massas)
print(f'{totcad} pessoas cadastradas.')
print(f'O meior peso foi de {pesomai}kg. {nomes[massas.index(pesomai)]}.')
print(f'O menor peso foi de {pesomin}kg. {nomes[massas.index(pesomin)]}.') |
"""
[2017-02-10] Challenge #302 [Hard] ASCII Histogram Maker: Part 2 - The Proper Histogram
https://www.reddit.com/r/dailyprogrammer/comments/5t7l07/20170210_challenge_302_hard_ascii_histogram_maker/
# Description
Most of us are familiar with the histogram chart - a representation of a frequency distribution by means of rectangles
whose widths represent class intervals and whose areas are proportional to the corresponding frequencies. It is similar
to a bar chart, but a histogram groups numbers into ranges. The area of the bar is the total frequency of all of the
covered values in the range.
# Input Description
You'll be given four numbers on the first line telling you the start and end of the horizontal (X) axis and the
vertical (Y) axis, respectively. The next line tells you the interval for the X-axis to use (the width of the bar).
Then you'll have a number on a single line telling you how many records to read. Then you'll be given the data as 2
numbers: the first is the variable, the second number is the frequency of that variable. Example:
1 4 1 10
2
4
1 3
2 3
3 2
4 6
# Challenge Output
Your program should emit an ASCII histogram plotting the data according to the specification - the size of the chart
and the frequency of the X-axis variables. Example:
10
9
8
7
6
5
4 ***
3*** ***
2*** ***
1*** ***
1 2 3 4
# Challenge Input
0 40 0 100
8
40
1 56
2 40
3 4
4 67
5 34
6 48
7 7
8 45
9 50
10 54
11 20
12 24
13 44
14 44
15 49
16 28
17 94
18 37
19 46
20 64
21 100
22 43
23 23
24 100
25 15
26 81
27 19
28 92
29 9
30 21
31 88
32 31
33 55
34 87
35 63
36 88
37 76
38 41
39 100
40 6
"""
def main():
pass
if __name__ == "__main__":
main()
| """
[2017-02-10] Challenge #302 [Hard] ASCII Histogram Maker: Part 2 - The Proper Histogram
https://www.reddit.com/r/dailyprogrammer/comments/5t7l07/20170210_challenge_302_hard_ascii_histogram_maker/
# Description
Most of us are familiar with the histogram chart - a representation of a frequency distribution by means of rectangles
whose widths represent class intervals and whose areas are proportional to the corresponding frequencies. It is similar
to a bar chart, but a histogram groups numbers into ranges. The area of the bar is the total frequency of all of the
covered values in the range.
# Input Description
You'll be given four numbers on the first line telling you the start and end of the horizontal (X) axis and the
vertical (Y) axis, respectively. The next line tells you the interval for the X-axis to use (the width of the bar).
Then you'll have a number on a single line telling you how many records to read. Then you'll be given the data as 2
numbers: the first is the variable, the second number is the frequency of that variable. Example:
1 4 1 10
2
4
1 3
2 3
3 2
4 6
# Challenge Output
Your program should emit an ASCII histogram plotting the data according to the specification - the size of the chart
and the frequency of the X-axis variables. Example:
10
9
8
7
6
5
4 ***
3*** ***
2*** ***
1*** ***
1 2 3 4
# Challenge Input
0 40 0 100
8
40
1 56
2 40
3 4
4 67
5 34
6 48
7 7
8 45
9 50
10 54
11 20
12 24
13 44
14 44
15 49
16 28
17 94
18 37
19 46
20 64
21 100
22 43
23 23
24 100
25 15
26 81
27 19
28 92
29 9
30 21
31 88
32 31
33 55
34 87
35 63
36 88
37 76
38 41
39 100
40 6
"""
def main():
pass
if __name__ == '__main__':
main() |
n = int(input())
for row in range(0, n):
if row == 0 or row == n - 1:
print('*' * 2 * n + ' ' * n + '*' * 2 * n)
else:
if row == ((n - 1) // 2):
print('*' + '/' * 2 * (n - 1) + '*' + '|' * n + '*' + '/' * 2 * (n - 1) + '*')
else:
print('*' + '/' * 2 * (n - 1) + '*' + ' ' * n + '*' + '/' * 2 * (n - 1) + '*')
| n = int(input())
for row in range(0, n):
if row == 0 or row == n - 1:
print('*' * 2 * n + ' ' * n + '*' * 2 * n)
elif row == (n - 1) // 2:
print('*' + '/' * 2 * (n - 1) + '*' + '|' * n + '*' + '/' * 2 * (n - 1) + '*')
else:
print('*' + '/' * 2 * (n - 1) + '*' + ' ' * n + '*' + '/' * 2 * (n - 1) + '*') |
# Configuration file for ipython-kernel.
# See <https://ipython.readthedocs.io/en/stable/config/options/kernel.html>
# With IPython >= 6.0.0, all outputs to stdout/stderr are captured.
# It is the case for subprocesses and output of compiled libraries like Spark.
# Those logs now both head to notebook logs and in notebooks outputs.
# Logs are particularly verbose with Spark, that is why we turn them off through this flag.
# <https://github.com/jupyter/docker-stacks/issues/1423>
# Attempt to capture and forward low-level output, e.g. produced by Extension
# libraries.
# Default: True
# type:ignore
c.IPKernelApp.capture_fd_output = False # noqa: F821 | c.IPKernelApp.capture_fd_output = False |
# Copyright (C) 2001 Python Software Foundation
__version__ = '0.4'
__all__ = ['Errors',
'Generator',
'Image',
'MIMEBase',
'Message',
'MsgReader',
'Parser',
'StringableMixin',
'Text',
'address',
'date',
]
| __version__ = '0.4'
__all__ = ['Errors', 'Generator', 'Image', 'MIMEBase', 'Message', 'MsgReader', 'Parser', 'StringableMixin', 'Text', 'address', 'date'] |
"""
Search In Sorted Matrix:
You're given a two-dimensional array (a matrix) of distinct integers and a target integer.
Each row in the matrix is sorted, and each column is also sorted; the matrix doesn't necessarily have the same height and width.
Write a function that returns an array of the row and column indices of the target integer if it's contained in the matrix, otherwise [-1, -1].
Sample Input:
matrix = [
[1, 4, 7, 12, 15, 1000],
[2, 5, 19, 31, 32, 1001],
[3, 8, 24, 33, 35, 1002],
[40, 41, 42, 44, 45, 1003],
[99, 100, 103, 106, 128, 1004],
]
target = 44
Sample Output:
[3, 3]
https://www.algoexpert.io/questions/Search%20In%20Sorted%20Matrix
"""
def searchInSortedMatrix(matrix, target):
# start at top right
row = 0
col = len(matrix[0]) - 1
while row < len(matrix) and col >= 0:
if matrix[row][col] > target:
col -= 1 # move left
elif matrix[row][col] < target:
row += 1 # move down
else:
return[row, col]
return[-1, -1]
| """
Search In Sorted Matrix:
You're given a two-dimensional array (a matrix) of distinct integers and a target integer.
Each row in the matrix is sorted, and each column is also sorted; the matrix doesn't necessarily have the same height and width.
Write a function that returns an array of the row and column indices of the target integer if it's contained in the matrix, otherwise [-1, -1].
Sample Input:
matrix = [
[1, 4, 7, 12, 15, 1000],
[2, 5, 19, 31, 32, 1001],
[3, 8, 24, 33, 35, 1002],
[40, 41, 42, 44, 45, 1003],
[99, 100, 103, 106, 128, 1004],
]
target = 44
Sample Output:
[3, 3]
https://www.algoexpert.io/questions/Search%20In%20Sorted%20Matrix
"""
def search_in_sorted_matrix(matrix, target):
row = 0
col = len(matrix[0]) - 1
while row < len(matrix) and col >= 0:
if matrix[row][col] > target:
col -= 1
elif matrix[row][col] < target:
row += 1
else:
return [row, col]
return [-1, -1] |
# entrada v1
v1 = float(input())
# entrada v2
v2 = float(input())
# entrada v3
v3 = float(input())
# entrada v4
v4 = float(input())
# entrada v5
v5 = float(input())
# entrada v6
v6 = float(input())
# variaveis
count = 0
countJ = 0
media = 0
listV = []
listP = []
# adicionar a lista
listV.append(v1)
listV.append(v2)
listV.append(v3)
listV.append(v4)
listV.append(v5)
listV.append(v6)
# percorrer a lista e encontrar numeros positivos
for i in listV:
if i >= 0:
count = count + 1
listP.append(i)
# percorrer a lista de positivos e calcular a media
for j in listP:
media = media + j
countJ = countJ + 1
# media total
mediaT = media / countJ
print('{} valores positivos\n{:.1f}'.format(count, mediaT))
| v1 = float(input())
v2 = float(input())
v3 = float(input())
v4 = float(input())
v5 = float(input())
v6 = float(input())
count = 0
count_j = 0
media = 0
list_v = []
list_p = []
listV.append(v1)
listV.append(v2)
listV.append(v3)
listV.append(v4)
listV.append(v5)
listV.append(v6)
for i in listV:
if i >= 0:
count = count + 1
listP.append(i)
for j in listP:
media = media + j
count_j = countJ + 1
media_t = media / countJ
print('{} valores positivos\n{:.1f}'.format(count, mediaT)) |
# Pretty good, but I golfed the top one even more
n=input
s="".join(n()for _ in"_"*int(n()))
print(s.count("00")+s.count("11")+1) | n = input
s = ''.join((n() for _ in '_' * int(n())))
print(s.count('00') + s.count('11') + 1) |
"""Provides the repo macro to import google libprotobuf_mutator"""
load("//third_party:repo.bzl", "tf_http_archive")
def repo():
"""Imports libprotobuf_mutator."""
tf_http_archive(
name = "com_google_libprotobuf_mutator",
sha256 = "792f250fb546bde8590e72d64311ea00a70c175fd77df6bb5e02328fa15fe28e",
strip_prefix = "libprotobuf-mutator-1.0",
build_file = "//third_party/libprotobuf_mutator:BUILD.bazel",
urls = [
"https://storage.googleapis.com/mirror.tensorflow.org/github.com/google/libprotobuf-mutator/archive/v1.0.tar.gz",
"https://github.com/google/libprotobuf-mutator/archive/v1.0.tar.gz",
],
)
| """Provides the repo macro to import google libprotobuf_mutator"""
load('//third_party:repo.bzl', 'tf_http_archive')
def repo():
"""Imports libprotobuf_mutator."""
tf_http_archive(name='com_google_libprotobuf_mutator', sha256='792f250fb546bde8590e72d64311ea00a70c175fd77df6bb5e02328fa15fe28e', strip_prefix='libprotobuf-mutator-1.0', build_file='//third_party/libprotobuf_mutator:BUILD.bazel', urls=['https://storage.googleapis.com/mirror.tensorflow.org/github.com/google/libprotobuf-mutator/archive/v1.0.tar.gz', 'https://github.com/google/libprotobuf-mutator/archive/v1.0.tar.gz']) |
def do_twice(f, v):
f(v)
f(v)
def print_twice(s):
print(s)
print(s)
# do_twice(print_twice, 'spam')
def do_four(f, v):
do_twice(f, v)
do_twice(f, v)
do_four(print, 'spam')
| def do_twice(f, v):
f(v)
f(v)
def print_twice(s):
print(s)
print(s)
def do_four(f, v):
do_twice(f, v)
do_twice(f, v)
do_four(print, 'spam') |
phi_list = {}
def naples(num):
b_count = 0
rel_list = []
for i in range(1, num+1):
count = 0
for j in range(2, i):
if num%j==0 and i%j==0:
count += 1
break
if count==0:
b_count += 1
rel_list.append(i)
phi_list[num] = b_count
for val in rel_list:
if val!=1:
phi_list[val*num] = phi_list[val] * phi_list[num]
return b_count
inc = 0
while True:
inc += 1
naples(inc)
if max(phi_list) > 1000000:
break
max1 = 0
max2 = 0
for i in phi_list:
if i/phi_list[i] > max1:
max1 = i/phi_list[i]
max2 = i
print(max2) # 510510
"""
Using the fact that the totient function is multiplicative here.
Our answer was not going to be a prime, since n/phi(n) is
small for primes. So once we get over 1,000,000 in our list,
we know the only values left to be filled in are prime.
We don't have to check those.
""" | phi_list = {}
def naples(num):
b_count = 0
rel_list = []
for i in range(1, num + 1):
count = 0
for j in range(2, i):
if num % j == 0 and i % j == 0:
count += 1
break
if count == 0:
b_count += 1
rel_list.append(i)
phi_list[num] = b_count
for val in rel_list:
if val != 1:
phi_list[val * num] = phi_list[val] * phi_list[num]
return b_count
inc = 0
while True:
inc += 1
naples(inc)
if max(phi_list) > 1000000:
break
max1 = 0
max2 = 0
for i in phi_list:
if i / phi_list[i] > max1:
max1 = i / phi_list[i]
max2 = i
print(max2)
"\n\nUsing the fact that the totient function is multiplicative here.\n\nOur answer was not going to be a prime, since n/phi(n) is\nsmall for primes. So once we get over 1,000,000 in our list,\nwe know the only values left to be filled in are prime.\nWe don't have to check those.\n\n" |
# -*- coding: utf-8 -*-
"""
Created on Mon Dec 4 12:31:27 2017
@author: James Jiang
"""
with open('Data.txt') as f:
for line in f:
number = line
digits = [i for i in str(number)]
step = int(len(digits)/2)
for i in range(int(len(digits)/2)):
digits.append(digits[i])
sum = 0
for i in range(int(len(digits)*2/3)):
if digits[i] == digits[i + step]:
sum += int(digits[i])
print(sum)
| """
Created on Mon Dec 4 12:31:27 2017
@author: James Jiang
"""
with open('Data.txt') as f:
for line in f:
number = line
digits = [i for i in str(number)]
step = int(len(digits) / 2)
for i in range(int(len(digits) / 2)):
digits.append(digits[i])
sum = 0
for i in range(int(len(digits) * 2 / 3)):
if digits[i] == digits[i + step]:
sum += int(digits[i])
print(sum) |
# https://www.youtube.com/watch?v=OSGv2VnC0go
names = ["rouge", "geralt", "blizzard", "yennefer"]
colors = ["red", "green", "blue", "yellow"]
for color in reversed(colors):
print(color)
for i, color in enumerate(colors):
print(i, "-->", color)
for name, color in zip(names, colors):
print("{:<12}{:<12}".format(name, color))
for color in sorted(zip(names, colors), key=lambda x: x[0]):
print(color)
| names = ['rouge', 'geralt', 'blizzard', 'yennefer']
colors = ['red', 'green', 'blue', 'yellow']
for color in reversed(colors):
print(color)
for (i, color) in enumerate(colors):
print(i, '-->', color)
for (name, color) in zip(names, colors):
print('{:<12}{:<12}'.format(name, color))
for color in sorted(zip(names, colors), key=lambda x: x[0]):
print(color) |
# --------------------------------------------------------------
# DO NOT EDIT BELOW OF THIS UNLESS REALLY SURE
NFDUMP_FIELDS = []
NFDUMP_FIELDS.append( { "ID": "pr", "AggrType_A": "proto", "AggrType_s": "proto", "Name": "Protocol" } )
NFDUMP_FIELDS.append( { "ID": "exp", "AggrType_A": None, "AggrType_s": "sysid", "Name": "Exporter ID" } )
NFDUMP_FIELDS.append( { "ID": "sa", "AggrType_A": "srcip", "AggrType_s": "srcip", "Name": "Source Address", "Details": "IP" } )
NFDUMP_FIELDS.append( { "ID": "da", "AggrType_A": "dstip", "AggrType_s": "dstip", "Name": "Destination Address", "Details": "IP" } )
NFDUMP_FIELDS.append( { "ID": "sp", "AggrType_A": "srcport", "AggrType_s": "srcport", "Name": "Source Port" } )
NFDUMP_FIELDS.append( { "ID": "dp", "AggrType_A": "dstport", "AggrType_s": "dstport", "Name": "Destination Port" } )
NFDUMP_FIELDS.append( { "ID": "nh", "AggrType_A": "next", "AggrType_s": "nhip", "Name": "Next-hop IP Address", "Details": "IP" } )
NFDUMP_FIELDS.append( { "ID": "nhb", "AggrType_A": "bgpnext", "AggrType_s": "nhbip", "Name": "BGP Next-hop IP Address", "Details": "IP" } )
NFDUMP_FIELDS.append( { "ID": "ra", "AggrType_A": "router", "AggrType_s": "router", "Name": "Router IP Address", "Details": "IP" } )
NFDUMP_FIELDS.append( { "ID": "sas", "AggrType_A": "srcas", "AggrType_s": "srcas", "Name": "Source AS", "Details": "AS" } )
NFDUMP_FIELDS.append( { "ID": "das", "AggrType_A": "dstas", "AggrType_s": "dstas", "Name": "Destination AS", "Details": "AS" } )
NFDUMP_FIELDS.append( { "ID": "nas", "AggrType_A": "nextas", "AggrType_s": None, "Name": "Next AS", "Details": "AS" } )
NFDUMP_FIELDS.append( { "ID": "pas", "AggrType_A": "prevas", "AggrType_s": None, "Name": "Previous AS", "Details": "AS" } )
NFDUMP_FIELDS.append( { "ID": "in", "AggrType_A": "inif", "AggrType_s": "inif", "Name": "Input Interface num" } )
NFDUMP_FIELDS.append( { "ID": "out", "AggrType_A": "outif", "AggrType_s": "outif", "Name": "Output Interface num" } )
NFDUMP_FIELDS.append( { "ID": "sn4", "AggrType_A": "srcip4/%s", "AggrType_s": None, "Name": "IPv4 source network", "Details": "IP",
"OutputField": "sa", "ArgRequired": True } )
NFDUMP_FIELDS.append( { "ID": "sn6", "AggrType_A": "srcip6/%s", "AggrType_s": None, "Name": "IPv6 source network", "Details": "IP",
"OutputField": "sa", "ArgRequired": True } )
NFDUMP_FIELDS.append( { "ID": "dn4", "AggrType_A": "dstip4/%s", "AggrType_s": None, "Name": "IPv4 destination network", "Details": "IP",
"OutputField": "da", "ArgRequired": True } )
NFDUMP_FIELDS.append( { "ID": "dn6", "AggrType_A": "dstip6/%s", "AggrType_s": None, "Name": "IPv6 destination network", "Details": "IP",
"OutputField": "da", "ArgRequired": True } )
| nfdump_fields = []
NFDUMP_FIELDS.append({'ID': 'pr', 'AggrType_A': 'proto', 'AggrType_s': 'proto', 'Name': 'Protocol'})
NFDUMP_FIELDS.append({'ID': 'exp', 'AggrType_A': None, 'AggrType_s': 'sysid', 'Name': 'Exporter ID'})
NFDUMP_FIELDS.append({'ID': 'sa', 'AggrType_A': 'srcip', 'AggrType_s': 'srcip', 'Name': 'Source Address', 'Details': 'IP'})
NFDUMP_FIELDS.append({'ID': 'da', 'AggrType_A': 'dstip', 'AggrType_s': 'dstip', 'Name': 'Destination Address', 'Details': 'IP'})
NFDUMP_FIELDS.append({'ID': 'sp', 'AggrType_A': 'srcport', 'AggrType_s': 'srcport', 'Name': 'Source Port'})
NFDUMP_FIELDS.append({'ID': 'dp', 'AggrType_A': 'dstport', 'AggrType_s': 'dstport', 'Name': 'Destination Port'})
NFDUMP_FIELDS.append({'ID': 'nh', 'AggrType_A': 'next', 'AggrType_s': 'nhip', 'Name': 'Next-hop IP Address', 'Details': 'IP'})
NFDUMP_FIELDS.append({'ID': 'nhb', 'AggrType_A': 'bgpnext', 'AggrType_s': 'nhbip', 'Name': 'BGP Next-hop IP Address', 'Details': 'IP'})
NFDUMP_FIELDS.append({'ID': 'ra', 'AggrType_A': 'router', 'AggrType_s': 'router', 'Name': 'Router IP Address', 'Details': 'IP'})
NFDUMP_FIELDS.append({'ID': 'sas', 'AggrType_A': 'srcas', 'AggrType_s': 'srcas', 'Name': 'Source AS', 'Details': 'AS'})
NFDUMP_FIELDS.append({'ID': 'das', 'AggrType_A': 'dstas', 'AggrType_s': 'dstas', 'Name': 'Destination AS', 'Details': 'AS'})
NFDUMP_FIELDS.append({'ID': 'nas', 'AggrType_A': 'nextas', 'AggrType_s': None, 'Name': 'Next AS', 'Details': 'AS'})
NFDUMP_FIELDS.append({'ID': 'pas', 'AggrType_A': 'prevas', 'AggrType_s': None, 'Name': 'Previous AS', 'Details': 'AS'})
NFDUMP_FIELDS.append({'ID': 'in', 'AggrType_A': 'inif', 'AggrType_s': 'inif', 'Name': 'Input Interface num'})
NFDUMP_FIELDS.append({'ID': 'out', 'AggrType_A': 'outif', 'AggrType_s': 'outif', 'Name': 'Output Interface num'})
NFDUMP_FIELDS.append({'ID': 'sn4', 'AggrType_A': 'srcip4/%s', 'AggrType_s': None, 'Name': 'IPv4 source network', 'Details': 'IP', 'OutputField': 'sa', 'ArgRequired': True})
NFDUMP_FIELDS.append({'ID': 'sn6', 'AggrType_A': 'srcip6/%s', 'AggrType_s': None, 'Name': 'IPv6 source network', 'Details': 'IP', 'OutputField': 'sa', 'ArgRequired': True})
NFDUMP_FIELDS.append({'ID': 'dn4', 'AggrType_A': 'dstip4/%s', 'AggrType_s': None, 'Name': 'IPv4 destination network', 'Details': 'IP', 'OutputField': 'da', 'ArgRequired': True})
NFDUMP_FIELDS.append({'ID': 'dn6', 'AggrType_A': 'dstip6/%s', 'AggrType_s': None, 'Name': 'IPv6 destination network', 'Details': 'IP', 'OutputField': 'da', 'ArgRequired': True}) |
#
# Vivante Cross Toolchain configuration
#
load("@bazel_tools//tools/build_defs/cc:action_names.bzl", "ACTION_NAMES")
load("@bazel_tools//tools/cpp:cc_toolchain_config_lib.bzl",
"tool_path",
"feature",
"with_feature_set",
"flag_group",
"flag_set")
load("//:cc_toolchain_base.bzl",
"build_cc_toolchain_config",
"all_compile_actions",
"all_cpp_compile_actions",
"all_link_actions")
tool_paths = [
tool_path(name = "ar", path = "bin/wrapper-ar",),
tool_path(name = "compat-ld", path = "bin/wrapper-ld",),
tool_path(name = "cpp", path = "bin/wrapper-cpp",),
tool_path(name = "dwp", path = "bin/wrapper-dwp",),
tool_path(name = "gcc", path = "bin/wrapper-gcc",),
tool_path(name = "gcov", path = "bin/wrapper-gcov",),
tool_path(name = "ld", path = "bin/wrapper-ld",),
tool_path(name = "nm", path = "bin/wrapper-nm",),
tool_path(name = "objcopy", path = "bin/wrapper-objcopy",),
tool_path(name = "objdump", path = "bin/wrapper-objdump",),
tool_path(name = "strip", path = "bin/wrapper-strip",),
]
def _impl(ctx):
builtin_sysroot = "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/libc"
compile_flags_feature = feature(
name = "compile_flags",
enabled = True,
flag_sets = [
flag_set(
actions = all_compile_actions,
flag_groups = [
flag_group(
flags = [
"-idirafter", "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/libc/usr/include",
"-idirafter", "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/include",
"-idirafter", "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/include-fixed",
"-idirafter", "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/install-tools/include",
"-idirafter", "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/plugin/include",
],
),
flag_group(
flags = [
"-D__arm64",
"-Wall", # All warnings are enabled.
"-Wunused-but-set-parameter", # Enable a few more warnings that aren't part of -Wall.
"-Wno-free-nonheap-object", # Disable some that are problematic, has false positives
"-fno-omit-frame-pointer", # Keep stack frames for debugging, even in opt mode.
"-no-canonical-prefixes",
"-fstack-protector",
"-fPIE",
"-fPIC",
],
),
],
),
flag_set(
actions = all_cpp_compile_actions + [ACTION_NAMES.lto_backend],
flag_groups = [
flag_group(
flags = [
"-isystem" , "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/include/c++/7.3.1",
"-isystem" , "external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/include/c++/7.3.1/aarch64-linux-gnu",
]
),
],
),
flag_set(
actions = all_compile_actions,
flag_groups = [
flag_group(
flags = [
"-g",
],
),
],
with_features = [with_feature_set(features = ["dbg"])],
),
flag_set(
actions = all_compile_actions,
flag_groups = [
flag_group(
flags = [
"-g0",
"-O2",
"-DNDEBUG",
"-ffunction-sections",
"-fdata-sections",
],
),
],
with_features = [with_feature_set(features = ["opt"])],
),
flag_set(
actions = all_link_actions,
flag_groups = [
flag_group(
flags = [
"-lstdc++",
],
),
],
),
flag_set(
actions = all_link_actions,
flag_groups = [
flag_group(
flags = [
"-Wl,--gc-sections",
],
),
],
with_features = [with_feature_set(features = ["opt"])],
),
flag_set(
actions = [
ACTION_NAMES.cpp_link_executable,
],
flag_groups = [
flag_group(
flags = [
"-pie",
],
),
],
),
],
)
cxx_builtin_include_directories = [
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//aarch64-linux-gnu/libc/usr/include)%",
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/include)%",
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/include-fixed)%",
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/install-tools/include)%",
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/plugin/include)%",
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//aarch64-linux-gnu/include/c++/7.3.1)%",
"%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//aarch64-linux-gnu/include/c++/7.3.1/aarch64-linux-gnu)%",
]
objcopy_embed_flags_feature = feature(
name = "objcopy_embed_flags",
enabled = True,
flag_sets = [
flag_set(
actions = ["objcopy_embed_data"],
flag_groups = [
flag_group(
flags = [
"-I",
"binary",
],
),
],
),
]
)
dbg_feature = feature(name = "dbg")
opt_feature = feature(name = "opt")
return cc_common.create_cc_toolchain_config_info(
ctx = ctx,
toolchain_identifier = ctx.attr.toolchain_name,
host_system_name = "",
target_system_name = "linux",
target_cpu = ctx.attr.target_cpu,
target_libc = ctx.attr.target_cpu,
compiler = ctx.attr.compiler,
abi_version = ctx.attr.compiler,
abi_libc_version = ctx.attr.compiler,
tool_paths = tool_paths,
features = [compile_flags_feature, objcopy_embed_flags_feature, dbg_feature, opt_feature],
cxx_builtin_include_directories = cxx_builtin_include_directories,
builtin_sysroot = builtin_sysroot,
)
# DON'T MODIFY
cc_toolchain_config = build_cc_toolchain_config(_impl)
# EOF
| load('@bazel_tools//tools/build_defs/cc:action_names.bzl', 'ACTION_NAMES')
load('@bazel_tools//tools/cpp:cc_toolchain_config_lib.bzl', 'tool_path', 'feature', 'with_feature_set', 'flag_group', 'flag_set')
load('//:cc_toolchain_base.bzl', 'build_cc_toolchain_config', 'all_compile_actions', 'all_cpp_compile_actions', 'all_link_actions')
tool_paths = [tool_path(name='ar', path='bin/wrapper-ar'), tool_path(name='compat-ld', path='bin/wrapper-ld'), tool_path(name='cpp', path='bin/wrapper-cpp'), tool_path(name='dwp', path='bin/wrapper-dwp'), tool_path(name='gcc', path='bin/wrapper-gcc'), tool_path(name='gcov', path='bin/wrapper-gcov'), tool_path(name='ld', path='bin/wrapper-ld'), tool_path(name='nm', path='bin/wrapper-nm'), tool_path(name='objcopy', path='bin/wrapper-objcopy'), tool_path(name='objdump', path='bin/wrapper-objdump'), tool_path(name='strip', path='bin/wrapper-strip')]
def _impl(ctx):
builtin_sysroot = 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/libc'
compile_flags_feature = feature(name='compile_flags', enabled=True, flag_sets=[flag_set(actions=all_compile_actions, flag_groups=[flag_group(flags=['-idirafter', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/libc/usr/include', '-idirafter', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/include', '-idirafter', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/include-fixed', '-idirafter', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/install-tools/include', '-idirafter', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/lib/gcc/aarch64-linux-gnu/7.3.1/plugin/include']), flag_group(flags=['-D__arm64', '-Wall', '-Wunused-but-set-parameter', '-Wno-free-nonheap-object', '-fno-omit-frame-pointer', '-no-canonical-prefixes', '-fstack-protector', '-fPIE', '-fPIC'])]), flag_set(actions=all_cpp_compile_actions + [ACTION_NAMES.lto_backend], flag_groups=[flag_group(flags=['-isystem', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/include/c++/7.3.1', '-isystem', 'external/gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu/aarch64-linux-gnu/include/c++/7.3.1/aarch64-linux-gnu'])]), flag_set(actions=all_compile_actions, flag_groups=[flag_group(flags=['-g'])], with_features=[with_feature_set(features=['dbg'])]), flag_set(actions=all_compile_actions, flag_groups=[flag_group(flags=['-g0', '-O2', '-DNDEBUG', '-ffunction-sections', '-fdata-sections'])], with_features=[with_feature_set(features=['opt'])]), flag_set(actions=all_link_actions, flag_groups=[flag_group(flags=['-lstdc++'])]), flag_set(actions=all_link_actions, flag_groups=[flag_group(flags=['-Wl,--gc-sections'])], with_features=[with_feature_set(features=['opt'])]), flag_set(actions=[ACTION_NAMES.cpp_link_executable], flag_groups=[flag_group(flags=['-pie'])])])
cxx_builtin_include_directories = ['%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//aarch64-linux-gnu/libc/usr/include)%', '%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/include)%', '%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/include-fixed)%', '%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/install-tools/include)%', '%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//lib/gcc/aarch64-linux-gnu/7.3.1/plugin/include)%', '%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//aarch64-linux-gnu/include/c++/7.3.1)%', '%package(@gcc-linaro-7.3.1-2018.05-x86_64_aarch64-linux-gnu//aarch64-linux-gnu/include/c++/7.3.1/aarch64-linux-gnu)%']
objcopy_embed_flags_feature = feature(name='objcopy_embed_flags', enabled=True, flag_sets=[flag_set(actions=['objcopy_embed_data'], flag_groups=[flag_group(flags=['-I', 'binary'])])])
dbg_feature = feature(name='dbg')
opt_feature = feature(name='opt')
return cc_common.create_cc_toolchain_config_info(ctx=ctx, toolchain_identifier=ctx.attr.toolchain_name, host_system_name='', target_system_name='linux', target_cpu=ctx.attr.target_cpu, target_libc=ctx.attr.target_cpu, compiler=ctx.attr.compiler, abi_version=ctx.attr.compiler, abi_libc_version=ctx.attr.compiler, tool_paths=tool_paths, features=[compile_flags_feature, objcopy_embed_flags_feature, dbg_feature, opt_feature], cxx_builtin_include_directories=cxx_builtin_include_directories, builtin_sysroot=builtin_sysroot)
cc_toolchain_config = build_cc_toolchain_config(_impl) |
dia = input('what day were you born?')
mes = input('what month were you born?')
ano = input('what year were you born?')
saudacaoDia = ('voce nasceu no dia')
saudacaoDe = ('de')
print(saudacaoDia, dia,saudacaoDe,mes,saudacaoDe,ano) | dia = input('what day were you born?')
mes = input('what month were you born?')
ano = input('what year were you born?')
saudacao_dia = 'voce nasceu no dia'
saudacao_de = 'de'
print(saudacaoDia, dia, saudacaoDe, mes, saudacaoDe, ano) |
#!/usr/bin/env python
if __name__ == "__main__":
N = int(raw_input())
for i in range(N):
print(pow(i,2))
| if __name__ == '__main__':
n = int(raw_input())
for i in range(N):
print(pow(i, 2)) |
'''
1. Write a Python program to create a tuple.
2. Write a Python program to create a tuple with different data types.
3. Write a Python program to create a tuple with numbers and print one item.
4. Write a Python program to unpack a tuple in several variables.
5. Write a Python program to add an item in a tuple.
6. Write a Python program to convert a tuple to a string.
7. Write a Python program to get the 4th element and 4th element from last of a tuple.
8. Write a Python program to create the colon of a tuple.
9. Write a Python program to find the repeated items of a tuple.
10. Write a Python program to check whether an element exists within a tuple.
'''
| """
1. Write a Python program to create a tuple.
2. Write a Python program to create a tuple with different data types.
3. Write a Python program to create a tuple with numbers and print one item.
4. Write a Python program to unpack a tuple in several variables.
5. Write a Python program to add an item in a tuple.
6. Write a Python program to convert a tuple to a string.
7. Write a Python program to get the 4th element and 4th element from last of a tuple.
8. Write a Python program to create the colon of a tuple.
9. Write a Python program to find the repeated items of a tuple.
10. Write a Python program to check whether an element exists within a tuple.
""" |
# Write a program that does the following:
## Prompt the user for their age. Convert it to a number, add one to it, and tell them how old they will be on their next birthday.
## Prompt the user for the number of egg cartons they have. Assume each carton holds 12 eggs, multiply their number by 12, and display the total number of eggs.
## Prompt the user for a number of cookies and a number of people. Then, divide the number of cookies by the number of people to determine how many cookies each person gets.
age_now = int(input("How old are you? "))
age_one_year_after = age_now+1
print("Next year you will be " +str(age_one_year_after))
print("\n----------------")
egg_cartoons = int(input("How much egg cartoons do you have? "))
total_eggs = egg_cartoons*12
print("Nice! So you have "+ str(total_eggs)+" eggs in total!")
print("\n----------------")
cookies = int(input("Give me a number of cookies: "))
people = int(input("Now, give a number of people: "))
num_parts_of_cookies = cookies/people
print(f"If we divide these {cookies} cookies to these {people} people, each person with have {num_parts_of_cookies} parts of cookies")
| age_now = int(input('How old are you? '))
age_one_year_after = age_now + 1
print('Next year you will be ' + str(age_one_year_after))
print('\n----------------')
egg_cartoons = int(input('How much egg cartoons do you have? '))
total_eggs = egg_cartoons * 12
print('Nice! So you have ' + str(total_eggs) + ' eggs in total!')
print('\n----------------')
cookies = int(input('Give me a number of cookies: '))
people = int(input('Now, give a number of people: '))
num_parts_of_cookies = cookies / people
print(f'If we divide these {cookies} cookies to these {people} people, each person with have {num_parts_of_cookies} parts of cookies') |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.