hexsha stringlengths 40 40 | size int64 5 1.05M | ext stringclasses 98
values | lang stringclasses 21
values | max_stars_repo_path stringlengths 3 945 | max_stars_repo_name stringlengths 4 118 | max_stars_repo_head_hexsha stringlengths 40 78 | max_stars_repo_licenses listlengths 1 10 | max_stars_count int64 1 368k ⌀ | max_stars_repo_stars_event_min_datetime stringlengths 24 24 ⌀ | max_stars_repo_stars_event_max_datetime stringlengths 24 24 ⌀ | max_issues_repo_path stringlengths 3 945 | max_issues_repo_name stringlengths 4 118 | max_issues_repo_head_hexsha stringlengths 40 78 | max_issues_repo_licenses listlengths 1 10 | max_issues_count int64 1 134k ⌀ | max_issues_repo_issues_event_min_datetime stringlengths 24 24 ⌀ | max_issues_repo_issues_event_max_datetime stringlengths 24 24 ⌀ | max_forks_repo_path stringlengths 3 945 | max_forks_repo_name stringlengths 4 135 | max_forks_repo_head_hexsha stringlengths 40 78 | max_forks_repo_licenses listlengths 1 10 | max_forks_count int64 1 105k ⌀ | max_forks_repo_forks_event_min_datetime stringlengths 24 24 ⌀ | max_forks_repo_forks_event_max_datetime stringlengths 24 24 ⌀ | content stringlengths 5 1.05M | avg_line_length float64 1 1.03M | max_line_length int64 2 1.03M | alphanum_fraction float64 0 1 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
b0a6135536e48f8004b729575f5f4284e28384bc | 1,903 | py | Python | slotted_outlier_removal.py | abdullah8a0/sweepline | 83ab2e34ed317c7ccef5cb2a10c491d2abec6b71 | [
"MIT"
] | null | null | null | slotted_outlier_removal.py | abdullah8a0/sweepline | 83ab2e34ed317c7ccef5cb2a10c491d2abec6b71 | [
"MIT"
] | null | null | null | slotted_outlier_removal.py | abdullah8a0/sweepline | 83ab2e34ed317c7ccef5cb2a10c491d2abec6b71 | [
"MIT"
] | null | null | null | import numpy as np
def remove_outliers(X:np.ndarray,Y:np.ndarray):
assert len(X.shape) == len(Y.shape) == 1
assert X.size == Y.size
EPSILON_X = 0.02
EPSILON_Y = 0.04
groups : dict= {0:{0}}
block = [(0,X[0],Y[0],0)]
for i,(x,y) in enumerate(zip(X[1:],Y[1:]),1):
while block and abs(block[0][1]-x)>EPSILON_X:
block.pop(0)
seen_groups =set()
for _,_,y_,g_ in block:
if abs(y_-y)>EPSILON_Y:
continue
seen_groups.add(g_)
if len(seen_groups)>1: # combines groups
new = set()
for group in seen_groups:
new |= groups[group]
del groups[group]
new.add(i)
groups[min(seen_groups)] = new
block = [(ind,i,j,min(seen_groups) if ind in new else k) for ind,i,j,k in block]
tfgroup = min(seen_groups)
elif len(seen_groups) == 1: # adds a to an existing group
tfgroup = min(seen_groups)
groups[tfgroup].add(i)
else: # creates a new group
tfgroup = max(groups.keys())+1
groups[tfgroup] = set([i])
block.append((i,x,x,tfgroup))
inliers = []
top = [[0,0],[0,0],[0,0]]
for group,ind in groups.items():
if len(ind) > top[0][1]:
top = [[0,0],top[0],top[1]]
top[0] = [group,len(ind)]
continue
elif len(ind) > top[1][1]:
top = [top[0],[0,0],top[1]]
top[1] = [group,len(ind)]
elif len(ind) > top[2][1]:
top[2] = [group,len(ind)]
if top[2][1] > 0.2*top[1][1]:
inliers = [ind for i,_ in top for ind in groups[i]]
else:
allowed = [top[0][0],top[1][0]]
inliers = [ind for i in allowed for ind in groups[i]]
inliers = np.sort(np.array(inliers))
return inliers | 30.693548 | 92 | 0.493431 |
38666cfa0a30807765a415ec132db9ac2172c35b | 6,186 | php | PHP | wstmart/home/controller/Friend.php | Elmwoods/PWareHouse | 2a266c1a9c961b4088e4272bdad158a3ff71430a | [
"Apache-2.0"
] | null | null | null | wstmart/home/controller/Friend.php | Elmwoods/PWareHouse | 2a266c1a9c961b4088e4272bdad158a3ff71430a | [
"Apache-2.0"
] | null | null | null | wstmart/home/controller/Friend.php | Elmwoods/PWareHouse | 2a266c1a9c961b4088e4272bdad158a3ff71430a | [
"Apache-2.0"
] | null | null | null | <?php
/**
* Created by PhpStorm.
* User: Lynn
* Date: 2017/4/26
* Time: 9:21
*/
namespace wstmart\home\controller;
use think\Controller;
class Friend extends Controller {
public $request;
public function __construct() {
$this -> request = request();
}
//获取朋友列表
public function friendList($userId) {
$param = $this -> request -> param();
if (!empty($param)) {
$user_friend = db('user_friends');
$arr = $user_friend ->field(['friendID', 'nickName', 'type']) -> where('userId', $param['userId']) -> where('isBlackList', 0) -> select();
$users = db('users');
$user_group = db('user_groups');
$friendArr[] = array();
for ($i=0; $i < count($arr); $i++) {
if ($arr[$i]['type'] == 0) {
$friendArr[$i] = $users -> field(['userId', 'userPhoto']) -> where('userId', $arr[$i]['friendID']) -> find();
$friendArr[$i]['nickName'] = $arr[$i]['nickName'];
$friendArr[$i]['type'] = '好友';
}else {
$friendArr[$i] = $user_group -> field(['groupID', 'name', 'icon']) -> where('groupID', $arr[$i]['friendID']) -> find();
$friendArr[$i]['type'] = '群组';
}
}
return json($friendArr);
}
}
//添加朋友
public function friendAdd($userId, $friendID, $nickName) {
$param = $this -> request -> param();
if (!empty($param)) { //判断是否post发送userId
$user_friend = db('user_friends');
$data = array(
'friendID' => $param['friendID'],
'userId' => $param['userId'],
'nickName' => $param['nickName'],
);
$friendArr = $user_friend -> where('friendID', $param['friendID']) -> where('userId', $param['userId']) -> find();
if ($friendArr) {
if ($friendArr['isBlackList'] == 1) { //判断该好友是否在黑名单
$user_friend -> where('id', $friendArr['id']) -> update(['isBlackList'=>0]);
}else { //如果不在黑名单
return json(array('result'=>'error', 'value'=>'她已在您的好友列表中'));
}
}elseif ($user_friend -> insert($data)) { //如果查不到该好友则添加好友
$arr = $user_friend -> where('userId', $param['userId']) -> where('isBlackList', 0) -> field(['friendID', 'nickName']) ->order('time', 'DESC') -> select();
for ($i=0; $i < count($arr); $i++) {
$arr[$i]['nickName'] = urlencode($arr[$i]['nickName']); //将昵称进行url编码
}
$users = db('users');
$friend_json = urldecode(json_encode($arr)); //将昵称和朋友的ID组合成json数组并用url解码
if ($users ->field('friendID') -> where('userId', $param['userId']) -> update(['friendID' => $friend_json])) {
return json(array('result'=>'success', 'value'=>'添加朋友成功'));
}else {
return json(array('result'=>'error', 'value'=>'未能更新用户总表的friendID'));
}
}else {
return json(array('result'=>'error', 'value'=>'添加朋友失败'));
}
}else {
return json(array('result'=>'error', 'value'=>'请传递自己和朋友的ID以及昵称'));
}
}
//拉黑好友
public function deFriend($userId, $friendID) {
$param = $this -> request -> param();
if (!empty($param)) {
$user_friend = db('user_friends');
if ($user_friend -> where('userId', $param['userId']) -> where('friendID', $param['friendID']) -> update(['isBlackList'=>1])) {
$arr = $user_friend -> where('userId', $param['userId']) -> where('isBlackList', 0) -> field(['friendID', 'nickName']) ->order('time', 'DESC') -> select();
for ($i=0; $i < count($arr); $i++) {
$arr[$i]['nickName'] = urlencode($arr[$i]['nickName']); //将昵称进行url编码
}
$users = db('users');
$friend_json = urldecode(json_encode($arr)); //将昵称和朋友的ID组合成json数组并用url解码
if ($users ->field('friendID') -> where('userId', $param['userId']) -> update(['friendID' => $friend_json])) {
return json(array('result'=>'success', 'value'=>'已成功拉黑好友'));
}else {
return json(array('result'=>'error', 'value'=>'未能更新用户总表的friendID'));
}
}else {
return json(array('result'=>'error', 'value'=>'拉黑好友失败,请稍候重试'));
}
}else {
return json(array('result'=>'error', 'value'=>'请传递自己和朋友的ID'));
}
}
//删除好友
public function friendDelete($userId, $friendID) {
$param = $this -> request -> param();
if (!empty($param)) {
$user_friend = db('user_friends');
if ($user_friend -> where('userId', $param['userId']) -> where('friendID', $param['friendID']) -> delete()) {
$arr = $user_friend -> where('userId', $param['userId']) -> where('isBlackList', 0) -> field(['friendID', 'nickName']) ->order('time', 'DESC') -> select();
for ($i=0; $i < count($arr); $i++) {
$arr[$i]['nickName'] = urlencode($arr[$i]['nickName']); //将昵称进行url编码
}
$users = db('users');
$friend_json = urldecode(json_encode($arr)); //将昵称和朋友的ID组合成json数组并用url解码
if ($users ->field('friendID') -> where('userId', $param['userId']) -> update(['friendID' => $friend_json])) {
return json(array('result'=>'success', 'value'=>'您已经将她遗忘,注孤生'));
}else {
return json(array('result'=>'error', 'value'=>'未能更新用户总表的friendID'));
}
}else {
return json(array('result'=>'error', 'value'=>'好险,差点就注孤生了'));
}
}else {
return json(array('result'=>'error', 'value'=>'请传递自己和朋友的ID'));
}
}
} | 46.863636 | 172 | 0.461849 |
bb67cada5e9b6699c868f89c93116955f0052211 | 2,223 | cs | C# | src/resharper-angularjs/Daemon/AngularJs/Stages/AngularJsDaemonStageBase.cs | jmkni/resharper-angularjs | 875ab82bfc4918cc0c3a1423d1db573712d9bf8e | [
"Apache-2.0"
] | 1 | 2017-12-01T13:46:03.000Z | 2017-12-01T13:46:03.000Z | src/resharper-angularjs/Daemon/AngularJs/Stages/AngularJsDaemonStageBase.cs | jmkni/resharper-angularjs | 875ab82bfc4918cc0c3a1423d1db573712d9bf8e | [
"Apache-2.0"
] | null | null | null | src/resharper-angularjs/Daemon/AngularJs/Stages/AngularJsDaemonStageBase.cs | jmkni/resharper-angularjs | 875ab82bfc4918cc0c3a1423d1db573712d9bf8e | [
"Apache-2.0"
] | null | null | null | #region license
// Copyright 2014 JetBrains s.r.o.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
#endregion
using System.Collections.Generic;
using System.Linq;
using JetBrains.Application.Settings;
using JetBrains.ReSharper.Daemon;
using JetBrains.ReSharper.Plugins.AngularJS.Psi.AngularJs;
using JetBrains.ReSharper.Psi;
using JetBrains.ReSharper.Psi.Files;
using JetBrains.ReSharper.Psi.JavaScript.Tree;
using JetBrains.Util;
namespace JetBrains.ReSharper.Plugins.AngularJS.Daemon.AngularJs.Stages
{
public abstract class AngularJsDaemonStageBase : IDaemonStage
{
public IEnumerable<IDaemonStageProcess> CreateProcess(IDaemonProcess process, IContextBoundSettingsStore settings, DaemonProcessKind processKind)
{
if (!IsSupported(process.SourceFile))
return Enumerable.Empty<IDaemonStageProcess>();
process.SourceFile.GetPsiServices().Files.AssertAllDocumentAreCommitted();
return process.SourceFile.GetPsiFiles<AngularJsLanguage>()
.SelectNotNull(file => CreateProcess(process, settings, processKind, (IJavaScriptFile)file));
}
protected abstract IDaemonStageProcess CreateProcess(IDaemonProcess process, IContextBoundSettingsStore settings,
DaemonProcessKind processKind, IJavaScriptFile file);
public abstract ErrorStripeRequest NeedsErrorStripe(IPsiSourceFile sourceFile, IContextBoundSettingsStore settings);
protected static bool IsSupported(IPsiSourceFile sourceFile)
{
if (sourceFile == null || !sourceFile.IsValid())
return false;
return sourceFile.IsLanguageSupported<AngularJsLanguage>();
}
}
} | 40.418182 | 153 | 0.74404 |
1426222bc1a803a186b87a0b8de290f591bef2ea | 2,067 | dart | Dart | lib/sqlite3_library_linux.dart | Milvintsiss/sqlite3_library_linux | aee7cee5e2e0c0d8147f76e5f85633c34fc83dad | [
"MIT"
] | 2 | 2021-03-08T14:31:03.000Z | 2021-06-28T15:45:40.000Z | lib/sqlite3_library_linux.dart | Milvintsiss/sqlite3_library_linux | aee7cee5e2e0c0d8147f76e5f85633c34fc83dad | [
"MIT"
] | null | null | null | lib/sqlite3_library_linux.dart | Milvintsiss/sqlite3_library_linux | aee7cee5e2e0c0d8147f76e5f85633c34fc83dad | [
"MIT"
] | null | null | null | /// Flutter package to bundle sqlite3 library to your linux apps
library sqlite3_library_linux;
import 'dart:ffi' show DynamicLibrary;
import 'dart:io' show File, Platform;
/// Relative path to default SQLite3 library file
const defaultSQLite3LinuxLibraryPath =
'/data/flutter_assets/packages/sqlite3_library_linux/default_libsqlite3.so';
/// Relative path to old SQLite3 library file
const oldSQLite3LinuxLibraryPath =
'/data/flutter_assets/packages/sqlite3_library_linux/old_libsqlite3.so';
/// This function open SQLite3 in memory and return the associated DynamicLibrary.
DynamicLibrary openSQLiteOnLinux() {
late DynamicLibrary library;
String executableDirectoryPath =
File(Platform.resolvedExecutable).parent.path;
print('executableDirectoryPath: $executableDirectoryPath');
try {
String sqliteLibraryPath =
executableDirectoryPath + defaultSQLite3LinuxLibraryPath;
print('SQLite3LibraryPath: $sqliteLibraryPath');
library = DynamicLibrary.open(sqliteLibraryPath);
print(_yellow("SQLite3 successfully loaded"));
} catch (e) {
try {
print(e);
//some linux distributions like debian cannot run the first version
print(_red("Failed to load SQLite3, "
"trying to load an old version of SQLite3..."));
String sqliteLibraryPath =
executableDirectoryPath + oldSQLite3LinuxLibraryPath;
print('SQLite3LibraryPath: $sqliteLibraryPath');
library = DynamicLibrary.open(sqliteLibraryPath);
print(_yellow("SQLite3 successfully loaded"));
} catch (e) {
try {
print(e);
print(_red("Failed to load SQLite3 from library file, "
"trying loading from system..."));
library = DynamicLibrary.open('libsqlite3.so');
print(_yellow("SQLite3 successfully loaded"));
} catch (e) {
print(e);
print(_red("Failed to load SQLite3."));
}
}
}
return library;
}
String _red(String string) => '\x1B[31m$string\x1B[0m';
String _yellow(String string) => '\x1B[32m$string\x1B[0m';
| 32.296875 | 82 | 0.706821 |
b7195e0b4a7870d5eb1e153904e59c4b42652bbe | 2,773 | cpp | C++ | systems/polyvox/PolyVoxShader.cpp | phisko/kengine | c30f98cc8e79cce6574b5f61088b511f29bbe8eb | [
"MIT"
] | 259 | 2018-11-01T05:12:37.000Z | 2022-03-28T11:15:27.000Z | systems/polyvox/PolyVoxShader.cpp | raptoravis/kengine | 619151c20e9db86584faf04937bed3d084e3bc21 | [
"MIT"
] | 2 | 2018-11-30T13:58:44.000Z | 2018-12-17T11:58:42.000Z | systems/polyvox/PolyVoxShader.cpp | raptoravis/kengine | 619151c20e9db86584faf04937bed3d084e3bc21 | [
"MIT"
] | 16 | 2018-12-01T13:38:18.000Z | 2021-12-04T21:31:55.000Z | #include "PolyVoxShader.hpp"
#include "EntityManager.hpp"
#include "data/TransformComponent.hpp"
#include "data/PolyVoxComponent.hpp"
#include "data/GraphicsComponent.hpp"
#include "data/ModelComponent.hpp"
#include "data/OpenGLModelComponent.hpp"
#include "systems/opengl/shaders/ApplyTransparencySrc.hpp"
#include "systems/opengl/ShaderHelper.hpp"
static inline const char * vert = R"(
#version 330
layout (location = 0) in vec3 position;
layout (location = 2) in vec3 color;
uniform mat4 proj;
uniform mat4 view;
uniform mat4 model;
uniform vec3 viewPos;
out vec4 WorldPosition;
out vec3 EyeRelativePos;
out vec3 Color;
void main() {
WorldPosition = model * vec4(position, 1.0);
EyeRelativePos = WorldPosition.xyz - viewPos;
Color = color;
//Color = vec3(1.0); // This is pretty
gl_Position = proj * view * WorldPosition;
}
)";
static inline const char * frag = R"(
#version 330
in vec4 WorldPosition;
in vec3 EyeRelativePos;
in vec3 Color;
uniform vec4 color;
uniform float entityID;
layout (location = 0) out vec4 gposition;
layout (location = 1) out vec3 gnormal;
layout (location = 2) out vec4 gcolor;
layout (location = 3) out float gentityID;
void applyTransparency(float a);
void main() {
applyTransparency(color.a);
gposition = WorldPosition;
gnormal = -normalize(cross(dFdy(EyeRelativePos), dFdx(EyeRelativePos)));
gcolor = vec4(Color * color.rgb, 0.0);
gentityID = entityID;
}
)";
namespace kengine {
static glm::vec3 toVec(const putils::Point3f & p) { return { p.x, p.y, p.z }; }
PolyVoxShader::PolyVoxShader(EntityManager & em)
: Program(false, putils_nameof(PolyVoxShader)),
_em(em)
{}
void PolyVoxShader::init(size_t firstTextureID) {
initWithShaders<PolyVoxShader>(putils::make_vector(
ShaderDescription{ vert, GL_VERTEX_SHADER },
ShaderDescription{ frag, GL_FRAGMENT_SHADER },
ShaderDescription{ Shaders::src::ApplyTransparency::Frag::glsl, GL_FRAGMENT_SHADER }
));
}
void PolyVoxShader::run(const Parameters & params) {
use();
_view = params.view;
_proj = params.proj;
_viewPos = params.camPos;
for (const auto &[e, poly, graphics, transform] : _em.getEntities<PolyVoxObjectComponent, GraphicsComponent, TransformComponent>()) {
if (graphics.model == Entity::INVALID_ID)
continue;
const auto & modelInfoEntity = _em.getEntity(graphics.model);
if (!modelInfoEntity.has<OpenGLModelComponent>() || !modelInfoEntity.has<ModelComponent>())
continue;
const auto & modelInfo = modelInfoEntity.get<ModelComponent>();
const auto & openGL = modelInfoEntity.get<OpenGLModelComponent>();
_model = ShaderHelper::getModelMatrix(modelInfo, transform);
_entityID = (float)e.id;
_color = graphics.color;
ShaderHelper::drawModel(openGL);
}
}
}
| 25.440367 | 135 | 0.728814 |
b72bcdc1cba305dc1b857157a455e1a46417bce8 | 2,902 | hpp | C++ | src/xalanc/XPath/XNumber.hpp | kidaa/xalan-c | bb666d0ab3d0a192410823e6857c203d83c27b16 | [
"Apache-2.0"
] | null | null | null | src/xalanc/XPath/XNumber.hpp | kidaa/xalan-c | bb666d0ab3d0a192410823e6857c203d83c27b16 | [
"Apache-2.0"
] | 1 | 2021-08-18T12:32:31.000Z | 2021-08-18T12:32:31.000Z | src/xalanc/XPath/XNumber.hpp | AaronNGray/xalan | 6741bbdcb64a9d33df8bd7e21b558d66bb4292ec | [
"Apache-2.0"
] | null | null | null | /*
* Licensed to the Apache Software Foundation (ASF) under one
* or more contributor license agreements. See the NOTICE file
* distributed with this work for additional information
* regarding copyright ownership. The ASF licenses this file
* to you under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
* limitations under the License.
*/
#if !defined(XNUMBER_HEADER_GUARD_1357924680)
#define XNUMBER_HEADER_GUARD_1357924680
// Base header file. Must be first.
#include <xalanc/XPath/XPathDefinitions.hpp>
#include <xalanc/XalanDOM/XalanDOMString.hpp>
// Base class header file.
#include <xalanc/XPath/XNumberBase.hpp>
XALAN_CPP_NAMESPACE_BEGIN
class XALAN_XPATH_EXPORT XNumber : public XNumberBase
{
public:
/**
* Create an XNumber from a number.
*
* @param val numeric value to use
*/
XNumber(
double val,
MemoryManager& theMemoryManager);
XNumber(
const XNumber& source,
MemoryManager& theMemoryManager);
virtual
~XNumber();
// These methods are inherited from XObject ...
virtual double
num(XPathExecutionContext& executionContext) const;
virtual double
num() const;
virtual const XalanDOMString&
str(XPathExecutionContext& executionContext) const;
virtual const XalanDOMString&
str() const;
virtual void
str(
XPathExecutionContext& executionContext,
FormatterListener& formatterListener,
MemberFunctionPtr function) const;
virtual void
str(
FormatterListener& formatterListener,
MemberFunctionPtr function) const;
virtual void
str(
XPathExecutionContext& executionContext,
XalanDOMString& theBuffer) const;
virtual void
str(XalanDOMString& theBuffer) const;
virtual double
stringLength(XPathExecutionContext& executionContext) const;
// These methods are new to XNumber...
/**
* Change the value of an XNumber
*
* @param theValue The new value.
*/
void
set(double theValue);
private:
// not implemented
XNumber();
XNumber(const XNumber&);
// Value of the number being represented.
double m_value;
mutable XalanDOMString m_cachedStringValue;
};
XALAN_CPP_NAMESPACE_END
#endif // XNUMBER_HEADER_GUARD_1357924680
| 23.216 | 75 | 0.677119 |
7dc53c4f74e5199576555cf12951ba4cb74286b6 | 35 | css | CSS | src/app/login/login.component.css | rjriel/ocasc-kb-frontend | d31b08799ce22ad0825ae71b6f6fbd2e92dd1320 | [
"MIT"
] | 1 | 2018-10-14T16:04:17.000Z | 2018-10-14T16:04:17.000Z | src/app/login/login.component.css | rjriel/ocasc-kb-frontend | d31b08799ce22ad0825ae71b6f6fbd2e92dd1320 | [
"MIT"
] | 1 | 2018-10-14T19:39:32.000Z | 2018-10-16T23:49:45.000Z | src/app/login/login.component.css | rjriel/ocasc-kb-frontend | d31b08799ce22ad0825ae71b6f6fbd2e92dd1320 | [
"MIT"
] | null | null | null | .mat-card {
max-width: 480px;
} | 11.666667 | 21 | 0.571429 |
744f66c35d32c17a873bace42a5d00b25859edba | 1,001 | css | CSS | public/css/reboot.css | Stephdw974/lappdlavi | d0429609931c2c7751e07fed2a772d61bc4e43f3 | [
"MIT"
] | null | null | null | public/css/reboot.css | Stephdw974/lappdlavi | d0429609931c2c7751e07fed2a772d61bc4e43f3 | [
"MIT"
] | 3 | 2021-03-10T05:44:39.000Z | 2022-02-18T19:12:15.000Z | public/css/reboot.css | Stephdw974/lappdlavi | d0429609931c2c7751e07fed2a772d61bc4e43f3 | [
"MIT"
] | null | null | null | @import "/css/fonts.min.css";
#app {
margin: 56px 0 56px 0;
}
.bg-rb {
background-color: var(--mainColor);
color: #f8f9fa;
}
.text-rb {
color: var(--mainColor);
}
.border-rb {
border-color: var(--mainColor);
}
.btn-rb {
background-color: var(--mainColor);
color: #f8f9fa;
}
.btn-rb:hover {
/* background-color: #123b64; */
filter: contrast(60%);
color: #f8f9fa;
}
.btn-rb.active {
/* background-color: #123b64; */
filter: contrast(60%);
color: #f8f9fa;
}
.btn-outline-rb {
color: var(--mainColor);
border-color: var(--mainColor);
}
.btn-outline-rb:hover {
color: #f8f9fa;
background-color: var(--mainColor);
border-color: var(--mainColor);
}
.hidden-nunmber {
-webkit-text-security: disc;
}
nav.navbar {
height: 42px;
padding: 0;
}
.navbar-brand {
font-weight: 100;
padding: 0;
margin: 0;
line-height: 44px;
/* left: 0;
right: 0;
margin-left: auto;
margin-right: auto; */
} | 15.166667 | 39 | 0.579421 |
afa38416a46ffbadd01ef6f9767c7d7dcd6cff8c | 728 | py | Python | test_autoarray/plot/mat_wrap/test_visuals.py | jonathanfrawley/PyAutoArray_copy | c21e8859bdb20737352147b9904797ac99985b73 | [
"MIT"
] | 5 | 2019-09-26T02:18:25.000Z | 2021-12-11T16:29:20.000Z | test_autoarray/plot/mat_wrap/test_visuals.py | jonathanfrawley/PyAutoArray_copy | c21e8859bdb20737352147b9904797ac99985b73 | [
"MIT"
] | 3 | 2020-03-30T14:25:57.000Z | 2021-12-21T17:10:55.000Z | test_autoarray/plot/mat_wrap/test_visuals.py | jonathanfrawley/PyAutoArray_copy | c21e8859bdb20737352147b9904797ac99985b73 | [
"MIT"
] | 4 | 2020-03-03T11:35:41.000Z | 2022-01-21T17:37:35.000Z | import autoarray.plot as aplt
class TestAbstractVisuals:
def test__add_visuals_together__replaces_nones(self):
visuals_1 = aplt.Visuals2D(mask=1)
visuals_0 = aplt.Visuals2D(border=10)
visuals = visuals_0 + visuals_1
assert visuals.mask == 1
assert visuals.border == 10
assert visuals_1.mask == 1
assert visuals_1.border == 10
assert visuals_0.border == 10
assert visuals_0.mask == None
visuals_0 = aplt.Visuals2D(mask=1)
visuals_1 = aplt.Visuals2D(mask=2)
visuals = visuals_1 + visuals_0
assert visuals.mask == 1
assert visuals.border == None
assert visuals_1.mask == 2
| 26.962963 | 58 | 0.615385 |
d98cd5f2a2d12f9d01f77b524fa5f88fd0603493 | 469 | rs | Rust | json-rpc/src/stream_rpc/errors.rs | GreyHyphen/dijets | 8c94c5c079fd025929dbd0455fc0e76d62e418c2 | [
"Apache-2.0"
] | null | null | null | json-rpc/src/stream_rpc/errors.rs | GreyHyphen/dijets | 8c94c5c079fd025929dbd0455fc0e76d62e418c2 | [
"Apache-2.0"
] | 123 | 2021-08-31T19:16:05.000Z | 2022-03-31T19:35:09.000Z | json-rpc/src/stream_rpc/errors.rs | lasthyphen/dijets | 35fc1295628bd3316f2923e677e062770949698b | [
"Apache-2.0"
] | null | null | null | // Copyright (c) The Dijets Core Contributors
// SPDX-License-Identifier: Apache-2.0
use thiserror::Error;
#[derive(Debug, Error)]
pub enum StreamError {
#[error("Could not convert {0} to string")]
CouldNotStringifyMessage(String),
#[error("Client#{0} is closed")]
ClientAlreadyClosed(u64),
#[error("Received disconnect request message from client")]
ClientWantsToDisconnect,
#[error("Transport error: {0}")]
TransportError(String),
}
| 27.588235 | 63 | 0.695096 |
8b8e268909d6ad27e20ac42f6ad445dbbdf2848b | 3,368 | rb | Ruby | fastlane/platforms/ios.rb | drewvolz/AAO-React-Native | 03c3a2721267beb0f100e3cdabecbc5e2addac3d | [
"MIT"
] | null | null | null | fastlane/platforms/ios.rb | drewvolz/AAO-React-Native | 03c3a2721267beb0f100e3cdabecbc5e2addac3d | [
"MIT"
] | null | null | null | fastlane/platforms/ios.rb | drewvolz/AAO-React-Native | 03c3a2721267beb0f100e3cdabecbc5e2addac3d | [
"MIT"
] | null | null | null | # coding: utf-8
require 'json'
platform :ios do
desc 'Runs all the tests'
lane :test do
scan(scheme: ENV['GYM_SCHEME'], project: ENV['GYM_PROJECT'])
end
desc 'Take screenshots'
lane :screenshot do
devices = [
'iPhone 7 Plus',
'iPhone 6',
'iPhone 5s',
# 'iPhone 4s',
'iPad Pro (9.7-inch)',
'iPad Pro (12.9-inch)',
]
snapshot(devices: devices,
languages: ['en-US'],
scheme: ENV['GYM_SCHEME'],
project: ENV['GYM_PROJECT'],
# concurrent_simulators: false,
number_of_retries: 0)
end
desc 'Checks that the app can be built'
lane :check_build do
# fetch the directory where Xcode will put the .app
settings = FastlaneCore::Helper.backticks(%(xcodebuild -showBuildSettings -configuration Debug -scheme "#{ENV['GYM_SCHEME']}" -project "../#{ENV['GYM_PROJECT']}" -destination 'generic/platform=iOS'))
products_dir = settings.split("\n").select { |line| line =~ /\bBUILT_PRODUCTS_DIR =/ }.uniq
products_dir = products_dir.map { |entry| entry.gsub(/.*BUILT_PRODUCTS_DIR = /, '') }
products = products_dir.map { |entry| entry + "/#{ENV['GYM_OUTPUT_NAME']}.app/" }
# save it to a log file for later use
FileUtils.mkdir_p('../logs')
File.open('../logs/products', 'w') { |file| file.write(products.to_json) }
# build the .app
build_status = 0
begin
propagate_version
xcodebuild(
build: true,
scheme: ENV['GYM_SCHEME'],
project: ENV['GYM_PROJECT'],
destination: 'generic/platform=iOS',
xcargs: %(CODE_SIGNING_REQUIRED=NO CODE_SIGN_IDENTITY="")
)
rescue IOError => e
build_status = 1
raise e
ensure
File.open('../logs/build-status', 'w') { |file| file.write(build_status.to_s) }
end
end
desc 'Builds and exports the app'
lane :build do
match(type: 'appstore', readonly: true)
propagate_version
# save it to a log file for later use
FileUtils.mkdir_p('../logs')
File.open('../logs/products', 'w') { |file| file.write('[]') }
build_status = 0
begin
gym(include_bitcode: true,
include_symbols: true)
rescue IOError => e
build_status = 1
raise e
ensure
File.open('../logs/build-status', 'w') { |file| file.write(build_status.to_s) }
end
end
desc 'Submit a new Beta Build to Testflight'
lane :beta do
build
testflight
end
desc 'Submit a new nightly Beta Build to Testflight'
lane :nightly do
build
# TestFlight is returning 500 errors when we upload changelogs again.
begin
testflight(changelog: make_changelog,
distribute_external: false)
rescue => error
puts 'Changelog failed to upload:'
puts error
end
generate_sourcemap
upload_sourcemap_to_bugsnag
end
desc 'Bundle an iOS sourcemap'
lane :sourcemap do
generate_sourcemap
end
desc 'Upload dYSM symbols to Bugsnag from Apple'
lane :refresh_dsyms do
download_dsyms
upload_symbols_to_bugsnag
clean_build_artifacts
end
desc 'Run iOS builds or tests, as appropriate'
lane :'ci-run' do
# set up things so they can run
authorize_ci_for_keys
# and run
auto_beta
# go ahead and download dSYMs for bugsnag too
# refresh_dsyms if circle?
end
end
| 27.16129 | 203 | 0.633314 |
3f9fd6229d48480c995107c049e899ef3bf1d7e8 | 2,359 | php | PHP | resources/views/backend/galerycategory/create.blade.php | Yahsimedya/yaylacikDemo | 76a0ff97e0137602124ddd7600027344217c699f | [
"MIT"
] | 1 | 2021-11-30T09:26:52.000Z | 2021-11-30T09:26:52.000Z | resources/views/backend/galerycategory/create.blade.php | Yahsimedya/kirikkalehaber | a5b2fc22e8f29261a5bde91bb208e249cc5342a6 | [
"MIT"
] | null | null | null | resources/views/backend/galerycategory/create.blade.php | Yahsimedya/kirikkalehaber | a5b2fc22e8f29261a5bde91bb208e249cc5342a6 | [
"MIT"
] | null | null | null | @extends('admin.admin_master')
@section('admin')
<div class="content">
<div class="card">
<div class="card-body">
<form action="{{route('create.galerycategory')}}" method="post">
@csrf
<fieldset class="mb-3">
<legend class="text-uppercase font-size-sm font-weight-bold">Kategori Ekle</legend>
<div class="form-group row">
<label class="col-form-label col-lg-2">Kategori İsmi (TR)</label>
<div class="col-lg-10">
<input type="text" name="category_title" class="form-control">
@error('category_title')
<span class="text-danger">{{$message}}</span>
@enderror
</div>
</div>
{{--
<div class="form-group row">
<label class="col-form-label col-lg-2">Kategori İsmi (EN)</label>
<div class="col-lg-10">
<input type="text" name="category_en" class="form-control">
@error('category_en')
<span class="text-danger">{{$message}}</span>
@enderror
</div>
</div> --}}
<div class="form-group row">
<label class="col-form-label col-lg-2">Kategori Keywords</label>
<div class="col-lg-10">
<textarea class="form-control" name="keywords_tr" id="" cols="30" rows="10"></textarea>
@error('keywords_tr')
<span class="text-danger">{{$message}}</span>
@enderror
</div>
</div>
<div class="form-group row">
<label class="col-form-label col-lg-2">Kategori Description</label>
<div class="col-lg-10">
<textarea class="form-control" name="description_tr" id="" cols="30" rows="10"></textarea>
@error('description_tr')
<span class="text-danger">{{$message}}</span>
@enderror
</div>
</div>
{{-- <div class="form-group row">
<label class="col-form-label col-lg-2">Input with placeholder</label>
<div class="col-lg-10">
<input type="text" class="form-control" placeholder="Enter your username...">
</div>
</div> --}}
<button type="submit" class="btn bg-success float-right"> Ekle</button>
</form>
</div>
</div>
</div>
@endsection
| 37.444444 | 106 | 0.523103 |
bb214ef4711e4ce343304d0aa5a122683d9438a7 | 1,252 | cs | C# | DataAccessLayer/EntityFremawork/EfArticlesDal.cs | OzkanBahrianil/HealthProject | 0ad84b2af487fbc487f3ebe40627340e1b59889a | [
"Apache-2.0"
] | null | null | null | DataAccessLayer/EntityFremawork/EfArticlesDal.cs | OzkanBahrianil/HealthProject | 0ad84b2af487fbc487f3ebe40627340e1b59889a | [
"Apache-2.0"
] | null | null | null | DataAccessLayer/EntityFremawork/EfArticlesDal.cs | OzkanBahrianil/HealthProject | 0ad84b2af487fbc487f3ebe40627340e1b59889a | [
"Apache-2.0"
] | null | null | null | using DataAccessLayer.Abstract;
using DataAccessLayer.Concrete;
using DataAccessLayer.Repositories;
using EntityLayer.Concrate;
using Microsoft.EntityFrameworkCore;
using System;
using System.Collections.Generic;
using System.Linq;
using System.Linq.Expressions;
using System.Text;
using System.Threading.Tasks;
namespace DataAccessLayer.EntityFremawork
{
public class EfArticlesDal : GenericRepository<Articles>, IArticlesDal
{
public List<Articles> GetListWithArticlesCategory()
{
using (var c = new Context())
{
return c.Articles.Include(x => x.ArticleCategory).Include(y=>y.User).ToList();
}
}
public List<Articles> GetListWithCategoryByWriter(int id)
{
using (var c = new Context())
{
return c.Articles.Include(x => x.ArticleCategory).Include(x => x.User).Where(x => x.UserID == id).ToList();
}
}
public List<Articles> GetList(Expression<Func<Articles, bool>> filter)
{
using (var c = new Context())
{
return c.Articles.Include(x => x.ArticleCategory).Include(x => x.User).Where(filter).ToList();
}
}
}
}
| 30.536585 | 123 | 0.61901 |
76f7d44ae3d30d6ecdd4cc1f9cc8347fd7e85e31 | 1,201 | ps1 | PowerShell | Chapter03/3.6 - Leveraging Compatibility.ps1 | EpicJohnson/CookbookClone | fdd11e8be595b3ac5fe00eb79184fcf2cb169c09 | [
"MIT"
] | 7 | 2020-10-04T14:20:20.000Z | 2022-03-31T07:43:40.000Z | Chapter03/3.6 - Leveraging Compatibility.ps1 | EpicJohnson/CookbookClone | fdd11e8be595b3ac5fe00eb79184fcf2cb169c09 | [
"MIT"
] | null | null | null | Chapter03/3.6 - Leveraging Compatibility.ps1 | EpicJohnson/CookbookClone | fdd11e8be595b3ac5fe00eb79184fcf2cb169c09 | [
"MIT"
] | 4 | 2021-07-28T05:06:00.000Z | 2022-03-01T05:07:37.000Z | # 3.6 - Leveraging Compatibility.ps1
# run on SRV1 after installing PowerShell 7 and VS Code.
# Ensure you start a fresh session (or create a new terminal in VS Code)
# run in an elevated console as well.;
# 1. Creating a session using the reserved name
$S1 = New-PSSession -Name WinPSCompatSession -ComputerName SRV1
# 2. Getting loaded modules in the remote session
Invoke-Command -Session $S1 -ScriptBlock {Get-Module}
# 3. Loading the ServerManger module in the remote session
Import-Module -Name ServerManager -WarningAction SilentlyContinue |
Out-Null
# 4. Getting loaded modules in remote session
Invoke-Command -Session $S1 -ScriptBlock {Get-Module}
# 5. Using Get-WindowsFeature
Get-WindowsFeature -Name PowerShell
# 6. Closing remoting sessions and removing module from current PS7 session
Get-PSSession| Remove-PSSession
Get-Module -Name ServerManager | Remove-Module
# 7. Creating a default compatibility remoting session
Import-Module -Name ServerManager -WarningAction SilentlyContinue
# 8. Getting the new remoting session
$S2 = Get-PSSession -Name 'WinPSCompatSession'
$S2
# 9. Examining modules in WInPSCompatSessionb
Invoke-Command -Session $S2 -ScriptBlock {Get-Module}
| 33.361111 | 75 | 0.787677 |
085ff752ee929b5e1ba60fce2cb72b5dc53df764 | 8,734 | cc | C++ | proxy/proxy_connector.cc | IanCassTwo/wanproxy | aab37fa4a44f4b27e0acc2bcf7e1648942676f6a | [
"BSD-2-Clause"
] | 2 | 2016-02-01T20:13:56.000Z | 2019-05-14T15:57:27.000Z | proxy/proxy_connector.cc | IanCassTwo/wanproxy | aab37fa4a44f4b27e0acc2bcf7e1648942676f6a | [
"BSD-2-Clause"
] | 1 | 2020-06-25T13:19:21.000Z | 2020-07-17T15:00:08.000Z | proxy/proxy_connector.cc | IanCassTwo/wanproxy | aab37fa4a44f4b27e0acc2bcf7e1648942676f6a | [
"BSD-2-Clause"
] | 3 | 2016-02-01T20:14:25.000Z | 2021-12-19T16:47:10.000Z | /*
* Copyright (c) 2008-2011 Juli Mallett. All rights reserved.
*
* Redistribution and use in source and binary forms, with or without
* modification, are permitted provided that the following conditions
* are met:
* 1. Redistributions of source code must retain the above copyright
* notice, this list of conditions and the following disclaimer.
* 2. Redistributions in binary form must reproduce the above copyright
* notice, this list of conditions and the following disclaimer in the
* documentation and/or other materials provided with the distribution.
*
* THIS SOFTWARE IS PROVIDED BY AUTHOR AND CONTRIBUTORS ``AS IS'' AND
* ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
* IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
* ARE DISCLAIMED. IN NO EVENT SHALL AUTHOR OR CONTRIBUTORS BE LIABLE
* FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
* DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS
* OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION)
* HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
* LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY
* OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
* SUCH DAMAGE.
*/
#include <event/event_system.h>
#include <io/socket/socket.h>
#include <io/sink_filter.h>
#include <ssh/ssh_filter.h>
#include <xcodec/xcodec_filter.h>
#include <zlib/zlib_filter.h>
#include <common/count_filter.h>
#include "proxy_connector.h"
////////////////////////////////////////////////////////////////////////////////
// //
// File: proxy_connector.cc //
// Description: carries data between endpoints through a filter chain //
// Project: WANProxy XTech //
// Adapted by: Andreu Vidal Bramfeld-Software //
// Last modified: 2016-02-28 //
// //
////////////////////////////////////////////////////////////////////////////////
ProxyConnector::ProxyConnector (const std::string& name,
WANProxyCodec* local_codec,
WANProxyCodec* remote_codec,
Socket* local_socket,
SocketAddressFamily family,
const std::string& remote_name,
bool cln, bool ssh)
: log_("/wanproxy/" + name + "/connector"),
local_codec_(local_codec),
remote_codec_(remote_codec),
local_socket_(local_socket),
remote_socket_(0),
is_cln_(cln),
is_ssh_(ssh),
request_chain_(this),
response_chain_(this),
connect_action_(0),
stop_action_(0),
request_action_(0),
response_action_(0),
close_action_(0),
flushing_(0)
{
if (local_socket_ && (remote_socket_ = Socket::create (family, SocketTypeStream, "tcp", remote_name)))
{
connect_action_ = remote_socket_->connect (remote_name, callback (this, &ProxyConnector::connect_complete));
stop_action_ = event_system.register_interest (EventInterestStop, callback (this, &ProxyConnector::conclude));
}
else
{
close_action_ = event_system.track (0, StreamModeWait, callback (this, &ProxyConnector::conclude));
}
}
ProxyConnector::~ProxyConnector ()
{
if (connect_action_)
connect_action_->cancel ();
if (stop_action_)
stop_action_->cancel ();
if (request_action_)
request_action_->cancel ();
if (response_action_)
response_action_->cancel ();
if (close_action_)
close_action_->cancel ();
if (local_socket_)
local_socket_->close ();
if (remote_socket_)
remote_socket_->close ();
delete local_socket_;
delete remote_socket_;
}
void ProxyConnector::connect_complete (Event e)
{
if (connect_action_)
connect_action_->cancel (), connect_action_ = 0;
switch (e.type_)
{
case Event::Done:
break;
case Event::Error:
INFO(log_) << "Connect failed: " << e;
conclude (e);
return;
default:
ERROR(log_) << "Unexpected event: " << e;
conclude (e);
return;
}
if (build_chains (local_codec_, remote_codec_, local_socket_, remote_socket_))
{
request_action_ = local_socket_->read (callback (this, &ProxyConnector::on_request_data));
response_action_ = remote_socket_->read (callback (this, &ProxyConnector::on_response_data));
}
}
bool ProxyConnector::build_chains (WANProxyCodec* cdc1, WANProxyCodec* cdc2, Socket* sck1, Socket* sck2)
{
if (! sck1 || ! sck2)
return false;
response_chain_.prepend (new SinkFilter ("/wanproxy/response", sck1, is_cln_));
if (is_ssh_)
{
SSH::EncryptFilter* enc; SSH::DecryptFilter* dec;
request_chain_.append ((dec = new SSH::DecryptFilter ((cdc1 ? SSH::SOURCE_ENCODED : 0))));
response_chain_.prepend ((enc = new SSH::EncryptFilter (SSH::ServerRole, (cdc1 ? SSH::SOURCE_ENCODED : 0))));
dec->set_encrypter (enc);
}
if (cdc1)
{
if (cdc1->counting_)
{
request_chain_.append (new CountFilter (cdc1->request_input_bytes_));
response_chain_.prepend (new CountFilter (cdc1->response_output_bytes_));
}
if (cdc1->compressor_)
{
request_chain_.append (new InflateFilter ());
response_chain_.prepend (new DeflateFilter (cdc1->compressor_level_));
}
if (cdc1->xcache_)
{
EncodeFilter* enc; DecodeFilter* dec;
request_chain_.append ((dec = new DecodeFilter ("/wanproxy/" + cdc1->name_ + "/dec", cdc1)));
response_chain_.prepend ((enc = new EncodeFilter ("/wanproxy/" + cdc1->name_ + "/enc", cdc1, 1)));
dec->set_upstream (enc);
}
if (cdc1->counting_)
{
request_chain_.append (new CountFilter (cdc1->request_output_bytes_));
response_chain_.prepend (new CountFilter (cdc1->response_input_bytes_, 1));
}
}
if (cdc2)
{
if (cdc2->counting_)
{
request_chain_.append (new CountFilter (cdc2->request_input_bytes_));
response_chain_.prepend (new CountFilter (cdc2->response_output_bytes_));
}
if (cdc2->xcache_)
{
EncodeFilter* enc; DecodeFilter* dec;
request_chain_.append ((enc = new EncodeFilter ("/wanproxy/" + cdc2->name_ + "/enc", cdc2)));
response_chain_.prepend ((dec = new DecodeFilter ("/wanproxy/" + cdc2->name_ + "/dec", cdc2)));
dec->set_upstream (enc);
}
if (cdc2->compressor_)
{
request_chain_.append (new DeflateFilter (cdc2->compressor_level_));
response_chain_.prepend (new InflateFilter ());
}
if (cdc2->counting_)
{
request_chain_.append (new CountFilter (cdc2->request_output_bytes_));
response_chain_.prepend (new CountFilter (cdc2->response_input_bytes_));
}
}
if (is_ssh_)
{
SSH::EncryptFilter* enc; SSH::DecryptFilter* dec;
request_chain_.append ((enc = new SSH::EncryptFilter (SSH::ClientRole, (cdc2 ? SSH::SOURCE_ENCODED : 0))));
response_chain_.prepend ((dec = new SSH::DecryptFilter ((cdc2 ? SSH::SOURCE_ENCODED : 0))));
dec->set_encrypter (enc);
}
request_chain_.append (new SinkFilter ("/wanproxy/request", sck2));
return true;
}
void ProxyConnector::on_request_data (Event e)
{
if (request_action_)
request_action_->cancel (), request_action_ = 0;
if (flushing_ & REQUEST_CHAIN_FLUSHING)
return;
switch (e.type_)
{
case Event::Done:
request_action_ = local_socket_->read (callback (this, &ProxyConnector::on_request_data));
if (request_chain_.consume (e.buffer_))
break;
case Event::EOS:
DEBUG(log_) << "Flushing request";
flushing_ |= REQUEST_CHAIN_FLUSHING;
request_chain_.flush (REQUEST_CHAIN_READY);
break;
default:
DEBUG(log_) << "Unexpected event: " << e;
conclude (e);
return;
}
}
void ProxyConnector::on_response_data (Event e)
{
if (response_action_)
response_action_->cancel (), response_action_ = 0;
if (flushing_ & RESPONSE_CHAIN_FLUSHING)
return;
switch (e.type_)
{
case Event::Done:
response_action_ = remote_socket_->read (callback (this, &ProxyConnector::on_response_data));
if (response_chain_.consume (e.buffer_))
break;
case Event::EOS:
DEBUG(log_) << "Flushing response";
flushing_ |= RESPONSE_CHAIN_FLUSHING;
response_chain_.flush (RESPONSE_CHAIN_READY);
break;
default:
DEBUG(log_) << "Unexpected event: " << e;
conclude (e);
return;
}
}
void ProxyConnector::flush (int flg)
{
flushing_ |= flg;
if ((flushing_ & (REQUEST_CHAIN_READY | RESPONSE_CHAIN_READY)) == (REQUEST_CHAIN_READY | RESPONSE_CHAIN_READY))
if (! close_action_)
close_action_ = event_system.track (0, StreamModeWait, callback (this, &ProxyConnector::conclude));
}
void ProxyConnector::conclude (Event e)
{
delete this;
}
| 31.992674 | 112 | 0.667163 |
f8200e0ffb31ef8789dc870466917fbefbc30839 | 658 | sh | Shell | .ci/aarch64/clean_up_aarch64.sh | liubin/tests | 11ea324de4144c5dc67e9e6fe9cb5514231089c9 | [
"Apache-2.0"
] | 154 | 2017-12-04T08:35:56.000Z | 2022-01-21T14:01:45.000Z | .ci/aarch64/clean_up_aarch64.sh | liubin/tests | 11ea324de4144c5dc67e9e6fe9cb5514231089c9 | [
"Apache-2.0"
] | 4,512 | 2017-12-15T18:44:55.000Z | 2022-03-31T20:59:31.000Z | .ci/aarch64/clean_up_aarch64.sh | liubin/tests | 11ea324de4144c5dc67e9e6fe9cb5514231089c9 | [
"Apache-2.0"
] | 163 | 2017-11-13T11:32:30.000Z | 2022-03-21T10:24:52.000Z | #!/bin/bash
#
# Copyright (c) 2018 ARM Limited
#
# SPDX-License-Identifier: Apache-2.0
source "/etc/os-release" || source "/usr/lib/os-release"
tests_repo="${tests_repo:-github.com/kata-containers/tests}"
lib_script="${GOPATH}/src/${tests_repo}/.ci/lib.sh"
source "${lib_script}"
gen_clean_arch || info "Arch cleanup scripts failed"
## Cleaning up stale files under $TMPDIR of last CI run
## $TMPDIR has been set as "/tmp/kata-containers" on all ARM CI node.
if [ "${TMPDIR}" != "/tmp" ]; then
if [ -n "$(ls -A "${TMPDIR}")" ]; then
echo "WARNING: ${TMPDIR} is Not Empty"
sudo -E sh -c "rm -rf "${TMPDIR}""
fi
fi
| 28.608696 | 69 | 0.62614 |
06645065e1092b2b59c68b62093df06c47df8733 | 506 | swift | Swift | TicTacToe/TicTacToe/Model/TicTacToe.swift | huntermcneil/TicTacToeGroup | 17ea898dc0bdb896d7af8395ca58b04698e9edf8 | [
"MIT"
] | null | null | null | TicTacToe/TicTacToe/Model/TicTacToe.swift | huntermcneil/TicTacToeGroup | 17ea898dc0bdb896d7af8395ca58b04698e9edf8 | [
"MIT"
] | null | null | null | TicTacToe/TicTacToe/Model/TicTacToe.swift | huntermcneil/TicTacToeGroup | 17ea898dc0bdb896d7af8395ca58b04698e9edf8 | [
"MIT"
] | 1 | 2020-07-08T17:54:49.000Z | 2020-07-08T17:54:49.000Z | //
// TicTacToe.swift
// TicTacToe
//
// Created by adetokunbo babatunde on 7/8/20.
// Copyright © 2020 Hunter McNeil. All rights reserved.
//
import Foundation
struct TicTacToe {
var activePlayer = 1
var count = 1
var gameState = [0, 0, 0, 0, 0, 0, 0, 0, 0]
var gameIsActive = true
let winningCombination = [[0, 1, 2], [3, 4, 5], [6, 7, 8], [0, 3, 6], [1, 4, 7,], [2, 5, 8], [0, 4, 8], [2, 4, 6]]
var winner = ""
var imageX = "tictactoeX"
var imageO = "tictactoeO"
}
| 24.095238 | 118 | 0.567194 |
872cc03fed1ec26035664e52d8eb28b02d9903a5 | 1,345 | swift | Swift | Sources/ModelsDSTU2/CodeSystemConditionCategoryCodes.swift | GrandLarseny/FHIRModels | d4acbcf08376af10d20c1df808e6f943d2033912 | [
"Apache-2.0"
] | 117 | 2020-06-26T17:12:32.000Z | 2022-03-20T18:34:05.000Z | Sources/ModelsDSTU2/CodeSystemConditionCategoryCodes.swift | GrandLarseny/FHIRModels | d4acbcf08376af10d20c1df808e6f943d2033912 | [
"Apache-2.0"
] | 14 | 2020-06-30T14:55:50.000Z | 2022-03-18T20:30:19.000Z | Sources/ModelsDSTU2/CodeSystemConditionCategoryCodes.swift | GrandLarseny/FHIRModels | d4acbcf08376af10d20c1df808e6f943d2033912 | [
"Apache-2.0"
] | 24 | 2020-08-19T15:48:58.000Z | 2022-03-26T11:20:14.000Z | //
// CodeSystems.swift
// HealthRecords
//
// Generated from FHIR 1.0.2.7202
// Copyright 2020 Apple Inc.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
import FMCore
/**
Preferred value set for Condition Categories.
URL: http://hl7.org/fhir/condition-category
ValueSet: http://hl7.org/fhir/ValueSet/condition-category
*/
public enum ConditionCategoryCodes: String, FHIRPrimitiveType {
/// The patient considers the condition an issue to be addressed.
case complaint = "complaint"
/// A symptom of a condition (as might be mentioned in a review of systems).
case symptom = "symptom"
/// An observation made by a healthcare provider.
case finding = "finding"
/// This is a judgment made by a healthcare provider that the patient has a particular disease or condition.
case diagnosis = "diagnosis"
}
| 32.02381 | 109 | 0.734572 |
2f44480ec94aa1132cdfe090adc873bdf0868ab3 | 1,122 | js | JavaScript | src/index.js | CalvinHacks/calvinhacks-2020 | 01b75b9c04a44f8a84aba3243d24191bb1ab0e00 | [
"MIT"
] | null | null | null | src/index.js | CalvinHacks/calvinhacks-2020 | 01b75b9c04a44f8a84aba3243d24191bb1ab0e00 | [
"MIT"
] | 5 | 2021-03-10T14:48:34.000Z | 2022-02-18T16:53:05.000Z | src/index.js | CalvinHacks/calvinhacks-2020 | 01b75b9c04a44f8a84aba3243d24191bb1ab0e00 | [
"MIT"
] | null | null | null | // Images
// import './images/atomic-object.png'
// import './images/TEKTON.png'
// import './images/profile.jpg'
import './images/atomic-object.png'
import './images/TEKTON.png'
import './images/profile.jpg'
import './images/steelcase.svg'
import './images/pec-tech.png'
import './images/spindance.jpg'
import './images/brooksource.svg'
import './images/blujay-solutions.jpg'
import './images/calvin.svg'
import './images/stickermule.svg'
// SVG
import './images/redbull.svg'
import './images/front.svg'
import './images/webpack-logo.svg'
import './images/logo.svg'
import './images/schedule-large.svg'
import './images/schedule-small.svg'
// Favicon
import './images/favicon/favicon.ico'
import './images/favicon/apple-touch-icon.png'
import './images/favicon/favicon-32x32.png'
import './images/favicon/favicon-16x16.png'
import './images/favicon/site.webmanifest'
import './images/favicon/safari-pinned-tab.svg'
// Styles
import './styles/index.scss'
// View
import './index.handlebars'
// Scripts
import '../node_modules/animejs/lib/anime.min.js'
import './scripts/scrollMonitor.js'
import './scripts/main.js'
| 25.5 | 49 | 0.730838 |
28c3df9e352a260b13ba14d9ce91c4a1e4203984 | 5,462 | swift | Swift | DuckDuckGo/ConfigurationDebugViewController.swift | brenoxp/iOS | e3ff95dd74d429f950faf147ad618ce4f1db2196 | [
"Apache-2.0"
] | null | null | null | DuckDuckGo/ConfigurationDebugViewController.swift | brenoxp/iOS | e3ff95dd74d429f950faf147ad618ce4f1db2196 | [
"Apache-2.0"
] | null | null | null | DuckDuckGo/ConfigurationDebugViewController.swift | brenoxp/iOS | e3ff95dd74d429f950faf147ad618ce4f1db2196 | [
"Apache-2.0"
] | null | null | null | //
// ConfigurationDebugViewController.swift
// DuckDuckGo
//
// Copyright © 2020 DuckDuckGo. All rights reserved.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
//
import UIKit
import BackgroundTasks
import Core
@available(iOS 13.0, *)
class ConfigurationDebugViewController: UITableViewController {
private let titles = [
Sections.refreshInformation: "Background Refresh Info",
Sections.queuedTasks: "Queued Tasks (Earliest Execution Date)",
Sections.etags: "ETags"
]
enum Sections: Int, CaseIterable {
case refreshInformation
case queuedTasks
case etags
}
enum RefreshInformationRows: Int, CaseIterable {
case lastRefreshDate
case resetLastRefreshDate
}
enum ETagRows: String, CaseIterable {
case httpsBloomFilterSpec
case httpsBloomFilter
case httpsExcludedDomains
case surrogates
case trackerDataSet
case privacyConfiguration
case resetEtags = "Reset ETags"
var showDetail: Bool {
return self != .resetEtags
}
}
@UserDefaultsWrapper(key: .lastConfigurationRefreshDate, defaultValue: .distantPast)
private var lastConfigurationRefreshDate: Date
private var queuedTasks: [BGTaskRequest] = []
private let etagStorage = DebugEtagStorage()
private let dateFormatter: DateFormatter = {
let formatter = DateFormatter()
formatter.dateStyle = .medium
formatter.timeStyle = .long
return formatter
}()
override func viewDidLoad() {
super.viewDidLoad()
BGTaskScheduler.shared.getPendingTaskRequests { tasks in
let filteredTasks = tasks.filter { $0.identifier == AppConfigurationFetch.Constants.backgroundProcessingTaskIdentifier }
self.queuedTasks = filteredTasks
DispatchQueue.main.async {
self.tableView.reloadData()
}
}
}
override func numberOfSections(in tableView: UITableView) -> Int {
return Sections.allCases.count
}
override func tableView(_ tableView: UITableView, titleForHeaderInSection section: Int) -> String? {
guard let section = Sections(rawValue: section) else { return nil }
return titles[section]
}
override func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCell(withIdentifier: "Cell", for: indexPath)
switch Sections(rawValue: indexPath.section) {
case .refreshInformation:
switch RefreshInformationRows(rawValue: indexPath.row) {
case .lastRefreshDate:
cell.textLabel?.text = "Last Refresh"
if lastConfigurationRefreshDate == Date.distantPast {
cell.detailTextLabel?.text = "Never"
} else {
cell.detailTextLabel?.text = dateFormatter.string(from: lastConfigurationRefreshDate)
}
case .resetLastRefreshDate:
cell.textLabel?.text = "Reset Last Refresh Date"
default: break
}
case .queuedTasks:
if queuedTasks.isEmpty {
cell.textLabel?.text = "None"
} else {
cell.textLabel?.text = dateFormatter.string(from: queuedTasks[indexPath.row].earliestBeginDate!)
}
case .etags:
let row = ETagRows.allCases[indexPath.row]
cell.textLabel?.text = row.rawValue
if let etag = etagStorage.etag(for: row.rawValue) {
cell.detailTextLabel?.text = etag
} else {
cell.detailTextLabel?.text = row.showDetail ? "None" : nil
}
default: break
}
return cell
}
override func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
switch Sections(rawValue: section) {
case .refreshInformation: return RefreshInformationRows.allCases.count
case .queuedTasks: return queuedTasks.isEmpty ? 1 : queuedTasks.count
case .etags: return ETagRows.allCases.count
default: return 0
}
}
override func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
switch Sections(rawValue: indexPath.section) {
case .refreshInformation:
switch RefreshInformationRows(rawValue: indexPath.row) {
case .resetLastRefreshDate:
lastConfigurationRefreshDate = Date.distantPast
tableView.reloadData()
default: break
}
case .etags:
switch ETagRows.allCases[indexPath.row] {
case .resetEtags:
etagStorage.resetAll()
tableView.reloadData()
default: break
}
default: break
}
}
}
| 32.129412 | 132 | 0.636031 |
68dd99ecb4004c73ff0094e5ad7accb14543263e | 5,888 | ps1 | PowerShell | Functions.Tests/Import-VisualStudioVars.Tests.ps1 | worseTyler/PSToolbox | 317387c4183544c6d456413b372889b2d0d505a9 | [
"MIT"
] | 5 | 2017-03-10T01:46:49.000Z | 2020-02-29T09:41:56.000Z | Functions.Tests/Import-VisualStudioVars.Tests.ps1 | worseTyler/PSToolbox | 317387c4183544c6d456413b372889b2d0d505a9 | [
"MIT"
] | 49 | 2016-05-19T21:53:26.000Z | 2022-01-31T21:17:56.000Z | Functions.Tests/Import-VisualStudioVars.Tests.ps1 | worseTyler/PSToolbox | 317387c4183544c6d456413b372889b2d0d505a9 | [
"MIT"
] | 6 | 2017-02-03T01:15:10.000Z | 2022-02-28T19:22:12.000Z | $sut = $PSCommandPath.Replace(".Tests", "")
. $sut
#ToDO: These should be imported from PSCX... for some reason that fails to happen.
#Function Push-EnvironmentBlock() {}
Function Invoke-BatchFile([string]$Path, [string]$Parameters) {}
function DebugBreak{}
function Debug{
Set-PSBreakpoint -command DebugBreak
DebugBreak
}
Describe "Import-VisualStudioVars" {
$expected = $null;
$installed = $false;
Mock Push-EnvironmentBlock {}
Context "Mock out the call" {
It "Test 2008 Not Installed" {
Mock Test-Path { $false }
$existingVariable = $Env:VS90COMNTOOLS
$Env:VS90COMNTOOLS = "TEST_VARIABLE"
Try
{
Import-VisualStudioVars "2008"
}
Catch
{
$_ | Should Be "Visual Studio 2008 is not installed or the expected environment variable is not found."
}
Finally
{
$Env:VS90COMNTOOLS = $existingVariable
}
Assert-VerifiableMocks
}
It "Test 2008 Installed" {
$existingVariable = $Env:VS90COMNTOOLS
Try
{
$Env:VS90COMNTOOLS = "TEST_VARIABLE"
Mock Test-Path { $true }
Mock Invoke-BatchFile { ($Path.EndsWith("vcvarsall.bat") -and $Path.Contains("TEST_VARIABLE")) | Should be $true } -Verifiable
Import-VisualStudioVars "2008"
}
Catch [System.Exception]
{
Write-Host $_.Exception.Message
}
Finally
{
$Env:VS90COMNTOOLS = $existingVariable
}
Assert-VerifiableMocks
}
It "Test 2010 Not Installed" {
Mock Test-Path { $false }
$existingVariable = $Env:VS100COMNTOOLS
$Env:VS100COMNTOOLS = "TEST_VARIABLE"
Try
{
Import-VisualStudioVars "2010"
}
Catch
{
$_ | Should Be "Visual Studio 2010 is not installed or the expected environment variable is not found."
}
Finally
{
$Env:VS100COMNTOOLS = $existingVariable
}
Assert-VerifiableMocks
}
#It "Test 2010 Installed" {
# $existingVariable = $Env:VS100COMNTOOLS
# Try
# {
# $Env:VS100COMNTOOLS = "TEST_VARIABLE"
# Mock Test-Path { $true }
# Mock Invoke-BatchFile { ($Path.EndsWith("vcvarsall.bat") -and $Path.Contains("TEST_VARIABLE")) | Should be $true } -Verifiable
# Import-VisualStudioVars "2010"
# }
# Catch [System.Exception]
# {
# Write-Host $_.Exception.Message
# }
# Finally
# {
# $Env:VS100COMNTOOLS = $existingVariable
# }
# Assert-VerifiableMocks
#}
It "Test 2012 Not Installed" {
Mock Test-Path { $false }
$existingVariable = $Env:VS110COMNTOOLS
$Env:VS110COMNTOOLS = "TEST_VARIABLE"
Try
{
Import-VisualStudioVars "2012"
}
Catch
{
$_ | Should Be "Visual Studio 2012 is not installed or the expected environment variable is not found."
}
Finally
{
$Env:VS110COMNTOOLS = $existingVariable
}
Assert-VerifiableMocks
}
It "Test 2012 Installed" {
$existingVariable = $Env:VS110COMNTOOLS
Try
{
$Env:VS110COMNTOOLS = "TEST_VARIABLE"
Mock Test-Path { $true }
Mock Invoke-BatchFile { ($Path.EndsWith("vcvarsall.bat") -and $Path.Contains("TEST_VARIABLE")) | Should be $true } -Verifiable
Import-VisualStudioVars "2012"
}
Catch [System.Exception]
{
Write-Host $_.Exception.Message
}
Finally
{
$Env:VS110COMNTOOLS = $existingVariable
}
Assert-VerifiableMocks
}
It "Test 2013 Not Installed" {
Mock Test-Path { $false }
$existingVariable = $Env:VS120COMNTOOLS
$Env:VS120COMNTOOLS = "TEST_VARIABLE"
Try
{
Import-VisualStudioVars "2013"
}
Catch
{
$_ | Should Be "Visual Studio 2013 is not installed or the expected environment variable is not found."
}
Finally
{
$Env:VS120COMNTOOLS = $existingVariable
}
Assert-VerifiableMocks
}
#It "Test 2013 Installed" {
# $existingVariable = $Env:VS120COMNTOOLS
# Try
# {
# $Env:VS120COMNTOOLS = "TEST_VARIABLE"
# Mock Test-Path { $true }
# Mock Invoke-BatchFile { ($Path.EndsWith("vcvarsall.bat") -and $Path.Contains("TEST_VARIABLE")) | Should be $true } -Verifiable
# Import-VisualStudioVars "2013"
# }
# Catch [System.Exception]
# {
# Write-Host $_.Exception.Message
# }
# Finally
# {
# $Env:VS120COMNTOOLS = $existingVariable
# }
# Assert-VerifiableMocks
#}
}
} | 33.265537 | 145 | 0.46858 |
26927f30978c6242541b67c571adc79a7f35ad15 | 10,920 | ps1 | PowerShell | Allfiles/Mod01/Labfiles/Solution/Exercise 1/packages/EntityFramework.6.2.0/tools/install.ps1 | vijayraavi/20483-Programming-in-C-Sharp | 5f8eff07cd6e0461283953c7c763662b8133ab9c | [
"MIT"
] | 286 | 2018-01-18T19:05:24.000Z | 2022-03-09T01:01:05.000Z | Allfiles/Mod01/Labfiles/Solution/Exercise 1/packages/EntityFramework.6.2.0/tools/install.ps1 | bogdan71/20483-Programming-in-C-Sharp | 8f1f982cc219e0840584cd5cd94c1cee7c327ec4 | [
"MIT"
] | 27 | 2018-06-07T14:43:15.000Z | 2022-02-15T11:55:16.000Z | Allfiles/Mod01/Labfiles/Solution/Exercise 1/packages/EntityFramework.6.2.0/tools/install.ps1 | bogdan71/20483-Programming-in-C-Sharp | 8f1f982cc219e0840584cd5cd94c1cee7c327ec4 | [
"MIT"
] | 382 | 2018-03-09T00:58:34.000Z | 2022-03-30T21:17:49.000Z | param($installPath, $toolsPath, $package, $project)
Initialize-EFConfiguration $project
Add-EFProvider $project 'System.Data.SqlClient' 'System.Data.Entity.SqlServer.SqlProviderServices, EntityFramework.SqlServer'
Write-Host
Write-Host "Type 'get-help EntityFramework' to see all available Entity Framework commands."
# SIG # Begin signature block
# MIIdeQYJKoZIhvcNAQcCoIIdajCCHWYCAQExCzAJBgUrDgMCGgUAMGkGCisGAQQB
# gjcCAQSgWzBZMDQGCisGAQQBgjcCAR4wJgIDAQAABBAfzDtgWUsITrck0sYpfvNR
# AgEAAgEAAgEAAgEAAgEAMCEwCQYFKw4DAhoFAAQUjgytciCovTic6/jKZPk7al+/
# G+WgghhVMIIEwzCCA6ugAwIBAgITMwAAAMZ4gDYBdRppcgAAAAAAxjANBgkqhkiG
# 9w0BAQUFADB3MQswCQYDVQQGEwJVUzETMBEGA1UECBMKV2FzaGluZ3RvbjEQMA4G
# A1UEBxMHUmVkbW9uZDEeMBwGA1UEChMVTWljcm9zb2Z0IENvcnBvcmF0aW9uMSEw
# HwYDVQQDExhNaWNyb3NvZnQgVGltZS1TdGFtcCBQQ0EwHhcNMTYwOTA3MTc1ODUz
# WhcNMTgwOTA3MTc1ODUzWjCBszELMAkGA1UEBhMCVVMxEzARBgNVBAgTCldhc2hp
# bmd0b24xEDAOBgNVBAcTB1JlZG1vbmQxHjAcBgNVBAoTFU1pY3Jvc29mdCBDb3Jw
# b3JhdGlvbjENMAsGA1UECxMETU9QUjEnMCUGA1UECxMebkNpcGhlciBEU0UgRVNO
# OkY1MjgtMzc3Ny04QTc2MSUwIwYDVQQDExxNaWNyb3NvZnQgVGltZS1TdGFtcCBT
# ZXJ2aWNlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEArQsjG6jKiCgU
# NuPDaF0GhCh1QYcSqJypNAJgoa1GtgoNrKXTDUZF6K+eHPNzXv9v/LaYLZX2GyOI
# 9lGz55tXVv1Ny6I1ueVhy2cUAhdE+IkVR6AtCo8Ar8uHwEpkyTi+4Ywr6sOGM7Yr
# wBqw+SeaBjBwON+8E8SAz0pgmHHj4cNvt5A6R+IQC6tyiFx+JEMO1qqnITSI2qx3
# kOXhD3yTF4YjjRnTx3HGpfawUCyfWsxasAHHlILEAfsVAmXsbr4XAC2HBZGKXo03
# jAmfvmbgbm3V4KBK296Unnp92RZmwAEqL08n+lrl+PEd6w4E9mtFHhR9wGSW29C5
# /0bOar9zHwIDAQABo4IBCTCCAQUwHQYDVR0OBBYEFNS/9jKwiDEP5hmU8T6/Mfpb
# Ag8JMB8GA1UdIwQYMBaAFCM0+NlSRnAK7UD7dvuzK7DDNbMPMFQGA1UdHwRNMEsw
# SaBHoEWGQ2h0dHA6Ly9jcmwubWljcm9zb2Z0LmNvbS9wa2kvY3JsL3Byb2R1Y3Rz
# L01pY3Jvc29mdFRpbWVTdGFtcFBDQS5jcmwwWAYIKwYBBQUHAQEETDBKMEgGCCsG
# AQUFBzAChjxodHRwOi8vd3d3Lm1pY3Jvc29mdC5jb20vcGtpL2NlcnRzL01pY3Jv
# c29mdFRpbWVTdGFtcFBDQS5jcnQwEwYDVR0lBAwwCgYIKwYBBQUHAwgwDQYJKoZI
# hvcNAQEFBQADggEBAJhbANzvo0iL5FA5Z5QkwG+PvkDfOaYsTYksqFk+MgpqzPxc
# FwSYME/S/wyihd4lwgQ6CPdO5AGz3m5DZU7gPS5FcCl10k9pTxZ4s857Pu8ZrE2x
# rnUyUiQFl5DYSNroRPuQYRZZXs2xK1WVn1JcwcAwJwfu1kwnebPD90o1DRlNozHF
# 3NMaIo0nCTRAN86eSByKdYpDndgpVLSoN2wUnsh4bLcZqod4ozdkvgGS7N1Af18R
# EFSUBVraf7MoSxKeNIKLLyhgNxDxZxrUgnPb3zL73zOj40A1Ibw3WzJob8vYK+gB
# YWORl4jm6vCwAq/591z834HDNH60Ud0bH+xS7PowggYBMIID6aADAgECAhMzAAAA
# xOmJ+HqBUOn/AAAAAADEMA0GCSqGSIb3DQEBCwUAMH4xCzAJBgNVBAYTAlVTMRMw
# EQYDVQQIEwpXYXNoaW5ndG9uMRAwDgYDVQQHEwdSZWRtb25kMR4wHAYDVQQKExVN
# aWNyb3NvZnQgQ29ycG9yYXRpb24xKDAmBgNVBAMTH01pY3Jvc29mdCBDb2RlIFNp
# Z25pbmcgUENBIDIwMTEwHhcNMTcwODExMjAyMDI0WhcNMTgwODExMjAyMDI0WjB0
# MQswCQYDVQQGEwJVUzETMBEGA1UECBMKV2FzaGluZ3RvbjEQMA4GA1UEBxMHUmVk
# bW9uZDEeMBwGA1UEChMVTWljcm9zb2Z0IENvcnBvcmF0aW9uMR4wHAYDVQQDExVN
# aWNyb3NvZnQgQ29ycG9yYXRpb24wggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEK
# AoIBAQCIirgkwwePmoB5FfwmYPxyiCz69KOXiJZGt6PLX4kvOjMuHpF4+nypH4IB
# tXrLGrwDykbrxZn3+wQd8oUK/yJuofJnPcUnGOUoH/UElEFj7OO6FYztE5o13jhw
# VG877K1FCTBJwb6PMJkMy3bJ93OVFnfRi7uUxwiFIO0eqDXxccLgdABLitLckevW
# eP6N+q1giD29uR+uYpe/xYSxkK7WryvTVPs12s1xkuYe/+xxa8t/CHZ04BBRSNTx
# AMhITKMHNeVZDf18nMjmWuOF9daaDx+OpuSEF8HWyp8dAcf9SKcTkjOXIUgy+MIk
# ogCyvlPKg24pW4HvOG6A87vsEwvrAgMBAAGjggGAMIIBfDAfBgNVHSUEGDAWBgor
# BgEEAYI3TAgBBggrBgEFBQcDAzAdBgNVHQ4EFgQUy9ZihM9gOer/Z8Jc0si7q7fD
# E5gwUgYDVR0RBEswSaRHMEUxDTALBgNVBAsTBE1PUFIxNDAyBgNVBAUTKzIzMDAx
# MitjODA0YjVlYS00OWI0LTQyMzgtODM2Mi1kODUxZmEyMjU0ZmMwHwYDVR0jBBgw
# FoAUSG5k5VAF04KqFzc3IrVtqMp1ApUwVAYDVR0fBE0wSzBJoEegRYZDaHR0cDov
# L3d3dy5taWNyb3NvZnQuY29tL3BraW9wcy9jcmwvTWljQ29kU2lnUENBMjAxMV8y
# MDExLTA3LTA4LmNybDBhBggrBgEFBQcBAQRVMFMwUQYIKwYBBQUHMAKGRWh0dHA6
# Ly93d3cubWljcm9zb2Z0LmNvbS9wa2lvcHMvY2VydHMvTWljQ29kU2lnUENBMjAx
# MV8yMDExLTA3LTA4LmNydDAMBgNVHRMBAf8EAjAAMA0GCSqGSIb3DQEBCwUAA4IC
# AQAGFh/bV8JQyCNPolF41+34/c291cDx+RtW7VPIaUcF1cTL7OL8mVuVXxE4KMAF
# RRPgmnmIvGar27vrAlUjtz0jeEFtrvjxAFqUmYoczAmV0JocRDCppRbHukdb9Ss0
# i5+PWDfDThyvIsoQzdiCEKk18K4iyI8kpoGL3ycc5GYdiT4u/1cDTcFug6Ay67Sz
# L1BWXQaxFYzIHWO3cwzj1nomDyqWRacygz6WPldJdyOJ/rEQx4rlCBVRxStaMVs5
# apaopIhrlihv8cSu6r1FF8xiToG1VBpHjpilbcBuJ8b4Jx/I7SCpC7HxzgualOJq
# nWmDoTbXbSD+hdX/w7iXNgn+PRTBmBSpwIbM74LBq1UkQxi1SIV4htD50p0/GdkU
# ieeNn2gkiGg7qceATibnCCFMY/2ckxVNM7VWYE/XSrk4jv8u3bFfpENryXjPsbtr
# j4Nsh3Kq6qX7n90a1jn8ZMltPgjlfIOxrbyjunvPllakeljLEkdi0iHv/DzEMQv3
# Lz5kpTdvYFA/t0SQT6ALi75+WPbHZ4dh256YxMiMy29H4cAulO2x9rAwbexqSajp
# lnbIvQjE/jv1rnM3BrJWzxnUu/WUyocc8oBqAU+2G4Fzs9NbIj86WBjfiO5nxEmn
# L9wliz1e0Ow0RJEdvJEMdoI+78TYLaEEAo5I+e/dAs8DojCCBgcwggPvoAMCAQIC
# CmEWaDQAAAAAABwwDQYJKoZIhvcNAQEFBQAwXzETMBEGCgmSJomT8ixkARkWA2Nv
# bTEZMBcGCgmSJomT8ixkARkWCW1pY3Jvc29mdDEtMCsGA1UEAxMkTWljcm9zb2Z0
# IFJvb3QgQ2VydGlmaWNhdGUgQXV0aG9yaXR5MB4XDTA3MDQwMzEyNTMwOVoXDTIx
# MDQwMzEzMDMwOVowdzELMAkGA1UEBhMCVVMxEzARBgNVBAgTCldhc2hpbmd0b24x
# EDAOBgNVBAcTB1JlZG1vbmQxHjAcBgNVBAoTFU1pY3Jvc29mdCBDb3Jwb3JhdGlv
# bjEhMB8GA1UEAxMYTWljcm9zb2Z0IFRpbWUtU3RhbXAgUENBMIIBIjANBgkqhkiG
# 9w0BAQEFAAOCAQ8AMIIBCgKCAQEAn6Fssd/bSJIqfGsuGeG94uPFmVEjUK3O3RhO
# JA/u0afRTK10MCAR6wfVVJUVSZQbQpKumFwwJtoAa+h7veyJBw/3DgSY8InMH8sz
# JIed8vRnHCz8e+eIHernTqOhwSNTyo36Rc8J0F6v0LBCBKL5pmyTZ9co3EZTsIbQ
# 5ShGLieshk9VUgzkAyz7apCQMG6H81kwnfp+1pez6CGXfvjSE/MIt1NtUrRFkJ9I
# AEpHZhEnKWaol+TTBoFKovmEpxFHFAmCn4TtVXj+AZodUAiFABAwRu233iNGu8Qt
# VJ+vHnhBMXfMm987g5OhYQK1HQ2x/PebsgHOIktU//kFw8IgCwIDAQABo4IBqzCC
# AacwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUIzT42VJGcArtQPt2+7MrsMM1
# sw8wCwYDVR0PBAQDAgGGMBAGCSsGAQQBgjcVAQQDAgEAMIGYBgNVHSMEgZAwgY2A
# FA6sgmBAVieX5SUT/CrhClOVWeSkoWOkYTBfMRMwEQYKCZImiZPyLGQBGRYDY29t
# MRkwFwYKCZImiZPyLGQBGRYJbWljcm9zb2Z0MS0wKwYDVQQDEyRNaWNyb3NvZnQg
# Um9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHmCEHmtFqFKoKWtTHNY9AcTLmUwUAYD
# VR0fBEkwRzBFoEOgQYY/aHR0cDovL2NybC5taWNyb3NvZnQuY29tL3BraS9jcmwv
# cHJvZHVjdHMvbWljcm9zb2Z0cm9vdGNlcnQuY3JsMFQGCCsGAQUFBwEBBEgwRjBE
# BggrBgEFBQcwAoY4aHR0cDovL3d3dy5taWNyb3NvZnQuY29tL3BraS9jZXJ0cy9N
# aWNyb3NvZnRSb290Q2VydC5jcnQwEwYDVR0lBAwwCgYIKwYBBQUHAwgwDQYJKoZI
# hvcNAQEFBQADggIBABCXisNcA0Q23em0rXfbznlRTQGxLnRxW20ME6vOvnuPuC7U
# EqKMbWK4VwLLTiATUJndekDiV7uvWJoc4R0Bhqy7ePKL0Ow7Ae7ivo8KBciNSOLw
# UxXdT6uS5OeNatWAweaU8gYvhQPpkSokInD79vzkeJkuDfcH4nC8GE6djmsKcpW4
# oTmcZy3FUQ7qYlw/FpiLID/iBxoy+cwxSnYxPStyC8jqcD3/hQoT38IKYY7w17gX
# 606Lf8U1K16jv+u8fQtCe9RTciHuMMq7eGVcWwEXChQO0toUmPU8uWZYsy0v5/mF
# hsxRVuidcJRsrDlM1PZ5v6oYemIp76KbKTQGdxpiyT0ebR+C8AvHLLvPQ7Pl+ex9
# teOkqHQ1uE7FcSMSJnYLPFKMcVpGQxS8s7OwTWfIn0L/gHkhgJ4VMGboQhJeGsie
# IiHQQ+kr6bv0SMws1NgygEwmKkgkX1rqVu+m3pmdyjpvvYEndAYR7nYhv5uCwSdU
# trFqPYmhdmG0bqETpr+qR/ASb/2KMmyy/t9RyIwjyWa9nR2HEmQCPS2vWY+45CHl
# tbDKY7R4VAXUQS5QrJSwpXirs6CWdRrZkocTdSIvMqgIbqBbjCW/oO+EyiHW6x5P
# yZruSeD3AWVviQt9yGnI5m7qp5fOMSn/DsVbXNhNG6HY+i+ePy5VFmvJE6P9MIIH
# ejCCBWKgAwIBAgIKYQ6Q0gAAAAAAAzANBgkqhkiG9w0BAQsFADCBiDELMAkGA1UE
# BhMCVVMxEzARBgNVBAgTCldhc2hpbmd0b24xEDAOBgNVBAcTB1JlZG1vbmQxHjAc
# BgNVBAoTFU1pY3Jvc29mdCBDb3Jwb3JhdGlvbjEyMDAGA1UEAxMpTWljcm9zb2Z0
# IFJvb3QgQ2VydGlmaWNhdGUgQXV0aG9yaXR5IDIwMTEwHhcNMTEwNzA4MjA1OTA5
# WhcNMjYwNzA4MjEwOTA5WjB+MQswCQYDVQQGEwJVUzETMBEGA1UECBMKV2FzaGlu
# Z3RvbjEQMA4GA1UEBxMHUmVkbW9uZDEeMBwGA1UEChMVTWljcm9zb2Z0IENvcnBv
# cmF0aW9uMSgwJgYDVQQDEx9NaWNyb3NvZnQgQ29kZSBTaWduaW5nIFBDQSAyMDEx
# MIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEAq/D6chAcLq3YbqqCEE00
# uvK2WCGfQhsqa+laUKq4BjgaBEm6f8MMHt03a8YS2AvwOMKZBrDIOdUBFDFC04kN
# eWSHfpRgJGyvnkmc6Whe0t+bU7IKLMOv2akrrnoJr9eWWcpgGgXpZnboMlImEi/n
# qwhQz7NEt13YxC4Ddato88tt8zpcoRb0RrrgOGSsbmQ1eKagYw8t00CT+OPeBw3V
# XHmlSSnnDb6gE3e+lD3v++MrWhAfTVYoonpy4BI6t0le2O3tQ5GD2Xuye4Yb2T6x
# jF3oiU+EGvKhL1nkkDstrjNYxbc+/jLTswM9sbKvkjh+0p2ALPVOVpEhNSXDOW5k
# f1O6nA+tGSOEy/S6A4aN91/w0FK/jJSHvMAhdCVfGCi2zCcoOCWYOUo2z3yxkq4c
# I6epZuxhH2rhKEmdX4jiJV3TIUs+UsS1Vz8kA/DRelsv1SPjcF0PUUZ3s/gA4bys
# AoJf28AVs70b1FVL5zmhD+kjSbwYuER8ReTBw3J64HLnJN+/RpnF78IcV9uDjexN
# STCnq47f7Fufr/zdsGbiwZeBe+3W7UvnSSmnEyimp31ngOaKYnhfsi+E11ecXL93
# KCjx7W3DKI8sj0A3T8HhhUSJxAlMxdSlQy90lfdu+HggWCwTXWCVmj5PM4TasIgX
# 3p5O9JawvEagbJjS4NaIjAsCAwEAAaOCAe0wggHpMBAGCSsGAQQBgjcVAQQDAgEA
# MB0GA1UdDgQWBBRIbmTlUAXTgqoXNzcitW2oynUClTAZBgkrBgEEAYI3FAIEDB4K
# AFMAdQBiAEMAQTALBgNVHQ8EBAMCAYYwDwYDVR0TAQH/BAUwAwEB/zAfBgNVHSME
# GDAWgBRyLToCMZBDuRQFTuHqp8cx0SOJNDBaBgNVHR8EUzBRME+gTaBLhklodHRw
# Oi8vY3JsLm1pY3Jvc29mdC5jb20vcGtpL2NybC9wcm9kdWN0cy9NaWNSb29DZXJB
# dXQyMDExXzIwMTFfMDNfMjIuY3JsMF4GCCsGAQUFBwEBBFIwUDBOBggrBgEFBQcw
# AoZCaHR0cDovL3d3dy5taWNyb3NvZnQuY29tL3BraS9jZXJ0cy9NaWNSb29DZXJB
# dXQyMDExXzIwMTFfMDNfMjIuY3J0MIGfBgNVHSAEgZcwgZQwgZEGCSsGAQQBgjcu
# AzCBgzA/BggrBgEFBQcCARYzaHR0cDovL3d3dy5taWNyb3NvZnQuY29tL3BraW9w
# cy9kb2NzL3ByaW1hcnljcHMuaHRtMEAGCCsGAQUFBwICMDQeMiAdAEwAZQBnAGEA
# bABfAHAAbwBsAGkAYwB5AF8AcwB0AGEAdABlAG0AZQBuAHQALiAdMA0GCSqGSIb3
# DQEBCwUAA4ICAQBn8oalmOBUeRou09h0ZyKbC5YR4WOSmUKWfdJ5DJDBZV8uLD74
# w3LRbYP+vj/oCso7v0epo/Np22O/IjWll11lhJB9i0ZQVdgMknzSGksc8zxCi1LQ
# sP1r4z4HLimb5j0bpdS1HXeUOeLpZMlEPXh6I/MTfaaQdION9MsmAkYqwooQu6Sp
# BQyb7Wj6aC6VoCo/KmtYSWMfCWluWpiW5IP0wI/zRive/DvQvTXvbiWu5a8n7dDd
# 8w6vmSiXmE0OPQvyCInWH8MyGOLwxS3OW560STkKxgrCxq2u5bLZ2xWIUUVYODJx
# Jxp/sfQn+N4sOiBpmLJZiWhub6e3dMNABQamASooPoI/E01mC8CzTfXhj38cbxV9
# Rad25UAqZaPDXVJihsMdYzaXht/a8/jyFqGaJ+HNpZfQ7l1jQeNbB5yHPgZ3BtEG
# sXUfFL5hYbXw3MYbBL7fQccOKO7eZS/sl/ahXJbYANahRr1Z85elCUtIEJmAH9AA
# KcWxm6U/RXceNcbSoqKfenoi+kiVH6v7RyOA9Z74v2u3S5fi63V4GuzqN5l5GEv/
# 1rMjaHXmr/r8i+sLgOppO6/8MO0ETI7f33VtY5E90Z1WTk+/gFcioXgRMiF670EK
# sT/7qMykXcGhiJtXcVZOSEXAQsmbdlsKgEhr/Xmfwb1tbWrJUnMTDXpQzTGCBI4w
# ggSKAgEBMIGVMH4xCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpXYXNoaW5ndG9uMRAw
# DgYDVQQHEwdSZWRtb25kMR4wHAYDVQQKExVNaWNyb3NvZnQgQ29ycG9yYXRpb24x
# KDAmBgNVBAMTH01pY3Jvc29mdCBDb2RlIFNpZ25pbmcgUENBIDIwMTECEzMAAADE
# 6Yn4eoFQ6f8AAAAAAMQwCQYFKw4DAhoFAKCBojAZBgkqhkiG9w0BCQMxDAYKKwYB
# BAGCNwIBBDAcBgorBgEEAYI3AgELMQ4wDAYKKwYBBAGCNwIBFTAjBgkqhkiG9w0B
# CQQxFgQUofTL2n/LL0obb5jwwKX7Knh9KDAwQgYKKwYBBAGCNwIBDDE0MDKgFIAS
# AE0AaQBjAHIAbwBzAG8AZgB0oRqAGGh0dHA6Ly93d3cubWljcm9zb2Z0LmNvbTAN
# BgkqhkiG9w0BAQEFAASCAQB0ebiDWcFkfJZ9qEG10SEkvbQesN7epQHbgdqkTPkD
# LlfCRBNInoOLMCqYyf7+q7XagX6hEDG5vKS4/FFkvVBrsYMNC++Vj+oNDSbUcI3a
# GckO6z9cXXYoYNZ0ib3/8MSdvgeLHX5iF3LI3Gt2XpDcaVVkov3O4POLDxqn9sVy
# Ke7ZQOAmx9ECku++i6yw9H5N1GpWUY5x970tkvw6JJsSsZI9RlGjQZg6AiE9iuoF
# A3VIr+w13qmQ2WiFhaglaVkCmwoeN8lY01SRPBuESoND3qpV8yvhho9oePfYZvAN
# 97FpdGoagZ4Bo3z7EFMkjypbvPxl2zzMhDiYkHno0wc3oYICKDCCAiQGCSqGSIb3
# DQEJBjGCAhUwggIRAgEBMIGOMHcxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpXYXNo
# aW5ndG9uMRAwDgYDVQQHEwdSZWRtb25kMR4wHAYDVQQKExVNaWNyb3NvZnQgQ29y
# cG9yYXRpb24xITAfBgNVBAMTGE1pY3Jvc29mdCBUaW1lLVN0YW1wIFBDQQITMwAA
# AMZ4gDYBdRppcgAAAAAAxjAJBgUrDgMCGgUAoF0wGAYJKoZIhvcNAQkDMQsGCSqG
# SIb3DQEHATAcBgkqhkiG9w0BCQUxDxcNMTgwNzA1MTAzMjA3WjAjBgkqhkiG9w0B
# CQQxFgQUufUa2WjHht8V9kPTOcVnPbe/CbkwDQYJKoZIhvcNAQEFBQAEggEAiFKV
# bIrZXLjpbVIrDdnZX/AY5fO4qlI2WSmevnEYzJxTusp1YkuyGD0DJ/uRuRNnHGaa
# YH1eezWapW9HL6fF3T1SCWcXEa5zeKjjPII6ejGmq+SU45h7ATpmXy7TsN7N2D4W
# E71UQ3ucXPQ+BsM0if1n1KMVd7bc6edJqS9wVA2GFHRoCA2b2B2JGDWoi/pSTqET
# zRy1pfjfMneZKe7C59djqXiP/SuycaGnbzHR7A153Vo6XT8AYrNmRGF2UV3x1Dqq
# ZDaJJYrcxtWJw9hnXLw9XhD3tKyNvBVYtoyeutD9CWu9/A2eIqK3RCipT3yia+Sn
# LQy1TA3VL9ZlZgKgtA==
# SIG # End signature block
| 65 | 125 | 0.933333 |
852f2bc3304e289998c0de756f7de5e4b61f991e | 255 | cs | C# | Exam11Nov2016/Exam/SchoolSystem.Framework/IStudentFactory.cs | pavelhristov/CSharpDesignPatterns | d51c51a9b31e08edcc73d2e2b4eca1bae8c270c1 | [
"MIT"
] | null | null | null | Exam11Nov2016/Exam/SchoolSystem.Framework/IStudentFactory.cs | pavelhristov/CSharpDesignPatterns | d51c51a9b31e08edcc73d2e2b4eca1bae8c270c1 | [
"MIT"
] | null | null | null | Exam11Nov2016/Exam/SchoolSystem.Framework/IStudentFactory.cs | pavelhristov/CSharpDesignPatterns | d51c51a9b31e08edcc73d2e2b4eca1bae8c270c1 | [
"MIT"
] | null | null | null | using SchoolSystem.Framework.Models.Contracts;
using SchoolSystem.Framework.Models.Enums;
namespace SchoolSystem.Framework
{
public interface IStudentFactory
{
IStudent GetStudent(string firstName, string lastName, Grade grade);
}
}
| 23.181818 | 76 | 0.764706 |
94030aca11aa1b8021fdbdeab4bd6e47eb1019a9 | 5,790 | sql | SQL | test/seed.sql | swashcap/habari2jekyll | d473c57b360345561b92d036ae2b2e978bc26a75 | [
"MIT"
] | null | null | null | test/seed.sql | swashcap/habari2jekyll | d473c57b360345561b92d036ae2b2e978bc26a75 | [
"MIT"
] | null | null | null | test/seed.sql | swashcap/habari2jekyll | d473c57b360345561b92d036ae2b2e978bc26a75 | [
"MIT"
] | null | null | null | --
-- Name: habari__poststatus_pkey_seq; Type: SEQUENCE; Schema: public; Owner: habari
--
CREATE SEQUENCE habari__poststatus_pkey_seq
START WITH 1
INCREMENT BY 1
NO MINVALUE
NO MAXVALUE
CACHE 1;
ALTER TABLE habari__poststatus_pkey_seq OWNER TO habari;
--
-- Name: habari__poststatus; Type: TABLE; Schema: public; Owner: habari; Tablespace:
--
CREATE TABLE habari__poststatus (
id integer DEFAULT nextval('habari__poststatus_pkey_seq'::regclass) NOT NULL,
name character varying(255) NOT NULL,
internal smallint
);
ALTER TABLE habari__poststatus OWNER TO habari;
--
-- Name: habari__posttype_pkey_seq; Type: SEQUENCE; Schema: public; Owner: habari
--
CREATE SEQUENCE habari__posttype_pkey_seq
START WITH 1
INCREMENT BY 1
NO MINVALUE
NO MAXVALUE
CACHE 1;
ALTER TABLE habari__posttype_pkey_seq OWNER TO habari;
--
-- Name: habari__posttype; Type: TABLE; Schema: public; Owner: habari; Tablespace:
--
CREATE TABLE habari__posttype (
id integer DEFAULT nextval('habari__posttype_pkey_seq'::regclass) NOT NULL,
name character varying(255) NOT NULL,
active smallint DEFAULT 1
);
ALTER TABLE habari__posttype OWNER TO habari;
--
-- Name: habari__posts_pkey_seq; Type: SEQUENCE; Schema: public; Owner: habari
--
CREATE SEQUENCE habari__posts_pkey_seq
START WITH 1
INCREMENT BY 1
NO MINVALUE
NO MAXVALUE
CACHE 1;
ALTER TABLE habari__posts_pkey_seq OWNER TO habari;
--
-- Name: habari__posts; Type: TABLE; Schema: public; Owner: habari; Tablespace:
--
CREATE TABLE habari__posts (
id bigint DEFAULT nextval('habari__posts_pkey_seq'::regclass) NOT NULL,
slug character varying(255) NOT NULL,
content_type integer NOT NULL,
title character varying(255) NOT NULL,
guid character varying(255) NOT NULL,
content text NOT NULL,
cached_content text NOT NULL,
user_id integer NOT NULL,
status integer NOT NULL,
pubdate integer NOT NULL,
updated integer NOT NULL,
modified integer NOT NULL
);
--
-- Data for Name: habari__poststatus; Type: TABLE DATA; Schema: public; Owner: habari
--
COPY habari__poststatus (id, name, internal) FROM stdin;
1 draft 0
2 published 0
3 scheduled 1
4 deleted 1
\.
--
-- Name: habari__poststatus_pkey_seq; Type: SEQUENCE SET; Schema: public; Owner: habari
--
SELECT pg_catalog.setval('habari__poststatus_pkey_seq', 4, true);
--
-- Data for Name: habari__posttype; Type: TABLE DATA; Schema: public; Owner: habari
--
COPY habari__posttype (id, name, active) FROM stdin;
1 entry 1
2 page 1
\.
--
-- Name: habari__posttype_pkey_seq; Type: SEQUENCE SET; Schema: public; Owner: habari
--
SELECT pg_catalog.setval('habari__posttype_pkey_seq', 2, true);
--
-- Data for Name: habari__posts; Type: TABLE DATA; Schema: public; Owner: habari
--
COPY habari__posts (id, slug, content_type, title, guid, content, cached_content, user_id, status, pubdate, updated, modified) FROM stdin;
5 coming-soon 2 Coming soon... tag:portal.mind.unm.edu,2011:coming-soon/1294882026 MICIS manual: a step by step guide to navigating MICIS and all of the NI tools. \n 2 2 1294882048 1294882048 1433276791
2 new-ursi-project-description 1 Overview of NI tools now available tag:portal.mind.unm.edu,2010:new-ursi-project-description/1292953221 2 1 1292953221 1292953221 1433276795
3 new-ursi-project-description-1 1 New URSI Project Description tag:portal.mind.unm.edu,2010:new-ursi-project-description-1/1292955279 Click the following link to view the description of the New URSI Project. <a href="http://portal.mind.unm.edu/habari/user/files/NewURSIProjectDescription.pdf">NewURSIProjectDescription.pdf</a> 2 2 1292955823 1292955823 1331252184
8 calculated-fields 1 Calculated Fields tag:portal.mind.unm.edu,2011:calculated-fields/1299694727 Click the following link to access instructions for Calculated Fields in Assessment Manager. <a href="http://portal.mind.unm.edu/habari/user/files/Calculated Fields.pdf">Calculated Fields.pdf</a> 2 1 1299694785 1299694785 1331252195
4 overview-of-ni-tools-now-available 1 Overview of NI tools now available tag:portal.mind.unm.edu,2011:overview-of-ni-tools-now-available/1294248818 Click the following link to open an overview of the NI tools. <a href="http://portal.mind.unm.edu/habari/user/files/MRN NI Core.pdf">MRN NI Core.pdf</a> 2 1 1294249624 1294249624 1331252265
30 march-15th-2012-coins-weekly-tips-and-updates 1 March 15th, 2012 COINS' Weekly Tips and Updates tag:portal.mrn.org,2012:march-15th-2012-coins-weekly-tips-and-updates/1340659535 Updates\n\nNI Updates Page\n\nYou may have noticed a change in the format of the Updates for Neuroinformatics located on the homepages in COINS. Under Navigation there are different pages that you can click on to access overview and training documents. We are working on creating more training materials for our users, including video tutorials.\n\nAssessment Manager\n\nIf you have a study visit that you are no longer entering data for, you can now hide it from the data entry cover sheets, this will eliminate the possibility of an operator entering data for a visit in error. To hide a study visit, go to the study details page in MICIS and click on the Study Visits button at the top of the page. You will be directed to a page that lists all of the study visits, select Edit next to the visit that you would like to hide. You will then check the box next to Hidden? and click Continue.\n\nHelpful Tips\n\nGo to Studies below and select How to create subject types.pdf to view a training guide on creating subject types for your study. 2 2 1340659535 1340659535 1340659715
\.
--
-- Name: habari__posts_pkey_seq; Type: SEQUENCE SET; Schema: public; Owner: habari
--
SELECT pg_catalog.setval('habari__posts_pkey_seq', 137, true);
| 40.48951 | 1,260 | 0.766839 |
d235f9857edcff0e28ed9c4960949415f0d55e34 | 862 | rs | Rust | peripherals/src/spu.rs | Zwo1in/peach-8 | 80f0937bc7eed3228ef8c0fef5618a6da02e5640 | [
"MIT"
] | null | null | null | peripherals/src/spu.rs | Zwo1in/peach-8 | 80f0937bc7eed3228ef8c0fef5618a6da02e5640 | [
"MIT"
] | null | null | null | peripherals/src/spu.rs | Zwo1in/peach-8 | 80f0937bc7eed3228ef8c0fef5618a6da02e5640 | [
"MIT"
] | null | null | null | use stm32f3xx_hal as stm32f303;
use stm32f303::{
gpio::{gpiob, AF2},
hal::PwmPin,
pwm::{self, PwmChannel, WithPins, TIM3_CH2},
rcc,
stm32::TIM3,
time::Hertz,
};
#[allow(unused_imports)]
use log::{debug, error, info, trace, warn};
pub fn init_tim3_pwm_on_pb5(
freq: Hertz,
tim3: TIM3,
pb5: gpiob::PB5<AF2>,
clocks: rcc::Clocks,
) -> PwmChannel<TIM3_CH2, WithPins> {
info!("configuring timer3 in pwm mode");
let resolution = core::u16::MAX;
debug!("resolution: {}, frequency: {}hz", resolution, freq.0);
debug!("using channels: 1");
let (_, tim3_ch2, ..) = pwm::tim3(tim3, resolution, freq, &clocks);
let mut tim3_ch2 = tim3_ch2.output_to_pb5(pb5);
let tim3_duty = tim3_ch2.get_max_duty() / 2;
debug!("setting timer3 duty: {}", tim3_duty);
tim3_ch2.set_duty(tim3_duty);
tim3_ch2
}
| 26.9375 | 71 | 0.638051 |
34ecac1750b973da9e128f7688ecbc2e53e78c2c | 115 | cs | C# | Oblqo/Core Classes/ActionIfFileExists.cs | fiftin/Oblqo | b7771d5295e4cbb0a2cafbe95e46500755a6ab66 | [
"Apache-2.0"
] | 6 | 2015-09-26T08:44:15.000Z | 2018-06-06T23:10:55.000Z | Oblqo/Core Classes/ActionIfFileExists.cs | fiftin/Oblqo | b7771d5295e4cbb0a2cafbe95e46500755a6ab66 | [
"Apache-2.0"
] | 22 | 2015-09-27T08:10:15.000Z | 2016-08-24T08:42:07.000Z | Oblqo/Core Classes/ActionIfFileExists.cs | fiftin/Oblqo | b7771d5295e4cbb0a2cafbe95e46500755a6ab66 | [
"Apache-2.0"
] | 1 | 2016-08-24T08:43:03.000Z | 2016-08-24T08:43:03.000Z | namespace Oblqo
{
public enum ActionIfFileExists
{
Rewrite,
Skip,
Rename,
}
}
| 11.5 | 34 | 0.513043 |
bb625dd51310dde3832e97e7cf600b112d6f6cd8 | 438 | lua | Lua | samples/demo_argparse.lua | gberger/malu | 36fc6c6bf6db2cd18fb39397262038cf4f14a1f3 | [
"MIT"
] | 1 | 2016-12-13T15:53:53.000Z | 2016-12-13T15:53:53.000Z | samples/demo_argparse.lua | gberger/malu | 36fc6c6bf6db2cd18fb39397262038cf4f14a1f3 | [
"MIT"
] | null | null | null | samples/demo_argparse.lua | gberger/malu | 36fc6c6bf6db2cd18fb39397262038cf4f14a1f3 | [
"MIT"
] | null | null | null | @dofile "samples/def_defmacro.lua"
@defmacro demo_argparse do
print('Parsing args...')
local args = macros.argparse(next_char)
print('Printing args:')
for i, arg in ipairs(args) do
print(i, macros.stringify_tokens(arg))
end
print()
end
@demo_argparse(
abc.xyz,
t[fn(1==2)],
(function () return 5 end)(),
function (a, b) local c,d = a,b end
)
@demo_argparse "str"
@demo_argparse {a=1, b=2}
| 16.222222 | 45 | 0.630137 |
38656a3c4dfe7131b06c71180a29a3b9ea79065b | 264 | php | PHP | application/config/config_extensions.php | zulifaidah/Php-MongoDB | f7eae25b355995cb83549275cf4561f6ce3d7aa1 | [
"MIT"
] | 2 | 2018-11-20T06:09:16.000Z | 2019-11-20T04:31:38.000Z | application/config/config_extensions.php | sitizuliatulf/Php-MongoDB | f7eae25b355995cb83549275cf4561f6ce3d7aa1 | [
"MIT"
] | 1 | 2018-01-07T15:00:22.000Z | 2018-01-11T14:58:51.000Z | application/config/config_extensions.php | zulifaidah/Php-MongoDB | f7eae25b355995cb83549275cf4561f6ce3d7aa1 | [
"MIT"
] | null | null | null | <?php
if (!defined('BASEPATH')) exit('No direct script access allowed');
$config['css'] = [
'./css/bootstrap/bootstrap.min.css',
'./css/custom/global.css'
];
$config['js'] = [
'./js/jquery/jquery.min.js',
'./js/bootstrap/bootstrap.min.js'
];
?> | 18.857143 | 66 | 0.594697 |
bb2cdfc24eb9cd073bf68484bd0870ebfe18ef50 | 1,135 | rs | Rust | opensubdiv/src/far/stencil_table_factory.rs | anderslanglands/opensubdiv-rs | 46f19f56db1c35ab9f768e16ece8c40310bf13cd | [
"Apache-2.0"
] | 5 | 2019-07-28T11:35:57.000Z | 2021-04-10T16:14:49.000Z | opensubdiv/src/far/stencil_table_factory.rs | anderslanglands/opensubdiv-rs | 46f19f56db1c35ab9f768e16ece8c40310bf13cd | [
"Apache-2.0"
] | 2 | 2020-05-08T20:45:24.000Z | 2021-04-03T21:55:52.000Z | opensubdiv/src/far/stencil_table_factory.rs | anderslanglands/opensubdiv-rs | 46f19f56db1c35ab9f768e16ece8c40310bf13cd | [
"Apache-2.0"
] | 1 | 2021-04-03T20:02:57.000Z | 2021-04-03T20:02:57.000Z | use super::stencil_table::StencilTable;
use super::topology_refiner::TopologyRefiner;
use opensubdiv_sys as sys;
pub use sys::far::stencil_table_factory::{Options, OptionsBuilder};
/// Short function for creating an [OptionsBuilder]
pub fn options() -> OptionsBuilder {
OptionsBuilder::new()
}
/// Instantiates a [StencilTable] from a [TopologyRefiner] that has been
/// refined uniformly or adaptively.
///
/// The factory only creates stencils for vertices that have already been
/// refined in the TopologyRefiner. Use [TopologyRefiner::refine_uniform()] or
/// [TopologyRefiner::refine_adaptive()] before constructing the stencils.
///
/// ## Parameters
/// * `refiner` - The [TopologyRefiner] containing the topology.
/// * `options` - [Options] controlling the creation of the table.
///
pub fn create(
refiner: &TopologyRefiner,
options: sys::far::stencil_table_factory::Options,
) -> StencilTable {
let ptr =
unsafe { sys::far::StencilTableFactory_Create(refiner.ptr, options) };
if ptr.is_null() {
panic!("StencilTableFactory_Create() returned null");
}
StencilTable { ptr }
}
| 32.428571 | 78 | 0.7163 |
46535a94a8f632695194876729db1b3633cf8158 | 8,626 | php | PHP | wordpress/wp-content/plugins/creative-mail-by-constant-contact/src/modules/contacts/Services/ContactsSyncService.php | triettm40/wordpress | e9e08265e67492b174dc02e657f81e2d568f8376 | [
"Apache-2.0"
] | 1 | 2021-05-25T14:23:01.000Z | 2021-05-25T14:23:01.000Z | wp-content/plugins/creative-mail-by-constant-contact/src/Modules/Contacts/Services/ContactsSyncService.php | fakhar-ali/mysocceracademy.com | b9e0c2f9cc45546274747d6200640315d467099a | [
"Unlicense"
] | null | null | null | wp-content/plugins/creative-mail-by-constant-contact/src/Modules/Contacts/Services/ContactsSyncService.php | fakhar-ali/mysocceracademy.com | b9e0c2f9cc45546274747d6200640315d467099a | [
"Unlicense"
] | null | null | null | <?php
namespace CreativeMail\Modules\Contacts\Services;
use CreativeMail\CreativeMail;
use CreativeMail\Helpers\EnvironmentHelper;
use CreativeMail\Helpers\OptionsHelper;
use CreativeMail\Helpers\ValidationHelper;
use CreativeMail\Managers\RaygunManager;
use CreativeMail\Modules\Api\Models\ApiRequestItem;
use CreativeMail\Modules\Contacts\Models\ContactModel;
use Exception;
use stdClass;
class ContactsSyncService
{
const FAST_LANE_LIMIT = 250;
const CSV_FILE_MAX_MEMORY_SIZE = 1024 * 1024 * 5; // 5MB
private function validate_email_address($emailAddress)
{
if (!isset($emailAddress) && empty($emailAddress)) {
throw new Exception('No valid email address provided');
}
}
private function ensure_event_type($eventType)
{
// DEV: For now, we only support WordPress.
if (isset($eventType) && !empty($eventType)) {
return $eventType;
}
return 'WordPress';
}
private function build_payload($contactModels)
{
$contacts = array();
foreach ($contactModels as $model) {
array_push($contacts, $model->toArray());
}
$data = array(
"contacts" => $contacts
);
return wp_json_encode($data);
}
public function upsertContact(ContactModel $contactModel)
{
if(!isset($contactModel)) {
return false;
}
$this->validate_email_address($contactModel->getEmail());
$contactModel->setEventType($this->ensure_event_type($contactModel->getEventType()));
$jsonData = $this->build_payload(array($contactModel));
$creativ_email = CreativeMail::get_instance();
$creativ_email->get_api_manager()->get_api_background_process()->push_to_queue(
new ApiRequestItem(
'POST',
'application/json',
'/v1.0/contacts',
$jsonData
)
);
// Start the queue.
$creativ_email->get_api_manager()->get_api_background_process()->save()->dispatch();
return true;
}
public function upsertContacts($contactModels)
{
try {
if (ValidationHelper::is_null_or_empty($contactModels)) {
// todo throw exception
}
if (count($contactModels) > self::FAST_LANE_LIMIT) {
$this->fast_lane_contacts_sync(array_slice($contactModels, 0, self::FAST_LANE_LIMIT));
$this->slow_lane_contacts_sync(array_slice($contactModels, self::FAST_LANE_LIMIT, count($contactModels) - self::FAST_LANE_LIMIT));
} else {
$this->fast_lane_contacts_sync($contactModels);
}
} catch (Exception $exception) {
RaygunManager::get_instance()->exception_handler($exception);
}
return true;
}
private function fast_lane_contacts_sync($contactModels)
{
if (ValidationHelper::is_null_or_empty($contactModels)) {
// todo throw exception
}
$url = EnvironmentHelper::get_app_gateway_url('wordpress') . '/v1.0/contacts';
$jsonData = $this->build_payload($contactModels);
$args = [
'headers' => [
'x-api-key' => OptionsHelper::get_instance_api_key(),
'x-account-id' => OptionsHelper::get_connected_account_id(),
'content-type' => 'application/json'
],
'body' => $jsonData
];
wp_remote_post($url, $args);
}
private function slow_lane_contacts_sync($contactModels)
{
if (ValidationHelper::is_null_or_empty($contactModels)) {
// todo throw exception
}
// 1. convert to csv file
$csv_file = $this->create_csv_file($contactModels);
// 2. request sas model (with url and uuid)
$sas_request_model = $this->request_sas_model();
// 3. upload csv file using sas url
$this->upload_csv_file($csv_file, $sas_request_model->url);
// 4. call endpoint to start import (using uuid)
$this->start_import_for_uuid($sas_request_model->uuid);
}
private function create_csv_file($contactModels)
{
if (ValidationHelper::is_null_or_empty($contactModels)) {
// todo throw exception
}
$fd = fopen('php://temp/maxmemory:' . self::CSV_FILE_MAX_MEMORY_SIZE, 'w');
if ($fd === false) {
// todo throw exception
}
foreach($contactModels as $contactModel) {
$contact_fields_array = $this->convert_contact_to_csv_array($contactModel);
if (!ValidationHelper::is_null_or_empty($contact_fields_array)) {
fputcsv($fd, $contact_fields_array);
}
}
rewind($fd);
$csv_content = stream_get_contents($fd);
fclose($fd);
return $csv_content;
}
private function request_sas_model()
{
$url = EnvironmentHelper::get_app_gateway_url('wordpress') . '/v1.0/contacts/request-import-sas-url';
$args = [
'headers' => [
'x-api-key' => OptionsHelper::get_instance_api_key(),
'x-account-id' => OptionsHelper::get_connected_account_id()
]
];
$response = wp_remote_get($url,
$args);
if (is_wp_error($response)) {
// todo throw error
}
if (!$this->is_success_response($response)) {
// todo throw error
}
$json = json_decode($response['body']);
$request_sas_model = new stdClass();
$request_sas_model->url = $json->url;
$request_sas_model->uuid = $json->uuid;
return $request_sas_model;
}
private function upload_csv_file($csv_file, $upload_url)
{
$args = array(
'headers' => array(
'x-ms-blob-type' => 'BlockBlob',
'content-type' => 'text/plain'
),
'body' => $csv_file,
'method' => 'PUT'
);
$response = wp_remote_request($upload_url, $args);
if (is_wp_error($response)) {
// todo throw exception
}
if (!$this->is_success_response($response)) {
// todo throw exception
}
}
private function start_import_for_uuid($uuid)
{
$url = EnvironmentHelper::get_app_gateway_url('wordpress') . '/v1.0/contacts/import';
$data = array (
'uuid' => $uuid
);
$args = [
'headers' => [
'x-api-key' => OptionsHelper::get_instance_api_key(),
'x-account-id' => OptionsHelper::get_connected_account_id(),
'content-type' => 'application/json'
],
'body' => wp_json_encode($data),
'method' => 'POST'
];
$response = wp_remote_post($url,
$args);
if (is_wp_error($response)) {
// todo throw exception
}
if(!$this->is_success_response($response)) {
// todo throw exception
}
}
private function convert_contact_to_csv_array(ContactModel $contactModel)
{
if (ValidationHelper::is_null_or_empty($contactModel)) {
return null;
}
$contact_fields = array(
strval($contactModel->getEmail()),
strval($contactModel->getFirstName()),
strval($contactModel->getLastName()));
$contactAddressModel = $contactModel->getContactAddress();
if (ValidationHelper::is_null_or_empty($contactAddressModel)) {
array_push($contact_fields, '','', '', '', '');
} else {
array_push($contact_fields, strval($contactAddressModel->getAddress()), strval($contactAddressModel->getCity()), strval($contactAddressModel->getPostalCode()),
strval($contactAddressModel->getCountryCode()), strval($contactAddressModel->getState()));
}
array_push($contact_fields, strval($contactModel->getPhone()), strval($contactModel->getBirthday()), strval($contactModel->getCompanyName()), '', // JobTitle
strval($contactModel->getOptIn()), strval($contactModel->getOptOut()), strval($contactModel->getEventType()));
return $contact_fields;
}
private function is_success_response($response)
{
$response_code = wp_remote_retrieve_response_code($response);
return $response_code >= 200 && $response_code <= 299;
}
}
| 30.917563 | 171 | 0.580107 |
2382ea5dde9cd06bd297ecb489c4cc544bd920c3 | 420 | js | JavaScript | app/assets/javascripts/login.js | asuarks/Melody-Forest | 420f640786237a67a8c00805866d766d21a62933 | [
"MIT"
] | null | null | null | app/assets/javascripts/login.js | asuarks/Melody-Forest | 420f640786237a67a8c00805866d766d21a62933 | [
"MIT"
] | 4 | 2020-07-22T17:06:37.000Z | 2022-03-31T01:36:59.000Z | app/assets/javascripts/login.js | asuarks/Melody-Forest | 420f640786237a67a8c00805866d766d21a62933 | [
"MIT"
] | null | null | null | document.addEventListener("turbolinks:load", function() {
$('#signup').click(function() {
$('.greenbox').css('transform', 'translateX(80%)');
$('.signin').addClass('nodisplay');
$('.signup').removeClass('nodisplay');
});
$('#signin').click(function() {
$('.greenbox').css('transform', 'translateX(0%)');
$('.signup').addClass('nodisplay');
$('.signin').removeClass('nodisplay');
});
}) | 28 | 57 | 0.583333 |
8517b43e3d6130a4e53cd3b300a753ae41370ab5 | 1,474 | cs | C# | src/Manga.WebApi/Program.cs | laerteuliam/clean-architecture-manga | 12bc52509ac12263defa66fc5fd74310cd07c7ba | [
"Apache-2.0"
] | 12 | 2018-08-01T19:48:54.000Z | 2021-04-17T14:03:03.000Z | src/Manga.WebApi/Program.cs | laerteuliam/clean-architecture-manga | 12bc52509ac12263defa66fc5fd74310cd07c7ba | [
"Apache-2.0"
] | null | null | null | src/Manga.WebApi/Program.cs | laerteuliam/clean-architecture-manga | 12bc52509ac12263defa66fc5fd74310cd07c7ba | [
"Apache-2.0"
] | 1 | 2019-05-12T16:41:53.000Z | 2019-05-12T16:41:53.000Z | namespace Manga.WebApi
{
using Microsoft.AspNetCore;
using Microsoft.AspNetCore.Hosting;
using Autofac.Extensions.DependencyInjection;
using Microsoft.Extensions.Configuration;
using Serilog;
using Serilog.Events;
using System.IO;
public class Program
{
public static void Main(string[] args)
{
BuildWebHost(args).Run();
}
public static IWebHost BuildWebHost(string[] args)
{
return WebHost.CreateDefaultBuilder(args)
.UseStartup<Startup>()
.ConfigureAppConfiguration((builderContext, config) =>
{
IHostingEnvironment env = builderContext.HostingEnvironment;
config.AddJsonFile("autofac.json");
config.AddEnvironmentVariables();
})
.UseSerilog((hostingContext, loggerConfiguration) =>
{
loggerConfiguration.MinimumLevel.Debug()
.MinimumLevel.Override("Microsoft", LogEventLevel.Information)
.Enrich.FromLogContext()
.WriteTo.RollingFile(Path.Combine(hostingContext.HostingEnvironment.ContentRootPath, "logs/log-{Date}.log"));
})
.ConfigureServices(services => services.AddAutofac())
.Build();
}
}
}
| 36.85 | 137 | 0.546133 |
57e87e789beb2546e426ca578f11256b58107de1 | 3,079 | php | PHP | framework/Kolab_Format/test/Horde/Kolab/Format/Unit/Xml/Type/RecurrenceTest.php | thomasjfox/horde | 690ced2b92d65e915c87591e7cc5a5d45c2917a1 | [
"Adobe-Glyph"
] | 1 | 2021-08-02T02:40:14.000Z | 2021-08-02T02:40:14.000Z | framework/Kolab_Format/test/Horde/Kolab/Format/Unit/Xml/Type/RecurrenceTest.php | mmatuska/horde | 6527ae0495b493b4650bbe6071e230421550b187 | [
"Adobe-Glyph"
] | null | null | null | framework/Kolab_Format/test/Horde/Kolab/Format/Unit/Xml/Type/RecurrenceTest.php | mmatuska/horde | 6527ae0495b493b4650bbe6071e230421550b187 | [
"Adobe-Glyph"
] | null | null | null | <?php
/**
* Test the recurrence handler.
*
* PHP version 5
*
* @category Kolab
* @package Kolab_Format
* @subpackage UnitTests
* @author Gunnar Wrobel <wrobel@pardus.de>
* @license http://www.horde.org/licenses/lgpl21 LGPL
* @link http://www.horde.org/libraries/Horde_Kolab_Format
*/
/**
* Test the recurrence handler.
*
* Copyright 2011-2016 Horde LLC (http://www.horde.org/)
*
* See the enclosed file COPYING for license information (LGPL). If you
* did not receive this file, see http://www.horde.org/licenses/lgpl21.
*
* @category Kolab
* @package Kolab_Format
* @subpackage UnitTests
* @author Gunnar Wrobel <wrobel@pardus.de>
* @license http://www.horde.org/licenses/lgpl21 LGPL
* @link http://www.horde.org/libraries/Horde_Kolab_Format
*/
class Horde_Kolab_Format_Unit_Xml_Type_RecurrenceTest
extends Horde_Kolab_Format_TestCase
{
/**
* @expectedException Horde_Kolab_Format_Exception_MissingValue
*/
public function testEmptyInterval()
{
$attributes = $this->load(
'<?xml version="1.0" encoding="UTF-8"?>
<kolab version="1.0" a="b"><recurrence>TEST</recurrence>c</kolab>'
);
$this->assertEquals(array(), $attributes['recurrence']);
}
/**
* @expectedException Horde_Kolab_Format_Exception_ParseError
*/
public function testIntervalBelowZero()
{
$attributes = $this->load(
'<?xml version="1.0" encoding="UTF-8"?>
<kolab version="1.0" a="b"><recurrence><interval>-1</interval>TEST</recurrence>c</kolab>'
);
$this->assertEquals(array(), $attributes['recurrence']);
}
/**
* @expectedException Horde_Kolab_Format_Exception_ParseError
*/
public function testMissingCycle()
{
$attributes = $this->load(
'<?xml version="1.0" encoding="UTF-8"?>
<kolab version="1.0" a="b"><recurrence><interval>2</interval>TEST</recurrence>c</kolab>'
);
}
/**
* @expectedException Horde_Kolab_Format_Exception_ParseError
*/
public function testMissingWeekday()
{
$attributes = $this->load(
'<?xml version="1.0" encoding="UTF-8"?>
<kolab version="1.0" a="b"><recurrence cycle="weekly"><interval>1</interval>TEST</recurrence>c</kolab>'
);
$this->assertEquals(array(), $attributes['recurrence']);
}
public function testWeekly()
{
$attributes = $this->load(
'<?xml version="1.0" encoding="UTF-8"?>
<kolab version="1.0" a="b"><recurrence cycle="weekly"><interval>1</interval><day>1</day>TEST</recurrence>c</kolab>'
);
$this->assertEquals(
array(
'complete' => '',
'cycle' => 'weekly',
'day' => array(1),
'exclusion' => '',
'interval' => '1',
'type' => ''
),
$attributes['recurrence']
);
}
protected function getTypeClass()
{
return 'Horde_Kolab_Format_Xml_Type_Composite_Recurrence';
}
}
| 29.605769 | 115 | 0.599545 |
5478a47725663e204e708048c45c4ff9d8daec5f | 7,575 | css | CSS | css/index.css | STVGecko/Semaine-dev-web-int-gration-web | cb2eef0e79abcd4cc37130eeb934424db37bac1a | [
"MIT"
] | null | null | null | css/index.css | STVGecko/Semaine-dev-web-int-gration-web | cb2eef0e79abcd4cc37130eeb934424db37bac1a | [
"MIT"
] | null | null | null | css/index.css | STVGecko/Semaine-dev-web-int-gration-web | cb2eef0e79abcd4cc37130eeb934424db37bac1a | [
"MIT"
] | 1 | 2020-11-18T17:44:45.000Z | 2020-11-18T17:44:45.000Z | @import url('https://fonts.googleapis.com/css2?family=Mukta+Mahee:wght@400;500;600;700;800&display=swap');
@import url('https://fonts.googleapis.com/css2?family=Noto+Sans:wght@400;700&display=swap');
html{
background-color: #2C2C2C;
}
.wrap_page {
margin-bottom: 240px;
}
a {
text-decoration : none;
}
.main_image{
position: relative;
}
.home_picture img{
width : 100%;
max-height: 700px;
}
.home_picture h1{
position : absolute;
margin-top: 16%;
margin-left: 32.5%;
margin-right: 50%;
text-align: center;
line-height: 88px;
font-family: 'Noto Sans',sans-serif;
font-size:80px;
font-weight: 700;
color:#FFFFFF;
}
.home_picture .absolute img {
margin-top : -9%;
margin-left: 47.5%;
width : 5%;
}
#text_know-how {
margin-top : 42px;
}
.paragraph1 {
margin-top : 78px;
margin-right : auto;
margin-left : auto;
width : 590px;
}
.paragraph1 p{
font-family: 'Mukta Mahee', sans-serif;
font-style: normal;
font-weight: 400;
font-size: 18px;
text-align: center;
color: #FFFFFF;
line-height : 30px;
}
.paragraph2 p{
font-family: 'Mukta Mahee', sans-serif;
font-style: normal;
font-weight: 400;
font-size: 18px;
text-align: center;
color: #FFFFFF;
line-height : 30px;
}
.section_index{
display: flex;
justify-content: center;
margin-top : 42px;
}
.section_index:not(:last-child){
margin-bottom: 110px;
}
.section_index a:not(:first-child){
margin-left: 32px;
}
.logo_know-how{
margin-top: 48px;
}
.logo_know-how h3 {
text-align: center;
font-family: 'Noto Sans', sans-serif;
font-style: normal;
font-weight: 500;
font-size: 26px;
color: #FFFFFF;
}
.border1 {
display : block;
margin-left : auto;
margin-right : auto;
border : 5px #C00A23 solid;
width : 265px;
height : 66px;
transition: 0.2s;
}
.border1:hover{
border: 5px white solid;
color: white;
}
.border2 {
display : block;
border : 5px #C00A23 solid;
width : 163px;
height : 58px;
transition: 0.2s;
}
.border2:hover{
border: 5px white solid;
color: white;
}
h2.h2_index {
text-align: center;
font-family: 'Noto Sans', sans-serif;
font-style: normal;
font-weight: 100;
font-size: 24px;
color: #C00A23;
margin-top : 21px;
white-space: nowrap;
}
h2.about {
text-align: center;
font-family: 'Noto Sans', sans-serif;
font-style: normal;
font-weight: 100;
font-size: 24px;
color: #C00A23;
margin-top : 14px;
white-space: nowrap;
}
.picture1 img {
margin : 64px -60px;
}
.picture2 img {
margin : 80px -50px;
}
.picture3 img {
margin : 78px -60px;
}
.picture4 img {
margin : 62px -80px;
}
.picture5 img {
margin : 65px -65px;
}
.picture6 img {
margin : 70px -65px;
}
.logo_savoir-faire img {
position : absolute;
}
.icon_name{
text-align: center;
font-family: 'Noto Sans', sans-serif;
font-style: normal;
font-weight:500;
font-size: 26px;
color: white;
position : absolute;
margin-top : 239px;
width : inherit;
}
.icon{
display : flex;
justify-content: center;
width: 410px;
height: 310px;
background-color: #C00A23;
transition: 0.2s;
}
.icon:hover{
box-shadow: 0 15px 35px rgba(0,0,0,0.3);
border: 2px solid white;
}
.about_index {
margin-top : 360px;
display : inline-block;
}
.about_index_image {
display : inline-block;
margin-left : 168px;
}
.about_index_image .absolute img {
margin : -524px -40px;
}
.about_index_text {
display : inline-block;
margin : 0 150px;
}
.about_index_text h2 {
letter-spacing: -0.4px;
}
.about_index_text p {
display : inline-block;
text-align: left;
line-height: 34px;
}
.arrow_about{
margin-left: 10px;
margin-bottom: -2px;
}
.absolute img {
position : absolute;
}
.paragraph2 {
margin : 25px 0;
width : 450px;
}
.more {
text-align : center;
font-family: 'Mukta Mahee', sans-serif;
font-style: normal;
font-weight: 500;
font-size: 18px;
color: #FFFFFF;
margin : 0.5% 0%;
}
.contact {
margin-top: 265px;
}
.contact p {
text-align : center;
font-family: 'Mukta Mahee', sans-serif;
font-style: normal;
font-weight: normal;
font-size: 24px;
color: #FFFFFF;
margin-top : 3%;
}
.estimation_index {
display : flex;
justify-content : center;
border-radius : 6px;
background-color : #C00A23;
margin-left: auto;
margin-right:auto;
width : 226px;
height : 39px;
margin-top : 32px;
}
.contact h3 {
text-align: center;
font-family: 'Noto Sans', sans-serif;
font-style: normal;
font-weight: bold;
font-size: 24px;
line-height: 32px;
color: #FFFFFF;
}
@media screen and (max-width: 1399px) {
.about_index {
margin-left: 28%;
}
.home_picture .absolute img {
margin-top: -7%;
}
.about_index_text {
margin : 208px 150px;
}
.home_picture h1{
margin-left: 29%;
}
@media screen and (max-width: 1024px) { /*(petite tablette paysage)*/
.wrap_page {
margin-bottom: 90px;
}
.about_index {
margin-left: 0px;
}
.about_index_text {
margin : 208px 150px;
}
.home_picture h1{
position : absolute;
margin-left: 40%;
margin-top: 18%;
text-align: center;
line-height: 53px;
font-size:34px;
}
.section_index{
display: block;
justify-content: none;
}
.logo_know-how{
display: flex;
flex-direction: column;
align-items: center;
}
.contact {
margin-top: 0px;
}
}
@media screen and (max-width: 768px) { /*(petite tablette portrait)*/
.home_picture h1 {
margin-left: 36%;
line-height: 43px;
font-size: 30px;
}
.icon{
width: 290px;
}
.icon_name{
font-size: 23px;
}
.paragraph1 {
width : 300px;
}
}
@media screen and (max-width: 375px) { /*(petite tablette portrait)*/
section.begin {
margin-top: 80px;
}
.home_picture h1 {
margin-left: 26%;
line-height: 27px;
font-size: 24px;
margin-top: 7%;
}
.home_picture .absolute img {
margin-top: -13%;
margin-left: 45.5%;
width: 7%;
}
.wrap_page {
margin-bottom: 0px;
}
.icon{
width: 213px;
height: 213px;
}
.icon_name{
font-size: 15px;
margin-top: 154px;
}
.border1 {
width: 195px;
border: 4px #C00A23 solid;
}
.border2 {
border: 4px #C00A23 solid;
width: 195px;
}
h2.h2_index {
font-size: 21px;
margin-top: 21px;
}
h2.about {
font-size: 21px;
margin-top: 18px;
}
.paragraph1 p{
font-size: 15px;
}
.logo_know-how h3 {
font-size: 20px;
}
.picture1 img {
margin : 42px -39px;
width: 70px;
}
.picture2 img {
margin : 42px -39px;
width: 70px;
}
.picture3 img {
margin : 42px -39px;
width: 70px;
}
.picture4 img {
margin : 42px -39px;
width: 70px;
}
.picture5 img {
margin : 42px -39px;
width: 70px;
}
.picture6 img {
margin : 42px -39px;
width: 70px;
}
.about_index {
margin-top: 160px;
display: flex;
flex-direction: column;
}
.about_index_text {
margin: 70px 67px;
}
.about_index_text p {
line-height: 28px;
width: 177px;
}
.arrow_about {
margin-left: -40px;
margin-bottom: -2px;
}
.about_index_image img {
width: 300px;
}
.about_index_image .absolute img {
margin: -300px -91px;
width: 60%;
}
.about_index_image img {
width: 165px;
margin-left: -70px;
margin-bottom: 95px;
}
.contact {
margin-top: 0px;
}
.paragraph2{
width: 0px;
}
}
| 15 | 106 | 0.610033 |
dbbf29c6f1cb8b5e30cf03254a50fc4155ca336e | 470 | lua | Lua | Ships/Mutoxicated-Rose/Rose.lua | RanPix/ppl-ships | 45d1717b9e8df666574a036466772955a7e39a29 | [
"MIT"
] | null | null | null | Ships/Mutoxicated-Rose/Rose.lua | RanPix/ppl-ships | 45d1717b9e8df666574a036466772955a7e39a29 | [
"MIT"
] | null | null | null | Ships/Mutoxicated-Rose/Rose.lua | RanPix/ppl-ships | 45d1717b9e8df666574a036466772955a7e39a29 | [
"MIT"
] | null | null | null | meshes = {
{
vertexes = {{-15,-14},{-7,-14},{2,0},{-7,14},{-15,14},{-6,0}, {0,-12},{8,-12},{16,0},{8,12},{0,12},{8,0}, {-12,0},{-16,-5},{-20,0},{-16,5}},
colors = {0x800020ff, 0xff0020ff, 0xff0020ff, 0xff0020ff, 0x800020ff, 0x800020ff, 0x800020ff, 0xff0020ff, 0xff0020ff, 0xff0020ff, 0x800020ff, 0x800020ff, 0xff00ffff, 0x700070ff, 0xff00ffff, 0x700070ff},
segments = {{0,1,2,3,4,5,0}, {6,7,8,9,10,11,6}, {15,12,13,}}
}
} | 67.142857 | 220 | 0.546809 |
07fd07010f52abbc45c803afac0568497f06a4b0 | 165 | ts | TypeScript | webui/node_modules/@clr/angular/forms/index.d.ts | satishgonella/sampleAngualar | 254f9ba4f51789dd654c76c2773e683b34eb3273 | [
"MIT"
] | null | null | null | webui/node_modules/@clr/angular/forms/index.d.ts | satishgonella/sampleAngualar | 254f9ba4f51789dd654c76c2773e683b34eb3273 | [
"MIT"
] | null | null | null | webui/node_modules/@clr/angular/forms/index.d.ts | satishgonella/sampleAngualar | 254f9ba4f51789dd654c76c2773e683b34eb3273 | [
"MIT"
] | null | null | null | export * from "./common/index";
export * from "./datepicker/index";
export * from "./checkbox/index";
export * from "./radio/index";
export * from "./forms.module";
| 27.5 | 35 | 0.666667 |
75413db65df6fe89118cbc242df0660d67180710 | 622 | css | CSS | packages/selenium-ide/src/neo/components/LogMessage/style.css | GURP-2018S/selenium-ide | b0177f685b1fddd0662fcecccf1cf41669602701 | [
"Apache-2.0"
] | null | null | null | packages/selenium-ide/src/neo/components/LogMessage/style.css | GURP-2018S/selenium-ide | b0177f685b1fddd0662fcecccf1cf41669602701 | [
"Apache-2.0"
] | null | null | null | packages/selenium-ide/src/neo/components/LogMessage/style.css | GURP-2018S/selenium-ide | b0177f685b1fddd0662fcecccf1cf41669602701 | [
"Apache-2.0"
] | null | null | null | .log {
padding-bottom: 7px;
}
.log .index {
display: inline-block;
width: 20px;
}
.log.notice {
font-weight: bold;
}
.log.warn {
color: #DC9914;
}
.log.error {
color: #E80600;
}
.log .message:after {
padding: 0 5px;
}
.log.success.notice {
color: #23843D;
}
.log.failure.notice {
color: #E80600;
}
.log.success .message .status {
color: #23843D;
}
.log.undetermined .message .status {
color: #da920e;
}
.log.failure .message .status {
color: #E80600;
}
.log .details {
padding-left: 20px;
}
.log.failure .details {
color: #E80600;
}
.log a:hover {
text-decoration: underline;
}
| 10.724138 | 36 | 0.620579 |
ff6460b85dc06351f8af756d1e07b9b4754f13cd | 4,384 | py | Python | ig-selenium/main.py | M-b850/ig-scraper | 7c6c8788bb876ff7dee9c318a6f1bf61e701cf02 | [
"MIT"
] | null | null | null | ig-selenium/main.py | M-b850/ig-scraper | 7c6c8788bb876ff7dee9c318a6f1bf61e701cf02 | [
"MIT"
] | null | null | null | ig-selenium/main.py | M-b850/ig-scraper | 7c6c8788bb876ff7dee9c318a6f1bf61e701cf02 | [
"MIT"
] | null | null | null | import os
import time
import requests
import datetime
from alive_progress import alive_bar
from instascrape import *
from database import DB
from selenium.webdriver import Firefox
from selenium.webdriver.firefox.options import Options
IG_URL = 'http://instagram.com/p/' # IG_URL + shortocde = post url
IG_PROFILE = 'http://instagram.com/' # IG_PROFILE + username = profile url
headers = {
"user-agent": "Mozilla/5.0 (Linux; Android 6.0; Nexus 5 Build/MRA58N) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/87.0.4280.88 Mobile Safari/537.36 Edg/87.0.664.57",
"cookie": "sessionid=48607609727%3ARbkUhXL7rxCt56%3A28;"
}
username = "mohammadalhamdon"
password = "Mb803613"
options = Options()
options.add_argument("--headless")
geckodriver = os.getcwd() +"/geckodriver"
webdriver = Firefox(options=options, executable_path=geckodriver)
# webdriver = Firefox(executable_path=geckodriver)
'''
getdriver = ("https://www.instagram.com/accounts/login/")
webdriver.get(getdriver)
webdriver.find_element_by_xpath("//input[@name='username']").send_keys(username)
webdriver.find_element_by_xpath("//input[@name='password']").send_keys(password)
webdriver.find_element_by_xpath("//button[@type='submit']").click()
time.sleep(10)
'''
def download(url, name):
session = requests.Session()
r = session.get(url)
with open(name, 'wb') as outfile:
outfile.write(r.content)
def file_name(realse_date):
suffix = '_'
realse_date = realse_date.replace(':', '_').replace(' ', '_')
return realse_date
def get_data(db, username):
instagram_profile = Profile(username)
instagram_profile.scrape(headers=headers)
posts = instagram_profile.get_recent_posts()
scraped_posts, unscraped_posts = scrape_posts(posts, headers=headers, pause=5, silent=False)
db.posts_col()
for p in scraped_posts:
InsPostlink = IG_URL + p.shortcode
filter = {'InsPostlink': str(InsPostlink)}
if not db.find_one(filter):
post = {
'InfoUpdateDate': datetime.datetime.utcnow(),
'InsPageLink': IG_PROFILE + username,
'PostFolowerPostShare': instagram_profile.followers,
'PostFolowingPostShare': instagram_profile.following,
'PostCount': len(posts),
'RelaseDate': p.upload_date,
'InsPostlink': IG_URL + p.shortcode,
'PostImagelink': p.display_url,
'PostLike': p.likes,
'PostComment': p.comments,
'PostSaveCount': None,
'PostSendCount': None,
'PostDiscription': p.caption,
}
_file_name = file_name(str(post['RelaseDate'])) + \
'_UTC' + f'_{username}'
image_address = f'media/{_file_name}'
filename = f'{image_address}.jpg'
download(p.display_url, filename)
post['PostImagelink'] = '/root/code/ig-scraper/' + image_address + '.jpg'
db.insert_one(post) # Insert to Database
res = {
'InsPageLink': IG_PROFILE + username,
'InsPageName': username,
'BioText': instagram_profile.biography,
'FolowerAtUpdate': instagram_profile.followers,
'FolowingAtUpdate': instagram_profile.following,
'PostCount': instagram_profile.posts,
'SiteLink': instagram_profile.external_url,
'Check': True,
}
return res
# Database setUp.
mydb = DB()
mydb.connect()
mydb.select_database('instagram_test')
with alive_bar(4325) as bar:
with open('usernames.txt') as f:
username_list = f.readlines()
for acc in username_list:
acc = acc.strip()
ig_uni_key = IG_PROFILE + acc
mydb.refinstagram_col()
filter = {'InsPageLink': ig_uni_key}
status = mydb.find_one(filter)
try:
if status['Check'] == True:
print('Passed.')
bar()
continue
except KeyError:
pass
except TypeError:
pass
print(acc)
result = get_data(mydb, acc)
if result:
mydb.refinstagram_col()
if status:
mydb.delete_one(status)
mydb.insert_one(result)
bar()
| 32.474074 | 171 | 0.613139 |
9560550ef1ff0a390101846b77ca939d4928ad4e | 424 | go | Go | events.go | inklabs/goauth2 | 75e39318efaa21b3cfbaa9ad9091c3d209efa675 | [
"BSD-3-Clause"
] | 36 | 2020-04-17T20:48:20.000Z | 2022-03-14T11:43:21.000Z | events.go | inklabs/goauth2 | 75e39318efaa21b3cfbaa9ad9091c3d209efa675 | [
"BSD-3-Clause"
] | 3 | 2020-04-29T21:51:20.000Z | 2020-08-27T06:29:33.000Z | events.go | inklabs/goauth2 | 75e39318efaa21b3cfbaa9ad9091c3d209efa675 | [
"BSD-3-Clause"
] | 6 | 2020-04-18T14:46:04.000Z | 2021-04-13T19:29:02.000Z | package goauth2
import (
"github.com/inklabs/rangedb"
)
//go:generate go run github.com/inklabs/rangedb/gen/eventbinder -package goauth2 -files client_application_events.go,resource_owner_events.go,refresh_token_events.go,authorization_code_events.go
// PendingEvents is the interface for retrieving CQRS events that will be saved to the event store.
type PendingEvents interface {
GetPendingEvents() []rangedb.Event
}
| 32.615385 | 194 | 0.818396 |
25cccb8d0eeb4e26dd4558cec679af5c6b1f9f27 | 3,115 | kt | Kotlin | font-awesome/src/commonMain/kotlin/compose/icons/fontawesomeicons/brands/Bootstrap.kt | ravitejasc/compose-icons | 09f752ef051b1c47e60554f3893bbed5ddd8bc1f | [
"MIT"
] | 230 | 2020-11-11T14:52:11.000Z | 2022-03-31T05:04:52.000Z | font-awesome/src/commonMain/kotlin/compose/icons/fontawesomeicons/brands/Bootstrap.kt | ravitejasc/compose-icons | 09f752ef051b1c47e60554f3893bbed5ddd8bc1f | [
"MIT"
] | 17 | 2021-03-02T00:00:32.000Z | 2022-03-02T16:01:03.000Z | font-awesome/src/commonMain/kotlin/compose/icons/fontawesomeicons/brands/Bootstrap.kt | ravitejasc/compose-icons | 09f752ef051b1c47e60554f3893bbed5ddd8bc1f | [
"MIT"
] | 18 | 2021-02-08T06:18:41.000Z | 2022-03-22T21:48:23.000Z | package compose.icons.fontawesomeicons.brands
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.PathFillType.Companion.NonZero
import androidx.compose.ui.graphics.SolidColor
import androidx.compose.ui.graphics.StrokeCap.Companion.Butt
import androidx.compose.ui.graphics.StrokeJoin.Companion.Miter
import androidx.compose.ui.graphics.vector.ImageVector
import androidx.compose.ui.graphics.vector.ImageVector.Builder
import androidx.compose.ui.graphics.vector.path
import androidx.compose.ui.unit.dp
import compose.icons.fontawesomeicons.BrandsGroup
public val BrandsGroup.Bootstrap: ImageVector
get() {
if (_bootstrap != null) {
return _bootstrap!!
}
_bootstrap = Builder(name = "Bootstrap", defaultWidth = 448.0.dp, defaultHeight = 512.0.dp,
viewportWidth = 448.0f, viewportHeight = 512.0f).apply {
path(fill = SolidColor(Color(0xFF000000)), stroke = null, strokeLineWidth = 0.0f,
strokeLineCap = Butt, strokeLineJoin = Miter, strokeLineMiter = 4.0f,
pathFillType = NonZero) {
moveTo(292.3f, 311.93f)
curveToRelative(0.0f, 42.41f, -39.72f, 41.43f, -43.92f, 41.43f)
horizontalLineToRelative(-80.89f)
verticalLineToRelative(-81.69f)
horizontalLineToRelative(80.89f)
curveToRelative(42.56f, 0.0f, 43.92f, 31.9f, 43.92f, 40.26f)
close()
moveTo(242.15f, 238.8f)
curveToRelative(0.67f, 0.0f, 38.44f, 1.0f, 38.44f, -36.31f)
curveToRelative(0.0f, -15.52f, -3.51f, -35.87f, -38.44f, -35.87f)
horizontalLineToRelative(-74.66f)
verticalLineToRelative(72.18f)
horizontalLineToRelative(74.66f)
close()
moveTo(448.0f, 106.67f)
verticalLineToRelative(298.66f)
arcTo(74.89f, 74.89f, 0.0f, false, true, 373.33f, 480.0f)
lineTo(74.67f, 480.0f)
arcTo(74.89f, 74.89f, 0.0f, false, true, 0.0f, 405.33f)
lineTo(0.0f, 106.67f)
arcTo(74.89f, 74.89f, 0.0f, false, true, 74.67f, 32.0f)
horizontalLineToRelative(298.66f)
arcTo(74.89f, 74.89f, 0.0f, false, true, 448.0f, 106.67f)
close()
moveTo(338.05f, 317.86f)
curveToRelative(0.0f, -21.57f, -6.65f, -58.29f, -49.05f, -67.35f)
verticalLineToRelative(-0.73f)
curveToRelative(22.91f, -9.78f, 37.34f, -28.25f, 37.34f, -55.64f)
curveToRelative(0.0f, -7.0f, 2.0f, -64.78f, -77.6f, -64.78f)
horizontalLineToRelative(-127.0f)
verticalLineToRelative(261.33f)
curveToRelative(128.23f, 0.0f, 139.87f, 1.68f, 163.6f, -5.71f)
curveToRelative(14.21f, -4.42f, 52.71f, -17.98f, 52.71f, -67.12f)
close()
}
}
.build()
return _bootstrap!!
}
private var _bootstrap: ImageVector? = null
| 47.923077 | 99 | 0.588764 |
bfa20a11181acd0b3ba9609d3ead168c855e61d5 | 2,024 | asm | Assembly | Source/Levels/L0610.asm | AbePralle/FGB | 52f004b8d9d4091a2a242a012dc8c1f90d4c160d | [
"MIT"
] | null | null | null | Source/Levels/L0610.asm | AbePralle/FGB | 52f004b8d9d4091a2a242a012dc8c1f90d4c160d | [
"MIT"
] | null | null | null | Source/Levels/L0610.asm | AbePralle/FGB | 52f004b8d9d4091a2a242a012dc8c1f90d4c160d | [
"MIT"
] | null | null | null | ; L0610.asm outback
; Generated 11.05.2000 by mlevel
; Modified 11.05.2000 by Abe Pralle
INCLUDE "Source/Defs.inc"
INCLUDE "Source/Levels.inc"
WATERINDEX EQU 2
VAR_WATER EQU 0
;---------------------------------------------------------------------
SECTION "Level0610Section",ROMX
;---------------------------------------------------------------------
L0610_Contents::
DW L0610_Load
DW L0610_Init
DW L0610_Check
DW L0610_Map
;---------------------------------------------------------------------
; Load
;---------------------------------------------------------------------
L0610_Load:
DW ((L0610_LoadFinished - L0610_Load2)) ;size
L0610_Load2:
call ParseMap
ret
L0610_LoadFinished:
;---------------------------------------------------------------------
; Map
;---------------------------------------------------------------------
L0610_Map:
INCBIN "Data/Levels/L0610_outback.lvl"
;---------------------------------------------------------------------
; Init
;---------------------------------------------------------------------
L0610_Init:
DW ((L0610_InitFinished - L0610_Init2)) ;size
L0610_Init2:
ld a,[bgTileMap + WATERINDEX]
ld [levelVars + VAR_WATER],a
ret
L0610_InitFinished:
;---------------------------------------------------------------------
; Check
;---------------------------------------------------------------------
L0610_Check:
DW ((L0610_CheckFinished - L0610_Check2)) ;size
L0610_Check2:
call ((.animateWater-L0610_Check2)+levelCheckRAM)
ret
.animateWater
ldio a,[updateTimer]
swap a
and %11
ld hl,levelVars + VAR_WATER
add [hl]
ld [bgTileMap + WATERINDEX],a
ret
L0610_CheckFinished:
PRINT "0610 Script Sizes (Load/Init/Check) (of $500): "
PRINT (L0610_LoadFinished - L0610_Load2)
PRINT " / "
PRINT (L0610_InitFinished - L0610_Init2)
PRINT " / "
PRINT (L0610_CheckFinished - L0610_Check2)
PRINT "\n"
| 26.986667 | 70 | 0.425889 |
3d1885d004fba1c165ee41923b9699df3c63752e | 1,134 | kt | Kotlin | app/src/main/java/com/yougame/takayamaaren/yougame/ui/payment/PaymentActivity.kt | 428talent/YouGame-Android | 7220b15262652bd59f8c8b035c88bdb02f78f6e6 | [
"MIT"
] | null | null | null | app/src/main/java/com/yougame/takayamaaren/yougame/ui/payment/PaymentActivity.kt | 428talent/YouGame-Android | 7220b15262652bd59f8c8b035c88bdb02f78f6e6 | [
"MIT"
] | null | null | null | app/src/main/java/com/yougame/takayamaaren/yougame/ui/payment/PaymentActivity.kt | 428talent/YouGame-Android | 7220b15262652bd59f8c8b035c88bdb02f78f6e6 | [
"MIT"
] | null | null | null | package com.yougame.takayamaaren.yougame.ui.payment
import android.os.Bundle
import android.support.v7.app.AppCompatActivity
import com.yougame.takayamaaren.yougame.R
import kotlinx.android.synthetic.main.activity_payment.*
import kotlinx.android.synthetic.main.content_payment.*
class PaymentActivity : AppCompatActivity() {
private val adapter by lazy {
PaymentAdapter(mutableListOf(
PaymentItem(),
PaymentItem(),
PaymentItem(),
PaymentItem(),
PaymentItem(),
PaymentItem(),
PaymentItem(),
PaymentItem()
)).apply {
bindToRecyclerView(pay_rv)
}
}
override fun onCreate(savedInstanceState: Bundle?) {
super.onCreate(savedInstanceState)
setContentView(R.layout.activity_payment)
setSupportActionBar(toolbar)
setSupportActionBar(toolbar)
supportActionBar?.setDisplayHomeAsUpEnabled(true)
toolbar.setNavigationOnClickListener {
onBackPressed()
}
pay_rv.adapter = adapter
}
}
| 27.658537 | 57 | 0.635802 |
3910cf27e046fee390b77eddb768d9d51431720e | 644 | py | Python | keras/applications/nasnet.py | PJmouraocs/keras | 7a39b6c62d43c25472b2c2476bd2a8983ae4f682 | [
"MIT"
] | 300 | 2018-04-04T05:01:21.000Z | 2022-02-25T18:56:04.000Z | keras/applications/nasnet.py | PJmouraocs/keras | 7a39b6c62d43c25472b2c2476bd2a8983ae4f682 | [
"MIT"
] | 163 | 2018-04-03T17:41:22.000Z | 2021-09-03T16:44:04.000Z | keras/applications/nasnet.py | PJmouraocs/keras | 7a39b6c62d43c25472b2c2476bd2a8983ae4f682 | [
"MIT"
] | 94 | 2016-02-17T20:59:27.000Z | 2021-04-19T08:18:16.000Z | from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from keras_applications import nasnet
from . import keras_modules_injection
@keras_modules_injection
def NASNetMobile(*args, **kwargs):
return nasnet.NASNetMobile(*args, **kwargs)
@keras_modules_injection
def NASNetLarge(*args, **kwargs):
return nasnet.NASNetLarge(*args, **kwargs)
@keras_modules_injection
def decode_predictions(*args, **kwargs):
return nasnet.decode_predictions(*args, **kwargs)
@keras_modules_injection
def preprocess_input(*args, **kwargs):
return nasnet.preprocess_input(*args, **kwargs)
| 23.851852 | 53 | 0.791925 |
7a9a9a39b8867dcdcfe33decdabf843cd35e5590 | 188 | rs | Rust | src/main.rs | mkrzywda/rust-nn | 93fcdfbf825511598548ce2f72d8c034ccabbf08 | [
"MIT"
] | null | null | null | src/main.rs | mkrzywda/rust-nn | 93fcdfbf825511598548ce2f72d8c034ccabbf08 | [
"MIT"
] | null | null | null | src/main.rs | mkrzywda/rust-nn | 93fcdfbf825511598548ce2f72d8c034ccabbf08 | [
"MIT"
] | null | null | null | pub mod agent;
pub mod network;
fn main() {
let mut population = agent::random_population(450);
for _ in 0..1000000 {
population = agent::generation(population);
}
}
| 17.090909 | 55 | 0.638298 |
0ab18e071a78bb671a4dc05652aa71eb00ca9ccd | 268 | cs | C# | src/EngineeringWork.Infrastructure/DTO/JwtDto.cs | piratezxe/Engineering | 17523e56acb235d77db4d0ec8b454cbad600e263 | [
"MIT"
] | null | null | null | src/EngineeringWork.Infrastructure/DTO/JwtDto.cs | piratezxe/Engineering | 17523e56acb235d77db4d0ec8b454cbad600e263 | [
"MIT"
] | null | null | null | src/EngineeringWork.Infrastructure/DTO/JwtDto.cs | piratezxe/Engineering | 17523e56acb235d77db4d0ec8b454cbad600e263 | [
"MIT"
] | null | null | null | using EngineeringWork.Core.Domain;
namespace EngineeringWork.Infrastructure.DTO
{
public class JwtDto
{
public string Token { get; set; }
public long Expires { get; set; }
public RefreshToken RefreshToken { get; set; }
}
} | 22.333333 | 54 | 0.634328 |
4d41dcb8bf7b12ad62e0b3f46e6b53ee6d9852a1 | 686 | cs | C# | easy/csharp/c0012_53_maximum-subarray/00_leetcode_0012.cs | drunkwater/leetcode | 8cc4a07763e71efbaedb523015f0c1eff2927f60 | [
"Ruby"
] | null | null | null | easy/csharp/c0012_53_maximum-subarray/00_leetcode_0012.cs | drunkwater/leetcode | 8cc4a07763e71efbaedb523015f0c1eff2927f60 | [
"Ruby"
] | null | null | null | easy/csharp/c0012_53_maximum-subarray/00_leetcode_0012.cs | drunkwater/leetcode | 8cc4a07763e71efbaedb523015f0c1eff2927f60 | [
"Ruby"
] | 3 | 2018-02-09T02:46:48.000Z | 2021-02-20T08:32:03.000Z | // DRUNKWATER TEMPLATE(add description and prototypes)
// Question Title and Description on leetcode.com
// Function Declaration and Function Prototypes on leetcode.com
//53. Maximum Subarray
//Given an integer array nums, find the contiguous subarray (containing at least one number) which has the largest sum and return its sum.
//Example:
//Input: [-2,1,-3,4,-1,2,1,-5,4],
//Output: 6
//Explanation: [4,-1,2,1] has the largest sum = 6.
//Follow up:
//If you have figured out the O(n) solution, try coding another solution using the divide and conquer approach, which is more subtle.
//public class Solution {
// public int MaxSubArray(int[] nums) {
// }
//}
// Time Is Money | 36.105263 | 138 | 0.721574 |
7f0fa7aa8e00b3d7e8d79d0c36c11ce826ed60d0 | 10,086 | cs | C# | POLA_MMS/UI_Member/frmMember_Transfer.Designer.cs | AprilYanmy/POLA_ManagerSystem | 9c77f570a320975730db2ed732b51c66f1ebb52d | [
"MIT"
] | null | null | null | POLA_MMS/UI_Member/frmMember_Transfer.Designer.cs | AprilYanmy/POLA_ManagerSystem | 9c77f570a320975730db2ed732b51c66f1ebb52d | [
"MIT"
] | null | null | null | POLA_MMS/UI_Member/frmMember_Transfer.Designer.cs | AprilYanmy/POLA_ManagerSystem | 9c77f570a320975730db2ed732b51c66f1ebb52d | [
"MIT"
] | 1 | 2022-01-11T06:58:52.000Z | 2022-01-11T06:58:52.000Z | namespace POLA_MMS.Member_UI
{
partial class frmMember_Transfer
{
/// <summary>
/// Required designer variable.
/// </summary>
private System.ComponentModel.IContainer components = null;
/// <summary>
/// Clean up any resources being used.
/// </summary>
/// <param name="disposing">true if managed resources should be disposed; otherwise, false.</param>
protected override void Dispose(bool disposing)
{
if (disposing && (components != null))
{
components.Dispose();
}
base.Dispose(disposing);
}
#region Windows Form Designer generated code
/// <summary>
/// Required method for Designer support - do not modify
/// the contents of this method with the code editor.
/// </summary>
private void InitializeComponent()
{
System.ComponentModel.ComponentResourceManager resources = new System.ComponentModel.ComponentResourceManager(typeof(frmMember_Transfer));
this.numMoney = new System.Windows.Forms.NumericUpDown();
this.label6 = new System.Windows.Forms.Label();
this.label5 = new System.Windows.Forms.Label();
this.txtNewID = new System.Windows.Forms.TextBox();
this.label3 = new System.Windows.Forms.Label();
this.btnCancel = new System.Windows.Forms.Button();
this.btnOK = new System.Windows.Forms.Button();
this.groupBox1 = new System.Windows.Forms.GroupBox();
this.lblBalance = new System.Windows.Forms.Label();
this.lblName = new System.Windows.Forms.Label();
this.lblOldID = new System.Windows.Forms.Label();
this.label4 = new System.Windows.Forms.Label();
this.label2 = new System.Windows.Forms.Label();
this.label1 = new System.Windows.Forms.Label();
((System.ComponentModel.ISupportInitialize)(this.numMoney)).BeginInit();
this.groupBox1.SuspendLayout();
this.SuspendLayout();
//
// numMoney
//
this.numMoney.DecimalPlaces = 2;
this.numMoney.Location = new System.Drawing.Point(113, 111);
this.numMoney.Name = "numMoney";
this.numMoney.Size = new System.Drawing.Size(60, 21);
this.numMoney.TabIndex = 28;
//
// label6
//
this.label6.AutoSize = true;
this.label6.Location = new System.Drawing.Point(179, 113);
this.label6.Name = "label6";
this.label6.Size = new System.Drawing.Size(17, 12);
this.label6.TabIndex = 27;
this.label6.Text = "元";
//
// label5
//
this.label5.AutoSize = true;
this.label5.Location = new System.Drawing.Point(42, 113);
this.label5.Name = "label5";
this.label5.Size = new System.Drawing.Size(65, 12);
this.label5.TabIndex = 26;
this.label5.Text = "转入金额:";
//
// txtNewID
//
this.txtNewID.Location = new System.Drawing.Point(113, 84);
this.txtNewID.MaxLength = 12;
this.txtNewID.Name = "txtNewID";
this.txtNewID.Size = new System.Drawing.Size(120, 21);
this.txtNewID.TabIndex = 22;
this.txtNewID.KeyPress += new System.Windows.Forms.KeyPressEventHandler(this.txtNewID_KeyPress);
//
// label3
//
this.label3.AutoSize = true;
this.label3.Location = new System.Drawing.Point(18, 87);
this.label3.Name = "label3";
this.label3.Size = new System.Drawing.Size(89, 12);
this.label3.TabIndex = 25;
this.label3.Text = "转入会员卡号:";
//
// btnCancel
//
this.btnCancel.Location = new System.Drawing.Point(250, 138);
this.btnCancel.Name = "btnCancel";
this.btnCancel.Size = new System.Drawing.Size(75, 23);
this.btnCancel.TabIndex = 24;
this.btnCancel.Text = "取消(&C)";
this.btnCancel.UseVisualStyleBackColor = true;
this.btnCancel.Click += new System.EventHandler(this.btnCancel_Click);
//
// btnOK
//
this.btnOK.Location = new System.Drawing.Point(169, 138);
this.btnOK.Name = "btnOK";
this.btnOK.Size = new System.Drawing.Size(75, 23);
this.btnOK.TabIndex = 23;
this.btnOK.Text = "确定(&O)";
this.btnOK.UseVisualStyleBackColor = true;
this.btnOK.Click += new System.EventHandler(this.btnOK_Click);
//
// groupBox1
//
this.groupBox1.Controls.Add(this.lblBalance);
this.groupBox1.Controls.Add(this.lblName);
this.groupBox1.Controls.Add(this.lblOldID);
this.groupBox1.Controls.Add(this.label4);
this.groupBox1.Controls.Add(this.label2);
this.groupBox1.Controls.Add(this.label1);
this.groupBox1.Location = new System.Drawing.Point(12, 12);
this.groupBox1.Name = "groupBox1";
this.groupBox1.Size = new System.Drawing.Size(313, 66);
this.groupBox1.TabIndex = 21;
this.groupBox1.TabStop = false;
this.groupBox1.Text = "会员信息";
//
// lblBalance
//
this.lblBalance.AutoSize = true;
this.lblBalance.ForeColor = System.Drawing.Color.Blue;
this.lblBalance.Location = new System.Drawing.Point(77, 45);
this.lblBalance.Name = "lblBalance";
this.lblBalance.Size = new System.Drawing.Size(77, 12);
this.lblBalance.TabIndex = 7;
this.lblBalance.Text = "[lblBalance]";
//
// lblName
//
this.lblName.AutoSize = true;
this.lblName.ForeColor = System.Drawing.Color.Red;
this.lblName.Location = new System.Drawing.Point(231, 17);
this.lblName.Name = "lblName";
this.lblName.Size = new System.Drawing.Size(59, 12);
this.lblName.TabIndex = 5;
this.lblName.Text = "[lblName]";
//
// lblOldID
//
this.lblOldID.AutoSize = true;
this.lblOldID.ForeColor = System.Drawing.Color.Red;
this.lblOldID.Location = new System.Drawing.Point(77, 17);
this.lblOldID.Name = "lblOldID";
this.lblOldID.Size = new System.Drawing.Size(65, 12);
this.lblOldID.TabIndex = 4;
this.lblOldID.Text = "[lblOldID]";
//
// label4
//
this.label4.AutoSize = true;
this.label4.Location = new System.Drawing.Point(6, 45);
this.label4.Name = "label4";
this.label4.Size = new System.Drawing.Size(65, 12);
this.label4.TabIndex = 3;
this.label4.Text = "当前余额:";
//
// label2
//
this.label2.AutoSize = true;
this.label2.Location = new System.Drawing.Point(160, 17);
this.label2.Name = "label2";
this.label2.Size = new System.Drawing.Size(65, 12);
this.label2.TabIndex = 1;
this.label2.Text = "会员姓名:";
//
// label1
//
this.label1.AutoSize = true;
this.label1.Location = new System.Drawing.Point(6, 17);
this.label1.Name = "label1";
this.label1.Size = new System.Drawing.Size(65, 12);
this.label1.TabIndex = 0;
this.label1.Text = "会员卡号:";
//
// frmMember_Transfer
//
this.AutoScaleDimensions = new System.Drawing.SizeF(6F, 12F);
this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
this.ClientSize = new System.Drawing.Size(338, 174);
this.Controls.Add(this.numMoney);
this.Controls.Add(this.label6);
this.Controls.Add(this.label5);
this.Controls.Add(this.txtNewID);
this.Controls.Add(this.label3);
this.Controls.Add(this.btnCancel);
this.Controls.Add(this.btnOK);
this.Controls.Add(this.groupBox1);
this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
this.Icon = ((System.Drawing.Icon)(resources.GetObject("$this.Icon")));
this.MaximizeBox = false;
this.MinimizeBox = false;
this.Name = "frmMember_Transfer";
this.ShowInTaskbar = false;
this.StartPosition = System.Windows.Forms.FormStartPosition.CenterParent;
this.Text = "会员余额转账";
this.Load += new System.EventHandler(this.frmMember_Transfer_Load);
((System.ComponentModel.ISupportInitialize)(this.numMoney)).EndInit();
this.groupBox1.ResumeLayout(false);
this.groupBox1.PerformLayout();
this.ResumeLayout(false);
this.PerformLayout();
}
#endregion
private System.Windows.Forms.NumericUpDown numMoney;
private System.Windows.Forms.Label label6;
private System.Windows.Forms.Label label5;
private System.Windows.Forms.TextBox txtNewID;
private System.Windows.Forms.Label label3;
private System.Windows.Forms.Button btnCancel;
private System.Windows.Forms.Button btnOK;
private System.Windows.Forms.GroupBox groupBox1;
private System.Windows.Forms.Label lblBalance;
private System.Windows.Forms.Label lblName;
private System.Windows.Forms.Label lblOldID;
private System.Windows.Forms.Label label4;
private System.Windows.Forms.Label label2;
private System.Windows.Forms.Label label1;
}
} | 43.287554 | 150 | 0.564347 |
f89ba308f94730263dc7ce991702bf72969349b7 | 4,364 | dart | Dart | test/analysis/set_priority_files_test.dart | lukechurch/as_test_supreme-octo-spork | 5a192ffebce2206e2d30da6e4887b3feaccf7470 | [
"BSD-3-Clause"
] | null | null | null | test/analysis/set_priority_files_test.dart | lukechurch/as_test_supreme-octo-spork | 5a192ffebce2206e2d30da6e4887b3feaccf7470 | [
"BSD-3-Clause"
] | null | null | null | test/analysis/set_priority_files_test.dart | lukechurch/as_test_supreme-octo-spork | 5a192ffebce2206e2d30da6e4887b3feaccf7470 | [
"BSD-3-Clause"
] | null | null | null | // Copyright (c) 2014, the Dart project authors. Please see the AUTHORS file
// for details. All rights reserved. Use of this source code is governed by a
// BSD-style license that can be found in the LICENSE file.
library test.analysis.set_priority_files;
import 'package:analysis_server/plugin/protocol/protocol.dart';
import 'package:analysis_server/src/domain_analysis.dart';
import 'package:analyzer/src/generated/engine.dart'
show InternalAnalysisContext;
import 'package:analyzer/src/generated/source.dart';
import 'package:test_reflective_loader/test_reflective_loader.dart';
import 'package:unittest/unittest.dart';
import '../analysis_abstract.dart';
import '../mocks.dart';
import '../utils.dart';
main() {
initializeTestEnvironment();
defineReflectiveTests(SetPriorityFilesTest);
}
@reflectiveTest
class SetPriorityFilesTest extends AbstractAnalysisTest {
@override
void setUp() {
super.setUp();
server.handlers = [new AnalysisDomainHandler(server),];
createProject();
}
test_fileDoesNotExist() async {
String file = '$projectPath/doesNotExist.dart';
Response response = await _setPriorityFile(file);
expect(response, isResponseSuccess('0'));
}
test_fileInAnalysisRoot() async {
addTestFile('');
// wait for analysis to ensure that the file is known to the context
await server.onAnalysisComplete;
// set priority files
Response response = await _setPriorityFile(testFile);
expect(response, isResponseSuccess('0'));
// verify
InternalAnalysisContext context = server.getContainingContext(testFile);
List<Source> prioritySources = context.prioritySources;
expect(prioritySources, hasLength(1));
expect(prioritySources.first.fullName, testFile);
}
test_fileInSdk() async {
addTestFile('');
await server.onAnalysisComplete;
// set priority files
String filePath = '/lib/convert/convert.dart';
Response response = await _setPriorityFile(filePath);
expect(response, isResponseSuccess('0'));
// verify
InternalAnalysisContext sdkContext = server.defaultSdk.context;
List<Source> prioritySources = sdkContext.prioritySources;
expect(prioritySources, hasLength(1));
expect(prioritySources.first.fullName, filePath);
}
test_fileNotInAnalysisRoot() async {
String path = '/other/file.dart';
addFile(path, '');
Response response = await _setPriorityFile(path);
expect(response.error, isNotNull);
expect(response.error.code, RequestErrorCode.UNANALYZED_PRIORITY_FILES);
}
test_ignoredInAnalysisOptions() async {
String sampleFile = '$projectPath/samples/sample.dart';
addFile(
'$projectPath/.analysis_options',
r'''
analyzer:
exclude:
- 'samples/**'
''');
addFile(sampleFile, '');
// attempt to set priority file
Response response = await _setPriorityFile(sampleFile);
expect(response.error, isNotNull);
expect(response.error.code, RequestErrorCode.UNANALYZED_PRIORITY_FILES);
}
test_ignoredInAnalysisOptions_inChildContext() async {
addFile('$projectPath/.packages', '');
addFile('$projectPath/child/.packages', '');
String sampleFile = '$projectPath/child/samples/sample.dart';
addFile(
'$projectPath/child/.analysis_options',
r'''
analyzer:
exclude:
- 'samples/**'
''');
addFile(sampleFile, '');
// attempt to set priority file
Response response = await _setPriorityFile(sampleFile);
expect(response.error, isNotNull);
expect(response.error.code, RequestErrorCode.UNANALYZED_PRIORITY_FILES);
}
test_ignoredInAnalysisOptions_inRootContext() async {
addFile('$projectPath/.packages', '');
addFile('$projectPath/child/.packages', '');
String sampleFile = '$projectPath/child/samples/sample.dart';
addFile(
'$projectPath/.analysis_options',
r'''
analyzer:
exclude:
- 'child/samples/**'
''');
addFile(sampleFile, '');
// attempt to set priority file
Response response = await _setPriorityFile(sampleFile);
expect(response.error, isNotNull);
expect(response.error.code, RequestErrorCode.UNANALYZED_PRIORITY_FILES);
}
_setPriorityFile(String file) async {
Request request =
new AnalysisSetPriorityFilesParams(<String>[file]).toRequest('0');
return await serverChannel.sendRequest(request);
}
}
| 32.81203 | 77 | 0.720669 |
a11713864d0469a29c10d9854ce0b9679831e8cc | 228 | ts | TypeScript | src/app/clan-search/state/loaded-clans/loaded-clans.actions.ts | WorthyD/d2-clandashboard | 74e9b752a5463e460719cb397517800d6a03c2a2 | [
"MIT"
] | 2 | 2020-12-22T21:46:32.000Z | 2021-09-06T17:10:16.000Z | src/app/home/state/loaded-clans/loaded-clans.actions.ts | WorthyD/d2-clandashboard | 74e9b752a5463e460719cb397517800d6a03c2a2 | [
"MIT"
] | 31 | 2020-02-08T11:35:45.000Z | 2022-03-28T10:33:55.000Z | src/app/home/state/loaded-clans/loaded-clans.actions.ts | WorthyD/d2-clandashboard | 74e9b752a5463e460719cb397517800d6a03c2a2 | [
"MIT"
] | null | null | null | import { createAction, props } from '@ngrx/store';
import { LoadedClan } from '../../models/loaded-clan';
const base = '[Loaded Clans] -';
export const addClan = createAction(`${base} Add Clan`, props<{ clan: LoadedClan }>());
| 38 | 87 | 0.666667 |
adbaebc65ef7d1bf82e1dfd8b9035ed015197998 | 554 | rb | Ruby | app/controllers/toc_controller.rb | pulibrary/pulfalight | 086bce870af1bbdac4cbc522b89bbfdb35b582ae | [
"Apache-2.0"
] | 4 | 2020-03-31T17:58:07.000Z | 2021-04-21T18:04:45.000Z | app/controllers/toc_controller.rb | pulibrary/pulfalight | 086bce870af1bbdac4cbc522b89bbfdb35b582ae | [
"Apache-2.0"
] | 645 | 2020-01-14T15:06:54.000Z | 2022-03-30T23:56:27.000Z | app/controllers/toc_controller.rb | pulibrary/pulfalight | 086bce870af1bbdac4cbc522b89bbfdb35b582ae | [
"Apache-2.0"
] | 1 | 2020-06-30T17:32:57.000Z | 2020-06-30T17:32:57.000Z | # frozen_string_literal: true
class TocController < ApplicationController
def toc
render json: TableOfContentsBuilder.build(document, single_node: single_node?, expanded: expanded?)
rescue Blacklight::Exceptions::RecordNotFound
render json: {}
end
def child_table
render json: ChildTableBuilder.new(params[:node]).to_a
end
private
def document
SolrDocument.find(params[:node])
end
def single_node?
return false if params[:full] == "true"
true
end
def expanded?
params[:expanded] == "true"
end
end
| 19.785714 | 103 | 0.716606 |
2ca7079cf4938ff8e15550deacd0300d439ccc72 | 713 | py | Python | scripts/checkabunds.py | tomasjames/UCLCHEM | 3a41a10200864227801a83b22b213d060d74c8e7 | [
"MIT"
] | null | null | null | scripts/checkabunds.py | tomasjames/UCLCHEM | 3a41a10200864227801a83b22b213d060d74c8e7 | [
"MIT"
] | null | null | null | scripts/checkabunds.py | tomasjames/UCLCHEM | 3a41a10200864227801a83b22b213d060d74c8e7 | [
"MIT"
] | null | null | null | from __future__ import print_function
from plotfunctions import *
cloud=getParameters("src/defaultparameters.f90")
time,cloud,species,abunds=readTimestep("output/fullcloud1.dat",1.64e07,cloud)
for element in ["+","C"]:
print("\n**********\n")
totalabund=0.0
oxyAbunds=[]
oxySpecs=[]
for i in range(0,len(species)):
nAtom=species[i].count(element)
if element+"2" in species[i]:
nAtom+=1
if nAtom>0:
totalabund+=(nAtom*abunds[i])
oxyAbunds.append(nAtom*abunds[i])
oxySpecs.append(species[i])
print("{:.2e}".format(totalabund))
A=zip(oxyAbunds,oxySpecs)
A=sorted(A,reverse=True)
oxyAbunds,oxySpecs=zip(*A)
for i in range(0,10):
print("{0} {1:.3e}".format(oxySpecs[i],oxyAbunds[i]))
| 25.464286 | 77 | 0.69425 |
fbcf3a8045c2e0d8a90e9539761ac1e612ef8b41 | 863 | sql | SQL | VS2013_PROJECT/DNN_DB/dbo/Views/dnn_vw_PublishedFiles.sql | EL-BID/nexso | d9ea4b922287c61234e28f00bf7e561f8b8ac632 | [
"MIT"
] | 4 | 2017-04-10T19:23:11.000Z | 2017-11-10T14:46:49.000Z | VS2013_PROJECT/DNN_DB/dbo/Views/dnn_vw_PublishedFiles.sql | EL-BID/nexso | d9ea4b922287c61234e28f00bf7e561f8b8ac632 | [
"MIT"
] | null | null | null | VS2013_PROJECT/DNN_DB/dbo/Views/dnn_vw_PublishedFiles.sql | EL-BID/nexso | d9ea4b922287c61234e28f00bf7e561f8b8ac632 | [
"MIT"
] | 3 | 2017-10-13T21:26:22.000Z | 2018-02-13T16:09:42.000Z | CREATE VIEW [dbo].[dnn_vw_PublishedFiles]
AS
SELECT
fi.[FileId]
,fi.[PortalId]
,fi.[FileName]
,fi.[Extension]
,fi.[Size]
,fi.[Width]
,fi.[Height]
,fi.[ContentType]
,fi.[FolderID]
,fi.[Content]
,fi.[CreatedByUserID]
,fi.[CreatedOnDate]
,fi.[LastModifiedByUserID]
,fi.[LastModifiedOnDate]
,fi.[UniqueId]
,fi.[VersionGuid]
,fi.[SHA1Hash]
,fi.[LastModificationTime]
,fi.[Title]
,fi.[StartDate]
,fi.[EnablePublishPeriod]
,fi.[EndDate]
,fi.[ContentItemID]
,fi.[PublishedVersion]
,fi.[Folder]
,fi.[IsCached]
,fi.[StorageLocation]
,fi.[FolderMappingID]
FROM dbo.[dnn_vw_Files] fi
WHERE [EnablePublishPeriod] = 0
OR ([StartDate] <= GETDATE()
AND ([EndDate] IS NULL OR GETDATE() <= [EndDate]))
| 23.324324 | 53 | 0.570104 |
c9d8da96b7a2c6384b3c6da34df58b79c9da764e | 226 | ts | TypeScript | src/index.ts | fractal-ly/tiny-validation | a9009fc1c0afd30c2e408d0c0e88fbf94c8f0a39 | [
"MIT"
] | 1 | 2021-07-20T23:35:31.000Z | 2021-07-20T23:35:31.000Z | src/index.ts | fractal-ly/tiny-validation | a9009fc1c0afd30c2e408d0c0e88fbf94c8f0a39 | [
"MIT"
] | null | null | null | src/index.ts | fractal-ly/tiny-validation | a9009fc1c0afd30c2e408d0c0e88fbf94c8f0a39 | [
"MIT"
] | null | null | null | import {
Fail,
Runner,
Schema,
Success,
validate,
Validation,
} from './lib/validation';
import * as Validators from './lib/validators';
export { Validators, Schema, Validation, Success, Fail, Runner, validate };
| 18.833333 | 75 | 0.690265 |
511deb60e45533b73d72412a98411fdaf2f69d5e | 384 | rs | Rust | src/test/ui/generator/issue-69017.rs | Eric-Arellano/rust | 0f6f2d681b39c5f95459cd09cb936b6ceb27cd82 | [
"ECL-2.0",
"Apache-2.0",
"MIT-0",
"MIT"
] | 66,762 | 2015-01-01T08:32:03.000Z | 2022-03-31T23:26:40.000Z | src/test/ui/generator/issue-69017.rs | Eric-Arellano/rust | 0f6f2d681b39c5f95459cd09cb936b6ceb27cd82 | [
"ECL-2.0",
"Apache-2.0",
"MIT-0",
"MIT"
] | 76,993 | 2015-01-01T00:06:33.000Z | 2022-03-31T23:59:15.000Z | src/test/ui/generator/issue-69017.rs | Eric-Arellano/rust | 0f6f2d681b39c5f95459cd09cb936b6ceb27cd82 | [
"ECL-2.0",
"Apache-2.0",
"MIT-0",
"MIT"
] | 11,787 | 2015-01-01T00:01:19.000Z | 2022-03-31T19:03:42.000Z | // This issue reproduces an ICE on compile
// Fails on 2020-02-08 nightly
// regressed commit: https://github.com/rust-lang/rust/commit/f8fd4624474a68bd26694eff3536b9f3a127b2d3
//
// check-pass
#![feature(generator_trait)]
#![feature(generators)]
use std::ops::Generator;
fn gen() -> impl Generator<usize> {
|_: usize| {
println!("-> {}", yield);
}
}
fn main() {}
| 20.210526 | 102 | 0.664063 |
e72b95320bbaef36f741fd69288672dc749df802 | 40 | kt | Kotlin | idea/testData/refactoring/move/kotlin/moveTopLevelDeclarations/misc/internalReferences/before/target/some.kt | qussarah/declare | c83b764c7394efa3364915d973ae79c4ebed2437 | [
"Apache-2.0"
] | 337 | 2020-05-14T00:40:10.000Z | 2022-02-16T23:39:07.000Z | idea/testData/refactoring/move/kotlin/moveTopLevelDeclarations/misc/internalReferences/before/target/some.kt | qussarah/declare | c83b764c7394efa3364915d973ae79c4ebed2437 | [
"Apache-2.0"
] | 92 | 2020-06-10T23:17:42.000Z | 2020-09-25T10:50:13.000Z | idea/testData/refactoring/move/kotlin/moveTopLevelDeclarations/misc/internalReferences/before/target/some.kt | qussarah/declare | c83b764c7394efa3364915d973ae79c4ebed2437 | [
"Apache-2.0"
] | 54 | 2016-02-29T16:27:38.000Z | 2020-12-26T15:02:23.000Z | package target
fun test2() = source.A() | 13.333333 | 24 | 0.7 |
9566ea6af2678ed011676cb714d9153174cc9399 | 134 | go | Go | agents_response.go | captureidx/go-client | 57ff3789268d69b150ca73846dad8eb16e232eb1 | [
"Apache-2.0"
] | null | null | null | agents_response.go | captureidx/go-client | 57ff3789268d69b150ca73846dad8eb16e232eb1 | [
"Apache-2.0"
] | null | null | null | agents_response.go | captureidx/go-client | 57ff3789268d69b150ca73846dad8eb16e232eb1 | [
"Apache-2.0"
] | null | null | null | package client
type Agents struct {
Name Name `json:"name"`
Phone Phone `json:"phone"`
AgentId string `json:"agent_id"`
}
| 16.75 | 33 | 0.664179 |
a9db9e2315461f7cd961e5c0a126c81d90a79329 | 2,687 | php | PHP | index.php | NothAmor/questions_search | 7f2f19dd89a7901edb48ee315640454325eef002 | [
"Apache-2.0"
] | null | null | null | index.php | NothAmor/questions_search | 7f2f19dd89a7901edb48ee315640454325eef002 | [
"Apache-2.0"
] | null | null | null | index.php | NothAmor/questions_search | 7f2f19dd89a7901edb48ee315640454325eef002 | [
"Apache-2.0"
] | null | null | null | <?php
$dbhost = 'localhost:3306';
$dbuser = 'root';
$dbpass = 'root';
$dbname = 'questions';
$conn = mysqli_connect($dbhost, $dbuser, $dbpass, $dbname);
if(!$conn) {
die("Connection failed! Contact website admin!" . mysqli_error($conn));
} else {
echo '';
}
?>
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="UTF-8">
<meta name="viewport" content="width=device-width, initial-scale=1.0">
<title>Questions</title>
<link href="https://maxcdn.bootstrapcdn.com/bootstrap/3.3.7/css/bootstrap.min.css" rel="stylesheet">
</head>
<body>
<style>
body {
text-align: center;
margin: 0 auto;
display: block;
}
table {
margin: 0 auto;
align: center;
}
.box {
width: 500px;
line-height: 30px;
display: block;
margin: 0 auto;
}
</style>
<div class="header">
<h3>Question Search</h3>
</div>
<nav class="navbar navbar-inverse navbar-fixed-top">
<div class="container">
<div class="navbar-header">
<a class="navbar-brand" href="#">Question Search</a>
</div>
<div id="navbar" class="collapse navbar-collapse">
<ul class="nav navbar-nav">
<li class="active"><a href="#">Home</a></li>
</ul>
<p class="navbar-text"><?php require_once('db.php'); ?></p>
</div>
</div>
</nav>
<div class="box">
<h1>Search Questions</h1>
<form action="" method="POST">
<div class="input-group">
<div class="input-group" style="width:500px; text-align:center;">
<input type="text" name="question" class="form-control" placeholder="Search for...">
<span class="input-group-btn">
<input type="submit" class="btn btn-success" value="Search">
</span>
</div><!-- /input-group -->
</div>
</form>
</div>
<br />
<?php
if($_POST['question'] != null) {
$sql = "SELECT * FROM `questions` WHERE question LIKE '%".$_POST['question']."%' ";
echo "<table border=1 style='width:1100px; text-align:center;' class='table table-bordered table-hover'><tr><th>Question</th><th>Answer</th></tr>";
// echo "<tr><th>".$_POST['question']."</th>";
$result = mysqli_query($conn, $sql);
while($row = mysqli_fetch_assoc($result)) {
echo "<tr><th>".$row['question']."</th>";
echo "<th>".$row['answer']."</th></tr>";
}
echo "</table>";
}
?>
</body>
</html> | 29.855556 | 155 | 0.507629 |
bef635fbeb1d44b390c5d93e772c8a5f3cd9fc19 | 753 | tsx | TypeScript | packages/ui/src/components/form/FormGroup.tsx | zxlfly/react-devui | bd50edbb8c27899a665a72d10519658898cddb21 | [
"MIT"
] | null | null | null | packages/ui/src/components/form/FormGroup.tsx | zxlfly/react-devui | bd50edbb8c27899a665a72d10519658898cddb21 | [
"MIT"
] | null | null | null | packages/ui/src/components/form/FormGroup.tsx | zxlfly/react-devui | bd50edbb8c27899a665a72d10519658898cddb21 | [
"MIT"
] | null | null | null | import type { FormGroup } from './form';
import React from 'react';
import { useComponentConfig } from '../../hooks';
import { registerComponentMate } from '../../utils';
export const DFormGroupContext = React.createContext<FormGroup | null>(null);
export interface DFormGroupProps {
children: React.ReactNode;
dFormGroup: FormGroup;
dTitle?: React.ReactNode;
}
const { COMPONENT_NAME } = registerComponentMate({ COMPONENT_NAME: 'DFormGroup' });
export function DFormGroup(props: DFormGroupProps): JSX.Element | null {
const { children, dFormGroup, dTitle } = useComponentConfig(COMPONENT_NAME, props);
return (
<DFormGroupContext.Provider value={dFormGroup}>
{dTitle}
{children}
</DFormGroupContext.Provider>
);
}
| 27.888889 | 85 | 0.721116 |
1a42ae01bb8bcd1ee2a3e4688e1227caf3ad7686 | 2,590 | py | Python | __init__.py | sandsunset/string-sum | 6d29904aeb2827971a7616a27722bfb74e5c1b0a | [
"MIT"
] | 4 | 2021-04-09T08:45:25.000Z | 2021-04-12T01:55:24.000Z | __init__.py | sandsunset/string-sum | 6d29904aeb2827971a7616a27722bfb74e5c1b0a | [
"MIT"
] | null | null | null | __init__.py | sandsunset/string-sum | 6d29904aeb2827971a7616a27722bfb74e5c1b0a | [
"MIT"
] | null | null | null | import re
class StringCal:
def __init__(self, formula:str, **variables):
self.formula = formula.replace(' ', '')
self.variables = variables
def get_coefficient(self) -> dict:
coefficients = {}
term = ""
for f in self.formula + ';':
variable_term = re.compile('(\W?[0-9]*)([a-zA-Z]+)')
constant_term = re.compile('(\W?[0-9]+)(\W)')
is_coefficientOne = re.compile('(\W?)([a-zA-Z]+)')
term += f
variable_term = variable_term.match(term)
constant_term = constant_term.match(term)
if variable_term == None and constant_term == None:
continue
elif variable_term != None:
variable = variable_term.group(2)
coefficient = variable_term.group(1)
if is_coefficientOne.match(variable_term.group()):
coefficient += '1'
try:
coefficients[variable] = eval(str(coefficients[variable]) + coefficient)
except KeyError:
coefficients[variable] = int(coefficient)
term = ""
elif constant_term != None:
constant = constant_term.group(1)
try:
coefficients['constant'] = eval(str(coefficients['constant']) + constant)
except KeyError:
coefficients['constant'] = int(constant)
term = constant_term.group(2)
return coefficients
def simplify(self) -> str:
simplified_formula = ""
no_plus_minus = re.compile('[0-9]+')
coefficients = self.get_coefficient()
for variable in coefficients:
coefficient = str(coefficients[variable])
if no_plus_minus.match(coefficient) != None and simplified_formula != '':
coefficient = '+' + coefficient
if variable == 'constant':
simplified_formula += coefficient
else:
simplified_formula += coefficient + variable
return simplified_formula
def define(self, **kwargs) -> int:
formula = self.formula
if kwargs != {}:
self.variables = kwargs
for var in self.variables:
var_value = str(self.variables[var])
formula = formula.replace(var, '*' + var_value)
return eval(formula)
if __name__ == '__main__':
formula = StringCal(formula='2x+3x+1-3+3y',x=1,y=1)
print(formula.define())
| 34.533333 | 93 | 0.534363 |
610e0eab8f95eb15bae16db7592a4d8e41ba691c | 4,116 | ps1 | PowerShell | unit/test/Get-VSTeamVariableGroup.Tests.ps1 | Seekatar/vsteam | 38d2c44ec3ba6cd795f5c2b27a082ef8bdf717ad | [
"MIT"
] | null | null | null | unit/test/Get-VSTeamVariableGroup.Tests.ps1 | Seekatar/vsteam | 38d2c44ec3ba6cd795f5c2b27a082ef8bdf717ad | [
"MIT"
] | null | null | null | unit/test/Get-VSTeamVariableGroup.Tests.ps1 | Seekatar/vsteam | 38d2c44ec3ba6cd795f5c2b27a082ef8bdf717ad | [
"MIT"
] | null | null | null | Set-StrictMode -Version Latest
Describe 'VSTeamVariableGroup' {
BeforeAll {
$sut = (Split-Path -Leaf $PSCommandPath).Replace(".Tests.", ".")
. "$PSScriptRoot/../../Source/Classes/VSTeamVersions.ps1"
. "$PSScriptRoot/../../Source/Classes/VSTeamProjectCache.ps1"
. "$PSScriptRoot/../../Source/Classes/ProjectCompleter.ps1"
. "$PSScriptRoot/../../Source/Classes/ProjectValidateAttribute.ps1"
. "$PSScriptRoot/../../Source/Private/applyTypes.ps1"
. "$PSScriptRoot/../../Source/Private/common.ps1"
. "$PSScriptRoot/../../Source/Public/Set-VSTeamAPIVersion.ps1"
. "$PSScriptRoot/../../Source/Public/$sut"
# Mock the call to Get-Projects by the dynamic parameter for ProjectName
Mock Invoke-RestMethod { return @() } -ParameterFilter { $Uri -like "*_apis/project*" }
Mock _getApiVersion { return '1.0-unitTests' } -ParameterFilter { $Service -eq 'VariableGroups' }
}
Context 'Get-VSTeamVariableGroup' {
Context 'Services' {
BeforeAll {
$sampleFileVSTS = $(Get-Content "$PSScriptRoot\sampleFiles\variableGroupSamples.json" | ConvertFrom-Json)
Mock _getApiVersion { return 'VSTS' }
Mock _getInstance { return 'https://dev.azure.com/test' }
Mock Invoke-RestMethod { return $sampleFileVSTS }
Mock Invoke-RestMethod { return $sampleFileVSTS.value[0] } -ParameterFilter { $Uri -like "*101*" }
}
It 'list should return all variable groups' {
Get-VSTeamVariableGroup -projectName project
Should -Invoke Invoke-RestMethod -Exactly -Scope It -Times 1 -ParameterFilter {
$Uri -eq "https://dev.azure.com/test/project/_apis/distributedtask/variablegroups?api-version=$(_getApiVersion VariableGroups)"
}
}
It 'by Id should return one variable group' {
$projectID = 101
Get-VSTeamVariableGroup -projectName project -id $projectID
Should -Invoke Invoke-RestMethod -Exactly -Scope It -Times 1 -ParameterFilter {
$Uri -eq "https://dev.azure.com/test/project/_apis/distributedtask/variablegroups/$($projectID)?api-version=$(_getApiVersion VariableGroups)"
}
}
}
Context 'Server' {
BeforeAll {
$sampleFile2017 = $(Get-Content "$PSScriptRoot\sampleFiles\variableGroupSamples2017.json" | ConvertFrom-Json)
Mock _getApiVersion { return 'TFS2017' }
Mock _getInstance { return 'http://localhost:8080/tfs/defaultcollection' } -Verifiable
Mock Invoke-RestMethod { return $sampleFile2017 }
Mock Invoke-RestMethod { return $sampleFile2017.value[0] } -ParameterFilter { $Uri -like "*101*" }
}
It 'list should return all variable groups' {
Get-VSTeamVariableGroup -projectName project
Should -Invoke Invoke-RestMethod -Exactly -Scope It -Times 1 -ParameterFilter {
$Uri -eq "http://localhost:8080/tfs/defaultcollection/project/_apis/distributedtask/variablegroups?api-version=$(_getApiVersion VariableGroups)"
}
}
It 'by Id should return one variable group' {
$projectID = 101
Get-VSTeamVariableGroup -projectName project -id $projectID
Should -Invoke Invoke-RestMethod -Exactly -Scope It -Times 1 -ParameterFilter {
$Uri -eq "http://localhost:8080/tfs/defaultcollection/project/_apis/distributedtask/variablegroups/$($projectID)?api-version=$(_getApiVersion VariableGroups)"
}
}
It 'by name should return one variable group' {
$varGroupName = "TestVariableGroup1"
Get-VSTeamVariableGroup -projectName project -Name $varGroupName
Should -Invoke Invoke-RestMethod -Exactly -Scope It -Times 1 -ParameterFilter {
$Uri -eq "http://localhost:8080/tfs/defaultcollection/project/_apis/distributedtask/variablegroups?api-version=$(_getApiVersion VariableGroups)&groupName=$varGroupName"
}
}
}
}
} | 45.230769 | 183 | 0.645773 |
0d2f08cd9c97594982dc87148cf4927fb16c086b | 23,643 | lua | Lua | luada.lua | ousttrue/luada | 7ae8e114d233c61b687080e404212753796c3458 | [
"MIT"
] | null | null | null | luada.lua | ousttrue/luada | 7ae8e114d233c61b687080e404212753796c3458 | [
"MIT"
] | null | null | null | luada.lua | ousttrue/luada | 7ae8e114d233c61b687080e404212753796c3458 | [
"MIT"
] | null | null | null | -- https://gist.github.com/tylerneylon/59f4bcf316be525b30ab
--[[ json.lua
A compact pure-Lua JSON library.
The main functions are: json.stringify, json.parse.
## json.stringify:
This expects the following to be true of any tables being encoded:
* They only have string or number keys. Number keys must be represented as
strings in json; this is part of the json spec.
* They are not recursive. Such a structure cannot be specified in json.
A Lua table is considered to be an array if and only if its set of keys is a
consecutive sequence of positive integers starting at 1. Arrays are encoded like
so: `[2, 3, false, "hi"]`. Any other type of Lua table is encoded as a json
object, encoded like so: `{"key1": 2, "key2": false}`.
Because the Lua nil value cannot be a key, and as a table value is considerd
equivalent to a missing key, there is no way to express the json "null" value in
a Lua table. The only way this will output "null" is if your entire input obj is
nil itself.
An empty Lua table, {}, could be considered either a json object or array -
it's an ambiguous edge case. We choose to treat this as an object as it is the
more general type.
To be clear, none of the above considerations is a limitation of this code.
Rather, it is what we get when we completely observe the json specification for
as arbitrary a Lua object as json is capable of expressing.
## json.parse:
This function parses json, with the exception that it does not pay attention to
\u-escaped unicode code points in strings.
It is difficult for Lua to return null as a value. In order to prevent the loss
of keys with a null value in a json string, this function uses the one-off
table value json.null (which is just an empty table) to indicate null values.
This way you can check if a value is null with the conditional
`val == json.null`.
If you have control over the data and are using Lua, I would recommend just
avoiding null values in your data to begin with.
--]]
local json = {}
-- Internal functions.
local function kind_of(obj)
if type(obj) ~= "table" then
return type(obj)
end
local i = 1
for _ in pairs(obj) do
if obj[i] ~= nil then
i = i + 1
else
return "table"
end
end
if i == 1 then
return "table"
else
return "array"
end
end
local function escape_str(s)
local in_char = { "\\", '"', "/", "\b", "\f", "\n", "\r", "\t" }
local out_char = { "\\", '"', "/", "b", "f", "n", "r", "t" }
for i, c in ipairs(in_char) do
s = s:gsub(c, "\\" .. out_char[i])
end
return s
end
-- Returns pos, did_find; there are two cases:
-- 1. Delimiter found: pos = pos after leading space + delim; did_find = true.
-- 2. Delimiter not found: pos = pos after leading space; did_find = false.
-- This throws an error if err_if_missing is true and the delim is not found.
local function skip_delim(str, pos, delim, err_if_missing)
pos = pos + #str:match("^%s*", pos)
if str:sub(pos, pos) ~= delim then
if err_if_missing then
error("Expected " .. delim .. " near position " .. pos)
end
return pos, false
end
return pos + 1, true
end
-- Expects the given pos to be the first character after the opening quote.
-- Returns val, pos; the returned pos is after the closing quote character.
local function parse_str_val(str, pos, val)
val = val or ""
local early_end_error = "End of input found while parsing string."
if pos > #str then
error(early_end_error)
end
local c = str:sub(pos, pos)
if c == '"' then
return val, pos + 1
end
if c ~= "\\" then
return parse_str_val(str, pos + 1, val .. c)
end
-- We must have a \ character.
local esc_map = { b = "\b", f = "\f", n = "\n", r = "\r", t = "\t" }
local nextc = str:sub(pos + 1, pos + 1)
if not nextc then
error(early_end_error)
end
return parse_str_val(str, pos + 2, val .. (esc_map[nextc] or nextc))
end
-- Returns val, pos; the returned pos is after the number's final character.
local function parse_num_val(str, pos)
local num_str = str:match("^-?%d+%.?%d*[eE]?[+-]?%d*", pos)
local val = tonumber(num_str)
if not val then
error("Error parsing number at position " .. pos .. ".")
end
return val, pos + #num_str
end
-- Public values and functions.
function json.stringify(obj, as_key)
local s = {} -- We'll build the string as an array of strings to be concatenated.
local kind = kind_of(obj) -- This is 'array' if it's an array or type(obj) otherwise.
if kind == "array" then
if as_key then
error("Can't encode array as key.")
end
s[#s + 1] = "["
for i, val in ipairs(obj) do
if i > 1 then
s[#s + 1] = ", "
end
s[#s + 1] = json.stringify(val)
end
s[#s + 1] = "]"
elseif kind == "table" then
if as_key then
error("Can't encode table as key.")
end
s[#s + 1] = "{"
for k, v in pairs(obj) do
if #s > 1 then
s[#s + 1] = ", "
end
s[#s + 1] = json.stringify(k, true)
s[#s + 1] = ":"
s[#s + 1] = json.stringify(v)
end
s[#s + 1] = "}"
elseif kind == "string" then
return '"' .. escape_str(obj) .. '"'
elseif kind == "number" then
if as_key then
return '"' .. tostring(obj) .. '"'
end
return tostring(obj)
elseif kind == "boolean" then
return tostring(obj)
elseif kind == "nil" then
return "null"
else
error("Unjsonifiable type: " .. kind .. ".")
end
return table.concat(s)
end
json.null = {} -- This is a one-off table to represent the null value.
function json.parse(str, pos, end_delim)
pos = pos or 1
if pos > #str then
error("Reached unexpected end of input.")
end
local pos = pos + #str:match("^%s*", pos) -- Skip whitespace.
local first = str:sub(pos, pos)
if first == "{" then -- Parse an object.
local obj, key, delim_found = {}, true, true
pos = pos + 1
while true do
key, pos = json.parse(str, pos, "}")
if key == nil then
return obj, pos
end
if not delim_found then
error("Comma missing between object items.")
end
pos = skip_delim(str, pos, ":", true) -- true -> error if missing.
obj[key], pos = json.parse(str, pos)
pos, delim_found = skip_delim(str, pos, ",")
end
elseif first == "[" then -- Parse an array.
local arr, val, delim_found = {}, true, true
pos = pos + 1
while true do
val, pos = json.parse(str, pos, "]")
if val == nil then
return arr, pos
end
if not delim_found then
error("Comma missing between array items.")
end
arr[#arr + 1] = val
pos, delim_found = skip_delim(str, pos, ",")
end
elseif first == '"' then -- Parse a string.
return parse_str_val(str, pos + 1)
elseif first == "-" or first:match("%d") then -- Parse a number.
return parse_num_val(str, pos)
elseif first == end_delim then -- End of an object or array.
return nil, pos + 1
else -- Parse true, false, or null.
local literals = { ["true"] = true, ["false"] = false, ["null"] = json.null }
for lit_str, lit_val in pairs(literals) do
local lit_end = pos + #lit_str - 1
if str:sub(pos, lit_end) == lit_str then
return lit_val, lit_end + 1
end
end
local pos_info_str = "position " .. pos .. ": " .. str:sub(pos, pos + 10)
error("Invalid json syntax starting at " .. pos_info_str)
end
end
------------------------------------------------------------------------------
--
-- lua Debug Adapter
--
-- https://microsoft.github.io/debug-adapter-protocol/specification
--
-- # message format(JSON-RPC)
-- Content-Length: length\r\n
-- \r\n
-- byte[length]
------------------------------------------------------------------------------
local args = { ... }
local W
local function logger(...)
if W then
W:write(string.format(...))
W:write("\n")
end
end
for i, arg in ipairs(args) do
if arg == "--DEBUG" then
W = io.open("luada.log", "ab")
end
end
---@param src string
---@return string
local function normalize_path(src)
local drive, path = src:match("^(%w:)(.*)")
if not drive then
drive = ""
path = src
end
return drive:lower() .. path:gsub("/", "\\")
end
---@class Breakpoint
---@field id number
---@field source any
---@field line number
---@field verified boolean
local Breakpoint = {
__tostring = function(self)
return string.format("<BreakPoint %d: %s:%d, %s>", self.id, self.source.path, self.line, self.verified)
end,
}
Breakpoint.new = function(id, source, line, verified)
local instance = {
id = id,
source = {
path = source,
},
line = line,
verified = verified,
}
Breakpoint.__index = Breakpoint
setmetatable(instance, Breakpoint)
return instance
end
---@class DA
---@field input file*
---@field output file*
---@field next_seq number
---@field queue any[]
---@field running_stack boolean[]
---@field breakpoints Breakpoint[]
---@field next_breakpoint_id number
local DA = {
enqueue = function(self, action)
table.insert(self.queue, action)
end,
add_breakpoint = function(self, source, line)
local match = self:match_breakpoint(source, line)
if match then
return Breakpoint.new(match.id, match.source.path, match.line, false)
end
local bp = Breakpoint.new(self.next_breakpoint_id, source, line, true)
self.next_breakpoint_id = self.next_breakpoint_id + 1
table.insert(self.breakpoints, bp)
return bp
end,
match_breakpoint = function(self, source, line)
for i, b in ipairs(self.breakpoints) do
self:send_message("output", {
category = "console",
output = string.format("#%s:%d <=> %s:%d#", b.source.path, b.line, source, line),
})
if b.line == line then
if b.source.path == source then
-- match
return b
end
end
end
end,
new_message = function(self, msg_type)
local msg = {
seq = self.next_seq,
type = msg_type,
}
self.next_seq = self.next_seq + 1
return msg
end,
new_response = function(self, seq, command, body)
local response = self:new_message("response")
response["success"] = true
response["request_seq"] = seq
response["command"] = command
if body then
response["body"] = body
end
return response
end,
new_event = function(self, event_name, body)
local event = {
type = "event",
event = event_name,
}
if body then
event.body = body
end
return event
end,
send_event = function(self, event_name, body)
local event = self:new_event(event_name, body)
self:send_message(event)
end,
push_frame = function(self, stack_level, frame, variables)
local stackframe = {
id = stack_level,
name = frame.name,
line = frame.currentline,
column = 1,
}
if type(frame.source) == "string" and frame.source:sub(1, 1) == "@" then
stackframe.source = {
path = frame.source:sub(2),
}
end
table.insert(self.stackframes, stackframe)
local scopes = {}
-- local
table.insert(scopes, {
name = "Locals",
presentationHint = "locals",
variablesReference = #self.variables + 1,
expensive = false,
})
table.insert(self.variables, variables)
-- upvalues
-- globals
self.scope = {
[stack_level] = scopes,
}
end,
--
-- debug.xxx 関数はこの関数内で呼ぶべし。他の関数に入ると stack_level を足す必要がある。
--
on_hook = function(self, stack_level, line)
-- hook_frame
local hook_frame = debug.getinfo(stack_level, "nSluf")
if hook_frame.source:sub(-#self.name) == self.name then
-- skip debugger code
return
end
local source = hook_frame.source
if source:sub(1, 1) ~= "@" then
return
end
source = source:sub(2)
local match
if self.next then
self:send_event("output", {
category = "console",
output = "next!\n",
})
self.next = false
else
match = self:match_breakpoint(source, line)
if not match then
-- not break
return
end
-- hit breakpoint
local s = ""
for k, v in pairs(hook_frame) do
s = s.. string.format(", %s=%s", k, v)
end
self:send_event("output", {
category = "console",
output = string.format("[luada]break {%s} %s:%d == %s\n", s, source, line, match),
})
end
-- clear
self.stackframes = {}
self.scope = {}
self.variables = {}
-- top
do
local variables = {}
local i = 1
while true do
local k, v = debug.getlocal(stack_level, i)
if not k then
break
end
-- io.stderr:write(string.format("(%q)[%q = %q]", stack_level, k, v))
i = i + 1
if k ~= "(*temporary)" then
table.insert(variables, {
variablesReference = 0,
name = k,
value = tostring(v),
type = type(v),
})
end
end
self:push_frame(stack_level, hook_frame, variables)
stack_level = stack_level + 1
end
-- frames
while true do
local frame = debug.getinfo(stack_level, "nSluf")
if not frame then
break
end
if frame.source:sub(-#self.name) == self.name then
-- skip debugger code
break
end
local variables = {}
local i = 1
while true do
local k, v = debug.getlocal(stack_level, i)
if not k then
break
end
-- io.stderr:write(string.format("(%q)[%q = %q]", stack_level, k, v))
i = i + 1
table.insert(variables, {
name = k,
value = v,
})
end
self:push_frame(stack_level, frame, variables)
stack_level = stack_level + 1
end
-- stacktrace & scpopes
if match then
self:send_event("stopped", {
reason = "breakpoint",
threadId = 0,
hitBreakpointIds = { match.id },
})
else
self:send_event("stopped", {
reason = "step",
threadId = 0,
})
end
-- start nested loop
io.stderr:write("[!yield!]\n")
table.insert(self.running_stack, true)
self:loop()
end,
launch = function(self)
local chunk = loadfile(self.debugee.program)
setfenv(chunk, {
print = function(...)
local msg = ""
for i, x in ipairs({ ... }) do
if i > 1 then
msg = msg .. ", "
end
msg = msg .. string.format("%q", x)
end
self:send_event("output", {
category = "stdout",
output = msg,
})
end,
})
debug.sethook(function(_, line)
-- 3 hook
-- 2 this
-- 1 on_hook
self:on_hook(3, line)
end, "l")
-- run
self:send_event("output", {
category = "console",
output = string.format("[luada]LAUNCH: %s...\n", self.debugee.program)
})
local rc
local success, err = xpcall(function()
rc = chunk(unpack(self.debugee.args))
end, function(err) end)
if success then
self:send_event("output", {
category = "console",
output = "[luada]EXIT\n",
})
-- exit
self.running_stack[#self.running_stack] = false
self:send_event("exited", {
exitCode = rc or 0,
})
else
self:send_event("output", {
category = "console",
output = string.format("[luada]%q\n", err),
})
end
end,
------------------------------------------------------------------------------
-- https://microsoft.github.io/debug-adapter-protocol/specification#Requests_Initialize
-- https://microsoft.github.io/debug-adapter-protocol/specification#Requests_Launch
-- https://microsoft.github.io/debug-adapter-protocol/specification#Requests_SetBreakpoints
------------------------------------------------------------------------------
on_request = function(self, parsed)
if parsed.command == "initialize" then
self:enqueue(function()
self:send_event("initialized")
end)
return self:new_response(parsed.seq, parsed.command, {
supportsConfigurationDoneRequest = true,
supportsVariableType = true,
})
elseif parsed.command == "launch" then
self.debugee = {
program = normalize_path(parsed.arguments.program),
args = parsed.arguments.args,
}
return self:new_response(parsed.seq, parsed.command)
elseif parsed.command == "setBreakpoints" then
local breakpoints = {}
for i, b in ipairs(parsed.arguments.breakpoints) do
local created = self:add_breakpoint(parsed.arguments.source.path, b.line)
self:send_event("output", {
category = "console",
output = string.format("created: %s\n", created),
})
if created then
table.insert(breakpoints, created)
end
end
return self:new_response(parsed.seq, parsed.command, {
breakpoints = breakpoints,
})
elseif parsed.command == "configurationDone" then
self:enqueue(function()
self:launch()
end)
return self:new_response(parsed.seq, parsed.command)
elseif parsed.command == "threads" then
return self:new_response(parsed.seq, parsed.command, {
threads = {
{
id = 0,
name = "main",
},
},
})
elseif parsed.command == "stackTrace" then
return self:new_response(parsed.seq, parsed.command, {
stackFrames = self.stackframes,
})
elseif parsed.command == "scopes" then
return self:new_response(parsed.seq, parsed.command, {
scopes = self.scope[parsed.arguments.frameId],
})
elseif parsed.command == "variables" then
return self:new_response(parsed.seq, parsed.command, {
variables = self.variables[parsed.arguments.variablesReference],
})
elseif parsed.command == "continue" then
self.running_stack[#self.running_stack] = false
return self:new_response(parsed.seq, parsed.command)
elseif parsed.command == "next" then
self.next = true
self.running_stack[#self.running_stack] = false
return self:new_response(parsed.seq, parsed.command)
else
error(string.format("unknown command: %q", parsed))
end
end,
on_message = function(self, parsed)
if parsed.type == "request" then
return self:on_request(parsed)
else
error(string.format("unknown type: %q", parsed))
end
end,
send_message = function(self, message)
local encoded = json.stringify(message)
logger("<= %q", encoded)
if encoded:find("\n") then
error("contain LF")
end
local encoded_length = string.len(encoded)
local msg = string.format("Content-Length: %d", encoded_length)
if package.config:sub(1, 1) == "\\" then
-- windows
msg = msg .. "\n\n"
else
msg = msg .. "\r\n\r\n"
end
msg = msg .. encoded
self.output:write(msg)
self.output:flush()
end,
process_message = function(self)
-- dequeue
while #self.queue > 0 do
local action = table.remove(self.queue, 1)
action()
end
-- read
local l = self.input:read("*l")
local m = string.match(l, "Content%-Length: (%d+)")
local length = tonumber(m)
self.input:read("*l") -- skip empty line
local body = self.input:read(length)
logger("=> %q", body)
local parsed = json.parse(body)
local response = self:on_message(parsed)
if response then
self:send_message(response)
end
end,
loop = function(self)
while self.running_stack[#self.running_stack] do
self:process_message()
end
table.remove(self.running_stack)
end,
}
DA.new = function()
local instance = {
name = "luada.lua",
input = io.stdin,
output = io.stdout,
next_seq = 0,
queue = {},
running_stack = { true },
breakpoints = {},
next_breakpoint_id = 1,
}
DA.__index = DA
setmetatable(instance, DA)
return instance
end
io.stdout:setvbuf("no", 0)
io.stderr:setvbuf("no", 0)
local da = DA.new()
da:loop()
if W then
io.close(W)
end
| 32.255116 | 112 | 0.508607 |
2faba2a3ace5d27d68b3ef0187a709114deac79f | 2,411 | py | Python | pytoda/datasets/tests/test_distributional_dataset.py | PaccMann/paccmann_datasets | 0cb0cee349ffab8e227f09f7df0a8bca6a71f22e | [
"MIT"
] | 14 | 2019-11-01T12:45:56.000Z | 2022-03-11T15:38:31.000Z | pytoda/datasets/tests/test_distributional_dataset.py | PaccMann/paccmann_datasets | 0cb0cee349ffab8e227f09f7df0a8bca6a71f22e | [
"MIT"
] | 74 | 2019-11-12T19:36:27.000Z | 2022-02-28T08:19:37.000Z | pytoda/datasets/tests/test_distributional_dataset.py | PaccMann/paccmann_datasets | 0cb0cee349ffab8e227f09f7df0a8bca6a71f22e | [
"MIT"
] | 2 | 2021-08-14T11:15:07.000Z | 2021-08-25T06:42:01.000Z | """Testing DistributionalDataset."""
import unittest
import torch
from pytoda.datasets import DistributionalDataset
from pytoda.datasets.utils.factories import DISTRIBUTION_FUNCTION_FACTORY
distribution_types = ['normal', 'uniform']
distribution_args = [{'loc': 0.0, 'scale': 1.0}, {'low': 0.0, 'high': 1.0}]
dataset_sizes = [100, 10000]
item_shapes = [(1, 16), (10, 16)]
seeds = [None, 1, 42]
class TestDistributionalDataset(unittest.TestCase):
"""Test DistributionalDataset class."""
def test__len__(self) -> None:
"""Test __len__."""
for dist_type, dist_args in zip(distribution_types, distribution_args):
distribution_function = DISTRIBUTION_FUNCTION_FACTORY[dist_type](
**dist_args
)
for size in dataset_sizes:
for shape in item_shapes:
for seed in seeds:
dataset = DistributionalDataset(
size,
shape,
distribution_function,
seed=seed,
)
self.assertEqual(len(dataset), size)
def test__getitem__(self) -> None:
"""Test __getitem__."""
for dist_type, dist_args in zip(distribution_types, distribution_args):
distribution_function = DISTRIBUTION_FUNCTION_FACTORY[dist_type](
**dist_args
)
for size in dataset_sizes:
for shape in item_shapes:
for seed in seeds:
dataset = DistributionalDataset(
size,
shape,
distribution_function,
seed=seed,
)
sample1_1 = dataset[42]
sample1_2 = dataset[42]
# Test shapes
self.assertEqual(sample1_1.shape, sample1_2.shape)
self.assertEqual(sample1_1.shape, shape)
# Test content
if seed is None:
self.assertFalse(torch.equal(sample1_1, sample1_2))
else:
self.assertTrue(torch.equal(sample1_1, sample1_2))
if __name__ == '__main__':
unittest.main()
| 35.455882 | 79 | 0.512236 |
39518d5b8f6b46ab40ff852bae78d601b8adfcfa | 4,828 | py | Python | HiDT/adaptive_unet.py | BradleyBrown19/HiDT | 2a9827e8ebd59e6b8caa093dc2cb8664f4042849 | [
"Apache-2.0"
] | 1 | 2020-07-06T06:58:49.000Z | 2020-07-06T06:58:49.000Z | HiDT/adaptive_unet.py | BradleyBrown19/HiDT | 2a9827e8ebd59e6b8caa093dc2cb8664f4042849 | [
"Apache-2.0"
] | 2 | 2020-07-28T05:46:46.000Z | 2022-02-26T08:38:53.000Z | HiDT/adaptive_unet.py | BradleyBrown19/HiDT | 2a9827e8ebd59e6b8caa093dc2cb8664f4042849 | [
"Apache-2.0"
] | 1 | 2021-03-23T15:52:53.000Z | 2021-03-23T15:52:53.000Z | # AUTOGENERATED! DO NOT EDIT! File to edit: AdaptiveUnet.ipynb (unless otherwise specified).
__all__ = ['ContentEncoder', 'StyleEncoder', 'get_adastats', 'AdaIN', 'AdaSkipBlock', 'AdaResBlock', 'Decoder']
# Cell
#export
from fastai import *
from fastai.vision import *
from fastai.callbacks import *
from fastai.utils.mem import *
from fastai.vision.gan import *
from PIL import Image
import numpy as np
import torch
import torch.nn.functional as F
import torch.nn as nn
from torch.utils.data import DataLoader
from torch.utils.data.dataset import TensorDataset
import pdb
from .building_blocks import *
from .data_bunch import *
# Cell
class ContentEncoder(nn.Module):
def __init__(self, ni=3):
super().__init__()
#downsampling
down1 = Conv2dBlock(8, 16, ks=3, stride=2, norm="none", activation="relu")
down2 = Conv2dBlock(32, 64, ks=3, stride=2, norm="none", activation="relu")
res_sizes = [(3,8),(16,16),(16,32),(64,128)]
#four residual blocks
res_blocks = [ResBlock(dim=d[0], dout=d[1]) for d in res_sizes]
#final conv
final = Conv2dBlock(128, 128, ks=3, stride=1)
self.model = nn.Sequential(
res_blocks[0],
down1,
res_blocks[1],
res_blocks[2],
down2,
res_blocks[3],
final
)
#hook activations for skip connections
def hook_fn(mod, inp, out):
self.hooks.append(out)
for res in res_blocks:
res.register_forward_hook(hook_fn)
#Hook outputs, don't need to hook last layer
self.hooks = []
def forward(self, xb):
self.hooks = []
xb = self.model(xb)
return xb, self.hooks
# Cell
class StyleEncoder(nn.Module):
def __init__(self, ni=3, num_down=4, latent_size=3):
super().__init__()
self.down_layers = [
Conv2dBlock(ni if i == 0 else 8*(2**(i-1)), 8*(2**i), ks=3, stride=2, norm="in", activation="relu") for i in range(num_down-1)
] + [Conv2dBlock(8*(2**(num_down-2)), latent_size, ks=3, stride=2, norm="in", activation="relu")]
self.downsampling = nn.Sequential(*self.down_layers)
def forward(self, xb):
down = self.downsampling(xb)
return down.mean(dim=-1).mean(dim=-1)
# Cell
def get_adastats(features):
bs, c = features.shape[:2]
features = features.view(bs, c, -1)
mean = features.mean(dim=2).view(bs,c,1,1)
std = features.var(dim=2).sqrt().view(bs,c,1,1)
return mean, std
# Cell
def AdaIN(content_feat, style_feat):
#calculating channel and batch specific stats
smean, sstd = get_adastats(style_feat)
cmean, cstd = get_adastats(content_feat)
csize = content_feat.size()
norm_content = (content_feat - cmean.expand(csize)) / cstd.expand(csize)
return norm_content * sstd.expand(csize) + smean.expand(csize)
# Cell
class AdaSkipBlock(nn.Module):
def __init__(self, nin, nout):
super().__init__()
self.ada = AdaIN
self.dense = Conv2dBlock(nin*2, nin, ks=3, stride=1)
self.ada_creator = nn.Sequential(
nn.Linear(3, 16),
nn.Linear(16,64),
nn.Linear(64,256),
Lambda(lambda x: x.view(x.shape[0], nin, -1))
)
def forward(self, content, style, hook):
ada_params = self.ada_creator(style)
ada = self.ada(hook, ada_params)
combined = torch.cat([content, ada], dim=1)
return self.dense(combined)
# Cell
class AdaResBlock(nn.Module):
def __init__(self, nin, nout):
super().__init__()
self.ada_block = AdaSkipBlock(nin, nin)
self.res_block = ResBlock(nin, nout)
self.skip = Conv2dBlock(nin, nout, 3, 1, activation="none") if nin != nout else None
def forward(self, content, style, hook):
ada = self.ada_block(content, style, hook)
res = self.res_block(ada)
if self.skip is not None:
content = self.skip(content)
return res + content
# Cell
class Decoder(nn.Module):
def __init__(self):
super().__init__()
#Upsampling blocks
self.up1 = UpBlock(64, 32)
self.up2 = UpBlock(16, 8)
#AdaIN Res Blocks
ada_sizes = [(128, 128), (128, 64), (32, 16), (16,16), (8,3)]
self.ada_skip_blocks = [
AdaResBlock(d[0], d[1]) for d in ada_sizes
]
def forward(self, xb, style, hooks):
xb = self.ada_skip_blocks[0](xb, style, xb)
xb = self.ada_skip_blocks[1](xb, style, hooks[3])
xb = self.up1(xb)
xb = self.ada_skip_blocks[2](xb, style, hooks[2])
xb = self.ada_skip_blocks[3](xb, style, hooks[1])
xb = self.up2(xb)
xb = self.ada_skip_blocks[4](xb, style, hooks[0])
return xb
| 27.588571 | 138 | 0.606048 |
e7571aa8de0f37772a3c2c06d5d66cbfeb18546d | 1,585 | php | PHP | phpmyadmin1/libraries/properties/options/groups/OptionsPropertySubgroup.php | Marudi/prattle | b4fece0a6e302282060bbd5153dcafd66be138ee | [
"MIT"
] | 32 | 2021-03-03T14:05:30.000Z | 2022-02-21T18:45:06.000Z | phpmyadmin1/libraries/properties/options/groups/OptionsPropertySubgroup.php | Marudi/prattle | b4fece0a6e302282060bbd5153dcafd66be138ee | [
"MIT"
] | 26 | 2021-08-30T01:41:08.000Z | 2022-03-21T02:11:11.000Z | phpmyadmin1/libraries/properties/options/groups/OptionsPropertySubgroup.php | Marudi/prattle | b4fece0a6e302282060bbd5153dcafd66be138ee | [
"MIT"
] | 28 | 2018-04-15T15:57:41.000Z | 2020-03-06T12:49:39.000Z | <?php
/* vim: set expandtab sw=4 ts=4 sts=4: */
/**
* Holds the PMA\libraries\properties\options\groups\OptionsPropertySubgroup class
*
* @package PhpMyAdmin
*/
namespace PMA\libraries\properties\options\groups;
use PMA\libraries\properties\options\OptionsPropertyGroup;
/**
* Group property item class of type subgroup
*
* @package PhpMyAdmin
*/
class OptionsPropertySubgroup extends OptionsPropertyGroup
{
/**
* Subgroup Header
*
* @var string
*/
private $_subgroupHeader;
/* ~~~~~~~~~~~~~~~~~~~~ Getters and Setters ~~~~~~~~~~~~~~~~~~~~ */
/**
* Returns the property item type of either an instance of
* - PMA\libraries\properties\options\OptionsPropertyOneItem ( f.e. "bool",
* "text", "radio", etc ) or
* - PMA\libraries\properties\options\OptionsPropertyGroup ( "root", "main"
* or "subgroup" )
* - PMA\libraries\properties\plugins\PluginPropertyItem ( "export", "import", "transformations" )
*
* @return string
*/
public function getItemType()
{
return "subgroup";
}
/**
* Gets the subgroup header
*
* @return \PMA\libraries\properties\PropertyItem
*/
public function getSubgroupHeader()
{
return $this->_subgroupHeader;
}
/**
* Sets the subgroup header
*
* @param \PMA\libraries\properties\PropertyItem $subgroupHeader subgroup header
*
* @return void
*/
public function setSubgroupHeader($subgroupHeader)
{
$this->_subgroupHeader = $subgroupHeader;
}
}
| 24.765625 | 107 | 0.62082 |
25425922531f10a1402df93bbe3bba93354bc89a | 917 | js | JavaScript | src/components/pages/Gameification/SubmissionsGallery/SubmissionPage.js | Lambda-School-Labs/story-squad-fe-a | 40d89d7da6c2ed30768258310b750c8aa496c8ea | [
"MIT"
] | 4 | 2021-02-16T22:05:13.000Z | 2021-05-04T01:33:11.000Z | src/components/pages/Gameification/SubmissionsGallery/SubmissionPage.js | Lambda-School-Labs/story-squad-fe | 9d8888100099ca72354f65f0723a1e1ca8dc164d | [
"MIT"
] | 67 | 2019-12-17T18:03:26.000Z | 2021-06-22T01:31:44.000Z | src/components/pages/Gameification/SubmissionsGallery/SubmissionPage.js | Lambda-School-Labs/story-squad-fe | 9d8888100099ca72354f65f0723a1e1ca8dc164d | [
"MIT"
] | 24 | 2020-03-01T21:33:18.000Z | 2021-07-10T02:12:16.000Z | import React, { useEffect, useState } from 'react';
import SubmissionGroups from './SubmissionGroups';
export default function SubmissionPage() {
// This will get all the submissions per episode
const [submissions, setSubmissions] = useState([]);
useEffect(() => {
// Use temp data for now
const tempSubmissions = [
{
ID: 1,
storyID: 1,
},
{
ID: 2,
storyID: 2,
},
];
setSubmissions(tempSubmissions);
}, []);
return (
<div id="submission-gallery">
<div className="inner-container">
<div className="heading">
<h2>Submission Gallery</h2>
</div>
<div className="gallery">
{submissions.map(submission => {
return (
<SubmissionGroups key={submission.ID} submission={submission} />
);
})}
</div>
</div>
</div>
);
}
| 21.833333 | 78 | 0.537623 |
c39c3255f78a05044323f0c112299f5e94a2ee10 | 121 | cs | C# | TanmaNabu/GameLogic/Game/GameEntity.cs | kubagdynia/TanmaNabu | edbadd7cddc7de0c651190307741e4088d987f4a | [
"MIT"
] | null | null | null | TanmaNabu/GameLogic/Game/GameEntity.cs | kubagdynia/TanmaNabu | edbadd7cddc7de0c651190307741e4088d987f4a | [
"MIT"
] | null | null | null | TanmaNabu/GameLogic/Game/GameEntity.cs | kubagdynia/TanmaNabu | edbadd7cddc7de0c651190307741e4088d987f4a | [
"MIT"
] | null | null | null | using Entitas;
namespace TanmaNabu.GameLogic.Game
{
public sealed partial class GameEntity : Entity
{
}
}
| 12.1 | 51 | 0.68595 |
b75aca774be3716425005322431cf3e8ac1ff06e | 215 | cs | C# | src/Lykke.Job.BlockchainCashoutProcessor.Core/Domain/RiskControl/CashoutRiskControlState.cs | LykkeCity/Lykke.Job.BlockchainCashoutProcessor | f760d08d4f0e386245f387850ba5abe09aad4f72 | [
"MIT"
] | 1 | 2019-03-25T18:07:28.000Z | 2019-03-25T18:07:28.000Z | src/Lykke.Job.BlockchainCashoutProcessor.Core/Domain/RiskControl/CashoutRiskControlState.cs | LykkeCity/Lykke.Job.BlockchainCashoutProcessor | f760d08d4f0e386245f387850ba5abe09aad4f72 | [
"MIT"
] | 1 | 2018-07-18T12:33:53.000Z | 2018-07-18T12:33:53.000Z | src/Lykke.Job.BlockchainCashoutProcessor.Core/Domain/RiskControl/CashoutRiskControlState.cs | LykkeCity/Lykke.Job.BlockchainCashoutProcessor | f760d08d4f0e386245f387850ba5abe09aad4f72 | [
"MIT"
] | 1 | 2021-03-09T05:55:38.000Z | 2021-03-09T05:55:38.000Z | namespace Lykke.Job.BlockchainCashoutProcessor.Core.Domain.RiskControl
{
public enum CashoutRiskControlState
{
Created,
Started,
OperationAccepted,
OperationRejected
}
}
| 19.545455 | 71 | 0.674419 |
6b1916a389b31ecb33020ed713938947e4231a01 | 1,207 | js | JavaScript | assets/js/containers/Home/Home.js | jpichon21/crij-portail | 889339af7610c3112be4248948649044ae328480 | [
"MIT"
] | null | null | null | assets/js/containers/Home/Home.js | jpichon21/crij-portail | 889339af7610c3112be4248948649044ae328480 | [
"MIT"
] | null | null | null | assets/js/containers/Home/Home.js | jpichon21/crij-portail | 889339af7610c3112be4248948649044ae328480 | [
"MIT"
] | null | null | null | import React from 'react'
import { connect } from 'react-redux'
import Header from '../../components/Header/Header'
import Slider from '../../components/Slider/Slider'
import Tile from '../../components/Tile/Tile'
import InfoUrl from '../../components/InfoUrl/InfoUrl'
import Footer from '../../components/Footer/Footer'
import * as Sample from '../../Sample'
export class Home extends React.Component {
constructor (props) {
super(props)
this.state = {
news: Sample.news,
categories: Sample.categories,
infoUrl: Sample.infoUrl
}
}
render () {
return (
<div id={'home'}>
<Header />
<div className={'box'}>
<Slider className={'slider'} items={this.state.news}>
<div className={'content'}>
{
this.state.categories.map((tile, index) => (
<Tile key={index} item={tile} />
))
}
<div className={'search'}><input type={'text'} placeholder={'Rechercher'} /></div>
</div>
</Slider>
</div>
<InfoUrl />
<Footer />
</div>
)
}
}
require('./Home.scss')
export default connect()(Home)
| 26.822222 | 96 | 0.548467 |
142266ca5ad86d992df5d44eff672fac8aeaa54b | 688 | ts | TypeScript | packages/laravel-kodyfire/src/index.ts | nooqta/kodyfire | ba5dde350f1e4b776efee056e06a047913e96907 | [
"MIT"
] | 1 | 2022-02-03T09:11:40.000Z | 2022-02-03T09:11:40.000Z | packages/laravel-kodyfire/src/index.ts | nooqta/kodyfire | ba5dde350f1e4b776efee056e06a047913e96907 | [
"MIT"
] | 4 | 2022-02-23T22:45:41.000Z | 2022-02-24T06:36:30.000Z | packages/laravel-kodyfire/src/index.ts | nooqta/kodyfire | ba5dde350f1e4b776efee056e06a047913e96907 | [
"MIT"
] | null | null | null | export { Concept } from './concepts/concept';
export { Kernel } from './concepts/kernel';
export { Controller } from './concepts/controller';
export { Model } from './concepts/model';
export { Request } from './concepts/request';
export { Repository } from './concepts/repository';
export { Migration } from './concepts/migration';
export { Api } from './concepts/api';
export { Web } from './concepts/web';
export { Factory } from './concepts/factory';
export { Seed } from './concepts/seed';
export { DatabaseSeed } from './concepts/databaseSeed';
export { Auth } from './concepts/auth';
export { Dependency } from './concepts/dependency';
export { Databag } from './concepts/databag';
| 43 | 55 | 0.694767 |
2fbb813247c72ac96b54ffa884030f958a75f82b | 130 | py | Python | src/udsxmlrpc/__init__.py | daizhaolin/udsxmlrpc | 1f16ce8029e0bd68b08ad02119ca5bcec61971dd | [
"BSD-3-Clause"
] | 1 | 2020-01-15T08:53:53.000Z | 2020-01-15T08:53:53.000Z | src/udsxmlrpc/__init__.py | daizhaolin/udsxmlrpc | 1f16ce8029e0bd68b08ad02119ca5bcec61971dd | [
"BSD-3-Clause"
] | null | null | null | src/udsxmlrpc/__init__.py | daizhaolin/udsxmlrpc | 1f16ce8029e0bd68b08ad02119ca5bcec61971dd | [
"BSD-3-Clause"
] | null | null | null | # -*- coding: UTF-8 -*-
'''
Created on 2020-01-13
@author: daizhaolin
'''
from .server import Server
from .client import Client
| 13 | 26 | 0.669231 |
2cddcd8889216dde8e8197eab76a84f25b0bdbe1 | 410 | hpp | C++ | library/ATF/stdext__hash_compare.hpp | lemkova/Yorozuya | f445d800078d9aba5de28f122cedfa03f26a38e4 | [
"MIT"
] | 29 | 2017-07-01T23:08:31.000Z | 2022-02-19T10:22:45.000Z | library/ATF/stdext__hash_compare.hpp | kotopes/Yorozuya | 605c97d3a627a8f6545cc09f2a1b0a8afdedd33a | [
"MIT"
] | 90 | 2017-10-18T21:24:51.000Z | 2019-06-06T02:30:33.000Z | library/ATF/stdext__hash_compare.hpp | kotopes/Yorozuya | 605c97d3a627a8f6545cc09f2a1b0a8afdedd33a | [
"MIT"
] | 44 | 2017-12-19T08:02:59.000Z | 2022-02-24T23:15:01.000Z | // This file auto generated by plugin for ida pro. Generated code only for x64. Please, dont change manually
#pragma once
#include <common/common.h>
#include <std__less.hpp>
START_ATF_NAMESPACE
namespace stdext
{
template<typename _Ty, typename _Less = std::less<_Ty>>
struct hash_compare
{
_Less comp;
};
}; // end namespace stdext
END_ATF_NAMESPACE
| 22.777778 | 108 | 0.663415 |
a3a1b64234a25f3501187caaa9ee5d64d0e955f7 | 147 | sql | SQL | Benchmarks/queries/flights/Q017.sql | dr-pain/omniscidb | 7bf56492aa7cf83ea0ca190207619bec93aac768 | [
"Apache-2.0"
] | 868 | 2019-05-14T22:11:17.000Z | 2022-02-28T09:15:23.000Z | Benchmarks/queries/flights/Q017.sql | dr-pain/omniscidb | 7bf56492aa7cf83ea0ca190207619bec93aac768 | [
"Apache-2.0"
] | 327 | 2019-05-16T18:07:57.000Z | 2022-02-26T09:34:04.000Z | Benchmarks/queries/flights/Q017.sql | dr-pain/omniscidb | 7bf56492aa7cf83ea0ca190207619bec93aac768 | [
"Apache-2.0"
] | 166 | 2019-05-22T11:17:10.000Z | 2022-02-26T06:58:45.000Z | select
origin_name,
dest_name,
avg(arrdelay),
avg(depdelay),
avg(arrdelay + depdelay)
from
##TAB##
group by
origin_name,
dest_name
| 12.25 | 26 | 0.687075 |
85865df80f450e0cb19b0ea4fdd0f331b3da42ec | 1,777 | swift | Swift | Sources/Constants/MIDIInterval.swift | oettam/Gong | 554859c13a34c5a5779111d0dc268b9e427eeba5 | [
"MIT"
] | 67 | 2017-04-30T01:07:20.000Z | 2022-02-03T00:09:50.000Z | Sources/Constants/MIDIInterval.swift | oettam/Gong | 554859c13a34c5a5779111d0dc268b9e427eeba5 | [
"MIT"
] | 10 | 2017-06-14T18:39:38.000Z | 2021-12-16T13:03:45.000Z | Sources/Constants/MIDIInterval.swift | oettam/Gong | 554859c13a34c5a5779111d0dc268b9e427eeba5 | [
"MIT"
] | 18 | 2017-05-18T03:13:00.000Z | 2022-02-09T19:08:53.000Z | //
// MIDIInterval.swift
// Gong
//
// Created by Daniel Clelland on 7/10/17.
// Copyright © 2017 Daniel Clelland. All rights reserved.
//
import Foundation
public let perfectUnison = 0
public let minorSecond = 1
public let majorSecond = 2
public let minorThird = 3
public let majorThird = 4
public let perfectFourth = 5
public let perfectFifth = 7
public let minorSixth = 8
public let majorSixth = 9
public let minorSeventh = 10
public let majorSeventh = 11
public let perfectOctave = 12
public let diminishedSecond = 0
public let augmentedUnison = 1
public let diminishedThird = 2
public let augmentedSecond = 3
public let diminishedFourth = 4
public let augmentedThird = 5
public let diminishedFifth = 6
public let augmentedFourth = 6
public let diminishedSixth = 7
public let augmentedFifth = 8
public let diminishedSeventh = 9
public let augmentedSixth = 10
public let diminishedOctave = 11
public let augmentedSeventh = 12
public let diminishedNinth = 12
public let augmentedOctave = 13
public let minorNinth = 13
public let majorNinth = 14
public let minorTenth = 15
public let majorTenth = 16
public let perfectEleventh = 17
public let perfectTwelfth = 19
public let minorThirteenth = 20
public let majorThirteenth = 21
public let minorFourteenth = 22
public let majorFourteenth = 23
public let doubleOctave = 24
public let diminishedTenth = 14
public let augmentedNinth = 15
public let diminishedEleventh = 16
public let augmentedTenth = 17
public let diminishedTwelfth = 18
public let augmentedEleventh = 18
public let diminishedThirteenth = 19
public let augmentedTwelfth = 20
public let diminishedFourteenth = 21
public let augmentedThirteenth = 22
public let diminishedFifteenth = 23
public let augmentedFourteenth = 24
public let augmentedFifteenth = 25
| 26.924242 | 58 | 0.793472 |
84afe111de2e6035c49326ff880c5f5ac600d5db | 3,131 | cs | C# | Source/CompFilter.cs | AUTOMATIC1111/Radiology | ec384125fa22d847a14fed76a7e5f1a5d4dd6d6f | [
"MIT"
] | 3 | 2018-09-07T21:27:33.000Z | 2021-11-03T01:05:04.000Z | Source/CompFilter.cs | AUTOMATIC1111/Radiology | ec384125fa22d847a14fed76a7e5f1a5d4dd6d6f | [
"MIT"
] | 3 | 2018-08-12T20:57:21.000Z | 2021-09-20T19:44:47.000Z | Source/CompFilter.cs | AUTOMATIC1111/Radiology | ec384125fa22d847a14fed76a7e5f1a5d4dd6d6f | [
"MIT"
] | 6 | 2018-08-12T20:47:38.000Z | 2021-11-03T01:05:07.000Z | using RimWorld;
using System;
using System.Collections.Generic;
using System.Linq;
using System.Text;
using UnityEngine;
using Verse;
namespace Radiology
{
class CompFilter :ThingComp, IRadiationModifier, ISelectMultiple<CompFilterOperationMode>
{
public new CompPropertiesFilter props => base.props as CompPropertiesFilter;
public void Modify(ref RadiationInfo info)
{
CompFilterOperationMode m = Mode;
if (m == null) return;
m.Modify(ref info);
}
public override string CompInspectStringExtra()
{
CompFilterOperationMode m = Mode;
string label = m == null ? "RadiologyFilterOperationModeNone".Translate().RawText : m.Label;
return string.Format("RadiologyFilterOperationMode".Translate(), label);
}
public override IEnumerable<Gizmo> CompGetGizmosExtra()
{
if (parent.Faction != Faction.OfPlayer) yield break;
yield return new Command_Action
{
defaultLabel = "RadiologyFilterOperationModeLabel".Translate(),
defaultDesc = "RadiologyFilterOperationModeDesc".Translate(),
icon = ContentFinder<Texture2D>.Get("Radiology/Icons/SetupFiltering", true),
action = delegate ()
{
Find.WindowStack.Add(new DialogSelectMultiple<CompFilterOperationMode>(this)
{
LabelSelected = "RadiologyFilterOperationModeSelected",
LabelNotSelected = "RadiologyFilterOperationModeNotSelected",
SelectedLimit = 1,
});
},
hotKey = KeyBindingDefOf.Misc3
};
yield break;
}
public override void PostExposeData()
{
Scribe_Values.Look(ref mode, "mode", -1);
}
public IEnumerable<CompFilterOperationMode> All() => operationModes.Where( x => x.Available );
public string Label(CompFilterOperationMode obj) => obj.Label.CapitalizeFirst();
public bool IsSelected(CompFilterOperationMode obj) => Mode == obj;
public void Select(CompFilterOperationMode obj) => mode = operationModes.FirstIndexOf(x => x == obj);
public void Unselect(CompFilterOperationMode obj) => mode = -1;
CompFilterOperationMode Mode => (mode >= 0 && mode < operationModes.Length) ? operationModes[mode] : null;
int mode = -1;
public static CompFilterOperationMode[] operationModes = {
new CompFilterOperationModeBasic(),
new CompFilterOperationModeIntermediate(),
new CompFilterOperationModeAdvanced(),
new CompFilterOperationModeRemoveNormal(),
new CompFilterOperationModeRemoveNormalIntermediate(),
new CompFilterOperationModeRemoveNormalAdvanced(),
new CompFilterOperationModeTradeoffRemoveBurn(),
new CompFilterOperationModeTradeoffRemoveNormal(),
new CompFilterOperationModeDouble(),
};
}
}
| 36.406977 | 114 | 0.624401 |
0cb3d709268fe517aa8744c5e53fca3c79033998 | 6,058 | rb | Ruby | spec/defines/repo_spec.rb | sohonet/computology-packagecloud | 1ebf8a5e79cf61234c85187a1641519c49f8986b | [
"Apache-2.0"
] | null | null | null | spec/defines/repo_spec.rb | sohonet/computology-packagecloud | 1ebf8a5e79cf61234c85187a1641519c49f8986b | [
"Apache-2.0"
] | null | null | null | spec/defines/repo_spec.rb | sohonet/computology-packagecloud | 1ebf8a5e79cf61234c85187a1641519c49f8986b | [
"Apache-2.0"
] | 1 | 2017-10-10T09:23:26.000Z | 2017-10-10T09:23:26.000Z | require 'spec_helper'
describe 'packagecloud::repo' do
let :pre_condition do
"Exec { path => [ '/bin/', '/sbin/' , '/usr/bin/', '/usr/sbin/' ] }"
end
# add these two lines in a single test block to enable puppet and hiera debug mode
# Puppet::Util::Log.level = :debug
# Puppet::Util::Log.newdestination(:console)
#
shared_examples 'creates yumrepo with execs' do
it do
is_expected.to compile.with_all_deps
end
it do
is_expected.to contain_class('packagecloud')
end
it do
is_expected.to create_packagecloud__repo('username/publicrepo')
end
it do
is_expected.to contain_file('username_publicrepo').
with({"path"=>"/etc/yum.repos.d/username_publicrepo.repo",
"mode"=>"0644",})
end
it do
is_expected.to contain_file('username_publicrepo').with_content(/baseurl=https:\/\/packagecloud.io\/username\/publicrepo\/el\/7\/x86_64\//)
end
it do
is_expected.to contain_exec('yum_make_cache_username/publicrepo').
with(
{
"command" => "yum -q makecache -y --disablerepo='*' --enablerepo='username_publicrepo'",
"path" => "/usr/bin",
"require" => "File[username_publicrepo]",
}
)
end
it do
is_expected.to create_packagecloud__repo('username/publicrepo')
end
end
shared_examples 'creates apt repo with execs' do
it do
is_expected.to compile.with_all_deps
end
it do
is_expected.to contain_class('packagecloud')
end
it do
is_expected.to contain_file('username_publicrepo').
with({"path"=>"/etc/apt/sources.list.d/username_publicrepo.list",
"mode"=>"0644",})
end
it do
is_expected.to contain_file('username_publicrepo').with_content(/deb https:\/\/packagecloud.io\/username\/publicrepo\/debian main/)
is_expected.to contain_file('username_publicrepo').with_content(/deb-src https:\/\/packagecloud.io\/username\/publicrepo\/debian main/)
end
it do
is_expected.to contain_exec('apt_get_update_username_publicrepo').
with(
{
"command" => 'apt-get update -o Dir::Etc::sourcelist="sources.list.d/username_publicrepo.list" -o Dir::Etc::sourceparts="-" -o APT::Get::List-Cleanup="0"',
"path" => "/usr/bin/:/bin/",
"require" => "Exec[apt_key_add_username_publicrepo]",
}
)
end
it do
is_expected.to contain_exec('apt_key_add_username_publicrepo').
with(
{
"command" => 'wget --auth-no-challenge -qO - https://packagecloud.io/username/publicrepo/gpgkey | apt-key add -',
"path" => "/usr/bin/:/bin/",
"require" => "File[username_publicrepo]",
}
)
end
it do
is_expected.to contain_package('apt-transport-https').with_ensure('present')
end
end
context 'rpm repo' do
context 'with sensible parameters' do
let(:facts) {{
:osfamily => 'RedHat',
:osreleasemaj => '7',
:operatingsystem => 'CentOS',
:architecture => 'x86_64',
}}
let(:title) { 'username/publicrepo' }
let(:params) do
{
:type => 'rpm',
}
end
it_behaves_like 'creates yumrepo with execs'
it do
is_expected.to contain_exec('yum_make_cache_username/publicrepo').
with_subscribe(nil)
end
it do
is_expected.to contain_exec('yum_make_cache_username/publicrepo').
with_refreshonly(nil)
end
it do
is_expected.to create_packagecloud__repo('username/publicrepo')
end
end
context 'with always_update_cache false' do
let(:facts) {{
:osfamily => 'RedHat',
:osreleasemaj => '7',
:operatingsystem => 'CentOS',
:architecture => 'x86_64',
}}
let(:title) { 'username/publicrepo' }
let(:params) do
{
:type => 'rpm',
:always_update_cache => false,
}
end
it_behaves_like 'creates yumrepo with execs'
it do
is_expected.to contain_exec('yum_make_cache_username/publicrepo').
with_subscribe("File[username_publicrepo]")
end
it do
is_expected.to contain_exec('yum_make_cache_username/publicrepo').
with_refreshonly(true)
end
end
end
context 'apt repo' do
context 'with sensible parameters' do
let(:facts) {{
:osfamily => 'Debian',
:osreleasemaj => '8',
:operatingsystem => 'Debian',
:architecture => 'x86_64',
}}
let(:title) { 'username/publicrepo' }
let(:params) do
{
:type => 'deb',
}
end
it_behaves_like 'creates apt repo with execs'
it do
is_expected.to contain_exec('apt_get_update_username_publicrepo').
with_subscribe(nil)
end
it do
is_expected.to contain_exec('apt_get_update_username_publicrepo').
with_refreshonly(nil)
end
end
context 'with always_update_cache false' do
let(:facts) {{
:osfamily => 'Debian',
:osreleasemaj => '8',
:operatingsystem => 'Debian',
:architecture => 'x86_64',
}}
let(:title) { 'username/publicrepo' }
let(:params) do
{
:type => 'deb',
:always_update_cache => false,
}
end
it_behaves_like 'creates apt repo with execs'
it do
is_expected.to contain_exec('apt_get_update_username_publicrepo').
with_subscribe("File[username_publicrepo]")
end
it do
is_expected.to contain_exec('apt_get_update_username_publicrepo').
with_refreshonly(true)
end
end
end
end
| 29.125 | 167 | 0.570155 |
dd650a7d697ae273d227eecc1f60e81e7f3305be | 32,688 | java | Java | org-netbeans-modules-form/src/main/java/org/netbeans/modules/form/CreationFactory.java | ses1112/adito-nb-modules | e908d4814f1e0c8a859bbef5b2db432e324b2f92 | [
"Apache-2.0"
] | null | null | null | org-netbeans-modules-form/src/main/java/org/netbeans/modules/form/CreationFactory.java | ses1112/adito-nb-modules | e908d4814f1e0c8a859bbef5b2db432e324b2f92 | [
"Apache-2.0"
] | null | null | null | org-netbeans-modules-form/src/main/java/org/netbeans/modules/form/CreationFactory.java | ses1112/adito-nb-modules | e908d4814f1e0c8a859bbef5b2db432e324b2f92 | [
"Apache-2.0"
] | null | null | null | /*
* DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS HEADER.
*
* Copyright 1997-2010 Oracle and/or its affiliates. All rights reserved.
*
* Oracle and Java are registered trademarks of Oracle and/or its affiliates.
* Other names may be trademarks of their respective owners.
*
* The contents of this file are subject to the terms of either the GNU
* General Public License Version 2 only ("GPL") or the Common
* Development and Distribution License("CDDL") (collectively, the
* "License"). You may not use this file except in compliance with the
* License. You can obtain a copy of the License at
* http://www.netbeans.org/cddl-gplv2.html
* or nbbuild/licenses/CDDL-GPL-2-CP. See the License for the
* specific language governing permissions and limitations under the
* License. When distributing the software, include this License Header
* Notice in each file and include the License file at
* nbbuild/licenses/CDDL-GPL-2-CP. Oracle designates this
* particular file as subject to the "Classpath" exception as provided
* by Oracle in the GPL Version 2 section of the License file that
* accompanied this code. If applicable, add the following below the
* License Header, with the fields enclosed by brackets [] replaced by
* your own identifying information:
* "Portions Copyrighted [year] [name of copyright owner]"
*
* Contributor(s):
*
* The Original Software is NetBeans. The Initial Developer of the Original
* Software is Sun Microsystems, Inc. Portions Copyright 1997-2006 Sun
* Microsystems, Inc. All Rights Reserved.
*
* If you wish your version of this file to be governed by only the CDDL
* or only the GPL Version 2, indicate your decision by adding
* "[Contributor] elects to include this software in this distribution
* under the [CDDL or GPL Version 2] license." If you do not indicate a
* single choice of license, a recipient has the option to distribute
* your version of this file under either the CDDL, the GPL Version 2 or
* to extend the choice of license to its licensees as provided above.
* However, if you add GPL Version 2 code and therefore, elected the GPL
* Version 2 license, then the option applies only if the new code is
* made subject to such option by the copyright holder.
*/
package org.netbeans.modules.form;
import java.awt.*;
import java.lang.reflect.InvocationTargetException;
import java.util.*;
import javax.swing.*;
import javax.swing.border.Border;
import org.openide.ErrorManager;
/**
* Factory class for creating objects, providing java creation code,
* registering CreationDescriptor classes, and related utility methods.
*
* @author Tomas Pavek
*/
public class CreationFactory {
private static Map<String,CreationDescriptor> registry;
private static boolean defaultDescriptorsCreated = false;
interface PropertyParameters {
public String getPropertyName();
public String getJavaParametersString(FormProperty prop);
public Object[] getPropertyParametersValues(FormProperty prop);
public Class[] getPropertyParametersTypes();
}
static class Property2ParametersMapper {
private final String propertyName;
private final Class[] propertyType = new Class[1];
private PropertyParameters parameters;
Property2ParametersMapper(Class propertyClass, String propertyName) {
this.propertyType[0] = propertyClass;
this.propertyName = propertyName;
}
public String getPropertyName() {
return propertyName;
}
public Class[] getPropertyTypes() {
if(parameters!=null){
return parameters.getPropertyParametersTypes();
}
return propertyType;
}
public String getJavaParametersString(FormProperty prop) {
if(parameters!=null){
return parameters.getJavaParametersString(prop);
}
return prop.getJavaInitializationString();
}
public Object[] getPropertyParametersValues(FormProperty prop) {
if(parameters!=null){
return parameters.getPropertyParametersValues(prop);
}
try{
return new Object[] { prop.getRealValue() };
} catch(InvocationTargetException ite) {
ErrorManager.getDefault().notify(ite);
} catch(IllegalAccessException iae){
ErrorManager.getDefault().notify(iae);
}
return new Object[] {};
}
public void setPropertyParameters(PropertyParameters parameters) {
this.parameters = parameters;
}
}
private CreationFactory() {}
// -----------
// registry methods
public static CreationDescriptor getDescriptor(Class cls) {
CreationDescriptor cd = getRegistry().get(cls.getName());
if (cd == null && !defaultDescriptorsCreated
&& (cls.getName().startsWith("javax.swing.") // NOI18N
|| cls.getName().startsWith("java.awt."))) { // NOI18N
createDefaultDescriptors();
cd = getRegistry().get(cls.getName());
}
if (cd != null) {
cd.setDescribedClass(cls);
}
return cd;
}
public static void registerDescriptor(CreationDescriptor desc) {
getRegistry().put(desc.getDescribedClassName(), desc);
}
public static void unregisterDescriptor(CreationDescriptor desc) {
if (registry != null)
registry.remove(desc.getDescribedClassName());
}
// -----------
// creation methods
public static Object createDefaultInstance(final Class cls)
throws Exception
{
CreationDescriptor cd = getDescriptor(cls);
Object cl = UIManager.get("ClassLoader"); // NOI18N
Object cl2 = UIManager.getLookAndFeelDefaults().get("ClassLoader"); // NOI18N
ClassLoader uiCl = (cl instanceof ClassLoader) ? (ClassLoader)cl : null;
ClassLoader systemCl = org.openide.util.Lookup.getDefault().lookup(ClassLoader.class);
ClassLoader beanCl = cls.getClassLoader();
java.util.List<ClassLoader> loaders = new ArrayList<ClassLoader>();
if (beanCl != null) {
loaders.add(beanCl);
}
loaders.add(systemCl);
if (uiCl != null) {
loaders.add(uiCl);
}
ClassLoader newCl = new MultiClassLoader(loaders.toArray(new ClassLoader[loaders.size()]));
UIManager.put("ClassLoader", newCl); // NOI18N
Object instance = cd != null ?
cd.createDefaultInstance() :
cls.newInstance();
if (cl == cl2) {
// The original classloader (i.e., cl) was in look and feel defaults.
// It remains there, we just have to remove the value that
// we set in user defaults (see the structure of MultiUIDefaults).
UIManager.getDefaults().remove("ClassLoader"); // NOI18N
} else {
// The original classloader was in user defaults => return it back
UIManager.put("ClassLoader", cl); // NOI18N
}
initAfterCreation(instance);
return instance;
}
public static Object createInstance(Class cls)
throws Exception
{
Object instance;
CreationDescriptor cd = CreationFactory.getDescriptor(cls);
instance = cd != null ? cd.createDefaultInstance() :
cls.newInstance();
initAfterCreation(instance);
return instance;
}
public static Object createInstance(Class cls,
FormProperty[] props,
int style)
throws Exception
{
CreationDescriptor cd = getDescriptor(cls);
if (cd == null)
return null;
CreationDescriptor.Creator creator = cd.findBestCreator(props, style);
if (creator == null)
return null;
Object instance = creator.createInstance(props);
initAfterCreation(instance);
return instance;
}
// A
/*public static String getJavaCreationCode(Class cls,
FormProperty[] props,
int style) {
CreationDescriptor cd = getDescriptor(cls);
if (cd != null) {
CreationDescriptor.Creator creator = cd.findBestCreator(props, style);
if (creator != null) {
creator.getJavaCreationCode(props, null, null, null, null);
}
}
return null;
}*/
// ------------
// utility methods
public static FormProperty[] getPropertiesForCreator(
CreationDescriptor.Creator creator,
FormProperty[] properties) {
String[] propNames = creator.getPropertyNames();
FormProperty[] crProps = new FormProperty[propNames.length];
for (int i=0; i < propNames.length; i++) {
String propName = propNames[i];
for (int j=0; j < properties.length; j++)
if (propName.equals(properties[j].getName())) {
crProps[i] = properties[j];
break;
}
if (crProps[i] == null)
return null; // missing property, should not happen
}
return crProps;
}
public static FormProperty[] getRemainingProperties(
CreationDescriptor.Creator creator,
FormProperty[] properties) {
String[] propNames = creator.getPropertyNames();
FormProperty[] remProps = new FormProperty[properties.length - propNames.length];
if (remProps.length == 0) return remProps;
int ii = 0;
for (int i=0; i < properties.length; i++) {
String propName = properties[i].getName();
for (int j=0; j < propNames.length; j++) {
if (propName.equals(propNames[j])) break;
if (j+1 == propNames.length) {
if (ii > remProps.length)
return null; // should not happen
remProps[ii++] = properties[i];
}
}
}
return remProps;
}
public static boolean containsProperty(CreationDescriptor desc,
String propName)
{
CreationDescriptor.Creator[] creators = desc.getCreators();
if (creators == null)
return false;
for (int i=0; i < creators.length; i++) {
String[] propNames = creators[i].getPropertyNames();
for (int j=0; j < propNames.length; j++)
if (propNames[j].equals(propName))
return true;
}
return false;
}
public static boolean containsProperty(CreationDescriptor.Creator creator,
String propName)
{
String[] propNames = creator.getPropertyNames();
for (int j=0; j < propNames.length; j++)
if (propNames[j].equals(propName))
return true;
return false;
}
public static FormProperty findProperty(String propName,
FormProperty[] properties) {
for (int i=0; i < properties.length; i++)
if (properties[i].getName().equals(propName))
return properties[i];
return null;
}
public static CreationDescriptor.Creator findCreator(
CreationDescriptor desc,
Class[] paramTypes)
{
CreationDescriptor.Creator[] creators = desc.getCreators();
for (int i=0; i < creators.length; i++) {
CreationDescriptor.Creator cr = creators[i];
if (cr.getParameterCount() == paramTypes.length) {
Class[] types = cr.getParameterTypes();
boolean match = true;
for (int j=0; j < types.length; j++)
if (!types[j].isAssignableFrom(paramTypes[j])) {
match = false;
break;
}
if (match)
return cr;
}
}
return null;
}
/** Evaluates creators for array of properties.
* (Useful for CreationDescriptor.findBestCreator(...) implementation.)
*
* @param creators creators to consider
* @param properties properties to consider
* @param changedOnly determines whether to consider changed properties only
* @return array of int - for each creator a count of placed properties
*/
public static int[] evaluateCreators(CreationDescriptor.Creator[] creators,
FormProperty[] properties,
boolean changedOnly) {
if (creators == null || creators.length == 0) return null;
int[] placed = new int[creators.length];
for (int i=0; i < properties.length; i++) {
if (!changedOnly || properties[i].isChanged()) {
String name = properties[i].getName();
for (int j=0; j < creators.length; j++) {
String[] crNames = creators[j].getPropertyNames();
for (int k=0; k < crNames.length; k++)
if (name.equals(crNames[k]))
placed[j]++;
}
}
}
return placed;
}
/** Finds the best creator upon given evaluation.
* (Useful for CreationDescriptor.findBestCreator(...) implementation.)
*
* @param creators creators to consider.
* @param properties properties to consider.
* @param placed for each creator a count of placed properties
* @param placeAllProps determines whether all properties should be placed
* @return index of most suitable creator
*/
public static int getBestCreator(CreationDescriptor.Creator[] creators,
FormProperty[] properties,
int[] placed,
boolean placeAllProps)
{
if (creators == null || creators.length == 0)
return -1;
int best = 0;
int[] sizes = new int[creators.length];
sizes[0] = creators[0].getParameterCount();
if (placeAllProps) {
// find shortest creator with all properties placed
for (int i=1; i < placed.length; i++) {
sizes[i] = creators[i].getParameterCount();
if (placed[i] > placed[best]
|| (placed[i] == placed[best]
&& (sizes[i] < sizes[best]
|| (sizes[i] == sizes[best]
&& compareCreatorsAmbiguity(
creators[i], creators[best], properties)
== 1))))
best = i;
}
}
else { // find longest creator with all parameters provided by properties
for (int i=1; i < placed.length; i++) {
sizes[i] = creators[i].getParameterCount();
int iDiff = sizes[i] - placed[i];
int bestDiff = sizes[best] - placed[best];
if (iDiff < bestDiff
|| (iDiff == bestDiff
&& (sizes[i] > sizes[best]
|| (sizes[i] == sizes[best]
&& compareCreatorsAmbiguity(
creators[i], creators[best], properties)
== 1))))
best = i;
}
}
return best;
}
// -----------
// non-public methods
/** Compares two creators with equal number of placed properties and equal
* number of all properties. To distinguish which one is better, their
* properties are checked for null values which could cause ambiguity in
* generated code.
* @return 1 if creator1 is better, 2 if creator2 is better, 0 if they
* are equal
*/
static int compareCreatorsAmbiguity(CreationDescriptor.Creator cr1,
CreationDescriptor.Creator cr2,
FormProperty[] properties)
{
int nullValues1 = 0;
int nullValues2 = 0;
for (int i=0, n=cr1.getParameterCount(); i < n; i++) {
String name1 = cr1.getPropertyNames()[i];
String name2 = cr2.getPropertyNames()[i];
if (!name1.equals(name2)) {
FormProperty prop1 = null;
FormProperty prop2 = null;
for (int j=0; j < properties.length; j++)
if (prop1 == null && name1.equals(properties[j].getName())) {
prop1 = properties[j];
if (prop2 != null)
break;
}
else if (prop2 == null && name2.equals(properties[j].getName())) {
prop2 = properties[j];
if (prop1 != null)
break;
}
if (prop1 != null && !prop1.getValueType().isPrimitive()) {
try {
if (prop1.getRealValue() == null)
nullValues1++;
}
catch (Exception ex) {} // ignore
}
if (prop2 != null && !prop2.getValueType().isPrimitive()) {
try {
if (prop2.getRealValue() == null)
nullValues2++;
}
catch (Exception ex) {} // ignore
}
}
}
if (nullValues1 == nullValues2)
return 0;
return nullValues1 < nullValues2 ? 1 : 2;
}
static Map<String,CreationDescriptor> getRegistry() {
if (registry == null)
registry = new HashMap<String,CreationDescriptor>(40);
return registry;
}
// additional initializations for some components - in fact hacks required
// by using fake peers and remapping L&F...
private static void initAfterCreation(Object instance) {
if (instance instanceof javax.swing.border.TitledBorder)
((javax.swing.border.TitledBorder)instance)
.setTitleFont(UIManager.getFont("TitledBorder.createDefaultInstancefont")); // NOI18N
else if (instance instanceof java.awt.Component
&& !(instance instanceof javax.swing.JComponent)
&& !(instance instanceof javax.swing.RootPaneContainer))
{
((Component)instance).setName(null);
}
else if (instance instanceof MenuComponent) {
((MenuComponent)instance).setName(null);
}
}
// ---------------------------------------------------
// constructors descriptors for some "special" classes...
private static void createDefaultDescriptors() {
Class[][] constrParamTypes;
String[][] constrPropertyNames;
Object[] defaultConstrParams;
String methodName;
CreationDescriptor cd;
InsetsPropertyParameters[] insetsPropertyParameters =
new InsetsPropertyParameters[] { new InsetsPropertyParameters("borderInsets") };
try {
// borders ------------
// LineBorder
constrParamTypes = new Class[][] {
{ Color.class, Integer.TYPE , Boolean.TYPE }
};
constrPropertyNames = new String[][] {
{ "lineColor", "thickness" , "roundedCorners" }
};
defaultConstrParams = new Object[] { java.awt.Color.black };
cd = new CreationDescriptor();
cd.addConstructorCreators(
javax.swing.border.LineBorder.class,
constrParamTypes, constrPropertyNames, defaultConstrParams);
constrParamTypes = new Class[][] {
{ Color.class },
{ Color.class, Integer.TYPE }
};
constrPropertyNames = new String[][] {
{ "lineColor" },
{ "lineColor", "thickness" }
};
methodName = "createLineBorder";
cd.addMethodCreators(
javax.swing.BorderFactory.class, javax.swing.border.LineBorder.class, methodName,
constrParamTypes, constrPropertyNames, null, defaultConstrParams);
registerDescriptor(cd);
// EtchedBorder
defaultConstrParams = new Object[] { };
constrParamTypes = new Class[][] {
{ },
{ Color.class, Color.class },
{ Integer.TYPE },
{ Integer.TYPE, Color.class, Color.class }
};
constrPropertyNames = new String[][] {
{ },
{ "highlightColor", "shadowColor" },
{ "etchType" },
{ "etchType", "highlightColor", "shadowColor" }
};
methodName = "createEtchedBorder";
registerDescriptor(new CreationDescriptor(
javax.swing.BorderFactory.class, javax.swing.border.EtchedBorder.class, methodName,
constrParamTypes, constrPropertyNames, null, defaultConstrParams));
// EmptyBorder
constrParamTypes = new Class[][] {
{ Insets.class }
};
constrPropertyNames = new String[][] {
{ "borderInsets" }
};
Integer one = Integer.valueOf(1);
defaultConstrParams = new Object[] { one, one, one, one };
methodName = "createEmptyBorder";
registerDescriptor(new CreationDescriptor(
javax.swing.BorderFactory.class, javax.swing.border.EmptyBorder.class,
methodName, constrParamTypes, constrPropertyNames, insetsPropertyParameters, defaultConstrParams));
// TitledBorder
constrParamTypes = new Class[][] {
{ String.class },
{ Border.class, String.class },
{ Border.class, String.class, Integer.TYPE, Integer.TYPE },
{ Border.class, String.class, Integer.TYPE, Integer.TYPE, Font.class },
{ Border.class, String.class, Integer.TYPE, Integer.TYPE, Font.class, Color.class },
{ Border.class }
};
constrPropertyNames = new String[][] {
{ "title" },
{ "border", "title" },
{ "border", "title", "titleJustification", "titlePosition" },
{ "border", "title", "titleJustification", "titlePosition", "titleFont" },
{ "border", "title", "titleJustification", "titlePosition", "titleFont", "titleColor" },
{ "border" }
};
defaultConstrParams = new Object[] { null, "", Integer.valueOf(0), Integer.valueOf(0) };
methodName = "createTitledBorder";
registerDescriptor(new CreationDescriptor(
javax.swing.BorderFactory.class, javax.swing.border.TitledBorder.class, methodName,
constrParamTypes, constrPropertyNames, null, defaultConstrParams));
// CompoundBorder
constrParamTypes = new Class[][] {
{ },
{ Border.class, Border.class }
};
constrPropertyNames = new String[][] {
{ },
{ "outsideBorder", "insideBorder" }
};
defaultConstrParams = new Object[0];
methodName = "createCompoundBorder";
registerDescriptor(new CreationDescriptor(
javax.swing.BorderFactory.class, javax.swing.border.CompoundBorder.class, methodName,
constrParamTypes, constrPropertyNames, null, defaultConstrParams));
// BevelBorder
constrParamTypes = new Class[][] {
{ Integer.TYPE },
{ Integer.TYPE, Color.class, Color.class },
{ Integer.TYPE, Color.class, Color.class, Color.class, Color.class }
};
constrPropertyNames = new String[][] {
{ "bevelType" },
{ "bevelType", "highlightOuterColor", "shadowOuterColor" },
{ "bevelType", "highlightOuterColor", "highlightInnerColor",
"shadowOuterColor", "shadowInnerColor" }
};
defaultConstrParams = new Object[] { Integer.valueOf(javax.swing.border.BevelBorder.RAISED) };
methodName = "createBevelBorder";
registerDescriptor(new CreationDescriptor(
javax.swing.BorderFactory.class, javax.swing.border.BevelBorder.class, methodName,
constrParamTypes, constrPropertyNames, null, defaultConstrParams));
// SoftBevelBorder
constrParamTypes = new Class[][] {
{ Integer.TYPE },
{ Integer.TYPE, Color.class, Color.class },
{ Integer.TYPE, Color.class, Color.class, Color.class, Color.class }
};
constrPropertyNames = new String[][] {
{ "bevelType" },
{ "bevelType", "highlightOuterColor", "shadowOuterColor" },
{ "bevelType", "highlightOuterColor", "highlightInnerColor",
"shadowOuterColor", "shadowInnerColor" }
};
registerDescriptor(new CreationDescriptor(
javax.swing.border.SoftBevelBorder.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// MatteBorder
cd = new CreationDescriptor();
constrParamTypes = new Class[][] {
{ Icon.class }
};
constrPropertyNames = new String[][] {
{ "tileIcon" }
};
cd.addConstructorCreators( javax.swing.border.MatteBorder.class,
constrParamTypes, constrPropertyNames, defaultConstrParams);
constrParamTypes = new Class[][] {
{ Insets.class, Icon.class },
{ Insets.class, Color.class }
};
constrPropertyNames = new String[][] {
{ "borderInsets", "tileIcon" },
{ "borderInsets", "matteColor" }
};
defaultConstrParams = new Object[] {
one, one, one, one,
java.awt.Color.black
};
methodName = "createMatteBorder";
cd.addMethodCreators(javax.swing.BorderFactory.class, javax.swing.border.MatteBorder.class, methodName,
constrParamTypes, constrPropertyNames, insetsPropertyParameters, defaultConstrParams);
registerDescriptor(cd);
// layouts --------------
// BorderLayout
constrParamTypes = new Class[][] {
{ },
{ Integer.TYPE, Integer.TYPE }
};
constrPropertyNames = new String[][] {
{ },
{ "hgap", "vgap" }
};
defaultConstrParams = new Object[0];
registerDescriptor(new CreationDescriptor(
java.awt.BorderLayout.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// FlowLayout
constrParamTypes = new Class[][] {
{ },
{ Integer.TYPE },
{ Integer.TYPE, Integer.TYPE, Integer.TYPE }
};
constrPropertyNames = new String[][] {
{ },
{ "alignment" },
{ "alignment", "hgap", "vgap" },
};
registerDescriptor(new CreationDescriptor(
java.awt.FlowLayout.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// GridBagLayout
constrParamTypes = new Class[][] {
{ }
};
constrPropertyNames = new String[][] {
{ }
};
registerDescriptor(new CreationDescriptor(
java.awt.GridBagLayout.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// GridLayout
constrParamTypes = new Class[][] {
{ },
{ Integer.TYPE, Integer.TYPE },
{ Integer.TYPE, Integer.TYPE, Integer.TYPE, Integer.TYPE }
};
constrPropertyNames = new String[][] {
{ },
{ "rows", "columns" },
{ "rows", "columns", "hgap", "vgap" }
};
registerDescriptor(new CreationDescriptor(
java.awt.GridLayout.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// CardLayout
constrParamTypes = new Class[][] {
{ },
{ Integer.TYPE, Integer.TYPE }
};
constrPropertyNames = new String[][] {
{ },
{ "hgap", "vgap" }
};
registerDescriptor(new CreationDescriptor(
java.awt.CardLayout.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// AWT --------
// Dialog
constrParamTypes = new Class[][] {
{ java.awt.Frame.class },
};
constrPropertyNames = new String[][] {
{ "owner" },
};
defaultConstrParams = new Object[] { new java.awt.Frame() };
registerDescriptor(new CreationDescriptor(
java.awt.Dialog.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// other -------
// JPanel on JDK 1.3 uses one instance of FlowLayout for all instances
// created by default constructor - this causes problems
registerDescriptor(
new CreationDescriptor(javax.swing.JPanel.class) {
@Override
public Object createDefaultInstance() {
return new javax.swing.JPanel(new java.awt.FlowLayout());
}
}
);
// Box.Filler
constrParamTypes = new Class[][] {
{ Dimension.class, Dimension.class, Dimension.class }
};
constrPropertyNames = new String[][] {
{ "minimumSize", "preferredSize", "maximumSize" }
};
defaultConstrParams = new Object[] {new Dimension(), new Dimension(), new Dimension()};
registerDescriptor(new CreationDescriptor(
javax.swing.Box.Filler.class,
constrParamTypes, constrPropertyNames, defaultConstrParams));
// ----------
defaultDescriptorsCreated = true;
}
catch (NoSuchMethodException ex) { // should not happen
ex.printStackTrace();
}
}
static class InsetsPropertyParameters implements PropertyParameters {
private static Class[] parameterTypes = new Class[] {Integer.TYPE, Integer.TYPE, Integer.TYPE, Integer.TYPE};
private final String propertyName;
public InsetsPropertyParameters(String propertyName) {
this.propertyName = propertyName;
}
@Override
public String getPropertyName() {
return propertyName;
}
@Override
public String getJavaParametersString(FormProperty prop) {
Insets insets = (Insets) getRealValue (prop);
if(insets != null) {
return insets.top + ", " + insets.left + ", " + insets.bottom + ", " + insets.right;
} else {
return "";
}
}
@Override
public Object[] getPropertyParametersValues(FormProperty prop) {
Insets insets = (Insets) getRealValue(prop);
if(insets != null) {
return new Object[] {
Integer.valueOf(insets.top),
Integer.valueOf(insets.left),
Integer.valueOf(insets.bottom),
Integer.valueOf(insets.right)
};
} else {
return new Object[] { };
}
}
@Override
public Class[] getPropertyParametersTypes() {
return parameterTypes;
}
private static Object getRealValue(FormProperty prop){
try {
return prop.getRealValue();
} catch(InvocationTargetException ite) {
ErrorManager.getDefault().notify(ite);
} catch(IllegalAccessException iae){
ErrorManager.getDefault().notify(iae);
}
return null;
}
}
}
| 37.658986 | 134 | 0.553445 |
a198bafc9d5d71861ea89a5284a058a33df864dc | 78 | ts | TypeScript | src/helpers/hooks/index.ts | danieka12/docheck-test | 8c68b704ad33a59d014d4bf95908e7867e9b4f5a | [
"MIT"
] | null | null | null | src/helpers/hooks/index.ts | danieka12/docheck-test | 8c68b704ad33a59d014d4bf95908e7867e9b4f5a | [
"MIT"
] | null | null | null | src/helpers/hooks/index.ts | danieka12/docheck-test | 8c68b704ad33a59d014d4bf95908e7867e9b4f5a | [
"MIT"
] | null | null | null | export { default as useQueryWrapper } from '@/helpers/hooks/useQueryWrapper';
| 39 | 77 | 0.782051 |
54208d3cb19e149df0e8f1e9ecc06bb097bed016 | 2,238 | css | CSS | public/css/event/showone.css | paulagolder/fflsas20 | b8dab71006a4a5bce9ec57e657f749a48d9481fa | [
"MIT"
] | null | null | null | public/css/event/showone.css | paulagolder/fflsas20 | b8dab71006a4a5bce9ec57e657f749a48d9481fa | [
"MIT"
] | 1 | 2020-07-21T16:12:47.000Z | 2020-07-21T16:12:47.000Z | web/css/event/showone.css | paulagolder/fflsas80 | b62f5b3e2acfe788841b5a0ffae1a7c9887a0f66 | [
"MIT"
] | null | null | null |
xdiv#event div.breadcrumbs
{
color:red;
font-size : 1em;
}
xdiv#event div.breadcrumbs a
{
color:blue;
text-decoration:none;
}
div#event a
{
color:blue;
text-decoration:none;
}
div#event div.heading
{
display:flex;
}
xdiv#event div.subheading
{
display:flex;
}
xdiv#event div.subheading div.label
{
color:yellow;
}
div#event div.dates
{
color:white;
font-size:1.0em;
margin-left:5em;
margin-top:10px;
}
div#event div.location
{
padding-top : 10px;
}
div#event div.location a
{
color:blue;
text-decoration:none;
}
div#event div.text
{
color:black;
font-size : 1.0em;
margin-left : 2em;
}
div#event div.participants
{
display: flex; /* or inline-flex */
flex-direction: row ;
flex-wrap: wrap ;
justify-content: space-evenly;
align-items: center ;
}
div#event div.participant
{
width: 200px;
margin: auto;
padding-top : 10px;
}
div#event div.image
{
/*! max-width: 138px; */
/*flex-grow: 1;*/
}
div#event div.imagegroup
{
display: flex;
flex-direction: row;
flex-wrap: wrap;
justify-content: space-evenly;
}
div#event div.image img
{
margin:10px;
max-width:150px;
max-height:150px;
}
div#event div.image div.imagelabel
{
max-width:150px;
color:blue;
font-size:0.75em;
}
div#event div#pdiv
{
margin-bottom: 2em;
}
div#event div#cdiv
{
margin-bottom: 2em;
}
div#event div.children
{
margin-left:2em;
margin-top:5px;
}
div#event div.children div span.dates
{
color:white;
font-size:0.8em;
}
div#event div.children div
{
margin-left :0em;
}
xdiv#event div.children div a
{
color:blue;
font-size:1.0em;
text-decoration:none;
}
@media only screen and (max-width: 538px)
{
div#person div.eventtree
{
font-size: 0.8em;
margin-left: 1em;
color: blue;
margin-top: 1em;
margin-bottom: 2em;
}
div#person div.eventtree ul
{
margin-top: 0.1em;
}
div#person div.imagelabel
{
font-size : 0.8em;
}
div#person div.text
{
margin-left: 1em;
font-size: 0.8em;
margin-top: 1em;
}
div#person div.text p
{
margin-top: 0.1em;
margin-bottom : 0.1em;
}
}
| 11.536082 | 43 | 0.615282 |
ae9bd267f239e3f3ada05e3e42f3a4b4b4ef7f59 | 12,515 | cs | C# | src/Couchbase.Lite.Shared/Replication/Batcher.cs | LongoMatch/couchbase-lite-net | 6971f39aa1633760e4167c9ad2783f72db0c3f84 | [
"Apache-2.0"
] | null | null | null | src/Couchbase.Lite.Shared/Replication/Batcher.cs | LongoMatch/couchbase-lite-net | 6971f39aa1633760e4167c9ad2783f72db0c3f84 | [
"Apache-2.0"
] | 3 | 2016-07-11T07:20:42.000Z | 2016-09-07T08:19:55.000Z | src/Couchbase.Lite.Shared/Replication/Batcher.cs | LongoMatch/couchbase-lite-net | 6971f39aa1633760e4167c9ad2783f72db0c3f84 | [
"Apache-2.0"
] | 1 | 2019-12-26T08:28:34.000Z | 2019-12-26T08:28:34.000Z | //
// Batcher.cs
//
// Author:
// Zachary Gramana <zack@xamarin.com>
//
// Copyright (c) 2014 Xamarin Inc
// Copyright (c) 2014 .NET Foundation
//
// Permission is hereby granted, free of charge, to any person obtaining
// a copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including
// without limitation the rights to use, copy, modify, merge, publish,
// distribute, sublicense, and/or sell copies of the Software, and to
// permit persons to whom the Software is furnished to do so, subject to
// the following conditions:
//
// The above copyright notice and this permission notice shall be
// included in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
// LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
// OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
// WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
//
//
// Copyright (c) 2014 Couchbase, Inc. All rights reserved.
//
// Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file
// except in compliance with the License. You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software distributed under the
// License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
// either express or implied. See the License for the specific language governing permissions
// and limitations under the License.
//
using System;
using System.Collections.Generic;
using Couchbase.Lite;
using Couchbase.Lite.Support;
using Couchbase.Lite.Util;
using Sharpen;
using System.Threading.Tasks;
using System.Threading;
using Couchbase.Lite.Internal;
using System.Linq;
namespace Couchbase.Lite.Support
{
/// <summary>
/// Utility that queues up objects until the queue fills up or a time interval elapses,
/// then passes all the objects at once to a client-supplied processor block.
/// </summary>
/// <remarks>
/// Utility that queues up objects until the queue fills up or a time interval elapses,
/// then passes all the objects at once to a client-supplied processor block.
/// </remarks>
internal class Batcher<T>
{
private readonly static string Tag = "Batcher";
private readonly TaskFactory workExecutor;
private Task flushFuture;
private readonly int capacity;
private readonly int delay;
private int scheduledDelay;
private List<T> inbox;
private readonly Action<IList<T>> processor;
private Boolean scheduled;
private DateTime lastProcessedTime;
private readonly Action processNowRunnable;
private readonly Object locker;
/// <summary>Initializes a batcher.</summary>
/// <remarks>Initializes a batcher.</remarks>
/// <param name="workExecutor">the work executor that performs actual work</param>
/// <param name="capacity">The maximum number of objects to batch up. If the queue reaches this size, the queued objects will be sent to the processor immediately.
/// </param>
/// <param name="delay">The maximum waiting time to collect objects before processing them. In some circumstances objects will be processed sooner.
/// </param>
/// <param name="processor">The callback/block that will be called to process the objects.
/// </param>
public Batcher(TaskFactory workExecutor, int capacity, int delay, Action<IList<T>> processor, CancellationTokenSource tokenSource = null)
{
Log.D(Tag, "New batcher created with capacity: {0}, delay: {1}", capacity, delay);
processNowRunnable = new Action(()=>
{
try
{
if (tokenSource != null && tokenSource.IsCancellationRequested)
{
return;
}
ProcessNow();
}
catch (Exception e)
{
// we don't want this to crash the batcher
Log.E(Tag, "BatchProcessor throw exception", e);
}
});
this.locker = new Object ();
this.workExecutor = workExecutor;
this.cancellationSource = tokenSource;
this.capacity = capacity;
this.delay = delay;
this.processor = processor;
}
public void ProcessNow()
{
Log.V(Tag, "ProcessNow() called");
scheduled = false;
var toProcess = new List<T>();
lock (locker)
{
if (inbox == null || inbox.Count == 0)
{
Log.V(Tag, "ProcessNow() called, but inbox is empty");
return;
}
if (inbox.Count <= capacity)
{
Log.D(Tag, "inbox size <= capacity, adding {0} items from inbox -> toProcess", inbox.Count);
toProcess.AddRange(inbox);
inbox = null;
}
else
{
Log.D(Tag, "ProcessNow() called, inbox size: {0}", inbox.Count);
int i = 0;
foreach (T item in inbox)
{
toProcess.AddItem(item);
i++;
if (i >= capacity)
{
break;
}
}
foreach (T item in toProcess)
{
Log.D(Tag, "ProcessNow() removing {0} from inbox", item);
inbox.Remove(item);
}
Log.D(Tag, "inbox.Count > capacity, moving {0} items from inbox -> toProcess array", toProcess.Count);
// There are more objects left, so schedule them Real Soon:
ScheduleWithDelay(DelayToUse());
}
}
if (toProcess != null && toProcess.Count > 0)
{
Log.D(Tag, "invoking processor with " + toProcess.Count + " items ");
processor(toProcess);
}
else
{
Log.D(Tag, "nothing to process");
}
lastProcessedTime = DateTime.UtcNow;
Log.D(Tag, "Set lastProcessedTime to {0}", lastProcessedTime.ToString());
}
CancellationTokenSource cancellationSource;
public void QueueObjects(IList<T> objects)
{
lock (locker)
{
Log.V(Tag, "QueueObjects called with {0} objects", objects.Count);
if (objects == null || objects.Count == 0)
{
return;
}
if (inbox == null)
{
inbox = new List<T>();
}
Log.V(Tag, "inbox size before adding objects: {0}", inbox.Count);
inbox.AddRange(objects);
ScheduleWithDelay(DelayToUse());
}
}
/// <summary>Adds an object to the queue.</summary>
public void QueueObject(T o)
{
var objects = new List<T> { o };
QueueObjects(objects);
}
/// <summary>Sends queued objects to the processor block (up to the capacity).</summary>
public void Flush()
{
lock (locker)
{
ScheduleWithDelay(DelayToUse());
}
}
/// <summary>Sends _all_ the queued objects at once to the processor block.</summary>
public void FlushAll()
{
lock (locker)
{
while(inbox != null && inbox.Count > 0)
{
Unschedule();
var toProcess = new List<T>(inbox);
inbox.Clear();
Log.D(Tag, "Flushing {0} downloads.", inbox.Count);
processor(toProcess);
lastProcessedTime = DateTime.UtcNow;
}
}
}
/// <summary>Number of items to be processed.</summary>
public int Count()
{
lock (locker) {
if (inbox == null) {
return 0;
}
return inbox.Count;
}
}
/// <summary>Empties the queue without processing any of the objects in it.</summary>
public void Clear()
{
lock (locker) {
Log.V(Tag, "clear() called, setting inbox to null");
Unschedule();
if (inbox != null) {
inbox.Clear();
inbox = null;
}
}
}
private void ScheduleWithDelay(Int32 suggestedDelay)
{
if (scheduled)
Log.V(Tag, "ScheduleWithDelay called with delay: {0} ms but already scheduled", suggestedDelay);
if (scheduled && (suggestedDelay < scheduledDelay))
{
Log.V(Tag, "Unscheduling");
Unschedule();
}
if (!scheduled)
{
Log.D(Tag, "not already scheduled");
scheduled = true;
scheduledDelay = suggestedDelay;
Log.D(Tag, "ScheduleWithDelay called with delay: {0} ms, scheduler: {1}/{2}", suggestedDelay, workExecutor.Scheduler.GetType().Name, ((SingleTaskThreadpoolScheduler)workExecutor.Scheduler).ScheduledTasks.Count());
cancellationSource = new CancellationTokenSource();
flushFuture = Task.Delay(suggestedDelay).ContinueWith((t)=>
{
Log.D(Tag, "ScheduleWithDelay fired");
if(!(cancellationSource.IsCancellationRequested))
{
processNowRunnable();
}
return true;
}, cancellationSource.Token, TaskContinuationOptions.None, workExecutor.Scheduler);
}
else
{
if (flushFuture == null || flushFuture.IsCompleted)
throw new InvalidOperationException("Flushfuture missing despite scheduled.");
}
}
private void Unschedule()
{
Log.V(Tag, "unschedule() called");
scheduled = false;
if (cancellationSource != null)
{
try
{
cancellationSource.Cancel(true);
}
catch (Exception)
{
// Swallow it.
}
Log.V(Tag, "cancallationSource.Cancel() called");
}
else
{
Log.V(Tag, "cancellationSource was null, doing nothing");
}
}
/// <summary>
/// Calculates the delay to use when scheduling the next batch of objects to process.
/// </summary>
/// <remarks>
/// There is a balance required between clearing down the input queue as fast as possible
/// and not exhausting downstream system resources such as sockets and http response buffers
/// by processing too many batches concurrently.
/// </remarks>
/// <returns>The to use.</returns>
private Int32 DelayToUse()
{
var delayToUse = delay;
var delta = (Int32)(DateTime.UtcNow - lastProcessedTime).TotalMilliseconds;
delayToUse = delta >= delay
? 0
: delay;
Log.V(Tag, "DelayToUse() delta: {0}, delayToUse: {1}, delay: {2} [last: {3}]", delta, delayToUse, delay, lastProcessedTime.ToString());
return delayToUse;
}
}
}
| 35.056022 | 229 | 0.526968 |
b0c908495552632d6217bd5dee2235f82f8f74cb | 224 | py | Python | webServer/input_DB.py | CSID-DGU/2021-2-OSSP2-Coconut-1 | d910af8760ee5b8e29f3bde61a0695656deadd9d | [
"MIT"
] | null | null | null | webServer/input_DB.py | CSID-DGU/2021-2-OSSP2-Coconut-1 | d910af8760ee5b8e29f3bde61a0695656deadd9d | [
"MIT"
] | null | null | null | webServer/input_DB.py | CSID-DGU/2021-2-OSSP2-Coconut-1 | d910af8760ee5b8e29f3bde61a0695656deadd9d | [
"MIT"
] | null | null | null | import pandas as pd
data = pd.read_csv("./2021-2-OSSP2-Coconut-1/algorithm/matrix_231x201.csv")
for row in range(len(data)):
for col in range(len(data.iloc[0])-2):
len(data.iloc[row])
print(data.iloc[0,1]) | 24.888889 | 75 | 0.665179 |
47ecc7b670b6a2de4b3b42aa3982d28c3a3da878 | 2,076 | rb | Ruby | app/models/requests/borrow_direct_lookup.rb | pulibrary/requests | dad6078a269f2508e1c06011131585e856b0b331 | [
"MIT"
] | 2 | 2017-07-07T04:21:29.000Z | 2018-05-02T20:55:16.000Z | app/models/requests/borrow_direct_lookup.rb | pulibrary/requests | dad6078a269f2508e1c06011131585e856b0b331 | [
"MIT"
] | 811 | 2015-11-30T18:13:01.000Z | 2022-03-30T20:34:24.000Z | app/models/requests/borrow_direct_lookup.rb | pulibrary/requests | dad6078a269f2508e1c06011131585e856b0b331 | [
"MIT"
] | null | null | null | require 'borrow_direct'
module Requests
class BorrowDirectLookup
attr_reader :query_params
attr_reader :find_response
attr_reader :request_number
def initialize; end
# default method using BorrowDirect::Defaults.find_item_patron_barcode
def find(query_params, barcode = nil)
## failed lookup response looks like
## #<BorrowDirect::FindItem::Response:0x007fd34f289900 @response_hash={"Problem"=>{"ErrorCode"=>"PUBFI002", "ErrorMessage"=>"No result"}}, @auth_id="lO1ufRAj6CcG9AqOHV_kks3ozR8">
## good response looks like
## #<BorrowDirect::FindItem::Response:0x007fd353863980 @response_hash={"Available"=>true, "SearchTerm"=>"isbn=0415296633", "RequestLink"=>{"ButtonLink"=>"AddRequest", "ButtonLabel"=>"Request", "RequestMessage"=>"Select a pick-up location and click the Request button to order this item through Borrow Direct."}, "NumberOfRecords"=>1, "PickupLocation"=>[{"PickupLocationCode"=>"I", "PickupLocationDescription"=>"Architecture Library"}, {"PickupLocationCode"=>"A", "PickupLocationDescription"=>"East Asian Library"}, {"PickupLocationCode"=>"B", "PickupLocationDescription"=>"Engineering Library"}, {"PickupLocationCode"=>"C", "PickupLocationDescription"=>"Firestone Library"}, {"PickupLocationCode"=>"E", "PickupLocationDescription"=>"Lewis Library"}, {"PickupLocationCode"=>"F", "PickupLocationDescription"=>"Mendel Music Library"}, {"PickupLocationCode"=>"D", "PickupLocationDescription"=>"Plasma Physics Library"}, {"PickupLocationCode"=>"H", "PickupLocationDescription"=>"Stokes Library"}]}, @auth_id="LSGSEDkamjcoLRNPxdNsgpbCD00">
@find_response = if barcode.nil?
::BorrowDirect::FindItem.new.find(query_params)
else
::BorrowDirect::FindItem.new(barcode).find(query_params)
end
rescue ::BorrowDirect::Error => error
@find_response = { error: error.message }
end
def available?
if find_response.requestable?
true
else
false
end
end
end
end
| 57.666667 | 1,039 | 0.696532 |
6d9530a93da32606ca9a2bbca2a838d364ff7219 | 4,045 | h | C | RenderCore/OpenGLES/Metal/Resource.h | pocketgems/XLE2 | 82771e9ab1fc3b12927f1687bbe05d4f7dce8765 | [
"MIT"
] | 3 | 2018-05-17T08:39:39.000Z | 2020-12-09T13:20:26.000Z | RenderCore/OpenGLES/Metal/Resource.h | pocketgems/XLE2 | 82771e9ab1fc3b12927f1687bbe05d4f7dce8765 | [
"MIT"
] | null | null | null | RenderCore/OpenGLES/Metal/Resource.h | pocketgems/XLE2 | 82771e9ab1fc3b12927f1687bbe05d4f7dce8765 | [
"MIT"
] | 1 | 2021-11-14T08:50:15.000Z | 2021-11-14T08:50:15.000Z | #pragma once
#include "../../ResourceDesc.h"
#include "../../IDevice.h"
#include "ObjectFactory.h"
#include "../../../Utility/IteratorUtils.h"
namespace RenderCore
{
class SubResourceInitData;
}
namespace RenderCore { namespace Metal_OpenGLES
{
class ObjectFactory;
class Resource : public IResource
{
public:
using Desc = ResourceDesc;
Desc GetDesc() const override { return _desc; }
const intrusive_ptr<OpenGL::Buffer>& GetBuffer() const { return _underlyingBuffer; }
const intrusive_ptr<OpenGL::Texture>& GetTexture() const { return _underlyingTexture; }
const intrusive_ptr<OpenGL::RenderBuffer>& GetRenderBuffer() const { return _underlyingRenderBuffer; }
IteratorRange<const void*> GetConstantBuffer() const { return MakeIteratorRange(_constantBuffer); }
uint64_t GetConstantBufferHash() const { return _constantBufferHash; }
const bool IsBackBuffer() { return _isBackBuffer; }
virtual void* QueryInterface(size_t guid) override;
virtual uint64_t GetGUID() const override;
virtual std::vector<uint8_t> ReadBack(IThreadContext& context, SubResourceId subRes) const override;
Resource(
ObjectFactory& factory, const Desc& desc,
const SubResourceInitData& initData = SubResourceInitData{});
Resource(
ObjectFactory& factory, const Desc& desc,
const IDevice::ResourceInitializer& initData);
Resource(const intrusive_ptr<OpenGL::Texture>&, const ResourceDesc& = {});
Resource(const intrusive_ptr<OpenGL::RenderBuffer>&);
Resource(const intrusive_ptr<OpenGL::Buffer>&);
Resource();
~Resource();
mutable uint64_t _lastBoundSamplerState = ~0u;
static Resource CreateBackBuffer(const Desc& desc);
protected:
intrusive_ptr<OpenGL::Buffer> _underlyingBuffer;
intrusive_ptr<OpenGL::Texture> _underlyingTexture;
intrusive_ptr<OpenGL::RenderBuffer> _underlyingRenderBuffer;
std::vector<uint8_t> _constantBuffer;
uint64_t _constantBufferHash = 0ull;
bool _isBackBuffer;
Desc _desc;
uint64_t _guid;
};
GLenum AsBufferTarget(BindFlag::BitField bindFlags);
GLenum AsUsageMode(CPUAccess::BitField cpuAccess, GPUAccess::BitField gpuAccess);
inline RawGLHandle GetBufferRawGLHandle(const IResource& resource)
{
return static_cast<const Resource&>(resource).GetBuffer()->AsRawGLHandle();
}
ResourceDesc ExtractDesc(const IResource& res);
IResourcePtr CreateResource(
ObjectFactory& factory, const ResourceDesc& desc,
const IDevice::ResourceInitializer& initData = nullptr);
ResourceDesc ExtractDesc(OpenGL::RenderBuffer* renderbuffer);
ResourceDesc ExtractDesc(OpenGL::Texture* renderbuffer);
ResourceDesc ExtractDesc(OpenGL::Buffer* renderbuffer);
std::string DescribeUnknownObject(unsigned glName);
class BlitPass
{
public:
class CopyPartial_Dest
{
public:
IResource* _resource;
SubResourceId _subResource;
VectorPattern<unsigned, 3> _leftTopFront;
};
class CopyPartial_Src
{
public:
IResource* _resource;
SubResourceId _subResource;
VectorPattern<unsigned, 3> _leftTopFront;
VectorPattern<unsigned, 3> _rightBottomBack;
};
void Write(
const CopyPartial_Dest& dst,
const SubResourceInitData& srcData,
Format srcDataFormat,
VectorPattern<unsigned, 3> srcDataDimensions);
void Copy(
const CopyPartial_Dest& dst,
const CopyPartial_Src& src);
BlitPass(IThreadContext& threadContext);
~BlitPass();
private:
GLint _prevTextureBinding;
GLint _prevUnpackAlignment, _prevUnpackRowLength;
bool _boundTexture;
};
}}
| 33.429752 | 110 | 0.659333 |
1f0c601a06a29c6590f1031a33192899f6bfebf6 | 2,240 | sql | SQL | sql/2020/css/calc_units.sql | andreylipattsev/almanac.httparchive.org | a05ae166c09eecdcd34e0c1882d3003b5bfee6b6 | [
"Apache-2.0"
] | 1 | 2022-02-17T21:14:02.000Z | 2022-02-17T21:14:02.000Z | sql/2020/css/calc_units.sql | andreylipattsev/almanac.httparchive.org | a05ae166c09eecdcd34e0c1882d3003b5bfee6b6 | [
"Apache-2.0"
] | 107 | 2019-10-10T22:56:25.000Z | 2021-06-03T05:28:54.000Z | sql/2020/css/calc_units.sql | andreylipattsev/almanac.httparchive.org | a05ae166c09eecdcd34e0c1882d3003b5bfee6b6 | [
"Apache-2.0"
] | 2 | 2019-10-10T11:31:25.000Z | 2020-07-19T04:20:42.000Z | #standardSQL
CREATE TEMPORARY FUNCTION getCalcUnits(css STRING)
RETURNS ARRAY<STRUCT<name STRING, freq INT64>>
LANGUAGE js
OPTIONS (library = "gs://httparchive/lib/css-utils.js")
AS '''
try {
function compute(ast) {
let ret = {
total: 0,
properties: {},
units: {},
number_of_different_units: {},
operators: {},
number_of_operators: {},
number_of_parens: {},
constants: new Set()
};
walkDeclarations(ast, ({property, value}) => {
for (let calc of extractFunctionCalls(value, {names: "calc"})) {
incrementByKey(ret.properties, property);
ret.total++;
let args = calc.args.replace(/calc\\(/g, "(");
let units = args.match(/[a-z]+|%/g) || [];
units.forEach(e => incrementByKey(ret.units, e));
incrementByKey(ret.number_of_different_units, new Set(units).size);
let ops = args.match(/[-+\\/*]/g) || [];
ops.forEach(e => incrementByKey(ret.operators, e));
incrementByKey(ret.number_of_operators, ops.length);
let parens = args.match(/\\(/g) || [];
incrementByKey(ret.number_of_parens, parens.length);
if (units.length === 0) {
ret.constants.add(args);
}
}
}, {
values: /calc\\(/,
not: {
values: /var\\(--/
}
});
ret.constants = [...ret.constants];
for (let type in ret) {
if (ret[type].constructor === Object) {
ret[type] = sortObject(ret[type]);
}
}
return ret;
}
var ast = JSON.parse(css);
var calc = compute(ast);
return Object.entries(calc.units).map(([name, freq]) => ({name, freq}))
} catch (e) {
return [];
}
''';
SELECT
client,
unit,
COUNT(DISTINCT url) AS pages,
SUM(freq) AS freq,
SUM(SUM(freq)) OVER (PARTITION BY client) AS total,
SUM(freq) / SUM(SUM(freq)) OVER (PARTITION BY client) AS pct
FROM (
SELECT
client,
url,
unit.name AS unit,
unit.freq
FROM
`httparchive.almanac.parsed_css`,
UNNEST(getCalcUnits(css)) AS unit
WHERE
date = '2020-08-01' AND
# Limit the size of the CSS to avoid OOM crashes.
LENGTH(css) < 0.1 * 1024 * 1024)
GROUP BY
client,
unit
HAVING
pages >= 100
ORDER BY
pct DESC
| 23.829787 | 75 | 0.580804 |
f37265dbff300f9c320bd94407f2e31866552a4b | 1,822 | lua | Lua | Hack/Lua/5.1/examples/luaex/test.lua | andregoro/sitemain | 44d9eb6e7e29253b89664efb462829294d0d6326 | [
"FSFAP"
] | 16 | 2020-09-20T22:32:54.000Z | 2021-04-02T17:14:25.000Z | Hack/Lua/5.1/examples/luaex/test.lua | andregoro/sitemain | 44d9eb6e7e29253b89664efb462829294d0d6326 | [
"FSFAP"
] | 3 | 2020-09-30T11:41:49.000Z | 2021-12-19T23:27:19.000Z | Hack/Lua/5.1/examples/luaex/test.lua | andregoro/sitemain | 44d9eb6e7e29253b89664efb462829294d0d6326 | [
"FSFAP"
] | 1 | 2020-06-29T07:13:57.000Z | 2020-06-29T07:13:57.000Z | -- ---------------------------------------------------------------------------
-- ex.lua - This is a small example of some of the things that can be done
-- with the 'ex' library.
--
-- Author: Ryan Pusztai
-- Date: 07/23/2007
-- Version: 1.00
--
-- NOTES:
-- * You can use the 'ex' namespace for all of the commands in the 'ex'
-- library. ex: ex.currentdir() and ex.chdir()
-- ---------------------------------------------------------------------------
-- INCLUDES ------------------------------------------------------------------
--
require( "ex" )
-- DEBUGGING -----------------------------------------------------------------
--
print( "-- CURRENT DIRECTORY --------------------------------------------------------" )
local oldCurDir = os.currentdir()
print( oldCurDir )
print( "-- CHANGE DIRECTORY (UP ONE DIRECTORY) --------------------------------------" )
os.chdir( ".." )
print( os.currentdir() )
print( "-- CHANGE DIRECTORY (BACK TO ORIGINAL) --------------------------------------" )
os.chdir( oldCurDir )
print( os.currentdir() )
print( "\n-- $PATH ENVIRONMENT VARIABLE -----------------------------------------------" )
print( os.getenv( "PATH" ) )
print( "\n-- ENUMERATE ALL ENVIRONMENT VARIABLES --------------------------------------" )
local e = assert( os.environ() )
table.foreach( e, function( nam, val ) print( string.format( "%s=%s", nam, val) ) end )
print( "\n-- SHOW ALL FILES AND DIRECTORIES IN THE CURRENT DIRECTORY ------------------" )
for e in assert(os.dir(".")) do
print(string.format("%.4s %9d %s", e.type or 'Unknown', e.size or -1, e.name))
end
print( "\n-- PING GOOGLE.COM ----------------------------------------------------------" )
local proc = assert( os.spawn( "ping", { "google.com" } ) )
print( proc )
print( "Process exit code:", assert( proc:wait() ) )
| 38.765957 | 90 | 0.431943 |
d3d548c65653c4517106ee5268e24d5733b9fec6 | 738 | rb | Ruby | lib/flickrb/configuration.rb | paveg/Flickrb | 8d884b11842b68de8c7cfae96a06f5fee736ba99 | [
"MIT"
] | null | null | null | lib/flickrb/configuration.rb | paveg/Flickrb | 8d884b11842b68de8c7cfae96a06f5fee736ba99 | [
"MIT"
] | 4 | 2018-06-17T18:46:56.000Z | 2018-07-19T17:39:35.000Z | lib/flickrb/configuration.rb | paveg/Flickrb | 8d884b11842b68de8c7cfae96a06f5fee736ba99 | [
"MIT"
] | 1 | 2018-07-20T05:55:10.000Z | 2018-07-20T05:55:10.000Z | # frozen_string_literal: true
require 'flickrb/configuration'
require 'flickrb/default'
module Flickrb
module Configuration
extend Forwardable
attr_accessor :api_key
class << self
# @return [Array]
def attr_keys
@attr_keys ||= %i[api_key api_secret]
end
end
def configure
yield self
self
end
def reset!
Flickrb::Configuration.attr_keys.each do |key|
instance_variable_set(:"@#{key}", Flickrb::Default.options[key])
end
self
end
private
# @return [Hash]
def options
Hash[
Flickrb::Configuration.attr_keys.map do |key|
[key, instance_variable_get(:"@#{key}")]
end
]
end
end
end
| 17.162791 | 72 | 0.604336 |
9fd4fd9cfb9349cc95f02927de8c1df6454f7007 | 876 | py | Python | 2020/d25/d225.py | adam-blinzler/advent_of_code_2020 | a9681c04e1618090913411c24d3872cd97fc6ec9 | [
"MIT"
] | null | null | null | 2020/d25/d225.py | adam-blinzler/advent_of_code_2020 | a9681c04e1618090913411c24d3872cd97fc6ec9 | [
"MIT"
] | null | null | null | 2020/d25/d225.py | adam-blinzler/advent_of_code_2020 | a9681c04e1618090913411c24d3872cd97fc6ec9 | [
"MIT"
] | null | null | null | def find_loop_size(target):
loop_size = 0
c = 1
while True:
loop_size += 1
c *= 7
c = c % 20201227
if c == target:
return loop_size
def transform_loop(public, loop_size):
c = 1
for _ in range(loop_size):
c *= public
c = c % 20201227
return c
####################
with open("input.txt") as f:
c_public = int(f.readline().strip())
d_public = int(f.readline().strip())
c_loop = find_loop_size(c_public)
d_loop = find_loop_size(d_public)
print("Card loop size :",c_loop)
print("Door loop size :",d_loop)
c_secret = transform_loop(c_public,d_loop)
d_secret = transform_loop(d_public,c_loop)
if c_secret == d_secret:
print("Secret key matched :",d_secret)
else:
print("Something went wrong!")
print("Card secrete was :", c_secret)
print("Door secrete was :", d_secret)
| 23.675676 | 42 | 0.615297 |
5b9fd2039504c3deec63eb89a371e56d62bd66ca | 793 | swift | Swift | Sources/ABCIMessages/Types/PartSetHeader.swift | CosmosSwift/swift-abci | 5d7d73a9038bdde5e266b9f0a337b4bb4a889bdc | [
"Apache-2.0"
] | 6 | 2020-06-05T16:20:19.000Z | 2021-02-17T22:40:09.000Z | Sources/ABCIMessages/Types/PartSetHeader.swift | CosmosSwift/swift-abci | 5d7d73a9038bdde5e266b9f0a337b4bb4a889bdc | [
"Apache-2.0"
] | null | null | null | Sources/ABCIMessages/Types/PartSetHeader.swift | CosmosSwift/swift-abci | 5d7d73a9038bdde5e266b9f0a337b4bb4a889bdc | [
"Apache-2.0"
] | null | null | null | // ===----------------------------------------------------------------------===
//
// This source file is part of the CosmosSwift open source project.
//
// PartSetHeader.swift last updated 02/06/2020
//
// Copyright © 2020 Katalysis B.V. and the CosmosSwift project authors.
// Licensed under Apache License v2.0
//
// See LICENSE.txt for license information
// See CONTRIBUTORS.txt for the list of CosmosSwift project authors
//
// SPDX-License-Identifier: Apache-2.0
//
// ===----------------------------------------------------------------------===
import Foundation
public struct PartSetHeader: Codable {
public let total: UInt32
public let hash: Data
public init(total: UInt32 = 0, hash: Data = Data()) {
self.total = total
self.hash = hash
}
}
| 28.321429 | 79 | 0.551072 |
a151cc232ee49f052b3eca683c197599bb0bcf49 | 730 | ts | TypeScript | src/backend/components/base.ts | synesthesia-project/light-desk | e71964362c35c93103d70eac3d9e70166e1e120c | [
"MIT"
] | 6 | 2018-12-12T19:05:18.000Z | 2019-09-24T19:33:31.000Z | src/backend/components/base.ts | synesthesia-project/light-desk | e71964362c35c93103d70eac3d9e70166e1e120c | [
"MIT"
] | 7 | 2020-09-05T20:31:10.000Z | 2022-01-11T08:35:46.000Z | src/backend/components/base.ts | synesthesia-project/light-desk | e71964362c35c93103d70eac3d9e70166e1e120c | [
"MIT"
] | null | null | null | import * as proto from '../../shared/proto';
import {IDMap} from '../util/id-map';
export abstract class Component {
/** @hidden */
private parent: Parent | null = null;
/** @hidden */
public setParent(parent: Parent) {
if (this.parent) {
// TODO: remove self from existing parent
}
this.parent = parent;
}
/** @hidden */
public updateTree() {
if (this.parent) this.parent.updateTree();
}
/** @hidden */
public abstract getProtoInfo(idMap: IDMap): proto.Component;
/** @hidden */
public handleMessage(message: proto.ClientComponentMessage): void {
console.log('Component Received Message:', message);
}
}
/** @hidden */
export interface Parent {
updateTree(): void;
}
| 20.277778 | 69 | 0.631507 |
0cadf215d9993a53a0a80b350c160e8eaf5bf5c1 | 471 | sql | SQL | src/data/books/updateBook.sql | rgorme/librarydb | 6ab6878f2ecf438d1d13ec51195a0bfc2ead801f | [
"MIT"
] | null | null | null | src/data/books/updateBook.sql | rgorme/librarydb | 6ab6878f2ecf438d1d13ec51195a0bfc2ead801f | [
"MIT"
] | null | null | null | src/data/books/updateBook.sql | rgorme/librarydb | 6ab6878f2ecf438d1d13ec51195a0bfc2ead801f | [
"MIT"
] | null | null | null | DECLARE @DB_BOOK_TITLE VARCHAR(1000)
DECLARE @DB_BOOK_PAGE_NUMBER INT
DECLARE @DB_BOOK_ISBN VARCHAR(13)
DECLARE @DB_BOOK_RESUME VARCHAR(MAX)
DECLARE @DB_BOOK_ID INT
SET @DB_BOOK_TITLE = @BOOK_TITLE
SET @DB_BOOK_PAGE_NUMBER = @BOOK_PAGE_NUMBER
SET @DB_BOOK_ISBN = @BOOK_ISBN
SET @DB_BOOK_RESUME = @BOOK_RESUME
SET @DB_BOOK_ID = @BOOK_ID
EXECUTE [dbo].[proc_InsertOrUpdateBook]
@DB_BOOK_TITLE
,@DB_BOOK_PAGE_NUMBER
,@DB_BOOK_ISBN
,@DB_BOOK_RESUME
,@DB_BOOK_ID | 26.166667 | 44 | 0.798301 |
05f145b8b46b39daeae5064c336d78fd9614276d | 1,761 | py | Python | tests/test_cards.py | SEary342/PyBlackjack | 479d45f4d0e0523475ac1c4b28502c0a7cf0e4f8 | [
"MIT"
] | null | null | null | tests/test_cards.py | SEary342/PyBlackjack | 479d45f4d0e0523475ac1c4b28502c0a7cf0e4f8 | [
"MIT"
] | null | null | null | tests/test_cards.py | SEary342/PyBlackjack | 479d45f4d0e0523475ac1c4b28502c0a7cf0e4f8 | [
"MIT"
] | null | null | null | import unittest
import copy
from cards import Card, build_deck, _shuffle
class Test_Card_Methods(unittest.TestCase):
card_list = [
Card("5", "Hearts", 5),
Card("6", "Spades", 6),
Card("King", "Spades", 10),
]
def test_card_reps(self):
test_card = Card("5", "Hearts", 5)
self.assertEqual(str(test_card), "5 of Hearts")
def test_string_cards(self):
self.assertEqual(
Card.string_cards(Test_Card_Methods.card_list),
"5 of Hearts, 6 of Spades, King of Spades (Total: 21)",
)
self.assertEqual(
Card.string_cards(Test_Card_Methods.card_list, True),
"(Hidden), 6 of Spades, King of Spades (Total: 16)",
)
self.assertEqual(
Card.string_cards(Test_Card_Methods.card_list, True, False),
"(Hidden), 6 of Spades, King of Spades",
)
def test_card_value(self):
# Test non-Ace
self.assertEqual(Card.cards_value(Test_Card_Methods.card_list), 21)
# Test Ace
card_list2 = [Card("5", "Hearts", 5), Card("Ace", "Hearts", (1, 11))]
self.assertEqual(Card.cards_value(card_list2), 16)
# Push the total over 21 with Ace == 11
card_list2.append(Card("King", "Hearts", 10))
self.assertEqual(Card.cards_value(card_list2), 16)
class Test_Deck_Build_Methods(unittest.TestCase):
def test_deck_build(self):
local_deck = build_deck()
self.assertEqual(len(local_deck), 52)
def test_shuffle(self):
local_deck = build_deck()
orig_deck = copy.deepcopy(local_deck)
new_deck = _shuffle(local_deck)
self.assertCountEqual(orig_deck, new_deck)
self.assertTrue(orig_deck != new_deck)
| 31.446429 | 77 | 0.618966 |
c9b87f811453e21246c33f0a86f10c361f7f6fcc | 1,234 | ts | TypeScript | dist/mixins/hookable-mixin.d.ts | Eveble/eveble | 634f8ce55b78e1ad2cdd9abb2068322382dcb873 | [
"MIT"
] | 7 | 2017-02-21T03:53:51.000Z | 2021-06-28T15:09:08.000Z | dist/mixins/hookable-mixin.d.ts | Eveble/eveble | 634f8ce55b78e1ad2cdd9abb2068322382dcb873 | [
"MIT"
] | 27 | 2020-07-05T19:38:29.000Z | 2022-03-27T01:54:32.000Z | dist/mixins/hookable-mixin.d.ts | Eveble/eveble | 634f8ce55b78e1ad2cdd9abb2068322382dcb873 | [
"MIT"
] | null | null | null | import 'reflect-metadata';
import { ExtendableError } from '@eveble/core';
import { types } from '../types';
export declare class HookError extends ExtendableError {
}
export declare class InvalidHookActionError extends HookError {
constructor(got: any);
}
export declare class InvalidHookIdError extends HookError {
constructor(got: any);
}
export declare class HookAlreadyExistsError extends HookError {
constructor(typeName: types.TypeName, action: string, id: string);
}
export declare class HookNotFoundError extends HookError {
constructor(typeName: types.TypeName, action: string, id: string);
}
export declare class HookableMixin implements types.Hookable {
registerHook(action: string, id: string, hook: types.Hook, shouldOverride?: boolean): void;
overrideHook(action: string, id: string, hook: types.Hook): void;
getHook(action: string, id: string): types.Hook | undefined;
getHookOrThrow(action: string, id: string): types.Hook;
getHooks(action: string): types.hooks.Mappings;
getActions(): types.hooks.Actions;
hasHook(action: string, id: string): boolean;
hasAction(action: string): boolean;
removeHook(action: string, id: string): void;
}
| 42.551724 | 96 | 0.729335 |
8eb127bd23e401dd104abdec94cc490b834fc568 | 845,276 | js | JavaScript | dist/vendor.js | GongT/actions-recreate-release | 3faec3928635e661a683e3ea12af7f4589279978 | [
"MIT"
] | 1 | 2020-12-07T14:37:22.000Z | 2020-12-07T14:37:22.000Z | dist/vendor.js | GongT/actions-recreate-release | 3faec3928635e661a683e3ea12af7f4589279978 | [
"MIT"
] | 1 | 2020-11-07T11:38:37.000Z | 2020-11-16T07:42:40.000Z | dist/vendor.js | GongT/actions-recreate-release | 3faec3928635e661a683e3ea12af7f4589279978 | [
"MIT"
] | null | null | null | 'use strict';
var path = require('path');
var fs = require('fs');
var constants = require('constants');
var Stream$1 = require('stream');
var util$1 = require('util');
var assert = require('assert');
var require$$0 = require('console');
var require$$0$1 = require('os');
var childProcess = require('child_process');
var require$$1 = require('events');
var require$$0$2 = require('buffer');
var http = require('http');
var url = require('url');
var https = require('https');
var zlib = require('zlib');
require('net');
var tls = require('tls');
function _interopDefaultLegacy (e) { return e && typeof e === 'object' && 'default' in e ? e : { 'default': e }; }
var path__default = /*#__PURE__*/_interopDefaultLegacy(path);
var fs__default = /*#__PURE__*/_interopDefaultLegacy(fs);
var constants__default = /*#__PURE__*/_interopDefaultLegacy(constants);
var Stream__default = /*#__PURE__*/_interopDefaultLegacy(Stream$1);
var util__default = /*#__PURE__*/_interopDefaultLegacy(util$1);
var assert__default = /*#__PURE__*/_interopDefaultLegacy(assert);
var require$$0__default = /*#__PURE__*/_interopDefaultLegacy(require$$0);
var require$$0__default$1 = /*#__PURE__*/_interopDefaultLegacy(require$$0$1);
var childProcess__default = /*#__PURE__*/_interopDefaultLegacy(childProcess);
var require$$1__default = /*#__PURE__*/_interopDefaultLegacy(require$$1);
var require$$0__default$2 = /*#__PURE__*/_interopDefaultLegacy(require$$0$2);
var http__default = /*#__PURE__*/_interopDefaultLegacy(http);
var url__default = /*#__PURE__*/_interopDefaultLegacy(url);
var https__default = /*#__PURE__*/_interopDefaultLegacy(https);
var zlib__default = /*#__PURE__*/_interopDefaultLegacy(zlib);
var tls__default = /*#__PURE__*/_interopDefaultLegacy(tls);
var commonjsGlobal = typeof globalThis !== 'undefined' ? globalThis : typeof window !== 'undefined' ? window : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};
function createCommonjsModule(fn, basedir, module) {
return module = {
path: basedir,
exports: {},
require: function (path, base) {
return commonjsRequire(path, (base === undefined || base === null) ? module.path : base);
}
}, fn(module, module.exports), module.exports;
}
function commonjsRequire () {
throw new Error('Dynamic requires are not currently supported by @rollup/plugin-commonjs');
}
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');
/**
* Encode an integer in the range of 0 to 63 to a single base 64 digit.
*/
var encode = function (number) {
if (0 <= number && number < intToCharMap.length) {
return intToCharMap[number];
}
throw new TypeError("Must be between 0 and 63: " + number);
};
/**
* Decode a single base 64 character code digit to an integer. Returns -1 on
* failure.
*/
var decode = function (charCode) {
var bigA = 65; // 'A'
var bigZ = 90; // 'Z'
var littleA = 97; // 'a'
var littleZ = 122; // 'z'
var zero = 48; // '0'
var nine = 57; // '9'
var plus = 43; // '+'
var slash = 47; // '/'
var littleOffset = 26;
var numberOffset = 52;
// 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ
if (bigA <= charCode && charCode <= bigZ) {
return (charCode - bigA);
}
// 26 - 51: abcdefghijklmnopqrstuvwxyz
if (littleA <= charCode && charCode <= littleZ) {
return (charCode - littleA + littleOffset);
}
// 52 - 61: 0123456789
if (zero <= charCode && charCode <= nine) {
return (charCode - zero + numberOffset);
}
// 62: +
if (charCode == plus) {
return 62;
}
// 63: /
if (charCode == slash) {
return 63;
}
// Invalid base64 digit.
return -1;
};
var base64 = {
encode: encode,
decode: decode
};
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*
* Based on the Base 64 VLQ implementation in Closure Compiler:
* https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
*
* Copyright 2011 The Closure Compiler Authors. All rights reserved.
* Redistribution and use in source and binary forms, with or without
* modification, are permitted provided that the following conditions are
* met:
*
* * Redistributions of source code must retain the above copyright
* notice, this list of conditions and the following disclaimer.
* * Redistributions in binary form must reproduce the above
* copyright notice, this list of conditions and the following
* disclaimer in the documentation and/or other materials provided
* with the distribution.
* * Neither the name of Google Inc. nor the names of its
* contributors may be used to endorse or promote products derived
* from this software without specific prior written permission.
*
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
* "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
* LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
* A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
* OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
* SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
* LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
* DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
* THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
* (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
* OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
*/
// A single base 64 digit can contain 6 bits of data. For the base 64 variable
// length quantities we use in the source map spec, the first bit is the sign,
// the next four bits are the actual value, and the 6th bit is the
// continuation bit. The continuation bit tells us whether there are more
// digits in this value following this digit.
//
// Continuation
// | Sign
// | |
// V V
// 101011
var VLQ_BASE_SHIFT = 5;
// binary: 100000
var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
// binary: 011111
var VLQ_BASE_MASK = VLQ_BASE - 1;
// binary: 100000
var VLQ_CONTINUATION_BIT = VLQ_BASE;
/**
* Converts from a two-complement value to a value where the sign bit is
* placed in the least significant bit. For example, as decimals:
* 1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
* 2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
*/
function toVLQSigned(aValue) {
return aValue < 0
? ((-aValue) << 1) + 1
: (aValue << 1) + 0;
}
/**
* Converts to a two-complement value from a value where the sign bit is
* placed in the least significant bit. For example, as decimals:
* 2 (10 binary) becomes 1, 3 (11 binary) becomes -1
* 4 (100 binary) becomes 2, 5 (101 binary) becomes -2
*/
function fromVLQSigned(aValue) {
var isNegative = (aValue & 1) === 1;
var shifted = aValue >> 1;
return isNegative
? -shifted
: shifted;
}
/**
* Returns the base 64 VLQ encoded value.
*/
var encode$1 = function base64VLQ_encode(aValue) {
var encoded = "";
var digit;
var vlq = toVLQSigned(aValue);
do {
digit = vlq & VLQ_BASE_MASK;
vlq >>>= VLQ_BASE_SHIFT;
if (vlq > 0) {
// There are still more digits in this value, so we must make sure the
// continuation bit is marked.
digit |= VLQ_CONTINUATION_BIT;
}
encoded += base64.encode(digit);
} while (vlq > 0);
return encoded;
};
/**
* Decodes the next base 64 VLQ value from the given string and returns the
* value and the rest of the string via the out parameter.
*/
var decode$1 = function base64VLQ_decode(aStr, aIndex, aOutParam) {
var strLen = aStr.length;
var result = 0;
var shift = 0;
var continuation, digit;
do {
if (aIndex >= strLen) {
throw new Error("Expected more digits in base 64 VLQ value.");
}
digit = base64.decode(aStr.charCodeAt(aIndex++));
if (digit === -1) {
throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1));
}
continuation = !!(digit & VLQ_CONTINUATION_BIT);
digit &= VLQ_BASE_MASK;
result = result + (digit << shift);
shift += VLQ_BASE_SHIFT;
} while (continuation);
aOutParam.value = fromVLQSigned(result);
aOutParam.rest = aIndex;
};
var base64Vlq = {
encode: encode$1,
decode: decode$1
};
var util = createCommonjsModule(function (module, exports) {
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
/**
* This is a helper function for getting values from parameter/options
* objects.
*
* @param args The object we are extracting values from
* @param name The name of the property we are getting.
* @param defaultValue An optional value to return if the property is missing
* from the object. If this is not specified and the property is missing, an
* error will be thrown.
*/
function getArg(aArgs, aName, aDefaultValue) {
if (aName in aArgs) {
return aArgs[aName];
} else if (arguments.length === 3) {
return aDefaultValue;
} else {
throw new Error('"' + aName + '" is a required argument.');
}
}
exports.getArg = getArg;
var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/;
var dataUrlRegexp = /^data:.+\,.+$/;
function urlParse(aUrl) {
var match = aUrl.match(urlRegexp);
if (!match) {
return null;
}
return {
scheme: match[1],
auth: match[2],
host: match[3],
port: match[4],
path: match[5]
};
}
exports.urlParse = urlParse;
function urlGenerate(aParsedUrl) {
var url = '';
if (aParsedUrl.scheme) {
url += aParsedUrl.scheme + ':';
}
url += '//';
if (aParsedUrl.auth) {
url += aParsedUrl.auth + '@';
}
if (aParsedUrl.host) {
url += aParsedUrl.host;
}
if (aParsedUrl.port) {
url += ":" + aParsedUrl.port;
}
if (aParsedUrl.path) {
url += aParsedUrl.path;
}
return url;
}
exports.urlGenerate = urlGenerate;
/**
* Normalizes a path, or the path portion of a URL:
*
* - Replaces consecutive slashes with one slash.
* - Removes unnecessary '.' parts.
* - Removes unnecessary '<dir>/..' parts.
*
* Based on code in the Node.js 'path' core module.
*
* @param aPath The path or url to normalize.
*/
function normalize(aPath) {
var path = aPath;
var url = urlParse(aPath);
if (url) {
if (!url.path) {
return aPath;
}
path = url.path;
}
var isAbsolute = exports.isAbsolute(path);
var parts = path.split(/\/+/);
for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
part = parts[i];
if (part === '.') {
parts.splice(i, 1);
} else if (part === '..') {
up++;
} else if (up > 0) {
if (part === '') {
// The first part is blank if the path is absolute. Trying to go
// above the root is a no-op. Therefore we can remove all '..' parts
// directly after the root.
parts.splice(i + 1, up);
up = 0;
} else {
parts.splice(i, 2);
up--;
}
}
}
path = parts.join('/');
if (path === '') {
path = isAbsolute ? '/' : '.';
}
if (url) {
url.path = path;
return urlGenerate(url);
}
return path;
}
exports.normalize = normalize;
/**
* Joins two paths/URLs.
*
* @param aRoot The root path or URL.
* @param aPath The path or URL to be joined with the root.
*
* - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
* scheme-relative URL: Then the scheme of aRoot, if any, is prepended
* first.
* - Otherwise aPath is a path. If aRoot is a URL, then its path portion
* is updated with the result and aRoot is returned. Otherwise the result
* is returned.
* - If aPath is absolute, the result is aPath.
* - Otherwise the two paths are joined with a slash.
* - Joining for example 'http://' and 'www.example.com' is also supported.
*/
function join(aRoot, aPath) {
if (aRoot === "") {
aRoot = ".";
}
if (aPath === "") {
aPath = ".";
}
var aPathUrl = urlParse(aPath);
var aRootUrl = urlParse(aRoot);
if (aRootUrl) {
aRoot = aRootUrl.path || '/';
}
// `join(foo, '//www.example.org')`
if (aPathUrl && !aPathUrl.scheme) {
if (aRootUrl) {
aPathUrl.scheme = aRootUrl.scheme;
}
return urlGenerate(aPathUrl);
}
if (aPathUrl || aPath.match(dataUrlRegexp)) {
return aPath;
}
// `join('http://', 'www.example.com')`
if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
aRootUrl.host = aPath;
return urlGenerate(aRootUrl);
}
var joined = aPath.charAt(0) === '/'
? aPath
: normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
if (aRootUrl) {
aRootUrl.path = joined;
return urlGenerate(aRootUrl);
}
return joined;
}
exports.join = join;
exports.isAbsolute = function (aPath) {
return aPath.charAt(0) === '/' || urlRegexp.test(aPath);
};
/**
* Make a path relative to a URL or another path.
*
* @param aRoot The root path or URL.
* @param aPath The path or URL to be made relative to aRoot.
*/
function relative(aRoot, aPath) {
if (aRoot === "") {
aRoot = ".";
}
aRoot = aRoot.replace(/\/$/, '');
// It is possible for the path to be above the root. In this case, simply
// checking whether the root is a prefix of the path won't work. Instead, we
// need to remove components from the root one by one, until either we find
// a prefix that fits, or we run out of components to remove.
var level = 0;
while (aPath.indexOf(aRoot + '/') !== 0) {
var index = aRoot.lastIndexOf("/");
if (index < 0) {
return aPath;
}
// If the only part of the root that is left is the scheme (i.e. http://,
// file:///, etc.), one or more slashes (/), or simply nothing at all, we
// have exhausted all components, so the path is not relative to the root.
aRoot = aRoot.slice(0, index);
if (aRoot.match(/^([^\/]+:\/)?\/*$/)) {
return aPath;
}
++level;
}
// Make sure we add a "../" for each component we removed from the root.
return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1);
}
exports.relative = relative;
var supportsNullProto = (function () {
var obj = Object.create(null);
return !('__proto__' in obj);
}());
function identity (s) {
return s;
}
/**
* Because behavior goes wacky when you set `__proto__` on objects, we
* have to prefix all the strings in our set with an arbitrary character.
*
* See https://github.com/mozilla/source-map/pull/31 and
* https://github.com/mozilla/source-map/issues/30
*
* @param String aStr
*/
function toSetString(aStr) {
if (isProtoString(aStr)) {
return '$' + aStr;
}
return aStr;
}
exports.toSetString = supportsNullProto ? identity : toSetString;
function fromSetString(aStr) {
if (isProtoString(aStr)) {
return aStr.slice(1);
}
return aStr;
}
exports.fromSetString = supportsNullProto ? identity : fromSetString;
function isProtoString(s) {
if (!s) {
return false;
}
var length = s.length;
if (length < 9 /* "__proto__".length */) {
return false;
}
if (s.charCodeAt(length - 1) !== 95 /* '_' */ ||
s.charCodeAt(length - 2) !== 95 /* '_' */ ||
s.charCodeAt(length - 3) !== 111 /* 'o' */ ||
s.charCodeAt(length - 4) !== 116 /* 't' */ ||
s.charCodeAt(length - 5) !== 111 /* 'o' */ ||
s.charCodeAt(length - 6) !== 114 /* 'r' */ ||
s.charCodeAt(length - 7) !== 112 /* 'p' */ ||
s.charCodeAt(length - 8) !== 95 /* '_' */ ||
s.charCodeAt(length - 9) !== 95 /* '_' */) {
return false;
}
for (var i = length - 10; i >= 0; i--) {
if (s.charCodeAt(i) !== 36 /* '$' */) {
return false;
}
}
return true;
}
/**
* Comparator between two mappings where the original positions are compared.
*
* Optionally pass in `true` as `onlyCompareGenerated` to consider two
* mappings with the same original source/line/column, but different generated
* line and column the same. Useful when searching for a mapping with a
* stubbed out mapping.
*/
function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
var cmp = strcmp(mappingA.source, mappingB.source);
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.originalLine - mappingB.originalLine;
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.originalColumn - mappingB.originalColumn;
if (cmp !== 0 || onlyCompareOriginal) {
return cmp;
}
cmp = mappingA.generatedColumn - mappingB.generatedColumn;
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.generatedLine - mappingB.generatedLine;
if (cmp !== 0) {
return cmp;
}
return strcmp(mappingA.name, mappingB.name);
}
exports.compareByOriginalPositions = compareByOriginalPositions;
/**
* Comparator between two mappings with deflated source and name indices where
* the generated positions are compared.
*
* Optionally pass in `true` as `onlyCompareGenerated` to consider two
* mappings with the same generated line and column, but different
* source/name/original line and column the same. Useful when searching for a
* mapping with a stubbed out mapping.
*/
function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {
var cmp = mappingA.generatedLine - mappingB.generatedLine;
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.generatedColumn - mappingB.generatedColumn;
if (cmp !== 0 || onlyCompareGenerated) {
return cmp;
}
cmp = strcmp(mappingA.source, mappingB.source);
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.originalLine - mappingB.originalLine;
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.originalColumn - mappingB.originalColumn;
if (cmp !== 0) {
return cmp;
}
return strcmp(mappingA.name, mappingB.name);
}
exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;
function strcmp(aStr1, aStr2) {
if (aStr1 === aStr2) {
return 0;
}
if (aStr1 === null) {
return 1; // aStr2 !== null
}
if (aStr2 === null) {
return -1; // aStr1 !== null
}
if (aStr1 > aStr2) {
return 1;
}
return -1;
}
/**
* Comparator between two mappings with inflated source and name strings where
* the generated positions are compared.
*/
function compareByGeneratedPositionsInflated(mappingA, mappingB) {
var cmp = mappingA.generatedLine - mappingB.generatedLine;
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.generatedColumn - mappingB.generatedColumn;
if (cmp !== 0) {
return cmp;
}
cmp = strcmp(mappingA.source, mappingB.source);
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.originalLine - mappingB.originalLine;
if (cmp !== 0) {
return cmp;
}
cmp = mappingA.originalColumn - mappingB.originalColumn;
if (cmp !== 0) {
return cmp;
}
return strcmp(mappingA.name, mappingB.name);
}
exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;
/**
* Strip any JSON XSSI avoidance prefix from the string (as documented
* in the source maps specification), and then parse the string as
* JSON.
*/
function parseSourceMapInput(str) {
return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, ''));
}
exports.parseSourceMapInput = parseSourceMapInput;
/**
* Compute the URL of a source given the the source root, the source's
* URL, and the source map's URL.
*/
function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) {
sourceURL = sourceURL || '';
if (sourceRoot) {
// This follows what Chrome does.
if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') {
sourceRoot += '/';
}
// The spec says:
// Line 4: An optional source root, useful for relocating source
// files on a server or removing repeated values in the
// “sources” entry. This value is prepended to the individual
// entries in the “source” field.
sourceURL = sourceRoot + sourceURL;
}
// Historically, SourceMapConsumer did not take the sourceMapURL as
// a parameter. This mode is still somewhat supported, which is why
// this code block is conditional. However, it's preferable to pass
// the source map URL to SourceMapConsumer, so that this function
// can implement the source URL resolution algorithm as outlined in
// the spec. This block is basically the equivalent of:
// new URL(sourceURL, sourceMapURL).toString()
// ... except it avoids using URL, which wasn't available in the
// older releases of node still supported by this library.
//
// The spec says:
// If the sources are not absolute URLs after prepending of the
// “sourceRoot”, the sources are resolved relative to the
// SourceMap (like resolving script src in a html document).
if (sourceMapURL) {
var parsed = urlParse(sourceMapURL);
if (!parsed) {
throw new Error("sourceMapURL could not be parsed");
}
if (parsed.path) {
// Strip the last path component, but keep the "/".
var index = parsed.path.lastIndexOf('/');
if (index >= 0) {
parsed.path = parsed.path.substring(0, index + 1);
}
}
sourceURL = join(urlGenerate(parsed), sourceURL);
}
return normalize(sourceURL);
}
exports.computeSourceURL = computeSourceURL;
});
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
var has = Object.prototype.hasOwnProperty;
var hasNativeMap = typeof Map !== "undefined";
/**
* A data structure which is a combination of an array and a set. Adding a new
* member is O(1), testing for membership is O(1), and finding the index of an
* element is O(1). Removing elements from the set is not supported. Only
* strings are supported for membership.
*/
function ArraySet() {
this._array = [];
this._set = hasNativeMap ? new Map() : Object.create(null);
}
/**
* Static method for creating ArraySet instances from an existing array.
*/
ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
var set = new ArraySet();
for (var i = 0, len = aArray.length; i < len; i++) {
set.add(aArray[i], aAllowDuplicates);
}
return set;
};
/**
* Return how many unique items are in this ArraySet. If duplicates have been
* added, than those do not count towards the size.
*
* @returns Number
*/
ArraySet.prototype.size = function ArraySet_size() {
return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;
};
/**
* Add the given string to this set.
*
* @param String aStr
*/
ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
var sStr = hasNativeMap ? aStr : util.toSetString(aStr);
var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);
var idx = this._array.length;
if (!isDuplicate || aAllowDuplicates) {
this._array.push(aStr);
}
if (!isDuplicate) {
if (hasNativeMap) {
this._set.set(aStr, idx);
} else {
this._set[sStr] = idx;
}
}
};
/**
* Is the given string a member of this set?
*
* @param String aStr
*/
ArraySet.prototype.has = function ArraySet_has(aStr) {
if (hasNativeMap) {
return this._set.has(aStr);
} else {
var sStr = util.toSetString(aStr);
return has.call(this._set, sStr);
}
};
/**
* What is the index of the given string in the array?
*
* @param String aStr
*/
ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
if (hasNativeMap) {
var idx = this._set.get(aStr);
if (idx >= 0) {
return idx;
}
} else {
var sStr = util.toSetString(aStr);
if (has.call(this._set, sStr)) {
return this._set[sStr];
}
}
throw new Error('"' + aStr + '" is not in the set.');
};
/**
* What is the element at the given index?
*
* @param Number aIdx
*/
ArraySet.prototype.at = function ArraySet_at(aIdx) {
if (aIdx >= 0 && aIdx < this._array.length) {
return this._array[aIdx];
}
throw new Error('No element indexed by ' + aIdx);
};
/**
* Returns the array representation of this set (which has the proper indices
* indicated by indexOf). Note that this is a copy of the internal array used
* for storing the members so that no one can mess with internal state.
*/
ArraySet.prototype.toArray = function ArraySet_toArray() {
return this._array.slice();
};
var ArraySet_1 = ArraySet;
var arraySet = {
ArraySet: ArraySet_1
};
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2014 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
/**
* Determine whether mappingB is after mappingA with respect to generated
* position.
*/
function generatedPositionAfter(mappingA, mappingB) {
// Optimized for most common case
var lineA = mappingA.generatedLine;
var lineB = mappingB.generatedLine;
var columnA = mappingA.generatedColumn;
var columnB = mappingB.generatedColumn;
return lineB > lineA || lineB == lineA && columnB >= columnA ||
util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;
}
/**
* A data structure to provide a sorted view of accumulated mappings in a
* performance conscious manner. It trades a neglibable overhead in general
* case for a large speedup in case of mappings being added in order.
*/
function MappingList() {
this._array = [];
this._sorted = true;
// Serves as infimum
this._last = {generatedLine: -1, generatedColumn: 0};
}
/**
* Iterate through internal items. This method takes the same arguments that
* `Array.prototype.forEach` takes.
*
* NOTE: The order of the mappings is NOT guaranteed.
*/
MappingList.prototype.unsortedForEach =
function MappingList_forEach(aCallback, aThisArg) {
this._array.forEach(aCallback, aThisArg);
};
/**
* Add the given source mapping.
*
* @param Object aMapping
*/
MappingList.prototype.add = function MappingList_add(aMapping) {
if (generatedPositionAfter(this._last, aMapping)) {
this._last = aMapping;
this._array.push(aMapping);
} else {
this._sorted = false;
this._array.push(aMapping);
}
};
/**
* Returns the flat, sorted array of mappings. The mappings are sorted by
* generated position.
*
* WARNING: This method returns internal data without copying, for
* performance. The return value must NOT be mutated, and should be treated as
* an immutable borrow. If you want to take ownership, you must make your own
* copy.
*/
MappingList.prototype.toArray = function MappingList_toArray() {
if (!this._sorted) {
this._array.sort(util.compareByGeneratedPositionsInflated);
this._sorted = true;
}
return this._array;
};
var MappingList_1 = MappingList;
var mappingList = {
MappingList: MappingList_1
};
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
var ArraySet$1 = arraySet.ArraySet;
var MappingList$1 = mappingList.MappingList;
/**
* An instance of the SourceMapGenerator represents a source map which is
* being built incrementally. You may pass an object with the following
* properties:
*
* - file: The filename of the generated source.
* - sourceRoot: A root for all relative URLs in this source map.
*/
function SourceMapGenerator(aArgs) {
if (!aArgs) {
aArgs = {};
}
this._file = util.getArg(aArgs, 'file', null);
this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
this._skipValidation = util.getArg(aArgs, 'skipValidation', false);
this._sources = new ArraySet$1();
this._names = new ArraySet$1();
this._mappings = new MappingList$1();
this._sourcesContents = null;
}
SourceMapGenerator.prototype._version = 3;
/**
* Creates a new SourceMapGenerator based on a SourceMapConsumer
*
* @param aSourceMapConsumer The SourceMap.
*/
SourceMapGenerator.fromSourceMap =
function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
var sourceRoot = aSourceMapConsumer.sourceRoot;
var generator = new SourceMapGenerator({
file: aSourceMapConsumer.file,
sourceRoot: sourceRoot
});
aSourceMapConsumer.eachMapping(function (mapping) {
var newMapping = {
generated: {
line: mapping.generatedLine,
column: mapping.generatedColumn
}
};
if (mapping.source != null) {
newMapping.source = mapping.source;
if (sourceRoot != null) {
newMapping.source = util.relative(sourceRoot, newMapping.source);
}
newMapping.original = {
line: mapping.originalLine,
column: mapping.originalColumn
};
if (mapping.name != null) {
newMapping.name = mapping.name;
}
}
generator.addMapping(newMapping);
});
aSourceMapConsumer.sources.forEach(function (sourceFile) {
var sourceRelative = sourceFile;
if (sourceRoot !== null) {
sourceRelative = util.relative(sourceRoot, sourceFile);
}
if (!generator._sources.has(sourceRelative)) {
generator._sources.add(sourceRelative);
}
var content = aSourceMapConsumer.sourceContentFor(sourceFile);
if (content != null) {
generator.setSourceContent(sourceFile, content);
}
});
return generator;
};
/**
* Add a single mapping from original source line and column to the generated
* source's line and column for this source map being created. The mapping
* object should have the following properties:
*
* - generated: An object with the generated line and column positions.
* - original: An object with the original line and column positions.
* - source: The original source file (relative to the sourceRoot).
* - name: An optional original token name for this mapping.
*/
SourceMapGenerator.prototype.addMapping =
function SourceMapGenerator_addMapping(aArgs) {
var generated = util.getArg(aArgs, 'generated');
var original = util.getArg(aArgs, 'original', null);
var source = util.getArg(aArgs, 'source', null);
var name = util.getArg(aArgs, 'name', null);
if (!this._skipValidation) {
this._validateMapping(generated, original, source, name);
}
if (source != null) {
source = String(source);
if (!this._sources.has(source)) {
this._sources.add(source);
}
}
if (name != null) {
name = String(name);
if (!this._names.has(name)) {
this._names.add(name);
}
}
this._mappings.add({
generatedLine: generated.line,
generatedColumn: generated.column,
originalLine: original != null && original.line,
originalColumn: original != null && original.column,
source: source,
name: name
});
};
/**
* Set the source content for a source file.
*/
SourceMapGenerator.prototype.setSourceContent =
function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
var source = aSourceFile;
if (this._sourceRoot != null) {
source = util.relative(this._sourceRoot, source);
}
if (aSourceContent != null) {
// Add the source content to the _sourcesContents map.
// Create a new _sourcesContents map if the property is null.
if (!this._sourcesContents) {
this._sourcesContents = Object.create(null);
}
this._sourcesContents[util.toSetString(source)] = aSourceContent;
} else if (this._sourcesContents) {
// Remove the source file from the _sourcesContents map.
// If the _sourcesContents map is empty, set the property to null.
delete this._sourcesContents[util.toSetString(source)];
if (Object.keys(this._sourcesContents).length === 0) {
this._sourcesContents = null;
}
}
};
/**
* Applies the mappings of a sub-source-map for a specific source file to the
* source map being generated. Each mapping to the supplied source file is
* rewritten using the supplied source map. Note: The resolution for the
* resulting mappings is the minimium of this map and the supplied map.
*
* @param aSourceMapConsumer The source map to be applied.
* @param aSourceFile Optional. The filename of the source file.
* If omitted, SourceMapConsumer's file property will be used.
* @param aSourceMapPath Optional. The dirname of the path to the source map
* to be applied. If relative, it is relative to the SourceMapConsumer.
* This parameter is needed when the two source maps aren't in the same
* directory, and the source map to be applied contains relative source
* paths. If so, those relative source paths need to be rewritten
* relative to the SourceMapGenerator.
*/
SourceMapGenerator.prototype.applySourceMap =
function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
var sourceFile = aSourceFile;
// If aSourceFile is omitted, we will use the file property of the SourceMap
if (aSourceFile == null) {
if (aSourceMapConsumer.file == null) {
throw new Error(
'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
'or the source map\'s "file" property. Both were omitted.'
);
}
sourceFile = aSourceMapConsumer.file;
}
var sourceRoot = this._sourceRoot;
// Make "sourceFile" relative if an absolute Url is passed.
if (sourceRoot != null) {
sourceFile = util.relative(sourceRoot, sourceFile);
}
// Applying the SourceMap can add and remove items from the sources and
// the names array.
var newSources = new ArraySet$1();
var newNames = new ArraySet$1();
// Find mappings for the "sourceFile"
this._mappings.unsortedForEach(function (mapping) {
if (mapping.source === sourceFile && mapping.originalLine != null) {
// Check if it can be mapped by the source map, then update the mapping.
var original = aSourceMapConsumer.originalPositionFor({
line: mapping.originalLine,
column: mapping.originalColumn
});
if (original.source != null) {
// Copy mapping
mapping.source = original.source;
if (aSourceMapPath != null) {
mapping.source = util.join(aSourceMapPath, mapping.source);
}
if (sourceRoot != null) {
mapping.source = util.relative(sourceRoot, mapping.source);
}
mapping.originalLine = original.line;
mapping.originalColumn = original.column;
if (original.name != null) {
mapping.name = original.name;
}
}
}
var source = mapping.source;
if (source != null && !newSources.has(source)) {
newSources.add(source);
}
var name = mapping.name;
if (name != null && !newNames.has(name)) {
newNames.add(name);
}
}, this);
this._sources = newSources;
this._names = newNames;
// Copy sourcesContents of applied map.
aSourceMapConsumer.sources.forEach(function (sourceFile) {
var content = aSourceMapConsumer.sourceContentFor(sourceFile);
if (content != null) {
if (aSourceMapPath != null) {
sourceFile = util.join(aSourceMapPath, sourceFile);
}
if (sourceRoot != null) {
sourceFile = util.relative(sourceRoot, sourceFile);
}
this.setSourceContent(sourceFile, content);
}
}, this);
};
/**
* A mapping can have one of the three levels of data:
*
* 1. Just the generated position.
* 2. The Generated position, original position, and original source.
* 3. Generated and original position, original source, as well as a name
* token.
*
* To maintain consistency, we validate that any new mapping being added falls
* in to one of these categories.
*/
SourceMapGenerator.prototype._validateMapping =
function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
aName) {
// When aOriginal is truthy but has empty values for .line and .column,
// it is most likely a programmer error. In this case we throw a very
// specific error message to try to guide them the right way.
// For example: https://github.com/Polymer/polymer-bundler/pull/519
if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {
throw new Error(
'original.line and original.column are not numbers -- you probably meant to omit ' +
'the original mapping entirely and only map the generated position. If so, pass ' +
'null for the original mapping instead of an object with empty or null values.'
);
}
if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
&& aGenerated.line > 0 && aGenerated.column >= 0
&& !aOriginal && !aSource && !aName) {
// Case 1.
return;
}
else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
&& aOriginal && 'line' in aOriginal && 'column' in aOriginal
&& aGenerated.line > 0 && aGenerated.column >= 0
&& aOriginal.line > 0 && aOriginal.column >= 0
&& aSource) {
// Cases 2 and 3.
return;
}
else {
throw new Error('Invalid mapping: ' + JSON.stringify({
generated: aGenerated,
source: aSource,
original: aOriginal,
name: aName
}));
}
};
/**
* Serialize the accumulated mappings in to the stream of base 64 VLQs
* specified by the source map format.
*/
SourceMapGenerator.prototype._serializeMappings =
function SourceMapGenerator_serializeMappings() {
var previousGeneratedColumn = 0;
var previousGeneratedLine = 1;
var previousOriginalColumn = 0;
var previousOriginalLine = 0;
var previousName = 0;
var previousSource = 0;
var result = '';
var next;
var mapping;
var nameIdx;
var sourceIdx;
var mappings = this._mappings.toArray();
for (var i = 0, len = mappings.length; i < len; i++) {
mapping = mappings[i];
next = '';
if (mapping.generatedLine !== previousGeneratedLine) {
previousGeneratedColumn = 0;
while (mapping.generatedLine !== previousGeneratedLine) {
next += ';';
previousGeneratedLine++;
}
}
else {
if (i > 0) {
if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {
continue;
}
next += ',';
}
}
next += base64Vlq.encode(mapping.generatedColumn
- previousGeneratedColumn);
previousGeneratedColumn = mapping.generatedColumn;
if (mapping.source != null) {
sourceIdx = this._sources.indexOf(mapping.source);
next += base64Vlq.encode(sourceIdx - previousSource);
previousSource = sourceIdx;
// lines are stored 0-based in SourceMap spec version 3
next += base64Vlq.encode(mapping.originalLine - 1
- previousOriginalLine);
previousOriginalLine = mapping.originalLine - 1;
next += base64Vlq.encode(mapping.originalColumn
- previousOriginalColumn);
previousOriginalColumn = mapping.originalColumn;
if (mapping.name != null) {
nameIdx = this._names.indexOf(mapping.name);
next += base64Vlq.encode(nameIdx - previousName);
previousName = nameIdx;
}
}
result += next;
}
return result;
};
SourceMapGenerator.prototype._generateSourcesContent =
function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
return aSources.map(function (source) {
if (!this._sourcesContents) {
return null;
}
if (aSourceRoot != null) {
source = util.relative(aSourceRoot, source);
}
var key = util.toSetString(source);
return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)
? this._sourcesContents[key]
: null;
}, this);
};
/**
* Externalize the source map.
*/
SourceMapGenerator.prototype.toJSON =
function SourceMapGenerator_toJSON() {
var map = {
version: this._version,
sources: this._sources.toArray(),
names: this._names.toArray(),
mappings: this._serializeMappings()
};
if (this._file != null) {
map.file = this._file;
}
if (this._sourceRoot != null) {
map.sourceRoot = this._sourceRoot;
}
if (this._sourcesContents) {
map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
}
return map;
};
/**
* Render the source map being generated to a string.
*/
SourceMapGenerator.prototype.toString =
function SourceMapGenerator_toString() {
return JSON.stringify(this.toJSON());
};
var SourceMapGenerator_1 = SourceMapGenerator;
var sourceMapGenerator = {
SourceMapGenerator: SourceMapGenerator_1
};
var binarySearch = createCommonjsModule(function (module, exports) {
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
exports.GREATEST_LOWER_BOUND = 1;
exports.LEAST_UPPER_BOUND = 2;
/**
* Recursive implementation of binary search.
*
* @param aLow Indices here and lower do not contain the needle.
* @param aHigh Indices here and higher do not contain the needle.
* @param aNeedle The element being searched for.
* @param aHaystack The non-empty array being searched.
* @param aCompare Function which takes two elements and returns -1, 0, or 1.
* @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
* 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
* closest element that is smaller than or greater than the one we are
* searching for, respectively, if the exact element cannot be found.
*/
function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {
// This function terminates when one of the following is true:
//
// 1. We find the exact element we are looking for.
//
// 2. We did not find the exact element, but we can return the index of
// the next-closest element.
//
// 3. We did not find the exact element, and there is no next-closest
// element than the one we are searching for, so we return -1.
var mid = Math.floor((aHigh - aLow) / 2) + aLow;
var cmp = aCompare(aNeedle, aHaystack[mid], true);
if (cmp === 0) {
// Found the element we are looking for.
return mid;
}
else if (cmp > 0) {
// Our needle is greater than aHaystack[mid].
if (aHigh - mid > 1) {
// The element is in the upper half.
return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);
}
// The exact needle element was not found in this haystack. Determine if
// we are in termination case (3) or (2) and return the appropriate thing.
if (aBias == exports.LEAST_UPPER_BOUND) {
return aHigh < aHaystack.length ? aHigh : -1;
} else {
return mid;
}
}
else {
// Our needle is less than aHaystack[mid].
if (mid - aLow > 1) {
// The element is in the lower half.
return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);
}
// we are in termination case (3) or (2) and return the appropriate thing.
if (aBias == exports.LEAST_UPPER_BOUND) {
return mid;
} else {
return aLow < 0 ? -1 : aLow;
}
}
}
/**
* This is an implementation of binary search which will always try and return
* the index of the closest element if there is no exact hit. This is because
* mappings between original and generated line/col pairs are single points,
* and there is an implicit region between each of them, so a miss just means
* that you aren't on the very start of a region.
*
* @param aNeedle The element you are looking for.
* @param aHaystack The array that is being searched.
* @param aCompare A function which takes the needle and an element in the
* array and returns -1, 0, or 1 depending on whether the needle is less
* than, equal to, or greater than the element, respectively.
* @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
* 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
* closest element that is smaller than or greater than the one we are
* searching for, respectively, if the exact element cannot be found.
* Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.
*/
exports.search = function search(aNeedle, aHaystack, aCompare, aBias) {
if (aHaystack.length === 0) {
return -1;
}
var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,
aCompare, aBias || exports.GREATEST_LOWER_BOUND);
if (index < 0) {
return -1;
}
// We have found either the exact element, or the next-closest element than
// the one we are searching for. However, there may be more than one such
// element. Make sure we always return the smallest of these.
while (index - 1 >= 0) {
if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {
break;
}
--index;
}
return index;
};
});
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
// It turns out that some (most?) JavaScript engines don't self-host
// `Array.prototype.sort`. This makes sense because C++ will likely remain
// faster than JS when doing raw CPU-intensive sorting. However, when using a
// custom comparator function, calling back and forth between the VM's C++ and
// JIT'd JS is rather slow *and* loses JIT type information, resulting in
// worse generated code for the comparator function than would be optimal. In
// fact, when sorting with a comparator, these costs outweigh the benefits of
// sorting in C++. By using our own JS-implemented Quick Sort (below), we get
// a ~3500ms mean speed-up in `bench/bench.html`.
/**
* Swap the elements indexed by `x` and `y` in the array `ary`.
*
* @param {Array} ary
* The array.
* @param {Number} x
* The index of the first item.
* @param {Number} y
* The index of the second item.
*/
function swap(ary, x, y) {
var temp = ary[x];
ary[x] = ary[y];
ary[y] = temp;
}
/**
* Returns a random integer within the range `low .. high` inclusive.
*
* @param {Number} low
* The lower bound on the range.
* @param {Number} high
* The upper bound on the range.
*/
function randomIntInRange(low, high) {
return Math.round(low + (Math.random() * (high - low)));
}
/**
* The Quick Sort algorithm.
*
* @param {Array} ary
* An array to sort.
* @param {function} comparator
* Function to use to compare two items.
* @param {Number} p
* Start index of the array
* @param {Number} r
* End index of the array
*/
function doQuickSort(ary, comparator, p, r) {
// If our lower bound is less than our upper bound, we (1) partition the
// array into two pieces and (2) recurse on each half. If it is not, this is
// the empty array and our base case.
if (p < r) {
// (1) Partitioning.
//
// The partitioning chooses a pivot between `p` and `r` and moves all
// elements that are less than or equal to the pivot to the before it, and
// all the elements that are greater than it after it. The effect is that
// once partition is done, the pivot is in the exact place it will be when
// the array is put in sorted order, and it will not need to be moved
// again. This runs in O(n) time.
// Always choose a random pivot so that an input array which is reverse
// sorted does not cause O(n^2) running time.
var pivotIndex = randomIntInRange(p, r);
var i = p - 1;
swap(ary, pivotIndex, r);
var pivot = ary[r];
// Immediately after `j` is incremented in this loop, the following hold
// true:
//
// * Every element in `ary[p .. i]` is less than or equal to the pivot.
//
// * Every element in `ary[i+1 .. j-1]` is greater than the pivot.
for (var j = p; j < r; j++) {
if (comparator(ary[j], pivot) <= 0) {
i += 1;
swap(ary, i, j);
}
}
swap(ary, i + 1, j);
var q = i + 1;
// (2) Recurse on each half.
doQuickSort(ary, comparator, p, q - 1);
doQuickSort(ary, comparator, q + 1, r);
}
}
/**
* Sort the given array in-place with the given comparator function.
*
* @param {Array} ary
* An array to sort.
* @param {function} comparator
* Function to use to compare two items.
*/
var quickSort_1 = function (ary, comparator) {
doQuickSort(ary, comparator, 0, ary.length - 1);
};
var quickSort = {
quickSort: quickSort_1
};
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
var ArraySet$2 = arraySet.ArraySet;
var quickSort$1 = quickSort.quickSort;
function SourceMapConsumer(aSourceMap, aSourceMapURL) {
var sourceMap = aSourceMap;
if (typeof aSourceMap === 'string') {
sourceMap = util.parseSourceMapInput(aSourceMap);
}
return sourceMap.sections != null
? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL)
: new BasicSourceMapConsumer(sourceMap, aSourceMapURL);
}
SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) {
return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL);
};
/**
* The version of the source mapping spec that we are consuming.
*/
SourceMapConsumer.prototype._version = 3;
// `__generatedMappings` and `__originalMappings` are arrays that hold the
// parsed mapping coordinates from the source map's "mappings" attribute. They
// are lazily instantiated, accessed via the `_generatedMappings` and
// `_originalMappings` getters respectively, and we only parse the mappings
// and create these arrays once queried for a source location. We jump through
// these hoops because there can be many thousands of mappings, and parsing
// them is expensive, so we only want to do it if we must.
//
// Each object in the arrays is of the form:
//
// {
// generatedLine: The line number in the generated code,
// generatedColumn: The column number in the generated code,
// source: The path to the original source file that generated this
// chunk of code,
// originalLine: The line number in the original source that
// corresponds to this chunk of generated code,
// originalColumn: The column number in the original source that
// corresponds to this chunk of generated code,
// name: The name of the original symbol which generated this chunk of
// code.
// }
//
// All properties except for `generatedLine` and `generatedColumn` can be
// `null`.
//
// `_generatedMappings` is ordered by the generated positions.
//
// `_originalMappings` is ordered by the original positions.
SourceMapConsumer.prototype.__generatedMappings = null;
Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {
configurable: true,
enumerable: true,
get: function () {
if (!this.__generatedMappings) {
this._parseMappings(this._mappings, this.sourceRoot);
}
return this.__generatedMappings;
}
});
SourceMapConsumer.prototype.__originalMappings = null;
Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {
configurable: true,
enumerable: true,
get: function () {
if (!this.__originalMappings) {
this._parseMappings(this._mappings, this.sourceRoot);
}
return this.__originalMappings;
}
});
SourceMapConsumer.prototype._charIsMappingSeparator =
function SourceMapConsumer_charIsMappingSeparator(aStr, index) {
var c = aStr.charAt(index);
return c === ";" || c === ",";
};
/**
* Parse the mappings in a string in to a data structure which we can easily
* query (the ordered arrays in the `this.__generatedMappings` and
* `this.__originalMappings` properties).
*/
SourceMapConsumer.prototype._parseMappings =
function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
throw new Error("Subclasses must implement _parseMappings");
};
SourceMapConsumer.GENERATED_ORDER = 1;
SourceMapConsumer.ORIGINAL_ORDER = 2;
SourceMapConsumer.GREATEST_LOWER_BOUND = 1;
SourceMapConsumer.LEAST_UPPER_BOUND = 2;
/**
* Iterate over each mapping between an original source/line/column and a
* generated line/column in this source map.
*
* @param Function aCallback
* The function that is called with each mapping.
* @param Object aContext
* Optional. If specified, this object will be the value of `this` every
* time that `aCallback` is called.
* @param aOrder
* Either `SourceMapConsumer.GENERATED_ORDER` or
* `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to
* iterate over the mappings sorted by the generated file's line/column
* order or the original's source/line/column order, respectively. Defaults to
* `SourceMapConsumer.GENERATED_ORDER`.
*/
SourceMapConsumer.prototype.eachMapping =
function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {
var context = aContext || null;
var order = aOrder || SourceMapConsumer.GENERATED_ORDER;
var mappings;
switch (order) {
case SourceMapConsumer.GENERATED_ORDER:
mappings = this._generatedMappings;
break;
case SourceMapConsumer.ORIGINAL_ORDER:
mappings = this._originalMappings;
break;
default:
throw new Error("Unknown order of iteration.");
}
var sourceRoot = this.sourceRoot;
mappings.map(function (mapping) {
var source = mapping.source === null ? null : this._sources.at(mapping.source);
source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL);
return {
source: source,
generatedLine: mapping.generatedLine,
generatedColumn: mapping.generatedColumn,
originalLine: mapping.originalLine,
originalColumn: mapping.originalColumn,
name: mapping.name === null ? null : this._names.at(mapping.name)
};
}, this).forEach(aCallback, context);
};
/**
* Returns all generated line and column information for the original source,
* line, and column provided. If no column is provided, returns all mappings
* corresponding to a either the line we are searching for or the next
* closest line that has any mappings. Otherwise, returns all mappings
* corresponding to the given line and either the column we are searching for
* or the next closest column that has any offsets.
*
* The only argument is an object with the following properties:
*
* - source: The filename of the original source.
* - line: The line number in the original source. The line number is 1-based.
* - column: Optional. the column number in the original source.
* The column number is 0-based.
*
* and an array of objects is returned, each with the following properties:
*
* - line: The line number in the generated source, or null. The
* line number is 1-based.
* - column: The column number in the generated source, or null.
* The column number is 0-based.
*/
SourceMapConsumer.prototype.allGeneratedPositionsFor =
function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {
var line = util.getArg(aArgs, 'line');
// When there is no exact match, BasicSourceMapConsumer.prototype._findMapping
// returns the index of the closest mapping less than the needle. By
// setting needle.originalColumn to 0, we thus find the last mapping for
// the given line, provided such a mapping exists.
var needle = {
source: util.getArg(aArgs, 'source'),
originalLine: line,
originalColumn: util.getArg(aArgs, 'column', 0)
};
needle.source = this._findSourceIndex(needle.source);
if (needle.source < 0) {
return [];
}
var mappings = [];
var index = this._findMapping(needle,
this._originalMappings,
"originalLine",
"originalColumn",
util.compareByOriginalPositions,
binarySearch.LEAST_UPPER_BOUND);
if (index >= 0) {
var mapping = this._originalMappings[index];
if (aArgs.column === undefined) {
var originalLine = mapping.originalLine;
// Iterate until either we run out of mappings, or we run into
// a mapping for a different line than the one we found. Since
// mappings are sorted, this is guaranteed to find all mappings for
// the line we found.
while (mapping && mapping.originalLine === originalLine) {
mappings.push({
line: util.getArg(mapping, 'generatedLine', null),
column: util.getArg(mapping, 'generatedColumn', null),
lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
});
mapping = this._originalMappings[++index];
}
} else {
var originalColumn = mapping.originalColumn;
// Iterate until either we run out of mappings, or we run into
// a mapping for a different line than the one we were searching for.
// Since mappings are sorted, this is guaranteed to find all mappings for
// the line we are searching for.
while (mapping &&
mapping.originalLine === line &&
mapping.originalColumn == originalColumn) {
mappings.push({
line: util.getArg(mapping, 'generatedLine', null),
column: util.getArg(mapping, 'generatedColumn', null),
lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
});
mapping = this._originalMappings[++index];
}
}
}
return mappings;
};
var SourceMapConsumer_1 = SourceMapConsumer;
/**
* A BasicSourceMapConsumer instance represents a parsed source map which we can
* query for information about the original file positions by giving it a file
* position in the generated source.
*
* The first parameter is the raw source map (either as a JSON string, or
* already parsed to an object). According to the spec, source maps have the
* following attributes:
*
* - version: Which version of the source map spec this map is following.
* - sources: An array of URLs to the original source files.
* - names: An array of identifiers which can be referrenced by individual mappings.
* - sourceRoot: Optional. The URL root from which all sources are relative.
* - sourcesContent: Optional. An array of contents of the original source files.
* - mappings: A string of base64 VLQs which contain the actual mappings.
* - file: Optional. The generated file this source map is associated with.
*
* Here is an example source map, taken from the source map spec[0]:
*
* {
* version : 3,
* file: "out.js",
* sourceRoot : "",
* sources: ["foo.js", "bar.js"],
* names: ["src", "maps", "are", "fun"],
* mappings: "AA,AB;;ABCDE;"
* }
*
* The second parameter, if given, is a string whose value is the URL
* at which the source map was found. This URL is used to compute the
* sources array.
*
* [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#
*/
function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) {
var sourceMap = aSourceMap;
if (typeof aSourceMap === 'string') {
sourceMap = util.parseSourceMapInput(aSourceMap);
}
var version = util.getArg(sourceMap, 'version');
var sources = util.getArg(sourceMap, 'sources');
// Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which
// requires the array) to play nice here.
var names = util.getArg(sourceMap, 'names', []);
var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);
var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);
var mappings = util.getArg(sourceMap, 'mappings');
var file = util.getArg(sourceMap, 'file', null);
// Once again, Sass deviates from the spec and supplies the version as a
// string rather than a number, so we use loose equality checking here.
if (version != this._version) {
throw new Error('Unsupported version: ' + version);
}
if (sourceRoot) {
sourceRoot = util.normalize(sourceRoot);
}
sources = sources
.map(String)
// Some source maps produce relative source paths like "./foo.js" instead of
// "foo.js". Normalize these first so that future comparisons will succeed.
// See bugzil.la/1090768.
.map(util.normalize)
// Always ensure that absolute sources are internally stored relative to
// the source root, if the source root is absolute. Not doing this would
// be particularly problematic when the source root is a prefix of the
// source (valid, but why??). See github issue #199 and bugzil.la/1188982.
.map(function (source) {
return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)
? util.relative(sourceRoot, source)
: source;
});
// Pass `true` below to allow duplicate names and sources. While source maps
// are intended to be compressed and deduplicated, the TypeScript compiler
// sometimes generates source maps with duplicates in them. See Github issue
// #72 and bugzil.la/889492.
this._names = ArraySet$2.fromArray(names.map(String), true);
this._sources = ArraySet$2.fromArray(sources, true);
this._absoluteSources = this._sources.toArray().map(function (s) {
return util.computeSourceURL(sourceRoot, s, aSourceMapURL);
});
this.sourceRoot = sourceRoot;
this.sourcesContent = sourcesContent;
this._mappings = mappings;
this._sourceMapURL = aSourceMapURL;
this.file = file;
}
BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;
/**
* Utility function to find the index of a source. Returns -1 if not
* found.
*/
BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) {
var relativeSource = aSource;
if (this.sourceRoot != null) {
relativeSource = util.relative(this.sourceRoot, relativeSource);
}
if (this._sources.has(relativeSource)) {
return this._sources.indexOf(relativeSource);
}
// Maybe aSource is an absolute URL as returned by |sources|. In
// this case we can't simply undo the transform.
var i;
for (i = 0; i < this._absoluteSources.length; ++i) {
if (this._absoluteSources[i] == aSource) {
return i;
}
}
return -1;
};
/**
* Create a BasicSourceMapConsumer from a SourceMapGenerator.
*
* @param SourceMapGenerator aSourceMap
* The source map that will be consumed.
* @param String aSourceMapURL
* The URL at which the source map can be found (optional)
* @returns BasicSourceMapConsumer
*/
BasicSourceMapConsumer.fromSourceMap =
function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) {
var smc = Object.create(BasicSourceMapConsumer.prototype);
var names = smc._names = ArraySet$2.fromArray(aSourceMap._names.toArray(), true);
var sources = smc._sources = ArraySet$2.fromArray(aSourceMap._sources.toArray(), true);
smc.sourceRoot = aSourceMap._sourceRoot;
smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),
smc.sourceRoot);
smc.file = aSourceMap._file;
smc._sourceMapURL = aSourceMapURL;
smc._absoluteSources = smc._sources.toArray().map(function (s) {
return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL);
});
// Because we are modifying the entries (by converting string sources and
// names to indices into the sources and names ArraySets), we have to make
// a copy of the entry or else bad things happen. Shared mutable state
// strikes again! See github issue #191.
var generatedMappings = aSourceMap._mappings.toArray().slice();
var destGeneratedMappings = smc.__generatedMappings = [];
var destOriginalMappings = smc.__originalMappings = [];
for (var i = 0, length = generatedMappings.length; i < length; i++) {
var srcMapping = generatedMappings[i];
var destMapping = new Mapping;
destMapping.generatedLine = srcMapping.generatedLine;
destMapping.generatedColumn = srcMapping.generatedColumn;
if (srcMapping.source) {
destMapping.source = sources.indexOf(srcMapping.source);
destMapping.originalLine = srcMapping.originalLine;
destMapping.originalColumn = srcMapping.originalColumn;
if (srcMapping.name) {
destMapping.name = names.indexOf(srcMapping.name);
}
destOriginalMappings.push(destMapping);
}
destGeneratedMappings.push(destMapping);
}
quickSort$1(smc.__originalMappings, util.compareByOriginalPositions);
return smc;
};
/**
* The version of the source mapping spec that we are consuming.
*/
BasicSourceMapConsumer.prototype._version = 3;
/**
* The list of original sources.
*/
Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {
get: function () {
return this._absoluteSources.slice();
}
});
/**
* Provide the JIT with a nice shape / hidden class.
*/
function Mapping() {
this.generatedLine = 0;
this.generatedColumn = 0;
this.source = null;
this.originalLine = null;
this.originalColumn = null;
this.name = null;
}
/**
* Parse the mappings in a string in to a data structure which we can easily
* query (the ordered arrays in the `this.__generatedMappings` and
* `this.__originalMappings` properties).
*/
BasicSourceMapConsumer.prototype._parseMappings =
function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
var generatedLine = 1;
var previousGeneratedColumn = 0;
var previousOriginalLine = 0;
var previousOriginalColumn = 0;
var previousSource = 0;
var previousName = 0;
var length = aStr.length;
var index = 0;
var cachedSegments = {};
var temp = {};
var originalMappings = [];
var generatedMappings = [];
var mapping, str, segment, end, value;
while (index < length) {
if (aStr.charAt(index) === ';') {
generatedLine++;
index++;
previousGeneratedColumn = 0;
}
else if (aStr.charAt(index) === ',') {
index++;
}
else {
mapping = new Mapping();
mapping.generatedLine = generatedLine;
// Because each offset is encoded relative to the previous one,
// many segments often have the same encoding. We can exploit this
// fact by caching the parsed variable length fields of each segment,
// allowing us to avoid a second parse if we encounter the same
// segment again.
for (end = index; end < length; end++) {
if (this._charIsMappingSeparator(aStr, end)) {
break;
}
}
str = aStr.slice(index, end);
segment = cachedSegments[str];
if (segment) {
index += str.length;
} else {
segment = [];
while (index < end) {
base64Vlq.decode(aStr, index, temp);
value = temp.value;
index = temp.rest;
segment.push(value);
}
if (segment.length === 2) {
throw new Error('Found a source, but no line and column');
}
if (segment.length === 3) {
throw new Error('Found a source and line, but no column');
}
cachedSegments[str] = segment;
}
// Generated column.
mapping.generatedColumn = previousGeneratedColumn + segment[0];
previousGeneratedColumn = mapping.generatedColumn;
if (segment.length > 1) {
// Original source.
mapping.source = previousSource + segment[1];
previousSource += segment[1];
// Original line.
mapping.originalLine = previousOriginalLine + segment[2];
previousOriginalLine = mapping.originalLine;
// Lines are stored 0-based
mapping.originalLine += 1;
// Original column.
mapping.originalColumn = previousOriginalColumn + segment[3];
previousOriginalColumn = mapping.originalColumn;
if (segment.length > 4) {
// Original name.
mapping.name = previousName + segment[4];
previousName += segment[4];
}
}
generatedMappings.push(mapping);
if (typeof mapping.originalLine === 'number') {
originalMappings.push(mapping);
}
}
}
quickSort$1(generatedMappings, util.compareByGeneratedPositionsDeflated);
this.__generatedMappings = generatedMappings;
quickSort$1(originalMappings, util.compareByOriginalPositions);
this.__originalMappings = originalMappings;
};
/**
* Find the mapping that best matches the hypothetical "needle" mapping that
* we are searching for in the given "haystack" of mappings.
*/
BasicSourceMapConsumer.prototype._findMapping =
function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,
aColumnName, aComparator, aBias) {
// To return the position we are searching for, we must first find the
// mapping for the given position and then return the opposite position it
// points to. Because the mappings are sorted, we can use binary search to
// find the best mapping.
if (aNeedle[aLineName] <= 0) {
throw new TypeError('Line must be greater than or equal to 1, got '
+ aNeedle[aLineName]);
}
if (aNeedle[aColumnName] < 0) {
throw new TypeError('Column must be greater than or equal to 0, got '
+ aNeedle[aColumnName]);
}
return binarySearch.search(aNeedle, aMappings, aComparator, aBias);
};
/**
* Compute the last column for each generated mapping. The last column is
* inclusive.
*/
BasicSourceMapConsumer.prototype.computeColumnSpans =
function SourceMapConsumer_computeColumnSpans() {
for (var index = 0; index < this._generatedMappings.length; ++index) {
var mapping = this._generatedMappings[index];
// Mappings do not contain a field for the last generated columnt. We
// can come up with an optimistic estimate, however, by assuming that
// mappings are contiguous (i.e. given two consecutive mappings, the
// first mapping ends where the second one starts).
if (index + 1 < this._generatedMappings.length) {
var nextMapping = this._generatedMappings[index + 1];
if (mapping.generatedLine === nextMapping.generatedLine) {
mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;
continue;
}
}
// The last mapping for each line spans the entire line.
mapping.lastGeneratedColumn = Infinity;
}
};
/**
* Returns the original source, line, and column information for the generated
* source's line and column positions provided. The only argument is an object
* with the following properties:
*
* - line: The line number in the generated source. The line number
* is 1-based.
* - column: The column number in the generated source. The column
* number is 0-based.
* - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
* 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
* closest element that is smaller than or greater than the one we are
* searching for, respectively, if the exact element cannot be found.
* Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
*
* and an object is returned with the following properties:
*
* - source: The original source file, or null.
* - line: The line number in the original source, or null. The
* line number is 1-based.
* - column: The column number in the original source, or null. The
* column number is 0-based.
* - name: The original identifier, or null.
*/
BasicSourceMapConsumer.prototype.originalPositionFor =
function SourceMapConsumer_originalPositionFor(aArgs) {
var needle = {
generatedLine: util.getArg(aArgs, 'line'),
generatedColumn: util.getArg(aArgs, 'column')
};
var index = this._findMapping(
needle,
this._generatedMappings,
"generatedLine",
"generatedColumn",
util.compareByGeneratedPositionsDeflated,
util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
);
if (index >= 0) {
var mapping = this._generatedMappings[index];
if (mapping.generatedLine === needle.generatedLine) {
var source = util.getArg(mapping, 'source', null);
if (source !== null) {
source = this._sources.at(source);
source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL);
}
var name = util.getArg(mapping, 'name', null);
if (name !== null) {
name = this._names.at(name);
}
return {
source: source,
line: util.getArg(mapping, 'originalLine', null),
column: util.getArg(mapping, 'originalColumn', null),
name: name
};
}
}
return {
source: null,
line: null,
column: null,
name: null
};
};
/**
* Return true if we have the source content for every source in the source
* map, false otherwise.
*/
BasicSourceMapConsumer.prototype.hasContentsOfAllSources =
function BasicSourceMapConsumer_hasContentsOfAllSources() {
if (!this.sourcesContent) {
return false;
}
return this.sourcesContent.length >= this._sources.size() &&
!this.sourcesContent.some(function (sc) { return sc == null; });
};
/**
* Returns the original source content. The only argument is the url of the
* original source file. Returns null if no original source content is
* available.
*/
BasicSourceMapConsumer.prototype.sourceContentFor =
function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
if (!this.sourcesContent) {
return null;
}
var index = this._findSourceIndex(aSource);
if (index >= 0) {
return this.sourcesContent[index];
}
var relativeSource = aSource;
if (this.sourceRoot != null) {
relativeSource = util.relative(this.sourceRoot, relativeSource);
}
var url;
if (this.sourceRoot != null
&& (url = util.urlParse(this.sourceRoot))) {
// XXX: file:// URIs and absolute paths lead to unexpected behavior for
// many users. We can help them out when they expect file:// URIs to
// behave like it would if they were running a local HTTP server. See
// https://bugzilla.mozilla.org/show_bug.cgi?id=885597.
var fileUriAbsPath = relativeSource.replace(/^file:\/\//, "");
if (url.scheme == "file"
&& this._sources.has(fileUriAbsPath)) {
return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]
}
if ((!url.path || url.path == "/")
&& this._sources.has("/" + relativeSource)) {
return this.sourcesContent[this._sources.indexOf("/" + relativeSource)];
}
}
// This function is used recursively from
// IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we
// don't want to throw if we can't find the source - we just want to
// return null, so we provide a flag to exit gracefully.
if (nullOnMissing) {
return null;
}
else {
throw new Error('"' + relativeSource + '" is not in the SourceMap.');
}
};
/**
* Returns the generated line and column information for the original source,
* line, and column positions provided. The only argument is an object with
* the following properties:
*
* - source: The filename of the original source.
* - line: The line number in the original source. The line number
* is 1-based.
* - column: The column number in the original source. The column
* number is 0-based.
* - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
* 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
* closest element that is smaller than or greater than the one we are
* searching for, respectively, if the exact element cannot be found.
* Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
*
* and an object is returned with the following properties:
*
* - line: The line number in the generated source, or null. The
* line number is 1-based.
* - column: The column number in the generated source, or null.
* The column number is 0-based.
*/
BasicSourceMapConsumer.prototype.generatedPositionFor =
function SourceMapConsumer_generatedPositionFor(aArgs) {
var source = util.getArg(aArgs, 'source');
source = this._findSourceIndex(source);
if (source < 0) {
return {
line: null,
column: null,
lastColumn: null
};
}
var needle = {
source: source,
originalLine: util.getArg(aArgs, 'line'),
originalColumn: util.getArg(aArgs, 'column')
};
var index = this._findMapping(
needle,
this._originalMappings,
"originalLine",
"originalColumn",
util.compareByOriginalPositions,
util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
);
if (index >= 0) {
var mapping = this._originalMappings[index];
if (mapping.source === needle.source) {
return {
line: util.getArg(mapping, 'generatedLine', null),
column: util.getArg(mapping, 'generatedColumn', null),
lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
};
}
}
return {
line: null,
column: null,
lastColumn: null
};
};
var BasicSourceMapConsumer_1 = BasicSourceMapConsumer;
/**
* An IndexedSourceMapConsumer instance represents a parsed source map which
* we can query for information. It differs from BasicSourceMapConsumer in
* that it takes "indexed" source maps (i.e. ones with a "sections" field) as
* input.
*
* The first parameter is a raw source map (either as a JSON string, or already
* parsed to an object). According to the spec for indexed source maps, they
* have the following attributes:
*
* - version: Which version of the source map spec this map is following.
* - file: Optional. The generated file this source map is associated with.
* - sections: A list of section definitions.
*
* Each value under the "sections" field has two fields:
* - offset: The offset into the original specified at which this section
* begins to apply, defined as an object with a "line" and "column"
* field.
* - map: A source map definition. This source map could also be indexed,
* but doesn't have to be.
*
* Instead of the "map" field, it's also possible to have a "url" field
* specifying a URL to retrieve a source map from, but that's currently
* unsupported.
*
* Here's an example source map, taken from the source map spec[0], but
* modified to omit a section which uses the "url" field.
*
* {
* version : 3,
* file: "app.js",
* sections: [{
* offset: {line:100, column:10},
* map: {
* version : 3,
* file: "section.js",
* sources: ["foo.js", "bar.js"],
* names: ["src", "maps", "are", "fun"],
* mappings: "AAAA,E;;ABCDE;"
* }
* }],
* }
*
* The second parameter, if given, is a string whose value is the URL
* at which the source map was found. This URL is used to compute the
* sources array.
*
* [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt
*/
function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) {
var sourceMap = aSourceMap;
if (typeof aSourceMap === 'string') {
sourceMap = util.parseSourceMapInput(aSourceMap);
}
var version = util.getArg(sourceMap, 'version');
var sections = util.getArg(sourceMap, 'sections');
if (version != this._version) {
throw new Error('Unsupported version: ' + version);
}
this._sources = new ArraySet$2();
this._names = new ArraySet$2();
var lastOffset = {
line: -1,
column: 0
};
this._sections = sections.map(function (s) {
if (s.url) {
// The url field will require support for asynchronicity.
// See https://github.com/mozilla/source-map/issues/16
throw new Error('Support for url field in sections not implemented.');
}
var offset = util.getArg(s, 'offset');
var offsetLine = util.getArg(offset, 'line');
var offsetColumn = util.getArg(offset, 'column');
if (offsetLine < lastOffset.line ||
(offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {
throw new Error('Section offsets must be ordered and non-overlapping.');
}
lastOffset = offset;
return {
generatedOffset: {
// The offset fields are 0-based, but we use 1-based indices when
// encoding/decoding from VLQ.
generatedLine: offsetLine + 1,
generatedColumn: offsetColumn + 1
},
consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL)
}
});
}
IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;
/**
* The version of the source mapping spec that we are consuming.
*/
IndexedSourceMapConsumer.prototype._version = 3;
/**
* The list of original sources.
*/
Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {
get: function () {
var sources = [];
for (var i = 0; i < this._sections.length; i++) {
for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {
sources.push(this._sections[i].consumer.sources[j]);
}
}
return sources;
}
});
/**
* Returns the original source, line, and column information for the generated
* source's line and column positions provided. The only argument is an object
* with the following properties:
*
* - line: The line number in the generated source. The line number
* is 1-based.
* - column: The column number in the generated source. The column
* number is 0-based.
*
* and an object is returned with the following properties:
*
* - source: The original source file, or null.
* - line: The line number in the original source, or null. The
* line number is 1-based.
* - column: The column number in the original source, or null. The
* column number is 0-based.
* - name: The original identifier, or null.
*/
IndexedSourceMapConsumer.prototype.originalPositionFor =
function IndexedSourceMapConsumer_originalPositionFor(aArgs) {
var needle = {
generatedLine: util.getArg(aArgs, 'line'),
generatedColumn: util.getArg(aArgs, 'column')
};
// Find the section containing the generated position we're trying to map
// to an original position.
var sectionIndex = binarySearch.search(needle, this._sections,
function(needle, section) {
var cmp = needle.generatedLine - section.generatedOffset.generatedLine;
if (cmp) {
return cmp;
}
return (needle.generatedColumn -
section.generatedOffset.generatedColumn);
});
var section = this._sections[sectionIndex];
if (!section) {
return {
source: null,
line: null,
column: null,
name: null
};
}
return section.consumer.originalPositionFor({
line: needle.generatedLine -
(section.generatedOffset.generatedLine - 1),
column: needle.generatedColumn -
(section.generatedOffset.generatedLine === needle.generatedLine
? section.generatedOffset.generatedColumn - 1
: 0),
bias: aArgs.bias
});
};
/**
* Return true if we have the source content for every source in the source
* map, false otherwise.
*/
IndexedSourceMapConsumer.prototype.hasContentsOfAllSources =
function IndexedSourceMapConsumer_hasContentsOfAllSources() {
return this._sections.every(function (s) {
return s.consumer.hasContentsOfAllSources();
});
};
/**
* Returns the original source content. The only argument is the url of the
* original source file. Returns null if no original source content is
* available.
*/
IndexedSourceMapConsumer.prototype.sourceContentFor =
function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
for (var i = 0; i < this._sections.length; i++) {
var section = this._sections[i];
var content = section.consumer.sourceContentFor(aSource, true);
if (content) {
return content;
}
}
if (nullOnMissing) {
return null;
}
else {
throw new Error('"' + aSource + '" is not in the SourceMap.');
}
};
/**
* Returns the generated line and column information for the original source,
* line, and column positions provided. The only argument is an object with
* the following properties:
*
* - source: The filename of the original source.
* - line: The line number in the original source. The line number
* is 1-based.
* - column: The column number in the original source. The column
* number is 0-based.
*
* and an object is returned with the following properties:
*
* - line: The line number in the generated source, or null. The
* line number is 1-based.
* - column: The column number in the generated source, or null.
* The column number is 0-based.
*/
IndexedSourceMapConsumer.prototype.generatedPositionFor =
function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {
for (var i = 0; i < this._sections.length; i++) {
var section = this._sections[i];
// Only consider this section if the requested source is in the list of
// sources of the consumer.
if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) {
continue;
}
var generatedPosition = section.consumer.generatedPositionFor(aArgs);
if (generatedPosition) {
var ret = {
line: generatedPosition.line +
(section.generatedOffset.generatedLine - 1),
column: generatedPosition.column +
(section.generatedOffset.generatedLine === generatedPosition.line
? section.generatedOffset.generatedColumn - 1
: 0)
};
return ret;
}
}
return {
line: null,
column: null
};
};
/**
* Parse the mappings in a string in to a data structure which we can easily
* query (the ordered arrays in the `this.__generatedMappings` and
* `this.__originalMappings` properties).
*/
IndexedSourceMapConsumer.prototype._parseMappings =
function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {
this.__generatedMappings = [];
this.__originalMappings = [];
for (var i = 0; i < this._sections.length; i++) {
var section = this._sections[i];
var sectionMappings = section.consumer._generatedMappings;
for (var j = 0; j < sectionMappings.length; j++) {
var mapping = sectionMappings[j];
var source = section.consumer._sources.at(mapping.source);
source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL);
this._sources.add(source);
source = this._sources.indexOf(source);
var name = null;
if (mapping.name) {
name = section.consumer._names.at(mapping.name);
this._names.add(name);
name = this._names.indexOf(name);
}
// The mappings coming from the consumer for the section have
// generated positions relative to the start of the section, so we
// need to offset them to be relative to the start of the concatenated
// generated file.
var adjustedMapping = {
source: source,
generatedLine: mapping.generatedLine +
(section.generatedOffset.generatedLine - 1),
generatedColumn: mapping.generatedColumn +
(section.generatedOffset.generatedLine === mapping.generatedLine
? section.generatedOffset.generatedColumn - 1
: 0),
originalLine: mapping.originalLine,
originalColumn: mapping.originalColumn,
name: name
};
this.__generatedMappings.push(adjustedMapping);
if (typeof adjustedMapping.originalLine === 'number') {
this.__originalMappings.push(adjustedMapping);
}
}
}
quickSort$1(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);
quickSort$1(this.__originalMappings, util.compareByOriginalPositions);
};
var IndexedSourceMapConsumer_1 = IndexedSourceMapConsumer;
var sourceMapConsumer = {
SourceMapConsumer: SourceMapConsumer_1,
BasicSourceMapConsumer: BasicSourceMapConsumer_1,
IndexedSourceMapConsumer: IndexedSourceMapConsumer_1
};
/* -*- Mode: js; js-indent-level: 2; -*- */
/*
* Copyright 2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE or:
* http://opensource.org/licenses/BSD-3-Clause
*/
var SourceMapGenerator$1 = sourceMapGenerator.SourceMapGenerator;
// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other
// operating systems these days (capturing the result).
var REGEX_NEWLINE = /(\r?\n)/;
// Newline character code for charCodeAt() comparisons
var NEWLINE_CODE = 10;
// Private symbol for identifying `SourceNode`s when multiple versions of
// the source-map library are loaded. This MUST NOT CHANGE across
// versions!
var isSourceNode = "$$$isSourceNode$$$";
/**
* SourceNodes provide a way to abstract over interpolating/concatenating
* snippets of generated JavaScript source code while maintaining the line and
* column information associated with the original source code.
*
* @param aLine The original line number.
* @param aColumn The original column number.
* @param aSource The original source's filename.
* @param aChunks Optional. An array of strings which are snippets of
* generated JS, or other SourceNodes.
* @param aName The original identifier.
*/
function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
this.children = [];
this.sourceContents = {};
this.line = aLine == null ? null : aLine;
this.column = aColumn == null ? null : aColumn;
this.source = aSource == null ? null : aSource;
this.name = aName == null ? null : aName;
this[isSourceNode] = true;
if (aChunks != null) this.add(aChunks);
}
/**
* Creates a SourceNode from generated code and a SourceMapConsumer.
*
* @param aGeneratedCode The generated code
* @param aSourceMapConsumer The SourceMap for the generated code
* @param aRelativePath Optional. The path that relative sources in the
* SourceMapConsumer should be relative to.
*/
SourceNode.fromStringWithSourceMap =
function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {
// The SourceNode we want to fill with the generated code
// and the SourceMap
var node = new SourceNode();
// All even indices of this array are one line of the generated code,
// while all odd indices are the newlines between two adjacent lines
// (since `REGEX_NEWLINE` captures its match).
// Processed fragments are accessed by calling `shiftNextLine`.
var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);
var remainingLinesIndex = 0;
var shiftNextLine = function() {
var lineContents = getNextLine();
// The last line of a file might not have a newline.
var newLine = getNextLine() || "";
return lineContents + newLine;
function getNextLine() {
return remainingLinesIndex < remainingLines.length ?
remainingLines[remainingLinesIndex++] : undefined;
}
};
// We need to remember the position of "remainingLines"
var lastGeneratedLine = 1, lastGeneratedColumn = 0;
// The generate SourceNodes we need a code range.
// To extract it current and last mapping is used.
// Here we store the last mapping.
var lastMapping = null;
aSourceMapConsumer.eachMapping(function (mapping) {
if (lastMapping !== null) {
// We add the code from "lastMapping" to "mapping":
// First check if there is a new line in between.
if (lastGeneratedLine < mapping.generatedLine) {
// Associate first line with "lastMapping"
addMappingWithCode(lastMapping, shiftNextLine());
lastGeneratedLine++;
lastGeneratedColumn = 0;
// The remaining code is added without mapping
} else {
// There is no new line in between.
// Associate the code between "lastGeneratedColumn" and
// "mapping.generatedColumn" with "lastMapping"
var nextLine = remainingLines[remainingLinesIndex] || '';
var code = nextLine.substr(0, mapping.generatedColumn -
lastGeneratedColumn);
remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -
lastGeneratedColumn);
lastGeneratedColumn = mapping.generatedColumn;
addMappingWithCode(lastMapping, code);
// No more remaining code, continue
lastMapping = mapping;
return;
}
}
// We add the generated code until the first mapping
// to the SourceNode without any mapping.
// Each line is added as separate string.
while (lastGeneratedLine < mapping.generatedLine) {
node.add(shiftNextLine());
lastGeneratedLine++;
}
if (lastGeneratedColumn < mapping.generatedColumn) {
var nextLine = remainingLines[remainingLinesIndex] || '';
node.add(nextLine.substr(0, mapping.generatedColumn));
remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);
lastGeneratedColumn = mapping.generatedColumn;
}
lastMapping = mapping;
}, this);
// We have processed all mappings.
if (remainingLinesIndex < remainingLines.length) {
if (lastMapping) {
// Associate the remaining code in the current line with "lastMapping"
addMappingWithCode(lastMapping, shiftNextLine());
}
// and add the remaining lines without any mapping
node.add(remainingLines.splice(remainingLinesIndex).join(""));
}
// Copy sourcesContent into SourceNode
aSourceMapConsumer.sources.forEach(function (sourceFile) {
var content = aSourceMapConsumer.sourceContentFor(sourceFile);
if (content != null) {
if (aRelativePath != null) {
sourceFile = util.join(aRelativePath, sourceFile);
}
node.setSourceContent(sourceFile, content);
}
});
return node;
function addMappingWithCode(mapping, code) {
if (mapping === null || mapping.source === undefined) {
node.add(code);
} else {
var source = aRelativePath
? util.join(aRelativePath, mapping.source)
: mapping.source;
node.add(new SourceNode(mapping.originalLine,
mapping.originalColumn,
source,
code,
mapping.name));
}
}
};
/**
* Add a chunk of generated JS to this source node.
*
* @param aChunk A string snippet of generated JS code, another instance of
* SourceNode, or an array where each member is one of those things.
*/
SourceNode.prototype.add = function SourceNode_add(aChunk) {
if (Array.isArray(aChunk)) {
aChunk.forEach(function (chunk) {
this.add(chunk);
}, this);
}
else if (aChunk[isSourceNode] || typeof aChunk === "string") {
if (aChunk) {
this.children.push(aChunk);
}
}
else {
throw new TypeError(
"Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
);
}
return this;
};
/**
* Add a chunk of generated JS to the beginning of this source node.
*
* @param aChunk A string snippet of generated JS code, another instance of
* SourceNode, or an array where each member is one of those things.
*/
SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
if (Array.isArray(aChunk)) {
for (var i = aChunk.length-1; i >= 0; i--) {
this.prepend(aChunk[i]);
}
}
else if (aChunk[isSourceNode] || typeof aChunk === "string") {
this.children.unshift(aChunk);
}
else {
throw new TypeError(
"Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
);
}
return this;
};
/**
* Walk over the tree of JS snippets in this node and its children. The
* walking function is called once for each snippet of JS and is passed that
* snippet and the its original associated source's line/column location.
*
* @param aFn The traversal function.
*/
SourceNode.prototype.walk = function SourceNode_walk(aFn) {
var chunk;
for (var i = 0, len = this.children.length; i < len; i++) {
chunk = this.children[i];
if (chunk[isSourceNode]) {
chunk.walk(aFn);
}
else {
if (chunk !== '') {
aFn(chunk, { source: this.source,
line: this.line,
column: this.column,
name: this.name });
}
}
}
};
/**
* Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
* each of `this.children`.
*
* @param aSep The separator.
*/
SourceNode.prototype.join = function SourceNode_join(aSep) {
var newChildren;
var i;
var len = this.children.length;
if (len > 0) {
newChildren = [];
for (i = 0; i < len-1; i++) {
newChildren.push(this.children[i]);
newChildren.push(aSep);
}
newChildren.push(this.children[i]);
this.children = newChildren;
}
return this;
};
/**
* Call String.prototype.replace on the very right-most source snippet. Useful
* for trimming whitespace from the end of a source node, etc.
*
* @param aPattern The pattern to replace.
* @param aReplacement The thing to replace the pattern with.
*/
SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
var lastChild = this.children[this.children.length - 1];
if (lastChild[isSourceNode]) {
lastChild.replaceRight(aPattern, aReplacement);
}
else if (typeof lastChild === 'string') {
this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
}
else {
this.children.push(''.replace(aPattern, aReplacement));
}
return this;
};
/**
* Set the source content for a source file. This will be added to the SourceMapGenerator
* in the sourcesContent field.
*
* @param aSourceFile The filename of the source file
* @param aSourceContent The content of the source file
*/
SourceNode.prototype.setSourceContent =
function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
};
/**
* Walk over the tree of SourceNodes. The walking function is called for each
* source file content and is passed the filename and source content.
*
* @param aFn The traversal function.
*/
SourceNode.prototype.walkSourceContents =
function SourceNode_walkSourceContents(aFn) {
for (var i = 0, len = this.children.length; i < len; i++) {
if (this.children[i][isSourceNode]) {
this.children[i].walkSourceContents(aFn);
}
}
var sources = Object.keys(this.sourceContents);
for (var i = 0, len = sources.length; i < len; i++) {
aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
}
};
/**
* Return the string representation of this source node. Walks over the tree
* and concatenates all the various snippets together to one string.
*/
SourceNode.prototype.toString = function SourceNode_toString() {
var str = "";
this.walk(function (chunk) {
str += chunk;
});
return str;
};
/**
* Returns the string representation of this source node along with a source
* map.
*/
SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
var generated = {
code: "",
line: 1,
column: 0
};
var map = new SourceMapGenerator$1(aArgs);
var sourceMappingActive = false;
var lastOriginalSource = null;
var lastOriginalLine = null;
var lastOriginalColumn = null;
var lastOriginalName = null;
this.walk(function (chunk, original) {
generated.code += chunk;
if (original.source !== null
&& original.line !== null
&& original.column !== null) {
if(lastOriginalSource !== original.source
|| lastOriginalLine !== original.line
|| lastOriginalColumn !== original.column
|| lastOriginalName !== original.name) {
map.addMapping({
source: original.source,
original: {
line: original.line,
column: original.column
},
generated: {
line: generated.line,
column: generated.column
},
name: original.name
});
}
lastOriginalSource = original.source;
lastOriginalLine = original.line;
lastOriginalColumn = original.column;
lastOriginalName = original.name;
sourceMappingActive = true;
} else if (sourceMappingActive) {
map.addMapping({
generated: {
line: generated.line,
column: generated.column
}
});
lastOriginalSource = null;
sourceMappingActive = false;
}
for (var idx = 0, length = chunk.length; idx < length; idx++) {
if (chunk.charCodeAt(idx) === NEWLINE_CODE) {
generated.line++;
generated.column = 0;
// Mappings end at eol
if (idx + 1 === length) {
lastOriginalSource = null;
sourceMappingActive = false;
} else if (sourceMappingActive) {
map.addMapping({
source: original.source,
original: {
line: original.line,
column: original.column
},
generated: {
line: generated.line,
column: generated.column
},
name: original.name
});
}
} else {
generated.column++;
}
}
});
this.walkSourceContents(function (sourceFile, sourceContent) {
map.setSourceContent(sourceFile, sourceContent);
});
return { code: generated.code, map: map };
};
var SourceNode_1 = SourceNode;
var sourceNode = {
SourceNode: SourceNode_1
};
/*
* Copyright 2009-2011 Mozilla Foundation and contributors
* Licensed under the New BSD license. See LICENSE.txt or:
* http://opensource.org/licenses/BSD-3-Clause
*/
var SourceMapGenerator$2 = sourceMapGenerator.SourceMapGenerator;
var SourceMapConsumer$1 = sourceMapConsumer.SourceMapConsumer;
var SourceNode$1 = sourceNode.SourceNode;
var sourceMap = {
SourceMapGenerator: SourceMapGenerator$2,
SourceMapConsumer: SourceMapConsumer$1,
SourceNode: SourceNode$1
};
var toString = Object.prototype.toString;
var isModern = (
typeof Buffer.alloc === 'function' &&
typeof Buffer.allocUnsafe === 'function' &&
typeof Buffer.from === 'function'
);
function isArrayBuffer (input) {
return toString.call(input).slice(8, -1) === 'ArrayBuffer'
}
function fromArrayBuffer (obj, byteOffset, length) {
byteOffset >>>= 0;
var maxLength = obj.byteLength - byteOffset;
if (maxLength < 0) {
throw new RangeError("'offset' is out of bounds")
}
if (length === undefined) {
length = maxLength;
} else {
length >>>= 0;
if (length > maxLength) {
throw new RangeError("'length' is out of bounds")
}
}
return isModern
? Buffer.from(obj.slice(byteOffset, byteOffset + length))
: new Buffer(new Uint8Array(obj.slice(byteOffset, byteOffset + length)))
}
function fromString (string, encoding) {
if (typeof encoding !== 'string' || encoding === '') {
encoding = 'utf8';
}
if (!Buffer.isEncoding(encoding)) {
throw new TypeError('"encoding" must be a valid string encoding')
}
return isModern
? Buffer.from(string, encoding)
: new Buffer(string, encoding)
}
function bufferFrom (value, encodingOrOffset, length) {
if (typeof value === 'number') {
throw new TypeError('"value" argument must not be a number')
}
if (isArrayBuffer(value)) {
return fromArrayBuffer(value, encodingOrOffset, length)
}
if (typeof value === 'string') {
return fromString(value, encodingOrOffset)
}
return isModern
? Buffer.from(value)
: new Buffer(value)
}
var bufferFrom_1 = bufferFrom;
var sourceMapSupport = createCommonjsModule(function (module, exports) {
var SourceMapConsumer = sourceMap.SourceMapConsumer;
var path = path__default['default'];
var fs;
try {
fs = fs__default['default'];
if (!fs.existsSync || !fs.readFileSync) {
// fs doesn't have all methods we need
fs = null;
}
} catch (err) {
/* nop */
}
/**
* Requires a module which is protected against bundler minification.
*
* @param {NodeModule} mod
* @param {string} request
*/
function dynamicRequire(mod, request) {
return mod.require(request);
}
// Only install once if called multiple times
var errorFormatterInstalled = false;
var uncaughtShimInstalled = false;
// If true, the caches are reset before a stack trace formatting operation
var emptyCacheBetweenOperations = false;
// Supports {browser, node, auto}
var environment = "auto";
// Maps a file path to a string containing the file contents
var fileContentsCache = {};
// Maps a file path to a source map for that file
var sourceMapCache = {};
// Regex for detecting source maps
var reSourceMap = /^data:application\/json[^,]+base64,/;
// Priority list of retrieve handlers
var retrieveFileHandlers = [];
var retrieveMapHandlers = [];
function isInBrowser() {
if (environment === "browser")
return true;
if (environment === "node")
return false;
return ((typeof window !== 'undefined') && (typeof XMLHttpRequest === 'function') && !(window.require && window.module && window.process && window.process.type === "renderer"));
}
function hasGlobalProcessEventEmitter() {
return ((typeof process === 'object') && (process !== null) && (typeof process.on === 'function'));
}
function handlerExec(list) {
return function(arg) {
for (var i = 0; i < list.length; i++) {
var ret = list[i](arg);
if (ret) {
return ret;
}
}
return null;
};
}
var retrieveFile = handlerExec(retrieveFileHandlers);
retrieveFileHandlers.push(function(path) {
// Trim the path to make sure there is no extra whitespace.
path = path.trim();
if (/^file:/.test(path)) {
// existsSync/readFileSync can't handle file protocol, but once stripped, it works
path = path.replace(/file:\/\/\/(\w:)?/, function(protocol, drive) {
return drive ?
'' : // file:///C:/dir/file -> C:/dir/file
'/'; // file:///root-dir/file -> /root-dir/file
});
}
if (path in fileContentsCache) {
return fileContentsCache[path];
}
var contents = '';
try {
if (!fs) {
// Use SJAX if we are in the browser
var xhr = new XMLHttpRequest();
xhr.open('GET', path, /** async */ false);
xhr.send(null);
if (xhr.readyState === 4 && xhr.status === 200) {
contents = xhr.responseText;
}
} else if (fs.existsSync(path)) {
// Otherwise, use the filesystem
contents = fs.readFileSync(path, 'utf8');
}
} catch (er) {
/* ignore any errors */
}
return fileContentsCache[path] = contents;
});
// Support URLs relative to a directory, but be careful about a protocol prefix
// in case we are in the browser (i.e. directories may start with "http://" or "file:///")
function supportRelativeURL(file, url) {
if (!file) return url;
var dir = path.dirname(file);
var match = /^\w+:\/\/[^\/]*/.exec(dir);
var protocol = match ? match[0] : '';
var startPath = dir.slice(protocol.length);
if (protocol && /^\/\w\:/.test(startPath)) {
// handle file:///C:/ paths
protocol += '/';
return protocol + path.resolve(dir.slice(protocol.length), url).replace(/\\/g, '/');
}
return protocol + path.resolve(dir.slice(protocol.length), url);
}
function retrieveSourceMapURL(source) {
var fileData;
if (isInBrowser()) {
try {
var xhr = new XMLHttpRequest();
xhr.open('GET', source, false);
xhr.send(null);
fileData = xhr.readyState === 4 ? xhr.responseText : null;
// Support providing a sourceMappingURL via the SourceMap header
var sourceMapHeader = xhr.getResponseHeader("SourceMap") ||
xhr.getResponseHeader("X-SourceMap");
if (sourceMapHeader) {
return sourceMapHeader;
}
} catch (e) {
}
}
// Get the URL of the source map
fileData = retrieveFile(source);
var re = /(?:\/\/[@#][\s]*sourceMappingURL=([^\s'"]+)[\s]*$)|(?:\/\*[@#][\s]*sourceMappingURL=([^\s*'"]+)[\s]*(?:\*\/)[\s]*$)/mg;
// Keep executing the search to find the *last* sourceMappingURL to avoid
// picking up sourceMappingURLs from comments, strings, etc.
var lastMatch, match;
while (match = re.exec(fileData)) lastMatch = match;
if (!lastMatch) return null;
return lastMatch[1];
}
// Can be overridden by the retrieveSourceMap option to install. Takes a
// generated source filename; returns a {map, optional url} object, or null if
// there is no source map. The map field may be either a string or the parsed
// JSON object (ie, it must be a valid argument to the SourceMapConsumer
// constructor).
var retrieveSourceMap = handlerExec(retrieveMapHandlers);
retrieveMapHandlers.push(function(source) {
var sourceMappingURL = retrieveSourceMapURL(source);
if (!sourceMappingURL) return null;
// Read the contents of the source map
var sourceMapData;
if (reSourceMap.test(sourceMappingURL)) {
// Support source map URL as a data url
var rawData = sourceMappingURL.slice(sourceMappingURL.indexOf(',') + 1);
sourceMapData = bufferFrom_1(rawData, "base64").toString();
sourceMappingURL = source;
} else {
// Support source map URLs relative to the source URL
sourceMappingURL = supportRelativeURL(source, sourceMappingURL);
sourceMapData = retrieveFile(sourceMappingURL);
}
if (!sourceMapData) {
return null;
}
return {
url: sourceMappingURL,
map: sourceMapData
};
});
function mapSourcePosition(position) {
var sourceMap = sourceMapCache[position.source];
if (!sourceMap) {
// Call the (overrideable) retrieveSourceMap function to get the source map.
var urlAndMap = retrieveSourceMap(position.source);
if (urlAndMap) {
sourceMap = sourceMapCache[position.source] = {
url: urlAndMap.url,
map: new SourceMapConsumer(urlAndMap.map)
};
// Load all sources stored inline with the source map into the file cache
// to pretend like they are already loaded. They may not exist on disk.
if (sourceMap.map.sourcesContent) {
sourceMap.map.sources.forEach(function(source, i) {
var contents = sourceMap.map.sourcesContent[i];
if (contents) {
var url = supportRelativeURL(sourceMap.url, source);
fileContentsCache[url] = contents;
}
});
}
} else {
sourceMap = sourceMapCache[position.source] = {
url: null,
map: null
};
}
}
// Resolve the source URL relative to the URL of the source map
if (sourceMap && sourceMap.map && typeof sourceMap.map.originalPositionFor === 'function') {
var originalPosition = sourceMap.map.originalPositionFor(position);
// Only return the original position if a matching line was found. If no
// matching line is found then we return position instead, which will cause
// the stack trace to print the path and line for the compiled file. It is
// better to give a precise location in the compiled file than a vague
// location in the original file.
if (originalPosition.source !== null) {
originalPosition.source = supportRelativeURL(
sourceMap.url, originalPosition.source);
return originalPosition;
}
}
return position;
}
// Parses code generated by FormatEvalOrigin(), a function inside V8:
// https://code.google.com/p/v8/source/browse/trunk/src/messages.js
function mapEvalOrigin(origin) {
// Most eval() calls are in this format
var match = /^eval at ([^(]+) \((.+):(\d+):(\d+)\)$/.exec(origin);
if (match) {
var position = mapSourcePosition({
source: match[2],
line: +match[3],
column: match[4] - 1
});
return 'eval at ' + match[1] + ' (' + position.source + ':' +
position.line + ':' + (position.column + 1) + ')';
}
// Parse nested eval() calls using recursion
match = /^eval at ([^(]+) \((.+)\)$/.exec(origin);
if (match) {
return 'eval at ' + match[1] + ' (' + mapEvalOrigin(match[2]) + ')';
}
// Make sure we still return useful information if we didn't find anything
return origin;
}
// This is copied almost verbatim from the V8 source code at
// https://code.google.com/p/v8/source/browse/trunk/src/messages.js. The
// implementation of wrapCallSite() used to just forward to the actual source
// code of CallSite.prototype.toString but unfortunately a new release of V8
// did something to the prototype chain and broke the shim. The only fix I
// could find was copy/paste.
function CallSiteToString() {
var fileName;
var fileLocation = "";
if (this.isNative()) {
fileLocation = "native";
} else {
fileName = this.getScriptNameOrSourceURL();
if (!fileName && this.isEval()) {
fileLocation = this.getEvalOrigin();
fileLocation += ", "; // Expecting source position to follow.
}
if (fileName) {
fileLocation += fileName;
} else {
// Source code does not originate from a file and is not native, but we
// can still get the source position inside the source string, e.g. in
// an eval string.
fileLocation += "<anonymous>";
}
var lineNumber = this.getLineNumber();
if (lineNumber != null) {
fileLocation += ":" + lineNumber;
var columnNumber = this.getColumnNumber();
if (columnNumber) {
fileLocation += ":" + columnNumber;
}
}
}
var line = "";
var functionName = this.getFunctionName();
var addSuffix = true;
var isConstructor = this.isConstructor();
var isMethodCall = !(this.isToplevel() || isConstructor);
if (isMethodCall) {
var typeName = this.getTypeName();
// Fixes shim to be backward compatable with Node v0 to v4
if (typeName === "[object Object]") {
typeName = "null";
}
var methodName = this.getMethodName();
if (functionName) {
if (typeName && functionName.indexOf(typeName) != 0) {
line += typeName + ".";
}
line += functionName;
if (methodName && functionName.indexOf("." + methodName) != functionName.length - methodName.length - 1) {
line += " [as " + methodName + "]";
}
} else {
line += typeName + "." + (methodName || "<anonymous>");
}
} else if (isConstructor) {
line += "new " + (functionName || "<anonymous>");
} else if (functionName) {
line += functionName;
} else {
line += fileLocation;
addSuffix = false;
}
if (addSuffix) {
line += " (" + fileLocation + ")";
}
return line;
}
function cloneCallSite(frame) {
var object = {};
Object.getOwnPropertyNames(Object.getPrototypeOf(frame)).forEach(function(name) {
object[name] = /^(?:is|get)/.test(name) ? function() { return frame[name].call(frame); } : frame[name];
});
object.toString = CallSiteToString;
return object;
}
function wrapCallSite(frame, state) {
// provides interface backward compatibility
if (state === undefined) {
state = { nextPosition: null, curPosition: null };
}
if(frame.isNative()) {
state.curPosition = null;
return frame;
}
// Most call sites will return the source file from getFileName(), but code
// passed to eval() ending in "//# sourceURL=..." will return the source file
// from getScriptNameOrSourceURL() instead
var source = frame.getFileName() || frame.getScriptNameOrSourceURL();
if (source) {
var line = frame.getLineNumber();
var column = frame.getColumnNumber() - 1;
// Fix position in Node where some (internal) code is prepended.
// See https://github.com/evanw/node-source-map-support/issues/36
// Header removed in node at ^10.16 || >=11.11.0
// v11 is not an LTS candidate, we can just test the one version with it.
// Test node versions for: 10.16-19, 10.20+, 12-19, 20-99, 100+, or 11.11
var noHeader = /^v(10\.1[6-9]|10\.[2-9][0-9]|10\.[0-9]{3,}|1[2-9]\d*|[2-9]\d|\d{3,}|11\.11)/;
var headerLength = noHeader.test(process.version) ? 0 : 62;
if (line === 1 && column > headerLength && !isInBrowser() && !frame.isEval()) {
column -= headerLength;
}
var position = mapSourcePosition({
source: source,
line: line,
column: column
});
state.curPosition = position;
frame = cloneCallSite(frame);
var originalFunctionName = frame.getFunctionName;
frame.getFunctionName = function() {
if (state.nextPosition == null) {
return originalFunctionName();
}
return state.nextPosition.name || originalFunctionName();
};
frame.getFileName = function() { return position.source; };
frame.getLineNumber = function() { return position.line; };
frame.getColumnNumber = function() { return position.column + 1; };
frame.getScriptNameOrSourceURL = function() { return position.source; };
return frame;
}
// Code called using eval() needs special handling
var origin = frame.isEval() && frame.getEvalOrigin();
if (origin) {
origin = mapEvalOrigin(origin);
frame = cloneCallSite(frame);
frame.getEvalOrigin = function() { return origin; };
return frame;
}
// If we get here then we were unable to change the source position
return frame;
}
// This function is part of the V8 stack trace API, for more info see:
// https://v8.dev/docs/stack-trace-api
function prepareStackTrace(error, stack) {
if (emptyCacheBetweenOperations) {
fileContentsCache = {};
sourceMapCache = {};
}
var name = error.name || 'Error';
var message = error.message || '';
var errorString = name + ": " + message;
var state = { nextPosition: null, curPosition: null };
var processedStack = [];
for (var i = stack.length - 1; i >= 0; i--) {
processedStack.push('\n at ' + wrapCallSite(stack[i], state));
state.nextPosition = state.curPosition;
}
state.curPosition = state.nextPosition = null;
return errorString + processedStack.reverse().join('');
}
// Generate position and snippet of original source with pointer
function getErrorSource(error) {
var match = /\n at [^(]+ \((.*):(\d+):(\d+)\)/.exec(error.stack);
if (match) {
var source = match[1];
var line = +match[2];
var column = +match[3];
// Support the inline sourceContents inside the source map
var contents = fileContentsCache[source];
// Support files on disk
if (!contents && fs && fs.existsSync(source)) {
try {
contents = fs.readFileSync(source, 'utf8');
} catch (er) {
contents = '';
}
}
// Format the line from the original source code like node does
if (contents) {
var code = contents.split(/(?:\r\n|\r|\n)/)[line - 1];
if (code) {
return source + ':' + line + '\n' + code + '\n' +
new Array(column).join(' ') + '^';
}
}
}
return null;
}
function printErrorAndExit (error) {
var source = getErrorSource(error);
// Ensure error is printed synchronously and not truncated
if (process.stderr._handle && process.stderr._handle.setBlocking) {
process.stderr._handle.setBlocking(true);
}
if (source) {
console.error();
console.error(source);
}
console.error(error.stack);
process.exit(1);
}
function shimEmitUncaughtException () {
var origEmit = process.emit;
process.emit = function (type) {
if (type === 'uncaughtException') {
var hasStack = (arguments[1] && arguments[1].stack);
var hasListeners = (this.listeners(type).length > 0);
if (hasStack && !hasListeners) {
return printErrorAndExit(arguments[1]);
}
}
return origEmit.apply(this, arguments);
};
}
var originalRetrieveFileHandlers = retrieveFileHandlers.slice(0);
var originalRetrieveMapHandlers = retrieveMapHandlers.slice(0);
exports.wrapCallSite = wrapCallSite;
exports.getErrorSource = getErrorSource;
exports.mapSourcePosition = mapSourcePosition;
exports.retrieveSourceMap = retrieveSourceMap;
exports.install = function(options) {
options = options || {};
if (options.environment) {
environment = options.environment;
if (["node", "browser", "auto"].indexOf(environment) === -1) {
throw new Error("environment " + environment + " was unknown. Available options are {auto, browser, node}")
}
}
// Allow sources to be found by methods other than reading the files
// directly from disk.
if (options.retrieveFile) {
if (options.overrideRetrieveFile) {
retrieveFileHandlers.length = 0;
}
retrieveFileHandlers.unshift(options.retrieveFile);
}
// Allow source maps to be found by methods other than reading the files
// directly from disk.
if (options.retrieveSourceMap) {
if (options.overrideRetrieveSourceMap) {
retrieveMapHandlers.length = 0;
}
retrieveMapHandlers.unshift(options.retrieveSourceMap);
}
// Support runtime transpilers that include inline source maps
if (options.hookRequire && !isInBrowser()) {
// Use dynamicRequire to avoid including in browser bundles
var Module = dynamicRequire(module, 'module');
var $compile = Module.prototype._compile;
if (!$compile.__sourceMapSupport) {
Module.prototype._compile = function(content, filename) {
fileContentsCache[filename] = content;
sourceMapCache[filename] = undefined;
return $compile.call(this, content, filename);
};
Module.prototype._compile.__sourceMapSupport = true;
}
}
// Configure options
if (!emptyCacheBetweenOperations) {
emptyCacheBetweenOperations = 'emptyCacheBetweenOperations' in options ?
options.emptyCacheBetweenOperations : false;
}
// Install the error reformatter
if (!errorFormatterInstalled) {
errorFormatterInstalled = true;
Error.prepareStackTrace = prepareStackTrace;
}
if (!uncaughtShimInstalled) {
var installHandler = 'handleUncaughtExceptions' in options ?
options.handleUncaughtExceptions : true;
// Do not override 'uncaughtException' with our own handler in Node.js
// Worker threads. Workers pass the error to the main thread as an event,
// rather than printing something to stderr and exiting.
try {
// We need to use `dynamicRequire` because `require` on it's own will be optimized by WebPack/Browserify.
var worker_threads = dynamicRequire(module, 'worker_threads');
if (worker_threads.isMainThread === false) {
installHandler = false;
}
} catch(e) {}
// Provide the option to not install the uncaught exception handler. This is
// to support other uncaught exception handlers (in test frameworks, for
// example). If this handler is not installed and there are no other uncaught
// exception handlers, uncaught exceptions will be caught by node's built-in
// exception handler and the process will still be terminated. However, the
// generated JavaScript code will be shown above the stack trace instead of
// the original source code.
if (installHandler && hasGlobalProcessEventEmitter()) {
uncaughtShimInstalled = true;
shimEmitUncaughtException();
}
}
};
exports.resetRetrieveHandlers = function() {
retrieveFileHandlers.length = 0;
retrieveMapHandlers.length = 0;
retrieveFileHandlers = originalRetrieveFileHandlers.slice(0);
retrieveMapHandlers = originalRetrieveMapHandlers.slice(0);
retrieveSourceMap = handlerExec(retrieveMapHandlers);
retrieveFile = handlerExec(retrieveFileHandlers);
};
});
sourceMapSupport.install();
var fromCallback = function (fn) {
return Object.defineProperty(function (...args) {
if (typeof args[args.length - 1] === 'function') fn.apply(this, args);
else {
return new Promise((resolve, reject) => {
fn.apply(
this,
args.concat([(err, res) => err ? reject(err) : resolve(res)])
);
})
}
}, 'name', { value: fn.name })
};
var fromPromise = function (fn) {
return Object.defineProperty(function (...args) {
const cb = args[args.length - 1];
if (typeof cb !== 'function') return fn.apply(this, args)
else fn.apply(this, args.slice(0, -1)).then(r => cb(null, r), cb);
}, 'name', { value: fn.name })
};
var universalify = {
fromCallback: fromCallback,
fromPromise: fromPromise
};
var origCwd = process.cwd;
var cwd = null;
var platform = process.env.GRACEFUL_FS_PLATFORM || process.platform;
process.cwd = function() {
if (!cwd)
cwd = origCwd.call(process);
return cwd
};
try {
process.cwd();
} catch (er) {}
var chdir = process.chdir;
process.chdir = function(d) {
cwd = null;
chdir.call(process, d);
};
var polyfills = patch;
function patch (fs) {
// (re-)implement some things that are known busted or missing.
// lchmod, broken prior to 0.6.2
// back-port the fix here.
if (constants__default['default'].hasOwnProperty('O_SYMLINK') &&
process.version.match(/^v0\.6\.[0-2]|^v0\.5\./)) {
patchLchmod(fs);
}
// lutimes implementation, or no-op
if (!fs.lutimes) {
patchLutimes(fs);
}
// https://github.com/isaacs/node-graceful-fs/issues/4
// Chown should not fail on einval or eperm if non-root.
// It should not fail on enosys ever, as this just indicates
// that a fs doesn't support the intended operation.
fs.chown = chownFix(fs.chown);
fs.fchown = chownFix(fs.fchown);
fs.lchown = chownFix(fs.lchown);
fs.chmod = chmodFix(fs.chmod);
fs.fchmod = chmodFix(fs.fchmod);
fs.lchmod = chmodFix(fs.lchmod);
fs.chownSync = chownFixSync(fs.chownSync);
fs.fchownSync = chownFixSync(fs.fchownSync);
fs.lchownSync = chownFixSync(fs.lchownSync);
fs.chmodSync = chmodFixSync(fs.chmodSync);
fs.fchmodSync = chmodFixSync(fs.fchmodSync);
fs.lchmodSync = chmodFixSync(fs.lchmodSync);
fs.stat = statFix(fs.stat);
fs.fstat = statFix(fs.fstat);
fs.lstat = statFix(fs.lstat);
fs.statSync = statFixSync(fs.statSync);
fs.fstatSync = statFixSync(fs.fstatSync);
fs.lstatSync = statFixSync(fs.lstatSync);
// if lchmod/lchown do not exist, then make them no-ops
if (!fs.lchmod) {
fs.lchmod = function (path, mode, cb) {
if (cb) process.nextTick(cb);
};
fs.lchmodSync = function () {};
}
if (!fs.lchown) {
fs.lchown = function (path, uid, gid, cb) {
if (cb) process.nextTick(cb);
};
fs.lchownSync = function () {};
}
// on Windows, A/V software can lock the directory, causing this
// to fail with an EACCES or EPERM if the directory contains newly
// created files. Try again on failure, for up to 60 seconds.
// Set the timeout this long because some Windows Anti-Virus, such as Parity
// bit9, may lock files for up to a minute, causing npm package install
// failures. Also, take care to yield the scheduler. Windows scheduling gives
// CPU to a busy looping process, which can cause the program causing the lock
// contention to be starved of CPU by node, so the contention doesn't resolve.
if (platform === "win32") {
fs.rename = (function (fs$rename) { return function (from, to, cb) {
var start = Date.now();
var backoff = 0;
fs$rename(from, to, function CB (er) {
if (er
&& (er.code === "EACCES" || er.code === "EPERM")
&& Date.now() - start < 60000) {
setTimeout(function() {
fs.stat(to, function (stater, st) {
if (stater && stater.code === "ENOENT")
fs$rename(from, to, CB);
else
cb(er);
});
}, backoff);
if (backoff < 100)
backoff += 10;
return;
}
if (cb) cb(er);
});
}})(fs.rename);
}
// if read() returns EAGAIN, then just try it again.
fs.read = (function (fs$read) {
function read (fd, buffer, offset, length, position, callback_) {
var callback;
if (callback_ && typeof callback_ === 'function') {
var eagCounter = 0;
callback = function (er, _, __) {
if (er && er.code === 'EAGAIN' && eagCounter < 10) {
eagCounter ++;
return fs$read.call(fs, fd, buffer, offset, length, position, callback)
}
callback_.apply(this, arguments);
};
}
return fs$read.call(fs, fd, buffer, offset, length, position, callback)
}
// This ensures `util.promisify` works as it does for native `fs.read`.
read.__proto__ = fs$read;
return read
})(fs.read);
fs.readSync = (function (fs$readSync) { return function (fd, buffer, offset, length, position) {
var eagCounter = 0;
while (true) {
try {
return fs$readSync.call(fs, fd, buffer, offset, length, position)
} catch (er) {
if (er.code === 'EAGAIN' && eagCounter < 10) {
eagCounter ++;
continue
}
throw er
}
}
}})(fs.readSync);
function patchLchmod (fs) {
fs.lchmod = function (path, mode, callback) {
fs.open( path
, constants__default['default'].O_WRONLY | constants__default['default'].O_SYMLINK
, mode
, function (err, fd) {
if (err) {
if (callback) callback(err);
return
}
// prefer to return the chmod error, if one occurs,
// but still try to close, and report closing errors if they occur.
fs.fchmod(fd, mode, function (err) {
fs.close(fd, function(err2) {
if (callback) callback(err || err2);
});
});
});
};
fs.lchmodSync = function (path, mode) {
var fd = fs.openSync(path, constants__default['default'].O_WRONLY | constants__default['default'].O_SYMLINK, mode);
// prefer to return the chmod error, if one occurs,
// but still try to close, and report closing errors if they occur.
var threw = true;
var ret;
try {
ret = fs.fchmodSync(fd, mode);
threw = false;
} finally {
if (threw) {
try {
fs.closeSync(fd);
} catch (er) {}
} else {
fs.closeSync(fd);
}
}
return ret
};
}
function patchLutimes (fs) {
if (constants__default['default'].hasOwnProperty("O_SYMLINK")) {
fs.lutimes = function (path, at, mt, cb) {
fs.open(path, constants__default['default'].O_SYMLINK, function (er, fd) {
if (er) {
if (cb) cb(er);
return
}
fs.futimes(fd, at, mt, function (er) {
fs.close(fd, function (er2) {
if (cb) cb(er || er2);
});
});
});
};
fs.lutimesSync = function (path, at, mt) {
var fd = fs.openSync(path, constants__default['default'].O_SYMLINK);
var ret;
var threw = true;
try {
ret = fs.futimesSync(fd, at, mt);
threw = false;
} finally {
if (threw) {
try {
fs.closeSync(fd);
} catch (er) {}
} else {
fs.closeSync(fd);
}
}
return ret
};
} else {
fs.lutimes = function (_a, _b, _c, cb) { if (cb) process.nextTick(cb); };
fs.lutimesSync = function () {};
}
}
function chmodFix (orig) {
if (!orig) return orig
return function (target, mode, cb) {
return orig.call(fs, target, mode, function (er) {
if (chownErOk(er)) er = null;
if (cb) cb.apply(this, arguments);
})
}
}
function chmodFixSync (orig) {
if (!orig) return orig
return function (target, mode) {
try {
return orig.call(fs, target, mode)
} catch (er) {
if (!chownErOk(er)) throw er
}
}
}
function chownFix (orig) {
if (!orig) return orig
return function (target, uid, gid, cb) {
return orig.call(fs, target, uid, gid, function (er) {
if (chownErOk(er)) er = null;
if (cb) cb.apply(this, arguments);
})
}
}
function chownFixSync (orig) {
if (!orig) return orig
return function (target, uid, gid) {
try {
return orig.call(fs, target, uid, gid)
} catch (er) {
if (!chownErOk(er)) throw er
}
}
}
function statFix (orig) {
if (!orig) return orig
// Older versions of Node erroneously returned signed integers for
// uid + gid.
return function (target, options, cb) {
if (typeof options === 'function') {
cb = options;
options = null;
}
function callback (er, stats) {
if (stats) {
if (stats.uid < 0) stats.uid += 0x100000000;
if (stats.gid < 0) stats.gid += 0x100000000;
}
if (cb) cb.apply(this, arguments);
}
return options ? orig.call(fs, target, options, callback)
: orig.call(fs, target, callback)
}
}
function statFixSync (orig) {
if (!orig) return orig
// Older versions of Node erroneously returned signed integers for
// uid + gid.
return function (target, options) {
var stats = options ? orig.call(fs, target, options)
: orig.call(fs, target);
if (stats.uid < 0) stats.uid += 0x100000000;
if (stats.gid < 0) stats.gid += 0x100000000;
return stats;
}
}
// ENOSYS means that the fs doesn't support the op. Just ignore
// that, because it doesn't matter.
//
// if there's no getuid, or if getuid() is something other
// than 0, and the error is EINVAL or EPERM, then just ignore
// it.
//
// This specific case is a silent failure in cp, install, tar,
// and most other unix tools that manage permissions.
//
// When running as root, or if other types of errors are
// encountered, then it's strict.
function chownErOk (er) {
if (!er)
return true
if (er.code === "ENOSYS")
return true
var nonroot = !process.getuid || process.getuid() !== 0;
if (nonroot) {
if (er.code === "EINVAL" || er.code === "EPERM")
return true
}
return false
}
}
var Stream = Stream__default['default'].Stream;
var legacyStreams = legacy;
function legacy (fs) {
return {
ReadStream: ReadStream,
WriteStream: WriteStream
}
function ReadStream (path, options) {
if (!(this instanceof ReadStream)) return new ReadStream(path, options);
Stream.call(this);
var self = this;
this.path = path;
this.fd = null;
this.readable = true;
this.paused = false;
this.flags = 'r';
this.mode = 438; /*=0666*/
this.bufferSize = 64 * 1024;
options = options || {};
// Mixin options into this
var keys = Object.keys(options);
for (var index = 0, length = keys.length; index < length; index++) {
var key = keys[index];
this[key] = options[key];
}
if (this.encoding) this.setEncoding(this.encoding);
if (this.start !== undefined) {
if ('number' !== typeof this.start) {
throw TypeError('start must be a Number');
}
if (this.end === undefined) {
this.end = Infinity;
} else if ('number' !== typeof this.end) {
throw TypeError('end must be a Number');
}
if (this.start > this.end) {
throw new Error('start must be <= end');
}
this.pos = this.start;
}
if (this.fd !== null) {
process.nextTick(function() {
self._read();
});
return;
}
fs.open(this.path, this.flags, this.mode, function (err, fd) {
if (err) {
self.emit('error', err);
self.readable = false;
return;
}
self.fd = fd;
self.emit('open', fd);
self._read();
});
}
function WriteStream (path, options) {
if (!(this instanceof WriteStream)) return new WriteStream(path, options);
Stream.call(this);
this.path = path;
this.fd = null;
this.writable = true;
this.flags = 'w';
this.encoding = 'binary';
this.mode = 438; /*=0666*/
this.bytesWritten = 0;
options = options || {};
// Mixin options into this
var keys = Object.keys(options);
for (var index = 0, length = keys.length; index < length; index++) {
var key = keys[index];
this[key] = options[key];
}
if (this.start !== undefined) {
if ('number' !== typeof this.start) {
throw TypeError('start must be a Number');
}
if (this.start < 0) {
throw new Error('start must be >= zero');
}
this.pos = this.start;
}
this.busy = false;
this._queue = [];
if (this.fd === null) {
this._open = fs.open;
this._queue.push([this._open, this.path, this.flags, this.mode, undefined]);
this.flush();
}
}
}
var clone_1 = clone;
function clone (obj) {
if (obj === null || typeof obj !== 'object')
return obj
if (obj instanceof Object)
var copy = { __proto__: obj.__proto__ };
else
var copy = Object.create(null);
Object.getOwnPropertyNames(obj).forEach(function (key) {
Object.defineProperty(copy, key, Object.getOwnPropertyDescriptor(obj, key));
});
return copy
}
var gracefulFs = createCommonjsModule(function (module) {
/* istanbul ignore next - node 0.x polyfill */
var gracefulQueue;
var previousSymbol;
/* istanbul ignore else - node 0.x polyfill */
if (typeof Symbol === 'function' && typeof Symbol.for === 'function') {
gracefulQueue = Symbol.for('graceful-fs.queue');
// This is used in testing by future versions
previousSymbol = Symbol.for('graceful-fs.previous');
} else {
gracefulQueue = '___graceful-fs.queue';
previousSymbol = '___graceful-fs.previous';
}
function noop () {}
function publishQueue(context, queue) {
Object.defineProperty(context, gracefulQueue, {
get: function() {
return queue
}
});
}
var debug = noop;
if (util__default['default'].debuglog)
debug = util__default['default'].debuglog('gfs4');
else if (/\bgfs4\b/i.test(process.env.NODE_DEBUG || ''))
debug = function() {
var m = util__default['default'].format.apply(util__default['default'], arguments);
m = 'GFS4: ' + m.split(/\n/).join('\nGFS4: ');
console.error(m);
};
// Once time initialization
if (!fs__default['default'][gracefulQueue]) {
// This queue can be shared by multiple loaded instances
var queue = commonjsGlobal[gracefulQueue] || [];
publishQueue(fs__default['default'], queue);
// Patch fs.close/closeSync to shared queue version, because we need
// to retry() whenever a close happens *anywhere* in the program.
// This is essential when multiple graceful-fs instances are
// in play at the same time.
fs__default['default'].close = (function (fs$close) {
function close (fd, cb) {
return fs$close.call(fs__default['default'], fd, function (err) {
// This function uses the graceful-fs shared queue
if (!err) {
retry();
}
if (typeof cb === 'function')
cb.apply(this, arguments);
})
}
Object.defineProperty(close, previousSymbol, {
value: fs$close
});
return close
})(fs__default['default'].close);
fs__default['default'].closeSync = (function (fs$closeSync) {
function closeSync (fd) {
// This function uses the graceful-fs shared queue
fs$closeSync.apply(fs__default['default'], arguments);
retry();
}
Object.defineProperty(closeSync, previousSymbol, {
value: fs$closeSync
});
return closeSync
})(fs__default['default'].closeSync);
if (/\bgfs4\b/i.test(process.env.NODE_DEBUG || '')) {
process.on('exit', function() {
debug(fs__default['default'][gracefulQueue]);
assert__default['default'].equal(fs__default['default'][gracefulQueue].length, 0);
});
}
}
if (!commonjsGlobal[gracefulQueue]) {
publishQueue(commonjsGlobal, fs__default['default'][gracefulQueue]);
}
module.exports = patch(clone_1(fs__default['default']));
if (process.env.TEST_GRACEFUL_FS_GLOBAL_PATCH && !fs__default['default'].__patched) {
module.exports = patch(fs__default['default']);
fs__default['default'].__patched = true;
}
function patch (fs) {
// Everything that references the open() function needs to be in here
polyfills(fs);
fs.gracefulify = patch;
fs.createReadStream = createReadStream;
fs.createWriteStream = createWriteStream;
var fs$readFile = fs.readFile;
fs.readFile = readFile;
function readFile (path, options, cb) {
if (typeof options === 'function')
cb = options, options = null;
return go$readFile(path, options, cb)
function go$readFile (path, options, cb) {
return fs$readFile(path, options, function (err) {
if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))
enqueue([go$readFile, [path, options, cb]]);
else {
if (typeof cb === 'function')
cb.apply(this, arguments);
retry();
}
})
}
}
var fs$writeFile = fs.writeFile;
fs.writeFile = writeFile;
function writeFile (path, data, options, cb) {
if (typeof options === 'function')
cb = options, options = null;
return go$writeFile(path, data, options, cb)
function go$writeFile (path, data, options, cb) {
return fs$writeFile(path, data, options, function (err) {
if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))
enqueue([go$writeFile, [path, data, options, cb]]);
else {
if (typeof cb === 'function')
cb.apply(this, arguments);
retry();
}
})
}
}
var fs$appendFile = fs.appendFile;
if (fs$appendFile)
fs.appendFile = appendFile;
function appendFile (path, data, options, cb) {
if (typeof options === 'function')
cb = options, options = null;
return go$appendFile(path, data, options, cb)
function go$appendFile (path, data, options, cb) {
return fs$appendFile(path, data, options, function (err) {
if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))
enqueue([go$appendFile, [path, data, options, cb]]);
else {
if (typeof cb === 'function')
cb.apply(this, arguments);
retry();
}
})
}
}
var fs$readdir = fs.readdir;
fs.readdir = readdir;
function readdir (path, options, cb) {
var args = [path];
if (typeof options !== 'function') {
args.push(options);
} else {
cb = options;
}
args.push(go$readdir$cb);
return go$readdir(args)
function go$readdir$cb (err, files) {
if (files && files.sort)
files.sort();
if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))
enqueue([go$readdir, [args]]);
else {
if (typeof cb === 'function')
cb.apply(this, arguments);
retry();
}
}
}
function go$readdir (args) {
return fs$readdir.apply(fs, args)
}
if (process.version.substr(0, 4) === 'v0.8') {
var legStreams = legacyStreams(fs);
ReadStream = legStreams.ReadStream;
WriteStream = legStreams.WriteStream;
}
var fs$ReadStream = fs.ReadStream;
if (fs$ReadStream) {
ReadStream.prototype = Object.create(fs$ReadStream.prototype);
ReadStream.prototype.open = ReadStream$open;
}
var fs$WriteStream = fs.WriteStream;
if (fs$WriteStream) {
WriteStream.prototype = Object.create(fs$WriteStream.prototype);
WriteStream.prototype.open = WriteStream$open;
}
Object.defineProperty(fs, 'ReadStream', {
get: function () {
return ReadStream
},
set: function (val) {
ReadStream = val;
},
enumerable: true,
configurable: true
});
Object.defineProperty(fs, 'WriteStream', {
get: function () {
return WriteStream
},
set: function (val) {
WriteStream = val;
},
enumerable: true,
configurable: true
});
// legacy names
var FileReadStream = ReadStream;
Object.defineProperty(fs, 'FileReadStream', {
get: function () {
return FileReadStream
},
set: function (val) {
FileReadStream = val;
},
enumerable: true,
configurable: true
});
var FileWriteStream = WriteStream;
Object.defineProperty(fs, 'FileWriteStream', {
get: function () {
return FileWriteStream
},
set: function (val) {
FileWriteStream = val;
},
enumerable: true,
configurable: true
});
function ReadStream (path, options) {
if (this instanceof ReadStream)
return fs$ReadStream.apply(this, arguments), this
else
return ReadStream.apply(Object.create(ReadStream.prototype), arguments)
}
function ReadStream$open () {
var that = this;
open(that.path, that.flags, that.mode, function (err, fd) {
if (err) {
if (that.autoClose)
that.destroy();
that.emit('error', err);
} else {
that.fd = fd;
that.emit('open', fd);
that.read();
}
});
}
function WriteStream (path, options) {
if (this instanceof WriteStream)
return fs$WriteStream.apply(this, arguments), this
else
return WriteStream.apply(Object.create(WriteStream.prototype), arguments)
}
function WriteStream$open () {
var that = this;
open(that.path, that.flags, that.mode, function (err, fd) {
if (err) {
that.destroy();
that.emit('error', err);
} else {
that.fd = fd;
that.emit('open', fd);
}
});
}
function createReadStream (path, options) {
return new fs.ReadStream(path, options)
}
function createWriteStream (path, options) {
return new fs.WriteStream(path, options)
}
var fs$open = fs.open;
fs.open = open;
function open (path, flags, mode, cb) {
if (typeof mode === 'function')
cb = mode, mode = null;
return go$open(path, flags, mode, cb)
function go$open (path, flags, mode, cb) {
return fs$open(path, flags, mode, function (err, fd) {
if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))
enqueue([go$open, [path, flags, mode, cb]]);
else {
if (typeof cb === 'function')
cb.apply(this, arguments);
retry();
}
})
}
}
return fs
}
function enqueue (elem) {
debug('ENQUEUE', elem[0].name, elem[1]);
fs__default['default'][gracefulQueue].push(elem);
}
function retry () {
var elem = fs__default['default'][gracefulQueue].shift();
if (elem) {
debug('RETRY', elem[0].name, elem[1]);
elem[0].apply(null, elem[1]);
}
}
});
var fs_1 = createCommonjsModule(function (module, exports) {
// This is adapted from https://github.com/normalize/mz
// Copyright (c) 2014-2016 Jonathan Ong me@jongleberry.com and Contributors
const u = universalify.fromCallback;
const api = [
'access',
'appendFile',
'chmod',
'chown',
'close',
'copyFile',
'fchmod',
'fchown',
'fdatasync',
'fstat',
'fsync',
'ftruncate',
'futimes',
'lchmod',
'lchown',
'link',
'lstat',
'mkdir',
'mkdtemp',
'open',
'opendir',
'readdir',
'readFile',
'readlink',
'realpath',
'rename',
'rmdir',
'stat',
'symlink',
'truncate',
'unlink',
'utimes',
'writeFile'
].filter(key => {
// Some commands are not available on some systems. Ex:
// fs.opendir was added in Node.js v12.12.0
// fs.lchown is not available on at least some Linux
return typeof gracefulFs[key] === 'function'
});
// Export all keys:
Object.keys(gracefulFs).forEach(key => {
if (key === 'promises') {
// fs.promises is a getter property that triggers ExperimentalWarning
// Don't re-export it here, the getter is defined in "lib/index.js"
return
}
exports[key] = gracefulFs[key];
});
// Universalify async methods:
api.forEach(method => {
exports[method] = u(gracefulFs[method]);
});
// We differ from mz/fs in that we still ship the old, broken, fs.exists()
// since we are a drop-in replacement for the native module
exports.exists = function (filename, callback) {
if (typeof callback === 'function') {
return gracefulFs.exists(filename, callback)
}
return new Promise(resolve => {
return gracefulFs.exists(filename, resolve)
})
};
// fs.read(), fs.write(), & fs.writev() need special treatment due to multiple callback args
exports.read = function (fd, buffer, offset, length, position, callback) {
if (typeof callback === 'function') {
return gracefulFs.read(fd, buffer, offset, length, position, callback)
}
return new Promise((resolve, reject) => {
gracefulFs.read(fd, buffer, offset, length, position, (err, bytesRead, buffer) => {
if (err) return reject(err)
resolve({ bytesRead, buffer });
});
})
};
// Function signature can be
// fs.write(fd, buffer[, offset[, length[, position]]], callback)
// OR
// fs.write(fd, string[, position[, encoding]], callback)
// We need to handle both cases, so we use ...args
exports.write = function (fd, buffer, ...args) {
if (typeof args[args.length - 1] === 'function') {
return gracefulFs.write(fd, buffer, ...args)
}
return new Promise((resolve, reject) => {
gracefulFs.write(fd, buffer, ...args, (err, bytesWritten, buffer) => {
if (err) return reject(err)
resolve({ bytesWritten, buffer });
});
})
};
// fs.writev only available in Node v12.9.0+
if (typeof gracefulFs.writev === 'function') {
// Function signature is
// s.writev(fd, buffers[, position], callback)
// We need to handle the optional arg, so we use ...args
exports.writev = function (fd, buffers, ...args) {
if (typeof args[args.length - 1] === 'function') {
return gracefulFs.writev(fd, buffers, ...args)
}
return new Promise((resolve, reject) => {
gracefulFs.writev(fd, buffers, ...args, (err, bytesWritten, buffers) => {
if (err) return reject(err)
resolve({ bytesWritten, buffers });
});
})
};
}
// fs.realpath.native only available in Node v9.2+
if (typeof gracefulFs.realpath.native === 'function') {
exports.realpath.native = u(gracefulFs.realpath.native);
}
});
var atLeastNode = r => {
const n = process.versions.node.split('.').map(x => parseInt(x, 10));
r = r.split('.').map(x => parseInt(x, 10));
return n[0] > r[0] || (n[0] === r[0] && (n[1] > r[1] || (n[1] === r[1] && n[2] >= r[2])))
};
const useNativeRecursiveOption = atLeastNode('10.12.0');
// https://github.com/nodejs/node/issues/8987
// https://github.com/libuv/libuv/pull/1088
const checkPath = pth => {
if (process.platform === 'win32') {
const pathHasInvalidWinCharacters = /[<>:"|?*]/.test(pth.replace(path__default['default'].parse(pth).root, ''));
if (pathHasInvalidWinCharacters) {
const error = new Error(`Path contains invalid characters: ${pth}`);
error.code = 'EINVAL';
throw error
}
}
};
const processOptions = options => {
const defaults = { mode: 0o777 };
if (typeof options === 'number') options = { mode: options };
return { ...defaults, ...options }
};
const permissionError = pth => {
// This replicates the exception of `fs.mkdir` with native the
// `recusive` option when run on an invalid drive under Windows.
const error = new Error(`operation not permitted, mkdir '${pth}'`);
error.code = 'EPERM';
error.errno = -4048;
error.path = pth;
error.syscall = 'mkdir';
return error
};
var makeDir_1 = async (input, options) => {
checkPath(input);
options = processOptions(options);
if (useNativeRecursiveOption) {
const pth = path__default['default'].resolve(input);
return fs_1.mkdir(pth, {
mode: options.mode,
recursive: true
})
}
const make = async pth => {
try {
await fs_1.mkdir(pth, options.mode);
} catch (error) {
if (error.code === 'EPERM') {
throw error
}
if (error.code === 'ENOENT') {
if (path__default['default'].dirname(pth) === pth) {
throw permissionError(pth)
}
if (error.message.includes('null bytes')) {
throw error
}
await make(path__default['default'].dirname(pth));
return make(pth)
}
try {
const stats = await fs_1.stat(pth);
if (!stats.isDirectory()) {
// This error is never exposed to the user
// it is caught below, and the original error is thrown
throw new Error('The path is not a directory')
}
} catch {
throw error
}
}
};
return make(path__default['default'].resolve(input))
};
var makeDirSync = (input, options) => {
checkPath(input);
options = processOptions(options);
if (useNativeRecursiveOption) {
const pth = path__default['default'].resolve(input);
return fs_1.mkdirSync(pth, {
mode: options.mode,
recursive: true
})
}
const make = pth => {
try {
fs_1.mkdirSync(pth, options.mode);
} catch (error) {
if (error.code === 'EPERM') {
throw error
}
if (error.code === 'ENOENT') {
if (path__default['default'].dirname(pth) === pth) {
throw permissionError(pth)
}
if (error.message.includes('null bytes')) {
throw error
}
make(path__default['default'].dirname(pth));
return make(pth)
}
try {
if (!fs_1.statSync(pth).isDirectory()) {
// This error is never exposed to the user
// it is caught below, and the original error is thrown
throw new Error('The path is not a directory')
}
} catch {
throw error
}
}
};
return make(path__default['default'].resolve(input))
};
var makeDir = {
makeDir: makeDir_1,
makeDirSync: makeDirSync
};
const u = universalify.fromPromise;
const { makeDir: _makeDir, makeDirSync: makeDirSync$1 } = makeDir;
const makeDir$1 = u(_makeDir);
var mkdirs = {
mkdirs: makeDir$1,
mkdirsSync: makeDirSync$1,
// alias
mkdirp: makeDir$1,
mkdirpSync: makeDirSync$1,
ensureDir: makeDir$1,
ensureDirSync: makeDirSync$1
};
function utimesMillis (path, atime, mtime, callback) {
// if (!HAS_MILLIS_RES) return fs.utimes(path, atime, mtime, callback)
gracefulFs.open(path, 'r+', (err, fd) => {
if (err) return callback(err)
gracefulFs.futimes(fd, atime, mtime, futimesErr => {
gracefulFs.close(fd, closeErr => {
if (callback) callback(futimesErr || closeErr);
});
});
});
}
function utimesMillisSync (path, atime, mtime) {
const fd = gracefulFs.openSync(path, 'r+');
gracefulFs.futimesSync(fd, atime, mtime);
return gracefulFs.closeSync(fd)
}
var utimes = {
utimesMillis,
utimesMillisSync
};
const nodeSupportsBigInt = atLeastNode('10.5.0');
const stat = (file) => nodeSupportsBigInt ? fs_1.stat(file, { bigint: true }) : fs_1.stat(file);
const statSync = (file) => nodeSupportsBigInt ? fs_1.statSync(file, { bigint: true }) : fs_1.statSync(file);
function getStats (src, dest) {
return Promise.all([
stat(src),
stat(dest).catch(err => {
if (err.code === 'ENOENT') return null
throw err
})
]).then(([srcStat, destStat]) => ({ srcStat, destStat }))
}
function getStatsSync (src, dest) {
let destStat;
const srcStat = statSync(src);
try {
destStat = statSync(dest);
} catch (err) {
if (err.code === 'ENOENT') return { srcStat, destStat: null }
throw err
}
return { srcStat, destStat }
}
function checkPaths (src, dest, funcName, cb) {
util__default['default'].callbackify(getStats)(src, dest, (err, stats) => {
if (err) return cb(err)
const { srcStat, destStat } = stats;
if (destStat && areIdentical(srcStat, destStat)) {
return cb(new Error('Source and destination must not be the same.'))
}
if (srcStat.isDirectory() && isSrcSubdir(src, dest)) {
return cb(new Error(errMsg(src, dest, funcName)))
}
return cb(null, { srcStat, destStat })
});
}
function checkPathsSync (src, dest, funcName) {
const { srcStat, destStat } = getStatsSync(src, dest);
if (destStat && areIdentical(srcStat, destStat)) {
throw new Error('Source and destination must not be the same.')
}
if (srcStat.isDirectory() && isSrcSubdir(src, dest)) {
throw new Error(errMsg(src, dest, funcName))
}
return { srcStat, destStat }
}
// recursively check if dest parent is a subdirectory of src.
// It works for all file types including symlinks since it
// checks the src and dest inodes. It starts from the deepest
// parent and stops once it reaches the src parent or the root path.
function checkParentPaths (src, srcStat, dest, funcName, cb) {
const srcParent = path__default['default'].resolve(path__default['default'].dirname(src));
const destParent = path__default['default'].resolve(path__default['default'].dirname(dest));
if (destParent === srcParent || destParent === path__default['default'].parse(destParent).root) return cb()
const callback = (err, destStat) => {
if (err) {
if (err.code === 'ENOENT') return cb()
return cb(err)
}
if (areIdentical(srcStat, destStat)) {
return cb(new Error(errMsg(src, dest, funcName)))
}
return checkParentPaths(src, srcStat, destParent, funcName, cb)
};
if (nodeSupportsBigInt) fs_1.stat(destParent, { bigint: true }, callback);
else fs_1.stat(destParent, callback);
}
function checkParentPathsSync (src, srcStat, dest, funcName) {
const srcParent = path__default['default'].resolve(path__default['default'].dirname(src));
const destParent = path__default['default'].resolve(path__default['default'].dirname(dest));
if (destParent === srcParent || destParent === path__default['default'].parse(destParent).root) return
let destStat;
try {
destStat = statSync(destParent);
} catch (err) {
if (err.code === 'ENOENT') return
throw err
}
if (areIdentical(srcStat, destStat)) {
throw new Error(errMsg(src, dest, funcName))
}
return checkParentPathsSync(src, srcStat, destParent, funcName)
}
function areIdentical (srcStat, destStat) {
if (destStat.ino && destStat.dev && destStat.ino === srcStat.ino && destStat.dev === srcStat.dev) {
if (nodeSupportsBigInt || destStat.ino < Number.MAX_SAFE_INTEGER) {
// definitive answer
return true
}
// Use additional heuristics if we can't use 'bigint'.
// Different 'ino' could be represented the same if they are >= Number.MAX_SAFE_INTEGER
// See issue 657
if (destStat.size === srcStat.size &&
destStat.mode === srcStat.mode &&
destStat.nlink === srcStat.nlink &&
destStat.atimeMs === srcStat.atimeMs &&
destStat.mtimeMs === srcStat.mtimeMs &&
destStat.ctimeMs === srcStat.ctimeMs &&
destStat.birthtimeMs === srcStat.birthtimeMs) {
// heuristic answer
return true
}
}
return false
}
// return true if dest is a subdir of src, otherwise false.
// It only checks the path strings.
function isSrcSubdir (src, dest) {
const srcArr = path__default['default'].resolve(src).split(path__default['default'].sep).filter(i => i);
const destArr = path__default['default'].resolve(dest).split(path__default['default'].sep).filter(i => i);
return srcArr.reduce((acc, cur, i) => acc && destArr[i] === cur, true)
}
function errMsg (src, dest, funcName) {
return `Cannot ${funcName} '${src}' to a subdirectory of itself, '${dest}'.`
}
var stat_1 = {
checkPaths,
checkPathsSync,
checkParentPaths,
checkParentPathsSync,
isSrcSubdir
};
const mkdirsSync = mkdirs.mkdirsSync;
const utimesMillisSync$1 = utimes.utimesMillisSync;
function copySync (src, dest, opts) {
if (typeof opts === 'function') {
opts = { filter: opts };
}
opts = opts || {};
opts.clobber = 'clobber' in opts ? !!opts.clobber : true; // default to true for now
opts.overwrite = 'overwrite' in opts ? !!opts.overwrite : opts.clobber; // overwrite falls back to clobber
// Warn about using preserveTimestamps on 32-bit node
if (opts.preserveTimestamps && process.arch === 'ia32') {
console.warn(`fs-extra: Using the preserveTimestamps option in 32-bit node is not recommended;\n
see https://github.com/jprichardson/node-fs-extra/issues/269`);
}
const { srcStat, destStat } = stat_1.checkPathsSync(src, dest, 'copy');
stat_1.checkParentPathsSync(src, srcStat, dest, 'copy');
return handleFilterAndCopy(destStat, src, dest, opts)
}
function handleFilterAndCopy (destStat, src, dest, opts) {
if (opts.filter && !opts.filter(src, dest)) return
const destParent = path__default['default'].dirname(dest);
if (!gracefulFs.existsSync(destParent)) mkdirsSync(destParent);
return startCopy(destStat, src, dest, opts)
}
function startCopy (destStat, src, dest, opts) {
if (opts.filter && !opts.filter(src, dest)) return
return getStats$1(destStat, src, dest, opts)
}
function getStats$1 (destStat, src, dest, opts) {
const statSync = opts.dereference ? gracefulFs.statSync : gracefulFs.lstatSync;
const srcStat = statSync(src);
if (srcStat.isDirectory()) return onDir(srcStat, destStat, src, dest, opts)
else if (srcStat.isFile() ||
srcStat.isCharacterDevice() ||
srcStat.isBlockDevice()) return onFile(srcStat, destStat, src, dest, opts)
else if (srcStat.isSymbolicLink()) return onLink(destStat, src, dest, opts)
}
function onFile (srcStat, destStat, src, dest, opts) {
if (!destStat) return copyFile(srcStat, src, dest, opts)
return mayCopyFile(srcStat, src, dest, opts)
}
function mayCopyFile (srcStat, src, dest, opts) {
if (opts.overwrite) {
gracefulFs.unlinkSync(dest);
return copyFile(srcStat, src, dest, opts)
} else if (opts.errorOnExist) {
throw new Error(`'${dest}' already exists`)
}
}
function copyFile (srcStat, src, dest, opts) {
gracefulFs.copyFileSync(src, dest);
if (opts.preserveTimestamps) handleTimestamps(srcStat.mode, src, dest);
return setDestMode(dest, srcStat.mode)
}
function handleTimestamps (srcMode, src, dest) {
// Make sure the file is writable before setting the timestamp
// otherwise open fails with EPERM when invoked with 'r+'
// (through utimes call)
if (fileIsNotWritable(srcMode)) makeFileWritable(dest, srcMode);
return setDestTimestamps(src, dest)
}
function fileIsNotWritable (srcMode) {
return (srcMode & 0o200) === 0
}
function makeFileWritable (dest, srcMode) {
return setDestMode(dest, srcMode | 0o200)
}
function setDestMode (dest, srcMode) {
return gracefulFs.chmodSync(dest, srcMode)
}
function setDestTimestamps (src, dest) {
// The initial srcStat.atime cannot be trusted
// because it is modified by the read(2) system call
// (See https://nodejs.org/api/fs.html#fs_stat_time_values)
const updatedSrcStat = gracefulFs.statSync(src);
return utimesMillisSync$1(dest, updatedSrcStat.atime, updatedSrcStat.mtime)
}
function onDir (srcStat, destStat, src, dest, opts) {
if (!destStat) return mkDirAndCopy(srcStat.mode, src, dest, opts)
if (destStat && !destStat.isDirectory()) {
throw new Error(`Cannot overwrite non-directory '${dest}' with directory '${src}'.`)
}
return copyDir(src, dest, opts)
}
function mkDirAndCopy (srcMode, src, dest, opts) {
gracefulFs.mkdirSync(dest);
copyDir(src, dest, opts);
return setDestMode(dest, srcMode)
}
function copyDir (src, dest, opts) {
gracefulFs.readdirSync(src).forEach(item => copyDirItem(item, src, dest, opts));
}
function copyDirItem (item, src, dest, opts) {
const srcItem = path__default['default'].join(src, item);
const destItem = path__default['default'].join(dest, item);
const { destStat } = stat_1.checkPathsSync(srcItem, destItem, 'copy');
return startCopy(destStat, srcItem, destItem, opts)
}
function onLink (destStat, src, dest, opts) {
let resolvedSrc = gracefulFs.readlinkSync(src);
if (opts.dereference) {
resolvedSrc = path__default['default'].resolve(process.cwd(), resolvedSrc);
}
if (!destStat) {
return gracefulFs.symlinkSync(resolvedSrc, dest)
} else {
let resolvedDest;
try {
resolvedDest = gracefulFs.readlinkSync(dest);
} catch (err) {
// dest exists and is a regular file or directory,
// Windows may throw UNKNOWN error. If dest already exists,
// fs throws error anyway, so no need to guard against it here.
if (err.code === 'EINVAL' || err.code === 'UNKNOWN') return gracefulFs.symlinkSync(resolvedSrc, dest)
throw err
}
if (opts.dereference) {
resolvedDest = path__default['default'].resolve(process.cwd(), resolvedDest);
}
if (stat_1.isSrcSubdir(resolvedSrc, resolvedDest)) {
throw new Error(`Cannot copy '${resolvedSrc}' to a subdirectory of itself, '${resolvedDest}'.`)
}
// prevent copy if src is a subdir of dest since unlinking
// dest in this case would result in removing src contents
// and therefore a broken symlink would be created.
if (gracefulFs.statSync(dest).isDirectory() && stat_1.isSrcSubdir(resolvedDest, resolvedSrc)) {
throw new Error(`Cannot overwrite '${resolvedDest}' with '${resolvedSrc}'.`)
}
return copyLink(resolvedSrc, dest)
}
}
function copyLink (resolvedSrc, dest) {
gracefulFs.unlinkSync(dest);
return gracefulFs.symlinkSync(resolvedSrc, dest)
}
var copySync_1 = copySync;
var copySync$1 = {
copySync: copySync_1
};
const u$1 = universalify.fromPromise;
function pathExists (path) {
return fs_1.access(path).then(() => true).catch(() => false)
}
var pathExists_1 = {
pathExists: u$1(pathExists),
pathExistsSync: fs_1.existsSync
};
const mkdirs$1 = mkdirs.mkdirs;
const pathExists$1 = pathExists_1.pathExists;
const utimesMillis$1 = utimes.utimesMillis;
function copy (src, dest, opts, cb) {
if (typeof opts === 'function' && !cb) {
cb = opts;
opts = {};
} else if (typeof opts === 'function') {
opts = { filter: opts };
}
cb = cb || function () {};
opts = opts || {};
opts.clobber = 'clobber' in opts ? !!opts.clobber : true; // default to true for now
opts.overwrite = 'overwrite' in opts ? !!opts.overwrite : opts.clobber; // overwrite falls back to clobber
// Warn about using preserveTimestamps on 32-bit node
if (opts.preserveTimestamps && process.arch === 'ia32') {
console.warn(`fs-extra: Using the preserveTimestamps option in 32-bit node is not recommended;\n
see https://github.com/jprichardson/node-fs-extra/issues/269`);
}
stat_1.checkPaths(src, dest, 'copy', (err, stats) => {
if (err) return cb(err)
const { srcStat, destStat } = stats;
stat_1.checkParentPaths(src, srcStat, dest, 'copy', err => {
if (err) return cb(err)
if (opts.filter) return handleFilter(checkParentDir, destStat, src, dest, opts, cb)
return checkParentDir(destStat, src, dest, opts, cb)
});
});
}
function checkParentDir (destStat, src, dest, opts, cb) {
const destParent = path__default['default'].dirname(dest);
pathExists$1(destParent, (err, dirExists) => {
if (err) return cb(err)
if (dirExists) return startCopy$1(destStat, src, dest, opts, cb)
mkdirs$1(destParent, err => {
if (err) return cb(err)
return startCopy$1(destStat, src, dest, opts, cb)
});
});
}
function handleFilter (onInclude, destStat, src, dest, opts, cb) {
Promise.resolve(opts.filter(src, dest)).then(include => {
if (include) return onInclude(destStat, src, dest, opts, cb)
return cb()
}, error => cb(error));
}
function startCopy$1 (destStat, src, dest, opts, cb) {
if (opts.filter) return handleFilter(getStats$2, destStat, src, dest, opts, cb)
return getStats$2(destStat, src, dest, opts, cb)
}
function getStats$2 (destStat, src, dest, opts, cb) {
const stat = opts.dereference ? gracefulFs.stat : gracefulFs.lstat;
stat(src, (err, srcStat) => {
if (err) return cb(err)
if (srcStat.isDirectory()) return onDir$1(srcStat, destStat, src, dest, opts, cb)
else if (srcStat.isFile() ||
srcStat.isCharacterDevice() ||
srcStat.isBlockDevice()) return onFile$1(srcStat, destStat, src, dest, opts, cb)
else if (srcStat.isSymbolicLink()) return onLink$1(destStat, src, dest, opts, cb)
});
}
function onFile$1 (srcStat, destStat, src, dest, opts, cb) {
if (!destStat) return copyFile$1(srcStat, src, dest, opts, cb)
return mayCopyFile$1(srcStat, src, dest, opts, cb)
}
function mayCopyFile$1 (srcStat, src, dest, opts, cb) {
if (opts.overwrite) {
gracefulFs.unlink(dest, err => {
if (err) return cb(err)
return copyFile$1(srcStat, src, dest, opts, cb)
});
} else if (opts.errorOnExist) {
return cb(new Error(`'${dest}' already exists`))
} else return cb()
}
function copyFile$1 (srcStat, src, dest, opts, cb) {
gracefulFs.copyFile(src, dest, err => {
if (err) return cb(err)
if (opts.preserveTimestamps) return handleTimestampsAndMode(srcStat.mode, src, dest, cb)
return setDestMode$1(dest, srcStat.mode, cb)
});
}
function handleTimestampsAndMode (srcMode, src, dest, cb) {
// Make sure the file is writable before setting the timestamp
// otherwise open fails with EPERM when invoked with 'r+'
// (through utimes call)
if (fileIsNotWritable$1(srcMode)) {
return makeFileWritable$1(dest, srcMode, err => {
if (err) return cb(err)
return setDestTimestampsAndMode(srcMode, src, dest, cb)
})
}
return setDestTimestampsAndMode(srcMode, src, dest, cb)
}
function fileIsNotWritable$1 (srcMode) {
return (srcMode & 0o200) === 0
}
function makeFileWritable$1 (dest, srcMode, cb) {
return setDestMode$1(dest, srcMode | 0o200, cb)
}
function setDestTimestampsAndMode (srcMode, src, dest, cb) {
setDestTimestamps$1(src, dest, err => {
if (err) return cb(err)
return setDestMode$1(dest, srcMode, cb)
});
}
function setDestMode$1 (dest, srcMode, cb) {
return gracefulFs.chmod(dest, srcMode, cb)
}
function setDestTimestamps$1 (src, dest, cb) {
// The initial srcStat.atime cannot be trusted
// because it is modified by the read(2) system call
// (See https://nodejs.org/api/fs.html#fs_stat_time_values)
gracefulFs.stat(src, (err, updatedSrcStat) => {
if (err) return cb(err)
return utimesMillis$1(dest, updatedSrcStat.atime, updatedSrcStat.mtime, cb)
});
}
function onDir$1 (srcStat, destStat, src, dest, opts, cb) {
if (!destStat) return mkDirAndCopy$1(srcStat.mode, src, dest, opts, cb)
if (destStat && !destStat.isDirectory()) {
return cb(new Error(`Cannot overwrite non-directory '${dest}' with directory '${src}'.`))
}
return copyDir$1(src, dest, opts, cb)
}
function mkDirAndCopy$1 (srcMode, src, dest, opts, cb) {
gracefulFs.mkdir(dest, err => {
if (err) return cb(err)
copyDir$1(src, dest, opts, err => {
if (err) return cb(err)
return setDestMode$1(dest, srcMode, cb)
});
});
}
function copyDir$1 (src, dest, opts, cb) {
gracefulFs.readdir(src, (err, items) => {
if (err) return cb(err)
return copyDirItems(items, src, dest, opts, cb)
});
}
function copyDirItems (items, src, dest, opts, cb) {
const item = items.pop();
if (!item) return cb()
return copyDirItem$1(items, item, src, dest, opts, cb)
}
function copyDirItem$1 (items, item, src, dest, opts, cb) {
const srcItem = path__default['default'].join(src, item);
const destItem = path__default['default'].join(dest, item);
stat_1.checkPaths(srcItem, destItem, 'copy', (err, stats) => {
if (err) return cb(err)
const { destStat } = stats;
startCopy$1(destStat, srcItem, destItem, opts, err => {
if (err) return cb(err)
return copyDirItems(items, src, dest, opts, cb)
});
});
}
function onLink$1 (destStat, src, dest, opts, cb) {
gracefulFs.readlink(src, (err, resolvedSrc) => {
if (err) return cb(err)
if (opts.dereference) {
resolvedSrc = path__default['default'].resolve(process.cwd(), resolvedSrc);
}
if (!destStat) {
return gracefulFs.symlink(resolvedSrc, dest, cb)
} else {
gracefulFs.readlink(dest, (err, resolvedDest) => {
if (err) {
// dest exists and is a regular file or directory,
// Windows may throw UNKNOWN error. If dest already exists,
// fs throws error anyway, so no need to guard against it here.
if (err.code === 'EINVAL' || err.code === 'UNKNOWN') return gracefulFs.symlink(resolvedSrc, dest, cb)
return cb(err)
}
if (opts.dereference) {
resolvedDest = path__default['default'].resolve(process.cwd(), resolvedDest);
}
if (stat_1.isSrcSubdir(resolvedSrc, resolvedDest)) {
return cb(new Error(`Cannot copy '${resolvedSrc}' to a subdirectory of itself, '${resolvedDest}'.`))
}
// do not copy if src is a subdir of dest since unlinking
// dest in this case would result in removing src contents
// and therefore a broken symlink would be created.
if (destStat.isDirectory() && stat_1.isSrcSubdir(resolvedDest, resolvedSrc)) {
return cb(new Error(`Cannot overwrite '${resolvedDest}' with '${resolvedSrc}'.`))
}
return copyLink$1(resolvedSrc, dest, cb)
});
}
});
}
function copyLink$1 (resolvedSrc, dest, cb) {
gracefulFs.unlink(dest, err => {
if (err) return cb(err)
return gracefulFs.symlink(resolvedSrc, dest, cb)
});
}
var copy_1 = copy;
const u$2 = universalify.fromCallback;
var copy$1 = {
copy: u$2(copy_1)
};
const isWindows = (process.platform === 'win32');
function defaults (options) {
const methods = [
'unlink',
'chmod',
'stat',
'lstat',
'rmdir',
'readdir'
];
methods.forEach(m => {
options[m] = options[m] || gracefulFs[m];
m = m + 'Sync';
options[m] = options[m] || gracefulFs[m];
});
options.maxBusyTries = options.maxBusyTries || 3;
}
function rimraf (p, options, cb) {
let busyTries = 0;
if (typeof options === 'function') {
cb = options;
options = {};
}
assert__default['default'](p, 'rimraf: missing path');
assert__default['default'].strictEqual(typeof p, 'string', 'rimraf: path should be a string');
assert__default['default'].strictEqual(typeof cb, 'function', 'rimraf: callback function required');
assert__default['default'](options, 'rimraf: invalid options argument provided');
assert__default['default'].strictEqual(typeof options, 'object', 'rimraf: options should be object');
defaults(options);
rimraf_(p, options, function CB (er) {
if (er) {
if ((er.code === 'EBUSY' || er.code === 'ENOTEMPTY' || er.code === 'EPERM') &&
busyTries < options.maxBusyTries) {
busyTries++;
const time = busyTries * 100;
// try again, with the same exact callback as this one.
return setTimeout(() => rimraf_(p, options, CB), time)
}
// already gone
if (er.code === 'ENOENT') er = null;
}
cb(er);
});
}
// Two possible strategies.
// 1. Assume it's a file. unlink it, then do the dir stuff on EPERM or EISDIR
// 2. Assume it's a directory. readdir, then do the file stuff on ENOTDIR
//
// Both result in an extra syscall when you guess wrong. However, there
// are likely far more normal files in the world than directories. This
// is based on the assumption that a the average number of files per
// directory is >= 1.
//
// If anyone ever complains about this, then I guess the strategy could
// be made configurable somehow. But until then, YAGNI.
function rimraf_ (p, options, cb) {
assert__default['default'](p);
assert__default['default'](options);
assert__default['default'](typeof cb === 'function');
// sunos lets the root user unlink directories, which is... weird.
// so we have to lstat here and make sure it's not a dir.
options.lstat(p, (er, st) => {
if (er && er.code === 'ENOENT') {
return cb(null)
}
// Windows can EPERM on stat. Life is suffering.
if (er && er.code === 'EPERM' && isWindows) {
return fixWinEPERM(p, options, er, cb)
}
if (st && st.isDirectory()) {
return rmdir(p, options, er, cb)
}
options.unlink(p, er => {
if (er) {
if (er.code === 'ENOENT') {
return cb(null)
}
if (er.code === 'EPERM') {
return (isWindows)
? fixWinEPERM(p, options, er, cb)
: rmdir(p, options, er, cb)
}
if (er.code === 'EISDIR') {
return rmdir(p, options, er, cb)
}
}
return cb(er)
});
});
}
function fixWinEPERM (p, options, er, cb) {
assert__default['default'](p);
assert__default['default'](options);
assert__default['default'](typeof cb === 'function');
options.chmod(p, 0o666, er2 => {
if (er2) {
cb(er2.code === 'ENOENT' ? null : er);
} else {
options.stat(p, (er3, stats) => {
if (er3) {
cb(er3.code === 'ENOENT' ? null : er);
} else if (stats.isDirectory()) {
rmdir(p, options, er, cb);
} else {
options.unlink(p, cb);
}
});
}
});
}
function fixWinEPERMSync (p, options, er) {
let stats;
assert__default['default'](p);
assert__default['default'](options);
try {
options.chmodSync(p, 0o666);
} catch (er2) {
if (er2.code === 'ENOENT') {
return
} else {
throw er
}
}
try {
stats = options.statSync(p);
} catch (er3) {
if (er3.code === 'ENOENT') {
return
} else {
throw er
}
}
if (stats.isDirectory()) {
rmdirSync(p, options, er);
} else {
options.unlinkSync(p);
}
}
function rmdir (p, options, originalEr, cb) {
assert__default['default'](p);
assert__default['default'](options);
assert__default['default'](typeof cb === 'function');
// try to rmdir first, and only readdir on ENOTEMPTY or EEXIST (SunOS)
// if we guessed wrong, and it's not a directory, then
// raise the original error.
options.rmdir(p, er => {
if (er && (er.code === 'ENOTEMPTY' || er.code === 'EEXIST' || er.code === 'EPERM')) {
rmkids(p, options, cb);
} else if (er && er.code === 'ENOTDIR') {
cb(originalEr);
} else {
cb(er);
}
});
}
function rmkids (p, options, cb) {
assert__default['default'](p);
assert__default['default'](options);
assert__default['default'](typeof cb === 'function');
options.readdir(p, (er, files) => {
if (er) return cb(er)
let n = files.length;
let errState;
if (n === 0) return options.rmdir(p, cb)
files.forEach(f => {
rimraf(path__default['default'].join(p, f), options, er => {
if (errState) {
return
}
if (er) return cb(errState = er)
if (--n === 0) {
options.rmdir(p, cb);
}
});
});
});
}
// this looks simpler, and is strictly *faster*, but will
// tie up the JavaScript thread and fail on excessively
// deep directory trees.
function rimrafSync (p, options) {
let st;
options = options || {};
defaults(options);
assert__default['default'](p, 'rimraf: missing path');
assert__default['default'].strictEqual(typeof p, 'string', 'rimraf: path should be a string');
assert__default['default'](options, 'rimraf: missing options');
assert__default['default'].strictEqual(typeof options, 'object', 'rimraf: options should be object');
try {
st = options.lstatSync(p);
} catch (er) {
if (er.code === 'ENOENT') {
return
}
// Windows can EPERM on stat. Life is suffering.
if (er.code === 'EPERM' && isWindows) {
fixWinEPERMSync(p, options, er);
}
}
try {
// sunos lets the root user unlink directories, which is... weird.
if (st && st.isDirectory()) {
rmdirSync(p, options, null);
} else {
options.unlinkSync(p);
}
} catch (er) {
if (er.code === 'ENOENT') {
return
} else if (er.code === 'EPERM') {
return isWindows ? fixWinEPERMSync(p, options, er) : rmdirSync(p, options, er)
} else if (er.code !== 'EISDIR') {
throw er
}
rmdirSync(p, options, er);
}
}
function rmdirSync (p, options, originalEr) {
assert__default['default'](p);
assert__default['default'](options);
try {
options.rmdirSync(p);
} catch (er) {
if (er.code === 'ENOTDIR') {
throw originalEr
} else if (er.code === 'ENOTEMPTY' || er.code === 'EEXIST' || er.code === 'EPERM') {
rmkidsSync(p, options);
} else if (er.code !== 'ENOENT') {
throw er
}
}
}
function rmkidsSync (p, options) {
assert__default['default'](p);
assert__default['default'](options);
options.readdirSync(p).forEach(f => rimrafSync(path__default['default'].join(p, f), options));
if (isWindows) {
// We only end up here once we got ENOTEMPTY at least once, and
// at this point, we are guaranteed to have removed all the kids.
// So, we know that it won't be ENOENT or ENOTDIR or anything else.
// try really hard to delete stuff on windows, because it has a
// PROFOUNDLY annoying habit of not closing handles promptly when
// files are deleted, resulting in spurious ENOTEMPTY errors.
const startTime = Date.now();
do {
try {
const ret = options.rmdirSync(p, options);
return ret
} catch {}
} while (Date.now() - startTime < 500) // give up after 500ms
} else {
const ret = options.rmdirSync(p, options);
return ret
}
}
var rimraf_1 = rimraf;
rimraf.sync = rimrafSync;
const u$3 = universalify.fromCallback;
var remove = {
remove: u$3(rimraf_1),
removeSync: rimraf_1.sync
};
const u$4 = universalify.fromCallback;
const emptyDir = u$4(function emptyDir (dir, callback) {
callback = callback || function () {};
gracefulFs.readdir(dir, (err, items) => {
if (err) return mkdirs.mkdirs(dir, callback)
items = items.map(item => path__default['default'].join(dir, item));
deleteItem();
function deleteItem () {
const item = items.pop();
if (!item) return callback()
remove.remove(item, err => {
if (err) return callback(err)
deleteItem();
});
}
});
});
function emptyDirSync (dir) {
let items;
try {
items = gracefulFs.readdirSync(dir);
} catch {
return mkdirs.mkdirsSync(dir)
}
items.forEach(item => {
item = path__default['default'].join(dir, item);
remove.removeSync(item);
});
}
var empty = {
emptyDirSync,
emptydirSync: emptyDirSync,
emptyDir,
emptydir: emptyDir
};
const u$5 = universalify.fromCallback;
function createFile (file, callback) {
function makeFile () {
gracefulFs.writeFile(file, '', err => {
if (err) return callback(err)
callback();
});
}
gracefulFs.stat(file, (err, stats) => { // eslint-disable-line handle-callback-err
if (!err && stats.isFile()) return callback()
const dir = path__default['default'].dirname(file);
gracefulFs.stat(dir, (err, stats) => {
if (err) {
// if the directory doesn't exist, make it
if (err.code === 'ENOENT') {
return mkdirs.mkdirs(dir, err => {
if (err) return callback(err)
makeFile();
})
}
return callback(err)
}
if (stats.isDirectory()) makeFile();
else {
// parent is not a directory
// This is just to cause an internal ENOTDIR error to be thrown
gracefulFs.readdir(dir, err => {
if (err) return callback(err)
});
}
});
});
}
function createFileSync (file) {
let stats;
try {
stats = gracefulFs.statSync(file);
} catch {}
if (stats && stats.isFile()) return
const dir = path__default['default'].dirname(file);
try {
if (!gracefulFs.statSync(dir).isDirectory()) {
// parent is not a directory
// This is just to cause an internal ENOTDIR error to be thrown
gracefulFs.readdirSync(dir);
}
} catch (err) {
// If the stat call above failed because the directory doesn't exist, create it
if (err && err.code === 'ENOENT') mkdirs.mkdirsSync(dir);
else throw err
}
gracefulFs.writeFileSync(file, '');
}
var file = {
createFile: u$5(createFile),
createFileSync
};
const u$6 = universalify.fromCallback;
const pathExists$2 = pathExists_1.pathExists;
function createLink (srcpath, dstpath, callback) {
function makeLink (srcpath, dstpath) {
gracefulFs.link(srcpath, dstpath, err => {
if (err) return callback(err)
callback(null);
});
}
pathExists$2(dstpath, (err, destinationExists) => {
if (err) return callback(err)
if (destinationExists) return callback(null)
gracefulFs.lstat(srcpath, (err) => {
if (err) {
err.message = err.message.replace('lstat', 'ensureLink');
return callback(err)
}
const dir = path__default['default'].dirname(dstpath);
pathExists$2(dir, (err, dirExists) => {
if (err) return callback(err)
if (dirExists) return makeLink(srcpath, dstpath)
mkdirs.mkdirs(dir, err => {
if (err) return callback(err)
makeLink(srcpath, dstpath);
});
});
});
});
}
function createLinkSync (srcpath, dstpath) {
const destinationExists = gracefulFs.existsSync(dstpath);
if (destinationExists) return undefined
try {
gracefulFs.lstatSync(srcpath);
} catch (err) {
err.message = err.message.replace('lstat', 'ensureLink');
throw err
}
const dir = path__default['default'].dirname(dstpath);
const dirExists = gracefulFs.existsSync(dir);
if (dirExists) return gracefulFs.linkSync(srcpath, dstpath)
mkdirs.mkdirsSync(dir);
return gracefulFs.linkSync(srcpath, dstpath)
}
var link = {
createLink: u$6(createLink),
createLinkSync
};
const pathExists$3 = pathExists_1.pathExists;
/**
* Function that returns two types of paths, one relative to symlink, and one
* relative to the current working directory. Checks if path is absolute or
* relative. If the path is relative, this function checks if the path is
* relative to symlink or relative to current working directory. This is an
* initiative to find a smarter `srcpath` to supply when building symlinks.
* This allows you to determine which path to use out of one of three possible
* types of source paths. The first is an absolute path. This is detected by
* `path.isAbsolute()`. When an absolute path is provided, it is checked to
* see if it exists. If it does it's used, if not an error is returned
* (callback)/ thrown (sync). The other two options for `srcpath` are a
* relative url. By default Node's `fs.symlink` works by creating a symlink
* using `dstpath` and expects the `srcpath` to be relative to the newly
* created symlink. If you provide a `srcpath` that does not exist on the file
* system it results in a broken symlink. To minimize this, the function
* checks to see if the 'relative to symlink' source file exists, and if it
* does it will use it. If it does not, it checks if there's a file that
* exists that is relative to the current working directory, if does its used.
* This preserves the expectations of the original fs.symlink spec and adds
* the ability to pass in `relative to current working direcotry` paths.
*/
function symlinkPaths (srcpath, dstpath, callback) {
if (path__default['default'].isAbsolute(srcpath)) {
return gracefulFs.lstat(srcpath, (err) => {
if (err) {
err.message = err.message.replace('lstat', 'ensureSymlink');
return callback(err)
}
return callback(null, {
toCwd: srcpath,
toDst: srcpath
})
})
} else {
const dstdir = path__default['default'].dirname(dstpath);
const relativeToDst = path__default['default'].join(dstdir, srcpath);
return pathExists$3(relativeToDst, (err, exists) => {
if (err) return callback(err)
if (exists) {
return callback(null, {
toCwd: relativeToDst,
toDst: srcpath
})
} else {
return gracefulFs.lstat(srcpath, (err) => {
if (err) {
err.message = err.message.replace('lstat', 'ensureSymlink');
return callback(err)
}
return callback(null, {
toCwd: srcpath,
toDst: path__default['default'].relative(dstdir, srcpath)
})
})
}
})
}
}
function symlinkPathsSync (srcpath, dstpath) {
let exists;
if (path__default['default'].isAbsolute(srcpath)) {
exists = gracefulFs.existsSync(srcpath);
if (!exists) throw new Error('absolute srcpath does not exist')
return {
toCwd: srcpath,
toDst: srcpath
}
} else {
const dstdir = path__default['default'].dirname(dstpath);
const relativeToDst = path__default['default'].join(dstdir, srcpath);
exists = gracefulFs.existsSync(relativeToDst);
if (exists) {
return {
toCwd: relativeToDst,
toDst: srcpath
}
} else {
exists = gracefulFs.existsSync(srcpath);
if (!exists) throw new Error('relative srcpath does not exist')
return {
toCwd: srcpath,
toDst: path__default['default'].relative(dstdir, srcpath)
}
}
}
}
var symlinkPaths_1 = {
symlinkPaths,
symlinkPathsSync
};
function symlinkType (srcpath, type, callback) {
callback = (typeof type === 'function') ? type : callback;
type = (typeof type === 'function') ? false : type;
if (type) return callback(null, type)
gracefulFs.lstat(srcpath, (err, stats) => {
if (err) return callback(null, 'file')
type = (stats && stats.isDirectory()) ? 'dir' : 'file';
callback(null, type);
});
}
function symlinkTypeSync (srcpath, type) {
let stats;
if (type) return type
try {
stats = gracefulFs.lstatSync(srcpath);
} catch {
return 'file'
}
return (stats && stats.isDirectory()) ? 'dir' : 'file'
}
var symlinkType_1 = {
symlinkType,
symlinkTypeSync
};
const u$7 = universalify.fromCallback;
const mkdirs$2 = mkdirs.mkdirs;
const mkdirsSync$1 = mkdirs.mkdirsSync;
const symlinkPaths$1 = symlinkPaths_1.symlinkPaths;
const symlinkPathsSync$1 = symlinkPaths_1.symlinkPathsSync;
const symlinkType$1 = symlinkType_1.symlinkType;
const symlinkTypeSync$1 = symlinkType_1.symlinkTypeSync;
const pathExists$4 = pathExists_1.pathExists;
function createSymlink (srcpath, dstpath, type, callback) {
callback = (typeof type === 'function') ? type : callback;
type = (typeof type === 'function') ? false : type;
pathExists$4(dstpath, (err, destinationExists) => {
if (err) return callback(err)
if (destinationExists) return callback(null)
symlinkPaths$1(srcpath, dstpath, (err, relative) => {
if (err) return callback(err)
srcpath = relative.toDst;
symlinkType$1(relative.toCwd, type, (err, type) => {
if (err) return callback(err)
const dir = path__default['default'].dirname(dstpath);
pathExists$4(dir, (err, dirExists) => {
if (err) return callback(err)
if (dirExists) return gracefulFs.symlink(srcpath, dstpath, type, callback)
mkdirs$2(dir, err => {
if (err) return callback(err)
gracefulFs.symlink(srcpath, dstpath, type, callback);
});
});
});
});
});
}
function createSymlinkSync (srcpath, dstpath, type) {
const destinationExists = gracefulFs.existsSync(dstpath);
if (destinationExists) return undefined
const relative = symlinkPathsSync$1(srcpath, dstpath);
srcpath = relative.toDst;
type = symlinkTypeSync$1(relative.toCwd, type);
const dir = path__default['default'].dirname(dstpath);
const exists = gracefulFs.existsSync(dir);
if (exists) return gracefulFs.symlinkSync(srcpath, dstpath, type)
mkdirsSync$1(dir);
return gracefulFs.symlinkSync(srcpath, dstpath, type)
}
var symlink = {
createSymlink: u$7(createSymlink),
createSymlinkSync
};
var ensure = {
// file
createFile: file.createFile,
createFileSync: file.createFileSync,
ensureFile: file.createFile,
ensureFileSync: file.createFileSync,
// link
createLink: link.createLink,
createLinkSync: link.createLinkSync,
ensureLink: link.createLink,
ensureLinkSync: link.createLinkSync,
// symlink
createSymlink: symlink.createSymlink,
createSymlinkSync: symlink.createSymlinkSync,
ensureSymlink: symlink.createSymlink,
ensureSymlinkSync: symlink.createSymlinkSync
};
function stringify (obj, options = {}) {
const EOL = options.EOL || '\n';
const str = JSON.stringify(obj, options ? options.replacer : null, options.spaces);
return str.replace(/\n/g, EOL) + EOL
}
function stripBom (content) {
// we do this because JSON.parse would convert it to a utf8 string if encoding wasn't specified
if (Buffer.isBuffer(content)) content = content.toString('utf8');
return content.replace(/^\uFEFF/, '')
}
var utils = { stringify, stripBom };
let _fs;
try {
_fs = gracefulFs;
} catch (_) {
_fs = fs__default['default'];
}
const { stringify: stringify$1, stripBom: stripBom$1 } = utils;
async function _readFile (file, options = {}) {
if (typeof options === 'string') {
options = { encoding: options };
}
const fs = options.fs || _fs;
const shouldThrow = 'throws' in options ? options.throws : true;
let data = await universalify.fromCallback(fs.readFile)(file, options);
data = stripBom$1(data);
let obj;
try {
obj = JSON.parse(data, options ? options.reviver : null);
} catch (err) {
if (shouldThrow) {
err.message = `${file}: ${err.message}`;
throw err
} else {
return null
}
}
return obj
}
const readFile = universalify.fromPromise(_readFile);
function readFileSync (file, options = {}) {
if (typeof options === 'string') {
options = { encoding: options };
}
const fs = options.fs || _fs;
const shouldThrow = 'throws' in options ? options.throws : true;
try {
let content = fs.readFileSync(file, options);
content = stripBom$1(content);
return JSON.parse(content, options.reviver)
} catch (err) {
if (shouldThrow) {
err.message = `${file}: ${err.message}`;
throw err
} else {
return null
}
}
}
async function _writeFile (file, obj, options = {}) {
const fs = options.fs || _fs;
const str = stringify$1(obj, options);
await universalify.fromCallback(fs.writeFile)(file, str, options);
}
const writeFile = universalify.fromPromise(_writeFile);
function writeFileSync (file, obj, options = {}) {
const fs = options.fs || _fs;
const str = stringify$1(obj, options);
// not sure if fs.writeFileSync returns anything, but just in case
return fs.writeFileSync(file, str, options)
}
const jsonfile = {
readFile,
readFileSync,
writeFile,
writeFileSync
};
var jsonfile_1 = jsonfile;
var jsonfile$1 = {
// jsonfile exports
readJson: jsonfile_1.readFile,
readJsonSync: jsonfile_1.readFileSync,
writeJson: jsonfile_1.writeFile,
writeJsonSync: jsonfile_1.writeFileSync
};
const u$8 = universalify.fromCallback;
const pathExists$5 = pathExists_1.pathExists;
function outputFile (file, data, encoding, callback) {
if (typeof encoding === 'function') {
callback = encoding;
encoding = 'utf8';
}
const dir = path__default['default'].dirname(file);
pathExists$5(dir, (err, itDoes) => {
if (err) return callback(err)
if (itDoes) return gracefulFs.writeFile(file, data, encoding, callback)
mkdirs.mkdirs(dir, err => {
if (err) return callback(err)
gracefulFs.writeFile(file, data, encoding, callback);
});
});
}
function outputFileSync (file, ...args) {
const dir = path__default['default'].dirname(file);
if (gracefulFs.existsSync(dir)) {
return gracefulFs.writeFileSync(file, ...args)
}
mkdirs.mkdirsSync(dir);
gracefulFs.writeFileSync(file, ...args);
}
var output = {
outputFile: u$8(outputFile),
outputFileSync
};
const { stringify: stringify$2 } = utils;
const { outputFile: outputFile$1 } = output;
async function outputJson (file, data, options = {}) {
const str = stringify$2(data, options);
await outputFile$1(file, str, options);
}
var outputJson_1 = outputJson;
const { stringify: stringify$3 } = utils;
const { outputFileSync: outputFileSync$1 } = output;
function outputJsonSync (file, data, options) {
const str = stringify$3(data, options);
outputFileSync$1(file, str, options);
}
var outputJsonSync_1 = outputJsonSync;
const u$9 = universalify.fromPromise;
jsonfile$1.outputJson = u$9(outputJson_1);
jsonfile$1.outputJsonSync = outputJsonSync_1;
// aliases
jsonfile$1.outputJSON = jsonfile$1.outputJson;
jsonfile$1.outputJSONSync = jsonfile$1.outputJsonSync;
jsonfile$1.writeJSON = jsonfile$1.writeJson;
jsonfile$1.writeJSONSync = jsonfile$1.writeJsonSync;
jsonfile$1.readJSON = jsonfile$1.readJson;
jsonfile$1.readJSONSync = jsonfile$1.readJsonSync;
var json = jsonfile$1;
const copySync$2 = copySync$1.copySync;
const removeSync = remove.removeSync;
const mkdirpSync = mkdirs.mkdirpSync;
function moveSync (src, dest, opts) {
opts = opts || {};
const overwrite = opts.overwrite || opts.clobber || false;
const { srcStat } = stat_1.checkPathsSync(src, dest, 'move');
stat_1.checkParentPathsSync(src, srcStat, dest, 'move');
mkdirpSync(path__default['default'].dirname(dest));
return doRename(src, dest, overwrite)
}
function doRename (src, dest, overwrite) {
if (overwrite) {
removeSync(dest);
return rename(src, dest, overwrite)
}
if (gracefulFs.existsSync(dest)) throw new Error('dest already exists.')
return rename(src, dest, overwrite)
}
function rename (src, dest, overwrite) {
try {
gracefulFs.renameSync(src, dest);
} catch (err) {
if (err.code !== 'EXDEV') throw err
return moveAcrossDevice(src, dest, overwrite)
}
}
function moveAcrossDevice (src, dest, overwrite) {
const opts = {
overwrite,
errorOnExist: true
};
copySync$2(src, dest, opts);
return removeSync(src)
}
var moveSync_1 = moveSync;
var moveSync$1 = {
moveSync: moveSync_1
};
const copy$2 = copy$1.copy;
const remove$1 = remove.remove;
const mkdirp = mkdirs.mkdirp;
const pathExists$6 = pathExists_1.pathExists;
function move (src, dest, opts, cb) {
if (typeof opts === 'function') {
cb = opts;
opts = {};
}
const overwrite = opts.overwrite || opts.clobber || false;
stat_1.checkPaths(src, dest, 'move', (err, stats) => {
if (err) return cb(err)
const { srcStat } = stats;
stat_1.checkParentPaths(src, srcStat, dest, 'move', err => {
if (err) return cb(err)
mkdirp(path__default['default'].dirname(dest), err => {
if (err) return cb(err)
return doRename$1(src, dest, overwrite, cb)
});
});
});
}
function doRename$1 (src, dest, overwrite, cb) {
if (overwrite) {
return remove$1(dest, err => {
if (err) return cb(err)
return rename$1(src, dest, overwrite, cb)
})
}
pathExists$6(dest, (err, destExists) => {
if (err) return cb(err)
if (destExists) return cb(new Error('dest already exists.'))
return rename$1(src, dest, overwrite, cb)
});
}
function rename$1 (src, dest, overwrite, cb) {
gracefulFs.rename(src, dest, err => {
if (!err) return cb()
if (err.code !== 'EXDEV') return cb(err)
return moveAcrossDevice$1(src, dest, overwrite, cb)
});
}
function moveAcrossDevice$1 (src, dest, overwrite, cb) {
const opts = {
overwrite,
errorOnExist: true
};
copy$2(src, dest, opts, err => {
if (err) return cb(err)
return remove$1(src, cb)
});
}
var move_1 = move;
const u$a = universalify.fromCallback;
var move$1 = {
move: u$a(move_1)
};
var lib = createCommonjsModule(function (module) {
module.exports = {
// Export promiseified graceful-fs:
...fs_1,
// Export extra methods:
...copySync$1,
...copy$1,
...empty,
...ensure,
...json,
...mkdirs,
...moveSync$1,
...move$1,
...output,
...pathExists_1,
...remove
};
// Export fs.promises as a getter property so that we don't trigger
// ExperimentalWarning before fs.promises is actually accessed.
if (Object.getOwnPropertyDescriptor(fs__default['default'], 'promises')) {
Object.defineProperty(module.exports, 'promises', {
get () { return fs__default['default'].promises }
});
}
});
var ansiWrap = function(a, b, msg) {
return '\u001b['+ a + 'm' + msg + '\u001b[' + b + 'm';
};
var ansiGray = function gray(message) {
return ansiWrap(90, 39, message);
};
/*!
* time-stamp <https://github.com/jonschlinkert/time-stamp>
*
* Copyright (c) 2015-2017, Jon Schlinkert.
* Released under the MIT License.
*/
/**
* Parse the given pattern and return a formatted
* timestamp.
*
* @param {String} `pattern` Date pattern.
* @param {Date} `date` Date object.
* @return {String}
*/
var timeStamp = function(pattern, date) {
if (typeof pattern !== 'string') {
date = pattern;
pattern = 'YYYY:MM:DD';
}
if (!date) date = new Date();
function timestamp() {
var regex = /(?=(YYYY|YY|MM|DD|HH|mm|ss|ms))\1([:\/]*)/;
var match = regex.exec(pattern);
if (match) {
var increment = method(match[1]);
var val = '00' + String(date[increment[0]]() + (increment[2] || 0));
var res = val.slice(-increment[1]) + (match[2] || '');
pattern = pattern.replace(match[0], res);
timestamp();
}
}
timestamp();
return pattern;
};
function method(key) {
return ({
YYYY: ['getFullYear', 4],
YY: ['getFullYear', 2],
// getMonth is zero-based, thus the extra increment field
MM: ['getMonth', 2, 1],
DD: ['getDate', 2],
HH: ['getHours', 2],
mm: ['getMinutes', 2],
ss: ['getSeconds', 2],
ms: ['getMilliseconds', 3]
})[key];
}
// call it on itself so we can test the export val for basic stuff
var colorSupport_1 = colorSupport({ alwaysReturn: true }, colorSupport);
function hasNone (obj, options) {
obj.level = 0;
obj.hasBasic = false;
obj.has256 = false;
obj.has16m = false;
if (!options.alwaysReturn) {
return false
}
return obj
}
function hasBasic (obj) {
obj.hasBasic = true;
obj.has256 = false;
obj.has16m = false;
obj.level = 1;
return obj
}
function has256 (obj) {
obj.hasBasic = true;
obj.has256 = true;
obj.has16m = false;
obj.level = 2;
return obj
}
function has16m (obj) {
obj.hasBasic = true;
obj.has256 = true;
obj.has16m = true;
obj.level = 3;
return obj
}
function colorSupport (options, obj) {
options = options || {};
obj = obj || {};
// if just requesting a specific level, then return that.
if (typeof options.level === 'number') {
switch (options.level) {
case 0:
return hasNone(obj, options)
case 1:
return hasBasic(obj)
case 2:
return has256(obj)
case 3:
return has16m(obj)
}
}
obj.level = 0;
obj.hasBasic = false;
obj.has256 = false;
obj.has16m = false;
if (typeof process === 'undefined' ||
!process ||
!process.stdout ||
!process.env ||
!process.platform) {
return hasNone(obj, options)
}
var env = options.env || process.env;
var stream = options.stream || process.stdout;
var term = options.term || env.TERM || '';
var platform = options.platform || process.platform;
if (!options.ignoreTTY && !stream.isTTY) {
return hasNone(obj, options)
}
if (!options.ignoreDumb && term === 'dumb' && !env.COLORTERM) {
return hasNone(obj, options)
}
if (platform === 'win32') {
return hasBasic(obj)
}
if (env.TMUX) {
return has256(obj)
}
if (!options.ignoreCI && (env.CI || env.TEAMCITY_VERSION)) {
if (env.TRAVIS) {
return has256(obj)
} else {
return hasNone(obj, options)
}
}
// TODO: add more term programs
switch (env.TERM_PROGRAM) {
case 'iTerm.app':
var ver = env.TERM_PROGRAM_VERSION || '0.';
if (/^[0-2]\./.test(ver)) {
return has256(obj)
} else {
return has16m(obj)
}
case 'HyperTerm':
case 'Hyper':
return has16m(obj)
case 'MacTerm':
return has16m(obj)
case 'Apple_Terminal':
return has256(obj)
}
if (/^xterm-256/.test(term)) {
return has256(obj)
}
if (/^screen|^xterm|^vt100|color|ansi|cygwin|linux/i.test(term)) {
return hasBasic(obj)
}
if (env.COLORTERM) {
return hasBasic(obj)
}
return hasNone(obj, options)
}
function parseNodeVersion(version) {
var match = version.match(/^v(\d{1,2})\.(\d{1,2})\.(\d{1,2})(?:-([0-9A-Za-z-.]+))?(?:\+([0-9A-Za-z-.]+))?$/); // eslint-disable-line max-len
if (!match) {
throw new Error('Unable to parse: ' + version);
}
var res = {
major: parseInt(match[1], 10),
minor: parseInt(match[2], 10),
patch: parseInt(match[3], 10),
pre: match[4] || '',
build: match[5] || '',
};
return res;
}
var parseNodeVersion_1 = parseNodeVersion;
var Console = require$$0__default['default'].Console;
var nodeVersion = parseNodeVersion_1(process.version);
var colorDetectionOptions = {
// If on Windows, ignore the isTTY check
// This is due to AppVeyor (and thus probably common Windows platforms?) failing the check
// TODO: If this is too broad, we can reduce it to an APPVEYOR env check
ignoreTTY: (process.platform === 'win32'),
};
// Needed to add this because node 10 decided to start coloring log output randomly
var console$1;
if (nodeVersion.major >= 10) {
// Node 10 also changed the way this is constructed
console$1 = new Console({
stdout: process.stdout,
stderr: process.stderr,
colorMode: false,
});
} else {
console$1 = new Console(process.stdout, process.stderr);
}
function hasFlag(flag) {
return (process.argv.indexOf('--' + flag) !== -1);
}
function addColor(str) {
if (hasFlag('no-color')) {
return str;
}
if (hasFlag('color')) {
return ansiGray(str);
}
if (colorSupport_1(colorDetectionOptions)) {
return ansiGray(str);
}
return str;
}
function getTimestamp() {
return '[' + addColor(timeStamp('HH:mm:ss')) + ']';
}
function info() {
var time = getTimestamp();
process.stdout.write(time + ' ');
console$1.info.apply(console$1, arguments);
return this;
}
function warn() {
var time = getTimestamp();
process.stderr.write(time + ' ');
console$1.warn.apply(console$1, arguments);
return this;
}
function error() {
var time = getTimestamp();
process.stderr.write(time + ' ');
console$1.error.apply(console$1, arguments);
return this;
}
var info_1 = info;
var warn_1 = warn;
var error_1 = error;
var command = createCommonjsModule(function (module, exports) {
var __importStar = (commonjsGlobal && commonjsGlobal.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];
result["default"] = mod;
return result;
};
Object.defineProperty(exports, "__esModule", { value: true });
const os = __importStar(require$$0__default$1['default']);
/**
* Commands
*
* Command Format:
* ::name key=value,key=value::message
*
* Examples:
* ::warning::This is the message
* ::set-env name=MY_VAR::some value
*/
function issueCommand(command, properties, message) {
const cmd = new Command(command, properties, message);
process.stdout.write(cmd.toString() + os.EOL);
}
exports.issueCommand = issueCommand;
function issue(name, message = '') {
issueCommand(name, {}, message);
}
exports.issue = issue;
const CMD_STRING = '::';
class Command {
constructor(command, properties, message) {
if (!command) {
command = 'missing.command';
}
this.command = command;
this.properties = properties;
this.message = message;
}
toString() {
let cmdStr = CMD_STRING + this.command;
if (this.properties && Object.keys(this.properties).length > 0) {
cmdStr += ' ';
let first = true;
for (const key in this.properties) {
if (this.properties.hasOwnProperty(key)) {
const val = this.properties[key];
if (val) {
if (first) {
first = false;
}
else {
cmdStr += ',';
}
cmdStr += `${key}=${escapeProperty(val)}`;
}
}
}
}
cmdStr += `${CMD_STRING}${escapeData(this.message)}`;
return cmdStr;
}
}
/**
* Sanitizes an input into a string so it can be passed into issueCommand safely
* @param input input to sanitize into a string
*/
function toCommandValue(input) {
if (input === null || input === undefined) {
return '';
}
else if (typeof input === 'string' || input instanceof String) {
return input;
}
return JSON.stringify(input);
}
exports.toCommandValue = toCommandValue;
function escapeData(s) {
return toCommandValue(s)
.replace(/%/g, '%25')
.replace(/\r/g, '%0D')
.replace(/\n/g, '%0A');
}
function escapeProperty(s) {
return toCommandValue(s)
.replace(/%/g, '%25')
.replace(/\r/g, '%0D')
.replace(/\n/g, '%0A')
.replace(/:/g, '%3A')
.replace(/,/g, '%2C');
}
});
var core = createCommonjsModule(function (module, exports) {
var __awaiter = (commonjsGlobal && commonjsGlobal.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
var __importStar = (commonjsGlobal && commonjsGlobal.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];
result["default"] = mod;
return result;
};
Object.defineProperty(exports, "__esModule", { value: true });
const os = __importStar(require$$0__default$1['default']);
const path = __importStar(path__default['default']);
/**
* The code to exit an action
*/
var ExitCode;
(function (ExitCode) {
/**
* A code indicating that the action was successful
*/
ExitCode[ExitCode["Success"] = 0] = "Success";
/**
* A code indicating that the action was a failure
*/
ExitCode[ExitCode["Failure"] = 1] = "Failure";
})(ExitCode = exports.ExitCode || (exports.ExitCode = {}));
//-----------------------------------------------------------------------
// Variables
//-----------------------------------------------------------------------
/**
* Sets env variable for this action and future actions in the job
* @param name the name of the variable to set
* @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify
*/
// eslint-disable-next-line @typescript-eslint/no-explicit-any
function exportVariable(name, val) {
const convertedVal = command.toCommandValue(val);
process.env[name] = convertedVal;
command.issueCommand('set-env', { name }, convertedVal);
}
exports.exportVariable = exportVariable;
/**
* Registers a secret which will get masked from logs
* @param secret value of the secret
*/
function setSecret(secret) {
command.issueCommand('add-mask', {}, secret);
}
exports.setSecret = setSecret;
/**
* Prepends inputPath to the PATH (for this action and future actions)
* @param inputPath
*/
function addPath(inputPath) {
command.issueCommand('add-path', {}, inputPath);
process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`;
}
exports.addPath = addPath;
/**
* Gets the value of an input. The value is also trimmed.
*
* @param name name of the input to get
* @param options optional. See InputOptions.
* @returns string
*/
function getInput(name, options) {
const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || '';
if (options && options.required && !val) {
throw new Error(`Input required and not supplied: ${name}`);
}
return val.trim();
}
exports.getInput = getInput;
/**
* Sets the value of an output.
*
* @param name name of the output to set
* @param value value to store. Non-string values will be converted to a string via JSON.stringify
*/
// eslint-disable-next-line @typescript-eslint/no-explicit-any
function setOutput(name, value) {
command.issueCommand('set-output', { name }, value);
}
exports.setOutput = setOutput;
/**
* Enables or disables the echoing of commands into stdout for the rest of the step.
* Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set.
*
*/
function setCommandEcho(enabled) {
command.issue('echo', enabled ? 'on' : 'off');
}
exports.setCommandEcho = setCommandEcho;
//-----------------------------------------------------------------------
// Results
//-----------------------------------------------------------------------
/**
* Sets the action status to failed.
* When the action exits it will be with an exit code of 1
* @param message add error issue message
*/
function setFailed(message) {
process.exitCode = ExitCode.Failure;
error(message);
}
exports.setFailed = setFailed;
//-----------------------------------------------------------------------
// Logging Commands
//-----------------------------------------------------------------------
/**
* Gets whether Actions Step Debug is on or not
*/
function isDebug() {
return process.env['RUNNER_DEBUG'] === '1';
}
exports.isDebug = isDebug;
/**
* Writes debug message to user log
* @param message debug message
*/
function debug(message) {
command.issueCommand('debug', {}, message);
}
exports.debug = debug;
/**
* Adds an error issue
* @param message error issue message. Errors will be converted to string via toString()
*/
function error(message) {
command.issue('error', message instanceof Error ? message.toString() : message);
}
exports.error = error;
/**
* Adds an warning issue
* @param message warning issue message. Errors will be converted to string via toString()
*/
function warning(message) {
command.issue('warning', message instanceof Error ? message.toString() : message);
}
exports.warning = warning;
/**
* Writes info to log with console.log.
* @param message info message
*/
function info(message) {
process.stdout.write(message + os.EOL);
}
exports.info = info;
/**
* Begin an output group.
*
* Output until the next `groupEnd` will be foldable in this group
*
* @param name The name of the output group
*/
function startGroup(name) {
command.issue('group', name);
}
exports.startGroup = startGroup;
/**
* End an output group.
*/
function endGroup() {
command.issue('endgroup');
}
exports.endGroup = endGroup;
/**
* Wrap an asynchronous function call in a group.
*
* Returns the same type as the function itself.
*
* @param name The name of the group
* @param fn The function to wrap in the group
*/
function group(name, fn) {
return __awaiter(this, void 0, void 0, function* () {
startGroup(name);
let result;
try {
result = yield fn();
}
finally {
endGroup();
}
return result;
});
}
exports.group = group;
//-----------------------------------------------------------------------
// Wrapper action state
//-----------------------------------------------------------------------
/**
* Saves state for current action, the state can only be retrieved by this action's post job execution.
*
* @param name name of the state to store
* @param value value to store. Non-string values will be converted to a string via JSON.stringify
*/
// eslint-disable-next-line @typescript-eslint/no-explicit-any
function saveState(name, value) {
command.issueCommand('save-state', { name }, value);
}
exports.saveState = saveState;
/**
* Gets the value of an state set by this action's main execution.
*
* @param name name of the state to get
* @returns string
*/
function getState(name) {
return process.env[`STATE_${name}`] || '';
}
exports.getState = getState;
});
var windows = isexe;
isexe.sync = sync;
function checkPathExt (path, options) {
var pathext = options.pathExt !== undefined ?
options.pathExt : process.env.PATHEXT;
if (!pathext) {
return true
}
pathext = pathext.split(';');
if (pathext.indexOf('') !== -1) {
return true
}
for (var i = 0; i < pathext.length; i++) {
var p = pathext[i].toLowerCase();
if (p && path.substr(-p.length).toLowerCase() === p) {
return true
}
}
return false
}
function checkStat (stat, path, options) {
if (!stat.isSymbolicLink() && !stat.isFile()) {
return false
}
return checkPathExt(path, options)
}
function isexe (path, options, cb) {
fs__default['default'].stat(path, function (er, stat) {
cb(er, er ? false : checkStat(stat, path, options));
});
}
function sync (path, options) {
return checkStat(fs__default['default'].statSync(path), path, options)
}
var mode = isexe$1;
isexe$1.sync = sync$1;
function isexe$1 (path, options, cb) {
fs__default['default'].stat(path, function (er, stat) {
cb(er, er ? false : checkStat$1(stat, options));
});
}
function sync$1 (path, options) {
return checkStat$1(fs__default['default'].statSync(path), options)
}
function checkStat$1 (stat, options) {
return stat.isFile() && checkMode(stat, options)
}
function checkMode (stat, options) {
var mod = stat.mode;
var uid = stat.uid;
var gid = stat.gid;
var myUid = options.uid !== undefined ?
options.uid : process.getuid && process.getuid();
var myGid = options.gid !== undefined ?
options.gid : process.getgid && process.getgid();
var u = parseInt('100', 8);
var g = parseInt('010', 8);
var o = parseInt('001', 8);
var ug = u | g;
var ret = (mod & o) ||
(mod & g) && gid === myGid ||
(mod & u) && uid === myUid ||
(mod & ug) && myUid === 0;
return ret
}
var core$1;
if (process.platform === 'win32' || commonjsGlobal.TESTING_WINDOWS) {
core$1 = windows;
} else {
core$1 = mode;
}
var isexe_1 = isexe$2;
isexe$2.sync = sync$2;
function isexe$2 (path, options, cb) {
if (typeof options === 'function') {
cb = options;
options = {};
}
if (!cb) {
if (typeof Promise !== 'function') {
throw new TypeError('callback not provided')
}
return new Promise(function (resolve, reject) {
isexe$2(path, options || {}, function (er, is) {
if (er) {
reject(er);
} else {
resolve(is);
}
});
})
}
core$1(path, options || {}, function (er, is) {
// ignore EACCES because that just means we aren't allowed to run it
if (er) {
if (er.code === 'EACCES' || options && options.ignoreErrors) {
er = null;
is = false;
}
}
cb(er, is);
});
}
function sync$2 (path, options) {
// my kingdom for a filtered catch
try {
return core$1.sync(path, options || {})
} catch (er) {
if (options && options.ignoreErrors || er.code === 'EACCES') {
return false
} else {
throw er
}
}
}
const isWindows$1 = process.platform === 'win32' ||
process.env.OSTYPE === 'cygwin' ||
process.env.OSTYPE === 'msys';
const COLON = isWindows$1 ? ';' : ':';
const getNotFoundError = (cmd) =>
Object.assign(new Error(`not found: ${cmd}`), { code: 'ENOENT' });
const getPathInfo = (cmd, opt) => {
const colon = opt.colon || COLON;
// If it has a slash, then we don't bother searching the pathenv.
// just check the file itself, and that's it.
const pathEnv = cmd.match(/\//) || isWindows$1 && cmd.match(/\\/) ? ['']
: (
[
// windows always checks the cwd first
...(isWindows$1 ? [process.cwd()] : []),
...(opt.path || process.env.PATH ||
/* istanbul ignore next: very unusual */ '').split(colon),
]
);
const pathExtExe = isWindows$1
? opt.pathExt || process.env.PATHEXT || '.EXE;.CMD;.BAT;.COM'
: '';
const pathExt = isWindows$1 ? pathExtExe.split(colon) : [''];
if (isWindows$1) {
if (cmd.indexOf('.') !== -1 && pathExt[0] !== '')
pathExt.unshift('');
}
return {
pathEnv,
pathExt,
pathExtExe,
}
};
const which = (cmd, opt, cb) => {
if (typeof opt === 'function') {
cb = opt;
opt = {};
}
if (!opt)
opt = {};
const { pathEnv, pathExt, pathExtExe } = getPathInfo(cmd, opt);
const found = [];
const step = i => new Promise((resolve, reject) => {
if (i === pathEnv.length)
return opt.all && found.length ? resolve(found)
: reject(getNotFoundError(cmd))
const ppRaw = pathEnv[i];
const pathPart = /^".*"$/.test(ppRaw) ? ppRaw.slice(1, -1) : ppRaw;
const pCmd = path__default['default'].join(pathPart, cmd);
const p = !pathPart && /^\.[\\\/]/.test(cmd) ? cmd.slice(0, 2) + pCmd
: pCmd;
resolve(subStep(p, i, 0));
});
const subStep = (p, i, ii) => new Promise((resolve, reject) => {
if (ii === pathExt.length)
return resolve(step(i + 1))
const ext = pathExt[ii];
isexe_1(p + ext, { pathExt: pathExtExe }, (er, is) => {
if (!er && is) {
if (opt.all)
found.push(p + ext);
else
return resolve(p + ext)
}
return resolve(subStep(p, i, ii + 1))
});
});
return cb ? step(0).then(res => cb(null, res), cb) : step(0)
};
const whichSync = (cmd, opt) => {
opt = opt || {};
const { pathEnv, pathExt, pathExtExe } = getPathInfo(cmd, opt);
const found = [];
for (let i = 0; i < pathEnv.length; i ++) {
const ppRaw = pathEnv[i];
const pathPart = /^".*"$/.test(ppRaw) ? ppRaw.slice(1, -1) : ppRaw;
const pCmd = path__default['default'].join(pathPart, cmd);
const p = !pathPart && /^\.[\\\/]/.test(cmd) ? cmd.slice(0, 2) + pCmd
: pCmd;
for (let j = 0; j < pathExt.length; j ++) {
const cur = p + pathExt[j];
try {
const is = isexe_1.sync(cur, { pathExt: pathExtExe });
if (is) {
if (opt.all)
found.push(cur);
else
return cur
}
} catch (ex) {}
}
}
if (opt.all && found.length)
return found
if (opt.nothrow)
return null
throw getNotFoundError(cmd)
};
var which_1 = which;
which.sync = whichSync;
const pathKey = (options = {}) => {
const environment = options.env || process.env;
const platform = options.platform || process.platform;
if (platform !== 'win32') {
return 'PATH';
}
return Object.keys(environment).reverse().find(key => key.toUpperCase() === 'PATH') || 'Path';
};
var pathKey_1 = pathKey;
// TODO: Remove this for the next major release
var _default = pathKey;
pathKey_1.default = _default;
function resolveCommandAttempt(parsed, withoutPathExt) {
const env = parsed.options.env || process.env;
const cwd = process.cwd();
const hasCustomCwd = parsed.options.cwd != null;
// Worker threads do not have process.chdir()
const shouldSwitchCwd = hasCustomCwd && process.chdir !== undefined && !process.chdir.disabled;
// If a custom `cwd` was specified, we need to change the process cwd
// because `which` will do stat calls but does not support a custom cwd
if (shouldSwitchCwd) {
try {
process.chdir(parsed.options.cwd);
} catch (err) {
/* Empty */
}
}
let resolved;
try {
resolved = which_1.sync(parsed.command, {
path: env[pathKey_1({ env })],
pathExt: withoutPathExt ? path__default['default'].delimiter : undefined,
});
} catch (e) {
/* Empty */
} finally {
if (shouldSwitchCwd) {
process.chdir(cwd);
}
}
// If we successfully resolved, ensure that an absolute path is returned
// Note that when a custom `cwd` was used, we need to resolve to an absolute path based on it
if (resolved) {
resolved = path__default['default'].resolve(hasCustomCwd ? parsed.options.cwd : '', resolved);
}
return resolved;
}
function resolveCommand(parsed) {
return resolveCommandAttempt(parsed) || resolveCommandAttempt(parsed, true);
}
var resolveCommand_1 = resolveCommand;
// See http://www.robvanderwoude.com/escapechars.php
const metaCharsRegExp = /([()\][%!^"`<>&|;, *?])/g;
function escapeCommand(arg) {
// Escape meta chars
arg = arg.replace(metaCharsRegExp, '^$1');
return arg;
}
function escapeArgument(arg, doubleEscapeMetaChars) {
// Convert to string
arg = `${arg}`;
// Algorithm below is based on https://qntm.org/cmd
// Sequence of backslashes followed by a double quote:
// double up all the backslashes and escape the double quote
arg = arg.replace(/(\\*)"/g, '$1$1\\"');
// Sequence of backslashes followed by the end of the string
// (which will become a double quote later):
// double up all the backslashes
arg = arg.replace(/(\\*)$/, '$1$1');
// All other backslashes occur literally
// Quote the whole thing:
arg = `"${arg}"`;
// Escape meta chars
arg = arg.replace(metaCharsRegExp, '^$1');
// Double escape meta chars if necessary
if (doubleEscapeMetaChars) {
arg = arg.replace(metaCharsRegExp, '^$1');
}
return arg;
}
var command$1 = escapeCommand;
var argument = escapeArgument;
var _escape = {
command: command$1,
argument: argument
};
var shebangRegex = /^#!(.*)/;
var shebangCommand = (string = '') => {
const match = string.match(shebangRegex);
if (!match) {
return null;
}
const [path, argument] = match[0].replace(/#! ?/, '').split(' ');
const binary = path.split('/').pop();
if (binary === 'env') {
return argument;
}
return argument ? `${binary} ${argument}` : binary;
};
function readShebang(command) {
// Read the first 150 bytes from the file
const size = 150;
const buffer = Buffer.alloc(size);
let fd;
try {
fd = fs__default['default'].openSync(command, 'r');
fs__default['default'].readSync(fd, buffer, 0, size, 0);
fs__default['default'].closeSync(fd);
} catch (e) { /* Empty */ }
// Attempt to extract shebang (null is returned if not a shebang)
return shebangCommand(buffer.toString());
}
var readShebang_1 = readShebang;
const isWin = process.platform === 'win32';
const isExecutableRegExp = /\.(?:com|exe)$/i;
const isCmdShimRegExp = /node_modules[\\/].bin[\\/][^\\/]+\.cmd$/i;
function detectShebang(parsed) {
parsed.file = resolveCommand_1(parsed);
const shebang = parsed.file && readShebang_1(parsed.file);
if (shebang) {
parsed.args.unshift(parsed.file);
parsed.command = shebang;
return resolveCommand_1(parsed);
}
return parsed.file;
}
function parseNonShell(parsed) {
if (!isWin) {
return parsed;
}
// Detect & add support for shebangs
const commandFile = detectShebang(parsed);
// We don't need a shell if the command filename is an executable
const needsShell = !isExecutableRegExp.test(commandFile);
// If a shell is required, use cmd.exe and take care of escaping everything correctly
// Note that `forceShell` is an hidden option used only in tests
if (parsed.options.forceShell || needsShell) {
// Need to double escape meta chars if the command is a cmd-shim located in `node_modules/.bin/`
// The cmd-shim simply calls execute the package bin file with NodeJS, proxying any argument
// Because the escape of metachars with ^ gets interpreted when the cmd.exe is first called,
// we need to double escape them
const needsDoubleEscapeMetaChars = isCmdShimRegExp.test(commandFile);
// Normalize posix paths into OS compatible paths (e.g.: foo/bar -> foo\bar)
// This is necessary otherwise it will always fail with ENOENT in those cases
parsed.command = path__default['default'].normalize(parsed.command);
// Escape command & arguments
parsed.command = _escape.command(parsed.command);
parsed.args = parsed.args.map((arg) => _escape.argument(arg, needsDoubleEscapeMetaChars));
const shellCommand = [parsed.command].concat(parsed.args).join(' ');
parsed.args = ['/d', '/s', '/c', `"${shellCommand}"`];
parsed.command = process.env.comspec || 'cmd.exe';
parsed.options.windowsVerbatimArguments = true; // Tell node's spawn that the arguments are already escaped
}
return parsed;
}
function parse(command, args, options) {
// Normalize arguments, similar to nodejs
if (args && !Array.isArray(args)) {
options = args;
args = null;
}
args = args ? args.slice(0) : []; // Clone array to avoid changing the original
options = Object.assign({}, options); // Clone object to avoid changing the original
// Build our parsed object
const parsed = {
command,
args,
options,
file: undefined,
original: {
command,
args,
},
};
// Delegate further parsing to shell or non-shell
return options.shell ? parsed : parseNonShell(parsed);
}
var parse_1 = parse;
const isWin$1 = process.platform === 'win32';
function notFoundError(original, syscall) {
return Object.assign(new Error(`${syscall} ${original.command} ENOENT`), {
code: 'ENOENT',
errno: 'ENOENT',
syscall: `${syscall} ${original.command}`,
path: original.command,
spawnargs: original.args,
});
}
function hookChildProcess(cp, parsed) {
if (!isWin$1) {
return;
}
const originalEmit = cp.emit;
cp.emit = function (name, arg1) {
// If emitting "exit" event and exit code is 1, we need to check if
// the command exists and emit an "error" instead
// See https://github.com/IndigoUnited/node-cross-spawn/issues/16
if (name === 'exit') {
const err = verifyENOENT(arg1, parsed);
if (err) {
return originalEmit.call(cp, 'error', err);
}
}
return originalEmit.apply(cp, arguments); // eslint-disable-line prefer-rest-params
};
}
function verifyENOENT(status, parsed) {
if (isWin$1 && status === 1 && !parsed.file) {
return notFoundError(parsed.original, 'spawn');
}
return null;
}
function verifyENOENTSync(status, parsed) {
if (isWin$1 && status === 1 && !parsed.file) {
return notFoundError(parsed.original, 'spawnSync');
}
return null;
}
var enoent = {
hookChildProcess,
verifyENOENT,
verifyENOENTSync,
notFoundError,
};
function spawn(command, args, options) {
// Parse the arguments
const parsed = parse_1(command, args, options);
// Spawn the child process
const spawned = childProcess__default['default'].spawn(parsed.command, parsed.args, parsed.options);
// Hook into child process "exit" event to emit an error if the command
// does not exists, see: https://github.com/IndigoUnited/node-cross-spawn/issues/16
enoent.hookChildProcess(spawned, parsed);
return spawned;
}
function spawnSync(command, args, options) {
// Parse the arguments
const parsed = parse_1(command, args, options);
// Spawn the child process
const result = childProcess__default['default'].spawnSync(parsed.command, parsed.args, parsed.options);
// Analyze if the command does not exist, see: https://github.com/IndigoUnited/node-cross-spawn/issues/16
result.error = result.error || enoent.verifyENOENTSync(result.status, parsed);
return result;
}
var crossSpawn = spawn;
var spawn_1 = spawn;
var sync$3 = spawnSync;
var _parse = parse_1;
var _enoent = enoent;
crossSpawn.spawn = spawn_1;
crossSpawn.sync = sync$3;
crossSpawn._parse = _parse;
crossSpawn._enoent = _enoent;
var stripFinalNewline = input => {
const LF = typeof input === 'string' ? '\n' : '\n'.charCodeAt();
const CR = typeof input === 'string' ? '\r' : '\r'.charCodeAt();
if (input[input.length - 1] === LF) {
input = input.slice(0, input.length - 1);
}
if (input[input.length - 1] === CR) {
input = input.slice(0, input.length - 1);
}
return input;
};
var npmRunPath_1 = createCommonjsModule(function (module) {
const npmRunPath = options => {
options = {
cwd: process.cwd(),
path: process.env[pathKey_1()],
execPath: process.execPath,
...options
};
let previous;
let cwdPath = path__default['default'].resolve(options.cwd);
const result = [];
while (previous !== cwdPath) {
result.push(path__default['default'].join(cwdPath, 'node_modules/.bin'));
previous = cwdPath;
cwdPath = path__default['default'].resolve(cwdPath, '..');
}
// Ensure the running `node` binary is used
const execPathDir = path__default['default'].resolve(options.cwd, options.execPath, '..');
result.push(execPathDir);
return result.concat(options.path).join(path__default['default'].delimiter);
};
module.exports = npmRunPath;
// TODO: Remove this for the next major release
module.exports.default = npmRunPath;
module.exports.env = options => {
options = {
env: process.env,
...options
};
const env = {...options.env};
const path = pathKey_1({env});
options.path = env[path];
env[path] = module.exports(options);
return env;
};
});
const mimicFn = (to, from) => {
for (const prop of Reflect.ownKeys(from)) {
Object.defineProperty(to, prop, Object.getOwnPropertyDescriptor(from, prop));
}
return to;
};
var mimicFn_1 = mimicFn;
// TODO: Remove this for the next major release
var _default$1 = mimicFn;
mimicFn_1.default = _default$1;
const calledFunctions = new WeakMap();
const onetime = (function_, options = {}) => {
if (typeof function_ !== 'function') {
throw new TypeError('Expected a function');
}
let returnValue;
let callCount = 0;
const functionName = function_.displayName || function_.name || '<anonymous>';
const onetime = function (...arguments_) {
calledFunctions.set(onetime, ++callCount);
if (callCount === 1) {
returnValue = function_.apply(this, arguments_);
function_ = null;
} else if (options.throw === true) {
throw new Error(`Function \`${functionName}\` can only be called once`);
}
return returnValue;
};
mimicFn_1(onetime, function_);
calledFunctions.set(onetime, callCount);
return onetime;
};
var onetime_1 = onetime;
// TODO: Remove this for the next major release
var _default$2 = onetime;
var callCount = function_ => {
if (!calledFunctions.has(function_)) {
throw new Error(`The given function \`${function_.name}\` is not wrapped by the \`onetime\` package`);
}
return calledFunctions.get(function_);
};
onetime_1.default = _default$2;
onetime_1.callCount = callCount;
var core$2 = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports,"__esModule",{value:true});exports.SIGNALS=void 0;
const SIGNALS=[
{
name:"SIGHUP",
number:1,
action:"terminate",
description:"Terminal closed",
standard:"posix"},
{
name:"SIGINT",
number:2,
action:"terminate",
description:"User interruption with CTRL-C",
standard:"ansi"},
{
name:"SIGQUIT",
number:3,
action:"core",
description:"User interruption with CTRL-\\",
standard:"posix"},
{
name:"SIGILL",
number:4,
action:"core",
description:"Invalid machine instruction",
standard:"ansi"},
{
name:"SIGTRAP",
number:5,
action:"core",
description:"Debugger breakpoint",
standard:"posix"},
{
name:"SIGABRT",
number:6,
action:"core",
description:"Aborted",
standard:"ansi"},
{
name:"SIGIOT",
number:6,
action:"core",
description:"Aborted",
standard:"bsd"},
{
name:"SIGBUS",
number:7,
action:"core",
description:
"Bus error due to misaligned, non-existing address or paging error",
standard:"bsd"},
{
name:"SIGEMT",
number:7,
action:"terminate",
description:"Command should be emulated but is not implemented",
standard:"other"},
{
name:"SIGFPE",
number:8,
action:"core",
description:"Floating point arithmetic error",
standard:"ansi"},
{
name:"SIGKILL",
number:9,
action:"terminate",
description:"Forced termination",
standard:"posix",
forced:true},
{
name:"SIGUSR1",
number:10,
action:"terminate",
description:"Application-specific signal",
standard:"posix"},
{
name:"SIGSEGV",
number:11,
action:"core",
description:"Segmentation fault",
standard:"ansi"},
{
name:"SIGUSR2",
number:12,
action:"terminate",
description:"Application-specific signal",
standard:"posix"},
{
name:"SIGPIPE",
number:13,
action:"terminate",
description:"Broken pipe or socket",
standard:"posix"},
{
name:"SIGALRM",
number:14,
action:"terminate",
description:"Timeout or timer",
standard:"posix"},
{
name:"SIGTERM",
number:15,
action:"terminate",
description:"Termination",
standard:"ansi"},
{
name:"SIGSTKFLT",
number:16,
action:"terminate",
description:"Stack is empty or overflowed",
standard:"other"},
{
name:"SIGCHLD",
number:17,
action:"ignore",
description:"Child process terminated, paused or unpaused",
standard:"posix"},
{
name:"SIGCLD",
number:17,
action:"ignore",
description:"Child process terminated, paused or unpaused",
standard:"other"},
{
name:"SIGCONT",
number:18,
action:"unpause",
description:"Unpaused",
standard:"posix",
forced:true},
{
name:"SIGSTOP",
number:19,
action:"pause",
description:"Paused",
standard:"posix",
forced:true},
{
name:"SIGTSTP",
number:20,
action:"pause",
description:"Paused using CTRL-Z or \"suspend\"",
standard:"posix"},
{
name:"SIGTTIN",
number:21,
action:"pause",
description:"Background process cannot read terminal input",
standard:"posix"},
{
name:"SIGBREAK",
number:21,
action:"terminate",
description:"User interruption with CTRL-BREAK",
standard:"other"},
{
name:"SIGTTOU",
number:22,
action:"pause",
description:"Background process cannot write to terminal output",
standard:"posix"},
{
name:"SIGURG",
number:23,
action:"ignore",
description:"Socket received out-of-band data",
standard:"bsd"},
{
name:"SIGXCPU",
number:24,
action:"core",
description:"Process timed out",
standard:"bsd"},
{
name:"SIGXFSZ",
number:25,
action:"core",
description:"File too big",
standard:"bsd"},
{
name:"SIGVTALRM",
number:26,
action:"terminate",
description:"Timeout or timer",
standard:"bsd"},
{
name:"SIGPROF",
number:27,
action:"terminate",
description:"Timeout or timer",
standard:"bsd"},
{
name:"SIGWINCH",
number:28,
action:"ignore",
description:"Terminal window size changed",
standard:"bsd"},
{
name:"SIGIO",
number:29,
action:"terminate",
description:"I/O is available",
standard:"other"},
{
name:"SIGPOLL",
number:29,
action:"terminate",
description:"Watched event",
standard:"other"},
{
name:"SIGINFO",
number:29,
action:"ignore",
description:"Request for process information",
standard:"other"},
{
name:"SIGPWR",
number:30,
action:"terminate",
description:"Device running out of power",
standard:"systemv"},
{
name:"SIGSYS",
number:31,
action:"core",
description:"Invalid system call",
standard:"other"},
{
name:"SIGUNUSED",
number:31,
action:"terminate",
description:"Invalid system call",
standard:"other"}];exports.SIGNALS=SIGNALS;
});
var realtime = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports,"__esModule",{value:true});exports.SIGRTMAX=exports.getRealtimeSignals=void 0;
const getRealtimeSignals=function(){
const length=SIGRTMAX-SIGRTMIN+1;
return Array.from({length},getRealtimeSignal);
};exports.getRealtimeSignals=getRealtimeSignals;
const getRealtimeSignal=function(value,index){
return {
name:`SIGRT${index+1}`,
number:SIGRTMIN+index,
action:"terminate",
description:"Application-specific signal (realtime)",
standard:"posix"};
};
const SIGRTMIN=34;
const SIGRTMAX=64;exports.SIGRTMAX=SIGRTMAX;
});
var signals = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports,"__esModule",{value:true});exports.getSignals=void 0;
const getSignals=function(){
const realtimeSignals=(0, realtime.getRealtimeSignals)();
const signals=[...core$2.SIGNALS,...realtimeSignals].map(normalizeSignal);
return signals;
};exports.getSignals=getSignals;
const normalizeSignal=function({
name,
number:defaultNumber,
description,
action,
forced=false,
standard})
{
const{
signals:{[name]:constantSignal}}=
require$$0__default$1['default'].constants;
const supported=constantSignal!==undefined;
const number=supported?constantSignal:defaultNumber;
return {name,number,description,supported,action,forced,standard};
};
});
var main = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports,"__esModule",{value:true});exports.signalsByNumber=exports.signalsByName=void 0;
const getSignalsByName=function(){
const signals$1=(0, signals.getSignals)();
return signals$1.reduce(getSignalByName,{});
};
const getSignalByName=function(
signalByNameMemo,
{name,number,description,supported,action,forced,standard})
{
return {
...signalByNameMemo,
[name]:{name,number,description,supported,action,forced,standard}};
};
const signalsByName=getSignalsByName();exports.signalsByName=signalsByName;
const getSignalsByNumber=function(){
const signals$1=(0, signals.getSignals)();
const length=realtime.SIGRTMAX+1;
const signalsA=Array.from({length},(value,number)=>
getSignalByNumber(number,signals$1));
return Object.assign({},...signalsA);
};
const getSignalByNumber=function(number,signals){
const signal=findSignalByNumber(number,signals);
if(signal===undefined){
return {};
}
const{name,description,supported,action,forced,standard}=signal;
return {
[number]:{
name,
number,
description,
supported,
action,
forced,
standard}};
};
const findSignalByNumber=function(number,signals){
const signal=signals.find(({name})=>require$$0__default$1['default'].constants.signals[name]===number);
if(signal!==undefined){
return signal;
}
return signals.find(signalA=>signalA.number===number);
};
const signalsByNumber=getSignalsByNumber();exports.signalsByNumber=signalsByNumber;
});
const {signalsByName} = main;
const getErrorPrefix = ({timedOut, timeout, errorCode, signal, signalDescription, exitCode, isCanceled}) => {
if (timedOut) {
return `timed out after ${timeout} milliseconds`;
}
if (isCanceled) {
return 'was canceled';
}
if (errorCode !== undefined) {
return `failed with ${errorCode}`;
}
if (signal !== undefined) {
return `was killed with ${signal} (${signalDescription})`;
}
if (exitCode !== undefined) {
return `failed with exit code ${exitCode}`;
}
return 'failed';
};
const makeError = ({
stdout,
stderr,
all,
error,
signal,
exitCode,
command,
timedOut,
isCanceled,
killed,
parsed: {options: {timeout}}
}) => {
// `signal` and `exitCode` emitted on `spawned.on('exit')` event can be `null`.
// We normalize them to `undefined`
exitCode = exitCode === null ? undefined : exitCode;
signal = signal === null ? undefined : signal;
const signalDescription = signal === undefined ? undefined : signalsByName[signal].description;
const errorCode = error && error.code;
const prefix = getErrorPrefix({timedOut, timeout, errorCode, signal, signalDescription, exitCode, isCanceled});
const execaMessage = `Command ${prefix}: ${command}`;
const isError = Object.prototype.toString.call(error) === '[object Error]';
const shortMessage = isError ? `${execaMessage}\n${error.message}` : execaMessage;
const message = [shortMessage, stderr, stdout].filter(Boolean).join('\n');
if (isError) {
error.originalMessage = error.message;
error.message = message;
} else {
error = new Error(message);
}
error.shortMessage = shortMessage;
error.command = command;
error.exitCode = exitCode;
error.signal = signal;
error.signalDescription = signalDescription;
error.stdout = stdout;
error.stderr = stderr;
if (all !== undefined) {
error.all = all;
}
if ('bufferedData' in error) {
delete error.bufferedData;
}
error.failed = true;
error.timedOut = Boolean(timedOut);
error.isCanceled = isCanceled;
error.killed = killed && !timedOut;
return error;
};
var error$1 = makeError;
const aliases = ['stdin', 'stdout', 'stderr'];
const hasAlias = opts => aliases.some(alias => opts[alias] !== undefined);
const normalizeStdio = opts => {
if (!opts) {
return;
}
const {stdio} = opts;
if (stdio === undefined) {
return aliases.map(alias => opts[alias]);
}
if (hasAlias(opts)) {
throw new Error(`It's not possible to provide \`stdio\` in combination with one of ${aliases.map(alias => `\`${alias}\``).join(', ')}`);
}
if (typeof stdio === 'string') {
return stdio;
}
if (!Array.isArray(stdio)) {
throw new TypeError(`Expected \`stdio\` to be of type \`string\` or \`Array\`, got \`${typeof stdio}\``);
}
const length = Math.max(stdio.length, aliases.length);
return Array.from({length}, (value, index) => stdio[index]);
};
var stdio = normalizeStdio;
// `ipc` is pushed unless it is already present
var node = opts => {
const stdio = normalizeStdio(opts);
if (stdio === 'ipc') {
return 'ipc';
}
if (stdio === undefined || typeof stdio === 'string') {
return [stdio, stdio, stdio, 'ipc'];
}
if (stdio.includes('ipc')) {
return stdio;
}
return [...stdio, 'ipc'];
};
stdio.node = node;
var signals$1 = createCommonjsModule(function (module) {
// This is not the set of all possible signals.
//
// It IS, however, the set of all signals that trigger
// an exit on either Linux or BSD systems. Linux is a
// superset of the signal names supported on BSD, and
// the unknown signals just fail to register, so we can
// catch that easily enough.
//
// Don't bother with SIGKILL. It's uncatchable, which
// means that we can't fire any callbacks anyway.
//
// If a user does happen to register a handler on a non-
// fatal signal like SIGWINCH or something, and then
// exit, it'll end up firing `process.emit('exit')`, so
// the handler will be fired anyway.
//
// SIGBUS, SIGFPE, SIGSEGV and SIGILL, when not raised
// artificially, inherently leave the process in a
// state from which it is not safe to try and enter JS
// listeners.
module.exports = [
'SIGABRT',
'SIGALRM',
'SIGHUP',
'SIGINT',
'SIGTERM'
];
if (process.platform !== 'win32') {
module.exports.push(
'SIGVTALRM',
'SIGXCPU',
'SIGXFSZ',
'SIGUSR2',
'SIGTRAP',
'SIGSYS',
'SIGQUIT',
'SIGIOT'
// should detect profiler and enable/disable accordingly.
// see #21
// 'SIGPROF'
);
}
if (process.platform === 'linux') {
module.exports.push(
'SIGIO',
'SIGPOLL',
'SIGPWR',
'SIGSTKFLT',
'SIGUNUSED'
);
}
});
// Note: since nyc uses this module to output coverage, any lines
// that are in the direct sync flow of nyc's outputCoverage are
// ignored, since we can never get coverage for them.
var signals$2 = signals$1;
var isWin$2 = /^win/i.test(process.platform);
var EE = require$$1__default['default'];
/* istanbul ignore if */
if (typeof EE !== 'function') {
EE = EE.EventEmitter;
}
var emitter;
if (process.__signal_exit_emitter__) {
emitter = process.__signal_exit_emitter__;
} else {
emitter = process.__signal_exit_emitter__ = new EE();
emitter.count = 0;
emitter.emitted = {};
}
// Because this emitter is a global, we have to check to see if a
// previous version of this library failed to enable infinite listeners.
// I know what you're about to say. But literally everything about
// signal-exit is a compromise with evil. Get used to it.
if (!emitter.infinite) {
emitter.setMaxListeners(Infinity);
emitter.infinite = true;
}
var signalExit = function (cb, opts) {
assert__default['default'].equal(typeof cb, 'function', 'a callback must be provided for exit handler');
if (loaded === false) {
load();
}
var ev = 'exit';
if (opts && opts.alwaysLast) {
ev = 'afterexit';
}
var remove = function () {
emitter.removeListener(ev, cb);
if (emitter.listeners('exit').length === 0 &&
emitter.listeners('afterexit').length === 0) {
unload();
}
};
emitter.on(ev, cb);
return remove
};
var unload_1 = unload;
function unload () {
if (!loaded) {
return
}
loaded = false;
signals$2.forEach(function (sig) {
try {
process.removeListener(sig, sigListeners[sig]);
} catch (er) {}
});
process.emit = originalProcessEmit;
process.reallyExit = originalProcessReallyExit;
emitter.count -= 1;
}
function emit (event, code, signal) {
if (emitter.emitted[event]) {
return
}
emitter.emitted[event] = true;
emitter.emit(event, code, signal);
}
// { <signal>: <listener fn>, ... }
var sigListeners = {};
signals$2.forEach(function (sig) {
sigListeners[sig] = function listener () {
// If there are no other listeners, an exit is coming!
// Simplest way: remove us and then re-send the signal.
// We know that this will kill the process, so we can
// safely emit now.
var listeners = process.listeners(sig);
if (listeners.length === emitter.count) {
unload();
emit('exit', null, sig);
/* istanbul ignore next */
emit('afterexit', null, sig);
/* istanbul ignore next */
if (isWin$2 && sig === 'SIGHUP') {
// "SIGHUP" throws an `ENOSYS` error on Windows,
// so use a supported signal instead
sig = 'SIGINT';
}
process.kill(process.pid, sig);
}
};
});
var signals_1 = function () {
return signals$2
};
var load_1 = load;
var loaded = false;
function load () {
if (loaded) {
return
}
loaded = true;
// This is the number of onSignalExit's that are in play.
// It's important so that we can count the correct number of
// listeners on signals, and don't wait for the other one to
// handle it instead of us.
emitter.count += 1;
signals$2 = signals$2.filter(function (sig) {
try {
process.on(sig, sigListeners[sig]);
return true
} catch (er) {
return false
}
});
process.emit = processEmit;
process.reallyExit = processReallyExit;
}
var originalProcessReallyExit = process.reallyExit;
function processReallyExit (code) {
process.exitCode = code || 0;
emit('exit', process.exitCode, null);
/* istanbul ignore next */
emit('afterexit', process.exitCode, null);
/* istanbul ignore next */
originalProcessReallyExit.call(process, process.exitCode);
}
var originalProcessEmit = process.emit;
function processEmit (ev, arg) {
if (ev === 'exit') {
if (arg !== undefined) {
process.exitCode = arg;
}
var ret = originalProcessEmit.apply(this, arguments);
emit('exit', process.exitCode, null);
/* istanbul ignore next */
emit('afterexit', process.exitCode, null);
return ret
} else {
return originalProcessEmit.apply(this, arguments)
}
}
signalExit.unload = unload_1;
signalExit.signals = signals_1;
signalExit.load = load_1;
const DEFAULT_FORCE_KILL_TIMEOUT = 1000 * 5;
// Monkey-patches `childProcess.kill()` to add `forceKillAfterTimeout` behavior
const spawnedKill = (kill, signal = 'SIGTERM', options = {}) => {
const killResult = kill(signal);
setKillTimeout(kill, signal, options, killResult);
return killResult;
};
const setKillTimeout = (kill, signal, options, killResult) => {
if (!shouldForceKill(signal, options, killResult)) {
return;
}
const timeout = getForceKillAfterTimeout(options);
const t = setTimeout(() => {
kill('SIGKILL');
}, timeout);
// Guarded because there's no `.unref()` when `execa` is used in the renderer
// process in Electron. This cannot be tested since we don't run tests in
// Electron.
// istanbul ignore else
if (t.unref) {
t.unref();
}
};
const shouldForceKill = (signal, {forceKillAfterTimeout}, killResult) => {
return isSigterm(signal) && forceKillAfterTimeout !== false && killResult;
};
const isSigterm = signal => {
return signal === require$$0__default$1['default'].constants.signals.SIGTERM ||
(typeof signal === 'string' && signal.toUpperCase() === 'SIGTERM');
};
const getForceKillAfterTimeout = ({forceKillAfterTimeout = true}) => {
if (forceKillAfterTimeout === true) {
return DEFAULT_FORCE_KILL_TIMEOUT;
}
if (!Number.isFinite(forceKillAfterTimeout) || forceKillAfterTimeout < 0) {
throw new TypeError(`Expected the \`forceKillAfterTimeout\` option to be a non-negative integer, got \`${forceKillAfterTimeout}\` (${typeof forceKillAfterTimeout})`);
}
return forceKillAfterTimeout;
};
// `childProcess.cancel()`
const spawnedCancel = (spawned, context) => {
const killResult = spawned.kill();
if (killResult) {
context.isCanceled = true;
}
};
const timeoutKill = (spawned, signal, reject) => {
spawned.kill(signal);
reject(Object.assign(new Error('Timed out'), {timedOut: true, signal}));
};
// `timeout` option handling
const setupTimeout = (spawned, {timeout, killSignal = 'SIGTERM'}, spawnedPromise) => {
if (timeout === 0 || timeout === undefined) {
return spawnedPromise;
}
if (!Number.isFinite(timeout) || timeout < 0) {
throw new TypeError(`Expected the \`timeout\` option to be a non-negative integer, got \`${timeout}\` (${typeof timeout})`);
}
let timeoutId;
const timeoutPromise = new Promise((resolve, reject) => {
timeoutId = setTimeout(() => {
timeoutKill(spawned, killSignal, reject);
}, timeout);
});
const safeSpawnedPromise = spawnedPromise.finally(() => {
clearTimeout(timeoutId);
});
return Promise.race([timeoutPromise, safeSpawnedPromise]);
};
// `cleanup` option handling
const setExitHandler = async (spawned, {cleanup, detached}, timedPromise) => {
if (!cleanup || detached) {
return timedPromise;
}
const removeExitHandler = signalExit(() => {
spawned.kill();
});
return timedPromise.finally(() => {
removeExitHandler();
});
};
var kill = {
spawnedKill,
spawnedCancel,
setupTimeout,
setExitHandler
};
const isStream = stream =>
stream !== null &&
typeof stream === 'object' &&
typeof stream.pipe === 'function';
isStream.writable = stream =>
isStream(stream) &&
stream.writable !== false &&
typeof stream._write === 'function' &&
typeof stream._writableState === 'object';
isStream.readable = stream =>
isStream(stream) &&
stream.readable !== false &&
typeof stream._read === 'function' &&
typeof stream._readableState === 'object';
isStream.duplex = stream =>
isStream.writable(stream) &&
isStream.readable(stream);
isStream.transform = stream =>
isStream.duplex(stream) &&
typeof stream._transform === 'function' &&
typeof stream._transformState === 'object';
var isStream_1 = isStream;
// Returns a wrapper function that returns a wrapped callback
// The wrapper function should do some stuff, and return a
// presumably different callback function.
// This makes sure that own properties are retained, so that
// decorations and such are not lost along the way.
var wrappy_1 = wrappy;
function wrappy (fn, cb) {
if (fn && cb) return wrappy(fn)(cb)
if (typeof fn !== 'function')
throw new TypeError('need wrapper function')
Object.keys(fn).forEach(function (k) {
wrapper[k] = fn[k];
});
return wrapper
function wrapper() {
var args = new Array(arguments.length);
for (var i = 0; i < args.length; i++) {
args[i] = arguments[i];
}
var ret = fn.apply(this, args);
var cb = args[args.length-1];
if (typeof ret === 'function' && ret !== cb) {
Object.keys(cb).forEach(function (k) {
ret[k] = cb[k];
});
}
return ret
}
}
var once_1 = wrappy_1(once);
var strict = wrappy_1(onceStrict);
once.proto = once(function () {
Object.defineProperty(Function.prototype, 'once', {
value: function () {
return once(this)
},
configurable: true
});
Object.defineProperty(Function.prototype, 'onceStrict', {
value: function () {
return onceStrict(this)
},
configurable: true
});
});
function once (fn) {
var f = function () {
if (f.called) return f.value
f.called = true;
return f.value = fn.apply(this, arguments)
};
f.called = false;
return f
}
function onceStrict (fn) {
var f = function () {
if (f.called)
throw new Error(f.onceError)
f.called = true;
return f.value = fn.apply(this, arguments)
};
var name = fn.name || 'Function wrapped with `once`';
f.onceError = name + " shouldn't be called more than once";
f.called = false;
return f
}
once_1.strict = strict;
var noop = function() {};
var isRequest = function(stream) {
return stream.setHeader && typeof stream.abort === 'function';
};
var isChildProcess = function(stream) {
return stream.stdio && Array.isArray(stream.stdio) && stream.stdio.length === 3
};
var eos = function(stream, opts, callback) {
if (typeof opts === 'function') return eos(stream, null, opts);
if (!opts) opts = {};
callback = once_1(callback || noop);
var ws = stream._writableState;
var rs = stream._readableState;
var readable = opts.readable || (opts.readable !== false && stream.readable);
var writable = opts.writable || (opts.writable !== false && stream.writable);
var cancelled = false;
var onlegacyfinish = function() {
if (!stream.writable) onfinish();
};
var onfinish = function() {
writable = false;
if (!readable) callback.call(stream);
};
var onend = function() {
readable = false;
if (!writable) callback.call(stream);
};
var onexit = function(exitCode) {
callback.call(stream, exitCode ? new Error('exited with error code: ' + exitCode) : null);
};
var onerror = function(err) {
callback.call(stream, err);
};
var onclose = function() {
process.nextTick(onclosenexttick);
};
var onclosenexttick = function() {
if (cancelled) return;
if (readable && !(rs && (rs.ended && !rs.destroyed))) return callback.call(stream, new Error('premature close'));
if (writable && !(ws && (ws.ended && !ws.destroyed))) return callback.call(stream, new Error('premature close'));
};
var onrequest = function() {
stream.req.on('finish', onfinish);
};
if (isRequest(stream)) {
stream.on('complete', onfinish);
stream.on('abort', onclose);
if (stream.req) onrequest();
else stream.on('request', onrequest);
} else if (writable && !ws) { // legacy streams
stream.on('end', onlegacyfinish);
stream.on('close', onlegacyfinish);
}
if (isChildProcess(stream)) stream.on('exit', onexit);
stream.on('end', onend);
stream.on('finish', onfinish);
if (opts.error !== false) stream.on('error', onerror);
stream.on('close', onclose);
return function() {
cancelled = true;
stream.removeListener('complete', onfinish);
stream.removeListener('abort', onclose);
stream.removeListener('request', onrequest);
if (stream.req) stream.req.removeListener('finish', onfinish);
stream.removeListener('end', onlegacyfinish);
stream.removeListener('close', onlegacyfinish);
stream.removeListener('finish', onfinish);
stream.removeListener('exit', onexit);
stream.removeListener('end', onend);
stream.removeListener('error', onerror);
stream.removeListener('close', onclose);
};
};
var endOfStream = eos;
// we only need fs to get the ReadStream and WriteStream prototypes
var noop$1 = function () {};
var ancient = /^v?\.0/.test(process.version);
var isFn = function (fn) {
return typeof fn === 'function'
};
var isFS = function (stream) {
if (!ancient) return false // newer node version do not need to care about fs is a special way
if (!fs__default['default']) return false // browser
return (stream instanceof (fs__default['default'].ReadStream || noop$1) || stream instanceof (fs__default['default'].WriteStream || noop$1)) && isFn(stream.close)
};
var isRequest$1 = function (stream) {
return stream.setHeader && isFn(stream.abort)
};
var destroyer = function (stream, reading, writing, callback) {
callback = once_1(callback);
var closed = false;
stream.on('close', function () {
closed = true;
});
endOfStream(stream, {readable: reading, writable: writing}, function (err) {
if (err) return callback(err)
closed = true;
callback();
});
var destroyed = false;
return function (err) {
if (closed) return
if (destroyed) return
destroyed = true;
if (isFS(stream)) return stream.close(noop$1) // use close for fs streams to avoid fd leaks
if (isRequest$1(stream)) return stream.abort() // request.destroy just do .end - .abort is what we want
if (isFn(stream.destroy)) return stream.destroy()
callback(err || new Error('stream was destroyed'));
}
};
var call = function (fn) {
fn();
};
var pipe = function (from, to) {
return from.pipe(to)
};
var pump = function () {
var streams = Array.prototype.slice.call(arguments);
var callback = isFn(streams[streams.length - 1] || noop$1) && streams.pop() || noop$1;
if (Array.isArray(streams[0])) streams = streams[0];
if (streams.length < 2) throw new Error('pump requires two streams per minimum')
var error;
var destroys = streams.map(function (stream, i) {
var reading = i < streams.length - 1;
var writing = i > 0;
return destroyer(stream, reading, writing, function (err) {
if (!error) error = err;
if (err) destroys.forEach(call);
if (reading) return
destroys.forEach(call);
callback(error);
})
});
return streams.reduce(pipe)
};
var pump_1 = pump;
const {PassThrough: PassThroughStream} = Stream__default['default'];
var bufferStream = options => {
options = {...options};
const {array} = options;
let {encoding} = options;
const isBuffer = encoding === 'buffer';
let objectMode = false;
if (array) {
objectMode = !(encoding || isBuffer);
} else {
encoding = encoding || 'utf8';
}
if (isBuffer) {
encoding = null;
}
const stream = new PassThroughStream({objectMode});
if (encoding) {
stream.setEncoding(encoding);
}
let length = 0;
const chunks = [];
stream.on('data', chunk => {
chunks.push(chunk);
if (objectMode) {
length = chunks.length;
} else {
length += chunk.length;
}
});
stream.getBufferedValue = () => {
if (array) {
return chunks;
}
return isBuffer ? Buffer.concat(chunks, length) : chunks.join('');
};
stream.getBufferedLength = () => length;
return stream;
};
const {constants: BufferConstants} = require$$0__default$2['default'];
class MaxBufferError extends Error {
constructor() {
super('maxBuffer exceeded');
this.name = 'MaxBufferError';
}
}
async function getStream(inputStream, options) {
if (!inputStream) {
return Promise.reject(new Error('Expected a stream'));
}
options = {
maxBuffer: Infinity,
...options
};
const {maxBuffer} = options;
let stream;
await new Promise((resolve, reject) => {
const rejectPromise = error => {
// Don't retrieve an oversized buffer.
if (error && stream.getBufferedLength() <= BufferConstants.MAX_LENGTH) {
error.bufferedData = stream.getBufferedValue();
}
reject(error);
};
stream = pump_1(inputStream, bufferStream(options), error => {
if (error) {
rejectPromise(error);
return;
}
resolve();
});
stream.on('data', () => {
if (stream.getBufferedLength() > maxBuffer) {
rejectPromise(new MaxBufferError());
}
});
});
return stream.getBufferedValue();
}
var getStream_1 = getStream;
// TODO: Remove this for the next major release
var _default$3 = getStream;
var buffer = (stream, options) => getStream(stream, {...options, encoding: 'buffer'});
var array = (stream, options) => getStream(stream, {...options, array: true});
var MaxBufferError_1 = MaxBufferError;
getStream_1.default = _default$3;
getStream_1.buffer = buffer;
getStream_1.array = array;
getStream_1.MaxBufferError = MaxBufferError_1;
const { PassThrough } = Stream__default['default'];
var mergeStream = function (/*streams...*/) {
var sources = [];
var output = new PassThrough({objectMode: true});
output.setMaxListeners(0);
output.add = add;
output.isEmpty = isEmpty;
output.on('unpipe', remove);
Array.prototype.slice.call(arguments).forEach(add);
return output
function add (source) {
if (Array.isArray(source)) {
source.forEach(add);
return this
}
sources.push(source);
source.once('end', remove.bind(null, source));
source.once('error', output.emit.bind(output, 'error'));
source.pipe(output, {end: false});
return this
}
function isEmpty () {
return sources.length == 0;
}
function remove (source) {
sources = sources.filter(function (it) { return it !== source });
if (!sources.length && output.readable) { output.end(); }
}
};
// `input` option
const handleInput = (spawned, input) => {
// Checking for stdin is workaround for https://github.com/nodejs/node/issues/26852
// TODO: Remove `|| spawned.stdin === undefined` once we drop support for Node.js <=12.2.0
if (input === undefined || spawned.stdin === undefined) {
return;
}
if (isStream_1(input)) {
input.pipe(spawned.stdin);
} else {
spawned.stdin.end(input);
}
};
// `all` interleaves `stdout` and `stderr`
const makeAllStream = (spawned, {all}) => {
if (!all || (!spawned.stdout && !spawned.stderr)) {
return;
}
const mixed = mergeStream();
if (spawned.stdout) {
mixed.add(spawned.stdout);
}
if (spawned.stderr) {
mixed.add(spawned.stderr);
}
return mixed;
};
// On failure, `result.stdout|stderr|all` should contain the currently buffered stream
const getBufferedData = async (stream, streamPromise) => {
if (!stream) {
return;
}
stream.destroy();
try {
return await streamPromise;
} catch (error) {
return error.bufferedData;
}
};
const getStreamPromise = (stream, {encoding, buffer, maxBuffer}) => {
if (!stream || !buffer) {
return;
}
if (encoding) {
return getStream_1(stream, {encoding, maxBuffer});
}
return getStream_1.buffer(stream, {maxBuffer});
};
// Retrieve result of child process: exit code, signal, error, streams (stdout/stderr/all)
const getSpawnedResult = async ({stdout, stderr, all}, {encoding, buffer, maxBuffer}, processDone) => {
const stdoutPromise = getStreamPromise(stdout, {encoding, buffer, maxBuffer});
const stderrPromise = getStreamPromise(stderr, {encoding, buffer, maxBuffer});
const allPromise = getStreamPromise(all, {encoding, buffer, maxBuffer: maxBuffer * 2});
try {
return await Promise.all([processDone, stdoutPromise, stderrPromise, allPromise]);
} catch (error) {
return Promise.all([
{error, signal: error.signal, timedOut: error.timedOut},
getBufferedData(stdout, stdoutPromise),
getBufferedData(stderr, stderrPromise),
getBufferedData(all, allPromise)
]);
}
};
const validateInputSync = ({input}) => {
if (isStream_1(input)) {
throw new TypeError('The `input` option cannot be a stream in sync mode');
}
};
var stream = {
handleInput,
makeAllStream,
getSpawnedResult,
validateInputSync
};
const nativePromisePrototype = (async () => {})().constructor.prototype;
const descriptors = ['then', 'catch', 'finally'].map(property => [
property,
Reflect.getOwnPropertyDescriptor(nativePromisePrototype, property)
]);
// The return value is a mixin of `childProcess` and `Promise`
const mergePromise = (spawned, promise) => {
for (const [property, descriptor] of descriptors) {
// Starting the main `promise` is deferred to avoid consuming streams
const value = typeof promise === 'function' ?
(...args) => Reflect.apply(descriptor.value, promise(), args) :
descriptor.value.bind(promise);
Reflect.defineProperty(spawned, property, {...descriptor, value});
}
return spawned;
};
// Use promises instead of `child_process` events
const getSpawnedPromise = spawned => {
return new Promise((resolve, reject) => {
spawned.on('exit', (exitCode, signal) => {
resolve({exitCode, signal});
});
spawned.on('error', error => {
reject(error);
});
if (spawned.stdin) {
spawned.stdin.on('error', error => {
reject(error);
});
}
});
};
var promise = {
mergePromise,
getSpawnedPromise
};
const SPACES_REGEXP = / +/g;
const joinCommand = (file, args = []) => {
if (!Array.isArray(args)) {
return file;
}
return [file, ...args].join(' ');
};
// Allow spaces to be escaped by a backslash if not meant as a delimiter
const handleEscaping = (tokens, token, index) => {
if (index === 0) {
return [token];
}
const previousToken = tokens[tokens.length - 1];
if (previousToken.endsWith('\\')) {
return [...tokens.slice(0, -1), `${previousToken.slice(0, -1)} ${token}`];
}
return [...tokens, token];
};
// Handle `execa.command()`
const parseCommand = command => {
return command
.trim()
.split(SPACES_REGEXP)
.reduce(handleEscaping, []);
};
var command$2 = {
joinCommand,
parseCommand
};
const {spawnedKill: spawnedKill$1, spawnedCancel: spawnedCancel$1, setupTimeout: setupTimeout$1, setExitHandler: setExitHandler$1} = kill;
const {handleInput: handleInput$1, getSpawnedResult: getSpawnedResult$1, makeAllStream: makeAllStream$1, validateInputSync: validateInputSync$1} = stream;
const {mergePromise: mergePromise$1, getSpawnedPromise: getSpawnedPromise$1} = promise;
const {joinCommand: joinCommand$1, parseCommand: parseCommand$1} = command$2;
const DEFAULT_MAX_BUFFER = 1000 * 1000 * 100;
const getEnv = ({env: envOption, extendEnv, preferLocal, localDir, execPath}) => {
const env = extendEnv ? {...process.env, ...envOption} : envOption;
if (preferLocal) {
return npmRunPath_1.env({env, cwd: localDir, execPath});
}
return env;
};
const handleArguments = (file, args, options = {}) => {
const parsed = crossSpawn._parse(file, args, options);
file = parsed.command;
args = parsed.args;
options = parsed.options;
options = {
maxBuffer: DEFAULT_MAX_BUFFER,
buffer: true,
stripFinalNewline: true,
extendEnv: true,
preferLocal: false,
localDir: options.cwd || process.cwd(),
execPath: process.execPath,
encoding: 'utf8',
reject: true,
cleanup: true,
all: false,
windowsHide: true,
...options
};
options.env = getEnv(options);
options.stdio = stdio(options);
if (process.platform === 'win32' && path__default['default'].basename(file, '.exe') === 'cmd') {
// #116
args.unshift('/q');
}
return {file, args, options, parsed};
};
const handleOutput = (options, value, error) => {
if (typeof value !== 'string' && !Buffer.isBuffer(value)) {
// When `execa.sync()` errors, we normalize it to '' to mimic `execa()`
return error === undefined ? undefined : '';
}
if (options.stripFinalNewline) {
return stripFinalNewline(value);
}
return value;
};
const execa = (file, args, options) => {
const parsed = handleArguments(file, args, options);
const command = joinCommand$1(file, args);
let spawned;
try {
spawned = childProcess__default['default'].spawn(parsed.file, parsed.args, parsed.options);
} catch (error) {
// Ensure the returned error is always both a promise and a child process
const dummySpawned = new childProcess__default['default'].ChildProcess();
const errorPromise = Promise.reject(error$1({
error,
stdout: '',
stderr: '',
all: '',
command,
parsed,
timedOut: false,
isCanceled: false,
killed: false
}));
return mergePromise$1(dummySpawned, errorPromise);
}
const spawnedPromise = getSpawnedPromise$1(spawned);
const timedPromise = setupTimeout$1(spawned, parsed.options, spawnedPromise);
const processDone = setExitHandler$1(spawned, parsed.options, timedPromise);
const context = {isCanceled: false};
spawned.kill = spawnedKill$1.bind(null, spawned.kill.bind(spawned));
spawned.cancel = spawnedCancel$1.bind(null, spawned, context);
const handlePromise = async () => {
const [{error, exitCode, signal, timedOut}, stdoutResult, stderrResult, allResult] = await getSpawnedResult$1(spawned, parsed.options, processDone);
const stdout = handleOutput(parsed.options, stdoutResult);
const stderr = handleOutput(parsed.options, stderrResult);
const all = handleOutput(parsed.options, allResult);
if (error || exitCode !== 0 || signal !== null) {
const returnedError = error$1({
error,
exitCode,
signal,
stdout,
stderr,
all,
command,
parsed,
timedOut,
isCanceled: context.isCanceled,
killed: spawned.killed
});
if (!parsed.options.reject) {
return returnedError;
}
throw returnedError;
}
return {
command,
exitCode: 0,
stdout,
stderr,
all,
failed: false,
timedOut: false,
isCanceled: false,
killed: false
};
};
const handlePromiseOnce = onetime_1(handlePromise);
crossSpawn._enoent.hookChildProcess(spawned, parsed.parsed);
handleInput$1(spawned, parsed.options.input);
spawned.all = makeAllStream$1(spawned, parsed.options);
return mergePromise$1(spawned, handlePromiseOnce);
};
var execa_1 = execa;
var sync$4 = (file, args, options) => {
const parsed = handleArguments(file, args, options);
const command = joinCommand$1(file, args);
validateInputSync$1(parsed.options);
let result;
try {
result = childProcess__default['default'].spawnSync(parsed.file, parsed.args, parsed.options);
} catch (error) {
throw error$1({
error,
stdout: '',
stderr: '',
all: '',
command,
parsed,
timedOut: false,
isCanceled: false,
killed: false
});
}
const stdout = handleOutput(parsed.options, result.stdout, result.error);
const stderr = handleOutput(parsed.options, result.stderr, result.error);
if (result.error || result.status !== 0 || result.signal !== null) {
const error = error$1({
stdout,
stderr,
error: result.error,
signal: result.signal,
exitCode: result.status,
command,
parsed,
timedOut: result.error && result.error.code === 'ETIMEDOUT',
isCanceled: false,
killed: result.signal !== null
});
if (!parsed.options.reject) {
return error;
}
throw error;
}
return {
command,
exitCode: 0,
stdout,
stderr,
failed: false,
timedOut: false,
isCanceled: false,
killed: false
};
};
var command$3 = (command, options) => {
const [file, ...args] = parseCommand$1(command);
return execa(file, args, options);
};
var commandSync = (command, options) => {
const [file, ...args] = parseCommand$1(command);
return execa.sync(file, args, options);
};
var node$1 = (scriptPath, args, options = {}) => {
if (args && !Array.isArray(args) && typeof args === 'object') {
options = args;
args = [];
}
const stdio$1 = stdio.node(options);
const {nodePath = process.execPath, nodeOptions = process.execArgv} = options;
return execa(
nodePath,
[
...nodeOptions,
scriptPath,
...(Array.isArray(args) ? args : [])
],
{
...options,
stdin: undefined,
stdout: undefined,
stderr: undefined,
stdio: stdio$1,
shell: false
}
);
};
execa_1.sync = sync$4;
execa_1.command = command$3;
execa_1.commandSync = commandSync;
execa_1.node = node$1;
function getUserAgent() {
if (typeof navigator === "object" && "userAgent" in navigator) {
return navigator.userAgent;
}
if (typeof process === "object" && "version" in process) {
return `Node.js/${process.version.substr(1)} (${process.platform}; ${process.arch})`;
}
return "<environment undetectable>";
}
var register_1 = register;
function register (state, name, method, options) {
if (typeof method !== 'function') {
throw new Error('method for before hook must be a function')
}
if (!options) {
options = {};
}
if (Array.isArray(name)) {
return name.reverse().reduce(function (callback, name) {
return register.bind(null, state, name, callback, options)
}, method)()
}
return Promise.resolve()
.then(function () {
if (!state.registry[name]) {
return method(options)
}
return (state.registry[name]).reduce(function (method, registered) {
return registered.hook.bind(null, method, options)
}, method)()
})
}
var add = addHook;
function addHook (state, kind, name, hook) {
var orig = hook;
if (!state.registry[name]) {
state.registry[name] = [];
}
if (kind === 'before') {
hook = function (method, options) {
return Promise.resolve()
.then(orig.bind(null, options))
.then(method.bind(null, options))
};
}
if (kind === 'after') {
hook = function (method, options) {
var result;
return Promise.resolve()
.then(method.bind(null, options))
.then(function (result_) {
result = result_;
return orig(result, options)
})
.then(function () {
return result
})
};
}
if (kind === 'error') {
hook = function (method, options) {
return Promise.resolve()
.then(method.bind(null, options))
.catch(function (error) {
return orig(error, options)
})
};
}
state.registry[name].push({
hook: hook,
orig: orig
});
}
var remove$2 = removeHook;
function removeHook (state, name, method) {
if (!state.registry[name]) {
return
}
var index = state.registry[name]
.map(function (registered) { return registered.orig })
.indexOf(method);
if (index === -1) {
return
}
state.registry[name].splice(index, 1);
}
// bind with array of arguments: https://stackoverflow.com/a/21792913
var bind = Function.bind;
var bindable = bind.bind(bind);
function bindApi (hook, state, name) {
var removeHookRef = bindable(remove$2, null).apply(null, name ? [state, name] : [state]);
hook.api = { remove: removeHookRef };
hook.remove = removeHookRef
;['before', 'error', 'after', 'wrap'].forEach(function (kind) {
var args = name ? [state, kind, name] : [state, kind];
hook[kind] = hook.api[kind] = bindable(add, null).apply(null, args);
});
}
function HookSingular () {
var singularHookName = 'h';
var singularHookState = {
registry: {}
};
var singularHook = register_1.bind(null, singularHookState, singularHookName);
bindApi(singularHook, singularHookState, singularHookName);
return singularHook
}
function HookCollection () {
var state = {
registry: {}
};
var hook = register_1.bind(null, state);
bindApi(hook, state);
return hook
}
var collectionHookDeprecationMessageDisplayed = false;
function Hook () {
if (!collectionHookDeprecationMessageDisplayed) {
console.warn('[before-after-hook]: "Hook()" repurposing warning, use "Hook.Collection()". Read more: https://git.io/upgrade-before-after-hook-to-1.4');
collectionHookDeprecationMessageDisplayed = true;
}
return HookCollection()
}
Hook.Singular = HookSingular.bind();
Hook.Collection = HookCollection.bind();
var beforeAfterHook = Hook;
// expose constructors as a named property for TypeScript
var Hook_1 = Hook;
var Singular = Hook.Singular;
var Collection = Hook.Collection;
beforeAfterHook.Hook = Hook_1;
beforeAfterHook.Singular = Singular;
beforeAfterHook.Collection = Collection;
/*!
* is-plain-object <https://github.com/jonschlinkert/is-plain-object>
*
* Copyright (c) 2014-2017, Jon Schlinkert.
* Released under the MIT License.
*/
function isObject(o) {
return Object.prototype.toString.call(o) === '[object Object]';
}
function isPlainObject(o) {
var ctor,prot;
if (isObject(o) === false) return false;
// If has modified constructor
ctor = o.constructor;
if (ctor === undefined) return true;
// If has modified prototype
prot = ctor.prototype;
if (isObject(prot) === false) return false;
// If constructor does not have an Object-specific method
if (prot.hasOwnProperty('isPrototypeOf') === false) {
return false;
}
// Most likely a plain Object
return true;
}
function lowercaseKeys(object) {
if (!object) {
return {};
}
return Object.keys(object).reduce((newObj, key) => {
newObj[key.toLowerCase()] = object[key];
return newObj;
}, {});
}
function mergeDeep(defaults, options) {
const result = Object.assign({}, defaults);
Object.keys(options).forEach((key) => {
if (isPlainObject(options[key])) {
if (!(key in defaults))
Object.assign(result, { [key]: options[key] });
else
result[key] = mergeDeep(defaults[key], options[key]);
}
else {
Object.assign(result, { [key]: options[key] });
}
});
return result;
}
function merge(defaults, route, options) {
if (typeof route === "string") {
let [method, url] = route.split(" ");
options = Object.assign(url ? { method, url } : { url: method }, options);
}
else {
options = Object.assign({}, route);
}
// lowercase header names before merging with defaults to avoid duplicates
options.headers = lowercaseKeys(options.headers);
const mergedOptions = mergeDeep(defaults || {}, options);
// mediaType.previews arrays are merged, instead of overwritten
if (defaults && defaults.mediaType.previews.length) {
mergedOptions.mediaType.previews = defaults.mediaType.previews
.filter((preview) => !mergedOptions.mediaType.previews.includes(preview))
.concat(mergedOptions.mediaType.previews);
}
mergedOptions.mediaType.previews = mergedOptions.mediaType.previews.map((preview) => preview.replace(/-preview/, ""));
return mergedOptions;
}
function addQueryParameters(url, parameters) {
const separator = /\?/.test(url) ? "&" : "?";
const names = Object.keys(parameters);
if (names.length === 0) {
return url;
}
return (url +
separator +
names
.map((name) => {
if (name === "q") {
return ("q=" + parameters.q.split("+").map(encodeURIComponent).join("+"));
}
return `${name}=${encodeURIComponent(parameters[name])}`;
})
.join("&"));
}
const urlVariableRegex = /\{[^}]+\}/g;
function removeNonChars(variableName) {
return variableName.replace(/^\W+|\W+$/g, "").split(/,/);
}
function extractUrlVariableNames(url) {
const matches = url.match(urlVariableRegex);
if (!matches) {
return [];
}
return matches.map(removeNonChars).reduce((a, b) => a.concat(b), []);
}
function omit(object, keysToOmit) {
return Object.keys(object)
.filter((option) => !keysToOmit.includes(option))
.reduce((obj, key) => {
obj[key] = object[key];
return obj;
}, {});
}
// Based on https://github.com/bramstein/url-template, licensed under BSD
// TODO: create separate package.
//
// Copyright (c) 2012-2014, Bram Stein
// All rights reserved.
// Redistribution and use in source and binary forms, with or without
// modification, are permitted provided that the following conditions
// are met:
// 1. Redistributions of source code must retain the above copyright
// notice, this list of conditions and the following disclaimer.
// 2. Redistributions in binary form must reproduce the above copyright
// notice, this list of conditions and the following disclaimer in the
// documentation and/or other materials provided with the distribution.
// 3. The name of the author may not be used to endorse or promote products
// derived from this software without specific prior written permission.
// THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS OR IMPLIED
// WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
// MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO
// EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT,
// INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
// BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY
// OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
// NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE,
// EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
/* istanbul ignore file */
function encodeReserved(str) {
return str
.split(/(%[0-9A-Fa-f]{2})/g)
.map(function (part) {
if (!/%[0-9A-Fa-f]/.test(part)) {
part = encodeURI(part).replace(/%5B/g, "[").replace(/%5D/g, "]");
}
return part;
})
.join("");
}
function encodeUnreserved(str) {
return encodeURIComponent(str).replace(/[!'()*]/g, function (c) {
return "%" + c.charCodeAt(0).toString(16).toUpperCase();
});
}
function encodeValue(operator, value, key) {
value =
operator === "+" || operator === "#"
? encodeReserved(value)
: encodeUnreserved(value);
if (key) {
return encodeUnreserved(key) + "=" + value;
}
else {
return value;
}
}
function isDefined(value) {
return value !== undefined && value !== null;
}
function isKeyOperator(operator) {
return operator === ";" || operator === "&" || operator === "?";
}
function getValues(context, operator, key, modifier) {
var value = context[key], result = [];
if (isDefined(value) && value !== "") {
if (typeof value === "string" ||
typeof value === "number" ||
typeof value === "boolean") {
value = value.toString();
if (modifier && modifier !== "*") {
value = value.substring(0, parseInt(modifier, 10));
}
result.push(encodeValue(operator, value, isKeyOperator(operator) ? key : ""));
}
else {
if (modifier === "*") {
if (Array.isArray(value)) {
value.filter(isDefined).forEach(function (value) {
result.push(encodeValue(operator, value, isKeyOperator(operator) ? key : ""));
});
}
else {
Object.keys(value).forEach(function (k) {
if (isDefined(value[k])) {
result.push(encodeValue(operator, value[k], k));
}
});
}
}
else {
const tmp = [];
if (Array.isArray(value)) {
value.filter(isDefined).forEach(function (value) {
tmp.push(encodeValue(operator, value));
});
}
else {
Object.keys(value).forEach(function (k) {
if (isDefined(value[k])) {
tmp.push(encodeUnreserved(k));
tmp.push(encodeValue(operator, value[k].toString()));
}
});
}
if (isKeyOperator(operator)) {
result.push(encodeUnreserved(key) + "=" + tmp.join(","));
}
else if (tmp.length !== 0) {
result.push(tmp.join(","));
}
}
}
}
else {
if (operator === ";") {
if (isDefined(value)) {
result.push(encodeUnreserved(key));
}
}
else if (value === "" && (operator === "&" || operator === "?")) {
result.push(encodeUnreserved(key) + "=");
}
else if (value === "") {
result.push("");
}
}
return result;
}
function parseUrl(template) {
return {
expand: expand.bind(null, template),
};
}
function expand(template, context) {
var operators = ["+", "#", ".", "/", ";", "?", "&"];
return template.replace(/\{([^\{\}]+)\}|([^\{\}]+)/g, function (_, expression, literal) {
if (expression) {
let operator = "";
const values = [];
if (operators.indexOf(expression.charAt(0)) !== -1) {
operator = expression.charAt(0);
expression = expression.substr(1);
}
expression.split(/,/g).forEach(function (variable) {
var tmp = /([^:\*]*)(?::(\d+)|(\*))?/.exec(variable);
values.push(getValues(context, operator, tmp[1], tmp[2] || tmp[3]));
});
if (operator && operator !== "+") {
var separator = ",";
if (operator === "?") {
separator = "&";
}
else if (operator !== "#") {
separator = operator;
}
return (values.length !== 0 ? operator : "") + values.join(separator);
}
else {
return values.join(",");
}
}
else {
return encodeReserved(literal);
}
});
}
function parse$1(options) {
// https://fetch.spec.whatwg.org/#methods
let method = options.method.toUpperCase();
// replace :varname with {varname} to make it RFC 6570 compatible
let url = (options.url || "/").replace(/:([a-z]\w+)/g, "{+$1}");
let headers = Object.assign({}, options.headers);
let body;
let parameters = omit(options, [
"method",
"baseUrl",
"url",
"headers",
"request",
"mediaType",
]);
// extract variable names from URL to calculate remaining variables later
const urlVariableNames = extractUrlVariableNames(url);
url = parseUrl(url).expand(parameters);
if (!/^http/.test(url)) {
url = options.baseUrl + url;
}
const omittedParameters = Object.keys(options)
.filter((option) => urlVariableNames.includes(option))
.concat("baseUrl");
const remainingParameters = omit(parameters, omittedParameters);
const isBinaryRequest = /application\/octet-stream/i.test(headers.accept);
if (!isBinaryRequest) {
if (options.mediaType.format) {
// e.g. application/vnd.github.v3+json => application/vnd.github.v3.raw
headers.accept = headers.accept
.split(/,/)
.map((preview) => preview.replace(/application\/vnd(\.\w+)(\.v3)?(\.\w+)?(\+json)?$/, `application/vnd$1$2.${options.mediaType.format}`))
.join(",");
}
if (options.mediaType.previews.length) {
const previewsFromAcceptHeader = headers.accept.match(/[\w-]+(?=-preview)/g) || [];
headers.accept = previewsFromAcceptHeader
.concat(options.mediaType.previews)
.map((preview) => {
const format = options.mediaType.format
? `.${options.mediaType.format}`
: "+json";
return `application/vnd.github.${preview}-preview${format}`;
})
.join(",");
}
}
// for GET/HEAD requests, set URL query parameters from remaining parameters
// for PATCH/POST/PUT/DELETE requests, set request body from remaining parameters
if (["GET", "HEAD"].includes(method)) {
url = addQueryParameters(url, remainingParameters);
}
else {
if ("data" in remainingParameters) {
body = remainingParameters.data;
}
else {
if (Object.keys(remainingParameters).length) {
body = remainingParameters;
}
else {
headers["content-length"] = 0;
}
}
}
// default content-type for JSON if body is set
if (!headers["content-type"] && typeof body !== "undefined") {
headers["content-type"] = "application/json; charset=utf-8";
}
// GitHub expects 'content-length: 0' header for PUT/PATCH requests without body.
// fetch does not allow to set `content-length` header, but we can set body to an empty string
if (["PATCH", "PUT"].includes(method) && typeof body === "undefined") {
body = "";
}
// Only return body/request keys if present
return Object.assign({ method, url, headers }, typeof body !== "undefined" ? { body } : null, options.request ? { request: options.request } : null);
}
function endpointWithDefaults(defaults, route, options) {
return parse$1(merge(defaults, route, options));
}
function withDefaults(oldDefaults, newDefaults) {
const DEFAULTS = merge(oldDefaults, newDefaults);
const endpoint = endpointWithDefaults.bind(null, DEFAULTS);
return Object.assign(endpoint, {
DEFAULTS,
defaults: withDefaults.bind(null, DEFAULTS),
merge: merge.bind(null, DEFAULTS),
parse: parse$1,
});
}
const VERSION = "6.0.6";
const userAgent = `octokit-endpoint.js/${VERSION} ${getUserAgent()}`;
// DEFAULTS has all properties set that EndpointOptions has, except url.
// So we use RequestParameters and add method as additional required property.
const DEFAULTS = {
method: "GET",
baseUrl: "https://api.github.com",
headers: {
accept: "application/vnd.github.v3+json",
"user-agent": userAgent,
},
mediaType: {
format: "",
previews: [],
},
};
const endpoint = withDefaults(null, DEFAULTS);
// Based on https://github.com/tmpvar/jsdom/blob/aa85b2abf07766ff7bf5c1f6daafb3726f2f2db5/lib/jsdom/living/blob.js
// fix for "Readable" isn't a named export issue
const Readable = Stream__default['default'].Readable;
const BUFFER = Symbol('buffer');
const TYPE = Symbol('type');
class Blob {
constructor() {
this[TYPE] = '';
const blobParts = arguments[0];
const options = arguments[1];
const buffers = [];
let size = 0;
if (blobParts) {
const a = blobParts;
const length = Number(a.length);
for (let i = 0; i < length; i++) {
const element = a[i];
let buffer;
if (element instanceof Buffer) {
buffer = element;
} else if (ArrayBuffer.isView(element)) {
buffer = Buffer.from(element.buffer, element.byteOffset, element.byteLength);
} else if (element instanceof ArrayBuffer) {
buffer = Buffer.from(element);
} else if (element instanceof Blob) {
buffer = element[BUFFER];
} else {
buffer = Buffer.from(typeof element === 'string' ? element : String(element));
}
size += buffer.length;
buffers.push(buffer);
}
}
this[BUFFER] = Buffer.concat(buffers);
let type = options && options.type !== undefined && String(options.type).toLowerCase();
if (type && !/[^\u0020-\u007E]/.test(type)) {
this[TYPE] = type;
}
}
get size() {
return this[BUFFER].length;
}
get type() {
return this[TYPE];
}
text() {
return Promise.resolve(this[BUFFER].toString());
}
arrayBuffer() {
const buf = this[BUFFER];
const ab = buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength);
return Promise.resolve(ab);
}
stream() {
const readable = new Readable();
readable._read = function () {};
readable.push(this[BUFFER]);
readable.push(null);
return readable;
}
toString() {
return '[object Blob]';
}
slice() {
const size = this.size;
const start = arguments[0];
const end = arguments[1];
let relativeStart, relativeEnd;
if (start === undefined) {
relativeStart = 0;
} else if (start < 0) {
relativeStart = Math.max(size + start, 0);
} else {
relativeStart = Math.min(start, size);
}
if (end === undefined) {
relativeEnd = size;
} else if (end < 0) {
relativeEnd = Math.max(size + end, 0);
} else {
relativeEnd = Math.min(end, size);
}
const span = Math.max(relativeEnd - relativeStart, 0);
const buffer = this[BUFFER];
const slicedBuffer = buffer.slice(relativeStart, relativeStart + span);
const blob = new Blob([], { type: arguments[2] });
blob[BUFFER] = slicedBuffer;
return blob;
}
}
Object.defineProperties(Blob.prototype, {
size: { enumerable: true },
type: { enumerable: true },
slice: { enumerable: true }
});
Object.defineProperty(Blob.prototype, Symbol.toStringTag, {
value: 'Blob',
writable: false,
enumerable: false,
configurable: true
});
/**
* fetch-error.js
*
* FetchError interface for operational errors
*/
/**
* Create FetchError instance
*
* @param String message Error message for human
* @param String type Error type for machine
* @param String systemError For Node.js system error
* @return FetchError
*/
function FetchError(message, type, systemError) {
Error.call(this, message);
this.message = message;
this.type = type;
// when err.type is `system`, err.code contains system error code
if (systemError) {
this.code = this.errno = systemError.code;
}
// hide custom error implementation details from end-users
Error.captureStackTrace(this, this.constructor);
}
FetchError.prototype = Object.create(Error.prototype);
FetchError.prototype.constructor = FetchError;
FetchError.prototype.name = 'FetchError';
let convert;
try {
convert = require('encoding').convert;
} catch (e) {}
const INTERNALS = Symbol('Body internals');
// fix an issue where "PassThrough" isn't a named export for node <10
const PassThrough$1 = Stream__default['default'].PassThrough;
/**
* Body mixin
*
* Ref: https://fetch.spec.whatwg.org/#body
*
* @param Stream body Readable stream
* @param Object opts Response options
* @return Void
*/
function Body(body) {
var _this = this;
var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
_ref$size = _ref.size;
let size = _ref$size === undefined ? 0 : _ref$size;
var _ref$timeout = _ref.timeout;
let timeout = _ref$timeout === undefined ? 0 : _ref$timeout;
if (body == null) {
// body is undefined or null
body = null;
} else if (isURLSearchParams(body)) {
// body is a URLSearchParams
body = Buffer.from(body.toString());
} else if (isBlob(body)) ; else if (Buffer.isBuffer(body)) ; else if (Object.prototype.toString.call(body) === '[object ArrayBuffer]') {
// body is ArrayBuffer
body = Buffer.from(body);
} else if (ArrayBuffer.isView(body)) {
// body is ArrayBufferView
body = Buffer.from(body.buffer, body.byteOffset, body.byteLength);
} else if (body instanceof Stream__default['default']) ; else {
// none of the above
// coerce to string then buffer
body = Buffer.from(String(body));
}
this[INTERNALS] = {
body,
disturbed: false,
error: null
};
this.size = size;
this.timeout = timeout;
if (body instanceof Stream__default['default']) {
body.on('error', function (err) {
const error = err.name === 'AbortError' ? err : new FetchError(`Invalid response body while trying to fetch ${_this.url}: ${err.message}`, 'system', err);
_this[INTERNALS].error = error;
});
}
}
Body.prototype = {
get body() {
return this[INTERNALS].body;
},
get bodyUsed() {
return this[INTERNALS].disturbed;
},
/**
* Decode response as ArrayBuffer
*
* @return Promise
*/
arrayBuffer() {
return consumeBody.call(this).then(function (buf) {
return buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength);
});
},
/**
* Return raw response as Blob
*
* @return Promise
*/
blob() {
let ct = this.headers && this.headers.get('content-type') || '';
return consumeBody.call(this).then(function (buf) {
return Object.assign(
// Prevent copying
new Blob([], {
type: ct.toLowerCase()
}), {
[BUFFER]: buf
});
});
},
/**
* Decode response as json
*
* @return Promise
*/
json() {
var _this2 = this;
return consumeBody.call(this).then(function (buffer) {
try {
return JSON.parse(buffer.toString());
} catch (err) {
return Body.Promise.reject(new FetchError(`invalid json response body at ${_this2.url} reason: ${err.message}`, 'invalid-json'));
}
});
},
/**
* Decode response as text
*
* @return Promise
*/
text() {
return consumeBody.call(this).then(function (buffer) {
return buffer.toString();
});
},
/**
* Decode response as buffer (non-spec api)
*
* @return Promise
*/
buffer() {
return consumeBody.call(this);
},
/**
* Decode response as text, while automatically detecting the encoding and
* trying to decode to UTF-8 (non-spec api)
*
* @return Promise
*/
textConverted() {
var _this3 = this;
return consumeBody.call(this).then(function (buffer) {
return convertBody(buffer, _this3.headers);
});
}
};
// In browsers, all properties are enumerable.
Object.defineProperties(Body.prototype, {
body: { enumerable: true },
bodyUsed: { enumerable: true },
arrayBuffer: { enumerable: true },
blob: { enumerable: true },
json: { enumerable: true },
text: { enumerable: true }
});
Body.mixIn = function (proto) {
for (const name of Object.getOwnPropertyNames(Body.prototype)) {
// istanbul ignore else: future proof
if (!(name in proto)) {
const desc = Object.getOwnPropertyDescriptor(Body.prototype, name);
Object.defineProperty(proto, name, desc);
}
}
};
/**
* Consume and convert an entire Body to a Buffer.
*
* Ref: https://fetch.spec.whatwg.org/#concept-body-consume-body
*
* @return Promise
*/
function consumeBody() {
var _this4 = this;
if (this[INTERNALS].disturbed) {
return Body.Promise.reject(new TypeError(`body used already for: ${this.url}`));
}
this[INTERNALS].disturbed = true;
if (this[INTERNALS].error) {
return Body.Promise.reject(this[INTERNALS].error);
}
let body = this.body;
// body is null
if (body === null) {
return Body.Promise.resolve(Buffer.alloc(0));
}
// body is blob
if (isBlob(body)) {
body = body.stream();
}
// body is buffer
if (Buffer.isBuffer(body)) {
return Body.Promise.resolve(body);
}
// istanbul ignore if: should never happen
if (!(body instanceof Stream__default['default'])) {
return Body.Promise.resolve(Buffer.alloc(0));
}
// body is stream
// get ready to actually consume the body
let accum = [];
let accumBytes = 0;
let abort = false;
return new Body.Promise(function (resolve, reject) {
let resTimeout;
// allow timeout on slow response body
if (_this4.timeout) {
resTimeout = setTimeout(function () {
abort = true;
reject(new FetchError(`Response timeout while trying to fetch ${_this4.url} (over ${_this4.timeout}ms)`, 'body-timeout'));
}, _this4.timeout);
}
// handle stream errors
body.on('error', function (err) {
if (err.name === 'AbortError') {
// if the request was aborted, reject with this Error
abort = true;
reject(err);
} else {
// other errors, such as incorrect content-encoding
reject(new FetchError(`Invalid response body while trying to fetch ${_this4.url}: ${err.message}`, 'system', err));
}
});
body.on('data', function (chunk) {
if (abort || chunk === null) {
return;
}
if (_this4.size && accumBytes + chunk.length > _this4.size) {
abort = true;
reject(new FetchError(`content size at ${_this4.url} over limit: ${_this4.size}`, 'max-size'));
return;
}
accumBytes += chunk.length;
accum.push(chunk);
});
body.on('end', function () {
if (abort) {
return;
}
clearTimeout(resTimeout);
try {
resolve(Buffer.concat(accum, accumBytes));
} catch (err) {
// handle streams that have accumulated too much data (issue #414)
reject(new FetchError(`Could not create Buffer from response body for ${_this4.url}: ${err.message}`, 'system', err));
}
});
});
}
/**
* Detect buffer encoding and convert to target encoding
* ref: http://www.w3.org/TR/2011/WD-html5-20110113/parsing.html#determining-the-character-encoding
*
* @param Buffer buffer Incoming buffer
* @param String encoding Target encoding
* @return String
*/
function convertBody(buffer, headers) {
if (typeof convert !== 'function') {
throw new Error('The package `encoding` must be installed to use the textConverted() function');
}
const ct = headers.get('content-type');
let charset = 'utf-8';
let res, str;
// header
if (ct) {
res = /charset=([^;]*)/i.exec(ct);
}
// no charset in content type, peek at response body for at most 1024 bytes
str = buffer.slice(0, 1024).toString();
// html5
if (!res && str) {
res = /<meta.+?charset=(['"])(.+?)\1/i.exec(str);
}
// html4
if (!res && str) {
res = /<meta[\s]+?http-equiv=(['"])content-type\1[\s]+?content=(['"])(.+?)\2/i.exec(str);
if (!res) {
res = /<meta[\s]+?content=(['"])(.+?)\1[\s]+?http-equiv=(['"])content-type\3/i.exec(str);
if (res) {
res.pop(); // drop last quote
}
}
if (res) {
res = /charset=(.*)/i.exec(res.pop());
}
}
// xml
if (!res && str) {
res = /<\?xml.+?encoding=(['"])(.+?)\1/i.exec(str);
}
// found charset
if (res) {
charset = res.pop();
// prevent decode issues when sites use incorrect encoding
// ref: https://hsivonen.fi/encoding-menu/
if (charset === 'gb2312' || charset === 'gbk') {
charset = 'gb18030';
}
}
// turn raw buffers into a single utf-8 buffer
return convert(buffer, 'UTF-8', charset).toString();
}
/**
* Detect a URLSearchParams object
* ref: https://github.com/bitinn/node-fetch/issues/296#issuecomment-307598143
*
* @param Object obj Object to detect by type or brand
* @return String
*/
function isURLSearchParams(obj) {
// Duck-typing as a necessary condition.
if (typeof obj !== 'object' || typeof obj.append !== 'function' || typeof obj.delete !== 'function' || typeof obj.get !== 'function' || typeof obj.getAll !== 'function' || typeof obj.has !== 'function' || typeof obj.set !== 'function') {
return false;
}
// Brand-checking and more duck-typing as optional condition.
return obj.constructor.name === 'URLSearchParams' || Object.prototype.toString.call(obj) === '[object URLSearchParams]' || typeof obj.sort === 'function';
}
/**
* Check if `obj` is a W3C `Blob` object (which `File` inherits from)
* @param {*} obj
* @return {boolean}
*/
function isBlob(obj) {
return typeof obj === 'object' && typeof obj.arrayBuffer === 'function' && typeof obj.type === 'string' && typeof obj.stream === 'function' && typeof obj.constructor === 'function' && typeof obj.constructor.name === 'string' && /^(Blob|File)$/.test(obj.constructor.name) && /^(Blob|File)$/.test(obj[Symbol.toStringTag]);
}
/**
* Clone body given Res/Req instance
*
* @param Mixed instance Response or Request instance
* @return Mixed
*/
function clone$1(instance) {
let p1, p2;
let body = instance.body;
// don't allow cloning a used body
if (instance.bodyUsed) {
throw new Error('cannot clone body after it is used');
}
// check that body is a stream and not form-data object
// note: we can't clone the form-data object without having it as a dependency
if (body instanceof Stream__default['default'] && typeof body.getBoundary !== 'function') {
// tee instance body
p1 = new PassThrough$1();
p2 = new PassThrough$1();
body.pipe(p1);
body.pipe(p2);
// set instance body to teed body and return the other teed body
instance[INTERNALS].body = p1;
body = p2;
}
return body;
}
/**
* Performs the operation "extract a `Content-Type` value from |object|" as
* specified in the specification:
* https://fetch.spec.whatwg.org/#concept-bodyinit-extract
*
* This function assumes that instance.body is present.
*
* @param Mixed instance Any options.body input
*/
function extractContentType(body) {
if (body === null) {
// body is null
return null;
} else if (typeof body === 'string') {
// body is string
return 'text/plain;charset=UTF-8';
} else if (isURLSearchParams(body)) {
// body is a URLSearchParams
return 'application/x-www-form-urlencoded;charset=UTF-8';
} else if (isBlob(body)) {
// body is blob
return body.type || null;
} else if (Buffer.isBuffer(body)) {
// body is buffer
return null;
} else if (Object.prototype.toString.call(body) === '[object ArrayBuffer]') {
// body is ArrayBuffer
return null;
} else if (ArrayBuffer.isView(body)) {
// body is ArrayBufferView
return null;
} else if (typeof body.getBoundary === 'function') {
// detect form data input from form-data module
return `multipart/form-data;boundary=${body.getBoundary()}`;
} else if (body instanceof Stream__default['default']) {
// body is stream
// can't really do much about this
return null;
} else {
// Body constructor defaults other things to string
return 'text/plain;charset=UTF-8';
}
}
/**
* The Fetch Standard treats this as if "total bytes" is a property on the body.
* For us, we have to explicitly get it with a function.
*
* ref: https://fetch.spec.whatwg.org/#concept-body-total-bytes
*
* @param Body instance Instance of Body
* @return Number? Number of bytes, or null if not possible
*/
function getTotalBytes(instance) {
const body = instance.body;
if (body === null) {
// body is null
return 0;
} else if (isBlob(body)) {
return body.size;
} else if (Buffer.isBuffer(body)) {
// body is buffer
return body.length;
} else if (body && typeof body.getLengthSync === 'function') {
// detect form data input from form-data module
if (body._lengthRetrievers && body._lengthRetrievers.length == 0 || // 1.x
body.hasKnownLength && body.hasKnownLength()) {
// 2.x
return body.getLengthSync();
}
return null;
} else {
// body is stream
return null;
}
}
/**
* Write a Body to a Node.js WritableStream (e.g. http.Request) object.
*
* @param Body instance Instance of Body
* @return Void
*/
function writeToStream(dest, instance) {
const body = instance.body;
if (body === null) {
// body is null
dest.end();
} else if (isBlob(body)) {
body.stream().pipe(dest);
} else if (Buffer.isBuffer(body)) {
// body is buffer
dest.write(body);
dest.end();
} else {
// body is stream
body.pipe(dest);
}
}
// expose Promise
Body.Promise = global.Promise;
/**
* headers.js
*
* Headers class offers convenient helpers
*/
const invalidTokenRegex = /[^\^_`a-zA-Z\-0-9!#$%&'*+.|~]/;
const invalidHeaderCharRegex = /[^\t\x20-\x7e\x80-\xff]/;
function validateName(name) {
name = `${name}`;
if (invalidTokenRegex.test(name) || name === '') {
throw new TypeError(`${name} is not a legal HTTP header name`);
}
}
function validateValue(value) {
value = `${value}`;
if (invalidHeaderCharRegex.test(value)) {
throw new TypeError(`${value} is not a legal HTTP header value`);
}
}
/**
* Find the key in the map object given a header name.
*
* Returns undefined if not found.
*
* @param String name Header name
* @return String|Undefined
*/
function find(map, name) {
name = name.toLowerCase();
for (const key in map) {
if (key.toLowerCase() === name) {
return key;
}
}
return undefined;
}
const MAP = Symbol('map');
class Headers {
/**
* Headers class
*
* @param Object headers Response headers
* @return Void
*/
constructor() {
let init = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : undefined;
this[MAP] = Object.create(null);
if (init instanceof Headers) {
const rawHeaders = init.raw();
const headerNames = Object.keys(rawHeaders);
for (const headerName of headerNames) {
for (const value of rawHeaders[headerName]) {
this.append(headerName, value);
}
}
return;
}
// We don't worry about converting prop to ByteString here as append()
// will handle it.
if (init == null) ; else if (typeof init === 'object') {
const method = init[Symbol.iterator];
if (method != null) {
if (typeof method !== 'function') {
throw new TypeError('Header pairs must be iterable');
}
// sequence<sequence<ByteString>>
// Note: per spec we have to first exhaust the lists then process them
const pairs = [];
for (const pair of init) {
if (typeof pair !== 'object' || typeof pair[Symbol.iterator] !== 'function') {
throw new TypeError('Each header pair must be iterable');
}
pairs.push(Array.from(pair));
}
for (const pair of pairs) {
if (pair.length !== 2) {
throw new TypeError('Each header pair must be a name/value tuple');
}
this.append(pair[0], pair[1]);
}
} else {
// record<ByteString, ByteString>
for (const key of Object.keys(init)) {
const value = init[key];
this.append(key, value);
}
}
} else {
throw new TypeError('Provided initializer must be an object');
}
}
/**
* Return combined header value given name
*
* @param String name Header name
* @return Mixed
*/
get(name) {
name = `${name}`;
validateName(name);
const key = find(this[MAP], name);
if (key === undefined) {
return null;
}
return this[MAP][key].join(', ');
}
/**
* Iterate over all headers
*
* @param Function callback Executed for each item with parameters (value, name, thisArg)
* @param Boolean thisArg `this` context for callback function
* @return Void
*/
forEach(callback) {
let thisArg = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : undefined;
let pairs = getHeaders(this);
let i = 0;
while (i < pairs.length) {
var _pairs$i = pairs[i];
const name = _pairs$i[0],
value = _pairs$i[1];
callback.call(thisArg, value, name, this);
pairs = getHeaders(this);
i++;
}
}
/**
* Overwrite header values given name
*
* @param String name Header name
* @param String value Header value
* @return Void
*/
set(name, value) {
name = `${name}`;
value = `${value}`;
validateName(name);
validateValue(value);
const key = find(this[MAP], name);
this[MAP][key !== undefined ? key : name] = [value];
}
/**
* Append a value onto existing header
*
* @param String name Header name
* @param String value Header value
* @return Void
*/
append(name, value) {
name = `${name}`;
value = `${value}`;
validateName(name);
validateValue(value);
const key = find(this[MAP], name);
if (key !== undefined) {
this[MAP][key].push(value);
} else {
this[MAP][name] = [value];
}
}
/**
* Check for header name existence
*
* @param String name Header name
* @return Boolean
*/
has(name) {
name = `${name}`;
validateName(name);
return find(this[MAP], name) !== undefined;
}
/**
* Delete all header values given name
*
* @param String name Header name
* @return Void
*/
delete(name) {
name = `${name}`;
validateName(name);
const key = find(this[MAP], name);
if (key !== undefined) {
delete this[MAP][key];
}
}
/**
* Return raw headers (non-spec api)
*
* @return Object
*/
raw() {
return this[MAP];
}
/**
* Get an iterator on keys.
*
* @return Iterator
*/
keys() {
return createHeadersIterator(this, 'key');
}
/**
* Get an iterator on values.
*
* @return Iterator
*/
values() {
return createHeadersIterator(this, 'value');
}
/**
* Get an iterator on entries.
*
* This is the default iterator of the Headers object.
*
* @return Iterator
*/
[Symbol.iterator]() {
return createHeadersIterator(this, 'key+value');
}
}
Headers.prototype.entries = Headers.prototype[Symbol.iterator];
Object.defineProperty(Headers.prototype, Symbol.toStringTag, {
value: 'Headers',
writable: false,
enumerable: false,
configurable: true
});
Object.defineProperties(Headers.prototype, {
get: { enumerable: true },
forEach: { enumerable: true },
set: { enumerable: true },
append: { enumerable: true },
has: { enumerable: true },
delete: { enumerable: true },
keys: { enumerable: true },
values: { enumerable: true },
entries: { enumerable: true }
});
function getHeaders(headers) {
let kind = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'key+value';
const keys = Object.keys(headers[MAP]).sort();
return keys.map(kind === 'key' ? function (k) {
return k.toLowerCase();
} : kind === 'value' ? function (k) {
return headers[MAP][k].join(', ');
} : function (k) {
return [k.toLowerCase(), headers[MAP][k].join(', ')];
});
}
const INTERNAL = Symbol('internal');
function createHeadersIterator(target, kind) {
const iterator = Object.create(HeadersIteratorPrototype);
iterator[INTERNAL] = {
target,
kind,
index: 0
};
return iterator;
}
const HeadersIteratorPrototype = Object.setPrototypeOf({
next() {
// istanbul ignore if
if (!this || Object.getPrototypeOf(this) !== HeadersIteratorPrototype) {
throw new TypeError('Value of `this` is not a HeadersIterator');
}
var _INTERNAL = this[INTERNAL];
const target = _INTERNAL.target,
kind = _INTERNAL.kind,
index = _INTERNAL.index;
const values = getHeaders(target, kind);
const len = values.length;
if (index >= len) {
return {
value: undefined,
done: true
};
}
this[INTERNAL].index = index + 1;
return {
value: values[index],
done: false
};
}
}, Object.getPrototypeOf(Object.getPrototypeOf([][Symbol.iterator]())));
Object.defineProperty(HeadersIteratorPrototype, Symbol.toStringTag, {
value: 'HeadersIterator',
writable: false,
enumerable: false,
configurable: true
});
/**
* Export the Headers object in a form that Node.js can consume.
*
* @param Headers headers
* @return Object
*/
function exportNodeCompatibleHeaders(headers) {
const obj = Object.assign({ __proto__: null }, headers[MAP]);
// http.request() only supports string as Host header. This hack makes
// specifying custom Host header possible.
const hostHeaderKey = find(headers[MAP], 'Host');
if (hostHeaderKey !== undefined) {
obj[hostHeaderKey] = obj[hostHeaderKey][0];
}
return obj;
}
/**
* Create a Headers object from an object of headers, ignoring those that do
* not conform to HTTP grammar productions.
*
* @param Object obj Object of headers
* @return Headers
*/
function createHeadersLenient(obj) {
const headers = new Headers();
for (const name of Object.keys(obj)) {
if (invalidTokenRegex.test(name)) {
continue;
}
if (Array.isArray(obj[name])) {
for (const val of obj[name]) {
if (invalidHeaderCharRegex.test(val)) {
continue;
}
if (headers[MAP][name] === undefined) {
headers[MAP][name] = [val];
} else {
headers[MAP][name].push(val);
}
}
} else if (!invalidHeaderCharRegex.test(obj[name])) {
headers[MAP][name] = [obj[name]];
}
}
return headers;
}
const INTERNALS$1 = Symbol('Response internals');
// fix an issue where "STATUS_CODES" aren't a named export for node <10
const STATUS_CODES = http__default['default'].STATUS_CODES;
/**
* Response class
*
* @param Stream body Readable stream
* @param Object opts Response options
* @return Void
*/
class Response {
constructor() {
let body = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
let opts = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
Body.call(this, body, opts);
const status = opts.status || 200;
const headers = new Headers(opts.headers);
if (body != null && !headers.has('Content-Type')) {
const contentType = extractContentType(body);
if (contentType) {
headers.append('Content-Type', contentType);
}
}
this[INTERNALS$1] = {
url: opts.url,
status,
statusText: opts.statusText || STATUS_CODES[status],
headers,
counter: opts.counter
};
}
get url() {
return this[INTERNALS$1].url || '';
}
get status() {
return this[INTERNALS$1].status;
}
/**
* Convenience property representing if the request ended normally
*/
get ok() {
return this[INTERNALS$1].status >= 200 && this[INTERNALS$1].status < 300;
}
get redirected() {
return this[INTERNALS$1].counter > 0;
}
get statusText() {
return this[INTERNALS$1].statusText;
}
get headers() {
return this[INTERNALS$1].headers;
}
/**
* Clone this response
*
* @return Response
*/
clone() {
return new Response(clone$1(this), {
url: this.url,
status: this.status,
statusText: this.statusText,
headers: this.headers,
ok: this.ok,
redirected: this.redirected
});
}
}
Body.mixIn(Response.prototype);
Object.defineProperties(Response.prototype, {
url: { enumerable: true },
status: { enumerable: true },
ok: { enumerable: true },
redirected: { enumerable: true },
statusText: { enumerable: true },
headers: { enumerable: true },
clone: { enumerable: true }
});
Object.defineProperty(Response.prototype, Symbol.toStringTag, {
value: 'Response',
writable: false,
enumerable: false,
configurable: true
});
const INTERNALS$2 = Symbol('Request internals');
// fix an issue where "format", "parse" aren't a named export for node <10
const parse_url = url__default['default'].parse;
const format_url = url__default['default'].format;
const streamDestructionSupported = 'destroy' in Stream__default['default'].Readable.prototype;
/**
* Check if a value is an instance of Request.
*
* @param Mixed input
* @return Boolean
*/
function isRequest$2(input) {
return typeof input === 'object' && typeof input[INTERNALS$2] === 'object';
}
function isAbortSignal(signal) {
const proto = signal && typeof signal === 'object' && Object.getPrototypeOf(signal);
return !!(proto && proto.constructor.name === 'AbortSignal');
}
/**
* Request class
*
* @param Mixed input Url or Request instance
* @param Object init Custom options
* @return Void
*/
class Request {
constructor(input) {
let init = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
let parsedURL;
// normalize input
if (!isRequest$2(input)) {
if (input && input.href) {
// in order to support Node.js' Url objects; though WHATWG's URL objects
// will fall into this branch also (since their `toString()` will return
// `href` property anyway)
parsedURL = parse_url(input.href);
} else {
// coerce input to a string before attempting to parse
parsedURL = parse_url(`${input}`);
}
input = {};
} else {
parsedURL = parse_url(input.url);
}
let method = init.method || input.method || 'GET';
method = method.toUpperCase();
if ((init.body != null || isRequest$2(input) && input.body !== null) && (method === 'GET' || method === 'HEAD')) {
throw new TypeError('Request with GET/HEAD method cannot have body');
}
let inputBody = init.body != null ? init.body : isRequest$2(input) && input.body !== null ? clone$1(input) : null;
Body.call(this, inputBody, {
timeout: init.timeout || input.timeout || 0,
size: init.size || input.size || 0
});
const headers = new Headers(init.headers || input.headers || {});
if (inputBody != null && !headers.has('Content-Type')) {
const contentType = extractContentType(inputBody);
if (contentType) {
headers.append('Content-Type', contentType);
}
}
let signal = isRequest$2(input) ? input.signal : null;
if ('signal' in init) signal = init.signal;
if (signal != null && !isAbortSignal(signal)) {
throw new TypeError('Expected signal to be an instanceof AbortSignal');
}
this[INTERNALS$2] = {
method,
redirect: init.redirect || input.redirect || 'follow',
headers,
parsedURL,
signal
};
// node-fetch-only options
this.follow = init.follow !== undefined ? init.follow : input.follow !== undefined ? input.follow : 20;
this.compress = init.compress !== undefined ? init.compress : input.compress !== undefined ? input.compress : true;
this.counter = init.counter || input.counter || 0;
this.agent = init.agent || input.agent;
}
get method() {
return this[INTERNALS$2].method;
}
get url() {
return format_url(this[INTERNALS$2].parsedURL);
}
get headers() {
return this[INTERNALS$2].headers;
}
get redirect() {
return this[INTERNALS$2].redirect;
}
get signal() {
return this[INTERNALS$2].signal;
}
/**
* Clone this request
*
* @return Request
*/
clone() {
return new Request(this);
}
}
Body.mixIn(Request.prototype);
Object.defineProperty(Request.prototype, Symbol.toStringTag, {
value: 'Request',
writable: false,
enumerable: false,
configurable: true
});
Object.defineProperties(Request.prototype, {
method: { enumerable: true },
url: { enumerable: true },
headers: { enumerable: true },
redirect: { enumerable: true },
clone: { enumerable: true },
signal: { enumerable: true }
});
/**
* Convert a Request to Node.js http request options.
*
* @param Request A Request instance
* @return Object The options object to be passed to http.request
*/
function getNodeRequestOptions(request) {
const parsedURL = request[INTERNALS$2].parsedURL;
const headers = new Headers(request[INTERNALS$2].headers);
// fetch step 1.3
if (!headers.has('Accept')) {
headers.set('Accept', '*/*');
}
// Basic fetch
if (!parsedURL.protocol || !parsedURL.hostname) {
throw new TypeError('Only absolute URLs are supported');
}
if (!/^https?:$/.test(parsedURL.protocol)) {
throw new TypeError('Only HTTP(S) protocols are supported');
}
if (request.signal && request.body instanceof Stream__default['default'].Readable && !streamDestructionSupported) {
throw new Error('Cancellation of streamed requests with AbortSignal is not supported in node < 8');
}
// HTTP-network-or-cache fetch steps 2.4-2.7
let contentLengthValue = null;
if (request.body == null && /^(POST|PUT)$/i.test(request.method)) {
contentLengthValue = '0';
}
if (request.body != null) {
const totalBytes = getTotalBytes(request);
if (typeof totalBytes === 'number') {
contentLengthValue = String(totalBytes);
}
}
if (contentLengthValue) {
headers.set('Content-Length', contentLengthValue);
}
// HTTP-network-or-cache fetch step 2.11
if (!headers.has('User-Agent')) {
headers.set('User-Agent', 'node-fetch/1.0 (+https://github.com/bitinn/node-fetch)');
}
// HTTP-network-or-cache fetch step 2.15
if (request.compress && !headers.has('Accept-Encoding')) {
headers.set('Accept-Encoding', 'gzip,deflate');
}
let agent = request.agent;
if (typeof agent === 'function') {
agent = agent(parsedURL);
}
if (!headers.has('Connection') && !agent) {
headers.set('Connection', 'close');
}
// HTTP-network fetch step 4.2
// chunked encoding is handled by Node.js
return Object.assign({}, parsedURL, {
method: request.method,
headers: exportNodeCompatibleHeaders(headers),
agent
});
}
/**
* abort-error.js
*
* AbortError interface for cancelled requests
*/
/**
* Create AbortError instance
*
* @param String message Error message for human
* @return AbortError
*/
function AbortError(message) {
Error.call(this, message);
this.type = 'aborted';
this.message = message;
// hide custom error implementation details from end-users
Error.captureStackTrace(this, this.constructor);
}
AbortError.prototype = Object.create(Error.prototype);
AbortError.prototype.constructor = AbortError;
AbortError.prototype.name = 'AbortError';
// fix an issue where "PassThrough", "resolve" aren't a named export for node <10
const PassThrough$1$1 = Stream__default['default'].PassThrough;
const resolve_url = url__default['default'].resolve;
/**
* Fetch function
*
* @param Mixed url Absolute url or Request instance
* @param Object opts Fetch options
* @return Promise
*/
function fetch(url, opts) {
// allow custom promise
if (!fetch.Promise) {
throw new Error('native promise missing, set fetch.Promise to your favorite alternative');
}
Body.Promise = fetch.Promise;
// wrap http.request into fetch
return new fetch.Promise(function (resolve, reject) {
// build request object
const request = new Request(url, opts);
const options = getNodeRequestOptions(request);
const send = (options.protocol === 'https:' ? https__default['default'] : http__default['default']).request;
const signal = request.signal;
let response = null;
const abort = function abort() {
let error = new AbortError('The user aborted a request.');
reject(error);
if (request.body && request.body instanceof Stream__default['default'].Readable) {
request.body.destroy(error);
}
if (!response || !response.body) return;
response.body.emit('error', error);
};
if (signal && signal.aborted) {
abort();
return;
}
const abortAndFinalize = function abortAndFinalize() {
abort();
finalize();
};
// send request
const req = send(options);
let reqTimeout;
if (signal) {
signal.addEventListener('abort', abortAndFinalize);
}
function finalize() {
req.abort();
if (signal) signal.removeEventListener('abort', abortAndFinalize);
clearTimeout(reqTimeout);
}
if (request.timeout) {
req.once('socket', function (socket) {
reqTimeout = setTimeout(function () {
reject(new FetchError(`network timeout at: ${request.url}`, 'request-timeout'));
finalize();
}, request.timeout);
});
}
req.on('error', function (err) {
reject(new FetchError(`request to ${request.url} failed, reason: ${err.message}`, 'system', err));
finalize();
});
req.on('response', function (res) {
clearTimeout(reqTimeout);
const headers = createHeadersLenient(res.headers);
// HTTP fetch step 5
if (fetch.isRedirect(res.statusCode)) {
// HTTP fetch step 5.2
const location = headers.get('Location');
// HTTP fetch step 5.3
const locationURL = location === null ? null : resolve_url(request.url, location);
// HTTP fetch step 5.5
switch (request.redirect) {
case 'error':
reject(new FetchError(`uri requested responds with a redirect, redirect mode is set to error: ${request.url}`, 'no-redirect'));
finalize();
return;
case 'manual':
// node-fetch-specific step: make manual redirect a bit easier to use by setting the Location header value to the resolved URL.
if (locationURL !== null) {
// handle corrupted header
try {
headers.set('Location', locationURL);
} catch (err) {
// istanbul ignore next: nodejs server prevent invalid response headers, we can't test this through normal request
reject(err);
}
}
break;
case 'follow':
// HTTP-redirect fetch step 2
if (locationURL === null) {
break;
}
// HTTP-redirect fetch step 5
if (request.counter >= request.follow) {
reject(new FetchError(`maximum redirect reached at: ${request.url}`, 'max-redirect'));
finalize();
return;
}
// HTTP-redirect fetch step 6 (counter increment)
// Create a new Request object.
const requestOpts = {
headers: new Headers(request.headers),
follow: request.follow,
counter: request.counter + 1,
agent: request.agent,
compress: request.compress,
method: request.method,
body: request.body,
signal: request.signal,
timeout: request.timeout,
size: request.size
};
// HTTP-redirect fetch step 9
if (res.statusCode !== 303 && request.body && getTotalBytes(request) === null) {
reject(new FetchError('Cannot follow redirect with body being a readable stream', 'unsupported-redirect'));
finalize();
return;
}
// HTTP-redirect fetch step 11
if (res.statusCode === 303 || (res.statusCode === 301 || res.statusCode === 302) && request.method === 'POST') {
requestOpts.method = 'GET';
requestOpts.body = undefined;
requestOpts.headers.delete('content-length');
}
// HTTP-redirect fetch step 15
resolve(fetch(new Request(locationURL, requestOpts)));
finalize();
return;
}
}
// prepare response
res.once('end', function () {
if (signal) signal.removeEventListener('abort', abortAndFinalize);
});
let body = res.pipe(new PassThrough$1$1());
const response_options = {
url: request.url,
status: res.statusCode,
statusText: res.statusMessage,
headers: headers,
size: request.size,
timeout: request.timeout,
counter: request.counter
};
// HTTP-network fetch step 12.1.1.3
const codings = headers.get('Content-Encoding');
// HTTP-network fetch step 12.1.1.4: handle content codings
// in following scenarios we ignore compression support
// 1. compression support is disabled
// 2. HEAD request
// 3. no Content-Encoding header
// 4. no content response (204)
// 5. content not modified response (304)
if (!request.compress || request.method === 'HEAD' || codings === null || res.statusCode === 204 || res.statusCode === 304) {
response = new Response(body, response_options);
resolve(response);
return;
}
// For Node v6+
// Be less strict when decoding compressed responses, since sometimes
// servers send slightly invalid responses that are still accepted
// by common browsers.
// Always using Z_SYNC_FLUSH is what cURL does.
const zlibOptions = {
flush: zlib__default['default'].Z_SYNC_FLUSH,
finishFlush: zlib__default['default'].Z_SYNC_FLUSH
};
// for gzip
if (codings == 'gzip' || codings == 'x-gzip') {
body = body.pipe(zlib__default['default'].createGunzip(zlibOptions));
response = new Response(body, response_options);
resolve(response);
return;
}
// for deflate
if (codings == 'deflate' || codings == 'x-deflate') {
// handle the infamous raw deflate response from old servers
// a hack for old IIS and Apache servers
const raw = res.pipe(new PassThrough$1$1());
raw.once('data', function (chunk) {
// see http://stackoverflow.com/questions/37519828
if ((chunk[0] & 0x0F) === 0x08) {
body = body.pipe(zlib__default['default'].createInflate());
} else {
body = body.pipe(zlib__default['default'].createInflateRaw());
}
response = new Response(body, response_options);
resolve(response);
});
return;
}
// for br
if (codings == 'br' && typeof zlib__default['default'].createBrotliDecompress === 'function') {
body = body.pipe(zlib__default['default'].createBrotliDecompress());
response = new Response(body, response_options);
resolve(response);
return;
}
// otherwise, use response as-is
response = new Response(body, response_options);
resolve(response);
});
writeToStream(req, request);
});
}
/**
* Redirect code matching
*
* @param Number code Status code
* @return Boolean
*/
fetch.isRedirect = function (code) {
return code === 301 || code === 302 || code === 303 || code === 307 || code === 308;
};
// expose Promise
fetch.Promise = global.Promise;
class Deprecation extends Error {
constructor(message) {
super(message); // Maintains proper stack trace (only available on V8)
/* istanbul ignore next */
if (Error.captureStackTrace) {
Error.captureStackTrace(this, this.constructor);
}
this.name = 'Deprecation';
}
}
var distWeb = /*#__PURE__*/Object.freeze({
__proto__: null,
Deprecation: Deprecation
});
const logOnce = once_1((deprecation) => console.warn(deprecation));
/**
* Error with extra properties to help with debugging
*/
class RequestError extends Error {
constructor(message, statusCode, options) {
super(message);
// Maintains proper stack trace (only available on V8)
/* istanbul ignore next */
if (Error.captureStackTrace) {
Error.captureStackTrace(this, this.constructor);
}
this.name = "HttpError";
this.status = statusCode;
Object.defineProperty(this, "code", {
get() {
logOnce(new Deprecation("[@octokit/request-error] `error.code` is deprecated, use `error.status`."));
return statusCode;
},
});
this.headers = options.headers || {};
// redact request credentials without mutating original request options
const requestCopy = Object.assign({}, options.request);
if (options.request.headers.authorization) {
requestCopy.headers = Object.assign({}, options.request.headers, {
authorization: options.request.headers.authorization.replace(/ .*$/, " [REDACTED]"),
});
}
requestCopy.url = requestCopy.url
// client_id & client_secret can be passed as URL query parameters to increase rate limit
// see https://developer.github.com/v3/#increasing-the-unauthenticated-rate-limit-for-oauth-applications
.replace(/\bclient_secret=\w+/g, "client_secret=[REDACTED]")
// OAuth tokens can be passed as URL query parameters, although it is not recommended
// see https://developer.github.com/v3/#oauth2-token-sent-in-a-header
.replace(/\baccess_token=\w+/g, "access_token=[REDACTED]");
this.request = requestCopy;
}
}
const VERSION$1 = "5.4.8";
function getBufferResponse(response) {
return response.arrayBuffer();
}
function fetchWrapper(requestOptions) {
if (isPlainObject(requestOptions.body) ||
Array.isArray(requestOptions.body)) {
requestOptions.body = JSON.stringify(requestOptions.body);
}
let headers = {};
let status;
let url;
const fetch$1 = (requestOptions.request && requestOptions.request.fetch) || fetch;
return fetch$1(requestOptions.url, Object.assign({
method: requestOptions.method,
body: requestOptions.body,
headers: requestOptions.headers,
redirect: requestOptions.redirect,
}, requestOptions.request))
.then((response) => {
url = response.url;
status = response.status;
for (const keyAndValue of response.headers) {
headers[keyAndValue[0]] = keyAndValue[1];
}
if (status === 204 || status === 205) {
return;
}
// GitHub API returns 200 for HEAD requests
if (requestOptions.method === "HEAD") {
if (status < 400) {
return;
}
throw new RequestError(response.statusText, status, {
headers,
request: requestOptions,
});
}
if (status === 304) {
throw new RequestError("Not modified", status, {
headers,
request: requestOptions,
});
}
if (status >= 400) {
return response
.text()
.then((message) => {
const error = new RequestError(message, status, {
headers,
request: requestOptions,
});
try {
let responseBody = JSON.parse(error.message);
Object.assign(error, responseBody);
let errors = responseBody.errors;
// Assumption `errors` would always be in Array format
error.message =
error.message + ": " + errors.map(JSON.stringify).join(", ");
}
catch (e) {
// ignore, see octokit/rest.js#684
}
throw error;
});
}
const contentType = response.headers.get("content-type");
if (/application\/json/.test(contentType)) {
return response.json();
}
if (!contentType || /^text\/|charset=utf-8$/.test(contentType)) {
return response.text();
}
return getBufferResponse(response);
})
.then((data) => {
return {
status,
url,
headers,
data,
};
})
.catch((error) => {
if (error instanceof RequestError) {
throw error;
}
throw new RequestError(error.message, 500, {
headers,
request: requestOptions,
});
});
}
function withDefaults$1(oldEndpoint, newDefaults) {
const endpoint = oldEndpoint.defaults(newDefaults);
const newApi = function (route, parameters) {
const endpointOptions = endpoint.merge(route, parameters);
if (!endpointOptions.request || !endpointOptions.request.hook) {
return fetchWrapper(endpoint.parse(endpointOptions));
}
const request = (route, parameters) => {
return fetchWrapper(endpoint.parse(endpoint.merge(route, parameters)));
};
Object.assign(request, {
endpoint,
defaults: withDefaults$1.bind(null, endpoint),
});
return endpointOptions.request.hook(request, endpointOptions);
};
return Object.assign(newApi, {
endpoint,
defaults: withDefaults$1.bind(null, endpoint),
});
}
const request = withDefaults$1(endpoint, {
headers: {
"user-agent": `octokit-request.js/${VERSION$1} ${getUserAgent()}`,
},
});
var distWeb$1 = /*#__PURE__*/Object.freeze({
__proto__: null,
request: request
});
const VERSION$2 = "4.5.6";
class GraphqlError extends Error {
constructor(request, response) {
const message = response.data.errors[0].message;
super(message);
Object.assign(this, response.data);
Object.assign(this, { headers: response.headers });
this.name = "GraphqlError";
this.request = request;
// Maintains proper stack trace (only available on V8)
/* istanbul ignore next */
if (Error.captureStackTrace) {
Error.captureStackTrace(this, this.constructor);
}
}
}
const NON_VARIABLE_OPTIONS = [
"method",
"baseUrl",
"url",
"headers",
"request",
"query",
"mediaType",
];
const GHES_V3_SUFFIX_REGEX = /\/api\/v3\/?$/;
function graphql(request, query, options) {
if (typeof query === "string" && options && "query" in options) {
return Promise.reject(new Error(`[@octokit/graphql] "query" cannot be used as variable name`));
}
const parsedOptions = typeof query === "string" ? Object.assign({ query }, options) : query;
const requestOptions = Object.keys(parsedOptions).reduce((result, key) => {
if (NON_VARIABLE_OPTIONS.includes(key)) {
result[key] = parsedOptions[key];
return result;
}
if (!result.variables) {
result.variables = {};
}
result.variables[key] = parsedOptions[key];
return result;
}, {});
// workaround for GitHub Enterprise baseUrl set with /api/v3 suffix
// https://github.com/octokit/auth-app.js/issues/111#issuecomment-657610451
const baseUrl = parsedOptions.baseUrl || request.endpoint.DEFAULTS.baseUrl;
if (GHES_V3_SUFFIX_REGEX.test(baseUrl)) {
requestOptions.url = baseUrl.replace(GHES_V3_SUFFIX_REGEX, "/api/graphql");
}
return request(requestOptions).then((response) => {
if (response.data.errors) {
const headers = {};
for (const key of Object.keys(response.headers)) {
headers[key] = response.headers[key];
}
throw new GraphqlError(requestOptions, {
headers,
data: response.data,
});
}
return response.data.data;
});
}
function withDefaults$2(request$1, newDefaults) {
const newRequest = request$1.defaults(newDefaults);
const newApi = (query, options) => {
return graphql(newRequest, query, options);
};
return Object.assign(newApi, {
defaults: withDefaults$2.bind(null, newRequest),
endpoint: request.endpoint,
});
}
const graphql$1 = withDefaults$2(request, {
headers: {
"user-agent": `octokit-graphql.js/${VERSION$2} ${getUserAgent()}`,
},
method: "POST",
url: "/graphql",
});
function withCustomRequest(customRequest) {
return withDefaults$2(customRequest, {
method: "POST",
url: "/graphql",
});
}
var distWeb$2 = /*#__PURE__*/Object.freeze({
__proto__: null,
graphql: graphql$1,
withCustomRequest: withCustomRequest
});
async function auth(token) {
const tokenType = token.split(/\./).length === 3
? "app"
: /^v\d+\./.test(token)
? "installation"
: "oauth";
return {
type: "token",
token: token,
tokenType
};
}
/**
* Prefix token for usage in the Authorization header
*
* @param token OAuth token or JSON Web Token
*/
function withAuthorizationPrefix(token) {
if (token.split(/\./).length === 3) {
return `bearer ${token}`;
}
return `token ${token}`;
}
async function hook(token, request, route, parameters) {
const endpoint = request.endpoint.merge(route, parameters);
endpoint.headers.authorization = withAuthorizationPrefix(token);
return request(endpoint);
}
const createTokenAuth = function createTokenAuth(token) {
if (!token) {
throw new Error("[@octokit/auth-token] No token passed to createTokenAuth");
}
if (typeof token !== "string") {
throw new Error("[@octokit/auth-token] Token passed to createTokenAuth is not a string");
}
token = token.replace(/^(token|bearer) +/i, "");
return Object.assign(auth.bind(null, token), {
hook: hook.bind(null, token)
});
};
var distWeb$3 = /*#__PURE__*/Object.freeze({
__proto__: null,
createTokenAuth: createTokenAuth
});
const VERSION$3 = "3.1.2";
class Octokit {
constructor(options = {}) {
const hook = new Collection();
const requestDefaults = {
baseUrl: request.endpoint.DEFAULTS.baseUrl,
headers: {},
request: Object.assign({}, options.request, {
hook: hook.bind(null, "request"),
}),
mediaType: {
previews: [],
format: "",
},
};
// prepend default user agent with `options.userAgent` if set
requestDefaults.headers["user-agent"] = [
options.userAgent,
`octokit-core.js/${VERSION$3} ${getUserAgent()}`,
]
.filter(Boolean)
.join(" ");
if (options.baseUrl) {
requestDefaults.baseUrl = options.baseUrl;
}
if (options.previews) {
requestDefaults.mediaType.previews = options.previews;
}
if (options.timeZone) {
requestDefaults.headers["time-zone"] = options.timeZone;
}
this.request = request.defaults(requestDefaults);
this.graphql = withCustomRequest(this.request).defaults({
...requestDefaults,
baseUrl: requestDefaults.baseUrl.replace(/\/api\/v3$/, "/api"),
});
this.log = Object.assign({
debug: () => { },
info: () => { },
warn: console.warn.bind(console),
error: console.error.bind(console),
}, options.log);
this.hook = hook;
// (1) If neither `options.authStrategy` nor `options.auth` are set, the `octokit` instance
// is unauthenticated. The `this.auth()` method is a no-op and no request hook is registred.
// (2) If only `options.auth` is set, use the default token authentication strategy.
// (3) If `options.authStrategy` is set then use it and pass in `options.auth`. Always pass own request as many strategies accept a custom request instance.
// TODO: type `options.auth` based on `options.authStrategy`.
if (!options.authStrategy) {
if (!options.auth) {
// (1)
this.auth = async () => ({
type: "unauthenticated",
});
}
else {
// (2)
const auth = createTokenAuth(options.auth);
// @ts-ignore ¯\_(ツ)_/¯
hook.wrap("request", auth.hook);
this.auth = auth;
}
}
else {
const auth = options.authStrategy(Object.assign({
request: this.request,
}, options.auth));
// @ts-ignore ¯\_(ツ)_/¯
hook.wrap("request", auth.hook);
this.auth = auth;
}
// apply plugins
// https://stackoverflow.com/a/16345172
const classConstructor = this.constructor;
classConstructor.plugins.forEach((plugin) => {
Object.assign(this, plugin(this, options));
});
}
static defaults(defaults) {
const OctokitWithDefaults = class extends this {
constructor(...args) {
const options = args[0] || {};
if (typeof defaults === "function") {
super(defaults(options));
return;
}
super(Object.assign({}, defaults, options, options.userAgent && defaults.userAgent
? {
userAgent: `${options.userAgent} ${defaults.userAgent}`,
}
: null));
}
};
return OctokitWithDefaults;
}
/**
* Attach a plugin (or many) to your Octokit instance.
*
* @example
* const API = Octokit.plugin(plugin1, plugin2, plugin3, ...)
*/
static plugin(...newPlugins) {
var _a;
const currentPlugins = this.plugins;
const NewOctokit = (_a = class extends this {
},
_a.plugins = currentPlugins.concat(newPlugins.filter((plugin) => !currentPlugins.includes(plugin))),
_a);
return NewOctokit;
}
}
Octokit.VERSION = VERSION$3;
Octokit.plugins = [];
const VERSION$4 = "1.0.0";
/**
* @param octokit Octokit instance
* @param options Options passed to Octokit constructor
*/
function requestLog(octokit) {
octokit.hook.wrap("request", (request, options) => {
octokit.log.debug("request", options);
const start = Date.now();
const requestOptions = octokit.request.endpoint.parse(options);
const path = requestOptions.url.replace(options.baseUrl, "");
return request(options)
.then(response => {
octokit.log.info(`${requestOptions.method} ${path} - ${response.status} in ${Date.now() - start}ms`);
return response;
})
.catch(error => {
octokit.log.info(`${requestOptions.method} ${path} - ${error.status} in ${Date.now() -
start}ms`);
throw error;
});
});
}
requestLog.VERSION = VERSION$4;
var distWeb$4 = /*#__PURE__*/Object.freeze({
__proto__: null,
requestLog: requestLog
});
const VERSION$5 = "2.3.3";
/**
* Some “list” response that can be paginated have a different response structure
*
* They have a `total_count` key in the response (search also has `incomplete_results`,
* /installation/repositories also has `repository_selection`), as well as a key with
* the list of the items which name varies from endpoint to endpoint.
*
* Octokit normalizes these responses so that paginated results are always returned following
* the same structure. One challenge is that if the list response has only one page, no Link
* header is provided, so this header alone is not sufficient to check wether a response is
* paginated or not.
*
* We check if a "total_count" key is present in the response data, but also make sure that
* a "url" property is not, as the "Get the combined status for a specific ref" endpoint would
* otherwise match: https://developer.github.com/v3/repos/statuses/#get-the-combined-status-for-a-specific-ref
*/
function normalizePaginatedListResponse(response) {
const responseNeedsNormalization = "total_count" in response.data && !("url" in response.data);
if (!responseNeedsNormalization)
return response;
// keep the additional properties intact as there is currently no other way
// to retrieve the same information.
const incompleteResults = response.data.incomplete_results;
const repositorySelection = response.data.repository_selection;
const totalCount = response.data.total_count;
delete response.data.incomplete_results;
delete response.data.repository_selection;
delete response.data.total_count;
const namespaceKey = Object.keys(response.data)[0];
const data = response.data[namespaceKey];
response.data = data;
if (typeof incompleteResults !== "undefined") {
response.data.incomplete_results = incompleteResults;
}
if (typeof repositorySelection !== "undefined") {
response.data.repository_selection = repositorySelection;
}
response.data.total_count = totalCount;
return response;
}
function iterator(octokit, route, parameters) {
const options = typeof route === "function"
? route.endpoint(parameters)
: octokit.request.endpoint(route, parameters);
const requestMethod = typeof route === "function" ? route : octokit.request;
const method = options.method;
const headers = options.headers;
let url = options.url;
return {
[Symbol.asyncIterator]: () => ({
next() {
if (!url) {
return Promise.resolve({ done: true });
}
return requestMethod({ method, url, headers })
.then(normalizePaginatedListResponse)
.then((response) => {
// `response.headers.link` format:
// '<https://api.github.com/users/aseemk/followers?page=2>; rel="next", <https://api.github.com/users/aseemk/followers?page=2>; rel="last"'
// sets `url` to undefined if "next" URL is not present or `link` header is not set
url = ((response.headers.link || "").match(/<([^>]+)>;\s*rel="next"/) || [])[1];
return { value: response };
});
},
}),
};
}
function paginate(octokit, route, parameters, mapFn) {
if (typeof parameters === "function") {
mapFn = parameters;
parameters = undefined;
}
return gather(octokit, [], iterator(octokit, route, parameters)[Symbol.asyncIterator](), mapFn);
}
function gather(octokit, results, iterator, mapFn) {
return iterator.next().then((result) => {
if (result.done) {
return results;
}
let earlyExit = false;
function done() {
earlyExit = true;
}
results = results.concat(mapFn ? mapFn(result.value, done) : result.value.data);
if (earlyExit) {
return results;
}
return gather(octokit, results, iterator, mapFn);
});
}
/**
* @param octokit Octokit instance
* @param options Options passed to Octokit constructor
*/
function paginateRest(octokit) {
return {
paginate: Object.assign(paginate.bind(null, octokit), {
iterator: iterator.bind(null, octokit),
}),
};
}
paginateRest.VERSION = VERSION$5;
const Endpoints = {
actions: {
addSelectedRepoToOrgSecret: [
"PUT /orgs/{org}/actions/secrets/{secret_name}/repositories/{repository_id}",
],
cancelWorkflowRun: [
"POST /repos/{owner}/{repo}/actions/runs/{run_id}/cancel",
],
createOrUpdateOrgSecret: ["PUT /orgs/{org}/actions/secrets/{secret_name}"],
createOrUpdateRepoSecret: [
"PUT /repos/{owner}/{repo}/actions/secrets/{secret_name}",
],
createRegistrationTokenForOrg: [
"POST /orgs/{org}/actions/runners/registration-token",
],
createRegistrationTokenForRepo: [
"POST /repos/{owner}/{repo}/actions/runners/registration-token",
],
createRemoveTokenForOrg: ["POST /orgs/{org}/actions/runners/remove-token"],
createRemoveTokenForRepo: [
"POST /repos/{owner}/{repo}/actions/runners/remove-token",
],
createWorkflowDispatch: [
"POST /repos/{owner}/{repo}/actions/workflows/{workflow_id}/dispatches",
],
deleteArtifact: [
"DELETE /repos/{owner}/{repo}/actions/artifacts/{artifact_id}",
],
deleteOrgSecret: ["DELETE /orgs/{org}/actions/secrets/{secret_name}"],
deleteRepoSecret: [
"DELETE /repos/{owner}/{repo}/actions/secrets/{secret_name}",
],
deleteSelfHostedRunnerFromOrg: [
"DELETE /orgs/{org}/actions/runners/{runner_id}",
],
deleteSelfHostedRunnerFromRepo: [
"DELETE /repos/{owner}/{repo}/actions/runners/{runner_id}",
],
deleteWorkflowRun: ["DELETE /repos/{owner}/{repo}/actions/runs/{run_id}"],
deleteWorkflowRunLogs: [
"DELETE /repos/{owner}/{repo}/actions/runs/{run_id}/logs",
],
downloadArtifact: [
"GET /repos/{owner}/{repo}/actions/artifacts/{artifact_id}/{archive_format}",
],
downloadJobLogsForWorkflowRun: [
"GET /repos/{owner}/{repo}/actions/jobs/{job_id}/logs",
],
downloadWorkflowRunLogs: [
"GET /repos/{owner}/{repo}/actions/runs/{run_id}/logs",
],
getArtifact: ["GET /repos/{owner}/{repo}/actions/artifacts/{artifact_id}"],
getJobForWorkflowRun: ["GET /repos/{owner}/{repo}/actions/jobs/{job_id}"],
getOrgPublicKey: ["GET /orgs/{org}/actions/secrets/public-key"],
getOrgSecret: ["GET /orgs/{org}/actions/secrets/{secret_name}"],
getRepoPublicKey: ["GET /repos/{owner}/{repo}/actions/secrets/public-key"],
getRepoSecret: ["GET /repos/{owner}/{repo}/actions/secrets/{secret_name}"],
getSelfHostedRunnerForOrg: ["GET /orgs/{org}/actions/runners/{runner_id}"],
getSelfHostedRunnerForRepo: [
"GET /repos/{owner}/{repo}/actions/runners/{runner_id}",
],
getWorkflow: ["GET /repos/{owner}/{repo}/actions/workflows/{workflow_id}"],
getWorkflowRun: ["GET /repos/{owner}/{repo}/actions/runs/{run_id}"],
getWorkflowRunUsage: [
"GET /repos/{owner}/{repo}/actions/runs/{run_id}/timing",
],
getWorkflowUsage: [
"GET /repos/{owner}/{repo}/actions/workflows/{workflow_id}/timing",
],
listArtifactsForRepo: ["GET /repos/{owner}/{repo}/actions/artifacts"],
listJobsForWorkflowRun: [
"GET /repos/{owner}/{repo}/actions/runs/{run_id}/jobs",
],
listOrgSecrets: ["GET /orgs/{org}/actions/secrets"],
listRepoSecrets: ["GET /repos/{owner}/{repo}/actions/secrets"],
listRepoWorkflows: ["GET /repos/{owner}/{repo}/actions/workflows"],
listRunnerApplicationsForOrg: ["GET /orgs/{org}/actions/runners/downloads"],
listRunnerApplicationsForRepo: [
"GET /repos/{owner}/{repo}/actions/runners/downloads",
],
listSelectedReposForOrgSecret: [
"GET /orgs/{org}/actions/secrets/{secret_name}/repositories",
],
listSelfHostedRunnersForOrg: ["GET /orgs/{org}/actions/runners"],
listSelfHostedRunnersForRepo: ["GET /repos/{owner}/{repo}/actions/runners"],
listWorkflowRunArtifacts: [
"GET /repos/{owner}/{repo}/actions/runs/{run_id}/artifacts",
],
listWorkflowRuns: [
"GET /repos/{owner}/{repo}/actions/workflows/{workflow_id}/runs",
],
listWorkflowRunsForRepo: ["GET /repos/{owner}/{repo}/actions/runs"],
reRunWorkflow: ["POST /repos/{owner}/{repo}/actions/runs/{run_id}/rerun"],
removeSelectedRepoFromOrgSecret: [
"DELETE /orgs/{org}/actions/secrets/{secret_name}/repositories/{repository_id}",
],
setSelectedReposForOrgSecret: [
"PUT /orgs/{org}/actions/secrets/{secret_name}/repositories",
],
},
activity: {
checkRepoIsStarredByAuthenticatedUser: ["GET /user/starred/{owner}/{repo}"],
deleteRepoSubscription: ["DELETE /repos/{owner}/{repo}/subscription"],
deleteThreadSubscription: [
"DELETE /notifications/threads/{thread_id}/subscription",
],
getFeeds: ["GET /feeds"],
getRepoSubscription: ["GET /repos/{owner}/{repo}/subscription"],
getThread: ["GET /notifications/threads/{thread_id}"],
getThreadSubscriptionForAuthenticatedUser: [
"GET /notifications/threads/{thread_id}/subscription",
],
listEventsForAuthenticatedUser: ["GET /users/{username}/events"],
listNotificationsForAuthenticatedUser: ["GET /notifications"],
listOrgEventsForAuthenticatedUser: [
"GET /users/{username}/events/orgs/{org}",
],
listPublicEvents: ["GET /events"],
listPublicEventsForRepoNetwork: ["GET /networks/{owner}/{repo}/events"],
listPublicEventsForUser: ["GET /users/{username}/events/public"],
listPublicOrgEvents: ["GET /orgs/{org}/events"],
listReceivedEventsForUser: ["GET /users/{username}/received_events"],
listReceivedPublicEventsForUser: [
"GET /users/{username}/received_events/public",
],
listRepoEvents: ["GET /repos/{owner}/{repo}/events"],
listRepoNotificationsForAuthenticatedUser: [
"GET /repos/{owner}/{repo}/notifications",
],
listReposStarredByAuthenticatedUser: ["GET /user/starred"],
listReposStarredByUser: ["GET /users/{username}/starred"],
listReposWatchedByUser: ["GET /users/{username}/subscriptions"],
listStargazersForRepo: ["GET /repos/{owner}/{repo}/stargazers"],
listWatchedReposForAuthenticatedUser: ["GET /user/subscriptions"],
listWatchersForRepo: ["GET /repos/{owner}/{repo}/subscribers"],
markNotificationsAsRead: ["PUT /notifications"],
markRepoNotificationsAsRead: ["PUT /repos/{owner}/{repo}/notifications"],
markThreadAsRead: ["PATCH /notifications/threads/{thread_id}"],
setRepoSubscription: ["PUT /repos/{owner}/{repo}/subscription"],
setThreadSubscription: [
"PUT /notifications/threads/{thread_id}/subscription",
],
starRepoForAuthenticatedUser: ["PUT /user/starred/{owner}/{repo}"],
unstarRepoForAuthenticatedUser: ["DELETE /user/starred/{owner}/{repo}"],
},
apps: {
addRepoToInstallation: [
"PUT /user/installations/{installation_id}/repositories/{repository_id}",
],
checkToken: ["POST /applications/{client_id}/token"],
createContentAttachment: [
"POST /content_references/{content_reference_id}/attachments",
{ mediaType: { previews: ["corsair"] } },
],
createFromManifest: ["POST /app-manifests/{code}/conversions"],
createInstallationAccessToken: [
"POST /app/installations/{installation_id}/access_tokens",
],
deleteAuthorization: ["DELETE /applications/{client_id}/grant"],
deleteInstallation: ["DELETE /app/installations/{installation_id}"],
deleteToken: ["DELETE /applications/{client_id}/token"],
getAuthenticated: ["GET /app"],
getBySlug: ["GET /apps/{app_slug}"],
getInstallation: ["GET /app/installations/{installation_id}"],
getOrgInstallation: ["GET /orgs/{org}/installation"],
getRepoInstallation: ["GET /repos/{owner}/{repo}/installation"],
getSubscriptionPlanForAccount: [
"GET /marketplace_listing/accounts/{account_id}",
],
getSubscriptionPlanForAccountStubbed: [
"GET /marketplace_listing/stubbed/accounts/{account_id}",
],
getUserInstallation: ["GET /users/{username}/installation"],
listAccountsForPlan: ["GET /marketplace_listing/plans/{plan_id}/accounts"],
listAccountsForPlanStubbed: [
"GET /marketplace_listing/stubbed/plans/{plan_id}/accounts",
],
listInstallationReposForAuthenticatedUser: [
"GET /user/installations/{installation_id}/repositories",
],
listInstallations: ["GET /app/installations"],
listInstallationsForAuthenticatedUser: ["GET /user/installations"],
listPlans: ["GET /marketplace_listing/plans"],
listPlansStubbed: ["GET /marketplace_listing/stubbed/plans"],
listReposAccessibleToInstallation: ["GET /installation/repositories"],
listSubscriptionsForAuthenticatedUser: ["GET /user/marketplace_purchases"],
listSubscriptionsForAuthenticatedUserStubbed: [
"GET /user/marketplace_purchases/stubbed",
],
removeRepoFromInstallation: [
"DELETE /user/installations/{installation_id}/repositories/{repository_id}",
],
resetToken: ["PATCH /applications/{client_id}/token"],
revokeInstallationAccessToken: ["DELETE /installation/token"],
suspendInstallation: ["PUT /app/installations/{installation_id}/suspended"],
unsuspendInstallation: [
"DELETE /app/installations/{installation_id}/suspended",
],
},
billing: {
getGithubActionsBillingOrg: ["GET /orgs/{org}/settings/billing/actions"],
getGithubActionsBillingUser: [
"GET /users/{username}/settings/billing/actions",
],
getGithubPackagesBillingOrg: ["GET /orgs/{org}/settings/billing/packages"],
getGithubPackagesBillingUser: [
"GET /users/{username}/settings/billing/packages",
],
getSharedStorageBillingOrg: [
"GET /orgs/{org}/settings/billing/shared-storage",
],
getSharedStorageBillingUser: [
"GET /users/{username}/settings/billing/shared-storage",
],
},
checks: {
create: [
"POST /repos/{owner}/{repo}/check-runs",
{ mediaType: { previews: ["antiope"] } },
],
createSuite: [
"POST /repos/{owner}/{repo}/check-suites",
{ mediaType: { previews: ["antiope"] } },
],
get: [
"GET /repos/{owner}/{repo}/check-runs/{check_run_id}",
{ mediaType: { previews: ["antiope"] } },
],
getSuite: [
"GET /repos/{owner}/{repo}/check-suites/{check_suite_id}",
{ mediaType: { previews: ["antiope"] } },
],
listAnnotations: [
"GET /repos/{owner}/{repo}/check-runs/{check_run_id}/annotations",
{ mediaType: { previews: ["antiope"] } },
],
listForRef: [
"GET /repos/{owner}/{repo}/commits/{ref}/check-runs",
{ mediaType: { previews: ["antiope"] } },
],
listForSuite: [
"GET /repos/{owner}/{repo}/check-suites/{check_suite_id}/check-runs",
{ mediaType: { previews: ["antiope"] } },
],
listSuitesForRef: [
"GET /repos/{owner}/{repo}/commits/{ref}/check-suites",
{ mediaType: { previews: ["antiope"] } },
],
rerequestSuite: [
"POST /repos/{owner}/{repo}/check-suites/{check_suite_id}/rerequest",
{ mediaType: { previews: ["antiope"] } },
],
setSuitesPreferences: [
"PATCH /repos/{owner}/{repo}/check-suites/preferences",
{ mediaType: { previews: ["antiope"] } },
],
update: [
"PATCH /repos/{owner}/{repo}/check-runs/{check_run_id}",
{ mediaType: { previews: ["antiope"] } },
],
},
codeScanning: {
getAlert: ["GET /repos/{owner}/{repo}/code-scanning/alerts/{alert_id}"],
listAlertsForRepo: ["GET /repos/{owner}/{repo}/code-scanning/alerts"],
},
codesOfConduct: {
getAllCodesOfConduct: [
"GET /codes_of_conduct",
{ mediaType: { previews: ["scarlet-witch"] } },
],
getConductCode: [
"GET /codes_of_conduct/{key}",
{ mediaType: { previews: ["scarlet-witch"] } },
],
getForRepo: [
"GET /repos/{owner}/{repo}/community/code_of_conduct",
{ mediaType: { previews: ["scarlet-witch"] } },
],
},
emojis: { get: ["GET /emojis"] },
gists: {
checkIsStarred: ["GET /gists/{gist_id}/star"],
create: ["POST /gists"],
createComment: ["POST /gists/{gist_id}/comments"],
delete: ["DELETE /gists/{gist_id}"],
deleteComment: ["DELETE /gists/{gist_id}/comments/{comment_id}"],
fork: ["POST /gists/{gist_id}/forks"],
get: ["GET /gists/{gist_id}"],
getComment: ["GET /gists/{gist_id}/comments/{comment_id}"],
getRevision: ["GET /gists/{gist_id}/{sha}"],
list: ["GET /gists"],
listComments: ["GET /gists/{gist_id}/comments"],
listCommits: ["GET /gists/{gist_id}/commits"],
listForUser: ["GET /users/{username}/gists"],
listForks: ["GET /gists/{gist_id}/forks"],
listPublic: ["GET /gists/public"],
listStarred: ["GET /gists/starred"],
star: ["PUT /gists/{gist_id}/star"],
unstar: ["DELETE /gists/{gist_id}/star"],
update: ["PATCH /gists/{gist_id}"],
updateComment: ["PATCH /gists/{gist_id}/comments/{comment_id}"],
},
git: {
createBlob: ["POST /repos/{owner}/{repo}/git/blobs"],
createCommit: ["POST /repos/{owner}/{repo}/git/commits"],
createRef: ["POST /repos/{owner}/{repo}/git/refs"],
createTag: ["POST /repos/{owner}/{repo}/git/tags"],
createTree: ["POST /repos/{owner}/{repo}/git/trees"],
deleteRef: ["DELETE /repos/{owner}/{repo}/git/refs/{ref}"],
getBlob: ["GET /repos/{owner}/{repo}/git/blobs/{file_sha}"],
getCommit: ["GET /repos/{owner}/{repo}/git/commits/{commit_sha}"],
getRef: ["GET /repos/{owner}/{repo}/git/ref/{ref}"],
getTag: ["GET /repos/{owner}/{repo}/git/tags/{tag_sha}"],
getTree: ["GET /repos/{owner}/{repo}/git/trees/{tree_sha}"],
listMatchingRefs: ["GET /repos/{owner}/{repo}/git/matching-refs/{ref}"],
updateRef: ["PATCH /repos/{owner}/{repo}/git/refs/{ref}"],
},
gitignore: {
getAllTemplates: ["GET /gitignore/templates"],
getTemplate: ["GET /gitignore/templates/{name}"],
},
interactions: {
getRestrictionsForOrg: [
"GET /orgs/{org}/interaction-limits",
{ mediaType: { previews: ["sombra"] } },
],
getRestrictionsForRepo: [
"GET /repos/{owner}/{repo}/interaction-limits",
{ mediaType: { previews: ["sombra"] } },
],
removeRestrictionsForOrg: [
"DELETE /orgs/{org}/interaction-limits",
{ mediaType: { previews: ["sombra"] } },
],
removeRestrictionsForRepo: [
"DELETE /repos/{owner}/{repo}/interaction-limits",
{ mediaType: { previews: ["sombra"] } },
],
setRestrictionsForOrg: [
"PUT /orgs/{org}/interaction-limits",
{ mediaType: { previews: ["sombra"] } },
],
setRestrictionsForRepo: [
"PUT /repos/{owner}/{repo}/interaction-limits",
{ mediaType: { previews: ["sombra"] } },
],
},
issues: {
addAssignees: [
"POST /repos/{owner}/{repo}/issues/{issue_number}/assignees",
],
addLabels: ["POST /repos/{owner}/{repo}/issues/{issue_number}/labels"],
checkUserCanBeAssigned: ["GET /repos/{owner}/{repo}/assignees/{assignee}"],
create: ["POST /repos/{owner}/{repo}/issues"],
createComment: [
"POST /repos/{owner}/{repo}/issues/{issue_number}/comments",
],
createLabel: ["POST /repos/{owner}/{repo}/labels"],
createMilestone: ["POST /repos/{owner}/{repo}/milestones"],
deleteComment: [
"DELETE /repos/{owner}/{repo}/issues/comments/{comment_id}",
],
deleteLabel: ["DELETE /repos/{owner}/{repo}/labels/{name}"],
deleteMilestone: [
"DELETE /repos/{owner}/{repo}/milestones/{milestone_number}",
],
get: ["GET /repos/{owner}/{repo}/issues/{issue_number}"],
getComment: ["GET /repos/{owner}/{repo}/issues/comments/{comment_id}"],
getEvent: ["GET /repos/{owner}/{repo}/issues/events/{event_id}"],
getLabel: ["GET /repos/{owner}/{repo}/labels/{name}"],
getMilestone: ["GET /repos/{owner}/{repo}/milestones/{milestone_number}"],
list: ["GET /issues"],
listAssignees: ["GET /repos/{owner}/{repo}/assignees"],
listComments: ["GET /repos/{owner}/{repo}/issues/{issue_number}/comments"],
listCommentsForRepo: ["GET /repos/{owner}/{repo}/issues/comments"],
listEvents: ["GET /repos/{owner}/{repo}/issues/{issue_number}/events"],
listEventsForRepo: ["GET /repos/{owner}/{repo}/issues/events"],
listEventsForTimeline: [
"GET /repos/{owner}/{repo}/issues/{issue_number}/timeline",
{ mediaType: { previews: ["mockingbird"] } },
],
listForAuthenticatedUser: ["GET /user/issues"],
listForOrg: ["GET /orgs/{org}/issues"],
listForRepo: ["GET /repos/{owner}/{repo}/issues"],
listLabelsForMilestone: [
"GET /repos/{owner}/{repo}/milestones/{milestone_number}/labels",
],
listLabelsForRepo: ["GET /repos/{owner}/{repo}/labels"],
listLabelsOnIssue: [
"GET /repos/{owner}/{repo}/issues/{issue_number}/labels",
],
listMilestones: ["GET /repos/{owner}/{repo}/milestones"],
lock: ["PUT /repos/{owner}/{repo}/issues/{issue_number}/lock"],
removeAllLabels: [
"DELETE /repos/{owner}/{repo}/issues/{issue_number}/labels",
],
removeAssignees: [
"DELETE /repos/{owner}/{repo}/issues/{issue_number}/assignees",
],
removeLabel: [
"DELETE /repos/{owner}/{repo}/issues/{issue_number}/labels/{name}",
],
setLabels: ["PUT /repos/{owner}/{repo}/issues/{issue_number}/labels"],
unlock: ["DELETE /repos/{owner}/{repo}/issues/{issue_number}/lock"],
update: ["PATCH /repos/{owner}/{repo}/issues/{issue_number}"],
updateComment: ["PATCH /repos/{owner}/{repo}/issues/comments/{comment_id}"],
updateLabel: ["PATCH /repos/{owner}/{repo}/labels/{name}"],
updateMilestone: [
"PATCH /repos/{owner}/{repo}/milestones/{milestone_number}",
],
},
licenses: {
get: ["GET /licenses/{license}"],
getAllCommonlyUsed: ["GET /licenses"],
getForRepo: ["GET /repos/{owner}/{repo}/license"],
},
markdown: {
render: ["POST /markdown"],
renderRaw: [
"POST /markdown/raw",
{ headers: { "content-type": "text/plain; charset=utf-8" } },
],
},
meta: { get: ["GET /meta"] },
migrations: {
cancelImport: ["DELETE /repos/{owner}/{repo}/import"],
deleteArchiveForAuthenticatedUser: [
"DELETE /user/migrations/{migration_id}/archive",
{ mediaType: { previews: ["wyandotte"] } },
],
deleteArchiveForOrg: [
"DELETE /orgs/{org}/migrations/{migration_id}/archive",
{ mediaType: { previews: ["wyandotte"] } },
],
downloadArchiveForOrg: [
"GET /orgs/{org}/migrations/{migration_id}/archive",
{ mediaType: { previews: ["wyandotte"] } },
],
getArchiveForAuthenticatedUser: [
"GET /user/migrations/{migration_id}/archive",
{ mediaType: { previews: ["wyandotte"] } },
],
getCommitAuthors: ["GET /repos/{owner}/{repo}/import/authors"],
getImportStatus: ["GET /repos/{owner}/{repo}/import"],
getLargeFiles: ["GET /repos/{owner}/{repo}/import/large_files"],
getStatusForAuthenticatedUser: [
"GET /user/migrations/{migration_id}",
{ mediaType: { previews: ["wyandotte"] } },
],
getStatusForOrg: [
"GET /orgs/{org}/migrations/{migration_id}",
{ mediaType: { previews: ["wyandotte"] } },
],
listForAuthenticatedUser: [
"GET /user/migrations",
{ mediaType: { previews: ["wyandotte"] } },
],
listForOrg: [
"GET /orgs/{org}/migrations",
{ mediaType: { previews: ["wyandotte"] } },
],
listReposForOrg: [
"GET /orgs/{org}/migrations/{migration_id}/repositories",
{ mediaType: { previews: ["wyandotte"] } },
],
listReposForUser: [
"GET /user/migrations/{migration_id}/repositories",
{ mediaType: { previews: ["wyandotte"] } },
],
mapCommitAuthor: ["PATCH /repos/{owner}/{repo}/import/authors/{author_id}"],
setLfsPreference: ["PATCH /repos/{owner}/{repo}/import/lfs"],
startForAuthenticatedUser: ["POST /user/migrations"],
startForOrg: ["POST /orgs/{org}/migrations"],
startImport: ["PUT /repos/{owner}/{repo}/import"],
unlockRepoForAuthenticatedUser: [
"DELETE /user/migrations/{migration_id}/repos/{repo_name}/lock",
{ mediaType: { previews: ["wyandotte"] } },
],
unlockRepoForOrg: [
"DELETE /orgs/{org}/migrations/{migration_id}/repos/{repo_name}/lock",
{ mediaType: { previews: ["wyandotte"] } },
],
updateImport: ["PATCH /repos/{owner}/{repo}/import"],
},
orgs: {
blockUser: ["PUT /orgs/{org}/blocks/{username}"],
checkBlockedUser: ["GET /orgs/{org}/blocks/{username}"],
checkMembershipForUser: ["GET /orgs/{org}/members/{username}"],
checkPublicMembershipForUser: ["GET /orgs/{org}/public_members/{username}"],
convertMemberToOutsideCollaborator: [
"PUT /orgs/{org}/outside_collaborators/{username}",
],
createInvitation: ["POST /orgs/{org}/invitations"],
createWebhook: ["POST /orgs/{org}/hooks"],
deleteWebhook: ["DELETE /orgs/{org}/hooks/{hook_id}"],
get: ["GET /orgs/{org}"],
getMembershipForAuthenticatedUser: ["GET /user/memberships/orgs/{org}"],
getMembershipForUser: ["GET /orgs/{org}/memberships/{username}"],
getWebhook: ["GET /orgs/{org}/hooks/{hook_id}"],
list: ["GET /organizations"],
listAppInstallations: ["GET /orgs/{org}/installations"],
listBlockedUsers: ["GET /orgs/{org}/blocks"],
listForAuthenticatedUser: ["GET /user/orgs"],
listForUser: ["GET /users/{username}/orgs"],
listInvitationTeams: ["GET /orgs/{org}/invitations/{invitation_id}/teams"],
listMembers: ["GET /orgs/{org}/members"],
listMembershipsForAuthenticatedUser: ["GET /user/memberships/orgs"],
listOutsideCollaborators: ["GET /orgs/{org}/outside_collaborators"],
listPendingInvitations: ["GET /orgs/{org}/invitations"],
listPublicMembers: ["GET /orgs/{org}/public_members"],
listWebhooks: ["GET /orgs/{org}/hooks"],
pingWebhook: ["POST /orgs/{org}/hooks/{hook_id}/pings"],
removeMember: ["DELETE /orgs/{org}/members/{username}"],
removeMembershipForUser: ["DELETE /orgs/{org}/memberships/{username}"],
removeOutsideCollaborator: [
"DELETE /orgs/{org}/outside_collaborators/{username}",
],
removePublicMembershipForAuthenticatedUser: [
"DELETE /orgs/{org}/public_members/{username}",
],
setMembershipForUser: ["PUT /orgs/{org}/memberships/{username}"],
setPublicMembershipForAuthenticatedUser: [
"PUT /orgs/{org}/public_members/{username}",
],
unblockUser: ["DELETE /orgs/{org}/blocks/{username}"],
update: ["PATCH /orgs/{org}"],
updateMembershipForAuthenticatedUser: [
"PATCH /user/memberships/orgs/{org}",
],
updateWebhook: ["PATCH /orgs/{org}/hooks/{hook_id}"],
},
projects: {
addCollaborator: [
"PUT /projects/{project_id}/collaborators/{username}",
{ mediaType: { previews: ["inertia"] } },
],
createCard: [
"POST /projects/columns/{column_id}/cards",
{ mediaType: { previews: ["inertia"] } },
],
createColumn: [
"POST /projects/{project_id}/columns",
{ mediaType: { previews: ["inertia"] } },
],
createForAuthenticatedUser: [
"POST /user/projects",
{ mediaType: { previews: ["inertia"] } },
],
createForOrg: [
"POST /orgs/{org}/projects",
{ mediaType: { previews: ["inertia"] } },
],
createForRepo: [
"POST /repos/{owner}/{repo}/projects",
{ mediaType: { previews: ["inertia"] } },
],
delete: [
"DELETE /projects/{project_id}",
{ mediaType: { previews: ["inertia"] } },
],
deleteCard: [
"DELETE /projects/columns/cards/{card_id}",
{ mediaType: { previews: ["inertia"] } },
],
deleteColumn: [
"DELETE /projects/columns/{column_id}",
{ mediaType: { previews: ["inertia"] } },
],
get: [
"GET /projects/{project_id}",
{ mediaType: { previews: ["inertia"] } },
],
getCard: [
"GET /projects/columns/cards/{card_id}",
{ mediaType: { previews: ["inertia"] } },
],
getColumn: [
"GET /projects/columns/{column_id}",
{ mediaType: { previews: ["inertia"] } },
],
getPermissionForUser: [
"GET /projects/{project_id}/collaborators/{username}/permission",
{ mediaType: { previews: ["inertia"] } },
],
listCards: [
"GET /projects/columns/{column_id}/cards",
{ mediaType: { previews: ["inertia"] } },
],
listCollaborators: [
"GET /projects/{project_id}/collaborators",
{ mediaType: { previews: ["inertia"] } },
],
listColumns: [
"GET /projects/{project_id}/columns",
{ mediaType: { previews: ["inertia"] } },
],
listForOrg: [
"GET /orgs/{org}/projects",
{ mediaType: { previews: ["inertia"] } },
],
listForRepo: [
"GET /repos/{owner}/{repo}/projects",
{ mediaType: { previews: ["inertia"] } },
],
listForUser: [
"GET /users/{username}/projects",
{ mediaType: { previews: ["inertia"] } },
],
moveCard: [
"POST /projects/columns/cards/{card_id}/moves",
{ mediaType: { previews: ["inertia"] } },
],
moveColumn: [
"POST /projects/columns/{column_id}/moves",
{ mediaType: { previews: ["inertia"] } },
],
removeCollaborator: [
"DELETE /projects/{project_id}/collaborators/{username}",
{ mediaType: { previews: ["inertia"] } },
],
update: [
"PATCH /projects/{project_id}",
{ mediaType: { previews: ["inertia"] } },
],
updateCard: [
"PATCH /projects/columns/cards/{card_id}",
{ mediaType: { previews: ["inertia"] } },
],
updateColumn: [
"PATCH /projects/columns/{column_id}",
{ mediaType: { previews: ["inertia"] } },
],
},
pulls: {
checkIfMerged: ["GET /repos/{owner}/{repo}/pulls/{pull_number}/merge"],
create: ["POST /repos/{owner}/{repo}/pulls"],
createReplyForReviewComment: [
"POST /repos/{owner}/{repo}/pulls/{pull_number}/comments/{comment_id}/replies",
],
createReview: ["POST /repos/{owner}/{repo}/pulls/{pull_number}/reviews"],
createReviewComment: [
"POST /repos/{owner}/{repo}/pulls/{pull_number}/comments",
],
deletePendingReview: [
"DELETE /repos/{owner}/{repo}/pulls/{pull_number}/reviews/{review_id}",
],
deleteReviewComment: [
"DELETE /repos/{owner}/{repo}/pulls/comments/{comment_id}",
],
dismissReview: [
"PUT /repos/{owner}/{repo}/pulls/{pull_number}/reviews/{review_id}/dismissals",
],
get: ["GET /repos/{owner}/{repo}/pulls/{pull_number}"],
getReview: [
"GET /repos/{owner}/{repo}/pulls/{pull_number}/reviews/{review_id}",
],
getReviewComment: ["GET /repos/{owner}/{repo}/pulls/comments/{comment_id}"],
list: ["GET /repos/{owner}/{repo}/pulls"],
listCommentsForReview: [
"GET /repos/{owner}/{repo}/pulls/{pull_number}/reviews/{review_id}/comments",
],
listCommits: ["GET /repos/{owner}/{repo}/pulls/{pull_number}/commits"],
listFiles: ["GET /repos/{owner}/{repo}/pulls/{pull_number}/files"],
listRequestedReviewers: [
"GET /repos/{owner}/{repo}/pulls/{pull_number}/requested_reviewers",
],
listReviewComments: [
"GET /repos/{owner}/{repo}/pulls/{pull_number}/comments",
],
listReviewCommentsForRepo: ["GET /repos/{owner}/{repo}/pulls/comments"],
listReviews: ["GET /repos/{owner}/{repo}/pulls/{pull_number}/reviews"],
merge: ["PUT /repos/{owner}/{repo}/pulls/{pull_number}/merge"],
removeRequestedReviewers: [
"DELETE /repos/{owner}/{repo}/pulls/{pull_number}/requested_reviewers",
],
requestReviewers: [
"POST /repos/{owner}/{repo}/pulls/{pull_number}/requested_reviewers",
],
submitReview: [
"POST /repos/{owner}/{repo}/pulls/{pull_number}/reviews/{review_id}/events",
],
update: ["PATCH /repos/{owner}/{repo}/pulls/{pull_number}"],
updateBranch: [
"PUT /repos/{owner}/{repo}/pulls/{pull_number}/update-branch",
{ mediaType: { previews: ["lydian"] } },
],
updateReview: [
"PUT /repos/{owner}/{repo}/pulls/{pull_number}/reviews/{review_id}",
],
updateReviewComment: [
"PATCH /repos/{owner}/{repo}/pulls/comments/{comment_id}",
],
},
rateLimit: { get: ["GET /rate_limit"] },
reactions: {
createForCommitComment: [
"POST /repos/{owner}/{repo}/comments/{comment_id}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
createForIssue: [
"POST /repos/{owner}/{repo}/issues/{issue_number}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
createForIssueComment: [
"POST /repos/{owner}/{repo}/issues/comments/{comment_id}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
createForPullRequestReviewComment: [
"POST /repos/{owner}/{repo}/pulls/comments/{comment_id}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
createForTeamDiscussionCommentInOrg: [
"POST /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments/{comment_number}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
createForTeamDiscussionInOrg: [
"POST /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteForCommitComment: [
"DELETE /repos/{owner}/{repo}/comments/{comment_id}/reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteForIssue: [
"DELETE /repos/{owner}/{repo}/issues/{issue_number}/reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteForIssueComment: [
"DELETE /repos/{owner}/{repo}/issues/comments/{comment_id}/reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteForPullRequestComment: [
"DELETE /repos/{owner}/{repo}/pulls/comments/{comment_id}/reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteForTeamDiscussion: [
"DELETE /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteForTeamDiscussionComment: [
"DELETE /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments/{comment_number}/reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
],
deleteLegacy: [
"DELETE /reactions/{reaction_id}",
{ mediaType: { previews: ["squirrel-girl"] } },
{
deprecated: "octokit.reactions.deleteLegacy() is deprecated, see https://developer.github.com/v3/reactions/#delete-a-reaction-legacy",
},
],
listForCommitComment: [
"GET /repos/{owner}/{repo}/comments/{comment_id}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
listForIssue: [
"GET /repos/{owner}/{repo}/issues/{issue_number}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
listForIssueComment: [
"GET /repos/{owner}/{repo}/issues/comments/{comment_id}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
listForPullRequestReviewComment: [
"GET /repos/{owner}/{repo}/pulls/comments/{comment_id}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
listForTeamDiscussionCommentInOrg: [
"GET /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments/{comment_number}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
listForTeamDiscussionInOrg: [
"GET /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/reactions",
{ mediaType: { previews: ["squirrel-girl"] } },
],
},
repos: {
acceptInvitation: ["PATCH /user/repository_invitations/{invitation_id}"],
addAppAccessRestrictions: [
"POST /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/apps",
{},
{ mapToData: "apps" },
],
addCollaborator: ["PUT /repos/{owner}/{repo}/collaborators/{username}"],
addStatusCheckContexts: [
"POST /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks/contexts",
{},
{ mapToData: "contexts" },
],
addTeamAccessRestrictions: [
"POST /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/teams",
{},
{ mapToData: "teams" },
],
addUserAccessRestrictions: [
"POST /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/users",
{},
{ mapToData: "users" },
],
checkCollaborator: ["GET /repos/{owner}/{repo}/collaborators/{username}"],
checkVulnerabilityAlerts: [
"GET /repos/{owner}/{repo}/vulnerability-alerts",
{ mediaType: { previews: ["dorian"] } },
],
compareCommits: ["GET /repos/{owner}/{repo}/compare/{base}...{head}"],
createCommitComment: [
"POST /repos/{owner}/{repo}/commits/{commit_sha}/comments",
],
createCommitSignatureProtection: [
"POST /repos/{owner}/{repo}/branches/{branch}/protection/required_signatures",
{ mediaType: { previews: ["zzzax"] } },
],
createCommitStatus: ["POST /repos/{owner}/{repo}/statuses/{sha}"],
createDeployKey: ["POST /repos/{owner}/{repo}/keys"],
createDeployment: ["POST /repos/{owner}/{repo}/deployments"],
createDeploymentStatus: [
"POST /repos/{owner}/{repo}/deployments/{deployment_id}/statuses",
],
createDispatchEvent: ["POST /repos/{owner}/{repo}/dispatches"],
createForAuthenticatedUser: ["POST /user/repos"],
createFork: ["POST /repos/{owner}/{repo}/forks"],
createInOrg: ["POST /orgs/{org}/repos"],
createOrUpdateFileContents: ["PUT /repos/{owner}/{repo}/contents/{path}"],
createPagesSite: [
"POST /repos/{owner}/{repo}/pages",
{ mediaType: { previews: ["switcheroo"] } },
],
createRelease: ["POST /repos/{owner}/{repo}/releases"],
createUsingTemplate: [
"POST /repos/{template_owner}/{template_repo}/generate",
{ mediaType: { previews: ["baptiste"] } },
],
createWebhook: ["POST /repos/{owner}/{repo}/hooks"],
declineInvitation: ["DELETE /user/repository_invitations/{invitation_id}"],
delete: ["DELETE /repos/{owner}/{repo}"],
deleteAccessRestrictions: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/restrictions",
],
deleteAdminBranchProtection: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/enforce_admins",
],
deleteBranchProtection: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection",
],
deleteCommitComment: ["DELETE /repos/{owner}/{repo}/comments/{comment_id}"],
deleteCommitSignatureProtection: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/required_signatures",
{ mediaType: { previews: ["zzzax"] } },
],
deleteDeployKey: ["DELETE /repos/{owner}/{repo}/keys/{key_id}"],
deleteDeployment: [
"DELETE /repos/{owner}/{repo}/deployments/{deployment_id}",
],
deleteFile: ["DELETE /repos/{owner}/{repo}/contents/{path}"],
deleteInvitation: [
"DELETE /repos/{owner}/{repo}/invitations/{invitation_id}",
],
deletePagesSite: [
"DELETE /repos/{owner}/{repo}/pages",
{ mediaType: { previews: ["switcheroo"] } },
],
deletePullRequestReviewProtection: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/required_pull_request_reviews",
],
deleteRelease: ["DELETE /repos/{owner}/{repo}/releases/{release_id}"],
deleteReleaseAsset: [
"DELETE /repos/{owner}/{repo}/releases/assets/{asset_id}",
],
deleteWebhook: ["DELETE /repos/{owner}/{repo}/hooks/{hook_id}"],
disableAutomatedSecurityFixes: [
"DELETE /repos/{owner}/{repo}/automated-security-fixes",
{ mediaType: { previews: ["london"] } },
],
disableVulnerabilityAlerts: [
"DELETE /repos/{owner}/{repo}/vulnerability-alerts",
{ mediaType: { previews: ["dorian"] } },
],
downloadArchive: ["GET /repos/{owner}/{repo}/{archive_format}/{ref}"],
enableAutomatedSecurityFixes: [
"PUT /repos/{owner}/{repo}/automated-security-fixes",
{ mediaType: { previews: ["london"] } },
],
enableVulnerabilityAlerts: [
"PUT /repos/{owner}/{repo}/vulnerability-alerts",
{ mediaType: { previews: ["dorian"] } },
],
get: ["GET /repos/{owner}/{repo}"],
getAccessRestrictions: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/restrictions",
],
getAdminBranchProtection: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/enforce_admins",
],
getAllStatusCheckContexts: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks/contexts",
],
getAllTopics: [
"GET /repos/{owner}/{repo}/topics",
{ mediaType: { previews: ["mercy"] } },
],
getAppsWithAccessToProtectedBranch: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/apps",
],
getBranch: ["GET /repos/{owner}/{repo}/branches/{branch}"],
getBranchProtection: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection",
],
getClones: ["GET /repos/{owner}/{repo}/traffic/clones"],
getCodeFrequencyStats: ["GET /repos/{owner}/{repo}/stats/code_frequency"],
getCollaboratorPermissionLevel: [
"GET /repos/{owner}/{repo}/collaborators/{username}/permission",
],
getCombinedStatusForRef: ["GET /repos/{owner}/{repo}/commits/{ref}/status"],
getCommit: ["GET /repos/{owner}/{repo}/commits/{ref}"],
getCommitActivityStats: ["GET /repos/{owner}/{repo}/stats/commit_activity"],
getCommitComment: ["GET /repos/{owner}/{repo}/comments/{comment_id}"],
getCommitSignatureProtection: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/required_signatures",
{ mediaType: { previews: ["zzzax"] } },
],
getCommunityProfileMetrics: [
"GET /repos/{owner}/{repo}/community/profile",
{ mediaType: { previews: ["black-panther"] } },
],
getContent: ["GET /repos/{owner}/{repo}/contents/{path}"],
getContributorsStats: ["GET /repos/{owner}/{repo}/stats/contributors"],
getDeployKey: ["GET /repos/{owner}/{repo}/keys/{key_id}"],
getDeployment: ["GET /repos/{owner}/{repo}/deployments/{deployment_id}"],
getDeploymentStatus: [
"GET /repos/{owner}/{repo}/deployments/{deployment_id}/statuses/{status_id}",
],
getLatestPagesBuild: ["GET /repos/{owner}/{repo}/pages/builds/latest"],
getLatestRelease: ["GET /repos/{owner}/{repo}/releases/latest"],
getPages: ["GET /repos/{owner}/{repo}/pages"],
getPagesBuild: ["GET /repos/{owner}/{repo}/pages/builds/{build_id}"],
getParticipationStats: ["GET /repos/{owner}/{repo}/stats/participation"],
getPullRequestReviewProtection: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/required_pull_request_reviews",
],
getPunchCardStats: ["GET /repos/{owner}/{repo}/stats/punch_card"],
getReadme: ["GET /repos/{owner}/{repo}/readme"],
getRelease: ["GET /repos/{owner}/{repo}/releases/{release_id}"],
getReleaseAsset: ["GET /repos/{owner}/{repo}/releases/assets/{asset_id}"],
getReleaseByTag: ["GET /repos/{owner}/{repo}/releases/tags/{tag}"],
getStatusChecksProtection: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks",
],
getTeamsWithAccessToProtectedBranch: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/teams",
],
getTopPaths: ["GET /repos/{owner}/{repo}/traffic/popular/paths"],
getTopReferrers: ["GET /repos/{owner}/{repo}/traffic/popular/referrers"],
getUsersWithAccessToProtectedBranch: [
"GET /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/users",
],
getViews: ["GET /repos/{owner}/{repo}/traffic/views"],
getWebhook: ["GET /repos/{owner}/{repo}/hooks/{hook_id}"],
listBranches: ["GET /repos/{owner}/{repo}/branches"],
listBranchesForHeadCommit: [
"GET /repos/{owner}/{repo}/commits/{commit_sha}/branches-where-head",
{ mediaType: { previews: ["groot"] } },
],
listCollaborators: ["GET /repos/{owner}/{repo}/collaborators"],
listCommentsForCommit: [
"GET /repos/{owner}/{repo}/commits/{commit_sha}/comments",
],
listCommitCommentsForRepo: ["GET /repos/{owner}/{repo}/comments"],
listCommitStatusesForRef: [
"GET /repos/{owner}/{repo}/commits/{ref}/statuses",
],
listCommits: ["GET /repos/{owner}/{repo}/commits"],
listContributors: ["GET /repos/{owner}/{repo}/contributors"],
listDeployKeys: ["GET /repos/{owner}/{repo}/keys"],
listDeploymentStatuses: [
"GET /repos/{owner}/{repo}/deployments/{deployment_id}/statuses",
],
listDeployments: ["GET /repos/{owner}/{repo}/deployments"],
listForAuthenticatedUser: ["GET /user/repos"],
listForOrg: ["GET /orgs/{org}/repos"],
listForUser: ["GET /users/{username}/repos"],
listForks: ["GET /repos/{owner}/{repo}/forks"],
listInvitations: ["GET /repos/{owner}/{repo}/invitations"],
listInvitationsForAuthenticatedUser: ["GET /user/repository_invitations"],
listLanguages: ["GET /repos/{owner}/{repo}/languages"],
listPagesBuilds: ["GET /repos/{owner}/{repo}/pages/builds"],
listPublic: ["GET /repositories"],
listPullRequestsAssociatedWithCommit: [
"GET /repos/{owner}/{repo}/commits/{commit_sha}/pulls",
{ mediaType: { previews: ["groot"] } },
],
listReleaseAssets: [
"GET /repos/{owner}/{repo}/releases/{release_id}/assets",
],
listReleases: ["GET /repos/{owner}/{repo}/releases"],
listTags: ["GET /repos/{owner}/{repo}/tags"],
listTeams: ["GET /repos/{owner}/{repo}/teams"],
listWebhooks: ["GET /repos/{owner}/{repo}/hooks"],
merge: ["POST /repos/{owner}/{repo}/merges"],
pingWebhook: ["POST /repos/{owner}/{repo}/hooks/{hook_id}/pings"],
removeAppAccessRestrictions: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/apps",
{},
{ mapToData: "apps" },
],
removeCollaborator: [
"DELETE /repos/{owner}/{repo}/collaborators/{username}",
],
removeStatusCheckContexts: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks/contexts",
{},
{ mapToData: "contexts" },
],
removeStatusCheckProtection: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks",
],
removeTeamAccessRestrictions: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/teams",
{},
{ mapToData: "teams" },
],
removeUserAccessRestrictions: [
"DELETE /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/users",
{},
{ mapToData: "users" },
],
replaceAllTopics: [
"PUT /repos/{owner}/{repo}/topics",
{ mediaType: { previews: ["mercy"] } },
],
requestPagesBuild: ["POST /repos/{owner}/{repo}/pages/builds"],
setAdminBranchProtection: [
"POST /repos/{owner}/{repo}/branches/{branch}/protection/enforce_admins",
],
setAppAccessRestrictions: [
"PUT /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/apps",
{},
{ mapToData: "apps" },
],
setStatusCheckContexts: [
"PUT /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks/contexts",
{},
{ mapToData: "contexts" },
],
setTeamAccessRestrictions: [
"PUT /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/teams",
{},
{ mapToData: "teams" },
],
setUserAccessRestrictions: [
"PUT /repos/{owner}/{repo}/branches/{branch}/protection/restrictions/users",
{},
{ mapToData: "users" },
],
testPushWebhook: ["POST /repos/{owner}/{repo}/hooks/{hook_id}/tests"],
transfer: ["POST /repos/{owner}/{repo}/transfer"],
update: ["PATCH /repos/{owner}/{repo}"],
updateBranchProtection: [
"PUT /repos/{owner}/{repo}/branches/{branch}/protection",
],
updateCommitComment: ["PATCH /repos/{owner}/{repo}/comments/{comment_id}"],
updateInformationAboutPagesSite: ["PUT /repos/{owner}/{repo}/pages"],
updateInvitation: [
"PATCH /repos/{owner}/{repo}/invitations/{invitation_id}",
],
updatePullRequestReviewProtection: [
"PATCH /repos/{owner}/{repo}/branches/{branch}/protection/required_pull_request_reviews",
],
updateRelease: ["PATCH /repos/{owner}/{repo}/releases/{release_id}"],
updateReleaseAsset: [
"PATCH /repos/{owner}/{repo}/releases/assets/{asset_id}",
],
updateStatusCheckPotection: [
"PATCH /repos/{owner}/{repo}/branches/{branch}/protection/required_status_checks",
],
updateWebhook: ["PATCH /repos/{owner}/{repo}/hooks/{hook_id}"],
uploadReleaseAsset: [
"POST /repos/{owner}/{repo}/releases/{release_id}/assets{?name,label}",
{ baseUrl: "https://uploads.github.com" },
],
},
search: {
code: ["GET /search/code"],
commits: ["GET /search/commits", { mediaType: { previews: ["cloak"] } }],
issuesAndPullRequests: ["GET /search/issues"],
labels: ["GET /search/labels"],
repos: ["GET /search/repositories"],
topics: ["GET /search/topics", { mediaType: { previews: ["mercy"] } }],
users: ["GET /search/users"],
},
teams: {
addOrUpdateMembershipForUserInOrg: [
"PUT /orgs/{org}/teams/{team_slug}/memberships/{username}",
],
addOrUpdateProjectPermissionsInOrg: [
"PUT /orgs/{org}/teams/{team_slug}/projects/{project_id}",
{ mediaType: { previews: ["inertia"] } },
],
addOrUpdateRepoPermissionsInOrg: [
"PUT /orgs/{org}/teams/{team_slug}/repos/{owner}/{repo}",
],
checkPermissionsForProjectInOrg: [
"GET /orgs/{org}/teams/{team_slug}/projects/{project_id}",
{ mediaType: { previews: ["inertia"] } },
],
checkPermissionsForRepoInOrg: [
"GET /orgs/{org}/teams/{team_slug}/repos/{owner}/{repo}",
],
create: ["POST /orgs/{org}/teams"],
createDiscussionCommentInOrg: [
"POST /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments",
],
createDiscussionInOrg: ["POST /orgs/{org}/teams/{team_slug}/discussions"],
deleteDiscussionCommentInOrg: [
"DELETE /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments/{comment_number}",
],
deleteDiscussionInOrg: [
"DELETE /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}",
],
deleteInOrg: ["DELETE /orgs/{org}/teams/{team_slug}"],
getByName: ["GET /orgs/{org}/teams/{team_slug}"],
getDiscussionCommentInOrg: [
"GET /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments/{comment_number}",
],
getDiscussionInOrg: [
"GET /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}",
],
getMembershipForUserInOrg: [
"GET /orgs/{org}/teams/{team_slug}/memberships/{username}",
],
list: ["GET /orgs/{org}/teams"],
listChildInOrg: ["GET /orgs/{org}/teams/{team_slug}/teams"],
listDiscussionCommentsInOrg: [
"GET /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments",
],
listDiscussionsInOrg: ["GET /orgs/{org}/teams/{team_slug}/discussions"],
listForAuthenticatedUser: ["GET /user/teams"],
listMembersInOrg: ["GET /orgs/{org}/teams/{team_slug}/members"],
listPendingInvitationsInOrg: [
"GET /orgs/{org}/teams/{team_slug}/invitations",
],
listProjectsInOrg: [
"GET /orgs/{org}/teams/{team_slug}/projects",
{ mediaType: { previews: ["inertia"] } },
],
listReposInOrg: ["GET /orgs/{org}/teams/{team_slug}/repos"],
removeMembershipForUserInOrg: [
"DELETE /orgs/{org}/teams/{team_slug}/memberships/{username}",
],
removeProjectInOrg: [
"DELETE /orgs/{org}/teams/{team_slug}/projects/{project_id}",
],
removeRepoInOrg: [
"DELETE /orgs/{org}/teams/{team_slug}/repos/{owner}/{repo}",
],
updateDiscussionCommentInOrg: [
"PATCH /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}/comments/{comment_number}",
],
updateDiscussionInOrg: [
"PATCH /orgs/{org}/teams/{team_slug}/discussions/{discussion_number}",
],
updateInOrg: ["PATCH /orgs/{org}/teams/{team_slug}"],
},
users: {
addEmailForAuthenticated: ["POST /user/emails"],
block: ["PUT /user/blocks/{username}"],
checkBlocked: ["GET /user/blocks/{username}"],
checkFollowingForUser: ["GET /users/{username}/following/{target_user}"],
checkPersonIsFollowedByAuthenticated: ["GET /user/following/{username}"],
createGpgKeyForAuthenticated: ["POST /user/gpg_keys"],
createPublicSshKeyForAuthenticated: ["POST /user/keys"],
deleteEmailForAuthenticated: ["DELETE /user/emails"],
deleteGpgKeyForAuthenticated: ["DELETE /user/gpg_keys/{gpg_key_id}"],
deletePublicSshKeyForAuthenticated: ["DELETE /user/keys/{key_id}"],
follow: ["PUT /user/following/{username}"],
getAuthenticated: ["GET /user"],
getByUsername: ["GET /users/{username}"],
getContextForUser: ["GET /users/{username}/hovercard"],
getGpgKeyForAuthenticated: ["GET /user/gpg_keys/{gpg_key_id}"],
getPublicSshKeyForAuthenticated: ["GET /user/keys/{key_id}"],
list: ["GET /users"],
listBlockedByAuthenticated: ["GET /user/blocks"],
listEmailsForAuthenticated: ["GET /user/emails"],
listFollowedByAuthenticated: ["GET /user/following"],
listFollowersForAuthenticatedUser: ["GET /user/followers"],
listFollowersForUser: ["GET /users/{username}/followers"],
listFollowingForUser: ["GET /users/{username}/following"],
listGpgKeysForAuthenticated: ["GET /user/gpg_keys"],
listGpgKeysForUser: ["GET /users/{username}/gpg_keys"],
listPublicEmailsForAuthenticated: ["GET /user/public_emails"],
listPublicKeysForUser: ["GET /users/{username}/keys"],
listPublicSshKeysForAuthenticated: ["GET /user/keys"],
setPrimaryEmailVisibilityForAuthenticated: ["PATCH /user/email/visibility"],
unblock: ["DELETE /user/blocks/{username}"],
unfollow: ["DELETE /user/following/{username}"],
updateAuthenticated: ["PATCH /user"],
},
};
const VERSION$6 = "4.1.4";
function endpointsToMethods(octokit, endpointsMap) {
const newMethods = {};
for (const [scope, endpoints] of Object.entries(endpointsMap)) {
for (const [methodName, endpoint] of Object.entries(endpoints)) {
const [route, defaults, decorations] = endpoint;
const [method, url] = route.split(/ /);
const endpointDefaults = Object.assign({ method, url }, defaults);
if (!newMethods[scope]) {
newMethods[scope] = {};
}
const scopeMethods = newMethods[scope];
if (decorations) {
scopeMethods[methodName] = decorate(octokit, scope, methodName, endpointDefaults, decorations);
continue;
}
scopeMethods[methodName] = octokit.request.defaults(endpointDefaults);
}
}
return newMethods;
}
function decorate(octokit, scope, methodName, defaults, decorations) {
const requestWithDefaults = octokit.request.defaults(defaults);
/* istanbul ignore next */
function withDecorations(...args) {
// @ts-ignore https://github.com/microsoft/TypeScript/issues/25488
let options = requestWithDefaults.endpoint.merge(...args);
// There are currently no other decorations than `.mapToData`
if (decorations.mapToData) {
options = Object.assign({}, options, {
data: options[decorations.mapToData],
[decorations.mapToData]: undefined,
});
return requestWithDefaults(options);
}
if (decorations.renamed) {
const [newScope, newMethodName] = decorations.renamed;
octokit.log.warn(`octokit.${scope}.${methodName}() has been renamed to octokit.${newScope}.${newMethodName}()`);
}
if (decorations.deprecated) {
octokit.log.warn(decorations.deprecated);
}
if (decorations.renamedParameters) {
// @ts-ignore https://github.com/microsoft/TypeScript/issues/25488
const options = requestWithDefaults.endpoint.merge(...args);
for (const [name, alias] of Object.entries(decorations.renamedParameters)) {
if (name in options) {
octokit.log.warn(`"${name}" parameter is deprecated for "octokit.${scope}.${methodName}()". Use "${alias}" instead`);
if (!(alias in options)) {
options[alias] = options[name];
}
delete options[name];
}
}
return requestWithDefaults(options);
}
// @ts-ignore https://github.com/microsoft/TypeScript/issues/25488
return requestWithDefaults(...args);
}
return Object.assign(withDecorations, requestWithDefaults);
}
/**
* This plugin is a 1:1 copy of internal @octokit/rest plugins. The primary
* goal is to rebuild @octokit/rest on top of @octokit/core. Once that is
* done, we will remove the registerEndpoints methods and return the methods
* directly as with the other plugins. At that point we will also remove the
* legacy workarounds and deprecations.
*
* See the plan at
* https://github.com/octokit/plugin-rest-endpoint-methods.js/pull/1
*/
function restEndpointMethods(octokit) {
return endpointsToMethods(octokit, Endpoints);
}
restEndpointMethods.VERSION = VERSION$6;
const VERSION$7 = "18.0.5";
const Octokit$1 = Octokit.plugin(requestLog, restEndpointMethods, paginateRest).defaults({
userAgent: `octokit-rest.js/${VERSION$7}`,
});
var endpointsByScope = {
actions: {
cancelWorkflowRun: {
method: "POST",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
run_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runs/:run_id/cancel"
},
createOrUpdateSecretForRepo: {
method: "PUT",
params: {
encrypted_value: { type: "string" },
key_id: { type: "string" },
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/secrets/:name"
},
createRegistrationToken: {
method: "POST",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/runners/registration-token"
},
createRemoveToken: {
method: "POST",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/runners/remove-token"
},
deleteArtifact: {
method: "DELETE",
params: {
artifact_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/artifacts/:artifact_id"
},
deleteSecretFromRepo: {
method: "DELETE",
params: {
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/secrets/:name"
},
downloadArtifact: {
method: "GET",
params: {
archive_format: { required: true, type: "string" },
artifact_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/artifacts/:artifact_id/:archive_format"
},
getArtifact: {
method: "GET",
params: {
artifact_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/artifacts/:artifact_id"
},
getPublicKey: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/secrets/public-key"
},
getSecret: {
method: "GET",
params: {
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/secrets/:name"
},
getSelfHostedRunner: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
runner_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runners/:runner_id"
},
getWorkflow: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
workflow_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/workflows/:workflow_id"
},
getWorkflowJob: {
method: "GET",
params: {
job_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/jobs/:job_id"
},
getWorkflowRun: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
run_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runs/:run_id"
},
listDownloadsForSelfHostedRunnerApplication: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/runners/downloads"
},
listJobsForWorkflowRun: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
run_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runs/:run_id/jobs"
},
listRepoWorkflowRuns: {
method: "GET",
params: {
actor: { type: "string" },
branch: { type: "string" },
event: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
status: { enum: ["completed", "status", "conclusion"], type: "string" }
},
url: "/repos/:owner/:repo/actions/runs"
},
listRepoWorkflows: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/workflows"
},
listSecretsForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/secrets"
},
listSelfHostedRunnersForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/runners"
},
listWorkflowJobLogs: {
method: "GET",
params: {
job_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/actions/jobs/:job_id/logs"
},
listWorkflowRunArtifacts: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
run_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runs/:run_id/artifacts"
},
listWorkflowRunLogs: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
run_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runs/:run_id/logs"
},
listWorkflowRuns: {
method: "GET",
params: {
actor: { type: "string" },
branch: { type: "string" },
event: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
status: { enum: ["completed", "status", "conclusion"], type: "string" },
workflow_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/workflows/:workflow_id/runs"
},
reRunWorkflow: {
method: "POST",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
run_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runs/:run_id/rerun"
},
removeSelfHostedRunner: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
runner_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/actions/runners/:runner_id"
}
},
activity: {
checkStarringRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/user/starred/:owner/:repo"
},
deleteRepoSubscription: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/subscription"
},
deleteThreadSubscription: {
method: "DELETE",
params: { thread_id: { required: true, type: "integer" } },
url: "/notifications/threads/:thread_id/subscription"
},
getRepoSubscription: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/subscription"
},
getThread: {
method: "GET",
params: { thread_id: { required: true, type: "integer" } },
url: "/notifications/threads/:thread_id"
},
getThreadSubscription: {
method: "GET",
params: { thread_id: { required: true, type: "integer" } },
url: "/notifications/threads/:thread_id/subscription"
},
listEventsForOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/events/orgs/:org"
},
listEventsForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/events"
},
listFeeds: { method: "GET", params: {}, url: "/feeds" },
listNotifications: {
method: "GET",
params: {
all: { type: "boolean" },
before: { type: "string" },
page: { type: "integer" },
participating: { type: "boolean" },
per_page: { type: "integer" },
since: { type: "string" }
},
url: "/notifications"
},
listNotificationsForRepo: {
method: "GET",
params: {
all: { type: "boolean" },
before: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
participating: { type: "boolean" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
since: { type: "string" }
},
url: "/repos/:owner/:repo/notifications"
},
listPublicEvents: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/events"
},
listPublicEventsForOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/events"
},
listPublicEventsForRepoNetwork: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/networks/:owner/:repo/events"
},
listPublicEventsForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/events/public"
},
listReceivedEventsForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/received_events"
},
listReceivedPublicEventsForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/received_events/public"
},
listRepoEvents: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/events"
},
listReposStarredByAuthenticatedUser: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/user/starred"
},
listReposStarredByUser: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
sort: { enum: ["created", "updated"], type: "string" },
username: { required: true, type: "string" }
},
url: "/users/:username/starred"
},
listReposWatchedByUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/subscriptions"
},
listStargazersForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/stargazers"
},
listWatchedReposForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/subscriptions"
},
listWatchersForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/subscribers"
},
markAsRead: {
method: "PUT",
params: { last_read_at: { type: "string" } },
url: "/notifications"
},
markNotificationsAsReadForRepo: {
method: "PUT",
params: {
last_read_at: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/notifications"
},
markThreadAsRead: {
method: "PATCH",
params: { thread_id: { required: true, type: "integer" } },
url: "/notifications/threads/:thread_id"
},
setRepoSubscription: {
method: "PUT",
params: {
ignored: { type: "boolean" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
subscribed: { type: "boolean" }
},
url: "/repos/:owner/:repo/subscription"
},
setThreadSubscription: {
method: "PUT",
params: {
ignored: { type: "boolean" },
thread_id: { required: true, type: "integer" }
},
url: "/notifications/threads/:thread_id/subscription"
},
starRepo: {
method: "PUT",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/user/starred/:owner/:repo"
},
unstarRepo: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/user/starred/:owner/:repo"
}
},
apps: {
addRepoToInstallation: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "PUT",
params: {
installation_id: { required: true, type: "integer" },
repository_id: { required: true, type: "integer" }
},
url: "/user/installations/:installation_id/repositories/:repository_id"
},
checkAccountIsAssociatedWithAny: {
method: "GET",
params: { account_id: { required: true, type: "integer" } },
url: "/marketplace_listing/accounts/:account_id"
},
checkAccountIsAssociatedWithAnyStubbed: {
method: "GET",
params: { account_id: { required: true, type: "integer" } },
url: "/marketplace_listing/stubbed/accounts/:account_id"
},
checkAuthorization: {
deprecated: "octokit.apps.checkAuthorization() is deprecated, see https://developer.github.com/v3/apps/oauth_applications/#check-an-authorization",
method: "GET",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/tokens/:access_token"
},
checkToken: {
headers: { accept: "application/vnd.github.doctor-strange-preview+json" },
method: "POST",
params: {
access_token: { type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/token"
},
createContentAttachment: {
headers: { accept: "application/vnd.github.corsair-preview+json" },
method: "POST",
params: {
body: { required: true, type: "string" },
content_reference_id: { required: true, type: "integer" },
title: { required: true, type: "string" }
},
url: "/content_references/:content_reference_id/attachments"
},
createFromManifest: {
headers: { accept: "application/vnd.github.fury-preview+json" },
method: "POST",
params: { code: { required: true, type: "string" } },
url: "/app-manifests/:code/conversions"
},
createInstallationToken: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "POST",
params: {
installation_id: { required: true, type: "integer" },
permissions: { type: "object" },
repository_ids: { type: "integer[]" }
},
url: "/app/installations/:installation_id/access_tokens"
},
deleteAuthorization: {
headers: { accept: "application/vnd.github.doctor-strange-preview+json" },
method: "DELETE",
params: {
access_token: { type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/grant"
},
deleteInstallation: {
headers: {
accept: "application/vnd.github.gambit-preview+json,application/vnd.github.machine-man-preview+json"
},
method: "DELETE",
params: { installation_id: { required: true, type: "integer" } },
url: "/app/installations/:installation_id"
},
deleteToken: {
headers: { accept: "application/vnd.github.doctor-strange-preview+json" },
method: "DELETE",
params: {
access_token: { type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/token"
},
findOrgInstallation: {
deprecated: "octokit.apps.findOrgInstallation() has been renamed to octokit.apps.getOrgInstallation() (2019-04-10)",
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { org: { required: true, type: "string" } },
url: "/orgs/:org/installation"
},
findRepoInstallation: {
deprecated: "octokit.apps.findRepoInstallation() has been renamed to octokit.apps.getRepoInstallation() (2019-04-10)",
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/installation"
},
findUserInstallation: {
deprecated: "octokit.apps.findUserInstallation() has been renamed to octokit.apps.getUserInstallation() (2019-04-10)",
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { username: { required: true, type: "string" } },
url: "/users/:username/installation"
},
getAuthenticated: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: {},
url: "/app"
},
getBySlug: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { app_slug: { required: true, type: "string" } },
url: "/apps/:app_slug"
},
getInstallation: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { installation_id: { required: true, type: "integer" } },
url: "/app/installations/:installation_id"
},
getOrgInstallation: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { org: { required: true, type: "string" } },
url: "/orgs/:org/installation"
},
getRepoInstallation: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/installation"
},
getUserInstallation: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { username: { required: true, type: "string" } },
url: "/users/:username/installation"
},
listAccountsUserOrOrgOnPlan: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
plan_id: { required: true, type: "integer" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/marketplace_listing/plans/:plan_id/accounts"
},
listAccountsUserOrOrgOnPlanStubbed: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
plan_id: { required: true, type: "integer" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/marketplace_listing/stubbed/plans/:plan_id/accounts"
},
listInstallationReposForAuthenticatedUser: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: {
installation_id: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/user/installations/:installation_id/repositories"
},
listInstallations: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/app/installations"
},
listInstallationsForAuthenticatedUser: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/installations"
},
listMarketplacePurchasesForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/marketplace_purchases"
},
listMarketplacePurchasesForAuthenticatedUserStubbed: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/marketplace_purchases/stubbed"
},
listPlans: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/marketplace_listing/plans"
},
listPlansStubbed: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/marketplace_listing/stubbed/plans"
},
listRepos: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/installation/repositories"
},
removeRepoFromInstallation: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "DELETE",
params: {
installation_id: { required: true, type: "integer" },
repository_id: { required: true, type: "integer" }
},
url: "/user/installations/:installation_id/repositories/:repository_id"
},
resetAuthorization: {
deprecated: "octokit.apps.resetAuthorization() is deprecated, see https://developer.github.com/v3/apps/oauth_applications/#reset-an-authorization",
method: "POST",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/tokens/:access_token"
},
resetToken: {
headers: { accept: "application/vnd.github.doctor-strange-preview+json" },
method: "PATCH",
params: {
access_token: { type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/token"
},
revokeAuthorizationForApplication: {
deprecated: "octokit.apps.revokeAuthorizationForApplication() is deprecated, see https://developer.github.com/v3/apps/oauth_applications/#revoke-an-authorization-for-an-application",
method: "DELETE",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/tokens/:access_token"
},
revokeGrantForApplication: {
deprecated: "octokit.apps.revokeGrantForApplication() is deprecated, see https://developer.github.com/v3/apps/oauth_applications/#revoke-a-grant-for-an-application",
method: "DELETE",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/grants/:access_token"
},
revokeInstallationToken: {
headers: { accept: "application/vnd.github.gambit-preview+json" },
method: "DELETE",
params: {},
url: "/installation/token"
}
},
checks: {
create: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "POST",
params: {
actions: { type: "object[]" },
"actions[].description": { required: true, type: "string" },
"actions[].identifier": { required: true, type: "string" },
"actions[].label": { required: true, type: "string" },
completed_at: { type: "string" },
conclusion: {
enum: [
"success",
"failure",
"neutral",
"cancelled",
"timed_out",
"action_required"
],
type: "string"
},
details_url: { type: "string" },
external_id: { type: "string" },
head_sha: { required: true, type: "string" },
name: { required: true, type: "string" },
output: { type: "object" },
"output.annotations": { type: "object[]" },
"output.annotations[].annotation_level": {
enum: ["notice", "warning", "failure"],
required: true,
type: "string"
},
"output.annotations[].end_column": { type: "integer" },
"output.annotations[].end_line": { required: true, type: "integer" },
"output.annotations[].message": { required: true, type: "string" },
"output.annotations[].path": { required: true, type: "string" },
"output.annotations[].raw_details": { type: "string" },
"output.annotations[].start_column": { type: "integer" },
"output.annotations[].start_line": { required: true, type: "integer" },
"output.annotations[].title": { type: "string" },
"output.images": { type: "object[]" },
"output.images[].alt": { required: true, type: "string" },
"output.images[].caption": { type: "string" },
"output.images[].image_url": { required: true, type: "string" },
"output.summary": { required: true, type: "string" },
"output.text": { type: "string" },
"output.title": { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
started_at: { type: "string" },
status: { enum: ["queued", "in_progress", "completed"], type: "string" }
},
url: "/repos/:owner/:repo/check-runs"
},
createSuite: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "POST",
params: {
head_sha: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/check-suites"
},
get: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "GET",
params: {
check_run_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/check-runs/:check_run_id"
},
getSuite: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "GET",
params: {
check_suite_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/check-suites/:check_suite_id"
},
listAnnotations: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "GET",
params: {
check_run_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/check-runs/:check_run_id/annotations"
},
listForRef: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "GET",
params: {
check_name: { type: "string" },
filter: { enum: ["latest", "all"], type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" },
status: { enum: ["queued", "in_progress", "completed"], type: "string" }
},
url: "/repos/:owner/:repo/commits/:ref/check-runs"
},
listForSuite: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "GET",
params: {
check_name: { type: "string" },
check_suite_id: { required: true, type: "integer" },
filter: { enum: ["latest", "all"], type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
status: { enum: ["queued", "in_progress", "completed"], type: "string" }
},
url: "/repos/:owner/:repo/check-suites/:check_suite_id/check-runs"
},
listSuitesForRef: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "GET",
params: {
app_id: { type: "integer" },
check_name: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:ref/check-suites"
},
rerequestSuite: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "POST",
params: {
check_suite_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/check-suites/:check_suite_id/rerequest"
},
setSuitesPreferences: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "PATCH",
params: {
auto_trigger_checks: { type: "object[]" },
"auto_trigger_checks[].app_id": { required: true, type: "integer" },
"auto_trigger_checks[].setting": { required: true, type: "boolean" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/check-suites/preferences"
},
update: {
headers: { accept: "application/vnd.github.antiope-preview+json" },
method: "PATCH",
params: {
actions: { type: "object[]" },
"actions[].description": { required: true, type: "string" },
"actions[].identifier": { required: true, type: "string" },
"actions[].label": { required: true, type: "string" },
check_run_id: { required: true, type: "integer" },
completed_at: { type: "string" },
conclusion: {
enum: [
"success",
"failure",
"neutral",
"cancelled",
"timed_out",
"action_required"
],
type: "string"
},
details_url: { type: "string" },
external_id: { type: "string" },
name: { type: "string" },
output: { type: "object" },
"output.annotations": { type: "object[]" },
"output.annotations[].annotation_level": {
enum: ["notice", "warning", "failure"],
required: true,
type: "string"
},
"output.annotations[].end_column": { type: "integer" },
"output.annotations[].end_line": { required: true, type: "integer" },
"output.annotations[].message": { required: true, type: "string" },
"output.annotations[].path": { required: true, type: "string" },
"output.annotations[].raw_details": { type: "string" },
"output.annotations[].start_column": { type: "integer" },
"output.annotations[].start_line": { required: true, type: "integer" },
"output.annotations[].title": { type: "string" },
"output.images": { type: "object[]" },
"output.images[].alt": { required: true, type: "string" },
"output.images[].caption": { type: "string" },
"output.images[].image_url": { required: true, type: "string" },
"output.summary": { required: true, type: "string" },
"output.text": { type: "string" },
"output.title": { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
started_at: { type: "string" },
status: { enum: ["queued", "in_progress", "completed"], type: "string" }
},
url: "/repos/:owner/:repo/check-runs/:check_run_id"
}
},
codesOfConduct: {
getConductCode: {
headers: { accept: "application/vnd.github.scarlet-witch-preview+json" },
method: "GET",
params: { key: { required: true, type: "string" } },
url: "/codes_of_conduct/:key"
},
getForRepo: {
headers: { accept: "application/vnd.github.scarlet-witch-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/community/code_of_conduct"
},
listConductCodes: {
headers: { accept: "application/vnd.github.scarlet-witch-preview+json" },
method: "GET",
params: {},
url: "/codes_of_conduct"
}
},
emojis: { get: { method: "GET", params: {}, url: "/emojis" } },
gists: {
checkIsStarred: {
method: "GET",
params: { gist_id: { required: true, type: "string" } },
url: "/gists/:gist_id/star"
},
create: {
method: "POST",
params: {
description: { type: "string" },
files: { required: true, type: "object" },
"files.content": { type: "string" },
public: { type: "boolean" }
},
url: "/gists"
},
createComment: {
method: "POST",
params: {
body: { required: true, type: "string" },
gist_id: { required: true, type: "string" }
},
url: "/gists/:gist_id/comments"
},
delete: {
method: "DELETE",
params: { gist_id: { required: true, type: "string" } },
url: "/gists/:gist_id"
},
deleteComment: {
method: "DELETE",
params: {
comment_id: { required: true, type: "integer" },
gist_id: { required: true, type: "string" }
},
url: "/gists/:gist_id/comments/:comment_id"
},
fork: {
method: "POST",
params: { gist_id: { required: true, type: "string" } },
url: "/gists/:gist_id/forks"
},
get: {
method: "GET",
params: { gist_id: { required: true, type: "string" } },
url: "/gists/:gist_id"
},
getComment: {
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
gist_id: { required: true, type: "string" }
},
url: "/gists/:gist_id/comments/:comment_id"
},
getRevision: {
method: "GET",
params: {
gist_id: { required: true, type: "string" },
sha: { required: true, type: "string" }
},
url: "/gists/:gist_id/:sha"
},
list: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" }
},
url: "/gists"
},
listComments: {
method: "GET",
params: {
gist_id: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/gists/:gist_id/comments"
},
listCommits: {
method: "GET",
params: {
gist_id: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/gists/:gist_id/commits"
},
listForks: {
method: "GET",
params: {
gist_id: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/gists/:gist_id/forks"
},
listPublic: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" }
},
url: "/gists/public"
},
listPublicForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" },
username: { required: true, type: "string" }
},
url: "/users/:username/gists"
},
listStarred: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" }
},
url: "/gists/starred"
},
star: {
method: "PUT",
params: { gist_id: { required: true, type: "string" } },
url: "/gists/:gist_id/star"
},
unstar: {
method: "DELETE",
params: { gist_id: { required: true, type: "string" } },
url: "/gists/:gist_id/star"
},
update: {
method: "PATCH",
params: {
description: { type: "string" },
files: { type: "object" },
"files.content": { type: "string" },
"files.filename": { type: "string" },
gist_id: { required: true, type: "string" }
},
url: "/gists/:gist_id"
},
updateComment: {
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_id: { required: true, type: "integer" },
gist_id: { required: true, type: "string" }
},
url: "/gists/:gist_id/comments/:comment_id"
}
},
git: {
createBlob: {
method: "POST",
params: {
content: { required: true, type: "string" },
encoding: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/blobs"
},
createCommit: {
method: "POST",
params: {
author: { type: "object" },
"author.date": { type: "string" },
"author.email": { type: "string" },
"author.name": { type: "string" },
committer: { type: "object" },
"committer.date": { type: "string" },
"committer.email": { type: "string" },
"committer.name": { type: "string" },
message: { required: true, type: "string" },
owner: { required: true, type: "string" },
parents: { required: true, type: "string[]" },
repo: { required: true, type: "string" },
signature: { type: "string" },
tree: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/commits"
},
createRef: {
method: "POST",
params: {
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/refs"
},
createTag: {
method: "POST",
params: {
message: { required: true, type: "string" },
object: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
tag: { required: true, type: "string" },
tagger: { type: "object" },
"tagger.date": { type: "string" },
"tagger.email": { type: "string" },
"tagger.name": { type: "string" },
type: {
enum: ["commit", "tree", "blob"],
required: true,
type: "string"
}
},
url: "/repos/:owner/:repo/git/tags"
},
createTree: {
method: "POST",
params: {
base_tree: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
tree: { required: true, type: "object[]" },
"tree[].content": { type: "string" },
"tree[].mode": {
enum: ["100644", "100755", "040000", "160000", "120000"],
type: "string"
},
"tree[].path": { type: "string" },
"tree[].sha": { allowNull: true, type: "string" },
"tree[].type": { enum: ["blob", "tree", "commit"], type: "string" }
},
url: "/repos/:owner/:repo/git/trees"
},
deleteRef: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/refs/:ref"
},
getBlob: {
method: "GET",
params: {
file_sha: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/blobs/:file_sha"
},
getCommit: {
method: "GET",
params: {
commit_sha: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/commits/:commit_sha"
},
getRef: {
method: "GET",
params: {
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/ref/:ref"
},
getTag: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
tag_sha: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/tags/:tag_sha"
},
getTree: {
method: "GET",
params: {
owner: { required: true, type: "string" },
recursive: { enum: ["1"], type: "integer" },
repo: { required: true, type: "string" },
tree_sha: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/trees/:tree_sha"
},
listMatchingRefs: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/matching-refs/:ref"
},
listRefs: {
method: "GET",
params: {
namespace: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/refs/:namespace"
},
updateRef: {
method: "PATCH",
params: {
force: { type: "boolean" },
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/git/refs/:ref"
}
},
gitignore: {
getTemplate: {
method: "GET",
params: { name: { required: true, type: "string" } },
url: "/gitignore/templates/:name"
},
listTemplates: { method: "GET", params: {}, url: "/gitignore/templates" }
},
interactions: {
addOrUpdateRestrictionsForOrg: {
headers: { accept: "application/vnd.github.sombra-preview+json" },
method: "PUT",
params: {
limit: {
enum: ["existing_users", "contributors_only", "collaborators_only"],
required: true,
type: "string"
},
org: { required: true, type: "string" }
},
url: "/orgs/:org/interaction-limits"
},
addOrUpdateRestrictionsForRepo: {
headers: { accept: "application/vnd.github.sombra-preview+json" },
method: "PUT",
params: {
limit: {
enum: ["existing_users", "contributors_only", "collaborators_only"],
required: true,
type: "string"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/interaction-limits"
},
getRestrictionsForOrg: {
headers: { accept: "application/vnd.github.sombra-preview+json" },
method: "GET",
params: { org: { required: true, type: "string" } },
url: "/orgs/:org/interaction-limits"
},
getRestrictionsForRepo: {
headers: { accept: "application/vnd.github.sombra-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/interaction-limits"
},
removeRestrictionsForOrg: {
headers: { accept: "application/vnd.github.sombra-preview+json" },
method: "DELETE",
params: { org: { required: true, type: "string" } },
url: "/orgs/:org/interaction-limits"
},
removeRestrictionsForRepo: {
headers: { accept: "application/vnd.github.sombra-preview+json" },
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/interaction-limits"
}
},
issues: {
addAssignees: {
method: "POST",
params: {
assignees: { type: "string[]" },
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/assignees"
},
addLabels: {
method: "POST",
params: {
issue_number: { required: true, type: "integer" },
labels: { required: true, type: "string[]" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/labels"
},
checkAssignee: {
method: "GET",
params: {
assignee: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/assignees/:assignee"
},
create: {
method: "POST",
params: {
assignee: { type: "string" },
assignees: { type: "string[]" },
body: { type: "string" },
labels: { type: "string[]" },
milestone: { type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
title: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues"
},
createComment: {
method: "POST",
params: {
body: { required: true, type: "string" },
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/comments"
},
createLabel: {
method: "POST",
params: {
color: { required: true, type: "string" },
description: { type: "string" },
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/labels"
},
createMilestone: {
method: "POST",
params: {
description: { type: "string" },
due_on: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
state: { enum: ["open", "closed"], type: "string" },
title: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/milestones"
},
deleteComment: {
method: "DELETE",
params: {
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/comments/:comment_id"
},
deleteLabel: {
method: "DELETE",
params: {
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/labels/:name"
},
deleteMilestone: {
method: "DELETE",
params: {
milestone_number: { required: true, type: "integer" },
number: {
alias: "milestone_number",
deprecated: true,
type: "integer"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/milestones/:milestone_number"
},
get: {
method: "GET",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number"
},
getComment: {
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/comments/:comment_id"
},
getEvent: {
method: "GET",
params: {
event_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/events/:event_id"
},
getLabel: {
method: "GET",
params: {
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/labels/:name"
},
getMilestone: {
method: "GET",
params: {
milestone_number: { required: true, type: "integer" },
number: {
alias: "milestone_number",
deprecated: true,
type: "integer"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/milestones/:milestone_number"
},
list: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
filter: {
enum: ["assigned", "created", "mentioned", "subscribed", "all"],
type: "string"
},
labels: { type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" },
sort: { enum: ["created", "updated", "comments"], type: "string" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/issues"
},
listAssignees: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/assignees"
},
listComments: {
method: "GET",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
since: { type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/comments"
},
listCommentsForRepo: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
since: { type: "string" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/repos/:owner/:repo/issues/comments"
},
listEvents: {
method: "GET",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/events"
},
listEventsForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/events"
},
listEventsForTimeline: {
headers: { accept: "application/vnd.github.mockingbird-preview+json" },
method: "GET",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/timeline"
},
listForAuthenticatedUser: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
filter: {
enum: ["assigned", "created", "mentioned", "subscribed", "all"],
type: "string"
},
labels: { type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" },
sort: { enum: ["created", "updated", "comments"], type: "string" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/user/issues"
},
listForOrg: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
filter: {
enum: ["assigned", "created", "mentioned", "subscribed", "all"],
type: "string"
},
labels: { type: "string" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" },
sort: { enum: ["created", "updated", "comments"], type: "string" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/orgs/:org/issues"
},
listForRepo: {
method: "GET",
params: {
assignee: { type: "string" },
creator: { type: "string" },
direction: { enum: ["asc", "desc"], type: "string" },
labels: { type: "string" },
mentioned: { type: "string" },
milestone: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
since: { type: "string" },
sort: { enum: ["created", "updated", "comments"], type: "string" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/repos/:owner/:repo/issues"
},
listLabelsForMilestone: {
method: "GET",
params: {
milestone_number: { required: true, type: "integer" },
number: {
alias: "milestone_number",
deprecated: true,
type: "integer"
},
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/milestones/:milestone_number/labels"
},
listLabelsForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/labels"
},
listLabelsOnIssue: {
method: "GET",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/labels"
},
listMilestonesForRepo: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
sort: { enum: ["due_on", "completeness"], type: "string" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/repos/:owner/:repo/milestones"
},
lock: {
method: "PUT",
params: {
issue_number: { required: true, type: "integer" },
lock_reason: {
enum: ["off-topic", "too heated", "resolved", "spam"],
type: "string"
},
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/lock"
},
removeAssignees: {
method: "DELETE",
params: {
assignees: { type: "string[]" },
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/assignees"
},
removeLabel: {
method: "DELETE",
params: {
issue_number: { required: true, type: "integer" },
name: { required: true, type: "string" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/labels/:name"
},
removeLabels: {
method: "DELETE",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/labels"
},
replaceLabels: {
method: "PUT",
params: {
issue_number: { required: true, type: "integer" },
labels: { type: "string[]" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/labels"
},
unlock: {
method: "DELETE",
params: {
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/lock"
},
update: {
method: "PATCH",
params: {
assignee: { type: "string" },
assignees: { type: "string[]" },
body: { type: "string" },
issue_number: { required: true, type: "integer" },
labels: { type: "string[]" },
milestone: { allowNull: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
state: { enum: ["open", "closed"], type: "string" },
title: { type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number"
},
updateComment: {
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/comments/:comment_id"
},
updateLabel: {
method: "PATCH",
params: {
color: { type: "string" },
current_name: { required: true, type: "string" },
description: { type: "string" },
name: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/labels/:current_name"
},
updateMilestone: {
method: "PATCH",
params: {
description: { type: "string" },
due_on: { type: "string" },
milestone_number: { required: true, type: "integer" },
number: {
alias: "milestone_number",
deprecated: true,
type: "integer"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
state: { enum: ["open", "closed"], type: "string" },
title: { type: "string" }
},
url: "/repos/:owner/:repo/milestones/:milestone_number"
}
},
licenses: {
get: {
method: "GET",
params: { license: { required: true, type: "string" } },
url: "/licenses/:license"
},
getForRepo: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/license"
},
list: {
deprecated: "octokit.licenses.list() has been renamed to octokit.licenses.listCommonlyUsed() (2019-03-05)",
method: "GET",
params: {},
url: "/licenses"
},
listCommonlyUsed: { method: "GET", params: {}, url: "/licenses" }
},
markdown: {
render: {
method: "POST",
params: {
context: { type: "string" },
mode: { enum: ["markdown", "gfm"], type: "string" },
text: { required: true, type: "string" }
},
url: "/markdown"
},
renderRaw: {
headers: { "content-type": "text/plain; charset=utf-8" },
method: "POST",
params: { data: { mapTo: "data", required: true, type: "string" } },
url: "/markdown/raw"
}
},
meta: { get: { method: "GET", params: {}, url: "/meta" } },
migrations: {
cancelImport: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/import"
},
deleteArchiveForAuthenticatedUser: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "DELETE",
params: { migration_id: { required: true, type: "integer" } },
url: "/user/migrations/:migration_id/archive"
},
deleteArchiveForOrg: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "DELETE",
params: {
migration_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/migrations/:migration_id/archive"
},
downloadArchiveForOrg: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: {
migration_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/migrations/:migration_id/archive"
},
getArchiveForAuthenticatedUser: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: { migration_id: { required: true, type: "integer" } },
url: "/user/migrations/:migration_id/archive"
},
getArchiveForOrg: {
deprecated: "octokit.migrations.getArchiveForOrg() has been renamed to octokit.migrations.downloadArchiveForOrg() (2020-01-27)",
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: {
migration_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/migrations/:migration_id/archive"
},
getCommitAuthors: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
since: { type: "string" }
},
url: "/repos/:owner/:repo/import/authors"
},
getImportProgress: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/import"
},
getLargeFiles: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/import/large_files"
},
getStatusForAuthenticatedUser: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: { migration_id: { required: true, type: "integer" } },
url: "/user/migrations/:migration_id"
},
getStatusForOrg: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: {
migration_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/migrations/:migration_id"
},
listForAuthenticatedUser: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/migrations"
},
listForOrg: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/migrations"
},
listReposForOrg: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: {
migration_id: { required: true, type: "integer" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/migrations/:migration_id/repositories"
},
listReposForUser: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "GET",
params: {
migration_id: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/user/:migration_id/repositories"
},
mapCommitAuthor: {
method: "PATCH",
params: {
author_id: { required: true, type: "integer" },
email: { type: "string" },
name: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/import/authors/:author_id"
},
setLfsPreference: {
method: "PATCH",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
use_lfs: { enum: ["opt_in", "opt_out"], required: true, type: "string" }
},
url: "/repos/:owner/:repo/import/lfs"
},
startForAuthenticatedUser: {
method: "POST",
params: {
exclude_attachments: { type: "boolean" },
lock_repositories: { type: "boolean" },
repositories: { required: true, type: "string[]" }
},
url: "/user/migrations"
},
startForOrg: {
method: "POST",
params: {
exclude_attachments: { type: "boolean" },
lock_repositories: { type: "boolean" },
org: { required: true, type: "string" },
repositories: { required: true, type: "string[]" }
},
url: "/orgs/:org/migrations"
},
startImport: {
method: "PUT",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
tfvc_project: { type: "string" },
vcs: {
enum: ["subversion", "git", "mercurial", "tfvc"],
type: "string"
},
vcs_password: { type: "string" },
vcs_url: { required: true, type: "string" },
vcs_username: { type: "string" }
},
url: "/repos/:owner/:repo/import"
},
unlockRepoForAuthenticatedUser: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "DELETE",
params: {
migration_id: { required: true, type: "integer" },
repo_name: { required: true, type: "string" }
},
url: "/user/migrations/:migration_id/repos/:repo_name/lock"
},
unlockRepoForOrg: {
headers: { accept: "application/vnd.github.wyandotte-preview+json" },
method: "DELETE",
params: {
migration_id: { required: true, type: "integer" },
org: { required: true, type: "string" },
repo_name: { required: true, type: "string" }
},
url: "/orgs/:org/migrations/:migration_id/repos/:repo_name/lock"
},
updateImport: {
method: "PATCH",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
vcs_password: { type: "string" },
vcs_username: { type: "string" }
},
url: "/repos/:owner/:repo/import"
}
},
oauthAuthorizations: {
checkAuthorization: {
deprecated: "octokit.oauthAuthorizations.checkAuthorization() has been renamed to octokit.apps.checkAuthorization() (2019-11-05)",
method: "GET",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/tokens/:access_token"
},
createAuthorization: {
deprecated: "octokit.oauthAuthorizations.createAuthorization() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#create-a-new-authorization",
method: "POST",
params: {
client_id: { type: "string" },
client_secret: { type: "string" },
fingerprint: { type: "string" },
note: { required: true, type: "string" },
note_url: { type: "string" },
scopes: { type: "string[]" }
},
url: "/authorizations"
},
deleteAuthorization: {
deprecated: "octokit.oauthAuthorizations.deleteAuthorization() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#delete-an-authorization",
method: "DELETE",
params: { authorization_id: { required: true, type: "integer" } },
url: "/authorizations/:authorization_id"
},
deleteGrant: {
deprecated: "octokit.oauthAuthorizations.deleteGrant() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#delete-a-grant",
method: "DELETE",
params: { grant_id: { required: true, type: "integer" } },
url: "/applications/grants/:grant_id"
},
getAuthorization: {
deprecated: "octokit.oauthAuthorizations.getAuthorization() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#get-a-single-authorization",
method: "GET",
params: { authorization_id: { required: true, type: "integer" } },
url: "/authorizations/:authorization_id"
},
getGrant: {
deprecated: "octokit.oauthAuthorizations.getGrant() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#get-a-single-grant",
method: "GET",
params: { grant_id: { required: true, type: "integer" } },
url: "/applications/grants/:grant_id"
},
getOrCreateAuthorizationForApp: {
deprecated: "octokit.oauthAuthorizations.getOrCreateAuthorizationForApp() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#get-or-create-an-authorization-for-a-specific-app",
method: "PUT",
params: {
client_id: { required: true, type: "string" },
client_secret: { required: true, type: "string" },
fingerprint: { type: "string" },
note: { type: "string" },
note_url: { type: "string" },
scopes: { type: "string[]" }
},
url: "/authorizations/clients/:client_id"
},
getOrCreateAuthorizationForAppAndFingerprint: {
deprecated: "octokit.oauthAuthorizations.getOrCreateAuthorizationForAppAndFingerprint() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#get-or-create-an-authorization-for-a-specific-app-and-fingerprint",
method: "PUT",
params: {
client_id: { required: true, type: "string" },
client_secret: { required: true, type: "string" },
fingerprint: { required: true, type: "string" },
note: { type: "string" },
note_url: { type: "string" },
scopes: { type: "string[]" }
},
url: "/authorizations/clients/:client_id/:fingerprint"
},
getOrCreateAuthorizationForAppFingerprint: {
deprecated: "octokit.oauthAuthorizations.getOrCreateAuthorizationForAppFingerprint() has been renamed to octokit.oauthAuthorizations.getOrCreateAuthorizationForAppAndFingerprint() (2018-12-27)",
method: "PUT",
params: {
client_id: { required: true, type: "string" },
client_secret: { required: true, type: "string" },
fingerprint: { required: true, type: "string" },
note: { type: "string" },
note_url: { type: "string" },
scopes: { type: "string[]" }
},
url: "/authorizations/clients/:client_id/:fingerprint"
},
listAuthorizations: {
deprecated: "octokit.oauthAuthorizations.listAuthorizations() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#list-your-authorizations",
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/authorizations"
},
listGrants: {
deprecated: "octokit.oauthAuthorizations.listGrants() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#list-your-grants",
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/applications/grants"
},
resetAuthorization: {
deprecated: "octokit.oauthAuthorizations.resetAuthorization() has been renamed to octokit.apps.resetAuthorization() (2019-11-05)",
method: "POST",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/tokens/:access_token"
},
revokeAuthorizationForApplication: {
deprecated: "octokit.oauthAuthorizations.revokeAuthorizationForApplication() has been renamed to octokit.apps.revokeAuthorizationForApplication() (2019-11-05)",
method: "DELETE",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/tokens/:access_token"
},
revokeGrantForApplication: {
deprecated: "octokit.oauthAuthorizations.revokeGrantForApplication() has been renamed to octokit.apps.revokeGrantForApplication() (2019-11-05)",
method: "DELETE",
params: {
access_token: { required: true, type: "string" },
client_id: { required: true, type: "string" }
},
url: "/applications/:client_id/grants/:access_token"
},
updateAuthorization: {
deprecated: "octokit.oauthAuthorizations.updateAuthorization() is deprecated, see https://developer.github.com/v3/oauth_authorizations/#update-an-existing-authorization",
method: "PATCH",
params: {
add_scopes: { type: "string[]" },
authorization_id: { required: true, type: "integer" },
fingerprint: { type: "string" },
note: { type: "string" },
note_url: { type: "string" },
remove_scopes: { type: "string[]" },
scopes: { type: "string[]" }
},
url: "/authorizations/:authorization_id"
}
},
orgs: {
addOrUpdateMembership: {
method: "PUT",
params: {
org: { required: true, type: "string" },
role: { enum: ["admin", "member"], type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/memberships/:username"
},
blockUser: {
method: "PUT",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/blocks/:username"
},
checkBlockedUser: {
method: "GET",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/blocks/:username"
},
checkMembership: {
method: "GET",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/members/:username"
},
checkPublicMembership: {
method: "GET",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/public_members/:username"
},
concealMembership: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/public_members/:username"
},
convertMemberToOutsideCollaborator: {
method: "PUT",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/outside_collaborators/:username"
},
createHook: {
method: "POST",
params: {
active: { type: "boolean" },
config: { required: true, type: "object" },
"config.content_type": { type: "string" },
"config.insecure_ssl": { type: "string" },
"config.secret": { type: "string" },
"config.url": { required: true, type: "string" },
events: { type: "string[]" },
name: { required: true, type: "string" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/hooks"
},
createInvitation: {
method: "POST",
params: {
email: { type: "string" },
invitee_id: { type: "integer" },
org: { required: true, type: "string" },
role: {
enum: ["admin", "direct_member", "billing_manager"],
type: "string"
},
team_ids: { type: "integer[]" }
},
url: "/orgs/:org/invitations"
},
deleteHook: {
method: "DELETE",
params: {
hook_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/hooks/:hook_id"
},
get: {
method: "GET",
params: { org: { required: true, type: "string" } },
url: "/orgs/:org"
},
getHook: {
method: "GET",
params: {
hook_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/hooks/:hook_id"
},
getMembership: {
method: "GET",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/memberships/:username"
},
getMembershipForAuthenticatedUser: {
method: "GET",
params: { org: { required: true, type: "string" } },
url: "/user/memberships/orgs/:org"
},
list: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "integer" }
},
url: "/organizations"
},
listBlockedUsers: {
method: "GET",
params: { org: { required: true, type: "string" } },
url: "/orgs/:org/blocks"
},
listForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/orgs"
},
listForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/orgs"
},
listHooks: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/hooks"
},
listInstallations: {
headers: { accept: "application/vnd.github.machine-man-preview+json" },
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/installations"
},
listInvitationTeams: {
method: "GET",
params: {
invitation_id: { required: true, type: "integer" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/invitations/:invitation_id/teams"
},
listMembers: {
method: "GET",
params: {
filter: { enum: ["2fa_disabled", "all"], type: "string" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
role: { enum: ["all", "admin", "member"], type: "string" }
},
url: "/orgs/:org/members"
},
listMemberships: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
state: { enum: ["active", "pending"], type: "string" }
},
url: "/user/memberships/orgs"
},
listOutsideCollaborators: {
method: "GET",
params: {
filter: { enum: ["2fa_disabled", "all"], type: "string" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/outside_collaborators"
},
listPendingInvitations: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/invitations"
},
listPublicMembers: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/public_members"
},
pingHook: {
method: "POST",
params: {
hook_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/hooks/:hook_id/pings"
},
publicizeMembership: {
method: "PUT",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/public_members/:username"
},
removeMember: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/members/:username"
},
removeMembership: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/memberships/:username"
},
removeOutsideCollaborator: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/outside_collaborators/:username"
},
unblockUser: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/blocks/:username"
},
update: {
method: "PATCH",
params: {
billing_email: { type: "string" },
company: { type: "string" },
default_repository_permission: {
enum: ["read", "write", "admin", "none"],
type: "string"
},
description: { type: "string" },
email: { type: "string" },
has_organization_projects: { type: "boolean" },
has_repository_projects: { type: "boolean" },
location: { type: "string" },
members_allowed_repository_creation_type: {
enum: ["all", "private", "none"],
type: "string"
},
members_can_create_internal_repositories: { type: "boolean" },
members_can_create_private_repositories: { type: "boolean" },
members_can_create_public_repositories: { type: "boolean" },
members_can_create_repositories: { type: "boolean" },
name: { type: "string" },
org: { required: true, type: "string" }
},
url: "/orgs/:org"
},
updateHook: {
method: "PATCH",
params: {
active: { type: "boolean" },
config: { type: "object" },
"config.content_type": { type: "string" },
"config.insecure_ssl": { type: "string" },
"config.secret": { type: "string" },
"config.url": { required: true, type: "string" },
events: { type: "string[]" },
hook_id: { required: true, type: "integer" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/hooks/:hook_id"
},
updateMembership: {
method: "PATCH",
params: {
org: { required: true, type: "string" },
state: { enum: ["active"], required: true, type: "string" }
},
url: "/user/memberships/orgs/:org"
}
},
projects: {
addCollaborator: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PUT",
params: {
permission: { enum: ["read", "write", "admin"], type: "string" },
project_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/projects/:project_id/collaborators/:username"
},
createCard: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
column_id: { required: true, type: "integer" },
content_id: { type: "integer" },
content_type: { type: "string" },
note: { type: "string" }
},
url: "/projects/columns/:column_id/cards"
},
createColumn: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
name: { required: true, type: "string" },
project_id: { required: true, type: "integer" }
},
url: "/projects/:project_id/columns"
},
createForAuthenticatedUser: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
body: { type: "string" },
name: { required: true, type: "string" }
},
url: "/user/projects"
},
createForOrg: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
body: { type: "string" },
name: { required: true, type: "string" },
org: { required: true, type: "string" }
},
url: "/orgs/:org/projects"
},
createForRepo: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
body: { type: "string" },
name: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/projects"
},
delete: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "DELETE",
params: { project_id: { required: true, type: "integer" } },
url: "/projects/:project_id"
},
deleteCard: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "DELETE",
params: { card_id: { required: true, type: "integer" } },
url: "/projects/columns/cards/:card_id"
},
deleteColumn: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "DELETE",
params: { column_id: { required: true, type: "integer" } },
url: "/projects/columns/:column_id"
},
get: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: { project_id: { required: true, type: "integer" } },
url: "/projects/:project_id"
},
getCard: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: { card_id: { required: true, type: "integer" } },
url: "/projects/columns/cards/:card_id"
},
getColumn: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: { column_id: { required: true, type: "integer" } },
url: "/projects/columns/:column_id"
},
listCards: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
archived_state: {
enum: ["all", "archived", "not_archived"],
type: "string"
},
column_id: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/projects/columns/:column_id/cards"
},
listCollaborators: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
affiliation: { enum: ["outside", "direct", "all"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
project_id: { required: true, type: "integer" }
},
url: "/projects/:project_id/collaborators"
},
listColumns: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
project_id: { required: true, type: "integer" }
},
url: "/projects/:project_id/columns"
},
listForOrg: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/orgs/:org/projects"
},
listForRepo: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/repos/:owner/:repo/projects"
},
listForUser: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
state: { enum: ["open", "closed", "all"], type: "string" },
username: { required: true, type: "string" }
},
url: "/users/:username/projects"
},
moveCard: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
card_id: { required: true, type: "integer" },
column_id: { type: "integer" },
position: {
required: true,
type: "string",
validation: "^(top|bottom|after:\\d+)$"
}
},
url: "/projects/columns/cards/:card_id/moves"
},
moveColumn: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "POST",
params: {
column_id: { required: true, type: "integer" },
position: {
required: true,
type: "string",
validation: "^(first|last|after:\\d+)$"
}
},
url: "/projects/columns/:column_id/moves"
},
removeCollaborator: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "DELETE",
params: {
project_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/projects/:project_id/collaborators/:username"
},
reviewUserPermissionLevel: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
project_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/projects/:project_id/collaborators/:username/permission"
},
update: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PATCH",
params: {
body: { type: "string" },
name: { type: "string" },
organization_permission: { type: "string" },
private: { type: "boolean" },
project_id: { required: true, type: "integer" },
state: { enum: ["open", "closed"], type: "string" }
},
url: "/projects/:project_id"
},
updateCard: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PATCH",
params: {
archived: { type: "boolean" },
card_id: { required: true, type: "integer" },
note: { type: "string" }
},
url: "/projects/columns/cards/:card_id"
},
updateColumn: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PATCH",
params: {
column_id: { required: true, type: "integer" },
name: { required: true, type: "string" }
},
url: "/projects/columns/:column_id"
}
},
pulls: {
checkIfMerged: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/merge"
},
create: {
method: "POST",
params: {
base: { required: true, type: "string" },
body: { type: "string" },
draft: { type: "boolean" },
head: { required: true, type: "string" },
maintainer_can_modify: { type: "boolean" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
title: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls"
},
createComment: {
method: "POST",
params: {
body: { required: true, type: "string" },
commit_id: { required: true, type: "string" },
in_reply_to: {
deprecated: true,
description: "The comment ID to reply to. **Note**: This must be the ID of a top-level comment, not a reply to that comment. Replies to replies are not supported.",
type: "integer"
},
line: { type: "integer" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
position: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
side: { enum: ["LEFT", "RIGHT"], type: "string" },
start_line: { type: "integer" },
start_side: { enum: ["LEFT", "RIGHT", "side"], type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/comments"
},
createCommentReply: {
deprecated: "octokit.pulls.createCommentReply() has been renamed to octokit.pulls.createComment() (2019-09-09)",
method: "POST",
params: {
body: { required: true, type: "string" },
commit_id: { required: true, type: "string" },
in_reply_to: {
deprecated: true,
description: "The comment ID to reply to. **Note**: This must be the ID of a top-level comment, not a reply to that comment. Replies to replies are not supported.",
type: "integer"
},
line: { type: "integer" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
position: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
side: { enum: ["LEFT", "RIGHT"], type: "string" },
start_line: { type: "integer" },
start_side: { enum: ["LEFT", "RIGHT", "side"], type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/comments"
},
createFromIssue: {
deprecated: "octokit.pulls.createFromIssue() is deprecated, see https://developer.github.com/v3/pulls/#create-a-pull-request",
method: "POST",
params: {
base: { required: true, type: "string" },
draft: { type: "boolean" },
head: { required: true, type: "string" },
issue: { required: true, type: "integer" },
maintainer_can_modify: { type: "boolean" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls"
},
createReview: {
method: "POST",
params: {
body: { type: "string" },
comments: { type: "object[]" },
"comments[].body": { required: true, type: "string" },
"comments[].path": { required: true, type: "string" },
"comments[].position": { required: true, type: "integer" },
commit_id: { type: "string" },
event: {
enum: ["APPROVE", "REQUEST_CHANGES", "COMMENT"],
type: "string"
},
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews"
},
createReviewCommentReply: {
method: "POST",
params: {
body: { required: true, type: "string" },
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/comments/:comment_id/replies"
},
createReviewRequest: {
method: "POST",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
reviewers: { type: "string[]" },
team_reviewers: { type: "string[]" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/requested_reviewers"
},
deleteComment: {
method: "DELETE",
params: {
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/comments/:comment_id"
},
deletePendingReview: {
method: "DELETE",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
review_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews/:review_id"
},
deleteReviewRequest: {
method: "DELETE",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
reviewers: { type: "string[]" },
team_reviewers: { type: "string[]" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/requested_reviewers"
},
dismissReview: {
method: "PUT",
params: {
message: { required: true, type: "string" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
review_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews/:review_id/dismissals"
},
get: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number"
},
getComment: {
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/comments/:comment_id"
},
getCommentsForReview: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
review_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews/:review_id/comments"
},
getReview: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
review_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews/:review_id"
},
list: {
method: "GET",
params: {
base: { type: "string" },
direction: { enum: ["asc", "desc"], type: "string" },
head: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
sort: {
enum: ["created", "updated", "popularity", "long-running"],
type: "string"
},
state: { enum: ["open", "closed", "all"], type: "string" }
},
url: "/repos/:owner/:repo/pulls"
},
listComments: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
since: { type: "string" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/comments"
},
listCommentsForRepo: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
since: { type: "string" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/repos/:owner/:repo/pulls/comments"
},
listCommits: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/commits"
},
listFiles: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/files"
},
listReviewRequests: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/requested_reviewers"
},
listReviews: {
method: "GET",
params: {
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews"
},
merge: {
method: "PUT",
params: {
commit_message: { type: "string" },
commit_title: { type: "string" },
merge_method: { enum: ["merge", "squash", "rebase"], type: "string" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
sha: { type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/merge"
},
submitReview: {
method: "POST",
params: {
body: { type: "string" },
event: {
enum: ["APPROVE", "REQUEST_CHANGES", "COMMENT"],
required: true,
type: "string"
},
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
review_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews/:review_id/events"
},
update: {
method: "PATCH",
params: {
base: { type: "string" },
body: { type: "string" },
maintainer_can_modify: { type: "boolean" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
state: { enum: ["open", "closed"], type: "string" },
title: { type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number"
},
updateBranch: {
headers: { accept: "application/vnd.github.lydian-preview+json" },
method: "PUT",
params: {
expected_head_sha: { type: "string" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/update-branch"
},
updateComment: {
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/comments/:comment_id"
},
updateReview: {
method: "PUT",
params: {
body: { required: true, type: "string" },
number: { alias: "pull_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
pull_number: { required: true, type: "integer" },
repo: { required: true, type: "string" },
review_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/pulls/:pull_number/reviews/:review_id"
}
},
rateLimit: { get: { method: "GET", params: {}, url: "/rate_limit" } },
reactions: {
createForCommitComment: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
comment_id: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/comments/:comment_id/reactions"
},
createForIssue: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/reactions"
},
createForIssueComment: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
comment_id: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/comments/:comment_id/reactions"
},
createForPullRequestReviewComment: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
comment_id: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/comments/:comment_id/reactions"
},
createForTeamDiscussion: {
deprecated: "octokit.reactions.createForTeamDiscussion() has been renamed to octokit.reactions.createForTeamDiscussionLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/reactions"
},
createForTeamDiscussionComment: {
deprecated: "octokit.reactions.createForTeamDiscussionComment() has been renamed to octokit.reactions.createForTeamDiscussionCommentLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
comment_number: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number/reactions"
},
createForTeamDiscussionCommentInOrg: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
comment_number: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments/:comment_number/reactions"
},
createForTeamDiscussionCommentLegacy: {
deprecated: "octokit.reactions.createForTeamDiscussionCommentLegacy() is deprecated, see https://developer.github.com/v3/reactions/#create-reaction-for-a-team-discussion-comment-legacy",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
comment_number: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number/reactions"
},
createForTeamDiscussionInOrg: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/reactions"
},
createForTeamDiscussionLegacy: {
deprecated: "octokit.reactions.createForTeamDiscussionLegacy() is deprecated, see https://developer.github.com/v3/reactions/#create-reaction-for-a-team-discussion-legacy",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "POST",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
required: true,
type: "string"
},
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/reactions"
},
delete: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "DELETE",
params: { reaction_id: { required: true, type: "integer" } },
url: "/reactions/:reaction_id"
},
listForCommitComment: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/comments/:comment_id/reactions"
},
listForIssue: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
issue_number: { required: true, type: "integer" },
number: { alias: "issue_number", deprecated: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/:issue_number/reactions"
},
listForIssueComment: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/issues/comments/:comment_id/reactions"
},
listForPullRequestReviewComment: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pulls/comments/:comment_id/reactions"
},
listForTeamDiscussion: {
deprecated: "octokit.reactions.listForTeamDiscussion() has been renamed to octokit.reactions.listForTeamDiscussionLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
discussion_number: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/reactions"
},
listForTeamDiscussionComment: {
deprecated: "octokit.reactions.listForTeamDiscussionComment() has been renamed to octokit.reactions.listForTeamDiscussionCommentLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
comment_number: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
discussion_number: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number/reactions"
},
listForTeamDiscussionCommentInOrg: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
comment_number: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments/:comment_number/reactions"
},
listForTeamDiscussionCommentLegacy: {
deprecated: "octokit.reactions.listForTeamDiscussionCommentLegacy() is deprecated, see https://developer.github.com/v3/reactions/#list-reactions-for-a-team-discussion-comment-legacy",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
comment_number: { required: true, type: "integer" },
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
discussion_number: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number/reactions"
},
listForTeamDiscussionInOrg: {
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/reactions"
},
listForTeamDiscussionLegacy: {
deprecated: "octokit.reactions.listForTeamDiscussionLegacy() is deprecated, see https://developer.github.com/v3/reactions/#list-reactions-for-a-team-discussion-legacy",
headers: { accept: "application/vnd.github.squirrel-girl-preview+json" },
method: "GET",
params: {
content: {
enum: [
"+1",
"-1",
"laugh",
"confused",
"heart",
"hooray",
"rocket",
"eyes"
],
type: "string"
},
discussion_number: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/reactions"
}
},
repos: {
acceptInvitation: {
method: "PATCH",
params: { invitation_id: { required: true, type: "integer" } },
url: "/user/repository_invitations/:invitation_id"
},
addCollaborator: {
method: "PUT",
params: {
owner: { required: true, type: "string" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
repo: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/collaborators/:username"
},
addDeployKey: {
method: "POST",
params: {
key: { required: true, type: "string" },
owner: { required: true, type: "string" },
read_only: { type: "boolean" },
repo: { required: true, type: "string" },
title: { type: "string" }
},
url: "/repos/:owner/:repo/keys"
},
addProtectedBranchAdminEnforcement: {
method: "POST",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/enforce_admins"
},
addProtectedBranchAppRestrictions: {
method: "POST",
params: {
apps: { mapTo: "data", required: true, type: "string[]" },
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/apps"
},
addProtectedBranchRequiredSignatures: {
headers: { accept: "application/vnd.github.zzzax-preview+json" },
method: "POST",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_signatures"
},
addProtectedBranchRequiredStatusChecksContexts: {
method: "POST",
params: {
branch: { required: true, type: "string" },
contexts: { mapTo: "data", required: true, type: "string[]" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks/contexts"
},
addProtectedBranchTeamRestrictions: {
method: "POST",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
teams: { mapTo: "data", required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/teams"
},
addProtectedBranchUserRestrictions: {
method: "POST",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
users: { mapTo: "data", required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/users"
},
checkCollaborator: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/collaborators/:username"
},
checkVulnerabilityAlerts: {
headers: { accept: "application/vnd.github.dorian-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/vulnerability-alerts"
},
compareCommits: {
method: "GET",
params: {
base: { required: true, type: "string" },
head: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/compare/:base...:head"
},
createCommitComment: {
method: "POST",
params: {
body: { required: true, type: "string" },
commit_sha: { required: true, type: "string" },
line: { type: "integer" },
owner: { required: true, type: "string" },
path: { type: "string" },
position: { type: "integer" },
repo: { required: true, type: "string" },
sha: { alias: "commit_sha", deprecated: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:commit_sha/comments"
},
createDeployment: {
method: "POST",
params: {
auto_merge: { type: "boolean" },
description: { type: "string" },
environment: { type: "string" },
owner: { required: true, type: "string" },
payload: { type: "string" },
production_environment: { type: "boolean" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" },
required_contexts: { type: "string[]" },
task: { type: "string" },
transient_environment: { type: "boolean" }
},
url: "/repos/:owner/:repo/deployments"
},
createDeploymentStatus: {
method: "POST",
params: {
auto_inactive: { type: "boolean" },
deployment_id: { required: true, type: "integer" },
description: { type: "string" },
environment: { enum: ["production", "staging", "qa"], type: "string" },
environment_url: { type: "string" },
log_url: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
state: {
enum: [
"error",
"failure",
"inactive",
"in_progress",
"queued",
"pending",
"success"
],
required: true,
type: "string"
},
target_url: { type: "string" }
},
url: "/repos/:owner/:repo/deployments/:deployment_id/statuses"
},
createDispatchEvent: {
method: "POST",
params: {
client_payload: { type: "object" },
event_type: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/dispatches"
},
createFile: {
deprecated: "octokit.repos.createFile() has been renamed to octokit.repos.createOrUpdateFile() (2019-06-07)",
method: "PUT",
params: {
author: { type: "object" },
"author.email": { required: true, type: "string" },
"author.name": { required: true, type: "string" },
branch: { type: "string" },
committer: { type: "object" },
"committer.email": { required: true, type: "string" },
"committer.name": { required: true, type: "string" },
content: { required: true, type: "string" },
message: { required: true, type: "string" },
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { type: "string" }
},
url: "/repos/:owner/:repo/contents/:path"
},
createForAuthenticatedUser: {
method: "POST",
params: {
allow_merge_commit: { type: "boolean" },
allow_rebase_merge: { type: "boolean" },
allow_squash_merge: { type: "boolean" },
auto_init: { type: "boolean" },
delete_branch_on_merge: { type: "boolean" },
description: { type: "string" },
gitignore_template: { type: "string" },
has_issues: { type: "boolean" },
has_projects: { type: "boolean" },
has_wiki: { type: "boolean" },
homepage: { type: "string" },
is_template: { type: "boolean" },
license_template: { type: "string" },
name: { required: true, type: "string" },
private: { type: "boolean" },
team_id: { type: "integer" },
visibility: {
enum: ["public", "private", "visibility", "internal"],
type: "string"
}
},
url: "/user/repos"
},
createFork: {
method: "POST",
params: {
organization: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/forks"
},
createHook: {
method: "POST",
params: {
active: { type: "boolean" },
config: { required: true, type: "object" },
"config.content_type": { type: "string" },
"config.insecure_ssl": { type: "string" },
"config.secret": { type: "string" },
"config.url": { required: true, type: "string" },
events: { type: "string[]" },
name: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks"
},
createInOrg: {
method: "POST",
params: {
allow_merge_commit: { type: "boolean" },
allow_rebase_merge: { type: "boolean" },
allow_squash_merge: { type: "boolean" },
auto_init: { type: "boolean" },
delete_branch_on_merge: { type: "boolean" },
description: { type: "string" },
gitignore_template: { type: "string" },
has_issues: { type: "boolean" },
has_projects: { type: "boolean" },
has_wiki: { type: "boolean" },
homepage: { type: "string" },
is_template: { type: "boolean" },
license_template: { type: "string" },
name: { required: true, type: "string" },
org: { required: true, type: "string" },
private: { type: "boolean" },
team_id: { type: "integer" },
visibility: {
enum: ["public", "private", "visibility", "internal"],
type: "string"
}
},
url: "/orgs/:org/repos"
},
createOrUpdateFile: {
method: "PUT",
params: {
author: { type: "object" },
"author.email": { required: true, type: "string" },
"author.name": { required: true, type: "string" },
branch: { type: "string" },
committer: { type: "object" },
"committer.email": { required: true, type: "string" },
"committer.name": { required: true, type: "string" },
content: { required: true, type: "string" },
message: { required: true, type: "string" },
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { type: "string" }
},
url: "/repos/:owner/:repo/contents/:path"
},
createRelease: {
method: "POST",
params: {
body: { type: "string" },
draft: { type: "boolean" },
name: { type: "string" },
owner: { required: true, type: "string" },
prerelease: { type: "boolean" },
repo: { required: true, type: "string" },
tag_name: { required: true, type: "string" },
target_commitish: { type: "string" }
},
url: "/repos/:owner/:repo/releases"
},
createStatus: {
method: "POST",
params: {
context: { type: "string" },
description: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { required: true, type: "string" },
state: {
enum: ["error", "failure", "pending", "success"],
required: true,
type: "string"
},
target_url: { type: "string" }
},
url: "/repos/:owner/:repo/statuses/:sha"
},
createUsingTemplate: {
headers: { accept: "application/vnd.github.baptiste-preview+json" },
method: "POST",
params: {
description: { type: "string" },
name: { required: true, type: "string" },
owner: { type: "string" },
private: { type: "boolean" },
template_owner: { required: true, type: "string" },
template_repo: { required: true, type: "string" }
},
url: "/repos/:template_owner/:template_repo/generate"
},
declineInvitation: {
method: "DELETE",
params: { invitation_id: { required: true, type: "integer" } },
url: "/user/repository_invitations/:invitation_id"
},
delete: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo"
},
deleteCommitComment: {
method: "DELETE",
params: {
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/comments/:comment_id"
},
deleteDownload: {
method: "DELETE",
params: {
download_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/downloads/:download_id"
},
deleteFile: {
method: "DELETE",
params: {
author: { type: "object" },
"author.email": { type: "string" },
"author.name": { type: "string" },
branch: { type: "string" },
committer: { type: "object" },
"committer.email": { type: "string" },
"committer.name": { type: "string" },
message: { required: true, type: "string" },
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/contents/:path"
},
deleteHook: {
method: "DELETE",
params: {
hook_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks/:hook_id"
},
deleteInvitation: {
method: "DELETE",
params: {
invitation_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/invitations/:invitation_id"
},
deleteRelease: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
release_id: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/:release_id"
},
deleteReleaseAsset: {
method: "DELETE",
params: {
asset_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/assets/:asset_id"
},
disableAutomatedSecurityFixes: {
headers: { accept: "application/vnd.github.london-preview+json" },
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/automated-security-fixes"
},
disablePagesSite: {
headers: { accept: "application/vnd.github.switcheroo-preview+json" },
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pages"
},
disableVulnerabilityAlerts: {
headers: { accept: "application/vnd.github.dorian-preview+json" },
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/vulnerability-alerts"
},
enableAutomatedSecurityFixes: {
headers: { accept: "application/vnd.github.london-preview+json" },
method: "PUT",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/automated-security-fixes"
},
enablePagesSite: {
headers: { accept: "application/vnd.github.switcheroo-preview+json" },
method: "POST",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
source: { type: "object" },
"source.branch": { enum: ["master", "gh-pages"], type: "string" },
"source.path": { type: "string" }
},
url: "/repos/:owner/:repo/pages"
},
enableVulnerabilityAlerts: {
headers: { accept: "application/vnd.github.dorian-preview+json" },
method: "PUT",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/vulnerability-alerts"
},
get: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo"
},
getAppsWithAccessToProtectedBranch: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/apps"
},
getArchiveLink: {
method: "GET",
params: {
archive_format: { required: true, type: "string" },
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/:archive_format/:ref"
},
getBranch: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch"
},
getBranchProtection: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection"
},
getClones: {
method: "GET",
params: {
owner: { required: true, type: "string" },
per: { enum: ["day", "week"], type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/traffic/clones"
},
getCodeFrequencyStats: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/stats/code_frequency"
},
getCollaboratorPermissionLevel: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/collaborators/:username/permission"
},
getCombinedStatusForRef: {
method: "GET",
params: {
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:ref/status"
},
getCommit: {
method: "GET",
params: {
commit_sha: { alias: "ref", deprecated: true, type: "string" },
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { alias: "ref", deprecated: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:ref"
},
getCommitActivityStats: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/stats/commit_activity"
},
getCommitComment: {
method: "GET",
params: {
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/comments/:comment_id"
},
getCommitRefSha: {
deprecated: "octokit.repos.getCommitRefSha() is deprecated, see https://developer.github.com/v3/repos/commits/#get-a-single-commit",
headers: { accept: "application/vnd.github.v3.sha" },
method: "GET",
params: {
owner: { required: true, type: "string" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:ref"
},
getContents: {
method: "GET",
params: {
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
ref: { type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/contents/:path"
},
getContributorsStats: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/stats/contributors"
},
getDeployKey: {
method: "GET",
params: {
key_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/keys/:key_id"
},
getDeployment: {
method: "GET",
params: {
deployment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/deployments/:deployment_id"
},
getDeploymentStatus: {
method: "GET",
params: {
deployment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
status_id: { required: true, type: "integer" }
},
url: "/repos/:owner/:repo/deployments/:deployment_id/statuses/:status_id"
},
getDownload: {
method: "GET",
params: {
download_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/downloads/:download_id"
},
getHook: {
method: "GET",
params: {
hook_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks/:hook_id"
},
getLatestPagesBuild: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pages/builds/latest"
},
getLatestRelease: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/latest"
},
getPages: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pages"
},
getPagesBuild: {
method: "GET",
params: {
build_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pages/builds/:build_id"
},
getParticipationStats: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/stats/participation"
},
getProtectedBranchAdminEnforcement: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/enforce_admins"
},
getProtectedBranchPullRequestReviewEnforcement: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_pull_request_reviews"
},
getProtectedBranchRequiredSignatures: {
headers: { accept: "application/vnd.github.zzzax-preview+json" },
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_signatures"
},
getProtectedBranchRequiredStatusChecks: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks"
},
getProtectedBranchRestrictions: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions"
},
getPunchCardStats: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/stats/punch_card"
},
getReadme: {
method: "GET",
params: {
owner: { required: true, type: "string" },
ref: { type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/readme"
},
getRelease: {
method: "GET",
params: {
owner: { required: true, type: "string" },
release_id: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/:release_id"
},
getReleaseAsset: {
method: "GET",
params: {
asset_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/assets/:asset_id"
},
getReleaseByTag: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
tag: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/tags/:tag"
},
getTeamsWithAccessToProtectedBranch: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/teams"
},
getTopPaths: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/traffic/popular/paths"
},
getTopReferrers: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/traffic/popular/referrers"
},
getUsersWithAccessToProtectedBranch: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/users"
},
getViews: {
method: "GET",
params: {
owner: { required: true, type: "string" },
per: { enum: ["day", "week"], type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/traffic/views"
},
list: {
method: "GET",
params: {
affiliation: { type: "string" },
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
sort: {
enum: ["created", "updated", "pushed", "full_name"],
type: "string"
},
type: {
enum: ["all", "owner", "public", "private", "member"],
type: "string"
},
visibility: { enum: ["all", "public", "private"], type: "string" }
},
url: "/user/repos"
},
listAppsWithAccessToProtectedBranch: {
deprecated: "octokit.repos.listAppsWithAccessToProtectedBranch() has been renamed to octokit.repos.getAppsWithAccessToProtectedBranch() (2019-09-13)",
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/apps"
},
listAssetsForRelease: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
release_id: { required: true, type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/:release_id/assets"
},
listBranches: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
protected: { type: "boolean" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches"
},
listBranchesForHeadCommit: {
headers: { accept: "application/vnd.github.groot-preview+json" },
method: "GET",
params: {
commit_sha: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:commit_sha/branches-where-head"
},
listCollaborators: {
method: "GET",
params: {
affiliation: { enum: ["outside", "direct", "all"], type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/collaborators"
},
listCommentsForCommit: {
method: "GET",
params: {
commit_sha: { required: true, type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
ref: { alias: "commit_sha", deprecated: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:commit_sha/comments"
},
listCommitComments: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/comments"
},
listCommits: {
method: "GET",
params: {
author: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
path: { type: "string" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
sha: { type: "string" },
since: { type: "string" },
until: { type: "string" }
},
url: "/repos/:owner/:repo/commits"
},
listContributors: {
method: "GET",
params: {
anon: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/contributors"
},
listDeployKeys: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/keys"
},
listDeploymentStatuses: {
method: "GET",
params: {
deployment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/deployments/:deployment_id/statuses"
},
listDeployments: {
method: "GET",
params: {
environment: { type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
ref: { type: "string" },
repo: { required: true, type: "string" },
sha: { type: "string" },
task: { type: "string" }
},
url: "/repos/:owner/:repo/deployments"
},
listDownloads: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/downloads"
},
listForOrg: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
sort: {
enum: ["created", "updated", "pushed", "full_name"],
type: "string"
},
type: {
enum: [
"all",
"public",
"private",
"forks",
"sources",
"member",
"internal"
],
type: "string"
}
},
url: "/orgs/:org/repos"
},
listForUser: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
sort: {
enum: ["created", "updated", "pushed", "full_name"],
type: "string"
},
type: { enum: ["all", "owner", "member"], type: "string" },
username: { required: true, type: "string" }
},
url: "/users/:username/repos"
},
listForks: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" },
sort: { enum: ["newest", "oldest", "stargazers"], type: "string" }
},
url: "/repos/:owner/:repo/forks"
},
listHooks: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks"
},
listInvitations: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/invitations"
},
listInvitationsForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/repository_invitations"
},
listLanguages: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/languages"
},
listPagesBuilds: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pages/builds"
},
listProtectedBranchRequiredStatusChecksContexts: {
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks/contexts"
},
listProtectedBranchTeamRestrictions: {
deprecated: "octokit.repos.listProtectedBranchTeamRestrictions() has been renamed to octokit.repos.getTeamsWithAccessToProtectedBranch() (2019-09-09)",
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/teams"
},
listProtectedBranchUserRestrictions: {
deprecated: "octokit.repos.listProtectedBranchUserRestrictions() has been renamed to octokit.repos.getUsersWithAccessToProtectedBranch() (2019-09-09)",
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/users"
},
listPublic: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "integer" }
},
url: "/repositories"
},
listPullRequestsAssociatedWithCommit: {
headers: { accept: "application/vnd.github.groot-preview+json" },
method: "GET",
params: {
commit_sha: { required: true, type: "string" },
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:commit_sha/pulls"
},
listReleases: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases"
},
listStatusesForRef: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
ref: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/commits/:ref/statuses"
},
listTags: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/tags"
},
listTeams: {
method: "GET",
params: {
owner: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/teams"
},
listTeamsWithAccessToProtectedBranch: {
deprecated: "octokit.repos.listTeamsWithAccessToProtectedBranch() has been renamed to octokit.repos.getTeamsWithAccessToProtectedBranch() (2019-09-13)",
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/teams"
},
listTopics: {
headers: { accept: "application/vnd.github.mercy-preview+json" },
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/topics"
},
listUsersWithAccessToProtectedBranch: {
deprecated: "octokit.repos.listUsersWithAccessToProtectedBranch() has been renamed to octokit.repos.getUsersWithAccessToProtectedBranch() (2019-09-13)",
method: "GET",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/users"
},
merge: {
method: "POST",
params: {
base: { required: true, type: "string" },
commit_message: { type: "string" },
head: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/merges"
},
pingHook: {
method: "POST",
params: {
hook_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks/:hook_id/pings"
},
removeBranchProtection: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection"
},
removeCollaborator: {
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/collaborators/:username"
},
removeDeployKey: {
method: "DELETE",
params: {
key_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/keys/:key_id"
},
removeProtectedBranchAdminEnforcement: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/enforce_admins"
},
removeProtectedBranchAppRestrictions: {
method: "DELETE",
params: {
apps: { mapTo: "data", required: true, type: "string[]" },
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/apps"
},
removeProtectedBranchPullRequestReviewEnforcement: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_pull_request_reviews"
},
removeProtectedBranchRequiredSignatures: {
headers: { accept: "application/vnd.github.zzzax-preview+json" },
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_signatures"
},
removeProtectedBranchRequiredStatusChecks: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks"
},
removeProtectedBranchRequiredStatusChecksContexts: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
contexts: { mapTo: "data", required: true, type: "string[]" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks/contexts"
},
removeProtectedBranchRestrictions: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions"
},
removeProtectedBranchTeamRestrictions: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
teams: { mapTo: "data", required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/teams"
},
removeProtectedBranchUserRestrictions: {
method: "DELETE",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
users: { mapTo: "data", required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/users"
},
replaceProtectedBranchAppRestrictions: {
method: "PUT",
params: {
apps: { mapTo: "data", required: true, type: "string[]" },
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/apps"
},
replaceProtectedBranchRequiredStatusChecksContexts: {
method: "PUT",
params: {
branch: { required: true, type: "string" },
contexts: { mapTo: "data", required: true, type: "string[]" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks/contexts"
},
replaceProtectedBranchTeamRestrictions: {
method: "PUT",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
teams: { mapTo: "data", required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/teams"
},
replaceProtectedBranchUserRestrictions: {
method: "PUT",
params: {
branch: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
users: { mapTo: "data", required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/restrictions/users"
},
replaceTopics: {
headers: { accept: "application/vnd.github.mercy-preview+json" },
method: "PUT",
params: {
names: { required: true, type: "string[]" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/topics"
},
requestPageBuild: {
method: "POST",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/pages/builds"
},
retrieveCommunityProfileMetrics: {
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/community/profile"
},
testPushHook: {
method: "POST",
params: {
hook_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks/:hook_id/tests"
},
transfer: {
method: "POST",
params: {
new_owner: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_ids: { type: "integer[]" }
},
url: "/repos/:owner/:repo/transfer"
},
update: {
method: "PATCH",
params: {
allow_merge_commit: { type: "boolean" },
allow_rebase_merge: { type: "boolean" },
allow_squash_merge: { type: "boolean" },
archived: { type: "boolean" },
default_branch: { type: "string" },
delete_branch_on_merge: { type: "boolean" },
description: { type: "string" },
has_issues: { type: "boolean" },
has_projects: { type: "boolean" },
has_wiki: { type: "boolean" },
homepage: { type: "string" },
is_template: { type: "boolean" },
name: { type: "string" },
owner: { required: true, type: "string" },
private: { type: "boolean" },
repo: { required: true, type: "string" },
visibility: {
enum: ["public", "private", "visibility", "internal"],
type: "string"
}
},
url: "/repos/:owner/:repo"
},
updateBranchProtection: {
method: "PUT",
params: {
allow_deletions: { type: "boolean" },
allow_force_pushes: { allowNull: true, type: "boolean" },
branch: { required: true, type: "string" },
enforce_admins: { allowNull: true, required: true, type: "boolean" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
required_linear_history: { type: "boolean" },
required_pull_request_reviews: {
allowNull: true,
required: true,
type: "object"
},
"required_pull_request_reviews.dismiss_stale_reviews": {
type: "boolean"
},
"required_pull_request_reviews.dismissal_restrictions": {
type: "object"
},
"required_pull_request_reviews.dismissal_restrictions.teams": {
type: "string[]"
},
"required_pull_request_reviews.dismissal_restrictions.users": {
type: "string[]"
},
"required_pull_request_reviews.require_code_owner_reviews": {
type: "boolean"
},
"required_pull_request_reviews.required_approving_review_count": {
type: "integer"
},
required_status_checks: {
allowNull: true,
required: true,
type: "object"
},
"required_status_checks.contexts": { required: true, type: "string[]" },
"required_status_checks.strict": { required: true, type: "boolean" },
restrictions: { allowNull: true, required: true, type: "object" },
"restrictions.apps": { type: "string[]" },
"restrictions.teams": { required: true, type: "string[]" },
"restrictions.users": { required: true, type: "string[]" }
},
url: "/repos/:owner/:repo/branches/:branch/protection"
},
updateCommitComment: {
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/comments/:comment_id"
},
updateFile: {
deprecated: "octokit.repos.updateFile() has been renamed to octokit.repos.createOrUpdateFile() (2019-06-07)",
method: "PUT",
params: {
author: { type: "object" },
"author.email": { required: true, type: "string" },
"author.name": { required: true, type: "string" },
branch: { type: "string" },
committer: { type: "object" },
"committer.email": { required: true, type: "string" },
"committer.name": { required: true, type: "string" },
content: { required: true, type: "string" },
message: { required: true, type: "string" },
owner: { required: true, type: "string" },
path: { required: true, type: "string" },
repo: { required: true, type: "string" },
sha: { type: "string" }
},
url: "/repos/:owner/:repo/contents/:path"
},
updateHook: {
method: "PATCH",
params: {
active: { type: "boolean" },
add_events: { type: "string[]" },
config: { type: "object" },
"config.content_type": { type: "string" },
"config.insecure_ssl": { type: "string" },
"config.secret": { type: "string" },
"config.url": { required: true, type: "string" },
events: { type: "string[]" },
hook_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
remove_events: { type: "string[]" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/hooks/:hook_id"
},
updateInformationAboutPagesSite: {
method: "PUT",
params: {
cname: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
source: {
enum: ['"gh-pages"', '"master"', '"master /docs"'],
type: "string"
}
},
url: "/repos/:owner/:repo/pages"
},
updateInvitation: {
method: "PATCH",
params: {
invitation_id: { required: true, type: "integer" },
owner: { required: true, type: "string" },
permissions: { enum: ["read", "write", "admin"], type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/invitations/:invitation_id"
},
updateProtectedBranchPullRequestReviewEnforcement: {
method: "PATCH",
params: {
branch: { required: true, type: "string" },
dismiss_stale_reviews: { type: "boolean" },
dismissal_restrictions: { type: "object" },
"dismissal_restrictions.teams": { type: "string[]" },
"dismissal_restrictions.users": { type: "string[]" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
require_code_owner_reviews: { type: "boolean" },
required_approving_review_count: { type: "integer" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_pull_request_reviews"
},
updateProtectedBranchRequiredStatusChecks: {
method: "PATCH",
params: {
branch: { required: true, type: "string" },
contexts: { type: "string[]" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
strict: { type: "boolean" }
},
url: "/repos/:owner/:repo/branches/:branch/protection/required_status_checks"
},
updateRelease: {
method: "PATCH",
params: {
body: { type: "string" },
draft: { type: "boolean" },
name: { type: "string" },
owner: { required: true, type: "string" },
prerelease: { type: "boolean" },
release_id: { required: true, type: "integer" },
repo: { required: true, type: "string" },
tag_name: { type: "string" },
target_commitish: { type: "string" }
},
url: "/repos/:owner/:repo/releases/:release_id"
},
updateReleaseAsset: {
method: "PATCH",
params: {
asset_id: { required: true, type: "integer" },
label: { type: "string" },
name: { type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" }
},
url: "/repos/:owner/:repo/releases/assets/:asset_id"
},
uploadReleaseAsset: {
method: "POST",
params: {
data: { mapTo: "data", required: true, type: "string | object" },
file: { alias: "data", deprecated: true, type: "string | object" },
headers: { required: true, type: "object" },
"headers.content-length": { required: true, type: "integer" },
"headers.content-type": { required: true, type: "string" },
label: { type: "string" },
name: { required: true, type: "string" },
url: { required: true, type: "string" }
},
url: ":url"
}
},
search: {
code: {
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
q: { required: true, type: "string" },
sort: { enum: ["indexed"], type: "string" }
},
url: "/search/code"
},
commits: {
headers: { accept: "application/vnd.github.cloak-preview+json" },
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
q: { required: true, type: "string" },
sort: { enum: ["author-date", "committer-date"], type: "string" }
},
url: "/search/commits"
},
issues: {
deprecated: "octokit.search.issues() has been renamed to octokit.search.issuesAndPullRequests() (2018-12-27)",
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
q: { required: true, type: "string" },
sort: {
enum: [
"comments",
"reactions",
"reactions-+1",
"reactions--1",
"reactions-smile",
"reactions-thinking_face",
"reactions-heart",
"reactions-tada",
"interactions",
"created",
"updated"
],
type: "string"
}
},
url: "/search/issues"
},
issuesAndPullRequests: {
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
q: { required: true, type: "string" },
sort: {
enum: [
"comments",
"reactions",
"reactions-+1",
"reactions--1",
"reactions-smile",
"reactions-thinking_face",
"reactions-heart",
"reactions-tada",
"interactions",
"created",
"updated"
],
type: "string"
}
},
url: "/search/issues"
},
labels: {
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
q: { required: true, type: "string" },
repository_id: { required: true, type: "integer" },
sort: { enum: ["created", "updated"], type: "string" }
},
url: "/search/labels"
},
repos: {
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
q: { required: true, type: "string" },
sort: {
enum: ["stars", "forks", "help-wanted-issues", "updated"],
type: "string"
}
},
url: "/search/repositories"
},
topics: {
method: "GET",
params: { q: { required: true, type: "string" } },
url: "/search/topics"
},
users: {
method: "GET",
params: {
order: { enum: ["desc", "asc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
q: { required: true, type: "string" },
sort: { enum: ["followers", "repositories", "joined"], type: "string" }
},
url: "/search/users"
}
},
teams: {
addMember: {
deprecated: "octokit.teams.addMember() has been renamed to octokit.teams.addMemberLegacy() (2020-01-16)",
method: "PUT",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/members/:username"
},
addMemberLegacy: {
deprecated: "octokit.teams.addMemberLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#add-team-member-legacy",
method: "PUT",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/members/:username"
},
addOrUpdateMembership: {
deprecated: "octokit.teams.addOrUpdateMembership() has been renamed to octokit.teams.addOrUpdateMembershipLegacy() (2020-01-16)",
method: "PUT",
params: {
role: { enum: ["member", "maintainer"], type: "string" },
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/memberships/:username"
},
addOrUpdateMembershipInOrg: {
method: "PUT",
params: {
org: { required: true, type: "string" },
role: { enum: ["member", "maintainer"], type: "string" },
team_slug: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/memberships/:username"
},
addOrUpdateMembershipLegacy: {
deprecated: "octokit.teams.addOrUpdateMembershipLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#add-or-update-team-membership-legacy",
method: "PUT",
params: {
role: { enum: ["member", "maintainer"], type: "string" },
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/memberships/:username"
},
addOrUpdateProject: {
deprecated: "octokit.teams.addOrUpdateProject() has been renamed to octokit.teams.addOrUpdateProjectLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PUT",
params: {
permission: { enum: ["read", "write", "admin"], type: "string" },
project_id: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects/:project_id"
},
addOrUpdateProjectInOrg: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PUT",
params: {
org: { required: true, type: "string" },
permission: { enum: ["read", "write", "admin"], type: "string" },
project_id: { required: true, type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/projects/:project_id"
},
addOrUpdateProjectLegacy: {
deprecated: "octokit.teams.addOrUpdateProjectLegacy() is deprecated, see https://developer.github.com/v3/teams/#add-or-update-team-project-legacy",
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "PUT",
params: {
permission: { enum: ["read", "write", "admin"], type: "string" },
project_id: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects/:project_id"
},
addOrUpdateRepo: {
deprecated: "octokit.teams.addOrUpdateRepo() has been renamed to octokit.teams.addOrUpdateRepoLegacy() (2020-01-16)",
method: "PUT",
params: {
owner: { required: true, type: "string" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
repo: { required: true, type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos/:owner/:repo"
},
addOrUpdateRepoInOrg: {
method: "PUT",
params: {
org: { required: true, type: "string" },
owner: { required: true, type: "string" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
repo: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/repos/:owner/:repo"
},
addOrUpdateRepoLegacy: {
deprecated: "octokit.teams.addOrUpdateRepoLegacy() is deprecated, see https://developer.github.com/v3/teams/#add-or-update-team-repository-legacy",
method: "PUT",
params: {
owner: { required: true, type: "string" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
repo: { required: true, type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos/:owner/:repo"
},
checkManagesRepo: {
deprecated: "octokit.teams.checkManagesRepo() has been renamed to octokit.teams.checkManagesRepoLegacy() (2020-01-16)",
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos/:owner/:repo"
},
checkManagesRepoInOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/repos/:owner/:repo"
},
checkManagesRepoLegacy: {
deprecated: "octokit.teams.checkManagesRepoLegacy() is deprecated, see https://developer.github.com/v3/teams/#check-if-a-team-manages-a-repository-legacy",
method: "GET",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos/:owner/:repo"
},
create: {
method: "POST",
params: {
description: { type: "string" },
maintainers: { type: "string[]" },
name: { required: true, type: "string" },
org: { required: true, type: "string" },
parent_team_id: { type: "integer" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
privacy: { enum: ["secret", "closed"], type: "string" },
repo_names: { type: "string[]" }
},
url: "/orgs/:org/teams"
},
createDiscussion: {
deprecated: "octokit.teams.createDiscussion() has been renamed to octokit.teams.createDiscussionLegacy() (2020-01-16)",
method: "POST",
params: {
body: { required: true, type: "string" },
private: { type: "boolean" },
team_id: { required: true, type: "integer" },
title: { required: true, type: "string" }
},
url: "/teams/:team_id/discussions"
},
createDiscussionComment: {
deprecated: "octokit.teams.createDiscussionComment() has been renamed to octokit.teams.createDiscussionCommentLegacy() (2020-01-16)",
method: "POST",
params: {
body: { required: true, type: "string" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments"
},
createDiscussionCommentInOrg: {
method: "POST",
params: {
body: { required: true, type: "string" },
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments"
},
createDiscussionCommentLegacy: {
deprecated: "octokit.teams.createDiscussionCommentLegacy() is deprecated, see https://developer.github.com/v3/teams/discussion_comments/#create-a-comment-legacy",
method: "POST",
params: {
body: { required: true, type: "string" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments"
},
createDiscussionInOrg: {
method: "POST",
params: {
body: { required: true, type: "string" },
org: { required: true, type: "string" },
private: { type: "boolean" },
team_slug: { required: true, type: "string" },
title: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions"
},
createDiscussionLegacy: {
deprecated: "octokit.teams.createDiscussionLegacy() is deprecated, see https://developer.github.com/v3/teams/discussions/#create-a-discussion-legacy",
method: "POST",
params: {
body: { required: true, type: "string" },
private: { type: "boolean" },
team_id: { required: true, type: "integer" },
title: { required: true, type: "string" }
},
url: "/teams/:team_id/discussions"
},
delete: {
deprecated: "octokit.teams.delete() has been renamed to octokit.teams.deleteLegacy() (2020-01-16)",
method: "DELETE",
params: { team_id: { required: true, type: "integer" } },
url: "/teams/:team_id"
},
deleteDiscussion: {
deprecated: "octokit.teams.deleteDiscussion() has been renamed to octokit.teams.deleteDiscussionLegacy() (2020-01-16)",
method: "DELETE",
params: {
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number"
},
deleteDiscussionComment: {
deprecated: "octokit.teams.deleteDiscussionComment() has been renamed to octokit.teams.deleteDiscussionCommentLegacy() (2020-01-16)",
method: "DELETE",
params: {
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number"
},
deleteDiscussionCommentInOrg: {
method: "DELETE",
params: {
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments/:comment_number"
},
deleteDiscussionCommentLegacy: {
deprecated: "octokit.teams.deleteDiscussionCommentLegacy() is deprecated, see https://developer.github.com/v3/teams/discussion_comments/#delete-a-comment-legacy",
method: "DELETE",
params: {
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number"
},
deleteDiscussionInOrg: {
method: "DELETE",
params: {
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number"
},
deleteDiscussionLegacy: {
deprecated: "octokit.teams.deleteDiscussionLegacy() is deprecated, see https://developer.github.com/v3/teams/discussions/#delete-a-discussion-legacy",
method: "DELETE",
params: {
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number"
},
deleteInOrg: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug"
},
deleteLegacy: {
deprecated: "octokit.teams.deleteLegacy() is deprecated, see https://developer.github.com/v3/teams/#delete-team-legacy",
method: "DELETE",
params: { team_id: { required: true, type: "integer" } },
url: "/teams/:team_id"
},
get: {
deprecated: "octokit.teams.get() has been renamed to octokit.teams.getLegacy() (2020-01-16)",
method: "GET",
params: { team_id: { required: true, type: "integer" } },
url: "/teams/:team_id"
},
getByName: {
method: "GET",
params: {
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug"
},
getDiscussion: {
deprecated: "octokit.teams.getDiscussion() has been renamed to octokit.teams.getDiscussionLegacy() (2020-01-16)",
method: "GET",
params: {
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number"
},
getDiscussionComment: {
deprecated: "octokit.teams.getDiscussionComment() has been renamed to octokit.teams.getDiscussionCommentLegacy() (2020-01-16)",
method: "GET",
params: {
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number"
},
getDiscussionCommentInOrg: {
method: "GET",
params: {
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments/:comment_number"
},
getDiscussionCommentLegacy: {
deprecated: "octokit.teams.getDiscussionCommentLegacy() is deprecated, see https://developer.github.com/v3/teams/discussion_comments/#get-a-single-comment-legacy",
method: "GET",
params: {
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number"
},
getDiscussionInOrg: {
method: "GET",
params: {
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number"
},
getDiscussionLegacy: {
deprecated: "octokit.teams.getDiscussionLegacy() is deprecated, see https://developer.github.com/v3/teams/discussions/#get-a-single-discussion-legacy",
method: "GET",
params: {
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number"
},
getLegacy: {
deprecated: "octokit.teams.getLegacy() is deprecated, see https://developer.github.com/v3/teams/#get-team-legacy",
method: "GET",
params: { team_id: { required: true, type: "integer" } },
url: "/teams/:team_id"
},
getMember: {
deprecated: "octokit.teams.getMember() has been renamed to octokit.teams.getMemberLegacy() (2020-01-16)",
method: "GET",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/members/:username"
},
getMemberLegacy: {
deprecated: "octokit.teams.getMemberLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#get-team-member-legacy",
method: "GET",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/members/:username"
},
getMembership: {
deprecated: "octokit.teams.getMembership() has been renamed to octokit.teams.getMembershipLegacy() (2020-01-16)",
method: "GET",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/memberships/:username"
},
getMembershipInOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/memberships/:username"
},
getMembershipLegacy: {
deprecated: "octokit.teams.getMembershipLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#get-team-membership-legacy",
method: "GET",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/memberships/:username"
},
list: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" }
},
url: "/orgs/:org/teams"
},
listChild: {
deprecated: "octokit.teams.listChild() has been renamed to octokit.teams.listChildLegacy() (2020-01-16)",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/teams"
},
listChildInOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/teams"
},
listChildLegacy: {
deprecated: "octokit.teams.listChildLegacy() is deprecated, see https://developer.github.com/v3/teams/#list-child-teams-legacy",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/teams"
},
listDiscussionComments: {
deprecated: "octokit.teams.listDiscussionComments() has been renamed to octokit.teams.listDiscussionCommentsLegacy() (2020-01-16)",
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
discussion_number: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments"
},
listDiscussionCommentsInOrg: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments"
},
listDiscussionCommentsLegacy: {
deprecated: "octokit.teams.listDiscussionCommentsLegacy() is deprecated, see https://developer.github.com/v3/teams/discussion_comments/#list-comments-legacy",
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
discussion_number: { required: true, type: "integer" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments"
},
listDiscussions: {
deprecated: "octokit.teams.listDiscussions() has been renamed to octokit.teams.listDiscussionsLegacy() (2020-01-16)",
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions"
},
listDiscussionsInOrg: {
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions"
},
listDiscussionsLegacy: {
deprecated: "octokit.teams.listDiscussionsLegacy() is deprecated, see https://developer.github.com/v3/teams/discussions/#list-discussions-legacy",
method: "GET",
params: {
direction: { enum: ["asc", "desc"], type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions"
},
listForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/teams"
},
listMembers: {
deprecated: "octokit.teams.listMembers() has been renamed to octokit.teams.listMembersLegacy() (2020-01-16)",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
role: { enum: ["member", "maintainer", "all"], type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/members"
},
listMembersInOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
role: { enum: ["member", "maintainer", "all"], type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/members"
},
listMembersLegacy: {
deprecated: "octokit.teams.listMembersLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#list-team-members-legacy",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
role: { enum: ["member", "maintainer", "all"], type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/members"
},
listPendingInvitations: {
deprecated: "octokit.teams.listPendingInvitations() has been renamed to octokit.teams.listPendingInvitationsLegacy() (2020-01-16)",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/invitations"
},
listPendingInvitationsInOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/invitations"
},
listPendingInvitationsLegacy: {
deprecated: "octokit.teams.listPendingInvitationsLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#list-pending-team-invitations-legacy",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/invitations"
},
listProjects: {
deprecated: "octokit.teams.listProjects() has been renamed to octokit.teams.listProjectsLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects"
},
listProjectsInOrg: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/projects"
},
listProjectsLegacy: {
deprecated: "octokit.teams.listProjectsLegacy() is deprecated, see https://developer.github.com/v3/teams/#list-team-projects-legacy",
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects"
},
listRepos: {
deprecated: "octokit.teams.listRepos() has been renamed to octokit.teams.listReposLegacy() (2020-01-16)",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos"
},
listReposInOrg: {
method: "GET",
params: {
org: { required: true, type: "string" },
page: { type: "integer" },
per_page: { type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/repos"
},
listReposLegacy: {
deprecated: "octokit.teams.listReposLegacy() is deprecated, see https://developer.github.com/v3/teams/#list-team-repos-legacy",
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos"
},
removeMember: {
deprecated: "octokit.teams.removeMember() has been renamed to octokit.teams.removeMemberLegacy() (2020-01-16)",
method: "DELETE",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/members/:username"
},
removeMemberLegacy: {
deprecated: "octokit.teams.removeMemberLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#remove-team-member-legacy",
method: "DELETE",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/members/:username"
},
removeMembership: {
deprecated: "octokit.teams.removeMembership() has been renamed to octokit.teams.removeMembershipLegacy() (2020-01-16)",
method: "DELETE",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/memberships/:username"
},
removeMembershipInOrg: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/memberships/:username"
},
removeMembershipLegacy: {
deprecated: "octokit.teams.removeMembershipLegacy() is deprecated, see https://developer.github.com/v3/teams/members/#remove-team-membership-legacy",
method: "DELETE",
params: {
team_id: { required: true, type: "integer" },
username: { required: true, type: "string" }
},
url: "/teams/:team_id/memberships/:username"
},
removeProject: {
deprecated: "octokit.teams.removeProject() has been renamed to octokit.teams.removeProjectLegacy() (2020-01-16)",
method: "DELETE",
params: {
project_id: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects/:project_id"
},
removeProjectInOrg: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
project_id: { required: true, type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/projects/:project_id"
},
removeProjectLegacy: {
deprecated: "octokit.teams.removeProjectLegacy() is deprecated, see https://developer.github.com/v3/teams/#remove-team-project-legacy",
method: "DELETE",
params: {
project_id: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects/:project_id"
},
removeRepo: {
deprecated: "octokit.teams.removeRepo() has been renamed to octokit.teams.removeRepoLegacy() (2020-01-16)",
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos/:owner/:repo"
},
removeRepoInOrg: {
method: "DELETE",
params: {
org: { required: true, type: "string" },
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/repos/:owner/:repo"
},
removeRepoLegacy: {
deprecated: "octokit.teams.removeRepoLegacy() is deprecated, see https://developer.github.com/v3/teams/#remove-team-repository-legacy",
method: "DELETE",
params: {
owner: { required: true, type: "string" },
repo: { required: true, type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/repos/:owner/:repo"
},
reviewProject: {
deprecated: "octokit.teams.reviewProject() has been renamed to octokit.teams.reviewProjectLegacy() (2020-01-16)",
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
project_id: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects/:project_id"
},
reviewProjectInOrg: {
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
org: { required: true, type: "string" },
project_id: { required: true, type: "integer" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/projects/:project_id"
},
reviewProjectLegacy: {
deprecated: "octokit.teams.reviewProjectLegacy() is deprecated, see https://developer.github.com/v3/teams/#review-a-team-project-legacy",
headers: { accept: "application/vnd.github.inertia-preview+json" },
method: "GET",
params: {
project_id: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/projects/:project_id"
},
update: {
deprecated: "octokit.teams.update() has been renamed to octokit.teams.updateLegacy() (2020-01-16)",
method: "PATCH",
params: {
description: { type: "string" },
name: { required: true, type: "string" },
parent_team_id: { type: "integer" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
privacy: { enum: ["secret", "closed"], type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id"
},
updateDiscussion: {
deprecated: "octokit.teams.updateDiscussion() has been renamed to octokit.teams.updateDiscussionLegacy() (2020-01-16)",
method: "PATCH",
params: {
body: { type: "string" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" },
title: { type: "string" }
},
url: "/teams/:team_id/discussions/:discussion_number"
},
updateDiscussionComment: {
deprecated: "octokit.teams.updateDiscussionComment() has been renamed to octokit.teams.updateDiscussionCommentLegacy() (2020-01-16)",
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number"
},
updateDiscussionCommentInOrg: {
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number/comments/:comment_number"
},
updateDiscussionCommentLegacy: {
deprecated: "octokit.teams.updateDiscussionCommentLegacy() is deprecated, see https://developer.github.com/v3/teams/discussion_comments/#edit-a-comment-legacy",
method: "PATCH",
params: {
body: { required: true, type: "string" },
comment_number: { required: true, type: "integer" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id/discussions/:discussion_number/comments/:comment_number"
},
updateDiscussionInOrg: {
method: "PATCH",
params: {
body: { type: "string" },
discussion_number: { required: true, type: "integer" },
org: { required: true, type: "string" },
team_slug: { required: true, type: "string" },
title: { type: "string" }
},
url: "/orgs/:org/teams/:team_slug/discussions/:discussion_number"
},
updateDiscussionLegacy: {
deprecated: "octokit.teams.updateDiscussionLegacy() is deprecated, see https://developer.github.com/v3/teams/discussions/#edit-a-discussion-legacy",
method: "PATCH",
params: {
body: { type: "string" },
discussion_number: { required: true, type: "integer" },
team_id: { required: true, type: "integer" },
title: { type: "string" }
},
url: "/teams/:team_id/discussions/:discussion_number"
},
updateInOrg: {
method: "PATCH",
params: {
description: { type: "string" },
name: { required: true, type: "string" },
org: { required: true, type: "string" },
parent_team_id: { type: "integer" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
privacy: { enum: ["secret", "closed"], type: "string" },
team_slug: { required: true, type: "string" }
},
url: "/orgs/:org/teams/:team_slug"
},
updateLegacy: {
deprecated: "octokit.teams.updateLegacy() is deprecated, see https://developer.github.com/v3/teams/#edit-team-legacy",
method: "PATCH",
params: {
description: { type: "string" },
name: { required: true, type: "string" },
parent_team_id: { type: "integer" },
permission: { enum: ["pull", "push", "admin"], type: "string" },
privacy: { enum: ["secret", "closed"], type: "string" },
team_id: { required: true, type: "integer" }
},
url: "/teams/:team_id"
}
},
users: {
addEmails: {
method: "POST",
params: { emails: { required: true, type: "string[]" } },
url: "/user/emails"
},
block: {
method: "PUT",
params: { username: { required: true, type: "string" } },
url: "/user/blocks/:username"
},
checkBlocked: {
method: "GET",
params: { username: { required: true, type: "string" } },
url: "/user/blocks/:username"
},
checkFollowing: {
method: "GET",
params: { username: { required: true, type: "string" } },
url: "/user/following/:username"
},
checkFollowingForUser: {
method: "GET",
params: {
target_user: { required: true, type: "string" },
username: { required: true, type: "string" }
},
url: "/users/:username/following/:target_user"
},
createGpgKey: {
method: "POST",
params: { armored_public_key: { type: "string" } },
url: "/user/gpg_keys"
},
createPublicKey: {
method: "POST",
params: { key: { type: "string" }, title: { type: "string" } },
url: "/user/keys"
},
deleteEmails: {
method: "DELETE",
params: { emails: { required: true, type: "string[]" } },
url: "/user/emails"
},
deleteGpgKey: {
method: "DELETE",
params: { gpg_key_id: { required: true, type: "integer" } },
url: "/user/gpg_keys/:gpg_key_id"
},
deletePublicKey: {
method: "DELETE",
params: { key_id: { required: true, type: "integer" } },
url: "/user/keys/:key_id"
},
follow: {
method: "PUT",
params: { username: { required: true, type: "string" } },
url: "/user/following/:username"
},
getAuthenticated: { method: "GET", params: {}, url: "/user" },
getByUsername: {
method: "GET",
params: { username: { required: true, type: "string" } },
url: "/users/:username"
},
getContextForUser: {
method: "GET",
params: {
subject_id: { type: "string" },
subject_type: {
enum: ["organization", "repository", "issue", "pull_request"],
type: "string"
},
username: { required: true, type: "string" }
},
url: "/users/:username/hovercard"
},
getGpgKey: {
method: "GET",
params: { gpg_key_id: { required: true, type: "integer" } },
url: "/user/gpg_keys/:gpg_key_id"
},
getPublicKey: {
method: "GET",
params: { key_id: { required: true, type: "integer" } },
url: "/user/keys/:key_id"
},
list: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
since: { type: "string" }
},
url: "/users"
},
listBlocked: { method: "GET", params: {}, url: "/user/blocks" },
listEmails: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/emails"
},
listFollowersForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/followers"
},
listFollowersForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/followers"
},
listFollowingForAuthenticatedUser: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/following"
},
listFollowingForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/following"
},
listGpgKeys: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/gpg_keys"
},
listGpgKeysForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/gpg_keys"
},
listPublicEmails: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/public_emails"
},
listPublicKeys: {
method: "GET",
params: { page: { type: "integer" }, per_page: { type: "integer" } },
url: "/user/keys"
},
listPublicKeysForUser: {
method: "GET",
params: {
page: { type: "integer" },
per_page: { type: "integer" },
username: { required: true, type: "string" }
},
url: "/users/:username/keys"
},
togglePrimaryEmailVisibility: {
method: "PATCH",
params: {
email: { required: true, type: "string" },
visibility: { required: true, type: "string" }
},
url: "/user/email/visibility"
},
unblock: {
method: "DELETE",
params: { username: { required: true, type: "string" } },
url: "/user/blocks/:username"
},
unfollow: {
method: "DELETE",
params: { username: { required: true, type: "string" } },
url: "/user/following/:username"
},
updateAuthenticated: {
method: "PATCH",
params: {
bio: { type: "string" },
blog: { type: "string" },
company: { type: "string" },
email: { type: "string" },
hireable: { type: "boolean" },
location: { type: "string" },
name: { type: "string" }
},
url: "/user"
}
}
};
const VERSION$8 = "2.4.0";
function registerEndpoints(octokit, routes) {
Object.keys(routes).forEach(namespaceName => {
if (!octokit[namespaceName]) {
octokit[namespaceName] = {};
}
Object.keys(routes[namespaceName]).forEach(apiName => {
const apiOptions = routes[namespaceName][apiName];
const endpointDefaults = ["method", "url", "headers"].reduce((map, key) => {
if (typeof apiOptions[key] !== "undefined") {
map[key] = apiOptions[key];
}
return map;
}, {});
endpointDefaults.request = {
validate: apiOptions.params
};
let request = octokit.request.defaults(endpointDefaults);
// patch request & endpoint methods to support deprecated parameters.
// Not the most elegant solution, but we don’t want to move deprecation
// logic into octokit/endpoint.js as it’s out of scope
const hasDeprecatedParam = Object.keys(apiOptions.params || {}).find(key => apiOptions.params[key].deprecated);
if (hasDeprecatedParam) {
const patch = patchForDeprecation.bind(null, octokit, apiOptions);
request = patch(octokit.request.defaults(endpointDefaults), `.${namespaceName}.${apiName}()`);
request.endpoint = patch(request.endpoint, `.${namespaceName}.${apiName}.endpoint()`);
request.endpoint.merge = patch(request.endpoint.merge, `.${namespaceName}.${apiName}.endpoint.merge()`);
}
if (apiOptions.deprecated) {
octokit[namespaceName][apiName] = Object.assign(function deprecatedEndpointMethod() {
octokit.log.warn(new Deprecation(`[@octokit/rest] ${apiOptions.deprecated}`));
octokit[namespaceName][apiName] = request;
return request.apply(null, arguments);
}, request);
return;
}
octokit[namespaceName][apiName] = request;
});
});
}
function patchForDeprecation(octokit, apiOptions, method, methodName) {
const patchedMethod = (options) => {
options = Object.assign({}, options);
Object.keys(options).forEach(key => {
if (apiOptions.params[key] && apiOptions.params[key].deprecated) {
const aliasKey = apiOptions.params[key].alias;
octokit.log.warn(new Deprecation(`[@octokit/rest] "${key}" parameter is deprecated for "${methodName}". Use "${aliasKey}" instead`));
if (!(aliasKey in options)) {
options[aliasKey] = options[key];
}
delete options[key];
}
});
return method(options);
};
Object.keys(method).forEach(key => {
patchedMethod[key] = method[key];
});
return patchedMethod;
}
/**
* This plugin is a 1:1 copy of internal @octokit/rest plugins. The primary
* goal is to rebuild @octokit/rest on top of @octokit/core. Once that is
* done, we will remove the registerEndpoints methods and return the methods
* directly as with the other plugins. At that point we will also remove the
* legacy workarounds and deprecations.
*
* See the plan at
* https://github.com/octokit/plugin-rest-endpoint-methods.js/pull/1
*/
function restEndpointMethods$1(octokit) {
// @ts-ignore
octokit.registerEndpoints = registerEndpoints.bind(null, octokit);
registerEndpoints(octokit, endpointsByScope);
// Aliasing scopes for backward compatibility
// See https://github.com/octokit/rest.js/pull/1134
[
["gitdata", "git"],
["authorization", "oauthAuthorizations"],
["pullRequests", "pulls"]
].forEach(([deprecatedScope, scope]) => {
Object.defineProperty(octokit, deprecatedScope, {
get() {
octokit.log.warn(
// @ts-ignore
new Deprecation(`[@octokit/plugin-rest-endpoint-methods] "octokit.${deprecatedScope}.*" methods are deprecated, use "octokit.${scope}.*" instead`));
// @ts-ignore
return octokit[scope];
}
});
});
return {};
}
restEndpointMethods$1.VERSION = VERSION$8;
var distWeb$5 = /*#__PURE__*/Object.freeze({
__proto__: null,
restEndpointMethods: restEndpointMethods$1
});
function getUserAgent$1() {
try {
return navigator.userAgent;
}
catch (e) {
return "<environment unknown>";
}
}
var distWeb$6 = /*#__PURE__*/Object.freeze({
__proto__: null,
getUserAgent: getUserAgent$1
});
var name = "@octokit/rest";
var version = "16.43.2";
var publishConfig = {
access: "public"
};
var description = "GitHub REST API client for Node.js";
var keywords = [
"octokit",
"github",
"rest",
"api-client"
];
var author = "Gregor Martynus (https://github.com/gr2m)";
var contributors = [
{
name: "Mike de Boer",
email: "info@mikedeboer.nl"
},
{
name: "Fabian Jakobs",
email: "fabian@c9.io"
},
{
name: "Joe Gallo",
email: "joe@brassafrax.com"
},
{
name: "Gregor Martynus",
url: "https://github.com/gr2m"
}
];
var repository = "https://github.com/octokit/rest.js";
var dependencies = {
"@octokit/auth-token": "^2.4.0",
"@octokit/plugin-paginate-rest": "^1.1.1",
"@octokit/plugin-request-log": "^1.0.0",
"@octokit/plugin-rest-endpoint-methods": "2.4.0",
"@octokit/request": "^5.2.0",
"@octokit/request-error": "^1.0.2",
"atob-lite": "^2.0.0",
"before-after-hook": "^2.0.0",
"btoa-lite": "^1.0.0",
deprecation: "^2.0.0",
"lodash.get": "^4.4.2",
"lodash.set": "^4.3.2",
"lodash.uniq": "^4.5.0",
"octokit-pagination-methods": "^1.1.0",
once: "^1.4.0",
"universal-user-agent": "^4.0.0"
};
var devDependencies = {
"@gimenete/type-writer": "^0.1.3",
"@octokit/auth": "^1.1.1",
"@octokit/fixtures-server": "^5.0.6",
"@octokit/graphql": "^4.2.0",
"@types/node": "^13.1.0",
bundlesize: "^0.18.0",
chai: "^4.1.2",
"compression-webpack-plugin": "^3.1.0",
cypress: "^4.0.0",
glob: "^7.1.2",
"http-proxy-agent": "^4.0.0",
"lodash.camelcase": "^4.3.0",
"lodash.merge": "^4.6.1",
"lodash.upperfirst": "^4.3.1",
lolex: "^6.0.0",
mkdirp: "^1.0.0",
mocha: "^7.0.1",
mustache: "^4.0.0",
nock: "^11.3.3",
"npm-run-all": "^4.1.2",
nyc: "^15.0.0",
prettier: "^1.14.2",
proxy: "^1.0.0",
"semantic-release": "^17.0.0",
sinon: "^8.0.0",
"sinon-chai": "^3.0.0",
"sort-keys": "^4.0.0",
"string-to-arraybuffer": "^1.0.0",
"string-to-jsdoc-comment": "^1.0.0",
typescript: "^3.3.1",
webpack: "^4.0.0",
"webpack-bundle-analyzer": "^3.0.0",
"webpack-cli": "^3.0.0"
};
var types = "index.d.ts";
var scripts = {
coverage: "nyc report --reporter=html && open coverage/index.html",
lint: "prettier --check '{lib,plugins,scripts,test}/**/*.{js,json,ts}' 'docs/*.{js,json}' 'docs/src/**/*' index.js README.md package.json",
"lint:fix": "prettier --write '{lib,plugins,scripts,test}/**/*.{js,json,ts}' 'docs/*.{js,json}' 'docs/src/**/*' index.js README.md package.json",
pretest: "npm run -s lint",
test: "nyc mocha test/mocha-node-setup.js \"test/*/**/*-test.js\"",
"test:browser": "cypress run --browser chrome",
build: "npm-run-all build:*",
"build:ts": "npm run -s update-endpoints:typescript",
"prebuild:browser": "mkdirp dist/",
"build:browser": "npm-run-all build:browser:*",
"build:browser:development": "webpack --mode development --entry . --output-library=Octokit --output=./dist/octokit-rest.js --profile --json > dist/bundle-stats.json",
"build:browser:production": "webpack --mode production --entry . --plugin=compression-webpack-plugin --output-library=Octokit --output-path=./dist --output-filename=octokit-rest.min.js --devtool source-map",
"generate-bundle-report": "webpack-bundle-analyzer dist/bundle-stats.json --mode=static --no-open --report dist/bundle-report.html",
"update-endpoints": "npm-run-all update-endpoints:*",
"update-endpoints:fetch-json": "node scripts/update-endpoints/fetch-json",
"update-endpoints:typescript": "node scripts/update-endpoints/typescript",
"prevalidate:ts": "npm run -s build:ts",
"validate:ts": "tsc --target es6 --noImplicitAny index.d.ts",
"postvalidate:ts": "tsc --noEmit --target es6 test/typescript-validate.ts",
"start-fixtures-server": "octokit-fixtures-server"
};
var license = "MIT";
var files = [
"index.js",
"index.d.ts",
"lib",
"plugins"
];
var nyc = {
ignore: [
"test"
]
};
var release = {
publish: [
"@semantic-release/npm",
{
path: "@semantic-release/github",
assets: [
"dist/*",
"!dist/*.map.gz"
]
}
]
};
var bundlesize = [
{
path: "./dist/octokit-rest.min.js.gz",
maxSize: "33 kB"
}
];
var pkg = {
name: name,
version: version,
publishConfig: publishConfig,
description: description,
keywords: keywords,
author: author,
contributors: contributors,
repository: repository,
dependencies: dependencies,
devDependencies: devDependencies,
types: types,
scripts: scripts,
license: license,
files: files,
nyc: nyc,
release: release,
bundlesize: bundlesize
};
var parseClientOptions = parseOptions;
const { Deprecation: Deprecation$1 } = distWeb;
const { getUserAgent: getUserAgent$2 } = distWeb$6;
const deprecateOptionsTimeout = once_1((log, deprecation) =>
log.warn(deprecation)
);
const deprecateOptionsAgent = once_1((log, deprecation) => log.warn(deprecation));
const deprecateOptionsHeaders = once_1((log, deprecation) =>
log.warn(deprecation)
);
function parseOptions(options, log, hook) {
if (options.headers) {
options.headers = Object.keys(options.headers).reduce((newObj, key) => {
newObj[key.toLowerCase()] = options.headers[key];
return newObj;
}, {});
}
const clientDefaults = {
headers: options.headers || {},
request: options.request || {},
mediaType: {
previews: [],
format: ""
}
};
if (options.baseUrl) {
clientDefaults.baseUrl = options.baseUrl;
}
if (options.userAgent) {
clientDefaults.headers["user-agent"] = options.userAgent;
}
if (options.previews) {
clientDefaults.mediaType.previews = options.previews;
}
if (options.timeZone) {
clientDefaults.headers["time-zone"] = options.timeZone;
}
if (options.timeout) {
deprecateOptionsTimeout(
log,
new Deprecation$1(
"[@octokit/rest] new Octokit({timeout}) is deprecated. Use {request: {timeout}} instead. See https://github.com/octokit/request.js#request"
)
);
clientDefaults.request.timeout = options.timeout;
}
if (options.agent) {
deprecateOptionsAgent(
log,
new Deprecation$1(
"[@octokit/rest] new Octokit({agent}) is deprecated. Use {request: {agent}} instead. See https://github.com/octokit/request.js#request"
)
);
clientDefaults.request.agent = options.agent;
}
if (options.headers) {
deprecateOptionsHeaders(
log,
new Deprecation$1(
"[@octokit/rest] new Octokit({headers}) is deprecated. Use {userAgent, previews} instead. See https://github.com/octokit/request.js#request"
)
);
}
const userAgentOption = clientDefaults.headers["user-agent"];
const defaultUserAgent = `octokit.js/${pkg.version} ${getUserAgent$2()}`;
clientDefaults.headers["user-agent"] = [userAgentOption, defaultUserAgent]
.filter(Boolean)
.join(" ");
clientDefaults.request.hook = hook.bind(null, "request");
return clientDefaults;
}
var constructor_1 = Octokit$2;
const { request: request$1 } = distWeb$1;
function Octokit$2(plugins, options) {
options = options || {};
const hook = new beforeAfterHook.Collection();
const log = Object.assign(
{
debug: () => {},
info: () => {},
warn: console.warn,
error: console.error
},
options && options.log
);
const api = {
hook,
log,
request: request$1.defaults(parseClientOptions(options, log, hook))
};
plugins.forEach(pluginFunction => pluginFunction(api, options));
return api;
}
var registerPlugin_1 = registerPlugin;
function registerPlugin(plugins, pluginFunction) {
return factory_1(
plugins.includes(pluginFunction) ? plugins : plugins.concat(pluginFunction)
);
}
var factory_1 = factory;
function factory(plugins) {
const Api = constructor_1.bind(null, plugins || []);
Api.plugin = registerPlugin_1.bind(null, plugins || []);
return Api;
}
var core$3 = factory_1();
var btoaNode = function btoa(str) {
return new Buffer(str).toString('base64')
};
var atobNode = function atob(str) {
return Buffer.from(str, 'base64').toString('binary')
};
var withAuthorizationPrefix_1 = withAuthorizationPrefix$1;
const REGEX_IS_BASIC_AUTH = /^[\w-]+:/;
function withAuthorizationPrefix$1(authorization) {
if (/^(basic|bearer|token) /i.test(authorization)) {
return authorization;
}
try {
if (REGEX_IS_BASIC_AUTH.test(atobNode(authorization))) {
return `basic ${authorization}`;
}
} catch (error) {}
if (authorization.split(/\./).length === 3) {
return `bearer ${authorization}`;
}
return `token ${authorization}`;
}
var beforeRequest = authenticationBeforeRequest;
function authenticationBeforeRequest(state, options) {
if (typeof state.auth === "string") {
options.headers.authorization = withAuthorizationPrefix_1(state.auth);
return;
}
if (state.auth.username) {
const hash = btoaNode(`${state.auth.username}:${state.auth.password}`);
options.headers.authorization = `Basic ${hash}`;
if (state.otp) {
options.headers["x-github-otp"] = state.otp;
}
return;
}
if (state.auth.clientId) {
// There is a special case for OAuth applications, when `clientId` and `clientSecret` is passed as
// Basic Authorization instead of query parameters. The only routes where that applies share the same
// URL though: `/applications/:client_id/tokens/:access_token`.
//
// 1. [Check an authorization](https://developer.github.com/v3/oauth_authorizations/#check-an-authorization)
// 2. [Reset an authorization](https://developer.github.com/v3/oauth_authorizations/#reset-an-authorization)
// 3. [Revoke an authorization for an application](https://developer.github.com/v3/oauth_authorizations/#revoke-an-authorization-for-an-application)
//
// We identify by checking the URL. It must merge both "/applications/:client_id/tokens/:access_token"
// as well as "/applications/123/tokens/token456"
if (/\/applications\/:?[\w_]+\/tokens\/:?[\w_]+($|\?)/.test(options.url)) {
const hash = btoaNode(`${state.auth.clientId}:${state.auth.clientSecret}`);
options.headers.authorization = `Basic ${hash}`;
return;
}
options.url += options.url.indexOf("?") === -1 ? "?" : "&";
options.url += `client_id=${state.auth.clientId}&client_secret=${state.auth.clientSecret}`;
return;
}
return Promise.resolve()
.then(() => {
return state.auth();
})
.then(authorization => {
options.headers.authorization = withAuthorizationPrefix_1(authorization);
});
}
const logOnce$1 = once_1((deprecation) => console.warn(deprecation));
/**
* Error with extra properties to help with debugging
*/
class RequestError$1 extends Error {
constructor(message, statusCode, options) {
super(message);
// Maintains proper stack trace (only available on V8)
/* istanbul ignore next */
if (Error.captureStackTrace) {
Error.captureStackTrace(this, this.constructor);
}
this.name = "HttpError";
this.status = statusCode;
Object.defineProperty(this, "code", {
get() {
logOnce$1(new Deprecation("[@octokit/request-error] `error.code` is deprecated, use `error.status`."));
return statusCode;
}
});
this.headers = options.headers || {};
// redact request credentials without mutating original request options
const requestCopy = Object.assign({}, options.request);
if (options.request.headers.authorization) {
requestCopy.headers = Object.assign({}, options.request.headers, {
authorization: options.request.headers.authorization.replace(/ .*$/, " [REDACTED]")
});
}
requestCopy.url = requestCopy.url
// client_id & client_secret can be passed as URL query parameters to increase rate limit
// see https://developer.github.com/v3/#increasing-the-unauthenticated-rate-limit-for-oauth-applications
.replace(/\bclient_secret=\w+/g, "client_secret=[REDACTED]")
// OAuth tokens can be passed as URL query parameters, although it is not recommended
// see https://developer.github.com/v3/#oauth2-token-sent-in-a-header
.replace(/\baccess_token=\w+/g, "access_token=[REDACTED]");
this.request = requestCopy;
}
}
var distWeb$7 = /*#__PURE__*/Object.freeze({
__proto__: null,
RequestError: RequestError$1
});
var requestError = authenticationRequestError;
const { RequestError: RequestError$2 } = distWeb$7;
function authenticationRequestError(state, error, options) {
if (!error.headers) throw error;
const otpRequired = /required/.test(error.headers["x-github-otp"] || "");
// handle "2FA required" error only
if (error.status !== 401 || !otpRequired) {
throw error;
}
if (
error.status === 401 &&
otpRequired &&
error.request &&
error.request.headers["x-github-otp"]
) {
if (state.otp) {
delete state.otp; // no longer valid, request again
} else {
throw new RequestError$2(
"Invalid one-time password for two-factor authentication",
401,
{
headers: error.headers,
request: options
}
);
}
}
if (typeof state.auth.on2fa !== "function") {
throw new RequestError$2(
"2FA required, but options.on2fa is not a function. See https://github.com/octokit/rest.js#authentication",
401,
{
headers: error.headers,
request: options
}
);
}
return Promise.resolve()
.then(() => {
return state.auth.on2fa();
})
.then(oneTimePassword => {
const newOptions = Object.assign(options, {
headers: Object.assign(options.headers, {
"x-github-otp": oneTimePassword
})
});
return state.octokit.request(newOptions).then(response => {
// If OTP still valid, then persist it for following requests
state.otp = oneTimePassword;
return response;
});
});
}
var validate = validateAuth;
function validateAuth(auth) {
if (typeof auth === "string") {
return;
}
if (typeof auth === "function") {
return;
}
if (auth.username && auth.password) {
return;
}
if (auth.clientId && auth.clientSecret) {
return;
}
throw new Error(`Invalid "auth" option: ${JSON.stringify(auth)}`);
}
var authentication = authenticationPlugin;
const { createTokenAuth: createTokenAuth$1 } = distWeb$3;
const { Deprecation: Deprecation$2 } = distWeb;
const deprecateAuthBasic = once_1((log, deprecation) => log.warn(deprecation));
const deprecateAuthObject = once_1((log, deprecation) => log.warn(deprecation));
function authenticationPlugin(octokit, options) {
// If `options.authStrategy` is set then use it and pass in `options.auth`
if (options.authStrategy) {
const auth = options.authStrategy(options.auth);
octokit.hook.wrap("request", auth.hook);
octokit.auth = auth;
return;
}
// If neither `options.authStrategy` nor `options.auth` are set, the `octokit` instance
// is unauthenticated. The `octokit.auth()` method is a no-op and no request hook is registred.
if (!options.auth) {
octokit.auth = () =>
Promise.resolve({
type: "unauthenticated"
});
return;
}
const isBasicAuthString =
typeof options.auth === "string" &&
/^basic/.test(withAuthorizationPrefix_1(options.auth));
// If only `options.auth` is set to a string, use the default token authentication strategy.
if (typeof options.auth === "string" && !isBasicAuthString) {
const auth = createTokenAuth$1(options.auth);
octokit.hook.wrap("request", auth.hook);
octokit.auth = auth;
return;
}
// Otherwise log a deprecation message
const [deprecationMethod, deprecationMessapge] = isBasicAuthString
? [
deprecateAuthBasic,
'Setting the "new Octokit({ auth })" option to a Basic Auth string is deprecated. Use https://github.com/octokit/auth-basic.js instead. See (https://octokit.github.io/rest.js/#authentication)'
]
: [
deprecateAuthObject,
'Setting the "new Octokit({ auth })" option to an object without also setting the "authStrategy" option is deprecated and will be removed in v17. See (https://octokit.github.io/rest.js/#authentication)'
];
deprecationMethod(
octokit.log,
new Deprecation$2("[@octokit/rest] " + deprecationMessapge)
);
octokit.auth = () =>
Promise.resolve({
type: "deprecated",
message: deprecationMessapge
});
validate(options.auth);
const state = {
octokit,
auth: options.auth
};
octokit.hook.before("request", beforeRequest.bind(null, state));
octokit.hook.error("request", requestError.bind(null, state));
}
var authenticate_1 = authenticate;
const { Deprecation: Deprecation$3 } = distWeb;
const deprecateAuthenticate = once_1((log, deprecation) => log.warn(deprecation));
function authenticate(state, options) {
deprecateAuthenticate(
state.octokit.log,
new Deprecation$3(
'[@octokit/rest] octokit.authenticate() is deprecated. Use "auth" constructor option instead.'
)
);
if (!options) {
state.auth = false;
return;
}
switch (options.type) {
case "basic":
if (!options.username || !options.password) {
throw new Error(
"Basic authentication requires both a username and password to be set"
);
}
break;
case "oauth":
if (!options.token && !(options.key && options.secret)) {
throw new Error(
"OAuth2 authentication requires a token or key & secret to be set"
);
}
break;
case "token":
case "app":
if (!options.token) {
throw new Error("Token authentication requires a token to be set");
}
break;
default:
throw new Error(
"Invalid authentication type, must be 'basic', 'oauth', 'token' or 'app'"
);
}
state.auth = options;
}
/**
* lodash (Custom Build) <https://lodash.com/>
* Build: `lodash modularize exports="npm" -o ./`
* Copyright jQuery Foundation and other contributors <https://jquery.org/>
* Released under MIT license <https://lodash.com/license>
* Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
*/
/** Used as the size to enable large array optimizations. */
var LARGE_ARRAY_SIZE = 200;
/** Used to stand-in for `undefined` hash values. */
var HASH_UNDEFINED = '__lodash_hash_undefined__';
/** Used as references for various `Number` constants. */
var INFINITY = 1 / 0;
/** `Object#toString` result references. */
var funcTag = '[object Function]',
genTag = '[object GeneratorFunction]';
/**
* Used to match `RegExp`
* [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
*/
var reRegExpChar = /[\\^$.*+?()[\]{}|]/g;
/** Used to detect host constructors (Safari). */
var reIsHostCtor = /^\[object .+?Constructor\]$/;
/** Detect free variable `global` from Node.js. */
var freeGlobal = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal;
/** Detect free variable `self`. */
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */
var root = freeGlobal || freeSelf || Function('return this')();
/**
* A specialized version of `_.includes` for arrays without support for
* specifying an index to search from.
*
* @private
* @param {Array} [array] The array to inspect.
* @param {*} target The value to search for.
* @returns {boolean} Returns `true` if `target` is found, else `false`.
*/
function arrayIncludes(array, value) {
var length = array ? array.length : 0;
return !!length && baseIndexOf(array, value, 0) > -1;
}
/**
* This function is like `arrayIncludes` except that it accepts a comparator.
*
* @private
* @param {Array} [array] The array to inspect.
* @param {*} target The value to search for.
* @param {Function} comparator The comparator invoked per element.
* @returns {boolean} Returns `true` if `target` is found, else `false`.
*/
function arrayIncludesWith(array, value, comparator) {
var index = -1,
length = array ? array.length : 0;
while (++index < length) {
if (comparator(value, array[index])) {
return true;
}
}
return false;
}
/**
* The base implementation of `_.findIndex` and `_.findLastIndex` without
* support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} predicate The function invoked per iteration.
* @param {number} fromIndex The index to search from.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseFindIndex(array, predicate, fromIndex, fromRight) {
var length = array.length,
index = fromIndex + (fromRight ? 1 : -1);
while ((fromRight ? index-- : ++index < length)) {
if (predicate(array[index], index, array)) {
return index;
}
}
return -1;
}
/**
* The base implementation of `_.indexOf` without `fromIndex` bounds checks.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseIndexOf(array, value, fromIndex) {
if (value !== value) {
return baseFindIndex(array, baseIsNaN, fromIndex);
}
var index = fromIndex - 1,
length = array.length;
while (++index < length) {
if (array[index] === value) {
return index;
}
}
return -1;
}
/**
* The base implementation of `_.isNaN` without support for number objects.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
*/
function baseIsNaN(value) {
return value !== value;
}
/**
* Checks if a cache value for `key` exists.
*
* @private
* @param {Object} cache The cache to query.
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function cacheHas(cache, key) {
return cache.has(key);
}
/**
* Gets the value at `key` of `object`.
*
* @private
* @param {Object} [object] The object to query.
* @param {string} key The key of the property to get.
* @returns {*} Returns the property value.
*/
function getValue(object, key) {
return object == null ? undefined : object[key];
}
/**
* Checks if `value` is a host object in IE < 9.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a host object, else `false`.
*/
function isHostObject(value) {
// Many host objects are `Object` objects that can coerce to strings
// despite having improperly defined `toString` methods.
var result = false;
if (value != null && typeof value.toString != 'function') {
try {
result = !!(value + '');
} catch (e) {}
}
return result;
}
/**
* Converts `set` to an array of its values.
*
* @private
* @param {Object} set The set to convert.
* @returns {Array} Returns the values.
*/
function setToArray(set) {
var index = -1,
result = Array(set.size);
set.forEach(function(value) {
result[++index] = value;
});
return result;
}
/** Used for built-in method references. */
var arrayProto = Array.prototype,
funcProto = Function.prototype,
objectProto = Object.prototype;
/** Used to detect overreaching core-js shims. */
var coreJsData = root['__core-js_shared__'];
/** Used to detect methods masquerading as native. */
var maskSrcKey = (function() {
var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
return uid ? ('Symbol(src)_1.' + uid) : '';
}());
/** Used to resolve the decompiled source of functions. */
var funcToString = funcProto.toString;
/** Used to check objects for own properties. */
var hasOwnProperty = objectProto.hasOwnProperty;
/**
* Used to resolve the
* [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
* of values.
*/
var objectToString = objectProto.toString;
/** Used to detect if a method is native. */
var reIsNative = RegExp('^' +
funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
.replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
);
/** Built-in value references. */
var splice = arrayProto.splice;
/* Built-in method references that are verified to be native. */
var Map$1 = getNative(root, 'Map'),
Set = getNative(root, 'Set'),
nativeCreate = getNative(Object, 'create');
/**
* Creates a hash object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Hash(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the hash.
*
* @private
* @name clear
* @memberOf Hash
*/
function hashClear() {
this.__data__ = nativeCreate ? nativeCreate(null) : {};
}
/**
* Removes `key` and its value from the hash.
*
* @private
* @name delete
* @memberOf Hash
* @param {Object} hash The hash to modify.
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function hashDelete(key) {
return this.has(key) && delete this.__data__[key];
}
/**
* Gets the hash value for `key`.
*
* @private
* @name get
* @memberOf Hash
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function hashGet(key) {
var data = this.__data__;
if (nativeCreate) {
var result = data[key];
return result === HASH_UNDEFINED ? undefined : result;
}
return hasOwnProperty.call(data, key) ? data[key] : undefined;
}
/**
* Checks if a hash value for `key` exists.
*
* @private
* @name has
* @memberOf Hash
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function hashHas(key) {
var data = this.__data__;
return nativeCreate ? data[key] !== undefined : hasOwnProperty.call(data, key);
}
/**
* Sets the hash `key` to `value`.
*
* @private
* @name set
* @memberOf Hash
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the hash instance.
*/
function hashSet(key, value) {
var data = this.__data__;
data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
return this;
}
// Add methods to `Hash`.
Hash.prototype.clear = hashClear;
Hash.prototype['delete'] = hashDelete;
Hash.prototype.get = hashGet;
Hash.prototype.has = hashHas;
Hash.prototype.set = hashSet;
/**
* Creates an list cache object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function ListCache(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the list cache.
*
* @private
* @name clear
* @memberOf ListCache
*/
function listCacheClear() {
this.__data__ = [];
}
/**
* Removes `key` and its value from the list cache.
*
* @private
* @name delete
* @memberOf ListCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function listCacheDelete(key) {
var data = this.__data__,
index = assocIndexOf(data, key);
if (index < 0) {
return false;
}
var lastIndex = data.length - 1;
if (index == lastIndex) {
data.pop();
} else {
splice.call(data, index, 1);
}
return true;
}
/**
* Gets the list cache value for `key`.
*
* @private
* @name get
* @memberOf ListCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function listCacheGet(key) {
var data = this.__data__,
index = assocIndexOf(data, key);
return index < 0 ? undefined : data[index][1];
}
/**
* Checks if a list cache value for `key` exists.
*
* @private
* @name has
* @memberOf ListCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function listCacheHas(key) {
return assocIndexOf(this.__data__, key) > -1;
}
/**
* Sets the list cache `key` to `value`.
*
* @private
* @name set
* @memberOf ListCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the list cache instance.
*/
function listCacheSet(key, value) {
var data = this.__data__,
index = assocIndexOf(data, key);
if (index < 0) {
data.push([key, value]);
} else {
data[index][1] = value;
}
return this;
}
// Add methods to `ListCache`.
ListCache.prototype.clear = listCacheClear;
ListCache.prototype['delete'] = listCacheDelete;
ListCache.prototype.get = listCacheGet;
ListCache.prototype.has = listCacheHas;
ListCache.prototype.set = listCacheSet;
/**
* Creates a map cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function MapCache(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the map.
*
* @private
* @name clear
* @memberOf MapCache
*/
function mapCacheClear() {
this.__data__ = {
'hash': new Hash,
'map': new (Map$1 || ListCache),
'string': new Hash
};
}
/**
* Removes `key` and its value from the map.
*
* @private
* @name delete
* @memberOf MapCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function mapCacheDelete(key) {
return getMapData(this, key)['delete'](key);
}
/**
* Gets the map value for `key`.
*
* @private
* @name get
* @memberOf MapCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function mapCacheGet(key) {
return getMapData(this, key).get(key);
}
/**
* Checks if a map value for `key` exists.
*
* @private
* @name has
* @memberOf MapCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function mapCacheHas(key) {
return getMapData(this, key).has(key);
}
/**
* Sets the map `key` to `value`.
*
* @private
* @name set
* @memberOf MapCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the map cache instance.
*/
function mapCacheSet(key, value) {
getMapData(this, key).set(key, value);
return this;
}
// Add methods to `MapCache`.
MapCache.prototype.clear = mapCacheClear;
MapCache.prototype['delete'] = mapCacheDelete;
MapCache.prototype.get = mapCacheGet;
MapCache.prototype.has = mapCacheHas;
MapCache.prototype.set = mapCacheSet;
/**
*
* Creates an array cache object to store unique values.
*
* @private
* @constructor
* @param {Array} [values] The values to cache.
*/
function SetCache(values) {
var index = -1,
length = values ? values.length : 0;
this.__data__ = new MapCache;
while (++index < length) {
this.add(values[index]);
}
}
/**
* Adds `value` to the array cache.
*
* @private
* @name add
* @memberOf SetCache
* @alias push
* @param {*} value The value to cache.
* @returns {Object} Returns the cache instance.
*/
function setCacheAdd(value) {
this.__data__.set(value, HASH_UNDEFINED);
return this;
}
/**
* Checks if `value` is in the array cache.
*
* @private
* @name has
* @memberOf SetCache
* @param {*} value The value to search for.
* @returns {number} Returns `true` if `value` is found, else `false`.
*/
function setCacheHas(value) {
return this.__data__.has(value);
}
// Add methods to `SetCache`.
SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
SetCache.prototype.has = setCacheHas;
/**
* Gets the index at which the `key` is found in `array` of key-value pairs.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} key The key to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function assocIndexOf(array, key) {
var length = array.length;
while (length--) {
if (eq(array[length][0], key)) {
return length;
}
}
return -1;
}
/**
* The base implementation of `_.isNative` without bad shim checks.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
*/
function baseIsNative(value) {
if (!isObject$1(value) || isMasked(value)) {
return false;
}
var pattern = (isFunction(value) || isHostObject(value)) ? reIsNative : reIsHostCtor;
return pattern.test(toSource(value));
}
/**
* The base implementation of `_.uniqBy` without support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new duplicate free array.
*/
function baseUniq(array, iteratee, comparator) {
var index = -1,
includes = arrayIncludes,
length = array.length,
isCommon = true,
result = [],
seen = result;
if (comparator) {
isCommon = false;
includes = arrayIncludesWith;
}
else if (length >= LARGE_ARRAY_SIZE) {
var set = iteratee ? null : createSet(array);
if (set) {
return setToArray(set);
}
isCommon = false;
includes = cacheHas;
seen = new SetCache;
}
else {
seen = iteratee ? [] : result;
}
outer:
while (++index < length) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
value = (comparator || value !== 0) ? value : 0;
if (isCommon && computed === computed) {
var seenIndex = seen.length;
while (seenIndex--) {
if (seen[seenIndex] === computed) {
continue outer;
}
}
if (iteratee) {
seen.push(computed);
}
result.push(value);
}
else if (!includes(seen, computed, comparator)) {
if (seen !== result) {
seen.push(computed);
}
result.push(value);
}
}
return result;
}
/**
* Creates a set object of `values`.
*
* @private
* @param {Array} values The values to add to the set.
* @returns {Object} Returns the new set.
*/
var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop$2 : function(values) {
return new Set(values);
};
/**
* Gets the data for `map`.
*
* @private
* @param {Object} map The map to query.
* @param {string} key The reference key.
* @returns {*} Returns the map data.
*/
function getMapData(map, key) {
var data = map.__data__;
return isKeyable(key)
? data[typeof key == 'string' ? 'string' : 'hash']
: data.map;
}
/**
* Gets the native function at `key` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {string} key The key of the method to get.
* @returns {*} Returns the function if it's native, else `undefined`.
*/
function getNative(object, key) {
var value = getValue(object, key);
return baseIsNative(value) ? value : undefined;
}
/**
* Checks if `value` is suitable for use as unique object key.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is suitable, else `false`.
*/
function isKeyable(value) {
var type = typeof value;
return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
? (value !== '__proto__')
: (value === null);
}
/**
* Checks if `func` has its source masked.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` is masked, else `false`.
*/
function isMasked(func) {
return !!maskSrcKey && (maskSrcKey in func);
}
/**
* Converts `func` to its source code.
*
* @private
* @param {Function} func The function to process.
* @returns {string} Returns the source code.
*/
function toSource(func) {
if (func != null) {
try {
return funcToString.call(func);
} catch (e) {}
try {
return (func + '');
} catch (e) {}
}
return '';
}
/**
* Creates a duplicate-free version of an array, using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons, in which only the first occurrence of each
* element is kept.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.uniq([2, 1, 2]);
* // => [2, 1]
*/
function uniq(array) {
return (array && array.length)
? baseUniq(array)
: [];
}
/**
* Performs a
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* comparison between two values to determine if they are equivalent.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.eq(object, object);
* // => true
*
* _.eq(object, other);
* // => false
*
* _.eq('a', 'a');
* // => true
*
* _.eq('a', Object('a'));
* // => false
*
* _.eq(NaN, NaN);
* // => true
*/
function eq(value, other) {
return value === other || (value !== value && other !== other);
}
/**
* Checks if `value` is classified as a `Function` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
* @example
*
* _.isFunction(_);
* // => true
*
* _.isFunction(/abc/);
* // => false
*/
function isFunction(value) {
// The use of `Object#toString` avoids issues with the `typeof` operator
// in Safari 8-9 which returns 'object' for typed array and other constructors.
var tag = isObject$1(value) ? objectToString.call(value) : '';
return tag == funcTag || tag == genTag;
}
/**
* Checks if `value` is the
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
* @example
*
* _.isObject({});
* // => true
*
* _.isObject([1, 2, 3]);
* // => true
*
* _.isObject(_.noop);
* // => true
*
* _.isObject(null);
* // => false
*/
function isObject$1(value) {
var type = typeof value;
return !!value && (type == 'object' || type == 'function');
}
/**
* This method returns `undefined`.
*
* @static
* @memberOf _
* @since 2.3.0
* @category Util
* @example
*
* _.times(2, _.noop);
* // => [undefined, undefined]
*/
function noop$2() {
// No operation performed.
}
var lodash_uniq = uniq;
var beforeRequest$1 = authenticationBeforeRequest$1;
function authenticationBeforeRequest$1(state, options) {
if (!state.auth.type) {
return;
}
if (state.auth.type === "basic") {
const hash = btoaNode(`${state.auth.username}:${state.auth.password}`);
options.headers.authorization = `Basic ${hash}`;
return;
}
if (state.auth.type === "token") {
options.headers.authorization = `token ${state.auth.token}`;
return;
}
if (state.auth.type === "app") {
options.headers.authorization = `Bearer ${state.auth.token}`;
const acceptHeaders = options.headers.accept
.split(",")
.concat("application/vnd.github.machine-man-preview+json");
options.headers.accept = lodash_uniq(acceptHeaders)
.filter(Boolean)
.join(",");
return;
}
options.url += options.url.indexOf("?") === -1 ? "?" : "&";
if (state.auth.token) {
options.url += `access_token=${encodeURIComponent(state.auth.token)}`;
return;
}
const key = encodeURIComponent(state.auth.key);
const secret = encodeURIComponent(state.auth.secret);
options.url += `client_id=${key}&client_secret=${secret}`;
}
var requestError$1 = authenticationRequestError$1;
const { RequestError: RequestError$3 } = distWeb$7;
function authenticationRequestError$1(state, error, options) {
/* istanbul ignore next */
if (!error.headers) throw error;
const otpRequired = /required/.test(error.headers["x-github-otp"] || "");
// handle "2FA required" error only
if (error.status !== 401 || !otpRequired) {
throw error;
}
if (
error.status === 401 &&
otpRequired &&
error.request &&
error.request.headers["x-github-otp"]
) {
throw new RequestError$3(
"Invalid one-time password for two-factor authentication",
401,
{
headers: error.headers,
request: options
}
);
}
if (typeof state.auth.on2fa !== "function") {
throw new RequestError$3(
"2FA required, but options.on2fa is not a function. See https://github.com/octokit/rest.js#authentication",
401,
{
headers: error.headers,
request: options
}
);
}
return Promise.resolve()
.then(() => {
return state.auth.on2fa();
})
.then(oneTimePassword => {
const newOptions = Object.assign(options, {
headers: Object.assign(
{ "x-github-otp": oneTimePassword },
options.headers
)
});
return state.octokit.request(newOptions);
});
}
var authenticationDeprecated = authenticationPlugin$1;
const { Deprecation: Deprecation$4 } = distWeb;
const deprecateAuthenticate$1 = once_1((log, deprecation) => log.warn(deprecation));
function authenticationPlugin$1(octokit, options) {
if (options.auth) {
octokit.authenticate = () => {
deprecateAuthenticate$1(
octokit.log,
new Deprecation$4(
'[@octokit/rest] octokit.authenticate() is deprecated and has no effect when "auth" option is set on Octokit constructor'
)
);
};
return;
}
const state = {
octokit,
auth: false
};
octokit.authenticate = authenticate_1.bind(null, state);
octokit.hook.before("request", beforeRequest$1.bind(null, state));
octokit.hook.error("request", requestError$1.bind(null, state));
}
const VERSION$9 = "1.1.2";
/**
* Some “list” response that can be paginated have a different response structure
*
* They have a `total_count` key in the response (search also has `incomplete_results`,
* /installation/repositories also has `repository_selection`), as well as a key with
* the list of the items which name varies from endpoint to endpoint:
*
* - https://developer.github.com/v3/search/#example (key `items`)
* - https://developer.github.com/v3/checks/runs/#response-3 (key: `check_runs`)
* - https://developer.github.com/v3/checks/suites/#response-1 (key: `check_suites`)
* - https://developer.github.com/v3/apps/installations/#list-repositories (key: `repositories`)
* - https://developer.github.com/v3/apps/installations/#list-installations-for-a-user (key `installations`)
*
* Octokit normalizes these responses so that paginated results are always returned following
* the same structure. One challenge is that if the list response has only one page, no Link
* header is provided, so this header alone is not sufficient to check wether a response is
* paginated or not. For the exceptions with the namespace, a fallback check for the route
* paths has to be added in order to normalize the response. We cannot check for the total_count
* property because it also exists in the response of Get the combined status for a specific ref.
*/
const REGEX = [
/^\/search\//,
/^\/repos\/[^/]+\/[^/]+\/commits\/[^/]+\/(check-runs|check-suites)([^/]|$)/,
/^\/installation\/repositories([^/]|$)/,
/^\/user\/installations([^/]|$)/,
/^\/repos\/[^/]+\/[^/]+\/actions\/secrets([^/]|$)/,
/^\/repos\/[^/]+\/[^/]+\/actions\/workflows(\/[^/]+\/runs)?([^/]|$)/,
/^\/repos\/[^/]+\/[^/]+\/actions\/runs(\/[^/]+\/(artifacts|jobs))?([^/]|$)/
];
function normalizePaginatedListResponse$1(octokit, url, response) {
const path = url.replace(octokit.request.endpoint.DEFAULTS.baseUrl, "");
const responseNeedsNormalization = REGEX.find(regex => regex.test(path));
if (!responseNeedsNormalization)
return;
// keep the additional properties intact as there is currently no other way
// to retrieve the same information.
const incompleteResults = response.data.incomplete_results;
const repositorySelection = response.data.repository_selection;
const totalCount = response.data.total_count;
delete response.data.incomplete_results;
delete response.data.repository_selection;
delete response.data.total_count;
const namespaceKey = Object.keys(response.data)[0];
const data = response.data[namespaceKey];
response.data = data;
if (typeof incompleteResults !== "undefined") {
response.data.incomplete_results = incompleteResults;
}
if (typeof repositorySelection !== "undefined") {
response.data.repository_selection = repositorySelection;
}
response.data.total_count = totalCount;
Object.defineProperty(response.data, namespaceKey, {
get() {
octokit.log.warn(`[@octokit/paginate-rest] "response.data.${namespaceKey}" is deprecated for "GET ${path}". Get the results directly from "response.data"`);
return Array.from(data);
}
});
}
function iterator$1(octokit, route, parameters) {
const options = octokit.request.endpoint(route, parameters);
const method = options.method;
const headers = options.headers;
let url = options.url;
return {
[Symbol.asyncIterator]: () => ({
next() {
if (!url) {
return Promise.resolve({ done: true });
}
return octokit
.request({ method, url, headers })
.then((response) => {
normalizePaginatedListResponse$1(octokit, url, response);
// `response.headers.link` format:
// '<https://api.github.com/users/aseemk/followers?page=2>; rel="next", <https://api.github.com/users/aseemk/followers?page=2>; rel="last"'
// sets `url` to undefined if "next" URL is not present or `link` header is not set
url = ((response.headers.link || "").match(/<([^>]+)>;\s*rel="next"/) || [])[1];
return { value: response };
});
}
})
};
}
function paginate$1(octokit, route, parameters, mapFn) {
if (typeof parameters === "function") {
mapFn = parameters;
parameters = undefined;
}
return gather$1(octokit, [], iterator$1(octokit, route, parameters)[Symbol.asyncIterator](), mapFn);
}
function gather$1(octokit, results, iterator, mapFn) {
return iterator.next().then(result => {
if (result.done) {
return results;
}
let earlyExit = false;
function done() {
earlyExit = true;
}
results = results.concat(mapFn ? mapFn(result.value, done) : result.value.data);
if (earlyExit) {
return results;
}
return gather$1(octokit, results, iterator, mapFn);
});
}
/**
* @param octokit Octokit instance
* @param options Options passed to Octokit constructor
*/
function paginateRest$1(octokit) {
return {
paginate: Object.assign(paginate$1.bind(null, octokit), {
iterator: iterator$1.bind(null, octokit)
})
};
}
paginateRest$1.VERSION = VERSION$9;
var distWeb$8 = /*#__PURE__*/Object.freeze({
__proto__: null,
paginateRest: paginateRest$1
});
var pagination = paginatePlugin;
const { paginateRest: paginateRest$2 } = distWeb$8;
function paginatePlugin(octokit) {
Object.assign(octokit, paginateRest$2(octokit));
}
/**
* lodash (Custom Build) <https://lodash.com/>
* Build: `lodash modularize exports="npm" -o ./`
* Copyright jQuery Foundation and other contributors <https://jquery.org/>
* Released under MIT license <https://lodash.com/license>
* Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
*/
/** Used as the `TypeError` message for "Functions" methods. */
var FUNC_ERROR_TEXT = 'Expected a function';
/** Used to stand-in for `undefined` hash values. */
var HASH_UNDEFINED$1 = '__lodash_hash_undefined__';
/** Used as references for various `Number` constants. */
var INFINITY$1 = 1 / 0;
/** `Object#toString` result references. */
var funcTag$1 = '[object Function]',
genTag$1 = '[object GeneratorFunction]',
symbolTag = '[object Symbol]';
/** Used to match property names within property paths. */
var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
reIsPlainProp = /^\w*$/,
reLeadingDot = /^\./,
rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
/**
* Used to match `RegExp`
* [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
*/
var reRegExpChar$1 = /[\\^$.*+?()[\]{}|]/g;
/** Used to match backslashes in property paths. */
var reEscapeChar = /\\(\\)?/g;
/** Used to detect host constructors (Safari). */
var reIsHostCtor$1 = /^\[object .+?Constructor\]$/;
/** Detect free variable `global` from Node.js. */
var freeGlobal$1 = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal;
/** Detect free variable `self`. */
var freeSelf$1 = typeof self == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */
var root$1 = freeGlobal$1 || freeSelf$1 || Function('return this')();
/**
* Gets the value at `key` of `object`.
*
* @private
* @param {Object} [object] The object to query.
* @param {string} key The key of the property to get.
* @returns {*} Returns the property value.
*/
function getValue$1(object, key) {
return object == null ? undefined : object[key];
}
/**
* Checks if `value` is a host object in IE < 9.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a host object, else `false`.
*/
function isHostObject$1(value) {
// Many host objects are `Object` objects that can coerce to strings
// despite having improperly defined `toString` methods.
var result = false;
if (value != null && typeof value.toString != 'function') {
try {
result = !!(value + '');
} catch (e) {}
}
return result;
}
/** Used for built-in method references. */
var arrayProto$1 = Array.prototype,
funcProto$1 = Function.prototype,
objectProto$1 = Object.prototype;
/** Used to detect overreaching core-js shims. */
var coreJsData$1 = root$1['__core-js_shared__'];
/** Used to detect methods masquerading as native. */
var maskSrcKey$1 = (function() {
var uid = /[^.]+$/.exec(coreJsData$1 && coreJsData$1.keys && coreJsData$1.keys.IE_PROTO || '');
return uid ? ('Symbol(src)_1.' + uid) : '';
}());
/** Used to resolve the decompiled source of functions. */
var funcToString$1 = funcProto$1.toString;
/** Used to check objects for own properties. */
var hasOwnProperty$1 = objectProto$1.hasOwnProperty;
/**
* Used to resolve the
* [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
* of values.
*/
var objectToString$1 = objectProto$1.toString;
/** Used to detect if a method is native. */
var reIsNative$1 = RegExp('^' +
funcToString$1.call(hasOwnProperty$1).replace(reRegExpChar$1, '\\$&')
.replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
);
/** Built-in value references. */
var Symbol$1 = root$1.Symbol,
splice$1 = arrayProto$1.splice;
/* Built-in method references that are verified to be native. */
var Map$2 = getNative$1(root$1, 'Map'),
nativeCreate$1 = getNative$1(Object, 'create');
/** Used to convert symbols to primitives and strings. */
var symbolProto = Symbol$1 ? Symbol$1.prototype : undefined,
symbolToString = symbolProto ? symbolProto.toString : undefined;
/**
* Creates a hash object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Hash$1(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the hash.
*
* @private
* @name clear
* @memberOf Hash
*/
function hashClear$1() {
this.__data__ = nativeCreate$1 ? nativeCreate$1(null) : {};
}
/**
* Removes `key` and its value from the hash.
*
* @private
* @name delete
* @memberOf Hash
* @param {Object} hash The hash to modify.
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function hashDelete$1(key) {
return this.has(key) && delete this.__data__[key];
}
/**
* Gets the hash value for `key`.
*
* @private
* @name get
* @memberOf Hash
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function hashGet$1(key) {
var data = this.__data__;
if (nativeCreate$1) {
var result = data[key];
return result === HASH_UNDEFINED$1 ? undefined : result;
}
return hasOwnProperty$1.call(data, key) ? data[key] : undefined;
}
/**
* Checks if a hash value for `key` exists.
*
* @private
* @name has
* @memberOf Hash
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function hashHas$1(key) {
var data = this.__data__;
return nativeCreate$1 ? data[key] !== undefined : hasOwnProperty$1.call(data, key);
}
/**
* Sets the hash `key` to `value`.
*
* @private
* @name set
* @memberOf Hash
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the hash instance.
*/
function hashSet$1(key, value) {
var data = this.__data__;
data[key] = (nativeCreate$1 && value === undefined) ? HASH_UNDEFINED$1 : value;
return this;
}
// Add methods to `Hash`.
Hash$1.prototype.clear = hashClear$1;
Hash$1.prototype['delete'] = hashDelete$1;
Hash$1.prototype.get = hashGet$1;
Hash$1.prototype.has = hashHas$1;
Hash$1.prototype.set = hashSet$1;
/**
* Creates an list cache object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function ListCache$1(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the list cache.
*
* @private
* @name clear
* @memberOf ListCache
*/
function listCacheClear$1() {
this.__data__ = [];
}
/**
* Removes `key` and its value from the list cache.
*
* @private
* @name delete
* @memberOf ListCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function listCacheDelete$1(key) {
var data = this.__data__,
index = assocIndexOf$1(data, key);
if (index < 0) {
return false;
}
var lastIndex = data.length - 1;
if (index == lastIndex) {
data.pop();
} else {
splice$1.call(data, index, 1);
}
return true;
}
/**
* Gets the list cache value for `key`.
*
* @private
* @name get
* @memberOf ListCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function listCacheGet$1(key) {
var data = this.__data__,
index = assocIndexOf$1(data, key);
return index < 0 ? undefined : data[index][1];
}
/**
* Checks if a list cache value for `key` exists.
*
* @private
* @name has
* @memberOf ListCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function listCacheHas$1(key) {
return assocIndexOf$1(this.__data__, key) > -1;
}
/**
* Sets the list cache `key` to `value`.
*
* @private
* @name set
* @memberOf ListCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the list cache instance.
*/
function listCacheSet$1(key, value) {
var data = this.__data__,
index = assocIndexOf$1(data, key);
if (index < 0) {
data.push([key, value]);
} else {
data[index][1] = value;
}
return this;
}
// Add methods to `ListCache`.
ListCache$1.prototype.clear = listCacheClear$1;
ListCache$1.prototype['delete'] = listCacheDelete$1;
ListCache$1.prototype.get = listCacheGet$1;
ListCache$1.prototype.has = listCacheHas$1;
ListCache$1.prototype.set = listCacheSet$1;
/**
* Creates a map cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function MapCache$1(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the map.
*
* @private
* @name clear
* @memberOf MapCache
*/
function mapCacheClear$1() {
this.__data__ = {
'hash': new Hash$1,
'map': new (Map$2 || ListCache$1),
'string': new Hash$1
};
}
/**
* Removes `key` and its value from the map.
*
* @private
* @name delete
* @memberOf MapCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function mapCacheDelete$1(key) {
return getMapData$1(this, key)['delete'](key);
}
/**
* Gets the map value for `key`.
*
* @private
* @name get
* @memberOf MapCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function mapCacheGet$1(key) {
return getMapData$1(this, key).get(key);
}
/**
* Checks if a map value for `key` exists.
*
* @private
* @name has
* @memberOf MapCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function mapCacheHas$1(key) {
return getMapData$1(this, key).has(key);
}
/**
* Sets the map `key` to `value`.
*
* @private
* @name set
* @memberOf MapCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the map cache instance.
*/
function mapCacheSet$1(key, value) {
getMapData$1(this, key).set(key, value);
return this;
}
// Add methods to `MapCache`.
MapCache$1.prototype.clear = mapCacheClear$1;
MapCache$1.prototype['delete'] = mapCacheDelete$1;
MapCache$1.prototype.get = mapCacheGet$1;
MapCache$1.prototype.has = mapCacheHas$1;
MapCache$1.prototype.set = mapCacheSet$1;
/**
* Gets the index at which the `key` is found in `array` of key-value pairs.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} key The key to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function assocIndexOf$1(array, key) {
var length = array.length;
while (length--) {
if (eq$1(array[length][0], key)) {
return length;
}
}
return -1;
}
/**
* The base implementation of `_.get` without support for default values.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to get.
* @returns {*} Returns the resolved value.
*/
function baseGet(object, path) {
path = isKey(path, object) ? [path] : castPath(path);
var index = 0,
length = path.length;
while (object != null && index < length) {
object = object[toKey(path[index++])];
}
return (index && index == length) ? object : undefined;
}
/**
* The base implementation of `_.isNative` without bad shim checks.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
*/
function baseIsNative$1(value) {
if (!isObject$2(value) || isMasked$1(value)) {
return false;
}
var pattern = (isFunction$1(value) || isHostObject$1(value)) ? reIsNative$1 : reIsHostCtor$1;
return pattern.test(toSource$1(value));
}
/**
* The base implementation of `_.toString` which doesn't convert nullish
* values to empty strings.
*
* @private
* @param {*} value The value to process.
* @returns {string} Returns the string.
*/
function baseToString(value) {
// Exit early for strings to avoid a performance hit in some environments.
if (typeof value == 'string') {
return value;
}
if (isSymbol(value)) {
return symbolToString ? symbolToString.call(value) : '';
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY$1) ? '-0' : result;
}
/**
* Casts `value` to a path array if it's not one.
*
* @private
* @param {*} value The value to inspect.
* @returns {Array} Returns the cast property path array.
*/
function castPath(value) {
return isArray(value) ? value : stringToPath(value);
}
/**
* Gets the data for `map`.
*
* @private
* @param {Object} map The map to query.
* @param {string} key The reference key.
* @returns {*} Returns the map data.
*/
function getMapData$1(map, key) {
var data = map.__data__;
return isKeyable$1(key)
? data[typeof key == 'string' ? 'string' : 'hash']
: data.map;
}
/**
* Gets the native function at `key` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {string} key The key of the method to get.
* @returns {*} Returns the function if it's native, else `undefined`.
*/
function getNative$1(object, key) {
var value = getValue$1(object, key);
return baseIsNative$1(value) ? value : undefined;
}
/**
* Checks if `value` is a property name and not a property path.
*
* @private
* @param {*} value The value to check.
* @param {Object} [object] The object to query keys on.
* @returns {boolean} Returns `true` if `value` is a property name, else `false`.
*/
function isKey(value, object) {
if (isArray(value)) {
return false;
}
var type = typeof value;
if (type == 'number' || type == 'symbol' || type == 'boolean' ||
value == null || isSymbol(value)) {
return true;
}
return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
(object != null && value in Object(object));
}
/**
* Checks if `value` is suitable for use as unique object key.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is suitable, else `false`.
*/
function isKeyable$1(value) {
var type = typeof value;
return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
? (value !== '__proto__')
: (value === null);
}
/**
* Checks if `func` has its source masked.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` is masked, else `false`.
*/
function isMasked$1(func) {
return !!maskSrcKey$1 && (maskSrcKey$1 in func);
}
/**
* Converts `string` to a property path array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the property path array.
*/
var stringToPath = memoize(function(string) {
string = toString$1(string);
var result = [];
if (reLeadingDot.test(string)) {
result.push('');
}
string.replace(rePropName, function(match, number, quote, string) {
result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match));
});
return result;
});
/**
* Converts `value` to a string key if it's not a string or symbol.
*
* @private
* @param {*} value The value to inspect.
* @returns {string|symbol} Returns the key.
*/
function toKey(value) {
if (typeof value == 'string' || isSymbol(value)) {
return value;
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY$1) ? '-0' : result;
}
/**
* Converts `func` to its source code.
*
* @private
* @param {Function} func The function to process.
* @returns {string} Returns the source code.
*/
function toSource$1(func) {
if (func != null) {
try {
return funcToString$1.call(func);
} catch (e) {}
try {
return (func + '');
} catch (e) {}
}
return '';
}
/**
* Creates a function that memoizes the result of `func`. If `resolver` is
* provided, it determines the cache key for storing the result based on the
* arguments provided to the memoized function. By default, the first argument
* provided to the memoized function is used as the map cache key. The `func`
* is invoked with the `this` binding of the memoized function.
*
* **Note:** The cache is exposed as the `cache` property on the memoized
* function. Its creation may be customized by replacing the `_.memoize.Cache`
* constructor with one whose instances implement the
* [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
* method interface of `delete`, `get`, `has`, and `set`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to have its output memoized.
* @param {Function} [resolver] The function to resolve the cache key.
* @returns {Function} Returns the new memoized function.
* @example
*
* var object = { 'a': 1, 'b': 2 };
* var other = { 'c': 3, 'd': 4 };
*
* var values = _.memoize(_.values);
* values(object);
* // => [1, 2]
*
* values(other);
* // => [3, 4]
*
* object.a = 2;
* values(object);
* // => [1, 2]
*
* // Modify the result cache.
* values.cache.set(object, ['a', 'b']);
* values(object);
* // => ['a', 'b']
*
* // Replace `_.memoize.Cache`.
* _.memoize.Cache = WeakMap;
*/
function memoize(func, resolver) {
if (typeof func != 'function' || (resolver && typeof resolver != 'function')) {
throw new TypeError(FUNC_ERROR_TEXT);
}
var memoized = function() {
var args = arguments,
key = resolver ? resolver.apply(this, args) : args[0],
cache = memoized.cache;
if (cache.has(key)) {
return cache.get(key);
}
var result = func.apply(this, args);
memoized.cache = cache.set(key, result);
return result;
};
memoized.cache = new (memoize.Cache || MapCache$1);
return memoized;
}
// Assign cache to `_.memoize`.
memoize.Cache = MapCache$1;
/**
* Performs a
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* comparison between two values to determine if they are equivalent.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.eq(object, object);
* // => true
*
* _.eq(object, other);
* // => false
*
* _.eq('a', 'a');
* // => true
*
* _.eq('a', Object('a'));
* // => false
*
* _.eq(NaN, NaN);
* // => true
*/
function eq$1(value, other) {
return value === other || (value !== value && other !== other);
}
/**
* Checks if `value` is classified as an `Array` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array, else `false`.
* @example
*
* _.isArray([1, 2, 3]);
* // => true
*
* _.isArray(document.body.children);
* // => false
*
* _.isArray('abc');
* // => false
*
* _.isArray(_.noop);
* // => false
*/
var isArray = Array.isArray;
/**
* Checks if `value` is classified as a `Function` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
* @example
*
* _.isFunction(_);
* // => true
*
* _.isFunction(/abc/);
* // => false
*/
function isFunction$1(value) {
// The use of `Object#toString` avoids issues with the `typeof` operator
// in Safari 8-9 which returns 'object' for typed array and other constructors.
var tag = isObject$2(value) ? objectToString$1.call(value) : '';
return tag == funcTag$1 || tag == genTag$1;
}
/**
* Checks if `value` is the
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
* @example
*
* _.isObject({});
* // => true
*
* _.isObject([1, 2, 3]);
* // => true
*
* _.isObject(_.noop);
* // => true
*
* _.isObject(null);
* // => false
*/
function isObject$2(value) {
var type = typeof value;
return !!value && (type == 'object' || type == 'function');
}
/**
* Checks if `value` is object-like. A value is object-like if it's not `null`
* and has a `typeof` result of "object".
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is object-like, else `false`.
* @example
*
* _.isObjectLike({});
* // => true
*
* _.isObjectLike([1, 2, 3]);
* // => true
*
* _.isObjectLike(_.noop);
* // => false
*
* _.isObjectLike(null);
* // => false
*/
function isObjectLike(value) {
return !!value && typeof value == 'object';
}
/**
* Checks if `value` is classified as a `Symbol` primitive or object.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
* @example
*
* _.isSymbol(Symbol.iterator);
* // => true
*
* _.isSymbol('abc');
* // => false
*/
function isSymbol(value) {
return typeof value == 'symbol' ||
(isObjectLike(value) && objectToString$1.call(value) == symbolTag);
}
/**
* Converts `value` to a string. An empty string is returned for `null`
* and `undefined` values. The sign of `-0` is preserved.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to process.
* @returns {string} Returns the string.
* @example
*
* _.toString(null);
* // => ''
*
* _.toString(-0);
* // => '-0'
*
* _.toString([1, 2, 3]);
* // => '1,2,3'
*/
function toString$1(value) {
return value == null ? '' : baseToString(value);
}
/**
* Gets the value at `path` of `object`. If the resolved value is
* `undefined`, the `defaultValue` is returned in its place.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to get.
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
* @returns {*} Returns the resolved value.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.get(object, 'a[0].b.c');
* // => 3
*
* _.get(object, ['a', '0', 'b', 'c']);
* // => 3
*
* _.get(object, 'a.b.c', 'default');
* // => 'default'
*/
function get(object, path, defaultValue) {
var result = object == null ? undefined : baseGet(object, path);
return result === undefined ? defaultValue : result;
}
var lodash_get = get;
/**
* lodash (Custom Build) <https://lodash.com/>
* Build: `lodash modularize exports="npm" -o ./`
* Copyright jQuery Foundation and other contributors <https://jquery.org/>
* Released under MIT license <https://lodash.com/license>
* Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
*/
/** Used as the `TypeError` message for "Functions" methods. */
var FUNC_ERROR_TEXT$1 = 'Expected a function';
/** Used to stand-in for `undefined` hash values. */
var HASH_UNDEFINED$2 = '__lodash_hash_undefined__';
/** Used as references for various `Number` constants. */
var INFINITY$2 = 1 / 0,
MAX_SAFE_INTEGER = 9007199254740991;
/** `Object#toString` result references. */
var funcTag$2 = '[object Function]',
genTag$2 = '[object GeneratorFunction]',
symbolTag$1 = '[object Symbol]';
/** Used to match property names within property paths. */
var reIsDeepProp$1 = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
reIsPlainProp$1 = /^\w*$/,
reLeadingDot$1 = /^\./,
rePropName$1 = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
/**
* Used to match `RegExp`
* [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
*/
var reRegExpChar$2 = /[\\^$.*+?()[\]{}|]/g;
/** Used to match backslashes in property paths. */
var reEscapeChar$1 = /\\(\\)?/g;
/** Used to detect host constructors (Safari). */
var reIsHostCtor$2 = /^\[object .+?Constructor\]$/;
/** Used to detect unsigned integer values. */
var reIsUint = /^(?:0|[1-9]\d*)$/;
/** Detect free variable `global` from Node.js. */
var freeGlobal$2 = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal;
/** Detect free variable `self`. */
var freeSelf$2 = typeof self == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */
var root$2 = freeGlobal$2 || freeSelf$2 || Function('return this')();
/**
* Gets the value at `key` of `object`.
*
* @private
* @param {Object} [object] The object to query.
* @param {string} key The key of the property to get.
* @returns {*} Returns the property value.
*/
function getValue$2(object, key) {
return object == null ? undefined : object[key];
}
/**
* Checks if `value` is a host object in IE < 9.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a host object, else `false`.
*/
function isHostObject$2(value) {
// Many host objects are `Object` objects that can coerce to strings
// despite having improperly defined `toString` methods.
var result = false;
if (value != null && typeof value.toString != 'function') {
try {
result = !!(value + '');
} catch (e) {}
}
return result;
}
/** Used for built-in method references. */
var arrayProto$2 = Array.prototype,
funcProto$2 = Function.prototype,
objectProto$2 = Object.prototype;
/** Used to detect overreaching core-js shims. */
var coreJsData$2 = root$2['__core-js_shared__'];
/** Used to detect methods masquerading as native. */
var maskSrcKey$2 = (function() {
var uid = /[^.]+$/.exec(coreJsData$2 && coreJsData$2.keys && coreJsData$2.keys.IE_PROTO || '');
return uid ? ('Symbol(src)_1.' + uid) : '';
}());
/** Used to resolve the decompiled source of functions. */
var funcToString$2 = funcProto$2.toString;
/** Used to check objects for own properties. */
var hasOwnProperty$2 = objectProto$2.hasOwnProperty;
/**
* Used to resolve the
* [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
* of values.
*/
var objectToString$2 = objectProto$2.toString;
/** Used to detect if a method is native. */
var reIsNative$2 = RegExp('^' +
funcToString$2.call(hasOwnProperty$2).replace(reRegExpChar$2, '\\$&')
.replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
);
/** Built-in value references. */
var Symbol$2 = root$2.Symbol,
splice$2 = arrayProto$2.splice;
/* Built-in method references that are verified to be native. */
var Map$3 = getNative$2(root$2, 'Map'),
nativeCreate$2 = getNative$2(Object, 'create');
/** Used to convert symbols to primitives and strings. */
var symbolProto$1 = Symbol$2 ? Symbol$2.prototype : undefined,
symbolToString$1 = symbolProto$1 ? symbolProto$1.toString : undefined;
/**
* Creates a hash object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Hash$2(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the hash.
*
* @private
* @name clear
* @memberOf Hash
*/
function hashClear$2() {
this.__data__ = nativeCreate$2 ? nativeCreate$2(null) : {};
}
/**
* Removes `key` and its value from the hash.
*
* @private
* @name delete
* @memberOf Hash
* @param {Object} hash The hash to modify.
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function hashDelete$2(key) {
return this.has(key) && delete this.__data__[key];
}
/**
* Gets the hash value for `key`.
*
* @private
* @name get
* @memberOf Hash
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function hashGet$2(key) {
var data = this.__data__;
if (nativeCreate$2) {
var result = data[key];
return result === HASH_UNDEFINED$2 ? undefined : result;
}
return hasOwnProperty$2.call(data, key) ? data[key] : undefined;
}
/**
* Checks if a hash value for `key` exists.
*
* @private
* @name has
* @memberOf Hash
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function hashHas$2(key) {
var data = this.__data__;
return nativeCreate$2 ? data[key] !== undefined : hasOwnProperty$2.call(data, key);
}
/**
* Sets the hash `key` to `value`.
*
* @private
* @name set
* @memberOf Hash
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the hash instance.
*/
function hashSet$2(key, value) {
var data = this.__data__;
data[key] = (nativeCreate$2 && value === undefined) ? HASH_UNDEFINED$2 : value;
return this;
}
// Add methods to `Hash`.
Hash$2.prototype.clear = hashClear$2;
Hash$2.prototype['delete'] = hashDelete$2;
Hash$2.prototype.get = hashGet$2;
Hash$2.prototype.has = hashHas$2;
Hash$2.prototype.set = hashSet$2;
/**
* Creates an list cache object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function ListCache$2(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the list cache.
*
* @private
* @name clear
* @memberOf ListCache
*/
function listCacheClear$2() {
this.__data__ = [];
}
/**
* Removes `key` and its value from the list cache.
*
* @private
* @name delete
* @memberOf ListCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function listCacheDelete$2(key) {
var data = this.__data__,
index = assocIndexOf$2(data, key);
if (index < 0) {
return false;
}
var lastIndex = data.length - 1;
if (index == lastIndex) {
data.pop();
} else {
splice$2.call(data, index, 1);
}
return true;
}
/**
* Gets the list cache value for `key`.
*
* @private
* @name get
* @memberOf ListCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function listCacheGet$2(key) {
var data = this.__data__,
index = assocIndexOf$2(data, key);
return index < 0 ? undefined : data[index][1];
}
/**
* Checks if a list cache value for `key` exists.
*
* @private
* @name has
* @memberOf ListCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function listCacheHas$2(key) {
return assocIndexOf$2(this.__data__, key) > -1;
}
/**
* Sets the list cache `key` to `value`.
*
* @private
* @name set
* @memberOf ListCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the list cache instance.
*/
function listCacheSet$2(key, value) {
var data = this.__data__,
index = assocIndexOf$2(data, key);
if (index < 0) {
data.push([key, value]);
} else {
data[index][1] = value;
}
return this;
}
// Add methods to `ListCache`.
ListCache$2.prototype.clear = listCacheClear$2;
ListCache$2.prototype['delete'] = listCacheDelete$2;
ListCache$2.prototype.get = listCacheGet$2;
ListCache$2.prototype.has = listCacheHas$2;
ListCache$2.prototype.set = listCacheSet$2;
/**
* Creates a map cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function MapCache$2(entries) {
var index = -1,
length = entries ? entries.length : 0;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the map.
*
* @private
* @name clear
* @memberOf MapCache
*/
function mapCacheClear$2() {
this.__data__ = {
'hash': new Hash$2,
'map': new (Map$3 || ListCache$2),
'string': new Hash$2
};
}
/**
* Removes `key` and its value from the map.
*
* @private
* @name delete
* @memberOf MapCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function mapCacheDelete$2(key) {
return getMapData$2(this, key)['delete'](key);
}
/**
* Gets the map value for `key`.
*
* @private
* @name get
* @memberOf MapCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function mapCacheGet$2(key) {
return getMapData$2(this, key).get(key);
}
/**
* Checks if a map value for `key` exists.
*
* @private
* @name has
* @memberOf MapCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function mapCacheHas$2(key) {
return getMapData$2(this, key).has(key);
}
/**
* Sets the map `key` to `value`.
*
* @private
* @name set
* @memberOf MapCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the map cache instance.
*/
function mapCacheSet$2(key, value) {
getMapData$2(this, key).set(key, value);
return this;
}
// Add methods to `MapCache`.
MapCache$2.prototype.clear = mapCacheClear$2;
MapCache$2.prototype['delete'] = mapCacheDelete$2;
MapCache$2.prototype.get = mapCacheGet$2;
MapCache$2.prototype.has = mapCacheHas$2;
MapCache$2.prototype.set = mapCacheSet$2;
/**
* Assigns `value` to `key` of `object` if the existing value is not equivalent
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function assignValue(object, key, value) {
var objValue = object[key];
if (!(hasOwnProperty$2.call(object, key) && eq$2(objValue, value)) ||
(value === undefined && !(key in object))) {
object[key] = value;
}
}
/**
* Gets the index at which the `key` is found in `array` of key-value pairs.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} key The key to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function assocIndexOf$2(array, key) {
var length = array.length;
while (length--) {
if (eq$2(array[length][0], key)) {
return length;
}
}
return -1;
}
/**
* The base implementation of `_.isNative` without bad shim checks.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
*/
function baseIsNative$2(value) {
if (!isObject$3(value) || isMasked$2(value)) {
return false;
}
var pattern = (isFunction$2(value) || isHostObject$2(value)) ? reIsNative$2 : reIsHostCtor$2;
return pattern.test(toSource$2(value));
}
/**
* The base implementation of `_.set`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @param {Function} [customizer] The function to customize path creation.
* @returns {Object} Returns `object`.
*/
function baseSet(object, path, value, customizer) {
if (!isObject$3(object)) {
return object;
}
path = isKey$1(path, object) ? [path] : castPath$1(path);
var index = -1,
length = path.length,
lastIndex = length - 1,
nested = object;
while (nested != null && ++index < length) {
var key = toKey$1(path[index]),
newValue = value;
if (index != lastIndex) {
var objValue = nested[key];
newValue = customizer ? customizer(objValue, key, nested) : undefined;
if (newValue === undefined) {
newValue = isObject$3(objValue)
? objValue
: (isIndex(path[index + 1]) ? [] : {});
}
}
assignValue(nested, key, newValue);
nested = nested[key];
}
return object;
}
/**
* The base implementation of `_.toString` which doesn't convert nullish
* values to empty strings.
*
* @private
* @param {*} value The value to process.
* @returns {string} Returns the string.
*/
function baseToString$1(value) {
// Exit early for strings to avoid a performance hit in some environments.
if (typeof value == 'string') {
return value;
}
if (isSymbol$1(value)) {
return symbolToString$1 ? symbolToString$1.call(value) : '';
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY$2) ? '-0' : result;
}
/**
* Casts `value` to a path array if it's not one.
*
* @private
* @param {*} value The value to inspect.
* @returns {Array} Returns the cast property path array.
*/
function castPath$1(value) {
return isArray$1(value) ? value : stringToPath$1(value);
}
/**
* Gets the data for `map`.
*
* @private
* @param {Object} map The map to query.
* @param {string} key The reference key.
* @returns {*} Returns the map data.
*/
function getMapData$2(map, key) {
var data = map.__data__;
return isKeyable$2(key)
? data[typeof key == 'string' ? 'string' : 'hash']
: data.map;
}
/**
* Gets the native function at `key` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {string} key The key of the method to get.
* @returns {*} Returns the function if it's native, else `undefined`.
*/
function getNative$2(object, key) {
var value = getValue$2(object, key);
return baseIsNative$2(value) ? value : undefined;
}
/**
* Checks if `value` is a valid array-like index.
*
* @private
* @param {*} value The value to check.
* @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
* @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
*/
function isIndex(value, length) {
length = length == null ? MAX_SAFE_INTEGER : length;
return !!length &&
(typeof value == 'number' || reIsUint.test(value)) &&
(value > -1 && value % 1 == 0 && value < length);
}
/**
* Checks if `value` is a property name and not a property path.
*
* @private
* @param {*} value The value to check.
* @param {Object} [object] The object to query keys on.
* @returns {boolean} Returns `true` if `value` is a property name, else `false`.
*/
function isKey$1(value, object) {
if (isArray$1(value)) {
return false;
}
var type = typeof value;
if (type == 'number' || type == 'symbol' || type == 'boolean' ||
value == null || isSymbol$1(value)) {
return true;
}
return reIsPlainProp$1.test(value) || !reIsDeepProp$1.test(value) ||
(object != null && value in Object(object));
}
/**
* Checks if `value` is suitable for use as unique object key.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is suitable, else `false`.
*/
function isKeyable$2(value) {
var type = typeof value;
return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
? (value !== '__proto__')
: (value === null);
}
/**
* Checks if `func` has its source masked.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` is masked, else `false`.
*/
function isMasked$2(func) {
return !!maskSrcKey$2 && (maskSrcKey$2 in func);
}
/**
* Converts `string` to a property path array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the property path array.
*/
var stringToPath$1 = memoize$1(function(string) {
string = toString$2(string);
var result = [];
if (reLeadingDot$1.test(string)) {
result.push('');
}
string.replace(rePropName$1, function(match, number, quote, string) {
result.push(quote ? string.replace(reEscapeChar$1, '$1') : (number || match));
});
return result;
});
/**
* Converts `value` to a string key if it's not a string or symbol.
*
* @private
* @param {*} value The value to inspect.
* @returns {string|symbol} Returns the key.
*/
function toKey$1(value) {
if (typeof value == 'string' || isSymbol$1(value)) {
return value;
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY$2) ? '-0' : result;
}
/**
* Converts `func` to its source code.
*
* @private
* @param {Function} func The function to process.
* @returns {string} Returns the source code.
*/
function toSource$2(func) {
if (func != null) {
try {
return funcToString$2.call(func);
} catch (e) {}
try {
return (func + '');
} catch (e) {}
}
return '';
}
/**
* Creates a function that memoizes the result of `func`. If `resolver` is
* provided, it determines the cache key for storing the result based on the
* arguments provided to the memoized function. By default, the first argument
* provided to the memoized function is used as the map cache key. The `func`
* is invoked with the `this` binding of the memoized function.
*
* **Note:** The cache is exposed as the `cache` property on the memoized
* function. Its creation may be customized by replacing the `_.memoize.Cache`
* constructor with one whose instances implement the
* [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
* method interface of `delete`, `get`, `has`, and `set`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to have its output memoized.
* @param {Function} [resolver] The function to resolve the cache key.
* @returns {Function} Returns the new memoized function.
* @example
*
* var object = { 'a': 1, 'b': 2 };
* var other = { 'c': 3, 'd': 4 };
*
* var values = _.memoize(_.values);
* values(object);
* // => [1, 2]
*
* values(other);
* // => [3, 4]
*
* object.a = 2;
* values(object);
* // => [1, 2]
*
* // Modify the result cache.
* values.cache.set(object, ['a', 'b']);
* values(object);
* // => ['a', 'b']
*
* // Replace `_.memoize.Cache`.
* _.memoize.Cache = WeakMap;
*/
function memoize$1(func, resolver) {
if (typeof func != 'function' || (resolver && typeof resolver != 'function')) {
throw new TypeError(FUNC_ERROR_TEXT$1);
}
var memoized = function() {
var args = arguments,
key = resolver ? resolver.apply(this, args) : args[0],
cache = memoized.cache;
if (cache.has(key)) {
return cache.get(key);
}
var result = func.apply(this, args);
memoized.cache = cache.set(key, result);
return result;
};
memoized.cache = new (memoize$1.Cache || MapCache$2);
return memoized;
}
// Assign cache to `_.memoize`.
memoize$1.Cache = MapCache$2;
/**
* Performs a
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* comparison between two values to determine if they are equivalent.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.eq(object, object);
* // => true
*
* _.eq(object, other);
* // => false
*
* _.eq('a', 'a');
* // => true
*
* _.eq('a', Object('a'));
* // => false
*
* _.eq(NaN, NaN);
* // => true
*/
function eq$2(value, other) {
return value === other || (value !== value && other !== other);
}
/**
* Checks if `value` is classified as an `Array` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array, else `false`.
* @example
*
* _.isArray([1, 2, 3]);
* // => true
*
* _.isArray(document.body.children);
* // => false
*
* _.isArray('abc');
* // => false
*
* _.isArray(_.noop);
* // => false
*/
var isArray$1 = Array.isArray;
/**
* Checks if `value` is classified as a `Function` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
* @example
*
* _.isFunction(_);
* // => true
*
* _.isFunction(/abc/);
* // => false
*/
function isFunction$2(value) {
// The use of `Object#toString` avoids issues with the `typeof` operator
// in Safari 8-9 which returns 'object' for typed array and other constructors.
var tag = isObject$3(value) ? objectToString$2.call(value) : '';
return tag == funcTag$2 || tag == genTag$2;
}
/**
* Checks if `value` is the
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
* @example
*
* _.isObject({});
* // => true
*
* _.isObject([1, 2, 3]);
* // => true
*
* _.isObject(_.noop);
* // => true
*
* _.isObject(null);
* // => false
*/
function isObject$3(value) {
var type = typeof value;
return !!value && (type == 'object' || type == 'function');
}
/**
* Checks if `value` is object-like. A value is object-like if it's not `null`
* and has a `typeof` result of "object".
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is object-like, else `false`.
* @example
*
* _.isObjectLike({});
* // => true
*
* _.isObjectLike([1, 2, 3]);
* // => true
*
* _.isObjectLike(_.noop);
* // => false
*
* _.isObjectLike(null);
* // => false
*/
function isObjectLike$1(value) {
return !!value && typeof value == 'object';
}
/**
* Checks if `value` is classified as a `Symbol` primitive or object.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
* @example
*
* _.isSymbol(Symbol.iterator);
* // => true
*
* _.isSymbol('abc');
* // => false
*/
function isSymbol$1(value) {
return typeof value == 'symbol' ||
(isObjectLike$1(value) && objectToString$2.call(value) == symbolTag$1);
}
/**
* Converts `value` to a string. An empty string is returned for `null`
* and `undefined` values. The sign of `-0` is preserved.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to process.
* @returns {string} Returns the string.
* @example
*
* _.toString(null);
* // => ''
*
* _.toString(-0);
* // => '-0'
*
* _.toString([1, 2, 3]);
* // => '1,2,3'
*/
function toString$2(value) {
return value == null ? '' : baseToString$1(value);
}
/**
* Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
* it's created. Arrays are created for missing index properties while objects
* are created for all other missing properties. Use `_.setWith` to customize
* `path` creation.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @returns {Object} Returns `object`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.set(object, 'a[0].b.c', 4);
* console.log(object.a[0].b.c);
* // => 4
*
* _.set(object, ['x', '0', 'y', 'z'], 5);
* console.log(object.x[0].y.z);
* // => 5
*/
function set(object, path, value) {
return object == null ? object : baseSet(object, path, value);
}
var lodash_set = set;
var validate_1 = validate$1;
const { RequestError: RequestError$4 } = distWeb$7;
function validate$1(octokit, options) {
if (!options.request.validate) {
return;
}
const { validate: params } = options.request;
Object.keys(params).forEach(parameterName => {
const parameter = lodash_get(params, parameterName);
const expectedType = parameter.type;
let parentParameterName;
let parentValue;
let parentParamIsPresent = true;
let parentParameterIsArray = false;
if (/\./.test(parameterName)) {
parentParameterName = parameterName.replace(/\.[^.]+$/, "");
parentParameterIsArray = parentParameterName.slice(-2) === "[]";
if (parentParameterIsArray) {
parentParameterName = parentParameterName.slice(0, -2);
}
parentValue = lodash_get(options, parentParameterName);
parentParamIsPresent =
parentParameterName === "headers" ||
(typeof parentValue === "object" && parentValue !== null);
}
const values = parentParameterIsArray
? (lodash_get(options, parentParameterName) || []).map(
value => value[parameterName.split(/\./).pop()]
)
: [lodash_get(options, parameterName)];
values.forEach((value, i) => {
const valueIsPresent = typeof value !== "undefined";
const valueIsNull = value === null;
const currentParameterName = parentParameterIsArray
? parameterName.replace(/\[\]/, `[${i}]`)
: parameterName;
if (!parameter.required && !valueIsPresent) {
return;
}
// if the parent parameter is of type object but allows null
// then the child parameters can be ignored
if (!parentParamIsPresent) {
return;
}
if (parameter.allowNull && valueIsNull) {
return;
}
if (!parameter.allowNull && valueIsNull) {
throw new RequestError$4(
`'${currentParameterName}' cannot be null`,
400,
{
request: options
}
);
}
if (parameter.required && !valueIsPresent) {
throw new RequestError$4(
`Empty value for parameter '${currentParameterName}': ${JSON.stringify(
value
)}`,
400,
{
request: options
}
);
}
// parse to integer before checking for enum
// so that string "1" will match enum with number 1
if (expectedType === "integer") {
const unparsedValue = value;
value = parseInt(value, 10);
if (isNaN(value)) {
throw new RequestError$4(
`Invalid value for parameter '${currentParameterName}': ${JSON.stringify(
unparsedValue
)} is NaN`,
400,
{
request: options
}
);
}
}
if (parameter.enum && parameter.enum.indexOf(String(value)) === -1) {
throw new RequestError$4(
`Invalid value for parameter '${currentParameterName}': ${JSON.stringify(
value
)}`,
400,
{
request: options
}
);
}
if (parameter.validation) {
const regex = new RegExp(parameter.validation);
if (!regex.test(value)) {
throw new RequestError$4(
`Invalid value for parameter '${currentParameterName}': ${JSON.stringify(
value
)}`,
400,
{
request: options
}
);
}
}
if (expectedType === "object" && typeof value === "string") {
try {
value = JSON.parse(value);
} catch (exception) {
throw new RequestError$4(
`JSON parse error of value for parameter '${currentParameterName}': ${JSON.stringify(
value
)}`,
400,
{
request: options
}
);
}
}
lodash_set(options, parameter.mapTo || currentParameterName, value);
});
});
return options;
}
var validate_1$1 = octokitValidate;
function octokitValidate(octokit) {
octokit.hook.before("request", validate_1.bind(null, octokit));
}
var deprecate_1 = deprecate;
const loggedMessages = {};
function deprecate (message) {
if (loggedMessages[message]) {
return
}
console.warn(`DEPRECATED (@octokit/rest): ${message}`);
loggedMessages[message] = 1;
}
var getPageLinks_1 = getPageLinks;
function getPageLinks (link) {
link = link.link || link.headers.link || '';
const links = {};
// link format:
// '<https://api.github.com/users/aseemk/followers?page=2>; rel="next", <https://api.github.com/users/aseemk/followers?page=2>; rel="last"'
link.replace(/<([^>]*)>;\s*rel="([\w]*)"/g, (m, uri, type) => {
links[type] = uri;
});
return links
}
var httpError = class HttpError extends Error {
constructor (message, code, headers) {
super(message);
// Maintains proper stack trace (only available on V8)
/* istanbul ignore next */
if (Error.captureStackTrace) {
Error.captureStackTrace(this, this.constructor);
}
this.name = 'HttpError';
this.code = code;
this.headers = headers;
}
};
var getPage_1 = getPage;
function getPage (octokit, link, which, headers) {
deprecate_1(`octokit.get${which.charAt(0).toUpperCase() + which.slice(1)}Page() – You can use octokit.paginate or async iterators instead: https://github.com/octokit/rest.js#pagination.`);
const url = getPageLinks_1(link)[which];
if (!url) {
const urlError = new httpError(`No ${which} page found`, 404);
return Promise.reject(urlError)
}
const requestOptions = {
url,
headers: applyAcceptHeader(link, headers)
};
const promise = octokit.request(requestOptions);
return promise
}
function applyAcceptHeader (res, headers) {
const previous = res.headers && res.headers['x-github-media-type'];
if (!previous || (headers && headers.accept)) {
return headers
}
headers = headers || {};
headers.accept = 'application/vnd.' + previous
.replace('; param=', '.')
.replace('; format=', '+');
return headers
}
var getFirstPage_1 = getFirstPage;
function getFirstPage (octokit, link, headers) {
return getPage_1(octokit, link, 'first', headers)
}
var getLastPage_1 = getLastPage;
function getLastPage (octokit, link, headers) {
return getPage_1(octokit, link, 'last', headers)
}
var getNextPage_1 = getNextPage;
function getNextPage (octokit, link, headers) {
return getPage_1(octokit, link, 'next', headers)
}
var getPreviousPage_1 = getPreviousPage;
function getPreviousPage (octokit, link, headers) {
return getPage_1(octokit, link, 'prev', headers)
}
var hasFirstPage_1 = hasFirstPage;
function hasFirstPage (link) {
deprecate_1(`octokit.hasFirstPage() – You can use octokit.paginate or async iterators instead: https://github.com/octokit/rest.js#pagination.`);
return getPageLinks_1(link).first
}
var hasLastPage_1 = hasLastPage;
function hasLastPage (link) {
deprecate_1(`octokit.hasLastPage() – You can use octokit.paginate or async iterators instead: https://github.com/octokit/rest.js#pagination.`);
return getPageLinks_1(link).last
}
var hasNextPage_1 = hasNextPage;
function hasNextPage (link) {
deprecate_1(`octokit.hasNextPage() – You can use octokit.paginate or async iterators instead: https://github.com/octokit/rest.js#pagination.`);
return getPageLinks_1(link).next
}
var hasPreviousPage_1 = hasPreviousPage;
function hasPreviousPage (link) {
deprecate_1(`octokit.hasPreviousPage() – You can use octokit.paginate or async iterators instead: https://github.com/octokit/rest.js#pagination.`);
return getPageLinks_1(link).prev
}
var octokitPaginationMethods = paginationMethodsPlugin;
function paginationMethodsPlugin (octokit) {
octokit.getFirstPage = getFirstPage_1.bind(null, octokit);
octokit.getLastPage = getLastPage_1.bind(null, octokit);
octokit.getNextPage = getNextPage_1.bind(null, octokit);
octokit.getPreviousPage = getPreviousPage_1.bind(null, octokit);
octokit.hasFirstPage = hasFirstPage_1;
octokit.hasLastPage = hasLastPage_1;
octokit.hasNextPage = hasNextPage_1;
octokit.hasPreviousPage = hasPreviousPage_1;
}
const { requestLog: requestLog$1 } = distWeb$4;
const {
restEndpointMethods: restEndpointMethods$2
} = distWeb$5;
const CORE_PLUGINS = [
authentication,
authenticationDeprecated, // deprecated: remove in v17
requestLog$1,
pagination,
restEndpointMethods$2,
validate_1$1,
octokitPaginationMethods // deprecated: remove in v17
];
const OctokitRest = core$3.plugin(CORE_PLUGINS);
function DeprecatedOctokit(options) {
const warn =
options && options.log && options.log.warn
? options.log.warn
: console.warn;
warn(
'[@octokit/rest] `const Octokit = require("@octokit/rest")` is deprecated. Use `const { Octokit } = require("@octokit/rest")` instead'
);
return new OctokitRest(options);
}
const Octokit$3 = Object.assign(DeprecatedOctokit, {
Octokit: OctokitRest
});
Object.keys(OctokitRest).forEach(key => {
/* istanbul ignore else */
if (OctokitRest.hasOwnProperty(key)) {
Octokit$3[key] = OctokitRest[key];
}
});
var rest = Octokit$3;
var context = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports, "__esModule", { value: true });
class Context {
/**
* Hydrate the context from the environment
*/
constructor() {
this.payload = {};
if (process.env.GITHUB_EVENT_PATH) {
if (fs__default['default'].existsSync(process.env.GITHUB_EVENT_PATH)) {
this.payload = JSON.parse(fs__default['default'].readFileSync(process.env.GITHUB_EVENT_PATH, { encoding: 'utf8' }));
}
else {
const path = process.env.GITHUB_EVENT_PATH;
process.stdout.write(`GITHUB_EVENT_PATH ${path} does not exist${require$$0__default$1['default'].EOL}`);
}
}
this.eventName = process.env.GITHUB_EVENT_NAME;
this.sha = process.env.GITHUB_SHA;
this.ref = process.env.GITHUB_REF;
this.workflow = process.env.GITHUB_WORKFLOW;
this.action = process.env.GITHUB_ACTION;
this.actor = process.env.GITHUB_ACTOR;
}
get issue() {
const payload = this.payload;
return Object.assign(Object.assign({}, this.repo), { number: (payload.issue || payload.pull_request || payload).number });
}
get repo() {
if (process.env.GITHUB_REPOSITORY) {
const [owner, repo] = process.env.GITHUB_REPOSITORY.split('/');
return { owner, repo };
}
if (this.payload.repository) {
return {
owner: this.payload.repository.owner.login,
repo: this.payload.repository.name
};
}
throw new Error("context.repo requires a GITHUB_REPOSITORY environment variable like 'owner/repo'");
}
}
exports.Context = Context;
});
var proxy = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports, "__esModule", { value: true });
function getProxyUrl(reqUrl) {
let usingSsl = reqUrl.protocol === 'https:';
let proxyUrl;
if (checkBypass(reqUrl)) {
return proxyUrl;
}
let proxyVar;
if (usingSsl) {
proxyVar = process.env['https_proxy'] || process.env['HTTPS_PROXY'];
}
else {
proxyVar = process.env['http_proxy'] || process.env['HTTP_PROXY'];
}
if (proxyVar) {
proxyUrl = url__default['default'].parse(proxyVar);
}
return proxyUrl;
}
exports.getProxyUrl = getProxyUrl;
function checkBypass(reqUrl) {
if (!reqUrl.hostname) {
return false;
}
let noProxy = process.env['no_proxy'] || process.env['NO_PROXY'] || '';
if (!noProxy) {
return false;
}
// Determine the request port
let reqPort;
if (reqUrl.port) {
reqPort = Number(reqUrl.port);
}
else if (reqUrl.protocol === 'http:') {
reqPort = 80;
}
else if (reqUrl.protocol === 'https:') {
reqPort = 443;
}
// Format the request hostname and hostname with port
let upperReqHosts = [reqUrl.hostname.toUpperCase()];
if (typeof reqPort === 'number') {
upperReqHosts.push(`${upperReqHosts[0]}:${reqPort}`);
}
// Compare request host against noproxy
for (let upperNoProxyItem of noProxy
.split(',')
.map(x => x.trim().toUpperCase())
.filter(x => x)) {
if (upperReqHosts.some(x => x === upperNoProxyItem)) {
return true;
}
}
return false;
}
exports.checkBypass = checkBypass;
});
var httpOverHttp_1 = httpOverHttp;
var httpsOverHttp_1 = httpsOverHttp;
var httpOverHttps_1 = httpOverHttps;
var httpsOverHttps_1 = httpsOverHttps;
function httpOverHttp(options) {
var agent = new TunnelingAgent(options);
agent.request = http__default['default'].request;
return agent;
}
function httpsOverHttp(options) {
var agent = new TunnelingAgent(options);
agent.request = http__default['default'].request;
agent.createSocket = createSecureSocket;
agent.defaultPort = 443;
return agent;
}
function httpOverHttps(options) {
var agent = new TunnelingAgent(options);
agent.request = https__default['default'].request;
return agent;
}
function httpsOverHttps(options) {
var agent = new TunnelingAgent(options);
agent.request = https__default['default'].request;
agent.createSocket = createSecureSocket;
agent.defaultPort = 443;
return agent;
}
function TunnelingAgent(options) {
var self = this;
self.options = options || {};
self.proxyOptions = self.options.proxy || {};
self.maxSockets = self.options.maxSockets || http__default['default'].Agent.defaultMaxSockets;
self.requests = [];
self.sockets = [];
self.on('free', function onFree(socket, host, port, localAddress) {
var options = toOptions(host, port, localAddress);
for (var i = 0, len = self.requests.length; i < len; ++i) {
var pending = self.requests[i];
if (pending.host === options.host && pending.port === options.port) {
// Detect the request to connect same origin server,
// reuse the connection.
self.requests.splice(i, 1);
pending.request.onSocket(socket);
return;
}
}
socket.destroy();
self.removeSocket(socket);
});
}
util__default['default'].inherits(TunnelingAgent, require$$1__default['default'].EventEmitter);
TunnelingAgent.prototype.addRequest = function addRequest(req, host, port, localAddress) {
var self = this;
var options = mergeOptions({request: req}, self.options, toOptions(host, port, localAddress));
if (self.sockets.length >= this.maxSockets) {
// We are over limit so we'll add it to the queue.
self.requests.push(options);
return;
}
// If we are under maxSockets create a new one.
self.createSocket(options, function(socket) {
socket.on('free', onFree);
socket.on('close', onCloseOrRemove);
socket.on('agentRemove', onCloseOrRemove);
req.onSocket(socket);
function onFree() {
self.emit('free', socket, options);
}
function onCloseOrRemove(err) {
self.removeSocket(socket);
socket.removeListener('free', onFree);
socket.removeListener('close', onCloseOrRemove);
socket.removeListener('agentRemove', onCloseOrRemove);
}
});
};
TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
var self = this;
var placeholder = {};
self.sockets.push(placeholder);
var connectOptions = mergeOptions({}, self.proxyOptions, {
method: 'CONNECT',
path: options.host + ':' + options.port,
agent: false,
headers: {
host: options.host + ':' + options.port
}
});
if (options.localAddress) {
connectOptions.localAddress = options.localAddress;
}
if (connectOptions.proxyAuth) {
connectOptions.headers = connectOptions.headers || {};
connectOptions.headers['Proxy-Authorization'] = 'Basic ' +
new Buffer(connectOptions.proxyAuth).toString('base64');
}
debug('making CONNECT request');
var connectReq = self.request(connectOptions);
connectReq.useChunkedEncodingByDefault = false; // for v0.6
connectReq.once('response', onResponse); // for v0.6
connectReq.once('upgrade', onUpgrade); // for v0.6
connectReq.once('connect', onConnect); // for v0.7 or later
connectReq.once('error', onError);
connectReq.end();
function onResponse(res) {
// Very hacky. This is necessary to avoid http-parser leaks.
res.upgrade = true;
}
function onUpgrade(res, socket, head) {
// Hacky.
process.nextTick(function() {
onConnect(res, socket, head);
});
}
function onConnect(res, socket, head) {
connectReq.removeAllListeners();
socket.removeAllListeners();
if (res.statusCode !== 200) {
debug('tunneling socket could not be established, statusCode=%d',
res.statusCode);
socket.destroy();
var error = new Error('tunneling socket could not be established, ' +
'statusCode=' + res.statusCode);
error.code = 'ECONNRESET';
options.request.emit('error', error);
self.removeSocket(placeholder);
return;
}
if (head.length > 0) {
debug('got illegal response body from proxy');
socket.destroy();
var error = new Error('got illegal response body from proxy');
error.code = 'ECONNRESET';
options.request.emit('error', error);
self.removeSocket(placeholder);
return;
}
debug('tunneling connection has established');
self.sockets[self.sockets.indexOf(placeholder)] = socket;
return cb(socket);
}
function onError(cause) {
connectReq.removeAllListeners();
debug('tunneling socket could not be established, cause=%s\n',
cause.message, cause.stack);
var error = new Error('tunneling socket could not be established, ' +
'cause=' + cause.message);
error.code = 'ECONNRESET';
options.request.emit('error', error);
self.removeSocket(placeholder);
}
};
TunnelingAgent.prototype.removeSocket = function removeSocket(socket) {
var pos = this.sockets.indexOf(socket);
if (pos === -1) {
return;
}
this.sockets.splice(pos, 1);
var pending = this.requests.shift();
if (pending) {
// If we have pending requests and a socket gets closed a new one
// needs to be created to take over in the pool for the one that closed.
this.createSocket(pending, function(socket) {
pending.request.onSocket(socket);
});
}
};
function createSecureSocket(options, cb) {
var self = this;
TunnelingAgent.prototype.createSocket.call(self, options, function(socket) {
var hostHeader = options.request.getHeader('host');
var tlsOptions = mergeOptions({}, self.options, {
socket: socket,
servername: hostHeader ? hostHeader.replace(/:.*$/, '') : options.host
});
// 0 is dummy port for v0.6
var secureSocket = tls__default['default'].connect(0, tlsOptions);
self.sockets[self.sockets.indexOf(socket)] = secureSocket;
cb(secureSocket);
});
}
function toOptions(host, port, localAddress) {
if (typeof host === 'string') { // since v0.10
return {
host: host,
port: port,
localAddress: localAddress
};
}
return host; // for v0.11 or later
}
function mergeOptions(target) {
for (var i = 1, len = arguments.length; i < len; ++i) {
var overrides = arguments[i];
if (typeof overrides === 'object') {
var keys = Object.keys(overrides);
for (var j = 0, keyLen = keys.length; j < keyLen; ++j) {
var k = keys[j];
if (overrides[k] !== undefined) {
target[k] = overrides[k];
}
}
}
}
return target;
}
var debug;
if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) {
debug = function() {
var args = Array.prototype.slice.call(arguments);
if (typeof args[0] === 'string') {
args[0] = 'TUNNEL: ' + args[0];
} else {
args.unshift('TUNNEL:');
}
console.error.apply(console, args);
};
} else {
debug = function() {};
}
var debug_1 = debug; // for test
var tunnel = {
httpOverHttp: httpOverHttp_1,
httpsOverHttp: httpsOverHttp_1,
httpOverHttps: httpOverHttps_1,
httpsOverHttps: httpsOverHttps_1,
debug: debug_1
};
var tunnel$1 = tunnel;
var httpClient = createCommonjsModule(function (module, exports) {
Object.defineProperty(exports, "__esModule", { value: true });
let tunnel;
var HttpCodes;
(function (HttpCodes) {
HttpCodes[HttpCodes["OK"] = 200] = "OK";
HttpCodes[HttpCodes["MultipleChoices"] = 300] = "MultipleChoices";
HttpCodes[HttpCodes["MovedPermanently"] = 301] = "MovedPermanently";
HttpCodes[HttpCodes["ResourceMoved"] = 302] = "ResourceMoved";
HttpCodes[HttpCodes["SeeOther"] = 303] = "SeeOther";
HttpCodes[HttpCodes["NotModified"] = 304] = "NotModified";
HttpCodes[HttpCodes["UseProxy"] = 305] = "UseProxy";
HttpCodes[HttpCodes["SwitchProxy"] = 306] = "SwitchProxy";
HttpCodes[HttpCodes["TemporaryRedirect"] = 307] = "TemporaryRedirect";
HttpCodes[HttpCodes["PermanentRedirect"] = 308] = "PermanentRedirect";
HttpCodes[HttpCodes["BadRequest"] = 400] = "BadRequest";
HttpCodes[HttpCodes["Unauthorized"] = 401] = "Unauthorized";
HttpCodes[HttpCodes["PaymentRequired"] = 402] = "PaymentRequired";
HttpCodes[HttpCodes["Forbidden"] = 403] = "Forbidden";
HttpCodes[HttpCodes["NotFound"] = 404] = "NotFound";
HttpCodes[HttpCodes["MethodNotAllowed"] = 405] = "MethodNotAllowed";
HttpCodes[HttpCodes["NotAcceptable"] = 406] = "NotAcceptable";
HttpCodes[HttpCodes["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired";
HttpCodes[HttpCodes["RequestTimeout"] = 408] = "RequestTimeout";
HttpCodes[HttpCodes["Conflict"] = 409] = "Conflict";
HttpCodes[HttpCodes["Gone"] = 410] = "Gone";
HttpCodes[HttpCodes["TooManyRequests"] = 429] = "TooManyRequests";
HttpCodes[HttpCodes["InternalServerError"] = 500] = "InternalServerError";
HttpCodes[HttpCodes["NotImplemented"] = 501] = "NotImplemented";
HttpCodes[HttpCodes["BadGateway"] = 502] = "BadGateway";
HttpCodes[HttpCodes["ServiceUnavailable"] = 503] = "ServiceUnavailable";
HttpCodes[HttpCodes["GatewayTimeout"] = 504] = "GatewayTimeout";
})(HttpCodes = exports.HttpCodes || (exports.HttpCodes = {}));
var Headers;
(function (Headers) {
Headers["Accept"] = "accept";
Headers["ContentType"] = "content-type";
})(Headers = exports.Headers || (exports.Headers = {}));
var MediaTypes;
(function (MediaTypes) {
MediaTypes["ApplicationJson"] = "application/json";
})(MediaTypes = exports.MediaTypes || (exports.MediaTypes = {}));
/**
* Returns the proxy URL, depending upon the supplied url and proxy environment variables.
* @param serverUrl The server URL where the request will be sent. For example, https://api.github.com
*/
function getProxyUrl(serverUrl) {
let proxyUrl = proxy.getProxyUrl(url__default['default'].parse(serverUrl));
return proxyUrl ? proxyUrl.href : '';
}
exports.getProxyUrl = getProxyUrl;
const HttpRedirectCodes = [
HttpCodes.MovedPermanently,
HttpCodes.ResourceMoved,
HttpCodes.SeeOther,
HttpCodes.TemporaryRedirect,
HttpCodes.PermanentRedirect
];
const HttpResponseRetryCodes = [
HttpCodes.BadGateway,
HttpCodes.ServiceUnavailable,
HttpCodes.GatewayTimeout
];
const RetryableHttpVerbs = ['OPTIONS', 'GET', 'DELETE', 'HEAD'];
const ExponentialBackoffCeiling = 10;
const ExponentialBackoffTimeSlice = 5;
class HttpClientResponse {
constructor(message) {
this.message = message;
}
readBody() {
return new Promise(async (resolve, reject) => {
let output = Buffer.alloc(0);
this.message.on('data', (chunk) => {
output = Buffer.concat([output, chunk]);
});
this.message.on('end', () => {
resolve(output.toString());
});
});
}
}
exports.HttpClientResponse = HttpClientResponse;
function isHttps(requestUrl) {
let parsedUrl = url__default['default'].parse(requestUrl);
return parsedUrl.protocol === 'https:';
}
exports.isHttps = isHttps;
class HttpClient {
constructor(userAgent, handlers, requestOptions) {
this._ignoreSslError = false;
this._allowRedirects = true;
this._allowRedirectDowngrade = false;
this._maxRedirects = 50;
this._allowRetries = false;
this._maxRetries = 1;
this._keepAlive = false;
this._disposed = false;
this.userAgent = userAgent;
this.handlers = handlers || [];
this.requestOptions = requestOptions;
if (requestOptions) {
if (requestOptions.ignoreSslError != null) {
this._ignoreSslError = requestOptions.ignoreSslError;
}
this._socketTimeout = requestOptions.socketTimeout;
if (requestOptions.allowRedirects != null) {
this._allowRedirects = requestOptions.allowRedirects;
}
if (requestOptions.allowRedirectDowngrade != null) {
this._allowRedirectDowngrade = requestOptions.allowRedirectDowngrade;
}
if (requestOptions.maxRedirects != null) {
this._maxRedirects = Math.max(requestOptions.maxRedirects, 0);
}
if (requestOptions.keepAlive != null) {
this._keepAlive = requestOptions.keepAlive;
}
if (requestOptions.allowRetries != null) {
this._allowRetries = requestOptions.allowRetries;
}
if (requestOptions.maxRetries != null) {
this._maxRetries = requestOptions.maxRetries;
}
}
}
options(requestUrl, additionalHeaders) {
return this.request('OPTIONS', requestUrl, null, additionalHeaders || {});
}
get(requestUrl, additionalHeaders) {
return this.request('GET', requestUrl, null, additionalHeaders || {});
}
del(requestUrl, additionalHeaders) {
return this.request('DELETE', requestUrl, null, additionalHeaders || {});
}
post(requestUrl, data, additionalHeaders) {
return this.request('POST', requestUrl, data, additionalHeaders || {});
}
patch(requestUrl, data, additionalHeaders) {
return this.request('PATCH', requestUrl, data, additionalHeaders || {});
}
put(requestUrl, data, additionalHeaders) {
return this.request('PUT', requestUrl, data, additionalHeaders || {});
}
head(requestUrl, additionalHeaders) {
return this.request('HEAD', requestUrl, null, additionalHeaders || {});
}
sendStream(verb, requestUrl, stream, additionalHeaders) {
return this.request(verb, requestUrl, stream, additionalHeaders);
}
/**
* Gets a typed object from an endpoint
* Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise
*/
async getJson(requestUrl, additionalHeaders = {}) {
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
let res = await this.get(requestUrl, additionalHeaders);
return this._processResponse(res, this.requestOptions);
}
async postJson(requestUrl, obj, additionalHeaders = {}) {
let data = JSON.stringify(obj, null, 2);
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson);
let res = await this.post(requestUrl, data, additionalHeaders);
return this._processResponse(res, this.requestOptions);
}
async putJson(requestUrl, obj, additionalHeaders = {}) {
let data = JSON.stringify(obj, null, 2);
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson);
let res = await this.put(requestUrl, data, additionalHeaders);
return this._processResponse(res, this.requestOptions);
}
async patchJson(requestUrl, obj, additionalHeaders = {}) {
let data = JSON.stringify(obj, null, 2);
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson);
let res = await this.patch(requestUrl, data, additionalHeaders);
return this._processResponse(res, this.requestOptions);
}
/**
* Makes a raw http request.
* All other methods such as get, post, patch, and request ultimately call this.
* Prefer get, del, post and patch
*/
async request(verb, requestUrl, data, headers) {
if (this._disposed) {
throw new Error('Client has already been disposed.');
}
let parsedUrl = url__default['default'].parse(requestUrl);
let info = this._prepareRequest(verb, parsedUrl, headers);
// Only perform retries on reads since writes may not be idempotent.
let maxTries = this._allowRetries && RetryableHttpVerbs.indexOf(verb) != -1
? this._maxRetries + 1
: 1;
let numTries = 0;
let response;
while (numTries < maxTries) {
response = await this.requestRaw(info, data);
// Check if it's an authentication challenge
if (response &&
response.message &&
response.message.statusCode === HttpCodes.Unauthorized) {
let authenticationHandler;
for (let i = 0; i < this.handlers.length; i++) {
if (this.handlers[i].canHandleAuthentication(response)) {
authenticationHandler = this.handlers[i];
break;
}
}
if (authenticationHandler) {
return authenticationHandler.handleAuthentication(this, info, data);
}
else {
// We have received an unauthorized response but have no handlers to handle it.
// Let the response return to the caller.
return response;
}
}
let redirectsRemaining = this._maxRedirects;
while (HttpRedirectCodes.indexOf(response.message.statusCode) != -1 &&
this._allowRedirects &&
redirectsRemaining > 0) {
const redirectUrl = response.message.headers['location'];
if (!redirectUrl) {
// if there's no location to redirect to, we won't
break;
}
let parsedRedirectUrl = url__default['default'].parse(redirectUrl);
if (parsedUrl.protocol == 'https:' &&
parsedUrl.protocol != parsedRedirectUrl.protocol &&
!this._allowRedirectDowngrade) {
throw new Error('Redirect from HTTPS to HTTP protocol. This downgrade is not allowed for security reasons. If you want to allow this behavior, set the allowRedirectDowngrade option to true.');
}
// we need to finish reading the response before reassigning response
// which will leak the open socket.
await response.readBody();
// strip authorization header if redirected to a different hostname
if (parsedRedirectUrl.hostname !== parsedUrl.hostname) {
for (let header in headers) {
// header names are case insensitive
if (header.toLowerCase() === 'authorization') {
delete headers[header];
}
}
}
// let's make the request with the new redirectUrl
info = this._prepareRequest(verb, parsedRedirectUrl, headers);
response = await this.requestRaw(info, data);
redirectsRemaining--;
}
if (HttpResponseRetryCodes.indexOf(response.message.statusCode) == -1) {
// If not a retry code, return immediately instead of retrying
return response;
}
numTries += 1;
if (numTries < maxTries) {
await response.readBody();
await this._performExponentialBackoff(numTries);
}
}
return response;
}
/**
* Needs to be called if keepAlive is set to true in request options.
*/
dispose() {
if (this._agent) {
this._agent.destroy();
}
this._disposed = true;
}
/**
* Raw request.
* @param info
* @param data
*/
requestRaw(info, data) {
return new Promise((resolve, reject) => {
let callbackForResult = function (err, res) {
if (err) {
reject(err);
}
resolve(res);
};
this.requestRawWithCallback(info, data, callbackForResult);
});
}
/**
* Raw request with callback.
* @param info
* @param data
* @param onResult
*/
requestRawWithCallback(info, data, onResult) {
let socket;
if (typeof data === 'string') {
info.options.headers['Content-Length'] = Buffer.byteLength(data, 'utf8');
}
let callbackCalled = false;
let handleResult = (err, res) => {
if (!callbackCalled) {
callbackCalled = true;
onResult(err, res);
}
};
let req = info.httpModule.request(info.options, (msg) => {
let res = new HttpClientResponse(msg);
handleResult(null, res);
});
req.on('socket', sock => {
socket = sock;
});
// If we ever get disconnected, we want the socket to timeout eventually
req.setTimeout(this._socketTimeout || 3 * 60000, () => {
if (socket) {
socket.end();
}
handleResult(new Error('Request timeout: ' + info.options.path), null);
});
req.on('error', function (err) {
// err has statusCode property
// res should have headers
handleResult(err, null);
});
if (data && typeof data === 'string') {
req.write(data, 'utf8');
}
if (data && typeof data !== 'string') {
data.on('close', function () {
req.end();
});
data.pipe(req);
}
else {
req.end();
}
}
/**
* Gets an http agent. This function is useful when you need an http agent that handles
* routing through a proxy server - depending upon the url and proxy environment variables.
* @param serverUrl The server URL where the request will be sent. For example, https://api.github.com
*/
getAgent(serverUrl) {
let parsedUrl = url__default['default'].parse(serverUrl);
return this._getAgent(parsedUrl);
}
_prepareRequest(method, requestUrl, headers) {
const info = {};
info.parsedUrl = requestUrl;
const usingSsl = info.parsedUrl.protocol === 'https:';
info.httpModule = usingSsl ? https__default['default'] : http__default['default'];
const defaultPort = usingSsl ? 443 : 80;
info.options = {};
info.options.host = info.parsedUrl.hostname;
info.options.port = info.parsedUrl.port
? parseInt(info.parsedUrl.port)
: defaultPort;
info.options.path =
(info.parsedUrl.pathname || '') + (info.parsedUrl.search || '');
info.options.method = method;
info.options.headers = this._mergeHeaders(headers);
if (this.userAgent != null) {
info.options.headers['user-agent'] = this.userAgent;
}
info.options.agent = this._getAgent(info.parsedUrl);
// gives handlers an opportunity to participate
if (this.handlers) {
this.handlers.forEach(handler => {
handler.prepareRequest(info.options);
});
}
return info;
}
_mergeHeaders(headers) {
const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {});
if (this.requestOptions && this.requestOptions.headers) {
return Object.assign({}, lowercaseKeys(this.requestOptions.headers), lowercaseKeys(headers));
}
return lowercaseKeys(headers || {});
}
_getExistingOrDefaultHeader(additionalHeaders, header, _default) {
const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {});
let clientHeader;
if (this.requestOptions && this.requestOptions.headers) {
clientHeader = lowercaseKeys(this.requestOptions.headers)[header];
}
return additionalHeaders[header] || clientHeader || _default;
}
_getAgent(parsedUrl) {
let agent;
let proxyUrl = proxy.getProxyUrl(parsedUrl);
let useProxy = proxyUrl && proxyUrl.hostname;
if (this._keepAlive && useProxy) {
agent = this._proxyAgent;
}
if (this._keepAlive && !useProxy) {
agent = this._agent;
}
// if agent is already assigned use that agent.
if (!!agent) {
return agent;
}
const usingSsl = parsedUrl.protocol === 'https:';
let maxSockets = 100;
if (!!this.requestOptions) {
maxSockets = this.requestOptions.maxSockets || http__default['default'].globalAgent.maxSockets;
}
if (useProxy) {
// If using proxy, need tunnel
if (!tunnel) {
tunnel = tunnel$1;
}
const agentOptions = {
maxSockets: maxSockets,
keepAlive: this._keepAlive,
proxy: {
proxyAuth: proxyUrl.auth,
host: proxyUrl.hostname,
port: proxyUrl.port
}
};
let tunnelAgent;
const overHttps = proxyUrl.protocol === 'https:';
if (usingSsl) {
tunnelAgent = overHttps ? tunnel.httpsOverHttps : tunnel.httpsOverHttp;
}
else {
tunnelAgent = overHttps ? tunnel.httpOverHttps : tunnel.httpOverHttp;
}
agent = tunnelAgent(agentOptions);
this._proxyAgent = agent;
}
// if reusing agent across request and tunneling agent isn't assigned create a new agent
if (this._keepAlive && !agent) {
const options = { keepAlive: this._keepAlive, maxSockets: maxSockets };
agent = usingSsl ? new https__default['default'].Agent(options) : new http__default['default'].Agent(options);
this._agent = agent;
}
// if not using private agent and tunnel agent isn't setup then use global agent
if (!agent) {
agent = usingSsl ? https__default['default'].globalAgent : http__default['default'].globalAgent;
}
if (usingSsl && this._ignoreSslError) {
// we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process
// http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options
// we have to cast it to any and change it directly
agent.options = Object.assign(agent.options || {}, {
rejectUnauthorized: false
});
}
return agent;
}
_performExponentialBackoff(retryNumber) {
retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber);
const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber);
return new Promise(resolve => setTimeout(() => resolve(), ms));
}
static dateTimeDeserializer(key, value) {
if (typeof value === 'string') {
let a = new Date(value);
if (!isNaN(a.valueOf())) {
return a;
}
}
return value;
}
async _processResponse(res, options) {
return new Promise(async (resolve, reject) => {
const statusCode = res.message.statusCode;
const response = {
statusCode: statusCode,
result: null,
headers: {}
};
// not found leads to null obj returned
if (statusCode == HttpCodes.NotFound) {
resolve(response);
}
let obj;
let contents;
// get the result from the body
try {
contents = await res.readBody();
if (contents && contents.length > 0) {
if (options && options.deserializeDates) {
obj = JSON.parse(contents, HttpClient.dateTimeDeserializer);
}
else {
obj = JSON.parse(contents);
}
response.result = obj;
}
response.headers = res.message.headers;
}
catch (err) {
// Invalid resource (contents not json); leaving result obj null
}
// note that 3xx redirects are handled by the http layer.
if (statusCode > 299) {
let msg;
// if exception/error in body, attempt to get better error
if (obj && obj.message) {
msg = obj.message;
}
else if (contents && contents.length > 0) {
// it may be the case that the exception is in the body message as string
msg = contents;
}
else {
msg = 'Failed request: (' + statusCode + ')';
}
let err = new Error(msg);
// attach statusCode and body obj (if available) to the error object
err['statusCode'] = statusCode;
if (response.result) {
err['result'] = response.result;
}
reject(err);
}
else {
resolve(response);
}
});
}
}
exports.HttpClient = HttpClient;
});
var github = createCommonjsModule(function (module, exports) {
var __importStar = (commonjsGlobal && commonjsGlobal.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];
result["default"] = mod;
return result;
};
Object.defineProperty(exports, "__esModule", { value: true });
// Originally pulled from https://github.com/JasonEtco/actions-toolkit/blob/master/src/github.ts
const Context = __importStar(context);
const httpClient$1 = __importStar(httpClient);
// We need this in order to extend Octokit
rest.Octokit.prototype = new rest.Octokit();
exports.context = new Context.Context();
class GitHub extends rest.Octokit {
constructor(token, opts) {
super(GitHub.getOctokitOptions(GitHub.disambiguate(token, opts)));
this.graphql = GitHub.getGraphQL(GitHub.disambiguate(token, opts));
}
/**
* Disambiguates the constructor overload parameters
*/
static disambiguate(token, opts) {
return [
typeof token === 'string' ? token : '',
typeof token === 'object' ? token : opts || {}
];
}
static getOctokitOptions(args) {
const token = args[0];
const options = Object.assign({}, args[1]); // Shallow clone - don't mutate the object provided by the caller
// Base URL - GHES or Dotcom
options.baseUrl = options.baseUrl || this.getApiBaseUrl();
// Auth
const auth = GitHub.getAuthString(token, options);
if (auth) {
options.auth = auth;
}
// Proxy
const agent = GitHub.getProxyAgent(options.baseUrl, options);
if (agent) {
// Shallow clone - don't mutate the object provided by the caller
options.request = options.request ? Object.assign({}, options.request) : {};
// Set the agent
options.request.agent = agent;
}
return options;
}
static getGraphQL(args) {
const defaults = {};
defaults.baseUrl = this.getGraphQLBaseUrl();
const token = args[0];
const options = args[1];
// Authorization
const auth = this.getAuthString(token, options);
if (auth) {
defaults.headers = {
authorization: auth
};
}
// Proxy
const agent = GitHub.getProxyAgent(defaults.baseUrl, options);
if (agent) {
defaults.request = { agent };
}
return distWeb$2.graphql.defaults(defaults);
}
static getAuthString(token, options) {
// Validate args
if (!token && !options.auth) {
throw new Error('Parameter token or opts.auth is required');
}
else if (token && options.auth) {
throw new Error('Parameters token and opts.auth may not both be specified');
}
return typeof options.auth === 'string' ? options.auth : `token ${token}`;
}
static getProxyAgent(destinationUrl, options) {
var _a;
if (!((_a = options.request) === null || _a === void 0 ? void 0 : _a.agent)) {
if (httpClient$1.getProxyUrl(destinationUrl)) {
const hc = new httpClient$1.HttpClient();
return hc.getAgent(destinationUrl);
}
}
return undefined;
}
static getApiBaseUrl() {
return process.env['GITHUB_API_URL'] || 'https://api.github.com';
}
static getGraphQLBaseUrl() {
let url = process.env['GITHUB_GRAPHQL_URL'] || 'https://api.github.com/graphql';
// Shouldn't be a trailing slash, but remove if so
if (url.endsWith('/')) {
url = url.substr(0, url.length - 1);
}
// Remove trailing "/graphql"
if (url.toUpperCase().endsWith('/GRAPHQL')) {
url = url.substr(0, url.length - '/graphql'.length);
}
return url;
}
}
exports.GitHub = GitHub;
});
const { GitHub, context: context$1 } = github;
async function run() {
try {
// Get authenticated GitHub client (Ocktokit): https://github.com/actions/toolkit/tree/master/packages/github#usage
const github = new GitHub(process.env.GITHUB_TOKEN);
// Get owner and repo from context of payload that triggered the action
const { owner, repo } = context$1.repo;
// Get the inputs from the workflow file: https://github.com/actions/toolkit/tree/master/packages/core#inputsoutputs
const tagName = core.getInput('tag_name', { required: true });
// This removes the 'refs/tags' portion of the string, i.e. from 'refs/tags/v1.10.15' to 'v1.10.15'
const tag = tagName.replace('refs/tags/', '');
const releaseName = core.getInput('release_name', { required: false }).replace('refs/tags/', '');
const body = core.getInput('body', { required: false });
const draft = core.getInput('draft', { required: false }) === 'true';
const prerelease = core.getInput('prerelease', { required: false }) === 'true';
const commitish = core.getInput('commitish', { required: false }) || context$1.sha;
const bodyPath = core.getInput('body_path', { required: false });
let bodyFileContent = null;
if (bodyPath !== '' && !!bodyPath) {
try {
bodyFileContent = fs__default['default'].readFileSync(bodyPath, { encoding: 'utf8' });
} catch (error) {
core.setFailed(error.message);
}
}
// Create a release
// API Documentation: https://developer.github.com/v3/repos/releases/#create-a-release
// Octokit Documentation: https://octokit.github.io/rest.js/#octokit-routes-repos-create-release
const createReleaseResponse = await github.repos.createRelease({
owner,
repo,
tag_name: tag,
name: releaseName,
body: bodyFileContent || body,
draft,
prerelease,
target_commitish: commitish
});
// Get the ID, html_url, and upload URL for the created Release from the response
const {
data: { id: releaseId, html_url: htmlUrl, upload_url: uploadUrl }
} = createReleaseResponse;
// Set the output variables for use by other actions: https://github.com/actions/toolkit/tree/master/packages/core#inputsoutputs
core.setOutput('id', releaseId);
core.setOutput('html_url', htmlUrl);
core.setOutput('upload_url', uploadUrl);
} catch (error) {
core.setFailed(error.message);
}
}
var createRelease = run;
var createRelease$1 = /*#__PURE__*/Object.freeze(/*#__PURE__*/Object.assign(/*#__PURE__*/Object.create(null), createRelease, {
'default': createRelease
}));
exports.Octokit = Octokit$1;
exports.core = core;
exports.createRelease = createRelease$1;
exports.error_1 = error_1;
exports.execa_1 = execa_1;
exports.info_1 = info_1;
exports.lib = lib;
exports.warn_1 = warn_1;
| 32.899078 | 321 | 0.572858 |
fa61a1793e2b57b94e64326851a048b2a43f300f | 1,172 | hpp | C++ | source/NanairoCore/Data/intersection_test_result.hpp | byzin/Nanairo | 23fb6deeec73509c538a9c21009e12be63e8d0e4 | [
"MIT"
] | 30 | 2015-09-06T03:14:29.000Z | 2021-06-18T11:00:19.000Z | source/NanairoCore/Data/intersection_test_result.hpp | byzin/Nanairo | 23fb6deeec73509c538a9c21009e12be63e8d0e4 | [
"MIT"
] | 31 | 2016-01-14T14:50:34.000Z | 2018-06-25T13:21:48.000Z | source/NanairoCore/Data/intersection_test_result.hpp | byzin/Nanairo | 23fb6deeec73509c538a9c21009e12be63e8d0e4 | [
"MIT"
] | 6 | 2017-04-09T13:07:47.000Z | 2021-05-29T21:17:34.000Z | /*!
\file intersection_test_result.hpp
\author Sho Ikeda
Copyright (c) 2015-2018 Sho Ikeda
This software is released under the MIT License.
http://opensource.org/licenses/mit-license.php
*/
#ifndef NANAIRO_INTERSECTION_TEST_RESULT_HPP
#define NANAIRO_INTERSECTION_TEST_RESULT_HPP
// Nanairo
#include "NanairoCore/nanairo_core_config.hpp"
namespace nanairo {
/*!
*/
class IntersectionTestResult
{
public:
//! Create a failure result
IntersectionTestResult() noexcept;
//! Create a success result with the distance
IntersectionTestResult(const Float d) noexcept;
//! Check if the result is success
explicit operator bool() const noexcept;
//! Return the failure distance
static constexpr Float failureDistance() noexcept;
//! Check if the result is success
bool isSuccess() const noexcept;
//! Return the distance of the intersection point
Float rayDistance() const noexcept;
//! Set the distance of the intersection point
void setRayDistance(const Float d) noexcept;
private:
Float distance_;
};
} // namespace nanairo
#include "intersection_test_result-inl.hpp"
#endif // NANAIRO_INTERSECTION_TEST_RESULT_HPP
| 21.309091 | 52 | 0.756826 |
ebb2d800a1c57bdaedfe55f4a9fa522243b3d776 | 338 | css | CSS | webinar-30-11/oldschool/styles.css | axZerk/fe11-webinars | 490e4a31ac183104fea10663d181062a890ad4d2 | [
"MIT"
] | 4 | 2017-12-05T19:26:30.000Z | 2018-03-09T20:24:40.000Z | webinar-30-11/oldschool/styles.css | axZerk/fe11-webinars | 490e4a31ac183104fea10663d181062a890ad4d2 | [
"MIT"
] | null | null | null | webinar-30-11/oldschool/styles.css | axZerk/fe11-webinars | 490e4a31ac183104fea10663d181062a890ad4d2 | [
"MIT"
] | 1 | 2018-03-08T14:45:06.000Z | 2018-03-08T14:45:06.000Z | * {
box-sizing: border-box;
padding: 0;
margin: 0;
}
.menu {
display: flex;
}
.menu__link {
text-decoration: none;
padding: 10px 20px;
margin-right: 10px;
border: 2px solid #424242;
text-transform: uppercase;
font-weight: 600;
color: #424242;
}
.menu__link--active {
background-color: #424242;
color: #fff;
}
| 13.52 | 28 | 0.642012 |
fa3e9a0bc2dd0bcba79d797ef2269824617ff5b6 | 3,440 | cpp | C++ | genome/genome.cpp | nicodex/lianzifu | 67c08abf0636e85512bfc91ac9ebe43dc2255186 | [
"MIT"
] | 2 | 2018-02-01T04:08:48.000Z | 2018-02-03T16:33:38.000Z | genome/genome.cpp | nicodex/lianzifu | 67c08abf0636e85512bfc91ac9ebe43dc2255186 | [
"MIT"
] | 1 | 2018-02-02T12:28:32.000Z | 2018-02-09T13:13:53.000Z | genome/genome.cpp | nicodex/lianzifu | 67c08abf0636e85512bfc91ac9ebe43dc2255186 | [
"MIT"
] | 1 | 2020-05-20T15:52:21.000Z | 2020-05-20T15:52:21.000Z | //
// Copyright (c) 2018 Nico Bendlin <nico@nicode.net>
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in
// all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
// THE SOFTWARE.
//
#include <genome/genome.hpp>
#include <genome/locale.hpp>
#include <genome/filesystem.hpp>
void
init_genome(void)
{
genome::locale::init();
genome::filesystem::init();
}
namespace genome {
namespace /*{anonymous}*/ {
char const*
skip_space(char const*& s)
{
if (!s) {
s = "";
} else {
while (('\t' == *s) || (' ' == *s)) {
++s;
}
}
return (s);
}
bool
is_end(char const*& s)
{
return ('\0' == *skip_space(s));
}
} // namespace genome::{anonymous}
//
// platforms
//
char const*
platform_name(platform target)
{
switch (target) {
default:
case platform_unknown:
return ("<invalid>");
case platform_pc:
return ("pc");
case platform_x64:
return ("x64");
case platform_ps3:
return ("ps3");
case platform_ps4:
return ("ps4");
case platform_x360:
return ("x360");
case platform_xone:
return ("xone");
}
}
char const*
platform_desc(platform target)
{
switch (target) {
default:
case platform_unknown:
return ("<invalid>");
case platform_pc:
return ("Windows (32-bit)");
case platform_x64:
return ("Windows (64-bit)");
case platform_ps3:
return ("PlayStation 3");
case platform_ps4:
return ("PlayStation 4");
case platform_x360:
return ("Xbox 360");
case platform_xone:
return ("Xbox One");
}
}
platform
platform_from_name(char const* name)
{
switch (*skip_space(name)) {
case 'p': case 'P':
switch (*++name) {
case 'c': case 'C':
if (is_end(++name)) {
return (platform_pc);
}
break;
case 's': case 'S':
switch (*++name) {
case '3':
if (is_end(++name)) {
return (platform_ps3);
}
break;
case '4':
if (is_end(++name)) {
return (platform_ps4);
}
break;
}
break;
}
break;
case 'x': case 'X':
switch (*++name) {
case '3':
if ('6' == *++name) {
if ('0' == *++name) {
if (is_end(++name)) {
return (platform_x360);
}
}
}
break;
case '6':
if ('4' == *++name) {
if (is_end(++name)) {
return (platform_x64);
}
}
break;
case 'o': case 'O':
if (++name, ('n' == *name) || ('N' == *name)) {
if (++name, ('e' == *name) || ('E' == *name)) {
if (is_end(++name)) {
return (platform_xone);
}
}
}
break;
}
break;
}
return (platform_unknown);
}
} // namespace genome
| 20.598802 | 80 | 0.623256 |
1424ec81b3cda693c0dc317dc745e45521ebd6da | 293 | ts | TypeScript | src/components/button/Button.d.ts | daofresh/primevue | f07a6a6a9c6655504e0c173bad24bafa3f750537 | [
"MIT"
] | 2,365 | 2017-09-20T18:40:37.000Z | 2022-03-31T19:03:56.000Z | src/components/button/Button.d.ts | daofresh/primevue | f07a6a6a9c6655504e0c173bad24bafa3f750537 | [
"MIT"
] | 2,084 | 2018-02-11T17:08:46.000Z | 2022-03-31T14:51:00.000Z | src/components/button/Button.d.ts | daofresh/primevue | f07a6a6a9c6655504e0c173bad24bafa3f750537 | [
"MIT"
] | 549 | 2017-12-28T02:28:47.000Z | 2022-03-31T09:17:19.000Z | interface ButtonProps {
style?: any;
class?: string;
label?: string;
icon?: string;
iconPos?: string;
badge?: string;
badgeClass?: string;
loading?: boolean;
loadingIcon?: string;
}
declare class Button {
$props: ButtonProps;
}
export default Button;
| 16.277778 | 25 | 0.627986 |
8e9d7321d52c3ee5f08a2d4d943569c6fa9211b4 | 745 | js | JavaScript | lib/resource.js | Dan70402/qless-js | 8300b590a901f7ee4ecb2cf510a911f250497d53 | [
"MIT"
] | null | null | null | lib/resource.js | Dan70402/qless-js | 8300b590a901f7ee4ecb2cf510a911f250497d53 | [
"MIT"
] | null | null | null | lib/resource.js | Dan70402/qless-js | 8300b590a901f7ee4ecb2cf510a911f250497d53 | [
"MIT"
] | 1 | 2017-06-27T16:18:30.000Z | 2017-06-27T16:18:30.000Z | 'use strict';
/**
* All our resource operations
*
* A class that allows us to change and manipulate resouce settings
*/
class Resource {
constructor(client) {
this.client = client;
}
counts(cb) {
this.client.call('resources', (err, res) => {
if (!err) res = JSON.parse(res);
cb(err, res);
});
}
get(key, cb) {
this.client.call('resource.get', key, (err, res) => {
if (!err) res = JSON.parse(res);
cb(err, res);
});
}
set(key, value, cb) {
this.client.call('resource.set', key, value, cb);
}
unset(key, cb) {
this.client.call('resource.unset', key, cb);
}
locks(key, cb) {
this.client.call('resource.locks', key, cb);
}
}
module.exports = { Resource };
| 17.325581 | 67 | 0.565101 |
2c9e3ab43e596b8dd9a357c573e43d2d5a997fcb | 883 | rs | Rust | runtime/standalone/src/benchmarking/chainlink_price_manager.rs | minterest-finance/minterest-chain-node | b932f0dfd3cda93a3de30e87c8463ad23116fea1 | [
"Apache-2.0"
] | 10 | 2021-03-03T12:14:25.000Z | 2021-05-19T10:01:36.000Z | runtime/standalone/src/benchmarking/chainlink_price_manager.rs | minterest-finance/minterest-chain-node | b932f0dfd3cda93a3de30e87c8463ad23116fea1 | [
"Apache-2.0"
] | 28 | 2021-03-02T08:09:08.000Z | 2021-07-27T10:52:46.000Z | runtime/standalone/src/benchmarking/chainlink_price_manager.rs | minterest-finance/minterest-chain-node | b932f0dfd3cda93a3de30e87c8463ad23116fea1 | [
"Apache-2.0"
] | 1 | 2021-07-07T11:33:50.000Z | 2021-07-07T11:33:50.000Z | use crate::Runtime;
use frame_system::RawOrigin;
use orml_benchmarking::runtime_benchmarks;
runtime_benchmarks! {
{ Runtime, chainlink_price_manager }
disable_feeding {
}: _(
RawOrigin::Root
)
enable_feeding {
}: _(
RawOrigin::Root
)
initiate_new_round {
}: _(
RawOrigin::None,
0, // feed_id
1 // round_id
)
}
#[cfg(test)]
mod tests {
use super::*;
use crate::benchmarking::utils::tests::test_externalities;
use frame_support::assert_ok;
#[test]
fn test_disable_feeding() {
test_externalities().execute_with(|| {
assert_ok!(test_benchmark_disable_feeding());
})
}
#[test]
fn test_enable_feeding() {
test_externalities().execute_with(|| {
assert_ok!(test_benchmark_enable_feeding());
})
}
#[test]
fn test_initiate_new_round() {
test_externalities().execute_with(|| {
assert_ok!(test_benchmark_initiate_new_round());
})
}
}
| 16.660377 | 59 | 0.697622 |
ebd806119e0282b4904d8f965b8972902af80d27 | 58 | css | CSS | src/ui-components/styled-hr/hr.css | DannyHeyes/personal-site-gatsby | 9e53dbb18acf2210fb0b751ba4d345e6b4613f73 | [
"RSA-MD"
] | null | null | null | src/ui-components/styled-hr/hr.css | DannyHeyes/personal-site-gatsby | 9e53dbb18acf2210fb0b751ba4d345e6b4613f73 | [
"RSA-MD"
] | 1 | 2021-12-07T12:35:03.000Z | 2021-12-07T12:35:03.000Z | src/ui-components/styled-hr/hr.css | DannyHeyes/personal-site-gatsby | 9e53dbb18acf2210fb0b751ba4d345e6b4613f73 | [
"RSA-MD"
] | null | null | null | hr {
border: none;
border-top: 2px solid #97979730;
}
| 11.6 | 34 | 0.637931 |
c696ffc0792f9f3bedb5ca987ed7e772c80141a3 | 3,845 | rs | Rust | fixed-uint-tests/tests/std_ops_shift.rs | EwoutH/rust-numext | 460bddb85b50687abb93dee71317c1dab1476b6b | [
"Apache-2.0",
"MIT"
] | 31 | 2019-01-10T13:52:56.000Z | 2022-03-09T07:55:29.000Z | fixed-uint-tests/tests/std_ops_shift.rs | EwoutH/rust-numext | 460bddb85b50687abb93dee71317c1dab1476b6b | [
"Apache-2.0",
"MIT"
] | 15 | 2019-01-02T03:12:55.000Z | 2021-09-16T06:24:26.000Z | fixed-uint-tests/tests/std_ops_shift.rs | EwoutH/rust-numext | 460bddb85b50687abb93dee71317c1dab1476b6b | [
"Apache-2.0",
"MIT"
] | 5 | 2018-11-06T04:05:51.000Z | 2018-12-24T09:44:13.000Z | // Copyright 2018-2019 Cryptape Technologies LLC.
//
// Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or
// http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your
// option. This file may not be copied, modified, or distributed
// except according to those terms.
#[macro_use]
extern crate proptest;
use nfuint_tests::props;
use proptest::prelude::any;
macro_rules! std_ops_shift {
($opr:tt, $bits:expr, $name:ident) => {
proptest! {
#[test]
fn $name(ref le in any::<props::U256LeBytes>()) {
let expected: props::U256LeBytes = {
let val: etypes::U256 = le.into();
let ret: etypes::U256 = val $opr $bits;
(&ret).into()
};
let result: props::U256LeBytes = {
let val: nfuint::U256 = le.into();
let ret: nfuint::U256 = val $opr $bits;
(&ret).into()
};
assert_eq!(expected, result);
}
}
};
}
macro_rules! std_ops_shift_neg {
(<<, $bits:expr, $name:ident) => {
std_ops_shift_neg!(<<, >>, $bits, $name);
};
(>>, $bits:expr, $name:ident) => {
std_ops_shift_neg!(<<, >>, $bits, $name);
};
($opr:tt, $opr_neg:tt, $bits:expr, $name:ident) => {
proptest! {
#[test]
fn $name(ref le in any::<props::U256LeBytes>()) {
let result: nfuint::U256 = {
let val: nfuint::U256 = le.into();
val $opr $bits
};
let expected: nfuint::U256 = {
let val: nfuint::U256 = le.into();
val $opr_neg $bits.abs()
};
assert_eq!(result, expected);
}
}
};
}
std_ops_shift!(<<, 0u8, ushl0);
std_ops_shift!(<<, 1u8, ushl1);
std_ops_shift!(<<, 7u16, ushl17);
std_ops_shift!(<<, 8u16, ushl18);
std_ops_shift!(<<, 31u32, ushl31);
std_ops_shift!(<<, 32u32, ushl32);
std_ops_shift!(<<, 129u64, ushl129);
std_ops_shift!(<<, 511u64, ushl511);
std_ops_shift!(<<, 513usize, ushl513);
std_ops_shift!(>>, 0u8, ushr0);
std_ops_shift!(>>, 1u8, ushr1);
std_ops_shift!(>>, 7u16, ushr7);
std_ops_shift!(>>, 8u16, ushr8);
std_ops_shift!(>>, 31u32, ushr31);
std_ops_shift!(>>, 32u32, ushr32);
std_ops_shift!(>>, 129u64, ushr129);
std_ops_shift!(>>, 511u64, ushr511);
std_ops_shift!(>>, 513usize, ushr513);
std_ops_shift!(<<, 0i8, ishl0);
std_ops_shift!(<<, 1i8, ishl1);
std_ops_shift!(<<, 7i16, ishl17);
std_ops_shift!(<<, 8i16, ishl18);
std_ops_shift!(<<, 31i32, ishl31);
std_ops_shift!(<<, 32i32, ishl32);
std_ops_shift!(<<, 129i64, ishl129);
std_ops_shift!(<<, 511i64, ishl511);
std_ops_shift!(<<, 513isize, ishl513);
std_ops_shift!(>>, 0i8, ishr0);
std_ops_shift!(>>, 1i8, ishr1);
std_ops_shift!(>>, 7i16, ishr7);
std_ops_shift!(>>, 8i16, ishr8);
std_ops_shift!(>>, 31i32, ishr31);
std_ops_shift!(>>, 32i32, ishr32);
std_ops_shift!(>>, 129i64, ishr129);
std_ops_shift!(>>, 511i64, ishr511);
std_ops_shift!(>>, 513isize, ishr513);
std_ops_shift_neg!(<<, -1i8, nishl1);
std_ops_shift_neg!(<<, -7i16, nishl17);
std_ops_shift_neg!(<<, -8i16, nishl18);
std_ops_shift_neg!(<<, -31i32, nishl31);
std_ops_shift_neg!(<<, -32i32, nishl32);
std_ops_shift_neg!(<<, -129i64, nishl129);
std_ops_shift_neg!(<<, -511i64, nishl511);
std_ops_shift_neg!(<<, -513isize, nishl513);
std_ops_shift_neg!(>>, -1i8, nishr1);
std_ops_shift_neg!(>>, -7i16, nishr7);
std_ops_shift_neg!(>>, -8i16, nishr8);
std_ops_shift_neg!(>>, -31i32, nishr31);
std_ops_shift_neg!(>>, -32i32, nishr32);
std_ops_shift_neg!(>>, -129i64, nishr129);
std_ops_shift_neg!(>>, -511i64, nishr511);
std_ops_shift_neg!(>>, -513isize, nishr513);
| 32.584746 | 68 | 0.586736 |