hexsha stringlengths 40 40 | size int64 5 1.05M | ext stringclasses 98
values | lang stringclasses 21
values | max_stars_repo_path stringlengths 3 945 | max_stars_repo_name stringlengths 4 118 | max_stars_repo_head_hexsha stringlengths 40 78 | max_stars_repo_licenses listlengths 1 10 | max_stars_count int64 1 368k ⌀ | max_stars_repo_stars_event_min_datetime stringlengths 24 24 ⌀ | max_stars_repo_stars_event_max_datetime stringlengths 24 24 ⌀ | max_issues_repo_path stringlengths 3 945 | max_issues_repo_name stringlengths 4 118 | max_issues_repo_head_hexsha stringlengths 40 78 | max_issues_repo_licenses listlengths 1 10 | max_issues_count int64 1 134k ⌀ | max_issues_repo_issues_event_min_datetime stringlengths 24 24 ⌀ | max_issues_repo_issues_event_max_datetime stringlengths 24 24 ⌀ | max_forks_repo_path stringlengths 3 945 | max_forks_repo_name stringlengths 4 135 | max_forks_repo_head_hexsha stringlengths 40 78 | max_forks_repo_licenses listlengths 1 10 | max_forks_count int64 1 105k ⌀ | max_forks_repo_forks_event_min_datetime stringlengths 24 24 ⌀ | max_forks_repo_forks_event_max_datetime stringlengths 24 24 ⌀ | content stringlengths 5 1.05M | avg_line_length float64 1 1.03M | max_line_length int64 2 1.03M | alphanum_fraction float64 0 1 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
7b9e9125c8f1adadda3d631df59bbefda2b6c721 | 9,029 | dart | Dart | lib/src/base/os_service_io.dart | hamatoma/dart_bones | fd6bc5870d09f694adb1c1ef8ccc3040c9106cd5 | [
"CC0-1.0"
] | 1 | 2021-12-30T10:46:55.000Z | 2021-12-30T10:46:55.000Z | lib/src/base/os_service_io.dart | hamatoma/dart_bones | fd6bc5870d09f694adb1c1ef8ccc3040c9106cd5 | [
"CC0-1.0"
] | null | null | null | lib/src/base/os_service_io.dart | hamatoma/dart_bones | fd6bc5870d09f694adb1c1ef8ccc3040c9106cd5 | [
"CC0-1.0"
] | null | null | null | import 'dart:io';
import 'package:path/path.dart' as package_path;
import 'base_logger.dart';
import 'bones_globals.dart';
import 'file_sync_io.dart';
import 'process_sync_io.dart';
/// Holds the information about the current user.
class OsService {
static OsService? _instance;
final BaseLogger logger;
final UserInfo userInfo = UserInfo();
final _fileSync = FileSync();
final _processSync = ProcessSync();
/// The public constructor.
/// If [logger] is null an isolated instance is returned. Otherwise a singleton.
/// Note: normally the singleton instance should be used.
/// Only in special cases like different threads ("isolates") isolated
/// instances will be meaningful.
factory OsService([BaseLogger? logger]) {
final rc = logger != null
? OsService._internal(logger)
: _instance ??= OsService._internal(globalLogger);
return rc;
}
/// Private constructor.
OsService._internal(this.logger);
/// Tests whether a [group] exists.
bool groupExists(String group) {
final lines = _fileSync.fileAsList('/etc/group');
final pattern = '$group:';
final rc = lines
.firstWhere((element) => element.startsWith(pattern), orElse: () => '')
.isNotEmpty;
return rc;
}
/// Returns the group id of an [group] or null.
int? groupId(String group) {
final lines = _fileSync.fileAsList('/etc/group');
final pattern = '$group:';
final line = lines.firstWhere((element) => element.startsWith(pattern),
orElse: () => '');
final rc = line.isEmpty ? null : int.parse(line.split(':')[2]);
return rc;
}
/// Installs an application named [appName].
/// [configurationFile] is the name of the configuration file to create.
/// [configurationContent] is a text to write into [configurationFile].
/// If [configurationContent] is null [configurationFile] is not written.
/// [targetExecutable] is the directory to store the executable.
void install(String appName,
{String? configurationFile,
String? configurationContent,
String targetExecutable = '/usr/local/bin'}) {
if (!userInfo.isRoot) {
logger.error('Be root');
} else {
configurationFile ??= '/etc/$appName/$appName.yaml';
if (configurationContent != null) {
_fileSync.ensureDirectory(package_path.basename(configurationFile));
logger.log('= writing configuration to $configurationFile');
_fileSync.toFile(configurationFile, configurationContent);
}
final executable = Platform.script.toFilePath();
final file = File(executable);
if (!file.existsSync()) {
logger.error('cannot access executable $executable');
} else {
logger.log('= $executable -> $targetExecutable');
file.copy(package_path.join(
targetExecutable, package_path.basename(executable)));
}
}
}
/// Creates the file controlling a systemd service.
/// [serviceName]: used for syslog and environment file.
/// [starter]: name of the starter with path, e.g. '/usr/local/bin/monitor'.
/// [user]: the service is started with this user.
/// [group]: the service is started with this group.
/// [description]: this string is showed when the status is requested.
/// [workingDirectory]: the service process starts with that.
/// [startAtOnce]: true: the service is started at once, false: the service
/// must be started manually.
void installService(String serviceName,
{required String starter,
String? user,
String? group,
String? description,
String? workingDirectory,
bool startAtOnce = true}) {
final userInfo = UserInfo();
if (!userInfo.isRoot) {
logger.error('Be root');
} else if (workingDirectory != null &&
!workingDirectory.startsWith(Platform.pathSeparator)) {
logger.error('working directory is not absolute: $workingDirectory');
} else if (!starter.startsWith(Platform.pathSeparator)) {
logger.error('starter executable is not absolute: $starter');
} else if (!File(starter).existsSync()) {
logger.error('starter executable does not exist: $starter');
} else {
final systemDPath = '/etc/systemd/system';
final systemDFile =
package_path.join(systemDPath, '$serviceName.service');
user ??= serviceName;
group ??= user;
description ??= 'A daemon to service $serviceName';
workingDirectory ??= '/etc/$serviceName';
final script = '''[Unit]
Description=$description.
After=syslog.target
[Service]
Type=simple
User=$user
Group=$user
WorkingDirectory=$workingDirectory
#EnvironmentFile=-$workingDirectory/$serviceName.env
ExecStart=$starter daemon $serviceName $user
ExecReload=$starter reload $serviceName $user
SyslogIdentifier=$serviceName
StandardOutput=syslog
StandardError=syslog
Restart=always
RestartSec=3
[Install]
WantedBy=multi-user.target
''';
logger.log('= installing $systemDFile');
_fileSync.toFile(systemDFile, script);
if (!userExists(user)) {
final args = <String>['--no-create-home'];
if (user != group) {
args.add('--no-user-group');
}
args.add(user);
logger.log('= creating user $user ' +
_processSync.executeToString('/usr/sbin/useradd', args).trim());
}
if (!groupExists(group)) {
logger.log('= creating group $group ' +
_processSync.executeToString('/usr/sbin/groupadd', [group]).trim());
}
logger.log(_processSync
.executeToString('/bin/systemctl', ['enable', serviceName]));
if (!startAtOnce) {
logger
.log('= Please check the configuration and than start the service:'
'systemctl start $serviceName');
} else {
_processSync.executeToString('/bin/systemctl', ['start', serviceName]);
logger.log('= Status $serviceName\n' +
_processSync
.executeToString('/bin/systemctl', ['status', serviceName]));
}
}
}
void uninstallService(String serviceName, {String? user, String? group}) {
final userInfo = UserInfo();
if (!userInfo.isRoot) {
logger.error('Be root');
} else {
logger.log('= Disabling and stopping the service $serviceName');
logger.log(_processSync
.executeToString('/bin/systemctl', ['disable', serviceName]));
logger.log(_processSync
.executeToString('/bin/systemctl', ['stop', serviceName]));
logger.log(_processSync
.executeToString('/bin/systemctl', ['status', serviceName]));
final systemDFile =
package_path.join('/etc/systemd/system', '$serviceName.service');
final file = File(systemDFile);
if (file.existsSync()) {
logger.log('= removing $systemDFile');
file.deleteSync();
}
if (group == serviceName && group != null && groupExists(group)) {
logger.log('= removing group $group ' +
_processSync.executeToString('/usr/sbin/groupdel', [group]));
}
if (user == serviceName && user != null && userExists(user)) {
logger.log('= removing user $user ' +
_processSync.executeToString('/usr/sbin/userdel', [user]));
}
}
}
/// Tests whether a user exists.
bool userExists(String user) {
var rc;
if (Platform.isLinux) {
final lines = _fileSync.fileAsList('/etc/passwd');
final pattern = '$user:';
rc = lines
.firstWhere((element) => element.startsWith(pattern),
orElse: () => '')
.isNotEmpty;
}
return rc;
}
/// Returns the user id of an [user] or null.
int? userId(String user) {
final lines = _fileSync.fileAsList('/etc/passwd');
final pattern = '$user:';
final line = lines.firstWhere((element) => element.startsWith(pattern),
orElse: () => '');
final rc = line.isEmpty ? null : int.parse(line.split(':')[2]);
return rc;
}
}
/// Holds the information about the current user.
class UserInfo {
final _processSync = ProcessSync();
String? currentUserName = fromEnv('USER');
int currentUserId = -1;
int? currentGroupId;
String? currentGroupName;
String? home = fromEnv('HOME');
UserInfo() {
if (Platform.isLinux) {
final info = _processSync.executeToString('/usr/bin/id', []);
final matcher =
RegExp(r'uid=(\d+)\((\w+)\) gid=(\d+)\((\w+)').firstMatch(info);
if (matcher != null) {
currentUserId = int.parse(matcher.group(1) ?? '');
currentUserName = matcher.group(2) ?? '';
currentGroupId = int.parse(matcher.group(3) ?? '');
currentGroupName = matcher.group(4);
}
}
}
bool get isRoot =>
currentUserId < 0 ? currentUserName == 'root' : currentUserId == 0;
/// Gets the value of a variable named [name] from the environment or null.
static String? fromEnv(String name) {
var rc = Platform.environment.containsKey(name)
? Platform.environment[name]
: null;
return rc;
}
}
| 35.687747 | 82 | 0.638498 |
1bf09c3b9c07cd3ef26965b75338b1490c53e35a | 5,852 | py | Python | sprox/providerselector.py | carl-wallace/sprox | 69c8639b86318c28bbaad36125232d144d8be380 | [
"MIT"
] | null | null | null | sprox/providerselector.py | carl-wallace/sprox | 69c8639b86318c28bbaad36125232d144d8be380 | [
"MIT"
] | null | null | null | sprox/providerselector.py | carl-wallace/sprox | 69c8639b86318c28bbaad36125232d144d8be380 | [
"MIT"
] | null | null | null | """
Provider Locator Module
a module to help dbsprockets automatically find providers
Copyright (c) 2008 Christopher Perkins
Original Version by Christopher Perkins 2007
Released under MIT license.
"""
import inspect
try:
from sqlalchemy import MetaData
from sqlalchemy.engine import Engine
from sqlalchemy.orm import _mapper_registry, class_mapper
from sqlalchemy.orm.session import Session
from sqlalchemy.orm.scoping import ScopedSession
except ImportError: # pragma: no cover
pass
try: #pragma:no cover
from sqlalchemy.orm.instrumentation import ClassManager
except ImportError: #pragma:no cover
try: # pragma: no cover
#sa 0.6- support
from sqlalchemy.orm.attributes import ClassManager
except ImportError:
pass
SAORMProvider = None
try:
from sprox.sa.provider import SAORMProvider
except ImportError: # pragma: no cover
pass
#MongoKitProvider = None
#try:
# from sprox.mk.provider import MongoKitProvider
#except ImportError: # pragma: no cover
# pass
MingProvider = None
MappedClass = None
try:
from sprox.mg.provider import MingProvider
try:
from ming.odm.declarative import MappedClass
except ImportError: #pragma: no cover
from ming.orm.declarative import MappedClass
except ImportError: # pragma: no cover
pass
from sprox.dummyentity import DummyEntity
class ProviderSelector:
def __init__(self):
self._identifiers = {}
self._entities = {}
def get_entity(self, name, **hints):
raise NotImplementedError
def get_identifier(self, entity, **hints):
raise NotImplementedError
def get_provider(self, entity, **hints):
raise NotImplementedError
#class _MongoKitSelector(ProviderSelector):
# def get_identifier(self, entity, **hints):
# return entity.__name__
# def get_provider(self, entity=None, hint=None, **hints):
# #TODO cache
# return MongoKitProvider(None)
class _MingSelector(ProviderSelector):
#def get_identifier(self, entity, **hints):
# return entity.__name__
def get_provider(self, entity=None, hint=None, **hints):
#TODO cache
return MingProvider(entity.__mongometa__.session)
class _SAORMSelector(ProviderSelector):
def __init__(self):
self._providers = {}
def _get_engine(self, hint, hints):
metadata = hints.get('metadata', None)
engine = hints.get('engine', None)
session = hints.get('session', None)
if isinstance(hint, Engine):
engine=hint
if isinstance(hint, MetaData):
metadata=hint
if isinstance(hint, (Session, ScopedSession)):
session = hint
if session is not None and engine is None:
engine = session.bind
if metadata is not None and engine is None:
engine = metadata.bind
return engine
def get_entity(self, identifier, hint=None, **hints):
engine = self._get_engine(hint, hints)
for mapper in _mapper_registry:
if mapper.class_.__name__ == identifier:
if engine is None:
return mapper.class_
if engine is not None and mapper.tables[0].bind == engine:
return mapper.class_
raise KeyError('could not find model by the name %s in %s'%(model_name, metadata))
def get_identifier(self, entity, **hints):
return entity.__name__
def get_provider(self, entity=None, hint=None, **hints):
"""
:Arguments:
Entity
Mapped class to find a provider for
hint/hints
variables sent in to the provider to give more information about
how the provider connects to the database.
Get a provider related to the entity. (They should share the same engine)
The provider's are cached as not to waste computation/memory.
:Usage:
>>> from sprox.providerselector import SAORMSelector
>>> provider = SAORMSelector.get_provider(User, session=session)
>>> str(provider.engine.url.drivername)
'sqlite'
"""
if entity is None and isinstance(hint, Engine):
engine = hint
if engine not in self._providers:
self._providers[engine] = SAORMProvider(hint, **hints)
return self._providers[engine]
if hint is None and entity is not None:
mapper = class_mapper(entity)
hint = mapper.tables[0].bind
engine = self._get_engine(hint, hints)
if engine not in self._providers:
if hint is None and len(hints) == 0:
hint = engine
self._providers[engine] = SAORMProvider(hint, **hints)
return self._providers[engine]
SAORMSelector = _SAORMSelector()
#MongoKitSelector = _MongoKitSelector()
MingSelector = _MingSelector()
#XXX:
#StormSelector = _StormSelector()
#SOSelector = _SOSelector()
class ProviderTypeSelectorError(Exception):pass
class ProviderTypeSelector(object):
def get_selector(self, entity=None, **hints):
#use a SA Helper
if hasattr(entity, '_sa_class_manager') and isinstance(entity._sa_class_manager, ClassManager):
return SAORMSelector
elif inspect.isclass(entity) and issubclass(entity, DummyEntity):
return SAORMSelector
#elif hasattr(entity, '_use_pylons') or hasattr(entity,'_enable_autoref'):
#xxx: find a better marker
# return MongoKitSelector
elif inspect.isclass(entity) and MappedClass is not None and issubclass(entity, MappedClass):
return MingSelector
#other helper definitions are going in here
else:
raise ProviderTypeSelectorError('Entity %s has no known provider mapping.'%entity)
| 30.638743 | 103 | 0.66285 |
5b5c6d9a38f5f5a1bf50417c12fb7883ba9a31da | 329 | cpp | C++ | containers/mystringlist.cpp | jamcodes/Qt5-Code-Examples | 8f2db35cb03425c237f867c04674e5ba3291524d | [
"BSD-2-Clause"
] | 5 | 2020-11-30T13:19:47.000Z | 2021-06-16T13:44:06.000Z | containers/mystringlist.cpp | jamcodes/Qt5-Code-Examples | 8f2db35cb03425c237f867c04674e5ba3291524d | [
"BSD-2-Clause"
] | null | null | null | containers/mystringlist.cpp | jamcodes/Qt5-Code-Examples | 8f2db35cb03425c237f867c04674e5ba3291524d | [
"BSD-2-Clause"
] | 3 | 2020-11-30T13:20:33.000Z | 2021-01-14T17:57:55.000Z | #include <QTextStream>
#include <QList>
int main(void) {
QTextStream out(stdout);
QString string = "coin, book, cup, pencil, clock, bookmark";
QStringList items = string.split(",");
QStringListIterator it(items);
while (it.hasNext()) {
out << it.next().trimmed() << endl;
}
return 0;
}
| 16.45 | 64 | 0.601824 |
ec2e59662a9264c0f0538f2a5a2df3a0d97ba11d | 5,426 | lua | Lua | gotylike/definitions/Sentinel.lua | ToddButler93/tamods-server-gotylike | 34cefd0d6dcd65b971e381c223e2ea83f3586cf5 | [
"MIT"
] | null | null | null | gotylike/definitions/Sentinel.lua | ToddButler93/tamods-server-gotylike | 34cefd0d6dcd65b971e381c223e2ea83f3586cf5 | [
"MIT"
] | null | null | null | gotylike/definitions/Sentinel.lua | ToddButler93/tamods-server-gotylike | 34cefd0d6dcd65b971e381c223e2ea83f3586cf5 | [
"MIT"
] | null | null | null | local classDef = {
ootbClass="Light",
armorClass="Sentinel",
weapons={
"BXT1",
"BXT1A",
"Phase Rifle",
"SAP20",
{class="Medium", name="Nova Blaster"},
{class="Heavy", name="Nova Blaster MX"},
"Falcon",
"Accurized Shotgun",
{class="Light", name="Shocklance"},
{class="Medium", name="Long Range Repair Tool"}, -- Dummy tertiary weapon
},
beltItems={
"T5 Grenades",
"Claymore Mines",
"Motion Mines",
},
packs={
"Light Energy Pack",
},
skins={
"Sentinel",
"Specter",
},
properties={
HealthPool = 800,
RegenTime = 20,
Mass = 100,
RegenRate = 0.1,
EnergyPool = 90,
VehicleSpeedInheritance = 1,
},
armorValueMods={
-- Sentinel Armor Upgrades
RegenTimeBuff = 0.25,
WalkSpeedBuff = 0.1,
HealthRegenRateBuff = 0.25,
HealthBuff = 100,
EnergyBuff = 10,
ExtraBeltAmmo = 1,
ExtraMines = 1,
}
}
local itemDefs = {
{
name="BXT1",
changes={
Damage = 10, -- Uncharged damage
BXTChargeMaxDamage = 500,
BXTChargeTime = 2.5,
BXTChargeMultCoefficient = 16,
BXTChargeDivCoefficient = 100,
ReloadTime = 1.4,
FireInterval = 1.0,
ClipAmmo = 5,
SpareAmmo = 32,
HitscanRange = 100000,
MinDamageProportion = 0.45,
MaxDamageRangeProportion = 0.12,
MinDamageRangeProportion = 0.24,
DamageAgainstShrikeMultiplier = 0.1,
},
},
{
name="BXT1A",
changes={
Damage = 10, -- Uncharged damage
BXTChargeMaxDamage = 500,
BXTChargeTime = 2.8,
BXTChargeMultCoefficient = 16,
BXTChargeDivCoefficient = 100,
ReloadTime = 1.4,
FireInterval = 1.0,
ClipAmmo = 6,
SpareAmmo = 34,
HitscanRange = 100000,
MinDamageProportion = 0.45,
MaxDamageRangeProportion = 0.12,
MinDamageRangeProportion = 0.24,
DamageAgainstShrikeMultiplier = 0.1,
},
},
{
name="Phase Rifle",
changes={
Damage = 60, -- Damage with no energy
PhaseDamagePerEnergy = 5.0,
PhaseMaxConsumedEnergy = 90.0,
ReloadTime = 1.4,
FireInterval = 1.0,
ClipAmmo = 5,
SpareAmmo = 32,
HitscanRange = 100000,
MinDamageProportion = 0.45,
MaxDamageRangeProportion = 0.12,
MinDamageRangeProportion = 0.24,
DamageAgainstShrikeMultiplier = 0.1,
},
valueMods={}
},
{
name="SAP20",
changes={
Damage = 60, -- Damage with no energy
PhaseDamagePerEnergy = 5.0,
PhaseMaxConsumedEnergy = 90.0,
ReloadTime = 1.4,
FireInterval = 1.0,
ClipAmmo = 5,
SpareAmmo = 32,
HitscanRange = 100000,
MinDamageProportion = 0.45,
MaxDamageRangeProportion = 0.12,
MinDamageRangeProportion = 0.24,
DamageAgainstShrikeMultiplier = 0.1,
},
valueMods={}
},
{
name="Falcon",
changes={
Damage = 65,
ProjectileInheritance = 0,
ClipAmmo = 24,
ReloadTime = 1.53,
FireInterval = 0.1,
},
},
{
class="Medium",
name="Nova Blaster",
changes={
Damage = 350,
ProjectileSpeed = 8000,
ProjectileLifespan = 1,
ClipAmmo = 8,
SpareAmmo = 96,
ReloadTime = 1.4,
FireInterval = 0.35,
MinDamageProportion = 1,
MaxDamageRangeProportion = 0.2,
MinDamageRangeProportion = 0.4,
HoldToFire = false,
},
},
{
class="Heavy",
name="Nova Blaster MX",
changes={
Damage = 250,
ProjectileSpeed = 8000,
ProjectileLifespan = 1,
ClipAmmo = 11,
SpareAmmo = 128,
ReloadTime = 1.4,
FireInterval = 0.25,
MinDamageProportion = 1,
MaxDamageRangeProportion = 0.2,
MinDamageRangeProportion = 0.4,
HoldToFire = false,
},
},
{
name="Accurized Shotgun",
changes={
Damage = 70,
ShotgunShotCount = 8,
ClipAmmo = 6,
SpareAmmo = 50,
HitscanRange = 3000,
},
},
{
name="Claymore Mines",
changes={
Damage=700,
DamageAgainstArmorMultiplier=0.50,
DamageAgainstGeneratorMultiplier=1.0,
DamageAgainstBeowulfMultiplier=0.50,
DamageAgainstGravCycleMultiplier=0.50,
DamageAgainstBaseTurretMultiplier=2.50,
DamageAgainstBaseSensorMultiplier=2.50,
DamageAgainstShrikeMultiplier=2.50,
},
},
{
name="T5 Grenades",
changes={
Damage = 1100,
ExplosiveRadius = 682,
SpareAmmo = 2,
},
},
}
return {items=itemDefs, class=classDef} | 26.861386 | 81 | 0.488758 |
94114f506bd8e17fff58fb00296f751c78f4bd84 | 3,017 | cpp | C++ | Kartkowki/2019-2020/K2_A_ZAD3.cpp | anuar2k/WDI-2019 | de8bc8c1c68d342cbcdafd7c274a953cc319b6d3 | [
"MIT"
] | null | null | null | Kartkowki/2019-2020/K2_A_ZAD3.cpp | anuar2k/WDI-2019 | de8bc8c1c68d342cbcdafd7c274a953cc319b6d3 | [
"MIT"
] | null | null | null | Kartkowki/2019-2020/K2_A_ZAD3.cpp | anuar2k/WDI-2019 | de8bc8c1c68d342cbcdafd7c274a953cc319b6d3 | [
"MIT"
] | null | null | null | #include <iostream>
using namespace std;
struct node {
int val;
node *next;
};
int remove(node *&list) {
node *mSubPrev; //wskaznik przed poczatkiem kawalka do wyciecia
int mSubLength = 0;
bool mSubTwice = true; //flaga na sytuacje, gdy mamy >= 2 kawalki maksymalne tej samej dlugosci
node *listCopy = list;
node *prev = nullptr;
while (listCopy != nullptr) {
if (listCopy->next != nullptr and listCopy->val == listCopy->next->val) {
node *subPrev = prev;
int subLength = 2;
listCopy = listCopy->next;
while (listCopy->next != nullptr and listCopy->next->val == listCopy->val) {
subLength++;
listCopy = listCopy->next;
}
if (subLength == mSubLength) {
mSubTwice = true;
}
if (subLength > mSubLength) {
mSubPrev = subPrev;
mSubLength = subLength;
mSubTwice = false;
}
}
prev = listCopy;
listCopy = listCopy->next;
}
if (!mSubTwice) {
node *mSubToDel = mSubPrev == nullptr ? list : mSubPrev->next;
for (int i = 0; i < mSubLength - 1; i++) {
node *next = mSubToDel->next;
delete mSubToDel;
mSubToDel = next;
}
if (mSubPrev == nullptr) {
list = mSubToDel->next;
}
else {
mSubPrev->next = mSubToDel->next;
}
delete mSubToDel;
return mSubLength;
}
else {
return 0;
}
}
//***********************************************************************
//***************************KOD DO TESTOWANIA***************************
//***********************************************************************
void wypisz(node *list) {
if (list == nullptr) {
return;
}
cout << list->val;
list = list->next;
while (list != nullptr) {
cout << "->" << list->val;
list = list->next;
}
cout << endl;
}
node *buildList(int values[], int size) {
node *result = nullptr;
for (int i = size - 1; i >= 0; i--) {
node *toAdd = new node;
toAdd->val = values[i];
toAdd->next = result;
result = toAdd;
}
return result;
}
void test(node *list) {
wypisz(list);
cout << remove(list) << endl;
wypisz(list);
cout << endl;
}
int main() {
wypisz(nullptr);
int A[] = {1, 1, 1, 1};
node *listA = buildList(A, 4);
test(listA);
int B[] = {1, 2, 3, 4, 5};
node *listB = buildList(B, 5);
test(listB);
int C[] = {1, 1, 1, 1, 2, 3, 3};
node *listC = buildList(C, 7);
test(listC);
int D[] = {4, 5, 5, 5, 5, 6, 6};
node *listD = buildList(D, 7);
test(listD);
int E[] = {7, 8, 8, 9, 9, 9, 9};
node *listE = buildList(E, 7);
test(listE);
int F[] = {10, 10, 10, 11, 11, 12, 12, 12};
node *listF = buildList(F, 8);
test(listF);
} | 23.944444 | 99 | 0.459397 |
487ed69b2c4ec4028c3b61fbc6c41234f8b52c09 | 1,910 | swift | Swift | Example/ASPCircleChart/ViewController.swift | Toparceanu/ASPCircleChart | 18ba9ee1ecc810ccf00c1232652d306a145e5c3d | [
"MIT"
] | 10 | 2016-10-19T12:51:17.000Z | 2021-04-18T11:01:32.000Z | Example/ASPCircleChart/ViewController.swift | Toparceanu/ASPCircleChart | 18ba9ee1ecc810ccf00c1232652d306a145e5c3d | [
"MIT"
] | 2 | 2016-10-21T13:50:33.000Z | 2017-04-24T07:48:41.000Z | Example/ASPCircleChart/ViewController.swift | Toparceanu/ASPCircleChart | 18ba9ee1ecc810ccf00c1232652d306a145e5c3d | [
"MIT"
] | 1 | 2018-12-04T14:29:58.000Z | 2018-12-04T14:29:58.000Z | //
// ViewController.swift
// ASPCircleChart
//
// Created by Andrei-Sergiu Pitis on 06/17/2016.
// Copyright (c) 2016 Andrei-Sergiu Pitis. All rights reserved.
//
import UIKit
import ASPCircleChart
class ViewController: UIViewController {
@IBOutlet weak var circleChart: ASPCircleChart!
let dataSource = DataSource()
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view, typically from a nib.
circleChart.lineCapStyle = .round
circleChart.latestSliceOnTop = false
circleChart.dataSource = dataSource
}
override func touchesBegan(_ touches: Set<UITouch>, with event: UIEvent?) {
var numberOfSlices = 2
while numberOfSlices <= 2 {
numberOfSlices = Int(arc4random()) % 8
}
var values = [Double]()
for _ in 0..<numberOfSlices {
let randomNumber = Double(arc4random() % 100)
values.append(randomNumber)
}
dataSource.items = values
circleChart.reloadData()
}
}
class DataSource: ASPCircleChartDataSource {
var items: [Double] = [44, 10, 134]
@objc func numberOfDataPoints() -> Int {
return items.count
}
@objc func dataPointsSum() -> Double {
return items.reduce(0.0, { (initial, new) -> Double in
return initial + new
})
}
@objc func dataPointAtIndex(_ index: Int) -> Double {
return items[index]
}
@objc func colorForDataPointAtIndex(_ index: Int) -> UIColor {
switch index {
case 0:
return UIColor(red: 205/255.0, green: 213/255.0, blue: 66/255.0, alpha: 1.0)
case 1:
return UIColor(red: 242/255.0, green: 115/255.0, blue: 82/255.0, alpha: 1.0)
case 2:
return UIColor(red: 83/255.0, green: 158/255.0, blue: 55/255.0, alpha: 1.0)
default:
return UIColor(red: CGFloat(Float(arc4random()) / Float(UINT32_MAX)), green: CGFloat(Float(arc4random()) / Float(UINT32_MAX)), blue: CGFloat(Float(arc4random()) / Float(UINT32_MAX)), alpha: 1.0)
}
}
}
| 24.487179 | 197 | 0.686387 |
6570598f2ef13665e826a5c8e920e59ce1b6b215 | 96 | lua | Lua | docs/illustrations/primitives/primitive_box.lua | holocronweaver/ogre-procedural | 27ede71b30d12ff05cddc2359acf8f1f8b12f579 | [
"MIT"
] | 158 | 2016-11-17T19:37:51.000Z | 2022-03-21T19:57:55.000Z | docs/illustrations/primitives/primitive_box.lua | holocronweaver/ogre-procedural | 27ede71b30d12ff05cddc2359acf8f1f8b12f579 | [
"MIT"
] | 94 | 2016-11-18T09:55:57.000Z | 2021-01-14T08:50:40.000Z | docs/illustrations/primitives/primitive_box.lua | holocronweaver/ogre-procedural | 27ede71b30d12ff05cddc2359acf8f1f8b12f579 | [
"MIT"
] | 51 | 2017-05-24T10:20:25.000Z | 2022-03-17T15:07:02.000Z | mesh = Procedural.BoxGenerator():setSizeX(1):buildTriangleBuffer()
tests:addTriangleBuffer(mesh) | 48 | 66 | 0.833333 |
725419ac2867e5d76ad5a363cdae5cd026b1ae56 | 6,726 | rs | Rust | tests/tensor_indexing.rs | cyb0124/tch-rs | 1603bbc65f62f98e9e2bb8c9d390e3dcbc67f4a5 | [
"Apache-2.0",
"MIT"
] | null | null | null | tests/tensor_indexing.rs | cyb0124/tch-rs | 1603bbc65f62f98e9e2bb8c9d390e3dcbc67f4a5 | [
"Apache-2.0",
"MIT"
] | null | null | null | tests/tensor_indexing.rs | cyb0124/tch-rs | 1603bbc65f62f98e9e2bb8c9d390e3dcbc67f4a5 | [
"Apache-2.0",
"MIT"
] | null | null | null | use tch::{Device, Kind, Tensor};
use tch::{IndexOp, NewAxis};
#[test]
fn integer_index() {
let opt = (Kind::Float, Device::Cpu);
let tensor = Tensor::arange1(0, 2 * 3, opt).view([2, 3]);
let result = tensor.i(1);
assert_eq!(result.size(), &[3]);
assert_eq!(Vec::<i64>::from(result), &[3, 4, 5]);
let tensor = Tensor::arange1(0, 2 * 3, opt).view([2, 3]);
let result = tensor.i((.., 2));
assert_eq!(result.size(), &[2]);
assert_eq!(Vec::<i64>::from(result), &[2, 5]);
let result = tensor.i((.., -2));
assert_eq!(result.size(), &[2]);
assert_eq!(Vec::<i64>::from(result), &[1, 4]);
}
#[test]
fn range_index() {
let opt = (Kind::Float, Device::Cpu);
// Range
let tensor = Tensor::arange1(0, 4 * 3, opt).view([4, 3]);
let result = tensor.i(1..3);
assert_eq!(result.size(), &[2, 3]);
assert_eq!(Vec::<i64>::from(result), &[3, 4, 5, 6, 7, 8]);
// RangeFull
let tensor = Tensor::arange1(0, 2 * 3, opt).view([2, 3]);
let result = tensor.i(..);
assert_eq!(result.size(), &[2, 3]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2, 3, 4, 5]);
// RangeFrom
let tensor = Tensor::arange1(0, 4 * 3, opt).view([4, 3]);
let result = tensor.i(2..);
assert_eq!(result.size(), &[2, 3]);
assert_eq!(Vec::<i64>::from(result), &[6, 7, 8, 9, 10, 11]);
// RangeTo
let tensor = Tensor::arange1(0, 4 * 3, opt).view([4, 3]);
let result = tensor.i(..2);
assert_eq!(result.size(), &[2, 3]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2, 3, 4, 5]);
// RangeInclusive
let tensor = Tensor::arange1(0, 4 * 3, opt).view([4, 3]);
let result = tensor.i(1..=2);
assert_eq!(result.size(), &[2, 3]);
assert_eq!(Vec::<i64>::from(result), &[3, 4, 5, 6, 7, 8]);
// RangeTo
let tensor = Tensor::arange1(0, 4 * 3, opt).view([4, 3]);
let result = tensor.i(..1);
assert_eq!(result.size(), &[1, 3]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2]);
// RangeToInclusive
let tensor = Tensor::arange1(0, 4 * 3, opt).view([4, 3]);
let result = tensor.i(..=1);
assert_eq!(result.size(), &[2, 3]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2, 3, 4, 5]);
}
#[test]
fn slice_index() {
let opt = (Kind::Float, Device::Cpu);
let tensor = Tensor::arange1(0, 6 * 2, opt).view([6, 2]);
let index: &[_] = &[1, 3, 5];
let result = tensor.i(index);
assert_eq!(result.size(), &[3, 2]);
assert_eq!(Vec::<i64>::from(result), &[2, 3, 6, 7, 10, 11]);
let tensor = Tensor::arange1(0, 3 * 4, opt).view([3, 4]);
let index: &[_] = &[3, 0];
let result = tensor.i((.., index));
assert_eq!(result.size(), &[3, 2]);
assert_eq!(Vec::<i64>::from(result), &[3, 0, 7, 4, 11, 8]);
}
#[test]
fn new_index() {
let opt = (Kind::Float, Device::Cpu);
let tensor = Tensor::arange1(0, 2 * 3, opt).view([2, 3]);
let result = tensor.i((NewAxis,));
assert_eq!(result.size(), &[1, 2, 3]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2, 3, 4, 5]);
let tensor = Tensor::arange1(0, 2 * 3, opt).view([2, 3]);
let result = tensor.i((.., NewAxis));
assert_eq!(result.size(), &[2, 1, 3]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2, 3, 4, 5]);
let tensor = Tensor::arange1(0, 2 * 3, opt).view([2, 3]);
let result = tensor.i((.., .., NewAxis));
assert_eq!(result.size(), &[2, 3, 1]);
assert_eq!(Vec::<i64>::from(result), &[0, 1, 2, 3, 4, 5]);
}
#[cfg(target_os = "linux")]
#[test]
fn complex_index() {
let opt = (Kind::Float, Device::Cpu);
let tensor = Tensor::arange1(0, 2 * 3 * 5 * 7, opt).view([2, 3, 5, 7]);
let result = tensor.i((1, 1..2, vec![2, 3, 0].as_slice(), NewAxis, 3..));
assert_eq!(result.size(), &[1, 3, 1, 4]);
assert_eq!(
Vec::<i64>::from(result),
&[157, 158, 159, 160, 164, 165, 166, 167, 143, 144, 145, 146]
);
}
#[test]
fn index_3d() {
let values: Vec<i64> = (0..24).collect();
let tensor = tch::Tensor::of_slice(&values).view((2, 3, 4));
assert_eq!(Vec::<i64>::from(tensor.i((0, 0, 0))), &[0]);
assert_eq!(Vec::<i64>::from(tensor.i((1, 0, 0))), &[12]);
assert_eq!(Vec::<i64>::from(tensor.i((0..2, 0, 0))), &[0, 12]);
}
#[test]
fn tensor_index() {
let t = Tensor::arange(6, (Kind::Int64, Device::Cpu)).view((2, 3));
let rows_select = Tensor::of_slice(&[0i64, 1, 0]);
let column_select = Tensor::of_slice(&[1i64, 2, 2]);
let selected = t.index(&[Some(rows_select), Some(column_select)]);
assert_eq!(selected.size(), &[3]);
assert_eq!(Vec::<i64>::from(selected), &[1, 5, 2]);
}
#[test]
fn tensor_multi_index() {
let t = Tensor::arange(6, (Kind::Int64, Device::Cpu)).view((2, 3));
let select_1 = Tensor::of_slice(&[0i64, 1, 0]);
let select_2 = Tensor::of_slice(&[1i64, 0, 0]);
let select_final = Tensor::stack(&[select_1, select_2], 0);
assert_eq!(select_final.size(), &[2, 3]);
let selected = t.index(&[Some(select_final)]); // index only rows
assert_eq!(selected.size(), &[2, 3, 3]);
assert_eq!(
Vec::<i64>::from(selected),
&[0, 1, 2, 3, 4, 5, 0, 1, 2, 3, 4, 5, 0, 1, 2, 0, 1, 2]
); // after flattening
}
#[test]
fn tensor_put() {
let t = Tensor::arange(6, (Kind::Int64, Device::Cpu)).view((2, 3));
let rows_select = Tensor::of_slice(&[0i64, 1, 0]);
let column_select = Tensor::of_slice(&[1i64, 2, 2]);
let values = Tensor::of_slice(&[10i64, 12, 24]);
let updated = t.index_put(&[Some(rows_select), Some(column_select)], &values, false);
assert_eq!(Vec::<i64>::from(updated), &[0i64, 10, 24, 3, 4, 12]); // after flattening
}
#[test]
fn indexing_doc() {
let tensor = Tensor::of_slice(&[1, 2, 3, 4, 5, 6]).view((2, 3));
let t = tensor.i(1);
assert_eq!(Vec::<i64>::from(t), [4, 5, 6]);
let t = tensor.i((.., -2));
assert_eq!(Vec::<i64>::from(t), [2, 5]);
let tensor = Tensor::of_slice(&[1, 2, 3, 4, 5, 6]).view((2, 3));
let t = tensor.i((.., 1..));
assert_eq!(t.size(), [2, 2]);
assert_eq!(Vec::<i64>::from(t.contiguous().view(-1)), [2, 3, 5, 6]);
let t = tensor.i((..1, ..));
assert_eq!(t.size(), [1, 3]);
assert_eq!(Vec::<i64>::from(t.contiguous().view(-1)), [1, 2, 3]);
let t = tensor.i((.., 1..2));
assert_eq!(t.size(), [2, 1]);
assert_eq!(Vec::<i64>::from(t.contiguous().view(-1)), [2, 5]);
let t = tensor.i((.., 1..=2));
assert_eq!(t.size(), [2, 2]);
assert_eq!(Vec::<i64>::from(t.contiguous().view(-1)), [2, 3, 5, 6]);
let tensor = Tensor::of_slice(&[1, 2, 3, 4, 5, 6]).view((2, 3));
let t = tensor.i((NewAxis,));
assert_eq!(t.size(), &[1, 2, 3]);
let t = tensor.i((.., .., NewAxis));
assert_eq!(t.size(), &[2, 3, 1]);
}
| 34.142132 | 89 | 0.532412 |
a95b7d99b06f98b4fc25b082ea34b36049e97e67 | 148 | swift | Swift | Example/Pods/ReadyMarkups/ReadyMarkups/Source/Markups/2 elements/Tiles2Markup.swift | Brander-ua/ReadyMarkups | a78747349e20dc2a48c4eaa2cf8a9213fd7354af | [
"MIT"
] | 1 | 2019-05-27T13:32:53.000Z | 2019-05-27T13:32:53.000Z | Example/Pods/ReadyMarkups/ReadyMarkups/Source/Markups/2 elements/Tiles2Markup.swift | Brander-ua/ReadyMarkups | a78747349e20dc2a48c4eaa2cf8a9213fd7354af | [
"MIT"
] | null | null | null | Example/Pods/ReadyMarkups/ReadyMarkups/Source/Markups/2 elements/Tiles2Markup.swift | Brander-ua/ReadyMarkups | a78747349e20dc2a48c4eaa2cf8a9213fd7354af | [
"MIT"
] | null | null | null | //
// Tiles2Markup.swift
// ReadyMarkups
//
import Foundation
public protocol Tiles2Markup {
func applyToView(tile1: UIView, tile2: UIView)
}
| 13.454545 | 48 | 0.72973 |
8b19796bef9a2f6bde61a8b047eed3ae694037e9 | 230 | ps1 | PowerShell | demos/dps2020/insidek8s/deploy/powershell/step12_querysql.ps1 | Korn1699/bobsql | c9b2b8eb02d30909eb6e939d19317a4f1ba7fb6c | [
"MIT"
] | 88 | 2019-05-26T10:08:35.000Z | 2022-03-17T03:48:09.000Z | demos/dps2020/insidek8s/deploy/powershell/step12_querysql.ps1 | Korn1699/bobsql | c9b2b8eb02d30909eb6e939d19317a4f1ba7fb6c | [
"MIT"
] | 4 | 2019-11-13T00:03:52.000Z | 2022-01-14T22:37:23.000Z | demos/dps2020/insidek8s/deploy/powershell/step12_querysql.ps1 | Korn1699/bobsql | c9b2b8eb02d30909eb6e939d19317a4f1ba7fb6c | [
"MIT"
] | 64 | 2019-05-09T01:01:39.000Z | 2022-03-18T13:22:41.000Z | $Service = kubectl get service | Select-String -Pattern mssql-service | Out-String
$Service = $Service.split(" ")
$Server+="-S"
$Server+=$Service[9]
$Server+=",31433"
sqlcmd '-Usa' '-PSql2019isfast' $Server '-Q"SELECT @@version"'
| 32.857143 | 82 | 0.686957 |
2dcbee293e16f7f05bfef5fd7edb031122be88da | 1,147 | html | HTML | index.html | Fahari/pig-dice | 7e08cdffb77eb40a3c1981bed1bb15540b12b7e6 | [
"MIT"
] | null | null | null | index.html | Fahari/pig-dice | 7e08cdffb77eb40a3c1981bed1bb15540b12b7e6 | [
"MIT"
] | null | null | null | index.html | Fahari/pig-dice | 7e08cdffb77eb40a3c1981bed1bb15540b12b7e6 | [
"MIT"
] | null | null | null | <!DOCTYPE html>
<html lang="en" dir="ltr">
<head>
<meta charset="utf-8">
<link rel="stylesheet" href="css/bootstrap.css">
<link rel="stylesheet" href="css/styles.css">
<script src="js/jquery-3.3.1.js" type="text/javascript"></script>
<script src="js/scripts.js" type="text/javascript"></script>
<title>Pig Dice</title>
</head>
<body>
<div class="container">
<div class="player1">
<div class="player1-scores" id="score1">0</div>
<div class="player1-total" id="player1" data-value='0'>0</div>
<div class="players">player1</div>
<p id="output1"></p>
</div>
<div class="player2">
<div class="player2-scores" id="score2">0</div>
<div class="player2-total" id="player2" data-value='0'>0</div>
<div class="players">player2</div>
<p id="output2"></p>
</div>
<div class="panel">
<button class="btn-new">New game</button>
<button class="btn-roll-1">Roll dice1</button>
<button class="btn-roll-2">Roll dice2</button>
<button class="btn-hold-1">Hold1</button>
<button class="btn-hold-2">Hold2</button>
</div>
</div>
</body>
</html>
| 26.068182 | 68 | 0.603313 |
7161901b4c0c750199093d3702fcb58da8a6d004 | 4,226 | lua | Lua | src/filters/ItemLevel.lua | doadin/Baggins | 0e787d80e50aed7d5f9752f03725b906b601a83b | [
"Zlib"
] | 3 | 2020-05-18T05:50:09.000Z | 2020-10-16T17:00:30.000Z | src/filters/ItemLevel.lua | doadin/Baggins | 0e787d80e50aed7d5f9752f03725b906b601a83b | [
"Zlib"
] | 54 | 2019-11-11T05:30:09.000Z | 2022-03-29T23:08:26.000Z | src/filters/ItemLevel.lua | doadin/Baggins | 0e787d80e50aed7d5f9752f03725b906b601a83b | [
"Zlib"
] | 8 | 2020-02-13T17:22:41.000Z | 2021-07-02T04:45:52.000Z | --[[ ==========================================================================
ItemLevel.lua
========================================================================== ]]--
local _G = _G
local AddOnName, _ = ...
local AddOn = _G[AddOnName]
-- WoW API
local GetContainerItemLink = _G.GetContainerItemLink
local GetItemInfo = _G.GetItemInfo
local UnitLevel = _G.UnitLevel
-- Libs
local LibStub = _G.LibStub
local L = LibStub("AceLocale-3.0"):GetLocale(AddOnName)
local LIUI = LibStub("LibItemUpgradeInfo-1.0") --luacheck: ignore 211
local function Matches(bag,slot,rule)
local link = GetContainerItemLink(bag, slot)
if not link then return false end
local _,_,_, itemLevel, itemMinLevel = GetItemInfo(link) --luacheck: ignore 211
local itemLevel = LIUI:GetUpgradedItemLevel(link) --luacheck: ignore 411
-- local itemLevel = GetDetailedItemLevelInfo(link)
local lvl = rule.useminlvl and itemMinLevel or itemLevel
if not lvl then -- can happen if itemcache hasn't been updated yet
return false
end
if rule.include0 and lvl==0 then
return true
end
if rule.include1 and lvl==1 then
return true
end
local minlvl = rule.minlvl or -9999
local maxlvl = rule.maxlvl or 9999
if rule.minlvl_rel then
minlvl = UnitLevel("player")+minlvl
end
if rule.maxlvl_rel then
maxlvl = UnitLevel("player")+maxlvl
end
return lvl>=minlvl and lvl<=maxlvl
end
AddOn:AddCustomRule("ItemLevel",
{
DisplayName = L["Item Level"],
Description = L["Filter by item's level - either \"ilvl\" or minimum required level"],
Matches = Matches,
Ace3Options = {
include0 = {
name = L["Include Level 0"],
desc = "",
type = 'toggle',
order = 10,
},
include1 = {
name = L["Include Level 1"],
desc = "",
type = 'toggle',
order = 11,
},
useminlvl = {
name = L["Look at Required Level"],
desc = "Look at 'minimum level required' rather than item level",
descStyle = "inline",
type = 'toggle',
order = 12,
width = "full"
},
minlvl = {
name = L["From level:"],
desc = "",
type = 'input',
set = function(info, value)
info.arg.minlvl = tonumber(value)
AddOn:OnRuleChanged()
end,
get = function(info)
return tostring(info.arg.minlvl or "")
end,
validate = function(info, value) --luacheck: ignore 212
return tonumber(value) ~= nil
end,
order = 20,
},
minlvl_rel = {
name = L["... plus Player's Level"],
desc = "",
type = 'toggle',
order = 21,
},
maxlvl = {
name = L["To level:"],
desc = "",
type = 'input',
set = function(info, value)
info.arg.maxlvl = tonumber(value)
AddOn:OnRuleChanged()
end,
get = function(info)
return tostring(info.arg.maxlvl or "")
end,
validate = function(info, value) --luacheck: ignore 212
return tonumber(value) ~= nil
end,
order = 30,
},
maxlvl_rel = {
name = L["... plus Player's Level"],
desc = "",
type = 'toggle',
order = 31,
},
},
CleanRule = function(rule)
rule.include0 = true
rule.include1 = false
rule.useminlvl = false
rule.minlvl_rel = true
rule.minlvl = -15
rule.maxlvl_rel = true
rule.maxlvl = 10
end,
}
) | 31.303704 | 94 | 0.459773 |
32295a485813f1db98dd49d7ecebc483a5712da8 | 13,571 | sql | SQL | Bkp_DB/db999999.sql | RonaldoSurdi/Checklist-logistica | 0340034e977b0af03b93a419c3f0920e420b1be9 | [
"MIT"
] | null | null | null | Bkp_DB/db999999.sql | RonaldoSurdi/Checklist-logistica | 0340034e977b0af03b93a419c3f0920e420b1be9 | [
"MIT"
] | null | null | null | Bkp_DB/db999999.sql | RonaldoSurdi/Checklist-logistica | 0340034e977b0af03b93a419c3f0920e420b1be9 | [
"MIT"
] | 1 | 2022-02-05T06:37:21.000Z | 2022-02-05T06:37:21.000Z | /*
SQLyog Enterprise - MySQL GUI v7.15
MySQL - 5.5.21 : Database - ck999999
*********************************************************************
*/
/*!40101 SET NAMES utf8 */;
/*!40101 SET SQL_MODE=''*/;
/*!40014 SET @OLD_FOREIGN_KEY_CHECKS=@@FOREIGN_KEY_CHECKS, FOREIGN_KEY_CHECKS=0 */;
/*!40101 SET @OLD_SQL_MODE=@@SQL_MODE, SQL_MODE='NO_AUTO_VALUE_ON_ZERO' */;
CREATE DATABASE /*!32312 IF NOT EXISTS*/`ck999999` /*!40100 DEFAULT CHARACTER SET latin1 COLLATE latin1_bin */;
USE `ck999999`;
/*Table structure for table `a701` */
DROP TABLE IF EXISTS `a701`;
CREATE TABLE `a701` (
`A7_COD` int(11) NOT NULL AUTO_INCREMENT,
`A7_DESCRICAO` varchar(60) COLLATE latin1_bin DEFAULT NULL,
PRIMARY KEY (`A7_COD`)
) ENGINE=InnoDB AUTO_INCREMENT=2 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `a901` */
DROP TABLE IF EXISTS `a901`;
CREATE TABLE `a901` (
`A9_CODIGO` int(11) NOT NULL AUTO_INCREMENT,
`A9_DESC` varchar(150) COLLATE latin1_bin DEFAULT NULL,
`A9_STATUS` varchar(1) COLLATE latin1_bin DEFAULT NULL,
`A9_CODREV` int(11) DEFAULT NULL,
`A9_APP` int(11) DEFAULT NULL,
PRIMARY KEY (`A9_CODIGO`)
) ENGINE=InnoDB AUTO_INCREMENT=2 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `aa01` */
DROP TABLE IF EXISTS `aa01`;
CREATE TABLE `aa01` (
`AA_CODCHK` int(11) NOT NULL,
`AA_CODIGO` int(11) NOT NULL AUTO_INCREMENT,
`AA_DESC` varchar(120) COLLATE latin1_bin DEFAULT NULL,
`AA_CODERP` int(11) DEFAULT NULL,
`AA_CODANT` int(11) DEFAULT NULL,
PRIMARY KEY (`AA_CODIGO`,`AA_CODCHK`)
) ENGINE=InnoDB AUTO_INCREMENT=32 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ab01` */
DROP TABLE IF EXISTS `ab01`;
CREATE TABLE `ab01` (
`AB_CODCHK` int(11) NOT NULL,
`AB_CODIGO` int(11) NOT NULL AUTO_INCREMENT,
`AB_DESC` varchar(40) COLLATE latin1_bin DEFAULT NULL,
`AB_CODANT` int(11) DEFAULT NULL,
PRIMARY KEY (`AB_CODIGO`,`AB_CODCHK`)
) ENGINE=InnoDB AUTO_INCREMENT=10 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ac01` */
DROP TABLE IF EXISTS `ac01`;
CREATE TABLE `ac01` (
`AC_CODCHK` int(11) NOT NULL,
`AC_CODTIPO` int(11) NOT NULL,
`AC_CODGRUPO` int(11) NOT NULL,
PRIMARY KEY (`AC_CODCHK`,`AC_CODTIPO`,`AC_CODGRUPO`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ad01` */
DROP TABLE IF EXISTS `ad01`;
CREATE TABLE `ad01` (
`AD_CODCHK` int(11) NOT NULL,
`AD_CODIGO` int(11) NOT NULL AUTO_INCREMENT,
`AD_PERGUNTA` varchar(500) COLLATE latin1_bin DEFAULT NULL,
`AD_TIPO` varchar(1) COLLATE latin1_bin DEFAULT NULL,
`AD_STATUS` varchar(1) COLLATE latin1_bin DEFAULT NULL,
`AD_CODANT` int(11) DEFAULT NULL,
`AD_SEQ` int(11) DEFAULT NULL,
PRIMARY KEY (`AD_CODIGO`,`AD_CODCHK`)
) ENGINE=InnoDB AUTO_INCREMENT=42 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ae01` */
DROP TABLE IF EXISTS `ae01`;
CREATE TABLE `ae01` (
`AE_CODCHK` int(11) NOT NULL,
`AE_GRUPO` int(11) NOT NULL,
`AE_CODPER` int(11) NOT NULL,
PRIMARY KEY (`AE_CODCHK`,`AE_GRUPO`,`AE_CODPER`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `af01` */
DROP TABLE IF EXISTS `af01`;
CREATE TABLE `af01` (
`AF_CODCHK` int(11) NOT NULL,
`AF_CODIGO` int(11) NOT NULL AUTO_INCREMENT,
`AF_RESPOSTA` varchar(50) COLLATE latin1_bin DEFAULT NULL,
`AF_CODANT` int(11) DEFAULT NULL,
PRIMARY KEY (`AF_CODCHK`,`AF_CODIGO`),
KEY `AF_CODIGO` (`AF_CODIGO`)
) ENGINE=InnoDB AUTO_INCREMENT=6 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ag01` */
DROP TABLE IF EXISTS `ag01`;
CREATE TABLE `ag01` (
`AG_CODCHK` int(11) NOT NULL,
`AG_PERPAI` int(11) NOT NULL,
`AG_PERFILHA` int(11) NOT NULL,
`AG_CODRESPAI` int(11) DEFAULT NULL,
PRIMARY KEY (`AG_CODCHK`,`AG_PERPAI`,`AG_PERFILHA`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ah01` */
DROP TABLE IF EXISTS `ah01`;
CREATE TABLE `ah01` (
`AH_CODCHK` int(11) NOT NULL,
`AH_CODPER` int(11) NOT NULL,
`AH_CODRES` int(11) NOT NULL,
`AH_ID` int(11) NOT NULL AUTO_INCREMENT,
`AH_IDANT` int(11) DEFAULT NULL,
PRIMARY KEY (`AH_CODCHK`,`AH_CODPER`,`AH_CODRES`),
UNIQUE KEY `AF_ID` (`AH_ID`)
) ENGINE=InnoDB AUTO_INCREMENT=19319 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ai01` */
DROP TABLE IF EXISTS `ai01`;
CREATE TABLE `ai01` (
`AI_CODCHK` int(11) NOT NULL,
`AI_CODPER` int(11) NOT NULL,
`AI_CODRES` int(11) NOT NULL,
PRIMARY KEY (`AI_CODCHK`,`AI_CODPER`,`AI_CODRES`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `aj01` */
DROP TABLE IF EXISTS `aj01`;
CREATE TABLE `aj01` (
`AJ_CODCHK` int(11) NOT NULL,
`AJ_CODGRP` int(11) NOT NULL,
`AJ_CODRES` int(11) NOT NULL,
`AJ_QTDRESTR` int(11) DEFAULT NULL,
PRIMARY KEY (`AJ_CODCHK`,`AJ_CODRES`,`AJ_CODGRP`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ba01` */
DROP TABLE IF EXISTS `ba01`;
CREATE TABLE `ba01` (
`BA_ID` int(11) NOT NULL AUTO_INCREMENT,
`BA_PLACA` varchar(8) COLLATE latin1_bin NOT NULL,
`BA_CHIP` varchar(30) COLLATE latin1_bin NOT NULL,
`BA_TIPO` int(11) DEFAULT NULL,
`BA_DESC` varchar(50) COLLATE latin1_bin DEFAULT NULL,
PRIMARY KEY (`BA_PLACA`,`BA_CHIP`),
UNIQUE KEY `BA_ID` (`BA_ID`)
) ENGINE=InnoDB AUTO_INCREMENT=242284 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `bb01` */
DROP TABLE IF EXISTS `bb01`;
CREATE TABLE `bb01` (
`BB_CODCHK` int(11) DEFAULT NULL,
`BB_CODIGO` int(11) NOT NULL AUTO_INCREMENT,
`BB_CODUSER` int(11) DEFAULT NULL,
`BB_PLACA` varchar(8) COLLATE latin1_bin DEFAULT NULL,
`BB_CHIP` varchar(30) COLLATE latin1_bin DEFAULT NULL,
`BB_DTCHECK` date DEFAULT NULL,
`BB_HRCHECK` varchar(5) COLLATE latin1_bin DEFAULT NULL,
`BB_OBS` varchar(500) COLLATE latin1_bin DEFAULT NULL,
`BB_STATUS` varchar(2) COLLATE latin1_bin DEFAULT NULL,
PRIMARY KEY (`BB_CODIGO`)
) ENGINE=InnoDB AUTO_INCREMENT=105 DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `bc01` */
DROP TABLE IF EXISTS `bc01`;
CREATE TABLE `bc01` (
`BC_CODCHK` int(11) NOT NULL,
`BC_CODIGO` int(11) NOT NULL,
`BC_CODPER` int(11) NOT NULL,
`BC_ID` int(11) NOT NULL,
PRIMARY KEY (`BC_CODCHK`,`BC_CODIGO`,`BC_ID`,`BC_CODPER`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `checklistsrealizados` */
DROP TABLE IF EXISTS `checklistsrealizados`;
CREATE TABLE `checklistsrealizados` (
`BB_PLACA` varchar(10) COLLATE latin1_bin NOT NULL,
`BB_PERGUNTA` varchar(5) COLLATE latin1_bin NOT NULL,
`BB_ID` varchar(4) COLLATE latin1_bin NOT NULL,
PRIMARY KEY (`BB_PLACA`,`BB_PERGUNTA`,`BB_ID`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/*Table structure for table `ex01` */
DROP TABLE IF EXISTS `ex01`;
CREATE TABLE `ex01` (
`EX_ID` int(11) NOT NULL AUTO_INCREMENT,
`EX_COD_INI` int(11) DEFAULT NULL,
`EX_COD_END` int(11) DEFAULT NULL,
`EX_DATA` datetime DEFAULT NULL,
`EX_REEXP` tinyint(1) DEFAULT '0',
PRIMARY KEY (`EX_ID`),
KEY `EX_COD_INI` (`EX_COD_INI`),
KEY `EX_COD_END` (`EX_COD_END`)
) ENGINE=InnoDB AUTO_INCREMENT=3 DEFAULT CHARSET=latin1 COLLATE=latin1_bin;
/*Table structure for table `im01` */
DROP TABLE IF EXISTS `im01`;
CREATE TABLE `im01` (
`IM_ID` int(11) NOT NULL AUTO_INCREMENT,
`IM_FILE` varchar(255) COLLATE latin1_bin DEFAULT NULL,
`IM_LINES` int(11) DEFAULT NULL,
`IM_DATA` datetime DEFAULT NULL,
PRIMARY KEY (`IM_ID`)
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin;
/*Table structure for table `perguntasdochecklist` */
DROP TABLE IF EXISTS `perguntasdochecklist`;
CREATE TABLE `perguntasdochecklist` (
`A9_CODIGO` double DEFAULT NULL,
`A9_DESC` varchar(450) COLLATE latin1_bin DEFAULT NULL,
`AA_CODIGO` double DEFAULT NULL,
`AA_DESC` varchar(360) COLLATE latin1_bin DEFAULT NULL,
`AB_CODIGO` double DEFAULT NULL,
`AB_DESC` varchar(120) COLLATE latin1_bin DEFAULT NULL,
`AD_CODIGO` double DEFAULT NULL,
`AD_PERGUNTA` varchar(900) COLLATE latin1_bin DEFAULT NULL,
`AF_CODIGO` double DEFAULT NULL,
`AF_RESPOSTA` varchar(150) COLLATE latin1_bin DEFAULT NULL,
`AH_ID` double DEFAULT NULL,
`AD_TIPO` varchar(3) COLLATE latin1_bin DEFAULT NULL,
`AG_PERFILHA` varchar(33) COLLATE latin1_bin DEFAULT NULL,
`AI_CODPER` varchar(33) COLLATE latin1_bin DEFAULT NULL,
`AJ_QTDRESTR` varchar(33) COLLATE latin1_bin DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=latin1 COLLATE=latin1_bin CHECKSUM=1 DELAY_KEY_WRITE=1 ROW_FORMAT=DYNAMIC;
/* Procedure structure for procedure `hws_retornarespostasdochecklist` */
/*!50003 DROP PROCEDURE IF EXISTS `hws_retornarespostasdochecklist` */;
DELIMITER $$
/*!50003 CREATE DEFINER=`user_hwschecklis`@`%` PROCEDURE `hws_retornarespostasdochecklist`(in
hws_checklist int,
hws_dataini varchar(10),
hws_datafim varchar(10),
hws_placaini varchar(07),
hws_placafim varchar(07))
begin
/*verificando quantas respostas possui o checklist */
declare cursorisdone_01 int default false;
declare cursorisdone_02 int default false;
declare vCAMPOS varchar(1000);
declare vCAMPOS2 varchar(1000);
declare hws_update varchar(1000);
declare vCAMPOS_DE_RESPOSTAS varchar(1000);
declare vBB_CODIGO varchar(11);
declare vAF_CODIGO varchar(11);
declare vAF_RESPOSTA varchar(50);
declare vBB_PLACA varchar(07);
declare vAD_CODIGO varchar(11);
declare vAD_PERGUNTA varchar(300);
declare hws_instrucao varchar(8000);
declare hws_cursor_respostas_do_checklist cursor for
select cast(AF_CODIGO as char(11)) as AF_CODIGO,AF_RESPOSTA from AF01 where AF_CODCHK = hws_checklist;
declare hws_cursos_busca_respostas cursor for
select
lpad(cast(BB_CODIGO as char(11)),11,0) as BB_CODIGO,
BB_PLACA,
lpad(cast(AD_CODIGO as char(11)),6,0) as AD_CODIGO,
AD_PERGUNTA,
lpad(cast(AF_CODIGO as char(11)),6,0) as AF_CODIGO,
AF_RESPOSTA
from
BB01
inner join BC01 on BC_CODCHK = BB_CODCHK and BC_CODIGO = BB_CODIGO
inner join AD01 on AD_CODCHK = BB_CODCHK and AD_CODIGO = BC_CODPER
inner join AH01 on AH_CODCHK = BB_CODCHK and AH_ID = BC_ID
inner join AF01 on AF_CODCHK = BB_CODCHK and AF_CODIGO = AH_CODRES
where
BB_CODCHK = hws_checklist and
BB_PLACA between hws_placaini and hws_placafim and
BB_DTCHECK between hws_dataini and hws_datafim
order by
BB_CODIGO,
BB_PLACA,
AD_CODIGO;
declare continue handler for not found set cursorisdone_01 = true, cursorisdone_02 = true;
open hws_cursor_respostas_do_checklist;
set vCAMPOS_DE_RESPOSTAS = '';
loop_hws_cursor_respostas_do_checklist: loop
fetch hws_cursor_respostas_do_checklist into vAF_CODIGO,vAF_RESPOSTA;
if cursorisdone_01 then
leave loop_hws_cursor_respostas_do_checklist;
end if;
set vCAMPOS = concat('R',lpad(vAF_CODIGO,6,0),' varchar(50) default "",');
set vCAMPOS_DE_RESPOSTAS = concat(vCAMPOS_DE_RESPOSTAS,vCAMPOS);
end loop loop_hws_cursor_respostas_do_checklist;
close hws_cursor_respostas_do_checklist;
set vCAMPOS_DE_RESPOSTAS = substring(vCAMPOS_DE_RESPOSTAS,1,length(vCAMPOS_DE_RESPOSTAS)-1);
set @hws_instrucao = concat('create temporary table hws_tabela_retorno (BB_CODIGO int, BB_PLACA varchar(07), AD_CODIGO int, AD_PERGUNTA varchar(500),',vCAMPOS_DE_RESPOSTAS,')');
drop table if exists hws_tabela_retorno;
prepare stm_hws_instrucoes from @hws_instrucao;
execute stm_hws_instrucoes;
set cursorisdone_02 = false;
open hws_cursos_busca_respostas;
loop_hws_cursos_busca_respostas: loop
fetch hws_cursos_busca_respostas into vBB_CODIGO, vBB_PLACA, vAD_CODIGO, vAD_PERGUNTA, vAF_CODIGO, vAF_RESPOSTA;
if cursorisdone_02 then
leave loop_hws_cursos_busca_respostas;
end if;
insert into hws_tabela_retorno (BB_CODIGO, BB_PLACA, AD_CODIGO, AD_PERGUNTA) values (vBB_CODIGO, vBB_PLACA, vAD_CODIGO, vAD_PERGUNTA);
set @hws_update = concat('update hws_tabela_retorno set R',vAF_CODIGO,'="',vAF_RESPOSTA,'" where BB_CODIGO = ', vBB_CODIGO,' and BB_PLACA = "',vBB_PLACA,'" and AD_CODIGO = ',vAD_CODIGO);
prepare stm_hws_update from @hws_update;
execute stm_hws_update;
end loop loop_hws_cursos_busca_respostas;
close hws_cursos_busca_respostas;
select * from hws_tabela_retorno;
end */$$
DELIMITER ;
/*!40101 SET SQL_MODE=@OLD_SQL_MODE */;
/*!40014 SET FOREIGN_KEY_CHECKS=@OLD_FOREIGN_KEY_CHECKS */;
| 36.777778 | 189 | 0.731634 |
61a38e864e378e947b4ecc188a4f991ccf571b80 | 4,985 | sql | SQL | compound/deposits_vs_borrows.sql | AndruAllen/compound_analysis | 996f6be0a7bf25b2a61e241ba0f4ea0e5bd953ea | [
"Apache-2.0"
] | 1 | 2021-09-22T03:53:28.000Z | 2021-09-22T03:53:28.000Z | compound/deposits_vs_borrows.sql | AndruAllen/flipside_analysis | 996f6be0a7bf25b2a61e241ba0f4ea0e5bd953ea | [
"Apache-2.0"
] | null | null | null | compound/deposits_vs_borrows.sql | AndruAllen/flipside_analysis | 996f6be0a7bf25b2a61e241ba0f4ea0e5bd953ea | [
"Apache-2.0"
] | null | null | null | WITH borrows_per_day AS (
SELECT
--case when block_timestamp >= CURRENT_DATE - 30 then 'last_30'
-- when block_timestamp >= CURRENT_DATE - 60 then '31_60'
-- when block_timestamp >= CURRENT_DATE - 90 then '61_90'
-- when block_timestamp >= CURRENT_DATE - 180 then '91_180'
-- when block_timestamp >= CURRENT_DATE - 360 then '181_360'
-- when block_timestamp < CURRENT_DATE - 360 then 'over_360'
-- else '_none_' end as num_days_since,
--borrower as wallet_address,
date_trunc('day',block_timestamp) as block_day,
borrows_contract_symbol AS underlying_symbol,
sum(loan_amount) AS token_loan_amount,
sum(loan_amount_usd) AS loan_amount_usd,
count(distinct borrower) as num_users,
count(distinct tx_id) as dist_num_txs,
count(tx_id) as num_txs
FROM compound.borrows
WHERE block_timestamp >= CURRENT_DATE - 180
GROUP BY 1,2--,3
), deposits_per_day AS (
SELECT
--case when block_timestamp >= CURRENT_DATE - 30 then 'last_30'
-- when block_timestamp >= CURRENT_DATE - 60 then '31_60'
-- when block_timestamp >= CURRENT_DATE - 90 then '61_90'
-- when block_timestamp >= CURRENT_DATE - 180 then '91_180'
-- when block_timestamp >= CURRENT_DATE - 360 then '181_360'
-- when block_timestamp < CURRENT_DATE - 360 then 'over_360'
-- else '_none_' end as num_days_since,
--supplier as wallet_address,
date_trunc('day',block_timestamp) as block_day,
supplied_symbol AS underlying_symbol,
sum(supplied_base_asset) AS token_loan_amount,
sum(supplied_base_asset_usd) AS loan_amount_usd,
count(distinct supplier) as num_users,
count(distinct tx_id) as dist_num_txs,
count(tx_id) as num_txs
FROM compound.deposits
WHERE block_timestamp >= CURRENT_DATE - 180
GROUP BY 1,2--,3
)
select *
, borrows_usd_30day_rolling_sum/(deposits_usd_30day_rolling_sum) as borrowing_as_pct_of_deposits_usd_30day_rolling
, dist_num_borrows_30day_rolling_sum/(dist_num_deposits_30day_rolling_sum) as dist_num_of_borrows_as_pct_of_deposits_30day_rolling
, num_borrowers_30day_rolling_avg/(num_depositors_30day_rolling_avg) as avg_num_borrowers_as_pct_of_depositors_30day_rolling
, -1*borrows_usd_30day_rolling_sum as neg_borrows_usd_30day_rolling_sum
, -1*dist_num_borrows_30day_rolling_sum as neg_dist_num_borrows_30day_rolling_sum
, -1*num_borrowers_30day_rolling_avg as neg_num_borrowers_30day_rolling_avg
, deposits_usd_30day_rolling_sum / dist_num_deposits_30day_rolling_sum as avg_deposit_size_usd_30day_rolling
, borrows_usd_30day_rolling_sum / dist_num_borrows_30day_rolling_sum as avg_borrow_size_usd_30day_rolling
from
(select
coalesce(b.block_day,d.block_day) overall_block_day, coalesce(b.underlying_symbol,d.underlying_symbol) as underlying_symbol
,sum(b.loan_amount_usd) OVER(PARTITION BY b.underlying_symbol ORDER BY b.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as borrows_usd_30day_rolling_sum
,sum(d.loan_amount_usd) OVER(PARTITION BY d.underlying_symbol ORDER BY d.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as deposits_usd_30day_rolling_sum
,sum(b.dist_num_txs) OVER(PARTITION BY b.underlying_symbol ORDER BY b.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as dist_num_borrows_30day_rolling_sum
,sum(d.dist_num_txs) OVER(PARTITION BY d.underlying_symbol ORDER BY d.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as dist_num_deposits_30day_rolling_sum
,sum(b.num_txs) OVER(PARTITION BY b.underlying_symbol ORDER BY b.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as num_borrows_30day_rolling_sum
,sum(d.num_txs) OVER(PARTITION BY d.underlying_symbol ORDER BY d.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as num_deposits_30day_rolling_sum
,avg(b.num_users) OVER(PARTITION BY b.underlying_symbol ORDER BY b.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as num_borrowers_30day_rolling_avg
,avg(d.num_users) OVER(PARTITION BY d.underlying_symbol ORDER BY d.block_day ROWS BETWEEN 29 PRECEDING AND CURRENT ROW) as num_depositors_30day_rolling_avg
--sum(rd.reserve_diff_usd) as revenue_usd,
--sum(b.comp_emissions_comp) as emissions_comp,
--sum(b.comp_emissions_usd) as emissions_usd
from borrows_per_day b
full outer join
deposits_per_day d
on b.block_day = d.block_day and b.underlying_symbol = d.underlying_symbol
--group by b.date, b.underlying_symbol
--where b.date > getdate() - interval '3 months'
order by overall_block_day desc) | 62.3125 | 164 | 0.711334 |
9856fb3c17212c2e01651ad6f663ea168ca42627 | 1,006 | html | HTML | trash/page-662-Saturday-October-19th-2019-10-02-40-AM/body.html | marvindanig/the-satyricon | 7d3e50dec8ac6c273d841ad2a1745d157e3f9587 | [
"BlueOak-1.0.0",
"CC-BY-4.0",
"Unlicense"
] | null | null | null | trash/page-662-Saturday-October-19th-2019-10-02-40-AM/body.html | marvindanig/the-satyricon | 7d3e50dec8ac6c273d841ad2a1745d157e3f9587 | [
"BlueOak-1.0.0",
"CC-BY-4.0",
"Unlicense"
] | 1 | 2021-05-08T09:06:03.000Z | 2021-05-08T09:06:03.000Z | trash/page-662-Saturday-October-19th-2019-10-02-40-AM/body.html | marvindanig/the-satyricon | 7d3e50dec8ac6c273d841ad2a1745d157e3f9587 | [
"BlueOak-1.0.0",
"CC-BY-4.0",
"Unlicense"
] | null | null | null | <div class="leaf flex"><div class="inner justify"><p>METRO: Please don’t flare up so quickly when you hear something unpleasant. A good woman must put up with everything. It’s all my fault for gossiping. My tongue ought to be cut out; honestly it should: but to get back to the question I asked you a moment ago: who stitched the dildo? Tell me if you love me! What makes you laugh when you look at me? What does your coyness mean? Have you never set eyes on me before? Don’t fib to me now, Koritto, I beg of you.</p><p>KORITTO: Why do you press me so? Kerdon stitched it.</p><p class=" stretch-last-line ">METRO: Which Kerdon? Tell me, because there are two Kerdons, one is that blue-eyed fellow, the neighbor of Myrtaline the daughter of Kylaithis; but he couldn’t even stitch a plectron to a lyre—the other one, who lives near the house of Hermodorus, after you have left the street, was pretty good once, but he’s too old, now; the late lamented Kylaithis—may her kinsfolk never forget</p></div> </div> | 1,006 | 1,006 | 0.756461 |
14b70cbc689e328f58b3f789a99e52ed4e15b105 | 1,438 | kt | Kotlin | app/src/main/java/com/omens/weather/db/DataSetterAndGetter.kt | Dovahkiin169/weather | f9568c0fc932ab6b8308c72b9a1ed19d9c045e9e | [
"Apache-2.0"
] | null | null | null | app/src/main/java/com/omens/weather/db/DataSetterAndGetter.kt | Dovahkiin169/weather | f9568c0fc932ab6b8308c72b9a1ed19d9c045e9e | [
"Apache-2.0"
] | null | null | null | app/src/main/java/com/omens/weather/db/DataSetterAndGetter.kt | Dovahkiin169/weather | f9568c0fc932ab6b8308c72b9a1ed19d9c045e9e | [
"Apache-2.0"
] | null | null | null | package com.omens.weather.db
import com.couchbase.lite.CouchbaseLiteException
import com.couchbase.lite.MutableDocument
import com.google.gson.Gson
import com.omens.weather.db.DataInterface.UserActionsListener
import com.omens.weather.model.ListWeatherCityResponse
import java.util.HashMap
class DataSetterAndGetter(private val dataFromDB: DataInterface.View) :
UserActionsListener {
val gson = Gson()
var outputList : ListWeatherCityResponse? = null
override fun fetchDataFormDB() {
val database = DatabaseManager.database
val docId = DatabaseManager.sharedInstance!!.currentDocId
if (database != null) {
val data: MutableMap<String, Any?> = HashMap()
data["document"] = DatabaseManager.sharedInstance!!.currentDoc
val document = database.getDocument(docId)
if (document != null)
outputList = gson.fromJson(document.getString("weatherList"), ListWeatherCityResponse::class.java)
dataFromDB.setData(outputList)
}
}
override fun saveDataToDb(data: MutableMap<String, Any>) {
val database = DatabaseManager.database
val docId = DatabaseManager.sharedInstance!!.currentDocId
val mutableDocument = MutableDocument(docId, data)
try {
database!!.save(mutableDocument)
} catch (e: CouchbaseLiteException) {
e.printStackTrace()
}
}
} | 36.871795 | 114 | 0.691238 |
e112937cb140acd19549a7621936bc1a589c663f | 3,402 | swift | Swift | Adyen/UI/List/ListSection.swift | for-meng/adyen-ios | 6bec6e3b4675dda4d4b56234adac0384a1377e17 | [
"MIT"
] | null | null | null | Adyen/UI/List/ListSection.swift | for-meng/adyen-ios | 6bec6e3b4675dda4d4b56234adac0384a1377e17 | [
"MIT"
] | null | null | null | Adyen/UI/List/ListSection.swift | for-meng/adyen-ios | 6bec6e3b4675dda4d4b56234adac0384a1377e17 | [
"MIT"
] | null | null | null | //
// Copyright (c) 2021 Adyen N.V.
//
// This file is open source and available under the MIT license. See the LICENSE file for more info.
//
import Foundation
/// The editing style.
/// :nodoc:
public enum EditingStyle {
case delete
case none
}
/// A section of items in a ListViewController.
/// :nodoc:
public struct ListSection: Hashable {
/// The title of the section.
public let header: ListSectionHeader?
/// The items inside the section.
public private(set) var items: [ListItem]
/// The footer title of the section.
public let footer: ListSectionFooter?
/// :nodoc:
public var isEditable: Bool {
header?.editingStyle != EditingStyle.none
}
/// Initializes the picker section.
///
/// - Parameters:
/// - header: The section header.
/// - items: The items inside the section.
/// - footer: The section footer.
public init(header: ListSectionHeader? = nil,
items: [ListItem],
footer: ListSectionFooter? = nil) {
self.header = header
self.items = items
self.footer = footer
self.identifier = UUID().uuidString
}
private let identifier: String
internal mutating func deleteItem(index: Int) {
guard items.indices.contains(index) else { return }
items.remove(at: index)
}
public func hash(into hasher: inout Hasher) {
hasher.combine(identifier)
hasher.combine(header)
hasher.combine(footer)
}
public static func == (lhs: ListSection, rhs: ListSection) -> Bool {
lhs.header == rhs.header &&
lhs.footer == rhs.footer &&
lhs.identifier == rhs.identifier
}
}
/// A list section header.
/// :nodoc:
public struct ListSectionHeader: Hashable {
/// The header title.
/// :nodoc:
public var title: String
/// The header style.
/// :nodoc:
public var style: ListSectionHeaderStyle
/// The editing style.
/// :nodoc:
public var editingStyle: EditingStyle = .none
/// :nodoc:
/// - Parameters:
/// - title: The header title
/// - style: The UI style.
public init(title: String, editingStyle: EditingStyle = .none, style: ListSectionHeaderStyle) {
self.title = title
self.editingStyle = editingStyle
self.style = style
}
public func hash(into hasher: inout Hasher) {
hasher.combine(title)
hasher.combine(editingStyle)
}
public static func == (lhs: ListSectionHeader, rhs: ListSectionHeader) -> Bool {
lhs.title == rhs.title && lhs.editingStyle == rhs.editingStyle
}
}
/// A list section footer.
/// :nodoc:
public struct ListSectionFooter: Hashable {
/// The footer title.
/// :nodoc:
public var title: String
/// The footer style.
/// :nodoc:
public var style: ListSectionFooterStyle
/// :nodoc:
/// - Parameters:
/// - title: The footer title
/// - style: The UI style.
public init(title: String, style: ListSectionFooterStyle) {
self.title = title
self.style = style
}
public func hash(into hasher: inout Hasher) {
hasher.combine(title)
}
public static func == (lhs: ListSectionFooter, rhs: ListSectionFooter) -> Bool {
lhs.title == rhs.title
}
}
| 25.2 | 100 | 0.601411 |
ceb3fc9ae497b23edad3896e504f7bb75e0ec21f | 372 | swift | Swift | APIconizer/Classes/Protocols/UniquelyIdentifiable.swift | warren-gavin/APIconizer | 1d2920e9b40e31ea822cef348d6993b023055886 | [
"MIT"
] | null | null | null | APIconizer/Classes/Protocols/UniquelyIdentifiable.swift | warren-gavin/APIconizer | 1d2920e9b40e31ea822cef348d6993b023055886 | [
"MIT"
] | null | null | null | APIconizer/Classes/Protocols/UniquelyIdentifiable.swift | warren-gavin/APIconizer | 1d2920e9b40e31ea822cef348d6993b023055886 | [
"MIT"
] | null | null | null | //
// UniquelyIdentifiable.swift
// APIconizer
//
// Created by Warren Gavin on 04/08/2017.
// Copyright © 2017 Apokrupto. All rights reserved.
//
import Foundation
protocol UniquelyIdentifiable: class {
static var identifier: String { get }
}
extension UniquelyIdentifiable {
static var identifier: String {
return String(describing: self)
}
}
| 18.6 | 52 | 0.701613 |
1be26ec268e850348aa14c4b38f7fdc8f14a647e | 581,572 | tab | SQL | nebulio/legacy/data/WFC3-filters/SystemThroughput/f200lp.UVIS2.tab | deprecated/nebulio | 8548d9f44117206e9314d676576b24c1bc5e1c76 | [
"MIT"
] | null | null | null | nebulio/legacy/data/WFC3-filters/SystemThroughput/f200lp.UVIS2.tab | deprecated/nebulio | 8548d9f44117206e9314d676576b24c1bc5e1c76 | [
"MIT"
] | null | null | null | nebulio/legacy/data/WFC3-filters/SystemThroughput/f200lp.UVIS2.tab | deprecated/nebulio | 8548d9f44117206e9314d676576b24c1bc5e1c76 | [
"MIT"
] | null | null | null | # Table f200lp.UVIS2.fits[1] Fri 11:54:40 08-Feb-2013
# row WAVELENGTH THROUGHPUT
# angstroms
1 1700. 0.
2 1701. 0.
3 1702. 0.
4 1703. 0.
5 1704. 0.
6 1705. 0.
7 1706. 0.
8 1707. 0.
9 1708. 0.
10 1709. 0.
11 1710. 0.
12 1711. 0.
13 1712. 0.
14 1713. 0.
15 1714. 0.
16 1715. 0.
17 1716. 0.
18 1717. 0.
19 1718. 0.
20 1719. 0.
21 1720. 0.
22 1721. 0.
23 1722. 0.
24 1723. 0.
25 1724. 0.
26 1725. 0.
27 1726. 0.
28 1727. 0.
29 1728. 0.
30 1729. 0.
31 1730. 0.
32 1731. 0.
33 1732. 0.
34 1733. 0.
35 1734. 0.
36 1735. 0.
37 1736. 0.
38 1737. 0.
39 1738. 0.
40 1739. 0.
41 1740. 0.
42 1741. 0.
43 1742. 0.
44 1743. 0.
45 1744. 0.
46 1745. 0.
47 1746. 0.
48 1747. 0.
49 1748. 0.
50 1749. 0.
51 1750. 0.
52 1751. 0.
53 1752. 0.
54 1753. 0.
55 1754. 0.
56 1755. 0.
57 1756. 0.
58 1757. 0.
59 1758. 0.
60 1759. 0.
61 1760. 0.
62 1761. 0.
63 1762. 0.
64 1763. 0.
65 1764. 0.
66 1765. 0.
67 1766. 0.
68 1767. 0.
69 1768. 0.
70 1769. 0.
71 1770. 0.
72 1771. 0.
73 1772. 0.
74 1773. 0.
75 1774. 0.
76 1775. 0.
77 1776. 0.
78 1777. 0.
79 1778. 0.
80 1779. 0.
81 1780. 0.
82 1781. 0.
83 1782. 0.
84 1783. 0.
85 1784. 0.
86 1785. 0.
87 1786. 0.
88 1787. 0.
89 1788. 0.
90 1789. 0.
91 1790. 0.
92 1791. 0.
93 1792. 0.
94 1793. 0.
95 1794. 0.
96 1795. 0.
97 1796. 0.
98 1797. 0.
99 1798. 0.
100 1799. 0.
101 1800. 0.
102 1801. 0.
103 1802. 0.
104 1803. 0.
105 1804. 0.
106 1805. 0.
107 1806. 0.
108 1807. 0.
109 1808. 0.
110 1809. 0.
111 1810. 0.
112 1811. 0.
113 1812. 0.
114 1813. 0.
115 1814. 0.
116 1815. 0.
117 1816. 0.
118 1817. 0.
119 1818. 0.
120 1819. 0.
121 1820. 0.
122 1821. 0.
123 1822. 0.
124 1823. 0.
125 1824. 0.
126 1825. 0.
127 1826. 0.
128 1827. 0.
129 1828. 0.
130 1829. 0.
131 1830. 0.
132 1831. 0.
133 1832. 0.
134 1833. 0.
135 1834. 0.
136 1835. 0.
137 1836. 0.
138 1837. 0.
139 1838. 0.
140 1839. 0.
141 1840. 0.
142 1841. 0.
143 1842. 0.
144 1843. 0.
145 1844. 0.
146 1845. 0.
147 1846. 0.
148 1847. 0.
149 1848. 0.
150 1849. 0.
151 1850. 0.
152 1851. 0.
153 1852. 0.
154 1853. 0.
155 1854. 0.
156 1855. 0.
157 1856. 0.
158 1857. 0.
159 1858. 0.
160 1859. 0.
161 1860. 0.
162 1861. 0.
163 1862. 0.
164 1863. 0.
165 1864. 0.
166 1865. 0.
167 1866. 0.
168 1867. 0.
169 1868. 0.
170 1869. 0.
171 1870. 0.
172 1871. 0.
173 1872. 0.
174 1873. 0.
175 1874. 0.
176 1875. 0.
177 1876. 0.
178 1877. 0.
179 1878. 0.
180 1879. 0.
181 1880. 0.
182 1881. 0.
183 1882. 0.
184 1883. 0.
185 1884. 0.
186 1885. 0.
187 1886. 0.
188 1887. 0.
189 1888. 0.
190 1889. 0.
191 1890. 0.
192 1891. 0.
193 1892. 0.
194 1893. 0.
195 1894. 0.
196 1895. 0.
197 1896. 0.
198 1897. 0.
199 1898. 0.
200 1899. 0.
201 1900. 0.
202 1901. 0.
203 1902. 0.
204 1903. 0.
205 1904. 0.
206 1905. 0.
207 1906. 0.
208 1907. 0.
209 1908. 0.
210 1909. 0.
211 1910. 0.
212 1911. 0.
213 1912. 0.
214 1913. 0.
215 1914. 0.
216 1915. 0.
217 1916. 0.
218 1917. 0.
219 1918. 0.
220 1919. 0.
221 1920. 0.
222 1921. 0.
223 1922. 0.
224 1923. 0.
225 1924. 0.
226 1925. 0.
227 1926. 0.
228 1927. 0.
229 1928. 0.
230 1929. 0.
231 1930. 0.
232 1931. 0.
233 1932. 0.
234 1933. 0.
235 1934. 0.
236 1935. 0.
237 1936. 0.
238 1937. 0.
239 1938. 0.
240 1939. 0.
241 1940. 0.
242 1941. 0.
243 1942. 0.
244 1943. 0.
245 1944. 0.
246 1945. 0.
247 1946. 0.
248 1947. 0.
249 1948. 0.
250 1949. 0.
251 1950. 0.
252 1951. 0.
253 1952. 0.
254 1953. 0.
255 1954. 0.
256 1955. 0.
257 1956. 0.
258 1957. 0.
259 1958. 0.
260 1959. 0.
261 1960. 0.
262 1961. 0.
263 1962. 0.
264 1963. 0.
265 1964. 0.
266 1965. 0.
267 1966. 0.
268 1967. 0.
269 1968. 0.
270 1969. 0.
271 1970. 0.
272 1971. 0.
273 1972. 0.
274 1973. 0.
275 1974. 0.
276 1975. 0.
277 1976. 0.
278 1977. 0.
279 1978. 0.
280 1979. 0.
281 1980. 0.
282 1981. 0.
283 1982. 0.
284 1983. 0.
285 1984. 0.
286 1985. 0.
287 1986. 0.
288 1987. 0.
289 1988. 0.
290 1989. 0.
291 1990. 0.136647
292 1991. 0.1375564
293 1992. 0.1384694
294 1993. 0.1393859
295 1994. 0.1403057
296 1995. 0.1412295
297 1996. 0.1421564
298 1997. 0.1430871
299 1998. 0.1440212
300 1999. 0.144959
301 2000. 0.1459003
302 2001. 0.1462839
303 2002. 0.1466539
304 2003. 0.1470244
305 2004. 0.1473957
306 2005. 0.1477677
307 2006. 0.1481404
308 2007. 0.1485137
309 2008. 0.1488879
310 2009. 0.1492626
311 2010. 0.149638
312 2011. 0.1500138
313 2012. 0.1503902
314 2013. 0.1507674
315 2014. 0.1511452
316 2015. 0.1515237
317 2016. 0.151903
318 2017. 0.1522829
319 2018. 0.1526636
320 2019. 0.1530449
321 2020. 0.1534269
322 2021. 0.1537829
323 2022. 0.1541179
324 2023. 0.1544535
325 2024. 0.1547896
326 2025. 0.1551263
327 2026. 0.1554635
328 2027. 0.1558012
329 2028. 0.1561394
330 2029. 0.1564782
331 2030. 0.1568175
332 2031. 0.1571715
333 2032. 0.1575261
334 2033. 0.1578812
335 2034. 0.158237
336 2035. 0.1585934
337 2036. 0.1589503
338 2037. 0.1593079
339 2038. 0.1596661
340 2039. 0.1600249
341 2040. 0.1603843
342 2041. 0.1607374
343 2042. 0.1610799
344 2043. 0.1614229
345 2044. 0.1617666
346 2045. 0.1621107
347 2046. 0.1624555
348 2047. 0.1628007
349 2048. 0.1631465
350 2049. 0.163493
351 2050. 0.1638399
352 2051. 0.1642203
353 2052. 0.1646015
354 2053. 0.1649833
355 2054. 0.1653658
356 2055. 0.1657491
357 2056. 0.1661331
358 2057. 0.1665177
359 2058. 0.1669032
360 2059. 0.1672892
361 2060. 0.167676
362 2061. 0.1680538
363 2062. 0.1684164
364 2063. 0.1687795
365 2064. 0.1691433
366 2065. 0.1695076
367 2066. 0.1698726
368 2067. 0.1702382
369 2068. 0.1706046
370 2069. 0.1709714
371 2070. 0.1713389
372 2071. 0.1716889
373 2072. 0.1720395
374 2073. 0.1723906
375 2074. 0.1727423
376 2075. 0.1730945
377 2076. 0.1734473
378 2077. 0.1738006
379 2078. 0.1741546
380 2079. 0.1745091
381 2080. 0.1748641
382 2081. 0.1752279
383 2082. 0.1755797
384 2083. 0.175932
385 2084. 0.1762849
386 2085. 0.1766383
387 2086. 0.1769923
388 2087. 0.1773469
389 2088. 0.177702
390 2089. 0.1780577
391 2090. 0.1784139
392 2091. 0.1787685
393 2092. 0.1791236
394 2093. 0.1794794
395 2094. 0.1798357
396 2095. 0.1801925
397 2096. 0.1805499
398 2097. 0.1809079
399 2098. 0.1812664
400 2099. 0.1816255
401 2100. 0.1819851
402 2101. 0.1826387
403 2102. 0.1832886
404 2103. 0.1839402
405 2104. 0.1845935
406 2105. 0.1852483
407 2106. 0.1859047
408 2107. 0.1865628
409 2108. 0.1872225
410 2109. 0.1878838
411 2110. 0.1885467
412 2111. 0.1892086
413 2112. 0.189872
414 2113. 0.1905371
415 2114. 0.1912037
416 2115. 0.191872
417 2116. 0.192542
418 2117. 0.1932136
419 2118. 0.1938867
420 2119. 0.1945616
421 2120. 0.1952381
422 2121. 0.1958925
423 2122. 0.1965441
424 2123. 0.1971972
425 2124. 0.1978517
426 2125. 0.1985078
427 2126. 0.1991653
428 2127. 0.1998243
429 2128. 0.2004847
430 2129. 0.2011467
431 2130. 0.2018102
432 2131. 0.2024908
433 2132. 0.203173
434 2133. 0.2038568
435 2134. 0.2045423
436 2135. 0.2052293
437 2136. 0.205918
438 2137. 0.2066082
439 2138. 0.2073001
440 2139. 0.2079935
441 2140. 0.2086887
442 2141. 0.2093744
443 2142. 0.2100468
444 2143. 0.2107207
445 2144. 0.2113961
446 2145. 0.2120729
447 2146. 0.2127512
448 2147. 0.213431
449 2148. 0.2141123
450 2149. 0.2147951
451 2150. 0.2154793
452 2151. 0.2161608
453 2152. 0.2168437
454 2153. 0.2175281
455 2154. 0.218214
456 2155. 0.2189015
457 2156. 0.2195903
458 2157. 0.2202806
459 2158. 0.2209724
460 2159. 0.2216657
461 2160. 0.2223605
462 2161. 0.2230266
463 2162. 0.223684
464 2163. 0.224343
465 2164. 0.2250029
466 2165. 0.2256643
467 2166. 0.226327
468 2167. 0.2269908
469 2168. 0.227656
470 2169. 0.2283224
471 2170. 0.22899
472 2171. 0.2296757
473 2172. 0.2303627
474 2173. 0.2310511
475 2174. 0.2317409
476 2175. 0.232432
477 2176. 0.2331246
478 2177. 0.2338185
479 2178. 0.2345138
480 2179. 0.2352105
481 2180. 0.2359086
482 2181. 0.2366064
483 2182. 0.2373137
484 2183. 0.2380223
485 2184. 0.2387325
486 2185. 0.2394441
487 2186. 0.2401572
488 2187. 0.2408716
489 2188. 0.2415876
490 2189. 0.242305
491 2190. 0.2430239
492 2191. 0.2437383
493 2192. 0.2444542
494 2193. 0.2451716
495 2194. 0.2458905
496 2195. 0.2466108
497 2196. 0.2473324
498 2197. 0.2480556
499 2198. 0.2487801
500 2199. 0.2495061
501 2200. 0.2502336
502 2201. 0.2508722
503 2202. 0.2515162
504 2203. 0.2521614
505 2204. 0.2528076
506 2205. 0.2534551
507 2206. 0.2541038
508 2207. 0.2547535
509 2208. 0.2554044
510 2209. 0.2560566
511 2210. 0.25671
512 2211. 0.2573819
513 2212. 0.2580549
514 2213. 0.2587293
515 2214. 0.2594052
516 2215. 0.2600821
517 2216. 0.2607603
518 2217. 0.2614399
519 2218. 0.2621207
520 2219. 0.2628028
521 2220. 0.2634861
522 2221. 0.2641589
523 2222. 0.264823
524 2223. 0.2654883
525 2224. 0.2661547
526 2225. 0.2668223
527 2226. 0.2674913
528 2227. 0.2681613
529 2228. 0.2688324
530 2229. 0.2695048
531 2230. 0.2701784
532 2231. 0.2707035
533 2232. 0.2712292
534 2233. 0.2717553
535 2234. 0.2722822
536 2235. 0.2728095
537 2236. 0.2733375
538 2237. 0.2738659
539 2238. 0.274395
540 2239. 0.2749246
541 2240. 0.2754549
542 2241. 0.275948
543 2242. 0.2764338
544 2243. 0.2769199
545 2244. 0.2774065
546 2245. 0.2778935
547 2246. 0.2783809
548 2247. 0.2788687
549 2248. 0.2793569
550 2249. 0.2798455
551 2250. 0.2803347
552 2251. 0.280842
553 2252. 0.2813498
554 2253. 0.2818581
555 2254. 0.2823669
556 2255. 0.2828762
557 2256. 0.2833859
558 2257. 0.2838962
559 2258. 0.2844069
560 2259. 0.2849182
561 2260. 0.28543
562 2261. 0.2859334
563 2262. 0.2864376
564 2263. 0.2869422
565 2264. 0.2874474
566 2265. 0.2879529
567 2266. 0.288459
568 2267. 0.2889655
569 2268. 0.2894725
570 2269. 0.2899799
571 2270. 0.2904878
572 2271. 0.2909878
573 2272. 0.2914881
574 2273. 0.291989
575 2274. 0.2924902
576 2275. 0.2929919
577 2276. 0.2934941
578 2277. 0.2939967
579 2278. 0.2944997
580 2279. 0.2950031
581 2280. 0.2955071
582 2281. 0.2959813
583 2282. 0.2964691
584 2283. 0.2969574
585 2284. 0.297446
586 2285. 0.297935
587 2286. 0.2984244
588 2287. 0.2989142
589 2288. 0.2994044
590 2289. 0.299895
591 2290. 0.300386
592 2291. 0.300898
593 2292. 0.3014105
594 2293. 0.3019235
595 2294. 0.3024369
596 2295. 0.3029508
597 2296. 0.3034652
598 2297. 0.3039801
599 2298. 0.3044954
600 2299. 0.3050111
601 2300. 0.3055274
602 2301. 0.305831
603 2302. 0.3061416
604 2303. 0.3064524
605 2304. 0.3067635
606 2305. 0.3070748
607 2306. 0.3073864
608 2307. 0.3076981
609 2308. 0.3080102
610 2309. 0.3083223
611 2310. 0.3086348
612 2311. 0.3089405
613 2312. 0.3092465
614 2313. 0.3095526
615 2314. 0.309859
616 2315. 0.3101656
617 2316. 0.3104724
618 2317. 0.3107795
619 2318. 0.3110868
620 2319. 0.3113942
621 2320. 0.311702
622 2321. 0.3119722
623 2322. 0.3122375
624 2323. 0.3125031
625 2324. 0.3127688
626 2325. 0.3130348
627 2326. 0.3133007
628 2327. 0.313567
629 2328. 0.3138332
630 2329. 0.3140997
631 2330. 0.3143663
632 2331. 0.3146564
633 2332. 0.3149466
634 2333. 0.3152371
635 2334. 0.3155276
636 2335. 0.3158185
637 2336. 0.3161095
638 2337. 0.3164007
639 2338. 0.3166922
640 2339. 0.3169838
641 2340. 0.3172757
642 2341. 0.3175602
643 2342. 0.3178404
644 2343. 0.3181207
645 2344. 0.3184013
646 2345. 0.3186821
647 2346. 0.318963
648 2347. 0.319244
649 2348. 0.3195254
650 2349. 0.3198068
651 2350. 0.3200884
652 2351. 0.320365
653 2352. 0.3206416
654 2353. 0.3209185
655 2354. 0.3211956
656 2355. 0.321473
657 2356. 0.3217505
658 2357. 0.322028
659 2358. 0.3223058
660 2359. 0.3225836
661 2360. 0.3228618
662 2361. 0.3231081
663 2362. 0.3233626
664 2363. 0.323617
665 2364. 0.3238716
666 2365. 0.3241266
667 2366. 0.3243816
668 2367. 0.3246364
669 2368. 0.3248916
670 2369. 0.3251469
671 2370. 0.3254025
672 2371. 0.3256838
673 2372. 0.3259653
674 2373. 0.3262469
675 2374. 0.3265286
676 2375. 0.3268106
677 2376. 0.3270927
678 2377. 0.3273749
679 2378. 0.3276573
680 2379. 0.32794
681 2380. 0.3282228
682 2381. 0.3285021
683 2382. 0.3287829
684 2383. 0.3290638
685 2384. 0.329345
686 2385. 0.3296262
687 2386. 0.3299077
688 2387. 0.3301893
689 2388. 0.3304712
690 2389. 0.3307532
691 2390. 0.3310353
692 2391. 0.3312831
693 2392. 0.331531
694 2393. 0.331779
695 2394. 0.3320271
696 2395. 0.3322755
697 2396. 0.3325238
698 2397. 0.3327723
699 2398. 0.3330211
700 2399. 0.3332697
701 2400. 0.3335186
702 2401. 0.3333296
703 2402. 0.3331392
704 2403. 0.3329484
705 2404. 0.3327575
706 2405. 0.3325663
707 2406. 0.332375
708 2407. 0.3321832
709 2408. 0.3319914
710 2409. 0.3317993
711 2410. 0.331607
712 2411. 0.3314116
713 2412. 0.3312159
714 2413. 0.33102
715 2414. 0.3308239
716 2415. 0.3306276
717 2416. 0.330431
718 2417. 0.3302342
719 2418. 0.3300373
720 2419. 0.3298399
721 2420. 0.3296424
722 2421. 0.3294416
723 2422. 0.3292381
724 2423. 0.3290346
725 2424. 0.3288307
726 2425. 0.3286268
727 2426. 0.3284226
728 2427. 0.328218
729 2428. 0.3280133
730 2429. 0.3278084
731 2430. 0.3276032
732 2431. 0.3273194
733 2432. 0.3270353
734 2433. 0.3267512
735 2434. 0.326467
736 2435. 0.3261827
737 2436. 0.3258983
738 2437. 0.3256138
739 2438. 0.3253293
740 2439. 0.3250445
741 2440. 0.3247598
742 2441. 0.3245074
743 2442. 0.3242657
744 2443. 0.3240238
745 2444. 0.3237818
746 2445. 0.3235396
747 2446. 0.3232973
748 2447. 0.3230547
749 2448. 0.322812
750 2449. 0.3225691
751 2450. 0.3223261
752 2451. 0.3220816
753 2452. 0.3218369
754 2453. 0.3215922
755 2454. 0.3213473
756 2455. 0.3211022
757 2456. 0.3208568
758 2457. 0.3206116
759 2458. 0.3203659
760 2459. 0.3201201
761 2460. 0.3198741
762 2461. 0.319593
763 2462. 0.3192984
764 2463. 0.3190035
765 2464. 0.3187086
766 2465. 0.3184136
767 2466. 0.3181185
768 2467. 0.3178233
769 2468. 0.3175281
770 2469. 0.3172328
771 2470. 0.3169374
772 2471. 0.3166709
773 2472. 0.3164043
774 2473. 0.3161375
775 2474. 0.3158705
776 2475. 0.3156034
777 2476. 0.3153362
778 2477. 0.3150689
779 2478. 0.3148014
780 2479. 0.3145338
781 2480. 0.3142661
782 2481. 0.3140018
783 2482. 0.3137478
784 2483. 0.3134934
785 2484. 0.3132391
786 2485. 0.3129846
787 2486. 0.3127299
788 2487. 0.3124751
789 2488. 0.3122201
790 2489. 0.3119649
791 2490. 0.3117096
792 2491. 0.3114257
793 2492. 0.3111417
794 2493. 0.3108577
795 2494. 0.3105735
796 2495. 0.3102892
797 2496. 0.3100048
798 2497. 0.3097203
799 2498. 0.3094357
800 2499. 0.309151
801 2500. 0.3088662
802 2501. 0.3085423
803 2502. 0.308229
804 2503. 0.3079155
805 2504. 0.3076017
806 2505. 0.3072876
807 2506. 0.3069733
808 2507. 0.306659
809 2508. 0.3063442
810 2509. 0.3060293
811 2510. 0.3057141
812 2511. 0.3053995
813 2512. 0.3050846
814 2513. 0.3047696
815 2514. 0.3044543
816 2515. 0.3041387
817 2516. 0.3038229
818 2517. 0.3035069
819 2518. 0.3031906
820 2519. 0.3028741
821 2520. 0.3025573
822 2521. 0.3022112
823 2522. 0.3018579
824 2523. 0.3015046
825 2524. 0.3011511
826 2525. 0.3007973
827 2526. 0.3004436
828 2527. 0.3000896
829 2528. 0.2997355
830 2529. 0.2993811
831 2530. 0.2990267
832 2531. 0.2987005
833 2532. 0.298374
834 2533. 0.2980472
835 2534. 0.2977203
836 2535. 0.2973931
837 2536. 0.2970657
838 2537. 0.2967381
839 2538. 0.2964103
840 2539. 0.2960823
841 2540. 0.295754
842 2541. 0.2954247
843 2542. 0.2950908
844 2543. 0.2947565
845 2544. 0.2944221
846 2545. 0.2940874
847 2546. 0.2937526
848 2547. 0.2934174
849 2548. 0.2930822
850 2549. 0.2927466
851 2550. 0.2924109
852 2551. 0.2920486
853 2552. 0.2916863
854 2553. 0.2913238
855 2554. 0.290961
856 2555. 0.2905982
857 2556. 0.2902352
858 2557. 0.2898721
859 2558. 0.2895089
860 2559. 0.2891454
861 2560. 0.2887819
862 2561. 0.2884443
863 2562. 0.2881032
864 2563. 0.2877618
865 2564. 0.2874203
866 2565. 0.2870786
867 2566. 0.2867366
868 2567. 0.2863945
869 2568. 0.2860521
870 2569. 0.2857095
871 2570. 0.2853668
872 2571. 0.2850245
873 2572. 0.2846818
874 2573. 0.2843389
875 2574. 0.2839959
876 2575. 0.2836526
877 2576. 0.2833093
878 2577. 0.2829655
879 2578. 0.2826217
880 2579. 0.2822776
881 2580. 0.2819334
882 2581. 0.2815664
883 2582. 0.2812083
884 2583. 0.28085
885 2584. 0.2804915
886 2585. 0.2801329
887 2586. 0.2797742
888 2587. 0.2794152
889 2588. 0.2790563
890 2589. 0.278697
891 2590. 0.2783375
892 2591. 0.278004
893 2592. 0.2776702
894 2593. 0.2773362
895 2594. 0.277002
896 2595. 0.2766674
897 2596. 0.2763327
898 2597. 0.2759978
899 2598. 0.2756627
900 2599. 0.2753273
901 2600. 0.2749915
902 2601. 0.2746155
903 2602. 0.2742369
904 2603. 0.2738579
905 2604. 0.2734788
906 2605. 0.2730994
907 2606. 0.2727197
908 2607. 0.2723399
909 2608. 0.2719597
910 2609. 0.2715793
911 2610. 0.2711986
912 2611. 0.2707933
913 2612. 0.2703879
914 2613. 0.2699823
915 2614. 0.2695764
916 2615. 0.2691704
917 2616. 0.2687642
918 2617. 0.2683578
919 2618. 0.2679513
920 2619. 0.2675444
921 2620. 0.2671375
922 2621. 0.2667533
923 2622. 0.2663614
924 2623. 0.2659692
925 2624. 0.2655769
926 2625. 0.2651843
927 2626. 0.2647915
928 2627. 0.2643985
929 2628. 0.2640051
930 2629. 0.2636116
931 2630. 0.2632179
932 2631. 0.2628365
933 2632. 0.2624547
934 2633. 0.2620728
935 2634. 0.2616906
936 2635. 0.2613081
937 2636. 0.2609253
938 2637. 0.2605423
939 2638. 0.260159
940 2639. 0.2597754
941 2640. 0.2593916
942 2641. 0.2589846
943 2642. 0.258579
944 2643. 0.2581731
945 2644. 0.2577669
946 2645. 0.2573606
947 2646. 0.2569542
948 2647. 0.2565474
949 2648. 0.2561405
950 2649. 0.2557335
951 2650. 0.2553261
952 2651. 0.2549423
953 2652. 0.2545582
954 2653. 0.2541738
955 2654. 0.2537891
956 2655. 0.2534042
957 2656. 0.253019
958 2657. 0.2526335
959 2658. 0.2522478
960 2659. 0.2518618
961 2660. 0.2514754
962 2661. 0.2510909
963 2662. 0.2507129
964 2663. 0.2503345
965 2664. 0.2499559
966 2665. 0.249577
967 2666. 0.2491977
968 2667. 0.2488181
969 2668. 0.2484383
970 2669. 0.2480581
971 2670. 0.2476777
972 2671. 0.2472746
973 2672. 0.2468714
974 2673. 0.2464679
975 2674. 0.2460641
976 2675. 0.2456602
977 2676. 0.245256
978 2677. 0.2448515
979 2678. 0.2444469
980 2679. 0.244042
981 2680. 0.2436368
982 2681. 0.2432521
983 2682. 0.2428594
984 2683. 0.2424663
985 2684. 0.242073
986 2685. 0.2416794
987 2686. 0.2412855
988 2687. 0.2408914
989 2688. 0.240497
990 2689. 0.2401022
991 2690. 0.2397073
992 2691. 0.2393124
993 2692. 0.2389171
994 2693. 0.2385216
995 2694. 0.2381258
996 2695. 0.2377297
997 2696. 0.2373333
998 2697. 0.2369367
999 2698. 0.2365398
1000 2699. 0.2361426
1001 2700. 0.2357451
1002 2701. 0.2357005
1003 2702. 0.2356511
1004 2703. 0.2356016
1005 2704. 0.235552
1006 2705. 0.2355025
1007 2706. 0.2354529
1008 2707. 0.2354034
1009 2708. 0.2353537
1010 2709. 0.235304
1011 2710. 0.2352543
1012 2711. 0.2352263
1013 2712. 0.2351981
1014 2713. 0.2351699
1015 2714. 0.2351417
1016 2715. 0.2351134
1017 2716. 0.2350851
1018 2717. 0.2350568
1019 2718. 0.2350284
1020 2719. 0.2349999
1021 2720. 0.2349715
1022 2721. 0.2349428
1023 2722. 0.2349122
1024 2723. 0.2348817
1025 2724. 0.2348511
1026 2725. 0.2348205
1027 2726. 0.2347898
1028 2727. 0.2347591
1029 2728. 0.2347284
1030 2729. 0.2346975
1031 2730. 0.2346667
1032 2731. 0.2346147
1033 2732. 0.2345626
1034 2733. 0.2345106
1035 2734. 0.2344584
1036 2735. 0.2344062
1037 2736. 0.2343541
1038 2737. 0.2343019
1039 2738. 0.2342496
1040 2739. 0.2341973
1041 2740. 0.2341451
1042 2741. 0.2341151
1043 2742. 0.2340884
1044 2743. 0.2340616
1045 2744. 0.2340349
1046 2745. 0.234008
1047 2746. 0.2339812
1048 2747. 0.2339543
1049 2748. 0.2339273
1050 2749. 0.2339003
1051 2750. 0.2338733
1052 2751. 0.2338251
1053 2752. 0.2337769
1054 2753. 0.2337287
1055 2754. 0.2336804
1056 2755. 0.2336322
1057 2756. 0.2335838
1058 2757. 0.2335355
1059 2758. 0.2334871
1060 2759. 0.2334386
1061 2760. 0.2333902
1062 2761. 0.2333633
1063 2762. 0.2333373
1064 2763. 0.2333114
1065 2764. 0.2332853
1066 2765. 0.2332593
1067 2766. 0.2332331
1068 2767. 0.233207
1069 2768. 0.2331807
1070 2769. 0.2331545
1071 2770. 0.2331282
1072 2771. 0.233102
1073 2772. 0.2330758
1074 2773. 0.2330495
1075 2774. 0.2330231
1076 2775. 0.2329967
1077 2776. 0.2329703
1078 2777. 0.2329437
1079 2778. 0.2329172
1080 2779. 0.2328906
1081 2780. 0.232864
1082 2781. 0.2328159
1083 2782. 0.2327658
1084 2783. 0.2327157
1085 2784. 0.2326654
1086 2785. 0.2326151
1087 2786. 0.2325649
1088 2787. 0.2325146
1089 2788. 0.2324643
1090 2789. 0.232414
1091 2790. 0.2323636
1092 2791. 0.2323343
1093 2792. 0.2323051
1094 2793. 0.2322758
1095 2794. 0.2322465
1096 2795. 0.2322171
1097 2796. 0.2321877
1098 2797. 0.2321583
1099 2798. 0.2321289
1100 2799. 0.2320993
1101 2800. 0.2320697
1102 2801. 0.2322082
1103 2802. 0.2323451
1104 2803. 0.2324822
1105 2804. 0.2326192
1106 2805. 0.2327563
1107 2806. 0.2328935
1108 2807. 0.2330307
1109 2808. 0.2331681
1110 2809. 0.2333053
1111 2810. 0.2334428
1112 2811. 0.2335592
1113 2812. 0.2336757
1114 2813. 0.2337922
1115 2814. 0.2339088
1116 2815. 0.2340254
1117 2816. 0.234142
1118 2817. 0.2342585
1119 2818. 0.2343752
1120 2819. 0.234492
1121 2820. 0.2346087
1122 2821. 0.2347466
1123 2822. 0.2348839
1124 2823. 0.2350212
1125 2824. 0.2351588
1126 2825. 0.2352962
1127 2826. 0.2354337
1128 2827. 0.2355714
1129 2828. 0.235709
1130 2829. 0.2358467
1131 2830. 0.2359844
1132 2831. 0.236076
1133 2832. 0.2361676
1134 2833. 0.2362591
1135 2834. 0.2363507
1136 2835. 0.2364424
1137 2836. 0.236534
1138 2837. 0.2366256
1139 2838. 0.2367173
1140 2839. 0.236809
1141 2840. 0.2369007
1142 2841. 0.2370136
1143 2842. 0.2371254
1144 2843. 0.2372373
1145 2844. 0.2373491
1146 2845. 0.2374611
1147 2846. 0.237573
1148 2847. 0.237685
1149 2848. 0.237797
1150 2849. 0.237909
1151 2850. 0.2380211
1152 2851. 0.2381333
1153 2852. 0.2382453
1154 2853. 0.2383575
1155 2854. 0.2384698
1156 2855. 0.238582
1157 2856. 0.2386943
1158 2857. 0.2388066
1159 2858. 0.2389189
1160 2859. 0.2390312
1161 2860. 0.2391437
1162 2861. 0.2392338
1163 2862. 0.2393204
1164 2863. 0.2394071
1165 2864. 0.2394938
1166 2865. 0.2395806
1167 2866. 0.2396674
1168 2867. 0.2397541
1169 2868. 0.2398408
1170 2869. 0.2399276
1171 2870. 0.2400143
1172 2871. 0.2401228
1173 2872. 0.2402312
1174 2873. 0.2403397
1175 2874. 0.2404483
1176 2875. 0.2405568
1177 2876. 0.2406654
1178 2877. 0.2407739
1179 2878. 0.2408825
1180 2879. 0.2409911
1181 2880. 0.2410998
1182 2881. 0.2411886
1183 2882. 0.2412877
1184 2883. 0.241387
1185 2884. 0.2414862
1186 2885. 0.2415855
1187 2886. 0.2416847
1188 2887. 0.241784
1189 2888. 0.2418833
1190 2889. 0.2419826
1191 2890. 0.242082
1192 2891. 0.2422032
1193 2892. 0.2423245
1194 2893. 0.2424458
1195 2894. 0.2425672
1196 2895. 0.2426886
1197 2896. 0.24281
1198 2897. 0.2429315
1199 2898. 0.243053
1200 2899. 0.2431745
1201 2900. 0.2432961
1202 2901. 0.2435168
1203 2902. 0.2437279
1204 2903. 0.2439389
1205 2904. 0.2441501
1206 2905. 0.2443613
1207 2906. 0.2445726
1208 2907. 0.2447838
1209 2908. 0.2449953
1210 2909. 0.2452067
1211 2910. 0.2454182
1212 2911. 0.2456076
1213 2912. 0.2457971
1214 2913. 0.2459865
1215 2914. 0.2461761
1216 2915. 0.2463656
1217 2916. 0.2465552
1218 2917. 0.2467447
1219 2918. 0.2469343
1220 2919. 0.247124
1221 2920. 0.2473136
1222 2921. 0.2475254
1223 2922. 0.2477374
1224 2923. 0.2479494
1225 2924. 0.2481613
1226 2925. 0.2483734
1227 2926. 0.2485856
1228 2927. 0.2487978
1229 2928. 0.2490101
1230 2929. 0.2492224
1231 2930. 0.2494347
1232 2931. 0.2496246
1233 2932. 0.2498145
1234 2933. 0.2500044
1235 2934. 0.2501943
1236 2935. 0.2503842
1237 2936. 0.2505742
1238 2937. 0.2507642
1239 2938. 0.2509542
1240 2939. 0.2511442
1241 2940. 0.2513343
1242 2941. 0.2515476
1243 2942. 0.2517652
1244 2943. 0.2519828
1245 2944. 0.2522004
1246 2945. 0.2524182
1247 2946. 0.2526361
1248 2947. 0.2528539
1249 2948. 0.2530719
1250 2949. 0.2532899
1251 2950. 0.253508
1252 2951. 0.253726
1253 2952. 0.253944
1254 2953. 0.2541623
1255 2954. 0.2543804
1256 2955. 0.2545987
1257 2956. 0.2548171
1258 2957. 0.2550355
1259 2958. 0.255254
1260 2959. 0.2554725
1261 2960. 0.2556911
1262 2961. 0.2558856
1263 2962. 0.2560728
1264 2963. 0.2562601
1265 2964. 0.2564474
1266 2965. 0.2566347
1267 2966. 0.256822
1268 2967. 0.2570093
1269 2968. 0.2571967
1270 2969. 0.257384
1271 2970. 0.2575714
1272 2971. 0.2577818
1273 2972. 0.2579922
1274 2973. 0.2582025
1275 2974. 0.258413
1276 2975. 0.2586235
1277 2976. 0.2588341
1278 2977. 0.2590447
1279 2978. 0.2592554
1280 2979. 0.2594661
1281 2980. 0.2596769
1282 2981. 0.2598642
1283 2982. 0.2600512
1284 2983. 0.2602382
1285 2984. 0.2604252
1286 2985. 0.2606123
1287 2986. 0.2607994
1288 2987. 0.2609864
1289 2988. 0.2611736
1290 2989. 0.2613608
1291 2990. 0.2615478
1292 2991. 0.2617584
1293 2992. 0.261969
1294 2993. 0.2621796
1295 2994. 0.2623902
1296 2995. 0.2626009
1297 2996. 0.2628118
1298 2997. 0.2630226
1299 2998. 0.2632335
1300 2999. 0.2634444
1301 3000. 0.2636554
1302 3001. 0.2636483
1303 3002. 0.263634
1304 3003. 0.2636196
1305 3004. 0.2636052
1306 3005. 0.263591
1307 3006. 0.2635767
1308 3007. 0.2635624
1309 3008. 0.263548
1310 3009. 0.2635337
1311 3010. 0.2635193
1312 3011. 0.2635284
1313 3012. 0.2635376
1314 3013. 0.2635468
1315 3014. 0.2635559
1316 3015. 0.2635649
1317 3016. 0.2635741
1318 3017. 0.2635832
1319 3018. 0.2635922
1320 3019. 0.2636013
1321 3020. 0.2636104
1322 3021. 0.2636192
1323 3022. 0.2636286
1324 3023. 0.263638
1325 3024. 0.2636474
1326 3025. 0.2636569
1327 3026. 0.2636662
1328 3027. 0.2636756
1329 3028. 0.2636849
1330 3029. 0.2636942
1331 3030. 0.2637036
1332 3031. 0.2636878
1333 3032. 0.2636721
1334 3033. 0.2636563
1335 3034. 0.2636405
1336 3035. 0.2636248
1337 3036. 0.2636091
1338 3037. 0.2635932
1339 3038. 0.2635774
1340 3039. 0.2635616
1341 3040. 0.2635459
1342 3041. 0.2635554
1343 3042. 0.2635793
1344 3043. 0.2636032
1345 3044. 0.2636271
1346 3045. 0.263651
1347 3046. 0.2636749
1348 3047. 0.2636988
1349 3048. 0.2637227
1350 3049. 0.2637466
1351 3050. 0.2637706
1352 3051. 0.2637707
1353 3052. 0.2637709
1354 3053. 0.2637712
1355 3054. 0.2637714
1356 3055. 0.2637716
1357 3056. 0.2637718
1358 3057. 0.263772
1359 3058. 0.2637721
1360 3059. 0.2637723
1361 3060. 0.2637725
1362 3061. 0.263795
1363 3062. 0.2638087
1364 3063. 0.2638223
1365 3064. 0.2638359
1366 3065. 0.2638495
1367 3066. 0.2638631
1368 3067. 0.2638766
1369 3068. 0.2638902
1370 3069. 0.2639038
1371 3070. 0.2639174
1372 3071. 0.2639073
1373 3072. 0.2638971
1374 3073. 0.263887
1375 3074. 0.2638768
1376 3075. 0.2638666
1377 3076. 0.2638564
1378 3077. 0.2638463
1379 3078. 0.2638362
1380 3079. 0.2638259
1381 3080. 0.2638158
1382 3081. 0.2638288
1383 3082. 0.2638396
1384 3083. 0.2638505
1385 3084. 0.2638612
1386 3085. 0.2638721
1387 3086. 0.2638829
1388 3087. 0.2638937
1389 3088. 0.2639045
1390 3089. 0.2639153
1391 3090. 0.2639261
1392 3091. 0.2639132
1393 3092. 0.2639002
1394 3093. 0.2638873
1395 3094. 0.2638744
1396 3095. 0.2638613
1397 3096. 0.2638484
1398 3097. 0.2638355
1399 3098. 0.2638225
1400 3099. 0.2638095
1401 3100. 0.2637965
1402 3101. 0.2638074
1403 3102. 0.2638216
1404 3103. 0.2638359
1405 3104. 0.2638501
1406 3105. 0.2638644
1407 3106. 0.2638786
1408 3107. 0.2638928
1409 3108. 0.263907
1410 3109. 0.2639213
1411 3110. 0.2639355
1412 3111. 0.2639497
1413 3112. 0.2639638
1414 3113. 0.2639778
1415 3114. 0.263992
1416 3115. 0.2640061
1417 3116. 0.2640202
1418 3117. 0.2640343
1419 3118. 0.2640484
1420 3119. 0.2640625
1421 3120. 0.2640766
1422 3121. 0.2640665
1423 3122. 0.2640516
1424 3123. 0.2640367
1425 3124. 0.2640218
1426 3125. 0.2640069
1427 3126. 0.2639921
1428 3127. 0.2639772
1429 3128. 0.2639623
1430 3129. 0.2639473
1431 3130. 0.2639325
1432 3131. 0.263941
1433 3132. 0.2639495
1434 3133. 0.2639581
1435 3134. 0.2639666
1436 3135. 0.2639751
1437 3136. 0.2639836
1438 3137. 0.2639921
1439 3138. 0.2640006
1440 3139. 0.2640091
1441 3140. 0.2640176
1442 3141. 0.2640024
1443 3142. 0.2639849
1444 3143. 0.2639675
1445 3144. 0.26395
1446 3145. 0.2639325
1447 3146. 0.263915
1448 3147. 0.2638976
1449 3148. 0.26388
1450 3149. 0.2638625
1451 3150. 0.2638451
1452 3151. 0.263851
1453 3152. 0.2638569
1454 3153. 0.2638627
1455 3154. 0.2638687
1456 3155. 0.2638746
1457 3156. 0.2638804
1458 3157. 0.2638863
1459 3158. 0.2638922
1460 3159. 0.263898
1461 3160. 0.2639039
1462 3161. 0.2638862
1463 3162. 0.2638683
1464 3163. 0.2638503
1465 3164. 0.2638323
1466 3165. 0.2638144
1467 3166. 0.2637965
1468 3167. 0.2637785
1469 3168. 0.2637605
1470 3169. 0.2637426
1471 3170. 0.2637246
1472 3171. 0.2637301
1473 3172. 0.2637355
1474 3173. 0.2637409
1475 3174. 0.2637463
1476 3175. 0.2637517
1477 3176. 0.2637571
1478 3177. 0.2637623
1479 3178. 0.2637677
1480 3179. 0.2637731
1481 3180. 0.2637785
1482 3181. 0.2637604
1483 3182. 0.2637429
1484 3183. 0.2637254
1485 3184. 0.2637078
1486 3185. 0.2636904
1487 3186. 0.2636728
1488 3187. 0.2636552
1489 3188. 0.2636378
1490 3189. 0.2636203
1491 3190. 0.2636027
1492 3191. 0.2636084
1493 3192. 0.2636143
1494 3193. 0.2636201
1495 3194. 0.2636259
1496 3195. 0.2636316
1497 3196. 0.2636375
1498 3197. 0.2636432
1499 3198. 0.2636491
1500 3199. 0.2636548
1501 3200. 0.2636606
1502 3201. 0.2636235
1503 3202. 0.2635922
1504 3203. 0.2635607
1505 3204. 0.2635293
1506 3205. 0.2634978
1507 3206. 0.2634664
1508 3207. 0.2634349
1509 3208. 0.2634035
1510 3209. 0.263372
1511 3210. 0.2633406
1512 3211. 0.2633324
1513 3212. 0.2633243
1514 3213. 0.2633164
1515 3214. 0.2633083
1516 3215. 0.2633002
1517 3216. 0.2632921
1518 3217. 0.2632838
1519 3218. 0.2632758
1520 3219. 0.2632675
1521 3220. 0.2632594
1522 3221. 0.2632275
1523 3222. 0.2631898
1524 3223. 0.2631521
1525 3224. 0.2631145
1526 3225. 0.2630769
1527 3226. 0.2630393
1528 3227. 0.2630016
1529 3228. 0.2629638
1530 3229. 0.2629262
1531 3230. 0.2628885
1532 3231. 0.2628741
1533 3232. 0.2628596
1534 3233. 0.2628453
1535 3234. 0.2628308
1536 3235. 0.2628164
1537 3236. 0.2628019
1538 3237. 0.2627875
1539 3238. 0.262773
1540 3239. 0.2627585
1541 3240. 0.262744
1542 3241. 0.2627063
1543 3242. 0.2626699
1544 3243. 0.2626334
1545 3244. 0.2625969
1546 3245. 0.2625603
1547 3246. 0.2625239
1548 3247. 0.2624874
1549 3248. 0.2624509
1550 3249. 0.2624144
1551 3250. 0.2623779
1552 3251. 0.2623647
1553 3252. 0.2623515
1554 3253. 0.2623382
1555 3254. 0.262325
1556 3255. 0.2623116
1557 3256. 0.2622983
1558 3257. 0.2622851
1559 3258. 0.2622717
1560 3259. 0.2622584
1561 3260. 0.2622451
1562 3261. 0.2622085
1563 3262. 0.26217
1564 3263. 0.2621316
1565 3264. 0.2620931
1566 3265. 0.2620548
1567 3266. 0.2620163
1568 3267. 0.2619778
1569 3268. 0.2619394
1570 3269. 0.261901
1571 3270. 0.2618625
1572 3271. 0.2618473
1573 3272. 0.2618321
1574 3273. 0.2618169
1575 3274. 0.2618017
1576 3275. 0.2617863
1577 3276. 0.2617711
1578 3277. 0.2617559
1579 3278. 0.2617406
1580 3279. 0.2617253
1581 3280. 0.2617101
1582 3281. 0.2616718
1583 3282. 0.2616369
1584 3283. 0.261602
1585 3284. 0.2615671
1586 3285. 0.2615322
1587 3286. 0.2614973
1588 3287. 0.2614625
1589 3288. 0.2614275
1590 3289. 0.2613926
1591 3290. 0.2613577
1592 3291. 0.261346
1593 3292. 0.2613342
1594 3293. 0.2613224
1595 3294. 0.2613106
1596 3295. 0.2612989
1597 3296. 0.261287
1598 3297. 0.2612752
1599 3298. 0.2612634
1600 3299. 0.2612517
1601 3300. 0.2612398
1602 3301. 0.2612048
1603 3302. 0.261167
1604 3303. 0.2611292
1605 3304. 0.2610914
1606 3305. 0.2610537
1607 3306. 0.2610158
1608 3307. 0.260978
1609 3308. 0.2609402
1610 3309. 0.2609023
1611 3310. 0.2608646
1612 3311. 0.26085
1613 3312. 0.2608354
1614 3313. 0.2608207
1615 3314. 0.260806
1616 3315. 0.2607913
1617 3316. 0.2607767
1618 3317. 0.2607621
1619 3318. 0.2607474
1620 3319. 0.2607326
1621 3320. 0.2607179
1622 3321. 0.2606803
1623 3322. 0.2606436
1624 3323. 0.2606069
1625 3324. 0.2605702
1626 3325. 0.2605335
1627 3326. 0.2604967
1628 3327. 0.26046
1629 3328. 0.2604233
1630 3329. 0.2603865
1631 3330. 0.2603499
1632 3331. 0.2603362
1633 3332. 0.2603225
1634 3333. 0.2603087
1635 3334. 0.260295
1636 3335. 0.2602813
1637 3336. 0.2602676
1638 3337. 0.2602538
1639 3338. 0.2602401
1640 3339. 0.2602263
1641 3340. 0.2602127
1642 3341. 0.2601761
1643 3342. 0.2601433
1644 3343. 0.2601105
1645 3344. 0.2600778
1646 3345. 0.2600449
1647 3346. 0.2600121
1648 3347. 0.2599794
1649 3348. 0.2599466
1650 3349. 0.2599137
1651 3350. 0.259881
1652 3351. 0.2598712
1653 3352. 0.2598613
1654 3353. 0.2598514
1655 3354. 0.2598416
1656 3355. 0.2598317
1657 3356. 0.2598218
1658 3357. 0.2598119
1659 3358. 0.259802
1660 3359. 0.259792
1661 3360. 0.2597822
1662 3361. 0.2597492
1663 3362. 0.2597097
1664 3363. 0.2596703
1665 3364. 0.2596308
1666 3365. 0.2595913
1667 3366. 0.2595519
1668 3367. 0.2595124
1669 3368. 0.2594729
1670 3369. 0.2594334
1671 3370. 0.259394
1672 3371. 0.2593775
1673 3372. 0.2593611
1674 3373. 0.2593447
1675 3374. 0.2593282
1676 3375. 0.2593117
1677 3376. 0.2592952
1678 3377. 0.2592787
1679 3378. 0.2592622
1680 3379. 0.2592456
1681 3380. 0.2592291
1682 3381. 0.25919
1683 3382. 0.2591541
1684 3383. 0.2591182
1685 3384. 0.2590823
1686 3385. 0.2590463
1687 3386. 0.2590103
1688 3387. 0.2589744
1689 3388. 0.2589385
1690 3389. 0.2589025
1691 3390. 0.2588666
1692 3391. 0.2588536
1693 3392. 0.2588405
1694 3393. 0.2588274
1695 3394. 0.2588143
1696 3395. 0.2588011
1697 3396. 0.2587881
1698 3397. 0.258775
1699 3398. 0.2587618
1700 3399. 0.2587487
1701 3400. 0.2587355
1702 3401. 0.2585704
1703 3402. 0.2584034
1704 3403. 0.2582364
1705 3404. 0.2580693
1706 3405. 0.2579024
1707 3406. 0.2577352
1708 3407. 0.2575683
1709 3408. 0.2574012
1710 3409. 0.2572341
1711 3410. 0.257067
1712 3411. 0.2569227
1713 3412. 0.2567784
1714 3413. 0.2566341
1715 3414. 0.2564896
1716 3415. 0.2563451
1717 3416. 0.2562006
1718 3417. 0.2560561
1719 3418. 0.2559115
1720 3419. 0.2557669
1721 3420. 0.2556223
1722 3421. 0.2554554
1723 3422. 0.2552864
1724 3423. 0.2551174
1725 3424. 0.2549485
1726 3425. 0.2547795
1727 3426. 0.2546106
1728 3427. 0.2544416
1729 3428. 0.2542726
1730 3429. 0.2541036
1731 3430. 0.2539347
1732 3431. 0.2537867
1733 3432. 0.2536387
1734 3433. 0.2534907
1735 3434. 0.2533426
1736 3435. 0.2531946
1737 3436. 0.2530465
1738 3437. 0.2528983
1739 3438. 0.2527502
1740 3439. 0.252602
1741 3440. 0.2524537
1742 3441. 0.2522837
1743 3442. 0.2521237
1744 3443. 0.2519638
1745 3444. 0.2518038
1746 3445. 0.2516437
1747 3446. 0.2514837
1748 3447. 0.2513236
1749 3448. 0.2511637
1750 3449. 0.2510035
1751 3450. 0.2508435
1752 3451. 0.2507056
1753 3452. 0.2505676
1754 3453. 0.2504295
1755 3454. 0.2502915
1756 3455. 0.2501534
1757 3456. 0.2500153
1758 3457. 0.2498771
1759 3458. 0.2497389
1760 3459. 0.2496006
1761 3460. 0.2494622
1762 3461. 0.2493021
1763 3462. 0.2491392
1764 3463. 0.2489764
1765 3464. 0.2488135
1766 3465. 0.2486505
1767 3466. 0.2484877
1768 3467. 0.2483247
1769 3468. 0.2481618
1770 3469. 0.2479988
1771 3470. 0.2478358
1772 3471. 0.2476731
1773 3472. 0.2475104
1774 3473. 0.2473477
1775 3474. 0.2471849
1776 3475. 0.247022
1777 3476. 0.2468593
1778 3477. 0.2466965
1779 3478. 0.2465338
1780 3479. 0.2463709
1781 3480. 0.2462081
1782 3481. 0.246067
1783 3482. 0.2459231
1784 3483. 0.2457791
1785 3484. 0.2456352
1786 3485. 0.2454911
1787 3486. 0.245347
1788 3487. 0.2452029
1789 3488. 0.2450587
1790 3489. 0.2449145
1791 3490. 0.2447704
1792 3491. 0.2446049
1793 3492. 0.2444394
1794 3493. 0.2442739
1795 3494. 0.2441084
1796 3495. 0.2439429
1797 3496. 0.2437773
1798 3497. 0.2436118
1799 3498. 0.2434463
1800 3499. 0.2432807
1801 3500. 0.2431152
1802 3501. 0.2429393
1803 3502. 0.2427598
1804 3503. 0.2425802
1805 3504. 0.2424007
1806 3505. 0.242221
1807 3506. 0.2420413
1808 3507. 0.2418616
1809 3508. 0.2416818
1810 3509. 0.2415021
1811 3510. 0.2413222
1812 3511. 0.2411214
1813 3512. 0.2409205
1814 3513. 0.2407196
1815 3514. 0.2405188
1816 3515. 0.240318
1817 3516. 0.2401171
1818 3517. 0.2399162
1819 3518. 0.2397153
1820 3519. 0.2395144
1821 3520. 0.2393135
1822 3521. 0.2391338
1823 3522. 0.2389582
1824 3523. 0.2387826
1825 3524. 0.2386068
1826 3525. 0.2384311
1827 3526. 0.2382553
1828 3527. 0.2380795
1829 3528. 0.2379036
1830 3529. 0.2377277
1831 3530. 0.2375517
1832 3531. 0.2373551
1833 3532. 0.2371584
1834 3533. 0.2369618
1835 3534. 0.2367652
1836 3535. 0.2365685
1837 3536. 0.2363718
1838 3537. 0.2361751
1839 3538. 0.2359784
1840 3539. 0.2357817
1841 3540. 0.235585
1842 3541. 0.2354091
1843 3542. 0.2352307
1844 3543. 0.2350523
1845 3544. 0.2348737
1846 3545. 0.2346951
1847 3546. 0.2345166
1848 3547. 0.2343379
1849 3548. 0.2341592
1850 3549. 0.2339805
1851 3550. 0.2338017
1852 3551. 0.2336026
1853 3552. 0.2334035
1854 3553. 0.2332044
1855 3554. 0.2330053
1856 3555. 0.2328061
1857 3556. 0.232607
1858 3557. 0.2324078
1859 3558. 0.2322086
1860 3559. 0.2320094
1861 3560. 0.2318103
1862 3561. 0.2316112
1863 3562. 0.2314121
1864 3563. 0.231213
1865 3564. 0.2310138
1866 3565. 0.2308148
1867 3566. 0.2306156
1868 3567. 0.2304165
1869 3568. 0.2302173
1870 3569. 0.2300182
1871 3570. 0.229819
1872 3571. 0.2296401
1873 3572. 0.2294611
1874 3573. 0.2292821
1875 3574. 0.229103
1876 3575. 0.2289239
1877 3576. 0.2287447
1878 3577. 0.2285655
1879 3578. 0.2283862
1880 3579. 0.2282069
1881 3580. 0.2280276
1882 3581. 0.2278285
1883 3582. 0.2276276
1884 3583. 0.2274268
1885 3584. 0.2272258
1886 3585. 0.2270249
1887 3586. 0.226824
1888 3587. 0.2266231
1889 3588. 0.2264222
1890 3589. 0.2262213
1891 3590. 0.2260204
1892 3591. 0.2258394
1893 3592. 0.2256583
1894 3593. 0.2254771
1895 3594. 0.2252959
1896 3595. 0.2251147
1897 3596. 0.2249334
1898 3597. 0.2247521
1899 3598. 0.2245708
1900 3599. 0.2243894
1901 3600. 0.224208
1902 3601. 0.2242486
1903 3602. 0.2243015
1904 3603. 0.2243549
1905 3604. 0.2244082
1906 3605. 0.2244615
1907 3606. 0.2245149
1908 3607. 0.2245681
1909 3608. 0.2246215
1910 3609. 0.2246748
1911 3610. 0.2247281
1912 3611. 0.2248012
1913 3612. 0.2248743
1914 3613. 0.2249475
1915 3614. 0.2250206
1916 3615. 0.2250937
1917 3616. 0.2251668
1918 3617. 0.22524
1919 3618. 0.2253131
1920 3619. 0.2253862
1921 3620. 0.2254594
1922 3621. 0.225513
1923 3622. 0.2255568
1924 3623. 0.2256003
1925 3624. 0.2256439
1926 3625. 0.2256874
1927 3626. 0.2257309
1928 3627. 0.2257744
1929 3628. 0.2258179
1930 3629. 0.2258614
1931 3630. 0.225905
1932 3631. 0.2259451
1933 3632. 0.2259852
1934 3633. 0.2260253
1935 3634. 0.2260655
1936 3635. 0.2261057
1937 3636. 0.2261458
1938 3637. 0.2261859
1939 3638. 0.2262261
1940 3639. 0.2262662
1941 3640. 0.2263063
1942 3641. 0.2263663
1943 3642. 0.2264165
1944 3643. 0.2264665
1945 3644. 0.2265163
1946 3645. 0.2265663
1947 3646. 0.2266161
1948 3647. 0.226666
1949 3648. 0.226716
1950 3649. 0.2267658
1951 3650. 0.2268157
1952 3651. 0.2268458
1953 3652. 0.226876
1954 3653. 0.2269062
1955 3654. 0.2269363
1956 3655. 0.2269665
1957 3656. 0.2269966
1958 3657. 0.2270267
1959 3658. 0.2270569
1960 3659. 0.227087
1961 3660. 0.227117
1962 3661. 0.2271671
1963 3662. 0.2272307
1964 3663. 0.2272949
1965 3664. 0.2273592
1966 3665. 0.2274235
1967 3666. 0.2274878
1968 3667. 0.227552
1969 3668. 0.2276164
1970 3669. 0.2276806
1971 3670. 0.227745
1972 3671. 0.2277894
1973 3672. 0.2278339
1974 3673. 0.2278785
1975 3674. 0.227923
1976 3675. 0.2279675
1977 3676. 0.2280121
1978 3677. 0.2280566
1979 3678. 0.228101
1980 3679. 0.2281456
1981 3680. 0.2281901
1982 3681. 0.2282347
1983 3682. 0.2282833
1984 3683. 0.2283321
1985 3684. 0.228381
1986 3685. 0.2284298
1987 3686. 0.2284787
1988 3687. 0.2285275
1989 3688. 0.2285764
1990 3689. 0.2286252
1991 3690. 0.2286741
1992 3691. 0.2287429
1993 3692. 0.2288117
1994 3693. 0.2288805
1995 3694. 0.2289493
1996 3695. 0.229018
1997 3696. 0.229087
1998 3697. 0.2291557
1999 3698. 0.2292246
2000 3699. 0.2292934
2001 3700. 0.2293622
2002 3701. 0.2294112
2003 3702. 0.2294507
2004 3703. 0.2294895
2005 3704. 0.2295284
2006 3705. 0.2295673
2007 3706. 0.2296063
2008 3707. 0.2296451
2009 3708. 0.229684
2010 3709. 0.2297229
2011 3710. 0.2297618
2012 3711. 0.2298207
2013 3712. 0.2298795
2014 3713. 0.2299383
2015 3714. 0.2299973
2016 3715. 0.2300562
2017 3716. 0.230115
2018 3717. 0.2301739
2019 3718. 0.2302328
2020 3719. 0.2302917
2021 3720. 0.2303506
2022 3721. 0.2303895
2023 3722. 0.2304238
2024 3723. 0.2304578
2025 3724. 0.2304917
2026 3725. 0.2305258
2027 3726. 0.2305597
2028 3727. 0.2305937
2029 3728. 0.2306277
2030 3729. 0.2306617
2031 3730. 0.2306956
2032 3731. 0.2307296
2033 3732. 0.2307636
2034 3733. 0.2307976
2035 3734. 0.2308316
2036 3735. 0.2308656
2037 3736. 0.2308996
2038 3737. 0.2309336
2039 3738. 0.2309676
2040 3739. 0.2310015
2041 3740. 0.2310356
2042 3741. 0.2310895
2043 3742. 0.231147
2044 3743. 0.2312048
2045 3744. 0.2312626
2046 3745. 0.2313204
2047 3746. 0.2313783
2048 3747. 0.2314361
2049 3748. 0.2314939
2050 3749. 0.2315517
2051 3750. 0.2316095
2052 3751. 0.2316472
2053 3752. 0.2316848
2054 3753. 0.2317225
2055 3754. 0.2317602
2056 3755. 0.2317979
2057 3756. 0.2318355
2058 3757. 0.2318732
2059 3758. 0.2319109
2060 3759. 0.2319485
2061 3760. 0.2319862
2062 3761. 0.232044
2063 3762. 0.2321111
2064 3763. 0.2321788
2065 3764. 0.2322465
2066 3765. 0.2323143
2067 3766. 0.2323821
2068 3767. 0.2324499
2069 3768. 0.2325176
2070 3769. 0.2325854
2071 3770. 0.2326532
2072 3771. 0.2327008
2073 3772. 0.2327483
2074 3773. 0.2327959
2075 3774. 0.2328435
2076 3775. 0.2328911
2077 3776. 0.2329386
2078 3777. 0.2329861
2079 3778. 0.2330337
2080 3779. 0.2330812
2081 3780. 0.2331288
2082 3781. 0.2331763
2083 3782. 0.2332174
2084 3783. 0.233258
2085 3784. 0.2332986
2086 3785. 0.2333391
2087 3786. 0.2333797
2088 3787. 0.2334203
2089 3788. 0.233461
2090 3789. 0.2335015
2091 3790. 0.2335421
2092 3791. 0.2336029
2093 3792. 0.2336636
2094 3793. 0.2337244
2095 3794. 0.2337853
2096 3795. 0.2338459
2097 3796. 0.2339067
2098 3797. 0.2339675
2099 3798. 0.2340284
2100 3799. 0.2340892
2101 3800. 0.23415
2102 3801. 0.2342682
2103 3802. 0.2343867
2104 3803. 0.2345053
2105 3804. 0.2346238
2106 3805. 0.2347424
2107 3806. 0.234861
2108 3807. 0.2349795
2109 3808. 0.2350981
2110 3809. 0.2352167
2111 3810. 0.2353352
2112 3811. 0.2354537
2113 3812. 0.2355721
2114 3813. 0.2356906
2115 3814. 0.235809
2116 3815. 0.2359274
2117 3816. 0.2360458
2118 3817. 0.2361643
2119 3818. 0.2362827
2120 3819. 0.2364011
2121 3820. 0.2365196
2122 3821. 0.2366584
2123 3822. 0.236798
2124 3823. 0.2369377
2125 3824. 0.2370775
2126 3825. 0.2372172
2127 3826. 0.237357
2128 3827. 0.2374968
2129 3828. 0.2376367
2130 3829. 0.2377764
2131 3830. 0.2379163
2132 3831. 0.2380354
2133 3832. 0.2381545
2134 3833. 0.2382736
2135 3834. 0.2383926
2136 3835. 0.2385118
2137 3836. 0.238631
2138 3837. 0.23875
2139 3838. 0.2388691
2140 3839. 0.2389882
2141 3840. 0.2391074
2142 3841. 0.2392471
2143 3842. 0.239388
2144 3843. 0.2395292
2145 3844. 0.2396703
2146 3845. 0.2398114
2147 3846. 0.2399526
2148 3847. 0.2400938
2149 3848. 0.240235
2150 3849. 0.2403763
2151 3850. 0.2405176
2152 3851. 0.2406379
2153 3852. 0.2407581
2154 3853. 0.2408784
2155 3854. 0.2409987
2156 3855. 0.241119
2157 3856. 0.2412393
2158 3857. 0.2413597
2159 3858. 0.2414799
2160 3859. 0.2416002
2161 3860. 0.2417205
2162 3861. 0.2418407
2163 3862. 0.2419583
2164 3863. 0.2420756
2165 3864. 0.2421928
2166 3865. 0.2423102
2167 3866. 0.2424275
2168 3867. 0.2425447
2169 3868. 0.2426621
2170 3869. 0.2427794
2171 3870. 0.2428966
2172 3871. 0.2430349
2173 3872. 0.2431731
2174 3873. 0.2433114
2175 3874. 0.2434497
2176 3875. 0.243588
2177 3876. 0.2437263
2178 3877. 0.2438647
2179 3878. 0.2440031
2180 3879. 0.2441414
2181 3880. 0.2442799
2182 3881. 0.2443971
2183 3882. 0.2445124
2184 3883. 0.2446276
2185 3884. 0.2447429
2186 3885. 0.2448582
2187 3886. 0.2449734
2188 3887. 0.2450885
2189 3888. 0.2452038
2190 3889. 0.245319
2191 3890. 0.2454343
2192 3891. 0.2455491
2193 3892. 0.2456641
2194 3893. 0.2457792
2195 3894. 0.2458941
2196 3895. 0.2460091
2197 3896. 0.2461241
2198 3897. 0.2462391
2199 3898. 0.246354
2200 3899. 0.2464689
2201 3900. 0.246584
2202 3901. 0.2467201
2203 3902. 0.2468609
2204 3903. 0.2470024
2205 3904. 0.2471439
2206 3905. 0.2472855
2207 3906. 0.247427
2208 3907. 0.2475686
2209 3908. 0.2477102
2210 3909. 0.2478519
2211 3910. 0.2479936
2212 3911. 0.2481135
2213 3912. 0.2482334
2214 3913. 0.2483533
2215 3914. 0.2484733
2216 3915. 0.2485933
2217 3916. 0.2487132
2218 3917. 0.2488331
2219 3918. 0.248953
2220 3919. 0.249073
2221 3920. 0.249193
2222 3921. 0.2493127
2223 3922. 0.2494293
2224 3923. 0.2495454
2225 3924. 0.2496615
2226 3925. 0.2497777
2227 3926. 0.2498938
2228 3927. 0.2500099
2229 3928. 0.2501261
2230 3929. 0.2502422
2231 3930. 0.2503583
2232 3931. 0.2504959
2233 3932. 0.2506335
2234 3933. 0.2507711
2235 3934. 0.2509086
2236 3935. 0.2510463
2237 3936. 0.2511841
2238 3937. 0.2513217
2239 3938. 0.2514594
2240 3939. 0.2515972
2241 3940. 0.251735
2242 3941. 0.2518507
2243 3942. 0.2519661
2244 3943. 0.2520814
2245 3944. 0.2521967
2246 3945. 0.2523122
2247 3946. 0.2524275
2248 3947. 0.2525429
2249 3948. 0.2526582
2250 3949. 0.2527735
2251 3950. 0.2528889
2252 3951. 0.2530039
2253 3952. 0.2531189
2254 3953. 0.2532339
2255 3954. 0.2533489
2256 3955. 0.2534639
2257 3956. 0.2535789
2258 3957. 0.2536939
2259 3958. 0.2538089
2260 3959. 0.2539239
2261 3960. 0.254039
2262 3961. 0.2541756
2263 3962. 0.2543185
2264 3963. 0.2544624
2265 3964. 0.2546063
2266 3965. 0.2547502
2267 3966. 0.2548942
2268 3967. 0.2550382
2269 3968. 0.2551821
2270 3969. 0.2553261
2271 3970. 0.2554702
2272 3971. 0.2555918
2273 3972. 0.2557135
2274 3973. 0.2558352
2275 3974. 0.2559568
2276 3975. 0.2560785
2277 3976. 0.2562002
2278 3977. 0.2563218
2279 3978. 0.2564435
2280 3979. 0.2565652
2281 3980. 0.2566869
2282 3981. 0.2568083
2283 3982. 0.256922
2284 3983. 0.2570347
2285 3984. 0.2571474
2286 3985. 0.25726
2287 3986. 0.2573727
2288 3987. 0.2574853
2289 3988. 0.2575981
2290 3989. 0.2577107
2291 3990. 0.2578234
2292 3991. 0.2579579
2293 3992. 0.2580925
2294 3993. 0.258227
2295 3994. 0.2583616
2296 3995. 0.2584962
2297 3996. 0.2586309
2298 3997. 0.2587655
2299 3998. 0.2589001
2300 3999. 0.2590348
2301 4000. 0.2591694
2302 4001. 0.2591898
2303 4002. 0.2592168
2304 4003. 0.2592449
2305 4004. 0.259273
2306 4005. 0.2593011
2307 4006. 0.2593292
2308 4007. 0.2593573
2309 4008. 0.2593854
2310 4009. 0.2594135
2311 4010. 0.2594416
2312 4011. 0.2594693
2313 4012. 0.259497
2314 4013. 0.2595249
2315 4014. 0.2595525
2316 4015. 0.2595803
2317 4016. 0.2596079
2318 4017. 0.2596357
2319 4018. 0.2596635
2320 4019. 0.2596912
2321 4020. 0.2597188
2322 4021. 0.2597686
2323 4022. 0.2598175
2324 4023. 0.2598663
2325 4024. 0.2599151
2326 4025. 0.2599638
2327 4026. 0.2600126
2328 4027. 0.2600614
2329 4028. 0.2601102
2330 4029. 0.260159
2331 4030. 0.2602078
2332 4031. 0.2602502
2333 4032. 0.2602925
2334 4033. 0.2603349
2335 4034. 0.2603774
2336 4035. 0.2604197
2337 4036. 0.2604622
2338 4037. 0.2605046
2339 4038. 0.260547
2340 4039. 0.2605894
2341 4040. 0.2606319
2342 4041. 0.260674
2343 4042. 0.2607051
2344 4043. 0.2607343
2345 4044. 0.2607635
2346 4045. 0.2607927
2347 4046. 0.2608219
2348 4047. 0.2608511
2349 4048. 0.2608804
2350 4049. 0.2609094
2351 4050. 0.2609388
2352 4051. 0.2609901
2353 4052. 0.2610414
2354 4053. 0.2610926
2355 4054. 0.261144
2356 4055. 0.2611953
2357 4056. 0.2612467
2358 4057. 0.261298
2359 4058. 0.2613494
2360 4059. 0.2614007
2361 4060. 0.2614521
2362 4061. 0.2614806
2363 4062. 0.2615092
2364 4063. 0.2615377
2365 4064. 0.2615663
2366 4065. 0.2615949
2367 4066. 0.2616234
2368 4067. 0.2616519
2369 4068. 0.2616806
2370 4069. 0.261709
2371 4070. 0.2617376
2372 4071. 0.2617658
2373 4072. 0.2617941
2374 4073. 0.2618223
2375 4074. 0.2618506
2376 4075. 0.2618788
2377 4076. 0.2619071
2378 4077. 0.2619354
2379 4078. 0.2619636
2380 4079. 0.2619919
2381 4080. 0.2620202
2382 4081. 0.2620707
2383 4082. 0.2621319
2384 4083. 0.262195
2385 4084. 0.2622582
2386 4085. 0.2623213
2387 4086. 0.2623845
2388 4087. 0.2624476
2389 4088. 0.2625108
2390 4089. 0.262574
2391 4090. 0.2626372
2392 4091. 0.2626775
2393 4092. 0.262718
2394 4093. 0.2627584
2395 4094. 0.2627987
2396 4095. 0.2628391
2397 4096. 0.2628796
2398 4097. 0.2629199
2399 4098. 0.2629603
2400 4099. 0.2630007
2401 4100. 0.2630411
2402 4101. 0.2630812
2403 4102. 0.2631214
2404 4103. 0.2631617
2405 4104. 0.263202
2406 4105. 0.2632421
2407 4106. 0.2632825
2408 4107. 0.2633228
2409 4108. 0.263363
2410 4109. 0.2634033
2411 4110. 0.2634436
2412 4111. 0.2635062
2413 4112. 0.2635688
2414 4113. 0.2636314
2415 4114. 0.2636941
2416 4115. 0.2637567
2417 4116. 0.2638194
2418 4117. 0.2638821
2419 4118. 0.2639447
2420 4119. 0.2640074
2421 4120. 0.2640701
2422 4121. 0.2641098
2423 4122. 0.2641478
2424 4123. 0.2641854
2425 4124. 0.264223
2426 4125. 0.2642605
2427 4126. 0.2642981
2428 4127. 0.2643357
2429 4128. 0.2643733
2430 4129. 0.2644109
2431 4130. 0.2644485
2432 4131. 0.264486
2433 4132. 0.2645233
2434 4133. 0.2645606
2435 4134. 0.264598
2436 4135. 0.2646353
2437 4136. 0.2646727
2438 4137. 0.26471
2439 4138. 0.2647475
2440 4139. 0.2647849
2441 4140. 0.2648223
2442 4141. 0.2648594
2443 4142. 0.2648968
2444 4143. 0.2649343
2445 4144. 0.2649717
2446 4145. 0.2650092
2447 4146. 0.2650467
2448 4147. 0.2650842
2449 4148. 0.2651216
2450 4149. 0.265159
2451 4150. 0.2651965
2452 4151. 0.2652566
2453 4152. 0.2653165
2454 4153. 0.2653766
2455 4154. 0.2654367
2456 4155. 0.2654967
2457 4156. 0.2655568
2458 4157. 0.2656169
2459 4158. 0.2656769
2460 4159. 0.265737
2461 4160. 0.2657971
2462 4161. 0.2658343
2463 4162. 0.2658697
2464 4163. 0.2659048
2465 4164. 0.2659397
2466 4165. 0.2659749
2467 4166. 0.2660099
2468 4167. 0.266045
2469 4168. 0.26608
2470 4169. 0.266115
2471 4170. 0.2661501
2472 4171. 0.266185
2473 4172. 0.2662197
2474 4173. 0.2662546
2475 4174. 0.2662894
2476 4175. 0.2663242
2477 4176. 0.2663589
2478 4177. 0.2663937
2479 4178. 0.2664286
2480 4179. 0.2664633
2481 4180. 0.2664981
2482 4181. 0.2665556
2483 4182. 0.2666158
2484 4183. 0.2666767
2485 4184. 0.2667376
2486 4185. 0.2667984
2487 4186. 0.2668594
2488 4187. 0.2669202
2489 4188. 0.2669812
2490 4189. 0.2670422
2491 4190. 0.2671031
2492 4191. 0.2671409
2493 4192. 0.2671787
2494 4193. 0.2672166
2495 4194. 0.2672544
2496 4195. 0.2672922
2497 4196. 0.2673301
2498 4197. 0.2673679
2499 4198. 0.2674058
2500 4199. 0.2674437
2501 4200. 0.2674814
2502 4201. 0.2675192
2503 4202. 0.2675524
2504 4203. 0.2675847
2505 4204. 0.2676171
2506 4205. 0.2676495
2507 4206. 0.2676818
2508 4207. 0.2677141
2509 4208. 0.2677464
2510 4209. 0.2677788
2511 4210. 0.2678111
2512 4211. 0.2678432
2513 4212. 0.2678755
2514 4213. 0.2679077
2515 4214. 0.2679398
2516 4215. 0.267972
2517 4216. 0.2680041
2518 4217. 0.2680362
2519 4218. 0.2680684
2520 4219. 0.2681005
2521 4220. 0.2681327
2522 4221. 0.2681876
2523 4222. 0.2682419
2524 4223. 0.2682962
2525 4224. 0.2683502
2526 4225. 0.2684043
2527 4226. 0.2684585
2528 4227. 0.2685125
2529 4228. 0.2685667
2530 4229. 0.2686208
2531 4230. 0.268675
2532 4231. 0.2686957
2533 4232. 0.2687162
2534 4233. 0.2687369
2535 4234. 0.2687576
2536 4235. 0.2687782
2537 4236. 0.2687989
2538 4237. 0.2688195
2539 4238. 0.2688402
2540 4239. 0.2688608
2541 4240. 0.2688814
2542 4241. 0.2689019
2543 4242. 0.2689228
2544 4243. 0.2689438
2545 4244. 0.2689649
2546 4245. 0.2689861
2547 4246. 0.2690071
2548 4247. 0.2690282
2549 4248. 0.2690493
2550 4249. 0.2690703
2551 4250. 0.2690914
2552 4251. 0.2691354
2553 4252. 0.2691794
2554 4253. 0.2692233
2555 4254. 0.2692673
2556 4255. 0.2693113
2557 4256. 0.2693554
2558 4257. 0.2693994
2559 4258. 0.2694434
2560 4259. 0.2694874
2561 4260. 0.2695314
2562 4261. 0.2695521
2563 4262. 0.269576
2564 4263. 0.2696005
2565 4264. 0.2696251
2566 4265. 0.2696497
2567 4266. 0.2696742
2568 4267. 0.2696988
2569 4268. 0.2697234
2570 4269. 0.2697479
2571 4270. 0.2697724
2572 4271. 0.2697969
2573 4272. 0.2698214
2574 4273. 0.2698458
2575 4274. 0.2698701
2576 4275. 0.2698946
2577 4276. 0.2699191
2578 4277. 0.2699435
2579 4278. 0.2699679
2580 4279. 0.2699923
2581 4280. 0.2700167
2582 4281. 0.270041
2583 4282. 0.2700641
2584 4283. 0.2700867
2585 4284. 0.2701094
2586 4285. 0.270132
2587 4286. 0.2701548
2588 4287. 0.2701774
2589 4288. 0.2702
2590 4289. 0.2702227
2591 4290. 0.2702455
2592 4291. 0.270291
2593 4292. 0.2703366
2594 4293. 0.2703821
2595 4294. 0.2704279
2596 4295. 0.2704735
2597 4296. 0.270519
2598 4297. 0.2705646
2599 4298. 0.2706102
2600 4299. 0.2706558
2601 4300. 0.2707014
2602 4301. 0.2707238
2603 4302. 0.2707422
2604 4303. 0.2707596
2605 4304. 0.270777
2606 4305. 0.2707942
2607 4306. 0.2708117
2608 4307. 0.2708291
2609 4308. 0.2708463
2610 4309. 0.2708637
2611 4310. 0.2708811
2612 4311. 0.2708983
2613 4312. 0.2709156
2614 4313. 0.2709327
2615 4314. 0.2709499
2616 4315. 0.2709671
2617 4316. 0.2709844
2618 4317. 0.2710015
2619 4318. 0.2710188
2620 4319. 0.2710358
2621 4320. 0.2710531
2622 4321. 0.2710704
2623 4322. 0.2710938
2624 4323. 0.2711188
2625 4324. 0.2711439
2626 4325. 0.271169
2627 4326. 0.2711941
2628 4327. 0.2712193
2629 4328. 0.2712443
2630 4329. 0.2712695
2631 4330. 0.2712946
2632 4331. 0.2713427
2633 4332. 0.271391
2634 4333. 0.2714392
2635 4334. 0.2714874
2636 4335. 0.2715356
2637 4336. 0.2715839
2638 4337. 0.2716322
2639 4338. 0.2716804
2640 4339. 0.2717287
2641 4340. 0.2717769
2642 4341. 0.2718019
2643 4342. 0.271827
2644 4343. 0.2718518
2645 4344. 0.2718768
2646 4345. 0.2719018
2647 4346. 0.2719269
2648 4347. 0.2719518
2649 4348. 0.2719767
2650 4349. 0.2720017
2651 4350. 0.2720267
2652 4351. 0.2720515
2653 4352. 0.2720763
2654 4353. 0.272101
2655 4354. 0.2721258
2656 4355. 0.2721507
2657 4356. 0.2721755
2658 4357. 0.2722003
2659 4358. 0.2722251
2660 4359. 0.2722498
2661 4360. 0.2722747
2662 4361. 0.2722992
2663 4362. 0.2723184
2664 4363. 0.272336
2665 4364. 0.2723536
2666 4365. 0.2723713
2667 4366. 0.2723889
2668 4367. 0.2724065
2669 4368. 0.2724241
2670 4369. 0.2724417
2671 4370. 0.2724593
2672 4371. 0.2725001
2673 4372. 0.2725409
2674 4373. 0.2725817
2675 4374. 0.2726225
2676 4375. 0.2726632
2677 4376. 0.272704
2678 4377. 0.2727447
2679 4378. 0.2727855
2680 4379. 0.2728262
2681 4380. 0.2728671
2682 4381. 0.2728845
2683 4382. 0.2729008
2684 4383. 0.2729169
2685 4384. 0.2729329
2686 4385. 0.2729489
2687 4386. 0.272965
2688 4387. 0.272981
2689 4388. 0.2729971
2690 4389. 0.2730131
2691 4390. 0.2730291
2692 4391. 0.273045
2693 4392. 0.2730609
2694 4393. 0.2730769
2695 4394. 0.2730928
2696 4395. 0.2731087
2697 4396. 0.2731246
2698 4397. 0.2731405
2699 4398. 0.2731565
2700 4399. 0.2731724
2701 4400. 0.2731883
2702 4401. 0.2732042
2703 4402. 0.2732207
2704 4403. 0.2732374
2705 4404. 0.2732541
2706 4405. 0.2732708
2707 4406. 0.2732875
2708 4407. 0.2733042
2709 4408. 0.2733209
2710 4409. 0.2733375
2711 4410. 0.2733543
2712 4411. 0.2733709
2713 4412. 0.2733877
2714 4413. 0.2734044
2715 4414. 0.2734211
2716 4415. 0.2734378
2717 4416. 0.2734545
2718 4417. 0.2734711
2719 4418. 0.2734878
2720 4419. 0.2735044
2721 4420. 0.2735211
2722 4421. 0.273561
2723 4422. 0.2736004
2724 4423. 0.2736396
2725 4424. 0.2736788
2726 4425. 0.2737181
2727 4426. 0.2737573
2728 4427. 0.2737965
2729 4428. 0.2738357
2730 4429. 0.2738749
2731 4430. 0.2739141
2732 4431. 0.2739403
2733 4432. 0.2739665
2734 4433. 0.2739927
2735 4434. 0.2740189
2736 4435. 0.2740451
2737 4436. 0.2740713
2738 4437. 0.2740976
2739 4438. 0.2741237
2740 4439. 0.2741499
2741 4440. 0.2741761
2742 4441. 0.2742022
2743 4442. 0.2742319
2744 4443. 0.2742629
2745 4444. 0.2742939
2746 4445. 0.2743248
2747 4446. 0.2743557
2748 4447. 0.2743867
2749 4448. 0.2744177
2750 4449. 0.2744486
2751 4450. 0.2744796
2752 4451. 0.2745105
2753 4452. 0.2745414
2754 4453. 0.2745724
2755 4454. 0.2746033
2756 4455. 0.2746342
2757 4456. 0.2746652
2758 4457. 0.2746961
2759 4458. 0.274727
2760 4459. 0.2747579
2761 4460. 0.2747888
2762 4461. 0.2748431
2763 4462. 0.2749009
2764 4463. 0.2749598
2765 4464. 0.2750187
2766 4465. 0.2750776
2767 4466. 0.2751366
2768 4467. 0.2751955
2769 4468. 0.2752545
2770 4469. 0.2753134
2771 4470. 0.2753724
2772 4471. 0.2754079
2773 4472. 0.2754433
2774 4473. 0.2754788
2775 4474. 0.2755143
2776 4475. 0.2755498
2777 4476. 0.2755854
2778 4477. 0.2756208
2779 4478. 0.2756563
2780 4479. 0.2756918
2781 4480. 0.2757273
2782 4481. 0.275763
2783 4482. 0.2757968
2784 4483. 0.2758301
2785 4484. 0.2758633
2786 4485. 0.2758965
2787 4486. 0.2759297
2788 4487. 0.275963
2789 4488. 0.2759963
2790 4489. 0.2760295
2791 4490. 0.2760628
2792 4491. 0.2760959
2793 4492. 0.2761292
2794 4493. 0.2761624
2795 4494. 0.2761956
2796 4495. 0.2762288
2797 4496. 0.276262
2798 4497. 0.2762952
2799 4498. 0.2763284
2800 4499. 0.2763616
2801 4500. 0.2763948
2802 4501. 0.2764109
2803 4502. 0.2764241
2804 4503. 0.2764361
2805 4504. 0.2764482
2806 4505. 0.2764603
2807 4506. 0.2764724
2808 4507. 0.2764845
2809 4508. 0.2764966
2810 4509. 0.2765087
2811 4510. 0.2765208
2812 4511. 0.2765563
2813 4512. 0.2765918
2814 4513. 0.2766274
2815 4514. 0.2766629
2816 4515. 0.2766984
2817 4516. 0.2767341
2818 4517. 0.2767695
2819 4518. 0.276805
2820 4519. 0.2768406
2821 4520. 0.2768762
2822 4521. 0.276888
2823 4522. 0.2768984
2824 4523. 0.2769082
2825 4524. 0.2769181
2826 4525. 0.2769279
2827 4526. 0.2769377
2828 4527. 0.2769475
2829 4528. 0.2769573
2830 4529. 0.2769671
2831 4530. 0.2769769
2832 4531. 0.2769867
2833 4532. 0.2769966
2834 4533. 0.2770064
2835 4534. 0.2770162
2836 4535. 0.2770261
2837 4536. 0.2770358
2838 4537. 0.2770456
2839 4538. 0.2770554
2840 4539. 0.2770652
2841 4540. 0.2770751
2842 4541. 0.2770849
2843 4542. 0.2770981
2844 4543. 0.2771125
2845 4544. 0.2771269
2846 4545. 0.2771414
2847 4546. 0.2771558
2848 4547. 0.2771702
2849 4548. 0.2771846
2850 4549. 0.277199
2851 4550. 0.2772135
2852 4551. 0.2772279
2853 4552. 0.2772422
2854 4553. 0.2772567
2855 4554. 0.277271
2856 4555. 0.2772854
2857 4556. 0.2772998
2858 4557. 0.2773142
2859 4558. 0.2773286
2860 4559. 0.2773429
2861 4560. 0.2773572
2862 4561. 0.2773953
2863 4562. 0.2774332
2864 4563. 0.2774711
2865 4564. 0.277509
2866 4565. 0.2775469
2867 4566. 0.2775849
2868 4567. 0.2776229
2869 4568. 0.2776608
2870 4569. 0.2776987
2871 4570. 0.2777367
2872 4571. 0.2777509
2873 4572. 0.2777651
2874 4573. 0.2777794
2875 4574. 0.2777936
2876 4575. 0.2778078
2877 4576. 0.277822
2878 4577. 0.2778362
2879 4578. 0.2778504
2880 4579. 0.2778646
2881 4580. 0.2778789
2882 4581. 0.2778931
2883 4582. 0.2779031
2884 4583. 0.2779112
2885 4584. 0.2779194
2886 4585. 0.2779276
2887 4586. 0.2779358
2888 4587. 0.2779439
2889 4588. 0.2779522
2890 4589. 0.2779603
2891 4590. 0.2779685
2892 4591. 0.2779768
2893 4592. 0.2779849
2894 4593. 0.2779931
2895 4594. 0.2780014
2896 4595. 0.2780096
2897 4596. 0.2780178
2898 4597. 0.278026
2899 4598. 0.2780343
2900 4599. 0.2780425
2901 4600. 0.2780508
2902 4601. 0.2780589
2903 4602. 0.2780689
2904 4603. 0.2780796
2905 4604. 0.2780903
2906 4605. 0.278101
2907 4606. 0.2781117
2908 4607. 0.2781223
2909 4608. 0.2781331
2910 4609. 0.2781436
2911 4610. 0.2781544
2912 4611. 0.2781888
2913 4612. 0.2782231
2914 4613. 0.2782574
2915 4614. 0.2782918
2916 4615. 0.2783261
2917 4616. 0.2783605
2918 4617. 0.2783947
2919 4618. 0.2784291
2920 4619. 0.2784633
2921 4620. 0.2784978
2922 4621. 0.2785082
2923 4622. 0.2785172
2924 4623. 0.2785255
2925 4624. 0.2785338
2926 4625. 0.278542
2927 4626. 0.2785503
2928 4627. 0.2785585
2929 4628. 0.2785667
2930 4629. 0.2785749
2931 4630. 0.2785832
2932 4631. 0.2785853
2933 4632. 0.2785875
2934 4633. 0.2785895
2935 4634. 0.2785916
2936 4635. 0.2785937
2937 4636. 0.2785956
2938 4637. 0.2785979
2939 4638. 0.2785999
2940 4639. 0.278602
2941 4640. 0.2786041
2942 4641. 0.2786062
2943 4642. 0.2786072
2944 4643. 0.2786078
2945 4644. 0.2786086
2946 4645. 0.2786091
2947 4646. 0.2786098
2948 4647. 0.2786104
2949 4648. 0.278611
2950 4649. 0.2786116
2951 4650. 0.2786123
2952 4651. 0.278613
2953 4652. 0.2786136
2954 4653. 0.2786143
2955 4654. 0.278615
2956 4655. 0.2786156
2957 4656. 0.2786163
2958 4657. 0.278617
2959 4658. 0.2786177
2960 4659. 0.2786182
2961 4660. 0.278619
2962 4661. 0.2786197
2963 4662. 0.278622
2964 4663. 0.2786251
2965 4664. 0.2786281
2966 4665. 0.2786312
2967 4666. 0.2786343
2968 4667. 0.2786373
2969 4668. 0.2786404
2970 4669. 0.2786434
2971 4670. 0.2786466
2972 4671. 0.2786732
2973 4672. 0.2786999
2974 4673. 0.2787267
2975 4674. 0.2787534
2976 4675. 0.2787801
2977 4676. 0.2788069
2978 4677. 0.2788336
2979 4678. 0.2788603
2980 4679. 0.278887
2981 4680. 0.2789137
2982 4681. 0.2789167
2983 4682. 0.2789207
2984 4683. 0.278925
2985 4684. 0.2789294
2986 4685. 0.2789337
2987 4686. 0.278938
2988 4687. 0.2789423
2989 4688. 0.2789467
2990 4689. 0.2789511
2991 4690. 0.2789554
2992 4691. 0.2789597
2993 4692. 0.278964
2994 4693. 0.2789682
2995 4694. 0.2789725
2996 4695. 0.2789767
2997 4696. 0.278981
2998 4697. 0.2789852
2999 4698. 0.2789895
3000 4699. 0.2789937
3001 4700. 0.278998
3002 4701. 0.2790022
3003 4702. 0.2790085
3004 4703. 0.2790158
3005 4704. 0.2790233
3006 4705. 0.2790306
3007 4706. 0.279038
3008 4707. 0.2790452
3009 4708. 0.2790526
3010 4709. 0.2790599
3011 4710. 0.2790673
3012 4711. 0.2790746
3013 4712. 0.2790819
3014 4713. 0.2790894
3015 4714. 0.2790967
3016 4715. 0.2791041
3017 4716. 0.2791114
3018 4717. 0.2791187
3019 4718. 0.279126
3020 4719. 0.2791333
3021 4720. 0.2791407
3022 4721. 0.2791481
3023 4722. 0.2791565
3024 4723. 0.2791651
3025 4724. 0.2791741
3026 4725. 0.2791829
3027 4726. 0.2791917
3028 4727. 0.2792005
3029 4728. 0.2792092
3030 4729. 0.279218
3031 4730. 0.2792268
3032 4731. 0.2792356
3033 4732. 0.2792444
3034 4733. 0.2792531
3035 4734. 0.2792619
3036 4735. 0.2792707
3037 4736. 0.2792795
3038 4737. 0.2792883
3039 4738. 0.2792971
3040 4739. 0.2793058
3041 4740. 0.2793146
3042 4741. 0.2793472
3043 4742. 0.2793778
3044 4743. 0.2794076
3045 4744. 0.2794373
3046 4745. 0.279467
3047 4746. 0.2794967
3048 4747. 0.2795264
3049 4748. 0.2795561
3050 4749. 0.2795858
3051 4750. 0.2796155
3052 4751. 0.2796214
3053 4752. 0.2796274
3054 4753. 0.2796333
3055 4754. 0.2796392
3056 4755. 0.2796451
3057 4756. 0.279651
3058 4757. 0.2796569
3059 4758. 0.2796628
3060 4759. 0.2796687
3061 4760. 0.2796746
3062 4761. 0.2796805
3063 4762. 0.2796885
3064 4763. 0.2796974
3065 4764. 0.2797063
3066 4765. 0.2797153
3067 4766. 0.2797243
3068 4767. 0.2797331
3069 4768. 0.2797421
3070 4769. 0.2797509
3071 4770. 0.2797599
3072 4771. 0.2797688
3073 4772. 0.2797778
3074 4773. 0.2797867
3075 4774. 0.2797956
3076 4775. 0.2798045
3077 4776. 0.2798134
3078 4777. 0.2798223
3079 4778. 0.2798313
3080 4779. 0.2798402
3081 4780. 0.2798491
3082 4781. 0.2798581
3083 4782. 0.279866
3084 4783. 0.2798735
3085 4784. 0.2798811
3086 4785. 0.2798886
3087 4786. 0.2798962
3088 4787. 0.2799037
3089 4788. 0.2799113
3090 4789. 0.2799188
3091 4790. 0.2799264
3092 4791. 0.279934
3093 4792. 0.2799414
3094 4793. 0.2799489
3095 4794. 0.2799564
3096 4795. 0.2799639
3097 4796. 0.2799714
3098 4797. 0.2799789
3099 4798. 0.2799864
3100 4799. 0.279994
3101 4800. 0.2800015
3102 4801. 0.2800089
3103 4802. 0.2800154
3104 4803. 0.2800213
3105 4804. 0.2800271
3106 4805. 0.280033
3107 4806. 0.2800389
3108 4807. 0.2800447
3109 4808. 0.2800506
3110 4809. 0.2800564
3111 4810. 0.2800623
3112 4811. 0.280092
3113 4812. 0.2801217
3114 4813. 0.2801515
3115 4814. 0.2801812
3116 4815. 0.2802108
3117 4816. 0.2802405
3118 4817. 0.2802702
3119 4818. 0.2803
3120 4819. 0.2803296
3121 4820. 0.2803593
3122 4821. 0.2803653
3123 4822. 0.2803704
3124 4823. 0.280375
3125 4824. 0.2803798
3126 4825. 0.2803843
3127 4826. 0.2803889
3128 4827. 0.2803935
3129 4828. 0.2803981
3130 4829. 0.2804027
3131 4830. 0.2804074
3132 4831. 0.2804089
3133 4832. 0.2804104
3134 4833. 0.280412
3135 4834. 0.2804134
3136 4835. 0.2804151
3137 4836. 0.2804166
3138 4837. 0.2804181
3139 4838. 0.2804196
3140 4839. 0.2804211
3141 4840. 0.2804227
3142 4841. 0.2804242
3143 4842. 0.2804252
3144 4843. 0.2804256
3145 4844. 0.2804261
3146 4845. 0.2804266
3147 4846. 0.2804271
3148 4847. 0.2804275
3149 4848. 0.2804281
3150 4849. 0.2804286
3151 4850. 0.280429
3152 4851. 0.2804295
3153 4852. 0.2804298
3154 4853. 0.2804303
3155 4854. 0.2804307
3156 4855. 0.2804311
3157 4856. 0.2804315
3158 4857. 0.2804319
3159 4858. 0.2804323
3160 4859. 0.2804327
3161 4860. 0.2804331
3162 4861. 0.2804334
3163 4862. 0.2804326
3164 4863. 0.2804312
3165 4864. 0.2804296
3166 4865. 0.2804282
3167 4866. 0.2804267
3168 4867. 0.2804252
3169 4868. 0.2804238
3170 4869. 0.2804223
3171 4870. 0.2804208
3172 4871. 0.2804193
3173 4872. 0.2804178
3174 4873. 0.2804164
3175 4874. 0.280415
3176 4875. 0.2804135
3177 4876. 0.2804121
3178 4877. 0.2804106
3179 4878. 0.2804092
3180 4879. 0.2804078
3181 4880. 0.2804063
3182 4881. 0.280405
3183 4882. 0.2804036
3184 4883. 0.2804022
3185 4884. 0.2804007
3186 4885. 0.2803993
3187 4886. 0.2803979
3188 4887. 0.2803964
3189 4888. 0.2803951
3190 4889. 0.2803936
3191 4890. 0.2803922
3192 4891. 0.2804145
3193 4892. 0.2804369
3194 4893. 0.2804593
3195 4894. 0.2804818
3196 4895. 0.2805041
3197 4896. 0.2805265
3198 4897. 0.2805488
3199 4898. 0.2805713
3200 4899. 0.2805936
3201 4900. 0.280616
3202 4901. 0.2806147
3203 4902. 0.2806146
3204 4903. 0.2806152
3205 4904. 0.2806159
3206 4905. 0.2806166
3207 4906. 0.2806173
3208 4907. 0.2806179
3209 4908. 0.2806185
3210 4909. 0.2806192
3211 4910. 0.2806199
3212 4911. 0.2806204
3213 4912. 0.280621
3214 4913. 0.2806215
3215 4914. 0.2806221
3216 4915. 0.2806227
3217 4916. 0.2806232
3218 4917. 0.2806238
3219 4918. 0.2806244
3220 4919. 0.2806249
3221 4920. 0.2806255
3222 4921. 0.2806261
3223 4922. 0.2806268
3224 4923. 0.2806274
3225 4924. 0.2806281
3226 4925. 0.2806287
3227 4926. 0.2806293
3228 4927. 0.2806299
3229 4928. 0.2806306
3230 4929. 0.2806313
3231 4930. 0.280632
3232 4931. 0.2806328
3233 4932. 0.2806334
3234 4933. 0.2806342
3235 4934. 0.2806349
3236 4935. 0.2806357
3237 4936. 0.2806365
3238 4937. 0.2806373
3239 4938. 0.2806381
3240 4939. 0.2806388
3241 4940. 0.2806396
3242 4941. 0.2806405
3243 4942. 0.2806425
3244 4943. 0.2806452
3245 4944. 0.2806479
3246 4945. 0.2806507
3247 4946. 0.2806535
3248 4947. 0.2806563
3249 4948. 0.280659
3250 4949. 0.2806618
3251 4950. 0.2806645
3252 4951. 0.2806673
3253 4952. 0.28067
3254 4953. 0.2806728
3255 4954. 0.2806755
3256 4955. 0.2806782
3257 4956. 0.280681
3258 4957. 0.2806838
3259 4958. 0.2806866
3260 4959. 0.2806892
3261 4960. 0.2806919
3262 4961. 0.2806946
3263 4962. 0.2806961
3264 4963. 0.2806966
3265 4964. 0.2806973
3266 4965. 0.280698
3267 4966. 0.2806986
3268 4967. 0.2806993
3269 4968. 0.2807
3270 4969. 0.2807007
3271 4970. 0.2807012
3272 4971. 0.2807019
3273 4972. 0.2807026
3274 4973. 0.2807032
3275 4974. 0.2807039
3276 4975. 0.2807045
3277 4976. 0.2807052
3278 4977. 0.2807058
3279 4978. 0.2807064
3280 4979. 0.280707
3281 4980. 0.2807077
3282 4981. 0.2807084
3283 4982. 0.2807075
3284 4983. 0.2807057
3285 4984. 0.2807039
3286 4985. 0.280702
3287 4986. 0.2807002
3288 4987. 0.2806983
3289 4988. 0.2806966
3290 4989. 0.2806948
3291 4990. 0.280693
3292 4991. 0.2807149
3293 4992. 0.280737
3294 4993. 0.280759
3295 4994. 0.280781
3296 4995. 0.280803
3297 4996. 0.280825
3298 4997. 0.280847
3299 4998. 0.2808692
3300 4999. 0.2808912
3301 5000. 0.2809133
3302 5001. 0.2809018
3303 5002. 0.2808935
3304 5003. 0.280887
3305 5004. 0.2808805
3306 5005. 0.280874
3307 5006. 0.2808676
3308 5007. 0.280861
3309 5008. 0.2808546
3310 5009. 0.280848
3311 5010. 0.2808416
3312 5011. 0.2808352
3313 5012. 0.2808288
3314 5013. 0.2808224
3315 5014. 0.280816
3316 5015. 0.2808097
3317 5016. 0.2808033
3318 5017. 0.2807968
3319 5018. 0.2807904
3320 5019. 0.280784
3321 5020. 0.2807776
3322 5021. 0.2807712
3323 5022. 0.2807646
3324 5023. 0.2807577
3325 5024. 0.2807511
3326 5025. 0.2807442
3327 5026. 0.2807374
3328 5027. 0.2807306
3329 5028. 0.2807238
3330 5029. 0.280717
3331 5030. 0.2807102
3332 5031. 0.2806969
3333 5032. 0.2806837
3334 5033. 0.2806706
3335 5034. 0.2806575
3336 5035. 0.2806442
3337 5036. 0.2806311
3338 5037. 0.2806179
3339 5038. 0.2806047
3340 5039. 0.2805915
3341 5040. 0.2805783
3342 5041. 0.2805652
3343 5042. 0.2805499
3344 5043. 0.2805332
3345 5044. 0.2805165
3346 5045. 0.2804998
3347 5046. 0.2804831
3348 5047. 0.2804664
3349 5048. 0.2804496
3350 5049. 0.2804329
3351 5050. 0.2804162
3352 5051. 0.2803994
3353 5052. 0.2803827
3354 5053. 0.280366
3355 5054. 0.2803493
3356 5055. 0.2803325
3357 5056. 0.2803157
3358 5057. 0.2802989
3359 5058. 0.2802821
3360 5059. 0.2802654
3361 5060. 0.2802486
3362 5061. 0.280232
3363 5062. 0.2802158
3364 5063. 0.2802
3365 5064. 0.2801842
3366 5065. 0.2801684
3367 5066. 0.2801526
3368 5067. 0.2801368
3369 5068. 0.280121
3370 5069. 0.2801052
3371 5070. 0.2800894
3372 5071. 0.2800737
3373 5072. 0.2800579
3374 5073. 0.2800422
3375 5074. 0.2800264
3376 5075. 0.2800107
3377 5076. 0.279995
3378 5077. 0.2799791
3379 5078. 0.2799633
3380 5079. 0.2799475
3381 5080. 0.2799319
3382 5081. 0.2799162
3383 5082. 0.2799002
3384 5083. 0.2798841
3385 5084. 0.279868
3386 5085. 0.2798518
3387 5086. 0.2798359
3388 5087. 0.2798196
3389 5088. 0.2798035
3390 5089. 0.2797873
3391 5090. 0.2797713
3392 5091. 0.2797552
3393 5092. 0.2797392
3394 5093. 0.2797231
3395 5094. 0.279707
3396 5095. 0.2796909
3397 5096. 0.2796749
3398 5097. 0.2796588
3399 5098. 0.2796428
3400 5099. 0.2796266
3401 5100. 0.2796106
3402 5101. 0.2795946
3403 5102. 0.279579
3404 5103. 0.2795637
3405 5104. 0.2795484
3406 5105. 0.2795331
3407 5106. 0.2795178
3408 5107. 0.2795026
3409 5108. 0.2794873
3410 5109. 0.279472
3411 5110. 0.2794567
3412 5111. 0.2794413
3413 5112. 0.2794261
3414 5113. 0.2794107
3415 5114. 0.2793953
3416 5115. 0.2793799
3417 5116. 0.2793646
3418 5117. 0.2793492
3419 5118. 0.2793339
3420 5119. 0.2793184
3421 5120. 0.2793031
3422 5121. 0.2792876
3423 5122. 0.2792726
3424 5123. 0.279258
3425 5124. 0.2792432
3426 5125. 0.2792286
3427 5126. 0.2792139
3428 5127. 0.2791992
3429 5128. 0.2791845
3430 5129. 0.2791699
3431 5130. 0.2791551
3432 5131. 0.2791641
3433 5132. 0.2791731
3434 5133. 0.279182
3435 5134. 0.279191
3436 5135. 0.2791999
3437 5136. 0.2792088
3438 5137. 0.2792177
3439 5138. 0.2792267
3440 5139. 0.2792356
3441 5140. 0.2792447
3442 5141. 0.2792301
3443 5142. 0.2792179
3444 5143. 0.2792073
3445 5144. 0.2791967
3446 5145. 0.2791861
3447 5146. 0.2791757
3448 5147. 0.2791651
3449 5148. 0.2791546
3450 5149. 0.279144
3451 5150. 0.2791336
3452 5151. 0.279123
3453 5152. 0.2791126
3454 5153. 0.279102
3455 5154. 0.2790916
3456 5155. 0.2790811
3457 5156. 0.2790707
3458 5157. 0.2790601
3459 5158. 0.2790497
3460 5159. 0.279039
3461 5160. 0.2790287
3462 5161. 0.2790181
3463 5162. 0.2790085
3464 5163. 0.2789996
3465 5164. 0.2789906
3466 5165. 0.2789817
3467 5166. 0.2789728
3468 5167. 0.2789638
3469 5168. 0.2789549
3470 5169. 0.2789459
3471 5170. 0.278937
3472 5171. 0.2789279
3473 5172. 0.2789188
3474 5173. 0.2789097
3475 5174. 0.2789007
3476 5175. 0.2788916
3477 5176. 0.2788825
3478 5177. 0.2788734
3479 5178. 0.2788644
3480 5179. 0.2788552
3481 5180. 0.2788462
3482 5181. 0.278837
3483 5182. 0.2788261
3484 5183. 0.2788137
3485 5184. 0.2788012
3486 5185. 0.2787887
3487 5186. 0.2787763
3488 5187. 0.2787639
3489 5188. 0.2787516
3490 5189. 0.2787392
3491 5190. 0.2787268
3492 5191. 0.2787144
3493 5192. 0.278702
3494 5193. 0.2786896
3495 5194. 0.2786773
3496 5195. 0.2786649
3497 5196. 0.2786525
3498 5197. 0.2786401
3499 5198. 0.2786278
3500 5199. 0.2786154
3501 5200. 0.2786031
3502 5201. 0.2785907
3503 5202. 0.2785783
3504 5203. 0.2785658
3505 5204. 0.2785534
3506 5205. 0.2785408
3507 5206. 0.2785284
3508 5207. 0.2785159
3509 5208. 0.2785034
3510 5209. 0.2784909
3511 5210. 0.2784786
3512 5211. 0.278466
3513 5212. 0.2784534
3514 5213. 0.2784409
3515 5214. 0.2784283
3516 5215. 0.2784158
3517 5216. 0.2784033
3518 5217. 0.2783908
3519 5218. 0.2783782
3520 5219. 0.2783656
3521 5220. 0.2783531
3522 5221. 0.2783405
3523 5222. 0.2783256
3524 5223. 0.278309
3525 5224. 0.2782924
3526 5225. 0.2782757
3527 5226. 0.2782591
3528 5227. 0.2782425
3529 5228. 0.2782257
3530 5229. 0.2782091
3531 5230. 0.2781925
3532 5231. 0.2781774
3533 5232. 0.2781623
3534 5233. 0.2781472
3535 5234. 0.2781321
3536 5235. 0.278117
3537 5236. 0.278102
3538 5237. 0.2780869
3539 5238. 0.2780718
3540 5239. 0.2780567
3541 5240. 0.2780417
3542 5241. 0.2780266
3543 5242. 0.2780111
3544 5243. 0.2779953
3545 5244. 0.2779796
3546 5245. 0.2779638
3547 5246. 0.277948
3548 5247. 0.2779323
3549 5248. 0.2779165
3550 5249. 0.2779006
3551 5250. 0.2778849
3552 5251. 0.2778692
3553 5252. 0.2778534
3554 5253. 0.2778376
3555 5254. 0.2778218
3556 5255. 0.277806
3557 5256. 0.2777903
3558 5257. 0.2777745
3559 5258. 0.2777587
3560 5259. 0.2777429
3561 5260. 0.2777272
3562 5261. 0.2777114
3563 5262. 0.2776965
3564 5263. 0.2776824
3565 5264. 0.2776684
3566 5265. 0.2776542
3567 5266. 0.27764
3568 5267. 0.2776259
3569 5268. 0.2776118
3570 5269. 0.2775975
3571 5270. 0.2775834
3572 5271. 0.2775693
3573 5272. 0.2775551
3574 5273. 0.2775409
3575 5274. 0.2775267
3576 5275. 0.2775126
3577 5276. 0.2774984
3578 5277. 0.2774842
3579 5278. 0.27747
3580 5279. 0.2774557
3581 5280. 0.2774416
3582 5281. 0.2774274
3583 5282. 0.2774139
3584 5283. 0.2774012
3585 5284. 0.2773886
3586 5285. 0.2773758
3587 5286. 0.2773632
3588 5287. 0.2773505
3589 5288. 0.2773378
3590 5289. 0.2773251
3591 5290. 0.2773124
3592 5291. 0.2772997
3593 5292. 0.277287
3594 5293. 0.2772741
3595 5294. 0.2772614
3596 5295. 0.2772487
3597 5296. 0.277236
3598 5297. 0.2772232
3599 5298. 0.2772105
3600 5299. 0.2771977
3601 5300. 0.2771851
3602 5301. 0.2771722
3603 5302. 0.2771591
3604 5303. 0.2771458
3605 5304. 0.2771324
3606 5305. 0.277119
3607 5306. 0.2771056
3608 5307. 0.2770922
3609 5308. 0.2770788
3610 5309. 0.2770654
3611 5310. 0.2770521
3612 5311. 0.2770386
3613 5312. 0.2770252
3614 5313. 0.2770116
3615 5314. 0.2769983
3616 5315. 0.2769847
3617 5316. 0.2769713
3618 5317. 0.2769579
3619 5318. 0.2769445
3620 5319. 0.2769309
3621 5320. 0.2769175
3622 5321. 0.276904
3623 5322. 0.2768905
3624 5323. 0.276877
3625 5324. 0.2768634
3626 5325. 0.2768498
3627 5326. 0.2768362
3628 5327. 0.2768227
3629 5328. 0.2768091
3630 5329. 0.2767955
3631 5330. 0.2767819
3632 5331. 0.2767683
3633 5332. 0.2767547
3634 5333. 0.276741
3635 5334. 0.2767273
3636 5335. 0.2767137
3637 5336. 0.2767
3638 5337. 0.2766863
3639 5338. 0.2766727
3640 5339. 0.276659
3641 5340. 0.2766455
3642 5341. 0.2766318
3643 5342. 0.2766156
3644 5343. 0.2765973
3645 5344. 0.2765788
3646 5345. 0.2765603
3647 5346. 0.276542
3648 5347. 0.2765235
3649 5348. 0.2765051
3650 5349. 0.2764866
3651 5350. 0.2764682
3652 5351. 0.2764496
3653 5352. 0.2764309
3654 5353. 0.2764122
3655 5354. 0.2763937
3656 5355. 0.2763749
3657 5356. 0.2763564
3658 5357. 0.2763376
3659 5358. 0.276319
3660 5359. 0.2763003
3661 5360. 0.2762817
3662 5361. 0.2762629
3663 5362. 0.2762489
3664 5363. 0.2762398
3665 5364. 0.2762307
3666 5365. 0.2762216
3667 5366. 0.2762124
3668 5367. 0.2762032
3669 5368. 0.2761941
3670 5369. 0.2761849
3671 5370. 0.2761758
3672 5371. 0.2761666
3673 5372. 0.2761573
3674 5373. 0.2761481
3675 5374. 0.2761389
3676 5375. 0.2761295
3677 5376. 0.2761204
3678 5377. 0.2761111
3679 5378. 0.2761019
3680 5379. 0.2760926
3681 5380. 0.2760834
3682 5381. 0.2760741
3683 5382. 0.276067
3684 5383. 0.2760618
3685 5384. 0.2760566
3686 5385. 0.2760514
3687 5386. 0.2760462
3688 5387. 0.276041
3689 5388. 0.276036
3690 5389. 0.2760307
3691 5390. 0.2760256
3692 5391. 0.2760204
3693 5392. 0.2760153
3694 5393. 0.2760101
3695 5394. 0.2760049
3696 5395. 0.2759997
3697 5396. 0.2759945
3698 5397. 0.2759893
3699 5398. 0.2759842
3700 5399. 0.275979
3701 5400. 0.2759739
3702 5401. 0.2759685
3703 5402. 0.2759582
3704 5403. 0.275943
3705 5404. 0.2759277
3706 5405. 0.2759124
3707 5406. 0.2758971
3708 5407. 0.2758818
3709 5408. 0.2758665
3710 5409. 0.2758512
3711 5410. 0.275836
3712 5411. 0.2758205
3713 5412. 0.2758052
3714 5413. 0.2757898
3715 5414. 0.2757744
3716 5415. 0.275759
3717 5416. 0.2757436
3718 5417. 0.2757282
3719 5418. 0.2757128
3720 5419. 0.2756973
3721 5420. 0.275682
3722 5421. 0.2756664
3723 5422. 0.2756481
3724 5423. 0.2756268
3725 5424. 0.2756056
3726 5425. 0.2755843
3727 5426. 0.2755631
3728 5427. 0.2755418
3729 5428. 0.2755206
3730 5429. 0.2754992
3731 5430. 0.2754779
3732 5431. 0.2754565
3733 5432. 0.2754348
3734 5433. 0.2754132
3735 5434. 0.2753916
3736 5435. 0.2753701
3737 5436. 0.2753485
3738 5437. 0.2753269
3739 5438. 0.2753052
3740 5439. 0.2752837
3741 5440. 0.2752621
3742 5441. 0.2752404
3743 5442. 0.2752235
3744 5443. 0.2752114
3745 5444. 0.2751994
3746 5445. 0.2751873
3747 5446. 0.2751752
3748 5447. 0.2751632
3749 5448. 0.2751512
3750 5449. 0.275139
3751 5450. 0.275127
3752 5451. 0.2751148
3753 5452. 0.2751026
3754 5453. 0.2750904
3755 5454. 0.2750781
3756 5455. 0.2750659
3757 5456. 0.2750537
3758 5457. 0.2750415
3759 5458. 0.2750293
3760 5459. 0.275017
3761 5460. 0.2750048
3762 5461. 0.2749924
3763 5462. 0.2749823
3764 5463. 0.2749745
3765 5464. 0.2749666
3766 5465. 0.2749588
3767 5466. 0.274951
3768 5467. 0.2749432
3769 5468. 0.2749353
3770 5469. 0.2749275
3771 5470. 0.2749197
3772 5471. 0.2749117
3773 5472. 0.2749037
3774 5473. 0.2748958
3775 5474. 0.2748877
3776 5475. 0.2748797
3777 5476. 0.2748718
3778 5477. 0.2748638
3779 5478. 0.2748558
3780 5479. 0.2748478
3781 5480. 0.2748397
3782 5481. 0.2748317
3783 5482. 0.2748204
3784 5483. 0.2748053
3785 5484. 0.2747903
3786 5485. 0.2747753
3787 5486. 0.2747603
3788 5487. 0.2747453
3789 5488. 0.2747304
3790 5489. 0.2747152
3791 5490. 0.2747003
3792 5491. 0.2746852
3793 5492. 0.27467
3794 5493. 0.2746549
3795 5494. 0.2746398
3796 5495. 0.2746246
3797 5496. 0.2746095
3798 5497. 0.2745944
3799 5498. 0.2745793
3800 5499. 0.2745641
3801 5500. 0.274549
3802 5501. 0.274533
3803 5502. 0.2745166
3804 5503. 0.2744991
3805 5504. 0.2744817
3806 5505. 0.2744643
3807 5506. 0.2744469
3808 5507. 0.2744296
3809 5508. 0.2744122
3810 5509. 0.2743948
3811 5510. 0.2743775
3812 5511. 0.27436
3813 5512. 0.2743425
3814 5513. 0.274325
3815 5514. 0.2743075
3816 5515. 0.27429
3817 5516. 0.2742725
3818 5517. 0.274255
3819 5518. 0.2742375
3820 5519. 0.27422
3821 5520. 0.2742024
3822 5521. 0.2741849
3823 5522. 0.2741657
3824 5523. 0.2741449
3825 5524. 0.2741239
3826 5525. 0.274103
3827 5526. 0.2740821
3828 5527. 0.2740613
3829 5528. 0.2740403
3830 5529. 0.2740193
3831 5530. 0.2739985
3832 5531. 0.2739774
3833 5532. 0.2739562
3834 5533. 0.2739352
3835 5534. 0.2739141
3836 5535. 0.273893
3837 5536. 0.273872
3838 5537. 0.2738508
3839 5538. 0.2738298
3840 5539. 0.2738088
3841 5540. 0.2737876
3842 5541. 0.2737663
3843 5542. 0.2737465
3844 5543. 0.2737284
3845 5544. 0.2737102
3846 5545. 0.273692
3847 5546. 0.2736739
3848 5547. 0.2736558
3849 5548. 0.2736375
3850 5549. 0.2736193
3851 5550. 0.2736012
3852 5551. 0.2735829
3853 5552. 0.2735647
3854 5553. 0.2735463
3855 5554. 0.273528
3856 5555. 0.2735097
3857 5556. 0.2734915
3858 5557. 0.2734732
3859 5558. 0.2734549
3860 5559. 0.2734367
3861 5560. 0.2734183
3862 5561. 0.2733999
3863 5562. 0.2733831
3864 5563. 0.2733684
3865 5564. 0.2733538
3866 5565. 0.2733392
3867 5566. 0.2733245
3868 5567. 0.2733097
3869 5568. 0.273295
3870 5569. 0.2732803
3871 5570. 0.2732657
3872 5571. 0.2732278
3873 5572. 0.2731899
3874 5573. 0.2731521
3875 5574. 0.2731141
3876 5575. 0.2730762
3877 5576. 0.2730384
3878 5577. 0.2730005
3879 5578. 0.2729626
3880 5579. 0.2729247
3881 5580. 0.2728869
3882 5581. 0.2728721
3883 5582. 0.272858
3884 5583. 0.2728451
3885 5584. 0.2728322
3886 5585. 0.2728193
3887 5586. 0.2728064
3888 5587. 0.2727934
3889 5588. 0.2727806
3890 5589. 0.2727677
3891 5590. 0.2727548
3892 5591. 0.2727419
3893 5592. 0.272729
3894 5593. 0.2727161
3895 5594. 0.2727031
3896 5595. 0.2726902
3897 5596. 0.2726774
3898 5597. 0.2726644
3899 5598. 0.2726516
3900 5599. 0.2726387
3901 5600. 0.2726258
3902 5601. 0.2726127
3903 5602. 0.2725964
3904 5603. 0.2725761
3905 5604. 0.2725557
3906 5605. 0.2725354
3907 5606. 0.2725151
3908 5607. 0.2724947
3909 5608. 0.2724744
3910 5609. 0.2724541
3911 5610. 0.2724338
3912 5611. 0.2724133
3913 5612. 0.272393
3914 5613. 0.2723725
3915 5614. 0.2723521
3916 5615. 0.2723317
3917 5616. 0.2723114
3918 5617. 0.2722909
3919 5618. 0.2722705
3920 5619. 0.2722501
3921 5620. 0.2722297
3922 5621. 0.272209
3923 5622. 0.2721897
3924 5623. 0.2721716
3925 5624. 0.2721537
3926 5625. 0.2721357
3927 5626. 0.2721177
3928 5627. 0.2720997
3929 5628. 0.2720817
3930 5629. 0.2720637
3931 5630. 0.2720457
3932 5631. 0.2720204
3933 5632. 0.2719952
3934 5633. 0.27197
3935 5634. 0.2719447
3936 5635. 0.2719194
3937 5636. 0.2718942
3938 5637. 0.271869
3939 5638. 0.2718437
3940 5639. 0.2718185
3941 5640. 0.2717932
3942 5641. 0.271768
3943 5642. 0.2717444
3944 5643. 0.2717227
3945 5644. 0.271701
3946 5645. 0.2716795
3947 5646. 0.2716578
3948 5647. 0.2716362
3949 5648. 0.2716146
3950 5649. 0.2715929
3951 5650. 0.2715713
3952 5651. 0.2715496
3953 5652. 0.2715281
3954 5653. 0.2715065
3955 5654. 0.2714848
3956 5655. 0.2714633
3957 5656. 0.2714416
3958 5657. 0.2714199
3959 5658. 0.2713984
3960 5659. 0.2713768
3961 5660. 0.2713552
3962 5661. 0.2713334
3963 5662. 0.2713117
3964 5663. 0.2712898
3965 5664. 0.2712679
3966 5665. 0.271246
3967 5666. 0.2712241
3968 5667. 0.2712023
3969 5668. 0.2711803
3970 5669. 0.2711584
3971 5670. 0.2711366
3972 5671. 0.2711145
3973 5672. 0.2710925
3974 5673. 0.2710705
3975 5674. 0.2710483
3976 5675. 0.2710263
3977 5676. 0.2710043
3978 5677. 0.2709822
3979 5678. 0.2709602
3980 5679. 0.2709382
3981 5680. 0.270916
3982 5681. 0.270894
3983 5682. 0.2708702
3984 5683. 0.2708445
3985 5684. 0.2708188
3986 5685. 0.2707931
3987 5686. 0.2707675
3988 5687. 0.2707417
3989 5688. 0.2707161
3990 5689. 0.2706903
3991 5690. 0.2706647
3992 5691. 0.2706389
3993 5692. 0.2706132
3994 5693. 0.2705874
3995 5694. 0.2705616
3996 5695. 0.2705359
3997 5696. 0.2705102
3998 5697. 0.2704845
3999 5698. 0.2704588
4000 5699. 0.2704331
4001 5700. 0.2704073
4002 5701. 0.2703817
4003 5702. 0.2703574
4004 5703. 0.2703352
4005 5704. 0.2703129
4006 5705. 0.2702906
4007 5706. 0.2702684
4008 5707. 0.2702461
4009 5708. 0.2702239
4010 5709. 0.2702016
4011 5710. 0.2701793
4012 5711. 0.2701571
4013 5712. 0.2701347
4014 5713. 0.2701125
4015 5714. 0.2700902
4016 5715. 0.270068
4017 5716. 0.2700457
4018 5717. 0.2700235
4019 5718. 0.2700012
4020 5719. 0.2699789
4021 5720. 0.2699567
4022 5721. 0.2699115
4023 5722. 0.2698659
4024 5723. 0.2698199
4025 5724. 0.2697739
4026 5725. 0.2697279
4027 5726. 0.2696819
4028 5727. 0.2696359
4029 5728. 0.2695899
4030 5729. 0.2695439
4031 5730. 0.2694978
4032 5731. 0.2694747
4033 5732. 0.2694514
4034 5733. 0.2694283
4035 5734. 0.2694049
4036 5735. 0.2693817
4037 5736. 0.2693584
4038 5737. 0.2693352
4039 5738. 0.2693121
4040 5739. 0.2692888
4041 5740. 0.2692656
4042 5741. 0.2692425
4043 5742. 0.2692196
4044 5743. 0.2691973
4045 5744. 0.269175
4046 5745. 0.2691526
4047 5746. 0.2691303
4048 5747. 0.2691079
4049 5748. 0.2690856
4050 5749. 0.2690634
4051 5750. 0.269041
4052 5751. 0.2690187
4053 5752. 0.2689964
4054 5753. 0.268974
4055 5754. 0.2689517
4056 5755. 0.2689293
4057 5756. 0.268907
4058 5757. 0.2688847
4059 5758. 0.2688623
4060 5759. 0.26884
4061 5760. 0.2688177
4062 5761. 0.2687954
4063 5762. 0.2687696
4064 5763. 0.2687385
4065 5764. 0.2687074
4066 5765. 0.2686764
4067 5766. 0.2686453
4068 5767. 0.2686141
4069 5768. 0.2685831
4070 5769. 0.268552
4071 5770. 0.2685209
4072 5771. 0.2684898
4073 5772. 0.2684588
4074 5773. 0.2684276
4075 5774. 0.2683964
4076 5775. 0.2683653
4077 5776. 0.2683342
4078 5777. 0.2683031
4079 5778. 0.268272
4080 5779. 0.2682407
4081 5780. 0.2682098
4082 5781. 0.2681786
4083 5782. 0.2681496
4084 5783. 0.2681239
4085 5784. 0.2680981
4086 5785. 0.2680725
4087 5786. 0.2680468
4088 5787. 0.2680212
4089 5788. 0.2679956
4090 5789. 0.2679698
4091 5790. 0.2679442
4092 5791. 0.2679184
4093 5792. 0.2678927
4094 5793. 0.267867
4095 5794. 0.2678412
4096 5795. 0.2678156
4097 5796. 0.2677899
4098 5797. 0.2677642
4099 5798. 0.2677385
4100 5799. 0.2677128
4101 5800. 0.2676871
4102 5801. 0.2676614
4103 5802. 0.2676392
4104 5803. 0.2676222
4105 5804. 0.2676052
4106 5805. 0.2675881
4107 5806. 0.2675711
4108 5807. 0.2675541
4109 5808. 0.267537
4110 5809. 0.2675199
4111 5810. 0.2675029
4112 5811. 0.2674859
4113 5812. 0.2674688
4114 5813. 0.2674519
4115 5814. 0.2674348
4116 5815. 0.2674179
4117 5816. 0.2674008
4118 5817. 0.2673838
4119 5818. 0.2673668
4120 5819. 0.2673497
4121 5820. 0.2673327
4122 5821. 0.267293
4123 5822. 0.267247
4124 5823. 0.267191
4125 5824. 0.2671351
4126 5825. 0.267079
4127 5826. 0.267023
4128 5827. 0.266967
4129 5828. 0.266911
4130 5829. 0.2668551
4131 5830. 0.266799
4132 5831. 0.2667697
4133 5832. 0.2667405
4134 5833. 0.2667112
4135 5834. 0.2666821
4136 5835. 0.2666527
4137 5836. 0.2666236
4138 5837. 0.2665943
4139 5838. 0.266565
4140 5839. 0.2665358
4141 5840. 0.2665065
4142 5841. 0.2664773
4143 5842. 0.266454
4144 5843. 0.2664405
4145 5844. 0.2664269
4146 5845. 0.2664134
4147 5846. 0.2663999
4148 5847. 0.2663863
4149 5848. 0.2663728
4150 5849. 0.2663593
4151 5850. 0.2663458
4152 5851. 0.2663324
4153 5852. 0.266319
4154 5853. 0.2663056
4155 5854. 0.2662923
4156 5855. 0.2662789
4157 5856. 0.2662655
4158 5857. 0.2662521
4159 5858. 0.2662387
4160 5859. 0.2662253
4161 5860. 0.2662119
4162 5861. 0.2661986
4163 5862. 0.2661835
4164 5863. 0.2661656
4165 5864. 0.2661478
4166 5865. 0.2661299
4167 5866. 0.266112
4168 5867. 0.2660941
4169 5868. 0.2660762
4170 5869. 0.2660584
4171 5870. 0.2660404
4172 5871. 0.2660226
4173 5872. 0.2660048
4174 5873. 0.2659869
4175 5874. 0.2659691
4176 5875. 0.2659513
4177 5876. 0.2659335
4178 5877. 0.2659156
4179 5878. 0.2658978
4180 5879. 0.26588
4181 5880. 0.2658622
4182 5881. 0.2658443
4183 5882. 0.2658263
4184 5883. 0.265808
4185 5884. 0.2657897
4186 5885. 0.2657713
4187 5886. 0.265753
4188 5887. 0.2657347
4189 5888. 0.2657163
4190 5889. 0.265698
4191 5890. 0.2656797
4192 5891. 0.2656614
4193 5892. 0.2656431
4194 5893. 0.2656248
4195 5894. 0.2656064
4196 5895. 0.2655882
4197 5896. 0.2655698
4198 5897. 0.2655515
4199 5898. 0.2655332
4200 5899. 0.2655149
4201 5900. 0.2654966
4202 5901. 0.2654558
4203 5902. 0.2654158
4204 5903. 0.2653773
4205 5904. 0.2653386
4206 5905. 0.2653001
4207 5906. 0.2652616
4208 5907. 0.2652231
4209 5908. 0.2651846
4210 5909. 0.265146
4211 5910. 0.2651075
4212 5911. 0.2650916
4213 5912. 0.2650757
4214 5913. 0.2650598
4215 5914. 0.2650439
4216 5915. 0.265028
4217 5916. 0.2650121
4218 5917. 0.2649963
4219 5918. 0.2649803
4220 5919. 0.2649645
4221 5920. 0.2649486
4222 5921. 0.2649327
4223 5922. 0.2649139
4224 5923. 0.2648896
4225 5924. 0.2648653
4226 5925. 0.264841
4227 5926. 0.2648169
4228 5927. 0.2647925
4229 5928. 0.2647683
4230 5929. 0.264744
4231 5930. 0.2647198
4232 5931. 0.2646956
4233 5932. 0.2646713
4234 5933. 0.2646471
4235 5934. 0.2646229
4236 5935. 0.2645986
4237 5936. 0.2645744
4238 5937. 0.2645502
4239 5938. 0.264526
4240 5939. 0.2645018
4241 5940. 0.2644776
4242 5941. 0.2644535
4243 5942. 0.2644308
4244 5943. 0.2644102
4245 5944. 0.2643897
4246 5945. 0.2643692
4247 5946. 0.2643488
4248 5947. 0.2643282
4249 5948. 0.2643077
4250 5949. 0.2642873
4251 5950. 0.2642667
4252 5951. 0.2642463
4253 5952. 0.2642258
4254 5953. 0.2642054
4255 5954. 0.2641849
4256 5955. 0.2641643
4257 5956. 0.2641439
4258 5957. 0.2641236
4259 5958. 0.2641031
4260 5959. 0.2640826
4261 5960. 0.2640621
4262 5961. 0.2640418
4263 5962. 0.2640222
4264 5963. 0.2640039
4265 5964. 0.2639858
4266 5965. 0.2639676
4267 5966. 0.2639494
4268 5967. 0.2639312
4269 5968. 0.2639131
4270 5969. 0.2638948
4271 5970. 0.2638766
4272 5971. 0.2638361
4273 5972. 0.2637955
4274 5973. 0.2637551
4275 5974. 0.2637146
4276 5975. 0.263674
4277 5976. 0.2636336
4278 5977. 0.263593
4279 5978. 0.2635524
4280 5979. 0.2635119
4281 5980. 0.2634714
4282 5981. 0.2634533
4283 5982. 0.2634345
4284 5983. 0.2634146
4285 5984. 0.2633947
4286 5985. 0.2633747
4287 5986. 0.2633547
4288 5987. 0.2633348
4289 5988. 0.2633149
4290 5989. 0.2632948
4291 5990. 0.2632749
4292 5991. 0.263255
4293 5992. 0.2632352
4294 5993. 0.2632153
4295 5994. 0.2631954
4296 5995. 0.2631755
4297 5996. 0.2631557
4298 5997. 0.2631357
4299 5998. 0.2631159
4300 5999. 0.2630961
4301 6000. 0.2630762
4302 6001. 0.2630824
4303 6002. 0.2630883
4304 6003. 0.2630934
4305 6004. 0.2630985
4306 6005. 0.2631037
4307 6006. 0.2631088
4308 6007. 0.2631139
4309 6008. 0.2631191
4310 6009. 0.2631242
4311 6010. 0.2631293
4312 6011. 0.2631346
4313 6012. 0.2631398
4314 6013. 0.2631453
4315 6014. 0.2631505
4316 6015. 0.2631558
4317 6016. 0.263161
4318 6017. 0.2631663
4319 6018. 0.2631716
4320 6019. 0.2631768
4321 6020. 0.2631821
4322 6021. 0.2631874
4323 6022. 0.2631948
4324 6023. 0.2632063
4325 6024. 0.2632179
4326 6025. 0.2632294
4327 6026. 0.2632408
4328 6027. 0.2632523
4329 6028. 0.2632638
4330 6029. 0.2632752
4331 6030. 0.2632867
4332 6031. 0.2632729
4333 6032. 0.263259
4334 6033. 0.2632452
4335 6034. 0.2632313
4336 6035. 0.2632175
4337 6036. 0.2632036
4338 6037. 0.2631897
4339 6038. 0.2631758
4340 6039. 0.2631619
4341 6040. 0.2631481
4342 6041. 0.2631566
4343 6042. 0.2631653
4344 6043. 0.2631742
4345 6044. 0.2631832
4346 6045. 0.2631922
4347 6046. 0.2632012
4348 6047. 0.26321
4349 6048. 0.2632191
4350 6049. 0.263228
4351 6050. 0.2632369
4352 6051. 0.2632459
4353 6052. 0.2632549
4354 6053. 0.2632639
4355 6054. 0.2632729
4356 6055. 0.2632818
4357 6056. 0.2632908
4358 6057. 0.2632998
4359 6058. 0.2633088
4360 6059. 0.2633177
4361 6060. 0.2633267
4362 6061. 0.2633357
4363 6062. 0.2633438
4364 6063. 0.2633496
4365 6064. 0.2633555
4366 6065. 0.2633614
4367 6066. 0.2633672
4368 6067. 0.2633731
4369 6068. 0.2633789
4370 6069. 0.2633848
4371 6070. 0.2633906
4372 6071. 0.2633967
4373 6072. 0.2634026
4374 6073. 0.2634086
4375 6074. 0.2634146
4376 6075. 0.2634206
4377 6076. 0.2634265
4378 6077. 0.2634325
4379 6078. 0.2634384
4380 6079. 0.2634444
4381 6080. 0.2634504
4382 6081. 0.2634563
4383 6082. 0.2634618
4384 6083. 0.2634665
4385 6084. 0.2634712
4386 6085. 0.2634757
4387 6086. 0.2634803
4388 6087. 0.2634849
4389 6088. 0.2634895
4390 6089. 0.2634941
4391 6090. 0.2634988
4392 6091. 0.263481
4393 6092. 0.2634633
4394 6093. 0.2634455
4395 6094. 0.2634278
4396 6095. 0.26341
4397 6096. 0.2633922
4398 6097. 0.2633744
4399 6098. 0.2633566
4400 6099. 0.2633388
4401 6100. 0.263321
4402 6101. 0.2633256
4403 6102. 0.263332
4404 6103. 0.2633423
4405 6104. 0.2633525
4406 6105. 0.2633627
4407 6106. 0.263373
4408 6107. 0.2633833
4409 6108. 0.2633936
4410 6109. 0.2634038
4411 6110. 0.2634142
4412 6111. 0.2634244
4413 6112. 0.2634346
4414 6113. 0.263445
4415 6114. 0.2634553
4416 6115. 0.2634655
4417 6116. 0.2634759
4418 6117. 0.2634861
4419 6118. 0.2634965
4420 6119. 0.2635067
4421 6120. 0.263517
4422 6121. 0.2635274
4423 6122. 0.2635371
4424 6123. 0.2635454
4425 6124. 0.2635538
4426 6125. 0.2635621
4427 6126. 0.2635704
4428 6127. 0.2635787
4429 6128. 0.2635871
4430 6129. 0.2635953
4431 6130. 0.2636037
4432 6131. 0.2636119
4433 6132. 0.2636202
4434 6133. 0.2636284
4435 6134. 0.2636367
4436 6135. 0.2636449
4437 6136. 0.2636532
4438 6137. 0.2636615
4439 6138. 0.2636697
4440 6139. 0.263678
4441 6140. 0.2636862
4442 6141. 0.2636945
4443 6142. 0.2637027
4444 6143. 0.2637104
4445 6144. 0.2637181
4446 6145. 0.2637258
4447 6146. 0.2637337
4448 6147. 0.2637414
4449 6148. 0.2637491
4450 6149. 0.2637568
4451 6150. 0.2637645
4452 6151. 0.2637498
4453 6152. 0.2637349
4454 6153. 0.2637203
4455 6154. 0.2637055
4456 6155. 0.2636907
4457 6156. 0.263676
4458 6157. 0.2636612
4459 6158. 0.2636465
4460 6159. 0.2636315
4461 6160. 0.2636168
4462 6161. 0.2636244
4463 6162. 0.2636326
4464 6163. 0.2636423
4465 6164. 0.2636521
4466 6165. 0.2636618
4467 6166. 0.2636715
4468 6167. 0.2636812
4469 6168. 0.2636909
4470 6169. 0.2637006
4471 6170. 0.2637104
4472 6171. 0.2637201
4473 6172. 0.2637299
4474 6173. 0.2637396
4475 6174. 0.2637493
4476 6175. 0.263759
4477 6176. 0.2637686
4478 6177. 0.2637784
4479 6178. 0.2637881
4480 6179. 0.2637978
4481 6180. 0.2638077
4482 6181. 0.2638173
4483 6182. 0.2638249
4484 6183. 0.2638276
4485 6184. 0.2638302
4486 6185. 0.2638329
4487 6186. 0.2638355
4488 6187. 0.2638382
4489 6188. 0.2638409
4490 6189. 0.2638434
4491 6190. 0.2638461
4492 6191. 0.2638486
4493 6192. 0.2638512
4494 6193. 0.2638536
4495 6194. 0.2638562
4496 6195. 0.2638587
4497 6196. 0.2638613
4498 6197. 0.2638637
4499 6198. 0.2638663
4500 6199. 0.2638689
4501 6200. 0.2638715
4502 6201. 0.2638514
4503 6202. 0.2638314
4504 6203. 0.2638114
4505 6204. 0.2637913
4506 6205. 0.2637713
4507 6206. 0.2637512
4508 6207. 0.2637312
4509 6208. 0.2637111
4510 6209. 0.263691
4511 6210. 0.263671
4512 6211. 0.2636734
4513 6212. 0.2636758
4514 6213. 0.2636783
4515 6214. 0.2636807
4516 6215. 0.2636831
4517 6216. 0.2636856
4518 6217. 0.2636879
4519 6218. 0.2636903
4520 6219. 0.2636927
4521 6220. 0.2636951
4522 6221. 0.2636974
4523 6222. 0.2637003
4524 6223. 0.2637043
4525 6224. 0.2637084
4526 6225. 0.2637124
4527 6226. 0.2637165
4528 6227. 0.2637205
4529 6228. 0.2637244
4530 6229. 0.2637285
4531 6230. 0.2637325
4532 6231. 0.2637382
4533 6232. 0.263744
4534 6233. 0.2637497
4535 6234. 0.2637555
4536 6235. 0.2637613
4537 6236. 0.263767
4538 6237. 0.2637728
4539 6238. 0.2637785
4540 6239. 0.2637842
4541 6240. 0.26379
4542 6241. 0.2637731
4543 6242. 0.263757
4544 6243. 0.2637429
4545 6244. 0.2637286
4546 6245. 0.2637146
4547 6246. 0.2637004
4548 6247. 0.2636862
4549 6248. 0.263672
4550 6249. 0.2636578
4551 6250. 0.2636437
4552 6251. 0.2636518
4553 6252. 0.26366
4554 6253. 0.2636682
4555 6254. 0.2636764
4556 6255. 0.2636846
4557 6256. 0.2636927
4558 6257. 0.2637009
4559 6258. 0.2637091
4560 6259. 0.2637173
4561 6260. 0.2637254
4562 6261. 0.2637334
4563 6262. 0.2637399
4564 6263. 0.2637422
4565 6264. 0.2637446
4566 6265. 0.2637469
4567 6266. 0.2637492
4568 6267. 0.2637516
4569 6268. 0.2637539
4570 6269. 0.2637562
4571 6270. 0.2637585
4572 6271. 0.2637607
4573 6272. 0.263763
4574 6273. 0.2637652
4575 6274. 0.2637675
4576 6275. 0.2637698
4577 6276. 0.263772
4578 6277. 0.2637743
4579 6278. 0.2637765
4580 6279. 0.2637789
4581 6280. 0.2637811
4582 6281. 0.2637832
4583 6282. 0.2637853
4584 6283. 0.2637872
4585 6284. 0.263789
4586 6285. 0.2637908
4587 6286. 0.2637927
4588 6287. 0.2637945
4589 6288. 0.2637963
4590 6289. 0.2637981
4591 6290. 0.2638
4592 6291. 0.2637792
4593 6292. 0.2637584
4594 6293. 0.2637376
4595 6294. 0.2637168
4596 6295. 0.263696
4597 6296. 0.2636752
4598 6297. 0.2636544
4599 6298. 0.2636336
4600 6299. 0.2636129
4601 6300. 0.263592
4602 6301. 0.2635936
4603 6302. 0.2635985
4604 6303. 0.2636122
4605 6304. 0.2636261
4606 6305. 0.2636401
4607 6306. 0.2636539
4608 6307. 0.2636678
4609 6308. 0.2636817
4610 6309. 0.2636955
4611 6310. 0.2637094
4612 6311. 0.2637231
4613 6312. 0.2637368
4614 6313. 0.2637505
4615 6314. 0.2637642
4616 6315. 0.2637779
4617 6316. 0.2637915
4618 6317. 0.2638053
4619 6318. 0.2638189
4620 6319. 0.2638326
4621 6320. 0.2638463
4622 6321. 0.2638599
4623 6322. 0.2638715
4624 6323. 0.263877
4625 6324. 0.2638824
4626 6325. 0.2638879
4627 6326. 0.2638934
4628 6327. 0.2638988
4629 6328. 0.2639043
4630 6329. 0.2639098
4631 6330. 0.2639153
4632 6331. 0.2638981
4633 6332. 0.2638809
4634 6333. 0.2638638
4635 6334. 0.2638465
4636 6335. 0.2638294
4637 6336. 0.2638122
4638 6337. 0.263795
4639 6338. 0.2637778
4640 6339. 0.2637607
4641 6340. 0.2637435
4642 6341. 0.2637487
4643 6342. 0.2637537
4644 6343. 0.2637579
4645 6344. 0.2637621
4646 6345. 0.2637662
4647 6346. 0.2637704
4648 6347. 0.2637745
4649 6348. 0.2637786
4650 6349. 0.2637827
4651 6350. 0.2637868
4652 6351. 0.2637908
4653 6352. 0.2637947
4654 6353. 0.2637987
4655 6354. 0.2638026
4656 6355. 0.2638066
4657 6356. 0.2638105
4658 6357. 0.2638145
4659 6358. 0.2638185
4660 6359. 0.2638223
4661 6360. 0.2638263
4662 6361. 0.2638301
4663 6362. 0.2638353
4664 6363. 0.2638449
4665 6364. 0.2638545
4666 6365. 0.2638642
4667 6366. 0.2638739
4668 6367. 0.2638836
4669 6368. 0.2638932
4670 6369. 0.2639029
4671 6370. 0.2639125
4672 6371. 0.2638995
4673 6372. 0.2638864
4674 6373. 0.2638733
4675 6374. 0.2638602
4676 6375. 0.2638471
4677 6376. 0.2638341
4678 6377. 0.2638209
4679 6378. 0.2638078
4680 6379. 0.2637947
4681 6380. 0.2637815
4682 6381. 0.2637909
4683 6382. 0.2638001
4684 6383. 0.2638093
4685 6384. 0.2638185
4686 6385. 0.2638277
4687 6386. 0.263837
4688 6387. 0.2638461
4689 6388. 0.2638554
4690 6389. 0.2638646
4691 6390. 0.2638738
4692 6391. 0.2638828
4693 6392. 0.2638918
4694 6393. 0.2639008
4695 6394. 0.2639098
4696 6395. 0.2639188
4697 6396. 0.2639279
4698 6397. 0.2639369
4699 6398. 0.2639459
4700 6399. 0.2639548
4701 6400. 0.2639638
4702 6401. 0.2639728
4703 6402. 0.2639816
4704 6403. 0.2639901
4705 6404. 0.2639984
4706 6405. 0.2640069
4707 6406. 0.2640153
4708 6407. 0.2640238
4709 6408. 0.2640322
4710 6409. 0.2640406
4711 6410. 0.264049
4712 6411. 0.2640347
4713 6412. 0.2640203
4714 6413. 0.2640059
4715 6414. 0.2639915
4716 6415. 0.2639772
4717 6416. 0.2639628
4718 6417. 0.2639483
4719 6418. 0.263934
4720 6419. 0.2639195
4721 6420. 0.2639051
4722 6421. 0.2639132
4723 6422. 0.2639205
4724 6423. 0.2639253
4725 6424. 0.2639303
4726 6425. 0.2639351
4727 6426. 0.26394
4728 6427. 0.2639449
4729 6428. 0.2639497
4730 6429. 0.2639545
4731 6430. 0.2639593
4732 6431. 0.2639594
4733 6432. 0.2639595
4734 6433. 0.2639594
4735 6434. 0.2639594
4736 6435. 0.2639595
4737 6436. 0.2639594
4738 6437. 0.2639595
4739 6438. 0.2639595
4740 6439. 0.2639594
4741 6440. 0.2639595
4742 6441. 0.2639592
4743 6442. 0.2639593
4744 6443. 0.2639601
4745 6444. 0.2639609
4746 6445. 0.2639616
4747 6446. 0.2639624
4748 6447. 0.2639632
4749 6448. 0.2639638
4750 6449. 0.2639647
4751 6450. 0.2639654
4752 6451. 0.2639433
4753 6452. 0.2639212
4754 6453. 0.2638992
4755 6454. 0.2638771
4756 6455. 0.2638551
4757 6456. 0.263833
4758 6457. 0.263811
4759 6458. 0.2637888
4760 6459. 0.2637668
4761 6460. 0.2637447
4762 6461. 0.263745
4763 6462. 0.2637427
4764 6463. 0.2637311
4765 6464. 0.2637194
4766 6465. 0.2637078
4767 6466. 0.2636962
4768 6467. 0.2636846
4769 6468. 0.263673
4770 6469. 0.2636614
4771 6470. 0.2636497
4772 6471. 0.2636378
4773 6472. 0.263626
4774 6473. 0.2636141
4775 6474. 0.2636022
4776 6475. 0.2635903
4777 6476. 0.2635784
4778 6477. 0.2635665
4779 6478. 0.2635547
4780 6479. 0.2635427
4781 6480. 0.2635308
4782 6481. 0.2635186
4783 6482. 0.26351
4784 6483. 0.263515
4785 6484. 0.26352
4786 6485. 0.2635249
4787 6486. 0.26353
4788 6487. 0.263535
4789 6488. 0.26354
4790 6489. 0.2635449
4791 6490. 0.26355
4792 6491. 0.2635321
4793 6492. 0.2635143
4794 6493. 0.2634965
4795 6494. 0.2634786
4796 6495. 0.2634609
4797 6496. 0.2634431
4798 6497. 0.2634252
4799 6498. 0.2634074
4800 6499. 0.2633896
4801 6500. 0.2633717
4802 6501. 0.2633261
4803 6502. 0.2632786
4804 6503. 0.2632229
4805 6504. 0.2631672
4806 6505. 0.2631116
4807 6506. 0.2630559
4808 6507. 0.2630002
4809 6508. 0.2629446
4810 6509. 0.2628889
4811 6510. 0.2628333
4812 6511. 0.2627774
4813 6512. 0.2627213
4814 6513. 0.2626655
4815 6514. 0.2626096
4816 6515. 0.2625536
4817 6516. 0.2624977
4818 6517. 0.2624418
4819 6518. 0.2623859
4820 6519. 0.26233
4821 6520. 0.2622741
4822 6521. 0.2621955
4823 6522. 0.2621184
4824 6523. 0.2620476
4825 6524. 0.2619768
4826 6525. 0.2619059
4827 6526. 0.2618352
4828 6527. 0.2617644
4829 6528. 0.2616937
4830 6529. 0.2616228
4831 6530. 0.2615521
4832 6531. 0.2615037
4833 6532. 0.2614553
4834 6533. 0.2614068
4835 6534. 0.2613584
4836 6535. 0.26131
4837 6536. 0.2612617
4838 6537. 0.2612132
4839 6538. 0.2611648
4840 6539. 0.2611163
4841 6540. 0.261068
4842 6541. 0.2610195
4843 6542. 0.2609692
4844 6543. 0.2609119
4845 6544. 0.2608547
4846 6545. 0.2607974
4847 6546. 0.2607401
4848 6547. 0.2606828
4849 6548. 0.2606256
4850 6549. 0.2605683
4851 6550. 0.2605111
4852 6551. 0.2604537
4853 6552. 0.2603963
4854 6553. 0.260339
4855 6554. 0.2602817
4856 6555. 0.2602243
4857 6556. 0.2601669
4858 6557. 0.2601097
4859 6558. 0.2600525
4860 6559. 0.259995
4861 6560. 0.2599378
4862 6561. 0.259858
4863 6562. 0.2597794
4864 6563. 0.2597058
4865 6564. 0.2596323
4866 6565. 0.2595587
4867 6566. 0.2594852
4868 6567. 0.2594117
4869 6568. 0.2593382
4870 6569. 0.2592647
4871 6570. 0.2591913
4872 6571. 0.2591399
4873 6572. 0.2590885
4874 6573. 0.2590371
4875 6574. 0.2589858
4876 6575. 0.2589343
4877 6576. 0.2588829
4878 6577. 0.2588315
4879 6578. 0.2587801
4880 6579. 0.2587287
4881 6580. 0.2586773
4882 6581. 0.2586257
4883 6582. 0.2585743
4884 6583. 0.258523
4885 6584. 0.2584719
4886 6585. 0.2584207
4887 6586. 0.2583696
4888 6587. 0.2583184
4889 6588. 0.2582673
4890 6589. 0.2582162
4891 6590. 0.2581651
4892 6591. 0.2580916
4893 6592. 0.258018
4894 6593. 0.2579446
4895 6594. 0.2578712
4896 6595. 0.2577977
4897 6596. 0.2577243
4898 6597. 0.2576508
4899 6598. 0.2575775
4900 6599. 0.2575041
4901 6600. 0.2574307
4902 6601. 0.2573793
4903 6602. 0.2573268
4904 6603. 0.2572696
4905 6604. 0.2572123
4906 6605. 0.2571551
4907 6606. 0.257098
4908 6607. 0.2570407
4909 6608. 0.2569835
4910 6609. 0.2569263
4911 6610. 0.2568691
4912 6611. 0.2568119
4913 6612. 0.2567545
4914 6613. 0.2566973
4915 6614. 0.25664
4916 6615. 0.2565828
4917 6616. 0.2565256
4918 6617. 0.2564683
4919 6618. 0.2564111
4920 6619. 0.2563539
4921 6620. 0.2562966
4922 6621. 0.2562394
4923 6622. 0.2561837
4924 6623. 0.2561353
4925 6624. 0.2560872
4926 6625. 0.2560388
4927 6626. 0.2559905
4928 6627. 0.2559423
4929 6628. 0.255894
4930 6629. 0.2558457
4931 6630. 0.2557974
4932 6631. 0.255717
4933 6632. 0.2556368
4934 6633. 0.2555566
4935 6634. 0.2554764
4936 6635. 0.2553962
4937 6636. 0.255316
4938 6637. 0.2552359
4939 6638. 0.2551557
4940 6639. 0.2550755
4941 6640. 0.2549954
4942 6641. 0.254937
4943 6642. 0.2548788
4944 6643. 0.2548219
4945 6644. 0.2547649
4946 6645. 0.2547079
4947 6646. 0.2546509
4948 6647. 0.2545938
4949 6648. 0.254537
4950 6649. 0.2544799
4951 6650. 0.254423
4952 6651. 0.2543658
4953 6652. 0.2543087
4954 6653. 0.2542516
4955 6654. 0.2541945
4956 6655. 0.2541373
4957 6656. 0.2540803
4958 6657. 0.2540232
4959 6658. 0.2539661
4960 6659. 0.253909
4961 6660. 0.253852
4962 6661. 0.2537728
4963 6662. 0.2536931
4964 6663. 0.25361
4965 6664. 0.253527
4966 6665. 0.2534439
4967 6666. 0.2533609
4968 6667. 0.2532778
4969 6668. 0.2531949
4970 6669. 0.2531119
4971 6670. 0.253029
4972 6671. 0.2529677
4973 6672. 0.2529065
4974 6673. 0.2528452
4975 6674. 0.252784
4976 6675. 0.2527229
4977 6676. 0.2526617
4978 6677. 0.2526005
4979 6678. 0.2525393
4980 6679. 0.2524782
4981 6680. 0.252417
4982 6681. 0.2523558
4983 6682. 0.2522932
4984 6683. 0.2522235
4985 6684. 0.2521538
4986 6685. 0.2520841
4987 6686. 0.2520143
4988 6687. 0.2519447
4989 6688. 0.251875
4990 6689. 0.2518053
4991 6690. 0.2517357
4992 6691. 0.2516443
4993 6692. 0.251553
4994 6693. 0.2514617
4995 6694. 0.2513705
4996 6695. 0.2512792
4997 6696. 0.2511881
4998 6697. 0.2510969
4999 6698. 0.2510057
5000 6699. 0.2509146
5001 6700. 0.2508234
5002 6701. 0.2507539
5003 6702. 0.2506863
5004 6703. 0.2506295
5005 6704. 0.2505726
5006 6705. 0.2505158
5007 6706. 0.2504589
5008 6707. 0.2504022
5009 6708. 0.2503453
5010 6709. 0.2502885
5011 6710. 0.2502318
5012 6711. 0.2501749
5013 6712. 0.2501181
5014 6713. 0.2500613
5015 6714. 0.2500045
5016 6715. 0.2499478
5017 6716. 0.249891
5018 6717. 0.2498343
5019 6718. 0.2497775
5020 6719. 0.2497207
5021 6720. 0.249664
5022 6721. 0.2495856
5023 6722. 0.2495057
5024 6723. 0.2494168
5025 6724. 0.2493277
5026 6725. 0.2492388
5027 6726. 0.2491498
5028 6727. 0.2490609
5029 6728. 0.248972
5030 6729. 0.2488832
5031 6730. 0.2487943
5032 6731. 0.2487268
5033 6732. 0.2486593
5034 6733. 0.2485918
5035 6734. 0.2485244
5036 6735. 0.2484569
5037 6736. 0.2483895
5038 6737. 0.2483221
5039 6738. 0.2482549
5040 6739. 0.2481873
5041 6740. 0.24812
5042 6741. 0.2480526
5043 6742. 0.2479867
5044 6743. 0.2479306
5045 6744. 0.2478744
5046 6745. 0.2478184
5047 6746. 0.2477623
5048 6747. 0.2477061
5049 6748. 0.24765
5050 6749. 0.2475939
5051 6750. 0.2475378
5052 6751. 0.2474603
5053 6752. 0.2473827
5054 6753. 0.2473053
5055 6754. 0.2472278
5056 6755. 0.2471504
5057 6756. 0.2470729
5058 6757. 0.2469955
5059 6758. 0.2469182
5060 6759. 0.2468407
5061 6760. 0.2467633
5062 6761. 0.2467073
5063 6762. 0.2466503
5064 6763. 0.2465879
5065 6764. 0.2465254
5066 6765. 0.246463
5067 6766. 0.2464006
5068 6767. 0.2463382
5069 6768. 0.2462758
5070 6769. 0.2462133
5071 6770. 0.246151
5072 6771. 0.2460885
5073 6772. 0.2460261
5074 6773. 0.2459637
5075 6774. 0.2459012
5076 6775. 0.2458389
5077 6776. 0.2457765
5078 6777. 0.2457141
5079 6778. 0.2456517
5080 6779. 0.2455894
5081 6780. 0.2455269
5082 6781. 0.2454434
5083 6782. 0.2453588
5084 6783. 0.2452684
5085 6784. 0.2451778
5086 6785. 0.2450874
5087 6786. 0.2449971
5088 6787. 0.2449066
5089 6788. 0.2448163
5090 6789. 0.2447258
5091 6790. 0.2446356
5092 6791. 0.2445663
5093 6792. 0.2444971
5094 6793. 0.2444279
5095 6794. 0.2443587
5096 6795. 0.2442895
5097 6796. 0.2442204
5098 6797. 0.2441513
5099 6798. 0.2440822
5100 6799. 0.2440131
5101 6800. 0.2439441
5102 6801. 0.2438749
5103 6802. 0.2438082
5104 6803. 0.2437584
5105 6804. 0.2437086
5106 6805. 0.2436587
5107 6806. 0.2436088
5108 6807. 0.243559
5109 6808. 0.2435091
5110 6809. 0.2434593
5111 6810. 0.2434094
5112 6811. 0.2433386
5113 6812. 0.2432678
5114 6813. 0.2431969
5115 6814. 0.2431262
5116 6815. 0.2430555
5117 6816. 0.2429847
5118 6817. 0.2429139
5119 6818. 0.2428431
5120 6819. 0.2427723
5121 6820. 0.2427016
5122 6821. 0.242652
5123 6822. 0.2426005
5124 6823. 0.2425362
5125 6824. 0.2424719
5126 6825. 0.2424075
5127 6826. 0.2423432
5128 6827. 0.2422789
5129 6828. 0.2422147
5130 6829. 0.2421503
5131 6830. 0.2420861
5132 6831. 0.2420274
5133 6832. 0.2419688
5134 6833. 0.2419101
5135 6834. 0.2418515
5136 6835. 0.2417929
5137 6836. 0.2417343
5138 6837. 0.2416758
5139 6838. 0.2416171
5140 6839. 0.2415586
5141 6840. 0.2415
5142 6841. 0.2414206
5143 6842. 0.2413414
5144 6843. 0.2412641
5145 6844. 0.2411866
5146 6845. 0.2411093
5147 6846. 0.241032
5148 6847. 0.2409546
5149 6848. 0.2408773
5150 6849. 0.2408001
5151 6850. 0.2407228
5152 6851. 0.2406664
5153 6852. 0.24061
5154 6853. 0.2405536
5155 6854. 0.2404972
5156 6855. 0.2404409
5157 6856. 0.2403845
5158 6857. 0.2403281
5159 6858. 0.2402718
5160 6859. 0.2402155
5161 6860. 0.2401592
5162 6861. 0.240082
5163 6862. 0.2400049
5164 6863. 0.239928
5165 6864. 0.239851
5166 6865. 0.239774
5167 6866. 0.2396972
5168 6867. 0.2396203
5169 6868. 0.2395435
5170 6869. 0.2394667
5171 6870. 0.2393899
5172 6871. 0.2393338
5173 6872. 0.2392777
5174 6873. 0.2392216
5175 6874. 0.2391656
5176 6875. 0.2391095
5177 6876. 0.2390535
5178 6877. 0.2389974
5179 6878. 0.2389414
5180 6879. 0.2388854
5181 6880. 0.2388294
5182 6881. 0.2387733
5183 6882. 0.2387169
5184 6883. 0.2386577
5185 6884. 0.2385985
5186 6885. 0.2385393
5187 6886. 0.2384801
5188 6887. 0.238421
5189 6888. 0.2383617
5190 6889. 0.2383026
5191 6890. 0.2382434
5192 6891. 0.2381637
5193 6892. 0.238084
5194 6893. 0.2380043
5195 6894. 0.2379246
5196 6895. 0.2378449
5197 6896. 0.2377654
5198 6897. 0.2376858
5199 6898. 0.2376062
5200 6899. 0.2375265
5201 6900. 0.237447
5202 6901. 0.2373882
5203 6902. 0.2373304
5204 6903. 0.2372832
5205 6904. 0.2372359
5206 6905. 0.2371887
5207 6906. 0.2371414
5208 6907. 0.2370942
5209 6908. 0.2370469
5210 6909. 0.2369997
5211 6910. 0.2369525
5212 6911. 0.2369054
5213 6912. 0.2368583
5214 6913. 0.2368112
5215 6914. 0.2367641
5216 6915. 0.236717
5217 6916. 0.2366699
5218 6917. 0.2366229
5219 6918. 0.2365758
5220 6919. 0.2365287
5221 6920. 0.2364817
5222 6921. 0.2364143
5223 6922. 0.2363464
5224 6923. 0.2362746
5225 6924. 0.2362027
5226 6925. 0.2361308
5227 6926. 0.236059
5228 6927. 0.2359872
5229 6928. 0.2359154
5230 6929. 0.2358436
5231 6930. 0.2357718
5232 6931. 0.2357205
5233 6932. 0.2356691
5234 6933. 0.2356178
5235 6934. 0.2355666
5236 6935. 0.2355153
5237 6936. 0.235464
5238 6937. 0.2354127
5239 6938. 0.2353615
5240 6939. 0.2353101
5241 6940. 0.235259
5242 6941. 0.2351872
5243 6942. 0.235115
5244 6943. 0.2350382
5245 6944. 0.2349614
5246 6945. 0.2348847
5247 6946. 0.2348079
5248 6947. 0.2347312
5249 6948. 0.2346544
5250 6949. 0.2345777
5251 6950. 0.2345011
5252 6951. 0.2344447
5253 6952. 0.2343884
5254 6953. 0.2343322
5255 6954. 0.2342758
5256 6955. 0.2342196
5257 6956. 0.2341633
5258 6957. 0.2341071
5259 6958. 0.2340509
5260 6959. 0.2339946
5261 6960. 0.2339384
5262 6961. 0.2338823
5263 6962. 0.2338261
5264 6963. 0.2337686
5265 6964. 0.233711
5266 6965. 0.2336536
5267 6966. 0.2335961
5268 6967. 0.2335386
5269 6968. 0.2334811
5270 6969. 0.2334236
5271 6970. 0.2333662
5272 6971. 0.2332887
5273 6972. 0.2332111
5274 6973. 0.2331335
5275 6974. 0.233056
5276 6975. 0.2329785
5277 6976. 0.2329011
5278 6977. 0.2328236
5279 6978. 0.2327462
5280 6979. 0.2326688
5281 6980. 0.2325914
5282 6981. 0.2325343
5283 6982. 0.2324777
5284 6983. 0.2324274
5285 6984. 0.232377
5286 6985. 0.2323267
5287 6986. 0.2322764
5288 6987. 0.232226
5289 6988. 0.2321758
5290 6989. 0.2321254
5291 6990. 0.2320751
5292 6991. 0.2320248
5293 6992. 0.2319746
5294 6993. 0.2319242
5295 6994. 0.231874
5296 6995. 0.2318238
5297 6996. 0.2317734
5298 6997. 0.2317232
5299 6998. 0.2316731
5300 6999. 0.2316228
5301 7000. 0.2315726
5302 7001. 0.2314894
5303 7002. 0.231406
5304 7003. 0.2313187
5305 7004. 0.2312314
5306 7005. 0.2311442
5307 7006. 0.231057
5308 7007. 0.2309697
5309 7008. 0.2308826
5310 7009. 0.2307954
5311 7010. 0.2307083
5312 7011. 0.2306413
5313 7012. 0.2305742
5314 7013. 0.2305074
5315 7014. 0.2304403
5316 7015. 0.2303735
5317 7016. 0.2303065
5318 7017. 0.2302396
5319 7018. 0.2301726
5320 7019. 0.2301057
5321 7020. 0.2300388
5322 7021. 0.2299522
5323 7022. 0.2298655
5324 7023. 0.2297787
5325 7024. 0.2296921
5326 7025. 0.2296054
5327 7026. 0.2295187
5328 7027. 0.229432
5329 7028. 0.2293454
5330 7029. 0.2292588
5331 7030. 0.2291722
5332 7031. 0.2290975
5333 7032. 0.229023
5334 7033. 0.2289484
5335 7034. 0.2288738
5336 7035. 0.2287993
5337 7036. 0.2287247
5338 7037. 0.2286502
5339 7038. 0.2285757
5340 7039. 0.2285012
5341 7040. 0.2284267
5342 7041. 0.2283523
5343 7042. 0.2282783
5344 7043. 0.2282098
5345 7044. 0.2281413
5346 7045. 0.2280728
5347 7046. 0.2280043
5348 7047. 0.2279359
5349 7048. 0.2278674
5350 7049. 0.2277989
5351 7050. 0.2277305
5352 7051. 0.2276423
5353 7052. 0.227554
5354 7053. 0.2274659
5355 7054. 0.2273777
5356 7055. 0.2272896
5357 7056. 0.2272015
5358 7057. 0.2271134
5359 7058. 0.2270253
5360 7059. 0.2269372
5361 7060. 0.2268492
5362 7061. 0.226781
5363 7062. 0.2267127
5364 7063. 0.2266401
5365 7064. 0.2265676
5366 7065. 0.2264953
5367 7066. 0.2264228
5368 7067. 0.2263504
5369 7068. 0.226278
5370 7069. 0.2262056
5371 7070. 0.2261332
5372 7071. 0.2260413
5373 7072. 0.2259493
5374 7073. 0.2258574
5375 7074. 0.2257655
5376 7075. 0.2256736
5377 7076. 0.2255818
5378 7077. 0.22549
5379 7078. 0.2253982
5380 7079. 0.2253064
5381 7080. 0.2252147
5382 7081. 0.2251426
5383 7082. 0.2250708
5384 7083. 0.2250028
5385 7084. 0.2249347
5386 7085. 0.2248666
5387 7086. 0.2247986
5388 7087. 0.2247306
5389 7088. 0.2246625
5390 7089. 0.2245944
5391 7090. 0.2245265
5392 7091. 0.224439
5393 7092. 0.2243515
5394 7093. 0.2242641
5395 7094. 0.2241767
5396 7095. 0.2240893
5397 7096. 0.2240021
5398 7097. 0.2239147
5399 7098. 0.2238274
5400 7099. 0.2237401
5401 7100. 0.2236529
5402 7101. 0.2235853
5403 7102. 0.2235176
5404 7103. 0.2234479
5405 7104. 0.2233781
5406 7105. 0.2233084
5407 7106. 0.2232387
5408 7107. 0.2231691
5409 7108. 0.2230994
5410 7109. 0.2230297
5411 7110. 0.2229601
5412 7111. 0.2228905
5413 7112. 0.2228209
5414 7113. 0.2227514
5415 7114. 0.2226819
5416 7115. 0.2226124
5417 7116. 0.2225429
5418 7117. 0.2224734
5419 7118. 0.222404
5420 7119. 0.2223346
5421 7120. 0.2222652
5422 7121. 0.2221763
5423 7122. 0.2220874
5424 7123. 0.2219975
5425 7124. 0.2219076
5426 7125. 0.2218177
5427 7126. 0.2217279
5428 7127. 0.221638
5429 7128. 0.2215481
5430 7129. 0.2214583
5431 7130. 0.2213686
5432 7131. 0.2212983
5433 7132. 0.2212279
5434 7133. 0.2211576
5435 7134. 0.2210873
5436 7135. 0.221017
5437 7136. 0.2209468
5438 7137. 0.2208765
5439 7138. 0.2208064
5440 7139. 0.2207361
5441 7140. 0.2206659
5442 7141. 0.2205766
5443 7142. 0.2204874
5444 7143. 0.2204024
5445 7144. 0.2203175
5446 7145. 0.2202327
5447 7146. 0.2201477
5448 7147. 0.220063
5449 7148. 0.2199781
5450 7149. 0.2198933
5451 7150. 0.2198086
5452 7151. 0.219743
5453 7152. 0.2196777
5454 7153. 0.2196123
5455 7154. 0.219547
5456 7155. 0.2194816
5457 7156. 0.2194163
5458 7157. 0.2193509
5459 7158. 0.2192856
5460 7159. 0.2192202
5461 7160. 0.219155
5462 7161. 0.2190705
5463 7162. 0.2189859
5464 7163. 0.2188879
5465 7164. 0.21879
5466 7165. 0.2186919
5467 7166. 0.218594
5468 7167. 0.218496
5469 7168. 0.2183982
5470 7169. 0.2183004
5471 7170. 0.2182026
5472 7171. 0.2181239
5473 7172. 0.2180453
5474 7173. 0.2179666
5475 7174. 0.2178881
5476 7175. 0.2178095
5477 7176. 0.2177309
5478 7177. 0.2176524
5479 7178. 0.2175739
5480 7179. 0.2174953
5481 7180. 0.2174168
5482 7181. 0.2173384
5483 7182. 0.2172602
5484 7183. 0.2171898
5485 7184. 0.2171194
5486 7185. 0.217049
5487 7186. 0.2169788
5488 7187. 0.2169083
5489 7188. 0.2168381
5490 7189. 0.2167677
5491 7190. 0.2166975
5492 7191. 0.2166082
5493 7192. 0.216519
5494 7193. 0.2164299
5495 7194. 0.2163407
5496 7195. 0.2162516
5497 7196. 0.2161625
5498 7197. 0.2160735
5499 7198. 0.2159846
5500 7199. 0.2158956
5501 7200. 0.2158066
5502 7201. 0.2157366
5503 7202. 0.2156668
5504 7203. 0.2155963
5505 7204. 0.2155259
5506 7205. 0.2154555
5507 7206. 0.215385
5508 7207. 0.2153147
5509 7208. 0.2152443
5510 7209. 0.2151739
5511 7210. 0.2151036
5512 7211. 0.2150145
5513 7212. 0.2149254
5514 7213. 0.2148365
5515 7214. 0.2147474
5516 7215. 0.2146584
5517 7216. 0.2145694
5518 7217. 0.2144805
5519 7218. 0.2143916
5520 7219. 0.2143027
5521 7220. 0.2142138
5522 7221. 0.2141439
5523 7222. 0.2140739
5524 7223. 0.2140055
5525 7224. 0.2139371
5526 7225. 0.2138687
5527 7226. 0.2138004
5528 7227. 0.2137319
5529 7228. 0.2136635
5530 7229. 0.2135952
5531 7230. 0.2135268
5532 7231. 0.2134315
5533 7232. 0.213336
5534 7233. 0.2132406
5535 7234. 0.2131453
5536 7235. 0.21305
5537 7236. 0.2129547
5538 7237. 0.2128595
5539 7238. 0.2127642
5540 7239. 0.212669
5541 7240. 0.2125739
5542 7241. 0.2124975
5543 7242. 0.2124212
5544 7243. 0.2123456
5545 7244. 0.21227
5546 7245. 0.2121944
5547 7246. 0.2121189
5548 7247. 0.2120434
5549 7248. 0.2119679
5550 7249. 0.2118924
5551 7250. 0.2118169
5552 7251. 0.211723
5553 7252. 0.2116291
5554 7253. 0.2115351
5555 7254. 0.2114413
5556 7255. 0.2113475
5557 7256. 0.2112537
5558 7257. 0.2111599
5559 7258. 0.2110662
5560 7259. 0.2109724
5561 7260. 0.2108788
5562 7261. 0.2108038
5563 7262. 0.2107288
5564 7263. 0.2106573
5565 7264. 0.2105858
5566 7265. 0.2105144
5567 7266. 0.210443
5568 7267. 0.2103716
5569 7268. 0.2103002
5570 7269. 0.2102288
5571 7270. 0.2101575
5572 7271. 0.2100862
5573 7272. 0.210015
5574 7273. 0.2099438
5575 7274. 0.2098726
5576 7275. 0.2098014
5577 7276. 0.2097303
5578 7277. 0.2096591
5579 7278. 0.209588
5580 7279. 0.2095169
5581 7280. 0.2094458
5582 7281. 0.2093563
5583 7282. 0.2092669
5584 7283. 0.2091737
5585 7284. 0.2090806
5586 7285. 0.2089875
5587 7286. 0.2088945
5588 7287. 0.2088015
5589 7288. 0.2087085
5590 7289. 0.2086155
5591 7290. 0.2085226
5592 7291. 0.2084481
5593 7292. 0.2083736
5594 7293. 0.2082991
5595 7294. 0.2082247
5596 7295. 0.2081503
5597 7296. 0.2080758
5598 7297. 0.2080014
5599 7298. 0.207927
5600 7299. 0.2078526
5601 7300. 0.2077784
5602 7301. 0.2076858
5603 7302. 0.2075933
5604 7303. 0.2074967
5605 7304. 0.2074
5606 7305. 0.2073033
5607 7306. 0.2072067
5608 7307. 0.2071101
5609 7308. 0.2070135
5610 7309. 0.2069171
5611 7310. 0.2068205
5612 7311. 0.2067425
5613 7312. 0.2066644
5614 7313. 0.2065863
5615 7314. 0.2065083
5616 7315. 0.2064303
5617 7316. 0.2063523
5618 7317. 0.2062743
5619 7318. 0.2061963
5620 7319. 0.2061184
5621 7320. 0.2060405
5622 7321. 0.2059446
5623 7322. 0.2058487
5624 7323. 0.2057621
5625 7324. 0.2056758
5626 7325. 0.2055894
5627 7326. 0.2055031
5628 7327. 0.2054168
5629 7328. 0.2053305
5630 7329. 0.2052443
5631 7330. 0.205158
5632 7331. 0.20509
5633 7332. 0.205022
5634 7333. 0.204954
5635 7334. 0.2048859
5636 7335. 0.2048181
5637 7336. 0.2047501
5638 7337. 0.2046821
5639 7338. 0.2046142
5640 7339. 0.2045462
5641 7340. 0.2044783
5642 7341. 0.2043925
5643 7342. 0.2043067
5644 7343. 0.2042182
5645 7344. 0.2041296
5646 7345. 0.2040412
5647 7346. 0.2039527
5648 7347. 0.2038642
5649 7348. 0.2037758
5650 7349. 0.2036874
5651 7350. 0.203599
5652 7351. 0.2035285
5653 7352. 0.2034582
5654 7353. 0.2033879
5655 7354. 0.2033175
5656 7355. 0.2032472
5657 7356. 0.2031769
5658 7357. 0.2031066
5659 7358. 0.2030363
5660 7359. 0.202966
5661 7360. 0.2028958
5662 7361. 0.2028077
5663 7362. 0.2027198
5664 7363. 0.2026317
5665 7364. 0.2025437
5666 7365. 0.2024558
5667 7366. 0.2023679
5668 7367. 0.20228
5669 7368. 0.2021921
5670 7369. 0.2021043
5671 7370. 0.2020165
5672 7371. 0.2019465
5673 7372. 0.2018766
5674 7373. 0.2018067
5675 7374. 0.2017368
5676 7375. 0.201667
5677 7376. 0.2015971
5678 7377. 0.2015273
5679 7378. 0.2014575
5680 7379. 0.2013876
5681 7380. 0.2013179
5682 7381. 0.2012305
5683 7382. 0.201143
5684 7383. 0.2010484
5685 7384. 0.2009536
5686 7385. 0.2008588
5687 7386. 0.2007641
5688 7387. 0.2006694
5689 7388. 0.2005748
5690 7389. 0.2004801
5691 7390. 0.2003856
5692 7391. 0.2003088
5693 7392. 0.2002321
5694 7393. 0.2001553
5695 7394. 0.2000786
5696 7395. 0.2000018
5697 7396. 0.1999251
5698 7397. 0.1998485
5699 7398. 0.1997719
5700 7399. 0.1996952
5701 7400. 0.1996187
5702 7401. 0.1995246
5703 7402. 0.1994305
5704 7403. 0.1993421
5705 7404. 0.1992539
5706 7405. 0.1991657
5707 7406. 0.1990776
5708 7407. 0.1989895
5709 7408. 0.1989014
5710 7409. 0.1988134
5711 7410. 0.1987254
5712 7411. 0.1986551
5713 7412. 0.1985847
5714 7413. 0.1985144
5715 7414. 0.1984441
5716 7415. 0.1983739
5717 7416. 0.1983036
5718 7417. 0.1982334
5719 7418. 0.1981631
5720 7419. 0.1980929
5721 7420. 0.1980228
5722 7421. 0.1979351
5723 7422. 0.1978476
5724 7423. 0.1977552
5725 7424. 0.1976627
5726 7425. 0.1975702
5727 7426. 0.1974777
5728 7427. 0.1973853
5729 7428. 0.1972928
5730 7429. 0.1972004
5731 7430. 0.1971081
5732 7431. 0.1970436
5733 7432. 0.196979
5734 7433. 0.1969145
5735 7434. 0.19685
5736 7435. 0.1967855
5737 7436. 0.196721
5738 7437. 0.1966565
5739 7438. 0.1965921
5740 7439. 0.1965276
5741 7440. 0.1964632
5742 7441. 0.1963814
5743 7442. 0.1962997
5744 7443. 0.1962241
5745 7444. 0.1961488
5746 7445. 0.1960734
5747 7446. 0.1959982
5748 7447. 0.1959229
5749 7448. 0.1958477
5750 7449. 0.1957724
5751 7450. 0.1956973
5752 7451. 0.1956394
5753 7452. 0.1955816
5754 7453. 0.1955238
5755 7454. 0.1954661
5756 7455. 0.1954082
5757 7456. 0.1953505
5758 7457. 0.1952927
5759 7458. 0.195235
5760 7459. 0.1951772
5761 7460. 0.1951195
5762 7461. 0.1950445
5763 7462. 0.1949694
5764 7463. 0.1948963
5765 7464. 0.1948231
5766 7465. 0.1947501
5767 7466. 0.1946771
5768 7467. 0.194604
5769 7468. 0.194531
5770 7469. 0.194458
5771 7470. 0.194385
5772 7471. 0.1943293
5773 7472. 0.1942735
5774 7473. 0.1942177
5775 7474. 0.194162
5776 7475. 0.1941063
5777 7476. 0.1940506
5778 7477. 0.1939949
5779 7478. 0.1939392
5780 7479. 0.1938834
5781 7480. 0.1938278
5782 7481. 0.1937551
5783 7482. 0.1936825
5784 7483. 0.1936069
5785 7484. 0.1935311
5786 7485. 0.1934554
5787 7486. 0.1933797
5788 7487. 0.193304
5789 7488. 0.1932283
5790 7489. 0.1931527
5791 7490. 0.193077
5792 7491. 0.1930189
5793 7492. 0.1929608
5794 7493. 0.1929027
5795 7494. 0.1928446
5796 7495. 0.1927866
5797 7496. 0.1927285
5798 7497. 0.1926704
5799 7498. 0.1926124
5800 7499. 0.1925544
5801 7500. 0.1924964
5802 7501. 0.1923976
5803 7502. 0.1922988
5804 7503. 0.1922006
5805 7504. 0.1921025
5806 7505. 0.1920044
5807 7506. 0.1919063
5808 7507. 0.1918083
5809 7508. 0.1917103
5810 7509. 0.1916122
5811 7510. 0.1915144
5812 7511. 0.1914338
5813 7512. 0.1913532
5814 7513. 0.1912726
5815 7514. 0.1911921
5816 7515. 0.1911115
5817 7516. 0.191031
5818 7517. 0.1909505
5819 7518. 0.19087
5820 7519. 0.1907895
5821 7520. 0.190709
5822 7521. 0.1906119
5823 7522. 0.1905148
5824 7523. 0.1904153
5825 7524. 0.1903155
5826 7525. 0.1902158
5827 7526. 0.1901162
5828 7527. 0.1900165
5829 7528. 0.1899169
5830 7529. 0.1898173
5831 7530. 0.1897178
5832 7531. 0.1896353
5833 7532. 0.1895527
5834 7533. 0.1894702
5835 7534. 0.1893877
5836 7535. 0.1893053
5837 7536. 0.1892228
5838 7537. 0.1891403
5839 7538. 0.1890578
5840 7539. 0.1889754
5841 7540. 0.188893
5842 7541. 0.1887939
5843 7542. 0.1886949
5844 7543. 0.1885922
5845 7544. 0.1884893
5846 7545. 0.1883865
5847 7546. 0.1882836
5848 7547. 0.1881808
5849 7548. 0.1880781
5850 7549. 0.1879754
5851 7550. 0.1878727
5852 7551. 0.1877867
5853 7552. 0.1877008
5854 7553. 0.1876149
5855 7554. 0.187529
5856 7555. 0.1874432
5857 7556. 0.1873573
5858 7557. 0.1872715
5859 7558. 0.1871857
5860 7559. 0.1870999
5861 7560. 0.1870141
5862 7561. 0.1869117
5863 7562. 0.1868094
5864 7563. 0.1867168
5865 7564. 0.1866252
5866 7565. 0.1865336
5867 7566. 0.1864419
5868 7567. 0.1863504
5869 7568. 0.1862587
5870 7569. 0.1861672
5871 7570. 0.1860757
5872 7571. 0.1860008
5873 7572. 0.185926
5874 7573. 0.1858511
5875 7574. 0.1857762
5876 7575. 0.1857014
5877 7576. 0.1856266
5878 7577. 0.1855517
5879 7578. 0.1854768
5880 7579. 0.185402
5881 7580. 0.1853273
5882 7581. 0.185236
5883 7582. 0.1851447
5884 7583. 0.1850513
5885 7584. 0.1849577
5886 7585. 0.184864
5887 7586. 0.1847704
5888 7587. 0.1846769
5889 7588. 0.1845833
5890 7589. 0.1844899
5891 7590. 0.1843964
5892 7591. 0.1843194
5893 7592. 0.1842424
5894 7593. 0.1841654
5895 7594. 0.1840884
5896 7595. 0.1840114
5897 7596. 0.1839345
5898 7597. 0.1838576
5899 7598. 0.1837807
5900 7599. 0.1837037
5901 7600. 0.1836269
5902 7601. 0.1835336
5903 7602. 0.1834404
5904 7603. 0.1833458
5905 7604. 0.1832508
5906 7605. 0.183156
5907 7606. 0.1830613
5908 7607. 0.1829665
5909 7608. 0.1828717
5910 7609. 0.1827771
5911 7610. 0.1826824
5912 7611. 0.1825878
5913 7612. 0.1824932
5914 7613. 0.1823987
5915 7614. 0.1823041
5916 7615. 0.1822096
5917 7616. 0.1821151
5918 7617. 0.1820206
5919 7618. 0.1819262
5920 7619. 0.1818318
5921 7620. 0.1817374
5922 7621. 0.1816593
5923 7622. 0.1815811
5924 7623. 0.181505
5925 7624. 0.1814292
5926 7625. 0.1813534
5927 7626. 0.1812775
5928 7627. 0.1812017
5929 7628. 0.1811259
5930 7629. 0.18105
5931 7630. 0.1809743
5932 7631. 0.1808622
5933 7632. 0.1807502
5934 7633. 0.1806381
5935 7634. 0.1805263
5936 7635. 0.1804143
5937 7636. 0.1803025
5938 7637. 0.1801907
5939 7638. 0.1800789
5940 7639. 0.1799673
5941 7640. 0.1798556
5942 7641. 0.1797601
5943 7642. 0.1796645
5944 7643. 0.1795657
5945 7644. 0.1794667
5946 7645. 0.1793677
5947 7646. 0.1792686
5948 7647. 0.1791697
5949 7648. 0.1790707
5950 7649. 0.1789719
5951 7650. 0.178873
5952 7651. 0.1787583
5953 7652. 0.1786435
5954 7653. 0.1785288
5955 7654. 0.1784142
5956 7655. 0.1782997
5957 7656. 0.1781852
5958 7657. 0.1780707
5959 7658. 0.1779563
5960 7659. 0.1778418
5961 7660. 0.1777276
5962 7661. 0.1776292
5963 7662. 0.1775308
5964 7663. 0.1774334
5965 7664. 0.1773362
5966 7665. 0.177239
5967 7666. 0.1771418
5968 7667. 0.1770447
5969 7668. 0.1769475
5970 7669. 0.1768504
5971 7670. 0.1767534
5972 7671. 0.1766406
5973 7672. 0.1765278
5974 7673. 0.1764151
5975 7674. 0.1763024
5976 7675. 0.1761898
5977 7676. 0.1760773
5978 7677. 0.1759647
5979 7678. 0.1758522
5980 7679. 0.1757399
5981 7680. 0.1756275
5982 7681. 0.1755309
5983 7682. 0.1754343
5984 7683. 0.1753346
5985 7684. 0.1752346
5986 7685. 0.1751346
5987 7686. 0.1750346
5988 7687. 0.1749346
5989 7688. 0.1748347
5990 7689. 0.1747348
5991 7690. 0.174635
5992 7691. 0.1745196
5993 7692. 0.1744042
5994 7693. 0.1742889
5995 7694. 0.1741737
5996 7695. 0.1740585
5997 7696. 0.1739433
5998 7697. 0.1738282
5999 7698. 0.1737131
6000 7699. 0.1735982
6001 7700. 0.1734832
6002 7701. 0.1733684
6003 7702. 0.1732535
6004 7703. 0.1731407
6005 7704. 0.173028
6006 7705. 0.1729155
6007 7706. 0.172803
6008 7707. 0.1726906
6009 7708. 0.1725781
6010 7709. 0.1724658
6011 7710. 0.1723535
6012 7711. 0.1722566
6013 7712. 0.1721599
6014 7713. 0.1720633
6015 7714. 0.1719665
6016 7715. 0.1718699
6017 7716. 0.1717732
6018 7717. 0.1716767
6019 7718. 0.1715801
6020 7719. 0.1714835
6021 7720. 0.1713871
6022 7721. 0.1712752
6023 7722. 0.1711635
6024 7723. 0.1710516
6025 7724. 0.1709398
6026 7725. 0.1708279
6027 7726. 0.1707162
6028 7727. 0.1706044
6029 7728. 0.1704927
6030 7729. 0.1703811
6031 7730. 0.1702696
6032 7731. 0.1701733
6033 7732. 0.1700771
6034 7733. 0.1699809
6035 7734. 0.1698848
6036 7735. 0.1697888
6037 7736. 0.1696926
6038 7737. 0.1695967
6039 7738. 0.1695006
6040 7739. 0.1694046
6041 7740. 0.1693087
6042 7741. 0.1691975
6043 7742. 0.1690866
6044 7743. 0.168977
6045 7744. 0.1688677
6046 7745. 0.1687585
6047 7746. 0.1686493
6048 7747. 0.1685402
6049 7748. 0.1684311
6050 7749. 0.1683221
6051 7750. 0.168213
6052 7751. 0.1681191
6053 7752. 0.1680254
6054 7753. 0.1679316
6055 7754. 0.1678378
6056 7755. 0.1677441
6057 7756. 0.1676504
6058 7757. 0.1675568
6059 7758. 0.1674632
6060 7759. 0.1673695
6061 7760. 0.167276
6062 7761. 0.1671674
6063 7762. 0.1670589
6064 7763. 0.1669559
6065 7764. 0.1668537
6066 7765. 0.1667514
6067 7766. 0.1666492
6068 7767. 0.1665471
6069 7768. 0.166445
6070 7769. 0.166343
6071 7770. 0.166241
6072 7771. 0.1661391
6073 7772. 0.1660371
6074 7773. 0.1659353
6075 7774. 0.1658335
6076 7775. 0.1657317
6077 7776. 0.1656299
6078 7777. 0.1655281
6079 7778. 0.1654265
6080 7779. 0.1653248
6081 7780. 0.1652232
6082 7781. 0.1651366
6083 7782. 0.1650499
6084 7783. 0.1649563
6085 7784. 0.1648615
6086 7785. 0.1647669
6087 7786. 0.1646722
6088 7787. 0.1645777
6089 7788. 0.1644831
6090 7789. 0.1643885
6091 7790. 0.1642939
6092 7791. 0.1641847
6093 7792. 0.1640755
6094 7793. 0.1639664
6095 7794. 0.1638573
6096 7795. 0.1637482
6097 7796. 0.1636392
6098 7797. 0.1635302
6099 7798. 0.1634213
6100 7799. 0.1633124
6101 7800. 0.1632037
6102 7801. 0.1631096
6103 7802. 0.1630156
6104 7803. 0.1629186
6105 7804. 0.162821
6106 7805. 0.1627235
6107 7806. 0.1626261
6108 7807. 0.1625287
6109 7808. 0.1624312
6110 7809. 0.1623339
6111 7810. 0.1622366
6112 7811. 0.1621246
6113 7812. 0.1620128
6114 7813. 0.1619011
6115 7814. 0.1617894
6116 7815. 0.1616776
6117 7816. 0.161566
6118 7817. 0.1614544
6119 7818. 0.1613429
6120 7819. 0.1612314
6121 7820. 0.16112
6122 7821. 0.1610232
6123 7822. 0.1609264
6124 7823. 0.1608369
6125 7824. 0.1607488
6126 7825. 0.1606607
6127 7826. 0.1605725
6128 7827. 0.1604844
6129 7828. 0.1603963
6130 7829. 0.1603082
6131 7830. 0.1602202
6132 7831. 0.160133
6133 7832. 0.1600458
6134 7833. 0.1599585
6135 7834. 0.1598714
6136 7835. 0.1597842
6137 7836. 0.1596971
6138 7837. 0.15961
6139 7838. 0.1595229
6140 7839. 0.1594359
6141 7840. 0.1593489
6142 7841. 0.1592619
6143 7842. 0.1591749
6144 7843. 0.1590859
6145 7844. 0.1589966
6146 7845. 0.1589073
6147 7846. 0.1588181
6148 7847. 0.1587288
6149 7848. 0.1586396
6150 7849. 0.1585504
6151 7850. 0.1584612
6152 7851. 0.1583865
6153 7852. 0.1583117
6154 7853. 0.1582369
6155 7854. 0.1581621
6156 7855. 0.1580874
6157 7856. 0.1580126
6158 7857. 0.157938
6159 7858. 0.1578632
6160 7859. 0.1577886
6161 7860. 0.1577139
6162 7861. 0.157625
6163 7862. 0.1575361
6164 7863. 0.1574443
6165 7864. 0.157352
6166 7865. 0.1572597
6167 7866. 0.1571675
6168 7867. 0.1570752
6169 7868. 0.156983
6170 7869. 0.1568908
6171 7870. 0.1567987
6172 7871. 0.1567208
6173 7872. 0.1566429
6174 7873. 0.156565
6175 7874. 0.1564872
6176 7875. 0.1564093
6177 7876. 0.1563314
6178 7877. 0.1562536
6179 7878. 0.1561758
6180 7879. 0.1560981
6181 7880. 0.1560203
6182 7881. 0.1559285
6183 7882. 0.1558367
6184 7883. 0.1557495
6185 7884. 0.1556634
6186 7885. 0.1555771
6187 7886. 0.155491
6188 7887. 0.1554047
6189 7888. 0.1553187
6190 7889. 0.1552325
6191 7890. 0.1551465
6192 7891. 0.1550605
6193 7892. 0.1549745
6194 7893. 0.1548885
6195 7894. 0.1548025
6196 7895. 0.1547166
6197 7896. 0.1546307
6198 7897. 0.1545448
6199 7898. 0.1544589
6200 7899. 0.1543731
6201 7900. 0.1542873
6202 7901. 0.1542155
6203 7902. 0.1541437
6204 7903. 0.1540713
6205 7904. 0.1539988
6206 7905. 0.1539262
6207 7906. 0.1538537
6208 7907. 0.1537811
6209 7908. 0.1537087
6210 7909. 0.1536362
6211 7910. 0.1535637
6212 7911. 0.1534773
6213 7912. 0.153391
6214 7913. 0.1533047
6215 7914. 0.1532184
6216 7915. 0.1531323
6217 7916. 0.153046
6218 7917. 0.1529598
6219 7918. 0.1528736
6220 7919. 0.1527875
6221 7920. 0.1527014
6222 7921. 0.1526292
6223 7922. 0.152557
6224 7923. 0.1524875
6225 7924. 0.1524186
6226 7925. 0.1523497
6227 7926. 0.1522808
6228 7927. 0.1522119
6229 7928. 0.152143
6230 7929. 0.1520742
6231 7930. 0.1520054
6232 7931. 0.1519228
6233 7932. 0.1518402
6234 7933. 0.1517577
6235 7934. 0.1516752
6236 7935. 0.1515927
6237 7936. 0.1515103
6238 7937. 0.1514278
6239 7938. 0.1513454
6240 7939. 0.151263
6241 7940. 0.1511807
6242 7941. 0.1510985
6243 7942. 0.1510162
6244 7943. 0.1509278
6245 7944. 0.150838
6246 7945. 0.1507483
6247 7946. 0.1506587
6248 7947. 0.150569
6249 7948. 0.1504793
6250 7949. 0.1503897
6251 7950. 0.1503001
6252 7951. 0.1502243
6253 7952. 0.1501485
6254 7953. 0.1500727
6255 7954. 0.149997
6256 7955. 0.1499212
6257 7956. 0.1498455
6258 7957. 0.1497697
6259 7958. 0.1496941
6260 7959. 0.1496184
6261 7960. 0.1495428
6262 7961. 0.1494535
6263 7962. 0.1493644
6264 7963. 0.1492756
6265 7964. 0.1491869
6266 7965. 0.1490982
6267 7966. 0.1490096
6268 7967. 0.148921
6269 7968. 0.1488324
6270 7969. 0.1487439
6271 7970. 0.1486554
6272 7971. 0.1485672
6273 7972. 0.1484789
6274 7973. 0.1483907
6275 7974. 0.1483025
6276 7975. 0.1482143
6277 7976. 0.1481263
6278 7977. 0.1480381
6279 7978. 0.1479501
6280 7979. 0.1478621
6281 7980. 0.1477741
6282 7981. 0.1477008
6283 7982. 0.1476275
6284 7983. 0.1475586
6285 7984. 0.1474907
6286 7985. 0.1474229
6287 7986. 0.1473549
6288 7987. 0.1472871
6289 7988. 0.1472192
6290 7989. 0.1471514
6291 7990. 0.1470836
6292 7991. 0.1470048
6293 7992. 0.1469261
6294 7993. 0.1468474
6295 7994. 0.1467688
6296 7995. 0.1466901
6297 7996. 0.1466115
6298 7997. 0.1465328
6299 7998. 0.1464543
6300 7999. 0.1463757
6301 8000. 0.1462972
6302 8001. 0.1462281
6303 8002. 0.1461591
6304 8003. 0.1460874
6305 8004. 0.1460149
6306 8005. 0.1459426
6307 8006. 0.1458702
6308 8007. 0.1457977
6309 8008. 0.1457254
6310 8009. 0.1456531
6311 8010. 0.1455807
6312 8011. 0.1454969
6313 8012. 0.1454132
6314 8013. 0.1453295
6315 8014. 0.1452458
6316 8015. 0.1451622
6317 8016. 0.1450785
6318 8017. 0.1449948
6319 8018. 0.1449112
6320 8019. 0.1448276
6321 8020. 0.1447441
6322 8021. 0.1446614
6323 8022. 0.1445789
6324 8023. 0.1444989
6325 8024. 0.1444198
6326 8025. 0.1443405
6327 8026. 0.1442613
6328 8027. 0.1441821
6329 8028. 0.1441029
6330 8029. 0.1440237
6331 8030. 0.1439447
6332 8031. 0.1438806
6333 8032. 0.1438166
6334 8033. 0.1437527
6335 8034. 0.1436887
6336 8035. 0.1436247
6337 8036. 0.1435607
6338 8037. 0.1434967
6339 8038. 0.1434328
6340 8039. 0.1433688
6341 8040. 0.1433048
6342 8041. 0.1432279
6343 8042. 0.1431511
6344 8043. 0.1430716
6345 8044. 0.1429914
6346 8045. 0.1429112
6347 8046. 0.142831
6348 8047. 0.1427507
6349 8048. 0.1426706
6350 8049. 0.1425904
6351 8050. 0.1425103
6352 8051. 0.1424302
6353 8052. 0.1423502
6354 8053. 0.1422701
6355 8054. 0.1421902
6356 8055. 0.1421102
6357 8056. 0.1420302
6358 8057. 0.1419502
6359 8058. 0.1418702
6360 8059. 0.1417903
6361 8060. 0.1417104
6362 8061. 0.1416435
6363 8062. 0.1415765
6364 8063. 0.1415096
6365 8064. 0.1414426
6366 8065. 0.1413756
6367 8066. 0.1413087
6368 8067. 0.1412417
6369 8068. 0.1411748
6370 8069. 0.1411078
6371 8070. 0.1410409
6372 8071. 0.1409611
6373 8072. 0.1408813
6374 8073. 0.1408016
6375 8074. 0.1407218
6376 8075. 0.1406421
6377 8076. 0.1405624
6378 8077. 0.1404827
6379 8078. 0.140403
6380 8079. 0.1403234
6381 8080. 0.1402438
6382 8081. 0.1401642
6383 8082. 0.1400846
6384 8083. 0.1400066
6385 8084. 0.139929
6386 8085. 0.1398514
6387 8086. 0.1397739
6388 8087. 0.1396963
6389 8088. 0.1396188
6390 8089. 0.1395412
6391 8090. 0.1394638
6392 8091. 0.139399
6393 8092. 0.1393342
6394 8093. 0.1392696
6395 8094. 0.1392048
6396 8095. 0.1391401
6397 8096. 0.1390754
6398 8097. 0.1390107
6399 8098. 0.138946
6400 8099. 0.1388812
6401 8100. 0.1388165
6402 8101. 0.1387392
6403 8102. 0.1386618
6404 8103. 0.1385833
6405 8104. 0.1385044
6406 8105. 0.1384256
6407 8106. 0.1383468
6408 8107. 0.1382679
6409 8108. 0.1381892
6410 8109. 0.1381105
6411 8110. 0.1380317
6412 8111. 0.137953
6413 8112. 0.1378742
6414 8113. 0.1377955
6415 8114. 0.1377168
6416 8115. 0.1376382
6417 8116. 0.1375595
6418 8117. 0.1374808
6419 8118. 0.1374022
6420 8119. 0.1373236
6421 8120. 0.137245
6422 8121. 0.137179
6423 8122. 0.1371131
6424 8123. 0.1370452
6425 8124. 0.1369769
6426 8125. 0.1369085
6427 8126. 0.1368401
6428 8127. 0.1367718
6429 8128. 0.1367034
6430 8129. 0.1366351
6431 8130. 0.1365667
6432 8131. 0.1364859
6433 8132. 0.136405
6434 8133. 0.1363242
6435 8134. 0.1362434
6436 8135. 0.1361626
6437 8136. 0.1360819
6438 8137. 0.1360011
6439 8138. 0.1359204
6440 8139. 0.1358397
6441 8140. 0.135759
6442 8141. 0.1356784
6443 8142. 0.1355978
6444 8143. 0.1355223
6445 8144. 0.1354485
6446 8145. 0.1353748
6447 8146. 0.1353011
6448 8147. 0.1352274
6449 8148. 0.1351536
6450 8149. 0.13508
6451 8150. 0.1350063
6452 8151. 0.1349451
6453 8152. 0.1348838
6454 8153. 0.1348226
6455 8154. 0.1347613
6456 8155. 0.1347001
6457 8156. 0.1346389
6458 8157. 0.1345776
6459 8158. 0.1345164
6460 8159. 0.1344552
6461 8160. 0.1343939
6462 8161. 0.1343204
6463 8162. 0.1342468
6464 8163. 0.1341709
6465 8164. 0.1340943
6466 8165. 0.1340178
6467 8166. 0.1339411
6468 8167. 0.1338645
6469 8168. 0.1337879
6470 8169. 0.1337114
6471 8170. 0.1336349
6472 8171. 0.1335584
6473 8172. 0.1334819
6474 8173. 0.1334053
6475 8174. 0.1333289
6476 8175. 0.1332524
6477 8176. 0.1331759
6478 8177. 0.1330995
6479 8178. 0.133023
6480 8179. 0.1329467
6481 8180. 0.1328703
6482 8181. 0.1328062
6483 8182. 0.132742
6484 8183. 0.132677
6485 8184. 0.1326118
6486 8185. 0.1325465
6487 8186. 0.1324812
6488 8187. 0.132416
6489 8188. 0.1323507
6490 8189. 0.1322855
6491 8190. 0.1322202
6492 8191. 0.1321428
6493 8192. 0.1320654
6494 8193. 0.1319881
6495 8194. 0.1319107
6496 8195. 0.1318334
6497 8196. 0.131756
6498 8197. 0.1316787
6499 8198. 0.1316015
6500 8199. 0.1315242
6501 8200. 0.131447
6502 8201. 0.1313716
6503 8202. 0.1312962
6504 8203. 0.1312238
6505 8204. 0.1311524
6506 8205. 0.131081
6507 8206. 0.1310097
6508 8207. 0.1309383
6509 8208. 0.130867
6510 8209. 0.1307957
6511 8210. 0.1307244
6512 8211. 0.1306652
6513 8212. 0.130606
6514 8213. 0.1305468
6515 8214. 0.1304875
6516 8215. 0.1304283
6517 8216. 0.1303691
6518 8217. 0.1303099
6519 8218. 0.1302507
6520 8219. 0.1301914
6521 8220. 0.1301322
6522 8221. 0.130061
6523 8222. 0.1299898
6524 8223. 0.1299178
6525 8224. 0.1298456
6526 8225. 0.1297733
6527 8226. 0.1297011
6528 8227. 0.1296289
6529 8228. 0.1295567
6530 8229. 0.1294845
6531 8230. 0.1294123
6532 8231. 0.1293477
6533 8232. 0.1292832
6534 8233. 0.1292186
6535 8234. 0.129154
6536 8235. 0.1290895
6537 8236. 0.1290249
6538 8237. 0.1289603
6539 8238. 0.1288958
6540 8239. 0.1288313
6541 8240. 0.1287667
6542 8241. 0.1287141
6543 8242. 0.1286614
6544 8243. 0.1286079
6545 8244. 0.128554
6546 8245. 0.1285
6547 8246. 0.1284461
6548 8247. 0.1283922
6549 8248. 0.1283383
6550 8249. 0.1282844
6551 8250. 0.1282304
6552 8251. 0.1281646
6553 8252. 0.1280988
6554 8253. 0.128033
6555 8254. 0.1279673
6556 8255. 0.1279015
6557 8256. 0.1278358
6558 8257. 0.12777
6559 8258. 0.1277042
6560 8259. 0.1276385
6561 8260. 0.1275727
6562 8261. 0.1275069
6563 8262. 0.1274412
6564 8263. 0.1273755
6565 8264. 0.1273099
6566 8265. 0.1272443
6567 8266. 0.1271787
6568 8267. 0.1271131
6569 8268. 0.1270474
6570 8269. 0.1269818
6571 8270. 0.1269162
6572 8271. 0.1268624
6573 8272. 0.1268086
6574 8273. 0.1267547
6575 8274. 0.1267009
6576 8275. 0.126647
6577 8276. 0.1265932
6578 8277. 0.1265393
6579 8278. 0.1264855
6580 8279. 0.1264316
6581 8280. 0.1263777
6582 8281. 0.1263121
6583 8282. 0.1262466
6584 8283. 0.1261804
6585 8284. 0.126114
6586 8285. 0.1260475
6587 8286. 0.1259811
6588 8287. 0.1259147
6589 8288. 0.1258482
6590 8289. 0.1257818
6591 8290. 0.1257154
6592 8291. 0.125649
6593 8292. 0.1255826
6594 8293. 0.1255162
6595 8294. 0.1254498
6596 8295. 0.1253834
6597 8296. 0.125317
6598 8297. 0.1252506
6599 8298. 0.1251843
6600 8299. 0.1251179
6601 8300. 0.1250515
6602 8301. 0.1249852
6603 8302. 0.1249189
6604 8303. 0.1248526
6605 8304. 0.1247865
6606 8305. 0.1247202
6607 8306. 0.1246541
6608 8307. 0.1245879
6609 8308. 0.1245217
6610 8309. 0.1244556
6611 8310. 0.1243894
6612 8311. 0.1243348
6613 8312. 0.1242802
6614 8313. 0.1242256
6615 8314. 0.124171
6616 8315. 0.1241163
6617 8316. 0.1240617
6618 8317. 0.124007
6619 8318. 0.1239524
6620 8319. 0.1238978
6621 8320. 0.1238432
6622 8321. 0.123777
6623 8322. 0.1237108
6624 8323. 0.1236481
6625 8324. 0.123587
6626 8325. 0.1235258
6627 8326. 0.1234646
6628 8327. 0.1234034
6629 8328. 0.1233422
6630 8329. 0.1232809
6631 8330. 0.1232198
6632 8331. 0.1231586
6633 8332. 0.1230974
6634 8333. 0.1230362
6635 8334. 0.122975
6636 8335. 0.1229138
6637 8336. 0.1228526
6638 8337. 0.1227915
6639 8338. 0.1227303
6640 8339. 0.1226691
6641 8340. 0.122608
6642 8341. 0.1225582
6643 8342. 0.1225084
6644 8343. 0.1224558
6645 8344. 0.1224022
6646 8345. 0.1223486
6647 8346. 0.122295
6648 8347. 0.1222413
6649 8348. 0.1221877
6650 8349. 0.122134
6651 8350. 0.1220804
6652 8351. 0.1220154
6653 8352. 0.1219504
6654 8353. 0.1218854
6655 8354. 0.1218204
6656 8355. 0.1217554
6657 8356. 0.1216905
6658 8357. 0.1216255
6659 8358. 0.1215605
6660 8359. 0.1214956
6661 8360. 0.1214306
6662 8361. 0.1213656
6663 8362. 0.1213007
6664 8363. 0.1212353
6665 8364. 0.1211697
6666 8365. 0.1211042
6667 8366. 0.1210387
6668 8367. 0.1209731
6669 8368. 0.1209076
6670 8369. 0.120842
6671 8370. 0.1207765
6672 8371. 0.120711
6673 8372. 0.1206454
6674 8373. 0.1205798
6675 8374. 0.1205144
6676 8375. 0.1204488
6677 8376. 0.1203834
6678 8377. 0.1203178
6679 8378. 0.1202523
6680 8379. 0.1201867
6681 8380. 0.1201212
6682 8381. 0.120067
6683 8382. 0.1200127
6684 8383. 0.1199584
6685 8384. 0.1199041
6686 8385. 0.1198497
6687 8386. 0.1197954
6688 8387. 0.1197411
6689 8388. 0.1196867
6690 8389. 0.1196324
6691 8390. 0.1195781
6692 8391. 0.1195125
6693 8392. 0.119447
6694 8393. 0.1193815
6695 8394. 0.119316
6696 8395. 0.1192506
6697 8396. 0.1191851
6698 8397. 0.1191196
6699 8398. 0.1190541
6700 8399. 0.1189887
6701 8400. 0.1189232
6702 8401. 0.1188663
6703 8402. 0.1188093
6704 8403. 0.1187501
6705 8404. 0.1186899
6706 8405. 0.1186297
6707 8406. 0.1185694
6708 8407. 0.1185092
6709 8408. 0.118449
6710 8409. 0.1183887
6711 8410. 0.1183285
6712 8411. 0.1182793
6713 8412. 0.1182301
6714 8413. 0.1181809
6715 8414. 0.1181317
6716 8415. 0.1180825
6717 8416. 0.1180333
6718 8417. 0.117984
6719 8418. 0.1179347
6720 8419. 0.1178855
6721 8420. 0.1178362
6722 8421. 0.117776
6723 8422. 0.1177157
6724 8423. 0.1176591
6725 8424. 0.1176043
6726 8425. 0.1175496
6727 8426. 0.1174947
6728 8427. 0.1174399
6729 8428. 0.117385
6730 8429. 0.1173302
6731 8430. 0.1172753
6732 8431. 0.1172313
6733 8432. 0.1171873
6734 8433. 0.1171432
6735 8434. 0.1170991
6736 8435. 0.117055
6737 8436. 0.117011
6738 8437. 0.1169668
6739 8438. 0.1169227
6740 8439. 0.1168786
6741 8440. 0.1168344
6742 8441. 0.1167902
6743 8442. 0.116746
6744 8443. 0.1167006
6745 8444. 0.1166547
6746 8445. 0.1166087
6747 8446. 0.1165627
6748 8447. 0.1165167
6749 8448. 0.1164707
6750 8449. 0.1164247
6751 8450. 0.1163786
6752 8451. 0.1163435
6753 8452. 0.1163084
6754 8453. 0.1162732
6755 8454. 0.116238
6756 8455. 0.1162028
6757 8456. 0.1161676
6758 8457. 0.1161323
6759 8458. 0.116097
6760 8459. 0.1160617
6761 8460. 0.1160265
6762 8461. 0.1159803
6763 8462. 0.115934
6764 8463. 0.1158878
6765 8464. 0.1158416
6766 8465. 0.1157954
6767 8466. 0.1157493
6768 8467. 0.115703
6769 8468. 0.1156568
6770 8469. 0.1156105
6771 8470. 0.1155642
6772 8471. 0.115518
6773 8472. 0.1154718
6774 8473. 0.1154255
6775 8474. 0.1153792
6776 8475. 0.1153329
6777 8476. 0.1152866
6778 8477. 0.1152403
6779 8478. 0.115194
6780 8479. 0.1151476
6781 8480. 0.1151012
6782 8481. 0.115055
6783 8482. 0.1150088
6784 8483. 0.1149622
6785 8484. 0.1149155
6786 8485. 0.1148688
6787 8486. 0.114822
6788 8487. 0.1147752
6789 8488. 0.1147285
6790 8489. 0.1146817
6791 8490. 0.1146349
6792 8491. 0.1145991
6793 8492. 0.1145633
6794 8493. 0.1145275
6795 8494. 0.1144917
6796 8495. 0.1144559
6797 8496. 0.11442
6798 8497. 0.1143842
6799 8498. 0.1143482
6800 8499. 0.1143123
6801 8500. 0.1142764
6802 8501. 0.1142102
6803 8502. 0.114144
6804 8503. 0.1140758
6805 8504. 0.1140065
6806 8505. 0.1139372
6807 8506. 0.113868
6808 8507. 0.1137987
6809 8508. 0.1137293
6810 8509. 0.11366
6811 8510. 0.1135907
6812 8511. 0.1135216
6813 8512. 0.1134525
6814 8513. 0.1133834
6815 8514. 0.1133143
6816 8515. 0.1132452
6817 8516. 0.113176
6818 8517. 0.1131068
6819 8518. 0.1130377
6820 8519. 0.1129685
6821 8520. 0.1128993
6822 8521. 0.1128301
6823 8522. 0.112761
6824 8523. 0.1126899
6825 8524. 0.1126176
6826 8525. 0.1125455
6827 8526. 0.1124733
6828 8527. 0.112401
6829 8528. 0.1123288
6830 8529. 0.1122566
6831 8530. 0.1121843
6832 8531. 0.1121226
6833 8532. 0.112061
6834 8533. 0.1119993
6835 8534. 0.1119375
6836 8535. 0.1118758
6837 8536. 0.111814
6838 8537. 0.1117522
6839 8538. 0.1116903
6840 8539. 0.1116285
6841 8540. 0.1115666
6842 8541. 0.1114943
6843 8542. 0.1114219
6844 8543. 0.1113508
6845 8544. 0.1112805
6846 8545. 0.1112102
6847 8546. 0.1111398
6848 8547. 0.1110695
6849 8548. 0.1109991
6850 8549. 0.1109287
6851 8550. 0.1108583
6852 8551. 0.1107879
6853 8552. 0.1107175
6854 8553. 0.110647
6855 8554. 0.1105766
6856 8555. 0.1105062
6857 8556. 0.1104357
6858 8557. 0.1103652
6859 8558. 0.1102947
6860 8559. 0.1102242
6861 8560. 0.1101536
6862 8561. 0.1100831
6863 8562. 0.1100125
6864 8563. 0.1099419
6865 8564. 0.1098713
6866 8565. 0.1098007
6867 8566. 0.10973
6868 8567. 0.1096594
6869 8568. 0.1095887
6870 8569. 0.1095181
6871 8570. 0.1094474
6872 8571. 0.1093871
6873 8572. 0.1093267
6874 8573. 0.1092663
6875 8574. 0.1092058
6876 8575. 0.1091454
6877 8576. 0.1090849
6878 8577. 0.1090244
6879 8578. 0.1089639
6880 8579. 0.1089033
6881 8580. 0.1088427
6882 8581. 0.1087718
6883 8582. 0.1087009
6884 8583. 0.10863
6885 8584. 0.1085591
6886 8585. 0.1084882
6887 8586. 0.1084172
6888 8587. 0.1083462
6889 8588. 0.1082752
6890 8589. 0.1082043
6891 8590. 0.1081333
6892 8591. 0.1080622
6893 8592. 0.1079911
6894 8593. 0.1079201
6895 8594. 0.107849
6896 8595. 0.1077778
6897 8596. 0.1077067
6898 8597. 0.1076356
6899 8598. 0.1075645
6900 8599. 0.1074933
6901 8600. 0.1074222
6902 8601. 0.107351
6903 8602. 0.1072798
6904 8603. 0.1072103
6905 8604. 0.1071417
6906 8605. 0.1070732
6907 8606. 0.1070046
6908 8607. 0.106936
6909 8608. 0.1068673
6910 8609. 0.1067987
6911 8610. 0.10673
6912 8611. 0.1066715
6913 8612. 0.1066129
6914 8613. 0.1065543
6915 8614. 0.1064956
6916 8615. 0.106437
6917 8616. 0.1063783
6918 8617. 0.1063195
6919 8618. 0.1062608
6920 8619. 0.106202
6921 8620. 0.1061431
6922 8621. 0.1060742
6923 8622. 0.1060053
6924 8623. 0.105937
6925 8624. 0.1058692
6926 8625. 0.1058013
6927 8626. 0.1057333
6928 8627. 0.1056654
6929 8628. 0.1055974
6930 8629. 0.1055294
6931 8630. 0.1054614
6932 8631. 0.1054146
6933 8632. 0.1053678
6934 8633. 0.105321
6935 8634. 0.1052741
6936 8635. 0.1052271
6937 8636. 0.1051802
6938 8637. 0.1051331
6939 8638. 0.1050861
6940 8639. 0.1050389
6941 8640. 0.1049918
6942 8641. 0.1049446
6943 8642. 0.1048973
6944 8643. 0.1048494
6945 8644. 0.1048011
6946 8645. 0.1047528
6947 8646. 0.1047045
6948 8647. 0.104656
6949 8648. 0.1046076
6950 8649. 0.1045591
6951 8650. 0.1045105
6952 8651. 0.1044619
6953 8652. 0.1044132
6954 8653. 0.1043645
6955 8654. 0.1043158
6956 8655. 0.104267
6957 8656. 0.1042182
6958 8657. 0.1041693
6959 8658. 0.1041204
6960 8659. 0.1040714
6961 8660. 0.1040224
6962 8661. 0.1039832
6963 8662. 0.1039441
6964 8663. 0.1039046
6965 8664. 0.1038651
6966 8665. 0.1038256
6967 8666. 0.103786
6968 8667. 0.1037463
6969 8668. 0.1037066
6970 8669. 0.1036668
6971 8670. 0.1036271
6972 8671. 0.1035773
6973 8672. 0.1035276
6974 8673. 0.1034777
6975 8674. 0.1034279
6976 8675. 0.103378
6977 8676. 0.1033281
6978 8677. 0.1032781
6979 8678. 0.103228
6980 8679. 0.1031779
6981 8680. 0.1031278
6982 8681. 0.1030777
6983 8682. 0.1030275
6984 8683. 0.1029779
6985 8684. 0.1029289
6986 8685. 0.1028798
6987 8686. 0.1028306
6988 8687. 0.1027814
6989 8688. 0.1027322
6990 8689. 0.1026829
6991 8690. 0.1026335
6992 8691. 0.1025841
6993 8692. 0.1025347
6994 8693. 0.1024852
6995 8694. 0.1024357
6996 8695. 0.1023861
6997 8696. 0.1023365
6998 8697. 0.1022868
6999 8698. 0.1022371
7000 8699. 0.1021874
7001 8700. 0.1021376
7002 8701. 0.1020877
7003 8702. 0.1020378
7004 8703. 0.1019879
7005 8704. 0.1019379
7006 8705. 0.101888
7007 8706. 0.1018379
7008 8707. 0.1017879
7009 8708. 0.1017378
7010 8709. 0.1016876
7011 8710. 0.1016374
7012 8711. 0.1015969
7013 8712. 0.1015563
7014 8713. 0.1015157
7015 8714. 0.101475
7016 8715. 0.1014342
7017 8716. 0.1013935
7018 8717. 0.1013526
7019 8718. 0.1013117
7020 8719. 0.1012707
7021 8720. 0.1012297
7022 8721. 0.1011789
7023 8722. 0.1011281
7024 8723. 0.1010766
7025 8724. 0.1010246
7026 8725. 0.1009725
7027 8726. 0.1009205
7028 8727. 0.1008683
7029 8728. 0.1008161
7030 8729. 0.1007638
7031 8730. 0.1007116
7032 8731. 0.1006592
7033 8732. 0.1006068
7034 8733. 0.1005544
7035 8734. 0.1005019
7036 8735. 0.1004494
7037 8736. 0.1003969
7038 8737. 0.1003442
7039 8738. 0.1002916
7040 8739. 0.1002389
7041 8740. 0.1001861
7042 8741. 0.1001333
7043 8742. 0.1000805
7044 8743. 0.1000274
7045 8744. 0.09997403
7046 8745. 0.09992065
7047 8746. 0.09986725
7048 8747. 0.09981377
7049 8748. 0.09976026
7050 8749. 0.09970671
7051 8750. 0.0996531
7052 8751. 0.09959944
7053 8752. 0.09954575
7054 8753. 0.09949201
7055 8754. 0.09943822
7056 8755. 0.09938439
7057 8756. 0.09933051
7058 8757. 0.09927658
7059 8758. 0.09922262
7060 8759. 0.09916859
7061 8760. 0.09911451
7062 8761. 0.09906992
7063 8762. 0.09902521
7064 8763. 0.09898124
7065 8764. 0.09893771
7066 8765. 0.09889413
7067 8766. 0.09885051
7068 8767. 0.09880682
7069 8768. 0.09876308
7070 8769. 0.09871927
7071 8770. 0.09867542
7072 8771. 0.09862205
7073 8772. 0.09856866
7074 8773. 0.0985152
7075 8774. 0.09846173
7076 8775. 0.09840817
7077 8776. 0.09835459
7078 8777. 0.09830093
7079 8778. 0.09824725
7080 8779. 0.0981935
7081 8780. 0.09813972
7082 8781. 0.09808593
7083 8782. 0.09803203
7084 8783. 0.09797796
7085 8784. 0.09792372
7086 8785. 0.09786948
7087 8786. 0.09781516
7088 8787. 0.09776083
7089 8788. 0.09770641
7090 8789. 0.09765197
7091 8790. 0.09759747
7092 8791. 0.09754293
7093 8792. 0.09748834
7094 8793. 0.0974337
7095 8794. 0.09737901
7096 8795. 0.09732424
7097 8796. 0.09726946
7098 8797. 0.09721465
7099 8798. 0.09715977
7100 8799. 0.09710484
7101 8800. 0.09704988
7102 8801. 0.0969822
7103 8802. 0.09691453
7104 8803. 0.09684639
7105 8804. 0.0967779
7106 8805. 0.09670936
7107 8806. 0.09664082
7108 8807. 0.09657224
7109 8808. 0.09650364
7110 8809. 0.09643499
7111 8810. 0.09636634
7112 8811. 0.09630688
7113 8812. 0.09624743
7114 8813. 0.09618791
7115 8814. 0.09612837
7116 8815. 0.09606877
7117 8816. 0.09600911
7118 8817. 0.09594948
7119 8818. 0.09588974
7120 8819. 0.09582998
7121 8820. 0.09577019
7122 8821. 0.09570116
7123 8822. 0.09563208
7124 8823. 0.09556364
7125 8824. 0.0954956
7126 8825. 0.09542752
7127 8826. 0.09535945
7128 8827. 0.09529131
7129 8828. 0.09522315
7130 8829. 0.09515495
7131 8830. 0.09508671
7132 8831. 0.09503404
7133 8832. 0.0949813
7134 8833. 0.0949285
7135 8834. 0.09487561
7136 8835. 0.09482274
7137 8836. 0.09476981
7138 8837. 0.09471679
7139 8838. 0.09466372
7140 8839. 0.09461058
7141 8840. 0.09455743
7142 8841. 0.09450421
7143 8842. 0.09445095
7144 8843. 0.09439739
7145 8844. 0.09434357
7146 8845. 0.09428972
7147 8846. 0.09423582
7148 8847. 0.09418184
7149 8848. 0.09412784
7150 8849. 0.09407375
7151 8850. 0.09401963
7152 8851. 0.09396546
7153 8852. 0.09391122
7154 8853. 0.09385692
7155 8854. 0.0938026
7156 8855. 0.09374823
7157 8856. 0.09369379
7158 8857. 0.09363928
7159 8858. 0.09358474
7160 8859. 0.09353013
7161 8860. 0.0934755
7162 8861. 0.09342077
7163 8862. 0.09336604
7164 8863. 0.09331115
7165 8864. 0.09325621
7166 8865. 0.09320117
7167 8866. 0.0931461
7168 8867. 0.09309096
7169 8868. 0.0930358
7170 8869. 0.09298054
7171 8870. 0.09292527
7172 8871. 0.09287892
7173 8872. 0.09283245
7174 8873. 0.09278598
7175 8874. 0.0927394
7176 8875. 0.0926928
7177 8876. 0.09264613
7178 8877. 0.09259938
7179 8878. 0.09255256
7180 8879. 0.0925057
7181 8880. 0.09245877
7182 8881. 0.09240286
7183 8882. 0.0923469
7184 8883. 0.09229096
7185 8884. 0.09223502
7186 8885. 0.09217905
7187 8886. 0.09212301
7188 8887. 0.09206691
7189 8888. 0.09201077
7190 8889. 0.09195457
7191 8890. 0.09189834
7192 8891. 0.091842
7193 8892. 0.09178565
7194 8893. 0.09172925
7195 8894. 0.09167276
7196 8895. 0.09161627
7197 8896. 0.0915597
7198 8897. 0.09150306
7199 8898. 0.0914464
7200 8899. 0.09138964
7201 8900. 0.09133287
7202 8901. 0.09127603
7203 8902. 0.09121913
7204 8903. 0.09116232
7205 8904. 0.09110554
7206 8905. 0.09104877
7207 8906. 0.09099188
7208 8907. 0.09093497
7209 8908. 0.09087799
7210 8909. 0.09082095
7211 8910. 0.09076387
7212 8911. 0.09070672
7213 8912. 0.0906495
7214 8913. 0.09059227
7215 8914. 0.09053494
7216 8915. 0.09047761
7217 8916. 0.0904202
7218 8917. 0.09036271
7219 8918. 0.09030522
7220 8919. 0.09024763
7221 8920. 0.09018999
7222 8921. 0.09013233
7223 8922. 0.09007459
7224 8923. 0.0900167
7225 8924. 0.08995865
7226 8925. 0.08990057
7227 8926. 0.08984244
7228 8927. 0.08978421
7229 8928. 0.08972598
7230 8929. 0.08966769
7231 8930. 0.08960932
7232 8931. 0.0895509
7233 8932. 0.08949242
7234 8933. 0.0894339
7235 8934. 0.08937532
7236 8935. 0.08931668
7237 8936. 0.08925801
7238 8937. 0.08919926
7239 8938. 0.08914047
7240 8939. 0.08908161
7241 8940. 0.08902273
7242 8941. 0.08897242
7243 8942. 0.08892203
7244 8943. 0.08887168
7245 8944. 0.08882131
7246 8945. 0.08877093
7247 8946. 0.08872046
7248 8947. 0.08866993
7249 8948. 0.08861931
7250 8949. 0.08856864
7251 8950. 0.08851788
7252 8951. 0.08845852
7253 8952. 0.08839904
7254 8953. 0.08833956
7255 8954. 0.08827998
7256 8955. 0.08822041
7257 8956. 0.08816074
7258 8957. 0.08810103
7259 8958. 0.08804126
7260 8959. 0.08798141
7261 8960. 0.08792153
7262 8961. 0.08786164
7263 8962. 0.08780169
7264 8963. 0.08774167
7265 8964. 0.08768156
7266 8965. 0.08762141
7267 8966. 0.08756121
7268 8967. 0.08750093
7269 8968. 0.08744059
7270 8969. 0.08738021
7271 8970. 0.08731978
7272 8971. 0.0872594
7273 8972. 0.08719892
7274 8973. 0.08713842
7275 8974. 0.08707783
7276 8975. 0.08701721
7277 8976. 0.08695653
7278 8977. 0.08689579
7279 8978. 0.086835
7280 8979. 0.08677413
7281 8980. 0.08671323
7282 8981. 0.08665238
7283 8982. 0.08659144
7284 8983. 0.08653025
7285 8984. 0.08646881
7286 8985. 0.08640732
7287 8986. 0.08634575
7288 8987. 0.08628415
7289 8988. 0.0862225
7290 8989. 0.08616079
7291 8990. 0.08609901
7292 8991. 0.08603721
7293 8992. 0.08597539
7294 8993. 0.08591348
7295 8994. 0.08585152
7296 8995. 0.08578951
7297 8996. 0.08572746
7298 8997. 0.08566534
7299 8998. 0.08560318
7300 8999. 0.08554097
7301 9000. 0.08547868
7302 9001. 0.0854177
7303 9002. 0.08535667
7304 9003. 0.0852959
7305 9004. 0.08523529
7306 9005. 0.08517468
7307 9006. 0.08511403
7308 9007. 0.08505333
7309 9008. 0.08499265
7310 9009. 0.08493188
7311 9010. 0.08487114
7312 9011. 0.0848188
7313 9012. 0.08476642
7314 9013. 0.08471405
7315 9014. 0.08466159
7316 9015. 0.08460911
7317 9016. 0.08455658
7318 9017. 0.08450402
7319 9018. 0.08445141
7320 9019. 0.08439876
7321 9020. 0.08434609
7322 9021. 0.08428524
7323 9022. 0.08422437
7324 9023. 0.08416335
7325 9024. 0.08410218
7326 9025. 0.08404098
7327 9026. 0.08397971
7328 9027. 0.08391846
7329 9028. 0.08385716
7330 9029. 0.08379582
7331 9030. 0.08373447
7332 9031. 0.08367845
7333 9032. 0.0836224
7334 9033. 0.08356632
7335 9034. 0.08351018
7336 9035. 0.08345404
7337 9036. 0.08339784
7338 9037. 0.08334162
7339 9038. 0.08328536
7340 9039. 0.08322904
7341 9040. 0.0831727
7342 9041. 0.08311647
7343 9042. 0.08306019
7344 9043. 0.08300364
7345 9044. 0.08294675
7346 9045. 0.08288987
7347 9046. 0.08283294
7348 9047. 0.08277595
7349 9048. 0.08271895
7350 9049. 0.08266193
7351 9050. 0.08260484
7352 9051. 0.08254785
7353 9052. 0.08249081
7354 9053. 0.08243376
7355 9054. 0.08237663
7356 9055. 0.0823195
7357 9056. 0.0822623
7358 9057. 0.08220509
7359 9058. 0.08214784
7360 9059. 0.08209055
7361 9060. 0.08203322
7362 9061. 0.081976
7363 9062. 0.08191873
7364 9063. 0.0818617
7365 9064. 0.08180494
7366 9065. 0.08174805
7367 9066. 0.0816912
7368 9067. 0.08163428
7369 9068. 0.08157735
7370 9069. 0.08152036
7371 9070. 0.08146334
7372 9071. 0.08140641
7373 9072. 0.08134945
7374 9072.999 0.08129248
7375 9074. 0.08123539
7376 9075. 0.08117831
7377 9076. 0.0811212
7378 9077. 0.08106402
7379 9078.001 0.0810068
7380 9079. 0.0809496
7381 9080. 0.08089234
7382 9081. 0.08084311
7383 9082. 0.0807938
7384 9083. 0.0807449
7385 9084. 0.08069639
7386 9085. 0.08064783
7387 9086. 0.08059922
7388 9087. 0.08055057
7389 9088. 0.08050185
7390 9089. 0.08045311
7391 9090. 0.0804043
7392 9091. 0.08034768
7393 9092. 0.08029098
7394 9093. 0.08023428
7395 9094. 0.08017752
7396 9094.999 0.08012078
7397 9096.001 0.08006383
7398 9097. 0.08000702
7399 9098. 0.0799501
7400 9099. 0.07989316
7401 9100. 0.07983617
7402 9101. 0.07977922
7403 9102. 0.07972223
7404 9103. 0.07966508
7405 9103.999 0.07960779
7406 9105. 0.07955036
7407 9106. 0.07949293
7408 9107. 0.07943548
7409 9108. 0.07937797
7410 9109. 0.07932045
7411 9110. 0.07926287
7412 9111. 0.07920537
7413 9112. 0.07914784
7414 9113. 0.07909024
7415 9114. 0.07903264
7416 9115. 0.07897499
7417 9116. 0.0789173
7418 9117. 0.07885958
7419 9118. 0.07880183
7420 9119. 0.07874399
7421 9120. 0.07868616
7422 9121. 0.07862835
7423 9122. 0.0785705
7424 9123. 0.07851207
7425 9124. 0.07845299
7426 9125. 0.07839389
7427 9126. 0.07833475
7428 9127. 0.07827554
7429 9128. 0.07821634
7430 9129. 0.07815704
7431 9130. 0.07809776
7432 9131. 0.07803851
7433 9132. 0.07797926
7434 9133. 0.07791992
7435 9134. 0.07786057
7436 9135. 0.07780119
7437 9136. 0.07774176
7438 9137.001 0.07768223
7439 9138. 0.07762279
7440 9139. 0.07756325
7441 9140. 0.07750369
7442 9141. 0.07744415
7443 9142. 0.07738457
7444 9143. 0.07732532
7445 9144. 0.07726641
7446 9145. 0.07720744
7447 9146.001 0.07714837
7448 9147. 0.07708938
7449 9148. 0.07703032
7450 9149. 0.07697117
7451 9150. 0.07691202
7452 9151. 0.0768529
7453 9152. 0.07679374
7454 9153. 0.07673453
7455 9153.999 0.07667536
7456 9155. 0.07661603
7457 9156. 0.0765567
7458 9157. 0.07649736
7459 9158. 0.07643794
7460 9159.001 0.07637843
7461 9160. 0.07631902
7462 9161. 0.07625958
7463 9162. 0.07620011
7464 9162.999 0.07614074
7465 9164. 0.07608124
7466 9165. 0.07602178
7467 9166. 0.07596228
7468 9167. 0.07590274
7469 9168.001 0.07584309
7470 9169. 0.07578352
7471 9170. 0.07572386
7472 9171. 0.07566423
7473 9171.999 0.07560465
7474 9173. 0.07554486
7475 9174. 0.07548514
7476 9175. 0.07542534
7477 9176. 0.07536551
7478 9177.001 0.0753056
7479 9178. 0.07524574
7480 9179. 0.07518577
7481 9180. 0.07512581
7482 9181. 0.07507329
7483 9182. 0.07502075
7484 9183. 0.07496802
7485 9184. 0.07491512
7486 9184.999 0.07486221
7487 9186.001 0.07480909
7488 9187. 0.07475609
7489 9188. 0.07470301
7490 9189. 0.07464984
7491 9190. 0.07459664
7492 9191. 0.07453605
7493 9192. 0.07447542
7494 9193. 0.07441476
7495 9193.999 0.07435411
7496 9195. 0.07429329
7497 9196. 0.07423253
7498 9197. 0.07417169
7499 9198. 0.07411087
7500 9199. 0.07404993
7501 9200. 0.073989
7502 9201. 0.0739233
7503 9202. 0.07385758
7504 9203. 0.07379185
7505 9204. 0.0737261
7506 9205. 0.07366031
7507 9206. 0.07359453
7508 9207. 0.07352867
7509 9208. 0.07346279
7510 9209. 0.0733969
7511 9210. 0.07333094
7512 9211. 0.07326505
7513 9212. 0.07319912
7514 9213. 0.07313316
7515 9214. 0.07306717
7516 9215. 0.07300116
7517 9216. 0.07293511
7518 9217. 0.07286898
7519 9218. 0.07280289
7520 9219. 0.0727367
7521 9220. 0.07267053
7522 9221. 0.07260438
7523 9222. 0.0725382
7524 9223. 0.0724719
7525 9224. 0.07240555
7526 9225. 0.07233915
7527 9226. 0.0722727
7528 9227. 0.07220622
7529 9228. 0.07213973
7530 9229. 0.07207319
7531 9230. 0.07200662
7532 9231. 0.0719432
7533 9232. 0.07187971
7534 9233. 0.07181623
7535 9234. 0.0717527
7536 9235. 0.07168911
7537 9236.001 0.07162544
7538 9237. 0.07156186
7539 9238. 0.07149817
7540 9239. 0.07143442
7541 9240. 0.07137067
7542 9241. 0.0713069
7543 9242. 0.07124313
7544 9243. 0.07117944
7545 9243.999 0.0711159
7546 9245. 0.07105219
7547 9246. 0.07098852
7548 9247. 0.07092483
7549 9248. 0.07086106
7550 9249.001 0.07079722
7551 9250. 0.07073346
7552 9251. 0.07066966
7553 9252. 0.07060581
7554 9253. 0.07054193
7555 9254. 0.07047798
7556 9255. 0.07041402
7557 9256. 0.07035002
7558 9257. 0.07028598
7559 9258. 0.07022192
7560 9259. 0.07015778
7561 9260. 0.07009361
7562 9261. 0.07002947
7563 9261.999 0.06996533
7564 9263. 0.06990105
7565 9264. 0.06983678
7566 9265. 0.0697725
7567 9266. 0.06970817
7568 9267.001 0.06964373
7569 9268. 0.06957937
7570 9269. 0.06951494
7571 9270. 0.06945046
7572 9271. 0.06938597
7573 9272. 0.06932144
7574 9273. 0.06925688
7575 9274. 0.06919226
7576 9274.999 0.06912769
7577 9276. 0.06906296
7578 9277. 0.06899824
7579 9278. 0.06893348
7580 9279. 0.06886867
7581 9280. 0.06880382
7582 9281. 0.068739
7583 9282. 0.06867414
7584 9283. 0.06860901
7585 9283.999 0.06854373
7586 9285. 0.06847827
7587 9286. 0.06841283
7588 9287. 0.06834736
7589 9288. 0.06828182
7590 9289. 0.06821626
7591 9290. 0.06815067
7592 9291. 0.06808508
7593 9292. 0.06801943
7594 9293. 0.06795376
7595 9294. 0.06788807
7596 9295. 0.06782233
7597 9296. 0.06775653
7598 9297. 0.0676907
7599 9298. 0.06762484
7600 9299. 0.06755892
7601 9300. 0.06749303
7602 9301. 0.06743383
7603 9302. 0.06737461
7604 9303. 0.06731533
7605 9304. 0.06725595
7606 9305. 0.06719653
7607 9306. 0.06713708
7608 9307. 0.06707755
7609 9308. 0.06701798
7610 9309. 0.06695835
7611 9310. 0.06689869
7612 9311. 0.0668323
7613 9312. 0.06676587
7614 9313. 0.06669938
7615 9314. 0.06663288
7616 9315. 0.06656635
7617 9316. 0.06649977
7618 9317. 0.06643313
7619 9318. 0.06636651
7620 9319. 0.06629977
7621 9320. 0.06623305
7622 9321. 0.0661663
7623 9322. 0.06609948
7624 9323. 0.06603247
7625 9324. 0.06596521
7626 9325. 0.0658979
7627 9326.001 0.06583049
7628 9327. 0.06576317
7629 9328. 0.06569576
7630 9329. 0.06562828
7631 9330. 0.0655608
7632 9331. 0.06549329
7633 9332. 0.06542575
7634 9333. 0.06535816
7635 9333.999 0.06529061
7636 9335. 0.06522288
7637 9336. 0.06515519
7638 9337. 0.06508746
7639 9338. 0.06501968
7640 9339. 0.06495187
7641 9340. 0.06488402
7642 9341. 0.06481616
7643 9342. 0.06474826
7644 9342.999 0.06468043
7645 9344. 0.06461249
7646 9345. 0.06454459
7647 9346. 0.06447666
7648 9347. 0.06440865
7649 9348.001 0.06434058
7650 9349. 0.0642726
7651 9350. 0.06420448
7652 9351. 0.06413638
7653 9351.999 0.06406829
7654 9353.001 0.06399995
7655 9354. 0.06393177
7656 9355. 0.06386352
7657 9355.999 0.06379528
7658 9357.001 0.06372679
7659 9358. 0.06365847
7660 9359. 0.06359002
7661 9360. 0.06352159
7662 9361. 0.06345309
7663 9362.001 0.06338451
7664 9363. 0.06331584
7665 9364. 0.0632468
7666 9364.999 0.0631778
7667 9366.001 0.06310856
7668 9367. 0.06303947
7669 9368. 0.06297028
7670 9368.999 0.06290114
7671 9370. 0.06283181
7672 9371.001 0.06276244
7673 9372. 0.06269317
7674 9373. 0.06262381
7675 9373.999 0.06255445
7676 9375. 0.06248493
7677 9376. 0.06241545
7678 9377. 0.06234591
7679 9377.999 0.06227641
7680 9379. 0.06220675
7681 9380.001 0.06213704
7682 9381. 0.06206746
7683 9382. 0.06199777
7684 9383. 0.06192803
7685 9384. 0.06185831
7686 9385. 0.06178853
7687 9386. 0.06171871
7688 9386.999 0.06164895
7689 9388. 0.061579
7690 9389. 0.06150905
7691 9390. 0.0614391
7692 9391. 0.06136912
7693 9392. 0.06129909
7694 9393. 0.06122905
7695 9394. 0.06115894
7696 9395. 0.0610888
7697 9395.999 0.06101869
7698 9397. 0.06094843
7699 9398. 0.06087819
7700 9399. 0.06080791
7701 9400. 0.06073758
7702 9401. 0.06066086
7703 9402. 0.06058414
7704 9403. 0.06050762
7705 9404. 0.06043141
7706 9405. 0.0603552
7707 9406. 0.06027896
7708 9407. 0.06020268
7709 9408. 0.06012639
7710 9408.999 0.06005016
7711 9410. 0.05997373
7712 9411. 0.05989736
7713 9412. 0.05982099
7714 9413. 0.0597446
7715 9414. 0.05966816
7716 9415. 0.05959169
7717 9416. 0.05951523
7718 9417. 0.05943873
7719 9417.999 0.05936227
7720 9419. 0.05928564
7721 9420. 0.05920908
7722 9421. 0.05913251
7723 9422. 0.05905589
7724 9423. 0.05897934
7725 9424. 0.0589029
7726 9425. 0.05882643
7727 9426. 0.05874994
7728 9427. 0.05867342
7729 9428. 0.05859688
7730 9429. 0.0585203
7731 9430. 0.05844372
7732 9431. 0.05837096
7733 9432. 0.05829816
7734 9433. 0.05822534
7735 9434. 0.05815245
7736 9435. 0.05807955
7737 9436. 0.05800662
7738 9437. 0.05793366
7739 9438. 0.05786066
7740 9439. 0.05778763
7741 9440.001 0.05771449
7742 9441. 0.05764145
7743 9442. 0.05756832
7744 9443. 0.05749525
7745 9444. 0.0574223
7746 9445. 0.05734933
7747 9446. 0.05727633
7748 9447. 0.05720328
7749 9448. 0.05713021
7750 9449. 0.05705707
7751 9450. 0.05698392
7752 9451. 0.05691074
7753 9452. 0.05683749
7754 9453. 0.05676424
7755 9454. 0.05669095
7756 9455. 0.0566176
7757 9456. 0.05654426
7758 9457. 0.05647084
7759 9458. 0.05639742
7760 9459. 0.05632394
7761 9460. 0.05625045
7762 9461. 0.0561769
7763 9462.001 0.05610325
7764 9463. 0.05602979
7765 9464. 0.05595635
7766 9465. 0.05588289
7767 9466. 0.0558094
7768 9467. 0.05573586
7769 9468. 0.0556623
7770 9469. 0.05558868
7771 9470. 0.05551504
7772 9471.001 0.05544128
7773 9472. 0.05536765
7774 9473. 0.0552939
7775 9474. 0.05522012
7776 9475. 0.05514632
7777 9476. 0.05507246
7778 9477. 0.05499857
7779 9478. 0.05492464
7780 9479. 0.05485069
7781 9480.001 0.05477662
7782 9481. 0.05470266
7783 9482. 0.05462858
7784 9483. 0.05455465
7785 9484.001 0.05448086
7786 9485. 0.05440718
7787 9486. 0.0543334
7788 9487. 0.05425955
7789 9488. 0.05418569
7790 9489. 0.05411179
7791 9490. 0.05403786
7792 9491. 0.05396387
7793 9492. 0.05388986
7794 9493.001 0.05381573
7795 9494. 0.05374172
7796 9495. 0.0536676
7797 9496. 0.05359342
7798 9497. 0.05351924
7799 9498. 0.053445
7800 9499. 0.05337074
7801 9500. 0.05329644
7802 9501. 0.05324023
7803 9502.001 0.05318392
7804 9503. 0.05312759
7805 9504. 0.05307095
7806 9505. 0.0530143
7807 9506.001 0.05295756
7808 9507. 0.0529009
7809 9508. 0.05284416
7810 9508.999 0.05278743
7811 9510. 0.05273059
7812 9511.001 0.05267368
7813 9512. 0.05261687
7814 9513. 0.05255996
7815 9513.999 0.05250309
7816 9515.001 0.05244602
7817 9516. 0.05238911
7818 9517. 0.05233209
7819 9517.999 0.0522751
7820 9519. 0.05221798
7821 9520.001 0.05216084
7822 9521. 0.05210376
7823 9522. 0.05204659
7824 9522.999 0.05198956
7825 9524.001 0.05193243
7826 9525. 0.05187548
7827 9526. 0.05181845
7828 9526.999 0.05176142
7829 9528.001 0.05170421
7830 9529. 0.05164712
7831 9530. 0.05158997
7832 9531. 0.05153276
7833 9531.999 0.05147558
7834 9533.001 0.0514182
7835 9534. 0.05136095
7836 9535. 0.05130364
7837 9535.999 0.05124635
7838 9537.001 0.05118885
7839 9538. 0.05113149
7840 9539. 0.05107406
7841 9540. 0.05101661
7842 9540.999 0.05095915
7843 9542.001 0.05090148
7844 9543. 0.05084394
7845 9544. 0.05078627
7846 9544.999 0.05072862
7847 9546.001 0.05067076
7848 9547. 0.05061307
7849 9548. 0.05055526
7850 9548.999 0.0504975
7851 9550. 0.0504396
7852 9551.001 0.05038164
7853 9552. 0.05032377
7854 9553. 0.05026582
7855 9553.999 0.0502079
7856 9555. 0.05014983
7857 9556. 0.0500918
7858 9557. 0.05003373
7859 9557.999 0.04997567
7860 9559. 0.0499175
7861 9560.001 0.0498593
7862 9561. 0.04980115
7863 9562. 0.04974294
7864 9562.999 0.04968459
7865 9564. 0.04962583
7866 9565. 0.0495671
7867 9566. 0.04950835
7868 9566.999 0.04944962
7869 9568. 0.04939076
7870 9569. 0.04933192
7871 9570. 0.04927306
7872 9571. 0.04921415
7873 9572. 0.04915519
7874 9573. 0.04909623
7875 9574. 0.04903723
7876 9575. 0.04897821
7877 9575.999 0.04891921
7878 9577. 0.04886007
7879 9578. 0.04880097
7880 9579. 0.04874182
7881 9580. 0.04868268
7882 9581. 0.04862347
7883 9582. 0.04856424
7884 9583. 0.04850502
7885 9584. 0.04844588
7886 9585. 0.04838671
7887 9586. 0.04832751
7888 9587. 0.04826828
7889 9588. 0.04820903
7890 9588.999 0.04814981
7891 9590. 0.04809045
7892 9591. 0.04803107
7893 9592. 0.04797167
7894 9593. 0.04791226
7895 9594. 0.0478528
7896 9595. 0.04779332
7897 9596. 0.04773382
7898 9597. 0.04767428
7899 9597.999 0.0476148
7900 9599. 0.04755516
7901 9600. 0.04749556
7902 9601. 0.04743904
7903 9602. 0.04738251
7904 9603. 0.04732604
7905 9604. 0.04726969
7906 9605. 0.04721333
7907 9606. 0.04715693
7908 9607. 0.04710051
7909 9608. 0.04704405
7910 9609. 0.04698754
7911 9610. 0.04693099
7912 9611. 0.04686469
7913 9612. 0.04679838
7914 9613. 0.04673207
7915 9614. 0.04666572
7916 9615. 0.04659938
7917 9616. 0.04653303
7918 9617. 0.04646665
7919 9618. 0.04640028
7920 9619. 0.04633388
7921 9620.001 0.04626742
7922 9621. 0.04620581
7923 9622. 0.04614414
7924 9623. 0.04608237
7925 9624. 0.04602047
7926 9625. 0.04595853
7927 9626. 0.04589659
7928 9627. 0.0458346
7929 9628. 0.04577262
7930 9629. 0.04571057
7931 9630. 0.04564854
7932 9631. 0.0455863
7933 9632. 0.04552405
7934 9633. 0.04546177
7935 9634. 0.04539947
7936 9635. 0.04533714
7937 9636. 0.0452748
7938 9637. 0.04521243
7939 9638. 0.04515004
7940 9639. 0.04508764
7941 9640. 0.04502521
7942 9641. 0.0449627
7943 9642.001 0.04490011
7944 9643. 0.04483764
7945 9644. 0.04477507
7946 9645. 0.04471247
7947 9646. 0.04464986
7948 9647. 0.04458721
7949 9648. 0.04452456
7950 9649. 0.04446188
7951 9650. 0.04439918
7952 9651.001 0.04433636
7953 9652. 0.04427366
7954 9653. 0.04421087
7955 9654. 0.04414804
7956 9655. 0.04408522
7957 9656. 0.04402236
7958 9657. 0.04395948
7959 9658. 0.04389659
7960 9659. 0.04383366
7961 9660.001 0.04377066
7962 9661. 0.04370771
7963 9662. 0.04364468
7964 9663. 0.0435816
7965 9664.001 0.04351839
7966 9665. 0.04345526
7967 9666. 0.04339208
7968 9667. 0.04332887
7969 9668. 0.04326561
7970 9669. 0.04320234
7971 9670. 0.04313907
7972 9671. 0.04307573
7973 9672. 0.04301238
7974 9673.001 0.04294893
7975 9674. 0.04288559
7976 9675. 0.04282217
7977 9676. 0.04275872
7978 9677. 0.04269526
7979 9678. 0.04263178
7980 9679. 0.04256826
7981 9680. 0.04250473
7982 9681. 0.04244114
7983 9682.001 0.04237746
7984 9683. 0.0423139
7985 9684. 0.04225026
7986 9685. 0.04218661
7987 9686.001 0.04212286
7988 9687. 0.04205923
7989 9688. 0.04199551
7990 9688.999 0.04193182
7991 9690. 0.041868
7992 9691.001 0.04180411
7993 9692. 0.04174033
7994 9693. 0.04167647
7995 9693.999 0.04161265
7996 9695.001 0.04154861
7997 9696. 0.04148476
7998 9697. 0.04142081
7999 9697.999 0.04135691
8000 9699. 0.04129286
8001 9700.001 0.04122879
8002 9701. 0.04116479
8003 9702. 0.0411007
8004 9702.999 0.04103655
8005 9704.001 0.040972
8006 9705. 0.04090764
8007 9706. 0.04084318
8008 9706.999 0.04077877
8009 9708.001 0.04071415
8010 9709. 0.04064969
8011 9710. 0.04058516
8012 9711. 0.04052056
8013 9711.999 0.04045603
8014 9713.001 0.04039126
8015 9714. 0.04032667
8016 9715. 0.04026201
8017 9715.999 0.04019736
8018 9717.001 0.04013252
8019 9718. 0.04006786
8020 9719. 0.04000309
8021 9720. 0.03993834
8022 9720.999 0.03987355
8023 9722.001 0.03980858
8024 9723. 0.03974388
8025 9724. 0.03967929
8026 9724.999 0.03961475
8027 9726.001 0.03955
8028 9727. 0.03948543
8029 9728. 0.03942076
8030 9728.999 0.03935615
8031 9730. 0.03929138
8032 9731.001 0.03922655
8033 9732. 0.03916182
8034 9733. 0.03909703
8035 9733.999 0.03903225
8036 9735.001 0.03896728
8037 9736. 0.03890249
8038 9737. 0.03883761
8039 9737.999 0.03877276
8040 9739. 0.03870778
8041 9740.001 0.03864277
8042 9741. 0.03857783
8043 9742. 0.03851278
8044 9742.999 0.03844786
8045 9744. 0.03838291
8046 9745. 0.03831801
8047 9746. 0.03825308
8048 9746.999 0.03818819
8049 9748. 0.03812317
8050 9749. 0.03805818
8051 9750. 0.03799316
8052 9751. 0.0379281
8053 9752. 0.03786299
8054 9753. 0.03779788
8055 9754. 0.03773274
8056 9755. 0.03766759
8057 9755.999 0.03760247
8058 9757. 0.03753721
8059 9758. 0.03747199
8060 9759. 0.03740675
8061 9760. 0.03734149
8062 9761. 0.03727616
8063 9762. 0.03721083
8064 9763. 0.0371454
8065 9764. 0.0370798
8066 9764.999 0.03701425
8067 9766. 0.03694856
8068 9767. 0.03688292
8069 9768. 0.03681725
8070 9768.999 0.03675162
8071 9770. 0.03668585
8072 9771. 0.03662007
8073 9772. 0.03655428
8074 9773. 0.03648846
8075 9774. 0.03642264
8076 9775. 0.03635678
8077 9776. 0.0362909
8078 9777. 0.036225
8079 9777.999 0.03615915
8080 9779. 0.03609316
8081 9780. 0.03602721
8082 9781. 0.03596119
8083 9782. 0.03589516
8084 9783. 0.03582903
8085 9784. 0.03576277
8086 9785. 0.0356965
8087 9786. 0.03563018
8088 9786.999 0.03556395
8089 9788. 0.03549754
8090 9789. 0.03543117
8091 9790. 0.03536479
8092 9791. 0.03529835
8093 9792. 0.0352319
8094 9793. 0.03516543
8095 9794. 0.03509892
8096 9795. 0.0350324
8097 9796. 0.03496587
8098 9797. 0.03489932
8099 9798. 0.03483276
8100 9799. 0.03476617
8101 9800. 0.03469957
8102 9801. 0.03463089
8103 9802. 0.0345622
8104 9803. 0.03449355
8105 9804. 0.03442494
8106 9805. 0.03435633
8107 9806. 0.03428771
8108 9807. 0.03421907
8109 9808. 0.03415043
8110 9809. 0.03408176
8111 9810. 0.03401311
8112 9811. 0.03394438
8113 9812. 0.03387565
8114 9813. 0.03380692
8115 9814. 0.03373815
8116 9815. 0.03366939
8117 9816. 0.03360062
8118 9817. 0.03353183
8119 9818. 0.03346303
8120 9819. 0.03339422
8121 9820. 0.03332541
8122 9821. 0.03325655
8123 9822. 0.03318765
8124 9823. 0.03311883
8125 9824. 0.03305013
8126 9825. 0.03298143
8127 9826. 0.03291271
8128 9827. 0.03284398
8129 9828. 0.03277525
8130 9829. 0.0327065
8131 9830. 0.03263773
8132 9831.001 0.03257012
8133 9832. 0.03250265
8134 9833. 0.03243508
8135 9834. 0.03236749
8136 9835. 0.03229989
8137 9836. 0.03223227
8138 9837. 0.03216464
8139 9838. 0.03209699
8140 9839. 0.03202932
8141 9840.001 0.03196158
8142 9841. 0.03189389
8143 9842. 0.03182613
8144 9843. 0.0317583
8145 9844. 0.0316903
8146 9845. 0.03162228
8147 9846. 0.03155425
8148 9847. 0.03148621
8149 9848. 0.03141815
8150 9849. 0.03135008
8151 9850. 0.03128199
8152 9851. 0.03121383
8153 9852. 0.03114566
8154 9853.001 0.0310774
8155 9854. 0.03100927
8156 9855. 0.03094105
8157 9856. 0.03087283
8158 9857. 0.03080459
8159 9858. 0.03073633
8160 9859. 0.03066804
8161 9860. 0.03059976
8162 9861. 0.03053141
8163 9862.001 0.03046297
8164 9863. 0.03039454
8165 9864. 0.03032573
8166 9865. 0.03025691
8167 9866.001 0.030188
8168 9867. 0.03011922
8169 9868. 0.03005036
8170 9868.999 0.02998155
8171 9870. 0.02991259
8172 9871.001 0.02984357
8173 9872. 0.02977468
8174 9873. 0.0297057
8175 9874. 0.02963671
8176 9875.001 0.02956764
8177 9876. 0.0294987
8178 9877. 0.02942967
8179 9877.999 0.0293607
8180 9879. 0.02929159
8181 9880.001 0.02922244
8182 9881. 0.02915339
8183 9882. 0.02908426
8184 9882.999 0.02901523
8185 9884.001 0.02894614
8186 9885. 0.02887724
8187 9886. 0.02880825
8188 9886.999 0.02873931
8189 9888.001 0.02867016
8190 9889. 0.02860121
8191 9890. 0.02853217
8192 9891. 0.02846307
8193 9891.999 0.02839401
8194 9893.001 0.02832475
8195 9894. 0.02825568
8196 9895. 0.02818654
8197 9895.999 0.02811744
8198 9897.001 0.02804812
8199 9898. 0.02797901
8200 9899. 0.0279098
8201 9900. 0.02784058
8202 9900.999 0.02776841
8203 9902.001 0.02769604
8204 9903. 0.02762405
8205 9904. 0.02755239
8206 9904.999 0.0274808
8207 9906.001 0.027409
8208 9907. 0.02733742
8209 9908. 0.02726576
8210 9908.999 0.02719415
8211 9910. 0.02712242
8212 9911.001 0.02705353
8213 9912. 0.02698477
8214 9913. 0.02691591
8215 9913.999 0.02684712
8216 9915.001 0.02677809
8217 9916. 0.02670928
8218 9917. 0.02664036
8219 9917.999 0.0265715
8220 9919. 0.02650249
8221 9920.001 0.02643347
8222 9921. 0.02636452
8223 9922. 0.02629548
8224 9922.999 0.02622641
8225 9924. 0.02615695
8226 9925. 0.02608754
8227 9926. 0.02601811
8228 9926.999 0.02594876
8229 9928. 0.02587924
8230 9929. 0.02580977
8231 9930. 0.02574029
8232 9931. 0.02567076
8233 9932. 0.02560122
8234 9933. 0.02553166
8235 9934. 0.02546208
8236 9935. 0.0253925
8237 9935.999 0.02532297
8238 9937. 0.02525329
8239 9938. 0.02518366
8240 9939. 0.02511403
8241 9940. 0.02504438
8242 9941. 0.02497468
8243 9942. 0.02490496
8244 9943. 0.02483524
8245 9944. 0.02476554
8246 9944.999 0.02469589
8247 9946. 0.02462609
8248 9947. 0.02455636
8249 9948. 0.02448661
8250 9948.999 0.02441691
8251 9950. 0.02434706
8252 9951. 0.02427723
8253 9952. 0.02420737
8254 9953. 0.0241375
8255 9954. 0.02406762
8256 9955. 0.02399774
8257 9956. 0.02392784
8258 9957. 0.02385792
8259 9957.999 0.02378805
8260 9959. 0.02371804
8261 9960. 0.02364809
8262 9961. 0.02357808
8263 9962. 0.02350807
8264 9963. 0.023438
8265 9964. 0.02336787
8266 9965. 0.02329771
8267 9966. 0.02322755
8268 9966.999 0.02315743
8269 9968. 0.02308718
8270 9969. 0.02301698
8271 9970. 0.02294677
8272 9971. 0.02287651
8273 9972. 0.02280623
8274 9973. 0.02273594
8275 9974. 0.02266565
8276 9975. 0.02259534
8277 9976. 0.02252503
8278 9977. 0.02245468
8279 9978. 0.02238435
8280 9979. 0.02231399
8281 9980. 0.02224363
8282 9981. 0.0221732
8283 9982. 0.02210277
8284 9983. 0.02203234
8285 9984. 0.02196196
8286 9985. 0.02189156
8287 9986. 0.02182115
8288 9987. 0.02175073
8289 9988. 0.02168029
8290 9988.999 0.02160992
8291 9990. 0.02153939
8292 9991. 0.02146888
8293 9992. 0.02139836
8294 9993. 0.02132783
8295 9994. 0.02125728
8296 9995. 0.02118672
8297 9996. 0.02111616
8298 9997. 0.02104558
8299 9998. 0.02097499
8300 9999. 0.02090439
8301 10000. 0.02083378
8302 10001. 0.02078681
8303 10002. 0.02073985
8304 10003. 0.02069294
8305 10004. 0.02064618
8306 10005. 0.02059942
8307 10006. 0.02055266
8308 10007. 0.02050591
8309 10008. 0.02045915
8310 10009. 0.02041239
8311 10010. 0.02036564
8312 10011. 0.0203188
8313 10012. 0.02027206
8314 10013. 0.02022527
8315 10014. 0.02017848
8316 10015. 0.02013169
8317 10016. 0.02008491
8318 10017. 0.02003811
8319 10018. 0.01999133
8320 10019. 0.01994454
8321 10020. 0.0198977
8322 10021. 0.01985093
8323 10022. 0.01980411
8324 10023. 0.01975719
8325 10024. 0.01970999
8326 10025. 0.01966281
8327 10026. 0.01961561
8328 10027. 0.01956843
8329 10028. 0.01952124
8330 10029. 0.01947406
8331 10030. 0.01942688
8332 10031. 0.01937757
8333 10032. 0.01932827
8334 10033. 0.01927894
8335 10034. 0.01922972
8336 10035. 0.01918046
8337 10036. 0.01913121
8338 10037. 0.01908198
8339 10038. 0.01903275
8340 10039. 0.01898354
8341 10040. 0.01893435
8342 10041. 0.01888718
8343 10042. 0.01883997
8344 10043. 0.0187929
8345 10044. 0.01874592
8346 10045. 0.01869894
8347 10046. 0.01865197
8348 10047. 0.018605
8349 10048. 0.01855802
8350 10049. 0.0185111
8351 10050. 0.01846409
8352 10051. 0.01841704
8353 10052. 0.0183701
8354 10053. 0.01832311
8355 10054. 0.01827612
8356 10055. 0.01822908
8357 10056. 0.01818214
8358 10057. 0.01813516
8359 10058. 0.01808823
8360 10059. 0.0180412
8361 10060. 0.01799417
8362 10061. 0.01794721
8363 10062. 0.01790022
8364 10063. 0.01785326
8365 10064. 0.01780618
8366 10065. 0.01775924
8367 10066. 0.01771225
8368 10067. 0.01766531
8369 10068. 0.01761828
8370 10069. 0.01757129
8371 10070. 0.01752432
8372 10071. 0.01747731
8373 10072. 0.01743036
8374 10073. 0.01738326
8375 10074. 0.01733631
8376 10075. 0.01728932
8377 10076. 0.01724237
8378 10077. 0.01719529
8379 10078. 0.01714834
8380 10079. 0.01710135
8381 10080. 0.01705437
8382 10081. 0.0170074
8383 10082. 0.01696031
8384 10083. 0.01691332
8385 10084. 0.0168662
8386 10085. 0.01681912
8387 10086. 0.01677191
8388 10087. 0.01672484
8389 10088. 0.01667773
8390 10089. 0.01663066
8391 10090. 0.01658351
8392 10091. 0.01653634
8393 10092. 0.01648926
8394 10093. 0.01644214
8395 10094. 0.01639507
8396 10095. 0.01634786
8397 10096. 0.0163008
8398 10097. 0.01625369
8399 10098. 0.01620663
8400 10099. 0.01615948
8401 10100. 0.01611234
8402 10101. 0.01606527
8403 10102. 0.01601815
8404 10103. 0.0159711
8405 10104. 0.015924
8406 10105. 0.01587695
8407 10106. 0.0158299
8408 10107. 0.01578291
8409 10108. 0.01573583
8410 10109. 0.01568879
8411 10110. 0.01564176
8412 10111. 0.01559471
8413 10112. 0.01554766
8414 10113. 0.01550061
8415 10114. 0.01545357
8416 10115. 0.01540654
8417 10116. 0.01535955
8418 10117. 0.01531247
8419 10118. 0.01526544
8420 10119. 0.01521842
8421 10120. 0.01517139
8422 10121. 0.0151227
8423 10122. 0.01507401
8424 10123. 0.01502532
8425 10124. 0.01497663
8426 10125. 0.01492799
8427 10126. 0.01487928
8428 10127. 0.01483062
8429 10128. 0.01478197
8430 10129. 0.01473334
8431 10130. 0.01468473
8432 10131. 0.01463771
8433 10132. 0.0145907
8434 10133. 0.01454369
8435 10134. 0.01449668
8436 10135. 0.01444969
8437 10136. 0.01440269
8438 10137. 0.0143557
8439 10138. 0.01430875
8440 10139. 0.01426172
8441 10140. 0.01421474
8442 10141. 0.01416774
8443 10142. 0.01412075
8444 10143. 0.01407379
8445 10144. 0.01402695
8446 10145. 0.01398012
8447 10146. 0.01393328
8448 10147. 0.0138865
8449 10148. 0.01383962
8450 10149. 0.0137928
8451 10150. 0.01374598
8452 10151. 0.01369915
8453 10152. 0.01365232
8454 10153. 0.01360549
8455 10154. 0.01355866
8456 10155. 0.01351184
8457 10156. 0.01346502
8458 10157. 0.01341821
8459 10158. 0.0133714
8460 10159. 0.01332459
8461 10160. 0.01327779
8462 10161. 0.01323096
8463 10162. 0.01318415
8464 10163. 0.01313734
8465 10164. 0.01309055
8466 10165. 0.01304377
8467 10166. 0.01299698
8468 10167. 0.01295021
8469 10168. 0.01290344
8470 10169. 0.01285662
8471 10170. 0.0128099
8472 10171. 0.01276311
8473 10172. 0.01271633
8474 10173. 0.01266956
8475 10174. 0.01262278
8476 10175. 0.01257601
8477 10176. 0.01252924
8478 10177. 0.01248248
8479 10178. 0.01243572
8480 10179. 0.01238896
8481 10180. 0.0123422
8482 10181. 0.01229544
8483 10182. 0.01224868
8484 10183. 0.01220188
8485 10184. 0.01215494
8486 10185. 0.01210801
8487 10186. 0.01206108
8488 10187. 0.01201415
8489 10188. 0.01196722
8490 10189. 0.0119203
8491 10190. 0.01187339
8492 10191. 0.01182642
8493 10192. 0.01177955
8494 10193. 0.01173264
8495 10194. 0.01168573
8496 10195. 0.01163882
8497 10196. 0.01159192
8498 10197. 0.01154502
8499 10198. 0.01149813
8500 10199. 0.01145125
8501 10200. 0.01140433
8502 10201. 0.01137313
8503 10202. 0.01134191
8504 10203. 0.0113107
8505 10204. 0.0112795
8506 10205. 0.0112483
8507 10206. 0.01121712
8508 10207. 0.01118595
8509 10208. 0.01115478
8510 10209. 0.0111236
8511 10210. 0.01109248
8512 10211. 0.01106257
8513 10212. 0.01103265
8514 10213. 0.01100271
8515 10214. 0.01097283
8516 10215. 0.01094292
8517 10216. 0.01091302
8518 10217. 0.01088312
8519 10218. 0.01085322
8520 10219. 0.01082333
8521 10220. 0.01079343
8522 10221. 0.01076353
8523 10222. 0.0107336
8524 10223. 0.01070376
8525 10224. 0.01067399
8526 10225. 0.01064422
8527 10226. 0.01061445
8528 10227. 0.01058469
8529 10228. 0.01055492
8530 10229. 0.01052516
8531 10230. 0.0104954
8532 10231. 0.01046561
8533 10232. 0.01043587
8534 10233. 0.01040611
8535 10234. 0.01037635
8536 10235. 0.01034657
8537 10236. 0.01031685
8538 10237. 0.0102871
8539 10238. 0.01025738
8540 10239. 0.0102276
8541 10240. 0.01019783
8542 10241. 0.01016811
8543 10242. 0.01013836
8544 10243. 0.01010864
8545 10244. 0.01007881
8546 10245. 0.01004908
8547 10246. 0.01001932
8548 10247. 0.009989594
8549 10248. 0.009959815
8550 10249. 0.009930032
8551 10250. 0.00990031
8552 10251. 0.009870559
8553 10252. 0.009840835
8554 10253. 0.00981103
8555 10254. 0.00978131
8556 10255. 0.009751569
8557 10256. 0.009721858
8558 10257. 0.009692064
8559 10258. 0.009662359
8560 10259. 0.009632627
8561 10260. 0.009602902
8562 10261. 0.009573188
8563 10262. 0.009543402
8564 10263. 0.009513696
8565 10264. 0.009483946
8566 10265. 0.00945423
8567 10266. 0.00942443
8568 10267. 0.009394717
8569 10268. 0.009364984
8570 10269. 0.009335248
8571 10270. 0.009305551
8572 10271. 0.009274718
8573 10272. 0.009243984
8574 10273. 0.009213237
8575 10274. 0.009182523
8576 10275. 0.009151732
8577 10276. 0.009121041
8578 10277. 0.009090325
8579 10278. 0.009059652
8580 10279. 0.009028929
8581 10280. 0.008998214
8582 10281. 0.008968565
8583 10282. 0.008938885
8584 10283. 0.008909243
8585 10284. 0.008879559
8586 10285. 0.008849906
8587 10286. 0.008820256
8588 10287. 0.008790639
8589 10288. 0.008760964
8590 10289. 0.008731295
8591 10290. 0.008701687
8592 10291. 0.008672044
8593 10292. 0.008642436
8594 10293. 0.008612772
8595 10294. 0.008583137
8596 10295. 0.008553507
8597 10296. 0.00852391
8598 10297. 0.008494258
8599 10298. 0.008464639
8600 10299. 0.00843502
8601 10300. 0.00840541
8602 10301. 0.008375793
8603 10302. 0.00834618
8604 10303. 0.008316575
8605 10304. 0.008286997
8606 10305. 0.008257453
8607 10306. 0.008227857
8608 10307. 0.008198293
8609 10308. 0.00816873
8610 10309. 0.00813917
8611 10310. 0.008109618
8612 10311. 0.008080054
8613 10312. 0.008050499
8614 10313. 0.008020944
8615 10314. 0.007991393
8616 10315. 0.007961847
8617 10316. 0.007932303
8618 10317. 0.007902759
8619 10318. 0.00787325
8620 10319. 0.007843687
8621 10320. 0.007814156
8622 10321. 0.007784618
8623 10322. 0.007755083
8624 10323. 0.007725528
8625 10324. 0.007695868
8626 10325. 0.007666212
8627 10326. 0.007636558
8628 10327. 0.007606939
8629 10328. 0.007577261
8630 10329. 0.007547621
8631 10330. 0.007517987
8632 10331. 0.007488347
8633 10332. 0.007458713
8634 10333. 0.007429085
8635 10334. 0.007399461
8636 10335. 0.007369845
8637 10336. 0.007340226
8638 10337. 0.007310613
8639 10338. 0.007281006
8640 10339. 0.007251403
8641 10340. 0.007221807
8642 10341. 0.007191395
8643 10342. 0.007160998
8644 10343. 0.007130624
8645 10344. 0.007100342
8646 10345. 0.007070069
8647 10346. 0.007039806
8648 10347. 0.007009551
8649 10348. 0.00697931
8650 10349. 0.006949043
8651 10350. 0.006918852
8652 10351. 0.006889411
8653 10352. 0.006859974
8654 10353. 0.006830539
8655 10354. 0.006801108
8656 10355. 0.00677168
8657 10356. 0.006742259
8658 10357. 0.006712842
8659 10358. 0.006683429
8660 10359. 0.006654014
8661 10360. 0.006624608
8662 10361. 0.006595196
8663 10362. 0.006565791
8664 10363. 0.006536399
8665 10364. 0.00650706
8666 10365. 0.006477725
8667 10366. 0.006448391
8668 10367. 0.006419063
8669 10368. 0.00638974
8670 10369. 0.006360416
8671 10370. 0.006331099
8672 10371. 0.006301749
8673 10372. 0.006272457
8674 10373. 0.006243143
8675 10374. 0.006213829
8676 10375. 0.006184522
8677 10376. 0.006155217
8678 10377. 0.006125914
8679 10378. 0.006096615
8680 10379. 0.00606732
8681 10380. 0.006037998
8682 10381. 0.006008734
8683 10382. 0.005979445
8684 10383. 0.005950148
8685 10384. 0.005920783
8686 10385. 0.005891422
8687 10386. 0.005862067
8688 10387. 0.005832713
8689 10388. 0.005803364
8690 10389. 0.005773991
8691 10390. 0.00574468
8692 10391. 0.005715337
8693 10392. 0.005686
8694 10393. 0.00565664
8695 10394. 0.005627342
8696 10395. 0.005598017
8697 10396. 0.005568698
8698 10397. 0.00553938
8699 10398. 0.00551007
8700 10399. 0.005480762
8701 10400. 0.005451457
8702 10401. 0.00543597
8703 10402. 0.00542047
8704 10403. 0.005405007
8705 10404. 0.005389532
8706 10405. 0.005374063
8707 10406. 0.0053586
8708 10407. 0.005343141
8709 10408. 0.005327689
8710 10409. 0.00531224
8711 10410. 0.005296799
8712 10411. 0.005281946
8713 10412. 0.005267125
8714 10413. 0.005252291
8715 10414. 0.005237459
8716 10415. 0.005222612
8717 10416. 0.0052078
8718 10417. 0.005192975
8719 10418. 0.005178165
8720 10419. 0.00516333
8721 10420. 0.005148497
8722 10421. 0.00513369
8723 10422. 0.005118873
8724 10423. 0.005104083
8725 10424. 0.005089322
8726 10425. 0.005074605
8727 10426. 0.005059876
8728 10427. 0.005045164
8729 10428. 0.005030425
8730 10429. 0.005015688
8731 10430. 0.005000979
8732 10431. 0.004986256
8733 10432. 0.004971548
8734 10433. 0.004956802
8735 10434. 0.004942097
8736 10435. 0.004927384
8737 10436. 0.004912684
8738 10437. 0.004897942
8739 10438. 0.004883246
8740 10439. 0.004868536
8741 10440. 0.00485383
8742 10441. 0.004839137
8743 10442. 0.004824402
8744 10443. 0.004809706
8745 10444. 0.004794964
8746 10445. 0.004780237
8747 10446. 0.00476547
8748 10447. 0.004750748
8749 10448. 0.004736013
8750 10449. 0.004721279
8751 10450. 0.004706563
8752 10451. 0.004691266
8753 10452. 0.004676017
8754 10453. 0.00466076
8755 10454. 0.004645523
8756 10455. 0.004630246
8757 10456. 0.004615019
8758 10457. 0.004599782
8759 10458. 0.004584565
8760 10459. 0.004569325
8761 10460. 0.00455409
8762 10461. 0.004539406
8763 10462. 0.004524712
8764 10463. 0.004510035
8765 10464. 0.004495336
8766 10465. 0.004480682
8767 10466. 0.004466014
8768 10467. 0.004451364
8769 10468. 0.004436686
8770 10469. 0.004422012
8771 10470. 0.004407367
8772 10471. 0.004392707
8773 10472. 0.004378064
8774 10473. 0.004363394
8775 10474. 0.004348741
8776 10475. 0.00433409
8777 10476. 0.004319454
8778 10477. 0.004304793
8779 10478. 0.004290146
8780 10479. 0.004275502
8781 10480. 0.004260862
8782 10481. 0.004246219
8783 10482. 0.004231579
8784 10483. 0.004216928
8785 10484. 0.00420219
8786 10485. 0.00418747
8787 10486. 0.004172723
8788 10487. 0.004157993
8789 10488. 0.004143268
8790 10489. 0.004128542
8791 10490. 0.004113822
8792 10491. 0.004099102
8793 10492. 0.004084384
8794 10493. 0.004069668
8795 10494. 0.00405497
8796 10495. 0.004040246
8797 10496. 0.004025539
8798 10497. 0.004010834
8799 10498. 0.003996146
8800 10499. 0.003981434
8801 10500. 0.003966738
8802 10501. 0.003951587
8803 10502. 0.003936442
8804 10503. 0.003921317
8805 10504. 0.003906296
8806 10505. 0.003891281
8807 10506. 0.00387627
8808 10507. 0.003861281
8809 10508. 0.003846265
8810 10509. 0.00383127
8811 10510. 0.003816282
8812 10511. 0.003801734
8813 10512. 0.00378719
8814 10513. 0.003772645
8815 10514. 0.003758104
8816 10515. 0.003743566
8817 10516. 0.003729042
8818 10517. 0.003714491
8819 10518. 0.003699958
8820 10519. 0.003685426
8821 10520. 0.003670896
8822 10521. 0.003656368
8823 10522. 0.003641836
8824 10523. 0.003627304
8825 10524. 0.003612729
8826 10525. 0.003598155
8827 10526. 0.003583584
8828 10527. 0.003569015
8829 10528. 0.003554447
8830 10529. 0.003539882
8831 10530. 0.003525321
8832 10531. 0.003510759
8833 10532. 0.003496201
8834 10533. 0.003481646
8835 10534. 0.003467092
8836 10535. 0.003452542
8837 10536. 0.003437991
8838 10537. 0.003423444
8839 10538. 0.0034089
8840 10539. 0.003394357
8841 10540. 0.003379819
8842 10541. 0.003365279
8843 10542. 0.003350744
8844 10543. 0.003336208
8845 10544. 0.003321669
8846 10545. 0.003307133
8847 10546. 0.003292599
8848 10547. 0.003278067
8849 10548. 0.003263538
8850 10549. 0.003249011
8851 10550. 0.003234487
8852 10551. 0.003219591
8853 10552. 0.0032047
8854 10553. 0.003189816
8855 10554. 0.003174937
8856 10555. 0.003160064
8857 10556. 0.003145196
8858 10557. 0.003130334
8859 10558. 0.00311548
8860 10559. 0.003100628
8861 10560. 0.00308577
8862 10561. 0.003071301
8863 10562. 0.003056821
8864 10563. 0.003042344
8865 10564. 0.003027876
8866 10565. 0.003013411
8867 10566. 0.002998948
8868 10567. 0.002984488
8869 10568. 0.00297003
8870 10569. 0.002955561
8871 10570. 0.002941122
8872 10571. 0.002926669
8873 10572. 0.002912219
8874 10573. 0.002897758
8875 10574. 0.002883326
8876 10575. 0.002868884
8877 10576. 0.002854443
8878 10577. 0.002840005
8879 10578. 0.002825569
8880 10579. 0.002811135
8881 10580. 0.002796705
8882 10581. 0.002782277
8883 10582. 0.002767835
8884 10583. 0.002753426
8885 10584. 0.002739004
8886 10585. 0.002724585
8887 10586. 0.002710169
8888 10587. 0.002695754
8889 10588. 0.002681342
8890 10589. 0.002666932
8891 10590. 0.002652525
8892 10591. 0.002638105
8893 10592. 0.002623716
8894 10593. 0.002609316
8895 10594. 0.002594918
8896 10595. 0.002580508
8897 10596. 0.002566129
8898 10597. 0.002551737
8899 10598. 0.002537363
8900 10599. 0.002522962
8901 10600. 0.002508573
8902 10601. 0.002502538
8903 10602. 0.002496499
8904 10603. 0.002490468
8905 10604. 0.002484421
8906 10605. 0.002478395
8907 10606. 0.002472364
8908 10607. 0.002466342
8909 10608. 0.00246031
8910 10609. 0.00245428
8911 10610. 0.002448265
8912 10611. 0.002442531
8913 10612. 0.002436805
8914 10613. 0.002431062
8915 10614. 0.002425337
8916 10615. 0.002419608
8917 10616. 0.002413885
8918 10617. 0.002408146
8919 10618. 0.002402426
8920 10619. 0.0023967
8921 10620. 0.002390976
8922 10621. 0.002385259
8923 10622. 0.002379525
8924 10623. 0.002373811
8925 10624. 0.002368113
8926 10625. 0.002362423
8927 10626. 0.002356716
8928 10627. 0.002351027
8929 10628. 0.002345333
8930 10629. 0.00233964
8931 10630. 0.002333954
8932 10631. 0.002328252
8933 10632. 0.002322568
8934 10633. 0.002316878
8935 10634. 0.002311196
8936 10635. 0.002305498
8937 10636. 0.002299817
8938 10637. 0.002294132
8939 10638. 0.002288453
8940 10639. 0.002282764
8941 10640. 0.002277076
8942 10641. 0.002271133
8943 10642. 0.002265187
8944 10643. 0.002259247
8945 10644. 0.002253275
8946 10645. 0.002247324
8947 10646. 0.002241368
8948 10647. 0.002235421
8949 10648. 0.002229465
8950 10649. 0.002223511
8951 10650. 0.002217571
8952 10651. 0.002211887
8953 10652. 0.00220621
8954 10653. 0.002200524
8955 10654. 0.002194843
8956 10655. 0.002189164
8957 10656. 0.00218349
8958 10657. 0.002177808
8959 10658. 0.002172132
8960 10659. 0.002166456
8961 10660. 0.002160783
8962 10661. 0.002155109
8963 10662. 0.002149437
8964 10663. 0.002143768
8965 10664. 0.002138117
8966 10665. 0.002132473
8967 10666. 0.002126819
8968 10667. 0.002121171
8969 10668. 0.002115525
8970 10669. 0.00210988
8971 10670. 0.002104236
8972 10671. 0.002098592
8973 10672. 0.002092948
8974 10673. 0.002087307
8975 10674. 0.002081671
8976 10675. 0.002076026
8977 10676. 0.002070387
8978 10677. 0.002064748
8979 10678. 0.002059116
8980 10679. 0.002053475
8981 10680. 0.00204784
8982 10681. 0.002042205
8983 10682. 0.002036571
8984 10683. 0.002030937
8985 10684. 0.002025291
8986 10685. 0.002019645
8987 10686. 0.002014
8988 10687. 0.002008363
8989 10688. 0.002002715
8990 10689. 0.001997073
8991 10690. 0.001991432
8992 10691. 0.001985558
8993 10692. 0.001979686
8994 10693. 0.001973817
8995 10694. 0.001967949
8996 10695. 0.001962084
8997 10696. 0.001956227
8998 10697. 0.001950361
8999 10698. 0.001944503
9000 10699. 0.001938647
9001 10700. 0.001932794
9002 10701. 0.001927171
9003 10702. 0.001921549
9004 10703. 0.001915928
9005 10704. 0.001910303
9006 10705. 0.00190468
9007 10706. 0.001899058
9008 10707. 0.001893438
9009 10708. 0.001887817
9010 10709. 0.001882197
9011 10710. 0.001876581
9012 10711. 0.001870963
9013 10712. 0.001865348
9014 10713. 0.001859733
9015 10714. 0.001854119
9016 10715. 0.001848508
9017 10716. 0.001842896
9018 10717. 0.001837286
9019 10718. 0.001831682
9020 10719. 0.001826068
9021 10720. 0.001820461
9022 10721. 0.001814855
9023 10722. 0.001809249
9024 10723. 0.001803645
9025 10724. 0.001798039
9026 10725. 0.001792433
9027 10726. 0.001786828
9028 10727. 0.001781225
9029 10728. 0.001775621
9030 10729. 0.00177002
9031 10730. 0.00176442
9032 10731. 0.001758611
9033 10732. 0.001752805
9034 10733. 0.001747002
9035 10734. 0.0017412
9036 10735. 0.001735402
9037 10736. 0.001729605
9038 10737. 0.001723811
9039 10738. 0.001718019
9040 10739. 0.001712229
9041 10740. 0.001706437
9042 10741. 0.001700861
9043 10742. 0.001695281
9044 10743. 0.001689702
9045 10744. 0.001684146
9046 10745. 0.00167859
9047 10746. 0.001673035
9048 10747. 0.00166748
9049 10748. 0.001661927
9050 10749. 0.001656369
9051 10750. 0.001650824
9052 10751. 0.001645274
9053 10752. 0.001639725
9054 10753. 0.001634177
9055 10754. 0.00162863
9056 10755. 0.001623084
9057 10756. 0.001617538
9058 10757. 0.001611994
9059 10758. 0.001606451
9060 10759. 0.001600908
9061 10760. 0.001595367
9062 10761. 0.001589826
9063 10762. 0.001584282
9064 10763. 0.001578749
9065 10764. 0.00157321
9066 10765. 0.001567672
9067 10766. 0.001562135
9068 10767. 0.001556599
9069 10768. 0.001551065
9070 10769. 0.001545531
9071 10770. 0.001539998
9072 10771. 0.001534277
9073 10772. 0.001528569
9074 10773. 0.001522858
9075 10774. 0.001517149
9076 10775. 0.001511442
9077 10776. 0.001505737
9078 10777. 0.001500035
9079 10778. 0.00149434
9080 10779. 0.001488637
9081 10780. 0.001482936
9082 10781. 0.001477426
9083 10782. 0.001471911
9084 10783. 0.001466396
9085 10784. 0.001460844
9086 10785. 0.001455303
9087 10786. 0.001449758
9088 10787. 0.001444219
9089 10788. 0.001438672
9090 10789. 0.001433125
9091 10790. 0.00142759
9092 10791. 0.001422051
9093 10792. 0.001416519
9094 10793. 0.001410973
9095 10794. 0.001405443
9096 10795. 0.001399909
9097 10796. 0.001394382
9098 10797. 0.00138884
9099 10798. 0.001383314
9100 10799. 0.001377785
9101 10800. 0.001372257
9102 10801. 0.001368029
9103 10802. 0.001363789
9104 10803. 0.001359563
9105 10804. 0.001355352
9106 10805. 0.001351147
9107 10806. 0.00134693
9108 10807. 0.001342726
9109 10808. 0.001338518
9110 10809. 0.001334312
9111 10810. 0.00133011
9112 10811. 0.001325738
9113 10812. 0.00132138
9114 10813. 0.001317019
9115 10814. 0.001312665
9116 10815. 0.0013083
9117 10816. 0.001303949
9118 10817. 0.001299595
9119 10818. 0.001295248
9120 10819. 0.001290894
9121 10820. 0.001286542
9122 10821. 0.001282355
9123 10822. 0.001278164
9124 10823. 0.001273979
9125 10824. 0.001269796
9126 10825. 0.001265626
9127 10826. 0.001261452
9128 10827. 0.001257283
9129 10828. 0.001253107
9130 10829. 0.001248931
9131 10830. 0.001244765
9132 10831. 0.001240595
9133 10832. 0.00123643
9134 10833. 0.001232257
9135 10834. 0.001228089
9136 10835. 0.001223923
9137 10836. 0.00121976
9138 10837. 0.001215591
9139 10838. 0.001211426
9140 10839. 0.001207261
9141 10840. 0.001203098
9142 10841. 0.001198791
9143 10842. 0.001194485
9144 10843. 0.001190181
9145 10844. 0.001185856
9146 10845. 0.001181538
9147 10846. 0.001177213
9148 10847. 0.001172895
9149 10848. 0.001168578
9150 10849. 0.001164262
9151 10850. 0.001159949
9152 10851. 0.001155778
9153 10852. 0.001151608
9154 10853. 0.001147439
9155 10854. 0.001143275
9156 10855. 0.001139103
9157 10856. 0.001134936
9158 10857. 0.00113077
9159 10858. 0.001126609
9160 10859. 0.001122441
9161 10860. 0.001118278
9162 10861. 0.001114116
9163 10862. 0.001109955
9164 10863. 0.001105795
9165 10864. 0.001101657
9166 10865. 0.001097521
9167 10866. 0.001093384
9168 10867. 0.001089253
9169 10868. 0.001085114
9170 10869. 0.001080979
9171 10870. 0.001076846
9172 10871. 0.001072714
9173 10872. 0.001068582
9174 10873. 0.001064451
9175 10874. 0.001060321
9176 10875. 0.001056191
9177 10876. 0.001052066
9178 10877. 0.001047934
9179 10878. 0.001043806
9180 10879. 0.001039679
9181 10880. 0.001035553
9182 10881. 0.001031302
9183 10882. 0.001027053
9184 10883. 0.001022805
9185 10884. 0.001018552
9186 10885. 0.0010143
9187 10886. 0.00101005
9188 10887. 0.001005801
9189 10888. 0.001001555
9190 10889. 9.973092E-4
9191 10890. 9.930661E-4
9192 10891. 9.889458E-4
9193 10892. 9.848261E-4
9194 10893. 9.807071E-4
9195 10894. 9.765889E-4
9196 10895. 9.724715E-4
9197 10896. 9.683550E-4
9198 10897. 9.642389E-4
9199 10898. 9.601195E-4
9200 10899. 9.560090E-4
9201 10900. 9.518951E-4
9202 10901. 9.477825E-4
9203 10902. 9.436703E-4
9204 10903. 9.395592E-4
9205 10904. 9.354451E-4
9206 10905. 9.313319E-4
9207 10906. 9.272196E-4
9208 10907. 9.231080E-4
9209 10908. 9.189972E-4
9210 10909. 9.148868E-4
9211 10910. 9.107781E-4
9212 10911. 9.066697E-4
9213 10912. 9.025628E-4
9214 10913. 8.984559E-4
9215 10914. 8.943502E-4
9216 10915. 8.902455E-4
9217 10916. 8.861414E-4
9218 10917. 8.820377E-4
9219 10918. 8.779350E-4
9220 10919. 8.738328E-4
9221 10920. 8.697276E-4
9222 10921. 8.655257E-4
9223 10922. 8.613212E-4
9224 10923. 8.571187E-4
9225 10924. 8.529199E-4
9226 10925. 8.487225E-4
9227 10926. 8.445269E-4
9228 10927. 8.403327E-4
9229 10928. 8.361402E-4
9230 10929. 8.319455E-4
9231 10930. 8.277606E-4
9232 10931. 8.236751E-4
9233 10932. 8.195904E-4
9234 10933. 8.155063E-4
9235 10934. 8.114227E-4
9236 10935. 8.073405E-4
9237 10936. 8.032583E-4
9238 10937. 7.991772E-4
9239 10938. 7.950928E-4
9240 10939. 7.910168E-4
9241 10940. 7.869381E-4
9242 10941. 7.828602E-4
9243 10942. 7.787794E-4
9244 10943. 7.747068E-4
9245 10944. 7.706322E-4
9246 10945. 7.665582E-4
9247 10946. 7.624849E-4
9248 10947. 7.584125E-4
9249 10948. 7.543408E-4
9250 10949. 7.502694E-4
9251 10950. 7.461990E-4
9252 10951. 7.420345E-4
9253 10952. 7.378797E-4
9254 10953. 7.337224E-4
9255 10954. 7.295668E-4
9256 10955. 7.254129E-4
9257 10956. 7.212606E-4
9258 10957. 7.171102E-4
9259 10958. 7.129617E-4
9260 10959. 7.088145E-4
9261 10960. 7.046653E-4
9262 10961. 7.006122E-4
9263 10962. 6.965563E-4
9264 10963. 6.925011E-4
9265 10964. 6.884404E-4
9266 10965. 6.843886E-4
9267 10966. 6.803335E-4
9268 10967. 6.762833E-4
9269 10968. 6.722258E-4
9270 10969. 6.681689E-4
9271 10970. 6.641208E-4
9272 10971. 6.600698E-4
9273 10972. 6.560235E-4
9274 10973. 6.519660E-4
9275 10974. 6.479211E-4
9276 10975. 6.438731E-4
9277 10976. 6.398297E-4
9278 10977. 6.357790E-4
9279 10978. 6.317293E-4
9280 10979. 6.276878E-4
9281 10980. 6.236435E-4
9282 10981. 6.195275E-4
9283 10982. 6.154014E-4
9284 10983. 6.112891E-4
9285 10984. 4.150590E-6
9286 10985. 0.
9287 10986. 0.
9288 10987. 0.
9289 10988. 0.
9290 10989. 0.
9291 10990. 0.
9292 10991. 0.
9293 10992. 0.
9294 10993. 0.
9295 10994. 0.
9296 10995. 0.
9297 10996. 0.
9298 10997. 0.
9299 10998. 0.
9300 10999. 0.
9301 11000. 0.
9302 11001. 0.
9303 11002. 0.
9304 11003. 0.
9305 11004. 0.
9306 11005. 0.
9307 11006. 0.
9308 11007. 0.
9309 11008. 0.
9310 11009. 0.
9311 11010. 0.
9312 11011. 0.
9313 11012. 0.
9314 11013. 0.
9315 11014. 0.
9316 11015. 0.
9317 11016. 0.
9318 11017. 0.
9319 11018. 0.
9320 11019. 0.
9321 11020. 0.
9322 11021. 0.
9323 11022. 0.
9324 11023. 0.
9325 11024. 0.
9326 11025. 0.
9327 11026. 0.
9328 11027. 0.
9329 11028. 0.
9330 11029. 0.
9331 11030. 0.
9332 11031. 0.
9333 11032. 0.
9334 11033. 0.
9335 11034. 0.
9336 11035. 0.
9337 11036. 0.
9338 11037. 0.
9339 11038. 0.
9340 11039. 0.
9341 11040. 0.
9342 11041. 0.
9343 11042. 0.
9344 11043. 0.
9345 11044. 0.
9346 11045. 0.
9347 11046. 0.
9348 11047. 0.
9349 11048. 0.
9350 11049. 0.
9351 11050. 0.
9352 11051. 0.
9353 11052. 0.
9354 11053. 0.
9355 11054. 0.
9356 11055. 0.
9357 11056. 0.
9358 11057. 0.
9359 11058. 0.
9360 11059. 0.
9361 11060. 0.
9362 11061. 0.
9363 11062. 0.
9364 11063. 0.
9365 11064. 0.
9366 11065. 0.
9367 11066. 0.
9368 11067. 0.
9369 11068. 0.
9370 11069. 0.
9371 11070. 0.
9372 11071. 0.
9373 11072. 0.
9374 11073. 0.
9375 11074. 0.
9376 11075. 0.
9377 11076. 0.
9378 11077. 0.
9379 11078. 0.
9380 11079. 0.
9381 11080. 0.
9382 11081. 0.
9383 11082. 0.
9384 11083. 0.
9385 11084. 0.
9386 11085. 0.
9387 11086. 0.
9388 11087. 0.
9389 11088. 0.
9390 11089. 0.
9391 11090. 0.
9392 11091. 0.
9393 11092. 0.
9394 11093. 0.
9395 11094. 0.
9396 11095. 0.
9397 11096. 0.
9398 11097. 0.
9399 11098. 0.
9400 11099. 0.
9401 11100. 0.
9402 11101. 0.
9403 11102. 0.
9404 11103. 0.
9405 11104. 0.
9406 11105. 0.
9407 11106. 0.
9408 11107. 0.
9409 11108. 0.
9410 11109. 0.
9411 11110. 0.
9412 11111. 0.
9413 11112. 0.
9414 11113. 0.
9415 11114. 0.
9416 11115. 0.
9417 11116. 0.
9418 11117. 0.
9419 11118. 0.
9420 11119. 0.
9421 11120. 0.
9422 11121. 0.
9423 11122. 0.
9424 11123. 0.
9425 11124. 0.
9426 11125. 0.
9427 11126. 0.
9428 11127. 0.
9429 11128. 0.
9430 11129. 0.
9431 11130. 0.
9432 11131. 0.
9433 11132. 0.
9434 11133. 0.
9435 11134. 0.
9436 11135. 0.
9437 11136. 0.
9438 11137. 0.
9439 11138. 0.
9440 11139. 0.
9441 11140. 0.
9442 11141. 0.
9443 11142. 0.
9444 11143. 0.
9445 11144. 0.
9446 11145. 0.
9447 11146. 0.
9448 11147. 0.
9449 11148. 0.
9450 11149. 0.
9451 11150. 0.
9452 11151. 0.
9453 11152. 0.
9454 11153. 0.
9455 11154. 0.
9456 11155. 0.
9457 11156. 0.
9458 11157. 0.
9459 11158. 0.
9460 11159. 0.
9461 11160. 0.
9462 11161. 0.
9463 11162. 0.
9464 11163. 0.
9465 11164. 0.
9466 11165. 0.
9467 11166. 0.
9468 11167. 0.
9469 11168. 0.
9470 11169. 0.
9471 11170. 0.
9472 11171. 0.
9473 11172. 0.
9474 11173. 0.
9475 11174. 0.
9476 11175. 0.
9477 11176. 0.
9478 11177. 0.
9479 11178. 0.
9480 11179. 0.
9481 11180. 0.
9482 11181. 0.
9483 11182. 0.
9484 11183. 0.
9485 11184. 0.
9486 11185. 0.
9487 11186. 0.
9488 11187. 0.
9489 11188. 0.
9490 11189. 0.
9491 11190. 0.
9492 11191. 0.
9493 11192. 0.
9494 11193. 0.
9495 11194. 0.
9496 11195. 0.
9497 11196. 0.
9498 11197. 0.
9499 11198. 0.
9500 11199. 0.
9501 11200. 0.
9502 11201. 0.
9503 11202. 0.
9504 11203. 0.
9505 11204. 0.
9506 11205. 0.
9507 11206. 0.
9508 11207. 0.
9509 11208. 0.
9510 11209. 0.
9511 11210. 0.
9512 11211. 0.
9513 11212. 0.
9514 11213. 0.
9515 11214. 0.
9516 11215. 0.
9517 11216. 0.
9518 11217. 0.
9519 11218. 0.
9520 11219. 0.
9521 11220. 0.
9522 11221. 0.
9523 11222. 0.
9524 11223. 0.
9525 11224. 0.
9526 11225. 0.
9527 11226. 0.
9528 11227. 0.
9529 11228. 0.
9530 11229. 0.
9531 11230. 0.
9532 11231. 0.
9533 11232. 0.
9534 11233. 0.
9535 11234. 0.
9536 11235. 0.
9537 11236. 0.
9538 11237. 0.
9539 11238. 0.
9540 11239. 0.
9541 11240. 0.
9542 11241. 0.
9543 11242. 0.
9544 11243. 0.
9545 11244. 0.
9546 11245. 0.
9547 11246. 0.
9548 11247. 0.
9549 11248. 0.
9550 11249. 0.
9551 11250. 0.
9552 11251. 0.
9553 11252. 0.
9554 11253. 0.
9555 11254. 0.
9556 11255. 0.
9557 11256. 0.
9558 11257. 0.
9559 11258. 0.
9560 11259. 0.
9561 11260. 0.
9562 11261. 0.
9563 11262. 0.
9564 11263. 0.
9565 11264. 0.
9566 11265. 0.
9567 11266. 0.
9568 11267. 0.
9569 11268. 0.
9570 11269. 0.
9571 11270. 0.
9572 11271. 0.
9573 11272. 0.
9574 11273. 0.
9575 11274. 0.
9576 11275. 0.
9577 11276. 0.
9578 11277. 0.
9579 11278. 0.
9580 11279. 0.
9581 11280. 0.
9582 11281. 0.
9583 11282. 0.
9584 11283. 0.
9585 11284. 0.
9586 11285. 0.
9587 11286. 0.
9588 11287. 0.
9589 11288. 0.
9590 11289. 0.
9591 11290. 0.
9592 11291. 0.
9593 11292. 0.
9594 11293. 0.
9595 11294. 0.
9596 11295. 0.
9597 11296. 0.
9598 11297. 0.
9599 11298. 0.
9600 11299. 0.
9601 11300. 0.
9602 11301. 0.
9603 11302. 0.
9604 11303. 0.
9605 11304. 0.
9606 11305. 0.
9607 11306. 0.
9608 11307. 0.
9609 11308. 0.
9610 11309. 0.
9611 11310. 0.
9612 11311. 0.
9613 11312. 0.
9614 11313. 0.
9615 11314. 0.
9616 11315. 0.
9617 11316. 0.
9618 11317. 0.
9619 11318. 0.
9620 11319. 0.
9621 11320. 0.
9622 11321. 0.
9623 11322. 0.
9624 11323. 0.
9625 11324. 0.
9626 11325. 0.
9627 11326. 0.
9628 11327. 0.
9629 11328. 0.
9630 11329. 0.
9631 11330. 0.
9632 11331. 0.
9633 11332. 0.
9634 11333. 0.
9635 11334. 0.
9636 11335. 0.
9637 11336. 0.
9638 11337. 0.
9639 11338. 0.
9640 11339. 0.
9641 11340. 0.
9642 11341. 0.
9643 11342. 0.
9644 11343. 0.
9645 11344. 0.
9646 11345. 0.
9647 11346. 0.
9648 11347. 0.
9649 11348. 0.
9650 11349. 0.
9651 11350. 0.
9652 11351. 0.
9653 11352. 0.
9654 11353. 0.
9655 11354. 0.
9656 11355. 0.
9657 11356. 0.
9658 11357. 0.
9659 11358. 0.
9660 11359. 0.
9661 11360. 0.
9662 11361. 0.
9663 11362. 0.
9664 11363. 0.
9665 11364. 0.
9666 11365. 0.
9667 11366. 0.
9668 11367. 0.
9669 11368. 0.
9670 11369. 0.
9671 11370. 0.
9672 11371. 0.
9673 11372. 0.
9674 11373. 0.
9675 11374. 0.
9676 11375. 0.
9677 11376. 0.
9678 11377. 0.
9679 11378. 0.
9680 11379. 0.
9681 11380. 0.
9682 11381. 0.
9683 11382. 0.
9684 11383. 0.
9685 11384. 0.
9686 11385. 0.
9687 11386. 0.
9688 11387. 0.
9689 11388. 0.
9690 11389. 0.
9691 11390. 0.
9692 11391. 0.
9693 11392. 0.
9694 11393. 0.
9695 11394. 0.
9696 11395. 0.
9697 11396. 0.
9698 11397. 0.
9699 11398. 0.
9700 11399. 0.
9701 11400. 0.
9702 11401. 0.
9703 11402. 0.
9704 11403. 0.
9705 11404. 0.
9706 11405. 0.
9707 11406. 0.
9708 11407. 0.
9709 11408. 0.
9710 11409. 0.
9711 11410. 0.
9712 11411. 0.
9713 11412. 0.
9714 11413. 0.
9715 11414. 0.
9716 11415. 0.
9717 11416. 0.
9718 11417. 0.
9719 11418. 0.
9720 11419. 0.
9721 11420. 0.
9722 11421. 0.
9723 11422. 0.
9724 11423. 0.
9725 11424. 0.
9726 11425. 0.
9727 11426. 0.
9728 11427. 0.
9729 11428. 0.
9730 11429. 0.
9731 11430. 0.
9732 11431. 0.
9733 11432. 0.
9734 11433. 0.
9735 11434. 0.
9736 11435. 0.
9737 11436. 0.
9738 11437. 0.
9739 11438. 0.
9740 11439. 0.
9741 11440. 0.
9742 11441. 0.
9743 11442. 0.
9744 11443. 0.
9745 11444. 0.
9746 11445. 0.
9747 11446. 0.
9748 11447. 0.
9749 11448. 0.
9750 11449. 0.
9751 11450. 0.
9752 11451. 0.
9753 11452. 0.
9754 11453. 0.
9755 11454. 0.
9756 11455. 0.
9757 11456. 0.
9758 11457. 0.
9759 11458. 0.
9760 11459. 0.
9761 11460. 0.
9762 11461. 0.
9763 11462. 0.
9764 11463. 0.
9765 11464. 0.
9766 11465. 0.
9767 11466. 0.
9768 11467. 0.
9769 11468. 0.
9770 11469. 0.
9771 11470. 0.
9772 11471. 0.
9773 11472. 0.
9774 11473. 0.
9775 11474. 0.
9776 11475. 0.
9777 11476. 0.
9778 11477. 0.
9779 11478. 0.
9780 11479. 0.
9781 11480. 0.
9782 11481. 0.
9783 11482. 0.
9784 11483. 0.
9785 11484. 0.
9786 11485. 0.
9787 11486. 0.
9788 11487. 0.
9789 11488. 0.
9790 11489. 0.
9791 11490. 0.
9792 11491. 0.
9793 11492. 0.
9794 11493. 0.
9795 11494. 0.
9796 11495. 0.
9797 11496. 0.
9798 11497. 0.
9799 11498. 0.
9800 11499. 0.
9801 11500. 0.
9802 11501. 0.
9803 11502. 0.
9804 11503. 0.
9805 11504. 0.
9806 11505. 0.
9807 11506. 0.
9808 11507. 0.
9809 11508. 0.
9810 11509. 0.
9811 11510. 0.
9812 11511. 0.
9813 11512. 0.
9814 11513. 0.
9815 11514. 0.
9816 11515. 0.
9817 11516. 0.
9818 11517. 0.
9819 11518. 0.
9820 11519. 0.
9821 11520. 0.
9822 11521. 0.
9823 11522. 0.
9824 11523. 0.
9825 11524. 0.
9826 11525. 0.
9827 11526. 0.
9828 11527. 0.
9829 11528. 0.
9830 11529. 0.
9831 11530. 0.
9832 11531. 0.
9833 11532. 0.
9834 11533. 0.
9835 11534. 0.
9836 11535. 0.
9837 11536. 0.
9838 11537. 0.
9839 11538. 0.
9840 11539. 0.
9841 11540. 0.
9842 11541. 0.
9843 11542. 0.
9844 11543. 0.
9845 11544. 0.
9846 11545. 0.
9847 11546. 0.
9848 11547. 0.
9849 11548. 0.
9850 11549. 0.
9851 11550. 0.
9852 11551. 0.
9853 11552. 0.
9854 11553. 0.
9855 11554. 0.
9856 11555. 0.
9857 11556. 0.
9858 11557. 0.
9859 11558. 0.
9860 11559. 0.
9861 11560. 0.
9862 11561. 0.
9863 11562. 0.
9864 11563. 0.
9865 11564. 0.
9866 11565. 0.
9867 11566. 0.
9868 11567. 0.
9869 11568. 0.
9870 11569. 0.
9871 11570. 0.
9872 11571. 0.
9873 11572. 0.
9874 11573. 0.
9875 11574. 0.
9876 11575. 0.
9877 11576. 0.
9878 11577. 0.
9879 11578. 0.
9880 11579. 0.
9881 11580. 0.
9882 11581. 0.
9883 11582. 0.
9884 11583. 0.
9885 11584. 0.
9886 11585. 0.
9887 11586. 0.
9888 11587. 0.
9889 11588. 0.
9890 11589. 0.
9891 11590. 0.
9892 11591. 0.
9893 11592. 0.
9894 11593. 0.
9895 11594. 0.
9896 11595. 0.
9897 11596. 0.
9898 11597. 0.
9899 11598. 0.
9900 11599. 0.
9901 11600. 0.
9902 11601. 0.
9903 11602. 0.
9904 11603. 0.
9905 11604. 0.
9906 11605. 0.
9907 11606. 0.
9908 11607. 0.
9909 11608. 0.
9910 11609. 0.
9911 11610. 0.
9912 11611. 0.
9913 11612. 0.
9914 11613. 0.
9915 11614. 0.
9916 11615. 0.
9917 11616. 0.
9918 11617. 0.
9919 11618. 0.
9920 11619. 0.
9921 11620. 0.
9922 11621. 0.
9923 11622. 0.
9924 11623. 0.
9925 11624. 0.
9926 11625. 0.
9927 11626. 0.
9928 11627. 0.
9929 11628. 0.
9930 11629. 0.
9931 11630. 0.
9932 11631. 0.
9933 11632. 0.
9934 11633. 0.
9935 11634. 0.
9936 11635. 0.
9937 11636. 0.
9938 11637. 0.
9939 11638. 0.
9940 11639. 0.
9941 11640. 0.
9942 11641. 0.
9943 11642. 0.
9944 11643. 0.
9945 11644. 0.
9946 11645. 0.
9947 11646. 0.
9948 11647. 0.
9949 11648. 0.
9950 11649. 0.
9951 11650. 0.
9952 11651. 0.
9953 11652. 0.
9954 11653. 0.
9955 11654. 0.
9956 11655. 0.
9957 11656. 0.
9958 11657. 0.
9959 11658. 0.
9960 11659. 0.
9961 11660. 0.
9962 11661. 0.
9963 11662. 0.
9964 11663. 0.
9965 11664. 0.
9966 11665. 0.
9967 11666. 0.
9968 11667. 0.
9969 11668. 0.
9970 11669. 0.
9971 11670. 0.
9972 11671. 0.
9973 11672. 0.
9974 11673. 0.
9975 11674. 0.
9976 11675. 0.
9977 11676. 0.
9978 11677. 0.
9979 11678. 0.
9980 11679. 0.
9981 11680. 0.
9982 11681. 0.
9983 11682. 0.
9984 11683. 0.
9985 11684. 0.
9986 11685. 0.
9987 11686. 0.
9988 11687. 0.
9989 11688. 0.
9990 11689. 0.
9991 11690. 0.
9992 11691. 0.
9993 11692. 0.
9994 11693. 0.
9995 11694. 0.
9996 11695. 0.
9997 11696. 0.
9998 11697. 0.
9999 11698. 0.
10000 11699. 0.
10001 11700. 0.
10002 11701. 0.
10003 11702. 0.
10004 11703. 0.
10005 11704. 0.
10006 11705. 0.
10007 11706. 0.
10008 11707. 0.
10009 11708. 0.
10010 11709. 0.
10011 11710. 0.
10012 11711. 0.
10013 11712. 0.
10014 11713. 0.
10015 11714. 0.
10016 11715. 0.
10017 11716. 0.
10018 11717. 0.
10019 11718. 0.
10020 11719. 0.
10021 11720. 0.
10022 11721. 0.
10023 11722. 0.
10024 11723. 0.
10025 11724. 0.
10026 11725. 0.
10027 11726. 0.
10028 11727. 0.
10029 11728. 0.
10030 11729. 0.
10031 11730. 0.
10032 11731. 0.
10033 11732. 0.
10034 11733. 0.
10035 11734. 0.
10036 11735. 0.
10037 11736. 0.
10038 11737. 0.
10039 11738. 0.
10040 11739. 0.
10041 11740. 0.
10042 11741. 0.
10043 11742. 0.
10044 11743. 0.
10045 11744. 0.
10046 11745. 0.
10047 11746. 0.
10048 11747. 0.
10049 11748. 0.
10050 11749. 0.
10051 11750. 0.
10052 11751. 0.
10053 11752. 0.
10054 11753. 0.
10055 11754. 0.
10056 11755. 0.
10057 11756. 0.
10058 11757. 0.
10059 11758. 0.
10060 11759. 0.
10061 11760. 0.
10062 11761. 0.
10063 11762. 0.
10064 11763. 0.
10065 11764. 0.
10066 11765. 0.
10067 11766. 0.
10068 11767. 0.
10069 11768. 0.
10070 11769. 0.
10071 11770. 0.
10072 11771. 0.
10073 11772. 0.
10074 11773. 0.
10075 11774. 0.
10076 11775. 0.
10077 11776. 0.
10078 11777. 0.
10079 11778. 0.
10080 11779. 0.
10081 11780. 0.
10082 11781. 0.
10083 11782. 0.
10084 11783. 0.
10085 11784. 0.
10086 11785. 0.
10087 11786. 0.
10088 11787. 0.
10089 11788. 0.
10090 11789. 0.
10091 11790. 0.
10092 11791. 0.
10093 11792. 0.
10094 11793. 0.
10095 11794. 0.
10096 11795. 0.
10097 11796. 0.
10098 11797. 0.
10099 11798. 0.
10100 11799. 0.
10101 11800. 0.
10102 11801. 0.
10103 11802. 0.
10104 11803. 0.
10105 11804. 0.
10106 11805. 0.
10107 11806. 0.
10108 11807. 0.
10109 11808. 0.
10110 11809. 0.
10111 11810. 0.
10112 11811. 0.
10113 11812. 0.
10114 11813. 0.
10115 11814. 0.
10116 11815. 0.
10117 11816. 0.
10118 11817. 0.
10119 11818. 0.
10120 11819. 0.
10121 11820. 0.
10122 11821. 0.
10123 11822. 0.
10124 11823. 0.
10125 11824. 0.
10126 11825. 0.
10127 11826. 0.
10128 11827. 0.
10129 11828. 0.
10130 11829. 0.
10131 11830. 0.
10132 11831. 0.
10133 11832. 0.
10134 11833. 0.
10135 11834. 0.
10136 11835. 0.
10137 11836. 0.
10138 11837. 0.
10139 11838. 0.
10140 11839. 0.
10141 11840. 0.
10142 11841. 0.
10143 11842. 0.
10144 11843. 0.
10145 11844. 0.
10146 11845. 0.
10147 11846. 0.
10148 11847. 0.
10149 11848. 0.
10150 11849. 0.
10151 11850. 0.
10152 11851. 0.
10153 11852. 0.
10154 11853. 0.
10155 11854. 0.
10156 11855. 0.
10157 11856. 0.
10158 11857. 0.
10159 11858. 0.
10160 11859. 0.
10161 11860. 0.
10162 11861. 0.
10163 11862. 0.
10164 11863. 0.
10165 11864. 0.
10166 11865. 0.
10167 11866. 0.
10168 11867. 0.
10169 11868. 0.
10170 11869. 0.
10171 11870. 0.
10172 11871. 0.
10173 11872. 0.
10174 11873. 0.
10175 11874. 0.
10176 11875. 0.
10177 11876. 0.
10178 11877. 0.
10179 11878. 0.
10180 11879. 0.
10181 11880. 0.
10182 11881. 0.
10183 11882. 0.
10184 11883. 0.
10185 11884. 0.
10186 11885. 0.
10187 11886. 0.
10188 11887. 0.
10189 11888. 0.
10190 11889. 0.
10191 11890. 0.
10192 11891. 0.
10193 11892. 0.
10194 11893. 0.
10195 11894. 0.
10196 11895. 0.
10197 11896. 0.
10198 11897. 0.
10199 11898. 0.
10200 11899. 0.
10201 11900. 0.
10202 11901. 0.
10203 11902. 0.
10204 11903. 0.
10205 11904. 0.
10206 11905. 0.
10207 11906. 0.
10208 11907. 0.
10209 11908. 0.
10210 11909. 0.
10211 11910. 0.
10212 11911. 0.
10213 11912. 0.
10214 11913. 0.
10215 11914. 0.
10216 11915. 0.
10217 11916. 0.
10218 11917. 0.
10219 11918. 0.
10220 11919. 0.
10221 11920. 0.
10222 11921. 0.
10223 11922. 0.
10224 11923. 0.
10225 11924. 0.
10226 11925. 0.
10227 11926. 0.
10228 11927. 0.
10229 11928. 0.
10230 11929. 0.
10231 11930. 0.
10232 11931. 0.
10233 11932. 0.
10234 11933. 0.
10235 11934. 0.
10236 11935. 0.
10237 11936. 0.
10238 11937. 0.
10239 11938. 0.
10240 11939. 0.
10241 11940. 0.
10242 11941. 0.
10243 11942. 0.
10244 11943. 0.
10245 11944. 0.
10246 11945. 0.
10247 11946. 0.
10248 11947. 0.
10249 11948. 0.
10250 11949. 0.
10251 11950. 0.
10252 11951. 0.
10253 11952. 0.
10254 11953. 0.
10255 11954. 0.
10256 11955. 0.
10257 11956. 0.
10258 11957. 0.
10259 11958. 0.
10260 11959. 0.
10261 11960. 0.
10262 11961. 0.
10263 11962. 0.
10264 11963. 0.
10265 11964. 0.
10266 11965. 0.
10267 11966. 0.
10268 11967. 0.
10269 11968. 0.
10270 11969. 0.
10271 11970. 0.
10272 11971. 0.
10273 11972. 0.
10274 11973. 0.
10275 11974. 0.
10276 11975. 0.
10277 11976. 0.
10278 11977. 0.
10279 11978. 0.
10280 11979. 0.
10281 11980. 0.
10282 11981. 0.
10283 11982. 0.
10284 11983. 0.
10285 11984. 0.
10286 11985. 0.
10287 11986. 0.
10288 11987. 0.
10289 11988. 0.
10290 11989. 0.
10291 11990. 0.
10292 11991. 0.
10293 11992. 0.
10294 11993. 0.
10295 11994. 0.
10296 11995. 0.
10297 11996. 0.
10298 11997. 0.
10299 11998. 0.
10300 11999. 0.
10301 12000. 0.
10302 12001. 0.
10303 12002. 0.
10304 12003. 0.
10305 12004. 0.
10306 12005. 0.
10307 12006. 0.
10308 12007. 0.
10309 12008. 0.
10310 12009. 0.
10311 12010. 0.
10312 12011. 0.
10313 12012. 0.
10314 12013. 0.
10315 12014. 0.
10316 12015. 0.
10317 12016. 0.
10318 12017. 0.
10319 12018. 0.
10320 12019. 0.
10321 12020. 0.
10322 12021. 0.
10323 12022. 0.
10324 12023. 0.
10325 12024. 0.
10326 12025. 0.
10327 12026. 0.
10328 12027. 0.
10329 12028. 0.
10330 12029. 0.
10331 12030. 0.
10332 12031. 0.
10333 12032. 0.
10334 12033. 0.
10335 12034. 0.
10336 12035. 0.
10337 12036. 0.
10338 12037. 0.
10339 12038. 0.
10340 12039. 0.
10341 12040. 0.
10342 12041. 0.
10343 12042. 0.
10344 12043. 0.
10345 12044. 0.
10346 12045. 0.
10347 12046. 0.
10348 12047. 0.
10349 12048. 0.
10350 12049. 0.
10351 12050. 0.
10352 12051. 0.
10353 12052. 0.
10354 12053. 0.
10355 12054. 0.
10356 12055. 0.
10357 12056. 0.
10358 12057. 0.
10359 12058. 0.
10360 12059. 0.
10361 12060. 0.
10362 12061. 0.
10363 12062. 0.
10364 12063. 0.
10365 12064. 0.
10366 12065. 0.
10367 12066. 0.
10368 12067. 0.
10369 12068. 0.
10370 12069. 0.
10371 12070. 0.
10372 12071. 0.
10373 12072. 0.
10374 12073. 0.
10375 12074. 0.
10376 12075. 0.
10377 12076. 0.
10378 12077. 0.
10379 12078. 0.
10380 12079. 0.
10381 12080. 0.
10382 12081. 0.
10383 12082. 0.
10384 12083. 0.
10385 12084. 0.
10386 12085. 0.
10387 12086. 0.
10388 12087. 0.
10389 12088. 0.
10390 12089. 0.
10391 12090. 0.
10392 12091. 0.
10393 12092. 0.
10394 12093. 0.
10395 12094. 0.
10396 12095. 0.
10397 12096. 0.
10398 12097. 0.
10399 12098. 0.
10400 12099. 0.
10401 12100. 0.
10402 12101. 0.
10403 12102. 0.
10404 12103. 0.
10405 12104. 0.
10406 12105. 0.
10407 12106. 0.
10408 12107. 0.
10409 12108. 0.
10410 12109. 0.
10411 12110. 0.
10412 12111. 0.
10413 12112. 0.
10414 12113. 0.
10415 12114. 0.
10416 12115. 0.
10417 12116. 0.
10418 12117. 0.
10419 12118. 0.
10420 12119. 0.
10421 12120. 0.
10422 12121. 0.
10423 12122. 0.
10424 12123. 0.
10425 12124. 0.
10426 12125. 0.
10427 12126. 0.
10428 12127. 0.
10429 12128. 0.
10430 12129. 0.
10431 12130. 0.
10432 12131. 0.
10433 12132. 0.
10434 12133. 0.
10435 12134. 0.
10436 12135. 0.
10437 12136. 0.
10438 12137. 0.
10439 12138. 0.
10440 12139. 0.
10441 12140. 0.
10442 12141. 0.
10443 12142. 0.
10444 12143. 0.
10445 12144. 0.
10446 12145. 0.
10447 12146. 0.
10448 12147. 0.
10449 12148. 0.
10450 12149. 0.
10451 12150. 0.
10452 12151. 0.
10453 12152. 0.
10454 12153. 0.
10455 12154. 0.
10456 12155. 0.
10457 12156. 0.
10458 12157. 0.
10459 12158. 0.
10460 12159. 0.
10461 12160. 0.
10462 12161. 0.
10463 12162. 0.
10464 12163. 0.
10465 12164. 0.
10466 12165. 0.
10467 12166. 0.
10468 12167. 0.
10469 12168. 0.
10470 12169. 0.
10471 12170. 0.
10472 12171. 0.
10473 12172. 0.
10474 12173. 0.
10475 12174. 0.
10476 12175. 0.
10477 12176. 0.
10478 12177. 0.
10479 12178. 0.
10480 12179. 0.
10481 12180. 0.
10482 12181. 0.
10483 12182. 0.
10484 12183. 0.
10485 12184. 0.
10486 12185. 0.
10487 12186. 0.
10488 12187. 0.
10489 12188. 0.
10490 12189. 0.
10491 12190. 0.
10492 12191. 0.
10493 12192. 0.
10494 12193. 0.
10495 12194. 0.
10496 12195. 0.
10497 12196. 0.
10498 12197. 0.
10499 12198. 0.
10500 12199. 0.
10501 12200. 0.
10502 12201. 0.
10503 12202. 0.
10504 12203. 0.
10505 12204. 0.
10506 12205. 0.
10507 12206. 0.
10508 12207. 0.
10509 12208. 0.
10510 12209. 0.
10511 12210. 0.
10512 12211. 0.
10513 12212. 0.
10514 12213. 0.
10515 12214. 0.
10516 12215. 0.
10517 12216. 0.
10518 12217. 0.
10519 12218. 0.
10520 12219. 0.
10521 12220. 0.
10522 12221. 0.
10523 12222. 0.
10524 12223. 0.
10525 12224. 0.
10526 12225. 0.
10527 12226. 0.
10528 12227. 0.
10529 12228. 0.
10530 12229. 0.
10531 12230. 0.
10532 12231. 0.
10533 12232. 0.
10534 12233. 0.
10535 12234. 0.
10536 12235. 0.
10537 12236. 0.
10538 12237. 0.
10539 12238. 0.
10540 12239. 0.
10541 12240. 0.
10542 12241. 0.
10543 12242. 0.
10544 12243. 0.
10545 12244. 0.
10546 12245. 0.
10547 12246. 0.
10548 12247. 0.
10549 12248. 0.
10550 12249. 0.
10551 12250. 0.
10552 12251. 0.
10553 12252. 0.
10554 12253. 0.
10555 12254. 0.
10556 12255. 0.
10557 12256. 0.
10558 12257. 0.
10559 12258. 0.
10560 12259. 0.
10561 12260. 0.
10562 12261. 0.
10563 12262. 0.
10564 12263. 0.
10565 12264. 0.
10566 12265. 0.
10567 12266. 0.
10568 12267. 0.
10569 12268. 0.
10570 12269. 0.
10571 12270. 0.
10572 12271. 0.
10573 12272. 0.
10574 12273. 0.
10575 12274. 0.
10576 12275. 0.
10577 12276. 0.
10578 12277. 0.
10579 12278. 0.
10580 12279. 0.
10581 12280. 0.
10582 12281. 0.
10583 12282. 0.
10584 12283. 0.
10585 12284. 0.
10586 12285. 0.
10587 12286. 0.
10588 12287. 0.
10589 12288. 0.
10590 12289. 0.
10591 12290. 0.
10592 12291. 0.
10593 12292. 0.
10594 12293. 0.
10595 12294. 0.
10596 12295. 0.
10597 12296. 0.
10598 12297. 0.
10599 12298. 0.
10600 12299. 0.
10601 12300. 0.
10602 12301. 0.
10603 12302. 0.
10604 12303. 0.
10605 12304. 0.
10606 12305. 0.
10607 12306. 0.
10608 12307. 0.
10609 12308. 0.
10610 12309. 0.
10611 12310. 0.
10612 12311. 0.
10613 12312. 0.
10614 12313. 0.
10615 12314. 0.
10616 12315. 0.
10617 12316. 0.
10618 12317. 0.
10619 12318. 0.
10620 12319. 0.
10621 12320. 0.
10622 12321. 0.
10623 12322. 0.
10624 12323. 0.
10625 12324. 0.
10626 12325. 0.
10627 12326. 0.
10628 12327. 0.
10629 12328. 0.
10630 12329. 0.
10631 12330. 0.
10632 12331. 0.
10633 12332. 0.
10634 12333. 0.
10635 12334. 0.
10636 12335. 0.
10637 12336. 0.
10638 12337. 0.
10639 12338. 0.
10640 12339. 0.
10641 12340. 0.
10642 12341. 0.
10643 12342. 0.
10644 12343. 0.
10645 12344. 0.
10646 12345. 0.
10647 12346. 0.
10648 12347. 0.
10649 12348. 0.
10650 12349. 0.
10651 12350. 0.
10652 12351. 0.
10653 12352. 0.
10654 12353. 0.
10655 12354. 0.
10656 12355. 0.
10657 12356. 0.
10658 12357. 0.
10659 12358. 0.
10660 12359. 0.
10661 12360. 0.
10662 12361. 0.
10663 12362. 0.
10664 12363. 0.
10665 12364. 0.
10666 12365. 0.
10667 12366. 0.
10668 12367. 0.
10669 12368. 0.
10670 12369. 0.
10671 12370. 0.
10672 12371. 0.
10673 12372. 0.
10674 12373. 0.
10675 12374. 0.
10676 12375. 0.
10677 12376. 0.
10678 12377. 0.
10679 12378. 0.
10680 12379. 0.
10681 12380. 0.
10682 12381. 0.
10683 12382. 0.
10684 12383. 0.
10685 12384. 0.
10686 12385. 0.
10687 12386. 0.
10688 12387. 0.
10689 12388. 0.
10690 12389. 0.
10691 12390. 0.
10692 12391. 0.
10693 12392. 0.
10694 12393. 0.
10695 12394. 0.
10696 12395. 0.
10697 12396. 0.
10698 12397. 0.
10699 12398. 0.
10700 12399. 0.
10701 12400. 0.
10702 12401. 0.
10703 12402. 0.
10704 12403. 0.
10705 12404. 0.
10706 12405. 0.
10707 12406. 0.
10708 12407. 0.
10709 12408. 0.
10710 12409. 0.
10711 12410. 0.
10712 12411. 0.
10713 12412. 0.
10714 12413. 0.
10715 12414. 0.
10716 12415. 0.
10717 12416. 0.
10718 12417. 0.
10719 12418. 0.
10720 12419. 0.
10721 12420. 0.
10722 12421. 0.
10723 12422. 0.
10724 12423. 0.
10725 12424. 0.
10726 12425. 0.
10727 12426. 0.
10728 12427. 0.
10729 12428. 0.
10730 12429. 0.
10731 12430. 0.
10732 12431. 0.
10733 12432. 0.
10734 12433. 0.
10735 12434. 0.
10736 12435. 0.
10737 12436. 0.
10738 12437. 0.
10739 12438. 0.
10740 12439. 0.
10741 12440. 0.
10742 12441. 0.
10743 12442. 0.
10744 12443. 0.
10745 12444. 0.
10746 12445. 0.
10747 12446. 0.
10748 12447. 0.
10749 12448. 0.
10750 12449. 0.
10751 12450. 0.
10752 12451. 0.
10753 12452. 0.
10754 12453. 0.
10755 12454. 0.
10756 12455. 0.
10757 12456. 0.
10758 12457. 0.
10759 12458. 0.
10760 12459. 0.
10761 12460. 0.
10762 12461. 0.
10763 12462. 0.
10764 12463. 0.
10765 12464. 0.
10766 12465. 0.
10767 12466. 0.
10768 12467. 0.
10769 12468. 0.
10770 12469. 0.
10771 12470. 0.
10772 12471. 0.
10773 12472. 0.
10774 12473. 0.
10775 12474. 0.
10776 12475. 0.
10777 12476. 0.
10778 12477. 0.
10779 12478. 0.
10780 12479. 0.
10781 12480. 0.
10782 12481. 0.
10783 12482. 0.
10784 12483. 0.
10785 12484. 0.
10786 12485. 0.
10787 12486. 0.
10788 12487. 0.
10789 12488. 0.
10790 12489. 0.
10791 12490. 0.
10792 12491. 0.
10793 12492. 0.
10794 12493. 0.
10795 12494. 0.
10796 12495. 0.
10797 12496. 0.
10798 12497. 0.
10799 12498. 0.
10800 12499. 0.
10801 12500. 0.
10802 12501. 0.
10803 12502. 0.
10804 12503. 0.
10805 12504. 0.
10806 12505. 0.
10807 12506. 0.
10808 12507. 0.
10809 12508. 0.
10810 12509. 0.
10811 12510. 0.
10812 12511. 0.
10813 12512. 0.
10814 12513. 0.
10815 12514. 0.
10816 12515. 0.
10817 12516. 0.
10818 12517. 0.
10819 12518. 0.
10820 12519. 0.
10821 12520. 0.
10822 12521. 0.
10823 12522. 0.
10824 12523. 0.
10825 12524. 0.
10826 12525. 0.
10827 12526. 0.
10828 12527. 0.
10829 12528. 0.
10830 12529. 0.
10831 12530. 0.
10832 12531. 0.
10833 12532. 0.
10834 12533. 0.
10835 12534. 0.
10836 12535. 0.
10837 12536. 0.
10838 12537. 0.
10839 12538. 0.
10840 12539. 0.
10841 12540. 0.
10842 12541. 0.
10843 12542. 0.
10844 12543. 0.
10845 12544. 0.
10846 12545. 0.
10847 12546. 0.
10848 12547. 0.
10849 12548. 0.
10850 12549. 0.
10851 12550. 0.
10852 12551. 0.
10853 12552. 0.
10854 12553. 0.
10855 12554. 0.
10856 12555. 0.
10857 12556. 0.
10858 12557. 0.
10859 12558. 0.
10860 12559. 0.
10861 12560. 0.
10862 12561. 0.
10863 12562. 0.
10864 12563. 0.
10865 12564. 0.
10866 12565. 0.
10867 12566. 0.
10868 12567. 0.
10869 12568. 0.
10870 12569. 0.
10871 12570. 0.
10872 12571. 0.
10873 12572. 0.
10874 12573. 0.
10875 12574. 0.
10876 12575. 0.
10877 12576. 0.
10878 12577. 0.
10879 12578. 0.
10880 12579. 0.
10881 12580. 0.
10882 12581. 0.
10883 12582. 0.
10884 12583. 0.
10885 12584. 0.
10886 12585. 0.
10887 12586. 0.
10888 12587. 0.
10889 12588. 0.
10890 12589. 0.
10891 12590. 0.
10892 12591. 0.
10893 12592. 0.
10894 12593. 0.
10895 12594. 0.
10896 12595. 0.
10897 12596. 0.
10898 12597. 0.
10899 12598. 0.
10900 12599. 0.
10901 12600. 0.
10902 12601. 0.
10903 12602. 0.
10904 12603. 0.
10905 12604. 0.
10906 12605. 0.
10907 12606. 0.
10908 12607. 0.
10909 12608. 0.
10910 12609. 0.
10911 12610. 0.
10912 12611. 0.
10913 12612. 0.
10914 12613. 0.
10915 12614. 0.
10916 12615. 0.
10917 12616. 0.
10918 12617. 0.
10919 12618. 0.
10920 12619. 0.
10921 12620. 0.
10922 12621. 0.
10923 12622. 0.
10924 12623. 0.
10925 12624. 0.
10926 12625. 0.
10927 12626. 0.
10928 12627. 0.
10929 12628. 0.
10930 12629. 0.
10931 12630. 0.
10932 12631. 0.
10933 12632. 0.
10934 12633. 0.
10935 12634. 0.
10936 12635. 0.
10937 12636. 0.
10938 12637. 0.
10939 12638. 0.
10940 12639. 0.
10941 12640. 0.
10942 12641. 0.
10943 12642. 0.
10944 12643. 0.
10945 12644. 0.
10946 12645. 0.
10947 12646. 0.
10948 12647. 0.
10949 12648. 0.
10950 12649. 0.
10951 12650. 0.
10952 12651. 0.
10953 12652. 0.
10954 12653. 0.
10955 12654. 0.
10956 12655. 0.
10957 12656. 0.
10958 12657. 0.
10959 12658. 0.
10960 12659. 0.
10961 12660. 0.
10962 12661. 0.
10963 12662. 0.
10964 12663. 0.
10965 12664. 0.
10966 12665. 0.
10967 12666. 0.
10968 12667. 0.
10969 12668. 0.
10970 12669. 0.
10971 12670. 0.
10972 12671. 0.
10973 12672. 0.
10974 12673. 0.
10975 12674. 0.
10976 12675. 0.
10977 12676. 0.
10978 12677. 0.
10979 12678. 0.
10980 12679. 0.
10981 12680. 0.
10982 12681. 0.
10983 12682. 0.
10984 12683. 0.
10985 12684. 0.
10986 12685. 0.
10987 12686. 0.
10988 12687. 0.
10989 12688. 0.
10990 12689. 0.
10991 12690. 0.
10992 12691. 0.
10993 12692. 0.
10994 12693. 0.
10995 12694. 0.
10996 12695. 0.
10997 12696. 0.
10998 12697. 0.
10999 12698. 0.
11000 12699. 0.
11001 12700. 0.
11002 12701. 0.
11003 12702. 0.
11004 12703. 0.
11005 12704. 0.
11006 12705. 0.
11007 12706. 0.
11008 12707. 0.
11009 12708. 0.
11010 12709. 0.
11011 12710. 0.
11012 12711. 0.
11013 12712. 0.
11014 12713. 0.
11015 12714. 0.
11016 12715. 0.
11017 12716. 0.
11018 12717. 0.
11019 12718. 0.
11020 12719. 0.
11021 12720. 0.
11022 12721. 0.
11023 12722. 0.
11024 12723. 0.
11025 12724. 0.
11026 12725. 0.
11027 12726. 0.
11028 12727. 0.
11029 12728. 0.
11030 12729. 0.
11031 12730. 0.
11032 12731. 0.
11033 12732. 0.
11034 12733. 0.
11035 12734. 0.
11036 12735. 0.
11037 12736. 0.
11038 12737. 0.
11039 12738. 0.
11040 12739. 0.
11041 12740. 0.
11042 12741. 0.
11043 12742. 0.
11044 12743. 0.
11045 12744. 0.
11046 12745. 0.
11047 12746. 0.
11048 12747. 0.
11049 12748. 0.
11050 12749. 0.
11051 12750. 0.
11052 12751. 0.
11053 12752. 0.
11054 12753. 0.
11055 12754. 0.
11056 12755. 0.
11057 12756. 0.
11058 12757. 0.
11059 12758. 0.
11060 12759. 0.
11061 12760. 0.
11062 12761. 0.
11063 12762. 0.
11064 12763. 0.
11065 12764. 0.
11066 12765. 0.
11067 12766. 0.
11068 12767. 0.
11069 12768. 0.
11070 12769. 0.
11071 12770. 0.
11072 12771. 0.
11073 12772. 0.
11074 12773. 0.
11075 12774. 0.
11076 12775. 0.
11077 12776. 0.
11078 12777. 0.
11079 12778. 0.
11080 12779. 0.
11081 12780. 0.
11082 12781. 0.
11083 12782. 0.
11084 12783. 0.
11085 12784. 0.
11086 12785. 0.
11087 12786. 0.
11088 12787. 0.
11089 12788. 0.
11090 12789. 0.
11091 12790. 0.
11092 12791. 0.
11093 12792. 0.
11094 12793. 0.
11095 12794. 0.
11096 12795. 0.
11097 12796. 0.
11098 12797. 0.
11099 12798. 0.
11100 12799. 0.
11101 12800. 0.
11102 12801. 0.
11103 12802. 0.
11104 12803. 0.
11105 12804. 0.
11106 12805. 0.
11107 12806. 0.
11108 12807. 0.
11109 12808. 0.
11110 12809. 0.
11111 12810. 0.
11112 12811. 0.
11113 12812. 0.
11114 12813. 0.
11115 12814. 0.
11116 12815. 0.
11117 12816. 0.
11118 12817. 0.
11119 12818. 0.
11120 12819. 0.
11121 12820. 0.
11122 12821. 0.
11123 12822. 0.
11124 12823. 0.
11125 12824. 0.
11126 12825. 0.
11127 12826. 0.
11128 12827. 0.
11129 12828. 0.
11130 12829. 0.
11131 12830. 0.
11132 12831. 0.
11133 12832. 0.
11134 12833. 0.
11135 12834. 0.
11136 12835. 0.
11137 12836. 0.
11138 12837. 0.
11139 12838. 0.
11140 12839. 0.
11141 12840. 0.
11142 12841. 0.
11143 12842. 0.
11144 12843. 0.
11145 12844. 0.
11146 12845. 0.
11147 12846. 0.
11148 12847. 0.
11149 12848. 0.
11150 12849. 0.
11151 12850. 0.
11152 12851. 0.
11153 12852. 0.
11154 12853. 0.
11155 12854. 0.
11156 12855. 0.
11157 12856. 0.
11158 12857. 0.
11159 12858. 0.
11160 12859. 0.
11161 12860. 0.
11162 12861. 0.
11163 12862. 0.
11164 12863. 0.
11165 12864. 0.
11166 12865. 0.
11167 12866. 0.
11168 12867. 0.
11169 12868. 0.
11170 12869. 0.
11171 12870. 0.
11172 12871. 0.
11173 12872. 0.
11174 12873. 0.
11175 12874. 0.
11176 12875. 0.
11177 12876. 0.
11178 12877. 0.
11179 12878. 0.
11180 12879. 0.
11181 12880. 0.
11182 12881. 0.
11183 12882. 0.
11184 12883. 0.
11185 12884. 0.
11186 12885. 0.
11187 12886. 0.
11188 12887. 0.
11189 12888. 0.
11190 12889. 0.
11191 12890. 0.
11192 12891. 0.
11193 12892. 0.
11194 12893. 0.
11195 12894. 0.
11196 12895. 0.
11197 12896. 0.
11198 12897. 0.
11199 12898. 0.
11200 12899. 0.
11201 12900. 0.
11202 12901. 0.
11203 12902. 0.
11204 12903. 0.
11205 12904. 0.
11206 12905. 0.
11207 12906. 0.
11208 12907. 0.
11209 12908. 0.
11210 12909. 0.
11211 12910. 0.
11212 12911. 0.
11213 12912. 0.
11214 12913. 0.
11215 12914. 0.
11216 12915. 0.
11217 12916. 0.
11218 12917. 0.
11219 12918. 0.
11220 12919. 0.
11221 12920. 0.
11222 12921. 0.
11223 12922. 0.
11224 12923. 0.
11225 12924. 0.
11226 12925. 0.
11227 12926. 0.
11228 12927. 0.
11229 12928. 0.
11230 12929. 0.
11231 12930. 0.
11232 12931. 0.
11233 12932. 0.
11234 12933. 0.
11235 12934. 0.
11236 12935. 0.
11237 12936. 0.
11238 12937. 0.
11239 12938. 0.
11240 12939. 0.
11241 12940. 0.
11242 12941. 0.
11243 12942. 0.
11244 12943. 0.
11245 12944. 0.
11246 12945. 0.
11247 12946. 0.
11248 12947. 0.
11249 12948. 0.
11250 12949. 0.
11251 12950. 0.
11252 12951. 0.
11253 12952. 0.
11254 12953. 0.
11255 12954. 0.
11256 12955. 0.
11257 12956. 0.
11258 12957. 0.
11259 12958. 0.
11260 12959. 0.
11261 12960. 0.
11262 12961. 0.
11263 12962. 0.
11264 12963. 0.
11265 12964. 0.
11266 12965. 0.
11267 12966. 0.
11268 12967. 0.
11269 12968. 0.
11270 12969. 0.
11271 12970. 0.
11272 12971. 0.
11273 12972. 0.
11274 12973. 0.
11275 12974. 0.
11276 12975. 0.
11277 12976. 0.
11278 12977. 0.
11279 12978. 0.
11280 12979. 0.
11281 12980. 0.
11282 12981. 0.
11283 12982. 0.
11284 12983. 0.
11285 12984. 0.
11286 12985. 0.
11287 12986. 0.
11288 12987. 0.
11289 12988. 0.
11290 12989. 0.
11291 12990. 0.
11292 12991. 0.
11293 12992. 0.
11294 12993. 0.
11295 12994. 0.
11296 12995. 0.
11297 12996. 0.
11298 12997. 0.
11299 12998. 0.
11300 12999. 0.
11301 13000. 0.
11302 13001. 0.
11303 13002. 0.
11304 13003. 0.
11305 13004. 0.
11306 13005. 0.
11307 13006. 0.
11308 13007. 0.
11309 13008. 0.
11310 13009. 0.
11311 13010. 0.
11312 13011. 0.
11313 13012. 0.
11314 13013. 0.
11315 13014. 0.
11316 13015. 0.
11317 13016. 0.
11318 13017. 0.
11319 13018. 0.
11320 13019. 0.
11321 13020. 0.
11322 13021. 0.
11323 13022. 0.
11324 13023. 0.
11325 13024. 0.
11326 13025. 0.
11327 13026. 0.
11328 13027. 0.
11329 13028. 0.
11330 13029. 0.
11331 13030. 0.
11332 13031. 0.
11333 13032. 0.
11334 13033. 0.
11335 13034. 0.
11336 13035. 0.
11337 13036. 0.
11338 13037. 0.
11339 13038. 0.
11340 13039. 0.
11341 13040. 0.
11342 13041. 0.
11343 13042. 0.
11344 13043. 0.
11345 13044. 0.
11346 13045. 0.
11347 13046. 0.
11348 13047. 0.
11349 13048. 0.
11350 13049. 0.
11351 13050. 0.
11352 13051. 0.
11353 13052. 0.
11354 13053. 0.
11355 13054. 0.
11356 13055. 0.
11357 13056. 0.
11358 13057. 0.
11359 13058. 0.
11360 13059. 0.
11361 13060. 0.
11362 13061. 0.
11363 13062. 0.
11364 13063. 0.
11365 13064. 0.
11366 13065. 0.
11367 13066. 0.
11368 13067. 0.
11369 13068. 0.
11370 13069. 0.
11371 13070. 0.
11372 13071. 0.
11373 13072. 0.
11374 13073. 0.
11375 13074. 0.
11376 13075. 0.
11377 13076. 0.
11378 13077. 0.
11379 13078. 0.
11380 13079. 0.
11381 13080. 0.
11382 13081. 0.
11383 13082. 0.
11384 13083. 0.
11385 13084. 0.
11386 13085. 0.
11387 13086. 0.
11388 13087. 0.
11389 13088. 0.
11390 13089. 0.
11391 13090. 0.
11392 13091. 0.
11393 13092. 0.
11394 13093. 0.
11395 13094. 0.
11396 13095. 0.
11397 13096. 0.
11398 13097. 0.
11399 13098. 0.
11400 13099. 0.
11401 13100. 0.
11402 13101. 0.
11403 13102. 0.
11404 13103. 0.
11405 13104. 0.
11406 13105. 0.
11407 13106. 0.
11408 13107. 0.
11409 13108. 0.
11410 13109. 0.
11411 13110. 0.
11412 13111. 0.
11413 13112. 0.
11414 13113. 0.
11415 13114. 0.
11416 13115. 0.
11417 13116. 0.
11418 13117. 0.
11419 13118. 0.
11420 13119. 0.
11421 13120. 0.
11422 13121. 0.
11423 13122. 0.
11424 13123. 0.
11425 13124. 0.
11426 13125. 0.
11427 13126. 0.
11428 13127. 0.
11429 13128. 0.
11430 13129. 0.
11431 13130. 0.
11432 13131. 0.
11433 13132. 0.
11434 13133. 0.
11435 13134. 0.
11436 13135. 0.
11437 13136. 0.
11438 13137. 0.
11439 13138. 0.
11440 13139. 0.
11441 13140. 0.
11442 13141. 0.
11443 13142. 0.
11444 13143. 0.
11445 13144. 0.
11446 13145. 0.
11447 13146. 0.
11448 13147. 0.
11449 13148. 0.
11450 13149. 0.
11451 13150. 0.
11452 13151. 0.
11453 13152. 0.
11454 13153. 0.
11455 13154. 0.
11456 13155. 0.
11457 13156. 0.
11458 13157. 0.
11459 13158. 0.
11460 13159. 0.
11461 13160. 0.
11462 13161. 0.
11463 13162. 0.
11464 13163. 0.
11465 13164. 0.
11466 13165. 0.
11467 13166. 0.
11468 13167. 0.
11469 13168. 0.
11470 13169. 0.
11471 13170. 0.
11472 13171. 0.
11473 13172. 0.
11474 13173. 0.
11475 13174. 0.
11476 13175. 0.
11477 13176. 0.
11478 13177. 0.
11479 13178. 0.
11480 13179. 0.
11481 13180. 0.
11482 13181. 0.
11483 13182. 0.
11484 13183. 0.
11485 13184. 0.
11486 13185. 0.
11487 13186. 0.
11488 13187. 0.
11489 13188. 0.
11490 13189. 0.
11491 13190. 0.
11492 13191. 0.
11493 13192. 0.
11494 13193. 0.
11495 13194. 0.
11496 13195. 0.
11497 13196. 0.
11498 13197. 0.
11499 13198. 0.
11500 13199. 0.
11501 13200. 0.
11502 13201. 0.
11503 13202. 0.
11504 13203. 0.
11505 13204. 0.
11506 13205. 0.
11507 13206. 0.
11508 13207. 0.
11509 13208. 0.
11510 13209. 0.
11511 13210. 0.
11512 13211. 0.
11513 13212. 0.
11514 13213. 0.
11515 13214. 0.
11516 13215. 0.
11517 13216. 0.
11518 13217. 0.
11519 13218. 0.
11520 13219. 0.
11521 13220. 0.
11522 13221. 0.
11523 13222. 0.
11524 13223. 0.
11525 13224. 0.
11526 13225. 0.
11527 13226. 0.
11528 13227. 0.
11529 13228. 0.
11530 13229. 0.
11531 13230. 0.
11532 13231. 0.
11533 13232. 0.
11534 13233. 0.
11535 13234. 0.
11536 13235. 0.
11537 13236. 0.
11538 13237. 0.
11539 13238. 0.
11540 13239. 0.
11541 13240. 0.
11542 13241. 0.
11543 13242. 0.
11544 13243. 0.
11545 13244. 0.
11546 13245. 0.
11547 13246. 0.
11548 13247. 0.
11549 13248. 0.
11550 13249. 0.
11551 13250. 0.
11552 13251. 0.
11553 13252. 0.
11554 13253. 0.
11555 13254. 0.
11556 13255. 0.
11557 13256. 0.
11558 13257. 0.
11559 13258. 0.
11560 13259. 0.
11561 13260. 0.
11562 13261. 0.
11563 13262. 0.
11564 13263. 0.
11565 13264. 0.
11566 13265. 0.
11567 13266. 0.
11568 13267. 0.
11569 13268. 0.
11570 13269. 0.
11571 13270. 0.
11572 13271. 0.
11573 13272. 0.
11574 13273. 0.
11575 13274. 0.
11576 13275. 0.
11577 13276. 0.
11578 13277. 0.
11579 13278. 0.
11580 13279. 0.
11581 13280. 0.
11582 13281. 0.
11583 13282. 0.
11584 13283. 0.
11585 13284. 0.
11586 13285. 0.
11587 13286. 0.
11588 13287. 0.
11589 13288. 0.
11590 13289. 0.
11591 13290. 0.
11592 13291. 0.
11593 13292. 0.
11594 13293. 0.
11595 13294. 0.
11596 13295. 0.
11597 13296. 0.
11598 13297. 0.
11599 13298. 0.
11600 13299. 0.
11601 13300. 0.
11602 13301. 0.
11603 13302. 0.
11604 13303. 0.
11605 13304. 0.
11606 13305. 0.
11607 13306. 0.
11608 13307. 0.
11609 13308. 0.
11610 13309. 0.
11611 13310. 0.
11612 13311. 0.
11613 13312. 0.
11614 13313. 0.
11615 13314. 0.
11616 13315. 0.
11617 13316. 0.
11618 13317. 0.
11619 13318. 0.
11620 13319. 0.
11621 13320. 0.
11622 13321. 0.
11623 13322. 0.
11624 13323. 0.
11625 13324. 0.
11626 13325. 0.
11627 13326. 0.
11628 13327. 0.
11629 13328. 0.
11630 13329. 0.
11631 13330. 0.
11632 13331. 0.
11633 13332. 0.
11634 13333. 0.
11635 13334. 0.
11636 13335. 0.
11637 13336. 0.
11638 13337. 0.
11639 13338. 0.
11640 13339. 0.
11641 13340. 0.
11642 13341. 0.
11643 13342. 0.
11644 13343. 0.
11645 13344. 0.
11646 13345. 0.
11647 13346. 0.
11648 13347. 0.
11649 13348. 0.
11650 13349. 0.
11651 13350. 0.
11652 13351. 0.
11653 13352. 0.
11654 13353. 0.
11655 13354. 0.
11656 13355. 0.
11657 13356. 0.
11658 13357. 0.
11659 13358. 0.
11660 13359. 0.
11661 13360. 0.
11662 13361. 0.
11663 13362. 0.
11664 13363. 0.
11665 13364. 0.
11666 13365. 0.
11667 13366. 0.
11668 13367. 0.
11669 13368. 0.
11670 13369. 0.
11671 13370. 0.
11672 13371. 0.
11673 13372. 0.
11674 13373. 0.
11675 13374. 0.
11676 13375. 0.
11677 13376. 0.
11678 13377. 0.
11679 13378. 0.
11680 13379. 0.
11681 13380. 0.
11682 13381. 0.
11683 13382. 0.
11684 13383. 0.
11685 13384. 0.
11686 13385. 0.
11687 13386. 0.
11688 13387. 0.
11689 13388. 0.
11690 13389. 0.
11691 13390. 0.
11692 13391. 0.
11693 13392. 0.
11694 13393. 0.
11695 13394. 0.
11696 13395. 0.
11697 13396. 0.
11698 13397. 0.
11699 13398. 0.
11700 13399. 0.
11701 13400. 0.
11702 13401. 0.
11703 13402. 0.
11704 13403. 0.
11705 13404. 0.
11706 13405. 0.
11707 13406. 0.
11708 13407. 0.
11709 13408. 0.
11710 13409. 0.
11711 13410. 0.
11712 13411. 0.
11713 13412. 0.
11714 13413. 0.
11715 13414. 0.
11716 13415. 0.
11717 13416. 0.
11718 13417. 0.
11719 13418. 0.
11720 13419. 0.
11721 13420. 0.
11722 13421. 0.
11723 13422. 0.
11724 13423. 0.
11725 13424. 0.
11726 13425. 0.
11727 13426. 0.
11728 13427. 0.
11729 13428. 0.
11730 13429. 0.
11731 13430. 0.
11732 13431. 0.
11733 13432. 0.
11734 13433. 0.
11735 13434. 0.
11736 13435. 0.
11737 13436. 0.
11738 13437. 0.
11739 13438. 0.
11740 13439. 0.
11741 13440. 0.
11742 13441. 0.
11743 13442. 0.
11744 13443. 0.
11745 13444. 0.
11746 13445. 0.
11747 13446. 0.
11748 13447. 0.
11749 13448. 0.
11750 13449. 0.
11751 13450. 0.
11752 13451. 0.
11753 13452. 0.
11754 13453. 0.
11755 13454. 0.
11756 13455. 0.
11757 13456. 0.
11758 13457. 0.
11759 13458. 0.
11760 13459. 0.
11761 13460. 0.
11762 13461. 0.
11763 13462. 0.
11764 13463. 0.
11765 13464. 0.
11766 13465. 0.
11767 13466. 0.
11768 13467. 0.
11769 13468. 0.
11770 13469. 0.
11771 13470. 0.
11772 13471. 0.
11773 13472. 0.
11774 13473. 0.
11775 13474. 0.
11776 13475. 0.
11777 13476. 0.
11778 13477. 0.
11779 13478. 0.
11780 13479. 0.
11781 13480. 0.
11782 13481. 0.
11783 13482. 0.
11784 13483. 0.
11785 13484. 0.
11786 13485. 0.
11787 13486. 0.
11788 13487. 0.
11789 13488. 0.
11790 13489. 0.
11791 13490. 0.
11792 13491. 0.
11793 13492. 0.
11794 13493. 0.
11795 13494. 0.
11796 13495. 0.
11797 13496. 0.
11798 13497. 0.
11799 13498. 0.
11800 13499. 0.
11801 13500. 0.
11802 13501. 0.
11803 13502. 0.
11804 13503. 0.
11805 13504. 0.
11806 13505. 0.
11807 13506. 0.
11808 13507. 0.
11809 13508. 0.
11810 13509. 0.
11811 13510. 0.
11812 13511. 0.
11813 13512. 0.
11814 13513. 0.
11815 13514. 0.
11816 13515. 0.
11817 13516. 0.
11818 13517. 0.
11819 13518. 0.
11820 13519. 0.
11821 13520. 0.
11822 13521. 0.
11823 13522. 0.
11824 13523. 0.
11825 13524. 0.
11826 13525. 0.
11827 13526. 0.
11828 13527. 0.
11829 13528. 0.
11830 13529. 0.
11831 13530. 0.
11832 13531. 0.
11833 13532. 0.
11834 13533. 0.
11835 13534. 0.
11836 13535. 0.
11837 13536. 0.
11838 13537. 0.
11839 13538. 0.
11840 13539. 0.
11841 13540. 0.
11842 13541. 0.
11843 13542. 0.
11844 13543. 0.
11845 13544. 0.
11846 13545. 0.
11847 13546. 0.
11848 13547. 0.
11849 13548. 0.
11850 13549. 0.
11851 13550. 0.
11852 13551. 0.
11853 13552. 0.
11854 13553. 0.
11855 13554. 0.
11856 13555. 0.
11857 13556. 0.
11858 13557. 0.
11859 13558. 0.
11860 13559. 0.
11861 13560. 0.
11862 13561. 0.
11863 13562. 0.
11864 13563. 0.
11865 13564. 0.
11866 13565. 0.
11867 13566. 0.
11868 13567. 0.
11869 13568. 0.
11870 13569. 0.
11871 13570. 0.
11872 13571. 0.
11873 13572. 0.
11874 13573. 0.
11875 13574. 0.
11876 13575. 0.
11877 13576. 0.
11878 13577. 0.
11879 13578. 0.
11880 13579. 0.
11881 13580. 0.
11882 13581. 0.
11883 13582. 0.
11884 13583. 0.
11885 13584. 0.
11886 13585. 0.
11887 13586. 0.
11888 13587. 0.
11889 13588. 0.
11890 13589. 0.
11891 13590. 0.
11892 13591. 0.
11893 13592. 0.
11894 13593. 0.
11895 13594. 0.
11896 13595. 0.
11897 13596. 0.
11898 13597. 0.
11899 13598. 0.
11900 13599. 0.
11901 13600. 0.
11902 13601. 0.
11903 13602. 0.
11904 13603. 0.
11905 13604. 0.
11906 13605. 0.
11907 13606. 0.
11908 13607. 0.
11909 13608. 0.
11910 13609. 0.
11911 13610. 0.
11912 13611. 0.
11913 13612. 0.
11914 13613. 0.
11915 13614. 0.
11916 13615. 0.
11917 13616. 0.
11918 13617. 0.
11919 13618. 0.
11920 13619. 0.
11921 13620. 0.
11922 13621. 0.
11923 13622. 0.
11924 13623. 0.
11925 13624. 0.
11926 13625. 0.
11927 13626. 0.
11928 13627. 0.
11929 13628. 0.
11930 13629. 0.
11931 13630. 0.
11932 13631. 0.
11933 13632. 0.
11934 13633. 0.
11935 13634. 0.
11936 13635. 0.
11937 13636. 0.
11938 13637. 0.
11939 13638. 0.
11940 13639. 0.
11941 13640. 0.
11942 13641. 0.
11943 13642. 0.
11944 13643. 0.
11945 13644. 0.
11946 13645. 0.
11947 13646. 0.
11948 13647. 0.
11949 13648. 0.
11950 13649. 0.
11951 13650. 0.
11952 13651. 0.
11953 13652. 0.
11954 13653. 0.
11955 13654. 0.
11956 13655. 0.
11957 13656. 0.
11958 13657. 0.
11959 13658. 0.
11960 13659. 0.
11961 13660. 0.
11962 13661. 0.
11963 13662. 0.
11964 13663. 0.
11965 13664. 0.
11966 13665. 0.
11967 13666. 0.
11968 13667. 0.
11969 13668. 0.
11970 13669. 0.
11971 13670. 0.
11972 13671. 0.
11973 13672. 0.
11974 13673. 0.
11975 13674. 0.
11976 13675. 0.
11977 13676. 0.
11978 13677. 0.
11979 13678. 0.
11980 13679. 0.
11981 13680. 0.
11982 13681. 0.
11983 13682. 0.
11984 13683. 0.
11985 13684. 0.
11986 13685. 0.
11987 13686. 0.
11988 13687. 0.
11989 13688. 0.
11990 13689. 0.
11991 13690. 0.
11992 13691. 0.
11993 13692. 0.
11994 13693. 0.
11995 13694. 0.
11996 13695. 0.
11997 13696. 0.
11998 13697. 0.
11999 13698. 0.
12000 13699. 0.
12001 13700. 0.
12002 13701. 0.
12003 13702. 0.
12004 13703. 0.
12005 13704. 0.
12006 13705. 0.
12007 13706. 0.
12008 13707. 0.
12009 13708. 0.
12010 13709. 0.
12011 13710. 0.
12012 13711. 0.
12013 13712. 0.
12014 13713. 0.
12015 13714. 0.
12016 13715. 0.
12017 13716. 0.
12018 13717. 0.
12019 13718. 0.
12020 13719. 0.
12021 13720. 0.
12022 13721. 0.
12023 13722. 0.
12024 13723. 0.
12025 13724. 0.
12026 13725. 0.
12027 13726. 0.
12028 13727. 0.
12029 13728. 0.
12030 13729. 0.
12031 13730. 0.
12032 13731. 0.
12033 13732. 0.
12034 13733. 0.
12035 13734. 0.
12036 13735. 0.
12037 13736. 0.
12038 13737. 0.
12039 13738. 0.
12040 13739. 0.
12041 13740. 0.
12042 13741. 0.
12043 13742. 0.
12044 13743. 0.
12045 13744. 0.
12046 13745. 0.
12047 13746. 0.
12048 13747. 0.
12049 13748. 0.
12050 13749. 0.
12051 13750. 0.
12052 13751. 0.
12053 13752. 0.
12054 13753. 0.
12055 13754. 0.
12056 13755. 0.
12057 13756. 0.
12058 13757. 0.
12059 13758. 0.
12060 13759. 0.
12061 13760. 0.
12062 13761. 0.
12063 13762. 0.
12064 13763. 0.
12065 13764. 0.
12066 13765. 0.
12067 13766. 0.
12068 13767. 0.
12069 13768. 0.
12070 13769. 0.
12071 13770. 0.
12072 13771. 0.
12073 13772. 0.
12074 13773. 0.
12075 13774. 0.
12076 13775. 0.
12077 13776. 0.
12078 13777. 0.
12079 13778. 0.
12080 13779. 0.
12081 13780. 0.
12082 13781. 0.
12083 13782. 0.
12084 13783. 0.
12085 13784. 0.
12086 13785. 0.
12087 13786. 0.
12088 13787. 0.
12089 13788. 0.
12090 13789. 0.
12091 13790. 0.
12092 13791. 0.
12093 13792. 0.
12094 13793. 0.
12095 13794. 0.
12096 13795. 0.
12097 13796. 0.
12098 13797. 0.
12099 13798. 0.
12100 13799. 0.
12101 13800. 0.
12102 13801. 0.
12103 13802. 0.
12104 13803. 0.
12105 13804. 0.
12106 13805. 0.
12107 13806. 0.
12108 13807. 0.
12109 13808. 0.
12110 13809. 0.
12111 13810. 0.
12112 13811. 0.
12113 13812. 0.
12114 13813. 0.
12115 13814. 0.
12116 13815. 0.
12117 13816. 0.
12118 13817. 0.
12119 13818. 0.
12120 13819. 0.
12121 13820. 0.
12122 13821. 0.
12123 13822. 0.
12124 13823. 0.
12125 13824. 0.
12126 13825. 0.
12127 13826. 0.
12128 13827. 0.
12129 13828. 0.
12130 13829. 0.
12131 13830. 0.
12132 13831. 0.
12133 13832. 0.
12134 13833. 0.
12135 13834. 0.
12136 13835. 0.
12137 13836. 0.
12138 13837. 0.
12139 13838. 0.
12140 13839. 0.
12141 13840. 0.
12142 13841. 0.
12143 13842. 0.
12144 13843. 0.
12145 13844. 0.
12146 13845. 0.
12147 13846. 0.
12148 13847. 0.
12149 13848. 0.
12150 13849. 0.
12151 13850. 0.
12152 13851. 0.
12153 13852. 0.
12154 13853. 0.
12155 13854. 0.
12156 13855. 0.
12157 13856. 0.
12158 13857. 0.
12159 13858. 0.
12160 13859. 0.
12161 13860. 0.
12162 13861. 0.
12163 13862. 0.
12164 13863. 0.
12165 13864. 0.
12166 13865. 0.
12167 13866. 0.
12168 13867. 0.
12169 13868. 0.
12170 13869. 0.
12171 13870. 0.
12172 13871. 0.
12173 13872. 0.
12174 13873. 0.
12175 13874. 0.
12176 13875. 0.
12177 13876. 0.
12178 13877. 0.
12179 13878. 0.
12180 13879. 0.
12181 13880. 0.
12182 13881. 0.
12183 13882. 0.
12184 13883. 0.
12185 13884. 0.
12186 13885. 0.
12187 13886. 0.
12188 13887. 0.
12189 13888. 0.
12190 13889. 0.
12191 13890. 0.
12192 13891. 0.
12193 13892. 0.
12194 13893. 0.
12195 13894. 0.
12196 13895. 0.
12197 13896. 0.
12198 13897. 0.
12199 13898. 0.
12200 13899. 0.
12201 13900. 0.
12202 13901. 0.
12203 13902. 0.
12204 13903. 0.
12205 13904. 0.
12206 13905. 0.
12207 13906. 0.
12208 13907. 0.
12209 13908. 0.
12210 13909. 0.
12211 13910. 0.
12212 13911. 0.
12213 13912. 0.
12214 13913. 0.
12215 13914. 0.
12216 13915. 0.
12217 13916. 0.
12218 13917. 0.
12219 13918. 0.
12220 13919. 0.
12221 13920. 0.
12222 13921. 0.
12223 13922. 0.
12224 13923. 0.
12225 13924. 0.
12226 13925. 0.
12227 13926. 0.
12228 13927. 0.
12229 13928. 0.
12230 13929. 0.
12231 13930. 0.
12232 13931. 0.
12233 13932. 0.
12234 13933. 0.
12235 13934. 0.
12236 13935. 0.
12237 13936. 0.
12238 13937. 0.
12239 13938. 0.
12240 13939. 0.
12241 13940. 0.
12242 13941. 0.
12243 13942. 0.
12244 13943. 0.
12245 13944. 0.
12246 13945. 0.
12247 13946. 0.
12248 13947. 0.
12249 13948. 0.
12250 13949. 0.
12251 13950. 0.
12252 13951. 0.
12253 13952. 0.
12254 13953. 0.
12255 13954. 0.
12256 13955. 0.
12257 13956. 0.
12258 13957. 0.
12259 13958. 0.
12260 13959. 0.
12261 13960. 0.
12262 13961. 0.
12263 13962. 0.
12264 13963. 0.
12265 13964. 0.
12266 13965. 0.
12267 13966. 0.
12268 13967. 0.
12269 13968. 0.
12270 13969. 0.
12271 13970. 0.
12272 13971. 0.
12273 13972. 0.
12274 13973. 0.
12275 13974. 0.
12276 13975. 0.
12277 13976. 0.
12278 13977. 0.
12279 13978. 0.
12280 13979. 0.
12281 13980. 0.
12282 13981. 0.
12283 13982. 0.
12284 13983. 0.
12285 13984. 0.
12286 13985. 0.
12287 13986. 0.
12288 13987. 0.
12289 13988. 0.
12290 13989. 0.
12291 13990. 0.
12292 13991. 0.
12293 13992. 0.
12294 13993. 0.
12295 13994. 0.
12296 13995. 0.
12297 13996. 0.
12298 13997. 0.
12299 13998. 0.
12300 13999. 0.
12301 14000. 0.
12302 14001. 0.
12303 14002. 0.
12304 14003. 0.
12305 14004. 0.
12306 14005. 0.
12307 14006. 0.
12308 14007. 0.
12309 14008. 0.
12310 14009. 0.
12311 14010. 0.
12312 14011. 0.
12313 14012. 0.
12314 14013. 0.
12315 14014. 0.
12316 14015. 0.
12317 14016. 0.
12318 14017. 0.
12319 14018. 0.
12320 14019. 0.
12321 14020. 0.
12322 14021. 0.
12323 14022. 0.
12324 14023. 0.
12325 14024. 0.
12326 14025. 0.
12327 14026. 0.
12328 14027. 0.
12329 14028. 0.
12330 14029. 0.
12331 14030. 0.
12332 14031. 0.
12333 14032. 0.
12334 14033. 0.
12335 14034. 0.
12336 14035. 0.
12337 14036. 0.
12338 14037. 0.
12339 14038. 0.
12340 14039. 0.
12341 14040. 0.
12342 14041. 0.
12343 14042. 0.
12344 14043. 0.
12345 14044. 0.
12346 14045. 0.
12347 14046. 0.
12348 14047. 0.
12349 14048. 0.
12350 14049. 0.
12351 14050. 0.
12352 14051. 0.
12353 14052. 0.
12354 14053. 0.
12355 14054. 0.
12356 14055. 0.
12357 14056. 0.
12358 14057. 0.
12359 14058. 0.
12360 14059. 0.
12361 14060. 0.
12362 14061. 0.
12363 14062. 0.
12364 14063. 0.
12365 14064. 0.
12366 14065. 0.
12367 14066. 0.
12368 14067. 0.
12369 14068. 0.
12370 14069. 0.
12371 14070. 0.
12372 14071. 0.
12373 14072. 0.
12374 14073. 0.
12375 14074. 0.
12376 14075. 0.
12377 14076. 0.
12378 14077. 0.
12379 14078. 0.
12380 14079. 0.
12381 14080. 0.
12382 14081. 0.
12383 14082. 0.
12384 14083. 0.
12385 14084. 0.
12386 14085. 0.
12387 14086. 0.
12388 14087. 0.
12389 14088. 0.
12390 14089. 0.
12391 14090. 0.
12392 14091. 0.
12393 14092. 0.
12394 14093. 0.
12395 14094. 0.
12396 14095. 0.
12397 14096. 0.
12398 14097. 0.
12399 14098. 0.
12400 14099. 0.
12401 14100. 0.
12402 14101. 0.
12403 14102. 0.
12404 14103. 0.
12405 14104. 0.
12406 14105. 0.
12407 14106. 0.
12408 14107. 0.
12409 14108. 0.
12410 14109. 0.
12411 14110. 0.
12412 14111. 0.
12413 14112. 0.
12414 14113. 0.
12415 14114. 0.
12416 14115. 0.
12417 14116. 0.
12418 14117. 0.
12419 14118. 0.
12420 14119. 0.
12421 14120. 0.
12422 14121. 0.
12423 14122. 0.
12424 14123. 0.
12425 14124. 0.
12426 14125. 0.
12427 14126. 0.
12428 14127. 0.
12429 14128. 0.
12430 14129. 0.
12431 14130. 0.
12432 14131. 0.
12433 14132. 0.
12434 14133. 0.
12435 14134. 0.
12436 14135. 0.
12437 14136. 0.
12438 14137. 0.
12439 14138. 0.
12440 14139. 0.
12441 14140. 0.
12442 14141. 0.
12443 14142. 0.
12444 14143. 0.
12445 14144. 0.
12446 14145. 0.
12447 14146. 0.
12448 14147. 0.
12449 14148. 0.
12450 14149. 0.
12451 14150. 0.
12452 14151. 0.
12453 14152. 0.
12454 14153. 0.
12455 14154. 0.
12456 14155. 0.
12457 14156. 0.
12458 14157. 0.
12459 14158. 0.
12460 14159. 0.
12461 14160. 0.
12462 14161. 0.
12463 14162. 0.
12464 14163. 0.
12465 14164. 0.
12466 14165. 0.
12467 14166. 0.
12468 14167. 0.
12469 14168. 0.
12470 14169. 0.
12471 14170. 0.
12472 14171. 0.
12473 14172. 0.
12474 14173. 0.
12475 14174. 0.
12476 14175. 0.
12477 14176. 0.
12478 14177. 0.
12479 14178. 0.
12480 14179. 0.
12481 14180. 0.
12482 14181. 0.
12483 14182. 0.
12484 14183. 0.
12485 14184. 0.
12486 14185. 0.
12487 14186. 0.
12488 14187. 0.
12489 14188. 0.
12490 14189. 0.
12491 14190. 0.
12492 14191. 0.
12493 14192. 0.
12494 14193. 0.
12495 14194. 0.
12496 14195. 0.
12497 14196. 0.
12498 14197. 0.
12499 14198. 0.
12500 14199. 0.
12501 14200. 0.
12502 14201. 0.
12503 14202. 0.
12504 14203. 0.
12505 14204. 0.
12506 14205. 0.
12507 14206. 0.
12508 14207. 0.
12509 14208. 0.
12510 14209. 0.
12511 14210. 0.
12512 14211. 0.
12513 14212. 0.
12514 14213. 0.
12515 14214. 0.
12516 14215. 0.
12517 14216. 0.
12518 14217. 0.
12519 14218. 0.
12520 14219. 0.
12521 14220. 0.
12522 14221. 0.
12523 14222. 0.
12524 14223. 0.
12525 14224. 0.
12526 14225. 0.
12527 14226. 0.
12528 14227. 0.
12529 14228. 0.
12530 14229. 0.
12531 14230. 0.
12532 14231. 0.
12533 14232. 0.
12534 14233. 0.
12535 14234. 0.
12536 14235. 0.
12537 14236. 0.
12538 14237. 0.
12539 14238. 0.
12540 14239. 0.
12541 14240. 0.
12542 14241. 0.
12543 14242. 0.
12544 14243. 0.
12545 14244. 0.
12546 14245. 0.
12547 14246. 0.
12548 14247. 0.
12549 14248. 0.
12550 14249. 0.
12551 14250. 0.
12552 14251. 0.
12553 14252. 0.
12554 14253. 0.
12555 14254. 0.
12556 14255. 0.
12557 14256. 0.
12558 14257. 0.
12559 14258. 0.
12560 14259. 0.
12561 14260. 0.
12562 14261. 0.
12563 14262. 0.
12564 14263. 0.
12565 14264. 0.
12566 14265. 0.
12567 14266. 0.
12568 14267. 0.
12569 14268. 0.
12570 14269. 0.
12571 14270. 0.
12572 14271. 0.
12573 14272. 0.
12574 14273. 0.
12575 14274. 0.
12576 14275. 0.
12577 14276. 0.
12578 14277. 0.
12579 14278. 0.
12580 14279. 0.
12581 14280. 0.
12582 14281. 0.
12583 14282. 0.
12584 14283. 0.
12585 14284. 0.
12586 14285. 0.
12587 14286. 0.
12588 14287. 0.
12589 14288. 0.
12590 14289. 0.
12591 14290. 0.
12592 14291. 0.
12593 14292. 0.
12594 14293. 0.
12595 14294. 0.
12596 14295. 0.
12597 14296. 0.
12598 14297. 0.
12599 14298. 0.
12600 14299. 0.
12601 14300. 0.
12602 14301. 0.
12603 14302. 0.
12604 14303. 0.
12605 14304. 0.
12606 14305. 0.
12607 14306. 0.
12608 14307. 0.
12609 14308. 0.
12610 14309. 0.
12611 14310. 0.
12612 14311. 0.
12613 14312. 0.
12614 14313. 0.
12615 14314. 0.
12616 14315. 0.
12617 14316. 0.
12618 14317. 0.
12619 14318. 0.
12620 14319. 0.
12621 14320. 0.
12622 14321. 0.
12623 14322. 0.
12624 14323. 0.
12625 14324. 0.
12626 14325. 0.
12627 14326. 0.
12628 14327. 0.
12629 14328. 0.
12630 14329. 0.
12631 14330. 0.
12632 14331. 0.
12633 14332. 0.
12634 14333. 0.
12635 14334. 0.
12636 14335. 0.
12637 14336. 0.
12638 14337. 0.
12639 14338. 0.
12640 14339. 0.
12641 14340. 0.
12642 14341. 0.
12643 14342. 0.
12644 14343. 0.
12645 14344. 0.
12646 14345. 0.
12647 14346. 0.
12648 14347. 0.
12649 14348. 0.
12650 14349. 0.
12651 14350. 0.
12652 14351. 0.
12653 14352. 0.
12654 14353. 0.
12655 14354. 0.
12656 14355. 0.
12657 14356. 0.
12658 14357. 0.
12659 14358. 0.
12660 14359. 0.
12661 14360. 0.
12662 14361. 0.
12663 14362. 0.
12664 14363. 0.
12665 14364. 0.
12666 14365. 0.
12667 14366. 0.
12668 14367. 0.
12669 14368. 0.
12670 14369. 0.
12671 14370. 0.
12672 14371. 0.
12673 14372. 0.
12674 14373. 0.
12675 14374. 0.
12676 14375. 0.
12677 14376. 0.
12678 14377. 0.
12679 14378. 0.
12680 14379. 0.
12681 14380. 0.
12682 14381. 0.
12683 14382. 0.
12684 14383. 0.
12685 14384. 0.
12686 14385. 0.
12687 14386. 0.
12688 14387. 0.
12689 14388. 0.
12690 14389. 0.
12691 14390. 0.
12692 14391. 0.
12693 14392. 0.
12694 14393. 0.
12695 14394. 0.
12696 14395. 0.
12697 14396. 0.
12698 14397. 0.
12699 14398. 0.
12700 14399. 0.
12701 14400. 0.
12702 14401. 0.
12703 14402. 0.
12704 14403. 0.
12705 14404. 0.
12706 14405. 0.
12707 14406. 0.
12708 14407. 0.
12709 14408. 0.
12710 14409. 0.
12711 14410. 0.
12712 14411. 0.
12713 14412. 0.
12714 14413. 0.
12715 14414. 0.
12716 14415. 0.
12717 14416. 0.
12718 14417. 0.
12719 14418. 0.
12720 14419. 0.
12721 14420. 0.
12722 14421. 0.
12723 14422. 0.
12724 14423. 0.
12725 14424. 0.
12726 14425. 0.
12727 14426. 0.
12728 14427. 0.
12729 14428. 0.
12730 14429. 0.
12731 14430. 0.
12732 14431. 0.
12733 14432. 0.
12734 14433. 0.
12735 14434. 0.
12736 14435. 0.
12737 14436. 0.
12738 14437. 0.
12739 14438. 0.
12740 14439. 0.
12741 14440. 0.
12742 14441. 0.
12743 14442. 0.
12744 14443. 0.
12745 14444. 0.
12746 14445. 0.
12747 14446. 0.
12748 14447. 0.
12749 14448. 0.
12750 14449. 0.
12751 14450. 0.
12752 14451. 0.
12753 14452. 0.
12754 14453. 0.
12755 14454. 0.
12756 14455. 0.
12757 14456. 0.
12758 14457. 0.
12759 14458. 0.
12760 14459. 0.
12761 14460. 0.
12762 14461. 0.
12763 14462. 0.
12764 14463. 0.
12765 14464. 0.
12766 14465. 0.
12767 14466. 0.
12768 14467. 0.
12769 14468. 0.
12770 14469. 0.
12771 14470. 0.
12772 14471. 0.
12773 14472. 0.
12774 14473. 0.
12775 14474. 0.
12776 14475. 0.
12777 14476. 0.
12778 14477. 0.
12779 14478. 0.
12780 14479. 0.
12781 14480. 0.
12782 14481. 0.
12783 14482. 0.
12784 14483. 0.
12785 14484. 0.
12786 14485. 0.
12787 14486. 0.
12788 14487. 0.
12789 14488. 0.
12790 14489. 0.
12791 14490. 0.
12792 14491. 0.
12793 14492. 0.
12794 14493. 0.
12795 14494. 0.
12796 14495. 0.
12797 14496. 0.
12798 14497. 0.
12799 14498. 0.
12800 14499. 0.
12801 14500. 0.
12802 14501. 0.
12803 14502. 0.
12804 14503. 0.
12805 14504. 0.
12806 14505. 0.
12807 14506. 0.
12808 14507. 0.
12809 14508. 0.
12810 14509. 0.
12811 14510. 0.
12812 14511. 0.
12813 14512. 0.
12814 14513. 0.
12815 14514. 0.
12816 14515. 0.
12817 14516. 0.
12818 14517. 0.
12819 14518. 0.
12820 14519. 0.
12821 14520. 0.
12822 14521. 0.
12823 14522. 0.
12824 14523. 0.
12825 14524. 0.
12826 14525. 0.
12827 14526. 0.
12828 14527. 0.
12829 14528. 0.
12830 14529. 0.
12831 14530. 0.
12832 14531. 0.
12833 14532. 0.
12834 14533. 0.
12835 14534. 0.
12836 14535. 0.
12837 14536. 0.
12838 14537. 0.
12839 14538. 0.
12840 14539. 0.
12841 14540. 0.
12842 14541. 0.
12843 14542. 0.
12844 14543. 0.
12845 14544. 0.
12846 14545. 0.
12847 14546. 0.
12848 14547. 0.
12849 14548. 0.
12850 14549. 0.
12851 14550. 0.
12852 14551. 0.
12853 14552. 0.
12854 14553. 0.
12855 14554. 0.
12856 14555. 0.
12857 14556. 0.
12858 14557. 0.
12859 14558. 0.
12860 14559. 0.
12861 14560. 0.
12862 14561. 0.
12863 14562. 0.
12864 14563. 0.
12865 14564. 0.
12866 14565. 0.
12867 14566. 0.
12868 14567. 0.
12869 14568. 0.
12870 14569. 0.
12871 14570. 0.
12872 14571. 0.
12873 14572. 0.
12874 14573. 0.
12875 14574. 0.
12876 14575. 0.
12877 14576. 0.
12878 14577. 0.
12879 14578. 0.
12880 14579. 0.
12881 14580. 0.
12882 14581. 0.
12883 14582. 0.
12884 14583. 0.
12885 14584. 0.
12886 14585. 0.
12887 14586. 0.
12888 14587. 0.
12889 14588. 0.
12890 14589. 0.
12891 14590. 0.
12892 14591. 0.
12893 14592. 0.
12894 14593. 0.
12895 14594. 0.
12896 14595. 0.
12897 14596. 0.
12898 14597. 0.
12899 14598. 0.
12900 14599. 0.
12901 14600. 0.
12902 14601. 0.
12903 14602. 0.
12904 14603. 0.
12905 14604. 0.
12906 14605. 0.
12907 14606. 0.
12908 14607. 0.
12909 14608. 0.
12910 14609. 0.
12911 14610. 0.
12912 14611. 0.
12913 14612. 0.
12914 14613. 0.
12915 14614. 0.
12916 14615. 0.
12917 14616. 0.
12918 14617. 0.
12919 14618. 0.
12920 14619. 0.
12921 14620. 0.
12922 14621. 0.
12923 14622. 0.
12924 14623. 0.
12925 14624. 0.
12926 14625. 0.
12927 14626. 0.
12928 14627. 0.
12929 14628. 0.
12930 14629. 0.
12931 14630. 0.
12932 14631. 0.
12933 14632. 0.
12934 14633. 0.
12935 14634. 0.
12936 14635. 0.
12937 14636. 0.
12938 14637. 0.
12939 14638. 0.
12940 14639. 0.
12941 14640. 0.
12942 14641. 0.
12943 14642. 0.
12944 14643. 0.
12945 14644. 0.
12946 14645. 0.
12947 14646. 0.
12948 14647. 0.
12949 14648. 0.
12950 14649. 0.
12951 14650. 0.
12952 14651. 0.
12953 14652. 0.
12954 14653. 0.
12955 14654. 0.
12956 14655. 0.
12957 14656. 0.
12958 14657. 0.
12959 14658. 0.
12960 14659. 0.
12961 14660. 0.
12962 14661. 0.
12963 14662. 0.
12964 14663. 0.
12965 14664. 0.
12966 14665. 0.
12967 14666. 0.
12968 14667. 0.
12969 14668. 0.
12970 14669. 0.
12971 14670. 0.
12972 14671. 0.
12973 14672. 0.
12974 14673. 0.
12975 14674. 0.
12976 14675. 0.
12977 14676. 0.
12978 14677. 0.
12979 14678. 0.
12980 14679. 0.
12981 14680. 0.
12982 14681. 0.
12983 14682. 0.
12984 14683. 0.
12985 14684. 0.
12986 14685. 0.
12987 14686. 0.
12988 14687. 0.
12989 14688. 0.
12990 14689. 0.
12991 14690. 0.
12992 14691. 0.
12993 14692. 0.
12994 14693. 0.
12995 14694. 0.
12996 14695. 0.
12997 14696. 0.
12998 14697. 0.
12999 14698. 0.
13000 14699. 0.
13001 14700. 0.
13002 14701. 0.
13003 14702. 0.
13004 14703. 0.
13005 14704. 0.
13006 14705. 0.
13007 14706. 0.
13008 14707. 0.
13009 14708. 0.
13010 14709. 0.
13011 14710. 0.
13012 14711. 0.
13013 14712. 0.
13014 14713. 0.
13015 14714. 0.
13016 14715. 0.
13017 14716. 0.
13018 14717. 0.
13019 14718. 0.
13020 14719. 0.
13021 14720. 0.
13022 14721. 0.
13023 14722. 0.
13024 14723. 0.
13025 14724. 0.
13026 14725. 0.
13027 14726. 0.
13028 14727. 0.
13029 14728. 0.
13030 14729. 0.
13031 14730. 0.
13032 14731. 0.
13033 14732. 0.
13034 14733. 0.
13035 14734. 0.
13036 14735. 0.
13037 14736. 0.
13038 14737. 0.
13039 14738. 0.
13040 14739. 0.
13041 14740. 0.
13042 14741. 0.
13043 14742. 0.
13044 14743. 0.
13045 14744. 0.
13046 14745. 0.
13047 14746. 0.
13048 14747. 0.
13049 14748. 0.
13050 14749. 0.
13051 14750. 0.
13052 14751. 0.
13053 14752. 0.
13054 14753. 0.
13055 14754. 0.
13056 14755. 0.
13057 14756. 0.
13058 14757. 0.
13059 14758. 0.
13060 14759. 0.
13061 14760. 0.
13062 14761. 0.
13063 14762. 0.
13064 14763. 0.
13065 14764. 0.
13066 14765. 0.
13067 14766. 0.
13068 14767. 0.
13069 14768. 0.
13070 14769. 0.
13071 14770. 0.
13072 14771. 0.
13073 14772. 0.
13074 14773. 0.
13075 14774. 0.
13076 14775. 0.
13077 14776. 0.
13078 14777. 0.
13079 14778. 0.
13080 14779. 0.
13081 14780. 0.
13082 14781. 0.
13083 14782. 0.
13084 14783. 0.
13085 14784. 0.
13086 14785. 0.
13087 14786. 0.
13088 14787. 0.
13089 14788. 0.
13090 14789. 0.
13091 14790. 0.
13092 14791. 0.
13093 14792. 0.
13094 14793. 0.
13095 14794. 0.
13096 14795. 0.
13097 14796. 0.
13098 14797. 0.
13099 14798. 0.
13100 14799. 0.
13101 14800. 0.
13102 14801. 0.
13103 14802. 0.
13104 14803. 0.
13105 14804. 0.
13106 14805. 0.
13107 14806. 0.
13108 14807. 0.
13109 14808. 0.
13110 14809. 0.
13111 14810. 0.
13112 14811. 0.
13113 14812. 0.
13114 14813. 0.
13115 14814. 0.
13116 14815. 0.
13117 14816. 0.
13118 14817. 0.
13119 14818. 0.
13120 14819. 0.
13121 14820. 0.
13122 14821. 0.
13123 14822. 0.
13124 14823. 0.
13125 14824. 0.
13126 14825. 0.
13127 14826. 0.
13128 14827. 0.
13129 14828. 0.
13130 14829. 0.
13131 14830. 0.
13132 14831. 0.
13133 14832. 0.
13134 14833. 0.
13135 14834. 0.
13136 14835. 0.
13137 14836. 0.
13138 14837. 0.
13139 14838. 0.
13140 14839. 0.
13141 14840. 0.
13142 14841. 0.
13143 14842. 0.
13144 14843. 0.
13145 14844. 0.
13146 14845. 0.
13147 14846. 0.
13148 14847. 0.
13149 14848. 0.
13150 14849. 0.
13151 14850. 0.
13152 14851. 0.
13153 14852. 0.
13154 14853. 0.
13155 14854. 0.
13156 14855. 0.
13157 14856. 0.
13158 14857. 0.
13159 14858. 0.
13160 14859. 0.
13161 14860. 0.
13162 14861. 0.
13163 14862. 0.
13164 14863. 0.
13165 14864. 0.
13166 14865. 0.
13167 14866. 0.
13168 14867. 0.
13169 14868. 0.
13170 14869. 0.
13171 14870. 0.
13172 14871. 0.
13173 14872. 0.
13174 14873. 0.
13175 14874. 0.
13176 14875. 0.
13177 14876. 0.
13178 14877. 0.
13179 14878. 0.
13180 14879. 0.
13181 14880. 0.
13182 14881. 0.
13183 14882. 0.
13184 14883. 0.
13185 14884. 0.
13186 14885. 0.
13187 14886. 0.
13188 14887. 0.
13189 14888. 0.
13190 14889. 0.
13191 14890. 0.
13192 14891. 0.
13193 14892. 0.
13194 14893. 0.
13195 14894. 0.
13196 14895. 0.
13197 14896. 0.
13198 14897. 0.
13199 14898. 0.
13200 14899. 0.
13201 14900. 0.
13202 14901. 0.
13203 14902. 0.
13204 14903. 0.
13205 14904. 0.
13206 14905. 0.
13207 14906. 0.
13208 14907. 0.
13209 14908. 0.
13210 14909. 0.
13211 14910. 0.
13212 14911. 0.
13213 14912. 0.
13214 14913. 0.
13215 14914. 0.
13216 14915. 0.
13217 14916. 0.
13218 14917. 0.
13219 14918. 0.
13220 14919. 0.
13221 14920. 0.
13222 14921. 0.
13223 14922. 0.
13224 14923. 0.
13225 14924. 0.
13226 14925. 0.
13227 14926. 0.
13228 14927. 0.
13229 14928. 0.
13230 14929. 0.
13231 14930. 0.
13232 14931. 0.
13233 14932. 0.
13234 14933. 0.
13235 14934. 0.
13236 14935. 0.
13237 14936. 0.
13238 14937. 0.
13239 14938. 0.
13240 14939. 0.
13241 14940. 0.
13242 14941. 0.
13243 14942. 0.
13244 14943. 0.
13245 14944. 0.
13246 14945. 0.
13247 14946. 0.
13248 14947. 0.
13249 14948. 0.
13250 14949. 0.
13251 14950. 0.
13252 14951. 0.
13253 14952. 0.
13254 14953. 0.
13255 14954. 0.
13256 14955. 0.
13257 14956. 0.
13258 14957. 0.
13259 14958. 0.
13260 14959. 0.
13261 14960. 0.
13262 14961. 0.
13263 14962. 0.
13264 14963. 0.
13265 14964. 0.
13266 14965. 0.
13267 14966. 0.
13268 14967. 0.
13269 14968. 0.
13270 14969. 0.
13271 14970. 0.
13272 14971. 0.
13273 14972. 0.
13274 14973. 0.
13275 14974. 0.
13276 14975. 0.
13277 14976. 0.
13278 14977. 0.
13279 14978. 0.
13280 14979. 0.
13281 14980. 0.
13282 14981. 0.
13283 14982. 0.
13284 14983. 0.
13285 14984. 0.
13286 14985. 0.
13287 14986. 0.
13288 14987. 0.
13289 14988. 0.
13290 14989. 0.
13291 14990. 0.
13292 14991. 0.
13293 14992. 0.
13294 14993. 0.
13295 14994. 0.
13296 14995. 0.
13297 14996. 0.
13298 14997. 0.
13299 14998. 0.
13300 14999. 0.
13301 15000. 0.
13302 15001. 0.
13303 15002. 0.
13304 15003. 0.
13305 15004. 0.
13306 15005. 0.
13307 15006. 0.
13308 15007. 0.
13309 15008. 0.
13310 15009. 0.
13311 15010. 0.
13312 15011. 0.
13313 15012. 0.
13314 15013. 0.
13315 15014. 0.
13316 15015. 0.
13317 15016. 0.
13318 15017. 0.
13319 15018. 0.
13320 15019. 0.
13321 15020. 0.
13322 15021. 0.
13323 15022. 0.
13324 15023. 0.
13325 15024. 0.
13326 15025. 0.
13327 15026. 0.
13328 15027. 0.
13329 15028. 0.
13330 15029. 0.
13331 15030. 0.
13332 15031. 0.
13333 15032. 0.
13334 15033. 0.
13335 15034. 0.
13336 15035. 0.
13337 15036. 0.
13338 15037. 0.
13339 15038. 0.
13340 15039. 0.
13341 15040. 0.
13342 15041. 0.
13343 15042. 0.
13344 15043. 0.
13345 15044. 0.
13346 15045. 0.
13347 15046. 0.
13348 15047. 0.
13349 15048. 0.
13350 15049. 0.
13351 15050. 0.
13352 15051. 0.
13353 15052. 0.
13354 15053. 0.
13355 15054. 0.
13356 15055. 0.
13357 15056. 0.
13358 15057. 0.
13359 15058. 0.
13360 15059. 0.
13361 15060. 0.
13362 15061. 0.
13363 15062. 0.
13364 15063. 0.
13365 15064. 0.
13366 15065. 0.
13367 15066. 0.
13368 15067. 0.
13369 15068. 0.
13370 15069. 0.
13371 15070. 0.
13372 15071. 0.
13373 15072. 0.
13374 15073. 0.
13375 15074. 0.
13376 15075. 0.
13377 15076. 0.
13378 15077. 0.
13379 15078. 0.
13380 15079. 0.
13381 15080. 0.
13382 15081. 0.
13383 15082. 0.
13384 15083. 0.
13385 15084. 0.
13386 15085. 0.
13387 15086. 0.
13388 15087. 0.
13389 15088. 0.
13390 15089. 0.
13391 15090. 0.
13392 15091. 0.
13393 15092. 0.
13394 15093. 0.
13395 15094. 0.
13396 15095. 0.
13397 15096. 0.
13398 15097. 0.
13399 15098. 0.
13400 15099. 0.
13401 15100. 0.
13402 15101. 0.
13403 15102. 0.
13404 15103. 0.
13405 15104. 0.
13406 15105. 0.
13407 15106. 0.
13408 15107. 0.
13409 15108. 0.
13410 15109. 0.
13411 15110. 0.
13412 15111. 0.
13413 15112. 0.
13414 15113. 0.
13415 15114. 0.
13416 15115. 0.
13417 15116. 0.
13418 15117. 0.
13419 15118. 0.
13420 15119. 0.
13421 15120. 0.
13422 15121. 0.
13423 15122. 0.
13424 15123. 0.
13425 15124. 0.
13426 15125. 0.
13427 15126. 0.
13428 15127. 0.
13429 15128. 0.
13430 15129. 0.
13431 15130. 0.
13432 15131. 0.
13433 15132. 0.
13434 15133. 0.
13435 15134. 0.
13436 15135. 0.
13437 15136. 0.
13438 15137. 0.
13439 15138. 0.
13440 15139. 0.
13441 15140. 0.
13442 15141. 0.
13443 15142. 0.
13444 15143. 0.
13445 15144. 0.
13446 15145. 0.
13447 15146. 0.
13448 15147. 0.
13449 15148. 0.
13450 15149. 0.
13451 15150. 0.
13452 15151. 0.
13453 15152. 0.
13454 15153. 0.
13455 15154. 0.
13456 15155. 0.
13457 15156. 0.
13458 15157. 0.
13459 15158. 0.
13460 15159. 0.
13461 15160. 0.
13462 15161. 0.
13463 15162. 0.
13464 15163. 0.
13465 15164. 0.
13466 15165. 0.
13467 15166. 0.
13468 15167. 0.
13469 15168. 0.
13470 15169. 0.
13471 15170. 0.
13472 15171. 0.
13473 15172. 0.
13474 15173. 0.
13475 15174. 0.
13476 15175. 0.
13477 15176. 0.
13478 15177. 0.
13479 15178. 0.
13480 15179. 0.
13481 15180. 0.
13482 15181. 0.
13483 15182. 0.
13484 15183. 0.
13485 15184. 0.
13486 15185. 0.
13487 15186. 0.
13488 15187. 0.
13489 15188. 0.
13490 15189. 0.
13491 15190. 0.
13492 15191. 0.
13493 15192. 0.
13494 15193. 0.
13495 15194. 0.
13496 15195. 0.
13497 15196. 0.
13498 15197. 0.
13499 15198. 0.
13500 15199. 0.
13501 15200. 0.
13502 15201. 0.
13503 15202. 0.
13504 15203. 0.
13505 15204. 0.
13506 15205. 0.
13507 15206. 0.
13508 15207. 0.
13509 15208. 0.
13510 15209. 0.
13511 15210. 0.
13512 15211. 0.
13513 15212. 0.
13514 15213. 0.
13515 15214. 0.
13516 15215. 0.
13517 15216. 0.
13518 15217. 0.
13519 15218. 0.
13520 15219. 0.
13521 15220. 0.
13522 15221. 0.
13523 15222. 0.
13524 15223. 0.
13525 15224. 0.
13526 15225. 0.
13527 15226. 0.
13528 15227. 0.
13529 15228. 0.
13530 15229. 0.
13531 15230. 0.
13532 15231. 0.
13533 15232. 0.
13534 15233. 0.
13535 15234. 0.
13536 15235. 0.
13537 15236. 0.
13538 15237. 0.
13539 15238. 0.
13540 15239. 0.
13541 15240. 0.
13542 15241. 0.
13543 15242. 0.
13544 15243. 0.
13545 15244. 0.
13546 15245. 0.
13547 15246. 0.
13548 15247. 0.
13549 15248. 0.
13550 15249. 0.
13551 15250. 0.
13552 15251. 0.
13553 15252. 0.
13554 15253. 0.
13555 15254. 0.
13556 15255. 0.
13557 15256. 0.
13558 15257. 0.
13559 15258. 0.
13560 15259. 0.
13561 15260. 0.
13562 15261. 0.
13563 15262. 0.
13564 15263. 0.
13565 15264. 0.
13566 15265. 0.
13567 15266. 0.
13568 15267. 0.
13569 15268. 0.
13570 15269. 0.
13571 15270. 0.
13572 15271. 0.
13573 15272. 0.
13574 15273. 0.
13575 15274. 0.
13576 15275. 0.
13577 15276. 0.
13578 15277. 0.
13579 15278. 0.
13580 15279. 0.
13581 15280. 0.
13582 15281. 0.
13583 15282. 0.
13584 15283. 0.
13585 15284. 0.
13586 15285. 0.
13587 15286. 0.
13588 15287. 0.
13589 15288. 0.
13590 15289. 0.
13591 15290. 0.
13592 15291. 0.
13593 15292. 0.
13594 15293. 0.
13595 15294. 0.
13596 15295. 0.
13597 15296. 0.
13598 15297. 0.
13599 15298. 0.
13600 15299. 0.
13601 15300. 0.
13602 15301. 0.
13603 15302. 0.
13604 15303. 0.
13605 15304. 0.
13606 15305. 0.
13607 15306. 0.
13608 15307. 0.
13609 15308. 0.
13610 15309. 0.
13611 15310. 0.
13612 15311. 0.
13613 15312. 0.
13614 15313. 0.
13615 15314. 0.
13616 15315. 0.
13617 15316. 0.
13618 15317. 0.
13619 15318. 0.
13620 15319. 0.
13621 15320. 0.
13622 15321. 0.
13623 15322. 0.
13624 15323. 0.
13625 15324. 0.
13626 15325. 0.
13627 15326. 0.
13628 15327. 0.
13629 15328. 0.
13630 15329. 0.
13631 15330. 0.
13632 15331. 0.
13633 15332. 0.
13634 15333. 0.
13635 15334. 0.
13636 15335. 0.
13637 15336. 0.
13638 15337. 0.
13639 15338. 0.
13640 15339. 0.
13641 15340. 0.
13642 15341. 0.
13643 15342. 0.
13644 15343. 0.
13645 15344. 0.
13646 15345. 0.
13647 15346. 0.
13648 15347. 0.
13649 15348. 0.
13650 15349. 0.
13651 15350. 0.
13652 15351. 0.
13653 15352. 0.
13654 15353. 0.
13655 15354. 0.
13656 15355. 0.
13657 15356. 0.
13658 15357. 0.
13659 15358. 0.
13660 15359. 0.
13661 15360. 0.
13662 15361. 0.
13663 15362. 0.
13664 15363. 0.
13665 15364. 0.
13666 15365. 0.
13667 15366. 0.
13668 15367. 0.
13669 15368. 0.
13670 15369. 0.
13671 15370. 0.
13672 15371. 0.
13673 15372. 0.
13674 15373. 0.
13675 15374. 0.
13676 15375. 0.
13677 15376. 0.
13678 15377. 0.
13679 15378. 0.
13680 15379. 0.
13681 15380. 0.
13682 15381. 0.
13683 15382. 0.
13684 15383. 0.
13685 15384. 0.
13686 15385. 0.
13687 15386. 0.
13688 15387. 0.
13689 15388. 0.
13690 15389. 0.
13691 15390. 0.
13692 15391. 0.
13693 15392. 0.
13694 15393. 0.
13695 15394. 0.
13696 15395. 0.
13697 15396. 0.
13698 15397. 0.
13699 15398. 0.
13700 15399. 0.
13701 15400. 0.
13702 15401. 0.
13703 15402. 0.
13704 15403. 0.
13705 15404. 0.
13706 15405. 0.
13707 15406. 0.
13708 15407. 0.
13709 15408. 0.
13710 15409. 0.
13711 15410. 0.
13712 15411. 0.
13713 15412. 0.
13714 15413. 0.
13715 15414. 0.
13716 15415. 0.
13717 15416. 0.
13718 15417. 0.
13719 15418. 0.
13720 15419. 0.
13721 15420. 0.
13722 15421. 0.
13723 15422. 0.
13724 15423. 0.
13725 15424. 0.
13726 15425. 0.
13727 15426. 0.
13728 15427. 0.
13729 15428. 0.
13730 15429. 0.
13731 15430. 0.
13732 15431. 0.
13733 15432. 0.
13734 15433. 0.
13735 15434. 0.
13736 15435. 0.
13737 15436. 0.
13738 15437. 0.
13739 15438. 0.
13740 15439. 0.
13741 15440. 0.
13742 15441. 0.
13743 15442. 0.
13744 15443. 0.
13745 15444. 0.
13746 15445. 0.
13747 15446. 0.
13748 15447. 0.
13749 15448. 0.
13750 15449. 0.
13751 15450. 0.
13752 15451. 0.
13753 15452. 0.
13754 15453. 0.
13755 15454. 0.
13756 15455. 0.
13757 15456. 0.
13758 15457. 0.
13759 15458. 0.
13760 15459. 0.
13761 15460. 0.
13762 15461. 0.
13763 15462. 0.
13764 15463. 0.
13765 15464. 0.
13766 15465. 0.
13767 15466. 0.
13768 15467. 0.
13769 15468. 0.
13770 15469. 0.
13771 15470. 0.
13772 15471. 0.
13773 15472. 0.
13774 15473. 0.
13775 15474. 0.
13776 15475. 0.
13777 15476. 0.
13778 15477. 0.
13779 15478. 0.
13780 15479. 0.
13781 15480. 0.
13782 15481. 0.
13783 15482. 0.
13784 15483. 0.
13785 15484. 0.
13786 15485. 0.
13787 15486. 0.
13788 15487. 0.
13789 15488. 0.
13790 15489. 0.
13791 15490. 0.
13792 15491. 0.
13793 15492. 0.
13794 15493. 0.
13795 15494. 0.
13796 15495. 0.
13797 15496. 0.
13798 15497. 0.
13799 15498. 0.
13800 15499. 0.
13801 15500. 0.
13802 15501. 0.
13803 15502. 0.
13804 15503. 0.
13805 15504. 0.
13806 15505. 0.
13807 15506. 0.
13808 15507. 0.
13809 15508. 0.
13810 15509. 0.
13811 15510. 0.
13812 15511. 0.
13813 15512. 0.
13814 15513. 0.
13815 15514. 0.
13816 15515. 0.
13817 15516. 0.
13818 15517. 0.
13819 15518. 0.
13820 15519. 0.
13821 15520. 0.
13822 15521. 0.
13823 15522. 0.
13824 15523. 0.
13825 15524. 0.
13826 15525. 0.
13827 15526. 0.
13828 15527. 0.
13829 15528. 0.
13830 15529. 0.
13831 15530. 0.
13832 15531. 0.
13833 15532. 0.
13834 15533. 0.
13835 15534. 0.
13836 15535. 0.
13837 15536. 0.
13838 15537. 0.
13839 15538. 0.
13840 15539. 0.
13841 15540. 0.
13842 15541. 0.
13843 15542. 0.
13844 15543. 0.
13845 15544. 0.
13846 15545. 0.
13847 15546. 0.
13848 15547. 0.
13849 15548. 0.
13850 15549. 0.
13851 15550. 0.
13852 15551. 0.
13853 15552. 0.
13854 15553. 0.
13855 15554. 0.
13856 15555. 0.
13857 15556. 0.
13858 15557. 0.
13859 15558. 0.
13860 15559. 0.
13861 15560. 0.
13862 15561. 0.
13863 15562. 0.
13864 15563. 0.
13865 15564. 0.
13866 15565. 0.
13867 15566. 0.
13868 15567. 0.
13869 15568. 0.
13870 15569. 0.
13871 15570. 0.
13872 15571. 0.
13873 15572. 0.
13874 15573. 0.
13875 15574. 0.
13876 15575. 0.
13877 15576. 0.
13878 15577. 0.
13879 15578. 0.
13880 15579. 0.
13881 15580. 0.
13882 15581. 0.
13883 15582. 0.
13884 15583. 0.
13885 15584. 0.
13886 15585. 0.
13887 15586. 0.
13888 15587. 0.
13889 15588. 0.
13890 15589. 0.
13891 15590. 0.
13892 15591. 0.
13893 15592. 0.
13894 15593. 0.
13895 15594. 0.
13896 15595. 0.
13897 15596. 0.
13898 15597. 0.
13899 15598. 0.
13900 15599. 0.
13901 15600. 0.
13902 15601. 0.
13903 15602. 0.
13904 15603. 0.
13905 15604. 0.
13906 15605. 0.
13907 15606. 0.
13908 15607. 0.
13909 15608. 0.
13910 15609. 0.
13911 15610. 0.
13912 15611. 0.
13913 15612. 0.
13914 15613. 0.
13915 15614. 0.
13916 15615. 0.
13917 15616. 0.
13918 15617. 0.
13919 15618. 0.
13920 15619. 0.
13921 15620. 0.
13922 15621. 0.
13923 15622. 0.
13924 15623. 0.
13925 15624. 0.
13926 15625. 0.
13927 15626. 0.
13928 15627. 0.
13929 15628. 0.
13930 15629. 0.
13931 15630. 0.
13932 15631. 0.
13933 15632. 0.
13934 15633. 0.
13935 15634. 0.
13936 15635. 0.
13937 15636. 0.
13938 15637. 0.
13939 15638. 0.
13940 15639. 0.
13941 15640. 0.
13942 15641. 0.
13943 15642. 0.
13944 15643. 0.
13945 15644. 0.
13946 15645. 0.
13947 15646. 0.
13948 15647. 0.
13949 15648. 0.
13950 15649. 0.
13951 15650. 0.
13952 15651. 0.
13953 15652. 0.
13954 15653. 0.
13955 15654. 0.
13956 15655. 0.
13957 15656. 0.
13958 15657. 0.
13959 15658. 0.
13960 15659. 0.
13961 15660. 0.
13962 15661. 0.
13963 15662. 0.
13964 15663. 0.
13965 15664. 0.
13966 15665. 0.
13967 15666. 0.
13968 15667. 0.
13969 15668. 0.
13970 15669. 0.
13971 15670. 0.
13972 15671. 0.
13973 15672. 0.
13974 15673. 0.
13975 15674. 0.
13976 15675. 0.
13977 15676. 0.
13978 15677. 0.
13979 15678. 0.
13980 15679. 0.
13981 15680. 0.
13982 15681. 0.
13983 15682. 0.
13984 15683. 0.
13985 15684. 0.
13986 15685. 0.
13987 15686. 0.
13988 15687. 0.
13989 15688. 0.
13990 15689. 0.
13991 15690. 0.
13992 15691. 0.
13993 15692. 0.
13994 15693. 0.
13995 15694. 0.
13996 15695. 0.
13997 15696. 0.
13998 15697. 0.
13999 15698. 0.
14000 15699. 0.
14001 15700. 0.
14002 15701. 0.
14003 15702. 0.
14004 15703. 0.
14005 15704. 0.
14006 15705. 0.
14007 15706. 0.
14008 15707. 0.
14009 15708. 0.
14010 15709. 0.
14011 15710. 0.
14012 15711. 0.
14013 15712. 0.
14014 15713. 0.
14015 15714. 0.
14016 15715. 0.
14017 15716. 0.
14018 15717. 0.
14019 15718. 0.
14020 15719. 0.
14021 15720. 0.
14022 15721. 0.
14023 15722. 0.
14024 15723. 0.
14025 15724. 0.
14026 15725. 0.
14027 15726. 0.
14028 15727. 0.
14029 15728. 0.
14030 15729. 0.
14031 15730. 0.
14032 15731. 0.
14033 15732. 0.
14034 15733. 0.
14035 15734. 0.
14036 15735. 0.
14037 15736. 0.
14038 15737. 0.
14039 15738. 0.
14040 15739. 0.
14041 15740. 0.
14042 15741. 0.
14043 15742. 0.
14044 15743. 0.
14045 15744. 0.
14046 15745. 0.
14047 15746. 0.
14048 15747. 0.
14049 15748. 0.
14050 15749. 0.
14051 15750. 0.
14052 15751. 0.
14053 15752. 0.
14054 15753. 0.
14055 15754. 0.
14056 15755. 0.
14057 15756. 0.
14058 15757. 0.
14059 15758. 0.
14060 15759. 0.
14061 15760. 0.
14062 15761. 0.
14063 15762. 0.
14064 15763. 0.
14065 15764. 0.
14066 15765. 0.
14067 15766. 0.
14068 15767. 0.
14069 15768. 0.
14070 15769. 0.
14071 15770. 0.
14072 15771. 0.
14073 15772. 0.
14074 15773. 0.
14075 15774. 0.
14076 15775. 0.
14077 15776. 0.
14078 15777. 0.
14079 15778. 0.
14080 15779. 0.
14081 15780. 0.
14082 15781. 0.
14083 15782. 0.
14084 15783. 0.
14085 15784. 0.
14086 15785. 0.
14087 15786. 0.
14088 15787. 0.
14089 15788. 0.
14090 15789. 0.
14091 15790. 0.
14092 15791. 0.
14093 15792. 0.
14094 15793. 0.
14095 15794. 0.
14096 15795. 0.
14097 15796. 0.
14098 15797. 0.
14099 15798. 0.
14100 15799. 0.
14101 15800. 0.
14102 15801. 0.
14103 15802. 0.
14104 15803. 0.
14105 15804. 0.
14106 15805. 0.
14107 15806. 0.
14108 15807. 0.
14109 15808. 0.
14110 15809. 0.
14111 15810. 0.
14112 15811. 0.
14113 15812. 0.
14114 15813. 0.
14115 15814. 0.
14116 15815. 0.
14117 15816. 0.
14118 15817. 0.
14119 15818. 0.
14120 15819. 0.
14121 15820. 0.
14122 15821. 0.
14123 15822. 0.
14124 15823. 0.
14125 15824. 0.
14126 15825. 0.
14127 15826. 0.
14128 15827. 0.
14129 15828. 0.
14130 15829. 0.
14131 15830. 0.
14132 15831. 0.
14133 15832. 0.
14134 15833. 0.
14135 15834. 0.
14136 15835. 0.
14137 15836. 0.
14138 15837. 0.
14139 15838. 0.
14140 15839. 0.
14141 15840. 0.
14142 15841. 0.
14143 15842. 0.
14144 15843. 0.
14145 15844. 0.
14146 15845. 0.
14147 15846. 0.
14148 15847. 0.
14149 15848. 0.
14150 15849. 0.
14151 15850. 0.
14152 15851. 0.
14153 15852. 0.
14154 15853. 0.
14155 15854. 0.
14156 15855. 0.
14157 15856. 0.
14158 15857. 0.
14159 15858. 0.
14160 15859. 0.
14161 15860. 0.
14162 15861. 0.
14163 15862. 0.
14164 15863. 0.
14165 15864. 0.
14166 15865. 0.
14167 15866. 0.
14168 15867. 0.
14169 15868. 0.
14170 15869. 0.
14171 15870. 0.
14172 15871. 0.
14173 15872. 0.
14174 15873. 0.
14175 15874. 0.
14176 15875. 0.
14177 15876. 0.
14178 15877. 0.
14179 15878. 0.
14180 15879. 0.
14181 15880. 0.
14182 15881. 0.
14183 15882. 0.
14184 15883. 0.
14185 15884. 0.
14186 15885. 0.
14187 15886. 0.
14188 15887. 0.
14189 15888. 0.
14190 15889. 0.
14191 15890. 0.
14192 15891. 0.
14193 15892. 0.
14194 15893. 0.
14195 15894. 0.
14196 15895. 0.
14197 15896. 0.
14198 15897. 0.
14199 15898. 0.
14200 15899. 0.
14201 15900. 0.
14202 15901. 0.
14203 15902. 0.
14204 15903. 0.
14205 15904. 0.
14206 15905. 0.
14207 15906. 0.
14208 15907. 0.
14209 15908. 0.
14210 15909. 0.
14211 15910. 0.
14212 15911. 0.
14213 15912. 0.
14214 15913. 0.
14215 15914. 0.
14216 15915. 0.
14217 15916. 0.
14218 15917. 0.
14219 15918. 0.
14220 15919. 0.
14221 15920. 0.
14222 15921. 0.
14223 15922. 0.
14224 15923. 0.
14225 15924. 0.
14226 15925. 0.
14227 15926. 0.
14228 15927. 0.
14229 15928. 0.
14230 15929. 0.
14231 15930. 0.
14232 15931. 0.
14233 15932. 0.
14234 15933. 0.
14235 15934. 0.
14236 15935. 0.
14237 15936. 0.
14238 15937. 0.
14239 15938. 0.
14240 15939. 0.
14241 15940. 0.
14242 15941. 0.
14243 15942. 0.
14244 15943. 0.
14245 15944. 0.
14246 15945. 0.
14247 15946. 0.
14248 15947. 0.
14249 15948. 0.
14250 15949. 0.
14251 15950. 0.
14252 15951. 0.
14253 15952. 0.
14254 15953. 0.
14255 15954. 0.
14256 15955. 0.
14257 15956. 0.
14258 15957. 0.
14259 15958. 0.
14260 15959. 0.
14261 15960. 0.
14262 15961. 0.
14263 15962. 0.
14264 15963. 0.
14265 15964. 0.
14266 15965. 0.
14267 15966. 0.
14268 15967. 0.
14269 15968. 0.
14270 15969. 0.
14271 15970. 0.
14272 15971. 0.
14273 15972. 0.
14274 15973. 0.
14275 15974. 0.
14276 15975. 0.
14277 15976. 0.
14278 15977. 0.
14279 15978. 0.
14280 15979. 0.
14281 15980. 0.
14282 15981. 0.
14283 15982. 0.
14284 15983. 0.
14285 15984. 0.
14286 15985. 0.
14287 15986. 0.
14288 15987. 0.
14289 15988. 0.
14290 15989. 0.
14291 15990. 0.
14292 15991. 0.
14293 15992. 0.
14294 15993. 0.
14295 15994. 0.
14296 15995. 0.
14297 15996. 0.
14298 15997. 0.
14299 15998. 0.
14300 15999. 0.
14301 16000. 0.
14302 16001. 0.
14303 16002. 0.
14304 16003. 0.
14305 16004. 0.
14306 16005. 0.
14307 16006. 0.
14308 16007. 0.
14309 16008. 0.
14310 16009. 0.
14311 16010. 0.
14312 16011. 0.
14313 16012. 0.
14314 16013. 0.
14315 16014. 0.
14316 16015. 0.
14317 16016. 0.
14318 16017. 0.
14319 16018. 0.
14320 16019. 0.
14321 16020. 0.
14322 16021. 0.
14323 16022. 0.
14324 16023. 0.
14325 16024. 0.
14326 16025. 0.
14327 16026. 0.
14328 16027. 0.
14329 16028. 0.
14330 16029. 0.
14331 16030. 0.
14332 16031. 0.
14333 16032. 0.
14334 16033. 0.
14335 16034. 0.
14336 16035. 0.
14337 16036. 0.
14338 16037. 0.
14339 16038. 0.
14340 16039. 0.
14341 16040. 0.
14342 16041. 0.
14343 16042. 0.
14344 16043. 0.
14345 16044. 0.
14346 16045. 0.
14347 16046. 0.
14348 16047. 0.
14349 16048. 0.
14350 16049. 0.
14351 16050. 0.
14352 16051. 0.
14353 16052. 0.
14354 16053. 0.
14355 16054. 0.
14356 16055. 0.
14357 16056. 0.
14358 16057. 0.
14359 16058. 0.
14360 16059. 0.
14361 16060. 0.
14362 16061. 0.
14363 16062. 0.
14364 16063. 0.
14365 16064. 0.
14366 16065. 0.
14367 16066. 0.
14368 16067. 0.
14369 16068. 0.
14370 16069. 0.
14371 16070. 0.
14372 16071. 0.
14373 16072. 0.
14374 16073. 0.
14375 16074. 0.
14376 16075. 0.
14377 16076. 0.
14378 16077. 0.
14379 16078. 0.
14380 16079. 0.
14381 16080. 0.
14382 16081. 0.
14383 16082. 0.
14384 16083. 0.
14385 16084. 0.
14386 16085. 0.
14387 16086. 0.
14388 16087. 0.
14389 16088. 0.
14390 16089. 0.
14391 16090. 0.
14392 16091. 0.
14393 16092. 0.
14394 16093. 0.
14395 16094. 0.
14396 16095. 0.
14397 16096. 0.
14398 16097. 0.
14399 16098. 0.
14400 16099. 0.
14401 16100. 0.
14402 16101. 0.
14403 16102. 0.
14404 16103. 0.
14405 16104. 0.
14406 16105. 0.
14407 16106. 0.
14408 16107. 0.
14409 16108. 0.
14410 16109. 0.
14411 16110. 0.
14412 16111. 0.
14413 16112. 0.
14414 16113. 0.
14415 16114. 0.
14416 16115. 0.
14417 16116. 0.
14418 16117. 0.
14419 16118. 0.
14420 16119. 0.
14421 16120. 0.
14422 16121. 0.
14423 16122. 0.
14424 16123. 0.
14425 16124. 0.
14426 16125. 0.
14427 16126. 0.
14428 16127. 0.
14429 16128. 0.
14430 16129. 0.
14431 16130. 0.
14432 16131. 0.
14433 16132. 0.
14434 16133. 0.
14435 16134. 0.
14436 16135. 0.
14437 16136. 0.
14438 16137. 0.
14439 16138. 0.
14440 16139. 0.
14441 16140. 0.
14442 16141. 0.
14443 16142. 0.
14444 16143. 0.
14445 16144. 0.
14446 16145. 0.
14447 16146. 0.
14448 16147. 0.
14449 16148. 0.
14450 16149. 0.
14451 16150. 0.
14452 16151. 0.
14453 16152. 0.
14454 16153. 0.
14455 16154. 0.
14456 16155. 0.
14457 16156. 0.
14458 16157. 0.
14459 16158. 0.
14460 16159. 0.
14461 16160. 0.
14462 16161. 0.
14463 16162. 0.
14464 16163. 0.
14465 16164. 0.
14466 16165. 0.
14467 16166. 0.
14468 16167. 0.
14469 16168. 0.
14470 16169. 0.
14471 16170. 0.
14472 16171. 0.
14473 16172. 0.
14474 16173. 0.
14475 16174. 0.
14476 16175. 0.
14477 16176. 0.
14478 16177. 0.
14479 16178. 0.
14480 16179. 0.
14481 16180. 0.
14482 16181. 0.
14483 16182. 0.
14484 16183. 0.
14485 16184. 0.
14486 16185. 0.
14487 16186. 0.
14488 16187. 0.
14489 16188. 0.
14490 16189. 0.
14491 16190. 0.
14492 16191. 0.
14493 16192. 0.
14494 16193. 0.
14495 16194. 0.
14496 16195. 0.
14497 16196. 0.
14498 16197. 0.
14499 16198. 0.
14500 16199. 0.
14501 16200. 0.
14502 16201. 0.
14503 16202. 0.
14504 16203. 0.
14505 16204. 0.
14506 16205. 0.
14507 16206. 0.
14508 16207. 0.
14509 16208. 0.
14510 16209. 0.
14511 16210. 0.
14512 16211. 0.
14513 16212. 0.
14514 16213. 0.
14515 16214. 0.
14516 16215. 0.
14517 16216. 0.
14518 16217. 0.
14519 16218. 0.
14520 16219. 0.
14521 16220. 0.
14522 16221. 0.
14523 16222. 0.
14524 16223. 0.
14525 16224. 0.
14526 16225. 0.
14527 16226. 0.
14528 16227. 0.
14529 16228. 0.
14530 16229. 0.
14531 16230. 0.
14532 16231. 0.
14533 16232. 0.
14534 16233. 0.
14535 16234. 0.
14536 16235. 0.
14537 16236. 0.
14538 16237. 0.
14539 16238. 0.
14540 16239. 0.
14541 16240. 0.
14542 16241. 0.
14543 16242. 0.
14544 16243. 0.
14545 16244. 0.
14546 16245. 0.
14547 16246. 0.
14548 16247. 0.
14549 16248. 0.
14550 16249. 0.
14551 16250. 0.
14552 16251. 0.
14553 16252. 0.
14554 16253. 0.
14555 16254. 0.
14556 16255. 0.
14557 16256. 0.
14558 16257. 0.
14559 16258. 0.
14560 16259. 0.
14561 16260. 0.
14562 16261. 0.
14563 16262. 0.
14564 16263. 0.
14565 16264. 0.
14566 16265. 0.
14567 16266. 0.
14568 16267. 0.
14569 16268. 0.
14570 16269. 0.
14571 16270. 0.
14572 16271. 0.
14573 16272. 0.
14574 16273. 0.
14575 16274. 0.
14576 16275. 0.
14577 16276. 0.
14578 16277. 0.
14579 16278. 0.
14580 16279. 0.
14581 16280. 0.
14582 16281. 0.
14583 16282. 0.
14584 16283. 0.
14585 16284. 0.
14586 16285. 0.
14587 16286. 0.
14588 16287. 0.
14589 16288. 0.
14590 16289. 0.
14591 16290. 0.
14592 16291. 0.
14593 16292. 0.
14594 16293. 0.
14595 16294. 0.
14596 16295. 0.
14597 16296. 0.
14598 16297. 0.
14599 16298. 0.
14600 16299. 0.
14601 16300. 0.
14602 16301. 0.
14603 16302. 0.
14604 16303. 0.
14605 16304. 0.
14606 16305. 0.
14607 16306. 0.
14608 16307. 0.
14609 16308. 0.
14610 16309. 0.
14611 16310. 0.
14612 16311. 0.
14613 16312. 0.
14614 16313. 0.
14615 16314. 0.
14616 16315. 0.
14617 16316. 0.
14618 16317. 0.
14619 16318. 0.
14620 16319. 0.
14621 16320. 0.
14622 16321. 0.
14623 16322. 0.
14624 16323. 0.
14625 16324. 0.
14626 16325. 0.
14627 16326. 0.
14628 16327. 0.
14629 16328. 0.
14630 16329. 0.
14631 16330. 0.
14632 16331. 0.
14633 16332. 0.
14634 16333. 0.
14635 16334. 0.
14636 16335. 0.
14637 16336. 0.
14638 16337. 0.
14639 16338. 0.
14640 16339. 0.
14641 16340. 0.
14642 16341. 0.
14643 16342. 0.
14644 16343. 0.
14645 16344. 0.
14646 16345. 0.
14647 16346. 0.
14648 16347. 0.
14649 16348. 0.
14650 16349. 0.
14651 16350. 0.
14652 16351. 0.
14653 16352. 0.
14654 16353. 0.
14655 16354. 0.
14656 16355. 0.
14657 16356. 0.
14658 16357. 0.
14659 16358. 0.
14660 16359. 0.
14661 16360. 0.
14662 16361. 0.
14663 16362. 0.
14664 16363. 0.
14665 16364. 0.
14666 16365. 0.
14667 16366. 0.
14668 16367. 0.
14669 16368. 0.
14670 16369. 0.
14671 16370. 0.
14672 16371. 0.
14673 16372. 0.
14674 16373. 0.
14675 16374. 0.
14676 16375. 0.
14677 16376. 0.
14678 16377. 0.
14679 16378. 0.
14680 16379. 0.
14681 16380. 0.
14682 16381. 0.
14683 16382. 0.
14684 16383. 0.
14685 16384. 0.
14686 16385. 0.
14687 16386. 0.
14688 16387. 0.
14689 16388. 0.
14690 16389. 0.
14691 16390. 0.
14692 16391. 0.
14693 16392. 0.
14694 16393. 0.
14695 16394. 0.
14696 16395. 0.
14697 16396. 0.
14698 16397. 0.
14699 16398. 0.
14700 16399. 0.
14701 16400. 0.
14702 16401. 0.
14703 16402. 0.
14704 16403. 0.
14705 16404. 0.
14706 16405. 0.
14707 16406. 0.
14708 16407. 0.
14709 16408. 0.
14710 16409. 0.
14711 16410. 0.
14712 16411. 0.
14713 16412. 0.
14714 16413. 0.
14715 16414. 0.
14716 16415. 0.
14717 16416. 0.
14718 16417. 0.
14719 16418. 0.
14720 16419. 0.
14721 16420. 0.
14722 16421. 0.
14723 16422. 0.
14724 16423. 0.
14725 16424. 0.
14726 16425. 0.
14727 16426. 0.
14728 16427. 0.
14729 16428. 0.
14730 16429. 0.
14731 16430. 0.
14732 16431. 0.
14733 16432. 0.
14734 16433. 0.
14735 16434. 0.
14736 16435. 0.
14737 16436. 0.
14738 16437. 0.
14739 16438. 0.
14740 16439. 0.
14741 16440. 0.
14742 16441. 0.
14743 16442. 0.
14744 16443. 0.
14745 16444. 0.
14746 16445. 0.
14747 16446. 0.
14748 16447. 0.
14749 16448. 0.
14750 16449. 0.
14751 16450. 0.
14752 16451. 0.
14753 16452. 0.
14754 16453. 0.
14755 16454. 0.
14756 16455. 0.
14757 16456. 0.
14758 16457. 0.
14759 16458. 0.
14760 16459. 0.
14761 16460. 0.
14762 16461. 0.
14763 16462. 0.
14764 16463. 0.
14765 16464. 0.
14766 16465. 0.
14767 16466. 0.
14768 16467. 0.
14769 16468. 0.
14770 16469. 0.
14771 16470. 0.
14772 16471. 0.
14773 16472. 0.
14774 16473. 0.
14775 16474. 0.
14776 16475. 0.
14777 16476. 0.
14778 16477. 0.
14779 16478. 0.
14780 16479. 0.
14781 16480. 0.
14782 16481. 0.
14783 16482. 0.
14784 16483. 0.
14785 16484. 0.
14786 16485. 0.
14787 16486. 0.
14788 16487. 0.
14789 16488. 0.
14790 16489. 0.
14791 16490. 0.
14792 16491. 0.
14793 16492. 0.
14794 16493. 0.
14795 16494. 0.
14796 16495. 0.
14797 16496. 0.
14798 16497. 0.
14799 16498. 0.
14800 16499. 0.
14801 16500. 0.
14802 16501. 0.
14803 16502. 0.
14804 16503. 0.
14805 16504. 0.
14806 16505. 0.
14807 16506. 0.
14808 16507. 0.
14809 16508. 0.
14810 16509. 0.
14811 16510. 0.
14812 16511. 0.
14813 16512. 0.
14814 16513. 0.
14815 16514. 0.
14816 16515. 0.
14817 16516. 0.
14818 16517. 0.
14819 16518. 0.
14820 16519. 0.
14821 16520. 0.
14822 16521. 0.
14823 16522. 0.
14824 16523. 0.
14825 16524. 0.
14826 16525. 0.
14827 16526. 0.
14828 16527. 0.
14829 16528. 0.
14830 16529. 0.
14831 16530. 0.
14832 16531. 0.
14833 16532. 0.
14834 16533. 0.
14835 16534. 0.
14836 16535. 0.
14837 16536. 0.
14838 16537. 0.
14839 16538. 0.
14840 16539. 0.
14841 16540. 0.
14842 16541. 0.
14843 16542. 0.
14844 16543. 0.
14845 16544. 0.
14846 16545. 0.
14847 16546. 0.
14848 16547. 0.
14849 16548. 0.
14850 16549. 0.
14851 16550. 0.
14852 16551. 0.
14853 16552. 0.
14854 16553. 0.
14855 16554. 0.
14856 16555. 0.
14857 16556. 0.
14858 16557. 0.
14859 16558. 0.
14860 16559. 0.
14861 16560. 0.
14862 16561. 0.
14863 16562. 0.
14864 16563. 0.
14865 16564. 0.
14866 16565. 0.
14867 16566. 0.
14868 16567. 0.
14869 16568. 0.
14870 16569. 0.
14871 16570. 0.
14872 16571. 0.
14873 16572. 0.
14874 16573. 0.
14875 16574. 0.
14876 16575. 0.
14877 16576. 0.
14878 16577. 0.
14879 16578. 0.
14880 16579. 0.
14881 16580. 0.
14882 16581. 0.
14883 16582. 0.
14884 16583. 0.
14885 16584. 0.
14886 16585. 0.
14887 16586. 0.
14888 16587. 0.
14889 16588. 0.
14890 16589. 0.
14891 16590. 0.
14892 16591. 0.
14893 16592. 0.
14894 16593. 0.
14895 16594. 0.
14896 16595. 0.
14897 16596. 0.
14898 16597. 0.
14899 16598. 0.
14900 16599. 0.
14901 16600. 0.
14902 16601. 0.
14903 16602. 0.
14904 16603. 0.
14905 16604. 0.
14906 16605. 0.
14907 16606. 0.
14908 16607. 0.
14909 16608. 0.
14910 16609. 0.
14911 16610. 0.
14912 16611. 0.
14913 16612. 0.
14914 16613. 0.
14915 16614. 0.
14916 16615. 0.
14917 16616. 0.
14918 16617. 0.
14919 16618. 0.
14920 16619. 0.
14921 16620. 0.
14922 16621. 0.
14923 16622. 0.
14924 16623. 0.
14925 16624. 0.
14926 16625. 0.
14927 16626. 0.
14928 16627. 0.
14929 16628. 0.
14930 16629. 0.
14931 16630. 0.
14932 16631. 0.
14933 16632. 0.
14934 16633. 0.
14935 16634. 0.
14936 16635. 0.
14937 16636. 0.
14938 16637. 0.
14939 16638. 0.
14940 16639. 0.
14941 16640. 0.
14942 16641. 0.
14943 16642. 0.
14944 16643. 0.
14945 16644. 0.
14946 16645. 0.
14947 16646. 0.
14948 16647. 0.
14949 16648. 0.
14950 16649. 0.
14951 16650. 0.
14952 16651. 0.
14953 16652. 0.
14954 16653. 0.
14955 16654. 0.
14956 16655. 0.
14957 16656. 0.
14958 16657. 0.
14959 16658. 0.
14960 16659. 0.
14961 16660. 0.
14962 16661. 0.
14963 16662. 0.
14964 16663. 0.
14965 16664. 0.
14966 16665. 0.
14967 16666. 0.
14968 16667. 0.
14969 16668. 0.
14970 16669. 0.
14971 16670. 0.
14972 16671. 0.
14973 16672. 0.
14974 16673. 0.
14975 16674. 0.
14976 16675. 0.
14977 16676. 0.
14978 16677. 0.
14979 16678. 0.
14980 16679. 0.
14981 16680. 0.
14982 16681. 0.
14983 16682. 0.
14984 16683. 0.
14985 16684. 0.
14986 16685. 0.
14987 16686. 0.
14988 16687. 0.
14989 16688. 0.
14990 16689. 0.
14991 16690. 0.
14992 16691. 0.
14993 16692. 0.
14994 16693. 0.
14995 16694. 0.
14996 16695. 0.
14997 16696. 0.
14998 16697. 0.
14999 16698. 0.
15000 16699. 0.
15001 16700. 0.
15002 16701. 0.
15003 16702. 0.
15004 16703. 0.
15005 16704. 0.
15006 16705. 0.
15007 16706. 0.
15008 16707. 0.
15009 16708. 0.
15010 16709. 0.
15011 16710. 0.
15012 16711. 0.
15013 16712. 0.
15014 16713. 0.
15015 16714. 0.
15016 16715. 0.
15017 16716. 0.
15018 16717. 0.
15019 16718. 0.
15020 16719. 0.
15021 16720. 0.
15022 16721. 0.
15023 16722. 0.
15024 16723. 0.
15025 16724. 0.
15026 16725. 0.
15027 16726. 0.
15028 16727. 0.
15029 16728. 0.
15030 16729. 0.
15031 16730. 0.
15032 16731. 0.
15033 16732. 0.
15034 16733. 0.
15035 16734. 0.
15036 16735. 0.
15037 16736. 0.
15038 16737. 0.
15039 16738. 0.
15040 16739. 0.
15041 16740. 0.
15042 16741. 0.
15043 16742. 0.
15044 16743. 0.
15045 16744. 0.
15046 16745. 0.
15047 16746. 0.
15048 16747. 0.
15049 16748. 0.
15050 16749. 0.
15051 16750. 0.
15052 16751. 0.
15053 16752. 0.
15054 16753. 0.
15055 16754. 0.
15056 16755. 0.
15057 16756. 0.
15058 16757. 0.
15059 16758. 0.
15060 16759. 0.
15061 16760. 0.
15062 16761. 0.
15063 16762. 0.
15064 16763. 0.
15065 16764. 0.
15066 16765. 0.
15067 16766. 0.
15068 16767. 0.
15069 16768. 0.
15070 16769. 0.
15071 16770. 0.
15072 16771. 0.
15073 16772. 0.
15074 16773. 0.
15075 16774. 0.
15076 16775. 0.
15077 16776. 0.
15078 16777. 0.
15079 16778. 0.
15080 16779. 0.
15081 16780. 0.
15082 16781. 0.
15083 16782. 0.
15084 16783. 0.
15085 16784. 0.
15086 16785. 0.
15087 16786. 0.
15088 16787. 0.
15089 16788. 0.
15090 16789. 0.
15091 16790. 0.
15092 16791. 0.
15093 16792. 0.
15094 16793. 0.
15095 16794. 0.
15096 16795. 0.
15097 16796. 0.
15098 16797. 0.
15099 16798. 0.
15100 16799. 0.
15101 16800. 0.
15102 16801. 0.
15103 16802. 0.
15104 16803. 0.
15105 16804. 0.
15106 16805. 0.
15107 16806. 0.
15108 16807. 0.
15109 16808. 0.
15110 16809. 0.
15111 16810. 0.
15112 16811. 0.
15113 16812. 0.
15114 16813. 0.
15115 16814. 0.
15116 16815. 0.
15117 16816. 0.
15118 16817. 0.
15119 16818. 0.
15120 16819. 0.
15121 16820. 0.
15122 16821. 0.
15123 16822. 0.
15124 16823. 0.
15125 16824. 0.
15126 16825. 0.
15127 16826. 0.
15128 16827. 0.
15129 16828. 0.
15130 16829. 0.
15131 16830. 0.
15132 16831. 0.
15133 16832. 0.
15134 16833. 0.
15135 16834. 0.
15136 16835. 0.
15137 16836. 0.
15138 16837. 0.
15139 16838. 0.
15140 16839. 0.
15141 16840. 0.
15142 16841. 0.
15143 16842. 0.
15144 16843. 0.
15145 16844. 0.
15146 16845. 0.
15147 16846. 0.
15148 16847. 0.
15149 16848. 0.
15150 16849. 0.
15151 16850. 0.
15152 16851. 0.
15153 16852. 0.
15154 16853. 0.
15155 16854. 0.
15156 16855. 0.
15157 16856. 0.
15158 16857. 0.
15159 16858. 0.
15160 16859. 0.
15161 16860. 0.
15162 16861. 0.
15163 16862. 0.
15164 16863. 0.
15165 16864. 0.
15166 16865. 0.
15167 16866. 0.
15168 16867. 0.
15169 16868. 0.
15170 16869. 0.
15171 16870. 0.
15172 16871. 0.
15173 16872. 0.
15174 16873. 0.
15175 16874. 0.
15176 16875. 0.
15177 16876. 0.
15178 16877. 0.
15179 16878. 0.
15180 16879. 0.
15181 16880. 0.
15182 16881. 0.
15183 16882. 0.
15184 16883. 0.
15185 16884. 0.
15186 16885. 0.
15187 16886. 0.
15188 16887. 0.
15189 16888. 0.
15190 16889. 0.
15191 16890. 0.
15192 16891. 0.
15193 16892. 0.
15194 16893. 0.
15195 16894. 0.
15196 16895. 0.
15197 16896. 0.
15198 16897. 0.
15199 16898. 0.
15200 16899. 0.
15201 16900. 0.
15202 16901. 0.
15203 16902. 0.
15204 16903. 0.
15205 16904. 0.
15206 16905. 0.
15207 16906. 0.
15208 16907. 0.
15209 16908. 0.
15210 16909. 0.
15211 16910. 0.
15212 16911. 0.
15213 16912. 0.
15214 16913. 0.
15215 16914. 0.
15216 16915. 0.
15217 16916. 0.
15218 16917. 0.
15219 16918. 0.
15220 16919. 0.
15221 16920. 0.
15222 16921. 0.
15223 16922. 0.
15224 16923. 0.
15225 16924. 0.
15226 16925. 0.
15227 16926. 0.
15228 16927. 0.
15229 16928. 0.
15230 16929. 0.
15231 16930. 0.
15232 16931. 0.
15233 16932. 0.
15234 16933. 0.
15235 16934. 0.
15236 16935. 0.
15237 16936. 0.
15238 16937. 0.
15239 16938. 0.
15240 16939. 0.
15241 16940. 0.
15242 16941. 0.
15243 16942. 0.
15244 16943. 0.
15245 16944. 0.
15246 16945. 0.
15247 16946. 0.
15248 16947. 0.
15249 16948. 0.
15250 16949. 0.
15251 16950. 0.
15252 16951. 0.
15253 16952. 0.
15254 16953. 0.
15255 16954. 0.
15256 16955. 0.
15257 16956. 0.
15258 16957. 0.
15259 16958. 0.
15260 16959. 0.
15261 16960. 0.
15262 16961. 0.
15263 16962. 0.
15264 16963. 0.
15265 16964. 0.
15266 16965. 0.
15267 16966. 0.
15268 16967. 0.
15269 16968. 0.
15270 16969. 0.
15271 16970. 0.
15272 16971. 0.
15273 16972. 0.
15274 16973. 0.
15275 16974. 0.
15276 16975. 0.
15277 16976. 0.
15278 16977. 0.
15279 16978. 0.
15280 16979. 0.
15281 16980. 0.
15282 16981. 0.
15283 16982. 0.
15284 16983. 0.
15285 16984. 0.
15286 16985. 0.
15287 16986. 0.
15288 16987. 0.
15289 16988. 0.
15290 16989. 0.
15291 16990. 0.
15292 16991. 0.
15293 16992. 0.
15294 16993. 0.
15295 16994. 0.
15296 16995. 0.
15297 16996. 0.
15298 16997. 0.
15299 16998. 0.
15300 16999. 0.
15301 17000. 0.
| 37.993859 | 55 | 0.368374 |
f186c378549155f71a7be775191454677acb13dd | 322 | lua | Lua | server/main.lua | bulva2/res1st-bulletproof-vest | 32ed8cded21be7792e36d070289bc06221d30e64 | [
"MIT"
] | 2 | 2021-01-07T16:27:16.000Z | 2021-04-16T09:02:18.000Z | server/main.lua | bulva2/res1st-bulletproof-vest | 32ed8cded21be7792e36d070289bc06221d30e64 | [
"MIT"
] | null | null | null | server/main.lua | bulva2/res1st-bulletproof-vest | 32ed8cded21be7792e36d070289bc06221d30e64 | [
"MIT"
] | null | null | null | ESX = nil
TriggerEvent('esx:getSharedObject', function(obj) ESX = obj end)
ESX.RegisterUsableItem('armor', function(source)
local xPlayer = ESX.GetPlayerFromId(source)
TriggerClientEvent('res1st-bulletproof-vest:useItem', source, 'armor')
xPlayer.removeInventoryItem('armor', 1)
Citizen.Wait(10000)
end) | 26.833333 | 72 | 0.745342 |
68416f193c2787243c5f294876857c99426016a3 | 24,085 | cpp | C++ | ego_controller/invdyn_controller/src/InvdynController.cpp | NMMI/AlterEgo_Gazebo_Simulator | df80d09972d46ff8f824adc6e27fe0d5770a51c0 | [
"BSD-3-Clause"
] | null | null | null | ego_controller/invdyn_controller/src/InvdynController.cpp | NMMI/AlterEgo_Gazebo_Simulator | df80d09972d46ff8f824adc6e27fe0d5770a51c0 | [
"BSD-3-Clause"
] | null | null | null | ego_controller/invdyn_controller/src/InvdynController.cpp | NMMI/AlterEgo_Gazebo_Simulator | df80d09972d46ff8f824adc6e27fe0d5770a51c0 | [
"BSD-3-Clause"
] | null | null | null | /***
* Software License Agreement: BSD 3-Clause License
*
* Copyright (c) 2021, NMMI
* All rights reserved.
*
* Redistribution and use in source and binary forms, with or without
* modification, are permitted provided that the following conditions are met:
*
* Redistributions of source code must retain the above copyright notice, this
* list of conditions and the following disclaimer.
*
* Redistributions in binary form must reproduce the above copyright notice,
* this list of conditions and the following disclaimer in the documentation
* and/or other materials provided with the distribution.
*
* Neither the name of the copyright holder nor the names of its
* contributors may be used to endorse or promote products derived from
* this software without specific prior written permission.
*
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
* AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
* IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
* DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
* FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
* DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
* SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
* CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
* OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
* OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
*/
// ----------------------------------------------------------------------------
/**
* \file InvdynController.cpp
*
* \author _Centro di Ricerca "E.Piaggio"_
* \author _Istituto Italiano di Tecnologia, Soft Robotics for Human Cooperation and Rehabilitation Lab_
**/
// ----------------------------------------------------------------------------
#include "InvdynController.h"
InvdynController::InvdynController(ros::NodeHandle nh)
{
ROS_INFO("InvdynController");
model = new Model();
std::string path;
if (!nh.getParam("/path", path))
{
ROS_ERROR("Specify the path of model.urdf");
exit(1);
}
const char *path_char = path.c_str();
if (!Addons::URDFReadFromFile(path_char, model, false, false))
{
std::cerr << "Error loading model ./onearm_ego.xacro" << std::endl;
// abort();
}
model->gravity = Vector3d(0., 0., -9.81);
// Initialize all the parameters that describe the robot (number of joints, number of actuators, ... )
joints_n_ = 16;
act_n_ = 12;
bodies_n_ = 13;
constraints_n_ = 3;
quasi_vel_n_ = 13;
// Initialize the desired quasi-velocities vector and its integral and derivative
qb_des_ = Eigen::VectorXd::Zero(quasi_vel_n_);
qb_des_(2) = -0.01313;
qb_dot_des_ = Eigen::VectorXd::Zero(quasi_vel_n_);
qb_ddot_des_ = Eigen::VectorXd::Zero(quasi_vel_n_);
// Initialize dynamics variables and matrices
masses_ = Eigen::VectorXd::Zero(bodies_n_); // Vector of masses
masses_ << 13.3260, 1.22, 1.22, 0.6010, 0.6430, 0.5910, 0.3530, 0.3810, 0.6010, 0.6430, 0.5910, 0.3530, 0.3810;
M_tot_ = 0;
for (int i = 0; i < masses_.size(); i++)
{
M_tot_ = M_tot_ + masses_(i);
}
M_ = Eigen::MatrixXd::Zero(joints_n_, joints_n_); // Inertia matrix M
c_ = Eigen::VectorXd::Zero(joints_n_); // Vector c = C*qd + g
g_ = Eigen::VectorXd::Zero(joints_n_); // Gravity vector
cor_ = Eigen::VectorXd::Zero(joints_n_); // Corilis Vector cor = C*qd
tau_act_ = Eigen::VectorXd::Zero(act_n_);
// Initialize projector into the nullspace of the constraints jacobian and its derivative
S_ = Eigen::MatrixXd::Zero(joints_n_, quasi_vel_n_);
S_dot_ = Eigen::MatrixXd::Zero(joints_n_, quasi_vel_n_);
// Initialize flag for callback
state_acquired_ = 0;
reference_acquired_ = 0;
// Initialize controller sampling time
Ts_ = 0.0025;
// simulated_robot_ == 0 -> real robot
// simulated_robot_ == 1 -> the robot is simulated on RVIZ
if (!nh.getParam("simulated_robot", simulated_robot_))
{
ROS_ERROR("Invdyn controller: Specify simulated parameter");
exit(1);
}
if (!nh.getParam("simulated_on_gazebo", sim_gazebo_))
{
ROS_ERROR("EgoModel: Specify simulated parameter");
exit(1);
}
ROS_INFO_STREAM("sim_gazebo_ == " << sim_gazebo_);
maximum_torque = 68.0;
maximum_torque_gazebo = 11.0;
// define subscribers and publisher
if (simulated_robot_ == 0)
{
// define subscriber for joints state
state_sub_ = nh.subscribe("/ego_model/robot_state", 10, &InvdynController::acquireStateCallback, this);
// publisher for arms torques
wheels_command_pub_ = nh.advertise<ego_msgs::Wheel_Torque>("/ego_model/control", 1);
rarm_model_torque_pub_ = nh.advertise<ego_msgs::Arm_Torque>("/ego_model/ra_control", 1);
larm_model_torque_pub_ = nh.advertise<ego_msgs::Arm_Torque>("/ego_model/la_control", 1);
// publisher for the wheels voltage
wheels_volt_command_pub_ = nh.advertise<geometry_msgs::Vector3>("/qb_class/cube_ref", 1);
// define subscriber for joints references
reference_sub_ = nh.subscribe("/ego_model/references", 10, &InvdynController::acquireReferenceCallback, this);
}
else
{
// define subscriber for joints state
state_sub_ = nh.subscribe("/robot_state", 10, &InvdynController::acquireStateCallback, this);
// publisher for torques
wheels_command_pub_ = nh.advertise<ego_msgs::Wheel_Torque>("/control", 1);
rarm_model_torque_pub_ = nh.advertise<ego_msgs::Arm_Torque>("/ra_control", 1);
larm_model_torque_pub_ = nh.advertise<ego_msgs::Arm_Torque>("/la_control", 1);
left_torque_pub_ = nh.advertise<std_msgs::Float64>("/ego/left_wheel_controller/command", 1);
right_torque_pub_ = nh.advertise<std_msgs::Float64>("/ego/right_wheel_controller/command", 1);
// define subscriber for joints references
reference_sub_ = nh.subscribe("/references", 10, &InvdynController::acquireReferenceCallback, this);
ref_base_sub_ = nh.subscribe("/ref_q_base", 10, &InvdynController::acquireBaseQRefCallback, this);
ref_qd_base_sub_ = nh.subscribe("/ref_qd_base", 10, &InvdynController::acquireBaseQdRefCallback, this);
ref_rarm_pos_sub_ = nh.subscribe("/ref_rarm_q", 10, &InvdynController::acquireRarmQRefCallback, this);
ref_rarm_vel_sub_ = nh.subscribe("/ref_rarm_qd", 10, &InvdynController::acquireRarmQdRefCallback, this);
ref_larm_pos_sub_ = nh.subscribe("/ref_larm_q", 10, &InvdynController::acquireLarmQRefCallback, this);
ref_larm_vel_sub_ = nh.subscribe("/ref_larm_qd", 10, &InvdynController::acquireLarmQdRefCallback, this);
}
// Initialize the gain matrix Kp
Kp_ = Eigen::MatrixXd::Zero(quasi_vel_n_, quasi_vel_n_);
if (!nh.getParam("Kp_linear_", Kp_(0, 0)))
{
ROS_ERROR("Specify linear position gain Kp_linear_");
exit(1);
}
if (!nh.getParam("Kp_yaw_", Kp_(1, 1)))
{
ROS_ERROR("Specify yaw position gain Kp_yaw_");
exit(1);
}
if (!nh.getParam("Kp_pitch_", Kp_(2, 2)))
{
ROS_ERROR("Specify pitch position gain Kp_pitch_");
exit(1);
}
std::string larm_prop_gain_string[5];
for (int i = 0; i < 5; i++)
{
larm_prop_gain_string[i] = std::to_string(i + 1);
if (!nh.getParam("Kp_larm" + larm_prop_gain_string[i] + "_", Kp_(3 + i, 3 + i)))
{
ROS_ERROR("Specify gain for right arm control");
exit(1);
}
}
std::string rarm_prop_gain_string[5];
for (int i = 0; i < 5; i++)
{
rarm_prop_gain_string[i] = std::to_string(i + 1);
if (!nh.getParam("Kp_rarm" + rarm_prop_gain_string[i] + "_", Kp_(8 + i, 8 + i)))
{
ROS_ERROR("Specify gain for right arm control");
exit(1);
}
}
if (!nh.getParam("Kp_larm_pitch_shoulder_", Kp_(3, 2)))
{
ROS_ERROR("Specify gain for left shoulder coupling control");
exit(1);
}
if (!nh.getParam("Kp_rarm_pitch_shoulder_", Kp_(8, 2)))
{
ROS_ERROR("Specify gain for right shoulder coupling control");
exit(1);
}
if (!nh.getParam("Kp_larm_pitch_elbow_", Kp_(6, 2)))
{
ROS_ERROR("Specify gain for left elbow coupling control");
exit(1);
}
if (!nh.getParam("Kp_rarm_pitch_elbow_", Kp_(11, 2)))
{
ROS_ERROR("Specify gain for right elbow coupling control");
exit(1);
}
// Initialize the gain matrix Kd
Kd_ = Eigen::MatrixXd::Zero(quasi_vel_n_, quasi_vel_n_);
if (!nh.getParam("Kd_linear_", Kd_(0, 0)))
{
ROS_ERROR("Specify linear derivative gain Kd_linear_");
exit(1);
}
if (!nh.getParam("Kd_yaw_", Kd_(1, 1)))
{
ROS_ERROR("Specify yaw derivative gain Kd_yaw_");
exit(1);
}
if (!nh.getParam("Kd_pitch_", Kd_(2, 2)))
{
ROS_ERROR("Specify pitch derivative gain Kd_pitch_");
exit(1);
}
std::string larm_der_gain_string[5];
for (int i = 0; i < 5; i++)
{
larm_der_gain_string[i] = std::to_string(i + 1);
if (!nh.getParam("Kd_larm" + larm_der_gain_string[i] + "_", Kd_(3 + i, 3 + i)))
{
ROS_ERROR("Specify gain for right arm control");
exit(1);
}
}
std::string rarm_der_gain_string[5];
for (int i = 0; i < 5; i++)
{
rarm_der_gain_string[i] = std::to_string(i + 1);
if (!nh.getParam("Kd_rarm" + rarm_der_gain_string[i] + "_", Kd_(8 + i, 8 + i)))
{
ROS_ERROR("Specify gain for right arm control");
exit(1);
}
}
if (!nh.getParam("Kd_larm_pitch_shoulder_", Kd_(3, 2)))
{
ROS_ERROR("Specify gain for left shoulder coupling control");
exit(1);
}
if (!nh.getParam("Kd_rarm_pitch_shoulder_", Kd_(8, 2)))
{
ROS_ERROR("Specify gain for right shoulder coupling control");
exit(1);
}
if (!nh.getParam("Kd_larm_pitch_elbow_", Kd_(6, 2)))
{
ROS_ERROR("Specify gain for left elbow coupling control");
exit(1);
}
if (!nh.getParam("Kd_rarm_pitch_elbow_", Kd_(11, 2)))
{
ROS_ERROR("Specify gain for right elbow coupling control");
exit(1);
}
}
InvdynController::~InvdynController()
{
ROS_INFO("InvdynController deleted");
delete model;
}
//------------------------------------------------------------------------------------------
// Callback to update robot state
//------------------------------------------------------------------------------------------
void InvdynController::acquireStateCallback(const sensor_msgs::JointState &msg)
{
sensor_msgs::JointState ego_state_temp; // temporary variable to store joints state
for (int i = 0; i < 17; i++)
{
ego_state_temp.position.push_back(msg.position[i]);
ego_state_temp.velocity.push_back(msg.velocity[i]);
}
ego_state_ = ego_state_temp;
state_acquired_ = 1; // set this flag to 1 to signal that callback has been executed the first time
}
//------------------------------------------------------------------------------------------
// Callback to update the reference of the quasi-velocity and their integral and derivative
//------------------------------------------------------------------------------------------
void InvdynController::acquireReferenceCallback(const sensor_msgs::JointState &msg)
{
reference_acquired_ = 1;
double qb_linear_old = qb_des_(0);
for (int i = 0; i < quasi_vel_n_; i++)
{
qb_des_(i) = msg.position[i];
qb_dot_des_(i) = msg.velocity[i];
qb_ddot_des_(i) = msg.effort[i];
}
qb_des_(0) = qb_linear_old + qb_dot_des_(0) * Ts_;
}
//------------------------------------------------------------------------------------------
// Callback to give by topic the reference to the integral of the quasi-velocities of the
// mobile acquire_base and to the quasi-velocities and their integral of the upper body.
// This option is implemented only for the case of simulated_robot_ == 1.
//------------------------------------------------------------------------------------------
void InvdynController::acquireBaseQRefCallback(const ego_msgs::EgoPose2DUnicycle &msg)
{
double qb_linear_old = qb_des_(0);
double yaw_old = qb_des_(1);
qb_des_(0) = msg.deltaForward + qb_linear_old;
qb_des_(1) = msg.deltaYaw + yaw_old;
}
void InvdynController::acquireBaseQdRefCallback(const ego_msgs::EgoTwist2DUnicycle &msg)
{
reference_acquired_ = 1;
qb_dot_des_(0) = msg.ForwardVelocity;
qb_dot_des_(1) = msg.YawRate;
}
void InvdynController::acquireLarmQRefCallback(const invdyn_controller::Arm_Des_Pos &msg)
{
qb_des_(3) = msg.ArmPosDes_1;
qb_des_(4) = msg.ArmPosDes_2;
qb_des_(5) = msg.ArmPosDes_3;
qb_des_(6) = msg.ArmPosDes_4;
qb_des_(7) = msg.ArmPosDes_5;
// qb_des_(6) = -msg.orientation.x;
}
void InvdynController::acquireRarmQRefCallback(const invdyn_controller::Arm_Des_Pos &msg)
{
qb_des_(8) = msg.ArmPosDes_1;
qb_des_(9) = msg.ArmPosDes_2;
qb_des_(10) = msg.ArmPosDes_3;
qb_des_(11) = msg.ArmPosDes_4;
qb_des_(12) = msg.ArmPosDes_5;
// qb_des_(10) = -msg.position.z;
// qb_des_(11) = -msg.orientation.x;
// qb_des_(12) = -msg.orientation.y;
}
void InvdynController::acquireLarmQdRefCallback(const invdyn_controller::Arm_Des_Vel &msg)
{
qb_dot_des_(3) = msg.ArmVelDes_1;
qb_dot_des_(4) = msg.ArmVelDes_2;
qb_dot_des_(5) = msg.ArmVelDes_3;
qb_dot_des_(6) = msg.ArmVelDes_4;
qb_dot_des_(7) = msg.ArmVelDes_5;
}
void InvdynController::acquireRarmQdRefCallback(const invdyn_controller::Arm_Des_Vel &msg)
{
qb_dot_des_(8) = msg.ArmVelDes_1;
qb_dot_des_(9) = msg.ArmVelDes_2;
qb_dot_des_(10) = msg.ArmVelDes_3;
qb_dot_des_(11) = msg.ArmVelDes_4;
qb_dot_des_(12) = msg.ArmVelDes_5;
}
//------------------------------------------------------------------------------------------
// Sign function
//------------------------------------------------------------------------------------------
double InvdynController::sign(double x)
{
double sign;
if (x >= 0)
{
sign = 1;
}
else
{
sign = -1;
}
return sign;
}
//-------------------------------------------------------------------------------------------
// Function to saturate motor voltage between -100 and 100
//-------------------------------------------------------------------------------------------
Eigen::VectorXd InvdynController::saturateMotorVoltage(Eigen::VectorXd voltage)
{
Eigen::VectorXd voltage_sat = Eigen::VectorXd::Zero(voltage.size());
for (int i = 0; i < voltage.size(); i++)
{
if (voltage(i) > 100)
voltage_sat(i) = 100;
else if (voltage(i) < -100)
voltage_sat(i) = -100;
else
voltage_sat = voltage;
}
return voltage_sat;
}
//-------------------------------------------------------------------------------------------
// Function to sent the torques of the mobile base
//-------------------------------------------------------------------------------------------
void InvdynController::publishMbTorques()
{
Eigen::VectorXd tau_wheels = Eigen::VectorXd::Zero(2);
Eigen::VectorXd tau_sent = Eigen::VectorXd::Zero(2);
Eigen::VectorXd vel_wheels = Eigen::VectorXd::Zero(2);
Eigen::VectorXd voltage = Eigen::VectorXd::Zero(2); // define motors voltage
Eigen::VectorXd voltage_sat = Eigen::VectorXd::Zero(2);
double sign_rw, sign_lw;
tau_wheels(0) = tau_act_(0);
tau_wheels(1) = tau_act_(1);
ego_msgs::Wheel_Torque msg;
for (int i = 0; i < 2; i++)
{
if (tau_wheels(i) > maximum_torque)
tau_wheels(i) = maximum_torque;
else if (tau_wheels(i) < -maximum_torque)
tau_wheels(i) = -maximum_torque;
}
// ROS_INFO_STREAM("Right torque (saturated): " << tau_wheels(1) << " (Nm)");
msg.left_wheel_torque = tau_wheels(0);
msg.right_wheel_torque = tau_wheels(1);
wheels_command_pub_.publish(msg);
}
void InvdynController::publishMbVoltage()
{
Eigen::VectorXd tau_sent = Eigen::VectorXd::Zero(2);
Eigen::VectorXd vel_wheels = Eigen::VectorXd::Zero(2);
Eigen::VectorXd voltage = Eigen::VectorXd::Zero(2); // define motors voltage
Eigen::VectorXd voltage_sat = Eigen::VectorXd::Zero(2);
double sign_rw, sign_lw;
tau_sent(0) = tau_act_(0);
tau_sent(1) = tau_act_(1);
vel_wheels(0) = ego_state_.velocity[4];
vel_wheels(1) = ego_state_.velocity[5];
voltage = (Rm / Kt * tau_sent) * 100 / (n * 24);
;
sign_lw = sign(voltage(0));
sign_rw = sign(voltage(1));
voltage(0) = voltage(0) + 20 * sign_lw;
voltage(1) = voltage(1) + 20 * sign_rw;
voltage_sat = saturateMotorVoltage(voltage);
if (simulated_robot_ == 0)
{
comm_pub_.x = (voltage_sat(1));
comm_pub_.y = (voltage_sat(0));
wheels_volt_command_pub_.publish(comm_pub_);
}
else
{
tau_sent = (n * 0.24) * Kt / Rm * (voltage_sat)*10.8 / 68.6;
for (int i = 0; i < 2; i++)
{
if (tau_sent(i) > maximum_torque_gazebo)
tau_sent(i) = maximum_torque_gazebo;
else if (tau_sent(i) < -maximum_torque_gazebo)
tau_sent(i) = -maximum_torque_gazebo;
}
std_msgs::Float64 msg_lw;
msg_lw.data = tau_sent(0);
left_torque_pub_.publish(msg_lw);
std_msgs::Float64 msg_rw;
msg_rw.data = tau_sent(1);
right_torque_pub_.publish(msg_rw);
ROS_INFO_STREAM("Left torque (saturated): " << tau_sent(0) << " (Nm) Right torque (saturated) " << tau_sent(1) << " (Nm) ");
}
}
//-------------------------------------------------------------------------------------------
// Function to sent the torques of the upper body
//-------------------------------------------------------------------------------------------
void InvdynController::publishUbTorques()
{
ego_msgs::Arm_Torque rarm_msg; // define message for right arm torques
ego_msgs::Arm_Torque larm_msg; // define message for left arm torques
larm_msg.ArmTau_1 = tau_act_(2);
larm_msg.ArmTau_2 = tau_act_(3);
larm_msg.ArmTau_3 = tau_act_(4);
larm_msg.ArmTau_4 = tau_act_(5);
larm_msg.ArmTau_5 = tau_act_(6);
rarm_msg.ArmTau_1 = tau_act_(7);
rarm_msg.ArmTau_2 = tau_act_(8);
rarm_msg.ArmTau_3 = tau_act_(9);
rarm_msg.ArmTau_4 = tau_act_(10);
rarm_msg.ArmTau_5 = tau_act_(11);
rarm_model_torque_pub_.publish(rarm_msg);
larm_model_torque_pub_.publish(larm_msg);
}
//-------------------------------------------------------------------------------------------
// compute dynamic matrixes which appears in the robot motion equations:
// M(q)ddot(q) + c = tau
// c = cor + g ---> c is the sum of coriolis and centrifugal terms and gravity vector
//-------------------------------------------------------------------------------------------
void InvdynController::computeDynamicMatrices()
{
VectorNd Q = VectorNd::Zero(model->q_size);
VectorNd QDot = VectorNd::Zero(model->qdot_size);
VectorNd QDDot = VectorNd::Zero(model->qdot_size);
VectorNd C = VectorNd::Zero(model->qdot_size);
MatrixNd M = MatrixNd::Zero(model->q_size, model->q_size);
for (int i = 0; i < joints_n_; i++)
{
Q(i) = ego_state_.position[i];
QDot(i) = ego_state_.velocity[i];
QDDot(i) = 0;
}
CompositeRigidBodyAlgorithm(*model, Q, M);
M_ = M;
// std::cout << "Inertia matrix:" << std::endl;
// std::cout << M << std::endl;
NonlinearEffects(*model, Q, QDot, C);
c_ = C;
QDot = VectorNd::Zero(model->qdot_size);
NonlinearEffects(*model, Q, QDot, C);
g_ = C;
// std::cout << "Gravity vector:" << std::endl;
// std::cout << g_ << std::endl;
cor_ = c_ - g_;
// std::cout << "Coriolis vector:" << std::endl;
// std::cout << cor_ << std::endl;
}
//---------------------------------------------------------------------------
// Compute the matrix S such that Jc_*S = 0
//---------------------------------------------------------------------------
void InvdynController::computeNullSpaceProjector()
{
double a = W / 2; // semilength of the axle
double theta = ego_state_.position[2];
S_(0, 0) = cos(theta);
S_(1, 0) = sin(theta);
S_(2, 1) = 1;
S_(3, 2) = 1;
S_(4, 0) = 1 / Rw;
S_(4, 1) = -a / Rw;
S_(4, 2) = -1;
S_(5, 0) = 1 / Rw;
S_(5, 1) = a / Rw;
S_(5, 2) = -1;
S_.block<10, 10>(6, 3) << Eigen::MatrixXd::Identity(10, 10);
}
//---------------------------------------------------------------------------
// Compute the derivative of the matrix S (S_dot_)
//---------------------------------------------------------------------------
void InvdynController::computeNullSpaceProjectorDerivate()
{
double theta = ego_state_.position[2];
double theta_dot = ego_state_.velocity[2];
S_dot_(0, 0) = -sin(theta) * theta_dot;
S_dot_(1, 0) = cos(theta) * theta_dot;
}
//----------------------------------------------------------------------------
// compute joint torques according to an inverse dynamics method
// M_tilde = S'*M*S
// c_tilde = S'*(c+g)
// U_tilde = S'*U
// solve in tau: c_tilde + M_tilde*(qb_ddot_des + Kd*(qb_dot_des - qb_dot) +
// + Kp*(qb_des - qb)) = U_tilde*tau
// where qb_dot = quasi-velocities, qb = quasi-velocities integrals
//----------------------------------------------------------------------------
void InvdynController::computeJointsTorques()
{
Eigen::MatrixXd M_tilde = Eigen::MatrixXd::Identity(quasi_vel_n_, quasi_vel_n_);
Eigen::VectorXd c_tilde = Eigen::VectorXd::Zero(quasi_vel_n_);
Eigen::MatrixXd U_tilde = Eigen::MatrixXd::Zero(quasi_vel_n_, act_n_);
Eigen::MatrixXd S_transposed = Eigen::MatrixXd::Identity(quasi_vel_n_, joints_n_);
Eigen::MatrixXd U = Eigen::MatrixXd::Zero(joints_n_, act_n_);
Eigen::VectorXd q = Eigen::VectorXd::Zero(joints_n_);
Eigen::VectorXd qd = Eigen::VectorXd::Zero(joints_n_);
Eigen::VectorXd qb = Eigen::VectorXd::Zero(quasi_vel_n_); // integral of quasi-velocities vector
Eigen::VectorXd qb_dot = Eigen::VectorXd::Zero(quasi_vel_n_); // quasi-velocities vector
Eigen::VectorXd tau_tilde = Eigen::VectorXd::Zero(quasi_vel_n_); // torque to control the quasi-velocities
Eigen::VectorXd tau_tilde_reduced = Eigen::VectorXd::Zero(act_n_); // tau_tilde without the one element to control the forward velocity
// update joints angles and velocities
for (int i = 0; i < joints_n_; i++)
{
q[i] = ego_state_.position[i];
qd[i] = ego_state_.velocity[i];
}
// update quasi velocities and their integrals
qb(0) = ego_state_.position[16]; // linear dispacement
qb_dot(0) = ego_state_.velocity[16];
qb(1) = q(2); // yaw angle
qb_dot(1) = qd(2);
qb(2) = q(3); // pitch angle
qb_dot(2) = qd(3);
for (int i = 0; i < 10; i++) // upper body
{
qb(3 + i) = q(6 + i);
qb_dot(3 + i) = qd(6 + i);
}
if (reference_acquired_ == 1)
{
double qb_linear_old = qb_des_(0);
double yaw_old = qb_des_(1);
qb_des_(0) = qb_linear_old + Ts_ * qb_dot_des_(0);
qb_des_(1) = yaw_old + Ts_ * qb_dot_des_(1);
}
S_transposed = S_.transpose();
U.block<12, 12>(4, 0) << Eigen::MatrixXd::Identity(act_n_, act_n_);
M_tilde = S_transposed * M_ * S_;
c_tilde = S_transposed * (c_ + M_ * S_dot_ * qb_dot);
U_tilde = S_transposed * U;
tau_tilde = M_tilde * (qb_ddot_des_ + Kp_ * (qb_des_ - qb) + Kd_ * (qb_dot_des_ - qb_dot)) + c_tilde;
// ROS_INFO_STREAM("Pitch angle: " << qb(2) << " (rad)" << " " << qb(2)*RAD2DEG << " (deg)");
// ROS_INFO_STREAM("Pitch rate: " << qb_dot(2) << " (rad/s)");
// ROS_INFO_STREAM("Des_linear_disp " << qb_des_(0) << " m" );
// compute the torque of the actuators
for (int i = 0; i < act_n_; i++)
{
tau_tilde_reduced(i) = tau_tilde(1 + i);
}
Eigen::MatrixXd U_tilde_reduced = Eigen::MatrixXd::Zero(act_n_, act_n_);
U_tilde_reduced << U_tilde.block<12, 12>(1, 0);
tau_act_ = U_tilde_reduced.inverse() * tau_tilde_reduced;
// ROS_INFO_STREAM("Left torque: " << tau_act_(0) << " (Nm)");
// ROS_INFO_STREAM("Right torque: " << tau_act_(1) << " (Nm)");
}
//-----------------------------------------------------------------------------
// main control routine
//-----------------------------------------------------------------------------
void InvdynController::control()
{
computeDynamicMatrices();
computeNullSpaceProjector();
computeNullSpaceProjectorDerivate();
computeJointsTorques();
publishMbTorques();
publishUbTorques();
if (simulated_robot_ == 0 || sim_gazebo_ == 1)
{
publishMbVoltage();
}
}
| 30.957584 | 137 | 0.613494 |
4b1a97ed920e59ce6a4ed32daae785426b915618 | 3,847 | html | HTML | public/index.html | gbmillz/jolloficons | decd4915bc22bb3fdd88b97ad042953fb3a4911d | [
"MIT"
] | 30 | 2018-12-31T09:20:25.000Z | 2021-06-24T15:36:51.000Z | public/index.html | gbmillz/jolloficons | decd4915bc22bb3fdd88b97ad042953fb3a4911d | [
"MIT"
] | null | null | null | public/index.html | gbmillz/jolloficons | decd4915bc22bb3fdd88b97ad042953fb3a4911d | [
"MIT"
] | 1 | 2021-05-02T20:58:18.000Z | 2021-05-02T20:58:18.000Z | <!DOCTYPE html>
<html lang="en" xmlns:og=”http://opengraphprotocol.org/schema/” xmlns:fb=”http://ogp.me/ns/fb#” xmlns:og=”http://opengraphprotocol.org/schema/”>
<head>
<!-- Global site tag (gtag.js) - Google Analytics -->
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-30061423-2"></script>
<script>
window.dataLayer = window.dataLayer || [];
function gtag(){dataLayer.push(arguments);}
gtag('js', new Date());
gtag('config', 'UA-30061423-2');
</script>
<!-- Google Tag Manager -->
<script>(function(w,d,s,l,i){w[l]=w[l]||[];w[l].push({'gtm.start':
new Date().getTime(),event:'gtm.js'});var f=d.getElementsByTagName(s)[0],
j=d.createElement(s),dl=l!='dataLayer'?'&l='+l:'';j.async=true;j.src=
'https://www.googletagmanager.com/gtm.js?id='+i+dl;f.parentNode.insertBefore(j,f);
})(window,document,'script','dataLayer','GTM-5F9NNT3');</script>
<!-- End Google Tag Manager -->
<!-- Google Tag Manager (noscript) -->
<noscript><iframe src="https://www.googletagmanager.com/ns.html?id=GTM-5F9NNT3"
height="0" width="0" style="display:none;visibility:hidden"></iframe></noscript>
<!-- End Google Tag Manager (noscript) -->
<!-- Place this tag in your head or just before your close body tag. -->
<script async defer src="https://buttons.github.io/buttons.js"></script>
<meta charset="utf-8">
<meta http-equiv="X-UA-Compatible" content="IE=edge">
<meta name="viewport" content="width=device-width,initial-scale=1.0">
<link rel="icon" href="<%= BASE_URL %>favicon.ico">
<link type="text/css" rel="stylesheet" href="//unpkg.com/bootstrap/dist/css/bootstrap.min.css"/>
<link type="text/css" rel="stylesheet" href="//unpkg.com/bootstrap-vue@latest/dist/bootstrap-vue.css"/>
<title>Jollof Icons</title>
<meta name="description" content="Open Source 3D, Abstract, Isometric icons and Emojis for your projects. Free jollof icons, illustrations.">
<meta name="robots" content="index, follow"/>
<meta property="og:type" content="website" />
<meta property="og:title" content="Free 3D Icons, Illustrations and Emojis">
<meta property="og:image" content="https://jolloficons.com/icons/share.png" />
<meta name="twitter:card" content="summary" />
<meta name="twitter:title" content="Jollof Icons | Free 3D Icons, Illustrations and Emojis" />
<meta name="twitter:description" content="Open Source 3D, Isometric, Abstract icons and Emojis for your projects." />
<meta name="twitter:image" content="https://jolloficons.com/icons/share.png" />
<meta name="twitter:url" content="https://jolloficons.com" />
<meta name=”twitter:site” content=”@jolloficons“>
<meta name=”twitter:creator” content=”@jolloficons“>
</head>
<body>
<noscript>
<strong>We're sorry but jolloficons doesn't work properly without JavaScript enabled. Please enable it to continue.</strong>
</noscript>
<div id="app"></div>
<!-- built files will be auto injected -->
<script
src="https://code.jquery.com/jquery-3.3.1.js"
integrity="sha256-2Kok7MbOyxpgUVvAk/HJ2jigOSYS2auK4Pfzbm7uH60="
crossorigin="anonymous"></script>
<script src="https://cdnjs.cloudflare.com/ajax/libs/popper.js/1.14.3/umd/popper.min.js" integrity="sha384-ZMP7rVo3mIykV+2+9J3UJ46jBk0WLaUAdn689aCwoqbBJiSnjAK/l8WvCWPIPm49" crossorigin="anonymous"></script>
<script src="https://stackpath.bootstrapcdn.com/bootstrap/4.1.3/js/bootstrap.min.js" integrity="sha384-ChfqqxuZUCnJSK3+MXmPNIyE6ZbWh2IMqE241rYiqJxyMiZ6OW/JmZQ5stwEULTy" crossorigin="anonymous"></script>
<script src="//unpkg.com/bootstrap-vue@latest/dist/bootstrap-vue.js"></script>
<script type="text/javascript">
$(function () {
$('[data-toggle="tooltip"]').tooltip();
});
</script>
</body>
</html>
| 51.293333 | 205 | 0.677671 |
4aa0f4c0e2fe4ce62189c796e48f68ed2303422e | 1,265 | htm | HTML | 1x/a9w3-auhome/trydofor/helpers/status/stat/article/date/2009/03/17-log.htm | trydofor/trydofor.github.com | e961e62767041ec34783436f98d63b0db8c60fc0 | [
"MIT"
] | null | null | null | 1x/a9w3-auhome/trydofor/helpers/status/stat/article/date/2009/03/17-log.htm | trydofor/trydofor.github.com | e961e62767041ec34783436f98d63b0db8c60fc0 | [
"MIT"
] | null | null | null | 1x/a9w3-auhome/trydofor/helpers/status/stat/article/date/2009/03/17-log.htm | trydofor/trydofor.github.com | e961e62767041ec34783436f98d63b0db8c60fc0 | [
"MIT"
] | null | null | null | 2009/0204145037|20090317003019|219.132.136.21
2009/0310140935|20090317003131|219.132.136.21
2008/1231092837|20090317003147|219.132.136.21
2009/0204145037|20090317003418|219.132.136.21
2008/1231092837|20090317004044|61.178.18.147
2008/1231092837|20090317004055|61.178.18.147
2009/0310140935|20090317090102|222.66.175.239
2009/0313170649|20090317091235|121.0.29.226
2009/0204145037|20090317091807|61.153.7.71
2009/0223211340|20090317091812|61.153.7.71
2009/0204145037|20090317102544|222.79.40.98
2009/0313170649|20090317172250|123.127.75.18
2009/0313170649|20090317172250|123.127.75.18
2009/0310140935|20090317175808|124.207.205.1
2009/0204145037|20090317180447|124.207.205.1
2009/0202134941|20090317180756|124.207.205.1
2008/1207034957|20090317180855|124.207.205.1
2008/1203100210|20090317180916|124.207.205.1
2009/0113075318|20090317191602|116.230.219.153
2009/0204145037|20090317191746|116.230.219.153
2009/0313170649|20090317194516|58.31.12.244
2009/0310140935|20090317194709|58.31.12.244
2008/1214074100|20090317195354|58.31.12.244
2009/0310140935|20090317202356|125.34.139.147
2009/0302204557|20090317202407|125.34.139.147
2009/0113135859|20090317203530|125.34.139.147
2009/0113032859|20090317221728|221.137.181.43
2009/0223211340|20090317221835|221.137.181.43
| 43.62069 | 46 | 0.845059 |
689f65d9fcb6d39b3e35bb23c5afaa955d7efb6a | 311 | sql | SQL | pg/m6/s7.sql | egalli64/hron | 696177f660afe1b9905768a25235069d0f4c26ce | [
"MIT"
] | null | null | null | pg/m6/s7.sql | egalli64/hron | 696177f660afe1b9905768a25235069d0f4c26ce | [
"MIT"
] | null | null | null | pg/m6/s7.sql | egalli64/hron | 696177f660afe1b9905768a25235069d0f4c26ce | [
"MIT"
] | null | null | null | -- example on view
-- check existing table
select *
from exec;
-- create view
create or replace view junior_exec_view as
select exec_id, first_name, last_name, hired from exec
where exec_id != 100;
-- check the derived view
select *
from junior_exec_view;
-- get rid of a view
drop view junior_exec_view;
| 17.277778 | 55 | 0.752412 |
9a3a64622f2820103aff51e17b3d00c112be5acc | 2,139 | lua | Lua | core.lua | prodhe/duty | 2506bc88acdacf5b639c17fa0760b9f0228b9649 | [
"MIT"
] | null | null | null | core.lua | prodhe/duty | 2506bc88acdacf5b639c17fa0760b9f0228b9649 | [
"MIT"
] | null | null | null | core.lua | prodhe/duty | 2506bc88acdacf5b639c17fa0760b9f0228b9649 | [
"MIT"
] | null | null | null | -- Load and set namespace
local _, core = ...
-- Stored default options.
core.options = {}
core.data = {}
core.options.debug = false -- print debug statements
core.options.dutyOpacity = 1
core.options.dutyShowFrame = true
core.data.assignList = {}
-- LoadDB tries to load the SavedVariables
function core:LoadDB()
if _G["DUTYDB"] == nil then
_G["DUTYDB"] = {
options = core.options,
data = core.data
}
core:Debug("Core: LoadDB: defaults")
else
-- Check if options are nil or not and then link it to core.options
if _G["DUTYDB"].options then
core.options = _G["DUTYDB"].options
else
_G["DUTYDB"].options = core.options
end
core.data = _G["DUTYDB"].data
core:Debug("Core: LoadDB: user")
end
end
function core:RestoreDefaults()
_G["DUTYDB"].options = nil
core:Print("Restored defaults.")
ReloadUI()
end
-- Print is a prefixed print function
function core:Print(...)
print("|cff" .. "f59c0a" .. "Duty:|r", ...)
end
-- Debug is a prefixed print function, which only prints if debug is activated
function core:Debug(...)
if core.options.debug then
print("|cff" .. "f59c0a" .. "DEBUG:|r", ...)
end
end
function core:ToggleDebug()
if core.options.debug then
core.options.debug = false
core:Print("Debugging off.")
else
core.options.debug = true
core:Print("Debugging on.")
end
end
-- RegisterEvents sets events for the obj using the handlerFunc
function core:RegisterEvents(obj, handlerFunc, ...)
core:Debug("Core: RegisterEvents:", tostringall(...))
for i = 1, select("#", ...) do
local ev = select(i, ...)
obj:RegisterEvent(ev)
end
obj:SetScript("OnEvent", handlerFunc)
end
-- A better remove from list than table.remove
function core:ArrayRemove(t, fnKeep)
local j, n = 1, #t;
for i=1,n do
if (fnKeep(t, i, j)) then
-- Move i's kept value to j's position, if it's not already there.
if (i ~= j) then
t[j] = t[i];
t[i] = nil;
end
j = j + 1; -- Increment position of where we'll place the next kept value.
else
t[i] = nil;
end
end
return t;
end | 24.306818 | 86 | 0.636746 |
b344d0abb019e6bf6d3eb80abb072c832c403e47 | 25 | rb | Ruby | app/helpers/movies_helper.rb | TheDreamingTree145/Movie-Project | ad93184931a96505d194b7cebac3681387516888 | [
"MIT"
] | null | null | null | app/helpers/movies_helper.rb | TheDreamingTree145/Movie-Project | ad93184931a96505d194b7cebac3681387516888 | [
"MIT"
] | 7 | 2020-03-04T21:18:23.000Z | 2022-03-31T00:44:33.000Z | app/helpers/movies_helper.rb | mikeisfake/filmr | 49e2e51acbe5482274af98146e4ccd38a4c75b0d | [
"MIT"
] | null | null | null | module MoviesHelper
end
| 6.25 | 19 | 0.84 |
26b6e13f90c6cab3775f5c682ebbe42241ea7a60 | 408 | java | Java | LACCPlus/Hadoop/3070_2.java | sgholamian/log-aware-clone-detection | 9993cb081c420413c231d1807bfff342c39aa69a | [
"MIT"
] | null | null | null | LACCPlus/Hadoop/3070_2.java | sgholamian/log-aware-clone-detection | 9993cb081c420413c231d1807bfff342c39aa69a | [
"MIT"
] | null | null | null | LACCPlus/Hadoop/3070_2.java | sgholamian/log-aware-clone-detection | 9993cb081c420413c231d1807bfff342c39aa69a | [
"MIT"
] | null | null | null | //,temp,DiskBalancerCLI.java,169,181,temp,JournalNode.java,412,420
//,3
public class xxx {
public static void main(String[] args) throws Exception {
StringUtils.startupShutdownMessage(JournalNode.class, args, LOG);
try {
System.exit(ToolRunner.run(new JournalNode(), args));
} catch (Throwable e) {
LOG.error("Failed to start journalnode.", e);
terminate(-1, e);
}
}
}; | 29.142857 | 69 | 0.669118 |
0801c0628d63f660b1aa604c31ccc21185747f54 | 10,431 | dart | Dart | lib/services/sms_filter/check_sms_type.dart | sgatibaru/Mpesa-Ledger-Flutter | 97529bf16a598094151fb5f3775ac9120703e7e9 | [
"MIT"
] | 2 | 2022-02-21T15:55:31.000Z | 2022-02-24T11:29:11.000Z | lib/services/sms_filter/check_sms_type.dart | sgatibaru/Mpesa-Ledger-Flutter | 97529bf16a598094151fb5f3775ac9120703e7e9 | [
"MIT"
] | null | null | null | lib/services/sms_filter/check_sms_type.dart | sgatibaru/Mpesa-Ledger-Flutter | 97529bf16a598094151fb5f3775ac9120703e7e9 | [
"MIT"
] | 1 | 2020-09-30T11:27:46.000Z | 2020-09-30T11:27:46.000Z | import 'package:jiffy/jiffy.dart';
import 'package:mpesa_ledger_flutter/utils/constants/regex_constants.dart'
as regexString;
import 'package:mpesa_ledger_flutter/utils/regex/regex.dart';
import 'package:mpesa_ledger_flutter/utils/string_utils/recase.dart';
import 'package:mpesa_ledger_flutter/utils/string_utils/replace.dart';
class CheckSMSType {
var replace = ReplaceUtil();
String body;
String timestamp;
CheckSMSType(this.body, this.timestamp);
bool isRegexTrue(String expression) {
return RegexUtil(expression, body).hasMatch;
}
bool checkRegexHasMatch(String expression) {
return RegexUtil(expression, body).hasMatch;
}
String getRegexFirstMatch(String expression) {
return RegexUtil(expression, body).getFirstMatch;
}
List<String> getRegexAllMatches(String expression, String input) {
return RegexUtil(expression, input).getAllMatchResults;
}
Map<String, dynamic> checkTypeOfSMS() {
Map<String, dynamic> result;
if (isRegexTrue(regexString.buyAirtimeForMyself)) {
result = buyAirtimeForMyself();
} else if (isRegexTrue(regexString.buyAirtimeForSomeone)) {
result = buyAirtimeForSomeone();
} else if (isRegexTrue(regexString.depositToAgent)) {
result = depositToAgent();
} else if (isRegexTrue(regexString.withdrawFromAgent)) {
result = withdrawFromAgent();
} else if (isRegexTrue(regexString.sendToPerson)) {
result = sendToPerson();
} else if (isRegexTrue(regexString.receiveFromPerson)) {
result = receiveFromPerson();
} else if (isRegexTrue(regexString.sendToPaybill)) {
result = sendToPaybill();
} else if (isRegexTrue(regexString.receiveFromPaybill)) {
result = receiveFromPaybill();
} else if (isRegexTrue(regexString.sendToBuyGoods)) {
result = sendToBuyGoods();
} else if (isRegexTrue(regexString.reversalToAccount)) {
result = reversalToAccount();
} else if (isRegexTrue(regexString.reversalFromAccount)) {
result = reversalFromAccount();
} else if (isRegexTrue(regexString.transferToMshwari)) {
result = transferToMshwari();
} else if (isRegexTrue(regexString.transferFromMshwari)) {
result = transferFromMshwari();
} else if (isRegexTrue(regexString.transferToKCBMpesa)) {
result = transferToKCBMpesa();
} else if (isRegexTrue(regexString.transferFromKCBMpesa)) {
result = transferFromKCBMpesa();
} else {
result = {
"unknown": "Unknown Transaction",
};
}
return result;
}
Future<Map<String, dynamic>> getCoreValues() async {
// Triggers if SMS message is not of importance
if (!(checkRegexHasMatch(regexString.mpesaBalance) ||
checkRegexHasMatch(regexString.transactionCost) ||
checkRegexHasMatch(regexString.transactionId))) {
return {"error": "Not an important SMS message"};
}
if (checkRegexHasMatch("Failed")) {
return {"error": "A failed MPESA message"};
}
String stringTime(String time) {
return time
.toUpperCase()
.replaceAll(" ", "")
.replaceAll("AM", " AM")
.replaceAll("PM", " PM");
}
double mpesaBalance = checkRegexHasMatch(regexString.mpesaBalance)
? double.parse(
replace.replaceString(
getRegexFirstMatch(regexString.mpesaBalance),
",",
"",
),
)
: null;
double transactionCost = checkRegexHasMatch(regexString.transactionCost)
? double.parse(
replace.replaceString(
getRegexFirstMatch(regexString.transactionCost),
",",
"",
),
)
: 0.00;
Jiffy jiffy;
if (checkRegexHasMatch(regexString.date) &&
checkRegexHasMatch(regexString.time)) {
String d = getRegexFirstMatch(regexString.date);
String t = stringTime(getRegexFirstMatch(regexString.time));
jiffy = Jiffy("$t $d", "hh:mm a dd/MM/yy")..add(years: 2000);
} else {
jiffy = Jiffy.unix(int.parse(timestamp));
}
String transactionId = checkRegexHasMatch(regexString.transactionId)
? getRegexFirstMatch(regexString.transactionId)
: null;
return {
"data": {
"mpesaBalance": mpesaBalance,
"jiffy": jiffy,
"transactionCost": transactionCost,
"transactionId": transactionId
},
};
}
Map<String, dynamic> buyAirtimeForMyself() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.buyAirtimeForMyself),
",",
"",
));
return {
"amount": amount,
"title": "Airtime",
"body": body + "{airtime_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> buyAirtimeForSomeone() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.buyAirtimeForSomeone),
",",
"",
));
return {
"amount": amount,
"title": "Airtime",
"body": body + "{airtime_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> sendToPerson() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.sendToPerson),
",",
"",
));
String title = RecaseUtil(replace
.replaceString(
getRegexFirstMatch(regexString.sendToPersonName),
"0",
"",
)
.trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{people_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> receiveFromPerson() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.receiveFromPerson),
",",
"",
));
String title = RecaseUtil(replace
.replaceString(
getRegexFirstMatch(regexString.receiveFromPersonName),
"0",
"",
)
.trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{people_transaction}",
"isDeposit": 1,
};
}
Map<String, dynamic> sendToPaybill() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.sendToPaybill),
",",
"",
));
String title = RecaseUtil(
getRegexFirstMatch(regexString.sendToPaybillBusinessName).trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{paybill_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> receiveFromPaybill() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.receiveFromPaybill),
",",
"",
));
String title = RecaseUtil(
getRegexFirstMatch(regexString.receiveFromPaybillBusinessName)
.trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{paybill_transaction}",
"isDeposit": 1,
};
}
Map<String, dynamic> sendToBuyGoods() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.sendToBuyGoods),
",",
"",
));
String title = RecaseUtil(
getRegexFirstMatch(regexString.sendToBuyGoodsBusinessName).trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{buy_goods_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> depositToAgent() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.depositToAgent),
",",
"",
));
String title = RecaseUtil(
getRegexFirstMatch(regexString.depositToAgentBusinessName).trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{agent_transaction}",
"isDeposit": 1,
};
}
Map<String, dynamic> withdrawFromAgent() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.withdrawFromAgent),
",",
"",
));
String title = RecaseUtil(
getRegexFirstMatch(regexString.withdrawFromAgentBusinessName)
.trim())
.title_case;
return {
"amount": amount,
"title": title,
"body": body + "{agent_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> reversalToAccount() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.reversalToAccount),
",",
"",
));
return {
"amount": amount,
"title": "Reversal",
"body": body + "{reversal_transaction}",
"isDeposit": 1,
};
}
Map<String, dynamic> reversalFromAccount() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.reversalFromAccount),
",",
"",
));
return {
"amount": amount,
"title": "Reversal",
"body": body + "{reversal_transaction}",
"isDeposit": 0,
};
}
Map<String, dynamic> transferToMshwari() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.transferToMshwari),
",",
"",
));
return {
"amount": amount,
"title": "M-Shwari",
"body": body,
"isDeposit": 0,
};
}
Map<String, dynamic> transferFromMshwari() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.transferFromMshwari),
",",
"",
));
return {
"amount": amount,
"title": "M-Shwari",
"body": body,
"isDeposit": 1,
};
}
Map<String, dynamic> transferToKCBMpesa() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.transferToKCBMpesa),
",",
"",
));
return {
"amount": amount,
"title": "KCB M-PESA",
"body": body + "{kcb_mpesa}",
"isDeposit": 0,
};
}
Map<String, dynamic> transferFromKCBMpesa() {
double amount = double.parse(replace.replaceString(
getRegexFirstMatch(regexString.transferFromKCBMpesa),
",",
"",
));
return {
"amount": amount,
"title": "KCB M-PESA",
"body": body + "{kcb_mpesa}",
"isDeposit": 1,
};
}
}
| 27.668435 | 78 | 0.608475 |
47d9c3574f50541d65b777f77d5f5f1c17628c33 | 2,486 | cc | C++ | fast_k_means_2020/tree_embedding.cc | shaun95/google-research | d41bbaca1eb9bfd980ec2b3fd201c3ddb4d1f2e5 | [
"Apache-2.0"
] | 1 | 2022-03-13T21:48:52.000Z | 2022-03-13T21:48:52.000Z | fast_k_means_2020/tree_embedding.cc | shaun95/google-research | d41bbaca1eb9bfd980ec2b3fd201c3ddb4d1f2e5 | [
"Apache-2.0"
] | null | null | null | fast_k_means_2020/tree_embedding.cc | shaun95/google-research | d41bbaca1eb9bfd980ec2b3fd201c3ddb4d1f2e5 | [
"Apache-2.0"
] | 1 | 2022-03-30T07:20:29.000Z | 2022-03-30T07:20:29.000Z | // Copyright 2022 The Google Research Authors.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
#include "tree_embedding.h"
#include <iostream>
namespace fast_k_means {
void TreeEmbedding::BuildTree(const vector<vector<int> >& input_points) {
id_space.push_back(map<int, vector<int> >());
space_id.push_back(map<vector<int>, int>());
// Constructing the first layer of the tree.
for (int i = 0; i < input_points.size(); i++) {
if (space_id[height].find(input_points[i]) == space_id[height].end()) {
id_space[height][first_unused_id] = input_points[i];
space_id[height][input_points[i]] = first_unused_id++;
number_points.push_back(0);
children.push_back(vector<int>(0));
points_in_node.push_back(vector<int>(0));
}
number_points[space_id[height][input_points[i]]]++;
points_in_node[space_id[height][input_points[i]]].push_back(i);
}
// If the size is one, then we have reached the root and construction is done.
while (space_id[height].size() > 1) {
id_space.push_back(map<int, vector<int> >());
space_id.push_back(map<vector<int>, int>());
for (const auto& e : space_id[height]) {
vector<int> e_space = e.first;
int e_int = e.second;
for (int i = 0; i < e_space.size(); i++) e_space[i] /= 2;
if (space_id[height + 1].find(e_space) == space_id[height + 1].end()) {
id_space[height + 1][first_unused_id] = e_space;
space_id[height + 1][e_space] = first_unused_id++;
number_points.push_back(0);
children.push_back(vector<int>(0));
points_in_node.push_back(vector<int>(0));
}
int current_id = space_id[height + 1][e_space];
number_points[current_id] += number_points[e_int];
children[current_id].push_back(e_int);
for (auto points : points_in_node[e_int])
points_in_node[current_id].push_back(points);
}
height++;
}
root = space_id[height++].begin()->second;
}
} // namespace fast_k_means
| 40.096774 | 80 | 0.675784 |
fb1610daf2809c43791ededa24c87b171bcb68b7 | 13,869 | c | C | fs/hdd.c | PenetratingShot/DripOS | 1298bae7e80c783a4c6120cd9e1105067644283d | [
"MIT"
] | null | null | null | fs/hdd.c | PenetratingShot/DripOS | 1298bae7e80c783a4c6120cd9e1105067644283d | [
"MIT"
] | null | null | null | fs/hdd.c | PenetratingShot/DripOS | 1298bae7e80c783a4c6120cd9e1105067644283d | [
"MIT"
] | null | null | null | /*
hdd.c
Copyright Menotdan 2018-2019
HDD Setup
MIT License
*/
#include <fs/hdd.h>
int ata_pio = 0;
uint16_t ata_drive = MASTER_DRIVE;
uint32_t ata_controler = PRIMARY_IDE;
int nodrives = 0;
uint16_t ata_buffer[256];
int mp = 1;
int sp = 1;
int ss = 1;
int ms = 1;
int mp28 = 1;
int sp28 = 1;
int ss28 = 1;
int ms28 = 1;
int mp48 = 1;
int sp48 = 1;
int ss48 = 1;
int ms48 = 1;
uint32_t sectors_read = 0;
int primary = 0;
int secondary = 0;
uint16_t tmp;
uint16_t readB;
void clear_ata_buffer() {
for(int i=0; i<256; i++) {
ata_buffer[i]=0;
}
}
// Primary IRQ handler
static void primary_handler(registers_t *r) {
sectors_read++;
UNUSED(r);
}
// Secondary IRQ handler
static void secondary_handler(registers_t *r) {
sectors_read++;
UNUSED(r);
}
void init_hdd() {
register_interrupt_handler(IRQ14, primary_handler);
register_interrupt_handler(IRQ15, secondary_handler);
}
int ata_pio28(uint16_t base, uint8_t type, uint16_t drive, uint32_t addr) {
if (nodrives == 0) {
int cycle=0;
port_byte_out(base+ATA_PORT_DRV, drive);
//PIO28
port_byte_out(base+ATA_PORT_FEATURES, 0x00);
port_byte_out(base+ATA_PORT_SCT_COUNT, 0x01);
port_byte_out(base+ATA_PORT_SCT_NUMBER, (unsigned char)addr);
port_byte_out(base+ATA_PORT_CYL_LOW, (unsigned char)(addr >> 8));
port_byte_out(base+ATA_PORT_CYL_HIGH, (unsigned char)(addr >> 16));
//type
if(type==ATA_READ) {
port_byte_out(base+ATA_PORT_COMMAND, 0x20); // Send command
}
else {
port_byte_out(base+ATA_PORT_COMMAND, 0x30);
}
//wait for BSY clear and DRQ set
cycle=0;
for(int i=0; i<1000; i++) {
port_byte_in(base+ATA_PORT_ALT_STATUS); //Delay
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
if( (port_byte_in(base+ATA_PORT_ALT_STATUS) & 0x88)==0x08 ) { //drq is set
cycle=1;
break;
}
}
if(cycle==0) {
port_byte_in(base+ATA_PORT_ALT_STATUS); //Delay so the drive can set its port values
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
if( (port_byte_in(base+ATA_PORT_ALT_STATUS) & 0x01)==0x01 ) {
kprint("");
}
return 1;
}
if( (port_byte_in(base+ATA_PORT_ALT_STATUS) & 0x01)==0x01 ) {
kprint("");
return 2;
}
for (int idx = 0; idx < 256; idx++)
{
if(type==ATA_READ) {
ata_buffer[idx] = port_word_in(base + ATA_PORT_DATA);
}
else {
port_word_out(base + ATA_PORT_DATA, ata_buffer[idx]);
}
}
return 0;
} else {
kprint("No drives found on this system!");
return 1;
}
}
int ata_pio48(uint16_t base, uint8_t type, uint16_t drive, uint32_t addr) {
if (nodrives == 0) {
int cycle=0;
port_byte_out(base+ATA_PORT_DRV, drive);
//PIO48
port_byte_out(base+ATA_PORT_FEATURES, 0x00); // NULL 1
port_byte_out(base+ATA_PORT_FEATURES, 0x00); // NULL 2
port_byte_out(base+ATA_PORT_SCT_COUNT, 0x0); // High sector count
port_byte_out(base+ATA_PORT_SCT_NUMBER, 0); // High sector num
port_byte_out(base+ATA_PORT_CYL_LOW, 0); // High low Cyl
port_byte_out(base+ATA_PORT_CYL_HIGH, 0); // High high Cyl
port_byte_out(base+ATA_PORT_SCT_COUNT, 0x01); // Low sector count
port_byte_out(base+ATA_PORT_SCT_NUMBER, (unsigned char)addr); // Low sector num
port_byte_out(base+ATA_PORT_CYL_LOW, (unsigned char)(addr >> 8)); // Low low Cyl
port_byte_out(base+ATA_PORT_CYL_HIGH, (unsigned char)(addr >> 16)); // Low high Cyl
//type
if(type==ATA_READ) {
port_byte_out(base+ATA_PORT_COMMAND, 0x24); // Send command
}
else {
port_byte_out(base+ATA_PORT_COMMAND, 0x34);
}
//wait for BSY clear and DRQ set
cycle=0;
for(int i=0; i<1000; i++) {
port_byte_in(base+ATA_PORT_ALT_STATUS); //Delay
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
if( (port_byte_in(base+ATA_PORT_ALT_STATUS) & 0x88)==0x08 ) { //drq is set
cycle=1;
break;
}
}
if(cycle==0) {
port_byte_in(base+ATA_PORT_ALT_STATUS); //Delay so the drive can set its port values
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
port_byte_in(base+ATA_PORT_ALT_STATUS);
if( (port_byte_in(base+ATA_PORT_ALT_STATUS) & 0x01)==0x01 ) {
kprint("");
}
return 1;
}
if( (port_byte_in(base+ATA_PORT_ALT_STATUS) & 0x01)==0x01 ) {
kprint("");
return 2;
}
if(type==ATA_READ) {
for (int idx = 0; idx < 256; idx++)
{
ata_buffer[idx] = port_word_in(base + ATA_PORT_DATA);
}
}
else {
for (int idx = 0; idx < 256; idx++)
{
port_word_out(base + ATA_PORT_DATA, ata_buffer[idx]);
}
}
return 0;
} else {
kprint("No drives found on this system!");
return 1;
}
}
void new_scan() {
mp = ata_pio28(0x1F0, ATA_READ, 0xE0, 0x0);
ms = ata_pio28(0x1F0, ATA_READ, 0xF0, 0x0);
sp = ata_pio28(0x170, ATA_READ, 0xE0, 0x0);
ss = ata_pio28(0x170, ATA_READ, 0xF0, 0x0);
mp48 = ata_pio48(0x1F0, ATA_READ, 0x40, 0x0);
ms48 = ata_pio48(0x1F0, ATA_READ, 0x50, 0x0);
sp48 = ata_pio48(0x170, ATA_READ, 0x40, 0x0);
ss48 = ata_pio48(0x170, ATA_READ, 0x50, 0x0);
// PIO28 Drives
if (mp == 0) {
ata_drive = MASTER_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
}
else if (ms == 0) {
ata_drive = SLAVE_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
}
else if (sp == 0) {
ata_drive = MASTER_DRIVE;
ata_controler = SECONDARY_IDE;
ata_pio = 0;
}
else if (ss == 0) {
ata_drive = SLAVE_DRIVE;
ata_controler = SECONDARY_IDE;
ata_pio = 0;
}
// PIO48 Drives
else if (mp48 == 0) {
ata_drive = MASTER_DRIVE_PIO48;
ata_controler = PRIMARY_IDE;
ata_pio = 1;
}
else if (ms48 == 0) {
ata_drive = SLAVE_DRIVE_PIO48;
ata_controler = PRIMARY_IDE;
ata_pio = 1;
}
else if (sp48 == 0) {
ata_drive = MASTER_DRIVE_PIO48;
ata_controler = SECONDARY_IDE;
ata_pio = 1;
}
else if (ss48 == 0) {
ata_drive = SLAVE_DRIVE_PIO48;
ata_controler = SECONDARY_IDE;
ata_pio = 1;
} else {
clear_ata_buffer();
nodrives = 1;
return;
}
clear_ata_buffer();
return;
}
void drive_scan() {
// Detect primary controller
port_byte_out(ATA_PORT_PRIMARY_DETECT, MAGIC_DETECT);
readB = port_byte_in(ATA_PORT_PRIMARY_DETECT);
if (readB == 0x88) {
// Primary controller exists
primary = 1;
// Detect Master Drive
port_byte_out(ATA_PORT_PRIMARY_DRIVE_DETECT, MASTER_DRIVE_DETECT);
wait(1);
tmp = port_byte_in(ATA_PORT_PRIMARY_STATUS);
if (tmp & 0x40) {
// Master drive exists
mp = 0;
mp28 = ata_pio28(0x1F0, ATA_READ, 0xE0, 0x0);
mp48 = ata_pio48(0x1F0, ATA_READ, 0x40, 0x0);
if (mp28 == 0) {
ata_drive = MASTER_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
current_drive = 1;
} else if (mp48 == 0) {
ata_drive = MASTER_DRIVE_PIO48;
ata_controler = PRIMARY_IDE;
ata_pio = 1;
current_drive = 1;
} else {
// Default to PIO28
ata_drive = MASTER_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
current_drive = 1;
}
}
// Detect Slave Drive
port_byte_out(ATA_PORT_PRIMARY_DRIVE_DETECT, SLAVE_DRIVE_DETECT);
wait(1);
//uint16_t tmp;
tmp = port_byte_in(ATA_PORT_PRIMARY_STATUS);
if (tmp & 0x40) {
// Slave drive exists
ms = 0;
ms28 = ata_pio28(0x1F0, ATA_READ, 0xF0, 0x0);
ms48 = ata_pio48(0x1F0, ATA_READ, 0x50, 0x0);
if (ms28 == 0) {
ata_drive = SLAVE_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
current_drive = 2;
} else if (ms48 == 0) {
ata_drive = SLAVE_DRIVE_PIO48;
ata_controler = PRIMARY_IDE;
ata_pio = 1;
current_drive = 2;
} else {
// Default to PIO28
ata_drive = SLAVE_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
current_drive = 2;
}
}
}
// Detect secondary controller
port_byte_out(ATA_PORT_SECONDARY_DETECT, MAGIC_DETECT);
readB = port_byte_in(ATA_PORT_SECONDARY_DETECT);
if (readB == 0x88) {
// Secondary controller exists
secondary = 1;
// Detect Master Drive
port_byte_out(ATA_PORT_SECONDARY_DRIVE_DETECT, MASTER_DRIVE_DETECT);
wait(1);
tmp = port_byte_in(ATA_PORT_SECONDARY_STATUS);
if (tmp & 0x40) {
// Master drive exists
sp = 0;
sp28 = ata_pio28(0x170, ATA_READ, 0xE0, 0x0);
sp48 = ata_pio48(0x170, ATA_READ, 0x40, 0x0);
if (sp28 == 0) {
ata_drive = MASTER_DRIVE;
ata_controler = SECONDARY_IDE;
ata_pio = 0;
current_drive = 3;
} else if (sp48 == 0) {
ata_drive = MASTER_DRIVE_PIO48;
ata_controler = SECONDARY_IDE;
ata_pio = 1;
current_drive = 3;
} else {
// Default to PIO28
ata_drive = MASTER_DRIVE;
ata_controler = SECONDARY_IDE;
ata_pio = 0;
current_drive = 3;
}
}
// Detect Slave Drive
port_byte_out(ATA_PORT_SECONDARY_DRIVE_DETECT, SLAVE_DRIVE_DETECT);
wait(1);
tmp = port_byte_in(ATA_PORT_SECONDARY_STATUS);
if (tmp & 0x40) {
// Slave drive exists
ss = 0;
ss28 = ata_pio28(0x170, ATA_READ, 0xF0, 0x0);
ss48 = ata_pio48(0x170, ATA_READ, 0x50, 0x0);
if (ss28 == 0) {
ata_drive = SLAVE_DRIVE;
ata_controler = SECONDARY_IDE;
ata_pio = 0;
current_drive = 4;
} else if (ss48 == 0) {
ata_drive = SLAVE_DRIVE_PIO48;
ata_controler = SECONDARY_IDE;
ata_pio = 1;
current_drive = 4;
} else {
// Default to PIO28
ata_drive = SLAVE_DRIVE;
ata_controler = SECONDARY_IDE;
ata_pio = 0;
current_drive = 4;
}
}
}
clear_ata_buffer();
if (mp == 0) {
if (mp28 == 0) {
ata_drive = MASTER_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
} else if (mp48 == 0) {
ata_drive = MASTER_DRIVE_PIO48;
ata_controler = PRIMARY_IDE;
ata_pio = 1;
} else {
// Default to PIO28
ata_drive = MASTER_DRIVE;
ata_controler = PRIMARY_IDE;
ata_pio = 0;
}
return;
} else if (ms == 0) {
return;
} else if (sp == 0) {
return;
} else if (ss == 0) {
return;
} else {
nodrives = 1;
return;
}
}
hdd_size_t drive_sectors(uint8_t devP, uint8_t controllerP) {
hdd_size_t size;
uint16_t controller = 0x170 + controllerP*0x80;
uint16_t deviceBit = (devP << 4) + (1 << 6);
if (deviceBit == 0) {
}
read(0, 0); // Start drive
while ((port_byte_in(controller+7) & 0x40) == 0); // Wait for the drive to be ready
if (ata_pio == 0) {
port_byte_out(controller + 7, 0xF8); // Send the command
while ((port_byte_in(controller + 7) & 0x80) != 0); // Wait for BSY to clear
size.MAX_LBA = (uint32_t)port_byte_in(controller+3);
size.MAX_LBA += (uint32_t)port_byte_in(controller+4) <<8;
size.MAX_LBA += (uint32_t)port_byte_in(controller+5) <<16;
size.MAX_LBA += ((uint32_t)port_byte_in(controller+6) & 0xF) <<24;
} else {
port_byte_out(controller + 7, 0x27); // Send the command
while ((port_byte_in(controller + 7) & 0x80) != 0); // Wait for BSY to clear
size.MAX_LBA = (uint32_t)port_byte_in(controller+3);
size.MAX_LBA += (uint32_t)port_byte_in(controller+4) <<8;
size.MAX_LBA += (uint32_t)port_byte_in(controller+5) <<16;
port_byte_out(controller+2, 0x80); // Set HOB to 1
size.MAX_LBA += (uint32_t)port_byte_in(controller+3)<<24;
size.MAX_LBA_HIGH = (uint32_t)port_byte_in(controller+4);
size.MAX_LBA_HIGH += (uint32_t)port_byte_in(controller+5) << 8;
size.HIGH_USED = 1;
}
return size;
} | 31.809633 | 96 | 0.544668 |
65898f2c9bb6e2f5a7bf6e798728a7ed79a6d58b | 57 | sql | SQL | microservicio/infraestructura/src/main/resources/sql/reserva/existeReserva.sql | kmiloramirez/ADNHOSTAL | 4a1e07cc8d9641ca6792bdce672cf06314c6b51a | [
"Apache-2.0"
] | null | null | null | microservicio/infraestructura/src/main/resources/sql/reserva/existeReserva.sql | kmiloramirez/ADNHOSTAL | 4a1e07cc8d9641ca6792bdce672cf06314c6b51a | [
"Apache-2.0"
] | null | null | null | microservicio/infraestructura/src/main/resources/sql/reserva/existeReserva.sql | kmiloramirez/ADNHOSTAL | 4a1e07cc8d9641ca6792bdce672cf06314c6b51a | [
"Apache-2.0"
] | null | null | null | SELECT count(1)
FROM reserva
WHERE id = :numeroReserva
| 9.5 | 25 | 0.754386 |
50c668beb9ad1c594e93c663dcacc49b220e3947 | 4,739 | go | Go | syncer/plugins/servicecenter/transform_test.go | yangtuantuan/servicecomb-service-center | 2eedd6f5aca80adb3af78d55385f589545b0a1ca | [
"Apache-2.0"
] | 1,048 | 2018-11-12T01:38:10.000Z | 2022-03-15T07:30:39.000Z | syncer/plugins/servicecenter/transform_test.go | yangtuantuan/servicecomb-service-center | 2eedd6f5aca80adb3af78d55385f589545b0a1ca | [
"Apache-2.0"
] | 368 | 2018-11-09T07:48:41.000Z | 2022-03-31T10:39:25.000Z | syncer/plugins/servicecenter/transform_test.go | yangtuantuan/servicecomb-service-center | 2eedd6f5aca80adb3af78d55385f589545b0a1ca | [
"Apache-2.0"
] | 203 | 2018-11-12T03:55:54.000Z | 2022-03-24T08:18:48.000Z | /*
* Licensed to the Apache Software Foundation (ASF) under one
* or more contributor license agreements. See the NOTICE file
* distributed with this work for additional information
* regarding copyright ownership. The ASF licenses this file
* to you under the Apache License, Version 2.0 (the
* "License"); you may not use this file except in compliance
* with the License. You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing,
* software distributed under the License is distributed on an
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
* KIND, either express or implied. See the License for the
* specific language governing permissions and limitations
* under the License.
*/
package servicecenter
import (
pbsc "github.com/apache/servicecomb-service-center/syncer/proto/sc"
scpb "github.com/go-chassis/cari/discovery"
"github.com/stretchr/testify/assert"
"testing"
)
func TestTransform_ServiceCopy(t *testing.T) {
t.Run("value will copy from scpb.MicroService to pbsc.MicroService", func(t *testing.T) {
service := scpb.MicroService{
ServiceId: "1234567",
}
serviceInpbsc := ServiceCopy(&service)
assert.NotNil(t, serviceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", serviceInpbsc.ServiceId)
})
t.Run("more values will copy from scpb.MicroService to pbsc.MicroService", func(t *testing.T) {
service := scpb.MicroService{
ServiceId: "1234567",
AppId: "appid",
ServiceName: "service",
}
serviceInpbsc := ServiceCopy(&service)
assert.NotNil(t, serviceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", serviceInpbsc.ServiceId)
assert.Equal(t, "appid", serviceInpbsc.AppId)
assert.Equal(t, "service", serviceInpbsc.ServiceName)
})
}
func TestTransform_ServiceCopyRe(t *testing.T) {
t.Run("value will copy from pbsc.MicroService to scpb.MicroService", func(t *testing.T) {
service := pbsc.MicroService{
ServiceId: "1234567",
}
serviceInpbsc := ServiceCopyRe(&service)
assert.NotNil(t, serviceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", serviceInpbsc.ServiceId)
})
t.Run("more values will copy from pbsc.MicroService to scpb.MicroService", func(t *testing.T) {
service := pbsc.MicroService{
ServiceId: "1234567",
AppId: "appid",
ServiceName: "service",
}
serviceInpbsc := ServiceCopyRe(&service)
assert.NotNil(t, serviceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", serviceInpbsc.ServiceId)
assert.Equal(t, "appid", serviceInpbsc.AppId)
assert.Equal(t, "service", serviceInpbsc.ServiceName)
})
}
func TestTransform_InstanceCopy(t *testing.T) {
t.Run("value will copy from scpb.MicroServiceInstance to pbsc.MicroServiceInstance", func(t *testing.T) {
instance := scpb.MicroServiceInstance{
ServiceId: "1234567",
}
instanceInpbsc := InstanceCopy(&instance)
assert.NotNil(t, instanceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", instanceInpbsc.ServiceId)
})
t.Run("more values will copy from scpb.MicroServiceInstance to pbsc.MicroServiceInstance", func(t *testing.T) {
instance := scpb.MicroServiceInstance{
ServiceId: "1234567",
InstanceId: "7654321",
}
instanceInpbsc := InstanceCopy(&instance)
assert.NotNil(t, instanceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", instanceInpbsc.ServiceId)
assert.Equal(t, "7654321", instanceInpbsc.InstanceId)
})
}
func TestTransform_InstanceCopyRe(t *testing.T) {
t.Run("value will copy from pbsc.MicroServiceInstance to scpb.MicroServiceInstance", func(t *testing.T) {
instance := pbsc.MicroServiceInstance{
ServiceId: "1234567",
}
instanceInpbsc := InstanceCopyRe(&instance)
assert.NotNil(t, instanceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", instanceInpbsc.ServiceId)
})
t.Run("value will copy from pbsc.MicroServiceInstance to scpb.MicroServiceInstance", func(t *testing.T) {
instance := pbsc.MicroServiceInstance{
ServiceId: "1234567",
InstanceId: "7654321",
}
instanceInpbsc := InstanceCopyRe(&instance)
assert.NotNil(t, instanceInpbsc.ServiceId, "serviceId is not nil")
assert.Equal(t, "1234567", instanceInpbsc.ServiceId)
assert.Equal(t, "7654321", instanceInpbsc.InstanceId)
})
}
func TestTransform_SchemaCopy(t *testing.T) {
t.Run("value will copy from scpb.Schema to pbsc.Schema", func(t *testing.T) {
schema := scpb.Schema{
SchemaId: "1234567",
}
instanceInpbsc := SchemaCopy(&schema)
assert.NotNil(t, instanceInpbsc.SchemaId, "schemaId is not nil")
assert.Equal(t, "1234567", instanceInpbsc.SchemaId)
})
}
| 37.023438 | 112 | 0.73602 |
76f64e04d43801b98a3b5f3a5e6d859cf644309b | 161 | asm | Assembly | audio/sfx/switch_1.asm | AmateurPanda92/pokemon-rby-dx | f7ba1cc50b22d93ed176571e074a52d73360da93 | [
"MIT"
] | 9 | 2020-07-12T19:44:21.000Z | 2022-03-03T23:32:40.000Z | audio/sfx/switch_1.asm | JStar-debug2020/pokemon-rby-dx | c2fdd8145d96683addbd8d9075f946a68d1527a1 | [
"MIT"
] | 7 | 2020-07-16T10:48:52.000Z | 2021-01-28T18:32:02.000Z | audio/sfx/switch_1.asm | JStar-debug2020/pokemon-rby-dx | c2fdd8145d96683addbd8d9075f946a68d1527a1 | [
"MIT"
] | 2 | 2021-03-28T18:33:43.000Z | 2021-05-06T13:12:09.000Z | SFX_Switch_1_Ch4:
duty 2
squarenote 4, 0, 0, 0
squarenote 2, 15, 1, 1664
squarenote 1, 0, 0, 0
squarenote 4, 15, 1, 1920
squarenote 4, 0, 0, 0
endchannel
| 17.888889 | 26 | 0.677019 |
acc49d38fa41206aa4cc6775180d6252cc4b0093 | 4,338 | hpp | C++ | libs/options/include/fcppt/options/commands_decl.hpp | pmiddend/fcppt | 9f437acbb10258e6df6982a550213a05815eb2be | [
"BSL-1.0"
] | null | null | null | libs/options/include/fcppt/options/commands_decl.hpp | pmiddend/fcppt | 9f437acbb10258e6df6982a550213a05815eb2be | [
"BSL-1.0"
] | null | null | null | libs/options/include/fcppt/options/commands_decl.hpp | pmiddend/fcppt | 9f437acbb10258e6df6982a550213a05815eb2be | [
"BSL-1.0"
] | null | null | null | // Copyright Carl Philipp Reh 2009 - 2018.
// Distributed under the Boost Software License, Version 1.0.
// (See accompanying file LICENSE_1_0.txt or copy at
// http://www.boost.org/LICENSE_1_0.txt)
#ifndef FCPPT_OPTIONS_COMMANDS_DECL_HPP_INCLUDED
#define FCPPT_OPTIONS_COMMANDS_DECL_HPP_INCLUDED
#include <fcppt/string.hpp>
#include <fcppt/options/commands_fwd.hpp>
#include <fcppt/options/flag_name_set.hpp>
#include <fcppt/options/option_name_set.hpp>
#include <fcppt/options/options_label.hpp>
#include <fcppt/options/parse_context_fwd.hpp>
#include <fcppt/options/parse_result_fwd.hpp>
#include <fcppt/options/result_of.hpp>
#include <fcppt/options/state_fwd.hpp>
#include <fcppt/options/sub_command_label.hpp>
#include <fcppt/preprocessor/disable_vc_warning.hpp>
#include <fcppt/preprocessor/pop_warning.hpp>
#include <fcppt/preprocessor/push_warning.hpp>
#include <fcppt/record/all_disjoint.hpp>
#include <fcppt/record/element_fwd.hpp>
#include <fcppt/record/variadic_fwd.hpp>
#include <fcppt/type_traits/remove_cv_ref_t.hpp>
#include <fcppt/variant/variadic_fwd.hpp>
#include <fcppt/config/external_begin.hpp>
#include <metal/lambda/arg.hpp>
#include <metal/lambda/bind.hpp>
#include <metal/lambda/lambda.hpp>
#include <metal/list/list.hpp>
#include <metal/list/transform.hpp>
#include <tuple>
#include <type_traits>
#include <fcppt/config/external_end.hpp>
namespace fcppt
{
namespace options
{
FCPPT_PP_PUSH_WARNING
FCPPT_PP_DISABLE_VC_WARNING(4625)
FCPPT_PP_DISABLE_VC_WARNING(4626)
/**
\brief A parser for multiple sub commands.
\ingroup fcpptoptions
A commands parser parses multiple sub commands. Each sub command consists of a
parser and a name, i.e. <code>(name_1, parser_1), ..., (name_n, parser_n)</code>.
The parser first searches for the first argument, ignoring all option names
from \a OptionsParser. If none is found, the parser fails. Otherwise, the
first argument is <code>arg</code>, which is then compared to
<code>name_1, ..., name_n</code>. If none of these is equal to <code>arg</code>, the parser
fails. Otherwise, let <code>arg = name_i</code>, then the \a OptionsParser
is used to parse everything up to the first argument, and <code>parser_i</code>
is used to parse everything after.
\warning Be careful not to include anything other than options or flags
in \a OptionsParser, because otherwise this may lead to very confusing results.
\tparam OptionsParser A parser that should only parse options.
*/
template<
typename OptionsParser,
typename... SubCommands
>
class commands
{
public:
static_assert(
sizeof...(
SubCommands
)
>=
1u,
"You must specify at least one subparser"
);
static_assert(
fcppt::record::all_disjoint<
::metal::transform<
::metal::bind<
::metal::lambda<
fcppt::options::result_of
>,
::metal::_1
>,
::metal::list<
SubCommands...
>
>
>::value,
"All sub-command labels must be distinct"
);
/**
\brief Constructs a commands parser.
\tparam OptionsParserArg A cv-ref to \a OptionsParser
\tparam SubCommandsArgs Cv-refs to \a SubCommands
*/
template<
typename OptionsParserArg,
typename... SubCommandsArgs,
typename =
std::enable_if_t<
std::conjunction_v<
std::is_same<
OptionsParser,
fcppt::type_traits::remove_cv_ref_t<
OptionsParserArg
>
>,
std::is_same<
SubCommands,
fcppt::type_traits::remove_cv_ref_t<
SubCommandsArgs
>
>...
>
>
>
explicit
commands(
OptionsParserArg &&,
SubCommandsArgs &&...
);
typedef
fcppt::variant::variadic<
fcppt::options::result_of<
SubCommands
>...
>
variant_result;
typedef
fcppt::record::variadic<
fcppt::record::element<
fcppt::options::options_label,
fcppt::options::result_of<
OptionsParser
>
>,
fcppt::record::element<
fcppt::options::sub_command_label,
variant_result
>
>
result_type;
fcppt::options::parse_result<
result_type
>
parse(
fcppt::options::state &&,
fcppt::options::parse_context const &
) const;
fcppt::options::flag_name_set
flag_names() const;
fcppt::options::option_name_set
option_names() const;
fcppt::string
usage() const;
private:
OptionsParser options_parser_;
std::tuple<
SubCommands...
>
sub_commands_;
};
FCPPT_PP_POP_WARNING
}
}
#endif
| 23.074468 | 91 | 0.726372 |
507b57da45fb39bd7e7d32b5a79266bd02ca09c1 | 1,183 | html | HTML | src/app/employees-page/employee-creation/employee-creation.component.html | briana-crm/briana-client | a2187086cfecb1b47adb9d20ae15809027ab8a07 | [
"MIT"
] | 7 | 2020-12-07T14:26:15.000Z | 2022-01-28T11:16:36.000Z | src/app/employees-page/employee-creation/employee-creation.component.html | briana-crm/briana-client | a2187086cfecb1b47adb9d20ae15809027ab8a07 | [
"MIT"
] | null | null | null | src/app/employees-page/employee-creation/employee-creation.component.html | briana-crm/briana-client | a2187086cfecb1b47adb9d20ae15809027ab8a07 | [
"MIT"
] | 2 | 2020-10-12T14:11:37.000Z | 2021-02-10T15:55:06.000Z | <div class="center">
<h3>{{ 'emNew' | lang }}</h3>
</div>
<div class="container">
<app-creation-handler
(submitEvent)="onSubmit()"
>
<form (ngSubmit)="onSubmit()" [formGroup]="form">
<div class="input-field">
<input formControlName="name" id="name" type="text">
<label for="name">{{ 'name' | lang }}</label>
</div>
<div class="input-field">
<input formControlName="phone" id="phone" type="tel">
<label for="phone">{{ 'phone' | lang }}</label>
</div>
<div class="input-field">
<input formControlName="email" id="email" type="email">
<label for="email">{{ 'email' | lang }}</label>
</div>
<div class="input-field">
<select #position formControlName="position" id="position">
<option disabled selected value="">{{ 'chPos' | lang }}</option>
<option
*ngFor=" let position of availablePositions$ | async"
[value]="position.name"
>
{{ position.name }}
</option>
</select>
<label for="position">{{ 'position' | lang }}</label>
</div>
</form>
</app-creation-handler>
</div>
| 31.972973 | 74 | 0.53508 |
89017a517888d00188d72a013eca93e47185847e | 5,471 | asm | Assembly | opengl_programs/pyramid1.asm | rgimad/fasm_programs | f6739ea19d5a3cdc759d902971a889eda5e98e9a | [
"MIT"
] | 8 | 2021-03-23T05:24:56.000Z | 2021-11-29T08:56:33.000Z | opengl_programs/pyramid1.asm | rgimad/fasm_programs | f6739ea19d5a3cdc759d902971a889eda5e98e9a | [
"MIT"
] | null | null | null | opengl_programs/pyramid1.asm | rgimad/fasm_programs | f6739ea19d5a3cdc759d902971a889eda5e98e9a | [
"MIT"
] | 1 | 2021-09-18T07:26:29.000Z | 2021-09-18T07:26:29.000Z | ;формат exe файла
format PE GUI 4.0
;точка входа программы
entry start
;включаем файлы API процедур (должна быть установлена переменная окружения "fasminc")
include '%fasminc%\win32a.inc'
;констант OpenGL
include 'include\opengl_const.inc'
;и макросов
include 'include\opengl_macros.inc'
;начало программы
start:
;обнулим ebx. Т.к. он не изменяется API процедурами то будем использывать push ebx вместо push 0, для оптимизации
xor ebx,ebx
;спрячим курсор
invoke ShowCursor,ebx
;поместим в стек 4-е "0" для процедуры "CreateWindowEx"
push ebx
push ebx
push ebx
push ebx
;получим текущее разрешение по вертикали
invoke GetSystemMetrics,SM_CYSCREEN
;поместим его в стек для процедуры "CreateWindowEx"
push eax
;и по горизонтали
invoke GetSystemMetrics,ebx
;и его в стек
push eax
;вычислим соотношение резрешений экрана по горизонтали и вертикали
fild dword [esp]
fidiv dword [esp+4]
;и сохраним его в ratio
fstp [ratio]
;создадим окно размером с экран с предопределенным классом "edit" (т.к. его регистрировать ненадо, то это позволяет избавиться от не нужного кода)
invoke CreateWindowEx,WS_EX_TOPMOST,szClass,szTitle,WS_VISIBLE+WS_POPUP,ebx,ebx
;получим контекст окна
invoke GetDC,eax
;сохраним его в ebp
xchg ebp,eax
;инициализируем дескриптор формата пикселей OpenGL (поддержку OpenGL и двойной буферизации)
mov [pfd.dwFlags],PFD_DRAW_TO_WINDOW+PFD_SUPPORT_OPENGL+PFD_DOUBLEBUFFER
;тип пикселей RedGreenBlueAlpha
mov [pfd.iPixelType],PFD_TYPE_RGBA
;глубину цвета
mov [pfd.cColorBits],32
;плоскость отображения
mov [pfd.dwLayerMask],PFD_MAIN_PLANE
;выберем его
invoke ChoosePixelFormat,ebp,pfd
;и установим его
invoke SetPixelFormat,ebp,eax,pfd
;преобразуем контекст окна в контекст OpenGL
invoke wglCreateContext,ebp
;и сделаем его текущим
invoke wglMakeCurrent,ebp,eax
;включим режим отсечения не лицевых граней (z-буфер)
invoke glEnable,GL_DEPTH_TEST
;включим источник света GL_LIGHT0 (используя значения по умолчанию)
invoke glEnable,GL_LIGHT0
;включим освещение
invoke glEnable,GL_LIGHTING
;включим изменение свойств материала взависимости от его цвета, иначе все будет тупо чернобелое
invoke glEnable,GL_COLOR_MATERIAL
;выберем режим вычисления перспективных преобразований (наилучший)
invoke glHint,GL_PERSPECTIVE_CORRECTION_HINT,GL_NICEST
;выберем для преобразований матрицу перспективной проекции
invoke glMatrixMode,GL_PROJECTION
;умножим ее на матрицу перспективы, т.е. попросту включим ее (используем макрос glcall т.к. параметры передаются в виде 8 байтов)
glcall gluPerspective,90.0,ratio,0.1,100.0
;выберем для преобразований матрицу изображения
invoke glMatrixMode,GL_MODELVIEW
;основной цикл
.draw:
;получаем текущее значение счетчика начала работы Windows (для синхронизации)
invoke GetTickCount
;сравним его с сохраненным значением
cmp eax,[msec]
;если оно не изменилось то ждем
jz .draw
;если значение поменялось сохраним его
mov [msec],eax
invoke glClear,GL_COLOR_BUFFER_BIT+GL_DEPTH_BUFFER_BIT
;обнулим текущую матрицу (матрицу изображения)
invoke glLoadIdentity
;отодвинем объекты в глубь экрана
invoke glTranslatef, 0.0, 0.0, -1.5
;последовательно умножим матрицу изображения на матрицы поворота (повернем все объекты сцены на угол theta относительно векторов x,y,z соответственно)
invoke glRotatef,[theta], 1.0, 0.0, 0.0
invoke glRotatef,[theta], 0.0, 1.0, 0.0
invoke glRotatef,[theta], 0.0, 0.0, 1.0
invoke glBegin, GL_POLYGON
invoke glNormal3f, 0.0, -0.5, -0.5
invoke glColor3f, 1.0, 0.0, 0.0
invoke glVertex3f, 0.5, 0.5, -0.5
invoke glVertex3f, 0.0, 0.0, 0.0
invoke glVertex3f, -0.5, 0.5, -0.5
invoke glEnd
invoke glBegin, GL_POLYGON
invoke glNormal3f, 0.0, 0.5, -0.5
invoke glColor3f, 1.0, 1.0, 0.0
invoke glVertex3f, 0.5, 0.5, 0.5
invoke glVertex3f, 0.0, 0.0, 0.0
invoke glVertex3f, -0.5, 0.5, 0.5
invoke glEnd
invoke glBegin, GL_POLYGON
invoke glNormal3f, 0.5, -0.5, 0.0
invoke glColor3f, 1.0, 0.5, 1.0
invoke glVertex3f, 0.5, 0.5, 0.5
invoke glVertex3f, 0.0, 0.0, 0.0
invoke glVertex3f, 0.5, 0.5, -0.5
invoke glEnd
invoke glBegin, GL_POLYGON
invoke glNormal3f, 0.5, 0.5, 0.0
invoke glColor3f, 1.0, 0.0, 0.3
invoke glVertex3f, -0.5, 0.5, 0.5
invoke glVertex3f, 0.0, 0.0, 0.0
invoke glVertex3f, -0.5, 0.5, -0.5
invoke glEnd
invoke glBegin, GL_POLYGON
invoke glNormal3f, 0.0, 1.0, 0.0
invoke glColor3f, 0.8, 0.2, 0.0
invoke glVertex3f, 0.5, 0.5, 0.5
invoke glVertex3f, 0.5, 0.5, -0.5
invoke glVertex3f, -0.5, 0.5, -0.5
invoke glVertex3f, -0.5, 0.5, 0.5
invoke glEnd
;отобразим буфер на экран
invoke SwapBuffers,ebp
;загрузим значение угла theta
fld [theta]
;увеличим его на значение delta
fadd [delta]
;и запишем обратно
fstp [theta]
;проверим на нажатие клавиши ESC
invoke GetAsyncKeyState,VK_ESCAPE
;если она не нажата
test eax,eax
;то продолжим цикл
jz .draw
;выход из программы
invoke ExitProcess,ebx
;заголовок окна
szTitle db 'OpenGL tutorial by Tyler Durden - Simple',0
;имя предопределенного класса окна
szClass db 'edit',0
;включим файл с описанием импорта
data import
include 'include\imports.inc'
end data
;описание ресурсов
data resource
directory RT_ICON,icons,RT_GROUP_ICON,group_icons
resource icons,1,LANG_NEUTRAL,icon_data
resource group_icons,1,LANG_NEUTRAL,icon
icon icon,icon_data,'resources\icons\simple.ico'
end data
;счетчик тиков таймера
msec dd ?
;угол поворота
theta dd ?
;значение приращения угла поворота
delta dd 0.3
;соотношение резрешений экрана по горизонтали и вертикали
ratio dq ?
;дескриптор пиксельного формата
pfd PIXELFORMATDESCRIPTOR | 29.733696 | 150 | 0.786328 |
ea849a03f19c3e4fe4bba17138b29ae88b2bae01 | 1,977 | dart | Dart | lib/core/presentation/widgets/state_indicators.dart | Juliotati/warframe | fd43cefa5a5ef3c6dbcb464c6ef54251e3d4b07c | [
"MIT"
] | 4 | 2021-04-15T01:04:31.000Z | 2022-02-03T12:56:43.000Z | lib/core/presentation/widgets/state_indicators.dart | Juliotati/warframe | fd43cefa5a5ef3c6dbcb464c6ef54251e3d4b07c | [
"MIT"
] | 28 | 2021-02-28T01:44:27.000Z | 2022-01-15T12:56:25.000Z | lib/core/presentation/widgets/state_indicators.dart | Juliotati/warframe | fd43cefa5a5ef3c6dbcb464c6ef54251e3d4b07c | [
"MIT"
] | null | null | null | part of presentation;
class LoadingIndicator extends StatelessWidget {
const LoadingIndicator([this.label = 'GETTING GAME DATA']);
final String label;
@override
Widget build(BuildContext context) {
const double size = 23.0;
return Center(
child: SizedBox(
height: WarframePlatform.isMobile ? size : size * 2,
width: WarframePlatform.isMobile ? size : size * 2,
child: const CircularProgressIndicator(
color: Color.fromRGBO(255, 255, 255, 0.9),
backgroundColor: Color.fromRGBO(255, 255, 255, 0.4),
),
),
);
}
}
class NoData extends StatelessWidget {
const NoData([this.label = 'NO DATA AVAILABLE']);
final String label;
@override
Widget build(BuildContext context) {
return Center(
child: Text(
label,
softWrap: true,
textAlign: TextAlign.center,
style: const TextStyle(
fontSize: 30,
color: Color.fromRGBO(255, 255, 255, 0.9),
),
),
);
}
}
class RetryButton extends StatelessWidget {
const RetryButton({
this.buttonLabel = 'Retry',
this.message = 'No data available for display',
required this.onTap,
});
final String buttonLabel;
final String message;
final void Function() onTap;
@override
Widget build(BuildContext context) {
return Center(
child: Column(
mainAxisAlignment: MainAxisAlignment.center,
children: <Widget>[
NoData(message),
const SizedBox(height: 10),
WarframeContainer(
onTap: onTap,
width: 140,
centerChild: true,
withShadow: true,
color: const Color.fromRGBO(255, 255, 255, 0.7),
child: Text(
buttonLabel,
style: const TextStyle(
fontSize: 24,
color: Color.fromRGBO(0, 0, 0, 1.0),
),
),
)
],
),
);
}
}
| 23.819277 | 62 | 0.573091 |
937d2fb7ff6d05ab3df43e0d3a6413b3180fd5ce | 1,150 | dart | Dart | examples/advanced_books/lib/books/ui/book_details_screen.dart | yumoose/beamer | 3e3773fcb7608f9861e0ad7970fd6197f703ce44 | [
"MIT"
] | null | null | null | examples/advanced_books/lib/books/ui/book_details_screen.dart | yumoose/beamer | 3e3773fcb7608f9861e0ad7970fd6197f703ce44 | [
"MIT"
] | null | null | null | examples/advanced_books/lib/books/ui/book_details_screen.dart | yumoose/beamer | 3e3773fcb7608f9861e0ad7970fd6197f703ce44 | [
"MIT"
] | null | null | null | import 'package:flutter/material.dart';
import 'package:beamer/beamer.dart';
import '../data.dart';
class BookDetailsScreen extends StatelessWidget {
BookDetailsScreen({
this.bookId,
}) : book = books.firstWhere((book) => book['id'] == bookId);
final String bookId;
final Map<String, String> book;
@override
Widget build(BuildContext context) {
return Scaffold(
appBar: AppBar(
title: Text(book['title']),
),
body: Center(
child: Column(
mainAxisAlignment: MainAxisAlignment.spaceEvenly,
children: [
ElevatedButton(
onPressed: () => Beamer.of(context).updateCurrentLocation(
pathBlueprint: '/books/:bookId/genres',
data: {'book': book},
),
child: Text('See genres'),
),
ElevatedButton(
onPressed: () => Beamer.of(context).updateCurrentLocation(
pathBlueprint: '/books/:bookId/buy',
data: {'book': book},
),
child: Text('Buy'),
),
],
),
),
);
}
}
| 26.136364 | 72 | 0.527826 |
199296616a2197104c04538c227acec25e50aea6 | 142 | lua | Lua | Graphics/StepsDisplayListRow Autogen.lua | agoramachina/Til-Death | 48c29706c2daa5426e61db536abbf57020bb7c48 | [
"MIT"
] | 5 | 2018-03-31T22:41:02.000Z | 2022-03-26T13:55:32.000Z | Graphics/StepsDisplayListRow Autogen.lua | agoramachina/Til-Death | 48c29706c2daa5426e61db536abbf57020bb7c48 | [
"MIT"
] | null | null | null | Graphics/StepsDisplayListRow Autogen.lua | agoramachina/Til-Death | 48c29706c2daa5426e61db536abbf57020bb7c48 | [
"MIT"
] | 2 | 2020-02-18T20:00:40.000Z | 2021-05-26T23:53:57.000Z | return LoadFont("Common Normal") .. {
InitCommand=cmd(xy,0,10;halign,0;zoom,0.4;);
BeginCommand=function(self)
self:settext("AG")
end;
}; | 23.666667 | 45 | 0.690141 |
b165dd9dce364fe65e270be5d2977818ec92762a | 813 | h | C | Example/MMRtcKit/MMView/TableViewInputCell.h | xugaoren/bjx-live-ios-demo | ae3dc15ed8bf926f88486924aff14a081f59805e | [
"MIT"
] | null | null | null | Example/MMRtcKit/MMView/TableViewInputCell.h | xugaoren/bjx-live-ios-demo | ae3dc15ed8bf926f88486924aff14a081f59805e | [
"MIT"
] | null | null | null | Example/MMRtcKit/MMView/TableViewInputCell.h | xugaoren/bjx-live-ios-demo | ae3dc15ed8bf926f88486924aff14a081f59805e | [
"MIT"
] | null | null | null | //
// TableViewInputCell.h
// MMRtcSample
//
// Created by RunX on 2021/1/21.
//
#import <UIKit/UIKit.h>
#import <MMRtcKit/MMRtcEnumerates.h>
NS_ASSUME_NONNULL_BEGIN
typedef NS_ENUM(NSInteger, TableViewInputCellType) {
TableViewInputCellType_ChannelName = 0, //频道名称
TableViewInputCellType_ChannelProfile = 1, //模式选择
};
typedef void(^TableViewInputCellChannelNameBlock)(NSString *name);
typedef void(^TableViewInputCellChannelProfileBlock)(MMRtcChannelProfile profile);
@interface TableViewInputCell : UITableViewCell
@property (nonatomic, assign) TableViewInputCellType cellType;
@property (nonatomic, copy) TableViewInputCellChannelNameBlock channelNameBlock;
@property (nonatomic, copy) TableViewInputCellChannelProfileBlock channelProfileBlock;
+ (NSString *)ID;
@end
NS_ASSUME_NONNULL_END
| 25.40625 | 86 | 0.806888 |
743a59961fa24fa2a7b50dcb8d660f27f9da2090 | 2,349 | html | HTML | application/templates/accounts/manage/form.html | kendog/coalman | 265c99d2e51f49f0b99772754b68efffd530e4bf | [
"Apache-2.0"
] | 3 | 2017-11-26T19:50:55.000Z | 2021-03-30T22:17:37.000Z | application/templates/accounts/manage/form.html | kendog/coalman | 265c99d2e51f49f0b99772754b68efffd530e4bf | [
"Apache-2.0"
] | null | null | null | application/templates/accounts/manage/form.html | kendog/coalman | 265c99d2e51f49f0b99772754b68efffd530e4bf | [
"Apache-2.0"
] | null | null | null | {% extends "layouts/layout1.html" %}
{% set active_section = "accounts" %}
{% block title %}Account{% endblock %}
{% block content %}
{%- if template_mode == "add" %}
<h3>Add Account</h3>
{% endif %}
{%- if template_mode == "edit" %}
<h3>Edit Account</h3>
{% endif %}
{%- if template_mode == "delete" %}
<h3>Delete Account</h3><p>Are you sure???</p>
{% endif %}
<hr>
<form id="accounts-form" method="post" action="">
<div class="row">
<div class="col-md-7">
<hr>
<div class="form-group">
<label for="name">Account Name:</label>
{%- if template_mode == "add" %}
<input type="text" class="form-control" id="name" name="name" value="" />
{% endif %}
{%- if template_mode == "edit" %}
<input type="text" class="form-control" id="name" name="name" value="{{ account.name }}" />
{% endif %}
{%- if template_mode == "delete" %}
<input type="text" class="form-control" id="name" name="name" value="{{ account.name }}" disabled />
{% endif %}
</div>
<hr>
</div>
<div class="col-md-1"></div>
<div class="col-md-4">
</div>
</div>
<div class="form-group">
{%- if template_mode == "add" %}
<input type="submit" class="btn btn-primary" name="submit-add" value="Submit">
{% endif %}
{%- if template_mode == "edit" %}
<input type="submit" class="btn btn-primary" name="submit-edit" value="Update">
{% endif %}
{%- if template_mode == "delete" %}
<input type="submit" class="btn btn-danger" name="submit-delete" value="Delete">
{% endif %}
</div>
</form>
{% endblock %}
{% block plugins %}
{%- if template_mode != "delete" %}
<script type="text/javascript" src="/static/js/jquery.validate.min.js"></script>
<script type="text/javascript">
$(function () {
$("#accounts-form").validate({
rules: {
name: "required"
}
});
});
</script>
{% endif %}
{% endblock %}
| 27.964286 | 120 | 0.458919 |
0d397dd2954a4a1ebdab7a4b6051d66102545519 | 34,900 | ps1 | PowerShell | SCRIPTS/Functions.ps1 | Alex-0293/MyFrameworkInstaller | d998bcea07e58e9d8105107b782970515e402855 | [
"Apache-2.0"
] | null | null | null | SCRIPTS/Functions.ps1 | Alex-0293/MyFrameworkInstaller | d998bcea07e58e9d8105107b782970515e402855 | [
"Apache-2.0"
] | null | null | null | SCRIPTS/Functions.ps1 | Alex-0293/MyFrameworkInstaller | d998bcea07e58e9d8105107b782970515e402855 | [
"Apache-2.0"
] | null | null | null | function Get-OSInfo {
$OSInfo = Get-CimInstance Win32_OperatingSystem | select-object *
return $OsInfo
}
function Convert-StringToDigitArray {
<#
.SYNOPSIS
Convert string to digit array
.DESCRIPTION
Convert string to array of digit.
.EXAMPLE
Convert-StringToDigitArray -UserInput $UserInput -DataSize $DataSize
.NOTES
AUTHOR Alexk
CREATED 05.11.20
VER 1
#>
[OutputType([Int[]])]
[CmdletBinding()]
param(
[Parameter( Mandatory = $True, Position = 0, HelpMessage = "String input data.")]
[string] $UserInput,
[Parameter( Mandatory = $True, Position = 1, HelpMessage = "Data size.")]
[int] $DataSize
)
$SelectedArray = ($UserInput -split ",").trim()
if ( $SelectedArray[0] -eq "*" ){
$SelectedArray = @()
foreach ( $Element in ( 1..( $DataSize-1 ) ) ) {
$SelectedArray += $Element
}
}
Else {
$SelectedIntervals = $SelectedArray | Where-Object { $_ -like "*-*" }
[int[]]$SelectedArray = $SelectedArray | Where-Object { $_ -NotLike "*-*" }
foreach ( $item in $SelectedIntervals ) {
[int[]]$Array = $item -split "-"
if ( $Array.count -eq 2 ) {
if ( $Array[0] -le $Array[1] ) {
$Begin = $Array[0]
$End = $Array[1]
}
Else {
$Begin = $Array[1]
$End = $Array[0]
}
foreach ( $Element in ($begin..$end) ) {
if ( -not ($Element -in $SelectedArray) -and ($Element -gt 0) ) {
$SelectedArray += $Element
}
}
}
}
}
return $SelectedArray
}
function Show-ColoredTable {
<#
.SYNOPSIS
Show colored table
.DESCRIPTION
Show table in color view.
.EXAMPLE
Parameter set: "Alerts"
Show-ColoredTable -Field $Field [-Data $Data] [-Definition $Definition] [-View $View] [-Title $Title] [-SelectField $SelectField] [-SelectMessage $SelectMessage]
Parameter set: "Color"
Show-ColoredTable [-Data $Data] [-View $View] [-Color $Color] [-Title $Title] [-AddRowNumbers $AddRowNumbers] [-SelectField $SelectField] [-SelectMessage $SelectMessage] [-PassThru $PassThru]
.NOTES
AUTHOR Alexk
CREATED 02.12.20
VER 1
#>
[CmdletBinding()]
Param (
[Parameter( Mandatory = $false, Position = 0, HelpMessage = "PsObject data." )]
[psObject[]] $Data,
[Parameter( Mandatory = $true, Position = 1, HelpMessage = "Field.", ParameterSetName = "Alerts" )]
[ValidateNotNullOrEmpty()]
[string] $Field,
[Parameter( Mandatory = $false, Position = 2, HelpMessage = "Color rules definition.", ParameterSetName = "Alerts" )]
[psObject] $Definition,
[Parameter( Mandatory = $false, Position = 3, HelpMessage = "Selected fields view." )]
$View,
[Parameter( Mandatory = $false, Position = 4, HelpMessage = "Change each line color.", ParameterSetName = "Color")]
[String[]] $Color,
[Parameter( Mandatory = $false, Position = 5, HelpMessage = "Table title.")]
[String] $Title,
[Parameter( Mandatory = $false, Position = 6, HelpMessage = "Add row numbers.", ParameterSetName = "Color" )]
[switch] $AddRowNumbers,
[Parameter( Mandatory = $false, Position = 7, HelpMessage = "Select message.")]
[string] $SelectField,
[Parameter( Mandatory = $false, Position = 8, HelpMessage = "Select message.")]
[string] $SelectMessage,
[Parameter( Mandatory = $false, Position = 9, HelpMessage = "Add new line at the end.", ParameterSetName = "Color" )]
[switch] $AddNewLine,
[Parameter( Mandatory = $false, Position = 10, HelpMessage = "Return object.", ParameterSetName = "Color" )]
[switch] $PassThru
)
If ( !$View ){
$View = "*"
}
$First = $true
if ( $Field ) {
if ( !$Definition ){
$Definition = [PSCustomObject]@{
Information = @{Field = "Information"; Color = "Green"}
Verbose = @{Field = "Verbose" ; Color = "Green"}
Error = @{Field = "Error" ; Color = "Red"}
Warning = @{Field = "Warning" ; Color = "Yellow"}
}
}
foreach ( $Item in $Data ){
switch ( $Item.$Field ) {
$Definition.Information.Field {
if ( $First ) {
write-host ""
write-host "$(($Item | format-table -property $View -AutoSize | Out-String).trim() )" -ForegroundColor $Definition.Information.Color
$First = $false
}
Else {
write-host "$(($Item | format-table -property $View -AutoSize -HideTableHeaders | Out-String).trim() )" -ForegroundColor $Definition.Information.Color
}
}
$Definition.Verbose.Field {
if ( $First ) {
write-host ""
write-host "$(($Item | format-table -property $View -AutoSize | Out-String).trim() )" -ForegroundColor $Definition.Verbose.Color
$First = $false
}
Else {
write-host "$(($Item | format-table -property $View -AutoSize -HideTableHeaders | Out-String).trim() )" -ForegroundColor $Definition.Verbose.Color
}
}
$Definition.Error.Field {
if ( $First ) {
write-host "$(($Item | format-table -property $View -AutoSize | Out-String).trim() )" -ForegroundColor $Definition.Error.Color
$First = $false
}
Else {
write-host "$(($Item | format-table -property $View -AutoSize -HideTableHeaders | Out-String).trim() )" -ForegroundColor $Definition.Error.Color
}
}
$Definition.Warning.Field {
if ( $First ) {
write-host "$(($Item | format-table -property $View -AutoSize | Out-String).trim() )" -ForegroundColor $Definition.Warning.Color
$First = $false
}
Else {
write-host "$(($Item | format-table -property $View -AutoSize -HideTableHeaders | Out-String).trim() )" -ForegroundColor $Definition.Warning.Color
}
}
Default {
Write-host "$(($Item | format-table -property $View -AutoSize -HideTableHeaders | Out-String).trim() )" -ForegroundColor "White"
}
}
}
}
Else {
if ( $AddRowNumbers ){
$Counter = 1
$Result = @()
foreach ( $item in $Data ) {
$item | Add-Member -MemberType NoteProperty -Name "Num" -Value "$Counter"
$Result += $item
$Counter ++
}
$NewView = @("Num")
$NewView += $View
$Data = $Result
$View = $NewView
}
if ( !$Color ){
$Exclude = "White", "Black", "Yellow", "Red"
$ColorList = [Enum]::GetValues([System.ConsoleColor])
$Basic = $ColorList | where-object {$_ -notlike "Dark*"} | where-object {$_ -notin $Exclude}
$Pairs = @()
foreach ( $Item in $basic ){
$Pairs += ,@("$Item", "Dark$Item")
}
$ColorPair = , @($Pairs) | Get-Random
$Header = $ColorList | where-object {$_ -notin $ColorPair} | get-random
$Color = @($Header)
$Color += $ColorPair
}
if ( $Title ){
write-host "$Title" -ForegroundColor $Color[0] # ($($Color -join(",")))"
write-host ""
}
$Cnt = 1
$FirstCnt = 0
$ColorCount = $Color.Count - 1
$TableData = ( $Data | format-table -property $View -AutoSize | Out-String ).trim().split("`r")
foreach ( $line in $TableData ){
if ( $First ) {
write-host $line -ForegroundColor $Color[0] -NoNewLine
$FirstCnt ++
if ( $FirstCnt -gt 1 ){
$First = $false
}
}
Else {
write-host $line -ForegroundColor $Color[$Cnt] -NoNewLine
}
if ( $Cnt -lt $ColorCount){
$Cnt++
}
Else {
$Cnt = 1
}
}
write-host ""
}
if ( $SelectMessage ){
Write-host ""
Write-Host $SelectMessage -NoNewline -ForegroundColor $Color[0]
$Selected = Read-Host
$SelectedNum = Convert-StringToDigitArray -UserInput $Selected -DataSize $Data.count
$SelectedFields = ($Data | Where-Object { ($Data.IndexOf($_) + 1) -in $SelectedNum }).$SelectField
$SelectedArray = $Data | Where-Object { $_.$SelectField -in $SelectedFields }
Write-Host ""
write-host "Selected items: " -ForegroundColor $Color[0]
$Cnt = 1
$ColorCount = $Color.Count - 1
$TableData = ( $SelectedArray | format-table -property $View -AutoSize | Out-String ).trim().split("`r")
foreach ( $line in $TableData ){
write-host $line -ForegroundColor $Color[$Cnt] -NoNewLine
if ( $Cnt -lt $ColorCount){
$Cnt++
}
Else {
$Cnt = 1
}
}
if ( $AddNewLine ){
Write-host ""
}
return $SelectedArray
}
Else {
if ( $AddNewLine ){
Write-host ""
}
if ( $PassThru ){
return $Result
}
}
}
Function Get-Answer {
<#
.SYNOPSIS
Get answer
.DESCRIPTION
Colored read host with features.
.EXAMPLE
Get-Answer -Title $Title [-ChooseFrom $ChooseFrom] [-DefaultChoose $DefaultChoose] [-Color $Color]
.NOTES
AUTHOR Alexk
CREATED 26.12.20
VER 1
#>
[CmdletBinding()]
param (
[Parameter(Mandatory = $True, Position = 0, HelpMessage = "Title message." )]
[ValidateNotNullOrEmpty()]
[string] $Title,
[Parameter(Mandatory = $false, Position = 1, HelpMessage = "Choose from list." )]
[string[]] $ChooseFrom,
[Parameter(Mandatory = $false, Position = 2, HelpMessage = "Default option." )]
[string] $DefaultChoose,
[Parameter(Mandatory = $false, Position = 3, HelpMessage = "Two view colors." )]
[String[]] $Color,
[Parameter(Mandatory = $false, Position = 4, HelpMessage = "Add new line at the end." )]
[Switch] $AddNewLine
)
$Res = $null
write-host ""
if ( $ChooseFrom ) {
$OptionSeparator = "/"
$ChoseFromString = ""
foreach ( $item in $ChooseFrom ) {
if ( $item.toupper() -ne $DefaultChoose.toupper() ){
$ChoseFromString += "$($item.toupper())$OptionSeparator"
}
Else {
$ChoseFromString += "($($item.toupper()))$OptionSeparator"
}
}
$ChoseFromString = $ChoseFromString.Substring(0,($ChoseFromString.Length-$OptionSeparator.Length))
$Message = "$Title [$ChoseFromString]"
$ChooseFromUpper = @()
foreach ( $item in $ChooseFrom ){
$ChooseFromUpper += $item.ToUpper()
}
if ( $DefaultChoose ){
$ChooseFromUpper += ""
}
while ( $res -notin $ChooseFromUpper ) {
if ( $Color ) {
write-host -object "$Title[" -ForegroundColor $Color[0] -NoNewline
write-host -object "$ChoseFromString" -ForegroundColor $Color[1] -NoNewline
write-host -object "]" -ForegroundColor $Color[0] -NoNewline
}
Else {
write-host -object $Message -NoNewline
}
$res = Read-Host
if ( $DefaultChoose ){
if ( $res -eq "" ) {
$res = $DefaultChoose
}
}
$res = $res.ToUpper()
}
}
Else {
write-host -object $Title -ForegroundColor $Color[0] -NoNewline
$res = Read-Host
}
write-host -object "Selected: " -ForegroundColor $Color[0] -NoNewline
write-host -object "$res" -ForegroundColor $Color[1] -NoNewline
if ( $AddNewLine ){
Write-host ""
}
return $Res
}
Function Start-ProgramNew {
param (
[string] $Program,
[string] $Command,
[string[]] $Arguments,
[string] $Description,
[string] $WorkDir,
[switch] $Evaluate,
[switch] $RunAs
)
Function Start-ProgramProcess {
<#
.SYNOPSIS
Start program
.DESCRIPTION
Function to start os executable file.
.EXAMPLE
Start-ProgramNew -LogFilePath $LogFilePath [-Program $Program] [-Arguments $Arguments] [-Credentials $Credentials] [-WorkDir $WorkDir] [-Evaluate $Evaluate] [-DebugRun $DebugRun] [-Wait $Wait]
.NOTES
AUTHOR Alexk
CREATED 05.11.20
VER 1
#>
[CmdletBinding()]
param (
[Parameter(Mandatory = $false, Position = 0, HelpMessage = "Program path to execute." )]
[ValidateNotNullOrEmpty()]
[string] $Program,
[Parameter(Mandatory = $false, Position = 1, HelpMessage = "Arguments." )]
[string] $Arguments,
[Parameter(Mandatory = $false, Position = 3, HelpMessage = "Working directory." )]
[string] $WorkDir,
[Parameter(Mandatory = $false, Position = 4, HelpMessage = "Use elevated rights." )]
[switch] $Evaluate,
[Parameter(Mandatory = $false, Position = 5, HelpMessage = "Debug run." )]
[switch] $DebugRun,
[Parameter(Mandatory = $false, Position = 6, HelpMessage = "Wait for result." )]
[switch] $Wait
)
$ProcessInfo = New-Object -TypeName System.Diagnostics.ProcessStartInfo
$ProcessInfo.FileName = $Program
$ProcessInfo.UseShellExecute = $false
$ProcessInfo.RedirectStandardError = $true
$ProcessInfo.RedirectStandardOutput = $true
$ProcessInfo.CreateNoWindow = $true
$Message = "User [$([System.Security.Principal.WindowsIdentity]::GetCurrent().Name)]. Starting program [$Program]"
if ($DebugRun){
$Message += ", with debug"
}
if ($Evaluate) {
$Message += ", with evaluate"
$ProcessInfo.Verb = "RunAs"
}
if ($WorkDir) {
$Message += ", use work directory [$WorkDir]"
$ProcessInfo.WorkingDirectory = "$WorkDir"
}
if ($Arguments){
$Message += ", use arguments [$Arguments]"
$ProcessInfo.Arguments = "$Arguments"
}
#Write-host "$Message."
if ($Wait){
$Process = New-Object System.Diagnostics.Process
$Process.StartInfo = $ProcessInfo
$Process.Start() | Out-Null
$Process.WaitForExit()
}
Else {
$Process = New-Object System.Diagnostics.Process
$Process.StartInfo = $ProcessInfo
$Process.Start() | Out-Null
}
Return $Process
}
$PSO = [PSCustomObject]@{
Program = $Program
Arguments = $Arguments
Description = $Description
Command = $null
Object = $null
Output = $null
ErrorOutput = $null
}
if ( $Program ) {
$PSO.Command = get-command $Program -ErrorAction SilentlyContinue
}
if ( $Description ){
write-host $Description -ForegroundColor Green
}
if ( $PSO.Command -or !$Program ) {
if ( $PSO.Command ) {
switch ( $PSO.Command.CommandType ) {
"Application" {
if ( $PSO.Command.path ) {
$ProgPath = $PSO.Command.path
}
Else {
Write-host "Command [$Program] not found!" -ForegroundColor red
exit 1
}
}
Default {
}
}
}
$Output = "$($Env:temp)\Output.txt"
$ErrorOutput = "$($Env:temp)\ErrorOutput.txt"
switch ( $PSO.Command.name ) {
"msiexec.exe" {
$MSIInstallerLogFilePath = "$($Env:TEMP)\msi.log"
$AddLog = $true
foreach ( $item in $Arguments ){
if ( $item.trim() -like "/LIME*"){
$AddLog = $False
}
}
if ( $AddLog ){
$Arguments += "/LIME `"$($MSIInstallerLogFilePath)`""
}
}
"wusa.exe" {
$WUSALogFilePath = "$($Env:TEMP)\wusa.etl"
$AddLog = $true
foreach ( $item in $Arguments ){
if ( $item.trim() -like "/log:*"){
$AddLog = $False
}
}
if ( $AddLog ){
$Arguments += "/log:`"$($WUSALogFilePath)`""
}
}
Default {}
}
#$PSO.Arguments = $Arguments
if ( $Evaluate ){
if ( $Arguments -and $ProgPath) {
$Res = gsudo "Start-Process '$ProgPath' -Wait -PassThru -ArgumentList '$Arguments' -RedirectStandardOutput '$Output' -RedirectStandardError '$ErrorOutput'"
}
Else {
$Command = $Command.Replace("`"","`"`"`"")
$Res = gsudo "$Command"
}
}
else {
if ( $PSO.Command ){
$Params = @{Program = $PSO.Command.Source}
$Params += @{Arguments = $Arguments -join " "}
$Params += @{Wait = $true}
if ( $WorkDir ){
$Params += @{ WorkDir = $WorkDir }
}
if ( $RunAs ) {
$Params += @{ Evaluate = $true }
}
Else {
$Params += @{ Evaluate = $false }
}
$Res = Start-ProgramProcess @Params
}
Else{
$Command = $Command.Replace("`"","`"`"`"")
$PowershellArguments = ""
$PowershellArguments += " -NonInteractive -NoLogo"
$PowershellArguments += " -ExecutionPolicy Bypass –NoProfile -Command `"& {$Command}`""
$Powershell = "powershell.exe"
$Params = @{
Program = $Powershell
Arguments = $PowershellArguments
Wait = $true
}
if ( $WorkDir ){
$Params += @{ WorkDir = $WorkDir }
}
if ( $RunAs ) {
$Params += @{ Evaluate = $true }
}
$Res = Start-ProgramProcess @Params
}
}
if ($Res.HasExited -or $Evaluate -or $RunAs ) {
if ( !$Evaluate ) {
$PSO.Object = $res
$PSO.output = $res.StandardOutput.ReadToEnd()
#Remove-Item -path $Output -Force -ErrorAction SilentlyContinue
$PSO.ErrorOutput = $res.StandardError.ReadToEnd()
#Remove-Item -path $ErrorOutput -Force -ErrorAction SilentlyContinue
switch ( $PSO.Command.name ) {
"msiexec.exe" {
$PSO.output += Get-Content -path $MSIInstallerLogFilePath -ErrorAction SilentlyContinue
Remove-Item -path $MSIInstallerLogFilePath -Force -ErrorAction SilentlyContinue
}
"wusa.exe" {
$PSO.output += (Get-WinEvent -Path $WUSALogFilePath -oldest | out-string)
Remove-Item -path $WUSALogFilePath -Force -ErrorAction SilentlyContinue
$WUSALogFilePath = "$($WUSALogFilePath.Split(".")[0]).dpx"
Remove-Item -path $WUSALogFilePath -Force -ErrorAction SilentlyContinue
}
Default {
}
}
switch ( $Res.ExitCode ) {
0 {
if ( ! $PSO.ErrorOutput ){
Write-host " Successfully finished." -ForegroundColor green
}
Else{
Write-host $PSO.ErrorOutput
}
}
Default {
if ( $PSO.ErrorOutput ) {
write-host "Error output:" -ForegroundColor DarkRed
write-host "=============" -ForegroundColor DarkRed
write-host "$($PSO.ErrorOutput)" -ForegroundColor red
}
write-host ""
if ( $PSO.Output ) {
write-host "Std output:" -ForegroundColor DarkRed
write-host "=============" -ForegroundColor DarkRed
write-host "$($PSO.Output)" -ForegroundColor red
}
}
}
} Else {
$PSO.Object = ""
$PSO.output = Get-Content -path $Output -ErrorAction SilentlyContinue
Remove-Item -path $Output -Force -ErrorAction SilentlyContinue
$PSO.ErrorOutput = Get-Content -path $ErrorOutput -ErrorAction SilentlyContinue
Remove-Item -path $ErrorOutput -Force -ErrorAction SilentlyContinue
switch ( $PSO.Command.name ) {
"msiexec.exe" {
$PSO.output += Get-Content -path $MSIInstallerLogFilePath -ErrorAction SilentlyContinue
Remove-Item -path $MSIInstallerLogFilePath -Force -ErrorAction SilentlyContinue
}
"wusa.exe" {
$PSO.output += (Get-WinEvent -Path $WUSALogFilePath -oldest | out-string)
Remove-Item -path $WUSALogFilePath -Force -ErrorAction SilentlyContinue
$WUSALogFilePath = "$($WUSALogFilePath.Split(".")[0]).dpx"
Remove-Item -path $WUSALogFilePath -Force -ErrorAction SilentlyContinue
}
Default {
}
}
}
}
Else {
Write-host "Error occured!" -ForegroundColor red
}
}
else{
Write-host "Command [$Program] not found!" -ForegroundColor red
}
Return $PSO
}
function Update-Environment {
write-host " Updating environment..." -ForegroundColor Yellow
$env:Path = [System.Environment]::GetEnvironmentVariable("Path","Machine") + ";" + [System.Environment]::GetEnvironmentVariable("Path","User")
}
function Add-ToStartUp {
Param (
[string] $FilePath,
[string] $ShortCutName,
[string] $WorkingDirectory
)
write-host "Adding shortcut [$ShortCutName] to user startup folder"
if ( $FilePath ) {
$UserStartUpFolderPath = "$($Env:APPDATA)\Microsoft\Windows\Start Menu\Programs\Startup"
$WshShell = New-Object -comObject WScript.Shell
$Shortcut = $WshShell.CreateShortcut("$UserStartUpFolderPath\$ShortCutName.lnk")
$Shortcut.TargetPath = $FilePath
#$Shortcut.Arguments = "/iq `"custom.bgi`" /accepteula /timer:0"
$Shortcut.WorkingDirectory = $WorkingDirectory
$Shortcut.Save()
}
}
function New-Folder {
Param (
[string] $FolderPath,
[switch] $Confirm
)
$FolderPathExist = test-path -path $FolderPath
if ( !($FolderPathExist) -or $Confirm ){
try {
if ( $Confirm -and $FolderPathExist ){
$Answer = Get-Answer -Title "Do you want to remove existed folder [$FolderPath]? " -Color "Cyan","DarkMagenta" -AddNewLine -ChooseFrom "y","n" -DefaultChoose "y"
if ( $Answer -eq "Y"){
Remove-Item -path $FolderPath -Force -recurse
New-Item -Path $FolderPath -ItemType Directory | Out-Null
}
}
Else {
New-Item -Path $FolderPath -ItemType Directory | Out-Null
}
}
Catch {
try {
if ( $Confirm ){
if ( $Answer -eq "Y"){
gsudo Remove-Item -path $FolderPath -Force -recurse
gsudo New-Item -Path $FolderPath -ItemType Directory | Out-Null
}
}
Else {
gsudo New-Item -Path $FolderPath -ItemType Directory | Out-Null
}
}
Catch {
Write-host "Folder path [$($FolderPath)] cannot be created! $_" -ForegroundColor Red
}
}
}
Else {
Write-host "Folder path [$($FolderPath)] already exist." -ForegroundColor Green
}
}
function Get-LatestGitHubRelease {
param (
[string] $Programm,
[switch] $Stable
)
$releases_url = "https://api.github.com/repos/$Programm/releases"
$releases = Invoke-RestMethod -uri "$($releases_url)" #?access_token=$($token)
if ( $stable ) {
$LatestRelease = $releases | Where-Object {$_.prerelease -eq $false} | Select-Object -First 1
}
Else {
$LatestRelease = $releases | Select-Object -First 1
}
return $LatestRelease
}
Function Install-Program {
param (
[string] $ProgramName,
[string] $Description,
[string] $GitRepo,
[URI] $DownloadURIx32,
[URI] $DownloadURIx64,
[string] $FilePartX32,
[string] $FilePartX64,
[string] $OSBit,
[switch] $RunAs,
[string] $Installer,
[string[]] $InstallerArguments,
[string] $TempFileFolder = $Env:TEMP,
[switch] $DontRemoveTempFiles,
[switch] $Force
)
$ProgramExist = Get-Command -name $ProgramName -ErrorAction SilentlyContinue
if ( $ProgramExist ){
$IsInstalled = $True
}
Else {
$IsInstalled = $False
}
#$IsInstalled = $False
if ( !$IsInstalled ) {
if ( $Force ){
$Answer = "Y"
}
Else {
$Answer = Get-Answer -Title "Do you want to install $Description" -ChooseFrom "y","n" -DefaultChoose "y" -Color "Cyan","DarkMagenta" -AddNewLine
}
if ( $Answer -eq "Y" ) {
if ( $GitRepo ){
$Release = Get-LatestGitHubRelease -Program $GitRepo -Stable
$GitRepo
switch ($OSBit) {
"32" {
$global:Program = $Release.assets | Where-Object {$_.name -like "*$FilePartX32"}
}
"64" {
$global:Program = $Release.assets | Where-Object {$_.name -like "*$FilePartX64"}
}
Default {}
}
$ProgramSize = $Program.size
[uri] $ProgramURI = $Program.browser_download_url
}
Else {
switch ($OSBit) {
"32" {
$ProgramURI = $DownloadURIx32
}
"64" {
$ProgramURI = $DownloadURIx64
}
Default {}
}
$ProgramURI = [System.Net.HttpWebRequest]::Create( $ProgramURI ).GetResponse()
$ProgramSize = $ProgramURI.contentLength
[uri] $ProgramURI = $ProgramURI.ResponseUri.AbsoluteUri
}
$ProgramFileName = "$TempFileFolder\$(split-path -path $ProgramURI -Leaf)"
write-host " Prepare to install $Description [$(split-path -path $ProgramURI -Leaf)] size [$([math]::round($ProgramSize/ 1mb,2)) MB]." -ForegroundColor "Green"
If ( $ProgramURI ) {
if ( test-path -path $ProgramFileName ){
#Remove-Item -Path $Global:ProgramFileName
}
Else {
Invoke-WebRequest -Uri $ProgramURI -OutFile $ProgramFileName
}
if ( test-path -path $ProgramFileName ){
Unblock-File -path $ProgramFileName
$ReplacedInstallerArguments = @()
foreach( $item in $InstallerArguments ){
$ReplacedInstallerArguments += $item.replace("%FilePath%",$ProgramFileName)
}
$Param = @{}
$Param += @{ Arguments = $ReplacedInstallerArguments }
$Param += @{ Description = " Installing $Description." }
if ( $Installer ){
$Param += @{ Program = $Installer }
}
Else {
$Param += @{ Program = $ProgramFileName }
}
if ( $RunAs ){
$Param += @{ RunAs = $true }
}
$Res = Start-ProgramNew @Param
if ( !$res.ErrorOutput ) {
$res = $true
}
Else {
$res = $false
}
}
Else {
Write-Host "Error downloading file [$ProgramFileName]!" -ForegroundColor Red
$res = $false
}
}
}
}
Else {
$res = $true
}
Return $res
}
function Compare-Version {
param(
[array] $Ver1,
[array] $Ver2
)
#return maximum version
if ( $Ver1.count -le $Ver2.count ){
$MinCount = $Ver1.count
}
Else {
$MinCount = $Ver2.count
}
foreach ( $item in (0..($MinCount-1))) {
if ( $ver1[$item] -gt $ver2[$item] ) {
return $ver1
}
elseif ( $ver2[$item] -gt $ver1[$item] ) {
return $ver2
}
}
return $ver1
}
function Remove-FromStartUp {
Param (
[string] $ShortCutName
)
if ( $ShortCutName ) {
$UserStartUpFolderPath = "$($Env:APPDATA)\Microsoft\Windows\Start Menu\Programs\Startup"
$ShorCutPath = "$UserStartUpFolderPath\$($ShortCutName).lnk"
write-host "Removing shortcut [$ShortCutName] from user startup folder" -ForegroundColor "Green"
remove-item -path $ShorCutPath -Force -ErrorAction SilentlyContinue
}
}
function Install-CustomModule {
param (
[string] $Name,
[string] $ModulePath,
[uri] $ModuleURI,
[switch] $Evaluate
)
if (-not (test-path "$ModulePath\$Name")){
if ((test-path "$ModulePath")){
Set-Location -path $ModulePath
if ( $Evaluate ){
$res = Start-ProgramNew -Program "git" -Arguments @('clone', $ModuleURI ) -Description " Git clone [$ModuleURI]." -Evaluate -WorkDir $ModulePath
#$res = Start-ProgramNew -command "& git clone `"$ModuleURI`"" -Description " Git clone [$ModuleURI]." -RunAs -WorkDir $ModulePath
}
Else {
$res = Start-ProgramNew -Program "git" -Arguments @('clone', $ModuleURI ) -Description " Git clone [$ModuleURI]." -WorkDir $ModulePath
}
if ( $res.ErrorOutput -eq "fatal: destination path 'MyFrameworkInstaller' already exists and is not an empty directory." ){
Write-host " Folder already exist." -ForegroundColor yellow
}
}
Else {
Write-Host " Path [$ModulePath] not found!" -ForegroundColor red
}
}
Else {
Write-Host " Module [$name] on [$modulePath] already exist!" -ForegroundColor green
}
}
function Install-Fonts {
param (
[Parameter(Mandatory = $true)]
[string]$FontFile
)
try {
$FontFileName = split-path -path $FontFile -Leaf
$FontFileNameWithoutExt = $FontFileName.Split(".")[0]
If (!(Test-Path "c:\windows\fonts\$FontFileName")) {
$Extention = $FontFileName.Split(".")[1]
switch ( $Extention ) {
"TTF" {
$FontName = "$FontFileNameWithoutExt (TrueType)"
}
"OTF" {
$FontName = "$FontFileNameWithoutExt (OpenType)"
}
}
#$res = Start-ProgramNew -Command "Copy-Item -Path `"$FontFile`" -Destination `"C:\Windows\Fonts\$FontFileName`" -Force" -RunAs
$res = Start-ProgramNew -Command "Copy-Item -Path `"$FontFile`" -Destination `"C:\Windows\Fonts\$FontFileName`" -Force" -Evaluate
#$res1 = Start-ProgramNew -Command "New-ItemProperty -Name `"$FontName`" -Path `"HKLM:\Software\Microsoft\Windows NT\CurrentVersion\Fonts`" -PropertyType string -Value `"$FontFileName`"" -RunAs
$res = Start-ProgramNew -Command "New-ItemProperty -Name `"$FontName`" -Path `"HKLM:\Software\Microsoft\Windows NT\CurrentVersion\Fonts`" -PropertyType string -Value `"$FontFileName`" -Force" -Evaluate
if ( $res -and $res1 ){
return $true
}
}
}
catch {
write-warning $_.exception.message
return $false
}
}
$Ver = "2.0"
write-host -object "Function version: $Ver"
| 36.544503 | 213 | 0.483754 |
2a05e51f9b07196decc198cdde789b8f1dfbb5f7 | 4,575 | java | Java | bigquery/src/test/java/com/google/cloud/hadoop/io/bigquery/mapred/BigQueryMapredOutputCommitterTest.java | AngusDavis/bigdata-interop | 7b3a2151ee35b0f2a12d0521b468a6d074e5e8b9 | [
"Apache-2.0"
] | null | null | null | bigquery/src/test/java/com/google/cloud/hadoop/io/bigquery/mapred/BigQueryMapredOutputCommitterTest.java | AngusDavis/bigdata-interop | 7b3a2151ee35b0f2a12d0521b468a6d074e5e8b9 | [
"Apache-2.0"
] | null | null | null | bigquery/src/test/java/com/google/cloud/hadoop/io/bigquery/mapred/BigQueryMapredOutputCommitterTest.java | AngusDavis/bigdata-interop | 7b3a2151ee35b0f2a12d0521b468a6d074e5e8b9 | [
"Apache-2.0"
] | null | null | null | package com.google.cloud.hadoop.io.bigquery.mapred;
import static org.mockito.Matchers.any;
import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.verifyNoMoreInteractions;
import org.apache.hadoop.mapred.JobContext;
import org.apache.hadoop.mapred.TaskAttemptContext;
import org.apache.hadoop.mapreduce.JobStatus.State;
import org.junit.After;
import org.junit.Before;
import org.junit.Rule;
import org.junit.Test;
import org.junit.rules.ExpectedException;
import org.junit.runner.RunWith;
import org.junit.runners.JUnit4;
import org.mockito.Mock;
import org.mockito.MockitoAnnotations;
import java.io.IOException;
/**
* Unit tests for {@link BigQueryMapredOutputCommitter}.
*/
@RunWith(JUnit4.class)
public class BigQueryMapredOutputCommitterTest {
@Rule public ExpectedException expectedException = ExpectedException.none();
@Mock private JobContext mockJobContext;
@Mock private TaskAttemptContext mockTaskAttemptContext;
@Mock private org.apache.hadoop.mapreduce.OutputCommitter mockOutputCommitter;
@Before public void setUp() {
MockitoAnnotations.initMocks(this);
}
@After public void tearDown() {
verifyNoMoreInteractions(mockJobContext);
verifyNoMoreInteractions(mockTaskAttemptContext);
verifyNoMoreInteractions(mockOutputCommitter);
}
@Test public void testAbortJob() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
int status = 1;
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.abortJob(mockJobContext, status);
verify(mockOutputCommitter).abortJob(
any(JobContext.class), any(State.class));
}
@Test public void testAbortJobBadStatus() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
int status = -1;
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
expectedException.expect(IllegalArgumentException.class);
outputCommitter.abortJob(mockJobContext, status);
}
@Test public void testAbortTask() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.abortTask(mockTaskAttemptContext);
verify(mockOutputCommitter).abortTask(any(TaskAttemptContext.class));
}
@Test public void testCleanupJob() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.cleanupJob(mockJobContext);
verify(mockOutputCommitter).cleanupJob(any(JobContext.class));
}
@Test public void testCommitJob() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.commitJob(mockJobContext);
verify(mockOutputCommitter).commitJob(any(JobContext.class));
}
@Test public void testCommitTask() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.commitTask(mockTaskAttemptContext);
verify(mockOutputCommitter).commitTask(any(TaskAttemptContext.class));
}
@Test public void testNeedsTaskCommit() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.needsTaskCommit(mockTaskAttemptContext);
verify(mockOutputCommitter).needsTaskCommit(any(TaskAttemptContext.class));
}
@Test public void testSetupJob() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.setupJob(mockJobContext);
verify(mockOutputCommitter).setupJob(any(JobContext.class));
}
@Test public void testSetupTask() throws IOException {
BigQueryMapredOutputCommitter outputCommitter =
new BigQueryMapredOutputCommitter();
outputCommitter.setMapreduceOutputCommitter(mockOutputCommitter);
outputCommitter.setupTask(mockTaskAttemptContext);
verify(mockOutputCommitter).setupTask(any(TaskAttemptContext.class));
}
}
| 33.639706 | 80 | 0.794317 |
d9d425a214f0df431ca879085e543310030e9fbe | 1,972 | kt | Kotlin | src/main/kotlin/com/jcs/suadeome/professionals/ProfessionalRepository.kt | jcsantosbr/suadeome-backendjvm | bf41f5775126fed2900da3f1185d57506b8c9358 | [
"MIT"
] | null | null | null | src/main/kotlin/com/jcs/suadeome/professionals/ProfessionalRepository.kt | jcsantosbr/suadeome-backendjvm | bf41f5775126fed2900da3f1185d57506b8c9358 | [
"MIT"
] | 6 | 2017-01-24T23:20:23.000Z | 2017-01-29T15:22:00.000Z | src/main/kotlin/com/jcs/suadeome/professionals/ProfessionalRepository.kt | jcsantosbr/suadeome-backendjvm | bf41f5775126fed2900da3f1185d57506b8c9358 | [
"MIT"
] | null | null | null | package com.jcs.suadeome.professionals
import com.jcs.suadeome.services.Service
import com.jcs.suadeome.types.Id
import org.skife.jdbi.v2.Handle
import java.util.*
class ProfessionalRepository(val openHandle: Handle) {
fun professionalsByService(services: List<Service>): List<Professional> {
if (services.isEmpty()) return Collections.emptyList()
val placeHolders = services.mapIndexed { i, service -> ":id$i" }.joinToString(",")
val whereClause = if (placeHolders.isBlank()) "" else "WHERE service_id IN ( $placeHolders )"
val query = openHandle.createQuery("""
SELECT id, name, phone, service_id
FROM professionals
$whereClause
ORDER BY name
""")
services.forEachIndexed { i, service ->
query.bind("id$i", service.id.value)
}
val rows = query.list()
val professionals = rows.map { rowToProfessional(it) }
return professionals
}
private fun rowToProfessional(row: Map<String, Any>): Professional {
val id = Id(row["id"].toString())
val name = row["name"].toString()
val phone = PhoneNumber(row["phone"].toString())
val serviceId = Id(row["service_id"].toString())
return Professional(id, name, phone, serviceId)
}
fun createProfessional(professional: Professional) {
val query = """
INSERT INTO professionals (id, name, phone, service_id, created_by, created_at)
VALUES (:id, :name, :phone, :serviceId, :user, :now)
"""
openHandle.createStatement(query)
.bind("id", professional.id.value)
.bind("name", professional.name)
.bind("phone", professional.phone.number)
.bind("serviceId", professional.serviceId.value)
.bind("user", 1)
.bind("now", Date())
.execute()
}
}
| 31.806452 | 101 | 0.592292 |
790b93b04ff63d9865707b4462ddaa075fff7ca2 | 639 | asm | Assembly | programs/oeis/156/A156863.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 22 | 2018-02-06T19:19:31.000Z | 2022-01-17T21:53:31.000Z | programs/oeis/156/A156863.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 41 | 2021-02-22T19:00:34.000Z | 2021-08-28T10:47:47.000Z | programs/oeis/156/A156863.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 5 | 2021-02-24T21:14:16.000Z | 2021-08-09T19:48:05.000Z | ; A156863: Denominator of Euler(n, 1/22).
; 1,11,484,5324,234256,2576816,113379904,1247178944,54875873536,603634608896,26559922791424,292159150705664,12855002631049216,141405028941541376,6221821273427820544,68440034007706025984,3011361496339065143296,33124976459729716576256,1457498964228107529355264,16032488606509182822907904,705429498686404044207947776,7759724485550444486287425536,341427877364219557396646723584,3755706651006415131363113959424,165251092644282265779977014214656,1817762019087104923579747156361216,79981528839832616637508874879893504,879796817238158783012597623678828544
mov $2,22
pow $2,$0
gcd $0,2
mul $0,$2
div $0,2
| 71 | 547 | 0.896714 |
382858f850ae71716dc76476a68e054b9326b30b | 14,257 | swift | Swift | EnjPodTest_01/Classes/Extension/SwiftExtensions.swift | zzenjolras/EnjTest_01 | fcfb482afa1dd1b28fbabe9335f367419f898f9a | [
"MIT"
] | null | null | null | EnjPodTest_01/Classes/Extension/SwiftExtensions.swift | zzenjolras/EnjTest_01 | fcfb482afa1dd1b28fbabe9335f367419f898f9a | [
"MIT"
] | null | null | null | EnjPodTest_01/Classes/Extension/SwiftExtensions.swift | zzenjolras/EnjTest_01 | fcfb482afa1dd1b28fbabe9335f367419f898f9a | [
"MIT"
] | null | null | null | ////
//// SwiftExtensions.swift
//// Yeting
////
//// Created by GYz on 2018/4/12.
//// Copyright © 2018年 GYz. All rights reserved.
////
//
//import Foundation
//
//extension String {
//
// /**
// * 是否包含字符串
// */
// func contains(find: String) -> Bool {
// return self.range(of: find) != nil
// }
//
// func containsIgnoringCase(find: String) -> Bool {
// return self.range(of: find, options: .caseInsensitive) != nil
// }
//
// var hexColor: UIColor {
// let hex = trimmingCharacters(in: CharacterSet.alphanumerics.inverted)
// var int = UInt32()
// Scanner(string: hex).scanHexInt32(&int)
// let a, r, g, b: UInt32
// switch hex.characters.count {
// case 3: // RGB (12-bit)
// (a, r, g, b) = (255, (int >> 8) * 17, (int >> 4 & 0xF) * 17, (int & 0xF) * 17)
// case 6: // RGB (24-bit)
// (a, r, g, b) = (255, int >> 16, int >> 8 & 0xFF, int & 0xFF)
// case 8: // ARGB (32-bit)
// (a, r, g, b) = (int >> 24, int >> 16 & 0xFF, int >> 8 & 0xFF, int & 0xFF)
// default:
// return .clear
// }
// return UIColor(red: CGFloat(r) / 255.0, green: CGFloat(g) / 255.0, blue: CGFloat(b) / 255.0, alpha: CGFloat(a) / 255.0)
// }
//
// func range(from nsRange: NSRange) -> Range<String.Index>? {
// guard
// let from16 = utf16.index(utf16.startIndex, offsetBy: nsRange.location, limitedBy: utf16.endIndex),
// let to16 = utf16.index(from16, offsetBy: nsRange.length, limitedBy: utf16.endIndex),
// let from = String.Index(from16, within: self),
// let to = String.Index(to16, within: self)
// else { return nil }
// return from ..< to
// }
//
// func nsRange(from range: Range<String.Index>) -> NSRange? {
// let utf16view = self.utf16
// if let from = range.lowerBound.samePosition(in: utf16view), let to = range.upperBound.samePosition(in: utf16view) {
// return NSMakeRange(utf16view.distance(from: utf16view.startIndex, to: from), utf16view.distance(from: from, to: to))
// }
// return nil
// }
//
// func heightWithConstrainedWidth(width: CGFloat, font: UIFont) -> CGFloat {
// let constraintRect = CGSize(width: width, height: CGFloat.greatestFiniteMagnitude)
// let boundingBox = self.boundingRect(with: constraintRect, options: NSStringDrawingOptions.usesLineFragmentOrigin, attributes: [.font: font], context: nil)
// return boundingBox.height
// }
//
// func widthWithConstrainedHeight(height: CGFloat, font: UIFont) -> CGFloat{
// let constraintRect = CGSize(width: CGFloat.greatestFiniteMagnitude, height:height)
// let boundingBox = self.boundingRect(with: constraintRect, options: NSStringDrawingOptions.usesLineFragmentOrigin, attributes: [.font: font], context: nil)
// return boundingBox.width
// }
//
// //根据开始位置和长度截取字符串
// func subString(start:Int = 0, length:Int = -1) -> String {
// var len = length
// if len == -1 {
// len = self.count - start
// }
// let st = self.index(startIndex, offsetBy:start)
// let en = self.index(st, offsetBy:len)
// return String(self[st ..< en])
// }
//
//
// /// 计算字符串个数
// ///
// /// - Parameters:
// /// - textStr: 需要计算的字符串
// /// - textFont: 字符串大小
// /// - textRect: 需计算的范围
// /// - Returns: 结果范围
// func getLineTextRangeWith(textStr: String,textFont: UIFont, textRect: CGRect) -> NSRange {
// let attributes = NSMutableDictionary(capacity: 5)
// let font = textFont
// attributes.setValue(font, forKey: NSAttributedStringKey.font.rawValue)
// let attributedString = NSAttributedString(string: textStr, attributes: attributes as? [NSAttributedStringKey : Any])
// let framesetter = CTFramesetterCreateWithAttributedString(attributedString)
// let bezierPath = UIBezierPath(rect: textRect)
// let frame = CTFramesetterCreateFrame(framesetter, CFRangeMake(0, 0), bezierPath.cgPath, nil)
// let range = CTFrameGetVisibleStringRange(frame)
// let rg = NSMakeRange(range.location, range.length)
// return rg
// }
//
// /// JSONString转换为字典
// static func getDictionaryFromJSONString(jsonString:String) ->NSDictionary {
//
// let jsonData:Data = jsonString.data(using: .utf8)!
//
// let dict = try? JSONSerialization.jsonObject(with: jsonData, options: .mutableContainers)
// if dict != nil {
// return dict as! NSDictionary
// }
// return NSDictionary()
// }
//
//
//}
//
//
//extension UIColor{
// convenience init(rgb:Int){
// let r = CGFloat(((rgb & 0xFF0000)>>16)) / CGFloat(255.0)
// let g = CGFloat(((rgb & 0xFF00)>>8)) / CGFloat(255.0)
// let b = CGFloat(((rgb & 0xFF))) / CGFloat(255.0)
// self.init(red: r, green: g, blue: b, alpha: 1.0)
// }
//
//
// class func colorWithHexString(hex:String,alpha:Float = 1) -> UIColor {
//
// var cString = hex.trimmingCharacters(in:CharacterSet.whitespacesAndNewlines).uppercased()
//
// if (cString.hasPrefix("#")) {
// let index = cString.index(cString.startIndex, offsetBy:1)
// cString = cString.substring(from: index)
// }
//
// if (cString.characters.count != 6) {
// return UIColor.red
// }
//
// let rIndex = cString.index(cString.startIndex, offsetBy: 2)
// let rString = cString.substring(to: rIndex)
// let otherString = cString.substring(from: rIndex)
// let gIndex = otherString.index(otherString.startIndex, offsetBy: 2)
// let gString = otherString.substring(to: gIndex)
// let bIndex = cString.index(cString.endIndex, offsetBy: -2)
// let bString = cString.substring(from: bIndex)
// var r:CUnsignedInt = 0, g:CUnsignedInt = 0, b:CUnsignedInt = 0
// Scanner(string: rString).scanHexInt32(&r)
// Scanner(string: gString).scanHexInt32(&g)
// Scanner(string: bString).scanHexInt32(&b)
//
// return UIColor(red: CGFloat(r) / 255.0, green: CGFloat(g) / 255.0, blue: CGFloat(b) / 255.0, alpha: CGFloat(alpha))
// }
//
//}
//
//extension UIButton {
// /// 设置 - 边框 & 文字 为相同颜色
// func setColor(same color: UIColor) {
// setTitleColor(color, for: .normal)
// borderColor = color
// }
//
// /// 水平排列，文字在左，图片在右
// ///
// /// - Parameter space: 文字和图片间隔
//
// func setTitleImageHorizontalAlignmentWithSpace(space: Float) {
// resetEdgeInsets()
// setNeedsLayout()
// layoutIfNeeded()
//
// let contentRect: CGRect = self.contentRect(forBounds: bounds)
// let titleSize: CGSize = self.titleRect(forContentRect: contentRect).size
// let imageSize: CGSize = self.imageRect(forContentRect: contentRect).size
// contentEdgeInsets = UIEdgeInsetsMake(0, 0, 0, CGFloat(space))
// titleEdgeInsets = UIEdgeInsetsMake(0, -imageSize.width, 0, imageSize.width)
// imageEdgeInsets = UIEdgeInsetsMake(0, titleSize.width + CGFloat(space), 0, -titleSize.width - CGFloat(space))
// }
//
//
// /// 水平排列，图片在左，文字在右
// ///
// /// - Parameter space: 图片和文字间隔
// func setImageTitleHorizontalAlignmentWithSpace(space: Float) {
// resetEdgeInsets()
// titleEdgeInsets = UIEdgeInsetsMake(0, CGFloat(space), 0, -CGFloat(space))
// contentEdgeInsets = UIEdgeInsetsMake(0, 0, 0, CGFloat(space))
// }
//
//
// /// 竖直排列，文字在上，图片在下
// ///
// /// - Parameter space: 文字和图片的间距
// func setTitleImageVerticalAlignmentWithSpace(space: Float) {
// verticalAlignmentWithTitleTop(isTop: true, space: space)
// }
//
//
// /// 竖直排列，图片在上，文字在下
// ///
// /// - Parameter space: 图片和文字的间距
// func setImageTitleVerticalAlignmentWithSpace(space: Float) {
// verticalAlignmentWithTitleTop(isTop: false, space: space)
// }
//
// private func resetEdgeInsets() {
// contentEdgeInsets = UIEdgeInsets.zero
// imageEdgeInsets = UIEdgeInsets.zero
// titleEdgeInsets = UIEdgeInsets.zero
// }
//
// private func verticalAlignmentWithTitleTop(isTop: Bool, space: Float) {
// resetEdgeInsets()
// setNeedsLayout()
// layoutIfNeeded()
//
// let contentRect: CGRect = self.contentRect(forBounds: bounds)
// let titleSize: CGSize = self.titleRect(forContentRect: contentRect).size
// let imageSize: CGSize = self.imageRect(forContentRect: contentRect).size
//
// let halfWidth: CGFloat = (titleSize.width + imageSize.width) / 2
// let halfHeight: CGFloat = (titleSize.height + imageSize.height) / 2
//
// let topInset = min(halfHeight, titleSize.height)
// let leftInset = (titleSize.width - imageSize.width) > 0 ? (titleSize.width - imageSize.width) / 2 : 0
// let bottomInset = (titleSize.height - imageSize.height) > 0 ? (titleSize.height - imageSize.height) / 2 : 0
// let rightInset = min(halfWidth, titleSize.width)
//
// if isTop {
// self.titleEdgeInsets = UIEdgeInsetsMake(-halfHeight - CGFloat(space), -halfWidth, halfHeight + CGFloat(space), halfWidth)
// self.contentEdgeInsets = UIEdgeInsetsMake(CGFloat(topInset) + CGFloat(space), leftInset, -bottomInset, -rightInset)
// }
// else {
// self.titleEdgeInsets = UIEdgeInsetsMake(halfHeight + CGFloat(space), -halfWidth, -halfHeight - CGFloat(space), halfWidth)
// self.contentEdgeInsets = UIEdgeInsetsMake(-bottomInset, leftInset, topInset + CGFloat(space), -rightInset)
// }
// }
//}
//
////MARK: - UIDevice延展
//public extension UIDevice {
//
// var modelName: String {
// var systemInfo = utsname()
// uname(&systemInfo)
// let machineMirror = Mirror(reflecting: systemInfo.machine)
// let identifier = machineMirror.children.reduce("") { identifier, element in
// guard let value = element.value as? Int8, value != 0 else { return identifier }
// return identifier + String(UnicodeScalar(UInt8(value)))
// }
//
// switch identifier {
// case "iPod1,1": return "iPod Touch 1"
// case "iPod2,1": return "iPod Touch 2"
// case "iPod3,1": return "iPod Touch 3"
// case "iPod4,1": return "iPod Touch 4"
// case "iPod5,1": return "iPod Touch (5 Gen)"
// case "iPod7,1": return "iPod Touch 6"
//
// case "iPhone3,1", "iPhone3,2", "iPhone3,3": return "iPhone 4"
// case "iPhone4,1": return "iPhone 4s"
// case "iPhone5,1": return "iPhone 5"
// case "iPhone5,2": return "iPhone 5 (GSM+CDMA)"
// case "iPhone5,3": return "iPhone 5c (GSM)"
// case "iPhone5,4": return "iPhone 5c (GSM+CDMA)"
// case "iPhone6,1": return "iPhone 5s (GSM)"
// case "iPhone6,2": return "iPhone 5s (GSM+CDMA)"
// case "iPhone7,2": return "iPhone 6"
// case "iPhone7,1": return "iPhone 6 Plus"
// case "iPhone8,1": return "iPhone 6s"
// case "iPhone8,2": return "iPhone 6s Plus"
// case "iPhone8,4": return "iPhone SE"
// case "iPhone9,1": return "国行、日版、港行iPhone 7"
// case "iPhone9,2": return "港行、国行iPhone 7 Plus"
// case "iPhone9,3": return "美版、台版iPhone 7"
// case "iPhone9,4": return "美版、台版iPhone 7 Plus"
// case "iPhone10,1","iPhone10,4": return "iPhone 8"
// case "iPhone10,2","iPhone10,5": return "iPhone 8 Plus"
// case "iPhone10,3","iPhone10,6": return "iPhone X"
//
// case "iPad1,1": return "iPad"
// case "iPad1,2": return "iPad 3G"
// case "iPad2,1", "iPad2,2", "iPad2,3", "iPad2,4": return "iPad 2"
// case "iPad2,5", "iPad2,6", "iPad2,7": return "iPad Mini"
// case "iPad3,1", "iPad3,2", "iPad3,3": return "iPad 3"
// case "iPad3,4", "iPad3,5", "iPad3,6": return "iPad 4"
// case "iPad4,1", "iPad4,2", "iPad4,3": return "iPad Air"
// case "iPad4,4", "iPad4,5", "iPad4,6": return "iPad Mini 2"
// case "iPad4,7", "iPad4,8", "iPad4,9": return "iPad Mini 3"
// case "iPad5,1", "iPad5,2": return "iPad Mini 4"
// case "iPad5,3", "iPad5,4": return "iPad Air 2"
// case "iPad6,3", "iPad6,4": return "iPad Pro 9.7"
// case "iPad6,7", "iPad6,8": return "iPad Pro 12.9"
// case "AppleTV2,1": return "Apple TV 2"
// case "AppleTV3,1","AppleTV3,2": return "Apple TV 3"
// case "AppleTV5,3": return "Apple TV 4"
// case "i386", "x86_64": return "Simulator"
// default: return identifier
// }
// }
//}
//
//
////extension UIScrollView {
//// open override func touchesBegan(_ touches: Set<UITouch>, with event: UIEvent?) {
//// next?.touchesBegan(touches, with: event)
//// }
//// open override func touchesMoved(_ touches: Set<UITouch>, with event: UIEvent?) {
//// next?.touchesMoved(touches, with: event)
//// }
//// open override func touchesEnded(_ touches: Set<UITouch>, with event: UIEvent?) {
//// next?.touchesEnded(touches, with: event)
//// }
////}
//
////extension UIViewController {
//// func getCurrentVCFrom(<#parameters#>) -> <#return type#> {
//// <#function body#>
//// }
////}
//
//
///**
// 向tableView 注册 UITableViewCell
//
// - parameter tableView: tableView
// - parameter cell: 要注册的类名
// */
//func regClass(_ tableView:UITableView , cell:AnyClass)->Void {
// tableView.register( cell, forCellReuseIdentifier: "\(cell)");
//}
///**
// 从tableView缓存中取出对应类型的Cell
// 如果缓存中没有，则重新创建一个
//
// - parameter tableView: tableView
// - parameter cell: 要返回的Cell类型
// - parameter indexPath: 位置
//
// - returns: 传入Cell类型的 实例对象
// */
//func getCell<T: UITableViewCell>(_ tableView:UITableView ,cell: T.Type ,indexPath:IndexPath) -> T {
// return tableView.dequeueReusableCell(withIdentifier: "\(cell)", for: indexPath) as! T ;
//}
//
| 40.851003 | 164 | 0.586729 |
1947bf40f30762b0f843b44caecdad9d28d8aa4d | 413 | swift | Swift | WaterLogging/WaterPickerView.swift | LucasBest/WaterLogging | 0d0677b5720001dc898664ca6e32ea3ec0cb2bcb | [
"MIT"
] | null | null | null | WaterLogging/WaterPickerView.swift | LucasBest/WaterLogging | 0d0677b5720001dc898664ca6e32ea3ec0cb2bcb | [
"MIT"
] | null | null | null | WaterLogging/WaterPickerView.swift | LucasBest/WaterLogging | 0d0677b5720001dc898664ca6e32ea3ec0cb2bcb | [
"MIT"
] | null | null | null | //
// WaterPickerView.swift
// WaterLogging
//
// Created by Lucas Best on 6/22/20.
// Copyright © 2020 Apple. All rights reserved.
//
import UIKit
class WaterPickerView: UIView {
/*
// Only override draw() if you perform custom drawing.
// An empty implementation adversely affects performance during animation.
override func draw(_ rect: CGRect) {
// Drawing code
}
*/
}
| 18.772727 | 78 | 0.656174 |
c20022d5f173371312a333cbf7b60f7897eac16b | 1,386 | go | Go | packets/unsuback.go | andschneider/goqtt | 30227f107ff89e3dfabae024771d47a46d7c6757 | [
"MIT"
] | null | null | null | packets/unsuback.go | andschneider/goqtt | 30227f107ff89e3dfabae024771d47a46d7c6757 | [
"MIT"
] | 3 | 2020-08-05T04:34:38.000Z | 2020-08-24T20:33:57.000Z | packets/unsuback.go | andschneider/goqtt | 30227f107ff89e3dfabae024771d47a46d7c6757 | [
"MIT"
] | null | null | null | package packets
import (
"bytes"
"fmt"
"io"
)
type UnsubackPacket struct {
FixedHeader
MessageId []byte
}
var unsubackType = PacketType{
name: "UNSUBACK",
packetId: 176,
}
// Name returns the packet type name.
func (ua *UnsubackPacket) Name() string {
return ua.name
}
// CreatePacket creates a new packet with the appropriate FixedHeader.
// It sets default values where needed as well.
func (ua *UnsubackPacket) CreatePacket() {
ua.FixedHeader = FixedHeader{PacketType: unsubackType}
ua.MessageId = defaultMessageId
}
func (ua *UnsubackPacket) String() string {
return fmt.Sprintf("%v messageid: %b", ua.FixedHeader, ua.MessageId)
}
// Write creates the bytes.Buffer of the packet and writes them to
// the supplied io.Writer.
func (ua *UnsubackPacket) Write(w io.Writer) error {
var body bytes.Buffer
var err error
body.Write(ua.MessageId)
ua.RemainingLength = body.Len()
packet := ua.WriteHeader()
packet.Write(body.Bytes())
_, err = packet.WriteTo(w)
return err
}
// Read creates the packet from an io.Reader. It assumes that the
// first byte, the packet id, has already been read.
func (ua *UnsubackPacket) Read(r io.Reader) error {
var fh FixedHeader
fh.PacketType = unsubackType
err := fh.read(r)
if err != nil {
return err
}
ua.FixedHeader = fh
ua.MessageId, err = decodeMessageId(r)
if err != nil {
return err
}
return nil
}
| 20.086957 | 70 | 0.715007 |
745374dba1a975971736a2b64d631f23d2e2dfc4 | 833 | html | HTML | demo/index.html | halilb/angular-number-spinner | bba2f1c6ba3c47838c6c385f00ce7e4b2b676396 | [
"MIT"
] | 3 | 2015-03-04T17:49:33.000Z | 2022-01-26T11:18:12.000Z | demo/index.html | halilb/angular-number-spinner | bba2f1c6ba3c47838c6c385f00ce7e4b2b676396 | [
"MIT"
] | null | null | null | demo/index.html | halilb/angular-number-spinner | bba2f1c6ba3c47838c6c385f00ce7e4b2b676396 | [
"MIT"
] | null | null | null | <!DOCTYPE html>
<html>
<head>
<meta name="viewport" content="width=device-width, initial-scale=1.0">
<title>Angular Number Spinner Directive Demo</title>
<link rel="stylesheet" href="css/style.css">
</head>
<body ng-app="NumberSpinnerDemo">
<div ng-controller="DemoController">
<label>Select a value:</label>
<input number-spinner max="maxValue" min="minValue" ng-model="currentNumber" state-changed="stateChanged(state, oldValue)">
<span ng-show="numberTooBig">The number was too big</span>
<span ng-show="numberTooSmall">The number was too small</span>
</div>
<script src="angular/angular.js"></script>
<script src="dist/angular-number-spinner.js"></script>
<script src="demo.js"></script>
<script src="//localhost:35729/livereload.js"></script>
</body>
</html>
| 32.038462 | 131 | 0.67467 |
fa35a346864953e7d0f85c1d903d06cb83319419 | 1,369 | asm | Assembly | Transynther/x86/_processed/AVXALIGN/_st_/i9-9900K_12_0xa0.log_2_1505.asm | ljhsiun2/medusa | 67d769b8a2fb42c538f10287abaf0e6dbb463f0c | [
"MIT"
] | 9 | 2020-08-13T19:41:58.000Z | 2022-03-30T12:22:51.000Z | Transynther/x86/_processed/AVXALIGN/_st_/i9-9900K_12_0xa0.log_2_1505.asm | ljhsiun2/medusa | 67d769b8a2fb42c538f10287abaf0e6dbb463f0c | [
"MIT"
] | 1 | 2021-04-29T06:29:35.000Z | 2021-05-13T21:02:30.000Z | Transynther/x86/_processed/AVXALIGN/_st_/i9-9900K_12_0xa0.log_2_1505.asm | ljhsiun2/medusa | 67d769b8a2fb42c538f10287abaf0e6dbb463f0c | [
"MIT"
] | 3 | 2020-07-14T17:07:07.000Z | 2022-03-21T01:12:22.000Z | .global s_prepare_buffers
s_prepare_buffers:
push %rbp
push %rcx
push %rdi
push %rdx
push %rsi
lea addresses_D_ht+0x1bace, %rsi
lea addresses_WT_ht+0x14f6e, %rdi
nop
sub $8028, %rdx
mov $3, %rcx
rep movsq
nop
nop
sub %rbp, %rbp
pop %rsi
pop %rdx
pop %rdi
pop %rcx
pop %rbp
ret
.global s_faulty_load
s_faulty_load:
push %r12
push %r13
push %r8
push %r9
push %rbx
push %rdi
push %rsi
// Store
mov $0x16df230000000f6e, %rdi
nop
nop
nop
add %r9, %r9
mov $0x5152535455565758, %r8
movq %r8, %xmm7
vmovups %ymm7, (%rdi)
nop
nop
sub %r13, %r13
// Faulty Load
lea addresses_normal+0x1276e, %rsi
sub %r12, %r12
movb (%rsi), %r13b
lea oracles, %r8
and $0xff, %r13
shlq $12, %r13
mov (%r8,%r13,1), %r13
pop %rsi
pop %rdi
pop %rbx
pop %r9
pop %r8
pop %r13
pop %r12
ret
/*
<gen_faulty_load>
[REF]
{'src': {'NT': False, 'same': False, 'congruent': 0, 'type': 'addresses_normal', 'AVXalign': False, 'size': 32}, 'OP': 'LOAD'}
{'OP': 'STOR', 'dst': {'NT': False, 'same': False, 'congruent': 11, 'type': 'addresses_NC', 'AVXalign': False, 'size': 32}}
[Faulty Load]
{'src': {'NT': True, 'same': True, 'congruent': 0, 'type': 'addresses_normal', 'AVXalign': False, 'size': 1}, 'OP': 'LOAD'}
<gen_prepare_buffer>
{'src': {'same': False, 'congruent': 3, 'type': 'addresses_D_ht'}, 'OP': 'REPM', 'dst': {'same': False, 'congruent': 11, 'type': 'addresses_WT_ht'}}
{'34': 2}
34 34
*/
| 18.013158 | 148 | 0.653031 |
33257a0af8469e27f7a0ccf12276dbf023a6e9b0 | 276 | py | Python | pythonx/lints/vim/vint.py | maralla/validator.vim | fd5ec0891cbd035bd572e74d684b8afd852b87bf | [
"MIT"
] | 255 | 2016-09-08T12:12:26.000Z | 2022-03-10T01:50:06.000Z | pythonx/lints/vim/vint.py | maralla/vim-fixup | fd5ec0891cbd035bd572e74d684b8afd852b87bf | [
"MIT"
] | 56 | 2016-09-09T05:53:24.000Z | 2020-11-11T16:02:05.000Z | pythonx/lints/vim/vint.py | maralla/vim-linter | fd5ec0891cbd035bd572e74d684b8afd852b87bf | [
"MIT"
] | 23 | 2016-09-09T13:37:51.000Z | 2019-04-08T22:31:24.000Z | # -*- coding: utf-8 -*-
from validator import Validator
class VimVint(Validator):
__filetype__ = 'vim'
checker = 'vint'
args = '-w --no-color'
regex = r"""
.+?:
(?P<lnum>\d+):
(?P<col>\d+):
\s(?P<text>.+)"""
| 17.25 | 31 | 0.434783 |
fc3dd989c0e5e252895b9f90dc0df646fee8c260 | 77 | css | CSS | www/forum/applications/dashboard/design/slice.css | juan0tron/knoopvszombies | 07f95b4217e3d6313100f492e3b8cea1dd8c904f | [
"MIT"
] | null | null | null | www/forum/applications/dashboard/design/slice.css | juan0tron/knoopvszombies | 07f95b4217e3d6313100f492e3b8cea1dd8c904f | [
"MIT"
] | 5 | 2015-05-10T06:38:03.000Z | 2015-05-10T07:01:35.000Z | www/forum/applications/dashboard/design/slice.css | juan0tron/knoopvszombies | 07f95b4217e3d6313100f492e3b8cea1dd8c904f | [
"MIT"
] | 1 | 2015-05-10T06:22:54.000Z | 2015-05-10T06:22:54.000Z | <?php
header('Content-type: text/css');
?>
div.SliceConfig { display: none; } | 19.25 | 34 | 0.675325 |
4b41d8585104e4ba9218ee81a3255df0a08094ea | 2,591 | html | HTML | pa1-skeleton/pa1-data/9/www.stanford.edu_dept_undergrad_cgi-bin_drupal_ual_AP_univ_req_IHUM_SLE_Living.html | yzhong94/cs276-spring-2019 | a4780a9f88b8c535146040fe11bb513c91c5693b | [
"MIT"
] | null | null | null | pa1-skeleton/pa1-data/9/www.stanford.edu_dept_undergrad_cgi-bin_drupal_ual_AP_univ_req_IHUM_SLE_Living.html | yzhong94/cs276-spring-2019 | a4780a9f88b8c535146040fe11bb513c91c5693b | [
"MIT"
] | null | null | null | pa1-skeleton/pa1-data/9/www.stanford.edu_dept_undergrad_cgi-bin_drupal_ual_AP_univ_req_IHUM_SLE_Living.html | yzhong94/cs276-spring-2019 | a4780a9f88b8c535146040fe11bb513c91c5693b | [
"MIT"
] | null | null | null | the art of living undergraduate academic life skip to main content area home stanford university top links freshman sophomore junior senior coterm transfers summer home academic planning advising academic policies university requirements ihum sle writing & rhetoric pwr major choosing courses choosing majors choosing minors choosing to coterm planning research planning for overseas study planning for honors working with faculty planning for graduate and professional school after stanford tutoring & academic support options & opportunities rights and responsibilities deadlines & events printables for faculty & staff for parents & family ask us give feedback the art of living faculty post doctoral fellows joshua landy department of french & italian kimberly lewis michael mcfall christy pichichero anne pollok kenneth taylor department of philosophy lanier anderson department of philosophy text selections plato symposium william shakespeare hamlet sren kierkegaard fear and trembling friederich nietzsche the gay science toni morrison song of solomon course description whether we realize it or not all of us are forced to make a fundamental choice by deciding what is most valuable to us we decide how we are going to live our life we may opt for a life of reason and knowledge one of faith and discipline one of nature and freedom one of community and altruism or one of originality and style we may even choose to live our lives as though they were works of art in every case hard work is required our lives are not just given to us but need to be made to live well is in fact to practice an art of living where however do such ideals come from how do we adopt and defend them what is required to put them into practice what do we do when they come into conflict with one another and what role do great works of art play in all this the art of living will explore the various ways in which it is possible to live well and beautifully what it takes to implement them and what happens when they come under pressure from inside and out back to top advising appointments deadlines & events ihum links ihum program overview ihum current quarter info ihum courses ihum enrollment and course change information ihum people and contact info faqs related links ihum program website ihum enrollment faqs structured liberal education sle writing and rhetoric pwr boothe essay prize get help with a writing project choosing courses approaching stanford axess vice provost for undergraduate education stanford university all rights reserved stanford ca 94305 site feedback site by wired moon
| 1,295.5 | 2,590 | 0.832497 |
2057c945fd77756afd8328dc4d400b041081858b | 5,432 | dart | Dart | lib/pages/profile/account/exportResultPage.dart | kaigedong/dbcwallet-app | 216245491bf0bf5800024fa08f3fda8dbd3fb1b5 | [
"Apache-2.0"
] | 101 | 2020-11-10T08:28:28.000Z | 2022-03-28T07:30:31.000Z | lib/pages/profile/account/exportResultPage.dart | kaigedong/dbcwallet-app | 216245491bf0bf5800024fa08f3fda8dbd3fb1b5 | [
"Apache-2.0"
] | 95 | 2020-11-27T07:34:52.000Z | 2022-03-29T11:07:27.000Z | lib/pages/profile/account/exportResultPage.dart | kaigedong/dbcwallet-app | 216245491bf0bf5800024fa08f3fda8dbd3fb1b5 | [
"Apache-2.0"
] | 56 | 2020-12-22T18:27:27.000Z | 2022-03-10T07:59:55.000Z | import 'package:app/utils/i18n/index.dart';
import 'package:flutter/cupertino.dart';
import 'package:flutter/material.dart';
import 'package:flutter_screenutil/flutter_screenutil.dart';
import 'package:polkawallet_sdk/storage/types/keyPairData.dart';
import 'package:polkawallet_sdk/utils/i18n.dart';
import 'package:polkawallet_ui/components/v3/back.dart';
import 'package:polkawallet_ui/utils/i18n.dart';
import 'package:polkawallet_ui/utils/index.dart';
class ExportResultPage extends StatelessWidget {
static final String route = '/account/key';
@override
Widget build(BuildContext context) {
final dic = I18n.of(context).getDic(i18n_full_dic_app, 'profile');
final SeedBackupData args = ModalRoute.of(context).settings.arguments;
final hasDerivePath = args.type != 'keystore' && args.seed.contains('/');
String seed = args.seed;
String path = '';
if (hasDerivePath) {
final seedSplit = args.seed.split('/');
seed = seedSplit[0];
path = '/${seedSplit.sublist(1).join('/')}';
}
return Scaffold(
appBar: AppBar(
title: Text(dic['export']), centerTitle: true, leading: BackBtn()),
body: SafeArea(
child: SingleChildScrollView(
physics: BouncingScrollPhysics(),
child: Container(
margin: EdgeInsets.fromLTRB(16.w, 0, 16.w, 16.h),
child: Column(
children: <Widget>[
Visibility(
visible: args.type != 'keystore',
child: Text(dic['export.warn'])),
Row(
mainAxisAlignment: MainAxisAlignment.end,
children: <Widget>[
GestureDetector(
child: Container(
padding: EdgeInsets.fromLTRB(8.w, 8.h, 0, 8.w),
child: Text(
I18n.of(context)
.getDic(i18n_full_dic_ui, 'common')['copy'],
style: TextStyle(
fontSize: 14,
fontFamily: 'TitilliumWeb',
color: Theme.of(context).toggleableActiveColor),
),
),
onTap: () => UI.copyAndNotify(context, seed),
)
],
),
Container(
decoration: BoxDecoration(
color: Colors.white,
border: Border.all(
color: Colors.black12,
width: 1,
),
borderRadius: BorderRadius.all(Radius.circular(4))),
padding: EdgeInsets.all(16),
child: Text(
seed,
style: Theme.of(context).textTheme.headline4,
),
),
Visibility(
visible: hasDerivePath,
child: Column(
crossAxisAlignment: CrossAxisAlignment.start,
children: [
Row(
mainAxisAlignment: MainAxisAlignment.spaceBetween,
crossAxisAlignment: CrossAxisAlignment.end,
children: <Widget>[
Padding(
padding: EdgeInsets.only(top: 16.h, bottom: 8.h),
child: Text(I18n.of(context).getDic(
i18n_full_dic_app, 'account')['path']),
),
GestureDetector(
child: Container(
padding: EdgeInsets.fromLTRB(8.w, 8.h, 0, 8.w),
child: Text(
I18n.of(context).getDic(
i18n_full_dic_ui, 'common')['copy'],
style: TextStyle(
fontSize: 14,
fontFamily: 'TitilliumWeb',
color: Theme.of(context)
.toggleableActiveColor),
),
),
onTap: () => UI.copyAndNotify(context, path),
)
],
),
Container(
decoration: BoxDecoration(
color: Colors.white,
border: Border.all(
color: Colors.black12,
width: 1,
),
borderRadius:
BorderRadius.all(Radius.circular(4))),
padding: EdgeInsets.all(16),
child: Row(
children: [
Text(path,
style: Theme.of(context).textTheme.headline4)
],
),
)
],
)),
],
),
),
),
),
);
}
}
| 41.151515 | 79 | 0.413476 |
cd48778b76c0473cffc62b25cf92896f8cf79ca3 | 376 | swift | Swift | ChuckFacts/Fact/View/Error/Connection/ConnectionErrorViewModel.swift | CalebeEmerick/Chuck-Facts | 192e8cc409b9b50aed6b3b5df4cd4def33d0f4e5 | [
"MIT"
] | null | null | null | ChuckFacts/Fact/View/Error/Connection/ConnectionErrorViewModel.swift | CalebeEmerick/Chuck-Facts | 192e8cc409b9b50aed6b3b5df4cd4def33d0f4e5 | [
"MIT"
] | 3 | 2018-03-06T13:14:35.000Z | 2018-03-21T18:15:48.000Z | ChuckFacts/Fact/View/Error/Connection/ConnectionErrorViewModel.swift | CalebeTest/Chuck-Facts | c90353a7c389b9678f35b67df6b58debb36acd85 | [
"MIT"
] | 1 | 2018-03-22T14:29:21.000Z | 2018-03-22T14:29:21.000Z | //
// ConnectionErrorViewModel.swift
// ChuckFacts
//
// Created by Calebe Emerick on 12/03/2018.
// Copyright © 2018 Stone Pagamentos. All rights reserved.
//
import UIKit
final class ConnectionErrorViewModel {
private let settings: SettingsOpenable
init(settings: SettingsOpenable) {
self.settings = settings
}
func openSettings() {
settings.open()
}
}
| 16.347826 | 59 | 0.720745 |
2905f26b9c4e48211faf7ec64835705149270dbc | 1,389 | py | Python | exerciciosEntrega/exercicioEntrega08.py | igorprati/python_modulo01_entrega | ba35181159c8f7c0916eaea431c591666977f16a | [
"MIT"
] | null | null | null | exerciciosEntrega/exercicioEntrega08.py | igorprati/python_modulo01_entrega | ba35181159c8f7c0916eaea431c591666977f16a | [
"MIT"
] | null | null | null | exerciciosEntrega/exercicioEntrega08.py | igorprati/python_modulo01_entrega | ba35181159c8f7c0916eaea431c591666977f16a | [
"MIT"
] | null | null | null | #08 - Crie um programa que leia nome, ano de nascimento e carteira de trabalho e cadastre-os (com idade) em um dicionário. Se por acaso a CTPS for diferente de 0, o dicionário receberá também o ano de contratação e o salário. Calcule e acrescente , além da idade, com quantos anos a pessoa vai se aposentar. Considere que o trabalhador deve contribuir por 35 anos para se aposentar.
ano = 2021 # ano atual que estamos
dados = dict() # dicionário com os dados do usuário
dados['Nome'] = input('Nome: ') # chave 'Nome' recebe valor
dados['Idade'] = 2021 - int(input('Ano de nascimento: ')) # chave 'Idade' recebe ano de nascimento
dados['CTPS'] = int(input('Carteira de trabalho: ')) # chave 'CTPS' recebe carteira de trabalho
if dados['CTPS'] != 0: # se a carteira de trabalho for diferente de ZERO:
dados['anoContratacao'] = int(input('Ano de contratação: ')) # o programa vai pedir ano de contratação e adicionar à chave 'anoContratacao'
dados['Salário'] = int(input('Salário: ')) # o programa vai pedir salario e adicionar à chave 'Salário'
aposentadoria = (dados['anoContratacao'] + 35) - 1998 # cria uma variável que recebe com quantos anos a pessoa vai se aposentar. Para isso, soma o ano de contratação + 35 anos de serviço - ano de nascimento
print(f'Você irá se aposentar com {aposentadoria} anos.')
else:
print('Não sei quando você vai se aposentar...')
| 81.705882 | 382 | 0.725702 |
542acb65de61b35fec6644de702b1e4cee0f38cb | 1,928 | ps1 | PowerShell | module/Private/GetType.ps1 | Jawz84/EditorServicesCommandSuite | a04d1134ab6e7d2eaef8a94200af18885e11b9f2 | [
"MIT"
] | null | null | null | module/Private/GetType.ps1 | Jawz84/EditorServicesCommandSuite | a04d1134ab6e7d2eaef8a94200af18885e11b9f2 | [
"MIT"
] | null | null | null | module/Private/GetType.ps1 | Jawz84/EditorServicesCommandSuite | a04d1134ab6e7d2eaef8a94200af18885e11b9f2 | [
"MIT"
] | null | null | null | function GetType {
<#
.SYNOPSIS
Get a type info object for any nonpublic or public type.
.DESCRIPTION
Retrieve type info directly from the assembly if nonpublic or from implicitly casting if public.
.INPUTS
System.String
You can pass type names to this function.
.OUTPUTS
System.Type
Returns a Type object if a match is found.
.EXAMPLE
PS C:\> 'System.Management.Automation.SessionStateScope' | GetType
Returns a Type object for SessionStateScope.
#>
[CmdletBinding()]
param (
# Specifies the type name to search for.
[Parameter(Mandatory, ValueFromPipeline)]
[ValidateNotNullOrEmpty()]
[string]
$TypeName
)
begin {
function GetTypeImpl {
param()
end {
if ($type = $TypeName -as [type]) {
return $type
}
$type = [AppDomain]::CurrentDomain.
GetAssemblies().
ForEach{ $PSItem.GetType($TypeName, $false, $true) }.
Where({ $PSItem }, 'First')[0]
if ($type) {
return $type
}
$type = [AppDomain]::CurrentDomain.
GetAssemblies().
GetTypes().
Where({ $PSItem.ToString() -match "$TypeName$" }, 'First')[0]
return $type
}
}
}
process {
if ($type = GetTypeImpl) {
return $type
}
$exception = [PSArgumentException]::new($Strings.TypeNotFound -f $TypeName)
throw [System.Management.Automation.ErrorRecord]::new(
<# exception: #> $exception,
<# errorId: #> 'TypeNotFound',
<# errorCategory: #> 'InvalidArgument',
<# targetObject: #> $TypeName)
}
}
| 29.212121 | 104 | 0.502075 |
1707dd8b273454a2364d2227ac4ccfe04060a309 | 449 | h | C | ch6/priqueue.h | SummerSad/CLRS | 981554d777d8aa84c72484936bd1c95b7f84f297 | [
"MIT"
] | null | null | null | ch6/priqueue.h | SummerSad/CLRS | 981554d777d8aa84c72484936bd1c95b7f84f297 | [
"MIT"
] | null | null | null | ch6/priqueue.h | SummerSad/CLRS | 981554d777d8aa84c72484936bd1c95b7f84f297 | [
"MIT"
] | null | null | null | #include "share.h"
// My implement of max priority queue
// It's based on heap data structures
// It's used for share work, after done we extractMax
// and go to work with their relatives
typedef struct Heap
{
int *arr;
int size;
} Heap;
int heapMax(Heap A);
int heapExtractMax(Heap *A);
void heapIncreaseKey(Heap A, int i, int key); // change A[i] to key
void maxHeapInsert(Heap *A, int key);
Heap *initHeap();
void delHeap(Heap *A);
| 23.631579 | 67 | 0.697105 |
59f41a5970cbe760bc10265465250951b60fe425 | 68,120 | cpp | C++ | packages/utility/core/test/tstFromStringTraits.cpp | bam241/FRENSIE | e1760cd792928699c84f2bdce70ff54228e88094 | [
"BSD-3-Clause"
] | 10 | 2019-11-14T19:58:30.000Z | 2021-04-04T17:44:09.000Z | packages/utility/core/test/tstFromStringTraits.cpp | bam241/FRENSIE | e1760cd792928699c84f2bdce70ff54228e88094 | [
"BSD-3-Clause"
] | 43 | 2020-03-03T19:59:20.000Z | 2021-09-08T03:36:08.000Z | packages/utility/core/test/tstFromStringTraits.cpp | bam241/FRENSIE | e1760cd792928699c84f2bdce70ff54228e88094 | [
"BSD-3-Clause"
] | 6 | 2020-02-12T17:37:07.000Z | 2020-09-08T18:59:51.000Z | //---------------------------------------------------------------------------//
//!
//! \file tstFromStringTraits.cpp
//! \author Alex Robinson
//! \brief FromStringTraits unit tests
//!
//---------------------------------------------------------------------------//
// Std Lib Includes
#include <iostream>
#include <sstream>
#include <type_traits>
// Boost Includes
#define BOOST_TEST_MAIN
#include <boost/test/unit_test.hpp>
#include <boost/mpl/list.hpp>
#include <boost/mpl/insert_range.hpp>
#include <boost/units/systems/cgs/energy.hpp>
#include <boost/units/systems/si/energy.hpp>
// FRENSIE Includes
#include "Utility_FromStringTraits.hpp"
#include "Utility_ElectronVoltUnit.hpp"
#include "Utility_QuantityTraits.hpp"
#include "Utility_UnitTraits.hpp"
using namespace Utility::Units;
namespace si = boost::units::si;
namespace cgs = boost::units::cgs;
//---------------------------------------------------------------------------//
// Template Test Types
//---------------------------------------------------------------------------//
typedef boost::mpl::list<char, signed char, unsigned char> SingleByteTypes;
typedef boost::mpl::list<short, int, long, long long> MultipleByteTypes;
typedef boost::mpl::list<int, unsigned int, long, unsigned long, long long, unsigned long long, float, double> ComplexTestTypes;
template<typename Unit, typename RawTypeWrapper = void>
struct QuantityTypeList
{
typedef boost::mpl::list<boost::units::quantity<Unit,float>, boost::units::quantity<Unit,double> > BasicFloatingPointQuantityTypes;
typedef boost::mpl::list<boost::units::quantity<Unit,int>, boost::units::quantity<Unit,float>, boost::units::quantity<Unit,double> > BasicQuantityTypes;
typedef boost::mpl::list<boost::units::quantity<Unit,std::complex<int> >, boost::units::quantity<Unit,std::complex<float> >, boost::units::quantity<Unit,std::complex<double> > > ComplexQuantityTypes;
typedef typename boost::mpl::insert_range<BasicQuantityTypes, typename boost::mpl::end<BasicQuantityTypes>::type,ComplexQuantityTypes>::type type;
};
template<typename... TypeLists>
struct MergeTypeLists
{ /* ... */ };
template<typename FrontList, typename... TypeLists>
struct MergeTypeLists<FrontList,TypeLists...>
{
private:
typedef typename MergeTypeLists<TypeLists...>::type BackMergedListType;
public:
typedef typename boost::mpl::insert_range<FrontList,typename boost::mpl::end<FrontList>::type,BackMergedListType>::type type;
};
template<typename FrontList>
struct MergeTypeLists<FrontList>
{
typedef FrontList type;
};
typedef typename MergeTypeLists<typename QuantityTypeList<cgs::energy>::BasicFloatingPointQuantityTypes, typename QuantityTypeList<si::energy>::BasicFloatingPointQuantityTypes, typename QuantityTypeList<ElectronVolt>::BasicFloatingPointQuantityTypes, typename QuantityTypeList<KiloElectronVolt>::BasicFloatingPointQuantityTypes>::type TestBasicFloatingPointQuantityTypes;
typedef typename MergeTypeLists<typename QuantityTypeList<cgs::energy>::BasicQuantityTypes, typename QuantityTypeList<si::energy>::BasicQuantityTypes, typename QuantityTypeList<ElectronVolt>::BasicQuantityTypes, typename QuantityTypeList<KiloElectronVolt>::BasicQuantityTypes>::type TestBasicQuantityTypes;
typedef typename MergeTypeLists<typename QuantityTypeList<cgs::energy>::ComplexQuantityTypes, typename QuantityTypeList<si::energy>::ComplexQuantityTypes, typename QuantityTypeList<ElectronVolt>::ComplexQuantityTypes, typename QuantityTypeList<KiloElectronVolt>::ComplexQuantityTypes>::type TestComplexQuantityTypes;
typedef typename MergeTypeLists<typename QuantityTypeList<cgs::energy>::type, typename QuantityTypeList<si::energy>::type, typename QuantityTypeList<ElectronVolt>::type, typename QuantityTypeList<KiloElectronVolt>::type>::type TestQuantityTypes;
//---------------------------------------------------------------------------//
// Tests
//---------------------------------------------------------------------------//
// Check that a string can be created from a string
BOOST_AUTO_TEST_CASE( string_fromString )
{
BOOST_CHECK_EQUAL( Utility::fromString<std::string>( " " ), " " );
BOOST_CHECK_EQUAL( Utility::fromString<std::string>( "testing" ), "testing" );
BOOST_CHECK_EQUAL( Utility::fromString<std::string>( "{{1,0},{-1,2}}" ), "{{1,0},{-1,2}}" );
BOOST_CHECK_EQUAL( Utility::fromString<std::string>( "{ {1,0}, {-1,2} }" ), "{ {1,0}, {-1,2} }" );
}
//---------------------------------------------------------------------------//
// Check that a string can be extracted from a stream
BOOST_AUTO_TEST_CASE( string_fromStream )
{
std::istringstream iss;
iss.str( " " );
std::string string;
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, " " );
iss.str( "testing" );
iss.clear();
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, "testing" );
string.clear();
// Multiple booleans in the same stream with default deliminators
iss.str( "testing-1\ntesting-2\ntesting-3\ntesting-4" );
iss.clear();
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, "testing-1" );
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, "testing-2" );
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, "testing-3" );
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, "testing-4" );
string.clear();
// Multiple booleans in the same stream with white space deliminators
iss.str( "testing-1 testing-2\ttesting-3\ntesting-4" );
iss.clear();
Utility::fromStream( iss, string, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( string, "testing-1" );
Utility::fromStream( iss, string, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( string, "testing-2" );
Utility::fromStream( iss, string, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( string, "testing-3" );
Utility::fromStream( iss, string, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( string, "testing-4" );
string.clear();
// Multiple booleans in the same stream with custom deliminators
iss.str( "testing-1,testing-2" );
iss.clear();
Utility::fromStream( iss, string, "," );
BOOST_CHECK_EQUAL( string, "testing-1" );
string.clear();
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, string );
BOOST_CHECK_EQUAL( string, "testing-2" );
// Multiple string elements in the same stream with container deliminators
iss.str( "{1,0},{-1,2}, {a,b} , {key, {a,b}} }" );
iss.clear();
Utility::fromStream( iss, string, ",}" );
BOOST_CHECK_EQUAL( string, "{1,0}" );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, string, ",}" );
BOOST_CHECK_EQUAL( string, "{-1,2}" );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, string, ",}" );
BOOST_CHECK_EQUAL( string, " {a,b}" );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, string, ",}" );
BOOST_CHECK_EQUAL( string, " {key, {a,b}}" );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
}
//---------------------------------------------------------------------------//
// Check that a LogRecordType can be created from a string
BOOST_AUTO_TEST_CASE( LogRecordType_fromString )
{
Utility::LogRecordType record_type;
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( "Error" ),
Utility::ERROR_RECORD );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( " Error " ),
Utility::ERROR_RECORD );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "error" ),
Utility::StringConversionException );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( "Warning" ),
Utility::WARNING_RECORD );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( " Warning " ),
Utility::WARNING_RECORD );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "warning" ),
Utility::StringConversionException );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( "Notification" ),
Utility::NOTIFICATION_RECORD );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( " Notification " ),
Utility::NOTIFICATION_RECORD );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "notification" ),
Utility::StringConversionException );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( "Details" ),
Utility::DETAILS_RECORD );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( " Details " ),
Utility::DETAILS_RECORD );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "details" ),
Utility::StringConversionException );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( "Pedantic Details" ),
Utility::PEDANTIC_DETAILS_RECORD );
BOOST_CHECK_EQUAL( Utility::fromString<Utility::LogRecordType>( " Pedantic Details " ),
Utility::PEDANTIC_DETAILS_RECORD );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "pedantic Details" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "Pedantic details" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<Utility::LogRecordType>( "pedantic details" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that a LogRecordType can be extracted from a stream
BOOST_AUTO_TEST_CASE( LogRecordType_fromStream )
{
Utility::LogRecordType record_type;
std::istringstream iss( "Error" );
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::ERROR_RECORD );
iss.str( " Error " );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::ERROR_RECORD );
iss.str( "error" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
iss.str( "Warning" );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::WARNING_RECORD );
iss.str( " Warning " );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::WARNING_RECORD );
iss.str( "warning" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
iss.str( "Notification" );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::NOTIFICATION_RECORD );
iss.str( " Notification " );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::NOTIFICATION_RECORD );
iss.str( "notification" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
iss.str( "Details" );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::DETAILS_RECORD );
iss.str( " Details " );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::DETAILS_RECORD );
iss.str( "details" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
iss.str( "Pedantic Details" );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::PEDANTIC_DETAILS_RECORD );
iss.str( " Pedantic Details " );
iss.clear();
Utility::fromStream( iss, record_type );
BOOST_CHECK_EQUAL( record_type, Utility::PEDANTIC_DETAILS_RECORD );
iss.str( "pedantic Details" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
iss.str( "Pedantic details" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
iss.str( "pedantic details" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, record_type ), std::runtime_error );
}
//---------------------------------------------------------------------------//
// Check that a boolean can be created from a string
BOOST_AUTO_TEST_CASE( bool_fromString )
{
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "0" ), false );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "false" ), false );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "False" ), false );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "FaLsE" ), false );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "FALSE" ), false );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "1" ), true );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "true" ), true );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "True" ), true );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "TrUe" ), true );
BOOST_CHECK_EQUAL( Utility::fromString<bool>( "TRUE" ), true );
BOOST_CHECK_THROW( Utility::fromString<bool>( "0 1" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<bool>( "1 false" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<bool>( "2" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<bool>( "abc" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that a boolean can be extracted from a stream
BOOST_AUTO_TEST_CASE( bool_fromStream )
{
std::istringstream iss( "0" );
bool boolean;
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, false );
iss.str( "false" );
iss.clear();
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, false );
iss.str( "1" );
iss.clear();
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, true );
iss.str( "true" );
iss.clear();
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, true );
// Multiple booleans in the same stream with default deliminators
iss.str( "0 1 true false " );
iss.clear();
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, false );
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, true );
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, true );
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, false );
// Multiple booleans in the same stream with custom deliminators
iss.str( "0, true" );
iss.clear();
Utility::fromStream( iss, boolean, "," );
BOOST_CHECK_EQUAL( boolean, false );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, boolean );
BOOST_CHECK_EQUAL( boolean, true );
}
//---------------------------------------------------------------------------//
// Check that single byte integer types can be created from a string
BOOST_AUTO_TEST_CASE_TEMPLATE( byte_fromString, T, SingleByteTypes )
{
BOOST_CHECK_EQUAL( Utility::fromString<T>( " " ), (T)32 );
std::string test_string;
test_string.push_back( '\t' );
BOOST_CHECK_EQUAL( Utility::fromString<T>( test_string ), (T)9 );
test_string.clear();
test_string.push_back( '\n' );
BOOST_CHECK_EQUAL( Utility::fromString<T>( test_string ), (T)10 );
test_string = "-128";
if( std::is_signed<T>::value )
{
BOOST_CHECK_EQUAL( Utility::fromString<T>( test_string ), (T)-128 );
}
else
{
BOOST_CHECK_THROW( Utility::fromString<T>( test_string ),
Utility::StringConversionException );
}
test_string = "127";
BOOST_CHECK_EQUAL( Utility::fromString<T>( test_string ), (T)127 );
test_string = "255";
if( std::is_signed<T>::value )
{
BOOST_CHECK_THROW( Utility::fromString<T>( test_string ),
Utility::StringConversionException );
}
else
{
BOOST_CHECK_EQUAL( Utility::fromString<T>( test_string ), (T)255 );
}
test_string.clear();
BOOST_CHECK_THROW( Utility::fromString<T>( "256" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "0.0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "0.000000000e+00" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "0 0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "ab" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "a b" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that single byte integer types can be created from a stream
BOOST_AUTO_TEST_CASE_TEMPLATE( byte_fromStream, T, SingleByteTypes )
{
std::istringstream iss( " " );
T test_byte;
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)32 );
{
std::string test_string;
test_string.push_back( '\t' );
iss.str( test_string );
iss.clear();
}
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)9 );
{
std::string test_string;
test_string.push_back( '\n' );
iss.str( test_string );
iss.clear();
}
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)10 );
// Multiple bytes in the same stream with no deliminators
iss.str( "-128" );
iss.clear();
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)'-' );
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)'1' );
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)'2' );
Utility::fromStream( iss, test_byte );
BOOST_CHECK_EQUAL( test_byte, (T)'8' );
// Multiple bytes in the same stream with white space deliminators
iss.str( "127" );
iss.clear();
Utility::fromStream( iss, test_byte, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( test_byte, (T)127 );
iss.str( "a 0\n127\t-" );
iss.clear();
Utility::fromStream( iss, test_byte, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( test_byte, (T)'a' );
Utility::fromStream( iss, test_byte, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( test_byte, (T)'0' );
Utility::fromStream( iss, test_byte, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( test_byte, (T)127 );
Utility::fromStream( iss, test_byte, Utility::Details::white_space_delims );
BOOST_CHECK_EQUAL( test_byte, (T)'-' );
// Multiple bytes in the same stream with custom deliminators
iss.str( "a, b, c, d, 127, , -}" );
iss.clear();
Utility::fromStream( iss, test_byte, "," );
BOOST_CHECK_EQUAL( test_byte, (T)'a' );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_byte, "," );
BOOST_CHECK_EQUAL( test_byte, (T)'b' );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_byte, "," );
BOOST_CHECK_EQUAL( test_byte, (T)'c' );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_byte, "," );
BOOST_CHECK_EQUAL( test_byte, (T)'d' );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_byte, "," );
BOOST_CHECK_EQUAL( test_byte, (T)127 );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_byte, "," );
BOOST_CHECK_EQUAL( test_byte, (T)' ' );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_byte, "}" );
BOOST_CHECK_EQUAL( test_byte, (T)'-' );
}
//---------------------------------------------------------------------------//
// Check that signed integer types can be created from a string
BOOST_AUTO_TEST_CASE_TEMPLATE( fromString, T, MultipleByteTypes )
{
BOOST_CHECK_EQUAL( Utility::fromString<T>( "-10" ), -10 );
BOOST_CHECK_EQUAL( Utility::fromString<T>( "0" ), 0 );
BOOST_CHECK_EQUAL( Utility::fromString<T>( " 10 " ), 10 );
BOOST_CHECK_THROW( Utility::fromString<T>( "0.0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "0.000000000e+00" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "0 0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<T>( "abc" ),
Utility::StringConversionException );
// Overflow should result in an error: #(2^63) > 2^63 - 1
BOOST_CHECK_THROW( Utility::fromString<T>( "9223372036854775808" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that signed integer types can be extracted from a stream
BOOST_AUTO_TEST_CASE_TEMPLATE( fromStream, T, MultipleByteTypes )
{
std::istringstream iss( "-10" );
T test_int;
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, -10 );
iss.str( "0" );
iss.clear();
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 0 );
iss.str( " 10 " );
iss.clear();
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 10 );
// Multiple integers in the same stream with default deliminators
iss.str( "-10 0 10 " );
iss.clear();
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, -10 );
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 0 );
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 10 );
// Multiple integers in the same stream with custom deliminators
iss.str( "-10, 1" );
iss.clear();
Utility::fromStream( iss, test_int, "," );
BOOST_CHECK_EQUAL( test_int, -10 );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 1 );
}
//---------------------------------------------------------------------------//
// Check that unsigned integer types can be created from a string
BOOST_AUTO_TEST_CASE_TEMPLATE( unsigned_fromString, T, MultipleByteTypes )
{
typedef typename std::make_unsigned<T>::type UnsignedT;
BOOST_CHECK_EQUAL( Utility::fromString<UnsignedT>( "0" ), 0 );
BOOST_CHECK_EQUAL( Utility::fromString<UnsignedT>( "10" ), 10 );
BOOST_CHECK_EQUAL( Utility::fromString<UnsignedT>( "255" ), 255 );
BOOST_CHECK_THROW( Utility::fromString<UnsignedT>( "-10" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<UnsignedT>( "0.0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<UnsignedT>( "0.000000000e+00" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<UnsignedT>( "-1." ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<UnsignedT>( "1 1" ),
Utility::StringConversionException );
// Overflow should result in an error: #(2^64) > 2^64 - 1
BOOST_CHECK_THROW( Utility::fromString<UnsignedT>( "18446744073709551616" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that unsigned integer types can be extracted from a stream
BOOST_AUTO_TEST_CASE_TEMPLATE( unsigned_fromStream, T, MultipleByteTypes )
{
std::istringstream iss( "0" );
T test_int;
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 0 );
iss.str( "10" );
iss.clear();
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 10 );
iss.str( "255" );
iss.clear();
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 255 );
// Multiple integers in the same stream with default deliminators
iss.str( "0 10 255 " );
iss.clear();
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 0 );
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 10 );
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 255 );
// Multiple integers in the same stream with custom deliminators
iss.str( "255, 1" );
iss.clear();
Utility::fromStream( iss, test_int, "," );
BOOST_CHECK_EQUAL( test_int, 255 );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_int );
BOOST_CHECK_EQUAL( test_int, 1 );
}
//---------------------------------------------------------------------------//
// Check that a float can be created from a string
BOOST_AUTO_TEST_CASE( float_fromString )
{
BOOST_CHECK_EQUAL( Utility::fromString<float>( "1" ), 1.0f );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-1.0" ), -1.0f );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "0.000000000e+00" ), 0.0f );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "inf" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "infinity" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "Inf" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "Infinity" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "InFiNiTy" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "INF" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "INFINITY" ),
std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-inf" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-infinity" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-Inf" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-Infinity" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-InFiNiTy" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-INF" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-INFINITY" ),
-std::numeric_limits<float>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "pi" ),
(float)Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<float>( " Pi" ),
(float)Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<float>( " PI " ),
(float)Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "1*pi" ),
(float)Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "2Pi" ),
2*(float)Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-pI" ),
-(float)Utility::PhysicalConstants::pi );
BOOST_CHECK_CLOSE_FRACTION( Utility::fromString<float>( "-5*pi" ),
-5*(float)Utility::PhysicalConstants::pi,
1e-7 );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "pi/2" ),
(float)Utility::PhysicalConstants::pi/2 );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-pi/2" ),
-(float)Utility::PhysicalConstants::pi/2 );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "pi/3" ),
(float)Utility::PhysicalConstants::pi/3 );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "2pi/3" ),
2*(float)Utility::PhysicalConstants::pi/3 );
BOOST_CHECK_EQUAL( Utility::fromString<float>( "-3pi/7" ),
-3*(float)Utility::PhysicalConstants::pi/7 );
BOOST_CHECK_CLOSE_FRACTION( Utility::fromString<float>( "5*pi/3" ),
5*(float)Utility::PhysicalConstants::pi/3,
1e-7 );
BOOST_CHECK_CLOSE_FRACTION( Utility::fromString<float>( "-5*PI/3" ),
-5*(float)Utility::PhysicalConstants::pi/3,
1e-7 );
BOOST_CHECK_THROW( Utility::fromString<float>( "1.0 1.0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<float>( "1 1" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<float>( "-pi / 2 5*pi/3" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<float>( "1.01.0" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that a float can be extracted from a stream
BOOST_AUTO_TEST_CASE( float_fromStream )
{
std::istringstream iss( "1" );
float test_float;
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, 1.0f );
iss.str( "-1.0" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -1.0f );
iss.str( "0.000000000e+00" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, 0.0f );
iss.str( "inf" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "infinity" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "Inf" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "Infinity" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "InFiNiTy" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "INF" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "INFINITY" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
iss.str( "-inf" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "-infinity" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "-Inf" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "-Infinity" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "-InFiNiTy" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "-INF" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "-INFINITY" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
iss.str( "pi" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi );
iss.str( " Pi" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi );
iss.str( " PI " );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi );
iss.str( "1*pi" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi );
iss.str( "2Pi" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, 2*(float)Utility::PhysicalConstants::pi );
iss.str( "-pI" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -(float)Utility::PhysicalConstants::pi );
iss.str( "-5*pi" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float,
-5*(float)Utility::PhysicalConstants::pi,
1e-7 );
iss.str( "pi/2" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi/2 );
iss.str( "-pi/2" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -(float)Utility::PhysicalConstants::pi/2 );
iss.str( "pi/3" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi/3 );
iss.str( "2pi/3" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, 2*(float)Utility::PhysicalConstants::pi/3 );
iss.str( "-3pi/7" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float,
-3*(float)Utility::PhysicalConstants::pi/7 );
iss.str( "5*pi/3" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float,
5*(float)Utility::PhysicalConstants::pi/3,
1e-7 );
iss.str( "-5*PI/3" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float,
-5*(float)Utility::PhysicalConstants::pi/3,
1e-7 );
// Multiple floats in the same stream with default deliminators
iss.str( "-Pi/2 5*pi/3 -inf INFTY 1.0e+00 -1.00000e+00 0" );
iss.clear();
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float,
-(float)Utility::PhysicalConstants::pi/2,
1e-7 );
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float,
5*(float)Utility::PhysicalConstants::pi/3,
1e-7 );
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, -std::numeric_limits<float>::infinity() );
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, std::numeric_limits<float>::infinity() );
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float, 1.0f, 1e-7 );
Utility::fromStream( iss, test_float );
BOOST_CHECK_CLOSE_FRACTION( test_float, -1.0f, 1e-7 );
Utility::fromStream( iss, test_float );
BOOST_CHECK_SMALL( test_float, 1e-7f );
// Multiple floats in the same stream with custom deliminators
iss.str( "-1, 1.000000000000000000e+00" );
iss.clear();
Utility::fromStream( iss, test_float, "," );
BOOST_CHECK_EQUAL( test_float, -1.0f );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, 1.0f );
iss.str( "-1, 2*pi/3" );
iss.clear();
Utility::fromStream( iss, test_float, "," );
BOOST_CHECK_EQUAL( test_float, -1.0f );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, 2*(float)Utility::PhysicalConstants::pi/3 );
iss.str( "-PI, Pi/2" );
iss.clear();
Utility::fromStream( iss, test_float, "," );
BOOST_CHECK_EQUAL( test_float, -(float)Utility::PhysicalConstants::pi );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_float );
BOOST_CHECK_EQUAL( test_float, (float)Utility::PhysicalConstants::pi/2 );
}
//---------------------------------------------------------------------------//
// Check that a double can be created from a string
BOOST_AUTO_TEST_CASE( double_fromString )
{
BOOST_CHECK_EQUAL( Utility::fromString<double>( "1" ), 1.0 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-1.0" ), -1.0 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "0.000000000000000000e+00" ), 0.0 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "inf" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "infinity" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "Inf" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "Infinity" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "InFiNiTy" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "INF" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "INFINITY" ),
std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-inf" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-infinity" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-Inf" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-Infinity" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-InFiNiTy" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-INF" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-INFINITY" ),
-std::numeric_limits<double>::infinity() );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "pi" ),
Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<double>( " Pi" ),
Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<double>( " PI " ),
Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "1*pi" ),
Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "2Pi" ),
2*Utility::PhysicalConstants::pi );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-pI" ),
-Utility::PhysicalConstants::pi );
BOOST_CHECK_CLOSE_FRACTION( Utility::fromString<double>( "-5*pi" ),
-5*Utility::PhysicalConstants::pi,
1e-7 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "pi/2" ),
Utility::PhysicalConstants::pi/2 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-pi/2" ),
-Utility::PhysicalConstants::pi/2 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "pi/3" ),
Utility::PhysicalConstants::pi/3 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "2pi/3" ),
2*Utility::PhysicalConstants::pi/3 );
BOOST_CHECK_EQUAL( Utility::fromString<double>( "-3pi/7" ),
-3*Utility::PhysicalConstants::pi/7 );
BOOST_CHECK_CLOSE_FRACTION( Utility::fromString<double>( "5*pi/3" ),
5*Utility::PhysicalConstants::pi/3,
1e-7 );
BOOST_CHECK_CLOSE_FRACTION( Utility::fromString<double>( "-5*PI/3" ),
-5*Utility::PhysicalConstants::pi/3,
1e-7 );
BOOST_CHECK_THROW( Utility::fromString<double>( "1.0 1.0" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<double>( "1 1" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<double>( "-pi / 2 5*pi/3" ),
Utility::StringConversionException );
BOOST_CHECK_THROW( Utility::fromString<double>( "1.01.0" ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that a double can be extracted from a stream
BOOST_AUTO_TEST_CASE( double_fromStream )
{
std::istringstream iss( "1" );
double test_double;
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, 1.0 );
iss.str( "-1.0" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -1.0 );
iss.str( "0.000000000000000000e+00" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, 0.0 );
iss.str( "inf" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "infinity" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "Inf" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "Infinity" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "InFiNiTy" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "INF" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "INFINITY" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
iss.str( "-inf" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "-infinity" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "-Inf" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "-Infinity" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "-InFiNiTy" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "-INF" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "-INFINITY" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
iss.str( "pi" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi );
iss.str( " Pi" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi );
iss.str( " PI " );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi );
iss.str( "1*pi" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi );
iss.str( "2Pi" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, 2*Utility::PhysicalConstants::pi );
iss.str( "-pI" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -Utility::PhysicalConstants::pi );
iss.str( "-5*pi" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double,
-5*Utility::PhysicalConstants::pi,
1e-14 );
iss.str( "pi/2" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi/2 );
iss.str( "-pi/2" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -Utility::PhysicalConstants::pi/2 );
iss.str( "pi/3" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi/3 );
iss.str( "2pi/3" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, 2*Utility::PhysicalConstants::pi/3 );
iss.str( "-3pi/7" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double,
-3*Utility::PhysicalConstants::pi/7 );
iss.str( "5*pi/3" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double,
5*Utility::PhysicalConstants::pi/3,
1e-14 );
iss.str( "-5*PI/3" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double,
-5*Utility::PhysicalConstants::pi/3,
1e-14 );
// Multiple doubles in the same stream with default deliminators
iss.str( "-Pi/2 5*pi/3 -inf INFTY 1.0e+00 -1.00000e+00 0" );
iss.clear();
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double,
-Utility::PhysicalConstants::pi/2,
1e-14 );
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double,
5*Utility::PhysicalConstants::pi/3,
1e-14 );
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, -std::numeric_limits<double>::infinity() );
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, std::numeric_limits<double>::infinity() );
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double, 1.0, 1e-14 );
Utility::fromStream( iss, test_double );
BOOST_CHECK_CLOSE_FRACTION( test_double, -1.0, 1e-14 );
Utility::fromStream( iss, test_double );
BOOST_CHECK_SMALL( test_double, 1e-14 );
// Multiple floats in the same stream with custom deliminators
iss.str( "-1, 1.000000000e+00" );
iss.clear();
Utility::fromStream( iss, test_double, "," );
BOOST_CHECK_EQUAL( test_double, -1.0 );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, 1.0 );
iss.str( "-1, 2*pi/3" );
iss.clear();
Utility::fromStream( iss, test_double, "," );
BOOST_CHECK_EQUAL( test_double, -1.0 );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, 2*Utility::PhysicalConstants::pi/3 );
iss.str( "-PI, Pi/2" );
iss.clear();
Utility::fromStream( iss, test_double, "," );
BOOST_CHECK_EQUAL( test_double, -Utility::PhysicalConstants::pi );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, test_double );
BOOST_CHECK_EQUAL( test_double, Utility::PhysicalConstants::pi/2 );
}
//---------------------------------------------------------------------------//
// Check that a std::complex can be created from a string
BOOST_AUTO_TEST_CASE_TEMPLATE( complex_fromString, T, ComplexTestTypes )
{
std::string complex_string = Utility::toString( std::complex<T>(0, 0) );
std::complex<T> complex_value =
Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 0) );
complex_string = Utility::toString( std::complex<T>(1, 0) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 0) );
complex_string = Utility::toString( std::complex<T>(0, 1) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 1) );
complex_string = Utility::toString( std::complex<T>(1, 1) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 1) );
complex_string = Utility::toString( std::complex<T>(2, 2) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(2, 2) );
if( std::is_signed<T>::value )
{
complex_string = Utility::toString( std::complex<T>(-1, 0) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(-1, 0) );
complex_string = Utility::toString( std::complex<T>(0, -1) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, -1) );
complex_string = Utility::toString( std::complex<T>(-1, -1) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(-1, -1) );
complex_string = Utility::toString( std::complex<T>(-2, -2) );
complex_value = Utility::fromString<std::complex<T> >( complex_string );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(-2, -2) );
}
complex_string = std::string("{") + Utility::toString(0) + "," +
Utility::toString(0) + "," + Utility::toString(0) + "}";
BOOST_CHECK_THROW( Utility::fromString<std::complex<T> >( complex_string ),
Utility::StringConversionException );
complex_string = std::string("{") + Utility::toString(0) + "}";
BOOST_CHECK_THROW( Utility::fromString<std::complex<T> >( complex_string ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that a std::complex can be extracted from a stream
BOOST_AUTO_TEST_CASE_TEMPLATE( complex_fromStream, T, ComplexTestTypes )
{
std::istringstream iss;
iss.str( Utility::toString( std::complex<T>(0, 0) ) );
std::complex<T> complex_value;
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 0) );
iss.str( Utility::toString( std::complex<T>(1, 0) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 0) );
iss.str( Utility::toString( std::complex<T>(0, 1) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 1) );
iss.str( Utility::toString( std::complex<T>(1, 1) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 1) );
iss.str( Utility::toString( std::complex<T>(2, 2) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(2, 2) );
// Multiple complex values in the same stream with default deliminators
iss.str( Utility::toString( std::complex<T>(0, 0) ) + " " +
Utility::toString( std::complex<T>(1, 0) ) + " " +
Utility::toString( std::complex<T>(0, 1) ) + " " +
Utility::toString( std::complex<T>(1, 1) ) + "\t" +
Utility::toString( std::complex<T>(2, 2) ) + "\n" +
Utility::toString( std::complex<T>(3, 3) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 0) );
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 0) );
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 1) );
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 1) );
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(2, 2) );
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(3, 3) );
// Multiple complex values in the same stream with custom deliminators
iss.str( Utility::toString( std::complex<T>(0, 0) ) + ", " +
Utility::toString( std::complex<T>(1, 0) ) + " , " +
Utility::toString( std::complex<T>(0, 1) ) + ", " +
Utility::toString( std::complex<T>(1, 1) ) + ",\t" +
Utility::toString( std::complex<T>(2, 2) ) + "," +
Utility::toString( std::complex<T>(3, 3) ) );
iss.clear();
Utility::fromStream( iss, complex_value, "," );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 0) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_value, "," );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 0) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_value, "," );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, 1) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_value, "," );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(1, 1) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_value, "," );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(2, 2) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(3, 3) );
if( std::is_signed<T>::value )
{
iss.str( Utility::toString( std::complex<T>(-1, 0) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(-1, 0) );
iss.str( Utility::toString( std::complex<T>(0, -1) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(0, -1) );
iss.str( Utility::toString( std::complex<T>(-1, -1) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(-1, -1) );
iss.str( Utility::toString( std::complex<T>(-2, -2) ) );
iss.clear();
Utility::fromStream( iss, complex_value );
BOOST_CHECK_EQUAL( complex_value, std::complex<T>(-2, -2) );
}
iss.str( std::string("{") + Utility::toString(0) + "," +
Utility::toString(0) + "," + Utility::toString(0) + "}" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, complex_value ),
Utility::StringConversionException );
iss.str( std::string("{") + Utility::toString(0) + "}" );
iss.clear();
BOOST_CHECK_THROW( Utility::fromStream( iss, complex_value ),
Utility::StringConversionException );
}
//---------------------------------------------------------------------------//
// Check that a boost::units::quantity can be created from a string
BOOST_AUTO_TEST_CASE_TEMPLATE( quantity_fromString,
QuantityType,
TestBasicQuantityTypes )
{
typedef typename Utility::QuantityTraits<QuantityType>::UnitType UnitType;
typedef typename Utility::QuantityTraits<QuantityType>::RawType RawType;
// Basic quantity types
std::string quantity_string =
Utility::toString( QuantityType::from_value(RawType(0)) );
QuantityType quantity =
Utility::fromString<QuantityType>( quantity_string );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(0)) );
quantity_string = Utility::toString( QuantityType::from_value(RawType(1)) );
quantity = Utility::fromString<QuantityType>( quantity_string );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(1)) );
quantity_string = Utility::toString( QuantityType::from_value(RawType(2)) );
quantity = Utility::fromString<QuantityType>( quantity_string );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(2)) );
// Complex quantity types
typedef std::complex<RawType> ComplexRawType;
typedef boost::units::quantity<UnitType,ComplexRawType> ComplexQuantityType;
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, 0)) );
ComplexQuantityType complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, 0)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(1, 0)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(1, 0)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, 1)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, 1)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(1, 1)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(1, 1)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(2, 2)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(2, 2)) );
if( Utility::QuantityTraits<QuantityType>::is_signed::value )
{
// Basic quantity types
quantity_string =
Utility::toString( QuantityType::from_value(RawType(-1)) );
quantity = Utility::fromString<QuantityType>( quantity_string );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(-1)) );
quantity_string =
Utility::toString( QuantityType::from_value(RawType(-2)) );
quantity = Utility::fromString<QuantityType>( quantity_string );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(-2)) );
// Complex quantity types
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(-1, 0)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(-1, 0)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, -1)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, -1)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(-1, -1)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(-1, -1)) );
quantity_string =
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(-2, -2)) );
complex_quantity =
Utility::fromString<ComplexQuantityType>( quantity_string );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(-2, -2)) );
}
}
//---------------------------------------------------------------------------//
// Check that a boost::units::quantity can be extracted from a stream
BOOST_AUTO_TEST_CASE_TEMPLATE( quantity_fromStream,
QuantityType,
TestBasicQuantityTypes )
{
typedef typename Utility::QuantityTraits<QuantityType>::UnitType UnitType;
typedef typename Utility::QuantityTraits<QuantityType>::RawType RawType;
std::istringstream iss;
// Basic quantity types
iss.str( Utility::toString( QuantityType::from_value(RawType(0)) ) );
QuantityType quantity;
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(0)) );
iss.str( Utility::toString( QuantityType::from_value(RawType(1)) ) );
iss.clear();
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(1)) );
iss.str( Utility::toString( QuantityType::from_value(RawType(2)) ) );
iss.clear();
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(2)) );
// Complex quantity types
typedef std::complex<RawType> ComplexRawType;
typedef boost::units::quantity<UnitType,ComplexRawType> ComplexQuantityType;
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, 0)) ) );
iss.clear();
ComplexQuantityType complex_quantity;
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, 0)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(1, 0)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(1, 0)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, 1)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, 1)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(1, 1)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(1, 1)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(2, 2)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(2, 2)) );
// Multiple quantities in the same stream with default deliminators
iss.str( Utility::toString( QuantityType::from_value(RawType(0)) ) + " " +
Utility::toString( QuantityType::from_value(RawType(1)) ) + " " +
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, 0)) ) + "\t" +
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(1, 1)) ) + "\n" +
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(2, 2)) ) );
iss.clear();
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(0)) );
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(1)) );
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, 0)) );
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(1, 1)) );
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(2, 2)) );
// Multiple quantities in the same stream with custom deliminators
iss.str( Utility::toString( QuantityType::from_value(RawType(0)) ) + ", " +
Utility::toString( QuantityType::from_value(RawType(1)) ) + ", " +
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, 0)) ) + ",\t" +
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(1, 1)) ) + " ,\n" +
Utility::toString( ComplexQuantityType::from_value(ComplexRawType(2, 2)) ) );
iss.clear();
Utility::fromStream( iss, quantity, "," );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(0)) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, quantity, "," );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(1)) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_quantity, "," );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, 0)) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_quantity, "," );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(1, 1)) );
Utility::moveInputStreamToNextElement( iss, ',', '}' );
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(2, 2)) );
if( Utility::QuantityTraits<QuantityType>::is_signed::value )
{
// Basic quantity types
iss.str( Utility::toString( QuantityType::from_value(RawType(-1)) ) );
iss.clear();
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(-1)) );
iss.str( Utility::toString( QuantityType::from_value(RawType(-2)) ) );
iss.clear();
Utility::fromStream( iss, quantity );
BOOST_CHECK_EQUAL( quantity, QuantityType::from_value(RawType(-2)) );
// Complex quantity types
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(-1, 0)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(-1, 0)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(0, -1)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(0, -1)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(-1, -1)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(-1, -1)) );
iss.str( Utility::toString( ComplexQuantityType::from_value(ComplexRawType(-2, -2)) ) );
iss.clear();
Utility::fromStream( iss, complex_quantity );
BOOST_CHECK_EQUAL( complex_quantity, ComplexQuantityType::from_value(ComplexRawType(-2, -2)) );
}
}
//---------------------------------------------------------------------------//
// end tstFromStringTraits.cpp
//---------------------------------------------------------------------------//
| 32.17761 | 371 | 0.644422 |
1f4a6f4e93ed1a2bc3c105cb78adb3802158be73 | 681 | cpp | C++ | Algorithms/1971.Find_if_Path_Exists_in_Graph.cpp | metehkaya/LeetCode | 52f4a1497758c6f996d515ced151e8783ae4d4d2 | [
"MIT"
] | 2 | 2020-07-20T06:40:22.000Z | 2021-11-20T01:23:26.000Z | Problems/LeetCode/Problems/1971.Find_if_Path_Exists_in_Graph.cpp | metehkaya/Algo-Archive | 03b5fdcf06f84a03125c57762c36a4e03ca6e756 | [
"MIT"
] | null | null | null | Problems/LeetCode/Problems/1971.Find_if_Path_Exists_in_Graph.cpp | metehkaya/Algo-Archive | 03b5fdcf06f84a03125c57762c36a4e03ca6e756 | [
"MIT"
] | null | null | null | class Solution {
public:
static const int maxn = 200000;
bool mark[maxn];
vector<int> adj[maxn];
void dfs(int u) {
if(mark[u])
return;
mark[u] = true;
int deg = adj[u].size();
for( int i = 0 ; i < deg ; i++ ) {
int v = adj[u][i];
dfs(v);
}
}
bool validPath(int n, vector<vector<int>>& edges, int start, int end) {
int m = edges.size();
for( int i = 0 ; i < m ; i++ ) {
int u = edges[i][0];
int v = edges[i][1];
adj[u].push_back(v);
adj[v].push_back(u);
}
dfs(start);
return mark[end];
}
}; | 25.222222 | 75 | 0.425844 |
acaaaa3e324e311e7f0bde5857419e06d222156a | 436 | asm | Assembly | programs/oeis/175/A175567.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 22 | 2018-02-06T19:19:31.000Z | 2022-01-17T21:53:31.000Z | programs/oeis/175/A175567.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 41 | 2021-02-22T19:00:34.000Z | 2021-08-28T10:47:47.000Z | programs/oeis/175/A175567.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 5 | 2021-02-24T21:14:16.000Z | 2021-08-09T19:48:05.000Z | ; A175567: (n!)^2 modulo n(n+1)/2.
; 0,1,0,6,0,15,0,0,0,45,0,66,0,0,0,120,0,153,0,0,0,231,0,0,0,0,0,378,0,435,0,0,0,0,0,630,0,0,0,780,0,861,0,0,0,1035,0,0,0,0,0,1326,0,0,0,0,0,1653,0,1770,0,0,0,0,0,2145,0,0,0,2415,0,2556,0,0,0,0,0,3003,0,0,0,3321,0,0,0,0,0,3828,0,0,0,0,0,0,0,4560,0,0,0,4950
mov $1,$0
add $1,1
seq $1,10051 ; Characteristic function of primes: 1 if n is prime, else 0.
mov $2,$0
mul $2,$0
add $0,$2
mul $0,$1
div $0,2
| 36.333333 | 256 | 0.605505 |
22ec3b18a98b1235ba40d246e2b45475bbbdb7ed | 1,350 | h | C | src/CwmCmdIcon.h | colinw7/Cwm | d37121d2781e82e27b82bb559bf8fb1d2c7ec539 | [
"MIT"
] | null | null | null | src/CwmCmdIcon.h | colinw7/Cwm | d37121d2781e82e27b82bb559bf8fb1d2c7ec539 | [
"MIT"
] | null | null | null | src/CwmCmdIcon.h | colinw7/Cwm | d37121d2781e82e27b82bb559bf8fb1d2c7ec539 | [
"MIT"
] | null | null | null | #define CwmCmdIconMgrInst CwmCmdIconMgr::getInstance()
class CwmCmdIconMgr {
public:
static CwmCmdIconMgr *getInstance();
CwmCmdIconMgr();
~CwmCmdIconMgr();
void addCmdIcon(CwmScreen &screen, CwmCustomIcon &icon_def);
CwmCmdIcon *lookup(const CwmWindow &xwindow);
CwmCmdIcon *lookup(Window xwin);
void deleteAll();
private:
typedef std::vector<CwmCmdIcon *> CmdIconList;
typedef std::map<Window, CwmCmdIcon *> CmdIconMap;
CmdIconList command_icon_list_;
CmdIconMap command_icon_map_;
};
class CwmCmdIcon {
public:
CwmCmdIcon(CwmScreen &screen, CwmCustomIcon &icon_def);
~CwmCmdIcon();
void redraw();
void invoke();
void move();
CwmWindow *getXWindow() { return xwindow_; }
private:
void createMask();
void reposition();
static void invokeProc(CwmWindow *xwindow, CwmData data, CwmData detail);
private:
CwmScreen &screen_;
CwmWindow *xwindow_;
CwmImage *image_;
CwmGraphics *graphics_;
CwmXPixmap *pixmap_mask_;
CwmMask *label_mask_;
int icon_x_;
int icon_y_;
int icon_width_;
int icon_height_;
int pixmap_dx_;
int pixmap_width_;
int pixmap_height_;
int label_dx_;
int label_width_;
int label_height_;
std::string label_;
std::string command_;
};
| 21.428571 | 75 | 0.673333 |
951affcb29f06faf4f3213a66d3e9d5f8d2d8557 | 629 | css | CSS | css/perceptronresult.css | sergedesmedt/MathOfNeuralNetworks | 8694bcb24b2646696c2d599d8f9020ca34e48187 | [
"MIT"
] | 2 | 2019-08-18T18:35:38.000Z | 2020-03-02T11:05:06.000Z | css/perceptronresult.css | sergedesmedt/MathOfNeuralNetworks | 8694bcb24b2646696c2d599d8f9020ca34e48187 | [
"MIT"
] | null | null | null | css/perceptronresult.css | sergedesmedt/MathOfNeuralNetworks | 8694bcb24b2646696c2d599d8f9020ca34e48187 | [
"MIT"
] | null | null | null | /*.perceptronResultPoint {
stroke: #000000;
fill: #d7d7d7;
}
.perceptronclass1 {
stroke: #000000;
fill: #ff6a00;
}
.perceptronclass2 {
stroke: #000000;
fill: #b6ff00;
}*/
.perceptronResultPoint {
fill: #d7d7d7;
}
.perceptronclass1 {
fill: #ff6a00;
}
.perceptronclass2 {
fill: #b6ff00;
}
div.tooltip {
position: absolute;
text-align: center;
width: 120px;
font: 10px sans-serif;
/*height: 28px;
padding: 2px;
*/
background: lightsteelblue;
border: 0px;
/*border-radius: 8px;
pointer-events: none;*/
}
| 14.97619 | 32 | 0.564388 |
6c548c6e9844a795a7161c41ae131c837a23dec0 | 1,353 | go | Go | cmd/migrathor/cli_test.go | denisbrodbeck/migrathor | de4dea82f28b388a468e51dd1d0dbdfe6cebea18 | [
"MIT"
] | null | null | null | cmd/migrathor/cli_test.go | denisbrodbeck/migrathor | de4dea82f28b388a468e51dd1d0dbdfe6cebea18 | [
"MIT"
] | null | null | null | cmd/migrathor/cli_test.go | denisbrodbeck/migrathor | de4dea82f28b388a468e51dd1d0dbdfe6cebea18 | [
"MIT"
] | null | null | null | package main
import (
"flag"
"testing"
"time"
_ "github.com/lib/pq"
)
// just define this here so we can run go test ./... from package root without warnings
var flagWithDb = flag.Bool("db", false, "Run tests against a test database.")
func Test_createDSN(t *testing.T) {
host := "localhost"
port := "5432"
name := "app1"
user := "mike"
pass := "secret"
sslmode := "verify-ca"
sslcert := "certs/db.cert"
sslkey := "certs/db.key"
sslrootcert := "certs/ca.cert"
timeout := time.Second * 42
want := `host=localhost port=5432 dbname='app1' user='mike' password='secret' sslmode=verify-ca sslcert='certs/db.cert' sslkey='certs/db.key' sslrootcert='certs/ca.cert' sslrootcert='certs/ca.cert' connect_timeout=42`
if got := createDSN(host, port, name, user, pass, sslmode, sslcert, sslkey, sslrootcert, timeout); got != want {
t.Errorf("createDSN()\ngot %q\nwant %q", got, want)
}
want = `password='ve ry$se\'cret!'`
if got := createDSN("", "", "", "", `ve ry$se'cret!`, "", "", "", "", time.Second*0); got != want {
t.Errorf("createDSN()\ngot %q\nwant %q", got, want)
}
}
func Test_connect(t *testing.T) {
if *flagWithDb == false {
t.Skip("skipping test: need a database")
}
dsn := "dbname=postgres user=postgres sslmode=disable connect_timeout=5"
db, err := connect(dsn)
if err != nil {
t.Fatal(err)
}
db.Close()
}
| 28.1875 | 218 | 0.649667 |
b05ab3d5495fce1a7848c0b0091efb6315518f64 | 727 | html | HTML | templates/student.html | sachin1740/project | 635d02a2286fabdd02a1bd5631524bc565227cfc | [
"Apache-2.0"
] | 1 | 2021-12-09T10:36:52.000Z | 2021-12-09T10:36:52.000Z | templates/student.html | sachin1740/project | 635d02a2286fabdd02a1bd5631524bc565227cfc | [
"Apache-2.0"
] | null | null | null | templates/student.html | sachin1740/project | 635d02a2286fabdd02a1bd5631524bc565227cfc | [
"Apache-2.0"
] | 3 | 2020-10-12T17:07:44.000Z | 2021-01-20T13:12:21.000Z | {% extends "template.html" %}
{% block body %}
<div class="container" style="margin-left: -180px;">
<table class="table table-striped">
<tr>
<th>Date</th>
<th>Present</th>
</tr>
{% for thanos in l %}
<tr>
<td>{{thanos['date']}}</td>
<td>{{thanos['present']}}</td>
</tr>
{% endfor %}
</table>
</div>
<div class="container" style="margin-left: -182px; text-align: center;">
<span><h2>Total Lectures Attended</h2></span>
<span><h3>{{attend}}/{{total}}</h3></span>
</div>
<div class="container" style="margin-left: -185px;">
{{ div_placeholder }}
</div>
{% endblock %} | 27.961538 | 76 | 0.481431 |
12b9ada28b01b59f9f73d1b91db29713fc710703 | 19,886 | html | HTML | javadoc/org/quartz/SchedulerContext.html | xzpoul/quartz-2.3.0-SNAPSHOT | 66282b114fd54152ac6db158c774dd2350401a9d | [
"Apache-2.0"
] | null | null | null | javadoc/org/quartz/SchedulerContext.html | xzpoul/quartz-2.3.0-SNAPSHOT | 66282b114fd54152ac6db158c774dd2350401a9d | [
"Apache-2.0"
] | null | null | null | javadoc/org/quartz/SchedulerContext.html | xzpoul/quartz-2.3.0-SNAPSHOT | 66282b114fd54152ac6db158c774dd2350401a9d | [
"Apache-2.0"
] | null | null | null | <!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd">
<!-- NewPage -->
<html lang="en">
<head>
<!-- Generated by javadoc (1.8.0_202) on Wed Feb 27 10:36:02 EST 2019 -->
<meta http-equiv="Content-Type" content="text/html; charset=UTF-8">
<title>SchedulerContext (Quartz Enterprise Job Scheduler 2.3.0-SNAPSHOT API)</title>
<meta name="date" content="2019-02-27">
<link rel="stylesheet" type="text/css" href="../../stylesheet.css" title="Style">
<script type="text/javascript" src="../../script.js"></script>
</head>
<body>
<script type="text/javascript"><!--
try {
if (location.href.indexOf('is-external=true') == -1) {
parent.document.title="SchedulerContext (Quartz Enterprise Job Scheduler 2.3.0-SNAPSHOT API)";
}
}
catch(err) {
}
//-->
</script>
<noscript>
<div>JavaScript is disabled on your browser.</div>
</noscript>
<!-- ========= START OF TOP NAVBAR ======= -->
<div class="topNav"><a name="navbar.top">
<!-- -->
</a>
<div class="skipNav"><a href="#skip.navbar.top" title="Skip navigation links">Skip navigation links</a></div>
<a name="navbar.top.firstrow">
<!-- -->
</a>
<ul class="navList" title="Navigation">
<li><a href="../../overview-summary.html">Overview</a></li>
<li><a href="package-summary.html">Package</a></li>
<li class="navBarCell1Rev">Class</li>
<li><a href="class-use/SchedulerContext.html">Use</a></li>
<li><a href="package-tree.html">Tree</a></li>
<li><a href="../../deprecated-list.html">Deprecated</a></li>
<li><a href="../../index-all.html">Index</a></li>
<li><a href="../../help-doc.html">Help</a></li>
</ul>
</div>
<div class="subNav">
<ul class="navList">
<li><a href="../../org/quartz/SchedulerConfigException.html" title="class in org.quartz"><span class="typeNameLink">Prev Class</span></a></li>
<li><a href="../../org/quartz/SchedulerException.html" title="class in org.quartz"><span class="typeNameLink">Next Class</span></a></li>
</ul>
<ul class="navList">
<li><a href="../../index.html?org/quartz/SchedulerContext.html" target="_top">Frames</a></li>
<li><a href="SchedulerContext.html" target="_top">No Frames</a></li>
</ul>
<ul class="navList" id="allclasses_navbar_top">
<li><a href="../../allclasses-noframe.html">All Classes</a></li>
</ul>
<div>
<script type="text/javascript"><!--
allClassesLink = document.getElementById("allclasses_navbar_top");
if(window==top) {
allClassesLink.style.display = "block";
}
else {
allClassesLink.style.display = "none";
}
//-->
</script>
</div>
<div>
<ul class="subNavList">
<li>Summary: </li>
<li>Nested | </li>
<li>Field | </li>
<li><a href="#constructor.summary">Constr</a> | </li>
<li><a href="#methods.inherited.from.class.org.quartz.utils.StringKeyDirtyFlagMap">Method</a></li>
</ul>
<ul class="subNavList">
<li>Detail: </li>
<li>Field | </li>
<li><a href="#constructor.detail">Constr</a> | </li>
<li>Method</li>
</ul>
</div>
<a name="skip.navbar.top">
<!-- -->
</a></div>
<!-- ========= END OF TOP NAVBAR ========= -->
<!-- ======== START OF CLASS DATA ======== -->
<div class="header">
<div class="subTitle">org.quartz</div>
<h2 title="Class SchedulerContext" class="title">Class SchedulerContext</h2>
</div>
<div class="contentContainer">
<ul class="inheritance">
<li><a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true" title="class or interface in java.lang">java.lang.Object</a></li>
<li>
<ul class="inheritance">
<li><a href="../../org/quartz/utils/DirtyFlagMap.html" title="class in org.quartz.utils">org.quartz.utils.DirtyFlagMap</a><<a href="http://docs.oracle.com/javase/7/docs/api/java/lang/String.html?is-external=true" title="class or interface in java.lang">String</a>,<a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true" title="class or interface in java.lang">Object</a>></li>
<li>
<ul class="inheritance">
<li><a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html" title="class in org.quartz.utils">org.quartz.utils.StringKeyDirtyFlagMap</a></li>
<li>
<ul class="inheritance">
<li>org.quartz.SchedulerContext</li>
</ul>
</li>
</ul>
</li>
</ul>
</li>
</ul>
<div class="description">
<ul class="blockList">
<li class="blockList">
<dl>
<dt>All Implemented Interfaces:</dt>
<dd><a href="http://docs.oracle.com/javase/7/docs/api/java/io/Serializable.html?is-external=true" title="class or interface in java.io">Serializable</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Cloneable.html?is-external=true" title="class or interface in java.lang">Cloneable</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true" title="class or interface in java.util">Map</a><<a href="http://docs.oracle.com/javase/7/docs/api/java/lang/String.html?is-external=true" title="class or interface in java.lang">String</a>,<a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true" title="class or interface in java.lang">Object</a>></dd>
</dl>
<hr>
<br>
<pre>public class <span class="typeNameLabel">SchedulerContext</span>
extends <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html" title="class in org.quartz.utils">StringKeyDirtyFlagMap</a>
implements <a href="http://docs.oracle.com/javase/7/docs/api/java/io/Serializable.html?is-external=true" title="class or interface in java.io">Serializable</a></pre>
<div class="block">Holds context/environment data that can be made available to Jobs as they
are executed. This feature is much like the ServletContext feature when
working with J2EE servlets.
<p>
Future versions of Quartz may make distinctions on how it propagates
data in <code>SchedulerContext</code> between instances of proxies to a
single scheduler instance - i.e. if Quartz is being used via RMI.
</p></div>
<dl>
<dt><span class="simpleTagLabel">Author:</span></dt>
<dd>James House</dd>
<dt><span class="seeLabel">See Also:</span></dt>
<dd><a href="../../org/quartz/Scheduler.html#getContext--"><code>Scheduler.getContext()</code></a>,
<a href="../../serialized-form.html#org.quartz.SchedulerContext">Serialized Form</a></dd>
</dl>
</li>
</ul>
</div>
<div class="summary">
<ul class="blockList">
<li class="blockList">
<!-- ======== NESTED CLASS SUMMARY ======== -->
<ul class="blockList">
<li class="blockList"><a name="nested.class.summary">
<!-- -->
</a>
<h3>Nested Class Summary</h3>
<ul class="blockList">
<li class="blockList"><a name="nested.classes.inherited.from.class.java.util.Map">
<!-- -->
</a>
<h3>Nested classes/interfaces inherited from interface java.util.<a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true" title="class or interface in java.util">Map</a></h3>
<code><a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.Entry.html?is-external=true" title="class or interface in java.util">Map.Entry</a><<a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.Entry.html?is-external=true" title="class or interface in java.util">K</a>,<a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.Entry.html?is-external=true" title="class or interface in java.util">V</a>></code></li>
</ul>
</li>
</ul>
<!-- ======== CONSTRUCTOR SUMMARY ======== -->
<ul class="blockList">
<li class="blockList"><a name="constructor.summary">
<!-- -->
</a>
<h3>Constructor Summary</h3>
<table class="memberSummary" border="0" cellpadding="3" cellspacing="0" summary="Constructor Summary table, listing constructors, and an explanation">
<caption><span>Constructors</span><span class="tabEnd"> </span></caption>
<tr>
<th class="colOne" scope="col">Constructor and Description</th>
</tr>
<tr class="altColor">
<td class="colOne"><code><span class="memberNameLink"><a href="../../org/quartz/SchedulerContext.html#SchedulerContext--">SchedulerContext</a></span>()</code>
<div class="block">Create an empty <code>SchedulerContext</code>.</div>
</td>
</tr>
<tr class="rowColor">
<td class="colOne"><code><span class="memberNameLink"><a href="../../org/quartz/SchedulerContext.html#SchedulerContext-java.util.Map-">SchedulerContext</a></span>(<a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true" title="class or interface in java.util">Map</a><?,?> map)</code>
<div class="block">Create a <code>SchedulerContext</code> with the given data.</div>
</td>
</tr>
</table>
</li>
</ul>
<!-- ========== METHOD SUMMARY =========== -->
<ul class="blockList">
<li class="blockList"><a name="method.summary">
<!-- -->
</a>
<h3>Method Summary</h3>
<ul class="blockList">
<li class="blockList"><a name="methods.inherited.from.class.org.quartz.utils.StringKeyDirtyFlagMap">
<!-- -->
</a>
<h3>Methods inherited from class org.quartz.utils.<a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html" title="class in org.quartz.utils">StringKeyDirtyFlagMap</a></h3>
<code><a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#containsTransientData--">containsTransientData</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#equals-java.lang.Object-">equals</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getAllowsTransientData--">getAllowsTransientData</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getBoolean-java.lang.String-">getBoolean</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getChar-java.lang.String-">getChar</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getDouble-java.lang.String-">getDouble</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getFloat-java.lang.String-">getFloat</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getInt-java.lang.String-">getInt</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getKeys--">getKeys</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getLong-java.lang.String-">getLong</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#getString-java.lang.String-">getString</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#hashCode--">hashCode</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-boolean-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-char-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-double-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-float-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-int-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-long-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-java.lang.Object-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#put-java.lang.String-java.lang.String-">put</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#removeTransientData--">removeTransientData</a>, <a href="../../org/quartz/utils/StringKeyDirtyFlagMap.html#setAllowsTransientData-boolean-">setAllowsTransientData</a></code></li>
</ul>
<ul class="blockList">
<li class="blockList"><a name="methods.inherited.from.class.org.quartz.utils.DirtyFlagMap">
<!-- -->
</a>
<h3>Methods inherited from class org.quartz.utils.<a href="../../org/quartz/utils/DirtyFlagMap.html" title="class in org.quartz.utils">DirtyFlagMap</a></h3>
<code><a href="../../org/quartz/utils/DirtyFlagMap.html#clear--">clear</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#clearDirtyFlag--">clearDirtyFlag</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#clone--">clone</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#containsKey-java.lang.Object-">containsKey</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#containsValue-java.lang.Object-">containsValue</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#entrySet--">entrySet</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#get-java.lang.Object-">get</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#getWrappedMap--">getWrappedMap</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#isDirty--">isDirty</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#isEmpty--">isEmpty</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#keySet--">keySet</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#putAll-java.util.Map-">putAll</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#remove-java.lang.Object-">remove</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#size--">size</a>, <a href="../../org/quartz/utils/DirtyFlagMap.html#values--">values</a></code></li>
</ul>
<ul class="blockList">
<li class="blockList"><a name="methods.inherited.from.class.java.lang.Object">
<!-- -->
</a>
<h3>Methods inherited from class java.lang.<a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true" title="class or interface in java.lang">Object</a></h3>
<code><a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#finalize--" title="class or interface in java.lang">finalize</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#getClass--" title="class or interface in java.lang">getClass</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#notify--" title="class or interface in java.lang">notify</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#notifyAll--" title="class or interface in java.lang">notifyAll</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#toString--" title="class or interface in java.lang">toString</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#wait--" title="class or interface in java.lang">wait</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#wait-long-" title="class or interface in java.lang">wait</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/lang/Object.html?is-external=true#wait-long-int-" title="class or interface in java.lang">wait</a></code></li>
</ul>
<ul class="blockList">
<li class="blockList"><a name="methods.inherited.from.class.java.util.Map">
<!-- -->
</a>
<h3>Methods inherited from interface java.util.<a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true" title="class or interface in java.util">Map</a></h3>
<code><a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#compute-K-java.util.function.BiFunction-" title="class or interface in java.util">compute</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#computeIfAbsent-K-java.util.function.Function-" title="class or interface in java.util">computeIfAbsent</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#computeIfPresent-K-java.util.function.BiFunction-" title="class or interface in java.util">computeIfPresent</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#forEach-java.util.function.BiConsumer-" title="class or interface in java.util">forEach</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#getOrDefault-java.lang.Object-V-" title="class or interface in java.util">getOrDefault</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#merge-K-V-java.util.function.BiFunction-" title="class or interface in java.util">merge</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#putIfAbsent-K-V-" title="class or interface in java.util">putIfAbsent</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#remove-java.lang.Object-java.lang.Object-" title="class or interface in java.util">remove</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#replace-K-V-" title="class or interface in java.util">replace</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#replace-K-V-V-" title="class or interface in java.util">replace</a>, <a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true#replaceAll-java.util.function.BiFunction-" title="class or interface in java.util">replaceAll</a></code></li>
</ul>
</li>
</ul>
</li>
</ul>
</div>
<div class="details">
<ul class="blockList">
<li class="blockList">
<!-- ========= CONSTRUCTOR DETAIL ======== -->
<ul class="blockList">
<li class="blockList"><a name="constructor.detail">
<!-- -->
</a>
<h3>Constructor Detail</h3>
<a name="SchedulerContext--">
<!-- -->
</a>
<ul class="blockList">
<li class="blockList">
<h4>SchedulerContext</h4>
<pre>public SchedulerContext()</pre>
<div class="block">Create an empty <code>SchedulerContext</code>.</div>
</li>
</ul>
<a name="SchedulerContext-java.util.Map-">
<!-- -->
</a>
<ul class="blockListLast">
<li class="blockList">
<h4>SchedulerContext</h4>
<pre>public SchedulerContext(<a href="http://docs.oracle.com/javase/7/docs/api/java/util/Map.html?is-external=true" title="class or interface in java.util">Map</a><?,?> map)</pre>
<div class="block">Create a <code>SchedulerContext</code> with the given data.</div>
</li>
</ul>
</li>
</ul>
</li>
</ul>
</div>
</div>
<!-- ========= END OF CLASS DATA ========= -->
<!-- ======= START OF BOTTOM NAVBAR ====== -->
<div class="bottomNav"><a name="navbar.bottom">
<!-- -->
</a>
<div class="skipNav"><a href="#skip.navbar.bottom" title="Skip navigation links">Skip navigation links</a></div>
<a name="navbar.bottom.firstrow">
<!-- -->
</a>
<ul class="navList" title="Navigation">
<li><a href="../../overview-summary.html">Overview</a></li>
<li><a href="package-summary.html">Package</a></li>
<li class="navBarCell1Rev">Class</li>
<li><a href="class-use/SchedulerContext.html">Use</a></li>
<li><a href="package-tree.html">Tree</a></li>
<li><a href="../../deprecated-list.html">Deprecated</a></li>
<li><a href="../../index-all.html">Index</a></li>
<li><a href="../../help-doc.html">Help</a></li>
</ul>
</div>
<div class="subNav">
<ul class="navList">
<li><a href="../../org/quartz/SchedulerConfigException.html" title="class in org.quartz"><span class="typeNameLink">Prev Class</span></a></li>
<li><a href="../../org/quartz/SchedulerException.html" title="class in org.quartz"><span class="typeNameLink">Next Class</span></a></li>
</ul>
<ul class="navList">
<li><a href="../../index.html?org/quartz/SchedulerContext.html" target="_top">Frames</a></li>
<li><a href="SchedulerContext.html" target="_top">No Frames</a></li>
</ul>
<ul class="navList" id="allclasses_navbar_bottom">
<li><a href="../../allclasses-noframe.html">All Classes</a></li>
</ul>
<div>
<script type="text/javascript"><!--
allClassesLink = document.getElementById("allclasses_navbar_bottom");
if(window==top) {
allClassesLink.style.display = "block";
}
else {
allClassesLink.style.display = "none";
}
//-->
</script>
</div>
<div>
<ul class="subNavList">
<li>Summary: </li>
<li>Nested | </li>
<li>Field | </li>
<li><a href="#constructor.summary">Constr</a> | </li>
<li><a href="#methods.inherited.from.class.org.quartz.utils.StringKeyDirtyFlagMap">Method</a></li>
</ul>
<ul class="subNavList">
<li>Detail: </li>
<li>Field | </li>
<li><a href="#constructor.detail">Constr</a> | </li>
<li>Method</li>
</ul>
</div>
<a name="skip.navbar.bottom">
<!-- -->
</a></div>
<!-- ======== END OF BOTTOM NAVBAR ======= -->
<p class="legalCopy"><small>Copyright 2001-2019, Terracotta, Inc.</small></p>
</body>
</html>
| 61.187692 | 2,236 | 0.696168 |
cd82727d9352310cd0e0ee0161a02da89a8b945e | 613 | swift | Swift | GeospatialKitTests/Mock/API/GeoJson/Box/MockGeoJsonGeohashBox.swift | kant/GeospatialKit | 83fa6b64931f02f343c9ef62e6439fb4bc664328 | [
"BSD-3-Clause"
] | null | null | null | GeospatialKitTests/Mock/API/GeoJson/Box/MockGeoJsonGeohashBox.swift | kant/GeospatialKit | 83fa6b64931f02f343c9ef62e6439fb4bc664328 | [
"BSD-3-Clause"
] | null | null | null | GeospatialKitTests/Mock/API/GeoJson/Box/MockGeoJsonGeohashBox.swift | kant/GeospatialKit | 83fa6b64931f02f343c9ef62e6439fb4bc664328 | [
"BSD-3-Clause"
] | null | null | null | @testable import GeospatialSwift
final class MockGeoJsonGeohashBox: MockGeoJsonBoundingBox, GeoJsonGeohashBox {
private(set) var geohashCallCount = 0
var geohashResult: String = ""
var geohash: String {
geohashCallCount += 1
return geohashResult
}
private(set) var geohashNeighborCallCount = 0
lazy var geohashNeighborResult: GeoJsonGeohashBox = MockGeoJsonGeohashBox()
func geohashNeighbor(direction: GeohashCompassPoint, precision: Int) -> GeoJsonGeohashBox {
geohashNeighborCallCount += 1
return geohashNeighborResult
}
}
| 30.65 | 95 | 0.709625 |
4b6bc6e37ba8b6ed387862e03c986a6019277ab2 | 5,107 | kt | Kotlin | katana-server/src/main/kotlin/jp/katana/server/network/ServerListener.kt | hiroki19990625/katana | aab8ae69beed267ea0ef9eab2ebd23b994ac0f25 | [
"MIT"
] | 1 | 2020-07-10T12:35:32.000Z | 2020-07-10T12:35:32.000Z | katana-server/src/main/kotlin/jp/katana/server/network/ServerListener.kt | hiroki19990625/katana | aab8ae69beed267ea0ef9eab2ebd23b994ac0f25 | [
"MIT"
] | null | null | null | katana-server/src/main/kotlin/jp/katana/server/network/ServerListener.kt | hiroki19990625/katana | aab8ae69beed267ea0ef9eab2ebd23b994ac0f25 | [
"MIT"
] | 1 | 2020-07-14T13:38:09.000Z | 2020-07-14T13:38:09.000Z | package jp.katana.server.network
import com.whirvis.jraknet.RakNetPacket
import com.whirvis.jraknet.peer.RakNetClientPeer
import com.whirvis.jraknet.server.RakNetServer
import com.whirvis.jraknet.server.RakNetServerListener
import jp.katana.i18n.I18n
import jp.katana.server.Server
import jp.katana.server.actor.ActorPlayer
import jp.katana.server.event.player.PlayerCreateEvent
import jp.katana.server.factory.PacketFactory
import jp.katana.server.io.DecompressException
import jp.katana.server.network.packet.BatchPacket
import jp.katana.utils.BinaryStream
import org.apache.logging.log4j.LogManager
import java.net.InetSocketAddress
import java.util.zip.Inflater
class ServerListener(private val server: Server, private val networkManager: NetworkManager) : RakNetServerListener {
private val logger = LogManager.getLogger()
private val factory = server.factoryManager.get(PacketFactory::class.java)!!
override fun onLogin(rServer: RakNetServer?, peer: RakNetClientPeer?) {
if (peer != null) {
val address = peer.address
logger.info(I18n["katana.server.client.connection", address, peer.maximumTransferUnit])
val event = PlayerCreateEvent()
server.eventManager(event, PlayerCreateEvent::class.java)
if (event.player == null)
event.player = ActorPlayer(address, server)
networkManager.addPlayer(address, event.player!!)
networkManager.addSession(address, peer)
networkManager.updateOnlinePlayerCount()
}
}
override fun onDisconnect(
server: RakNetServer?,
address: InetSocketAddress?,
peer: RakNetClientPeer?,
reason: String?
) {
if (peer != null) {
val socketAddress = peer.address
val player = networkManager.getPlayer(socketAddress)!!
player.onDisconnect(reason)
logger.info(I18n["katana.server.client.disConnection", socketAddress, reason ?: "none"])
networkManager.removePlayer(socketAddress)
networkManager.removeSession(socketAddress)
networkManager.updateOnlinePlayerCount()
}
}
override fun handleMessage(server: RakNetServer?, peer: RakNetClientPeer?, packet: RakNetPacket?, channel: Int) {
if (peer != null && packet != null) {
val address = peer.address
val player = networkManager.getPlayer(address)!!
val batch = BatchPacket(Inflater(true), null)
try {
batch.isEncrypt = player.isEncrypted
batch.decrypt = player.decrypt
batch.encrypt = player.encrypt
batch.decryptCounter = player.decryptCounter
batch.encryptCounter = player.encryptCounter
batch.sharedKey = player.sharedKey
batch.setBuffer(packet.array())
batch.decode()
if (player.isEncrypted)
player.decryptCounter++
var data = BinaryStream()
data.setBuffer(batch.payload)
val buf = data.read(data.readUnsignedVarInt())
data.close()
data = BinaryStream()
data.setBuffer(buf)
val id = data.readUnsignedVarInt()
if (this.server.katanaConfig!!.showHandlePacketId)
logger.info("Handle 0x" + id.toString(16) + " -> Size " + data.array().size)
if (this.server.katanaConfig!!.handlePacketDump)
logger.info("HandleDump " + buf.joinToString("") { String.format("%02X", (it.toInt() and 0xFF)) })
val f = factory[id]
if (f != null) {
try {
val pk = f()
pk.setBuffer(buf)
pk.decode()
if (this.server.katanaConfig!!.printHandlePacket)
logger.info("HandlePrint \n$pk")
networkManager.handlePacket(address, pk)
pk.close()
} catch (e: Exception) {
throw InvalidPacketException(e.toString())
}
}
} catch (e: DecompressException) {
this.server.logger.warn("", e)
} catch (e: DecryptException) {
this.server.logger.warn("", e)
} catch (e: InvalidPacketException) {
this.server.logger.warn("", e)
} finally {
batch.close()
packet.clear()
packet.buffer()?.release()
}
}
}
override fun onPeerException(server: RakNetServer?, peer: RakNetClientPeer?, throwable: Throwable?) {
logger.warn("", throwable)
}
override fun onHandlerException(server: RakNetServer?, address: InetSocketAddress?, throwable: Throwable?) {
logger.warn("", throwable)
}
override fun onStart(server: RakNetServer?) {
networkManager.updateState(true)
}
} | 39.284615 | 118 | 0.59487 |
1d2fcc5421bc899de6717ff5bcdbff29bc59dae7 | 1,598 | asm | Assembly | programs/oeis/293/A293412.asm | karttu/loda | 9c3b0fc57b810302220c044a9d17db733c76a598 | [
"Apache-2.0"
] | 1 | 2021-03-15T11:38:20.000Z | 2021-03-15T11:38:20.000Z | programs/oeis/293/A293412.asm | karttu/loda | 9c3b0fc57b810302220c044a9d17db733c76a598 | [
"Apache-2.0"
] | null | null | null | programs/oeis/293/A293412.asm | karttu/loda | 9c3b0fc57b810302220c044a9d17db733c76a598 | [
"Apache-2.0"
] | null | null | null | ; A293412: Greatest integer k such that k/n^2 < e.
; 0,2,10,24,43,67,97,133,173,220,271,328,391,459,532,611,695,785,880,981,1087,1198,1315,1437,1565,1698,1837,1981,2131,2286,2446,2612,2783,2960,3142,3329,3522,3721,3925,4134,4349,4569,4795,5026,5262,5504,5751,6004,6262,6526,6795,7070,7350,7635,7926,8222,8524,8831,9144,9462,9785,10114,10449,10788,11134,11484,11840,12202,12569,12941,13319,13702,14091,14485,14885,15290,15700,16116,16538,16964,17397,17834,18277,18726,19180,19639,20104,20574,21050,21531,22018,22510,23007,23510,24018,24532,25051,25576,26106,26641,27182,27729,28281,28838,29400,29969,30542,31121,31706,32295,32891,33491,34098,34709,35326,35949,36577,37210,37849,38493,39143,39798,40458,41124,41796,42473,43155,43843,44536,45234,45938,46648,47363,48083,48809,49540,50277,51019,51766,52519,53278,54042,54811,55586,56366,57151,57942,58739,59541,60348,61161,61979,62803,63632,64466,65306,66152,67002,67859,68720,69588,70460,71338,72222,73110,74005,74904,75810,76720,77636,78558,79485,80417,81355,82298,83247,84201,85161,86126,87096,88072,89053,90040,91032,92030,93033,94041,95055,96074,97099,98129,99165,100206,101253,102305,103362,104425,105493,106567,107646,108731,109821,110916,112017,113124,114235,115353,116475,117603,118737,119876,121020,122170,123325,124486,125652,126824,128001,129183,130371,131564,132763,133967,135177,136392,137613,138838,140070,141307,142549,143797,145050,146308,147572,148842,150117,151397,152683,153974,155270,156573,157880,159193,160511,161835,163164,164499,165839,167185,168536
pow $0,2
cal $0,22843 ; Beatty sequence for e: a(n) = floor(n*e).
add $1,$0
| 228.285714 | 1,469 | 0.812891 |
a9a9d750636c8f4d0248345c16d89852dc436803 | 419 | html | HTML | views/egame/handlebars/application.html | alubame001/egame | 40b7fe7255596be060beaafb008a4c4e6bd58f33 | [
"Apache-2.0"
] | 1 | 2018-12-06T14:03:33.000Z | 2018-12-06T14:03:33.000Z | views/egame/handlebars/application.html | alubame001/egame | 40b7fe7255596be060beaafb008a4c4e6bd58f33 | [
"Apache-2.0"
] | null | null | null | views/egame/handlebars/application.html | alubame001/egame | 40b7fe7255596be060beaafb008a4c4e6bd58f33 | [
"Apache-2.0"
] | 2 | 2019-06-14T11:10:55.000Z | 2021-04-08T06:11:05.000Z | <script type="text/x-handlebars" data-template-name="application" >
<div class="container">
<div class="row home-box">
<div class="col-md-12">
{{outlet}}
</div>
</div>
</div>
</script>
<script type="text/x-handlebars" data-template-name="videopoke">
</script>
<script type="text/x-handlebars" data-template-name="slot">
</script>
| 13.09375 | 67 | 0.548926 |
f0229b401abe3feee370d9a51bbc8c817449f9e9 | 1,132 | py | Python | tests/checkout_four_sdk_test.py | riaz-bordie-cko/checkout-sdk-python | d9bc073306c1a98544c326be693ed722576ea895 | [
"MIT"
] | null | null | null | tests/checkout_four_sdk_test.py | riaz-bordie-cko/checkout-sdk-python | d9bc073306c1a98544c326be693ed722576ea895 | [
"MIT"
] | null | null | null | tests/checkout_four_sdk_test.py | riaz-bordie-cko/checkout-sdk-python | d9bc073306c1a98544c326be693ed722576ea895 | [
"MIT"
] | null | null | null | import pytest
import checkout_sdk
from checkout_sdk.environment import Environment
from checkout_sdk.exception import CheckoutArgumentException
def test_should_create_four_sdk():
checkout_sdk.FourSdk() \
.secret_key('sk_sbox_m73dzbpy7cf3gfd46xr4yj5xo4e') \
.public_key('pk_sbox_pkhpdtvmkgf7hdnpwnbhw7r2uic') \
.environment(Environment.sandbox()) \
.build()
sdk = checkout_sdk.FourSdk() \
.secret_key('sk_m73dzbpy7cf3gfd46xr4yj5xo4e') \
.public_key('pk_pkhpdtvmkgf7hdnpwnbhw7r2uic') \
.environment(Environment.production()) \
.build()
assert sdk is not None
assert sdk.tokens is not None
def test_should_fail_create_four_sdk():
with pytest.raises(CheckoutArgumentException):
checkout_sdk.FourSdk() \
.secret_key('sk_sbox_m73dzbpy7c-f3gfd46xr4yj5xo4e') \
.environment(Environment.sandbox()) \
.build()
with pytest.raises(CheckoutArgumentException):
checkout_sdk.FourSdk() \
.public_key('pk_sbox_pkh') \
.environment(Environment.sandbox()) \
.build()
| 30.594595 | 65 | 0.682862 |
8c0f6d79b31fe51c22d4bfdf8dae759e05f0b7ab | 4,711 | cpp | C++ | libftw/libftw.cpp | JohnHoder/vicious_dll_injector | 1f558fa93d7ec953910f177b4b3959983e12f206 | [
"FSFAP"
] | 2 | 2021-07-26T17:03:11.000Z | 2021-07-27T15:06:54.000Z | libftw/libftw.cpp | JohnHoder/vicious_dll_injector | 1f558fa93d7ec953910f177b4b3959983e12f206 | [
"FSFAP"
] | null | null | null | libftw/libftw.cpp | JohnHoder/vicious_dll_injector | 1f558fa93d7ec953910f177b4b3959983e12f206 | [
"FSFAP"
] | 2 | 2021-07-27T15:06:54.000Z | 2021-08-01T16:13:15.000Z | // libftw.cpp : Defines the entry point for the DLL application.
//
#include "stdafx.h"
#include <tlhelp32.h>
#define IDCX 456
#define IDC_REFRESH 120
#define IDC_SELECT 121
#define IDC_WINPROC 100
#define IDC_PROC 555
char Data[260];
HWND ProcessesBox;
HANDLE RecvProc;
HWND parentWnd;
DWORD WINAPI PWindow(HWND parent);
typedef BOOL (WINAPI *TH32_PROCESS)
(HANDLE hSnapShot, LPPROCESSENTRY32 lppe);
static TH32_PROCESS pProcess32First = NULL;
static TH32_PROCESS pProcess32Next = NULL;
HANDLE hInst = NULL;
extern "C" void __declspec(dllexport) showMessageBox(const LPCSTR sometext)
{
MessageBoxA(0, sometext, "DLL Message", MB_OK | MB_ICONINFORMATION);
}
extern "C" DWORD __declspec(dllexport) drawToWnd(HWND hWin)
{
//MessageBoxA(hWin, "Handle obtained?", "DLL Message", MB_OK | MB_ICONINFORMATION);
CreateWindowEx(0,"BUTTON","DLL",
WS_CHILD | BS_AUTOCHECKBOX | WS_VISIBLE,
5,318,60,15,
hWin,HMENU(IDCX),
(HINSTANCE)hInst,0);
return 0;
}
extern "C" DWORD __declspec(dllexport) chooseProcessWnd(HWND hWin)
{
parentWnd = hWin;
PWindow(hWin);
return 0;
}
BOOL APIENTRY DllMain( HANDLE hInstance, DWORD dwReason, LPVOID lpReserved)
{
switch (dwReason)
{
case DLL_PROCESS_ATTACH:
{
hInst = hInstance;
//showMessageBox("TOF owns ya, byatch!");
//MessageBox(0, "dll", "DLL Message", MB_OK | MB_ICONINFORMATION);
}
}
return true;
}
//333333333333333333333333333333333333333333333333333333333333333333333333333333333333333
DWORD WINAPI GetProcesses(LPVOID)
{
PROCESSENTRY32 pe32 = {0};
HANDLE hSnapshot = NULL;
HINSTANCE hDll = LoadLibrary("kernel32.dll");
pProcess32First=(TH32_PROCESS)GetProcAddress(hDll, "Process32First");
pProcess32Next=(TH32_PROCESS)GetProcAddress(hDll, "Process32Next");
hSnapshot = CreateToolhelp32Snapshot(TH32CS_SNAPPROCESS, 0);
if(hSnapshot != (HANDLE) -1)
{
pe32.dwSize = sizeof(PROCESSENTRY32);
int proc_cnt = 0, thrd_cnt = 0;
if(pProcess32First(hSnapshot, &pe32))
{
do
{
strcpy(Data, pe32.szExeFile);
SendMessage(ProcessesBox, LB_INSERTSTRING, (WPARAM)-1, (LPARAM)Data);
}
while(pProcess32Next(hSnapshot, &pe32));
CloseHandle(hSnapshot);
}
}
return 0;
}
LRESULT CALLBACK ProcessesCallback (HWND hwnd, UINT message, WPARAM wParam, LPARAM lParam)
{
int Cursel;
switch (message)
{
case WM_DESTROY:
strcpy(Data, "");
PostQuitMessage(0);
break;
case WM_CREATE:
CreateWindowEx(0, "Button", "Refresh", WS_VISIBLE | WS_CHILD | WS_BORDER, 40, 260, 70, 20, hwnd, (HMENU)IDC_REFRESH, 0, NULL);
CreateWindowEx(0, "Button", "Select", WS_VISIBLE | WS_CHILD | WS_BORDER, 130, 260, 70, 20, hwnd, (HMENU)IDC_SELECT, 0, NULL);
ProcessesBox = CreateWindowEx(0, "ListBox", 0, WS_VISIBLE | WS_CHILD | WS_BORDER | WS_VSCROLL | LBS_DISABLENOSCROLL, 20, 10, 200, 240, hwnd, (HMENU)IDC_WINPROC, 0, NULL);
RecvProc = CreateThread(NULL, 0, GetProcesses, 0, 0, NULL);
break;
case WM_COMMAND:
switch(LOWORD(wParam))
{
case IDC_REFRESH:
TerminateThread(RecvProc, 0);
SendMessage(ProcessesBox, LB_RESETCONTENT, 0, 0);
RecvProc = CreateThread(NULL, 0, GetProcesses, 0, 0, NULL);
break;
case IDC_SELECT:
Cursel = SendMessage(ProcessesBox, LB_GETCURSEL, 0, 0);
SendMessage(ProcessesBox, LB_GETTEXT, (WPARAM)Cursel, (LPARAM)Data);
SendMessage(parentWnd, WM_NOTIFY, IDC_PROC, (LPARAM)Data);
DestroyWindow(hwnd);
break;
}
default:
return DefWindowProc (hwnd, message, wParam, lParam);
}
return 0;
}
DWORD WINAPI PWindow(HWND parent)
{
HWND hwnd;
MSG messages;
WNDCLASSEX wincl;
wincl.hInstance = 0;
wincl.lpszClassName = "Processes";
wincl.lpfnWndProc = ProcessesCallback;
wincl.style = CS_DBLCLKS;
wincl.cbSize = sizeof (WNDCLASSEX);
wincl.hIcon = LoadIcon (NULL, IDI_APPLICATION);
wincl.hIconSm = LoadIcon (NULL, IDI_APPLICATION);
wincl.hCursor = LoadCursor (NULL, IDC_ARROW);
wincl.lpszMenuName = NULL;
wincl.cbClsExtra = 0;
wincl.cbWndExtra = 0;
wincl.hbrBackground = (HBRUSH) COLOR_BACKGROUND+4;
RegisterClassEx(&wincl);
hwnd = CreateWindowEx (
0,
"Processes",
"Processes",
WS_SYSMENU | WS_VISIBLE | WS_POPUP, //here we added WS_POPUP and it's not tested yet
CW_USEDEFAULT,
CW_USEDEFAULT,
250,
380,
parent,
NULL,
0,
NULL
);
while (GetMessage (&messages, NULL, 0, 0))
{
TranslateMessage(&messages);
DispatchMessage(&messages);
}
return 0;
} | 24.925926 | 173 | 0.66886 |
6d25c5a78ad4acc11153eb1f9a407c350582cb2e | 11,915 | lua | Lua | [bases]/AURmaps/Uncompiled/ssg11.lua | OwningCurtX/AuroraRPG | f76a4aad25ccc8790e42b2f23dfa2dc304e34fb6 | [
"Apache-2.0"
] | 1 | 2020-04-18T20:43:16.000Z | 2020-04-18T20:43:16.000Z | [bases]/AURmaps/Uncompiled/ssg11.lua | OwningCurtX/AuroraRPG | f76a4aad25ccc8790e42b2f23dfa2dc304e34fb6 | [
"Apache-2.0"
] | 1 | 2019-10-20T08:41:34.000Z | 2019-10-20T08:41:34.000Z | [bases]/AURmaps/Uncompiled/ssg11.lua | OwningCurtX/AuroraRPG | f76a4aad25ccc8790e42b2f23dfa2dc304e34fb6 | [
"Apache-2.0"
] | null | null | null | for i,v in ipairs({
{6959,21.79981,492,1,0,0,0},
{6959,63.15,492,1,0,0,0},
{6959,-19.5,492,1,0,0,0},
{6959,-19.5,452,1,0,0,0},
{6959,21.79981,452,1,0,0,0},
{6959,63.15,452,1,0,0,0},
{6959,-19.4,412,1,0,0,0},
{6959,21.90039,412,1,0,0,0},
{6959,63.2002,412,1,0,0,0},
{6959,-19.4,372,1,0,0,0},
{6959,21.9,372,1,0,0,0},
{6959,63.2002,372,1,0,0,0},
{6959,63.2002,332,1,0,0,0},
{6959,21.90039,332,1,0,0,0},
{6959,-19.4,332,1,0,0,0},
{6959,-19.4,292,1,0,0,0},
{6959,21.9,292,1,0,0,0},
{6959,63.2002,292,1,0,0,0},
{6959,-19.40039,252.97,1.01,0,0,0},
{6959,21.90039,252,1,0,0,0},
{6959,63.2002,252,1,0,0,0},
{6959,104.5,253,1.01,0,0,0},
{6959,104.5,292,1,0,0,0},
{6959,104.5,332,1.01,0,0,0},
{6959,104.5,372,1,0,0,0},
{6959,104.5,412,1,0,0,0},
{6959,104.5,452,1,0,0,0},
{6959,104.5,492,1,0,0,0},
{6959,145.7998,257.79999,1.01,0,0,0},
{6959,145.8,292,1,0,0,0},
{6959,145.5,332,1,0,0,0},
{6959,145.8,372,1,0,0,0},
{6959,145.7998,412,1,0,0,0},
{6959,145.7998,452,1,0,0,0},
{6959,145.7998,492,1.01,0,0,0},
{8392,110.2002,534,30,0,0,345.987},
{8392,-16.7998,535,30,0,0,179.995},
{3749,47.1,626.59998,12.1,0,0,0},
{6959,41.40039,532,1,0,0,0},
{8392,169.7002,475,30,0,0,270},
{8392,172,293.2998,27.3,0,0,90},
{8392,-75,480,18.3,0,0,270},
{8392,-76,270,30,0,0,99.998},
{6959,-60.7,332,1,0,0,0},
{6959,-60.7,292,1,0,0,0},
{6959,-59.9,252,1,0,0,0},
{6959,-60.7,372,1,0,0,0},
{6959,-60.7,412,1,0,0,0},
{6959,-60.8,452,1,0,0,0},
{6959,-60.8,492,1,0,0,0},
{6959,137.05273,147.73535,-0.13744,0,0,0},
{7371,165,249.89999,1,0,0,179.995},
{7371,165.2,508,1,0,0,0},
{8168,177,402,3,0,0,16.996},
{7371,177,408,0.53,0,0,90},
{7371,177.2998,350.7998,0.53,0,0,90},
{3268,276.65625,1989.5469,16.63281,0,0,179.995},
{3268,276.65625,1989.5469,16.63281,0,0,179.995},
{7371,-81,508.89999,1,0,0,0},
{7371,-81.5,262.79999,1,0,0,179.995},
{3524,-80.9,383,3.9,0,0,90},
{3524,-81,388.5,3.9,0,0,90},
{11495,-92.2,384.79999,0.7,0,0,270},
{11495,-92.20019,386.59961,0.7,0,0,90},
{1472,-103.2,384.89999,0.5,0,0,270},
{1472,-103.2,386.39999,0.5,0,0,270},
{10828,158.39999,493.39999,9.3,0,0,90},
{10828,158.5,459.09961,9.3,0,0,90},
{3749,121.7,473.70001,6.8,0,0,90},
{10828,121.09961,501.5,9.3,0,0,90},
{10828,120.5,446.2998,9.3,0,0,90},
{10828,139.09961,430,9.3,0,0,0},
{6959,157,448.5,13,0,0,0},
{6959,157.5,488.60001,13,0,0,0},
{6959,140.7002,469.59961,13.1,0,0,0},
{6959,141,506.59961,13.11,0,0,0},
{6959,140.7002,449,13.12,0,0,0},
{9241,146.2002,311.5,2.7,0,0,0},
{9241,95.5,267.5,2.7,0,0,179.995},
{2792,191.7,356.39999,1.7,0,0,0},
{2793,228.2,357.20001,1.7,0,0,0},
{2794,260.60001,357.89999,1.6,0,0,0},
{2795,281.39999,357.20001,1.7,0,0,0},
{2774,164,350.2002,14,0,0,0},
{2774,164,406.90039,14,0,0,0},
{2792,196.60001,400.70001,1.6,0,0,0},
{2793,234.60001,400.60001,1.6,0,0,0},
{2794,262.39999,401,1.7,0,0,0},
{2795,281.20001,400.39999,1.7,0,0,0},
{5837,76.59961,528.70001,2.7,0,0,166},
{2935,147.8,499,14.5,0,0,0},
{2934,124.5,473.2002,14.6,0,0,0},
{2935,152.89999,446.39999,14.5,0,0,0},
{2932,147.8,477.20001,14.5,0,0,0},
{2932,133.7002,450.2998,14.6,0,0,0},
{1431,141.39999,441.10001,13.6,0,0,0},
{2669,139.39999,460.39999,14.4,0,0,0},
{3565,131.2002,489.2002,14.5,0,0,0},
{3571,142.7,468.70001,14.4,0,0,0},
{3073,153.7,462.60001,14.8,0,0,0},
{13591,136,505.7002,13.6,0,0,0},
{3364,153.7998,488.7998,13.1,0,0,0},
{3363,142.10001,448.39999,13.1,0,0,0},
{3625,126.5,458.09961,15.93,0,0,90},
{3363,135.8,481.5,13.1,0,0,0},
{3364,149.7002,434.5,13.1,0,0,0},
{18451,146.5,457.20001,13.6,0,0,0},
{2931,125.2002,496.2998,13.1,0,0,0},
{3565,133.09961,496.7002,14.5,0,0,90},
{3575,126.5,438.79999,15.8,0,0,0},
{6959,142,506.60001,27,0,0,0},
{6959,142,472.7002,27.3,0,0,0},
{6959,142,449,27.2,0,0,0},
{10828,120,446.2002,24.4,0,0,90},
{10828,120.2998,481.59961,24.4,0,0,90},
{10828,120.30957,481.60001,25.4,0,0,90},
{10828,138.90039,429.5,24.3,0,0,0},
{13749,112,494.5,6.4,0,0,339.994},
{10828,120.08984,520.96002,24.4,0,0,90},
{6959,82.7,522.70001,1.01,0,0,0},
{6959,104.09961,511.59961,1.02,0,0,0},
{6959,133.40039,510.5,1.01,0,0,0},
{10828,120.40039,520.90002,9.3,0,0,90},
{16662,205.10001,1821.8,17.8,0,0,63.336},
{10828,155,428.7998,25,0,0,0},
{10828,155,429.2002,10,0,0,0},
{8392,-7.7998,239.2,24.1,0,0,0},
{8392,118.2002,240.2002,30.6,0,0,0},
{8392,64.90039,237.2002,24.1,0,0,0},
{10828,158.90039,445.40039,9.6,0,0,90},
{3625,146.40039,514.5,16,0,0,174.996},
{6959,148.2998,504.70001,1.02,0,0,0},
{3364,127.6,517.20001,13.1,0,0,0},
{6959,-12,508,1.01,0,0,0},
{6959,-53.3,506.39999,1.01,0,0,0},
{3095,-51.7998,262,0.45,0,0,0},
{10828,56.2,538.5,29,0,90,0},
{3095,-42.7998,262,0.45,0,0,0},
{10828,33,538.59961,29,0,90,179.995},
{3095,-51.8,270.89999,0.45,0,0,0},
{3095,-42.7998,270.90039,0.45,0,0,0},
{8392,175.40039,493,30.01,0,0,270},
{3095,-33.7998,262,0.45,0,0,0},
{3095,-24.8,262,0.45,0,0,0},
{3095,-33.8,270.89999,0.45,0,0,0},
{3095,-24.8,270.89999,0.45,0,0,0},
{3095,-51.8,279.79999,0.45,0,0,0},
{3095,-42.7998,279.7998,0.45,0,0,0},
{3095,-33.7998,279.7998,0.45,0,0,0},
{3095,-24.7998,279.7998,0.45,0,0,0},
{16770,-21,272,2.6,0,0,180},
{16665,42.29981,262,1,0,0,90},
{17950,-7.3,251,3.2,0,0,0},
{16662,42.29981,251,1.6,0,0,149.996},
{16782,42.79981,249,2.2,0,0,90},
{17950,-0.52,251,3.2,0,0,0},
{17950,6.2,251,3.2,0,0,0},
{1715,40.4,259.20001,1,0,0,90},
{1715,46.1,258.5,1,0,0,270},
{1714,43.3,255.7,1,0,0,179.995},
{1715,46,261.29999,1,0,0,320},
{13011,10.4,252,2.2,0,0,180},
{1715,45.6,256.10001,1,0,0,220},
{1715,40.4,256.60001,1,0,0,120},
{1715,41.1,261.70001,1,0,0,40},
{1715,43.40039,262,1,0,0,0},
{3051,44.2002,267.7998,2.1,0,0,122.992},
{3051,40.3,267.79999,2.1,0,0,340},
{11292,-0.5,250,6.9,0,0,180},
{1502,43.7,267.79999,1,0,0,165},
{1502,40.74023,268.13965,1,0,0,0},
{6959,15.5,511.40039,1.02,0,0,0},
{10378,41.3,390,1,0,0,0},
{3885,33.5,538.70001,56.8,0,0,0},
{3885,60.4,542.59998,56.8,0,0,0},
{3884,59.8,542.70001,57.3,0,0,0},
{3884,33.9,539.29999,57.3,0,0,50},
{14602,-52.09961,478.90039,6.4,0,0,90},
{1502,-45,473.60001,1.1,0,0,90},
{1713,-50.9,466.89999,1,0,0,0},
{1713,-55,466.89999,1,0,0,0},
{1713,-50.9,471.39999,1,0,0,0},
{1713,-54.9,471.39999,1,0,0,0},
{1713,-54.8,476.79999,1,0,0,0},
{1713,-50.9,476.89999,1,0,0,0},
{1713,-59,466.89999,1,0,0,0},
{1713,-63.1,466.70001,1,0,0,0},
{1713,-46.4,466.70001,1,0,0,0},
{1713,-42.4,466.70001,1,0,0,0},
{1714,-52.1,460.89999,1,0,0,180},
{1714,-54.90039,458,1,0,0,179.995},
{1714,-49.3,458.10001,1,0,0,180},
{1714,-56.4,457.89999,1,0,0,180},
{1714,-47.6,458.10001,1,0,0,180},
{1522,-52.9,493.59,1.03,0,0,0},
{14805,166.7,118.9,472.79999,0,0,0},
{9833,21.79981,412.7002,4.5,0,0,0},
{9833,21.79981,366.5,4.5,0,0,0},
{9833,64,366.59961,4.5,0,0,0},
{9833,64,412,4.5,0,0,0},
{2570,-66.7,473.29999,1,0,0,90},
{1649,-60.20019,471.2002,2.8,0,0,0},
{1649,-57.7,480.5,2.8,0,0,90},
{1649,-57.7,476.10001,2.8,0,0,90},
{1649,-64.6,471.20001,2.8,0,0,0},
{3051,-67.4,471.20001,3.11,0,0,315},
{3051,-67.4,471.20001,0.4,0,0,315},
{2207,-63.09961,477.5,1,0,0,0},
{1703,-59.7998,472.09961,1,0,0,179.995},
{2140,-67.3,478.10001,1,0,0,90},
{1714,-62.1,479.5,1,0,0,0},
{2311,-63,475,1,0,0,0},
{1703,-63.2,472.10001,1,0,0,180},
{12943,111.33984,511.2998,1,0,0,179.797},
{3437,121.1,538.70001,33,0,0,0},
{3437,116.7,539.79999,38,0,90,347},
{3437,116.8,539.79999,28,0,90,347},
{3437,112,541,23,0,0,0},
{3437,116.8,539.79999,18,0,270,345},
{3437,107.1,546.09998,33,0,0,0},
{3437,103,547.40002,38,0,90,346},
{3437,102.6,547.29999,28.2,0,90,347},
{3437,97.9,548.5,23,0,0,0},
{3437,102.6,547.29999,18.1,0,270,345},
{3437,91,550.59998,33,0,0,0},
{3437,85.8,551.5,37.5,0,90,346},
{3437,86.1,551.40002,18.1,0,90,347},
{3437,91,550.70001,23,0,0,0},
{3437,81.5,552.59998,23,0,0,0},
{3437,82,553.09998,27.7,0,270,347},
{10558,116.7002,507.5,0,90,0,90},
{2395,-12.7998,506.7998,1,0,0,0},
{2395,-9.07,506.79999,1,0,0,0},
{2395,-5.34,506.7998,1,0,0,0},
{2395,-1.66992,506.7998,1,0,0,0},
{2395,2,506.7998,1,0,0,0},
{2395,12.7,507.29999,1,0,0,90},
{2395,12.7002,511,1,0,0,90},
{2395,12.71,514.40997,1.01,0,0,90},
{2395,-13.2,507.39999,1,0,0,90},
{2395,-13.20019,511.09961,1,0,0,90},
{2395,-13.20019,514.5,1,0,0,90},
{2395,-12.75977,517.71997,1,0,0,0},
{2395,-9.09961,517.71997,1,0,0,0},
{2395,-5.40039,517.71997,1,0,0,0},
{2395,-1.7002,517.71973,1,0,0,0},
{2395,2,517.71997,1,0,0,0},
{2395,5.7002,517.71997,1,0,0,0},
{2395,9.40039,517.71997,1,0,0,357.995},
{10767,250,379,-13.68,0,0,314.995},
{2395,-12.7998,509.63965,3.7,90,0,0},
{2395,-9.05,509.63965,3.7,90,0,0},
{2395,-5.32,509.63965,3.7,90,0,0},
{2395,-1.57,509.63965,3.7,90,0,0},
{2395,2.13965,509.63965,3.7,90,0,0},
{2395,5.87,509.63965,3.7,90,0,0},
{2395,9.4,509.63965,3.71,90,0,0},
{2395,9.4,512.37,3.7,90,0,0},
{2395,9.40039,515.09961,3.7,90,0,0},
{2395,9.4,517.84003,3.7,90,0,0},
{2395,5.66,512.34998,3.7,90,0,0},
{2395,5.66016,515.09003,3.7,90,0,0},
{2395,5.66016,517.83984,3.7,90,0,0},
{2395,1.92969,512.36035,3.7,90,0,0},
{2395,1.93,515.09998,3.7,90,0,0},
{2395,1.93,517.84003,3.7,90,0,0},
{2395,-1.59961,512,3.7,88.995,0,0},
{2395,-1.59961,515.09961,3.7,90,0,0},
{2395,-1.6,517.84003,3.7,90,0,0},
{2395,-5.32,512.35999,3.7,90,0,0},
{2395,-5.32,515.09998,3.7,90,0,0},
{2395,-5.32,517.84003,3.7,90,0,0},
{2395,-9.05,512.35999,3.7,90,0,0},
{2395,-9.05,515.09998,3.7,90,0,0},
{2395,-9.05,517.84003,3.7,90,0,0},
{2395,-12.7998,512.35999,3.7,90,0,0},
{2395,-12.7998,515.09961,3.7,90,0,0},
{2395,-12.7998,517.84003,3.7,90,0,0},
{1703,-5.40039,517.2002,1,0,0,0},
{1703,2.6,517.09998,1,0,0,0},
{1703,4.2002,507.59961,1,0,0,179.995},
{1703,-4.5,507.40039,1,0,0,179.995},
{2311,-1.2002,511.90039,1,0,0,0},
{2576,-11.7998,517.20001,1,0,0,0},
{2571,-11.6,510.60001,1,0,0,90},
{2066,7.2002,517.20001,1,0,0,0},
{2311,-7.9,511.89999,1,0,0,0},
{2311,6.8,511.89999,1,0,0,0},
{2321,-1.7002,507.39999,1,0,0,0},
{2321,-1.2002,517.20001,1,0,0,0},
{2239,-8.7,507.20001,1,0,0,0},
{2007,8,517.20001,1,0,0,0},
{10828,54.7002,556,17.6,90,0,90},
{10828,48,556,17.62,90,0,90},
{10828,58,554,15.9,0,0,90},
{10828,36.29981,554,15.9,0,0,90},
{10828,36.31,589.40002,15.9,0,0,90},
{10828,58,589.39899,15.9,0,0,90},
{10828,58.01,610,15.91,0,0,90},
{10828,36.3,610,15.91,0,0,90},
{10828,44.8,591.29999,17.61,90,90,180},
{10828,40,591,17.62,90,180,90},
{10828,54.2,610,17,90,0,90},
{3279,96.5,239.10001,56.7,0,0,179.995},
{10828,39,610,17.01,90,180,90},
{3279,-78.6,287,56.1,0,0,1},
{2395,-1.6,514,3.71,90,0,0},
{3108,137.60001,477.10001,27.3,0,0,0},
{3108,137.7,465.20001,27.3,0,0,0},
{2321,-12.8,507.2998,1,0,0,0},
{2395,4.4,517,3.701,90,0,0},
{3279,-4.4,536,56.1,0,0,0},
{3279,170.8,481.60001,56.1,0,0,0},
}) do
local obj = createObject(v[1], v[2], v[3], v[4], v[5], v[6], v[7])
setObjectScale(obj, 1)
setElementDimension(obj, 0)
setElementInterior(obj, 0)
setElementDoubleSided(obj, true)
setObjectBreakable(obj, false)
end | 36.888545 | 70 | 0.556693 |
cff6992e45d9be89f37fd5d98576894e38bcbeff | 118 | kt | Kotlin | compiler/src/main/kotlin/com/logickoder/simpletron/compiler/CompileError.kt | jeffreyorazulike/simpletron-compiler | 3819ec0135a6343896ed5766b5d7a5c657777b16 | [
"Apache-2.0"
] | 1 | 2022-01-24T16:55:20.000Z | 2022-01-24T16:55:20.000Z | compiler/src/main/kotlin/com/logickoder/simpletron/compiler/CompileError.kt | logickoder/simpletron-compiler | 3819ec0135a6343896ed5766b5d7a5c657777b16 | [
"Apache-2.0"
] | null | null | null | compiler/src/main/kotlin/com/logickoder/simpletron/compiler/CompileError.kt | logickoder/simpletron-compiler | 3819ec0135a6343896ed5766b5d7a5c657777b16 | [
"Apache-2.0"
] | null | null | null | package com.logickoder.simpletron.compiler
/**
*
*/
class CompileError(message: String) : RuntimeException(message) | 19.666667 | 63 | 0.771186 |
12c0ef095bff1be856ca430129e5baaed10f08be | 838 | asm | Assembly | oeis/243/A243451.asm | neoneye/loda-programs | 84790877f8e6c2e821b183d2e334d612045d29c0 | [
"Apache-2.0"
] | 11 | 2021-08-22T19:44:55.000Z | 2022-03-20T16:47:57.000Z | oeis/243/A243451.asm | neoneye/loda-programs | 84790877f8e6c2e821b183d2e334d612045d29c0 | [
"Apache-2.0"
] | 9 | 2021-08-29T13:15:54.000Z | 2022-03-09T19:52:31.000Z | oeis/243/A243451.asm | neoneye/loda-programs | 84790877f8e6c2e821b183d2e334d612045d29c0 | [
"Apache-2.0"
] | 3 | 2021-08-22T20:56:47.000Z | 2021-09-29T06:26:12.000Z | ; A243451: Primes of the form n^2 + 16.
; Submitted by Jon Maiga
; 17,41,97,137,241,457,641,857,977,1697,2417,2617,3041,4241,5641,6257,6577,7937,8297,9041,9817,11897,13241,14177,14657,15641,16657,22817,27241,32057,36497,44537,47977,48857,52457,53377,60041,62017,70241,75641,78977,83537,84697,87041,89417,90617,96737,99241,112241,123217,126041,130337,133241,136177,145177,151337,152897,156041,160817,168937,177257,184057,192737,203417,207041,219977,235241,239137,249017,265241,269377,275641,279857,303617,308041,326057,330641,342241,354041,361217,370897,378241,385657
mov $1,9
mov $2,332202
mov $5,16
lpb $2
mov $3,$6
seq $3,10051 ; Characteristic function of primes: 1 if n is prime, else 0.
sub $0,$3
add $1,2
mov $4,$0
max $4,0
cmp $4,$0
mul $2,$4
sub $2,18
sub $5,12
add $5,$1
mov $6,$5
lpe
mov $0,$5
add $0,1
| 34.916667 | 501 | 0.73031 |
3f80a2729d7a43b7e9ad143cbb18bd21bf119cf0 | 867 | kts | Kotlin | initial/build.gradle.kts | zerkshohei/spring-master-sample | eb11f5b1ab91dcb2bcfbd0db9d76cdafe801da95 | [
"MIT"
] | null | null | null | initial/build.gradle.kts | zerkshohei/spring-master-sample | eb11f5b1ab91dcb2bcfbd0db9d76cdafe801da95 | [
"MIT"
] | 3 | 2020-02-06T15:16:23.000Z | 2020-02-24T16:39:53.000Z | initial/build.gradle.kts | zerkshohei/spring-master-sample | eb11f5b1ab91dcb2bcfbd0db9d76cdafe801da95 | [
"MIT"
] | null | null | null |
plugins {
id("org.springframework.boot")
kotlin("jvm")
kotlin("plugin.spring")
}
dependencies {
implementation("com.fasterxml.jackson.module:jackson-module-kotlin")
implementation("org.jetbrains.kotlin:kotlin-reflect")
implementation("org.jetbrains.kotlin:kotlin-stdlib-jdk8")
implementation("org.springframework.boot:spring-boot-starter-web")
compileOnly("org.projectlombok:lombok")
implementation("org.springframework.boot:spring-boot-devtools")
implementation("org.springframework.boot:spring-boot-starter-validation")
annotationProcessor("org.springframework.boot:spring-boot-configuration-processor")
annotationProcessor("org.projectlombok:lombok")
testImplementation("org.springframework.boot:spring-boot-starter-test") {
exclude(group = "org.junit.vintage", module = "junit-vintage-engine")
}
}
| 41.285714 | 87 | 0.753172 |
9412361d60d4d8368a94a5200067a2f02cf922fe | 565 | cc | C++ | packages/mccomposite/tests/libmccomposite/geometry/testDilation.cc | mcvine/mcvine | 42232534b0c6af729628009bed165cd7d833789d | [
"BSD-3-Clause"
] | 5 | 2017-01-16T03:59:47.000Z | 2020-06-23T02:54:19.000Z | packages/mccomposite/tests/libmccomposite/geometry/testDilation.cc | mcvine/mcvine | 42232534b0c6af729628009bed165cd7d833789d | [
"BSD-3-Clause"
] | 293 | 2015-10-29T17:45:52.000Z | 2022-01-07T16:31:09.000Z | packages/mccomposite/tests/libmccomposite/geometry/testDilation.cc | mcvine/mcvine | 42232534b0c6af729628009bed165cd7d833789d | [
"BSD-3-Clause"
] | 1 | 2019-05-25T00:53:31.000Z | 2019-05-25T00:53:31.000Z | // -*- C++ -*-
//
// ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
//
// Jiao Lin
// California Institute of Technology
// (C) 2005 All Rights Reserved
//
// {LicenseText}
//
// ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
//
#include <iostream>
#include "mccomposite/geometry/operations/Dilation.h"
using namespace mccomposite;
void test1()
{
}
int main()
{
test1();
}
// version
// $Id$
// End of file
| 15.694444 | 81 | 0.346903 |
5b33115b5823306fc8befdff183e7c4f969e656e | 566 | cpp | C++ | Classes/PlayerCoinsComponent.cpp | kryvytskyidenys/Flower-farm | 85a58ce5eb1d1092b477bb4166c65b81b482af2e | [
"Apache-2.0"
] | 5 | 2019-03-15T17:53:43.000Z | 2022-03-12T10:39:02.000Z | Classes/PlayerCoinsComponent.cpp | KryvytskyiDenis/Flower-farm | 85a58ce5eb1d1092b477bb4166c65b81b482af2e | [
"Apache-2.0"
] | 1 | 2020-04-12T09:50:51.000Z | 2020-04-12T09:50:51.000Z | Classes/PlayerCoinsComponent.cpp | KryvytskyiDenis/Flower-farm | 85a58ce5eb1d1092b477bb4166c65b81b482af2e | [
"Apache-2.0"
] | null | null | null | #include "PlayerCoinsComponent.h"
long PlayerCoinsComponent::GetCoinsCount() const
{
return m_CoinsCount;
}
void PlayerCoinsComponent::VUpdate(void)
{
}
ComponentId PlayerCoinsComponent::VGetComponentId(void) const
{
return m_PlayerCoinsId;
}
void PlayerCoinsComponent::AddCoins(int coins)
{
m_CoinsCount += coins;
}
void PlayerCoinsComponent::RemoveCoins(int coins)
{
m_CoinsCount -= coins;
}
int PlayerCoinsComponent::GetFlowerPrice() const
{
return m_FlowerPrice;
}
PlayerCoinsComponent::PlayerCoinsComponent()
:m_CoinsCount(0)
{
}
| 15.722222 | 61 | 0.759717 |
724a6218e4d2ac38b5a776a6f8e942d2b1831c0c | 320 | swift | Swift | OnTheMap/OnTheMap/Controllers/LocationsList/Cell/LocationsListCell.swift | rsaenzi/iOS-Nanodegree-OnTheMap | e725b984ede3033f85ec1f22f9b87644d88da760 | [
"MIT"
] | null | null | null | OnTheMap/OnTheMap/Controllers/LocationsList/Cell/LocationsListCell.swift | rsaenzi/iOS-Nanodegree-OnTheMap | e725b984ede3033f85ec1f22f9b87644d88da760 | [
"MIT"
] | null | null | null | OnTheMap/OnTheMap/Controllers/LocationsList/Cell/LocationsListCell.swift | rsaenzi/iOS-Nanodegree-OnTheMap | e725b984ede3033f85ec1f22f9b87644d88da760 | [
"MIT"
] | null | null | null | //
// LocationsListCell.swift
// OnTheMap
//
// Created by Rigoberto Sáenz Imbacuán on 12/24/17.
// Copyright © 2017 Rigoberto Sáenz Imbacuán. All rights reserved.
//
import UIKit
class LocationsListCell: UITableViewCell {
@IBOutlet weak var labelName: UILabel!
@IBOutlet weak var labelWebsite: UILabel!
}
| 21.333333 | 67 | 0.73125 |
e5f679f025cd6107ae599f9ff8f7de5dfaa5c4ff | 1,424 | sql | SQL | coeus-db/coeus-db-sql/src/main/resources/org/kuali/coeus/coeus-sql/log/Release_2_0_logs/KRACOEUS-3404.sql | mrudulpolus/kc | 55f529e5ff0985f3bf5247e2a1e63c5dec07f560 | [
"ECL-2.0"
] | null | null | null | coeus-db/coeus-db-sql/src/main/resources/org/kuali/coeus/coeus-sql/log/Release_2_0_logs/KRACOEUS-3404.sql | mrudulpolus/kc | 55f529e5ff0985f3bf5247e2a1e63c5dec07f560 | [
"ECL-2.0"
] | null | null | null | coeus-db/coeus-db-sql/src/main/resources/org/kuali/coeus/coeus-sql/log/Release_2_0_logs/KRACOEUS-3404.sql | mrudulpolus/kc | 55f529e5ff0985f3bf5247e2a1e63c5dec07f560 | [
"ECL-2.0"
] | null | null | null | create table tmp_sponsor_form_templates as select * from sponsor_form_templates;
CREATE OR REPLACE
FUNCTION BLOB2CLOB(
L_BLOB BLOB)
RETURN CLOB
IS
L_CLOB CLOB;
L_SRC_OFFSET NUMBER;
L_DEST_OFFSET NUMBER;
L_BLOB_CSID NUMBER := DBMS_LOB.DEFAULT_CSID;
V_LANG_CONTEXT NUMBER := DBMS_LOB.DEFAULT_LANG_CTX;
L_WARNING NUMBER;
L_AMOUNT NUMBER := DBMS_LOB.LOBMAXSIZE;
BEGIN
IF L_BLOB IS NULL THEN
RETURN NULL;
ELSE
DBMS_LOB.CREATETEMPORARY (L_CLOB, TRUE);
L_SRC_OFFSET := 1;
L_DEST_OFFSET := 1;
L_AMOUNT := NVL(DBMS_LOB.GETLENGTH (L_BLOB), 0);
DBMS_LOB.CONVERTTOCLOB (L_CLOB, L_BLOB, L_AMOUNT, L_SRC_OFFSET, L_DEST_OFFSET, 0, V_LANG_CONTEXT, L_WARNING );
RETURN L_CLOB;
END IF;
END;
/
delete from sponsor_form_templates;
alter table sponsor_form_templates drop column form_template ;
alter table sponsor_form_templates add form_template clob;
INSERT
INTO SPONSOR_FORM_TEMPLATES
(
SPONSOR_CODE,
PACKAGE_NUMBER,
PAGE_NUMBER,
PAGE_DESCRIPTION,
UPDATE_TIMESTAMP,
UPDATE_USER,
VER_NBR,
OBJ_ID,
FILE_NAME,
CONTENT_TYPE,
FORM_TEMPLATE
)
SELECT SPONSOR_CODE,
PACKAGE_NUMBER,
PAGE_NUMBER,
PAGE_DESCRIPTION,
UPDATE_TIMESTAMP,
UPDATE_USER,
VER_NBR,
OBJ_ID,
FILE_NAME,
CONTENT_TYPE,
blob2clob(form_template)
FROM TMP_SPONSOR_FORM_TEMPLATES ;
COMMIT;
DROP FUNCTION BLOB2CLOB;
| 24.135593 | 116 | 0.729635 |
bdd214320cee45abbccedb4d924da2fa7b7d03ce | 407 | sql | SQL | public/assets/migrations/2018_04_16_111700_create_change_log_table.sql | KevinMarete/adtv4 | 37736d7f27c2b9fcc9178ddc5202d843b5f3a38c | [
"MIT"
] | null | null | null | public/assets/migrations/2018_04_16_111700_create_change_log_table.sql | KevinMarete/adtv4 | 37736d7f27c2b9fcc9178ddc5202d843b5f3a38c | [
"MIT"
] | null | null | null | public/assets/migrations/2018_04_16_111700_create_change_log_table.sql | KevinMarete/adtv4 | 37736d7f27c2b9fcc9178ddc5202d843b5f3a38c | [
"MIT"
] | null | null | null | CREATE TABLE IF NOT EXISTS change_log (
id bigint(20) NOT NULL AUTO_INCREMENT,
patient varchar(20) NOT NULL,
facility int(32) NOT NULL,
change_type varchar(20) NOT NULL,
old_value varchar(50) NOT NULL,
new_value varchar(50) NOT NULL,
change_purpose varchar(50) NOT NULL,
change_date timestamp NOT NULL DEFAULT now(),
PRIMARY KEY (id),
KEY patient (patient),
KEY facility (facility)
)// | 31.307692 | 47 | 0.732187 |
3db67af1294aa026ef2ec12afa296514ead0d250 | 3,968 | ps1 | PowerShell | PSCI/Private/deploy/Update-ConfigFile/Get-UpdateKeyValueCmdParams.Tests.ps1 | CyMadigan/PSCI | 6f6e240594701aaac06f8e850e705a832186b265 | [
"MIT"
] | 48 | 2016-12-10T07:32:28.000Z | 2022-02-04T21:48:17.000Z | PSCI/Private/deploy/Update-ConfigFile/Get-UpdateKeyValueCmdParams.Tests.ps1 | CyMadigan/PSCI | 6f6e240594701aaac06f8e850e705a832186b265 | [
"MIT"
] | 46 | 2015-02-22T10:47:51.000Z | 2016-05-04T13:19:58.000Z | PSCI/Private/deploy/Update-ConfigFile/Get-UpdateKeyValueCmdParams.Tests.ps1 | CyMadigan/PSCI | 6f6e240594701aaac06f8e850e705a832186b265 | [
"MIT"
] | 16 | 2015-04-29T08:51:18.000Z | 2016-11-23T12:50:56.000Z | <#
The MIT License (MIT)
Copyright (c) 2015 Objectivity Bespoke Software Specialists
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.
#>
Import-Module -Name "$PSScriptRoot\..\..\..\PSCI.psd1"
Describe -Tag "PSCI.unit" "Get-UpdateKeyValueCmdParams" {
InModuleScope PSCI {
$testFileName = "$PSScriptRoot\Get-UpdateKeyValueCmdParams.test"
function New-TestFile {
Set-Content -Path $testFileName -Value @'
key1=value1
key\2 = value2
[Section]
key3=value3
key4= value4
key5=
key6=value6
app.webservice.password=zzz
'@
}
Context "when supplied a file with multiple key=value lines" {
It "should properly update the lines" {
try {
New-TestFile
$configValues = @('key1=newValue1', 'key\2=newValue2', 'key3=value3', 'key5=c:\a\b', 'key6=', 'keyNew=newValue', 'app.webservice.password=123')
$params = Get-UpdateKeyValueCmdParams -ConfigFiles $testFileName -ConfigValues $configValues
$result = Invoke-Command @params
Write-Host $result
$content = [IO.File]::ReadAllText($testFileName)
$content | Should Be @'
key1=newValue1
key\2 =newValue2
[Section]
key3=value3
key4= value4
key5=c:\\a\\b
key6=
app.webservice.password=123
keyNew=newValue
'@
$result | Should Not Be $null
$result.Count | Should Be 8
$result[0] | Should Match "Key 'key1' - value set to 'newValue1'"
$result[1] | Should Match "Key 'key\\2' - value set to 'newValue2'"
$result[2] | Should Match "Key 'key3' - value is already 'value3'"
$result[3] | Should Match "Key 'key5' - value set to 'c:\\\\a\\\\b'"
$result[4] | Should Match "Key 'key6' - value set to ''"
$result[5] | Should Match "Key 'keyNew' not found - adding with value 'newValue'"
$result[6] | Should Match "Key 'app.webservice.password' - value set to '123'"
} finally {
Remove-Item -LiteralPath $testFileName -Force -ErrorAction SilentlyContinue
}
}
}
Context "when FailIfCannotMatch=true and cannot match" {
It "should fail" {
try {
New-TestFile
$params = Get-UpdateKeyValueCmdParams -ConfigFiles $testFileName -ConfigValues 'keyNotFound=test' -FailIfCannotMatch
try {
Invoke-Command @params
} catch {
Write-Host $_
return
}
0 | Should Be 1
} finally {
Remove-Item -LiteralPath $testFileName -Force -ErrorAction SilentlyContinue
}
}
}
}
}
| 35.428571 | 163 | 0.597278 |
8ed9f4f7f5fa515c27bed1acad622f019204d059 | 292 | swift | Swift | TextureBook/Library/InlineCellNode.swift | muukii/TextureBook | 40563b071b66217fbc46cae5c0196c7878bc40ee | [
"MIT"
] | 6 | 2018-09-13T11:17:11.000Z | 2019-10-31T10:31:32.000Z | TextureBook/Library/InlineCellNode.swift | muukii/TextureBook | 40563b071b66217fbc46cae5c0196c7878bc40ee | [
"MIT"
] | null | null | null | TextureBook/Library/InlineCellNode.swift | muukii/TextureBook | 40563b071b66217fbc46cae5c0196c7878bc40ee | [
"MIT"
] | 1 | 2020-02-05T13:47:36.000Z | 2020-02-05T13:47:36.000Z | //
// InlineCellNode.swift
// TextureBook
//
// Created by muukii on 9/12/18.
// Copyright © 2018 muukii. All rights reserved.
//
import UIKit
import AsyncDisplayKit
class InlineCellNode : ASCellNode {
init(_ setup: (InlineCellNode) -> Void) {
super.init()
setup(self)
}
}
| 15.368421 | 49 | 0.667808 |
91bb6271355c0f63575256aabe0b1a5e4a07c8a2 | 1,563 | lua | Lua | src/utils.lua | michidevv/tile-rpg | 880a242e6e021c9b2d2058ee225e2a6024e8113b | [
"MIT"
] | null | null | null | src/utils.lua | michidevv/tile-rpg | 880a242e6e021c9b2d2058ee225e2a6024e8113b | [
"MIT"
] | null | null | null | src/utils.lua | michidevv/tile-rpg | 880a242e6e021c9b2d2058ee225e2a6024e8113b | [
"MIT"
] | null | null | null | local Utils = {
generateQuads = function (atlas, tileWidth, tileHeight)
local quads = {}
local width, height = atlas:getDimensions()
local sheetWidth = width / tileWidth
local sheetHeight = height / tileHeight
local spriteCount = 1
for y = 0, sheetHeight - 1 do
for x = 0, sheetWidth - 1 do
quads[spriteCount] = love.graphics.newQuad(x * tileWidth, y * tileHeight,
tileWidth, tileHeight, width, height)
spriteCount = spriteCount + 1
end
end
return quads
end,
generateQuadsFromTo = function(atlas, tileWidth, tileHeight, from, total, offset)
from = from or { x = 0, y = 0 }
total = total or -1
offset = offset or { x = 0, y = 0 }
local quads = {}
local width, height = atlas:getDimensions()
local sheetWidth = width / tileWidth
local sheetHeight = height / tileHeight
local spriteCount = 0
(function()
for y = from.y, sheetHeight - 1 do
for x = from.x, sheetWidth - 1 do
spriteCount = spriteCount + 1
quads[spriteCount] = love.graphics.newQuad(x * (tileWidth + offset.x), y * (tileHeight + offset.y),
tileWidth, tileHeight, width, height)
if spriteCount >= total then
return
end
end
end
end)()
return quads
end
}
return Utils
| 30.057692 | 119 | 0.522713 |
8048d04b0b0827eb343835ea837733f04b89abcf | 741 | sql | SQL | db/course-group-management.sql | FelixJacobi/stsbl-iserv-course-group-management | 2d348626bf7e9faec4880dd8212926d7602b0408 | [
"MIT"
] | null | null | null | db/course-group-management.sql | FelixJacobi/stsbl-iserv-course-group-management | 2d348626bf7e9faec4880dd8212926d7602b0408 | [
"MIT"
] | null | null | null | db/course-group-management.sql | FelixJacobi/stsbl-iserv-course-group-management | 2d348626bf7e9faec4880dd8212926d7602b0408 | [
"MIT"
] | null | null | null | /**
* Author: Felix Jacobi
* Created: 17.07.2019
* License: https://opensource.org/licenses/MIT MIT license
*/
CREATE TABLE cgr_management_promotion_requests (
ID SERIAL PRIMARY KEY,
ActGrp TEXT NOT NULL UNIQUE
REFERENCES groups(Act)
ON UPDATE CASCADE
ON DELETE CASCADE,
ActUsr TEXT NOT NULL
REFERENCES users(Act)
ON UPDATE CASCADE
ON DELETE CASCADE,
Created TIMESTAMPTZ NOT NULL,
Comment TEXT
);
GRANT SELECT, USAGE ON "cgr_management_promotion_requests_id_seq" TO "symfony";
GRANT SELECT, INSERT, UPDATE, DELETE ON "cgr_management_promotion_requests" TO "symfony"; | 33.681818 | 89 | 0.611336 |
0c90a406e4f9fdbea0679ef7fa814f9200555402 | 15,023 | py | Python | taylor_based_methods.py | PabloAMC/TFermion | ed313a7d9cae0c4ca232732bed046f56bc8594a2 | [
"Apache-2.0"
] | 4 | 2021-12-02T09:13:16.000Z | 2022-01-25T10:43:50.000Z | taylor_based_methods.py | PabloAMC/TFermion | ed313a7d9cae0c4ca232732bed046f56bc8594a2 | [
"Apache-2.0"
] | 3 | 2021-12-21T14:22:57.000Z | 2022-02-05T18:35:16.000Z | taylor_based_methods.py | PabloAMC/TFermion | ed313a7d9cae0c4ca232732bed046f56bc8594a2 | [
"Apache-2.0"
] | null | null | null | import math
import sympy
import numpy as np
from scipy.special import binom
import scipy
class Taylor_based_methods:
def __init__(self, tools):
self.tools = tools
# Taylorization (babbush2016exponential)
# Let us know calcula the cost of performing Phase Estimation.
# 1. We have already mentioned that in this case, controlling the direction of the time evolution adds negligible cost. We will also take the unitary $U$ in Phase estimation to be $U_r$. The number of segments we will have to Hamiltonian simulate in the phase estimation protocol is $r \\approx \\frac{4.7}{\\epsilon_{\\text{PEA}}}$.
# 2. Using oblivious amplitude amplification operator $G$ requires to use $\\mathcal{W}$ three times.
# 3. Each operator $G$ requires to use Prepare$(\\beta)$ twice and Select$(V)$ once.
# 4. The cost of Select$(V)$ is bounded in $8N\\lceil \\log_2\\Gamma + 1\\rceil\\frac{K(K+1)(2K+1)}{3}+ 16N K(K+1)$.
# 5. The cost of Prepare$(\\beta)$ is $(20+24\\log\\epsilon^{-1}_{SS})K$ T gates for the preparation of $\\ket{k}$; and $(10+12\\log\\epsilon^{-1}_{SS})2^{\\lceil \\log \\Gamma \\rceil + 1}K$ T gates for the implementation of the $K$ Prepare$(W)$ circuits. Here notice that $2K$ and $2^{\\lceil \\log \\Gamma \\rceil + 1}K$ rotations up to error $\\epsilon_{SS}$ will be implemented.
# Remember that
# $$ K = O\\left( \\frac{\\log(r/\\epsilon_{HS})}{\\log \\log(r/\\epsilon_{HS})} \\right)$$
# Notice that the $\\lambda$ parameters comes in the algorithm only implicitly,
# since we take the evolution time of a single segment to be $t_1 = \\ln 2/\\lambda$ such that the first segment in Phase estimation has $r = \\frac{\\lambda t_1}{\\ln 2} = 1$ as it should be.
# In general, we will need to implement $r \\approx \\frac{4.7}{\\epsilon_{PEA}}$. However, since $\\epsilon_{PEA}$ makes reference to $H$ and we are instead simulating $H \\ln 2/ \\lambda$,
# we will have to calculate the eigenvalue to precision $\\epsilon \\ln 2/ \\lambda$; so it is equivalently to fixing an initial time $t_1$ and running multiple segments in each of the $U$ operators in Phase Estimation.
def taylor_naive(self, epsilons, p_fail, lambda_value, Gamma, N):
epsilon_QPE = epsilons[0]
epsilon_HS = epsilons[1]
epsilon_S = epsilons[2]
t = np.pi/epsilon_QPE*(1/2+1/(2*p_fail))
r = np.ceil(t*lambda_value / np.log(2)) # Number of time segments
K = np.ceil( -1 + 2* np.log(2*r/epsilon_HS)/np.log(np.log(2*r/epsilon_HS)+1))
arb_state_synt = self.tools.arbitrary_state_synthesis(4*np.ceil(np.log2(N)))
epsilon_SS = epsilon_S /(r*3*2*(K*arb_state_synt + 2*K) ) # 3 from AA, 2 for for Prepare and Prepare^+, then Prepare_beta_1 and Prepare_beta_2, finally r
Select_j = 4*N*self.tools.multi_controlled_not(np.ceil(np.log2(N))+2) + 4*N + N*self.tools.multi_controlled_not(np.ceil(np.log2(N)))
# We use an accumulator that applies C-Z and upon stop applies the X or Y with phase: The 4 comes from values of q, the N from values of j;
# the first term applies the X or Y (and phase); the 4N comes from the Toffolis in the C-Z; the third term deactivates the accumulator
Select_H = 4*Select_j # 4 creation/annihilation operators per H_\gamma
QPE_adaptation = self.tools.multi_controlled_not(np.ceil(K/2) + 1)
Select_V = Select_H * K + QPE_adaptation
crot_synt = self.tools.c_pauli_rotation_synthesis(epsilon_SS)
rot_synt = self.tools.pauli_rotation_synthesis(epsilon_SS)
Prepare_beta_1 = crot_synt*K
Prepare_beta_2 = rot_synt*K*arb_state_synt
Prepare_beta = Prepare_beta_1 + Prepare_beta_2
R = self.tools.multi_controlled_not((K+1)*np.ceil(np.log2(Gamma)) + N) # The prepare qubits and the select qubits (in Jordan-Wigner there are N)
result = r*(3*(2*Prepare_beta + Select_V) + 2*R) # 3 from AA, 2 Prepare_beta for Prepare and Prepare^+
return result
def taylor_on_the_fly(self, epsilons, p_fail, N, Gamma, phi_max, dphi_max, zeta_max_i, J):
epsilon_QPE = epsilons[0]
epsilon_HS = epsilons[1]
epsilon_S = epsilons[2]
epsilon_H = epsilons[3]
eps_tay = epsilons[4]
'''
Error terms
eps_PEA: Phase estimation
eps_HS: the truncation of K
eps_S: gate synthesis
eps_H: discretization of integrals
eps_taylor: Used for arithmetic operations such as taylor series, babylon algorithm for the sqrt and CORDIC algorithm for cos
zeta_max_i: maximum nuclear charge
J: number of atoms
'''
d = 6 # Number of Gaussians per basis function
t = np.pi/epsilon_QPE*(1/2+1/(2*p_fail))
x_max = np.log(N * t/ epsilon_H)* self.tools.config_variables['xmax_mult_factor_taylor'] # eq 68 in the original paper
Vol_max_w_gamma = (2**6*phi_max**4 * x_max**5) # eq 66 in the original article
lambda_value = Gamma*Vol_max_w_gamma # eq 60 in the original article
r = np.ceil(lambda_value* t / np.log(2))
K = np.ceil( -1 + 2* np.log(2*r/epsilon_HS)/np.log(np.log(2*r/epsilon_HS)+1))
# zeta = epsilon_HS /(2*3*K*r*Gamma*Vol); eq 55 in the original article
M = lambda_value* 2*3*K*r/epsilon_H # = 6*K*r*Gamma*Vol_max_w_gamma/epsilon_H; eq 55 in the original article
epsilon_SS = epsilon_S /(r*3*2*(2*K)) # 3 from AA, 2 Prepare_beta for Prepare and Prepare^+, 2K T gates in the initial theta rotations
number_of_taylor_expansions = (((4+2+2)*d*N + (J+1))*K*2*3*r) #4+2+2 = two_body + kinetic + external_potential
eps_tay_s = eps_tay/number_of_taylor_expansions
x = sympy.Symbol('x')
exp_order = self.tools.order_find(lambda x:math.exp(zeta_max_i*(x)**2), e = eps_tay_s, xeval = x_max, function_name = 'exp')
sqrt_order = self.tools.order_find(lambda x:math.sqrt(x), e = eps_tay_s, xeval = x_max, function_name = 'sqrt')
mu = ( r*3*2*K/epsilon_H *2*(4*dphi_max + phi_max/x_max)*phi_max**3 * x_max**6 )**6
n = np.ceil(np.ceil(np.log2(mu))/3) #each coordinate is a third
sum = self.tools.sum_cost(n)
mult = self.tools.multiplication_cost(n)
div = self.tools.divide_cost(n)
tay = exp_order*sum + (exp_order-1)*(mult + div) # For the exp
babylon = sqrt_order*(div + sum) # For the sqrt
Q = N*d*((3*sum) + (3*mult +2*sum) + (mult) + tay + (3*mult)) #In parenthesis each step in the list
Qnabla = Q + N*d*(4*sum+mult+div)
R = 2*mult + sum + babylon
xi = 3*sum
two_body = xi + 4*Q + R + 4*mult
kinetic = Q + Qnabla + mult
external_potential = 2*Q + J*R + J*mult + (J-1)*sum + xi*J
sample = two_body + (kinetic + external_potential + sum)
# Notice the change of n here: it is the size of register |m>
n = np.ceil(np.log2(M))
sum = self.tools.sum_cost(n)
mult = self.tools.multiplication_cost(n)
div = self.tools.divide_cost(n)
comp = self.tools.compare_cost(max(np.ceil(np.log2(M)),np.ceil(np.log2(mu))))
kickback = 2*(mult + 3*sum + comp) #For the comparison operation. The rotation itself is Clifford, as it is a C-R(pi/2)
crot_synt = self.tools.c_pauli_rotation_synthesis(epsilon_SS)
Prepare_beta_1 = crot_synt*K
Prepare_beta_2 = ( 2*sample + kickback )*K
Prepare_beta = Prepare_beta_1 + Prepare_beta_2
Select_j = 4*N*self.tools.multi_controlled_not(np.ceil(np.log2(N))+2) + 4*N + N*self.tools.multi_controlled_not(np.ceil(np.log2(N)))
# The 4 comes from values of q, the N from values of j; the 4N comes from the Toffolis in the C-Z; the third term deactivates the accumulator
Select_H = 4*Select_j
QPE_adaptation = self.tools.multi_controlled_not(np.ceil(K/2) + 1)
Select_V = Select_H * K + QPE_adaptation
R = self.tools.multi_controlled_not((K+1)*np.log2(Gamma) + N) # The prepare qubits and the select qubits (in Jordan-Wigner there are N)
result = r*(3*(2*Prepare_beta + Select_V) + 2*R)
return result
def configuration_interaction(self, epsilons, p_fail, N, eta, alpha, gamma1, gamma2, zeta_max_i, phi_max, J):
epsilon_QPE = epsilons[0]
epsilon_HS = epsilons[1]
epsilon_S = epsilons[2]
epsilon_H = epsilons[3]
eps_tay = epsilons[4]
'''
gamma1, gamma2, alpha are defined in 28, 29 and 30 of the original paper https://iopscience.iop.org/article/10.1088/2058-9565/aa9463/meta
'''
d = 6 ## THIS IS SORT OF AN HYPERPARAMETER: THE NUMBER OF GAUSSIANS PER BASIS FUNCTION
K0 = 26*gamma1/alpha**2 + 8*np.pi*gamma2/alpha**3 + 32*np.sqrt(3)*gamma1*gamma2 # eq 37 in original article
K1 = 8*np.pi**2/alpha**3*(alpha + 2) + 1121*(8*gamma1 + np.sqrt(2)) # eq 41 in original article
K2 = 128*np.pi/alpha**6*(alpha + 2) + 2161*np.pi**2*(20*gamma1 + np.sqrt(2)) # eq 45 in original article
t = np.pi/epsilon_QPE*(1/2+1/(2*p_fail))
x_max = 1 # Default units are Angstroms. See https://en.wikipedia.org/wiki/Atomic_radius and https://en.wikipedia.org/wiki/Atomic_radii_of_the_elements_(data_page)
Gamma = binom(eta, 2)*binom(N-eta, 2) + binom(eta,1)*binom(N-eta,1) + 1 # = d
Zq = eta
'''
Warning, we have a circular definition here of delta, mu_M_zeta and r.
In practice we compute the equality value r given by the lemmas in the paper:
r ~= r_bound_calc(r)
'''
def r_bound_calc(r):
K = np.ceil( -1 + 2* np.log(2*r/epsilon_HS)/np.log(np.log(2*r/epsilon_HS)+1))
delta = epsilon_H/(2*3*r*K) # delta is the error in calculating a single integral. There are 2*3K*r of them in the simulation,
# as r segments are simulated, for a total time of t
mu_M_zeta_bound = np.max([
672*np.pi**2/(alpha**3)*phi_max**4*x_max**5*(np.log(K2*phi_max**4*x_max**5/delta))**6,
256*np.pi**2/(alpha**3)*Zq*phi_max**2*x_max**2*(np.log(K1*Zq*phi_max**2*x_max**2/delta))**3,
32*gamma1**2/(alpha**3)*phi_max**2*x_max*(np.log(K0*phi_max**2*x_max/delta))**3
]) #This bound is so because Lemmas 1-3 are bounding aleph_{\gamma,\rho}. Taking the definition of M, it is clear.
r_bound = 2*Gamma*t*mu_M_zeta_bound/np.log(2)
return r_bound
result = scipy.optimize.minimize(fun = lambda logr: (logr - np.log(r_bound_calc(np.exp(logr))))**2, x0 = 25, tol = .05, options = {'maxiter': 5000}, method='COBYLA') # Works with COBYLA, but not with SLSQP (misses the boundaries) or trust-constr (oscillates)
logr = np.ceil(result['x'])
r = np.exp(logr)
#bound = r_bound_calc(r) #This should be close to each r, relatively speaking
#r_alt = r_bound_calc(Gamma*t) #Alternative and less accurate way of computing the result
K = np.ceil( -1 + 2* np.log(2*r/epsilon_HS)/np.log(np.log(2*r/epsilon_HS)+1))
delta = epsilon_H/(2*3*r*K)
mu_M_zeta = np.max([
672*np.pi**2/(alpha**3)*phi_max**4*x_max**5*(np.log(K2*phi_max**4*x_max**5/delta))**6,
256*np.pi**2/(alpha**3)*Zq*phi_max**2*x_max**2*(np.log(K1*Zq*phi_max**2*x_max**2/delta))**3,
32*gamma1**2/(alpha**3)*phi_max**2*x_max*(np.log(K0*phi_max**2*x_max/delta))**3
])
log2mu = np.max([
6*(np.log2(K2*phi_max**4*x_max**5) + np.log2(1/delta) + 7*np.log2(1/alpha*(np.log(K2*phi_max**4*x_max**5)+np.log(1/delta)))),
3*(np.log2(K1*Zq*phi_max**2*x_max**2)+np.log2(1/delta) + 4*np.log2(2/alpha*(np.log(K1*Zq*phi_max**2*x_max**2)+np.log(1/delta)))),
3*(np.log2(K0*phi_max**2*x_max)+np.log2(1/delta) +4*np.log2 (2/alpha*(np.log(K0*phi_max**2*x_max)+np.log(1/delta))))
])
#zeta = epsilon_H/(r*Gamma*mu*3*2*K)
log2M = np.ceil(np.log2(mu_M_zeta)+ np.log2(3*2*K*r*Gamma)+ np.log2(1/epsilon_H)) #M = mu_M_zeta*/(mu*zeta)
epsilon_SS = epsilon_S / (r*3*2*(2*K)) # 3 from AA, 2 Prepare_beta for Prepare and Prepare^+, 2K T gates in the initial theta rotations
crot_synt = self.tools.c_pauli_rotation_synthesis(epsilon_SS)
Prepare_beta = crot_synt*K
#### Qval cost computation
n = np.ceil(log2mu/3) #each coordinate is a third
x = sympy.Symbol('x')
number_of_taylor_expansions = (((2*4+2+2)*d*N + (J+1))*K*2*3*r) #2*4+2+2 = 2*two_body + kinetic + external_potential
eps_tay_s = eps_tay/number_of_taylor_expansions
exp_order = self.tools.order_find(lambda x:math.exp(zeta_max_i*(x)**2), function_name = 'exp', e = eps_tay_s, xeval = x_max)
sqrt_order = self.tools.order_find(lambda x:math.sqrt(x), function_name = 'sqrt', e = eps_tay_s, xeval = x_max)
sum = self.tools.sum_cost(n)
mult = self.tools.multiplication_cost(n)
div = self.tools.divide_cost(n)
tay = exp_order*sum + (exp_order-1)*(mult + div) # For the exp
babylon = sqrt_order*(div + sum) # For the sqrt
Q = N*d*((3*sum) + (3*mult +2*sum) + (mult) + tay + (3*mult)) #In parenthesis each step in the list
Qnabla = Q + N*d*(4*sum+mult+div)
R = 2*mult + sum + babylon
xi = 3*sum
two_body = xi + 4*Q + R + 4*mult
kinetic = Q + Qnabla + mult
external_potential = 2*Q + J*R + J*mult + (J-1)*sum + xi*J
sample_2body = 2*two_body + sum
sample_1body = kinetic + external_potential + sum
comp = self.tools.compare_cost(max(np.ceil(log2M),np.ceil(log2mu)))
kickback = 2*comp
Q_val = 2*(sample_2body + sample_1body) + kickback
### Qcol cost computation
# There will be eta registers with log2(N) qubits each
compare = self.tools.compare_cost(np.ceil(np.log2(N)))
sort = eta*(4 + compare) # 4 for the c-swap and one comparison
check = self.tools.multi_controlled_not(eta*np.ceil(np.log2(N)))
sum = self.tools.sum_cost(np.ceil(np.log2(N)))
find_alphas = 2* eta*(4*sum + check + sort + compare) #The 2 is because if it fails we have to reverse the computation
find_gammas_2y4 = 2*(3*sum + check+ sort+ compare +3*4) + find_alphas # The 3*4 is the final 3 Toffolis; the 2 is is because if it fails we have to reverse the computation
Q_col = 2*find_alphas + 2*find_gammas_2y4
Select_H = Q_val + 2*Q_col # +swaps, but they are Clifford
QPE_adaptation = self.tools.multi_controlled_not(np.ceil(K/2) + 1)
Select_V = K*Select_H + QPE_adaptation
R = self.tools.multi_controlled_not((K+1)*np.ceil(np.log2(Gamma)) + N) # The prepare qubits and the select qubits (in Jordan-Wigner there are N)
result = r*(3*(2*Prepare_beta + Select_V) + 2*R)
return result | 55.847584 | 387 | 0.628969 |
9bb63571f6208f30bdf7c93e4e1b892c1f967e3f | 799 | js | JavaScript | 2/2_inputs.js | johannesmadis/advent-of-code-2019 | 7f57554baf003d145ef6d45f309e86368c037c10 | [
"MIT"
] | null | null | null | 2/2_inputs.js | johannesmadis/advent-of-code-2019 | 7f57554baf003d145ef6d45f309e86368c037c10 | [
"MIT"
] | null | null | null | 2/2_inputs.js | johannesmadis/advent-of-code-2019 | 7f57554baf003d145ef6d45f309e86368c037c10 | [
"MIT"
] | null | null | null | exports.initialMemory = [
1,
0,
0,
3,
1,
1,
2,
3,
1,
3,
4,
3,
1,
5,
0,
3,
2,
13,
1,
19,
1,
19,
6,
23,
1,
23,
6,
27,
1,
13,
27,
31,
2,
13,
31,
35,
1,
5,
35,
39,
2,
39,
13,
43,
1,
10,
43,
47,
2,
13,
47,
51,
1,
6,
51,
55,
2,
55,
13,
59,
1,
59,
10,
63,
1,
63,
10,
67,
2,
10,
67,
71,
1,
6,
71,
75,
1,
10,
75,
79,
1,
79,
9,
83,
2,
83,
6,
87,
2,
87,
9,
91,
1,
5,
91,
95,
1,
6,
95,
99,
1,
99,
9,
103,
2,
10,
103,
107,
1,
107,
6,
111,
2,
9,
111,
115,
1,
5,
115,
119,
1,
10,
119,
123,
1,
2,
123,
127,
1,
127,
6,
0,
99,
2,
14,
0,
0,
];
| 5.707143 | 25 | 0.302879 |
cb60d53c646d0de1aa88586ea58813ae4a484e44 | 322 | html | HTML | src/modules/content-news.html | duckies/rbp-theme | 00c9804bbc300958e43471a0c8b27684b9bb0a73 | [
"MIT"
] | null | null | null | src/modules/content-news.html | duckies/rbp-theme | 00c9804bbc300958e43471a0c8b27684b9bb0a73 | [
"MIT"
] | 5 | 2018-10-21T09:29:34.000Z | 2019-04-17T06:49:02.000Z | src/modules/content-news.html | Seikcud/rbp-theme | 00c9804bbc300958e43471a0c8b27684b9bb0a73 | [
"MIT"
] | null | null | null | <div id="news-api-wrapper" class="news flex-row">
<div class="news--loader">
<div class="news--loader__block"></div>
<div class="news--loader__block"></div>
<div class="news--loader__block"></div>
<div class="news--loader__block"></div>
<div class="news--loader__block"></div>
</div>
</div> | 35.777778 | 50 | 0.618012 |
f5c71ec79eb2d8341c6b5df594db726e473bf14b | 262 | ps1 | PowerShell | automatic/notepadplusplus.install/update.ps1 | tunisiano187/chocolatey-coreteampackages | 7d4cb3536f200d4013abe8db03042a029eb7763c | [
"Apache-2.0"
] | 145 | 2019-04-26T10:14:58.000Z | 2021-08-18T04:51:09.000Z | automatic/notepadplusplus.install/update.ps1 | tunisiano187/chocolatey-coreteampackages | 7d4cb3536f200d4013abe8db03042a029eb7763c | [
"Apache-2.0"
] | 524 | 2019-04-24T13:28:52.000Z | 2021-10-13T05:43:25.000Z | automatic/notepadplusplus.install/update.ps1 | tunisiano187/chocolatey-coreteampackages | 7d4cb3536f200d4013abe8db03042a029eb7763c | [
"Apache-2.0"
] | 180 | 2019-04-24T13:23:39.000Z | 2021-10-12T20:11:16.000Z | . $PSScriptRoot\..\notepadplusplus.commandline\update.ps1
function global:au_BeforeUpdate {
$Latest.URL32 = $Latest.URL32_i
$Latest.URL64 = $Latest.URL64_i
$Latest.FileType = 'exe'
Get-RemoteFiles -Purge -NoSuffix
}
update -ChecksumFor none
| 23.818182 | 59 | 0.721374 |
0dcd076d685e9b35e6ed0cedb048ba13dbf55072 | 888 | sql | SQL | apps/periods/models/tables/data/en/sql/tbl_period_data.sql | wvanheemstra/core | 8461e49e392b73f841058514414dd0cf74e55033 | [
"Unlicense",
"MIT"
] | 1 | 2018-03-15T15:01:39.000Z | 2018-03-15T15:01:39.000Z | apps/periods/models/tables/data/en/sql/tbl_period_data.sql | wvanheemstra/core | 8461e49e392b73f841058514414dd0cf74e55033 | [
"Unlicense",
"MIT"
] | null | null | null | apps/periods/models/tables/data/en/sql/tbl_period_data.sql | wvanheemstra/core | 8461e49e392b73f841058514414dd0cf74e55033 | [
"Unlicense",
"MIT"
] | null | null | null | /*
Navicat MySQL Data Transfer
Source Server : wvanheem_core_local
Source Server Version : 50509
Source Host : 127.0.0.1
Source Database : core
Target Server Version : 50509
File Encoding : utf-8
Date: 06/23/2012 10:45:18 AM
*/
SET NAMES utf8;
SET FOREIGN_KEY_CHECKS = 0;
-- ----------------------------
-- Table structure for `tbl_period_data`
-- ----------------------------
DROP TABLE IF EXISTS `tbl_period_data`;
CREATE TABLE `tbl_period_data` (
`kp_PeriodID` int(11) NOT NULL AUTO_INCREMENT,
`kf_DateID` int(11) NOT NULL DEFAULT 0,
`kf_KindOfPeriodID` int(11) NOT NULL DEFAULT 0,
`PeriodName` varchar(255) COLLATE utf8_bin NOT NULL,
PRIMARY KEY (`kp_PeriodID`),
KEY `kf_DateID` (`kf_DateID`),
KEY `kf_KindOfPeriodID` (`kf_KindOfPeriodID`)
) ENGINE=InnoDB DEFAULT CHARSET=utf8 COLLATE=utf8_bin;
SET FOREIGN_KEY_CHECKS = 1;
| 26.909091 | 54 | 0.662162 |
f3bee2d27332bbade30eb07b6b87807cc7de25f4 | 2,649 | swift | Swift | LightningNode/LightningAPI.swift | reez/Tabs | 40260f149c1e43adbd5369959752af1e6c2b493b | [
"MIT"
] | 3 | 2019-02-06T01:07:48.000Z | 2021-08-15T03:43:14.000Z | LightningNode/LightningAPI.swift | reez/Tabs | 40260f149c1e43adbd5369959752af1e6c2b493b | [
"MIT"
] | 50 | 2019-03-02T02:44:35.000Z | 2020-05-02T14:58:11.000Z | LightningNode/LightningAPI.swift | reez/Tabs | 40260f149c1e43adbd5369959752af1e6c2b493b | [
"MIT"
] | null | null | null | //
// LightningNode
//
// Created by Matthew Ramsden on 1/1/19.
// Copyright © 2019 Matthew Ramsden. All rights reserved.
//
import Foundation
import LNDrpc
struct LightningApiRPC {
var addInvoice = addInvoice(value: memo: completion:)
var canConnect = canConnect(completion:)
var info = info(completion:)
}
func addInvoice(value: Int, memo: String, completion: @escaping (Result<String, DataError>) -> Void) {
guard let rnc = Current.remoteNodeConnectionFormatted else { return }
let host = rnc.uri
let lnd = Lightning(host: host)
try? GRPCCall.setTLSPEMRootCerts(rnc.certificate, forHost: host)
let invoice = Invoice(value: value, memo: memo)
lnd.rpcToAddInvoice(withRequest: invoice) { (response, _) in
response?.paymentRequest.flatMap {
completion(Result.success($0))
}
}.runWithMacaroon(rnc.macaroon)
}
func invoices(completion: @escaping (Result<[Invoice], DataError>) -> Void) {
guard let rnc = Current.remoteNodeConnectionFormatted else { return }
let host = rnc.uri
let lnd = Lightning(host: host)
try? GRPCCall.setTLSPEMRootCerts(rnc.certificate, forHost: host)
let invoices = ListInvoiceRequest()
lnd.rpcToListInvoices(with: invoices) { (response, _) in
// does this need to be compactmap?
response?.invoicesArray.flatMap {
let invoice = $0 as? [Invoice]
guard let invoiceArray = invoice else { return }
completion(Result.success(invoiceArray))
}
}.runWithMacaroon(rnc.macaroon)
}
func canConnect(completion: @escaping (Bool) -> Void) {
guard let rnc = Current.remoteNodeConnectionFormatted else { return }
let host = rnc.uri
let lnd = Lightning(host: host)
try? GRPCCall.setTLSPEMRootCerts(rnc.certificate, forHost: host)
lnd.rpcToGetInfo(with: GetInfoRequest()) { (response, _) in
completion(response != nil)
}.runWithMacaroon(rnc.macaroon)
}
func info(completion: @escaping (Result<Info, DataError>) -> Void) {
guard let rnc = Current.remoteNodeConnectionFormatted else { return }
let host = rnc.uri
let lnd = Lightning(host: host)
try? GRPCCall.setTLSPEMRootCerts(rnc.certificate, forHost: host)
lnd.rpcToGetInfo(with: GetInfoRequest()) { (response, _) in
_ = response.flatMap {
let info = Info.init(getInfoResponse: $0)
completion(Result.success(info))
}
}.runWithMacaroon(rnc.macaroon)
}
extension GRPCProtoCall {
func runWithMacaroon(_ macaroon: String) {
requestHeaders["macaroon"] = macaroon
start()
}
}
| 30.802326 | 102 | 0.668177 |
420df35fce65e146d8ed4f01c05a3e8de77f44ed | 3,350 | dart | Dart | sqlite3/lib/src/impl/data_change_notifications.dart | Atom735/sqlite3.dart | acfafcd1d9958b7bf7b5a7e6aab7cd83ee54e437 | [
"MIT"
] | null | null | null | sqlite3/lib/src/impl/data_change_notifications.dart | Atom735/sqlite3.dart | acfafcd1d9958b7bf7b5a7e6aab7cd83ee54e437 | [
"MIT"
] | null | null | null | sqlite3/lib/src/impl/data_change_notifications.dart | Atom735/sqlite3.dart | acfafcd1d9958b7bf7b5a7e6aab7cd83ee54e437 | [
"MIT"
] | null | null | null | part of 'implementation.dart';
int _id = 0;
final Map<int, List<MultiStreamController<SqliteUpdate>>> _listeners = {};
final Map<int, List<void Function(SqliteUpdate)>> _callbacks = {};
void _updateCallback(Pointer<Void> data, int kind, Pointer<sqlite3_char> db,
Pointer<sqlite3_char> table, int rowid) {
SqliteUpdateKind updateKind;
switch (kind) {
case SQLITE_INSERT:
updateKind = SqliteUpdateKind.insert;
break;
case SQLITE_UPDATE:
updateKind = SqliteUpdateKind.update;
break;
case SQLITE_DELETE:
updateKind = SqliteUpdateKind.delete;
break;
default:
return;
}
final tableName = table.readString();
final update = SqliteUpdate(updateKind, tableName, rowid);
final listeners = _listeners[data.address];
final callbacks = _callbacks[data.address];
if (listeners != null) {
for (final listener in listeners) {
listener.add(update);
}
}
if (callbacks != null) {
for (final callback in callbacks) {
callback(update);
}
}
}
final Pointer<NativeType> _updateCallbackPtr = Pointer.fromFunction<
Void Function(Pointer<Void>, Int32, Pointer<sqlite3_char>,
Pointer<sqlite3_char>, Int64)>(_updateCallback);
class _DatabaseUpdates {
final DatabaseImpl impl;
final int id = _id++;
final List<MultiStreamController<SqliteUpdate>> listeners = [];
final List<void Function(SqliteUpdate)> callbacks = [];
bool closed = false;
_DatabaseUpdates(this.impl);
Stream<SqliteUpdate> get updates {
return Stream.multi((listener) {
if (closed) {
listener.closeSync();
return;
}
addListener(listener);
listener
..onPause = (() => removeListener(listener))
..onResume = (() => addListener(listener))
..onCancel = (() => removeListener(listener));
}, isBroadcast: true);
}
void registerNativeCallback() {
impl._bindings.sqlite3_update_hook(
impl._handle,
_updateCallbackPtr.cast(),
Pointer.fromAddress(id),
);
}
void unregisterNativeCallback() {
impl._bindings.sqlite3_update_hook(
impl._handle,
nullPtr(),
Pointer.fromAddress(id),
);
}
void addCallback(void Function(SqliteUpdate) callback) {
final isFirstListener = listeners.isEmpty && callbacks.isEmpty;
callbacks.add(callback);
if (isFirstListener) {
_listeners[id] = listeners;
_callbacks[id] = callbacks;
registerNativeCallback();
}
}
void removeCallback(void Function(SqliteUpdate) callback) {
callbacks.remove(callback);
if (listeners.isEmpty && callbacks.isEmpty && !closed) {
unregisterNativeCallback();
}
}
void addListener(MultiStreamController<SqliteUpdate> listener) {
final isFirstListener = listeners.isEmpty && callbacks.isEmpty;
listeners.add(listener);
if (isFirstListener) {
_listeners[id] = listeners;
_callbacks[id] = callbacks;
registerNativeCallback();
}
}
void removeListener(MultiStreamController<SqliteUpdate> listener) {
listeners.remove(listener);
if (listeners.isEmpty && callbacks.isEmpty && !closed) {
unregisterNativeCallback();
}
}
void close() {
closed = true;
for (final listener in listeners) {
listener.close();
}
unregisterNativeCallback();
}
}
| 24.814815 | 76 | 0.666269 |
afd92871e828ba9477a2fdb5b2c6d8c6dbb3a240 | 3,837 | html | HTML | Manuals/HRM/Hardware_Manual_guide/node0084.html | jonathanbennett73/amiga-pjz-planet-disco-balls | 1890f797ec7e8061ce4bfb9a8e6844f2ce9f6e1b | [
"MIT"
] | 21 | 2021-04-04T06:00:44.000Z | 2022-01-19T19:12:24.000Z | Manuals/HRM/Hardware_Manual_guide/node0084.html | jonathanbennett73/amiga-pjz-planet-disco-balls | 1890f797ec7e8061ce4bfb9a8e6844f2ce9f6e1b | [
"MIT"
] | null | null | null | Manuals/HRM/Hardware_Manual_guide/node0084.html | jonathanbennett73/amiga-pjz-planet-disco-balls | 1890f797ec7e8061ce4bfb9a8e6844f2ce9f6e1b | [
"MIT"
] | null | null | null | <!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 3.2 Final//EN">
<HTML>
<!-- AG2HTML: CONVERTER=AG2HTML/1.1 FORMAT=AMIGAGUIDE/34.11 FILE="Hardware/Hard_3" NODE="3-4-1-5" TITLE="3 / / Picture is Larger than Window / Selecting the Stopping Position" INDEX="Hardware/Hard_Index/MAIN" -->
<head>
<title>3 / / Picture is Larger than Window / Selecting the Stopping Position</title>
</head>
<body>
<img src="../images/toc_d.gif" alt="[Contents]">
<a href="../Hardware_Manual_guide/node0240.html"><img src="../images/index.gif" alt="[Index]" border=0></a>
<img src="../images/help_d.gif" alt="[Help]">
<img src="../images/retrace_d.gif" alt="[Retrace]">
<a href="../Hardware_Manual_guide/node0083.html"><img src="../images/prev.gif" alt="[Browse <]" border=0></a>
<a href="../Hardware_Manual_guide/node0085.html"><img src="../images/next.gif" alt="[Browse >]" border=0></a>
<hr>
<pre>
<!-- AG2HTML: BODY=START -->
The stopping position for the display window is the horizontal and
vertical coordinates of the lower right-hand corner of the display window.
One register, <a href="../Hardware_Manual_guide/node0071.html">DIWSTOP</a> , contains both coordinates, known as HSTOP and
VSTOP.
<a name="line7">See the notes in the "Forming a Basic Playfield" section for instructions</a>
on setting these registers.
0 255 511 ($1FF)
__________________________|___________________________
| | |
| | |
| |<------------------------->|
| | HSTOP of |
| | DISPLAY WINDOW occurs |
| | is this region |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
|__________________________|___________________________|
Figure 3-21: Display Window Horizontal Stopping Position
Select a value that represents the correct position in low resolution,
<a name="line31">non-interlaced mode.</a>
______________________________________________________
| | 0
| |
| |
|------------------------------------------------------+- 128
| /|\ |
| | |
| | VSTOP of |
| | DISPLAY WINDOW |
| | occurs in |
| | this region |
262 -+------------------- (NTSC) | |
| | |
| | |
| \|/ | 383 ($17F)
------------------------------------------------------
Figure 3-22: Display Window Vertical Stopping Position
To set the display window stopping position, write HSTOP into bits 0
through 7 and VSTOP into bits 8 through 15 of <a href="../Hardware_Manual_guide/node0071.html">DIWSTOP</a> .
<!-- AG2HTML: BODY=END -->
</pre>
</body>
</html>
| 51.851351 | 212 | 0.40318 |
b6ebc85a3b913f259f0d8de3651221a272ca36a5 | 10,531 | asm | Assembly | libsrc/_DEVELOPMENT/target/rc2014/device/sio/sio_interrupt.asm | vipoo/z88dk | 261f835c98977c21f2faced9c9d3e1048c215783 | [
"ClArtistic"
] | 1 | 2021-04-05T00:08:04.000Z | 2021-04-05T00:08:04.000Z | libsrc/_DEVELOPMENT/target/rc2014/device/sio/sio_interrupt.asm | vipoo/z88dk | 261f835c98977c21f2faced9c9d3e1048c215783 | [
"ClArtistic"
] | null | null | null | libsrc/_DEVELOPMENT/target/rc2014/device/sio/sio_interrupt.asm | vipoo/z88dk | 261f835c98977c21f2faced9c9d3e1048c215783 | [
"ClArtistic"
] | null | null | null |
INCLUDE "config_private.inc"
SECTION code_driver
EXTERN siobRxBuffer
EXTERN siobTxBuffer
EXTERN sioaRxBuffer
EXTERN sioaTxBuffer
EXTERN siobRxCount, siobRxIn
EXTERN siobTxCount, siobTxOut
EXTERN sioaRxCount, sioaRxIn
EXTERN sioaTxCount, sioaTxOut
PUBLIC __siob_interrupt_tx_empty
PUBLIC __siob_interrupt_ext_status
PUBLIC __siob_interrupt_rx_char
PUBLIC __siob_interrupt_rx_error
PUBLIC __sioa_interrupt_tx_empty
PUBLIC __sioa_interrupt_ext_status
PUBLIC __sioa_interrupt_rx_char
PUBLIC __sioa_interrupt_rx_error
__siob_interrupt_tx_empty: ; start doing the SIOB Tx stuff
push af
push hl
ld a,(siobTxCount) ; get the number of bytes in the Tx buffer
or a ; check whether it is zero
jr Z,siob_tx_int_pend ; if the count is zero, disable the Tx Interrupt and exit
ld hl,(siobTxOut) ; get the pointer to place where we pop the Tx byte
ld a,(hl) ; get the Tx byte
out (__IO_SIOB_DATA_REGISTER),a ; output the Tx byte to the SIOB
inc l ; move the Tx pointer, just low byte along
IF __IO_SIO_TX_SIZE != 0x100
ld a,__IO_SIO_TX_SIZE-1 ; load the buffer size, (n^2)-1
and l ; range check
or siobTxBuffer&0xFF ; locate base
ld l,a ; return the low byte to l
ENDIF
ld (siobTxOut),hl ; write where the next byte should be popped
ld hl,siobTxCount
dec (hl) ; atomically decrement current Tx count
jr NZ,siob_tx_end
siob_tx_int_pend:
ld a,__IO_SIO_WR0_TX_INT_PENDING_RESET ; otherwise pend the Tx interrupt
out (__IO_SIOB_CONTROL_REGISTER),a ; into the SIOB register R0
siob_tx_end: ; if we've more Tx bytes to send, we're done for now
pop hl
pop af
__siob_interrupt_ext_status:
ei
reti
__siob_interrupt_rx_char:
push af
push hl
siob_rx_get:
in a,(__IO_SIOB_DATA_REGISTER) ; move Rx byte from the SIOB to A
ld l,a ; put it in L
ld a,(siobRxCount) ; get the number of bytes in the Rx buffer
cp __IO_SIO_RX_SIZE-1 ; check whether there is space in the buffer
jr NC,siob_rx_check ; buffer full, check whether we need to drain H/W FIFO
ld a,l ; get Rx byte from l
ld hl,siobRxCount
inc (hl) ; atomically increment Rx buffer count
ld hl,(siobRxIn) ; get the pointer to where we poke
ld (hl),a ; write the Rx byte to the siobRxIn target
inc l ; move the Rx pointer low byte along
IF __IO_SIO_RX_SIZE != 0x100
ld a,__IO_SIO_RX_SIZE-1 ; load the buffer size, (n^2)-1
and l ; range check
or siobRxBuffer&0xFF ; locate base
ld l,a ; return the low byte to l
ENDIF
ld (siobRxIn),hl ; write where the next byte should be poked
; ld a,(siobRxCount) ; get the current Rx count
; cp __IO_SIO_RX_FULLISH ; compare the count with the preferred full size
; jr C,siob_rx_check ; if the buffer is fullish reset the RTS line
; this means getting characters will be slower
; when the buffer is fullish,
; but we stop the lemmings.
; ld a,__IO_SIO_WR0_R5 ; prepare for a read from R5
; out (__IO_SIOB_CONTROL_REGISTER),a ; write to SIOB control register
; in a,(__IO_SIOB_CONTROL_REGISTER) ; read from the SIOB R5 register
; ld l,a ; put it in L
; ld a,__IO_SIO_WR0_R5 ; prepare for a write to R5
; out (__IO_SIOB_CONTROL_REGISTER),a ; write to SIOB control register
; ld a,~__IO_SIO_WR5_RTS ; clear RTS
; and l ; with previous contents of R5
; out (__IO_SIOB_CONTROL_REGISTER),a ; write the SIOB R5 register
siob_rx_check: ; SIO has 4 byte Rx H/W FIFO
in a,(__IO_SIOB_CONTROL_REGISTER) ; get the SIOB register R0
rrca ; test whether we have received on SIOB
jr C,siob_rx_get ; if still more bytes in H/W FIFO, get them
pop hl ; or clean up
pop af
ei
reti
__siob_interrupt_rx_error:
push af
push hl
ld a,__IO_SIO_WR0_R1 ; set request for SIOB Read Register 1
out (__IO_SIOB_CONTROL_REGISTER),a ; into the SIOB control register
in a,(__IO_SIOB_CONTROL_REGISTER) ; load Read Register 1
; test whether we have error on SIOB
and __IO_SIO_RR1_RX_FRAMING_ERROR|__IO_SIO_RR1_RX_OVERRUN|__IO_SIO_RR1_RX_PARITY_ERROR
jr Z,siob_interrupt_rx_exit ; clear error, and exit
in a,(__IO_SIOB_DATA_REGISTER) ; remove errored Rx byte from the SIOB
siob_interrupt_rx_exit:
ld a,__IO_SIO_WR0_ERROR_RESET ; otherwise reset the Error flags
out (__IO_SIOB_CONTROL_REGISTER),a ; in the SIOB Write Register 0
pop hl ; and clean up
pop af
ei
reti
__sioa_interrupt_tx_empty: ; start doing the SIOA Tx stuff
push af
push hl
ld a,(sioaTxCount) ; get the number of bytes in the Tx buffer
or a ; check whether it is zero
jr Z,sioa_tx_int_pend ; if the count is zero, disable the Tx Interrupt and exit
ld hl,(sioaTxOut) ; get the pointer to place where we pop the Tx byte
ld a,(hl) ; get the Tx byte
out (__IO_SIOA_DATA_REGISTER),a ; output the Tx byte to the SIOA
inc l ; move the Tx pointer, just low byte along
IF __IO_SIO_TX_SIZE != 0x100
ld a,__IO_SIO_TX_SIZE-1 ; load the buffer size, (n^2)-1
and l ; range check
or sioaTxBuffer&0xFF ; locate base
ld l,a ; return the low byte to l
ENDIF
ld (sioaTxOut),hl ; write where the next byte should be popped
ld hl,sioaTxCount
dec (hl) ; atomically decrement current Tx count
jr NZ,sioa_tx_end
sioa_tx_int_pend:
ld a,__IO_SIO_WR0_TX_INT_PENDING_RESET ; otherwise pend the Tx interrupt
out (__IO_SIOA_CONTROL_REGISTER),a ; into the SIOA register R0
sioa_tx_end: ; if we've more Tx bytes to send, we're done for now
pop hl
pop af
__sioa_interrupt_ext_status:
ei
reti
__sioa_interrupt_rx_char:
push af
push hl
sioa_rx_get:
in a,(__IO_SIOA_DATA_REGISTER) ; move Rx byte from the SIOA to A
ld l,a ; put it in L
ld a,(sioaRxCount) ; get the number of bytes in the Rx buffer
cp __IO_SIO_RX_SIZE-1 ; check whether there is space in the buffer
jr NC,sioa_rx_check ; buffer full, check whether we need to drain H/W FIFO
ld a,l ; get Rx byte from l
ld hl,sioaRxCount
inc (hl) ; atomically increment Rx buffer count
ld hl,(sioaRxIn) ; get the pointer to where we poke
ld (hl),a ; write the Rx byte to the sioaRxIn target
inc l ; move the Rx pointer low byte along
IF __IO_SIO_RX_SIZE != 0x100
ld a,__IO_SIO_RX_SIZE-1 ; load the buffer size, (n^2)-1
and l ; range check
or sioaRxBuffer&0xFF ; locate base
ld l,a ; return the low byte to l
ENDIF
ld (sioaRxIn),hl ; write where the next byte should be poked
; ld a,(sioaRxCount) ; get the current Rx count
; cp __IO_SIO_RX_FULLISH ; compare the count with the preferred full size
; jr C,sioa_rx_check ; if the buffer is fullish reset the RTS line
; this means getting characters will be slower
; when the buffer is fullish,
; but we stop the lemmings.
; ld a,__IO_SIO_WR0_R5 ; prepare for a read from R5
; out (__IO_SIOA_CONTROL_REGISTER),a ; write to SIOA control register
; in a,(__IO_SIOA_CONTROL_REGISTER) ; read from the SIOA R5 register
; ld l,a ; put it in L
; ld a,__IO_SIO_WR0_R5 ; prepare for a write to R5
; out (__IO_SIOA_CONTROL_REGISTER),a ; write to SIOA control register
; ld a,~__IO_SIO_WR5_RTS ; clear RTS
; and l ; with previous contents of R5
; out (__IO_SIOA_CONTROL_REGISTER),a ; write the SIOA R5 register
sioa_rx_check: ; SIO has 4 byte Rx H/W FIFO
in a,(__IO_SIOA_CONTROL_REGISTER) ; get the SIOA register R0
rrca ; test whether we have received on SIOA
jr C,sioa_rx_get ; if still more bytes in H/W FIFO, get them
pop hl ; or clean up
pop af
ei
reti
__sioa_interrupt_rx_error:
push af
push hl
ld a,__IO_SIO_WR0_R1 ; set request for SIOA Read Register 1
out (__IO_SIOA_CONTROL_REGISTER),a ; into the SIOA control register
in a,(__IO_SIOA_CONTROL_REGISTER) ; load Read Register 1
; test whether we have error on SIOA
and __IO_SIO_RR1_RX_FRAMING_ERROR|__IO_SIO_RR1_RX_OVERRUN|__IO_SIO_RR1_RX_PARITY_ERROR
jr Z,sioa_interrupt_rx_exit ; clear error, and exit
in a,(__IO_SIOA_DATA_REGISTER) ; remove errored Rx byte from the SIOA
sioa_interrupt_rx_exit:
ld a,__IO_SIO_WR0_ERROR_RESET ; otherwise reset the Error flags
out (__IO_SIOA_CONTROL_REGISTER),a ; in the SIOA Write Register 0
pop hl ; and clean up
pop af
ei
reti
EXTERN _sio_need
defc NEED = _sio_need
| 40.976654 | 94 | 0.572785 |
abc3b29619ed6b097584565b3d3fdca6190c38c0 | 951 | sql | SQL | software/cabio-database/scripts/sql_loader/arrays/disable_constraints.sql | NCIP/cabio | 3abe332d7ec2af35fa64aa0e39a6b5a718088a2f | [
"BSD-3-Clause"
] | 2 | 2016-06-21T22:11:37.000Z | 2018-06-19T16:23:24.000Z | software/cabio-database/scripts/sql_loader/arrays/disable_constraints.sql | NCIP/cabio | 3abe332d7ec2af35fa64aa0e39a6b5a718088a2f | [
"BSD-3-Clause"
] | null | null | null | software/cabio-database/scripts/sql_loader/arrays/disable_constraints.sql | NCIP/cabio | 3abe332d7ec2af35fa64aa0e39a6b5a718088a2f | [
"BSD-3-Clause"
] | 3 | 2016-10-13T05:38:13.000Z | 2020-09-01T03:57:26.000Z | /*L
Copyright SAIC
Distributed under the OSI-approved BSD 3-Clause License.
See http://ncip.github.com/cabio/LICENSE.txt for details.
L*/
@$LOAD/constraints/protein_domain.disable.sql;
@$LOAD/constraints/gene_relative_location.disable.sql;
@$LOAD/constraints/marker_marker_rel_location.disable.sql;
@$LOAD/constraints/marker_relative_location.disable.sql;
@$LOAD/constraints/expression_reporter.disable.sql;
@$LOAD/constraints/zstg_expression_reporter.disable.sql;
@$LOAD/constraints/expr_reporter_protein_domain.disable.sql;
@$LOAD/constraints/snp_reporter.disable.sql;
@$LOAD/constraints/zstg_snp_reporter.disable.sql;
@$LOAD/constraints/exon_reporter_gene.disable.sql;
@$LOAD/constraints/exon_reporter.disable.sql;
@$LOAD/constraints/zstg_exon_reporter.disable.sql;
@$LOAD/constraints/exon.disable.sql;
@$LOAD/constraints/transcript_gene.disable.sql;
@$LOAD/constraints/transcript.disable.sql;
@$LOAD/constraints/microarray.disable.sql;
| 39.625 | 60 | 0.821241 |
18952658259d8b4c23afafcd13efae6644c4a071 | 213 | css | CSS | modules/admin/styles/spaw2/plugins/spawfm/lib/filelist0.css | bukin242/abukin-cms | 9014913e5447a5171769d3b47bd5b8c2ff6c0463 | [
"Apache-2.0"
] | null | null | null | modules/admin/styles/spaw2/plugins/spawfm/lib/filelist0.css | bukin242/abukin-cms | 9014913e5447a5171769d3b47bd5b8c2ff6c0463 | [
"Apache-2.0"
] | null | null | null | modules/admin/styles/spaw2/plugins/spawfm/lib/filelist0.css | bukin242/abukin-cms | 9014913e5447a5171769d3b47bd5b8c2ff6c0463 | [
"Apache-2.0"
] | null | null | null | /* default filelist style */
body {
padding: 5px;
margin: 0px;
}
.fm_file {
/*display: none;*/
}
.fm_file_title {
}
.fm_file_icon {
}
.fm_file_icon_big {
}
.fm_file_thumb {
}
| 9.26087 | 29 | 0.539906 |
770e7e4fe7c44dca8157bff3ad04fc99c3b8a28d | 194 | asm | Assembly | programs/oeis/217/A217923.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 22 | 2018-02-06T19:19:31.000Z | 2022-01-17T21:53:31.000Z | programs/oeis/217/A217923.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 41 | 2021-02-22T19:00:34.000Z | 2021-08-28T10:47:47.000Z | programs/oeis/217/A217923.asm | neoneye/loda | afe9559fb53ee12e3040da54bd6aa47283e0d9ec | [
"Apache-2.0"
] | 5 | 2021-02-24T21:14:16.000Z | 2021-08-09T19:48:05.000Z | ; A217923: F-block elements for Janet periodic table.
; 57,58,59,60,61,62,63,64,65,66,67,68,69,70,89,90,91,92,93,94,95,96,97,98,99,100,101,102
mov $2,$0
div $0,14
mul $0,18
add $0,$2
add $0,57
| 21.555556 | 88 | 0.664948 |
8f03a68a334a9a35c034bc57fd2126fbe3f050b2 | 162 | java | Java | Client/src/com/jagex/RuntimeException_Sub1.java | dylan-worth/OfflineRS | 7d217a1de621e65effffe84b208f7a5537536b2d | [
"Apache-2.0"
] | null | null | null | Client/src/com/jagex/RuntimeException_Sub1.java | dylan-worth/OfflineRS | 7d217a1de621e65effffe84b208f7a5537536b2d | [
"Apache-2.0"
] | null | null | null | Client/src/com/jagex/RuntimeException_Sub1.java | dylan-worth/OfflineRS | 7d217a1de621e65effffe84b208f7a5537536b2d | [
"Apache-2.0"
] | null | null | null | package com.jagex;
public class RuntimeException_Sub1 extends RuntimeException {
public RuntimeException_Sub1(String var1) {
super(var1);
}
}
| 20.25 | 62 | 0.716049 |
683a3daf136d724474a60e43a53df4a5b2cf9aa1 | 6,275 | html | HTML | story-coastal-birth.html | gladyschua/tra | 8b21eeaa5c4f3f87c16ba092259b6b44e8a940db | [
"MIT"
] | null | null | null | story-coastal-birth.html | gladyschua/tra | 8b21eeaa5c4f3f87c16ba092259b6b44e8a940db | [
"MIT"
] | null | null | null | story-coastal-birth.html | gladyschua/tra | 8b21eeaa5c4f3f87c16ba092259b6b44e8a940db | [
"MIT"
] | null | null | null | <!DOCTYPE html>
<html lang="en">
<head>
<meta charset="UTF-8">
<meta content="width=device-width, initial-scale=1.0" name="viewport">
<!--
* sets the width of the page to follow the screen-width of the device
* sets the initial zoom level when the page
-->
<title>Tilly's Reef Adventure</title>
<link href="https://fonts.googleapis.com/css?family=Raleway:100i,200,200i,300,300i,400,400i,500,500i,600,600i,700,700i" rel="stylesheet">
<link rel="stylesheet" href="css/style.css">
</head>
<body>
<div class="page-wrap">
<a href="#content">
<header role="banner" class="banner">
<img id="banner-logo" src="img/tillysreefadventure/logo-banner.png" alt="Tilly's Reef Adventure banner logo">
</header>
</a>
<section id="content">
<nav role="navigation" class="global" >
<a href="index.html"><img id="banner-logo-nav" src="img/tillysreefadventure/logo-banner.png" alt="Tilly's Reef Adventure banner logo"></a>
<ul>
<li id="home"><a href="index.html">Home</a></li>
<li class="active"><a class="active" href= "story.html">Story</a>
<ul class="dropdown">
<li class="active"><a class="active" href= "story-coastal-birth.html">Tilly's Coastal Birth</a></li>
<li><a href="story-reef-adventure.html">Tilly's Reef Adventure</a></li>
<li><a href="story-coastal-rescue.html">Tilly's Coastal Rescue</a></li>
</ul>
</li>
<!-- spacer hack -->
<li class="spacer"></li>
<li class="spacer"></li>
<li><a href="characters.html">Characters</a></li>
<li><a href="resources.html">Resources</a></li>
</ul>
</nav>
<main class="story-slides">
<nav role="navigation breadcrumb" class="breadcrumb">
<ul>
<li class="active"><a class="active" href="story-coastal-birth.html">Tilly's Coastal birth</a></li> >
<li><a href="story-reef-adventure.html">Tilly's Reef Adventure</a></li> >
<li><a href="story-coastal-rescue.html">Tilly's Coastal Rescue</a></li>
</ul>
</nav>
<!-- slideshow -->
<section class="carousel-slideshow" id="story-reef-adventure">
<figure class="carousel slide">
<div class="numbertext">1 / 3</div>
<img class="slideshow-img" src="img/tillysreefadventure/slide-mother-turtle.png">
<article class="slideshow-text">
<h1>On a still night, a mother turtle digs a hole and lays her eggs. She carefully covers them to keep them safe.</h1>
<br>
<h1>Thereafter, she makes her way back to the sea with the other mother turtles.</h1>
</article>
</figure>
<figure class="carousel slide">
<div class="numbertext">2 / 3</div>
<img class="slideshow-img" src="img/tillysreefadventure/slide-hatchlings.png">
<article class="slideshow-text">
<h1>Eight weeks later, the baby turtles hatch, digging their way out of their sandy nest. The hatchlings scramble to the water.</h1>
<br>
<h1>The hatchlings scramble to the water. They have to get to safety!</h1>
</article>
</figure>
<figure class="carousel slide">
<div class="numbertext">3 / 3</div>
<img class="slideshow-img" src="img\tillysreefadventure\hatchling-gulls.png">
<article class="slideshow-text">
<h1>Tilly is the first one out. She is worried the gulls want to snap them up. They squawk and they swoop and they peck at the little turtles...</h1> <br>
<h1>And, there is more danger ahead!</h1><br>
<a class="slide-link" href="story-reef-adventure.html"><h1 class="slide-link">Explore the reef adventure...</h1></a>
</article>
</figure>
</section>
<a class="prev" onclick="plusSlides(-1)">❮</a>
<a class="next" onclick="plusSlides(1)">❯</a>
</main>
<footer>
<img src="/tra/img/cc-by-nc-sa.JPG" alt="Creative Commons Attribution Non-commercial Share Alike">
<nav class="footer">
<ul>
<li><a href="https://www.rhondasart.com.au/pages/about-us">About the Author</a></li>
<li><a href="credits.html">Credits</a></li>
</ul>
</nav>
</footer>
</section>
</div> <!--page wrap end tag-->
<!-- particles.js lib modified, stats counter removed - https://github.com/VincentGarreau/particles.js -->
<script src="js/particles.min.js"></script>
<div id="particles-js"></div> <!-- particles.js container -->
<script src="js/jquery-3.3.1.min.js"></script>
<!--https://zengabor.github.io/zenscroll/#license-->
<script src="js/zenscroll-min.js"></script>
<script src="js/script.js"></script>
</body>
</html>
| 52.291667 | 186 | 0.461833 |
116486e098037ab9806356538c391315623a5885 | 1,529 | dart | Dart | lib/interfaces/i_data_source.dart | bderbidge/cloud_firestore_database_wrapper | 411ce10220e96d56d09dd0bb3e54afd98adafc58 | [
"MIT"
] | null | null | null | lib/interfaces/i_data_source.dart | bderbidge/cloud_firestore_database_wrapper | 411ce10220e96d56d09dd0bb3e54afd98adafc58 | [
"MIT"
] | null | null | null | lib/interfaces/i_data_source.dart | bderbidge/cloud_firestore_database_wrapper | 411ce10220e96d56d09dd0bb3e54afd98adafc58 | [
"MIT"
] | null | null | null | import "dart:async";
import 'package:cloud_firestore_database_wrapper/util/firestore_parser.dart';
enum WhereQueryType {
IsEqualTo,
IsLessThan,
IsLessThanOrEqualTo,
IsGreaterThan,
IsGreaterThanOrEqualTo,
ArrayContains,
ArrayContainsAny,
WhereIn,
WhereNotIn,
IsNull,
IsNotEqualTo,
}
final Set<WhereQueryType> queryRange = {
WhereQueryType.IsLessThan,
WhereQueryType.IsLessThanOrEqualTo,
WhereQueryType.IsGreaterThan,
WhereQueryType.IsGreaterThanOrEqualTo,
};
class QueryType {
final id;
final dynamic value;
final WhereQueryType? whereQueryType;
QueryType({this.id, this.value, this.whereQueryType});
}
abstract class IDataSource {
delete(String path, String id);
update(String path, String id, Map<String, dynamic> data);
Future<String> create(String path, Map<String, dynamic> data, {String? id});
Future<T> getSingleByRefId<T>(String path, String id, FromJson fromJson);
Future<List<T>> getCollection<T>(String path, FromJson fromJson);
Future<List<T>> getCollectionwithParams<T>(String path, FromJson fromJson,
{List<QueryType>? where,
Map<String, bool>? orderby,
int? limit,
String? startAfterID});
Stream<List<T>> getCollectionStreamWithParams<T>(
String path, FromJson fromJson,
{List<QueryType>? where, Map<String, bool>? orderby, int? limit});
Future<List<T>> getSubCollection<T>(
List<String> paths, List<String> ids, FromJson fromJson,
{List<QueryType>? where, Map<String, bool>? orderby, int? limit});
}
| 26.362069 | 78 | 0.730543 |