hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
958k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f71d63cc7c9ddb1abda047591af6a10facfba083
1,119
py
Python
Web/Python/paraview/web/camera.py
qiangwushuang/ParaView
f35ed90a6582e9d21924b66a905498f6a38ab4a3
[ "Apache-2.0", "BSD-3-Clause" ]
2
2021-07-07T22:53:19.000Z
2021-07-31T19:29:35.000Z
Web/Python/paraview/web/camera.py
qiangwushuang/ParaView
f35ed90a6582e9d21924b66a905498f6a38ab4a3
[ "Apache-2.0", "BSD-3-Clause" ]
2
2020-11-18T16:50:34.000Z
2022-01-21T13:31:47.000Z
Web/Python/paraview/web/camera.py
qiangwushuang/ParaView
f35ed90a6582e9d21924b66a905498f6a38ab4a3
[ "Apache-2.0", "BSD-3-Clause" ]
5
2020-10-02T10:14:35.000Z
2022-03-10T07:50:22.000Z
from paraview import simple from vtk.web import camera def update_camera(viewProxy, cameraData): viewProxy.CameraFocalPoint = cameraData['focalPoint'] viewProxy.CameraPosition = cameraData['position'] viewProxy.CameraViewUp = cameraData['viewUp'] simple.Render(viewProxy) def create_spherical_camera(viewProxy, dataHandler, phiValues, thetaValues): return camera.SphericalCamera(dataHandler, viewProxy.CenterOfRotation, viewProxy.CameraPosition, viewProxy.CameraViewUp, phiValues, thetaValues) def create_cylindrical_camera(viewProxy, dataHandler, phiValues, translationValues): return camera.CylindricalCamera(dataHandler, viewProxy.CenterOfRotation, viewProxy.CameraPosition, viewProxy.CameraViewUp, phiValues, translationValues) def create_cube_camera(viewProxy, dataHandler, viewForward, viewUp, positions): return camera.CubeCamera(dataHandler, viewForward, viewUp, positions) def create_stereo_cube_camera(viewProxy, dataHandler, viewForward, viewUp, positions, eyeSeparation = 6.5): return camera.StereoCubeCamera(dataHandler, viewForward, viewUp, positions, eyeSeparation)
53.285714
156
0.822163
from paraview import simple from vtk.web import camera def update_camera(viewProxy, cameraData): viewProxy.CameraFocalPoint = cameraData['focalPoint'] viewProxy.CameraPosition = cameraData['position'] viewProxy.CameraViewUp = cameraData['viewUp'] simple.Render(viewProxy) def create_spherical_camera(viewProxy, dataHandler, phiValues, thetaValues): return camera.SphericalCamera(dataHandler, viewProxy.CenterOfRotation, viewProxy.CameraPosition, viewProxy.CameraViewUp, phiValues, thetaValues) def create_cylindrical_camera(viewProxy, dataHandler, phiValues, translationValues): return camera.CylindricalCamera(dataHandler, viewProxy.CenterOfRotation, viewProxy.CameraPosition, viewProxy.CameraViewUp, phiValues, translationValues) def create_cube_camera(viewProxy, dataHandler, viewForward, viewUp, positions): return camera.CubeCamera(dataHandler, viewForward, viewUp, positions) def create_stereo_cube_camera(viewProxy, dataHandler, viewForward, viewUp, positions, eyeSeparation = 6.5): return camera.StereoCubeCamera(dataHandler, viewForward, viewUp, positions, eyeSeparation)
true
true
f71d643bcaead34b7c38c908b32114c9c2c37e08
5,835
py
Python
shell/bii.py
bowlofstew/client
0d5ae42aaf9863e3871828b6df06170aad17c560
[ "MIT" ]
40
2015-04-15T09:40:23.000Z
2022-02-11T11:07:24.000Z
shell/bii.py
bowlofstew/client
0d5ae42aaf9863e3871828b6df06170aad17c560
[ "MIT" ]
19
2015-04-15T18:34:53.000Z
2018-11-17T00:11:05.000Z
shell/bii.py
bowlofstew/client
0d5ae42aaf9863e3871828b6df06170aad17c560
[ "MIT" ]
22
2015-04-15T09:45:46.000Z
2020-09-29T17:04:19.000Z
import sys import os import shlex import traceback from biicode.client.command.executor import ToolExecutor from biicode.client.command.tool_catalog import ToolCatalog from biicode.common.exception import BiiException from biicode.client.shell.userio import UserIO from biicode.common.utils.bii_logging import logger from biicode.client.command.biicommand import BiiCommand from biicode.client.dev.cpp.cpptoolchain import CPPToolChain from biicode.client.shell.biistream import BiiOutputStream from biicode.common.output_stream import OutputStream, INFO from biicode.client.setups.setup_commands import SetupCommands from biicode.client.dev.hardware.raspberry_pi.rpitoolchain import RPiToolChain from biicode.client.dev.hardware.arduino.arduinotoolchain import ArduinoToolChain from biicode.client.shell.updates_manager import UpdatesStore, UpdatesManager from biicode.common.model.server_info import ClientVersion from biicode.client.exception import ObsoleteClient from biicode.client.conf import BII_RESTURL from biicode.client.rest.bii_rest_api_client import BiiRestApiClient from biicode.client.dev.node.nodetoolchain import NodeToolChain from biicode.client.workspace.bii_paths import BiiPaths from biicode.client.workspace.hive_disk_image import HiveDiskImage from biicode.client.workspace.user_cache import UserCache class Bii(object): '''Entry point class for bii executable''' def __init__(self, user_io, current_folder, user_biicode_folder): self.user_io = user_io self.bii_paths = BiiPaths(current_folder, user_biicode_folder) self.user_cache = UserCache(self.bii_paths.user_bii_home) toolcatalog = ToolCatalog(BiiCommand, tools=[CPPToolChain, RPiToolChain, SetupCommands, ArduinoToolChain, NodeToolChain]) self.executor = ToolExecutor(self, toolcatalog) self._biiapi = None @property def hive_disk_image(self): # not able to keep it persistent, as tests make a database locked operational error return HiveDiskImage(self.bii_paths, self.user_cache, self.user_io.out) @property def biiapi(self): if self._biiapi is None: from biicode.client.api.biiapi_proxy import BiiAPIProxy from biicode.client.api.biiapi_auth_manager import BiiApiAuthManager auth_manager = BiiApiAuthManager(self._restapi, self.user_io, self.user_cache.localdb) self._biiapi = BiiAPIProxy(self.user_cache.localdb, auth_manager, self.user_io) return self._biiapi @property def _restapi(self): return BiiRestApiClient(BII_RESTURL) def execute(self, argv): '''Executes user provided command. Eg. bii run:cpp''' errors = False try: if isinstance(argv, basestring): # To make tests easier to write argv = shlex.split(argv) self.executor.execute(argv) # Executor only raises not expected Exceptions except (KeyboardInterrupt, SystemExit) as e: logger.debug('Execution terminated: %s', e) errors = True except BiiException as e: errors = True self.user_io.out.error(str(e)) except Exception as e: tb = traceback.format_exc() logger.error(tb) errors = True self.user_io.out.error('Unexpected Exception\n %s' % e) self.user_io.out.error('Error executing command.\n' '\tCheck the documentation in http://docs.biicode.com\n' '\tor ask in the forum http://forum.biicode.com\n') return errors def run_main(args, user_io=None, current_folder=None, user_folder=None, biiapi_client=None): try: user_folder = user_folder or os.path.expanduser("~") biicode_folder = os.path.join(user_folder, '.biicode') current_folder = current_folder or os.getcwd() user_io = user_io or create_user_io(biicode_folder) bii = Bii(user_io, current_folder, biicode_folder) # Update manager doesn't need proxy nor authentication to call get_server_info biiapi_client = biiapi_client or bii.biiapi updates_manager = get_updates_manager(biiapi_client, biicode_folder) try: # Check for updates updates_manager.check_for_updates(bii.user_io.out) except ObsoleteClient as e: bii.user_io.out.error(e.message) return int(True) errors = bii.execute(args) return int(errors) except OSError as e: print str(e) return 1 def create_user_io(biicode_folder): """Creates the bii folder and init user_io with outputstream and logfile""" try: os.makedirs(biicode_folder) except: pass log_file = os.path.join(biicode_folder, 'bii.log') if hasattr(sys.stdout, "isatty") and sys.stdout.isatty(): from colorama import init init() OutputStream.color = True user_io = UserIO(sys.stdin, BiiOutputStream(sys.stdout, log_file, level=INFO)) return user_io def get_updates_manager(biiapi, biicode_folder): file_store = os.path.join(biicode_folder, ".remote_version_info") updates_store = UpdatesStore(file_store) current_client = ClientVersion(get_current_client_version()) manager = UpdatesManager(updates_store, biiapi, current_client) return manager def get_current_client_version(): from biicode.common import __version__ as current_version return current_version def main(args): error = run_main(args) sys.exit(error) if __name__ == '__main__': main(sys.argv[1:])
39.693878
98
0.688775
import sys import os import shlex import traceback from biicode.client.command.executor import ToolExecutor from biicode.client.command.tool_catalog import ToolCatalog from biicode.common.exception import BiiException from biicode.client.shell.userio import UserIO from biicode.common.utils.bii_logging import logger from biicode.client.command.biicommand import BiiCommand from biicode.client.dev.cpp.cpptoolchain import CPPToolChain from biicode.client.shell.biistream import BiiOutputStream from biicode.common.output_stream import OutputStream, INFO from biicode.client.setups.setup_commands import SetupCommands from biicode.client.dev.hardware.raspberry_pi.rpitoolchain import RPiToolChain from biicode.client.dev.hardware.arduino.arduinotoolchain import ArduinoToolChain from biicode.client.shell.updates_manager import UpdatesStore, UpdatesManager from biicode.common.model.server_info import ClientVersion from biicode.client.exception import ObsoleteClient from biicode.client.conf import BII_RESTURL from biicode.client.rest.bii_rest_api_client import BiiRestApiClient from biicode.client.dev.node.nodetoolchain import NodeToolChain from biicode.client.workspace.bii_paths import BiiPaths from biicode.client.workspace.hive_disk_image import HiveDiskImage from biicode.client.workspace.user_cache import UserCache class Bii(object): '''Entry point class for bii executable''' def __init__(self, user_io, current_folder, user_biicode_folder): self.user_io = user_io self.bii_paths = BiiPaths(current_folder, user_biicode_folder) self.user_cache = UserCache(self.bii_paths.user_bii_home) toolcatalog = ToolCatalog(BiiCommand, tools=[CPPToolChain, RPiToolChain, SetupCommands, ArduinoToolChain, NodeToolChain]) self.executor = ToolExecutor(self, toolcatalog) self._biiapi = None @property def hive_disk_image(self): return HiveDiskImage(self.bii_paths, self.user_cache, self.user_io.out) @property def biiapi(self): if self._biiapi is None: from biicode.client.api.biiapi_proxy import BiiAPIProxy from biicode.client.api.biiapi_auth_manager import BiiApiAuthManager auth_manager = BiiApiAuthManager(self._restapi, self.user_io, self.user_cache.localdb) self._biiapi = BiiAPIProxy(self.user_cache.localdb, auth_manager, self.user_io) return self._biiapi @property def _restapi(self): return BiiRestApiClient(BII_RESTURL) def execute(self, argv): '''Executes user provided command. Eg. bii run:cpp''' errors = False try: if isinstance(argv, basestring): argv = shlex.split(argv) self.executor.execute(argv) except (KeyboardInterrupt, SystemExit) as e: logger.debug('Execution terminated: %s', e) errors = True except BiiException as e: errors = True self.user_io.out.error(str(e)) except Exception as e: tb = traceback.format_exc() logger.error(tb) errors = True self.user_io.out.error('Unexpected Exception\n %s' % e) self.user_io.out.error('Error executing command.\n' '\tCheck the documentation in http://docs.biicode.com\n' '\tor ask in the forum http://forum.biicode.com\n') return errors def run_main(args, user_io=None, current_folder=None, user_folder=None, biiapi_client=None): try: user_folder = user_folder or os.path.expanduser("~") biicode_folder = os.path.join(user_folder, '.biicode') current_folder = current_folder or os.getcwd() user_io = user_io or create_user_io(biicode_folder) bii = Bii(user_io, current_folder, biicode_folder) biiapi_client = biiapi_client or bii.biiapi updates_manager = get_updates_manager(biiapi_client, biicode_folder) try: # Check for updates updates_manager.check_for_updates(bii.user_io.out) except ObsoleteClient as e: bii.user_io.out.error(e.message) return int(True) errors = bii.execute(args) return int(errors) except OSError as e: print str(e) return 1 def create_user_io(biicode_folder): """Creates the bii folder and init user_io with outputstream and logfile""" try: os.makedirs(biicode_folder) except: pass log_file = os.path.join(biicode_folder, 'bii.log') if hasattr(sys.stdout, "isatty") and sys.stdout.isatty(): from colorama import init init() OutputStream.color = True user_io = UserIO(sys.stdin, BiiOutputStream(sys.stdout, log_file, level=INFO)) return user_io def get_updates_manager(biiapi, biicode_folder): file_store = os.path.join(biicode_folder, ".remote_version_info") updates_store = UpdatesStore(file_store) current_client = ClientVersion(get_current_client_version()) manager = UpdatesManager(updates_store, biiapi, current_client) return manager def get_current_client_version(): from biicode.common import __version__ as current_version return current_version def main(args): error = run_main(args) sys.exit(error) if __name__ == '__main__': main(sys.argv[1:])
false
true
f71d6480f5768061a17266b485d534816caa4c41
3,535
py
Python
callbacks.py
WHATDOESTHEFOXSAY2U/Colab_Train
393269fe0fdf6c175926f485e7dfaf653a3686f3
[ "Apache-2.0" ]
8
2017-09-17T03:20:20.000Z
2020-10-16T03:07:39.000Z
callbacks.py
navtosh-das/automatic-essay-grader-master
30fdf2f9f72fbef51447ecc91070189ccca301b2
[ "Apache-2.0" ]
4
2020-02-26T00:16:29.000Z
2022-02-26T05:19:48.000Z
callbacks.py
navtosh-das/automatic-essay-grader-master
30fdf2f9f72fbef51447ecc91070189ccca301b2
[ "Apache-2.0" ]
4
2017-08-31T20:05:44.000Z
2018-10-21T20:09:43.000Z
""" Contains custom callbacks. """ from constants import minimum_scores, maximum_scores import constants import datetime import json from keras.callbacks import Callback, ModelCheckpoint import numpy as np import os from sklearn.metrics import cohen_kappa_score from util import process_data, create_folder class QWKScore(Callback): def __init__(self, essays, save_to_file=True, print_to_screen=True): super() self.essays = essays self.save_to_file = save_to_file self.print_to_screen = print_to_screen def on_epoch_end(self, epoch, logs={}): # for each essay set calculate the QWK scores qwk_scores = [] number_essays = [] if self.print_to_screen: print("\nQWK Scores") for essay_set in range(1, 9): essays_in_set = self.essays[self.essays['essay_set'] == essay_set] X, y = process_data(essays_in_set) y_true = essays_in_set['domain1_score'].values normalised_prediction = self.model.predict(X) normalised_prediction = np.array(normalised_prediction) y_pred = np.around((normalised_prediction * (maximum_scores[essay_set] - minimum_scores[essay_set])) + minimum_scores[essay_set]) qwk_score = cohen_kappa_score(y_true, y_pred, weights='quadratic') qwk_scores.append(qwk_score) number_essays.append(len(essays_in_set)) if self.print_to_screen: print("Set {}: {:.2f}".format(essay_set, qwk_score), end=' ') qwk_scores = np.array(qwk_scores) number_essays = np.array(number_essays) weighted_qwk_score = np.sum(qwk_scores * number_essays) / np.sum(number_essays) if self.print_to_screen: print('\nWeighted QWK score: {:.2f}'.format(weighted_qwk_score)) if self.save_to_file: summary = "Epoch " + str(epoch + 1) log_values = "\n" for key, value in logs.items(): log_values += "{}: {:.4f} ".format(key, value) individual_qwk_scores = "\n" for essay_set in range(8): individual_qwk_scores += "Set {}: {:.2f} ".format(essay_set + 1, qwk_scores[essay_set]) summary = summary + log_values + individual_qwk_scores summary += '\nWeighted QWK score: {:.2f}'.format(weighted_qwk_score) summary += '\n\n' with open(os.path.join(constants.SAVE_DIR, "scores.txt"), "a") as f: f.write(summary) class SaveModel(ModelCheckpoint): """ Wrapper of Model Checkpoint class. """ def __init__(self, directory, filename, monitor='val_loss', verbose=0, save_best_only=False, save_weights_only=False, mode='auto', period=1): # make folder with the current time as name now = datetime.datetime.now() current_time = "{}_{}_{}_{}_{}_{}".format(now.day, now.month, now.year, now.hour, now.minute, now.second) constants.SAVE_DIR = os.path.join(directory, current_time) create_folder(constants.SAVE_DIR) ModelCheckpoint.__init__(self, os.path.join(constants.SAVE_DIR, filename), monitor=monitor, save_best_only=save_best_only, save_weights_only=save_weights_only, mode=mode, period=period) def on_train_begin(self, logs=None): # save model architecture. parsed = json.loads(self.model.to_json()) with open(os.path.join(constants.SAVE_DIR, 'model.txt'), 'w') as file: file.write(json.dumps(parsed, indent=4))
40.632184
193
0.648656
from constants import minimum_scores, maximum_scores import constants import datetime import json from keras.callbacks import Callback, ModelCheckpoint import numpy as np import os from sklearn.metrics import cohen_kappa_score from util import process_data, create_folder class QWKScore(Callback): def __init__(self, essays, save_to_file=True, print_to_screen=True): super() self.essays = essays self.save_to_file = save_to_file self.print_to_screen = print_to_screen def on_epoch_end(self, epoch, logs={}): qwk_scores = [] number_essays = [] if self.print_to_screen: print("\nQWK Scores") for essay_set in range(1, 9): essays_in_set = self.essays[self.essays['essay_set'] == essay_set] X, y = process_data(essays_in_set) y_true = essays_in_set['domain1_score'].values normalised_prediction = self.model.predict(X) normalised_prediction = np.array(normalised_prediction) y_pred = np.around((normalised_prediction * (maximum_scores[essay_set] - minimum_scores[essay_set])) + minimum_scores[essay_set]) qwk_score = cohen_kappa_score(y_true, y_pred, weights='quadratic') qwk_scores.append(qwk_score) number_essays.append(len(essays_in_set)) if self.print_to_screen: print("Set {}: {:.2f}".format(essay_set, qwk_score), end=' ') qwk_scores = np.array(qwk_scores) number_essays = np.array(number_essays) weighted_qwk_score = np.sum(qwk_scores * number_essays) / np.sum(number_essays) if self.print_to_screen: print('\nWeighted QWK score: {:.2f}'.format(weighted_qwk_score)) if self.save_to_file: summary = "Epoch " + str(epoch + 1) log_values = "\n" for key, value in logs.items(): log_values += "{}: {:.4f} ".format(key, value) individual_qwk_scores = "\n" for essay_set in range(8): individual_qwk_scores += "Set {}: {:.2f} ".format(essay_set + 1, qwk_scores[essay_set]) summary = summary + log_values + individual_qwk_scores summary += '\nWeighted QWK score: {:.2f}'.format(weighted_qwk_score) summary += '\n\n' with open(os.path.join(constants.SAVE_DIR, "scores.txt"), "a") as f: f.write(summary) class SaveModel(ModelCheckpoint): def __init__(self, directory, filename, monitor='val_loss', verbose=0, save_best_only=False, save_weights_only=False, mode='auto', period=1): now = datetime.datetime.now() current_time = "{}_{}_{}_{}_{}_{}".format(now.day, now.month, now.year, now.hour, now.minute, now.second) constants.SAVE_DIR = os.path.join(directory, current_time) create_folder(constants.SAVE_DIR) ModelCheckpoint.__init__(self, os.path.join(constants.SAVE_DIR, filename), monitor=monitor, save_best_only=save_best_only, save_weights_only=save_weights_only, mode=mode, period=period) def on_train_begin(self, logs=None): parsed = json.loads(self.model.to_json()) with open(os.path.join(constants.SAVE_DIR, 'model.txt'), 'w') as file: file.write(json.dumps(parsed, indent=4))
true
true
f71d64ae1faeafbcfe3e3258855aea0147730782
87
py
Python
fandogh_cli/__init__.py
behroozmirzaie7/fandogh-cli
e23d5c761a85b539b1c5f80bd9c6fd7bd2e5f9f0
[ "MIT" ]
131
2018-05-14T21:00:40.000Z
2022-03-29T10:00:54.000Z
fandogh_cli/__init__.py
behroozmirzaie7/fandogh-cli
e23d5c761a85b539b1c5f80bd9c6fd7bd2e5f9f0
[ "MIT" ]
130
2018-05-14T19:43:18.000Z
2021-08-28T08:52:04.000Z
fandogh_cli/__init__.py
behroozmirzaie7/fandogh-cli
e23d5c761a85b539b1c5f80bd9c6fd7bd2e5f9f0
[ "MIT" ]
37
2018-05-15T05:59:56.000Z
2022-03-08T05:26:54.000Z
VERSION = "1.21.3" NAME = "fandogh_cli" if __name__ == "__main__": print(VERSION)
14.5
26
0.643678
VERSION = "1.21.3" NAME = "fandogh_cli" if __name__ == "__main__": print(VERSION)
true
true
f71d650791f7f46ff04b43e0175f98b5c704dac5
7,390
py
Python
main.py
hujunxianligong/Graph-U-Nets
d1a483400131fbe75a55cff27439585c62c4a575
[ "MIT" ]
1
2021-01-03T09:23:41.000Z
2021-01-03T09:23:41.000Z
main.py
hujunxianligong/Graph-U-Nets
d1a483400131fbe75a55cff27439585c62c4a575
[ "MIT" ]
null
null
null
main.py
hujunxianligong/Graph-U-Nets
d1a483400131fbe75a55cff27439585c62c4a575
[ "MIT" ]
null
null
null
import sys import os import torch import random import numpy as np from tqdm import tqdm import torch.nn as nn import torch.optim as optim import math from network import GUNet from mlp_dropout import MLPClassifier from sklearn import metrics from util import cmd_args, load_data sys.path.append( '%s/pytorch_structure2vec-master/s2v_lib' % os.path.dirname( os.path.realpath(__file__))) class Classifier(nn.Module): def __init__(self): super(Classifier, self).__init__() model = GUNet self.s2v = model( latent_dim=cmd_args.latent_dim, output_dim=cmd_args.out_dim, num_node_feats=cmd_args.feat_dim+cmd_args.attr_dim, num_edge_feats=0, k=cmd_args.sortpooling_k) out_dim = cmd_args.out_dim if out_dim == 0: out_dim = self.s2v.dense_dim self.mlp = MLPClassifier( input_size=out_dim, hidden_size=cmd_args.hidden, num_class=cmd_args.num_class, with_dropout=cmd_args.dropout) def PrepareFeatureLabel(self, batch_graph): labels = torch.LongTensor(len(batch_graph)) n_nodes = 0 if batch_graph[0].node_tags is not None: node_tag_flag = True concat_tag = [] else: node_tag_flag = False if batch_graph[0].node_features is not None: node_feat_flag = True concat_feat = [] else: node_feat_flag = False for i in range(len(batch_graph)): labels[i] = batch_graph[i].label n_nodes += batch_graph[i].num_nodes if node_tag_flag: concat_tag += batch_graph[i].node_tags if node_feat_flag: tmp = torch.from_numpy( batch_graph[i].node_features).type('torch.FloatTensor') concat_feat.append(tmp) if node_tag_flag: concat_tag = torch.LongTensor(concat_tag).view(-1, 1) node_tag = torch.zeros(n_nodes, cmd_args.feat_dim) node_tag.scatter_(1, concat_tag, 1) if node_feat_flag: node_feat = torch.cat(concat_feat, 0) if node_feat_flag and node_tag_flag: # concatenate one-hot embedding of node tags (node labels) # with continuous node features node_feat = torch.cat([node_tag.type_as(node_feat), node_feat], 1) elif node_feat_flag is False and node_tag_flag: node_feat = node_tag elif node_feat_flag and node_tag_flag is False: pass else: node_feat = torch.ones(n_nodes, 1) if cmd_args.mode == 'gpu': node_feat = node_feat.cuda() labels = labels.cuda() return node_feat, labels def forward(self, batch_graph): node_feat, labels = self.PrepareFeatureLabel(batch_graph) embed = self.s2v(batch_graph, node_feat, None) return self.mlp(embed, labels) def output_features(self, batch_graph): node_feat, labels = self.PrepareFeatureLabel(batch_graph) embed = self.s2v(batch_graph, node_feat, None) return embed, labels def loop_dataset(g_list, classifier, sample_idxes, optimizer=None, bsize=cmd_args.batch_size): total_loss = [] total_iters = (len(sample_idxes) + (bsize - 1) * (optimizer is None)) // bsize # noqa pbar = tqdm(range(total_iters), unit='batch') all_targets = [] all_scores = [] n_samples = 0 for pos in pbar: selected_idx = sample_idxes[pos * bsize: (pos + 1) * bsize] batch_graph = [g_list[idx] for idx in selected_idx] targets = [g_list[idx].label for idx in selected_idx] all_targets += targets logits, loss, acc = classifier(batch_graph) all_scores.append(logits[:, 1].detach()) # for binary classification if optimizer is not None: optimizer.zero_grad() loss.backward() optimizer.step() loss = loss.data.cpu().numpy() pbar.set_description('loss: %0.5f acc: %0.5f' % (loss, acc)) total_loss.append(np.array([loss, acc]) * len(selected_idx)) n_samples += len(selected_idx) if optimizer is None: assert n_samples == len(sample_idxes) total_loss = np.array(total_loss) avg_loss = np.sum(total_loss, 0) / n_samples all_scores = torch.cat(all_scores).cpu().numpy() # np.savetxt('test_scores.txt', all_scores) # output test predictions all_targets = np.array(all_targets) fpr, tpr, _ = metrics.roc_curve(all_targets, all_scores, pos_label=1) auc = metrics.auc(fpr, tpr) avg_loss = np.concatenate((avg_loss, [auc])) return avg_loss if __name__ == '__main__': print(cmd_args) random.seed(cmd_args.seed) np.random.seed(cmd_args.seed) torch.manual_seed(cmd_args.seed) train_graphs, test_graphs = load_data() print('# train: %d, # test: %d' % (len(train_graphs), len(test_graphs))) if cmd_args.sortpooling_k <= 1: num_nodes_list = sorted([ g.num_nodes for g in train_graphs + test_graphs]) cmd_args.sortpooling_k = num_nodes_list[ int(math.ceil(cmd_args.sortpooling_k * len(num_nodes_list))) - 1] cmd_args.sortpooling_k = max(10, cmd_args.sortpooling_k) print('k used in SortPooling is: ' + str(cmd_args.sortpooling_k)) classifier = Classifier() if cmd_args.mode == 'gpu': classifier = classifier.cuda() optimizer = optim.Adam( classifier.parameters(), lr=cmd_args.learning_rate, amsgrad=True, weight_decay=0.0008) train_idxes = list(range(len(train_graphs))) best_loss = None max_acc = 0.0 for epoch in range(cmd_args.num_epochs): random.shuffle(train_idxes) classifier.train() avg_loss = loop_dataset( train_graphs, classifier, train_idxes, optimizer=optimizer) if not cmd_args.printAUC: avg_loss[2] = 0.0 print('\033[92maverage training of epoch %d: loss %.5f acc %.5f auc %.5f\033[0m' % (epoch, avg_loss[0], avg_loss[1], avg_loss[2])) # noqa classifier.eval() test_loss = loop_dataset( test_graphs, classifier, list(range(len(test_graphs)))) if not cmd_args.printAUC: test_loss[2] = 0.0 print('\033[93maverage test of epoch %d: loss %.5f acc %.5f auc %.5f\033[0m' % (epoch, test_loss[0], test_loss[1], test_loss[2])) # noqa max_acc = max(max_acc, test_loss[1]) with open('acc_result_%s.txt' % cmd_args.data, 'a+') as f: # f.write(str(test_loss[1]) + '\n') f.write(str(max_acc) + '\n') if cmd_args.printAUC: with open('auc_results.txt', 'a+') as f: f.write(str(test_loss[2]) + '\n') if cmd_args.extract_features: features, labels = classifier.output_features(train_graphs) labels = labels.type('torch.FloatTensor') np.savetxt('extracted_features_train.txt', torch.cat( [labels.unsqueeze(1), features.cpu()], dim=1).detach().numpy(), '%.4f') features, labels = classifier.output_features(test_graphs) labels = labels.type('torch.FloatTensor') np.savetxt('extracted_features_test.txt', torch.cat( [labels.unsqueeze(1), features.cpu()], dim=1).detach().numpy(), '%.4f')
35.023697
145
0.625304
import sys import os import torch import random import numpy as np from tqdm import tqdm import torch.nn as nn import torch.optim as optim import math from network import GUNet from mlp_dropout import MLPClassifier from sklearn import metrics from util import cmd_args, load_data sys.path.append( '%s/pytorch_structure2vec-master/s2v_lib' % os.path.dirname( os.path.realpath(__file__))) class Classifier(nn.Module): def __init__(self): super(Classifier, self).__init__() model = GUNet self.s2v = model( latent_dim=cmd_args.latent_dim, output_dim=cmd_args.out_dim, num_node_feats=cmd_args.feat_dim+cmd_args.attr_dim, num_edge_feats=0, k=cmd_args.sortpooling_k) out_dim = cmd_args.out_dim if out_dim == 0: out_dim = self.s2v.dense_dim self.mlp = MLPClassifier( input_size=out_dim, hidden_size=cmd_args.hidden, num_class=cmd_args.num_class, with_dropout=cmd_args.dropout) def PrepareFeatureLabel(self, batch_graph): labels = torch.LongTensor(len(batch_graph)) n_nodes = 0 if batch_graph[0].node_tags is not None: node_tag_flag = True concat_tag = [] else: node_tag_flag = False if batch_graph[0].node_features is not None: node_feat_flag = True concat_feat = [] else: node_feat_flag = False for i in range(len(batch_graph)): labels[i] = batch_graph[i].label n_nodes += batch_graph[i].num_nodes if node_tag_flag: concat_tag += batch_graph[i].node_tags if node_feat_flag: tmp = torch.from_numpy( batch_graph[i].node_features).type('torch.FloatTensor') concat_feat.append(tmp) if node_tag_flag: concat_tag = torch.LongTensor(concat_tag).view(-1, 1) node_tag = torch.zeros(n_nodes, cmd_args.feat_dim) node_tag.scatter_(1, concat_tag, 1) if node_feat_flag: node_feat = torch.cat(concat_feat, 0) if node_feat_flag and node_tag_flag: node_feat = torch.cat([node_tag.type_as(node_feat), node_feat], 1) elif node_feat_flag is False and node_tag_flag: node_feat = node_tag elif node_feat_flag and node_tag_flag is False: pass else: node_feat = torch.ones(n_nodes, 1) if cmd_args.mode == 'gpu': node_feat = node_feat.cuda() labels = labels.cuda() return node_feat, labels def forward(self, batch_graph): node_feat, labels = self.PrepareFeatureLabel(batch_graph) embed = self.s2v(batch_graph, node_feat, None) return self.mlp(embed, labels) def output_features(self, batch_graph): node_feat, labels = self.PrepareFeatureLabel(batch_graph) embed = self.s2v(batch_graph, node_feat, None) return embed, labels def loop_dataset(g_list, classifier, sample_idxes, optimizer=None, bsize=cmd_args.batch_size): total_loss = [] total_iters = (len(sample_idxes) + (bsize - 1) * (optimizer is None)) // bsize pbar = tqdm(range(total_iters), unit='batch') all_targets = [] all_scores = [] n_samples = 0 for pos in pbar: selected_idx = sample_idxes[pos * bsize: (pos + 1) * bsize] batch_graph = [g_list[idx] for idx in selected_idx] targets = [g_list[idx].label for idx in selected_idx] all_targets += targets logits, loss, acc = classifier(batch_graph) all_scores.append(logits[:, 1].detach()) if optimizer is not None: optimizer.zero_grad() loss.backward() optimizer.step() loss = loss.data.cpu().numpy() pbar.set_description('loss: %0.5f acc: %0.5f' % (loss, acc)) total_loss.append(np.array([loss, acc]) * len(selected_idx)) n_samples += len(selected_idx) if optimizer is None: assert n_samples == len(sample_idxes) total_loss = np.array(total_loss) avg_loss = np.sum(total_loss, 0) / n_samples all_scores = torch.cat(all_scores).cpu().numpy() ray(all_targets) fpr, tpr, _ = metrics.roc_curve(all_targets, all_scores, pos_label=1) auc = metrics.auc(fpr, tpr) avg_loss = np.concatenate((avg_loss, [auc])) return avg_loss if __name__ == '__main__': print(cmd_args) random.seed(cmd_args.seed) np.random.seed(cmd_args.seed) torch.manual_seed(cmd_args.seed) train_graphs, test_graphs = load_data() print('# train: %d, # test: %d' % (len(train_graphs), len(test_graphs))) if cmd_args.sortpooling_k <= 1: num_nodes_list = sorted([ g.num_nodes for g in train_graphs + test_graphs]) cmd_args.sortpooling_k = num_nodes_list[ int(math.ceil(cmd_args.sortpooling_k * len(num_nodes_list))) - 1] cmd_args.sortpooling_k = max(10, cmd_args.sortpooling_k) print('k used in SortPooling is: ' + str(cmd_args.sortpooling_k)) classifier = Classifier() if cmd_args.mode == 'gpu': classifier = classifier.cuda() optimizer = optim.Adam( classifier.parameters(), lr=cmd_args.learning_rate, amsgrad=True, weight_decay=0.0008) train_idxes = list(range(len(train_graphs))) best_loss = None max_acc = 0.0 for epoch in range(cmd_args.num_epochs): random.shuffle(train_idxes) classifier.train() avg_loss = loop_dataset( train_graphs, classifier, train_idxes, optimizer=optimizer) if not cmd_args.printAUC: avg_loss[2] = 0.0 print('\033[92maverage training of epoch %d: loss %.5f acc %.5f auc %.5f\033[0m' % (epoch, avg_loss[0], avg_loss[1], avg_loss[2])) classifier.eval() test_loss = loop_dataset( test_graphs, classifier, list(range(len(test_graphs)))) if not cmd_args.printAUC: test_loss[2] = 0.0 print('\033[93maverage test of epoch %d: loss %.5f acc %.5f auc %.5f\033[0m' % (epoch, test_loss[0], test_loss[1], test_loss[2])) max_acc = max(max_acc, test_loss[1]) with open('acc_result_%s.txt' % cmd_args.data, 'a+') as f: f.write(str(max_acc) + '\n') if cmd_args.printAUC: with open('auc_results.txt', 'a+') as f: f.write(str(test_loss[2]) + '\n') if cmd_args.extract_features: features, labels = classifier.output_features(train_graphs) labels = labels.type('torch.FloatTensor') np.savetxt('extracted_features_train.txt', torch.cat( [labels.unsqueeze(1), features.cpu()], dim=1).detach().numpy(), '%.4f') features, labels = classifier.output_features(test_graphs) labels = labels.type('torch.FloatTensor') np.savetxt('extracted_features_test.txt', torch.cat( [labels.unsqueeze(1), features.cpu()], dim=1).detach().numpy(), '%.4f')
true
true
f71d65ca0d14c5df4be828df9a38fc4cf62124f4
1,636
py
Python
python_developer_tools/cv/classes/ResNeXt.py
carlsummer/python_developer_tools
a8c4365b7cc601cda55648cdfd8c0cb1faae132f
[ "Apache-2.0" ]
32
2021-06-21T04:49:48.000Z
2022-03-29T05:46:59.000Z
python_developer_tools/cv/classes/ResNeXt.py
HonestyBrave/python_developer_tools
fc0dcf5c4ef088e2e535206dc82f09bbfd01f280
[ "Apache-2.0" ]
1
2021-11-12T03:45:55.000Z
2021-11-12T03:45:55.000Z
python_developer_tools/cv/classes/ResNeXt.py
HonestyBrave/python_developer_tools
fc0dcf5c4ef088e2e535206dc82f09bbfd01f280
[ "Apache-2.0" ]
10
2021-06-03T08:05:05.000Z
2021-12-13T03:10:42.000Z
import torch import torch.nn as nn import torchvision class ResNeXtBlock(nn.Module): def __init__(self,in_places,places, stride=1,downsampling=False, expansion = 2, cardinality=32): super(ResNeXtBlock,self).__init__() self.expansion = expansion self.downsampling = downsampling self.bottleneck = nn.Sequential( nn.Conv2d(in_channels=in_places, out_channels=places, kernel_size=1, stride=1, bias=False), nn.BatchNorm2d(places), nn.ReLU(inplace=True), nn.Conv2d(in_channels=places, out_channels=places, kernel_size=3, stride=stride, padding=1, bias=False, groups=cardinality), nn.BatchNorm2d(places), nn.ReLU(inplace=True), nn.Conv2d(in_channels=places, out_channels=places * self.expansion, kernel_size=1, stride=1, bias=False), nn.BatchNorm2d(places * self.expansion), ) if self.downsampling: self.downsample = nn.Sequential( nn.Conv2d(in_channels=in_places, out_channels=places * self.expansion, kernel_size=1, stride=stride,bias=False), nn.BatchNorm2d(places * self.expansion) ) self.relu = nn.ReLU(inplace=True) def forward(self, x): residual = x out = self.bottleneck(x) if self.downsampling: residual = self.downsample(x) out += residual out = self.relu(out) return out if __name__ =='__main__': model = ResNeXtBlock(in_places=256, places=128) print(model) input = torch.randn(1,256,64,64) out = model(input) print(out.shape)
34.083333
136
0.635697
import torch import torch.nn as nn import torchvision class ResNeXtBlock(nn.Module): def __init__(self,in_places,places, stride=1,downsampling=False, expansion = 2, cardinality=32): super(ResNeXtBlock,self).__init__() self.expansion = expansion self.downsampling = downsampling self.bottleneck = nn.Sequential( nn.Conv2d(in_channels=in_places, out_channels=places, kernel_size=1, stride=1, bias=False), nn.BatchNorm2d(places), nn.ReLU(inplace=True), nn.Conv2d(in_channels=places, out_channels=places, kernel_size=3, stride=stride, padding=1, bias=False, groups=cardinality), nn.BatchNorm2d(places), nn.ReLU(inplace=True), nn.Conv2d(in_channels=places, out_channels=places * self.expansion, kernel_size=1, stride=1, bias=False), nn.BatchNorm2d(places * self.expansion), ) if self.downsampling: self.downsample = nn.Sequential( nn.Conv2d(in_channels=in_places, out_channels=places * self.expansion, kernel_size=1, stride=stride,bias=False), nn.BatchNorm2d(places * self.expansion) ) self.relu = nn.ReLU(inplace=True) def forward(self, x): residual = x out = self.bottleneck(x) if self.downsampling: residual = self.downsample(x) out += residual out = self.relu(out) return out if __name__ =='__main__': model = ResNeXtBlock(in_places=256, places=128) print(model) input = torch.randn(1,256,64,64) out = model(input) print(out.shape)
true
true
f71d65e945a2a090fa91fb86ee8b0f75888af76e
20,918
py
Python
kedro/io/core.py
jonasrk/kedro
9fd2abd112c0118b7a001aba7f11fa287d10db18
[ "Apache-2.0" ]
1
2020-12-30T01:44:36.000Z
2020-12-30T01:44:36.000Z
kedro/io/core.py
jonasrk/kedro
9fd2abd112c0118b7a001aba7f11fa287d10db18
[ "Apache-2.0" ]
null
null
null
kedro/io/core.py
jonasrk/kedro
9fd2abd112c0118b7a001aba7f11fa287d10db18
[ "Apache-2.0" ]
null
null
null
# Copyright 2018-2019 QuantumBlack Visual Analytics Limited # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, # EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES # OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, AND # NONINFRINGEMENT. IN NO EVENT WILL THE LICENSOR OR OTHER CONTRIBUTORS # BE LIABLE FOR ANY CLAIM, DAMAGES, OR OTHER LIABILITY, WHETHER IN AN # ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF, OR IN # CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. # # The QuantumBlack Visual Analytics Limited ("QuantumBlack") name and logo # (either separately or in combination, "QuantumBlack Trademarks") are # trademarks of QuantumBlack. The License does not grant you any right or # license to the QuantumBlack Trademarks. You may not use the QuantumBlack # Trademarks or any confusingly similar mark as a trademark for your product, # or use the QuantumBlack Trademarks in any other manner that might cause # confusion in the marketplace, including but not limited to in advertising, # on websites, or on software. # # See the License for the specific language governing permissions and # limitations under the License. """This module provides a set of classes which underpin the data loading and saving functionality provided by ``kedro.io``. """ import abc import copy import logging import os from collections import namedtuple from datetime import datetime, timezone from glob import iglob from pathlib import Path, PurePath from typing import Any, Callable, Dict, List, Optional, Tuple, Type from urllib.parse import urlparse from warnings import warn from kedro.utils import load_obj VERSIONED_FLAG_KEY = "versioned" VERSION_KEY = "version" class DataSetError(Exception): """``DataSetError`` raised by ``AbstractDataSet`` implementations in case of failure of input/output methods. ``AbstractDataSet`` implementations should provide instructive information in case of failure. """ pass class DataSetNotFoundError(DataSetError): """``DataSetNotFoundError`` raised by ``DataCatalog`` class in case of trying to use a non-existing data set. """ pass class DataSetAlreadyExistsError(DataSetError): """``DataSetAlreadyExistsError`` raised by ``DataCatalog`` class in case of trying to add a data set which already exists in the ``DataCatalog``. """ pass class VersionNotFoundError(DataSetError): """``VersionNotFoundError`` raised by ``AbstractVersionedDataSet`` implementations in case of no load versions available for the data set. """ pass class AbstractDataSet(abc.ABC): """``AbstractDataSet`` is the base class for all data set implementations. All data set implementations should extend this abstract class and implement the methods marked as abstract. Example: :: >>> from kedro.io import AbstractDataSet >>> import pandas as pd >>> >>> class MyOwnDataSet(AbstractDataSet): >>> def __init__(self, param1, param2): >>> self._param1 = param1 >>> self._param2 = param2 >>> >>> def _load(self) -> pd.DataFrame: >>> print("Dummy load: {}".format(self._param1)) >>> return pd.DataFrame() >>> >>> def _save(self, df: pd.DataFrame) -> None: >>> print("Dummy save: {}".format(self._param2)) >>> >>> def _describe(self): >>> return dict(param1=self._param1, param2=self._param2) """ @classmethod def from_config( cls: Type, name: str, config: Dict[str, Any], load_version: str = None, save_version: str = None, ) -> "AbstractDataSet": """Create a data set instance using the configuration provided. Args: name: Data set name. config: Data set config dictionary. load_version: Version string to be used for ``load`` operation if the data set is versioned. Has no effect on the data set if versioning was not enabled. save_version: Version string to be used for ``save`` operation if the data set is versioned. Has no effect on the data set if versioning was not enabled. Returns: An instance of an ``AbstractDataSet`` subclass. Raises: DataSetError: When the function fails to create the data set from its config. """ try: class_obj, config = parse_dataset_definition( config, load_version, save_version ) except Exception as ex: raise DataSetError( "An exception occurred when parsing config " "for DataSet `{}`:\n{}".format(name, str(ex)) ) try: data_set = class_obj(**config) # type: ignore except TypeError as err: raise DataSetError( "\n{}.\nDataSet '{}' must only contain " "arguments valid for the constructor " "of `{}.{}`.".format( str(err), name, class_obj.__module__, class_obj.__qualname__ ) ) except Exception as err: raise DataSetError( "\n{}.\nFailed to instantiate DataSet " "'{}' of type `{}.{}`.".format( str(err), name, class_obj.__module__, class_obj.__qualname__ ) ) return data_set @property def _logger(self) -> logging.Logger: return logging.getLogger(__name__) def get_last_load_version(self) -> Optional[str]: """Versioned datasets should override this property to return last loaded version""" # pylint: disable=no-self-use return None # pragma: no cover def load(self) -> Any: """Loads data by delegation to the provided load method. Returns: Data returned by the provided load method. Raises: DataSetError: When underlying load method raises error. """ self._logger.debug("Loading %s", str(self)) try: return self._load() except DataSetError: raise except Exception as exc: # This exception handling is by design as the composed data sets # can throw any type of exception. message = "Failed while loading data from data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def get_last_save_version(self) -> Optional[str]: """Versioned datasets should override this property to return last saved version.""" # pylint: disable=no-self-use return None # pragma: no cover def save(self, data: Any) -> None: """Saves data by delegation to the provided save method. Args: data: the value to be saved by provided save method. Raises: DataSetError: when underlying save method raises error. """ if data is None: raise DataSetError("Saving `None` to a `DataSet` is not allowed") try: self._logger.debug("Saving %s", str(self)) self._save(data) except DataSetError: raise except Exception as exc: message = "Failed while saving data to data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def __str__(self): def _to_str(obj, is_root=False): """Returns a string representation where 1. The root level (i.e. the DataSet.__init__ arguments) are formatted like DataSet(key=value). 2. Dictionaries have the keys alphabetically sorted recursively. 3. Empty dictionaries and None values are not shown. """ fmt = "{}={}" if is_root else "'{}': {}" # 1 if isinstance(obj, dict): sorted_dict = sorted(obj.items(), key=lambda pair: str(pair[0])) # 2 text = ", ".join( fmt.format(key, _to_str(value)) # 2 for key, value in sorted_dict if value or isinstance(value, bool) ) # 3 return text if is_root else "{" + text + "}" # 1 # not a dictionary return str(obj) return "{}({})".format(type(self).__name__, _to_str(self._describe(), True)) @abc.abstractmethod def _load(self) -> Any: raise NotImplementedError( "`{}` is a subclass of AbstractDataSet and" "it must implement the `_load` method".format(self.__class__.__name__) ) @abc.abstractmethod def _save(self, data: Any) -> None: raise NotImplementedError( "`{}` is a subclass of AbstractDataSet and" "it must implement the `_save` method".format(self.__class__.__name__) ) @abc.abstractmethod def _describe(self) -> Dict[str, Any]: raise NotImplementedError( "`{}` is a subclass of AbstractDataSet and" "it must implement the `_describe` method".format(self.__class__.__name__) ) def exists(self) -> bool: """Checks whether a data set's output already exists by calling the provided _exists() method. Returns: Flag indicating whether the output already exists. Raises: DataSetError: when underlying exists method raises error. """ try: self._logger.debug("Checking whether target of %s exists", str(self)) return self._exists() except Exception as exc: message = "Failed during exists check for data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def _exists(self) -> bool: self._logger.warning( "`exists()` not implemented for `%s`. Assuming output does not exist.", self.__class__.__name__, ) return False def release(self) -> None: """Release any cached data. Raises: DataSetError: when underlying exists method raises error. """ try: self._logger.debug("Releasing %s", str(self)) self._release() except Exception as exc: message = "Failed during release for data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def _release(self) -> None: pass def generate_timestamp() -> str: """Generate the timestamp to be used by versioning. Returns: String representation of the current timestamp. """ current_ts = datetime.now(tz=timezone.utc) fmt = ( "{d.year:04d}-{d.month:02d}-{d.day:02d}T{d.hour:02d}" ".{d.minute:02d}.{d.second:02d}.{ms:03d}Z" ) return fmt.format(d=current_ts, ms=current_ts.microsecond // 1000) class Version(namedtuple("Version", ["load", "save"])): """This namedtuple is used to provide load and save versions for versioned data sets. If ``Version.load`` is None, then the latest available version is loaded. If ``Version.save`` is None, then save version is formatted as YYYY-MM-DDThh.mm.ss.sssZ of the current timestamp. """ __slots__ = () CONSISTENCY_WARNING = ( "Save version `{}` did not match load version `{}` for {}. This is strongly " "discouraged due to inconsistencies it may cause between `save` and " "`load` operations. Please refrain from setting exact load version for " "intermediate data sets where possible to avoid this warning." ) def parse_dataset_definition( config: Dict[str, Any], load_version: str = None, save_version: str = None ) -> Tuple[Type[AbstractDataSet], Dict]: """Parse and instantiate a dataset class using the configuration provided. Args: config: Data set config dictionary. It *must* contain the `type` key with fully qualified class name. load_version: Version string to be used for ``load`` operation if the data set is versioned. Has no effect on the data set if versioning was not enabled. save_version: Version string to be used for ``save`` operation if the data set is versioned. Has no effect on the data set if versioning was not enabled. Raises: DataSetError: If the function fails to parse the configuration provided. Returns: 2-tuple: (Dataset class object, configuration dictionary) """ save_version = save_version or generate_timestamp() config = copy.deepcopy(config) if "type" not in config: raise DataSetError("`type` is missing from DataSet catalog configuration") class_obj = config.pop("type") if isinstance(class_obj, str): try: class_obj = load_obj(class_obj, "kedro.io") except ImportError: raise DataSetError( "Cannot import module when trying to load type `{}`.".format(class_obj) ) except AttributeError: raise DataSetError("Class `{}` not found.".format(class_obj)) if not issubclass(class_obj, AbstractDataSet): raise DataSetError( "DataSet type `{}.{}` is invalid: all data set types must extend " "`AbstractDataSet`.".format(class_obj.__module__, class_obj.__qualname__) ) if VERSION_KEY in config: # remove "version" key so that it's not passed # to the "unversioned" data set constructor message = ( "`%s` attribute removed from data set configuration since it is a " "reserved word and cannot be directly specified" ) logging.getLogger(__name__).warning(message, VERSION_KEY) del config[VERSION_KEY] if config.pop(VERSIONED_FLAG_KEY, False): # data set is versioned config[VERSION_KEY] = Version(load_version, save_version) return class_obj, config def _local_exists(filepath: str) -> bool: filepath = Path(filepath) return filepath.exists() or any(par.is_file() for par in filepath.parents) def is_remote_path(filepath: str) -> bool: """Check if the given path looks like a remote URL (has scheme).""" # Get rid of Windows-specific "C:\" start, # which is treated as a URL scheme. _, filepath = os.path.splitdrive(filepath) return bool(urlparse(filepath).scheme) class AbstractVersionedDataSet(AbstractDataSet, abc.ABC): """ ``AbstractVersionedDataSet`` is the base class for all versioned data set implementations. All data sets that implement versioning should extend this abstract class and implement the methods marked as abstract. Example: :: >>> from kedro.io import AbstractVersionedDataSet >>> import pandas as pd >>> >>> >>> class MyOwnDataSet(AbstractVersionedDataSet): >>> def __init__(self, param1, param2, filepath, version): >>> super().__init__(filepath, version) >>> self._param1 = param1 >>> self._param2 = param2 >>> >>> def _load(self) -> pd.DataFrame: >>> load_path = self._get_load_path() >>> return pd.read_csv(load_path) >>> >>> def _save(self, df: pd.DataFrame) -> None: >>> save_path = self._get_save_path() >>> df.to_csv(str(save_path)) >>> >>> def _exists(self) -> bool: >>> path = self._get_load_path() >>> return path.is_file() >>> >>> def _describe(self): >>> return dict(version=self._version, param1=self._param1, param2=self._param2) """ # pylint: disable=abstract-method def __init__( self, filepath: PurePath, version: Optional[Version], exists_function: Callable[[str], bool] = None, glob_function: Callable[[str], List[str]] = None, ): """Creates a new instance of ``AbstractVersionedDataSet``. Args: filepath: Path to file. version: If specified, should be an instance of ``kedro.io.core.Version``. If its ``load`` attribute is None, the latest version will be loaded. If its ``save`` attribute is None, save version will be autogenerated. exists_function: Function that is used for determining whether a path exists in a filesystem. glob_function: Function that is used for finding all paths in a filesystem, which match a given pattern. """ self._filepath = filepath self._version = version self._exists_function = exists_function or _local_exists self._glob_function = glob_function or iglob self._last_load_version = None # type: Optional[str] self._last_save_version = None # type: Optional[str] def get_last_load_version(self) -> Optional[str]: return self._last_load_version def _lookup_load_version(self) -> Optional[str]: if not self._version: return None if self._version.load: return self._version.load # When load version is unpinned, fetch the most recent existing # version from the given path pattern = str(self._get_versioned_path("*")) version_paths = sorted(self._glob_function(pattern), reverse=True) most_recent = next( (path for path in version_paths if self._exists_function(path)), None ) if not most_recent: raise VersionNotFoundError( "Did not find any versions for {}".format(str(self)) ) return PurePath(most_recent).parent.name def _get_load_path(self) -> PurePath: if not self._version: # When versioning is disabled, load from original filepath return self._filepath load_version = self._last_load_version or self._lookup_load_version() return self._get_versioned_path(load_version) # type: ignore def get_last_save_version(self) -> Optional[str]: return self._last_save_version def _lookup_save_version(self) -> Optional[str]: if not self._version: return None return self._version.save or generate_timestamp() def _get_save_path(self) -> PurePath: if not self._version: # When versioning is disabled, return original filepath return self._filepath save_version = self._last_save_version or self._lookup_save_version() versioned_path = self._get_versioned_path(save_version) # type: ignore if self._exists_function(str(versioned_path)): raise DataSetError( "Save path `{}` for {} must not exist if versioning " "is enabled.".format(versioned_path, str(self)) ) return versioned_path def _get_versioned_path(self, version: str) -> PurePath: return self._filepath / version / self._filepath.name def load(self) -> Any: self._last_load_version = self._lookup_load_version() return super().load() def save(self, data: Any) -> None: self._last_save_version = self._lookup_save_version() super().save(data) load_version = self._lookup_load_version() if load_version != self._last_save_version: warn( CONSISTENCY_WARNING.format( self._last_save_version, load_version, str(self) ) ) def exists(self) -> bool: """Checks whether a data set's output already exists by calling the provided _exists() method. Returns: Flag indicating whether the output already exists. Raises: DataSetError: when underlying exists method raises error. """ self._logger.debug("Checking whether target of %s exists", str(self)) try: return self._exists() except VersionNotFoundError: return False except Exception as exc: message = "Failed during exists check for data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc
35.156303
96
0.612821
import abc import copy import logging import os from collections import namedtuple from datetime import datetime, timezone from glob import iglob from pathlib import Path, PurePath from typing import Any, Callable, Dict, List, Optional, Tuple, Type from urllib.parse import urlparse from warnings import warn from kedro.utils import load_obj VERSIONED_FLAG_KEY = "versioned" VERSION_KEY = "version" class DataSetError(Exception): pass class DataSetNotFoundError(DataSetError): pass class DataSetAlreadyExistsError(DataSetError): pass class VersionNotFoundError(DataSetError): pass class AbstractDataSet(abc.ABC): @classmethod def from_config( cls: Type, name: str, config: Dict[str, Any], load_version: str = None, save_version: str = None, ) -> "AbstractDataSet": try: class_obj, config = parse_dataset_definition( config, load_version, save_version ) except Exception as ex: raise DataSetError( "An exception occurred when parsing config " "for DataSet `{}`:\n{}".format(name, str(ex)) ) try: data_set = class_obj(**config) except TypeError as err: raise DataSetError( "\n{}.\nDataSet '{}' must only contain " "arguments valid for the constructor " "of `{}.{}`.".format( str(err), name, class_obj.__module__, class_obj.__qualname__ ) ) except Exception as err: raise DataSetError( "\n{}.\nFailed to instantiate DataSet " "'{}' of type `{}.{}`.".format( str(err), name, class_obj.__module__, class_obj.__qualname__ ) ) return data_set @property def _logger(self) -> logging.Logger: return logging.getLogger(__name__) def get_last_load_version(self) -> Optional[str]: return None def load(self) -> Any: self._logger.debug("Loading %s", str(self)) try: return self._load() except DataSetError: raise except Exception as exc: message = "Failed while loading data from data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def get_last_save_version(self) -> Optional[str]: return None def save(self, data: Any) -> None: if data is None: raise DataSetError("Saving `None` to a `DataSet` is not allowed") try: self._logger.debug("Saving %s", str(self)) self._save(data) except DataSetError: raise except Exception as exc: message = "Failed while saving data to data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def __str__(self): def _to_str(obj, is_root=False): fmt = "{}={}" if is_root else "'{}': {}" if isinstance(obj, dict): sorted_dict = sorted(obj.items(), key=lambda pair: str(pair[0])) text = ", ".join( fmt.format(key, _to_str(value)) for key, value in sorted_dict if value or isinstance(value, bool) ) return text if is_root else "{" + text + "}" return str(obj) return "{}({})".format(type(self).__name__, _to_str(self._describe(), True)) @abc.abstractmethod def _load(self) -> Any: raise NotImplementedError( "`{}` is a subclass of AbstractDataSet and" "it must implement the `_load` method".format(self.__class__.__name__) ) @abc.abstractmethod def _save(self, data: Any) -> None: raise NotImplementedError( "`{}` is a subclass of AbstractDataSet and" "it must implement the `_save` method".format(self.__class__.__name__) ) @abc.abstractmethod def _describe(self) -> Dict[str, Any]: raise NotImplementedError( "`{}` is a subclass of AbstractDataSet and" "it must implement the `_describe` method".format(self.__class__.__name__) ) def exists(self) -> bool: try: self._logger.debug("Checking whether target of %s exists", str(self)) return self._exists() except Exception as exc: message = "Failed during exists check for data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def _exists(self) -> bool: self._logger.warning( "`exists()` not implemented for `%s`. Assuming output does not exist.", self.__class__.__name__, ) return False def release(self) -> None: try: self._logger.debug("Releasing %s", str(self)) self._release() except Exception as exc: message = "Failed during release for data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc def _release(self) -> None: pass def generate_timestamp() -> str: current_ts = datetime.now(tz=timezone.utc) fmt = ( "{d.year:04d}-{d.month:02d}-{d.day:02d}T{d.hour:02d}" ".{d.minute:02d}.{d.second:02d}.{ms:03d}Z" ) return fmt.format(d=current_ts, ms=current_ts.microsecond // 1000) class Version(namedtuple("Version", ["load", "save"])): __slots__ = () CONSISTENCY_WARNING = ( "Save version `{}` did not match load version `{}` for {}. This is strongly " "discouraged due to inconsistencies it may cause between `save` and " "`load` operations. Please refrain from setting exact load version for " "intermediate data sets where possible to avoid this warning." ) def parse_dataset_definition( config: Dict[str, Any], load_version: str = None, save_version: str = None ) -> Tuple[Type[AbstractDataSet], Dict]: save_version = save_version or generate_timestamp() config = copy.deepcopy(config) if "type" not in config: raise DataSetError("`type` is missing from DataSet catalog configuration") class_obj = config.pop("type") if isinstance(class_obj, str): try: class_obj = load_obj(class_obj, "kedro.io") except ImportError: raise DataSetError( "Cannot import module when trying to load type `{}`.".format(class_obj) ) except AttributeError: raise DataSetError("Class `{}` not found.".format(class_obj)) if not issubclass(class_obj, AbstractDataSet): raise DataSetError( "DataSet type `{}.{}` is invalid: all data set types must extend " "`AbstractDataSet`.".format(class_obj.__module__, class_obj.__qualname__) ) if VERSION_KEY in config: # to the "unversioned" data set constructor message = ( "`%s` attribute removed from data set configuration since it is a " "reserved word and cannot be directly specified" ) logging.getLogger(__name__).warning(message, VERSION_KEY) del config[VERSION_KEY] if config.pop(VERSIONED_FLAG_KEY, False): # data set is versioned config[VERSION_KEY] = Version(load_version, save_version) return class_obj, config def _local_exists(filepath: str) -> bool: filepath = Path(filepath) return filepath.exists() or any(par.is_file() for par in filepath.parents) def is_remote_path(filepath: str) -> bool: # Get rid of Windows-specific "C:\" start, # which is treated as a URL scheme. _, filepath = os.path.splitdrive(filepath) return bool(urlparse(filepath).scheme) class AbstractVersionedDataSet(AbstractDataSet, abc.ABC): # pylint: disable=abstract-method def __init__( self, filepath: PurePath, version: Optional[Version], exists_function: Callable[[str], bool] = None, glob_function: Callable[[str], List[str]] = None, ): self._filepath = filepath self._version = version self._exists_function = exists_function or _local_exists self._glob_function = glob_function or iglob self._last_load_version = None # type: Optional[str] self._last_save_version = None # type: Optional[str] def get_last_load_version(self) -> Optional[str]: return self._last_load_version def _lookup_load_version(self) -> Optional[str]: if not self._version: return None if self._version.load: return self._version.load # When load version is unpinned, fetch the most recent existing # version from the given path pattern = str(self._get_versioned_path("*")) version_paths = sorted(self._glob_function(pattern), reverse=True) most_recent = next( (path for path in version_paths if self._exists_function(path)), None ) if not most_recent: raise VersionNotFoundError( "Did not find any versions for {}".format(str(self)) ) return PurePath(most_recent).parent.name def _get_load_path(self) -> PurePath: if not self._version: # When versioning is disabled, load from original filepath return self._filepath load_version = self._last_load_version or self._lookup_load_version() return self._get_versioned_path(load_version) # type: ignore def get_last_save_version(self) -> Optional[str]: return self._last_save_version def _lookup_save_version(self) -> Optional[str]: if not self._version: return None return self._version.save or generate_timestamp() def _get_save_path(self) -> PurePath: if not self._version: # When versioning is disabled, return original filepath return self._filepath save_version = self._last_save_version or self._lookup_save_version() versioned_path = self._get_versioned_path(save_version) # type: ignore if self._exists_function(str(versioned_path)): raise DataSetError( "Save path `{}` for {} must not exist if versioning " "is enabled.".format(versioned_path, str(self)) ) return versioned_path def _get_versioned_path(self, version: str) -> PurePath: return self._filepath / version / self._filepath.name def load(self) -> Any: self._last_load_version = self._lookup_load_version() return super().load() def save(self, data: Any) -> None: self._last_save_version = self._lookup_save_version() super().save(data) load_version = self._lookup_load_version() if load_version != self._last_save_version: warn( CONSISTENCY_WARNING.format( self._last_save_version, load_version, str(self) ) ) def exists(self) -> bool: self._logger.debug("Checking whether target of %s exists", str(self)) try: return self._exists() except VersionNotFoundError: return False except Exception as exc: message = "Failed during exists check for data set {}.\n{}".format( str(self), str(exc) ) raise DataSetError(message) from exc
true
true
f71d664600932b67be3bc734c66fe4ff4b43a8de
17,171
py
Python
engine/SCons/Tool/rpmutils.py
cctbx/scons
9eb46f7e2a965e1041e5b1a6bc941c1e97bceb00
[ "MIT" ]
1
2020-05-28T17:50:54.000Z
2020-05-28T17:50:54.000Z
engine/SCons/Tool/rpmutils.py
cctbx/scons
9eb46f7e2a965e1041e5b1a6bc941c1e97bceb00
[ "MIT" ]
4
2018-07-24T05:46:04.000Z
2018-08-07T06:10:45.000Z
engine/SCons/Tool/rpmutils.py
cctbx/scons
9eb46f7e2a965e1041e5b1a6bc941c1e97bceb00
[ "MIT" ]
1
2018-07-23T10:34:27.000Z
2018-07-23T10:34:27.000Z
"""SCons.Tool.rpmutils.py RPM specific helper routines for general usage in the test framework and SCons core modules. Since we check for the RPM package target name in several places, we have to know which machine/system name RPM will use for the current hardware setup. The following dictionaries and functions try to mimic the exact naming rules of the RPM source code. They were directly derived from the file "rpmrc.in" of the version rpm-4.9.1.3. For updating to a more recent version of RPM, this Python script can be used standalone. The usage() function below shows the exact syntax. """ # Copyright (c) 2001 - 2017 The SCons Foundation # # Permission is hereby granted, free of charge, to any person obtaining # a copy of this software and associated documentation files (the # "Software"), to deal in the Software without restriction, including # without limitation the rights to use, copy, modify, merge, publish, # distribute, sublicense, and/or sell copies of the Software, and to # permit persons to whom the Software is furnished to do so, subject to # the following conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY # KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE # WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND # NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE # LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION # OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION # WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. from __future__ import print_function __revision__ = "src/engine/SCons/Tool/rpmutils.py rel_3.0.0:4395:8972f6a2f699 2017/09/18 12:59:24 bdbaddog" import platform import subprocess import SCons.Util # Start of rpmrc dictionaries (Marker, don't change or remove!) os_canon = { 'AIX' : ['AIX','5'], 'AmigaOS' : ['AmigaOS','5'], 'BSD_OS' : ['bsdi','12'], 'CYGWIN32_95' : ['cygwin32','15'], 'CYGWIN32_NT' : ['cygwin32','14'], 'Darwin' : ['darwin','21'], 'FreeBSD' : ['FreeBSD','8'], 'HP-UX' : ['hpux10','6'], 'IRIX' : ['Irix','2'], 'IRIX64' : ['Irix64','10'], 'Linux' : ['Linux','1'], 'Linux/390' : ['OS/390','20'], 'Linux/ESA' : ['VM/ESA','20'], 'MacOSX' : ['macosx','21'], 'MiNT' : ['FreeMiNT','17'], 'NEXTSTEP' : ['NextStep','11'], 'OS/390' : ['OS/390','18'], 'OSF1' : ['osf1','7'], 'SCO_SV' : ['SCO_SV3.2v5.0.2','9'], 'SunOS4' : ['SunOS','4'], 'SunOS5' : ['solaris','3'], 'UNIX_SV' : ['MP_RAS','16'], 'VM/ESA' : ['VM/ESA','19'], 'machten' : ['machten','13'], 'osf3.2' : ['osf1','7'], 'osf4.0' : ['osf1','7'], } buildarch_compat = { 'alpha' : ['noarch'], 'alphaev5' : ['alpha'], 'alphaev56' : ['alphaev5'], 'alphaev6' : ['alphapca56'], 'alphaev67' : ['alphaev6'], 'alphapca56' : ['alphaev56'], 'amd64' : ['x86_64'], 'armv3l' : ['noarch'], 'armv4b' : ['noarch'], 'armv4l' : ['armv3l'], 'armv4tl' : ['armv4l'], 'armv5tejl' : ['armv5tel'], 'armv5tel' : ['armv4tl'], 'armv6l' : ['armv5tejl'], 'armv7l' : ['armv6l'], 'atariclone' : ['m68kmint','noarch'], 'atarist' : ['m68kmint','noarch'], 'atariste' : ['m68kmint','noarch'], 'ataritt' : ['m68kmint','noarch'], 'athlon' : ['i686'], 'falcon' : ['m68kmint','noarch'], 'geode' : ['i586'], 'hades' : ['m68kmint','noarch'], 'hppa1.0' : ['parisc'], 'hppa1.1' : ['hppa1.0'], 'hppa1.2' : ['hppa1.1'], 'hppa2.0' : ['hppa1.2'], 'i386' : ['noarch','fat'], 'i486' : ['i386'], 'i586' : ['i486'], 'i686' : ['i586'], 'ia32e' : ['x86_64'], 'ia64' : ['noarch'], 'm68k' : ['noarch'], 'milan' : ['m68kmint','noarch'], 'mips' : ['noarch'], 'mipsel' : ['noarch'], 'parisc' : ['noarch'], 'pentium3' : ['i686'], 'pentium4' : ['pentium3'], 'ppc' : ['noarch','fat'], 'ppc32dy4' : ['noarch'], 'ppc64' : ['noarch','fat'], 'ppc64iseries' : ['ppc64'], 'ppc64pseries' : ['ppc64'], 'ppc8260' : ['noarch'], 'ppc8560' : ['noarch'], 'ppciseries' : ['noarch'], 'ppcpseries' : ['noarch'], 's390' : ['noarch'], 's390x' : ['noarch'], 'sh3' : ['noarch'], 'sh4' : ['noarch'], 'sh4a' : ['sh4'], 'sparc' : ['noarch'], 'sparc64' : ['sparcv9v'], 'sparc64v' : ['sparc64'], 'sparcv8' : ['sparc'], 'sparcv9' : ['sparcv8'], 'sparcv9v' : ['sparcv9'], 'sun4c' : ['noarch'], 'sun4d' : ['noarch'], 'sun4m' : ['noarch'], 'sun4u' : ['noarch'], 'x86_64' : ['noarch'], } os_compat = { 'BSD_OS' : ['bsdi'], 'Darwin' : ['MacOSX'], 'FreeMiNT' : ['mint','MiNT','TOS'], 'IRIX64' : ['IRIX'], 'MiNT' : ['FreeMiNT','mint','TOS'], 'TOS' : ['FreeMiNT','MiNT','mint'], 'bsdi4.0' : ['bsdi'], 'hpux10.00' : ['hpux9.07'], 'hpux10.01' : ['hpux10.00'], 'hpux10.10' : ['hpux10.01'], 'hpux10.20' : ['hpux10.10'], 'hpux10.30' : ['hpux10.20'], 'hpux11.00' : ['hpux10.30'], 'hpux9.05' : ['hpux9.04'], 'hpux9.07' : ['hpux9.05'], 'mint' : ['FreeMiNT','MiNT','TOS'], 'ncr-sysv4.3' : ['ncr-sysv4.2'], 'osf4.0' : ['osf3.2','osf1'], 'solaris2.4' : ['solaris2.3'], 'solaris2.5' : ['solaris2.3','solaris2.4'], 'solaris2.6' : ['solaris2.3','solaris2.4','solaris2.5'], 'solaris2.7' : ['solaris2.3','solaris2.4','solaris2.5','solaris2.6'], } arch_compat = { 'alpha' : ['axp','noarch'], 'alphaev5' : ['alpha'], 'alphaev56' : ['alphaev5'], 'alphaev6' : ['alphapca56'], 'alphaev67' : ['alphaev6'], 'alphapca56' : ['alphaev56'], 'amd64' : ['x86_64','athlon','noarch'], 'armv3l' : ['noarch'], 'armv4b' : ['noarch'], 'armv4l' : ['armv3l'], 'armv4tl' : ['armv4l'], 'armv5tejl' : ['armv5tel'], 'armv5tel' : ['armv4tl'], 'armv6l' : ['armv5tejl'], 'armv7l' : ['armv6l'], 'atariclone' : ['m68kmint','noarch'], 'atarist' : ['m68kmint','noarch'], 'atariste' : ['m68kmint','noarch'], 'ataritt' : ['m68kmint','noarch'], 'athlon' : ['i686'], 'falcon' : ['m68kmint','noarch'], 'geode' : ['i586'], 'hades' : ['m68kmint','noarch'], 'hppa1.0' : ['parisc'], 'hppa1.1' : ['hppa1.0'], 'hppa1.2' : ['hppa1.1'], 'hppa2.0' : ['hppa1.2'], 'i370' : ['noarch'], 'i386' : ['noarch','fat'], 'i486' : ['i386'], 'i586' : ['i486'], 'i686' : ['i586'], 'ia32e' : ['x86_64','athlon','noarch'], 'ia64' : ['noarch'], 'milan' : ['m68kmint','noarch'], 'mips' : ['noarch'], 'mipsel' : ['noarch'], 'osfmach3_i386' : ['i486'], 'osfmach3_i486' : ['i486','osfmach3_i386'], 'osfmach3_i586' : ['i586','osfmach3_i486'], 'osfmach3_i686' : ['i686','osfmach3_i586'], 'osfmach3_ppc' : ['ppc'], 'parisc' : ['noarch'], 'pentium3' : ['i686'], 'pentium4' : ['pentium3'], 'powerpc' : ['ppc'], 'powerppc' : ['ppc'], 'ppc' : ['rs6000'], 'ppc32dy4' : ['ppc'], 'ppc64' : ['ppc'], 'ppc64iseries' : ['ppc64'], 'ppc64pseries' : ['ppc64'], 'ppc8260' : ['ppc'], 'ppc8560' : ['ppc'], 'ppciseries' : ['ppc'], 'ppcpseries' : ['ppc'], 'rs6000' : ['noarch','fat'], 's390' : ['noarch'], 's390x' : ['s390','noarch'], 'sh3' : ['noarch'], 'sh4' : ['noarch'], 'sh4a' : ['sh4'], 'sparc' : ['noarch'], 'sparc64' : ['sparcv9'], 'sparc64v' : ['sparc64'], 'sparcv8' : ['sparc'], 'sparcv9' : ['sparcv8'], 'sparcv9v' : ['sparcv9'], 'sun4c' : ['sparc'], 'sun4d' : ['sparc'], 'sun4m' : ['sparc'], 'sun4u' : ['sparc64'], 'x86_64' : ['amd64','athlon','noarch'], } buildarchtranslate = { 'alphaev5' : ['alpha'], 'alphaev56' : ['alpha'], 'alphaev6' : ['alpha'], 'alphaev67' : ['alpha'], 'alphapca56' : ['alpha'], 'amd64' : ['x86_64'], 'armv3l' : ['armv3l'], 'armv4b' : ['armv4b'], 'armv4l' : ['armv4l'], 'armv4tl' : ['armv4tl'], 'armv5tejl' : ['armv5tejl'], 'armv5tel' : ['armv5tel'], 'armv6l' : ['armv6l'], 'armv7l' : ['armv7l'], 'atariclone' : ['m68kmint'], 'atarist' : ['m68kmint'], 'atariste' : ['m68kmint'], 'ataritt' : ['m68kmint'], 'athlon' : ['i386'], 'falcon' : ['m68kmint'], 'geode' : ['i386'], 'hades' : ['m68kmint'], 'i386' : ['i386'], 'i486' : ['i386'], 'i586' : ['i386'], 'i686' : ['i386'], 'ia32e' : ['x86_64'], 'ia64' : ['ia64'], 'milan' : ['m68kmint'], 'osfmach3_i386' : ['i386'], 'osfmach3_i486' : ['i386'], 'osfmach3_i586' : ['i386'], 'osfmach3_i686' : ['i386'], 'osfmach3_ppc' : ['ppc'], 'pentium3' : ['i386'], 'pentium4' : ['i386'], 'powerpc' : ['ppc'], 'powerppc' : ['ppc'], 'ppc32dy4' : ['ppc'], 'ppc64iseries' : ['ppc64'], 'ppc64pseries' : ['ppc64'], 'ppc8260' : ['ppc'], 'ppc8560' : ['ppc'], 'ppciseries' : ['ppc'], 'ppcpseries' : ['ppc'], 's390' : ['s390'], 's390x' : ['s390x'], 'sh3' : ['sh3'], 'sh4' : ['sh4'], 'sh4a' : ['sh4'], 'sparc64v' : ['sparc64'], 'sparcv8' : ['sparc'], 'sparcv9' : ['sparc'], 'sparcv9v' : ['sparc'], 'sun4c' : ['sparc'], 'sun4d' : ['sparc'], 'sun4m' : ['sparc'], 'sun4u' : ['sparc64'], 'x86_64' : ['x86_64'], } optflags = { 'alpha' : ['-O2','-g','-mieee'], 'alphaev5' : ['-O2','-g','-mieee','-mtune=ev5'], 'alphaev56' : ['-O2','-g','-mieee','-mtune=ev56'], 'alphaev6' : ['-O2','-g','-mieee','-mtune=ev6'], 'alphaev67' : ['-O2','-g','-mieee','-mtune=ev67'], 'alphapca56' : ['-O2','-g','-mieee','-mtune=pca56'], 'amd64' : ['-O2','-g'], 'armv3l' : ['-O2','-g','-march=armv3'], 'armv4b' : ['-O2','-g','-march=armv4'], 'armv4l' : ['-O2','-g','-march=armv4'], 'armv4tl' : ['-O2','-g','-march=armv4t'], 'armv5tejl' : ['-O2','-g','-march=armv5te'], 'armv5tel' : ['-O2','-g','-march=armv5te'], 'armv6l' : ['-O2','-g','-march=armv6'], 'armv7l' : ['-O2','-g','-march=armv7'], 'atariclone' : ['-O2','-g','-fomit-frame-pointer'], 'atarist' : ['-O2','-g','-fomit-frame-pointer'], 'atariste' : ['-O2','-g','-fomit-frame-pointer'], 'ataritt' : ['-O2','-g','-fomit-frame-pointer'], 'athlon' : ['-O2','-g','-march=athlon'], 'falcon' : ['-O2','-g','-fomit-frame-pointer'], 'fat' : ['-O2','-g','-arch','i386','-arch','ppc'], 'geode' : ['-Os','-g','-m32','-march=geode'], 'hades' : ['-O2','-g','-fomit-frame-pointer'], 'hppa1.0' : ['-O2','-g','-mpa-risc-1-0'], 'hppa1.1' : ['-O2','-g','-mpa-risc-1-0'], 'hppa1.2' : ['-O2','-g','-mpa-risc-1-0'], 'hppa2.0' : ['-O2','-g','-mpa-risc-1-0'], 'i386' : ['-O2','-g','-march=i386','-mtune=i686'], 'i486' : ['-O2','-g','-march=i486'], 'i586' : ['-O2','-g','-march=i586'], 'i686' : ['-O2','-g','-march=i686'], 'ia32e' : ['-O2','-g'], 'ia64' : ['-O2','-g'], 'm68k' : ['-O2','-g','-fomit-frame-pointer'], 'milan' : ['-O2','-g','-fomit-frame-pointer'], 'mips' : ['-O2','-g'], 'mipsel' : ['-O2','-g'], 'parisc' : ['-O2','-g','-mpa-risc-1-0'], 'pentium3' : ['-O2','-g','-march=pentium3'], 'pentium4' : ['-O2','-g','-march=pentium4'], 'ppc' : ['-O2','-g','-fsigned-char'], 'ppc32dy4' : ['-O2','-g','-fsigned-char'], 'ppc64' : ['-O2','-g','-fsigned-char'], 'ppc8260' : ['-O2','-g','-fsigned-char'], 'ppc8560' : ['-O2','-g','-fsigned-char'], 'ppciseries' : ['-O2','-g','-fsigned-char'], 'ppcpseries' : ['-O2','-g','-fsigned-char'], 's390' : ['-O2','-g'], 's390x' : ['-O2','-g'], 'sh3' : ['-O2','-g'], 'sh4' : ['-O2','-g','-mieee'], 'sh4a' : ['-O2','-g','-mieee'], 'sparc' : ['-O2','-g','-m32','-mtune=ultrasparc'], 'sparc64' : ['-O2','-g','-m64','-mtune=ultrasparc'], 'sparc64v' : ['-O2','-g','-m64','-mtune=niagara'], 'sparcv8' : ['-O2','-g','-m32','-mtune=ultrasparc','-mv8'], 'sparcv9' : ['-O2','-g','-m32','-mtune=ultrasparc'], 'sparcv9v' : ['-O2','-g','-m32','-mtune=niagara'], 'x86_64' : ['-O2','-g'], } arch_canon = { 'IP' : ['sgi','7'], 'alpha' : ['alpha','2'], 'alphaev5' : ['alphaev5','2'], 'alphaev56' : ['alphaev56','2'], 'alphaev6' : ['alphaev6','2'], 'alphaev67' : ['alphaev67','2'], 'alphapca56' : ['alphapca56','2'], 'amd64' : ['amd64','1'], 'armv3l' : ['armv3l','12'], 'armv4b' : ['armv4b','12'], 'armv4l' : ['armv4l','12'], 'armv5tejl' : ['armv5tejl','12'], 'armv5tel' : ['armv5tel','12'], 'armv6l' : ['armv6l','12'], 'armv7l' : ['armv7l','12'], 'atariclone' : ['m68kmint','13'], 'atarist' : ['m68kmint','13'], 'atariste' : ['m68kmint','13'], 'ataritt' : ['m68kmint','13'], 'athlon' : ['athlon','1'], 'falcon' : ['m68kmint','13'], 'geode' : ['geode','1'], 'hades' : ['m68kmint','13'], 'i370' : ['i370','14'], 'i386' : ['i386','1'], 'i486' : ['i486','1'], 'i586' : ['i586','1'], 'i686' : ['i686','1'], 'ia32e' : ['ia32e','1'], 'ia64' : ['ia64','9'], 'm68k' : ['m68k','6'], 'm68kmint' : ['m68kmint','13'], 'milan' : ['m68kmint','13'], 'mips' : ['mips','4'], 'mipsel' : ['mipsel','11'], 'pentium3' : ['pentium3','1'], 'pentium4' : ['pentium4','1'], 'ppc' : ['ppc','5'], 'ppc32dy4' : ['ppc32dy4','5'], 'ppc64' : ['ppc64','16'], 'ppc64iseries' : ['ppc64iseries','16'], 'ppc64pseries' : ['ppc64pseries','16'], 'ppc8260' : ['ppc8260','5'], 'ppc8560' : ['ppc8560','5'], 'ppciseries' : ['ppciseries','5'], 'ppcpseries' : ['ppcpseries','5'], 'rs6000' : ['rs6000','8'], 's390' : ['s390','14'], 's390x' : ['s390x','15'], 'sh' : ['sh','17'], 'sh3' : ['sh3','17'], 'sh4' : ['sh4','17'], 'sh4a' : ['sh4a','17'], 'sparc' : ['sparc','3'], 'sparc64' : ['sparc64','2'], 'sparc64v' : ['sparc64v','2'], 'sparcv8' : ['sparcv8','3'], 'sparcv9' : ['sparcv9','3'], 'sparcv9v' : ['sparcv9v','3'], 'sun4' : ['sparc','3'], 'sun4c' : ['sparc','3'], 'sun4d' : ['sparc','3'], 'sun4m' : ['sparc','3'], 'sun4u' : ['sparc64','2'], 'x86_64' : ['x86_64','1'], 'xtensa' : ['xtensa','18'], } # End of rpmrc dictionaries (Marker, don't change or remove!) def defaultMachine(use_rpm_default=True): """ Return the canonicalized machine name. """ if use_rpm_default: try: # This should be the most reliable way to get the default arch rmachine = subprocess.check_output(['rpm', '--eval=%_target_cpu'], shell=False).rstrip() rmachine = SCons.Util.to_str(rmachine) except Exception as e: # Something went wrong, try again by looking up platform.machine() return defaultMachine(False) else: rmachine = platform.machine() # Try to lookup the string in the canon table if rmachine in arch_canon: rmachine = arch_canon[rmachine][0] return rmachine def defaultSystem(): """ Return the canonicalized system name. """ rsystem = platform.system() # Try to lookup the string in the canon tables if rsystem in os_canon: rsystem = os_canon[rsystem][0] return rsystem def defaultNames(): """ Return the canonicalized machine and system name. """ return defaultMachine(), defaultSystem() def updateRpmDicts(rpmrc, pyfile): """ Read the given rpmrc file with RPM definitions and update the info dictionaries in the file pyfile with it. The arguments will usually be 'rpmrc.in' from a recent RPM source tree, and 'rpmutils.py' referring to this script itself. See also usage() below. """ try: # Read old rpmutils.py file oldpy = open(pyfile,"r").readlines() # Read current rpmrc.in file rpm = open(rpmrc,"r").readlines() # Parse for data data = {} # Allowed section names that get parsed sections = ['optflags', 'arch_canon', 'os_canon', 'buildarchtranslate', 'arch_compat', 'os_compat', 'buildarch_compat'] for l in rpm: l = l.rstrip('\n').replace(':',' ') # Skip comments if l.lstrip().startswith('#'): continue tokens = l.strip().split() if len(tokens): key = tokens[0] if key in sections: # Have we met this section before? if tokens[0] not in data: # No, so insert it data[key] = {} # Insert data data[key][tokens[1]] = tokens[2:] # Write new rpmutils.py file out = open(pyfile,"w") pm = 0 for l in oldpy: if pm: if l.startswith('# End of rpmrc dictionaries'): pm = 0 out.write(l) else: out.write(l) if l.startswith('# Start of rpmrc dictionaries'): pm = 1 # Write data sections to single dictionaries for key, entries in data.items(): out.write("%s = {\n" % key) for arch in sorted(entries.keys()): out.write(" '%s' : ['%s'],\n" % (arch, "','".join(entries[arch]))) out.write("}\n\n") out.close() except: pass def usage(): print("rpmutils.py rpmrc.in rpmutils.py") def main(): import sys if len(sys.argv) < 3: usage() sys.exit(0) updateRpmDicts(sys.argv[1], sys.argv[2]) if __name__ == "__main__": main()
31.333942
107
0.524314
from __future__ import print_function __revision__ = "src/engine/SCons/Tool/rpmutils.py rel_3.0.0:4395:8972f6a2f699 2017/09/18 12:59:24 bdbaddog" import platform import subprocess import SCons.Util os_canon = { 'AIX' : ['AIX','5'], 'AmigaOS' : ['AmigaOS','5'], 'BSD_OS' : ['bsdi','12'], 'CYGWIN32_95' : ['cygwin32','15'], 'CYGWIN32_NT' : ['cygwin32','14'], 'Darwin' : ['darwin','21'], 'FreeBSD' : ['FreeBSD','8'], 'HP-UX' : ['hpux10','6'], 'IRIX' : ['Irix','2'], 'IRIX64' : ['Irix64','10'], 'Linux' : ['Linux','1'], 'Linux/390' : ['OS/390','20'], 'Linux/ESA' : ['VM/ESA','20'], 'MacOSX' : ['macosx','21'], 'MiNT' : ['FreeMiNT','17'], 'NEXTSTEP' : ['NextStep','11'], 'OS/390' : ['OS/390','18'], 'OSF1' : ['osf1','7'], 'SCO_SV' : ['SCO_SV3.2v5.0.2','9'], 'SunOS4' : ['SunOS','4'], 'SunOS5' : ['solaris','3'], 'UNIX_SV' : ['MP_RAS','16'], 'VM/ESA' : ['VM/ESA','19'], 'machten' : ['machten','13'], 'osf3.2' : ['osf1','7'], 'osf4.0' : ['osf1','7'], } buildarch_compat = { 'alpha' : ['noarch'], 'alphaev5' : ['alpha'], 'alphaev56' : ['alphaev5'], 'alphaev6' : ['alphapca56'], 'alphaev67' : ['alphaev6'], 'alphapca56' : ['alphaev56'], 'amd64' : ['x86_64'], 'armv3l' : ['noarch'], 'armv4b' : ['noarch'], 'armv4l' : ['armv3l'], 'armv4tl' : ['armv4l'], 'armv5tejl' : ['armv5tel'], 'armv5tel' : ['armv4tl'], 'armv6l' : ['armv5tejl'], 'armv7l' : ['armv6l'], 'atariclone' : ['m68kmint','noarch'], 'atarist' : ['m68kmint','noarch'], 'atariste' : ['m68kmint','noarch'], 'ataritt' : ['m68kmint','noarch'], 'athlon' : ['i686'], 'falcon' : ['m68kmint','noarch'], 'geode' : ['i586'], 'hades' : ['m68kmint','noarch'], 'hppa1.0' : ['parisc'], 'hppa1.1' : ['hppa1.0'], 'hppa1.2' : ['hppa1.1'], 'hppa2.0' : ['hppa1.2'], 'i386' : ['noarch','fat'], 'i486' : ['i386'], 'i586' : ['i486'], 'i686' : ['i586'], 'ia32e' : ['x86_64'], 'ia64' : ['noarch'], 'm68k' : ['noarch'], 'milan' : ['m68kmint','noarch'], 'mips' : ['noarch'], 'mipsel' : ['noarch'], 'parisc' : ['noarch'], 'pentium3' : ['i686'], 'pentium4' : ['pentium3'], 'ppc' : ['noarch','fat'], 'ppc32dy4' : ['noarch'], 'ppc64' : ['noarch','fat'], 'ppc64iseries' : ['ppc64'], 'ppc64pseries' : ['ppc64'], 'ppc8260' : ['noarch'], 'ppc8560' : ['noarch'], 'ppciseries' : ['noarch'], 'ppcpseries' : ['noarch'], 's390' : ['noarch'], 's390x' : ['noarch'], 'sh3' : ['noarch'], 'sh4' : ['noarch'], 'sh4a' : ['sh4'], 'sparc' : ['noarch'], 'sparc64' : ['sparcv9v'], 'sparc64v' : ['sparc64'], 'sparcv8' : ['sparc'], 'sparcv9' : ['sparcv8'], 'sparcv9v' : ['sparcv9'], 'sun4c' : ['noarch'], 'sun4d' : ['noarch'], 'sun4m' : ['noarch'], 'sun4u' : ['noarch'], 'x86_64' : ['noarch'], } os_compat = { 'BSD_OS' : ['bsdi'], 'Darwin' : ['MacOSX'], 'FreeMiNT' : ['mint','MiNT','TOS'], 'IRIX64' : ['IRIX'], 'MiNT' : ['FreeMiNT','mint','TOS'], 'TOS' : ['FreeMiNT','MiNT','mint'], 'bsdi4.0' : ['bsdi'], 'hpux10.00' : ['hpux9.07'], 'hpux10.01' : ['hpux10.00'], 'hpux10.10' : ['hpux10.01'], 'hpux10.20' : ['hpux10.10'], 'hpux10.30' : ['hpux10.20'], 'hpux11.00' : ['hpux10.30'], 'hpux9.05' : ['hpux9.04'], 'hpux9.07' : ['hpux9.05'], 'mint' : ['FreeMiNT','MiNT','TOS'], 'ncr-sysv4.3' : ['ncr-sysv4.2'], 'osf4.0' : ['osf3.2','osf1'], 'solaris2.4' : ['solaris2.3'], 'solaris2.5' : ['solaris2.3','solaris2.4'], 'solaris2.6' : ['solaris2.3','solaris2.4','solaris2.5'], 'solaris2.7' : ['solaris2.3','solaris2.4','solaris2.5','solaris2.6'], } arch_compat = { 'alpha' : ['axp','noarch'], 'alphaev5' : ['alpha'], 'alphaev56' : ['alphaev5'], 'alphaev6' : ['alphapca56'], 'alphaev67' : ['alphaev6'], 'alphapca56' : ['alphaev56'], 'amd64' : ['x86_64','athlon','noarch'], 'armv3l' : ['noarch'], 'armv4b' : ['noarch'], 'armv4l' : ['armv3l'], 'armv4tl' : ['armv4l'], 'armv5tejl' : ['armv5tel'], 'armv5tel' : ['armv4tl'], 'armv6l' : ['armv5tejl'], 'armv7l' : ['armv6l'], 'atariclone' : ['m68kmint','noarch'], 'atarist' : ['m68kmint','noarch'], 'atariste' : ['m68kmint','noarch'], 'ataritt' : ['m68kmint','noarch'], 'athlon' : ['i686'], 'falcon' : ['m68kmint','noarch'], 'geode' : ['i586'], 'hades' : ['m68kmint','noarch'], 'hppa1.0' : ['parisc'], 'hppa1.1' : ['hppa1.0'], 'hppa1.2' : ['hppa1.1'], 'hppa2.0' : ['hppa1.2'], 'i370' : ['noarch'], 'i386' : ['noarch','fat'], 'i486' : ['i386'], 'i586' : ['i486'], 'i686' : ['i586'], 'ia32e' : ['x86_64','athlon','noarch'], 'ia64' : ['noarch'], 'milan' : ['m68kmint','noarch'], 'mips' : ['noarch'], 'mipsel' : ['noarch'], 'osfmach3_i386' : ['i486'], 'osfmach3_i486' : ['i486','osfmach3_i386'], 'osfmach3_i586' : ['i586','osfmach3_i486'], 'osfmach3_i686' : ['i686','osfmach3_i586'], 'osfmach3_ppc' : ['ppc'], 'parisc' : ['noarch'], 'pentium3' : ['i686'], 'pentium4' : ['pentium3'], 'powerpc' : ['ppc'], 'powerppc' : ['ppc'], 'ppc' : ['rs6000'], 'ppc32dy4' : ['ppc'], 'ppc64' : ['ppc'], 'ppc64iseries' : ['ppc64'], 'ppc64pseries' : ['ppc64'], 'ppc8260' : ['ppc'], 'ppc8560' : ['ppc'], 'ppciseries' : ['ppc'], 'ppcpseries' : ['ppc'], 'rs6000' : ['noarch','fat'], 's390' : ['noarch'], 's390x' : ['s390','noarch'], 'sh3' : ['noarch'], 'sh4' : ['noarch'], 'sh4a' : ['sh4'], 'sparc' : ['noarch'], 'sparc64' : ['sparcv9'], 'sparc64v' : ['sparc64'], 'sparcv8' : ['sparc'], 'sparcv9' : ['sparcv8'], 'sparcv9v' : ['sparcv9'], 'sun4c' : ['sparc'], 'sun4d' : ['sparc'], 'sun4m' : ['sparc'], 'sun4u' : ['sparc64'], 'x86_64' : ['amd64','athlon','noarch'], } buildarchtranslate = { 'alphaev5' : ['alpha'], 'alphaev56' : ['alpha'], 'alphaev6' : ['alpha'], 'alphaev67' : ['alpha'], 'alphapca56' : ['alpha'], 'amd64' : ['x86_64'], 'armv3l' : ['armv3l'], 'armv4b' : ['armv4b'], 'armv4l' : ['armv4l'], 'armv4tl' : ['armv4tl'], 'armv5tejl' : ['armv5tejl'], 'armv5tel' : ['armv5tel'], 'armv6l' : ['armv6l'], 'armv7l' : ['armv7l'], 'atariclone' : ['m68kmint'], 'atarist' : ['m68kmint'], 'atariste' : ['m68kmint'], 'ataritt' : ['m68kmint'], 'athlon' : ['i386'], 'falcon' : ['m68kmint'], 'geode' : ['i386'], 'hades' : ['m68kmint'], 'i386' : ['i386'], 'i486' : ['i386'], 'i586' : ['i386'], 'i686' : ['i386'], 'ia32e' : ['x86_64'], 'ia64' : ['ia64'], 'milan' : ['m68kmint'], 'osfmach3_i386' : ['i386'], 'osfmach3_i486' : ['i386'], 'osfmach3_i586' : ['i386'], 'osfmach3_i686' : ['i386'], 'osfmach3_ppc' : ['ppc'], 'pentium3' : ['i386'], 'pentium4' : ['i386'], 'powerpc' : ['ppc'], 'powerppc' : ['ppc'], 'ppc32dy4' : ['ppc'], 'ppc64iseries' : ['ppc64'], 'ppc64pseries' : ['ppc64'], 'ppc8260' : ['ppc'], 'ppc8560' : ['ppc'], 'ppciseries' : ['ppc'], 'ppcpseries' : ['ppc'], 's390' : ['s390'], 's390x' : ['s390x'], 'sh3' : ['sh3'], 'sh4' : ['sh4'], 'sh4a' : ['sh4'], 'sparc64v' : ['sparc64'], 'sparcv8' : ['sparc'], 'sparcv9' : ['sparc'], 'sparcv9v' : ['sparc'], 'sun4c' : ['sparc'], 'sun4d' : ['sparc'], 'sun4m' : ['sparc'], 'sun4u' : ['sparc64'], 'x86_64' : ['x86_64'], } optflags = { 'alpha' : ['-O2','-g','-mieee'], 'alphaev5' : ['-O2','-g','-mieee','-mtune=ev5'], 'alphaev56' : ['-O2','-g','-mieee','-mtune=ev56'], 'alphaev6' : ['-O2','-g','-mieee','-mtune=ev6'], 'alphaev67' : ['-O2','-g','-mieee','-mtune=ev67'], 'alphapca56' : ['-O2','-g','-mieee','-mtune=pca56'], 'amd64' : ['-O2','-g'], 'armv3l' : ['-O2','-g','-march=armv3'], 'armv4b' : ['-O2','-g','-march=armv4'], 'armv4l' : ['-O2','-g','-march=armv4'], 'armv4tl' : ['-O2','-g','-march=armv4t'], 'armv5tejl' : ['-O2','-g','-march=armv5te'], 'armv5tel' : ['-O2','-g','-march=armv5te'], 'armv6l' : ['-O2','-g','-march=armv6'], 'armv7l' : ['-O2','-g','-march=armv7'], 'atariclone' : ['-O2','-g','-fomit-frame-pointer'], 'atarist' : ['-O2','-g','-fomit-frame-pointer'], 'atariste' : ['-O2','-g','-fomit-frame-pointer'], 'ataritt' : ['-O2','-g','-fomit-frame-pointer'], 'athlon' : ['-O2','-g','-march=athlon'], 'falcon' : ['-O2','-g','-fomit-frame-pointer'], 'fat' : ['-O2','-g','-arch','i386','-arch','ppc'], 'geode' : ['-Os','-g','-m32','-march=geode'], 'hades' : ['-O2','-g','-fomit-frame-pointer'], 'hppa1.0' : ['-O2','-g','-mpa-risc-1-0'], 'hppa1.1' : ['-O2','-g','-mpa-risc-1-0'], 'hppa1.2' : ['-O2','-g','-mpa-risc-1-0'], 'hppa2.0' : ['-O2','-g','-mpa-risc-1-0'], 'i386' : ['-O2','-g','-march=i386','-mtune=i686'], 'i486' : ['-O2','-g','-march=i486'], 'i586' : ['-O2','-g','-march=i586'], 'i686' : ['-O2','-g','-march=i686'], 'ia32e' : ['-O2','-g'], 'ia64' : ['-O2','-g'], 'm68k' : ['-O2','-g','-fomit-frame-pointer'], 'milan' : ['-O2','-g','-fomit-frame-pointer'], 'mips' : ['-O2','-g'], 'mipsel' : ['-O2','-g'], 'parisc' : ['-O2','-g','-mpa-risc-1-0'], 'pentium3' : ['-O2','-g','-march=pentium3'], 'pentium4' : ['-O2','-g','-march=pentium4'], 'ppc' : ['-O2','-g','-fsigned-char'], 'ppc32dy4' : ['-O2','-g','-fsigned-char'], 'ppc64' : ['-O2','-g','-fsigned-char'], 'ppc8260' : ['-O2','-g','-fsigned-char'], 'ppc8560' : ['-O2','-g','-fsigned-char'], 'ppciseries' : ['-O2','-g','-fsigned-char'], 'ppcpseries' : ['-O2','-g','-fsigned-char'], 's390' : ['-O2','-g'], 's390x' : ['-O2','-g'], 'sh3' : ['-O2','-g'], 'sh4' : ['-O2','-g','-mieee'], 'sh4a' : ['-O2','-g','-mieee'], 'sparc' : ['-O2','-g','-m32','-mtune=ultrasparc'], 'sparc64' : ['-O2','-g','-m64','-mtune=ultrasparc'], 'sparc64v' : ['-O2','-g','-m64','-mtune=niagara'], 'sparcv8' : ['-O2','-g','-m32','-mtune=ultrasparc','-mv8'], 'sparcv9' : ['-O2','-g','-m32','-mtune=ultrasparc'], 'sparcv9v' : ['-O2','-g','-m32','-mtune=niagara'], 'x86_64' : ['-O2','-g'], } arch_canon = { 'IP' : ['sgi','7'], 'alpha' : ['alpha','2'], 'alphaev5' : ['alphaev5','2'], 'alphaev56' : ['alphaev56','2'], 'alphaev6' : ['alphaev6','2'], 'alphaev67' : ['alphaev67','2'], 'alphapca56' : ['alphapca56','2'], 'amd64' : ['amd64','1'], 'armv3l' : ['armv3l','12'], 'armv4b' : ['armv4b','12'], 'armv4l' : ['armv4l','12'], 'armv5tejl' : ['armv5tejl','12'], 'armv5tel' : ['armv5tel','12'], 'armv6l' : ['armv6l','12'], 'armv7l' : ['armv7l','12'], 'atariclone' : ['m68kmint','13'], 'atarist' : ['m68kmint','13'], 'atariste' : ['m68kmint','13'], 'ataritt' : ['m68kmint','13'], 'athlon' : ['athlon','1'], 'falcon' : ['m68kmint','13'], 'geode' : ['geode','1'], 'hades' : ['m68kmint','13'], 'i370' : ['i370','14'], 'i386' : ['i386','1'], 'i486' : ['i486','1'], 'i586' : ['i586','1'], 'i686' : ['i686','1'], 'ia32e' : ['ia32e','1'], 'ia64' : ['ia64','9'], 'm68k' : ['m68k','6'], 'm68kmint' : ['m68kmint','13'], 'milan' : ['m68kmint','13'], 'mips' : ['mips','4'], 'mipsel' : ['mipsel','11'], 'pentium3' : ['pentium3','1'], 'pentium4' : ['pentium4','1'], 'ppc' : ['ppc','5'], 'ppc32dy4' : ['ppc32dy4','5'], 'ppc64' : ['ppc64','16'], 'ppc64iseries' : ['ppc64iseries','16'], 'ppc64pseries' : ['ppc64pseries','16'], 'ppc8260' : ['ppc8260','5'], 'ppc8560' : ['ppc8560','5'], 'ppciseries' : ['ppciseries','5'], 'ppcpseries' : ['ppcpseries','5'], 'rs6000' : ['rs6000','8'], 's390' : ['s390','14'], 's390x' : ['s390x','15'], 'sh' : ['sh','17'], 'sh3' : ['sh3','17'], 'sh4' : ['sh4','17'], 'sh4a' : ['sh4a','17'], 'sparc' : ['sparc','3'], 'sparc64' : ['sparc64','2'], 'sparc64v' : ['sparc64v','2'], 'sparcv8' : ['sparcv8','3'], 'sparcv9' : ['sparcv9','3'], 'sparcv9v' : ['sparcv9v','3'], 'sun4' : ['sparc','3'], 'sun4c' : ['sparc','3'], 'sun4d' : ['sparc','3'], 'sun4m' : ['sparc','3'], 'sun4u' : ['sparc64','2'], 'x86_64' : ['x86_64','1'], 'xtensa' : ['xtensa','18'], } # End of rpmrc dictionaries (Marker, don't change or remove!) def defaultMachine(use_rpm_default=True): if use_rpm_default: try: rmachine = subprocess.check_output(['rpm', '--eval=%_target_cpu'], shell=False).rstrip() rmachine = SCons.Util.to_str(rmachine) except Exception as e: return defaultMachine(False) else: rmachine = platform.machine() if rmachine in arch_canon: rmachine = arch_canon[rmachine][0] return rmachine def defaultSystem(): rsystem = platform.system() if rsystem in os_canon: rsystem = os_canon[rsystem][0] return rsystem def defaultNames(): return defaultMachine(), defaultSystem() def updateRpmDicts(rpmrc, pyfile): try: oldpy = open(pyfile,"r").readlines() rpm = open(rpmrc,"r").readlines() data = {} sections = ['optflags', 'arch_canon', 'os_canon', 'buildarchtranslate', 'arch_compat', 'os_compat', 'buildarch_compat'] for l in rpm: l = l.rstrip('\n').replace(':',' ') if l.lstrip().startswith('#'): continue tokens = l.strip().split() if len(tokens): key = tokens[0] if key in sections: if tokens[0] not in data: data[key] = {} data[key][tokens[1]] = tokens[2:] out = open(pyfile,"w") pm = 0 for l in oldpy: if pm: if l.startswith('# End of rpmrc dictionaries'): pm = 0 out.write(l) else: out.write(l) if l.startswith('# Start of rpmrc dictionaries'): pm = 1 for key, entries in data.items(): out.write("%s = {\n" % key) for arch in sorted(entries.keys()): out.write(" '%s' : ['%s'],\n" % (arch, "','".join(entries[arch]))) out.write("}\n\n") out.close() except: pass def usage(): print("rpmutils.py rpmrc.in rpmutils.py") def main(): import sys if len(sys.argv) < 3: usage() sys.exit(0) updateRpmDicts(sys.argv[1], sys.argv[2]) if __name__ == "__main__": main()
true
true
f71d672bcf533ac2ac8ebfb1e4f4f25cd9aa808f
4,105
py
Python
mesos_operations/mesos_operations.py
sasank1/plugins
f12dcb207dcd53819f2f23eeaab3b60a40885d4b
[ "BSD-2-Clause" ]
36
2016-03-30T10:59:37.000Z
2022-02-28T21:46:42.000Z
mesos_operations/mesos_operations.py
sasank1/plugins
f12dcb207dcd53819f2f23eeaab3b60a40885d4b
[ "BSD-2-Clause" ]
21
2016-10-07T06:20:56.000Z
2022-03-10T12:09:34.000Z
mesos_operations/mesos_operations.py
sasank1/plugins
f12dcb207dcd53819f2f23eeaab3b60a40885d4b
[ "BSD-2-Clause" ]
65
2016-03-16T09:11:48.000Z
2022-03-09T13:10:08.000Z
#!/usr/bin/python import json import urllib2 ### For monitoring the performance metrics of your Mesos Agents using Site24x7 Server Monitoring Plugins. ### 1. Have the site24x7 server monitoring agent up and running. ### 2. Download the plugin from github ### 3. Create a folder in name of the plugin under agent plugins directory (/opt/site24x7/monagent/plugins/) ### 4. Place the plugin inside the folder ### Language : Python ### Author: Anita, Zoho Corp ### Tested in Ubuntu # Change the mesos agents stats accordingly here. HOST="localhost" PORT="5050" URL = "http://"+HOST+":"+PORT+"/metrics/snapshot" USERNAME = None PASSWORD = None # If any changes done in the plugin, plugin_version must be incremented by 1. For. E.g 2,3,4.. PLUGIN_VERSION = "1" # Setting this to true will alert you when there is a communication problem while posting plugin data to server HEARTBEAT = "true" class MesosAgents(): def __init__(self): self.data = {} self.data['plugin_version'] = PLUGIN_VERSION self.data['heartbeat_required'] = HEARTBEAT def getData(self): try: ### Create Authentication Handler for the HTTP Request pwdmgr = urllib2.HTTPPasswordMgr() pwdmgr.add_password(None, URL, USERNAME, PASSWORD) auth = urllib2.HTTPBasicAuthHandler(pwdmgr) ### Create Proxy Handler for the HTTP Request proxy = urllib2.ProxyHandler({}) # Uses NO Proxy ### Create a HTTP Request with the authentication and proxy handlers opener = urllib2.build_opener(proxy, auth) urllib2.install_opener(opener) ### Get HTTP Response response = urllib2.urlopen(URL, timeout=10) ### Parse the response data if response.getcode() == 200: bytedata = response.read() output = bytedata.decode() self.data = self.parseClusterData(output) else: self.data['msg'] = str(response.getcode()) self.status = 0 except Exception as e: self.data['msg'] = str(e) self.status = 0 return self.data def parseClusterData(self, output): try: data = json.loads(output.decode('UTF-8')) self.data['master_slave_registrations'] = data['master/slave_registrations']#Number of agents that were able to cleanly re-join the cluster and connect back to the master after the master is disconnected. self.data['master_master_slave_reregistrations'] = data['master/slave_reregistrations']#Number of agent re-registrations self.data['master_slave_removals'] = data['master/slave_removals']#Number of agent removed for various reasons, including maintenance self.data['master_slave_shutdowns_scheduled'] = data['master/slave_shutdowns_scheduled']#Number of agents which have failed their health check and are scheduled to be removed. self.data['master_slave_shutdowns_canceled'] = data['master/slave_shutdowns_canceled']#Number of cancelled agent shutdowns. self.data['master_slave_shutdowns_completed'] = data['master/slave_shutdowns_completed']#Number of agents that failed their health check. self.data['master_slaves_active'] = data['master/slaves_active']#Number of active agents self.data['master_slaves_connected'] = data['master/slaves_connected']#Number of connected agents self.data['master_slaves_disconnected'] = data['master/slaves_disconnected']#Number of disconnected agents self.data['master_slaves_inactive'] = data['master/slaves_inactive']#Number of inactive agents except Exception as e: self.data['msg'] = str(e) self.status = 0 return self.data if __name__ == '__main__': mesosagt = MesosAgents() result = mesosagt.getData() print(json.dumps(result, indent=4, sort_keys=True))
42.760417
216
0.649939
import json import urllib2 msg'] = str(e) self.status = 0 return self.data def parseClusterData(self, output): try: data = json.loads(output.decode('UTF-8')) self.data['master_slave_registrations'] = data['master/slave_registrations'] self.data['master_master_slave_reregistrations'] = data['master/slave_reregistrations'] self.data['master_slave_removals'] = data['master/slave_removals'] self.data['master_slave_shutdowns_scheduled'] = data['master/slave_shutdowns_scheduled'] self.data['master_slave_shutdowns_canceled'] = data['master/slave_shutdowns_canceled'] self.data['master_slave_shutdowns_completed'] = data['master/slave_shutdowns_completed'] self.data['master_slaves_active'] = data['master/slaves_active'] self.data['master_slaves_connected'] = data['master/slaves_connected'] self.data['master_slaves_disconnected'] = data['master/slaves_disconnected'] self.data['master_slaves_inactive'] = data['master/slaves_inactive'] except Exception as e: self.data['msg'] = str(e) self.status = 0 return self.data if __name__ == '__main__': mesosagt = MesosAgents() result = mesosagt.getData() print(json.dumps(result, indent=4, sort_keys=True))
true
true
f71d6913191f30ac3e407165484554354a24b22d
1,734
py
Python
muddery/server/upgrader/base_upgrader.py
MarsZone/DreamLand
87455f421c1ba09cb6efd5fc0882fbc2a29ea1a5
[ "BSD-3-Clause-No-Nuclear-License-2014", "BSD-3-Clause" ]
null
null
null
muddery/server/upgrader/base_upgrader.py
MarsZone/DreamLand
87455f421c1ba09cb6efd5fc0882fbc2a29ea1a5
[ "BSD-3-Clause-No-Nuclear-License-2014", "BSD-3-Clause" ]
null
null
null
muddery/server/upgrader/base_upgrader.py
MarsZone/DreamLand
87455f421c1ba09cb6efd5fc0882fbc2a29ea1a5
[ "BSD-3-Clause-No-Nuclear-License-2014", "BSD-3-Clause" ]
null
null
null
""" Upgrade custom's game dir to the latest version. """ from utils import compare_version class BaseUpgrader(object): """ Upgrade a game dir from the version in [<from_version>, <to_version>) to version <target_version>. """ # Can upgrade the game of version between from_version and to_version. # min version 0.0.0 (include this version) from_min_version = (0, 0, 0) # from max version 0.0.0 (not include this version) from_max_version = (0, 0, 0) # Upgrade to the target version. None means the latest version. target_version = None def upgrade_game(self, game_dir, game_template, muddery_lib): """ Upgrade a game. Args: game_dir: (string) the game dir to be upgraded. game_template: (string) the game template used to upgrade the game dir. muddery_lib: (string) muddery's dir """ pass def upgrade_data(self, data_path, game_template, muddery_lib): """ Upgrade game data. Args: data_path: (string) the data path to be upgraded. game_template: (string) the game template used to upgrade the game dir. muddery_lib: (string) muddery's dir """ pass def can_upgrade(self, game_ver): """ game_version: (list)version numbers. """ # The game version should be equal or bigger than from_min_version. if compare_version(game_ver, self.from_min_version) == -1: return False # The game version should be smaller than from_max_version. if compare_version(game_ver, self.from_max_version) != -1: return False return True
29.896552
84
0.619954
from utils import compare_version class BaseUpgrader(object): from_min_version = (0, 0, 0) from_max_version = (0, 0, 0) target_version = None def upgrade_game(self, game_dir, game_template, muddery_lib): pass def upgrade_data(self, data_path, game_template, muddery_lib): pass def can_upgrade(self, game_ver): if compare_version(game_ver, self.from_min_version) == -1: return False if compare_version(game_ver, self.from_max_version) != -1: return False return True
true
true
f71d69f1c9f19da80953622dfdb60cfd07448bed
17,664
py
Python
saticl/training.py
edornd/multimodal-icl
f79bfa73665db471c12ee9cb57bbee1bcabb0467
[ "MIT" ]
6
2021-12-08T05:58:18.000Z
2021-12-29T09:55:32.000Z
saticl/training.py
edornd/multimodal-icl
f79bfa73665db471c12ee9cb57bbee1bcabb0467
[ "MIT" ]
null
null
null
saticl/training.py
edornd/multimodal-icl
f79bfa73665db471c12ee9cb57bbee1bcabb0467
[ "MIT" ]
null
null
null
from itertools import chain from pathlib import Path from typing import Tuple import torch from accelerate import Accelerator from torch.utils.data import DataLoader from saticl.config import Configuration, SSLConfiguration from saticl.datasets.icl import ICLDataset from saticl.datasets.transforms import invariance_transforms, inverse_transform, ssl_transforms from saticl.datasets.wrappers import SSLDataset from saticl.logging.tensorboard import TensorBoardLogger from saticl.losses.regularization import AugmentationInvariance from saticl.models.icl import ICLSegmenter from saticl.prepare import prepare_dataset, prepare_metrics, prepare_metrics_ssl, prepare_model, prepare_model_ssl from saticl.tasks import Task from saticl.trainer.base import Trainer from saticl.trainer.callbacks import Checkpoint, DisplaySamples, EarlyStopping, EarlyStoppingCriterion from saticl.trainer.invariance import AugInvarianceTrainer from saticl.trainer.ssl import SSLStage, SSLTrainer from saticl.utils.common import flatten_config, get_logger, git_revision_hash, store_config from saticl.utils.ml import checkpoint_path, init_experiment, seed_everything, seed_worker LOG = get_logger(__name__) def init_from_previous_step(config: Configuration, new_model: ICLSegmenter, old_model: ICLSegmenter, model_folder: Path, task: Task) -> Tuple[ICLSegmenter, ICLSegmenter]: if task.step == 0: LOG.info("Step 0: training from scratch without old model") return new_model, old_model LOG.info("Loading checkpoint from step: %d", task.step - 1) if config.task.step_checkpoint is not None: ckpt_path = Path(config.task.step_checkpoint) else: ckpt_path = checkpoint_path(model_folder, task_name=task.name, step=task.step - 1) assert ckpt_path.exists() and ckpt_path.is_file(), f"Checkpoint for step {task.step-1} not found at {str(ckpt_path)}" checkpoint = torch.load(str(ckpt_path), map_location="cpu") # load checkpoint into the new model, without strict matching because of ICL heads new_model.load_state_dict(checkpoint, strict=False) if config.model.init_balanced: new_model.init_classifier() # load the same checkpoint into the old model, this time strict since it's the very same old_model.load_state_dict(checkpoint, strict=True) old_model.freeze() old_model.eval() del checkpoint return new_model, old_model def train(config: Configuration): # assertions before starting assert config.name is not None or config.task.step == 0, "Specify the experiment name with ICL steps >= 1!" assert torch.backends.cudnn.enabled, "AMP requires CUDNN backend to be enabled." # prepare accelerator ASAP accelerator = Accelerator(fp16=config.trainer.amp, cpu=config.trainer.cpu) # Create the directory tree: # outputs # |-- dataset # |--task_name # |-- exp_name # |-- models # |-- logs accelerator.wait_for_everyone() log_name = f"output-{config.task.step}.log" exp_id, out_folder, model_folder, logs_folder = init_experiment(config=config, log_name=log_name) config_path = out_folder / f"segmenter-config-s{config.task.step}.yaml" LOG.info("Run started") LOG.info("Experiment ID: %s", exp_id) LOG.info("Output folder: %s", out_folder) LOG.info("Models folder: %s", model_folder) LOG.info("Logs folder: %s", logs_folder) LOG.info("Configuration: %s", config_path) # seeding everything LOG.info("Using seed: %d", config.seed) seed_everything(config.seed) # prepare datasets LOG.info("Loading datasets...") train_set, valid_set = prepare_dataset(config=config, partial_transforms=False) LOG.info("Full sets - train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) add_background = not train_set.has_background() task = Task(dataset=config.dataset, name=config.task.name, step=config.task.step, add_background=add_background) train_mask, valid_mask = 0, 255 train_set = ICLDataset(dataset=train_set, task=task, mask_value=train_mask, filter_mode=config.task.filter_mode) valid_set = ICLDataset(dataset=valid_set, task=task, mask_value=valid_mask, filter_mode=config.task.filter_mode) # construct data loaders train_loader = DataLoader(dataset=train_set, batch_size=config.trainer.batch_size, shuffle=True, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker, drop_last=True) valid_loader = DataLoader(dataset=valid_set, batch_size=config.trainer.batch_size, shuffle=False, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker) LOG.info("ICL sets - Train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) # prepare models LOG.info("Preparing model...") new_model = prepare_model(config=config, task=task) new_model = new_model.to(accelerator.device) if task.step > 0: old_task = Task(dataset=config.dataset, name=config.task.name, step=task.step - 1, add_background=add_background) old_model = prepare_model(config=config, task=old_task) old_model = old_model.to(accelerator.device) else: old_model = None new_model, old_model = init_from_previous_step(config, new_model, old_model, model_folder, task) LOG.info("Done preparing models") # prepare optimizer and scheduler optimizer = config.optimizer.instantiate(new_model.parameters()) scheduler = config.scheduler.instantiate(optimizer) # prepare losses weights = None if config.class_weights: weights = train_set.load_class_weights(Path(config.class_weights), device=accelerator.device, normalize=config.ce.tversky) LOG.info("Using class weights: %s", str(weights)) segment_loss = config.ce.instantiate(ignore_index=255, old_class_count=task.old_class_count(), weight=weights) distill_loss = config.kd.instantiate() if task.step > 0 and config.ce.unbiased: seg_loss_name = str(type(segment_loss)) kdd_loss_name = str(type(distill_loss)) if "Unbiased" not in seg_loss_name: LOG.warn(f"Non-ubiased segmentation loss '{seg_loss_name}' for step {task.step}!") if "Unbiased" not in kdd_loss_name: LOG.warn(f"Non-unbiased KD loss '{kdd_loss_name}' for step {task.step}") # prepare metrics and logger monitored = config.trainer.monitor.name train_metrics, valid_metrics = prepare_metrics(task=task, device=accelerator.device) logger = TensorBoardLogger(log_folder=logs_folder, filename_suffix=f"step-{task.step}", icl_step=task.step, comment=config.comment) # logging configuration to tensorboard LOG.debug("Logging flattened config. to TensorBoard") logger.log_table("config", flatten_config(config.dict())) # prepare trainer LOG.info("Visualize: %s, num. batches for visualization: %s", str(config.visualize), str(config.num_samples)) num_samples = int(config.visualize) * config.num_samples # choose trainer class depending on task or regularization trainer_class = Trainer kwargs = dict() if config.aug.apply: inv_transforms = invariance_transforms(config.aug) LOG.info("Invariance transforms: ") LOG.info(str(inv_transforms)) kwargs.update(aug_criterion=AugmentationInvariance(transform=inv_transforms), aug_lambda=config.aug.factor, aug_lambda_icl=config.aug.factor_icl, temperature=config.trainer.temperature, temp_epochs=config.trainer.temp_epochs) trainer_class = AugInvarianceTrainer trainer = trainer_class(accelerator=accelerator, task=task, new_model=new_model, old_model=old_model, optimizer=optimizer, scheduler=scheduler, train_metrics=train_metrics, val_metrics=valid_metrics, old_classes=train_set.old_categories(), new_classes=train_set.new_categories(), seg_criterion=segment_loss, kdd_criterion=distill_loss, kde_criterion=None, kdd_lambda=config.kd.decoder_factor, kde_lambda=config.kd.encoder_factor, logger=logger, samples=num_samples, debug=config.debug, **kwargs) trainer.add_callback(EarlyStopping(call_every=1, metric=monitored, criterion=EarlyStoppingCriterion.maximum, patience=config.trainer.patience)) \ .add_callback(Checkpoint(call_every=1, model_folder=model_folder, name_format=f"task{task.name}_step-{task.step}", save_best=True)) \ .add_callback(DisplaySamples(inverse_transform=inverse_transform(), color_palette=train_set.palette())) # storing config and starting training config.version = git_revision_hash() store_config(config, path=config_path) trainer.fit(train_dataloader=train_loader, val_dataloader=valid_loader, max_epochs=config.trainer.max_epochs) LOG.info(f"Training completed at epoch {trainer.current_epoch:<2d} " f"(best {monitored}: {trainer.best_score:.4f})") LOG.info("Experiment %s (step %d) completed!", exp_id, task.step) def train_ssl(config: SSLConfiguration): # assertions before starting assert config.name is not None or config.task.step == 0, "Specify the experiment name with ICL steps >= 1!" assert torch.backends.cudnn.enabled, "AMP requires CUDNN backend to be enabled." if config.in_channels != 4: LOG.warn("Forcing input channels to 4 (previous value: %d)", config.in_channels) config.in_channels = 4 # prepare accelerator ASAP accelerator = Accelerator(fp16=config.trainer.amp, cpu=config.trainer.cpu) # Create the directory tree: # outputs # |-- dataset # |--task_name # |-- exp_name # |-- models # |-- logs accelerator.wait_for_everyone() log_name = f"output-{config.task.step}.log" exp_id, out_folder, model_folder, logs_folder = init_experiment(config=config, log_name=log_name) config_path = out_folder / f"segmenter-config-s{config.task.step}.yaml" store_config(config, path=config_path) LOG.info("Run started") LOG.info("Experiment ID: %s", exp_id) LOG.info("Output folder: %s", out_folder) LOG.info("Models folder: %s", model_folder) LOG.info("Logs folder: %s", logs_folder) LOG.info("Configuration: %s", config_path) # seeding everything LOG.info("Using seed: %d", config.seed) seed_everything(config.seed) # prepare datasets LOG.info("Loading datasets...") train_set, valid_set = prepare_dataset(config=config) train_set = SSLDataset(train_set, transform=ssl_transforms()) LOG.info("Full sets - train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) add_background = not train_set.has_background() task = Task(dataset=config.dataset, name=config.task.name, step=config.task.step, add_background=add_background) train_mask, valid_mask = 0, 255 train_set = ICLDataset(dataset=train_set, task=task, mask_value=train_mask, filter_mode=config.task.filter_mode) valid_set = ICLDataset(dataset=valid_set, task=task, mask_value=valid_mask, filter_mode=config.task.filter_mode) train_loader = DataLoader(dataset=train_set, batch_size=config.trainer.batch_size, shuffle=True, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker, drop_last=True) valid_loader = DataLoader(dataset=valid_set, batch_size=config.trainer.batch_size, shuffle=False, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker) LOG.info("ICL sets - Train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) # prepare models LOG.info("Preparing model...") new_model, ssl_model = prepare_model_ssl(config=config, task=task) new_model = new_model.to(accelerator.device) ssl_model = ssl_model.to(accelerator.device) if task.step > 0: old_task = Task(dataset=config.dataset, name=config.task.name, step=task.step - 1, add_background=add_background) old_model = prepare_model(config=config, task=old_task) old_model = old_model.to(accelerator.device) else: old_model = None new_model, old_model = init_from_previous_step(config, new_model, old_model, model_folder, task) LOG.info("Done preparing models") # prepare optimizer and scheduler parameters = chain(new_model.parameters(), ssl_model.head.parameters()) optimizer = config.optimizer.instantiate(parameters) scheduler = config.scheduler.instantiate(optimizer) # prepare losses, including SSL segment_loss = config.ce.instantiate(ignore_index=255, old_class_count=task.old_class_count()) distill_loss = config.kd.instantiate() pretext_loss = config.ssl_loss() # asserts to verify their validity if task.step > 0 and config.ce.unbiased: seg_loss_name = str(type(segment_loss)) kdd_loss_name = str(type(distill_loss)) assert "Unbiased" in seg_loss_name, f"Wrong loss '{seg_loss_name}' for step {task.step}" assert "Unbiased" in kdd_loss_name, f"Wrong loss '{kdd_loss_name}' for step {task.step}" # prepare metrics and logger monitored = config.trainer.monitor.name train_metrics, valid_metrics = prepare_metrics(task=task, device=accelerator.device) ssl_metrics = prepare_metrics_ssl(num_classes=config.model.pretext_classes, device=accelerator.device) logger = TensorBoardLogger(log_folder=logs_folder, filename_suffix=f"step-{task.step}", icl_step=task.step, comment=config.comment) # logging configuration to tensorboard LOG.debug("Logging flattened config. to TensorBoard") logger.log_table("config", flatten_config(config.dict())) # prepare trainer LOG.info("Visualize: %s, num. batches for visualization: %s", str(config.visualize), str(config.num_samples)) num_samples = int(config.visualize) * config.num_samples trainer = SSLTrainer(accelerator=accelerator, task=task, new_model=new_model, old_model=old_model, ssl_model=ssl_model, optimizer=optimizer, scheduler=scheduler, train_metrics=train_metrics, val_metrics=valid_metrics, old_classes=train_set.old_categories(), new_classes=train_set.new_categories(), seg_criterion=segment_loss, ssl_criterion=pretext_loss, kdd_criterion=distill_loss, kde_criterion=None, kdd_lambda=config.kd.decoder_factor, kde_lambda=config.kd.encoder_factor, logger=logger, samples=num_samples, debug=config.debug) trainer.add_metrics(SSLStage.ssl, metrics=ssl_metrics) trainer.add_callback(EarlyStopping(call_every=1, metric=monitored, criterion=EarlyStoppingCriterion.maximum, patience=config.trainer.patience)) \ .add_callback(Checkpoint(call_every=1, model_folder=model_folder, name_format=f"task{task.name}_step-{task.step}", save_best=True)) \ .add_callback(DisplaySamples(inverse_transform=inverse_transform(), color_palette=train_set.palette())) trainer.fit(train_dataloader=train_loader, val_dataloader=valid_loader, max_epochs=config.trainer.max_epochs) LOG.info(f"Training completed at epoch {trainer.current_epoch:<2d} " f"(best {monitored}: {trainer.best_score:.4f})") LOG.info("Experiment %s (step %d) completed!", exp_id, task.step)
50.613181
121
0.637908
from itertools import chain from pathlib import Path from typing import Tuple import torch from accelerate import Accelerator from torch.utils.data import DataLoader from saticl.config import Configuration, SSLConfiguration from saticl.datasets.icl import ICLDataset from saticl.datasets.transforms import invariance_transforms, inverse_transform, ssl_transforms from saticl.datasets.wrappers import SSLDataset from saticl.logging.tensorboard import TensorBoardLogger from saticl.losses.regularization import AugmentationInvariance from saticl.models.icl import ICLSegmenter from saticl.prepare import prepare_dataset, prepare_metrics, prepare_metrics_ssl, prepare_model, prepare_model_ssl from saticl.tasks import Task from saticl.trainer.base import Trainer from saticl.trainer.callbacks import Checkpoint, DisplaySamples, EarlyStopping, EarlyStoppingCriterion from saticl.trainer.invariance import AugInvarianceTrainer from saticl.trainer.ssl import SSLStage, SSLTrainer from saticl.utils.common import flatten_config, get_logger, git_revision_hash, store_config from saticl.utils.ml import checkpoint_path, init_experiment, seed_everything, seed_worker LOG = get_logger(__name__) def init_from_previous_step(config: Configuration, new_model: ICLSegmenter, old_model: ICLSegmenter, model_folder: Path, task: Task) -> Tuple[ICLSegmenter, ICLSegmenter]: if task.step == 0: LOG.info("Step 0: training from scratch without old model") return new_model, old_model LOG.info("Loading checkpoint from step: %d", task.step - 1) if config.task.step_checkpoint is not None: ckpt_path = Path(config.task.step_checkpoint) else: ckpt_path = checkpoint_path(model_folder, task_name=task.name, step=task.step - 1) assert ckpt_path.exists() and ckpt_path.is_file(), f"Checkpoint for step {task.step-1} not found at {str(ckpt_path)}" checkpoint = torch.load(str(ckpt_path), map_location="cpu") new_model.load_state_dict(checkpoint, strict=False) if config.model.init_balanced: new_model.init_classifier() old_model.load_state_dict(checkpoint, strict=True) old_model.freeze() old_model.eval() del checkpoint return new_model, old_model def train(config: Configuration): # assertions before starting assert config.name is not None or config.task.step == 0, "Specify the experiment name with ICL steps >= 1!" assert torch.backends.cudnn.enabled, "AMP requires CUDNN backend to be enabled." # prepare accelerator ASAP accelerator = Accelerator(fp16=config.trainer.amp, cpu=config.trainer.cpu) # Create the directory tree: # outputs # |-- dataset # |--task_name # |-- exp_name # |-- models # |-- logs accelerator.wait_for_everyone() log_name = f"output-{config.task.step}.log" exp_id, out_folder, model_folder, logs_folder = init_experiment(config=config, log_name=log_name) config_path = out_folder / f"segmenter-config-s{config.task.step}.yaml" LOG.info("Run started") LOG.info("Experiment ID: %s", exp_id) LOG.info("Output folder: %s", out_folder) LOG.info("Models folder: %s", model_folder) LOG.info("Logs folder: %s", logs_folder) LOG.info("Configuration: %s", config_path) # seeding everything LOG.info("Using seed: %d", config.seed) seed_everything(config.seed) # prepare datasets LOG.info("Loading datasets...") train_set, valid_set = prepare_dataset(config=config, partial_transforms=False) LOG.info("Full sets - train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) add_background = not train_set.has_background() task = Task(dataset=config.dataset, name=config.task.name, step=config.task.step, add_background=add_background) train_mask, valid_mask = 0, 255 train_set = ICLDataset(dataset=train_set, task=task, mask_value=train_mask, filter_mode=config.task.filter_mode) valid_set = ICLDataset(dataset=valid_set, task=task, mask_value=valid_mask, filter_mode=config.task.filter_mode) # construct data loaders train_loader = DataLoader(dataset=train_set, batch_size=config.trainer.batch_size, shuffle=True, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker, drop_last=True) valid_loader = DataLoader(dataset=valid_set, batch_size=config.trainer.batch_size, shuffle=False, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker) LOG.info("ICL sets - Train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) # prepare models LOG.info("Preparing model...") new_model = prepare_model(config=config, task=task) new_model = new_model.to(accelerator.device) if task.step > 0: old_task = Task(dataset=config.dataset, name=config.task.name, step=task.step - 1, add_background=add_background) old_model = prepare_model(config=config, task=old_task) old_model = old_model.to(accelerator.device) else: old_model = None new_model, old_model = init_from_previous_step(config, new_model, old_model, model_folder, task) LOG.info("Done preparing models") # prepare optimizer and scheduler optimizer = config.optimizer.instantiate(new_model.parameters()) scheduler = config.scheduler.instantiate(optimizer) # prepare losses weights = None if config.class_weights: weights = train_set.load_class_weights(Path(config.class_weights), device=accelerator.device, normalize=config.ce.tversky) LOG.info("Using class weights: %s", str(weights)) segment_loss = config.ce.instantiate(ignore_index=255, old_class_count=task.old_class_count(), weight=weights) distill_loss = config.kd.instantiate() if task.step > 0 and config.ce.unbiased: seg_loss_name = str(type(segment_loss)) kdd_loss_name = str(type(distill_loss)) if "Unbiased" not in seg_loss_name: LOG.warn(f"Non-ubiased segmentation loss '{seg_loss_name}' for step {task.step}!") if "Unbiased" not in kdd_loss_name: LOG.warn(f"Non-unbiased KD loss '{kdd_loss_name}' for step {task.step}") # prepare metrics and logger monitored = config.trainer.monitor.name train_metrics, valid_metrics = prepare_metrics(task=task, device=accelerator.device) logger = TensorBoardLogger(log_folder=logs_folder, filename_suffix=f"step-{task.step}", icl_step=task.step, comment=config.comment) # logging configuration to tensorboard LOG.debug("Logging flattened config. to TensorBoard") logger.log_table("config", flatten_config(config.dict())) # prepare trainer LOG.info("Visualize: %s, num. batches for visualization: %s", str(config.visualize), str(config.num_samples)) num_samples = int(config.visualize) * config.num_samples # choose trainer class depending on task or regularization trainer_class = Trainer kwargs = dict() if config.aug.apply: inv_transforms = invariance_transforms(config.aug) LOG.info("Invariance transforms: ") LOG.info(str(inv_transforms)) kwargs.update(aug_criterion=AugmentationInvariance(transform=inv_transforms), aug_lambda=config.aug.factor, aug_lambda_icl=config.aug.factor_icl, temperature=config.trainer.temperature, temp_epochs=config.trainer.temp_epochs) trainer_class = AugInvarianceTrainer trainer = trainer_class(accelerator=accelerator, task=task, new_model=new_model, old_model=old_model, optimizer=optimizer, scheduler=scheduler, train_metrics=train_metrics, val_metrics=valid_metrics, old_classes=train_set.old_categories(), new_classes=train_set.new_categories(), seg_criterion=segment_loss, kdd_criterion=distill_loss, kde_criterion=None, kdd_lambda=config.kd.decoder_factor, kde_lambda=config.kd.encoder_factor, logger=logger, samples=num_samples, debug=config.debug, **kwargs) trainer.add_callback(EarlyStopping(call_every=1, metric=monitored, criterion=EarlyStoppingCriterion.maximum, patience=config.trainer.patience)) \ .add_callback(Checkpoint(call_every=1, model_folder=model_folder, name_format=f"task{task.name}_step-{task.step}", save_best=True)) \ .add_callback(DisplaySamples(inverse_transform=inverse_transform(), color_palette=train_set.palette())) # storing config and starting training config.version = git_revision_hash() store_config(config, path=config_path) trainer.fit(train_dataloader=train_loader, val_dataloader=valid_loader, max_epochs=config.trainer.max_epochs) LOG.info(f"Training completed at epoch {trainer.current_epoch:<2d} " f"(best {monitored}: {trainer.best_score:.4f})") LOG.info("Experiment %s (step %d) completed!", exp_id, task.step) def train_ssl(config: SSLConfiguration): # assertions before starting assert config.name is not None or config.task.step == 0, "Specify the experiment name with ICL steps >= 1!" assert torch.backends.cudnn.enabled, "AMP requires CUDNN backend to be enabled." if config.in_channels != 4: LOG.warn("Forcing input channels to 4 (previous value: %d)", config.in_channels) config.in_channels = 4 # prepare accelerator ASAP accelerator = Accelerator(fp16=config.trainer.amp, cpu=config.trainer.cpu) # Create the directory tree: # outputs # |-- dataset # |--task_name # |-- exp_name # |-- models # |-- logs accelerator.wait_for_everyone() log_name = f"output-{config.task.step}.log" exp_id, out_folder, model_folder, logs_folder = init_experiment(config=config, log_name=log_name) config_path = out_folder / f"segmenter-config-s{config.task.step}.yaml" store_config(config, path=config_path) LOG.info("Run started") LOG.info("Experiment ID: %s", exp_id) LOG.info("Output folder: %s", out_folder) LOG.info("Models folder: %s", model_folder) LOG.info("Logs folder: %s", logs_folder) LOG.info("Configuration: %s", config_path) # seeding everything LOG.info("Using seed: %d", config.seed) seed_everything(config.seed) # prepare datasets LOG.info("Loading datasets...") train_set, valid_set = prepare_dataset(config=config) train_set = SSLDataset(train_set, transform=ssl_transforms()) LOG.info("Full sets - train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) add_background = not train_set.has_background() task = Task(dataset=config.dataset, name=config.task.name, step=config.task.step, add_background=add_background) train_mask, valid_mask = 0, 255 train_set = ICLDataset(dataset=train_set, task=task, mask_value=train_mask, filter_mode=config.task.filter_mode) valid_set = ICLDataset(dataset=valid_set, task=task, mask_value=valid_mask, filter_mode=config.task.filter_mode) train_loader = DataLoader(dataset=train_set, batch_size=config.trainer.batch_size, shuffle=True, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker, drop_last=True) valid_loader = DataLoader(dataset=valid_set, batch_size=config.trainer.batch_size, shuffle=False, num_workers=config.trainer.num_workers, worker_init_fn=seed_worker) LOG.info("ICL sets - Train set: %d samples, validation set: %d samples", len(train_set), len(valid_set)) # prepare models LOG.info("Preparing model...") new_model, ssl_model = prepare_model_ssl(config=config, task=task) new_model = new_model.to(accelerator.device) ssl_model = ssl_model.to(accelerator.device) if task.step > 0: old_task = Task(dataset=config.dataset, name=config.task.name, step=task.step - 1, add_background=add_background) old_model = prepare_model(config=config, task=old_task) old_model = old_model.to(accelerator.device) else: old_model = None new_model, old_model = init_from_previous_step(config, new_model, old_model, model_folder, task) LOG.info("Done preparing models") # prepare optimizer and scheduler parameters = chain(new_model.parameters(), ssl_model.head.parameters()) optimizer = config.optimizer.instantiate(parameters) scheduler = config.scheduler.instantiate(optimizer) # prepare losses, including SSL segment_loss = config.ce.instantiate(ignore_index=255, old_class_count=task.old_class_count()) distill_loss = config.kd.instantiate() pretext_loss = config.ssl_loss() # asserts to verify their validity if task.step > 0 and config.ce.unbiased: seg_loss_name = str(type(segment_loss)) kdd_loss_name = str(type(distill_loss)) assert "Unbiased" in seg_loss_name, f"Wrong loss '{seg_loss_name}' for step {task.step}" assert "Unbiased" in kdd_loss_name, f"Wrong loss '{kdd_loss_name}' for step {task.step}" # prepare metrics and logger monitored = config.trainer.monitor.name train_metrics, valid_metrics = prepare_metrics(task=task, device=accelerator.device) ssl_metrics = prepare_metrics_ssl(num_classes=config.model.pretext_classes, device=accelerator.device) logger = TensorBoardLogger(log_folder=logs_folder, filename_suffix=f"step-{task.step}", icl_step=task.step, comment=config.comment) # logging configuration to tensorboard LOG.debug("Logging flattened config. to TensorBoard") logger.log_table("config", flatten_config(config.dict())) # prepare trainer LOG.info("Visualize: %s, num. batches for visualization: %s", str(config.visualize), str(config.num_samples)) num_samples = int(config.visualize) * config.num_samples trainer = SSLTrainer(accelerator=accelerator, task=task, new_model=new_model, old_model=old_model, ssl_model=ssl_model, optimizer=optimizer, scheduler=scheduler, train_metrics=train_metrics, val_metrics=valid_metrics, old_classes=train_set.old_categories(), new_classes=train_set.new_categories(), seg_criterion=segment_loss, ssl_criterion=pretext_loss, kdd_criterion=distill_loss, kde_criterion=None, kdd_lambda=config.kd.decoder_factor, kde_lambda=config.kd.encoder_factor, logger=logger, samples=num_samples, debug=config.debug) trainer.add_metrics(SSLStage.ssl, metrics=ssl_metrics) trainer.add_callback(EarlyStopping(call_every=1, metric=monitored, criterion=EarlyStoppingCriterion.maximum, patience=config.trainer.patience)) \ .add_callback(Checkpoint(call_every=1, model_folder=model_folder, name_format=f"task{task.name}_step-{task.step}", save_best=True)) \ .add_callback(DisplaySamples(inverse_transform=inverse_transform(), color_palette=train_set.palette())) trainer.fit(train_dataloader=train_loader, val_dataloader=valid_loader, max_epochs=config.trainer.max_epochs) LOG.info(f"Training completed at epoch {trainer.current_epoch:<2d} " f"(best {monitored}: {trainer.best_score:.4f})") LOG.info("Experiment %s (step %d) completed!", exp_id, task.step)
true
true
f71d6afb0bb38164f69476aebefe7d64806e5c99
484
py
Python
src/scrapper/scrappers/webSiteScrappers/leadersScrapper.py
media-watch/mediascrapper
43e35eb4ae8011ff83cabb2d6c95e26a673aba27
[ "BSD-2-Clause" ]
null
null
null
src/scrapper/scrappers/webSiteScrappers/leadersScrapper.py
media-watch/mediascrapper
43e35eb4ae8011ff83cabb2d6c95e26a673aba27
[ "BSD-2-Clause" ]
4
2021-07-14T22:25:00.000Z
2021-07-14T22:40:00.000Z
src/scrapper/scrappers/webSiteScrappers/leadersScrapper.py
media-watch/mediascrapper
43e35eb4ae8011ff83cabb2d6c95e26a673aba27
[ "BSD-2-Clause" ]
null
null
null
from bs4 import BeautifulSoup class LeadersScrapper: def scrap(self, html): soup = BeautifulSoup(html, features="html.parser") title = soup.find("h1").text date = soup.find("div",{"class":"infos"}).text data = [ arti.text for arti in soup.find("div", {"class":"article_body"}).findChildren()] idx = data.index("Lire aussi") article = " ".join(data[:idx]) return {"title":title, "date":date, "article":article}
37.230769
97
0.592975
from bs4 import BeautifulSoup class LeadersScrapper: def scrap(self, html): soup = BeautifulSoup(html, features="html.parser") title = soup.find("h1").text date = soup.find("div",{"class":"infos"}).text data = [ arti.text for arti in soup.find("div", {"class":"article_body"}).findChildren()] idx = data.index("Lire aussi") article = " ".join(data[:idx]) return {"title":title, "date":date, "article":article}
true
true
f71d6b8d8c08175c683fa96aa4f11e6b6b31103d
705
py
Python
contact/migrations/0002_auto_20200914_2108.py
SandyAbdullahi/francis_cms
55b64d91fcbc1d6b4dd853aff7294dedd417e0ab
[ "MIT" ]
null
null
null
contact/migrations/0002_auto_20200914_2108.py
SandyAbdullahi/francis_cms
55b64d91fcbc1d6b4dd853aff7294dedd417e0ab
[ "MIT" ]
null
null
null
contact/migrations/0002_auto_20200914_2108.py
SandyAbdullahi/francis_cms
55b64d91fcbc1d6b4dd853aff7294dedd417e0ab
[ "MIT" ]
null
null
null
# Generated by Django 3.1.1 on 2020-09-14 18:08 from django.db import migrations import wagtail.core.fields class Migration(migrations.Migration): dependencies = [ ('contact', '0001_initial'), ] operations = [ migrations.RemoveField( model_name='contactpage', name='body', ), migrations.AddField( model_name='contactpage', name='headline_message', field=wagtail.core.fields.RichTextField(blank=True), ), migrations.AddField( model_name='contactpage', name='headline_title', field=wagtail.core.fields.RichTextField(blank=True), ), ]
24.310345
64
0.585816
from django.db import migrations import wagtail.core.fields class Migration(migrations.Migration): dependencies = [ ('contact', '0001_initial'), ] operations = [ migrations.RemoveField( model_name='contactpage', name='body', ), migrations.AddField( model_name='contactpage', name='headline_message', field=wagtail.core.fields.RichTextField(blank=True), ), migrations.AddField( model_name='contactpage', name='headline_title', field=wagtail.core.fields.RichTextField(blank=True), ), ]
true
true
f71d6cbd63ff5c532cd6188976d551d9a5e087ea
2,743
py
Python
src/slider_experiment/slider_experiment/thruster_pwm_tsl.py
frank20a/collaborative-sats
9d26d3c8f66cf43bbd514f02434851439e746797
[ "MIT" ]
null
null
null
src/slider_experiment/slider_experiment/thruster_pwm_tsl.py
frank20a/collaborative-sats
9d26d3c8f66cf43bbd514f02434851439e746797
[ "MIT" ]
6
2022-03-22T18:54:38.000Z
2022-03-31T16:42:37.000Z
src/slider_experiment/slider_experiment/thruster_pwm_tsl.py
frank20a/collaborative-sats
9d26d3c8f66cf43bbd514f02434851439e746797
[ "MIT" ]
null
null
null
import rclpy from rclpy.node import Node from geometry_msgs.msg import Vector3 from std_msgs.msg import Int16 from rclpy.qos import QoSPresetProfiles from ament_index_python import get_package_share_directory import numpy as np import sys, os from .parameters import force from .flags import flags def create_pwm(value, resolution): if value < 0.0: value = -value if value > 1.0: value = 1.0 return np.concatenate((np.ones(np.floor(resolution * value).astype(np.int32)), np.zeros(np.ceil(resolution * (1 - value)).astype(np.int32)))) class ThrustController(Node): def __init__(self): super().__init__('thrust_controller') self.declare_parameter('verbose', 0) self.declare_parameter('frequency', 10) self.declare_parameter('resolution', 100) self.verbose = self.get_parameter('verbose').get_parameter_value().integer_value self.frequency = self.get_parameter('frequency').get_parameter_value().integer_value self.resolution = self.get_parameter('resolution').get_parameter_value().integer_value sys.path.insert(1, os.path.join(get_package_share_directory('slider_experiment'), 'python_build/tsl_optimizer')) import tsl_optimizer as optimizer self.solver = optimizer.solver() self.signals = [create_pwm(0, self.resolution) for i in range(8)] self.i = 0 self.create_subscription(Vector3, 'thrust_cmd', self.callback, QoSPresetProfiles.get_from_short_key('system_default')) self.pub = self.create_publisher(Int16, 'thruster_flags', QoSPresetProfiles.get_from_short_key('sensor_data')) self.create_timer(1/(self.frequency * self.resolution), self.send_signals) def callback(self, msg: Vector3): T = self.solver.run(p = [msg.x, msg.y, msg.z]).solution if self.verbose > 0: self.get_logger().info(f'\n Fx = {msg.x: 2.2f}\n Fy = {msg.y: 2.2f}\ntau = {msg.z: 2.2f}') self.get_logger().info(f'cmd: {T}') self.signals = [create_pwm(T[i] / force, self.resolution) for i in range(8)] def send_signals(self): req = Int16() tmp = 0 for i in range(8): if self.signals[i][self.i] == 1: tmp ^= flags[i] try: req.data = tmp except AssertionError: print(tmp) self.i += 1 self.i %= self.resolution self.pub.publish(req) def main(args=None): rclpy.init(args=args) node = ThrustController() rclpy.spin(node) node.destroy_node() rclpy.shutdown() if __name__ == '__main__': main()
31.895349
145
0.62778
import rclpy from rclpy.node import Node from geometry_msgs.msg import Vector3 from std_msgs.msg import Int16 from rclpy.qos import QoSPresetProfiles from ament_index_python import get_package_share_directory import numpy as np import sys, os from .parameters import force from .flags import flags def create_pwm(value, resolution): if value < 0.0: value = -value if value > 1.0: value = 1.0 return np.concatenate((np.ones(np.floor(resolution * value).astype(np.int32)), np.zeros(np.ceil(resolution * (1 - value)).astype(np.int32)))) class ThrustController(Node): def __init__(self): super().__init__('thrust_controller') self.declare_parameter('verbose', 0) self.declare_parameter('frequency', 10) self.declare_parameter('resolution', 100) self.verbose = self.get_parameter('verbose').get_parameter_value().integer_value self.frequency = self.get_parameter('frequency').get_parameter_value().integer_value self.resolution = self.get_parameter('resolution').get_parameter_value().integer_value sys.path.insert(1, os.path.join(get_package_share_directory('slider_experiment'), 'python_build/tsl_optimizer')) import tsl_optimizer as optimizer self.solver = optimizer.solver() self.signals = [create_pwm(0, self.resolution) for i in range(8)] self.i = 0 self.create_subscription(Vector3, 'thrust_cmd', self.callback, QoSPresetProfiles.get_from_short_key('system_default')) self.pub = self.create_publisher(Int16, 'thruster_flags', QoSPresetProfiles.get_from_short_key('sensor_data')) self.create_timer(1/(self.frequency * self.resolution), self.send_signals) def callback(self, msg: Vector3): T = self.solver.run(p = [msg.x, msg.y, msg.z]).solution if self.verbose > 0: self.get_logger().info(f'\n Fx = {msg.x: 2.2f}\n Fy = {msg.y: 2.2f}\ntau = {msg.z: 2.2f}') self.get_logger().info(f'cmd: {T}') self.signals = [create_pwm(T[i] / force, self.resolution) for i in range(8)] def send_signals(self): req = Int16() tmp = 0 for i in range(8): if self.signals[i][self.i] == 1: tmp ^= flags[i] try: req.data = tmp except AssertionError: print(tmp) self.i += 1 self.i %= self.resolution self.pub.publish(req) def main(args=None): rclpy.init(args=args) node = ThrustController() rclpy.spin(node) node.destroy_node() rclpy.shutdown() if __name__ == '__main__': main()
true
true
f71d6cf373223c59a20c6cb59a39218776e382a0
2,697
py
Python
flink-python/pyflink/table/tests/test_environment_completeness.py
sekikn/flink
405cf8f429c6a5031c21597abe9193bedcb8e15b
[ "Apache-2.0" ]
4
2020-05-28T03:36:05.000Z
2022-02-22T13:46:05.000Z
flink-python/pyflink/table/tests/test_environment_completeness.py
sekikn/flink
405cf8f429c6a5031c21597abe9193bedcb8e15b
[ "Apache-2.0" ]
5
2021-03-30T04:48:08.000Z
2021-12-24T08:22:11.000Z
flink-python/pyflink/table/tests/test_environment_completeness.py
sekikn/flink
405cf8f429c6a5031c21597abe9193bedcb8e15b
[ "Apache-2.0" ]
null
null
null
################################################################################ # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ################################################################################ import unittest from pyflink.testing.test_case_utils import PythonAPICompletenessTestCase from pyflink.table import TableEnvironment class EnvironmentAPICompletenessTests(PythonAPICompletenessTestCase, unittest.TestCase): """ Tests whether the Python :class:`TableEnvironment` is consistent with Java `org.apache.flink.table.api.TableEnvironment`. """ @classmethod def python_class(cls): return TableEnvironment @classmethod def java_class(cls): return "org.apache.flink.table.api.TableEnvironment" @classmethod def excluded_methods(cls): # getCompletionHints has been deprecated. It will be removed in the next release. # TODO add TableEnvironment#create method with EnvironmentSettings as a parameter return { 'getCompletionHints', 'create', 'loadModule', 'unloadModule', 'createTemporarySystemFunction', 'dropTemporarySystemFunction', 'createFunction', 'dropFunction', 'createTemporaryFunction', 'dropTemporaryFunction'} @classmethod def java_method_name(cls, python_method_name): """ Due to 'from' is python keyword, so we use 'from_path' in Python API corresponding 'from' in Java API. :param python_method_name: :return: """ return {'from_path': 'from'}.get(python_method_name, python_method_name) if __name__ == '__main__': import unittest try: import xmlrunner testRunner = xmlrunner.XMLTestRunner(output='target/test-reports') except ImportError: testRunner = None unittest.main(testRunner=testRunner, verbosity=2)
35.96
89
0.656285
true
true
f71d6e590e9719f5ddc95217fd64f92e9bd77eaa
375
py
Python
recover-commits.py
pendashteh/git-recover-index
2dba70959a463879a34a072a30fba839e974d8e8
[ "MIT" ]
39
2016-03-17T18:36:08.000Z
2021-06-18T18:15:30.000Z
recover-commits.py
pendashteh/git-recover-index
2dba70959a463879a34a072a30fba839e974d8e8
[ "MIT" ]
1
2019-01-06T22:10:18.000Z
2019-01-06T22:10:18.000Z
recover-commits.py
pendashteh/git-recover-index
2dba70959a463879a34a072a30fba839e974d8e8
[ "MIT" ]
6
2016-05-06T14:00:20.000Z
2019-09-04T16:04:26.000Z
import os commits_file = os.environ['_git_recover_index_tmpfile'] commits_recover_path = os.environ['_git_recover_index_recover_path'] commits = [line.rstrip('\n') for line in open(commits_file)] from subprocess import call filename = commits_recover_path + "/file-" i = 1 for c in commits: f = open(filename + str(i),"wb") call(["git", "show", c],stdout=f) i+=1
31.25
68
0.717333
import os commits_file = os.environ['_git_recover_index_tmpfile'] commits_recover_path = os.environ['_git_recover_index_recover_path'] commits = [line.rstrip('\n') for line in open(commits_file)] from subprocess import call filename = commits_recover_path + "/file-" i = 1 for c in commits: f = open(filename + str(i),"wb") call(["git", "show", c],stdout=f) i+=1
true
true
f71d6e6997ab22122d04476adc125c2e2dca54b2
374
py
Python
code/day09/demo04.py
picktsh/python
0f758dcdf9eee3580d8f6e2241ef557b6320ef54
[ "MIT" ]
1
2019-12-31T16:44:06.000Z
2019-12-31T16:44:06.000Z
code/day09/demo04.py
picktsh/python
0f758dcdf9eee3580d8f6e2241ef557b6320ef54
[ "MIT" ]
null
null
null
code/day09/demo04.py
picktsh/python
0f758dcdf9eee3580d8f6e2241ef557b6320ef54
[ "MIT" ]
1
2022-01-13T10:32:22.000Z
2022-01-13T10:32:22.000Z
### 多个函数间的配合 ## 变量的作用域 rent = 3000 variable_cost = 0 def cost(): global variable_cost # 使用全局的变量 utilities = int(input('请输入本月的水电费用')) food_cost = int(input('请输入本月的食材费用')) variable_cost = utilities + food_cost print('本月的变动成本费用是' + str(variable_cost)) def sum_cost(): sum = rent + variable_cost print('本月的总成本是' + str(sum)) cost() sum_cost()
16.26087
44
0.657754
= 0 def cost(): global variable_cost utilities = int(input('请输入本月的水电费用')) food_cost = int(input('请输入本月的食材费用')) variable_cost = utilities + food_cost print('本月的变动成本费用是' + str(variable_cost)) def sum_cost(): sum = rent + variable_cost print('本月的总成本是' + str(sum)) cost() sum_cost()
true
true
f71d6eddc110a6ecb2c6c457700d79c73a0ae05f
404
py
Python
python/kata/6-kyu/Corner Fill/solution.py
Carlososuna11/codewars-handbook
a0e7c9ac5ad19cfaed3ad463c04616daa3fed82e
[ "MIT" ]
null
null
null
python/kata/6-kyu/Corner Fill/solution.py
Carlososuna11/codewars-handbook
a0e7c9ac5ad19cfaed3ad463c04616daa3fed82e
[ "MIT" ]
null
null
null
python/kata/6-kyu/Corner Fill/solution.py
Carlososuna11/codewars-handbook
a0e7c9ac5ad19cfaed3ad463c04616daa3fed82e
[ "MIT" ]
null
null
null
def corner_fill(square): removeStarting = lambda x: [y[:-1] for y in x[1:]] corner = lambda x: x[0]+[y[-1] for y in x[1:]] result =[] n = len(square) if n == 0: return [] for i in range(n): if i % 2 ==0: result = result + corner(square) else: result = result + corner(square)[::-1] square = removeStarting(square) return result
31.076923
55
0.519802
def corner_fill(square): removeStarting = lambda x: [y[:-1] for y in x[1:]] corner = lambda x: x[0]+[y[-1] for y in x[1:]] result =[] n = len(square) if n == 0: return [] for i in range(n): if i % 2 ==0: result = result + corner(square) else: result = result + corner(square)[::-1] square = removeStarting(square) return result
true
true
f71d6f2d262c160937a5abfacbcec8080a0ea116
228
py
Python
algorithms/tree_diameter.py
nazaruka/Catan-AI
d7c91c7011ac82ad41d3b80a29c73c23ab7b579e
[ "MIT" ]
9
2019-07-16T15:28:00.000Z
2022-02-08T00:53:39.000Z
algorithms/tree_diameter.py
nazaruka/Catan-AI
d7c91c7011ac82ad41d3b80a29c73c23ab7b579e
[ "MIT" ]
2
2020-01-09T15:27:58.000Z
2020-09-23T18:04:41.000Z
algorithms/tree_diameter.py
nazaruka/Catan-AI
d7c91c7011ac82ad41d3b80a29c73c23ab7b579e
[ "MIT" ]
5
2019-08-07T16:51:38.000Z
2021-05-06T04:01:32.000Z
import networkx from algorithms.dfs import dfs def tree_diameter(t: networkx.Graph): if __debug__: assert networkx.is_tree(t) v, _ = dfs(t) _, longest_path_length = dfs(t, v) return longest_path_length
20.727273
38
0.697368
import networkx from algorithms.dfs import dfs def tree_diameter(t: networkx.Graph): if __debug__: assert networkx.is_tree(t) v, _ = dfs(t) _, longest_path_length = dfs(t, v) return longest_path_length
true
true
f71d6fc4eaee727eeda655eda3c7d6e9b60c45e6
4,713
py
Python
app.py
lucaskolson/ddd
f273c61856bca27a40b9691b2a9842d8705a3503
[ "MIT" ]
null
null
null
app.py
lucaskolson/ddd
f273c61856bca27a40b9691b2a9842d8705a3503
[ "MIT" ]
null
null
null
app.py
lucaskolson/ddd
f273c61856bca27a40b9691b2a9842d8705a3503
[ "MIT" ]
null
null
null
import dash from dash import dcc from dash import html from dash.dependencies import Input, Output import plotly.express as px import pandas as pd from dash import callback_context df = px.data.election() geojson = px.data.election_geojson() candidates = df.winner.unique() external_stylesheets = ['https://codepen.io/chriddyp/pen/bWLwgP.css'] app = dash.Dash(__name__, external_stylesheets=external_stylesheets) server = app.server app.title = "ICE Detention Data Dashboard" fy = ['2015-10-01', '2016-10-01', '2017-10-01', '2018-10-01'] loc = ["East Coast", "West Coast", "Southwest", "Midwest", "All"] app.layout = html.Div( children=[ html.Div( children=[ html.H1( children="ICE Detention Analytics", className="header-title" ), html.P( children="A dashboard and data repository of" " ICE detention trends and facilities across the US" " between 2010 and 2020", className="header-description", ), ], className="header", ), html.Div( children=[ dcc.RadioItems( id='candidate', options=[{'value': x, 'label': x} for x in candidates], value=candidates[0], labelStyle={'display': 'inline-block'} ), html.Div( children=[dcc.Graph( id="choropleth", config={"displayModeBar": False}, ), html.Button("Download CSV", id="btn_csv"), dcc.Download(id="download-dataframe-csv"), html.Button("Download Image", id="btn_image"), dcc.Download(id="download-image")], className="card", ), dcc.RadioItems( id='us_loc', options=[{'value': x, 'label': x} for x in loc], value=loc[0], labelStyle={'display': 'inline-block'} ), html.Div( children=dcc.Graph( id="fy_arrests", config={"displayModeBar": False}, ), className="card", ), ], className="wrapper", ), ] ) @app.callback( Output("choropleth", "figure"), [Input("candidate", "value")]) def display_choropleth(candidate): fig = px.choropleth( df, geojson=geojson, color=candidate, locations="district", featureidkey="properties.district", projection="mercator", range_color=[0, 6500]) fig.update_geos(fitbounds="locations", visible=False) fig.update_layout(margin={"r":0,"t":0,"l":0,"b":0}) return fig @app.callback( Output("download-dataframe-csv", "data"), Input("btn_csv", "n_clicks"), prevent_initial_call=True, ) def func(n_clicks): return dcc.send_data_frame(df.to_csv, "mydf.csv") @app.callback( Output("download-image", "data"), Input("btn_image", "n_clicks"), prevent_initial_call=True, ) def func(n_clicks): return dcc.send_file( "./plot_downloads/test.png" ) @app.callback( Output("fy_arrests", "figure"), [Input("us_loc", "value")]) def display_arrest_fy(us_loc): arrests_by_fy = pd.read_csv("./data/arrests_by_fy.csv") if us_loc == "West Coast": aor = ['LOS', 'SEA', 'SFR', 'SND'] elif us_loc == "East Coast": aor = ['ATL', 'BAL', 'BOS', 'BUF', 'DET', 'MIA', 'NEW', 'NOL', 'NYC', 'PHI', 'WAS', 'HQ'] elif us_loc == "Midwest": aor = ['CHI', 'SPM'] elif us_loc == "Southwest": aor = ['DAL', 'DEN', 'ELP', 'HOU', 'PHO', 'SLC', 'SNA'] elif us_loc == "All": aor = ['ATL', 'BAL', 'BOS', 'BUF', 'CHI', 'DAL', 'DEN', 'DET', 'ELP', 'HOU', 'HQ', 'LOS', 'MIA', 'NEW', 'NOL','NYC', 'PHI', 'PHO', 'SEA', 'SFR', 'SLC', 'SNA', 'SND', 'SPM', 'WAS'] else: aor = ['ATL', 'BAL', 'BOS', 'BUF', 'CHI', 'DAL', 'DEN', 'DET', 'ELP', 'HOU', 'HQ', 'LOS', 'MIA', 'NEW', 'NOL','NYC', 'PHI', 'PHO', 'SEA', 'SFR', 'SLC', 'SNA', 'SND', 'SPM', 'WAS'] fig = px.line(arrests_by_fy, x=fy, y=aor, title = "Arrests in AOR per FY", labels=dict(x="Fiscal Year", y="Number of Arrests")) fig.update_xaxes(title="Fiscal Year", nticks = 4) fig.update_yaxes(title="Number of Arrests") fig.update_layout(legend_title_text='AOR') return fig if __name__ == "__main__": app.run_server(debug=True)
32.503448
187
0.51708
import dash from dash import dcc from dash import html from dash.dependencies import Input, Output import plotly.express as px import pandas as pd from dash import callback_context df = px.data.election() geojson = px.data.election_geojson() candidates = df.winner.unique() external_stylesheets = ['https://codepen.io/chriddyp/pen/bWLwgP.css'] app = dash.Dash(__name__, external_stylesheets=external_stylesheets) server = app.server app.title = "ICE Detention Data Dashboard" fy = ['2015-10-01', '2016-10-01', '2017-10-01', '2018-10-01'] loc = ["East Coast", "West Coast", "Southwest", "Midwest", "All"] app.layout = html.Div( children=[ html.Div( children=[ html.H1( children="ICE Detention Analytics", className="header-title" ), html.P( children="A dashboard and data repository of" " ICE detention trends and facilities across the US" " between 2010 and 2020", className="header-description", ), ], className="header", ), html.Div( children=[ dcc.RadioItems( id='candidate', options=[{'value': x, 'label': x} for x in candidates], value=candidates[0], labelStyle={'display': 'inline-block'} ), html.Div( children=[dcc.Graph( id="choropleth", config={"displayModeBar": False}, ), html.Button("Download CSV", id="btn_csv"), dcc.Download(id="download-dataframe-csv"), html.Button("Download Image", id="btn_image"), dcc.Download(id="download-image")], className="card", ), dcc.RadioItems( id='us_loc', options=[{'value': x, 'label': x} for x in loc], value=loc[0], labelStyle={'display': 'inline-block'} ), html.Div( children=dcc.Graph( id="fy_arrests", config={"displayModeBar": False}, ), className="card", ), ], className="wrapper", ), ] ) @app.callback( Output("choropleth", "figure"), [Input("candidate", "value")]) def display_choropleth(candidate): fig = px.choropleth( df, geojson=geojson, color=candidate, locations="district", featureidkey="properties.district", projection="mercator", range_color=[0, 6500]) fig.update_geos(fitbounds="locations", visible=False) fig.update_layout(margin={"r":0,"t":0,"l":0,"b":0}) return fig @app.callback( Output("download-dataframe-csv", "data"), Input("btn_csv", "n_clicks"), prevent_initial_call=True, ) def func(n_clicks): return dcc.send_data_frame(df.to_csv, "mydf.csv") @app.callback( Output("download-image", "data"), Input("btn_image", "n_clicks"), prevent_initial_call=True, ) def func(n_clicks): return dcc.send_file( "./plot_downloads/test.png" ) @app.callback( Output("fy_arrests", "figure"), [Input("us_loc", "value")]) def display_arrest_fy(us_loc): arrests_by_fy = pd.read_csv("./data/arrests_by_fy.csv") if us_loc == "West Coast": aor = ['LOS', 'SEA', 'SFR', 'SND'] elif us_loc == "East Coast": aor = ['ATL', 'BAL', 'BOS', 'BUF', 'DET', 'MIA', 'NEW', 'NOL', 'NYC', 'PHI', 'WAS', 'HQ'] elif us_loc == "Midwest": aor = ['CHI', 'SPM'] elif us_loc == "Southwest": aor = ['DAL', 'DEN', 'ELP', 'HOU', 'PHO', 'SLC', 'SNA'] elif us_loc == "All": aor = ['ATL', 'BAL', 'BOS', 'BUF', 'CHI', 'DAL', 'DEN', 'DET', 'ELP', 'HOU', 'HQ', 'LOS', 'MIA', 'NEW', 'NOL','NYC', 'PHI', 'PHO', 'SEA', 'SFR', 'SLC', 'SNA', 'SND', 'SPM', 'WAS'] else: aor = ['ATL', 'BAL', 'BOS', 'BUF', 'CHI', 'DAL', 'DEN', 'DET', 'ELP', 'HOU', 'HQ', 'LOS', 'MIA', 'NEW', 'NOL','NYC', 'PHI', 'PHO', 'SEA', 'SFR', 'SLC', 'SNA', 'SND', 'SPM', 'WAS'] fig = px.line(arrests_by_fy, x=fy, y=aor, title = "Arrests in AOR per FY", labels=dict(x="Fiscal Year", y="Number of Arrests")) fig.update_xaxes(title="Fiscal Year", nticks = 4) fig.update_yaxes(title="Number of Arrests") fig.update_layout(legend_title_text='AOR') return fig if __name__ == "__main__": app.run_server(debug=True)
true
true
f71d6ffb1dd30874cf880bc17a48e08b5e247ed7
1,072
py
Python
migrations/versions/3aa95a42561c_this_is_a_migration.py
rice0208/Flog
d56be0b814a0c6ca1fe4abd2c764552121698a94
[ "MIT" ]
14
2020-09-20T01:23:01.000Z
2022-02-09T09:11:10.000Z
migrations/versions/3aa95a42561c_this_is_a_migration.py
rice0208/Flog
d56be0b814a0c6ca1fe4abd2c764552121698a94
[ "MIT" ]
15
2020-12-23T13:19:46.000Z
2022-01-22T08:38:22.000Z
migrations/versions/3aa95a42561c_this_is_a_migration.py
rice0208/Flog
d56be0b814a0c6ca1fe4abd2c764552121698a94
[ "MIT" ]
4
2021-03-14T01:49:30.000Z
2021-11-25T08:31:55.000Z
"""this is a migration Revision ID: 3aa95a42561c Revises: 98fef64846fe Create Date: 2021-10-04 10:49:46.832296 """ from alembic import op import sqlalchemy as sa # revision identifiers, used by Alembic. revision = "3aa95a42561c" down_revision = "98fef64846fe" branch_labels = None depends_on = None def upgrade(): # ### commands auto generated by Alembic - please adjust! ### with op.batch_alter_table("belong", schema=None) as batch_op: batch_op.create_foreign_key("owner_id", "user", ["owner_id"], ["id"]) with op.batch_alter_table("user", schema=None) as batch_op: batch_op.add_column(sa.Column("avatar_style", sa.String(length=1024))) # ### end Alembic commands ### def downgrade(): # ### commands auto generated by Alembic - please adjust! ### with op.batch_alter_table("user", schema=None) as batch_op: batch_op.drop_column("avatar_style") with op.batch_alter_table("belong", schema=None) as batch_op: batch_op.drop_constraint("owner_id", type_="foreignkey") # ### end Alembic commands ###
27.487179
78
0.698694
from alembic import op import sqlalchemy as sa revision = "3aa95a42561c" down_revision = "98fef64846fe" branch_labels = None depends_on = None def upgrade(): r", schema=None) as batch_op: batch_op.add_column(sa.Column("avatar_style", sa.String(length=1024)))
true
true
f71d703c6b01e0801154484a75bebd175b111b06
699
py
Python
e3nn/__init__.py
claycurry34/e3nn
3cfbf679d10781a01d9c83b04a2e7d79d4914c23
[ "MIT" ]
null
null
null
e3nn/__init__.py
claycurry34/e3nn
3cfbf679d10781a01d9c83b04a2e7d79d4914c23
[ "MIT" ]
null
null
null
e3nn/__init__.py
claycurry34/e3nn
3cfbf679d10781a01d9c83b04a2e7d79d4914c23
[ "MIT" ]
null
null
null
__version__ = "0.4.4" from typing import Dict _OPT_DEFAULTS: Dict[str, bool] = dict( specialized_code=True, optimize_einsums=True, jit_script_fx=True, ) def set_optimization_defaults(**kwargs) -> None: r"""Globally set the default optimization settings. Parameters ---------- **kwargs Keyword arguments to set the default optimization settings. """ for k, v in kwargs.items(): if k not in _OPT_DEFAULTS: raise ValueError(f"Unknown optimization option: {k}") _OPT_DEFAULTS[k] = v def get_optimization_defaults() -> Dict[str, bool]: r"""Get the global default optimization settings.""" return dict(_OPT_DEFAULTS)
23.3
67
0.663805
__version__ = "0.4.4" from typing import Dict _OPT_DEFAULTS: Dict[str, bool] = dict( specialized_code=True, optimize_einsums=True, jit_script_fx=True, ) def set_optimization_defaults(**kwargs) -> None: for k, v in kwargs.items(): if k not in _OPT_DEFAULTS: raise ValueError(f"Unknown optimization option: {k}") _OPT_DEFAULTS[k] = v def get_optimization_defaults() -> Dict[str, bool]: return dict(_OPT_DEFAULTS)
true
true
f71d71cddd85fa3d98cd38c34ab0b09669a18685
752
py
Python
notes-n-resources/Data-Structures-N-Algo/_DS-n-Algos/_Another-One/Project Euler/Problem 40/sol1.py
side-projects-42/INTERVIEW-PREP-COMPLETE
627a3315cee4bbc38a0e81c256f27f928eac2d63
[ "MIT" ]
13
2021-03-11T00:25:22.000Z
2022-03-19T00:19:23.000Z
notes-n-resources/Data-Structures-N-Algo/_DS-n-Algos/_Another-One/Project Euler/Problem 40/sol1.py
side-projects-42/INTERVIEW-PREP-COMPLETE
627a3315cee4bbc38a0e81c256f27f928eac2d63
[ "MIT" ]
160
2021-04-26T19:04:15.000Z
2022-03-26T20:18:37.000Z
notes-n-resources/Data-Structures-N-Algo/_DS-n-Algos/_Another-One/Project Euler/Problem 40/sol1.py
side-projects-42/INTERVIEW-PREP-COMPLETE
627a3315cee4bbc38a0e81c256f27f928eac2d63
[ "MIT" ]
12
2021-04-26T19:43:01.000Z
2022-01-31T08:36:29.000Z
# -.- coding: latin-1 -.- from __future__ import print_function """ Champernowne's constant Problem 40 An irrational decimal fraction is created by concatenating the positive integers: 0.123456789101112131415161718192021... It can be seen that the 12th digit of the fractional part is 1. If dn represents the nth digit of the fractional part, find the value of the following expression. d1 × d10 × d100 × d1000 × d10000 × d100000 × d1000000 """ constant = [] i = 1 while len(constant) < 1e6: constant.append(str(i)) i += 1 constant = "".join(constant) print( int(constant[0]) * int(constant[9]) * int(constant[99]) * int(constant[999]) * int(constant[9999]) * int(constant[99999]) * int(constant[999999]) )
20.888889
98
0.6875
from __future__ import print_function constant = [] i = 1 while len(constant) < 1e6: constant.append(str(i)) i += 1 constant = "".join(constant) print( int(constant[0]) * int(constant[9]) * int(constant[99]) * int(constant[999]) * int(constant[9999]) * int(constant[99999]) * int(constant[999999]) )
true
true
f71d71fe37a1f2f44e56d006e3c304850b855a98
2,553
py
Python
src/books.py
LucasAntognoni/book-bot
625632b8115654921caa3961153412c129961164
[ "MIT" ]
3
2019-07-09T19:56:15.000Z
2020-02-19T23:26:00.000Z
src/books.py
LucasAntognoni/book-bot
625632b8115654921caa3961153412c129961164
[ "MIT" ]
null
null
null
src/books.py
LucasAntognoni/book-bot
625632b8115654921caa3961153412c129961164
[ "MIT" ]
null
null
null
import requests class Books(object): BASE_URL = \ 'https://www.googleapis.com/books/v1/volumes?' \ 'q="{}"&projection={}&printType={}&langRestrict={}&maxResults={}' MAX_RESULTS = 1 PRINT_TYPE = 'books' PROJECTION = 'full' LANGUAGE = 'en' # SEARCH_FIELDS = { # "title": "intitle", # "author": "inauthor", # "publisher": "inpublisher", # "subject": "subject", # "isbn": "isbn", # } BOOK_FIELDS = [ 'title', 'authors', 'categories', 'description', 'imageLinks' ] def __init__(self): pass @staticmethod def get_attribute(data, attribute, default_value): return data.get(attribute) or default_value def process_search(self, data): book = {} for field in self.BOOK_FIELDS: book[field] = self.get_attribute(data, field, '') if (field == 'authors') or (field == 'categories') and book[field] != '': if len(book[field]) > 1: book[field] = ', '.join(book[field]) else: book[field] = book[field][0] if field == 'imageLinks' and book[field] != '': book[field] = self.get_attribute(book[field], 'thumbnail', '') return book def search(self, field, query): """ Search book on Google Books API Parameters ---------- field Search field query Value to be searched Returns ------- JSON Search results in JSON format if successful, None o/w """ if field == 'search': url = self.BASE_URL.format(query.replace(' ', '+'), self.PROJECTION, self.PRINT_TYPE, self.LANGUAGE, self.MAX_RESULTS) else: return None try: response = requests.get(url) if response.status_code == 200: response_json = response.json() if response_json['totalItems'] != 0: return self.process_search(response_json['items'][0]['volumeInfo']) else: return None except requests.exceptions.RequestException as e: print(e) return None
25.277228
87
0.461418
import requests class Books(object): BASE_URL = \ 'https://www.googleapis.com/books/v1/volumes?' \ 'q="{}"&projection={}&printType={}&langRestrict={}&maxResults={}' MAX_RESULTS = 1 PRINT_TYPE = 'books' PROJECTION = 'full' LANGUAGE = 'en' BOOK_FIELDS = [ 'title', 'authors', 'categories', 'description', 'imageLinks' ] def __init__(self): pass @staticmethod def get_attribute(data, attribute, default_value): return data.get(attribute) or default_value def process_search(self, data): book = {} for field in self.BOOK_FIELDS: book[field] = self.get_attribute(data, field, '') if (field == 'authors') or (field == 'categories') and book[field] != '': if len(book[field]) > 1: book[field] = ', '.join(book[field]) else: book[field] = book[field][0] if field == 'imageLinks' and book[field] != '': book[field] = self.get_attribute(book[field], 'thumbnail', '') return book def search(self, field, query): if field == 'search': url = self.BASE_URL.format(query.replace(' ', '+'), self.PROJECTION, self.PRINT_TYPE, self.LANGUAGE, self.MAX_RESULTS) else: return None try: response = requests.get(url) if response.status_code == 200: response_json = response.json() if response_json['totalItems'] != 0: return self.process_search(response_json['items'][0]['volumeInfo']) else: return None except requests.exceptions.RequestException as e: print(e) return None
true
true
f71d72c5ef13e3198b890b424d27e5e967a73e65
6,945
py
Python
qiskit/visualization/timeline/plotters/matplotlib.py
Roshan-Thomas/qiskit-terra
77219b5c7b7146b1545c5e5190739b36f4064b2f
[ "Apache-2.0" ]
1,456
2017-08-05T16:33:05.000Z
2018-06-05T04:15:35.000Z
qiskit/visualization/timeline/plotters/matplotlib.py
Roshan-Thomas/qiskit-terra
77219b5c7b7146b1545c5e5190739b36f4064b2f
[ "Apache-2.0" ]
365
2017-08-04T06:09:16.000Z
2018-06-05T08:33:37.000Z
qiskit/visualization/timeline/plotters/matplotlib.py
Roshan-Thomas/qiskit-terra
77219b5c7b7146b1545c5e5190739b36f4064b2f
[ "Apache-2.0" ]
463
2017-08-05T04:10:01.000Z
2018-06-05T06:43:21.000Z
# This code is part of Qiskit. # # (C) Copyright IBM 2020. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=invalid-name """Matplotlib plotter API.""" from typing import Optional, Tuple import matplotlib import matplotlib.pyplot as plt import numpy as np from matplotlib.collections import PatchCollection from matplotlib.patches import Rectangle from qiskit.visualization.exceptions import VisualizationError from qiskit.visualization.timeline import core, types, drawings from qiskit.visualization.timeline.plotters.base_plotter import BasePlotter from qiskit.visualization.utils import matplotlib_close_if_inline class MplPlotter(BasePlotter): """Matplotlib API for pulse drawer. This plotter arranges bits along y axis of 2D canvas with vertical offset. """ def __init__(self, canvas: core.DrawerCanvas, axis: Optional[plt.Axes] = None): """Create new plotter. Args: canvas: Configured drawer canvas object. Canvas object should be updated with `.update` method before initializing the plotter. axis: Matplotlib axis object. When `axis` is provided, the plotter updates given axis instead of creating and returning new matplotlib figure. """ super().__init__(canvas=canvas) if axis is None: fig_height = self.canvas.vmax - self.canvas.vmin fig_h = self.canvas.formatter["general.fig_unit_height"] * fig_height fig_w = self.canvas.formatter["general.fig_width"] self.figure = plt.figure(figsize=(fig_w, fig_h)) self.ax = self.figure.add_subplot(1, 1, 1) else: self.figure = axis.figure self.ax = axis self.initialize_canvas() def initialize_canvas(self): """Format appearance of matplotlib canvas.""" self.ax.set_facecolor(self.canvas.formatter["color.background"]) # axis lines self.ax.spines["right"].set_color("none") self.ax.spines["left"].set_color("none") self.ax.spines["top"].set_color("none") # axis labels self.ax.set_yticks([]) axis_config = self.canvas.layout["time_axis_map"](time_window=self.canvas.time_range) self.ax.set_xticks(list(axis_config.axis_map.keys())) self.ax.set_xticklabels( list(axis_config.axis_map.values()), fontsize=self.canvas.formatter["text_size.axis_label"], ) self.ax.set_xlabel( axis_config.label, fontsize=self.canvas.formatter["text_size.axis_label"] ) # boundary self.ax.set_xlim(*self.canvas.time_range) self.ax.set_ylim(self.canvas.vmin, self.canvas.vmax) def draw(self): """Output drawings stored in canvas object.""" for _, data in self.canvas.collections: xvals = np.asarray(data.xvals, dtype=float) yvals = np.asarray(data.yvals, dtype=float) offsets = [self.canvas.assigned_coordinates[bit] for bit in data.bits] if isinstance(data, drawings.BoxData): # box data if data.data_type in [ str(types.BoxType.SCHED_GATE.value), str(types.BoxType.DELAY.value), ]: # draw a smoothly rounded rectangle xs, ys1, ys2 = self._time_bucket_outline(xvals, yvals) self.ax.fill_between( x=xs, y1=ys1 + offsets[0], y2=ys2 + offsets[0], **data.styles ) else: # draw a rectangle x0, x1 = xvals y0, y1 = yvals + offsets[0] rect = Rectangle(xy=(x0, y0), width=x1 - x0, height=y1 - y0) pc = PatchCollection([rect], **data.styles) self.ax.add_collection(pc) elif isinstance(data, drawings.LineData): # line data self.ax.plot(xvals, yvals + offsets[0], **data.styles) elif isinstance(data, drawings.TextData): # text data if data.latex is not None: s = rf"${data.latex}$" else: s = data.text self.ax.text(x=xvals[0], y=yvals[0] + offsets[0], s=s, **data.styles) elif isinstance(data, drawings.GateLinkData): # gate link data self.ax.plot(xvals.repeat(len(offsets)), offsets, **data.styles) else: VisualizationError( "Data {name} is not supported by {plotter}" "".format(name=data, plotter=self.__class__.__name__) ) def _time_bucket_outline( self, xvals: np.ndarray, yvals: np.ndarray ) -> Tuple[np.ndarray, np.ndarray, np.ndarray]: """Generate outline of time bucket. Edges are smoothly faded. Args: xvals: Left and right point coordinates. yvals: Bottom and top point coordinates. Returns: Coordinate vectors of time bucket fringe. """ x0, x1 = xvals y0, y1 = yvals width = x1 - x0 y_mid = 0.5 * (y0 + y1) risefall = int(min(self.canvas.formatter["time_bucket.edge_dt"], max(width / 2 - 2, 0))) edge = np.sin(np.pi / 2 * np.arange(0, risefall) / risefall) xs = np.concatenate( [ np.arange(x0, x0 + risefall), [x0 + risefall, x1 - risefall], np.arange(x1 - risefall + 1, x1 + 1), ] ) l1 = (y1 - y_mid) * np.concatenate([edge, [1, 1], edge[::-1]]) l2 = (y0 - y_mid) * np.concatenate([edge, [1, 1], edge[::-1]]) return xs, l1, l2 def save_file(self, filename: str): """Save image to file. Args: filename: File path to output image data. """ plt.savefig(filename, bbox_inches="tight", dpi=self.canvas.formatter["general.dpi"]) def get_image(self, interactive: bool = False) -> matplotlib.pyplot.Figure: """Get image data to return. Args: interactive: When set `True` show the circuit in a new window. This depends on the matplotlib backend being used supporting this. Returns: Matplotlib figure data. """ matplotlib_close_if_inline(self.figure) if self.figure and interactive: self.figure.show() return self.figure
35.798969
96
0.589201
from typing import Optional, Tuple import matplotlib import matplotlib.pyplot as plt import numpy as np from matplotlib.collections import PatchCollection from matplotlib.patches import Rectangle from qiskit.visualization.exceptions import VisualizationError from qiskit.visualization.timeline import core, types, drawings from qiskit.visualization.timeline.plotters.base_plotter import BasePlotter from qiskit.visualization.utils import matplotlib_close_if_inline class MplPlotter(BasePlotter): def __init__(self, canvas: core.DrawerCanvas, axis: Optional[plt.Axes] = None): super().__init__(canvas=canvas) if axis is None: fig_height = self.canvas.vmax - self.canvas.vmin fig_h = self.canvas.formatter["general.fig_unit_height"] * fig_height fig_w = self.canvas.formatter["general.fig_width"] self.figure = plt.figure(figsize=(fig_w, fig_h)) self.ax = self.figure.add_subplot(1, 1, 1) else: self.figure = axis.figure self.ax = axis self.initialize_canvas() def initialize_canvas(self): self.ax.set_facecolor(self.canvas.formatter["color.background"]) self.ax.spines["right"].set_color("none") self.ax.spines["left"].set_color("none") self.ax.spines["top"].set_color("none") self.ax.set_yticks([]) axis_config = self.canvas.layout["time_axis_map"](time_window=self.canvas.time_range) self.ax.set_xticks(list(axis_config.axis_map.keys())) self.ax.set_xticklabels( list(axis_config.axis_map.values()), fontsize=self.canvas.formatter["text_size.axis_label"], ) self.ax.set_xlabel( axis_config.label, fontsize=self.canvas.formatter["text_size.axis_label"] ) self.ax.set_xlim(*self.canvas.time_range) self.ax.set_ylim(self.canvas.vmin, self.canvas.vmax) def draw(self): for _, data in self.canvas.collections: xvals = np.asarray(data.xvals, dtype=float) yvals = np.asarray(data.yvals, dtype=float) offsets = [self.canvas.assigned_coordinates[bit] for bit in data.bits] if isinstance(data, drawings.BoxData): if data.data_type in [ str(types.BoxType.SCHED_GATE.value), str(types.BoxType.DELAY.value), ]: xs, ys1, ys2 = self._time_bucket_outline(xvals, yvals) self.ax.fill_between( x=xs, y1=ys1 + offsets[0], y2=ys2 + offsets[0], **data.styles ) else: x0, x1 = xvals y0, y1 = yvals + offsets[0] rect = Rectangle(xy=(x0, y0), width=x1 - x0, height=y1 - y0) pc = PatchCollection([rect], **data.styles) self.ax.add_collection(pc) elif isinstance(data, drawings.LineData): self.ax.plot(xvals, yvals + offsets[0], **data.styles) elif isinstance(data, drawings.TextData): if data.latex is not None: s = rf"${data.latex}$" else: s = data.text self.ax.text(x=xvals[0], y=yvals[0] + offsets[0], s=s, **data.styles) elif isinstance(data, drawings.GateLinkData): self.ax.plot(xvals.repeat(len(offsets)), offsets, **data.styles) else: VisualizationError( "Data {name} is not supported by {plotter}" "".format(name=data, plotter=self.__class__.__name__) ) def _time_bucket_outline( self, xvals: np.ndarray, yvals: np.ndarray ) -> Tuple[np.ndarray, np.ndarray, np.ndarray]: x0, x1 = xvals y0, y1 = yvals width = x1 - x0 y_mid = 0.5 * (y0 + y1) risefall = int(min(self.canvas.formatter["time_bucket.edge_dt"], max(width / 2 - 2, 0))) edge = np.sin(np.pi / 2 * np.arange(0, risefall) / risefall) xs = np.concatenate( [ np.arange(x0, x0 + risefall), [x0 + risefall, x1 - risefall], np.arange(x1 - risefall + 1, x1 + 1), ] ) l1 = (y1 - y_mid) * np.concatenate([edge, [1, 1], edge[::-1]]) l2 = (y0 - y_mid) * np.concatenate([edge, [1, 1], edge[::-1]]) return xs, l1, l2 def save_file(self, filename: str): plt.savefig(filename, bbox_inches="tight", dpi=self.canvas.formatter["general.dpi"]) def get_image(self, interactive: bool = False) -> matplotlib.pyplot.Figure: matplotlib_close_if_inline(self.figure) if self.figure and interactive: self.figure.show() return self.figure
true
true
f71d72cda2b0734621a761af5136ca30a617de91
13,762
py
Python
tests/ut/python/dataset/test_compose.py
limberc/mindspore
e294acdffc9246cb6d77ea18ea00d08244d30c59
[ "Apache-2.0" ]
1
2021-01-25T07:39:46.000Z
2021-01-25T07:39:46.000Z
tests/ut/python/dataset/test_compose.py
forwhat461/mindspore
59a277756eb4faad9ac9afcc7fd526e8277d4994
[ "Apache-2.0" ]
null
null
null
tests/ut/python/dataset/test_compose.py
forwhat461/mindspore
59a277756eb4faad9ac9afcc7fd526e8277d4994
[ "Apache-2.0" ]
null
null
null
# Copyright 2020 Huawei Technologies Co., Ltd # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== import numpy as np import pytest import mindspore.common.dtype as mstype import mindspore.dataset as ds import mindspore.dataset.transforms.c_transforms as c_transforms import mindspore.dataset.transforms.py_transforms as py_transforms import mindspore.dataset.vision.c_transforms as c_vision import mindspore.dataset.vision.py_transforms as py_vision from util import visualize_list, save_and_check_md5, config_get_set_seed, config_get_set_num_parallel_workers GENERATE_GOLDEN = False def test_compose(): """ Test C++ and Python Compose Op """ ds.config.set_seed(0) def test_config(arr, op_list): try: data = ds.NumpySlicesDataset(arr, column_names="col", shuffle=False) data = data.map(input_columns=["col"], operations=op_list) res = [] for i in data.create_dict_iterator(output_numpy=True): res.append(i["col"].tolist()) return res except (TypeError, ValueError) as e: return str(e) # Test simple compose with only 1 op, this would generate a warning assert test_config([[1, 0], [3, 4]], c_transforms.Compose([c_transforms.Fill(2)])) == [[2, 2], [2, 2]] # Test 1 column -> 2 columns -> 1 -> 2 -> 1 assert test_config([[1, 0]], c_transforms.Compose( [c_transforms.Duplicate(), c_transforms.Concatenate(), c_transforms.Duplicate(), c_transforms.Concatenate()])) \ == [[1, 0] * 4] # Test one Python transform followed by a C++ transform. Type after OneHot is a float (mixed use-case) assert test_config([1, 0], c_transforms.Compose([py_transforms.OneHotOp(2), c_transforms.TypeCast(mstype.int32)])) \ == [[[0, 1]], [[1, 0]]] # Test exceptions. with pytest.raises(TypeError) as error_info: c_transforms.Compose([1, c_transforms.TypeCast(mstype.int32)]) assert "op_list[0] is neither a c_transform op (TensorOperation) nor a callable pyfunc." in str(error_info.value) # Test empty op list with pytest.raises(ValueError) as error_info: test_config([1, 0], c_transforms.Compose([])) assert "op_list can not be empty." in str(error_info.value) # Test Python compose op assert test_config([1, 0], py_transforms.Compose([py_transforms.OneHotOp(2)])) == [[[0, 1]], [[1, 0]]] assert test_config([1, 0], py_transforms.Compose([py_transforms.OneHotOp(2), (lambda x: x + x)])) == [[[0, 2]], [[2, 0]]] # Test nested Python compose op assert test_config([1, 0], py_transforms.Compose([py_transforms.Compose([py_transforms.OneHotOp(2)]), (lambda x: x + x)])) \ == [[[0, 2]], [[2, 0]]] # Test passing a list of Python ops without Compose wrapper assert test_config([1, 0], [py_transforms.Compose([py_transforms.OneHotOp(2)]), (lambda x: x + x)]) \ == [[[0, 2]], [[2, 0]]] assert test_config([1, 0], [py_transforms.OneHotOp(2), (lambda x: x + x)]) == [[[0, 2]], [[2, 0]]] # Test a non callable function with pytest.raises(ValueError) as error_info: py_transforms.Compose([1]) assert "transforms[0] is not callable." in str(error_info.value) # Test empty Python op list with pytest.raises(ValueError) as error_info: test_config([1, 0], py_transforms.Compose([])) assert "transforms list is empty." in str(error_info.value) # Pass in extra brackets with pytest.raises(TypeError) as error_info: py_transforms.Compose([(lambda x: x + x)])() assert "Compose was called without an image. Fix invocation (avoid it being invoked as Compose([...])())." in str( error_info.value) def test_lambdas(): """ Test Multi Column Python Compose Op """ ds.config.set_seed(0) def test_config(arr, input_columns, output_cols, op_list): data = ds.NumpySlicesDataset(arr, column_names=input_columns, shuffle=False) data = data.map(operations=op_list, input_columns=input_columns, output_columns=output_cols, column_order=output_cols) res = [] for i in data.create_dict_iterator(output_numpy=True): for col_name in output_cols: res.append(i[col_name].tolist()) return res arr = ([[1]], [[3]]) assert test_config(arr, ["col0", "col1"], ["a"], py_transforms.Compose([(lambda x, y: x)])) == [[1]] assert test_config(arr, ["col0", "col1"], ["a"], py_transforms.Compose([lambda x, y: x, lambda x: x])) == [[1]] assert test_config(arr, ["col0", "col1"], ["a", "b"], py_transforms.Compose([lambda x, y: x, lambda x: (x, x * 2)])) == \ [[1], [2]] assert test_config(arr, ["col0", "col1"], ["a", "b"], [lambda x, y: (x, x + y), lambda x, y: (x, y * 2)]) == [[1], [8]] def test_c_py_compose_transforms_module(): """ Test combining Python and C++ transforms """ ds.config.set_seed(0) def test_config(arr, input_columns, output_cols, op_list): data = ds.NumpySlicesDataset(arr, column_names=input_columns, shuffle=False) data = data.map(operations=op_list, input_columns=input_columns, output_columns=output_cols, column_order=output_cols) res = [] for i in data.create_dict_iterator(output_numpy=True): for col_name in output_cols: res.append(i[col_name].tolist()) return res arr = [1, 0] assert test_config(arr, ["cols"], ["cols"], [py_transforms.OneHotOp(2), c_transforms.Mask(c_transforms.Relational.EQ, 1)]) == \ [[[False, True]], [[True, False]]] assert test_config(arr, ["cols"], ["cols"], [py_transforms.OneHotOp(2), (lambda x: x + x), c_transforms.Fill(1)]) \ == [[[1, 1]], [[1, 1]]] assert test_config(arr, ["cols"], ["cols"], [py_transforms.OneHotOp(2), (lambda x: x + x), c_transforms.Fill(1), (lambda x: x + x)]) \ == [[[2, 2]], [[2, 2]]] assert test_config([[1, 3]], ["cols"], ["cols"], [c_transforms.PadEnd([3], -1), (lambda x: x + x)]) \ == [[2, 6, -2]] arr = ([[1]], [[3]]) assert test_config(arr, ["col0", "col1"], ["a"], [(lambda x, y: x + y), c_transforms.PadEnd([2], -1)]) == [[4, -1]] def test_c_py_compose_vision_module(plot=False, run_golden=True): """ Test combining Python and C++ vision transforms """ original_seed = config_get_set_seed(10) original_num_parallel_workers = config_get_set_num_parallel_workers(1) def test_config(plot, file_name, op_list): data_dir = "../data/dataset/testImageNetData/train/" data1 = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data1 = data1.map(operations=op_list, input_columns=["image"]) data2 = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data2 = data2.map(operations=c_vision.Decode(), input_columns=["image"]) original_images = [] transformed_images = [] for item in data1.create_dict_iterator(num_epochs=1, output_numpy=True): transformed_images.append(item["image"]) for item in data2.create_dict_iterator(num_epochs=1, output_numpy=True): original_images.append(item["image"]) if run_golden: # Compare with expected md5 from images save_and_check_md5(data1, file_name, generate_golden=GENERATE_GOLDEN) if plot: visualize_list(original_images, transformed_images) test_config(op_list=[c_vision.Decode(), py_vision.ToPIL(), py_vision.Resize((224, 224)), np.array], plot=plot, file_name="compose_c_py_1.npz") test_config(op_list=[c_vision.Decode(), c_vision.Resize((224, 244)), py_vision.ToPIL(), np.array, c_vision.Resize((24, 24))], plot=plot, file_name="compose_c_py_2.npz") test_config(op_list=[py_vision.Decode(), py_vision.Resize((224, 224)), np.array, c_vision.RandomColor()], plot=plot, file_name="compose_c_py_3.npz") # Restore configuration ds.config.set_seed(original_seed) ds.config.set_num_parallel_workers((original_num_parallel_workers)) def test_py_transforms_with_c_vision(): """ These examples will fail, as py_transforms.Random(Apply/Choice/Order) expect callable functions """ ds.config.set_seed(0) def test_config(op_list): data_dir = "../data/dataset/testImageNetData/train/" data = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data = data.map(operations=op_list) res = [] for i in data.create_dict_iterator(output_numpy=True): for col_name in output_cols: res.append(i[col_name].tolist()) return res with pytest.raises(ValueError) as error_info: test_config(py_transforms.RandomApply([c_vision.RandomResizedCrop(200)])) assert "transforms[0] is not callable." in str(error_info.value) with pytest.raises(ValueError) as error_info: test_config(py_transforms.RandomChoice([c_vision.RandomResizedCrop(200)])) assert "transforms[0] is not callable." in str(error_info.value) with pytest.raises(ValueError) as error_info: test_config(py_transforms.RandomOrder([np.array, c_vision.RandomResizedCrop(200)])) assert "transforms[1] is not callable." in str(error_info.value) with pytest.raises(RuntimeError) as error_info: test_config([py_transforms.OneHotOp(20, 0.1)]) assert "The truth value of an array with more than one element is ambiguous. Use a.any() or a.all()" in str( error_info.value) def test_py_vision_with_c_transforms(): """ Test combining Python vision operations with C++ transforms operations """ ds.config.set_seed(0) def test_config(op_list): data_dir = "../data/dataset/testImageNetData/train/" data1 = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data1 = data1.map(operations=op_list, input_columns=["image"]) transformed_images = [] for item in data1.create_dict_iterator(num_epochs=1, output_numpy=True): transformed_images.append(item["image"]) return transformed_images # Test with Mask Op output_arr = test_config([py_vision.Decode(), py_vision.CenterCrop((2)), np.array, c_transforms.Mask(c_transforms.Relational.GE, 100)]) exp_arr = [np.array([[[True, False, False], [True, False, False]], [[True, False, False], [True, False, False]]]), np.array([[[True, False, False], [True, False, False]], [[True, False, False], [True, False, False]]])] for exp_a, output in zip(exp_arr, output_arr): np.testing.assert_array_equal(exp_a, output) # Test with Fill Op output_arr = test_config([py_vision.Decode(), py_vision.CenterCrop((4)), np.array, c_transforms.Fill(10)]) exp_arr = [np.ones((4, 4, 3)) * 10] * 2 for exp_a, output in zip(exp_arr, output_arr): np.testing.assert_array_equal(exp_a, output) # Test with Concatenate Op, which will raise an error since ConcatenateOp only supports rank 1 tensors. with pytest.raises(RuntimeError) as error_info: test_config([py_vision.Decode(), py_vision.CenterCrop((2)), np.array, c_transforms.Concatenate(0)]) assert "Only 1D tensors supported" in str(error_info.value) def test_compose_with_custom_function(): """ Test Python Compose with custom function """ def custom_function(x): return (x, x * x) # First dataset op_list = [ lambda x: x * 3, custom_function, # convert two column output to one lambda *images: np.stack(images) ] data = ds.NumpySlicesDataset([[1, 2]], column_names=["col0"], shuffle=False) data = data.map(input_columns=["col0"], operations=op_list) # res = [] for i in data.create_dict_iterator(output_numpy=True): res.append(i["col0"].tolist()) assert res == [[[3, 6], [9, 36]]] if __name__ == "__main__": test_compose() test_lambdas() test_c_py_compose_transforms_module() test_c_py_compose_vision_module(plot=True) test_py_transforms_with_c_vision() test_py_vision_with_c_transforms() test_compose_with_custom_function()
40.476471
120
0.60994
import numpy as np import pytest import mindspore.common.dtype as mstype import mindspore.dataset as ds import mindspore.dataset.transforms.c_transforms as c_transforms import mindspore.dataset.transforms.py_transforms as py_transforms import mindspore.dataset.vision.c_transforms as c_vision import mindspore.dataset.vision.py_transforms as py_vision from util import visualize_list, save_and_check_md5, config_get_set_seed, config_get_set_num_parallel_workers GENERATE_GOLDEN = False def test_compose(): ds.config.set_seed(0) def test_config(arr, op_list): try: data = ds.NumpySlicesDataset(arr, column_names="col", shuffle=False) data = data.map(input_columns=["col"], operations=op_list) res = [] for i in data.create_dict_iterator(output_numpy=True): res.append(i["col"].tolist()) return res except (TypeError, ValueError) as e: return str(e) assert test_config([[1, 0], [3, 4]], c_transforms.Compose([c_transforms.Fill(2)])) == [[2, 2], [2, 2]] assert test_config([[1, 0]], c_transforms.Compose( [c_transforms.Duplicate(), c_transforms.Concatenate(), c_transforms.Duplicate(), c_transforms.Concatenate()])) \ == [[1, 0] * 4] assert test_config([1, 0], c_transforms.Compose([py_transforms.OneHotOp(2), c_transforms.TypeCast(mstype.int32)])) \ == [[[0, 1]], [[1, 0]]] with pytest.raises(TypeError) as error_info: c_transforms.Compose([1, c_transforms.TypeCast(mstype.int32)]) assert "op_list[0] is neither a c_transform op (TensorOperation) nor a callable pyfunc." in str(error_info.value) with pytest.raises(ValueError) as error_info: test_config([1, 0], c_transforms.Compose([])) assert "op_list can not be empty." in str(error_info.value) assert test_config([1, 0], py_transforms.Compose([py_transforms.OneHotOp(2)])) == [[[0, 1]], [[1, 0]]] assert test_config([1, 0], py_transforms.Compose([py_transforms.OneHotOp(2), (lambda x: x + x)])) == [[[0, 2]], [[2, 0]]] assert test_config([1, 0], py_transforms.Compose([py_transforms.Compose([py_transforms.OneHotOp(2)]), (lambda x: x + x)])) \ == [[[0, 2]], [[2, 0]]] assert test_config([1, 0], [py_transforms.Compose([py_transforms.OneHotOp(2)]), (lambda x: x + x)]) \ == [[[0, 2]], [[2, 0]]] assert test_config([1, 0], [py_transforms.OneHotOp(2), (lambda x: x + x)]) == [[[0, 2]], [[2, 0]]] with pytest.raises(ValueError) as error_info: py_transforms.Compose([1]) assert "transforms[0] is not callable." in str(error_info.value) with pytest.raises(ValueError) as error_info: test_config([1, 0], py_transforms.Compose([])) assert "transforms list is empty." in str(error_info.value) with pytest.raises(TypeError) as error_info: py_transforms.Compose([(lambda x: x + x)])() assert "Compose was called without an image. Fix invocation (avoid it being invoked as Compose([...])())." in str( error_info.value) def test_lambdas(): ds.config.set_seed(0) def test_config(arr, input_columns, output_cols, op_list): data = ds.NumpySlicesDataset(arr, column_names=input_columns, shuffle=False) data = data.map(operations=op_list, input_columns=input_columns, output_columns=output_cols, column_order=output_cols) res = [] for i in data.create_dict_iterator(output_numpy=True): for col_name in output_cols: res.append(i[col_name].tolist()) return res arr = ([[1]], [[3]]) assert test_config(arr, ["col0", "col1"], ["a"], py_transforms.Compose([(lambda x, y: x)])) == [[1]] assert test_config(arr, ["col0", "col1"], ["a"], py_transforms.Compose([lambda x, y: x, lambda x: x])) == [[1]] assert test_config(arr, ["col0", "col1"], ["a", "b"], py_transforms.Compose([lambda x, y: x, lambda x: (x, x * 2)])) == \ [[1], [2]] assert test_config(arr, ["col0", "col1"], ["a", "b"], [lambda x, y: (x, x + y), lambda x, y: (x, y * 2)]) == [[1], [8]] def test_c_py_compose_transforms_module(): ds.config.set_seed(0) def test_config(arr, input_columns, output_cols, op_list): data = ds.NumpySlicesDataset(arr, column_names=input_columns, shuffle=False) data = data.map(operations=op_list, input_columns=input_columns, output_columns=output_cols, column_order=output_cols) res = [] for i in data.create_dict_iterator(output_numpy=True): for col_name in output_cols: res.append(i[col_name].tolist()) return res arr = [1, 0] assert test_config(arr, ["cols"], ["cols"], [py_transforms.OneHotOp(2), c_transforms.Mask(c_transforms.Relational.EQ, 1)]) == \ [[[False, True]], [[True, False]]] assert test_config(arr, ["cols"], ["cols"], [py_transforms.OneHotOp(2), (lambda x: x + x), c_transforms.Fill(1)]) \ == [[[1, 1]], [[1, 1]]] assert test_config(arr, ["cols"], ["cols"], [py_transforms.OneHotOp(2), (lambda x: x + x), c_transforms.Fill(1), (lambda x: x + x)]) \ == [[[2, 2]], [[2, 2]]] assert test_config([[1, 3]], ["cols"], ["cols"], [c_transforms.PadEnd([3], -1), (lambda x: x + x)]) \ == [[2, 6, -2]] arr = ([[1]], [[3]]) assert test_config(arr, ["col0", "col1"], ["a"], [(lambda x, y: x + y), c_transforms.PadEnd([2], -1)]) == [[4, -1]] def test_c_py_compose_vision_module(plot=False, run_golden=True): original_seed = config_get_set_seed(10) original_num_parallel_workers = config_get_set_num_parallel_workers(1) def test_config(plot, file_name, op_list): data_dir = "../data/dataset/testImageNetData/train/" data1 = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data1 = data1.map(operations=op_list, input_columns=["image"]) data2 = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data2 = data2.map(operations=c_vision.Decode(), input_columns=["image"]) original_images = [] transformed_images = [] for item in data1.create_dict_iterator(num_epochs=1, output_numpy=True): transformed_images.append(item["image"]) for item in data2.create_dict_iterator(num_epochs=1, output_numpy=True): original_images.append(item["image"]) if run_golden: save_and_check_md5(data1, file_name, generate_golden=GENERATE_GOLDEN) if plot: visualize_list(original_images, transformed_images) test_config(op_list=[c_vision.Decode(), py_vision.ToPIL(), py_vision.Resize((224, 224)), np.array], plot=plot, file_name="compose_c_py_1.npz") test_config(op_list=[c_vision.Decode(), c_vision.Resize((224, 244)), py_vision.ToPIL(), np.array, c_vision.Resize((24, 24))], plot=plot, file_name="compose_c_py_2.npz") test_config(op_list=[py_vision.Decode(), py_vision.Resize((224, 224)), np.array, c_vision.RandomColor()], plot=plot, file_name="compose_c_py_3.npz") ds.config.set_seed(original_seed) ds.config.set_num_parallel_workers((original_num_parallel_workers)) def test_py_transforms_with_c_vision(): ds.config.set_seed(0) def test_config(op_list): data_dir = "../data/dataset/testImageNetData/train/" data = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data = data.map(operations=op_list) res = [] for i in data.create_dict_iterator(output_numpy=True): for col_name in output_cols: res.append(i[col_name].tolist()) return res with pytest.raises(ValueError) as error_info: test_config(py_transforms.RandomApply([c_vision.RandomResizedCrop(200)])) assert "transforms[0] is not callable." in str(error_info.value) with pytest.raises(ValueError) as error_info: test_config(py_transforms.RandomChoice([c_vision.RandomResizedCrop(200)])) assert "transforms[0] is not callable." in str(error_info.value) with pytest.raises(ValueError) as error_info: test_config(py_transforms.RandomOrder([np.array, c_vision.RandomResizedCrop(200)])) assert "transforms[1] is not callable." in str(error_info.value) with pytest.raises(RuntimeError) as error_info: test_config([py_transforms.OneHotOp(20, 0.1)]) assert "The truth value of an array with more than one element is ambiguous. Use a.any() or a.all()" in str( error_info.value) def test_py_vision_with_c_transforms(): ds.config.set_seed(0) def test_config(op_list): data_dir = "../data/dataset/testImageNetData/train/" data1 = ds.ImageFolderDataset(dataset_dir=data_dir, shuffle=False) data1 = data1.map(operations=op_list, input_columns=["image"]) transformed_images = [] for item in data1.create_dict_iterator(num_epochs=1, output_numpy=True): transformed_images.append(item["image"]) return transformed_images output_arr = test_config([py_vision.Decode(), py_vision.CenterCrop((2)), np.array, c_transforms.Mask(c_transforms.Relational.GE, 100)]) exp_arr = [np.array([[[True, False, False], [True, False, False]], [[True, False, False], [True, False, False]]]), np.array([[[True, False, False], [True, False, False]], [[True, False, False], [True, False, False]]])] for exp_a, output in zip(exp_arr, output_arr): np.testing.assert_array_equal(exp_a, output) output_arr = test_config([py_vision.Decode(), py_vision.CenterCrop((4)), np.array, c_transforms.Fill(10)]) exp_arr = [np.ones((4, 4, 3)) * 10] * 2 for exp_a, output in zip(exp_arr, output_arr): np.testing.assert_array_equal(exp_a, output) with pytest.raises(RuntimeError) as error_info: test_config([py_vision.Decode(), py_vision.CenterCrop((2)), np.array, c_transforms.Concatenate(0)]) assert "Only 1D tensors supported" in str(error_info.value) def test_compose_with_custom_function(): def custom_function(x): return (x, x * x) op_list = [ lambda x: x * 3, custom_function, lambda *images: np.stack(images) ] data = ds.NumpySlicesDataset([[1, 2]], column_names=["col0"], shuffle=False) data = data.map(input_columns=["col0"], operations=op_list) res = [] for i in data.create_dict_iterator(output_numpy=True): res.append(i["col0"].tolist()) assert res == [[[3, 6], [9, 36]]] if __name__ == "__main__": test_compose() test_lambdas() test_c_py_compose_transforms_module() test_c_py_compose_vision_module(plot=True) test_py_transforms_with_c_vision() test_py_vision_with_c_transforms() test_compose_with_custom_function()
true
true
f71d732ef7336c113e6a500672479f9fa4c6e935
4,185
py
Python
packnet_sfm/models/SemiSupModel_fisheye.py
vbelissen/packnet-sfm
dfba692596b08ccff17abb9423c1958cecc75b0f
[ "MIT" ]
null
null
null
packnet_sfm/models/SemiSupModel_fisheye.py
vbelissen/packnet-sfm
dfba692596b08ccff17abb9423c1958cecc75b0f
[ "MIT" ]
null
null
null
packnet_sfm/models/SemiSupModel_fisheye.py
vbelissen/packnet-sfm
dfba692596b08ccff17abb9423c1958cecc75b0f
[ "MIT" ]
null
null
null
# Copyright 2020 Toyota Research Institute. All rights reserved. import torch from packnet_sfm.models.SelfSupModel_fisheye import SfmModel, SelfSupModel_fisheye from packnet_sfm.losses.supervised_loss_valeo import SupervisedLoss from packnet_sfm.models.model_utils import merge_outputs from packnet_sfm.utils.depth import depth2inv class SemiSupModel_fisheye(SelfSupModel_fisheye): """ Model that inherits a depth and pose networks, plus the self-supervised loss from SelfSupModel and includes a supervised loss for semi-supervision. Parameters ---------- supervised_loss_weight : float Weight for the supervised loss kwargs : dict Extra parameters """ def __init__(self, supervised_loss_weight=0.9, **kwargs): # Initializes SelfSupModel super().__init__(**kwargs) # If supervision weight is 0.0, use SelfSupModel directly assert 0. < supervised_loss_weight <= 1., "Model requires (0, 1] supervision" # Store weight and initializes supervised loss self.supervised_loss_weight = supervised_loss_weight self._supervised_loss = SupervisedLoss(**kwargs) # Pose network is only required if there is self-supervision self._network_requirements['pose_net'] = self.supervised_loss_weight < 1 # GT depth is only required if there is supervision self._train_requirements['gt_depth'] = self.supervised_loss_weight > 0 @property def logs(self): """Return logs.""" return { **super().logs, **self._supervised_loss.logs } def supervised_loss(self, inv_depths, gt_inv_depths, path_to_ego_mask, return_logs=False, progress=0.0): """ Calculates the supervised loss. Parameters ---------- inv_depths : torch.Tensor [B,1,H,W] Predicted inverse depth maps from the original image gt_inv_depths : torch.Tensor [B,1,H,W] Ground-truth inverse depth maps from the original image return_logs : bool True if logs are stored progress : Training progress percentage Returns ------- output : dict Dictionary containing a "loss" scalar a "metrics" dictionary """ return self._supervised_loss( inv_depths, gt_inv_depths, path_to_ego_mask, return_logs=return_logs, progress=progress) def forward(self, batch, return_logs=False, progress=0.0): """ Processes a batch. Parameters ---------- batch : dict Input batch return_logs : bool True if logs are stored progress : Training progress percentage Returns ------- output : dict Dictionary containing a "loss" scalar and different metrics and predictions for logging and downstream usage. """ if not self.training: # If not training, no need for self-supervised loss return SfmModel.forward(self, batch) else: if self.supervised_loss_weight == 1.: # If no self-supervision, no need to calculate loss self_sup_output = SfmModel.forward(self, batch) loss = torch.tensor([0.]).type_as(batch['rgb']) else: # Otherwise, calculate and weight self-supervised loss self_sup_output = SelfSupModel_fisheye.forward(self, batch) loss = (1.0 - self.supervised_loss_weight) * self_sup_output['loss'] # Calculate and weight supervised loss sup_output = self.supervised_loss( self_sup_output['inv_depths'], depth2inv(batch['depth']), batch['path_to_ego_mask'], return_logs=return_logs, progress=progress) loss += self.supervised_loss_weight * sup_output['loss'] # Merge and return outputs return { 'loss': loss, **merge_outputs(self_sup_output, sup_output), }
36.710526
87
0.615054
import torch from packnet_sfm.models.SelfSupModel_fisheye import SfmModel, SelfSupModel_fisheye from packnet_sfm.losses.supervised_loss_valeo import SupervisedLoss from packnet_sfm.models.model_utils import merge_outputs from packnet_sfm.utils.depth import depth2inv class SemiSupModel_fisheye(SelfSupModel_fisheye): def __init__(self, supervised_loss_weight=0.9, **kwargs): super().__init__(**kwargs) assert 0. < supervised_loss_weight <= 1., "Model requires (0, 1] supervision" self.supervised_loss_weight = supervised_loss_weight self._supervised_loss = SupervisedLoss(**kwargs) self._network_requirements['pose_net'] = self.supervised_loss_weight < 1 self._train_requirements['gt_depth'] = self.supervised_loss_weight > 0 @property def logs(self): return { **super().logs, **self._supervised_loss.logs } def supervised_loss(self, inv_depths, gt_inv_depths, path_to_ego_mask, return_logs=False, progress=0.0): return self._supervised_loss( inv_depths, gt_inv_depths, path_to_ego_mask, return_logs=return_logs, progress=progress) def forward(self, batch, return_logs=False, progress=0.0): if not self.training: return SfmModel.forward(self, batch) else: if self.supervised_loss_weight == 1.: self_sup_output = SfmModel.forward(self, batch) loss = torch.tensor([0.]).type_as(batch['rgb']) else: self_sup_output = SelfSupModel_fisheye.forward(self, batch) loss = (1.0 - self.supervised_loss_weight) * self_sup_output['loss'] sup_output = self.supervised_loss( self_sup_output['inv_depths'], depth2inv(batch['depth']), batch['path_to_ego_mask'], return_logs=return_logs, progress=progress) loss += self.supervised_loss_weight * sup_output['loss'] return { 'loss': loss, **merge_outputs(self_sup_output, sup_output), }
true
true
f71d73d71ba339d6c7641179ef7f69755e76319e
616
py
Python
cythonTest/onlineSample/combination/jit_combination.py
terasakisatoshi/pythonCodes
baee095ecee96f6b5ec6431267cdc6c40512a542
[ "MIT" ]
null
null
null
cythonTest/onlineSample/combination/jit_combination.py
terasakisatoshi/pythonCodes
baee095ecee96f6b5ec6431267cdc6c40512a542
[ "MIT" ]
null
null
null
cythonTest/onlineSample/combination/jit_combination.py
terasakisatoshi/pythonCodes
baee095ecee96f6b5ec6431267cdc6c40512a542
[ "MIT" ]
null
null
null
import time from numba import jit import numpy as np @jit() def jit_sum_conbination(N): xs = [i for i in range(N)] ys = [i for i in range(N)] total = 0 for x in xs: for y in ys: total += x+y return total def py_sum_conbination(N): xs = np.arange(N) ys = np.arange(N) total = 0 for x in xs: for y in ys: total += x+y return total def main(): N = 10000 start = time.time() total = jit_sum_conbination(N) end = time.time() print(total) print('elapsed time=', end-start) if __name__ == '__main__': main()
18.117647
37
0.553571
import time from numba import jit import numpy as np @jit() def jit_sum_conbination(N): xs = [i for i in range(N)] ys = [i for i in range(N)] total = 0 for x in xs: for y in ys: total += x+y return total def py_sum_conbination(N): xs = np.arange(N) ys = np.arange(N) total = 0 for x in xs: for y in ys: total += x+y return total def main(): N = 10000 start = time.time() total = jit_sum_conbination(N) end = time.time() print(total) print('elapsed time=', end-start) if __name__ == '__main__': main()
true
true
f71d73df5330b5ef66e0e587f04a759ffd88b242
4,409
py
Python
test/functional/p2p_zpos_fakestake_accepted.py
salo50/coin
2c7cc3a4b4cb8931e14845a60eb6b051eae18a72
[ "MIT" ]
null
null
null
test/functional/p2p_zpos_fakestake_accepted.py
salo50/coin
2c7cc3a4b4cb8931e14845a60eb6b051eae18a72
[ "MIT" ]
null
null
null
test/functional/p2p_zpos_fakestake_accepted.py
salo50/coin
2c7cc3a4b4cb8931e14845a60eb6b051eae18a72
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) 2019 The redspace Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. ''' Performs the same check as in Test_02 verifying that zPoS forked blocks that stake a zerocoin which is spent on mainchain on an higher block are still accepted. ''' from test_framework.authproxy import JSONRPCException from fake_stake.base_test import redspace_FakeStakeTest from time import sleep class zPoSFakeStakeAccepted(redspace_FakeStakeTest): def set_test_params(self): ''' Setup test environment :param: :return: ''' self.setup_clean_chain = True self.num_nodes = 1 self.extra_args = [['-staking=1', '-debug=net', '-zrscstake']] * self.num_nodes def run_test(self): self.description = "Performs the same check as in Test_02 verifying that zPoS forked blocks that stake a zerocoin which is spent on mainchain on an higher block are still accepted." self.init_test() DENOM_TO_USE = 1000 # zc denomination INITAL_MINED_BLOCKS = 321 MORE_MINED_BLOCKS = 301 FORK_DEPTH = 75 self.NUM_BLOCKS = 2 # 1) Starting mining blocks self.log.info("Mining %d blocks to get to zPOS activation...." % INITAL_MINED_BLOCKS) self.node.generate(INITAL_MINED_BLOCKS) sleep(2) # 2) Collect the possible prevouts and mint zerocoins with those self.log.info("Collecting all unspent coins which we generated from mining...") balance = self.node.getbalance("*", 100) self.log.info("Minting zerocoins...") initial_mints = 0 while balance > DENOM_TO_USE: try: self.node.mintzerocoin(DENOM_TO_USE) except JSONRPCException: break sleep(1) initial_mints += 1 self.node.generate(1) sleep(1) if initial_mints % 5 == 0: self.log.info("Minted %d coins" % initial_mints) if initial_mints >= 20: break balance = self.node.getbalance("*", 100) self.log.info("Minted %d coins in the %d-denom, remaining balance %d", initial_mints, DENOM_TO_USE, balance) sleep(2) # 3) mine more blocks self.log.info("Mining %d more blocks ... and getting spendable zerocoins" % MORE_MINED_BLOCKS) self.node.generate(MORE_MINED_BLOCKS) sleep(2) mints = self.node.listmintedzerocoins(True, True) sleep(1) mints_hashes = [x["serial hash"] for x in mints] # This mints are not ready spendable, only few of them. self.log.info("Got %d confirmed mints" % len(mints_hashes)) # 4) Start mining again so that spends get confirmed in a block. self.log.info("Mining 200 more blocks...") self.node.generate(200) sleep(2) # 5) spend mints self.log.info("Spending mints in block %d..." % self.node.getblockcount()) spends = 0 for mint in mints_hashes: # create a single element list to pass to RPC spendzerocoinmints mint_arg = [] mint_arg.append(mint) try: self.node.spendzerocoinmints(mint_arg) sleep(1) spends += 1 except JSONRPCException as e: self.log.warning(str(e)) continue sleep(1) self.log.info("Successfully spent %d mints" % spends) self.log.info("Mining 6 more blocks...") self.node.generate(6) sleep(2) # 6) Collect some prevouts for random txes self.log.info("Collecting inputs for txes...") utxo_list = self.node.listunspent() sleep(1) # 7) Create valid forked zPoS blocks and send them self.log.info("Creating stake zPoS blocks...") err_msgs = self.test_spam("Fork", mints, spending_utxo_list=utxo_list, fZPoS=True, fRandomHeight=True, randomRange=FORK_DEPTH, randomRange2=50, fMustPass=True) if not len(err_msgs) == 0: self.log.error("result: " + " | ".join(err_msgs)) raise AssertionError("TEST FAILED") self.log.info("%s PASSED" % self.__class__.__name__) if __name__ == '__main__': zPoSFakeStakeAccepted().main()
37.364407
189
0.621456
from test_framework.authproxy import JSONRPCException from fake_stake.base_test import redspace_FakeStakeTest from time import sleep class zPoSFakeStakeAccepted(redspace_FakeStakeTest): def set_test_params(self): self.setup_clean_chain = True self.num_nodes = 1 self.extra_args = [['-staking=1', '-debug=net', '-zrscstake']] * self.num_nodes def run_test(self): self.description = "Performs the same check as in Test_02 verifying that zPoS forked blocks that stake a zerocoin which is spent on mainchain on an higher block are still accepted." self.init_test() DENOM_TO_USE = 1000 INITAL_MINED_BLOCKS = 321 MORE_MINED_BLOCKS = 301 FORK_DEPTH = 75 self.NUM_BLOCKS = 2 self.log.info("Mining %d blocks to get to zPOS activation...." % INITAL_MINED_BLOCKS) self.node.generate(INITAL_MINED_BLOCKS) sleep(2) self.log.info("Collecting all unspent coins which we generated from mining...") balance = self.node.getbalance("*", 100) self.log.info("Minting zerocoins...") initial_mints = 0 while balance > DENOM_TO_USE: try: self.node.mintzerocoin(DENOM_TO_USE) except JSONRPCException: break sleep(1) initial_mints += 1 self.node.generate(1) sleep(1) if initial_mints % 5 == 0: self.log.info("Minted %d coins" % initial_mints) if initial_mints >= 20: break balance = self.node.getbalance("*", 100) self.log.info("Minted %d coins in the %d-denom, remaining balance %d", initial_mints, DENOM_TO_USE, balance) sleep(2) self.log.info("Mining %d more blocks ... and getting spendable zerocoins" % MORE_MINED_BLOCKS) self.node.generate(MORE_MINED_BLOCKS) sleep(2) mints = self.node.listmintedzerocoins(True, True) sleep(1) mints_hashes = [x["serial hash"] for x in mints] self.log.info("Got %d confirmed mints" % len(mints_hashes)) self.log.info("Mining 200 more blocks...") self.node.generate(200) sleep(2) self.log.info("Spending mints in block %d..." % self.node.getblockcount()) spends = 0 for mint in mints_hashes: mint_arg = [] mint_arg.append(mint) try: self.node.spendzerocoinmints(mint_arg) sleep(1) spends += 1 except JSONRPCException as e: self.log.warning(str(e)) continue sleep(1) self.log.info("Successfully spent %d mints" % spends) self.log.info("Mining 6 more blocks...") self.node.generate(6) sleep(2) self.log.info("Collecting inputs for txes...") utxo_list = self.node.listunspent() sleep(1) self.log.info("Creating stake zPoS blocks...") err_msgs = self.test_spam("Fork", mints, spending_utxo_list=utxo_list, fZPoS=True, fRandomHeight=True, randomRange=FORK_DEPTH, randomRange2=50, fMustPass=True) if not len(err_msgs) == 0: self.log.error("result: " + " | ".join(err_msgs)) raise AssertionError("TEST FAILED") self.log.info("%s PASSED" % self.__class__.__name__) if __name__ == '__main__': zPoSFakeStakeAccepted().main()
true
true
f71d73fee6e604915153c8e6e7d293a6a713e8a7
11,201
py
Python
docs/source/conf.py
colindonfack/statsmodels
a251e4cd4b689781916e1001d7e8ca2c0395ef1f
[ "BSD-3-Clause" ]
15
2015-03-03T09:47:42.000Z
2022-01-05T18:28:31.000Z
docs/source/conf.py
colindonfack/statsmodels
a251e4cd4b689781916e1001d7e8ca2c0395ef1f
[ "BSD-3-Clause" ]
7
2015-11-20T08:33:04.000Z
2020-07-24T19:34:39.000Z
docs/source/conf.py
colindonfack/statsmodels
a251e4cd4b689781916e1001d7e8ca2c0395ef1f
[ "BSD-3-Clause" ]
14
2015-01-06T22:08:34.000Z
2021-01-01T16:33:23.000Z
# -*- coding: utf-8 -*- # # statsmodels documentation build configuration file, created by # sphinx-quickstart on Sat Jan 22 11:17:58 2011. # # This file is execfile()d with the current directory set to its containing dir. # # Note that not all possible configuration values are present in this # autogenerated file. # # All configuration values have a default; values that are commented out # serve to show the default. import sys, os # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. sys.path.insert(0, os.path.abspath('../sphinxext')) # -- General configuration ----------------------------------------------------- # If your documentation needs a minimal Sphinx version, state it here. # Add any Sphinx extension module names here, as strings. They can be extensions # coming with Sphinx (named 'sphinx.ext.*') or your custom ones. extensions = ['sphinx.ext.autodoc', 'sphinx.ext.doctest', 'sphinx.ext.intersphinx', 'sphinx.ext.todo', 'sphinx.ext.mathjax', # One of mathjax or imgmath # 'sphinx.ext.imgmath', 'sphinx.ext.viewcode', 'sphinx.ext.autosummary', 'sphinx.ext.inheritance_diagram', 'matplotlib.sphinxext.plot_directive', 'IPython.sphinxext.ipython_console_highlighting', 'IPython.sphinxext.ipython_directive', 'github', # for GitHub links, # 'numpydoc', # numpydoc or napoleon, but not both 'sphinx.ext.napoleon' ] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix of source filenames. source_suffix = '.rst' # The encoding of source files. #source_encoding = 'utf-8-sig' # The master toctree document. master_doc = 'index' # General information about the project. project = u'statsmodels' copyright = u'2009-2017, Josef Perktold, Skipper Seabold, Jonathan Taylor, statsmodels-developers' autosummary_generate = True autoclass_content = 'class' # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # from statsmodels import __version__ release = __version__ # The full version, including dev tag. version = __version__ # set inheritance_graph_attrs # you need graphviz installed to use this # see: http://sphinx.pocoo.org/ext/inheritance.html # and graphviz dot documentation http://www.graphviz.org/content/attrs #NOTE: giving the empty string to size allows graphviz to figure out # the size inheritance_graph_attrs = dict(size='""', ratio="compress", fontsize=14, rankdir="LR") #inheritance_node_attrs = dict(shape='ellipse', fontsize=14, height=0.75, # color='dodgerblue1', style='filled') # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. #language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: #today = '' # Else, today_fmt is used as the format for a strftime call. #today_fmt = '%B %d, %Y' # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. exclude_patterns = ['*/autosummary/class.rst', '*/autosummary/glmfamilies.rst'] # The reST default role (used for this markup: `text`) to use for all documents. #default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. add_function_parentheses = False # If true, the current module name will be prepended to all description # unit titles (such as .. function::). #add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. #show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # A list of ignored prefixes for module index sorting. #modindex_common_prefix = [] # -- Options for HTML output --------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. #html_theme = 'default' if 'htmlhelp' in sys.argv: #html_theme = 'statsmodels_htmlhelp' #doesn't look nice yet html_theme = 'default' print('################# using statsmodels_htmlhelp ############') else: html_theme = 'statsmodels' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. #html_theme_options = {} # Add any paths that contain custom themes here, relative to this directory. html_theme_path = ['../themes'] # The name for this set of Sphinx documents. If None, it defaults to # "<project> v<release> documentation". #html_title = None # A shorter title for the navigation bar. Default is the same as html_title. #html_short_title = None # The name of an image file (relative to this directory) to place at the top # of the sidebar. html_logo = 'images/statsmodels_hybi_banner.png' # The name of an image file (within the static path) to use as favicon of the # docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. html_favicon = 'images/statsmodels_hybi_favico.ico' # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # If not '', a 'Last updated on:' timestamp is inserted at every page bottom, # using the given strftime format. #html_last_updated_fmt = '%b %d, %Y' # If true, SmartyPants will be used to convert quotes and dashes to # typographically correct entities. #html_use_smartypants = True # Custom sidebar templates, maps document names to template names. html_sidebars = {'index' : ['indexsidebar.html','searchbox.html','sidelinks.html']} # Additional templates that should be rendered to pages, maps page names to # template names. #html_additional_pages = {} # If false, no module index is generated. html_domain_indices = True # If false, no index is generated. #html_use_index = True # If true, the index is split into individual pages for each letter. #html_split_index = False # If true, links to the reST sources are added to the pages. #html_show_sourcelink = True # If true, "Created using Sphinx" is shown in the HTML footer. Default is True. #html_show_sphinx = True # If true, "(C) Copyright ..." is shown in the HTML footer. Default is True. #html_show_copyright = True # If true, an OpenSearch description file will be output, and all pages will # contain a <link> tag referring to it. The value of this option must be the # base URL from which the finished HTML is served. #html_use_opensearch = '' # This is the file name suffix for HTML files (e.g. ".xhtml"). #html_file_suffix = None # Output file base name for HTML help builder. htmlhelp_basename = 'statsmodelsdoc' # -- Options for LaTeX output -------------------------------------------------- # The paper size ('letter' or 'a4'). #latex_paper_size = 'letter' # The font size ('10pt', '11pt' or '12pt'). #latex_font_size = '10pt' # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass [howto/manual]). latex_documents = [ ('index', 'statsmodels.tex', u'statsmodels Documentation', u'Josef Perktold, Skipper Seabold', 'manual'), ] # The name of an image file (relative to this directory) to place at the top of # the title page. #latex_logo = None # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. #latex_use_parts = False # If true, show page references after internal links. #latex_show_pagerefs = False # If true, show URL addresses after external links. #latex_show_urls = False # Additional stuff for the LaTeX preamble. #latex_preamble = '' # Documents to append as an appendix to all manuals. #latex_appendices = [] # If false, no module index is generated. #latex_domain_indices = True # imgmath options imgmath_image_format = 'png' imgmath_latex_preamble = r'\usepackage[active]{preview}' imgmath_use_preview = True # -- Options for manual page output -------------------------------------------- # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ ('index', 'statsmodels', u'statsmodels Documentation', [u'Josef Perktold, Skipper Seabold, Jonathan Taylor'], 1) ] # -- Options for Epub output --------------------------------------------------- # Bibliographic Dublin Core info. epub_title = u'statsmodels' epub_author = u'Josef Perktold, Skipper Seabold' epub_publisher = u'Josef Perktold, Skipper Seabold' epub_copyright = u'2009-2017, Josef Perktold, Skipper Seabold, Jonathan Taylor, statsmodels-developers' # The language of the text. It defaults to the language option # or en if the language is not set. #epub_language = '' # The scheme of the identifier. Typical schemes are ISBN or URL. #epub_scheme = '' # The unique identifier of the text. This can be a ISBN number # or the project homepage. #epub_identifier = '' # A unique identification for the text. #epub_uid = '' # HTML files that should be inserted before the pages created by sphinx. # The format is a list of tuples containing the path and title. #epub_pre_files = [] # HTML files shat should be inserted after the pages created by sphinx. # The format is a list of tuples containing the path and title. #epub_post_files = [] # A list of files that should not be packed into the epub file. #epub_exclude_files = [] # The depth of the table of contents in toc.ncx. #epub_tocdepth = 3 # Allow duplicate toc entries. #epub_tocdup = True # Example configuration for intersphinx: refer to the Python standard library. intersphinx_mapping = { 'numpy': ('https://docs.scipy.org/doc/numpy/', None), 'python': ('https://docs.python.org/3/', None), 'pydagogue': ('https://matthew-brett.github.io/pydagogue/', None), 'patsy': ('https://patsy.readthedocs.io/en/latest/', None), 'pandas': ('https://pandas.pydata.org/pandas-docs/stable/', None), } from os.path import dirname, abspath, join plot_basedir = join(dirname(dirname(os.path.abspath(__file__))), 'source') # ghissue config github_project_url = "https://github.com/statsmodels/statsmodels" # for the examples landing page import json example_context = json.load(open('examples/landing.json')) html_context = {'examples': example_context } # --------------- DOCTEST ------------------- doctest_global_setup = """ import statsmodels.api as sm import statsmodels.formula.api as smf import numpy as np import scipy.stats as stats import matplotlib.pyplot as plt import pandas as pd """
33.942424
103
0.70949
import sys, os sys.path.insert(0, os.path.abspath('../sphinxext')) extensions = ['sphinx.ext.autodoc', 'sphinx.ext.doctest', 'sphinx.ext.intersphinx', 'sphinx.ext.todo', 'sphinx.ext.mathjax', 'sphinx.ext.viewcode', 'sphinx.ext.autosummary', 'sphinx.ext.inheritance_diagram', 'matplotlib.sphinxext.plot_directive', 'IPython.sphinxext.ipython_console_highlighting', 'IPython.sphinxext.ipython_directive', 'github', ] templates_path = ['_templates'] source_suffix = '.rst' master_doc = 'index' project = u'statsmodels' copyright = u'2009-2017, Josef Perktold, Skipper Seabold, Jonathan Taylor, statsmodels-developers' autosummary_generate = True autoclass_content = 'class' # |version| and |release|, also used in various other places throughout the # built documents. # from statsmodels import __version__ release = __version__ # The full version, including dev tag. version = __version__ # set inheritance_graph_attrs # you need graphviz installed to use this # see: http://sphinx.pocoo.org/ext/inheritance.html # and graphviz dot documentation http://www.graphviz.org/content/attrs #NOTE: giving the empty string to size allows graphviz to figure out # the size inheritance_graph_attrs = dict(size='""', ratio="compress", fontsize=14, rankdir="LR") #inheritance_node_attrs = dict(shape='ellipse', fontsize=14, height=0.75, # color='dodgerblue1', style='filled') # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. #language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: #today = '' # Else, today_fmt is used as the format for a strftime call. #today_fmt = '%B %d, %Y' # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. exclude_patterns = ['*/autosummary/class.rst', '*/autosummary/glmfamilies.rst'] # The reST default role (used for this markup: `text`) to use for all documents. #default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. add_function_parentheses = False # If true, the current module name will be prepended to all description # unit titles (such as .. function::). #add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. #show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # A list of ignored prefixes for module index sorting. #modindex_common_prefix = [] # -- Options for HTML output --------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. #html_theme = 'default' if 'htmlhelp' in sys.argv: #html_theme = 'statsmodels_htmlhelp' #doesn't look nice yet html_theme = 'default' print('################# using statsmodels_htmlhelp ############') else: html_theme = 'statsmodels' html_theme_path = ['../themes'] html_logo = 'images/statsmodels_hybi_banner.png' html_favicon = 'images/statsmodels_hybi_favico.ico' html_static_path = ['_static'] html_sidebars = {'index' : ['indexsidebar.html','searchbox.html','sidelinks.html']} html_domain_indices = True htmlhelp_basename = 'statsmodelsdoc' latex_documents = [ ('index', 'statsmodels.tex', u'statsmodels Documentation', u'Josef Perktold, Skipper Seabold', 'manual'), ] imgmath_image_format = 'png' imgmath_latex_preamble = r'\usepackage[active]{preview}' imgmath_use_preview = True man_pages = [ ('index', 'statsmodels', u'statsmodels Documentation', [u'Josef Perktold, Skipper Seabold, Jonathan Taylor'], 1) ] epub_title = u'statsmodels' epub_author = u'Josef Perktold, Skipper Seabold' epub_publisher = u'Josef Perktold, Skipper Seabold' epub_copyright = u'2009-2017, Josef Perktold, Skipper Seabold, Jonathan Taylor, statsmodels-developers' intersphinx_mapping = { 'numpy': ('https://docs.scipy.org/doc/numpy/', None), 'python': ('https://docs.python.org/3/', None), 'pydagogue': ('https://matthew-brett.github.io/pydagogue/', None), 'patsy': ('https://patsy.readthedocs.io/en/latest/', None), 'pandas': ('https://pandas.pydata.org/pandas-docs/stable/', None), } from os.path import dirname, abspath, join plot_basedir = join(dirname(dirname(os.path.abspath(__file__))), 'source') github_project_url = "https://github.com/statsmodels/statsmodels" import json example_context = json.load(open('examples/landing.json')) html_context = {'examples': example_context } doctest_global_setup = """ import statsmodels.api as sm import statsmodels.formula.api as smf import numpy as np import scipy.stats as stats import matplotlib.pyplot as plt import pandas as pd """
true
true
f71d74209b671ba4f44feb645fe56447c58e62e9
20,551
py
Python
venv/lib/python3.9/site-packages/jupyter_client/tests/test_kernelmanager.py
CMU-IDS-2022/final-project-the-evaluators
3b9262ad1a0f7315208a94a05ea1ce38e679d01d
[ "BSD-3-Clause" ]
null
null
null
venv/lib/python3.9/site-packages/jupyter_client/tests/test_kernelmanager.py
CMU-IDS-2022/final-project-the-evaluators
3b9262ad1a0f7315208a94a05ea1ce38e679d01d
[ "BSD-3-Clause" ]
null
null
null
venv/lib/python3.9/site-packages/jupyter_client/tests/test_kernelmanager.py
CMU-IDS-2022/final-project-the-evaluators
3b9262ad1a0f7315208a94a05ea1ce38e679d01d
[ "BSD-3-Clause" ]
null
null
null
"""Tests for the KernelManager""" # Copyright (c) Jupyter Development Team. # Distributed under the terms of the Modified BSD License. import asyncio import concurrent.futures import json import os import signal import sys import time from subprocess import PIPE import pytest from jupyter_core import paths from traitlets.config.loader import Config from ..manager import _ShutdownStatus from ..manager import start_new_async_kernel from ..manager import start_new_kernel from .utils import AsyncKMSubclass from .utils import SyncKMSubclass from jupyter_client import AsyncKernelManager from jupyter_client import KernelManager pjoin = os.path.join TIMEOUT = 30 @pytest.fixture(params=["tcp", "ipc"]) def transport(request): if sys.platform == "win32" and request.param == "ipc": # pytest.skip("Transport 'ipc' not supported on Windows.") return request.param @pytest.fixture def config(transport): c = Config() c.KernelManager.transport = transport if transport == "ipc": c.KernelManager.ip = "test" return c def _install_kernel(name="signaltest", extra_env=None): if extra_env is None: extra_env = {} kernel_dir = pjoin(paths.jupyter_data_dir(), "kernels", name) os.makedirs(kernel_dir) with open(pjoin(kernel_dir, "kernel.json"), "w") as f: f.write( json.dumps( { "argv": [ sys.executable, "-m", "jupyter_client.tests.signalkernel", "-f", "{connection_file}", ], "display_name": "Signal Test Kernel", "env": {"TEST_VARS": "${TEST_VARS}:test_var_2", **extra_env}, } ) ) @pytest.fixture def install_kernel(): return _install_kernel() def install_kernel_dont_shutdown(): _install_kernel("signaltest-no-shutdown", {"NO_SHUTDOWN_REPLY": "1"}) def install_kernel_dont_terminate(): return _install_kernel( "signaltest-no-terminate", {"NO_SHUTDOWN_REPLY": "1", "NO_SIGTERM_REPLY": "1"} ) @pytest.fixture def start_kernel(): km, kc = start_new_kernel(kernel_name="signaltest") yield km, kc kc.stop_channels() km.shutdown_kernel() assert km.context.closed @pytest.fixture def km(config): km = KernelManager(config=config) return km @pytest.fixture def km_subclass(config): km = SyncKMSubclass(config=config) return km @pytest.fixture def zmq_context(): import zmq ctx = zmq.Context() yield ctx ctx.term() @pytest.fixture(params=[AsyncKernelManager, AsyncKMSubclass]) def async_km(request, config): km = request.param(config=config) return km @pytest.fixture def async_km_subclass(config): km = AsyncKMSubclass(config=config) return km @pytest.fixture async def start_async_kernel(): km, kc = await start_new_async_kernel(kernel_name="signaltest") yield km, kc kc.stop_channels() await km.shutdown_kernel() assert km.context.closed class TestKernelManagerShutDownGracefully: parameters = ( "name, install, expected", [ ("signaltest", _install_kernel, _ShutdownStatus.ShutdownRequest), ( "signaltest-no-shutdown", install_kernel_dont_shutdown, _ShutdownStatus.SigtermRequest, ), ( "signaltest-no-terminate", install_kernel_dont_terminate, _ShutdownStatus.SigkillRequest, ), ], ) @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") @pytest.mark.parametrize(*parameters) def test_signal_kernel_subprocesses(self, name, install, expected): # ipykernel doesn't support 3.6 and this test uses async shutdown_request if expected == _ShutdownStatus.ShutdownRequest and sys.version_info < (3, 7): pytest.skip() install() km, kc = start_new_kernel(kernel_name=name) assert km._shutdown_status == _ShutdownStatus.Unset assert km.is_alive() # kc.execute("1") kc.stop_channels() km.shutdown_kernel() if expected == _ShutdownStatus.ShutdownRequest: expected = [expected, _ShutdownStatus.SigtermRequest] else: expected = [expected] assert km._shutdown_status in expected @pytest.mark.asyncio @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") @pytest.mark.parametrize(*parameters) async def test_async_signal_kernel_subprocesses(self, name, install, expected): install() km, kc = await start_new_async_kernel(kernel_name=name) assert km._shutdown_status == _ShutdownStatus.Unset assert await km.is_alive() # kc.execute("1") kc.stop_channels() await km.shutdown_kernel() if expected == _ShutdownStatus.ShutdownRequest: expected = [expected, _ShutdownStatus.SigtermRequest] else: expected = [expected] assert km._shutdown_status in expected class TestKernelManager: def test_lifecycle(self, km): km.start_kernel(stdout=PIPE, stderr=PIPE) assert km.is_alive() is_done = km.ready.done() assert is_done km.restart_kernel(now=True) assert km.is_alive() km.interrupt_kernel() assert isinstance(km, KernelManager) km.shutdown_kernel(now=True) assert km.context.closed def test_get_connect_info(self, km): cinfo = km.get_connection_info() keys = sorted(cinfo.keys()) expected = sorted( [ "ip", "transport", "hb_port", "shell_port", "stdin_port", "iopub_port", "control_port", "key", "signature_scheme", ] ) assert keys == expected @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") def test_signal_kernel_subprocesses(self, install_kernel, start_kernel): km, kc = start_kernel def execute(cmd): request_id = kc.execute(cmd) while True: reply = kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content N = 5 for i in range(N): execute("start") time.sleep(1) # make sure subprocs stay up reply = execute("check") assert reply["user_expressions"]["poll"] == [None] * N # start a job on the kernel to be interrupted kc.execute("sleep") time.sleep(1) # ensure sleep message has been handled before we interrupt km.interrupt_kernel() reply = kc.get_shell_msg(TIMEOUT) content = reply["content"] assert content["status"] == "ok" assert content["user_expressions"]["interrupted"] # wait up to 10s for subprocesses to handle signal for i in range(100): reply = execute("check") if reply["user_expressions"]["poll"] != [-signal.SIGINT] * N: time.sleep(0.1) else: break # verify that subprocesses were interrupted assert reply["user_expressions"]["poll"] == [-signal.SIGINT] * N def test_start_new_kernel(self, install_kernel, start_kernel): km, kc = start_kernel assert km.is_alive() assert kc.is_alive() assert km.context.closed is False def _env_test_body(self, kc): def execute(cmd): request_id = kc.execute(cmd) while True: reply = kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content reply = execute("env") assert reply is not None assert reply["user_expressions"]["env"] == "test_var_1:test_var_2" def test_templated_kspec_env(self, install_kernel, start_kernel): km, kc = start_kernel assert km.is_alive() assert kc.is_alive() assert km.context.closed is False self._env_test_body(kc) def test_cleanup_context(self, km): assert km.context is not None km.cleanup_resources(restart=False) assert km.context.closed def test_no_cleanup_shared_context(self, zmq_context): """kernel manager does not terminate shared context""" km = KernelManager(context=zmq_context) assert km.context == zmq_context assert km.context is not None km.cleanup_resources(restart=False) assert km.context.closed is False assert zmq_context.closed is False def test_subclass_callables(self, km_subclass): km_subclass.reset_counts() km_subclass.start_kernel(stdout=PIPE, stderr=PIPE) assert km_subclass.call_count("start_kernel") == 1 assert km_subclass.call_count("_launch_kernel") == 1 is_alive = km_subclass.is_alive() assert is_alive km_subclass.reset_counts() km_subclass.restart_kernel(now=True) assert km_subclass.call_count("restart_kernel") == 1 assert km_subclass.call_count("shutdown_kernel") == 1 assert km_subclass.call_count("interrupt_kernel") == 1 assert km_subclass.call_count("_kill_kernel") == 1 assert km_subclass.call_count("cleanup_resources") == 1 assert km_subclass.call_count("start_kernel") == 1 assert km_subclass.call_count("_launch_kernel") == 1 assert km_subclass.call_count("signal_kernel") == 1 is_alive = km_subclass.is_alive() assert is_alive assert km_subclass.call_count("is_alive") >= 1 km_subclass.reset_counts() km_subclass.interrupt_kernel() assert km_subclass.call_count("interrupt_kernel") == 1 assert km_subclass.call_count("signal_kernel") == 1 assert isinstance(km_subclass, KernelManager) km_subclass.reset_counts() km_subclass.shutdown_kernel(now=False) assert km_subclass.call_count("shutdown_kernel") == 1 assert km_subclass.call_count("interrupt_kernel") == 1 assert km_subclass.call_count("request_shutdown") == 1 assert km_subclass.call_count("finish_shutdown") == 1 assert km_subclass.call_count("cleanup_resources") == 1 assert km_subclass.call_count("signal_kernel") == 1 assert km_subclass.call_count("is_alive") >= 1 is_alive = km_subclass.is_alive() assert is_alive is False assert km_subclass.call_count("is_alive") >= 1 assert km_subclass.context.closed class TestParallel: @pytest.mark.timeout(TIMEOUT) def test_start_sequence_kernels(self, config, install_kernel): """Ensure that a sequence of kernel startups doesn't break anything.""" self._run_signaltest_lifecycle(config) self._run_signaltest_lifecycle(config) self._run_signaltest_lifecycle(config) @pytest.mark.timeout(TIMEOUT + 10) def test_start_parallel_thread_kernels(self, config, install_kernel): if config.KernelManager.transport == "ipc": # FIXME pytest.skip("IPC transport is currently not working for this test!") self._run_signaltest_lifecycle(config) with concurrent.futures.ThreadPoolExecutor(max_workers=2) as thread_executor: future1 = thread_executor.submit(self._run_signaltest_lifecycle, config) future2 = thread_executor.submit(self._run_signaltest_lifecycle, config) future1.result() future2.result() @pytest.mark.timeout(TIMEOUT) @pytest.mark.skipif( (sys.platform == "darwin") and (sys.version_info >= (3, 6)) and (sys.version_info < (3, 8)), reason='"Bad file descriptor" error', ) def test_start_parallel_process_kernels(self, config, install_kernel): if config.KernelManager.transport == "ipc": # FIXME pytest.skip("IPC transport is currently not working for this test!") self._run_signaltest_lifecycle(config) with concurrent.futures.ThreadPoolExecutor(max_workers=1) as thread_executor: future1 = thread_executor.submit(self._run_signaltest_lifecycle, config) with concurrent.futures.ProcessPoolExecutor(max_workers=1) as process_executor: future2 = process_executor.submit(self._run_signaltest_lifecycle, config) future2.result() future1.result() @pytest.mark.timeout(TIMEOUT) @pytest.mark.skipif( (sys.platform == "darwin") and (sys.version_info >= (3, 6)) and (sys.version_info < (3, 8)), reason='"Bad file descriptor" error', ) def test_start_sequence_process_kernels(self, config, install_kernel): if config.KernelManager.transport == "ipc": # FIXME pytest.skip("IPC transport is currently not working for this test!") self._run_signaltest_lifecycle(config) with concurrent.futures.ProcessPoolExecutor(max_workers=1) as pool_executor: future = pool_executor.submit(self._run_signaltest_lifecycle, config) future.result() def _prepare_kernel(self, km, startup_timeout=TIMEOUT, **kwargs): km.start_kernel(**kwargs) kc = km.client() kc.start_channels() try: kc.wait_for_ready(timeout=startup_timeout) except RuntimeError: kc.stop_channels() km.shutdown_kernel() raise return kc def _run_signaltest_lifecycle(self, config=None): km = KernelManager(config=config, kernel_name="signaltest") kc = self._prepare_kernel(km, stdout=PIPE, stderr=PIPE) def execute(cmd): request_id = kc.execute(cmd) while True: reply = kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content execute("start") assert km.is_alive() execute("check") assert km.is_alive() km.restart_kernel(now=True) assert km.is_alive() execute("check") km.shutdown_kernel() assert km.context.closed kc.stop_channels() @pytest.mark.asyncio class TestAsyncKernelManager: async def test_lifecycle(self, async_km): await async_km.start_kernel(stdout=PIPE, stderr=PIPE) is_alive = await async_km.is_alive() assert is_alive is_ready = async_km.ready.done() assert is_ready await async_km.restart_kernel(now=True) is_alive = await async_km.is_alive() assert is_alive await async_km.interrupt_kernel() assert isinstance(async_km, AsyncKernelManager) await async_km.shutdown_kernel(now=True) is_alive = await async_km.is_alive() assert is_alive is False assert async_km.context.closed async def test_get_connect_info(self, async_km): cinfo = async_km.get_connection_info() keys = sorted(cinfo.keys()) expected = sorted( [ "ip", "transport", "hb_port", "shell_port", "stdin_port", "iopub_port", "control_port", "key", "signature_scheme", ] ) assert keys == expected @pytest.mark.timeout(10) @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") async def test_signal_kernel_subprocesses(self, install_kernel, start_async_kernel): km, kc = start_async_kernel async def execute(cmd): request_id = kc.execute(cmd) while True: reply = await kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content # Ensure that shutdown_kernel and stop_channels are called at the end of the test. # Note: we cannot use addCleanup(<func>) for these since it doesn't prpperly handle # coroutines - which km.shutdown_kernel now is. N = 5 for i in range(N): await execute("start") await asyncio.sleep(1) # make sure subprocs stay up reply = await execute("check") assert reply["user_expressions"]["poll"] == [None] * N # start a job on the kernel to be interrupted request_id = kc.execute("sleep") await asyncio.sleep(1) # ensure sleep message has been handled before we interrupt await km.interrupt_kernel() while True: reply = await kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" assert content["user_expressions"]["interrupted"] is True # wait up to 5s for subprocesses to handle signal for i in range(50): reply = await execute("check") if reply["user_expressions"]["poll"] != [-signal.SIGINT] * N: await asyncio.sleep(0.1) else: break # verify that subprocesses were interrupted assert reply["user_expressions"]["poll"] == [-signal.SIGINT] * N @pytest.mark.timeout(10) async def test_start_new_async_kernel(self, install_kernel, start_async_kernel): km, kc = start_async_kernel is_alive = await km.is_alive() assert is_alive is_alive = await kc.is_alive() assert is_alive async def test_subclass_callables(self, async_km_subclass): async_km_subclass.reset_counts() await async_km_subclass.start_kernel(stdout=PIPE, stderr=PIPE) assert async_km_subclass.call_count("start_kernel") == 1 assert async_km_subclass.call_count("_launch_kernel") == 1 is_alive = await async_km_subclass.is_alive() assert is_alive assert async_km_subclass.call_count("is_alive") >= 1 async_km_subclass.reset_counts() await async_km_subclass.restart_kernel(now=True) assert async_km_subclass.call_count("restart_kernel") == 1 assert async_km_subclass.call_count("shutdown_kernel") == 1 assert async_km_subclass.call_count("interrupt_kernel") == 1 assert async_km_subclass.call_count("_kill_kernel") == 1 assert async_km_subclass.call_count("cleanup_resources") == 1 assert async_km_subclass.call_count("start_kernel") == 1 assert async_km_subclass.call_count("_launch_kernel") == 1 assert async_km_subclass.call_count("signal_kernel") == 1 is_alive = await async_km_subclass.is_alive() assert is_alive assert async_km_subclass.call_count("is_alive") >= 1 async_km_subclass.reset_counts() await async_km_subclass.interrupt_kernel() assert async_km_subclass.call_count("interrupt_kernel") == 1 assert async_km_subclass.call_count("signal_kernel") == 1 assert isinstance(async_km_subclass, AsyncKernelManager) async_km_subclass.reset_counts() await async_km_subclass.shutdown_kernel(now=False) assert async_km_subclass.call_count("shutdown_kernel") == 1 assert async_km_subclass.call_count("interrupt_kernel") == 1 assert async_km_subclass.call_count("request_shutdown") == 1 assert async_km_subclass.call_count("finish_shutdown") == 1 assert async_km_subclass.call_count("cleanup_resources") == 1 assert async_km_subclass.call_count("signal_kernel") == 1 assert async_km_subclass.call_count("is_alive") >= 1 is_alive = await async_km_subclass.is_alive() assert is_alive is False assert async_km_subclass.call_count("is_alive") >= 1 assert async_km_subclass.context.closed
35.190068
100
0.634373
import asyncio import concurrent.futures import json import os import signal import sys import time from subprocess import PIPE import pytest from jupyter_core import paths from traitlets.config.loader import Config from ..manager import _ShutdownStatus from ..manager import start_new_async_kernel from ..manager import start_new_kernel from .utils import AsyncKMSubclass from .utils import SyncKMSubclass from jupyter_client import AsyncKernelManager from jupyter_client import KernelManager pjoin = os.path.join TIMEOUT = 30 @pytest.fixture(params=["tcp", "ipc"]) def transport(request): if sys.platform == "win32" and request.param == "ipc": pytest.skip("Transport 'ipc' not supported on Windows.") return request.param @pytest.fixture def config(transport): c = Config() c.KernelManager.transport = transport if transport == "ipc": c.KernelManager.ip = "test" return c def _install_kernel(name="signaltest", extra_env=None): if extra_env is None: extra_env = {} kernel_dir = pjoin(paths.jupyter_data_dir(), "kernels", name) os.makedirs(kernel_dir) with open(pjoin(kernel_dir, "kernel.json"), "w") as f: f.write( json.dumps( { "argv": [ sys.executable, "-m", "jupyter_client.tests.signalkernel", "-f", "{connection_file}", ], "display_name": "Signal Test Kernel", "env": {"TEST_VARS": "${TEST_VARS}:test_var_2", **extra_env}, } ) ) @pytest.fixture def install_kernel(): return _install_kernel() def install_kernel_dont_shutdown(): _install_kernel("signaltest-no-shutdown", {"NO_SHUTDOWN_REPLY": "1"}) def install_kernel_dont_terminate(): return _install_kernel( "signaltest-no-terminate", {"NO_SHUTDOWN_REPLY": "1", "NO_SIGTERM_REPLY": "1"} ) @pytest.fixture def start_kernel(): km, kc = start_new_kernel(kernel_name="signaltest") yield km, kc kc.stop_channels() km.shutdown_kernel() assert km.context.closed @pytest.fixture def km(config): km = KernelManager(config=config) return km @pytest.fixture def km_subclass(config): km = SyncKMSubclass(config=config) return km @pytest.fixture def zmq_context(): import zmq ctx = zmq.Context() yield ctx ctx.term() @pytest.fixture(params=[AsyncKernelManager, AsyncKMSubclass]) def async_km(request, config): km = request.param(config=config) return km @pytest.fixture def async_km_subclass(config): km = AsyncKMSubclass(config=config) return km @pytest.fixture async def start_async_kernel(): km, kc = await start_new_async_kernel(kernel_name="signaltest") yield km, kc kc.stop_channels() await km.shutdown_kernel() assert km.context.closed class TestKernelManagerShutDownGracefully: parameters = ( "name, install, expected", [ ("signaltest", _install_kernel, _ShutdownStatus.ShutdownRequest), ( "signaltest-no-shutdown", install_kernel_dont_shutdown, _ShutdownStatus.SigtermRequest, ), ( "signaltest-no-terminate", install_kernel_dont_terminate, _ShutdownStatus.SigkillRequest, ), ], ) @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") @pytest.mark.parametrize(*parameters) def test_signal_kernel_subprocesses(self, name, install, expected): # ipykernel doesn't support 3.6 and this test uses async shutdown_request if expected == _ShutdownStatus.ShutdownRequest and sys.version_info < (3, 7): pytest.skip() install() km, kc = start_new_kernel(kernel_name=name) assert km._shutdown_status == _ShutdownStatus.Unset assert km.is_alive() kc.stop_channels() km.shutdown_kernel() if expected == _ShutdownStatus.ShutdownRequest: expected = [expected, _ShutdownStatus.SigtermRequest] else: expected = [expected] assert km._shutdown_status in expected @pytest.mark.asyncio @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") @pytest.mark.parametrize(*parameters) async def test_async_signal_kernel_subprocesses(self, name, install, expected): install() km, kc = await start_new_async_kernel(kernel_name=name) assert km._shutdown_status == _ShutdownStatus.Unset assert await km.is_alive() # kc.execute("1") kc.stop_channels() await km.shutdown_kernel() if expected == _ShutdownStatus.ShutdownRequest: expected = [expected, _ShutdownStatus.SigtermRequest] else: expected = [expected] assert km._shutdown_status in expected class TestKernelManager: def test_lifecycle(self, km): km.start_kernel(stdout=PIPE, stderr=PIPE) assert km.is_alive() is_done = km.ready.done() assert is_done km.restart_kernel(now=True) assert km.is_alive() km.interrupt_kernel() assert isinstance(km, KernelManager) km.shutdown_kernel(now=True) assert km.context.closed def test_get_connect_info(self, km): cinfo = km.get_connection_info() keys = sorted(cinfo.keys()) expected = sorted( [ "ip", "transport", "hb_port", "shell_port", "stdin_port", "iopub_port", "control_port", "key", "signature_scheme", ] ) assert keys == expected @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") def test_signal_kernel_subprocesses(self, install_kernel, start_kernel): km, kc = start_kernel def execute(cmd): request_id = kc.execute(cmd) while True: reply = kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content N = 5 for i in range(N): execute("start") time.sleep(1) reply = execute("check") assert reply["user_expressions"]["poll"] == [None] * N kc.execute("sleep") time.sleep(1) km.interrupt_kernel() reply = kc.get_shell_msg(TIMEOUT) content = reply["content"] assert content["status"] == "ok" assert content["user_expressions"]["interrupted"] for i in range(100): reply = execute("check") if reply["user_expressions"]["poll"] != [-signal.SIGINT] * N: time.sleep(0.1) else: break assert reply["user_expressions"]["poll"] == [-signal.SIGINT] * N def test_start_new_kernel(self, install_kernel, start_kernel): km, kc = start_kernel assert km.is_alive() assert kc.is_alive() assert km.context.closed is False def _env_test_body(self, kc): def execute(cmd): request_id = kc.execute(cmd) while True: reply = kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content reply = execute("env") assert reply is not None assert reply["user_expressions"]["env"] == "test_var_1:test_var_2" def test_templated_kspec_env(self, install_kernel, start_kernel): km, kc = start_kernel assert km.is_alive() assert kc.is_alive() assert km.context.closed is False self._env_test_body(kc) def test_cleanup_context(self, km): assert km.context is not None km.cleanup_resources(restart=False) assert km.context.closed def test_no_cleanup_shared_context(self, zmq_context): km = KernelManager(context=zmq_context) assert km.context == zmq_context assert km.context is not None km.cleanup_resources(restart=False) assert km.context.closed is False assert zmq_context.closed is False def test_subclass_callables(self, km_subclass): km_subclass.reset_counts() km_subclass.start_kernel(stdout=PIPE, stderr=PIPE) assert km_subclass.call_count("start_kernel") == 1 assert km_subclass.call_count("_launch_kernel") == 1 is_alive = km_subclass.is_alive() assert is_alive km_subclass.reset_counts() km_subclass.restart_kernel(now=True) assert km_subclass.call_count("restart_kernel") == 1 assert km_subclass.call_count("shutdown_kernel") == 1 assert km_subclass.call_count("interrupt_kernel") == 1 assert km_subclass.call_count("_kill_kernel") == 1 assert km_subclass.call_count("cleanup_resources") == 1 assert km_subclass.call_count("start_kernel") == 1 assert km_subclass.call_count("_launch_kernel") == 1 assert km_subclass.call_count("signal_kernel") == 1 is_alive = km_subclass.is_alive() assert is_alive assert km_subclass.call_count("is_alive") >= 1 km_subclass.reset_counts() km_subclass.interrupt_kernel() assert km_subclass.call_count("interrupt_kernel") == 1 assert km_subclass.call_count("signal_kernel") == 1 assert isinstance(km_subclass, KernelManager) km_subclass.reset_counts() km_subclass.shutdown_kernel(now=False) assert km_subclass.call_count("shutdown_kernel") == 1 assert km_subclass.call_count("interrupt_kernel") == 1 assert km_subclass.call_count("request_shutdown") == 1 assert km_subclass.call_count("finish_shutdown") == 1 assert km_subclass.call_count("cleanup_resources") == 1 assert km_subclass.call_count("signal_kernel") == 1 assert km_subclass.call_count("is_alive") >= 1 is_alive = km_subclass.is_alive() assert is_alive is False assert km_subclass.call_count("is_alive") >= 1 assert km_subclass.context.closed class TestParallel: @pytest.mark.timeout(TIMEOUT) def test_start_sequence_kernels(self, config, install_kernel): self._run_signaltest_lifecycle(config) self._run_signaltest_lifecycle(config) self._run_signaltest_lifecycle(config) @pytest.mark.timeout(TIMEOUT + 10) def test_start_parallel_thread_kernels(self, config, install_kernel): if config.KernelManager.transport == "ipc": pytest.skip("IPC transport is currently not working for this test!") self._run_signaltest_lifecycle(config) with concurrent.futures.ThreadPoolExecutor(max_workers=2) as thread_executor: future1 = thread_executor.submit(self._run_signaltest_lifecycle, config) future2 = thread_executor.submit(self._run_signaltest_lifecycle, config) future1.result() future2.result() @pytest.mark.timeout(TIMEOUT) @pytest.mark.skipif( (sys.platform == "darwin") and (sys.version_info >= (3, 6)) and (sys.version_info < (3, 8)), reason='"Bad file descriptor" error', ) def test_start_parallel_process_kernels(self, config, install_kernel): if config.KernelManager.transport == "ipc": pytest.skip("IPC transport is currently not working for this test!") self._run_signaltest_lifecycle(config) with concurrent.futures.ThreadPoolExecutor(max_workers=1) as thread_executor: future1 = thread_executor.submit(self._run_signaltest_lifecycle, config) with concurrent.futures.ProcessPoolExecutor(max_workers=1) as process_executor: future2 = process_executor.submit(self._run_signaltest_lifecycle, config) future2.result() future1.result() @pytest.mark.timeout(TIMEOUT) @pytest.mark.skipif( (sys.platform == "darwin") and (sys.version_info >= (3, 6)) and (sys.version_info < (3, 8)), reason='"Bad file descriptor" error', ) def test_start_sequence_process_kernels(self, config, install_kernel): if config.KernelManager.transport == "ipc": pytest.skip("IPC transport is currently not working for this test!") self._run_signaltest_lifecycle(config) with concurrent.futures.ProcessPoolExecutor(max_workers=1) as pool_executor: future = pool_executor.submit(self._run_signaltest_lifecycle, config) future.result() def _prepare_kernel(self, km, startup_timeout=TIMEOUT, **kwargs): km.start_kernel(**kwargs) kc = km.client() kc.start_channels() try: kc.wait_for_ready(timeout=startup_timeout) except RuntimeError: kc.stop_channels() km.shutdown_kernel() raise return kc def _run_signaltest_lifecycle(self, config=None): km = KernelManager(config=config, kernel_name="signaltest") kc = self._prepare_kernel(km, stdout=PIPE, stderr=PIPE) def execute(cmd): request_id = kc.execute(cmd) while True: reply = kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content execute("start") assert km.is_alive() execute("check") assert km.is_alive() km.restart_kernel(now=True) assert km.is_alive() execute("check") km.shutdown_kernel() assert km.context.closed kc.stop_channels() @pytest.mark.asyncio class TestAsyncKernelManager: async def test_lifecycle(self, async_km): await async_km.start_kernel(stdout=PIPE, stderr=PIPE) is_alive = await async_km.is_alive() assert is_alive is_ready = async_km.ready.done() assert is_ready await async_km.restart_kernel(now=True) is_alive = await async_km.is_alive() assert is_alive await async_km.interrupt_kernel() assert isinstance(async_km, AsyncKernelManager) await async_km.shutdown_kernel(now=True) is_alive = await async_km.is_alive() assert is_alive is False assert async_km.context.closed async def test_get_connect_info(self, async_km): cinfo = async_km.get_connection_info() keys = sorted(cinfo.keys()) expected = sorted( [ "ip", "transport", "hb_port", "shell_port", "stdin_port", "iopub_port", "control_port", "key", "signature_scheme", ] ) assert keys == expected @pytest.mark.timeout(10) @pytest.mark.skipif(sys.platform == "win32", reason="Windows doesn't support signals") async def test_signal_kernel_subprocesses(self, install_kernel, start_async_kernel): km, kc = start_async_kernel async def execute(cmd): request_id = kc.execute(cmd) while True: reply = await kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" return content # Ensure that shutdown_kernel and stop_channels are called at the end of the test. # Note: we cannot use addCleanup(<func>) for these since it doesn't prpperly handle N = 5 for i in range(N): await execute("start") await asyncio.sleep(1) reply = await execute("check") assert reply["user_expressions"]["poll"] == [None] * N request_id = kc.execute("sleep") await asyncio.sleep(1) await km.interrupt_kernel() while True: reply = await kc.get_shell_msg(TIMEOUT) if reply["parent_header"]["msg_id"] == request_id: break content = reply["content"] assert content["status"] == "ok" assert content["user_expressions"]["interrupted"] is True for i in range(50): reply = await execute("check") if reply["user_expressions"]["poll"] != [-signal.SIGINT] * N: await asyncio.sleep(0.1) else: break assert reply["user_expressions"]["poll"] == [-signal.SIGINT] * N @pytest.mark.timeout(10) async def test_start_new_async_kernel(self, install_kernel, start_async_kernel): km, kc = start_async_kernel is_alive = await km.is_alive() assert is_alive is_alive = await kc.is_alive() assert is_alive async def test_subclass_callables(self, async_km_subclass): async_km_subclass.reset_counts() await async_km_subclass.start_kernel(stdout=PIPE, stderr=PIPE) assert async_km_subclass.call_count("start_kernel") == 1 assert async_km_subclass.call_count("_launch_kernel") == 1 is_alive = await async_km_subclass.is_alive() assert is_alive assert async_km_subclass.call_count("is_alive") >= 1 async_km_subclass.reset_counts() await async_km_subclass.restart_kernel(now=True) assert async_km_subclass.call_count("restart_kernel") == 1 assert async_km_subclass.call_count("shutdown_kernel") == 1 assert async_km_subclass.call_count("interrupt_kernel") == 1 assert async_km_subclass.call_count("_kill_kernel") == 1 assert async_km_subclass.call_count("cleanup_resources") == 1 assert async_km_subclass.call_count("start_kernel") == 1 assert async_km_subclass.call_count("_launch_kernel") == 1 assert async_km_subclass.call_count("signal_kernel") == 1 is_alive = await async_km_subclass.is_alive() assert is_alive assert async_km_subclass.call_count("is_alive") >= 1 async_km_subclass.reset_counts() await async_km_subclass.interrupt_kernel() assert async_km_subclass.call_count("interrupt_kernel") == 1 assert async_km_subclass.call_count("signal_kernel") == 1 assert isinstance(async_km_subclass, AsyncKernelManager) async_km_subclass.reset_counts() await async_km_subclass.shutdown_kernel(now=False) assert async_km_subclass.call_count("shutdown_kernel") == 1 assert async_km_subclass.call_count("interrupt_kernel") == 1 assert async_km_subclass.call_count("request_shutdown") == 1 assert async_km_subclass.call_count("finish_shutdown") == 1 assert async_km_subclass.call_count("cleanup_resources") == 1 assert async_km_subclass.call_count("signal_kernel") == 1 assert async_km_subclass.call_count("is_alive") >= 1 is_alive = await async_km_subclass.is_alive() assert is_alive is False assert async_km_subclass.call_count("is_alive") >= 1 assert async_km_subclass.context.closed
true
true
f71d74fb9dde8bde86b6b8d92cb15d0c1a7d332a
3,476
py
Python
image_subsets/image_subsets.py
Comp4710AprioriTextIllustrator/TextIllustrator
fd46b2f80530f622e7ae4302693fbfaad45a8de8
[ "MIT" ]
1
2015-11-04T15:21:11.000Z
2015-11-04T15:21:11.000Z
image_subsets/image_subsets.py
Comp4710AprioriTextIllustrator/TextIllustrator
fd46b2f80530f622e7ae4302693fbfaad45a8de8
[ "MIT" ]
null
null
null
image_subsets/image_subsets.py
Comp4710AprioriTextIllustrator/TextIllustrator
fd46b2f80530f622e7ae4302693fbfaad45a8de8
[ "MIT" ]
null
null
null
#!/bin/python # -*- coding: utf-8 -*- import comparators.pixel_comparator import comparators.chained_image_comparator import comparators.avg_pixel_comparator import image_iterator import sys # Not really sets, since they may contain "duplicate" images(ie ones that when compared return True) ''' Input: image_sets: A list of sets where each set contains a list of file paths for the images to be compared comparator: A comparator that will be used to compare the images Output: The common subset of all the image_sets ''' def get_common_subset_of_image_sets(image_sets, comparator): if len(image_subsets) == 0: return None current_image_subset = image_sets[0] for image_set in image_sets[1:]: # Refine the subset current_image_subset = intersection_of_sets(current_image_subset, image_set, comparator) return current_image_set ''' Performs a block based intersection of the two image sets image_set1 and image_set2 using the comparator specified by the comparator parameter ''' def intersection_of_sets(image_set1, image_set2, comparator): subset = [] # Done this way so we don't keep more that 2*image_iterator.max_images_per_block for images in image_iterator.load_images(image_set1): for other_images in image_iterator.load_images(image_set2): # Load 2 blocks of images into memory, run a comparison of every image in the first block against all images in the second block. for image in images: for other_image in other_images: if comparator.compare(image[1], other_image[1]): subset.append(image[0]) break return subset def parse_subsets(subset_file): subsets = [] curr_subset = [] curr_line = subset_file.readline() while curr_line != '': if curr_line.strip() == '' and len(curr_subset) > 0: subsets.append(curr_subset) curr_subset = [] elif curr_line.strip() != '': curr_subset.append(curr_line.strip()) curr_line = subset_file.readline() if len(curr_subset) > 0: subsets.append(curr_subset) return subsets def usage(): print "python image_subsets.py <image_sets_file>" ''' Will parse a file were grouped lines of file paths are considered sets of images. Then find the common subset of these sets. Example: test_file.txt ------------- C:\some_file.bmp C:\some_other_file.bmp C:\another_file.jpg C:\final_file.gif ---------------- This will produce 3 sets 1: ['C:\some_file.bmp', 'C:\some_other_file.bmp'] 2: ['C:\another_file.jpg'] 3: ['C:\final_file.gif'] ''' if __name__=="__main__": if len(sys.argv) == 2: image_iterator.max_images_per_block = 1 try: image_subsets = None with open(sys.argv[1], 'r') as subset_file: image_subsets = parse_subsets(subset_file) print image_subsets if image_subsets: chained_comparators = [comparators.pixel_comparator.PixelComparator(), comparators.avg_pixel_comparator.AvgPixelComparator()] comparator = comparators.chained_image_comparator.ChainedImageComparator(image_comparators=chained_comparators) print get_common_subset_of_image_sets(image_subsets, comparator) except Exception as e: print e usage() else: usage()
33.423077
142
0.671174
import comparators.pixel_comparator import comparators.chained_image_comparator import comparators.avg_pixel_comparator import image_iterator import sys ''' Input: image_sets: A list of sets where each set contains a list of file paths for the images to be compared comparator: A comparator that will be used to compare the images Output: The common subset of all the image_sets ''' def get_common_subset_of_image_sets(image_sets, comparator): if len(image_subsets) == 0: return None current_image_subset = image_sets[0] for image_set in image_sets[1:]: current_image_subset = intersection_of_sets(current_image_subset, image_set, comparator) return current_image_set ''' Performs a block based intersection of the two image sets image_set1 and image_set2 using the comparator specified by the comparator parameter ''' def intersection_of_sets(image_set1, image_set2, comparator): subset = [] for images in image_iterator.load_images(image_set1): for other_images in image_iterator.load_images(image_set2): # Load 2 blocks of images into memory, run a comparison of every image in the first block against all images in the second block. for image in images: for other_image in other_images: if comparator.compare(image[1], other_image[1]): subset.append(image[0]) break return subset def parse_subsets(subset_file): subsets = [] curr_subset = [] curr_line = subset_file.readline() while curr_line != '': if curr_line.strip() == '' and len(curr_subset) > 0: subsets.append(curr_subset) curr_subset = [] elif curr_line.strip() != '': curr_subset.append(curr_line.strip()) curr_line = subset_file.readline() if len(curr_subset) > 0: subsets.append(curr_subset) return subsets def usage(): print "python image_subsets.py <image_sets_file>" ''' Will parse a file were grouped lines of file paths are considered sets of images. Then find the common subset of these sets. Example: test_file.txt ------------- C:\some_file.bmp C:\some_other_file.bmp C:\another_file.jpg C:\final_file.gif ---------------- This will produce 3 sets 1: ['C:\some_file.bmp', 'C:\some_other_file.bmp'] 2: ['C:\another_file.jpg'] 3: ['C:\final_file.gif'] ''' if __name__=="__main__": if len(sys.argv) == 2: image_iterator.max_images_per_block = 1 try: image_subsets = None with open(sys.argv[1], 'r') as subset_file: image_subsets = parse_subsets(subset_file) print image_subsets if image_subsets: chained_comparators = [comparators.pixel_comparator.PixelComparator(), comparators.avg_pixel_comparator.AvgPixelComparator()] comparator = comparators.chained_image_comparator.ChainedImageComparator(image_comparators=chained_comparators) print get_common_subset_of_image_sets(image_subsets, comparator) except Exception as e: print e usage() else: usage()
false
true
f71d75126854c13366d9024369f6b81a57870f3f
4,707
py
Python
modnotes/modnotes.py
chasehult/misc-cogs
171bfacccb534d5e73bf53ce71e0a312c35e0ec7
[ "MIT" ]
null
null
null
modnotes/modnotes.py
chasehult/misc-cogs
171bfacccb534d5e73bf53ce71e0a312c35e0ec7
[ "MIT" ]
null
null
null
modnotes/modnotes.py
chasehult/misc-cogs
171bfacccb534d5e73bf53ce71e0a312c35e0ec7
[ "MIT" ]
null
null
null
""" Utilities for managing moderator notes about users. """ import re import discord from redbot.core import checks from redbot.core import commands from redbot.core.bot import Red from redbot.core.utils.chat_formatting import inline, box, pagify from tsutils import CogSettings class ModNotes(commands.Cog): def __init__(self, bot: Red, *args, **kwargs): super().__init__(*args, **kwargs) self.bot = bot self.settings = ModNotesSettings("modnotes") @commands.group(aliases=["usernote"]) @commands.guild_only() @checks.mod_or_permissions(manage_guild=True) async def usernotes(self, ctx): """Moderator notes for users. This module allows you to create notes to share between moderators. """ async def red_get_data_for_user(self, *, user_id): """Get a user's personal data.""" data = "No data is stored for user with ID {}.\n".format(user_id) return {"user_data.txt": BytesIO(data.encode())} async def red_delete_data_for_user(self, *, requester, user_id): """Delete a user's personal data. No personal data is stored in this cog. """ return @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def get(self, ctx, user: discord.User): """Sends the notes for a user.""" notes = self.settings.getNotesForUser(ctx.guild.id, user.id) if not notes: await ctx.send(box('No notes for {}'.format(user.name))) return for idx, note in enumerate(notes): await ctx.send(inline('Note {} of {}:'.format(idx + 1, len(notes)))) await ctx.send(box(note)) @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def add(self, ctx, user: discord.User, *, note_text: str): """Add a note to a user.""" timestamp = str(ctx.message.created_at)[:-7] msg = 'Added by {} ({}): {}'.format(ctx.author.name, timestamp, note_text) server_id = ctx.guild.id notes = self.settings.addNoteForUser(server_id, user.id, msg) await ctx.send(inline('Done. User {} now has {} notes'.format(user.name, len(notes)))) @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def delete(self, ctx, user: discord.User, note_num: int): """Delete a specific note for a user.""" notes = self.settings.getNotesForUser(ctx.guild.id, user.id) if len(notes) < note_num: await ctx.send(box('Note not found for {}'.format(user.name))) return note = notes[note_num - 1] notes.remove(note) self.settings.setNotesForUser(ctx.guild.id, user.id, notes) await ctx.send(inline('Removed note {}. User has {} remaining.'.format(note_num, len(notes)))) await ctx.send(box(note)) @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def list(self, ctx): """Lists all users and note counts for the server.""" user_notes = self.settings.getUserNotes(ctx.guild.id) msg = 'Notes for {} users'.format(len(user_notes)) for user_id, notes in user_notes.items(): user = ctx.guild.get_member(user_id) user_text = '{} ({})'.format(user.name, user.id) if user else user_id msg += '\n\t{} : {}'.format(len(notes), user_text) for page in pagify(msg): await ctx.send(box(page)) class ModNotesSettings(CogSettings): def make_default_settings(self): config = { 'servers': {} } return config def servers(self): return self.bot_settings['servers'] def getServer(self, server_id): servers = self.servers() if server_id not in servers: servers[server_id] = {} return servers[server_id] def getUserNotes(self, server_id): server = self.getServer(server_id) key = 'user_notes' if key not in server: server[key] = {} return server[key] def getNotesForUser(self, server_id, user_id): user_notes = self.getUserNotes(server_id) return user_notes.get(user_id, []) def setNotesForUser(self, server_id, user_id, notes): user_notes = self.getUserNotes(server_id) if notes: user_notes[user_id] = notes else: user_notes.pop(user_id, None) self.save_settings() return notes def addNoteForUser(self, server_id, user_id, note: str): notes = self.getNotesForUser(server_id, user_id) notes.append(note) self.setNotesForUser(server_id, user_id, notes) return notes
34.357664
102
0.626089
import re import discord from redbot.core import checks from redbot.core import commands from redbot.core.bot import Red from redbot.core.utils.chat_formatting import inline, box, pagify from tsutils import CogSettings class ModNotes(commands.Cog): def __init__(self, bot: Red, *args, **kwargs): super().__init__(*args, **kwargs) self.bot = bot self.settings = ModNotesSettings("modnotes") @commands.group(aliases=["usernote"]) @commands.guild_only() @checks.mod_or_permissions(manage_guild=True) async def usernotes(self, ctx): async def red_get_data_for_user(self, *, user_id): data = "No data is stored for user with ID {}.\n".format(user_id) return {"user_data.txt": BytesIO(data.encode())} async def red_delete_data_for_user(self, *, requester, user_id): return @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def get(self, ctx, user: discord.User): notes = self.settings.getNotesForUser(ctx.guild.id, user.id) if not notes: await ctx.send(box('No notes for {}'.format(user.name))) return for idx, note in enumerate(notes): await ctx.send(inline('Note {} of {}:'.format(idx + 1, len(notes)))) await ctx.send(box(note)) @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def add(self, ctx, user: discord.User, *, note_text: str): timestamp = str(ctx.message.created_at)[:-7] msg = 'Added by {} ({}): {}'.format(ctx.author.name, timestamp, note_text) server_id = ctx.guild.id notes = self.settings.addNoteForUser(server_id, user.id, msg) await ctx.send(inline('Done. User {} now has {} notes'.format(user.name, len(notes)))) @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def delete(self, ctx, user: discord.User, note_num: int): notes = self.settings.getNotesForUser(ctx.guild.id, user.id) if len(notes) < note_num: await ctx.send(box('Note not found for {}'.format(user.name))) return note = notes[note_num - 1] notes.remove(note) self.settings.setNotesForUser(ctx.guild.id, user.id, notes) await ctx.send(inline('Removed note {}. User has {} remaining.'.format(note_num, len(notes)))) await ctx.send(box(note)) @usernotes.command() @checks.mod_or_permissions(manage_guild=True) async def list(self, ctx): user_notes = self.settings.getUserNotes(ctx.guild.id) msg = 'Notes for {} users'.format(len(user_notes)) for user_id, notes in user_notes.items(): user = ctx.guild.get_member(user_id) user_text = '{} ({})'.format(user.name, user.id) if user else user_id msg += '\n\t{} : {}'.format(len(notes), user_text) for page in pagify(msg): await ctx.send(box(page)) class ModNotesSettings(CogSettings): def make_default_settings(self): config = { 'servers': {} } return config def servers(self): return self.bot_settings['servers'] def getServer(self, server_id): servers = self.servers() if server_id not in servers: servers[server_id] = {} return servers[server_id] def getUserNotes(self, server_id): server = self.getServer(server_id) key = 'user_notes' if key not in server: server[key] = {} return server[key] def getNotesForUser(self, server_id, user_id): user_notes = self.getUserNotes(server_id) return user_notes.get(user_id, []) def setNotesForUser(self, server_id, user_id, notes): user_notes = self.getUserNotes(server_id) if notes: user_notes[user_id] = notes else: user_notes.pop(user_id, None) self.save_settings() return notes def addNoteForUser(self, server_id, user_id, note: str): notes = self.getNotesForUser(server_id, user_id) notes.append(note) self.setNotesForUser(server_id, user_id, notes) return notes
true
true
f71d75e458e3cb8f6494897fe66d3dc4ecbfc02d
209
py
Python
algorithms/1047. Remove All Adjacent Duplicates In String.py
woozway/py3-leetcode
e51a9ce7a6bb3e35c0fcb8c8f4f6cd5763708dbf
[ "MIT" ]
1
2020-12-02T13:54:30.000Z
2020-12-02T13:54:30.000Z
algorithms/1047. Remove All Adjacent Duplicates In String.py
woozway/py3-leetcode
e51a9ce7a6bb3e35c0fcb8c8f4f6cd5763708dbf
[ "MIT" ]
null
null
null
algorithms/1047. Remove All Adjacent Duplicates In String.py
woozway/py3-leetcode
e51a9ce7a6bb3e35c0fcb8c8f4f6cd5763708dbf
[ "MIT" ]
null
null
null
class Solution: def removeDuplicates(self, S: str) -> str: stack = [] for c in S: if stack and stack[-1] == c: stack.pop() else: stack.append(c) return ''.join(stack)
20.9
44
0.5311
class Solution: def removeDuplicates(self, S: str) -> str: stack = [] for c in S: if stack and stack[-1] == c: stack.pop() else: stack.append(c) return ''.join(stack)
true
true
f71d7736dd803f04fc96aeb047ba3df44f0a3091
3,802
py
Python
orttraining/orttraining/python/training/_ortmodule_utils.py
alexshuang/onnxruntime
771a6d235b8495d05bcf6a906107df1bd6e81744
[ "MIT" ]
null
null
null
orttraining/orttraining/python/training/_ortmodule_utils.py
alexshuang/onnxruntime
771a6d235b8495d05bcf6a906107df1bd6e81744
[ "MIT" ]
null
null
null
orttraining/orttraining/python/training/_ortmodule_utils.py
alexshuang/onnxruntime
771a6d235b8495d05bcf6a906107df1bd6e81744
[ "MIT" ]
null
null
null
# ------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. # -------------------------------------------------------------------------- from . import _utils from onnxruntime.capi.onnxruntime_inference_collection import OrtValue from onnxruntime.capi import _pybind_state as C import torch from torch.utils.dlpack import from_dlpack, to_dlpack from torch.utils.cpp_extension import load_inline def _ortvalue_to_torch_tensor(ortvalue): # PyTorch's to_dlpack() uses same config for both torch.bool and torch.uint8, # and convert the config to torch.uint8 tensor duing from_dlpack(). # So we need to convert the torch tensor to torch.bool type if OrtValue is bool tensor. torch_tensor = from_dlpack(ortvalue._ortvalue.to_dlpack()) return torch_tensor.to(torch.bool) if ortvalue.data_type() == 'tensor(bool)' else torch_tensor def _ortvalue_from_torch_tensor(torch_tensor): return OrtValue(C.OrtValue.from_dlpack(to_dlpack(torch_tensor), torch_tensor.dtype == torch.bool)) def _load_torch_gpu_allocator_cpp_extension(verbosity, is_rocm_pytorch): gpu_identifier = "hip" if is_rocm_pytorch else "cuda" gpu_allocator_header = "HIPCachingAllocator" if is_rocm_pytorch else "CUDACachingAllocator" torch_gpu_allocator_addresses_cpp_source = f''' #include <torch/extension.h> #include <c10/{gpu_identifier}/{gpu_allocator_header}.h> size_t gpu_caching_allocator_raw_alloc_address() {{ return reinterpret_cast<size_t>(&c10::{gpu_identifier}::{gpu_allocator_header}::raw_alloc); }} size_t gpu_caching_allocator_raw_delete_address() {{ return reinterpret_cast<size_t>(&c10::{gpu_identifier}::{gpu_allocator_header}::raw_delete); }} ''' return load_inline(name='inline_extension', cpp_sources=[torch_gpu_allocator_addresses_cpp_source], extra_cflags=['-D__HIP_PLATFORM_HCC__=1' if is_rocm_pytorch else ''], functions=['gpu_caching_allocator_raw_alloc_address', 'gpu_caching_allocator_raw_delete_address'], verbose=verbosity, with_cuda=True) def _check_same_device(device, argument_str, *args): '''Check that all tensor arguments in *args reside on the same device as the input device''' assert isinstance(device, torch.device), '`device` must be a valid `torch.device` object' for arg in args: if arg is not None and isinstance(arg, torch.Tensor): arg_device = torch.device(arg.device) if arg_device != device: raise RuntimeError( f"{argument_str} found on device {arg_device}, but expected it to be on module device {device}.") def get_device_from_module(module): '''Returns the first device found in the `module`'s parameters or None''' device = None try: device = next(module.parameters()).device for param in module.parameters(): if param.device != device: raise RuntimeError('ORTModule supports a single device per model for now') except StopIteration: # Model doesn't have a device set to any of the model parameters pass return device def _create_iobinding(io_binding, inputs, model, device): '''Creates IO binding for a `model` inputs and output''' for idx, value_info in enumerate(model.graph.input): io_binding.bind_ortvalue_input(value_info.name, _ortvalue_from_torch_tensor(inputs[idx])) for value_info in model.graph.output: io_binding.bind_output(value_info.name, device.type, device_id=_utils.get_device_index(device))
44.209302
117
0.675697
from . import _utils from onnxruntime.capi.onnxruntime_inference_collection import OrtValue from onnxruntime.capi import _pybind_state as C import torch from torch.utils.dlpack import from_dlpack, to_dlpack from torch.utils.cpp_extension import load_inline def _ortvalue_to_torch_tensor(ortvalue): # and convert the config to torch.uint8 tensor duing from_dlpack(). # So we need to convert the torch tensor to torch.bool type if OrtValue is bool tensor. torch_tensor = from_dlpack(ortvalue._ortvalue.to_dlpack()) return torch_tensor.to(torch.bool) if ortvalue.data_type() == 'tensor(bool)' else torch_tensor def _ortvalue_from_torch_tensor(torch_tensor): return OrtValue(C.OrtValue.from_dlpack(to_dlpack(torch_tensor), torch_tensor.dtype == torch.bool)) def _load_torch_gpu_allocator_cpp_extension(verbosity, is_rocm_pytorch): gpu_identifier = "hip" if is_rocm_pytorch else "cuda" gpu_allocator_header = "HIPCachingAllocator" if is_rocm_pytorch else "CUDACachingAllocator" torch_gpu_allocator_addresses_cpp_source = f''' #include <torch/extension.h> #include <c10/{gpu_identifier}/{gpu_allocator_header}.h> size_t gpu_caching_allocator_raw_alloc_address() {{ return reinterpret_cast<size_t>(&c10::{gpu_identifier}::{gpu_allocator_header}::raw_alloc); }} size_t gpu_caching_allocator_raw_delete_address() {{ return reinterpret_cast<size_t>(&c10::{gpu_identifier}::{gpu_allocator_header}::raw_delete); }} ''' return load_inline(name='inline_extension', cpp_sources=[torch_gpu_allocator_addresses_cpp_source], extra_cflags=['-D__HIP_PLATFORM_HCC__=1' if is_rocm_pytorch else ''], functions=['gpu_caching_allocator_raw_alloc_address', 'gpu_caching_allocator_raw_delete_address'], verbose=verbosity, with_cuda=True) def _check_same_device(device, argument_str, *args): assert isinstance(device, torch.device), '`device` must be a valid `torch.device` object' for arg in args: if arg is not None and isinstance(arg, torch.Tensor): arg_device = torch.device(arg.device) if arg_device != device: raise RuntimeError( f"{argument_str} found on device {arg_device}, but expected it to be on module device {device}.") def get_device_from_module(module): device = None try: device = next(module.parameters()).device for param in module.parameters(): if param.device != device: raise RuntimeError('ORTModule supports a single device per model for now') except StopIteration: # Model doesn't have a device set to any of the model parameters pass return device def _create_iobinding(io_binding, inputs, model, device): for idx, value_info in enumerate(model.graph.input): io_binding.bind_ortvalue_input(value_info.name, _ortvalue_from_torch_tensor(inputs[idx])) for value_info in model.graph.output: io_binding.bind_output(value_info.name, device.type, device_id=_utils.get_device_index(device))
true
true
f71d7757a47a3d5539caee900fabbeca9eb0d27c
2,709
py
Python
share/qt/extract_strings_qt.py
CoinStaging/Apollon
0c78aa921244d67517ecb699b48767093e95de69
[ "MIT" ]
17
2020-03-21T21:03:31.000Z
2021-04-07T18:45:38.000Z
share/qt/extract_strings_qt.py
CoinStaging/Apollon
0c78aa921244d67517ecb699b48767093e95de69
[ "MIT" ]
8
2020-04-05T19:14:44.000Z
2020-05-22T04:15:31.000Z
share/qt/extract_strings_qt.py
CoinStaging/Apollon
0c78aa921244d67517ecb699b48767093e95de69
[ "MIT" ]
19
2020-03-04T19:32:03.000Z
2021-11-16T04:27:14.000Z
#!/usr/bin/python # Copyright (c) 2012-2016 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. ''' Extract _("...") strings for translation and convert to Qt stringdefs so that they can be picked up by Qt linguist. ''' from __future__ import division,print_function,unicode_literals from subprocess import Popen, PIPE import glob import operator import os import sys OUT_CPP="qt/bitcoinstrings.cpp" EMPTY=['""'] def parse_po(text): """ Parse 'po' format produced by xgettext. Return a list of (msgid,msgstr) tuples. """ messages = [] msgid = [] msgstr = [] in_msgid = False in_msgstr = False for line in text.split('\n'): line = line.rstrip('\r') if line.startswith('msgid '): if in_msgstr: messages.append((msgid, msgstr)) in_msgstr = False # message start in_msgid = True msgid = [line[6:]] elif line.startswith('msgstr '): in_msgid = False in_msgstr = True msgstr = [line[7:]] elif line.startswith('"'): if in_msgid: msgid.append(line) if in_msgstr: msgstr.append(line) if in_msgstr: messages.append((msgid, msgstr)) return messages files = sys.argv[1:] # xgettext -n --keyword=_ $FILES XGETTEXT=os.getenv('XGETTEXT', 'xgettext') if not XGETTEXT: print('Cannot extract strings: xgettext utility is not installed or not configured.',file=sys.stderr) print('Please install package "gettext" and re-run \'./configure\'.',file=sys.stderr) exit(1) child = Popen([XGETTEXT,'--output=-','-n','--keyword=_'] + files, stdout=PIPE) (out, err) = child.communicate() messages = parse_po(out.decode('utf-8')) f = open(OUT_CPP, 'w') f.write(""" #include <QtGlobal> // Automatically generated by extract_strings_qt.py #ifdef __GNUC__ #define UNUSED __attribute__((unused)) #else #define UNUSED #endif """) f.write('static const char UNUSED *bitcoin_strings[] = {\n') f.write('QT_TRANSLATE_NOOP("index-core", "%s"),\n' % (os.getenv('PACKAGE_NAME'),)) f.write('QT_TRANSLATE_NOOP("index-core", "%s"),\n' % (os.getenv('COPYRIGHT_HOLDERS'),)) if os.getenv('COPYRIGHT_HOLDERS_SUBSTITUTION') != os.getenv('PACKAGE_NAME'): f.write('QT_TRANSLATE_NOOP("index-core", "%s"),\n' % (os.getenv('COPYRIGHT_HOLDERS_SUBSTITUTION'),)) messages.sort(key=operator.itemgetter(0)) for (msgid, msgstr) in messages: if msgid != EMPTY: f.write('QT_TRANSLATE_NOOP("index-core", %s),\n' % ('\n'.join(msgid))) f.write('};\n') f.close()
29.769231
105
0.641565
from __future__ import division,print_function,unicode_literals from subprocess import Popen, PIPE import glob import operator import os import sys OUT_CPP="qt/bitcoinstrings.cpp" EMPTY=['""'] def parse_po(text): messages = [] msgid = [] msgstr = [] in_msgid = False in_msgstr = False for line in text.split('\n'): line = line.rstrip('\r') if line.startswith('msgid '): if in_msgstr: messages.append((msgid, msgstr)) in_msgstr = False in_msgid = True msgid = [line[6:]] elif line.startswith('msgstr '): in_msgid = False in_msgstr = True msgstr = [line[7:]] elif line.startswith('"'): if in_msgid: msgid.append(line) if in_msgstr: msgstr.append(line) if in_msgstr: messages.append((msgid, msgstr)) return messages files = sys.argv[1:] # xgettext -n --keyword=_ $FILES XGETTEXT=os.getenv('XGETTEXT', 'xgettext') if not XGETTEXT: print('Cannot extract strings: xgettext utility is not installed or not configured.',file=sys.stderr) print('Please install package "gettext" and re-run \'./configure\'.',file=sys.stderr) exit(1) child = Popen([XGETTEXT,'--output=-','-n','--keyword=_'] + files, stdout=PIPE) (out, err) = child.communicate() messages = parse_po(out.decode('utf-8')) f = open(OUT_CPP, 'w') f.write(""" #include <QtGlobal> // Automatically generated by extract_strings_qt.py #ifdef __GNUC__ #define UNUSED __attribute__((unused)) #else #define UNUSED #endif """) f.write('static const char UNUSED *bitcoin_strings[] = {\n') f.write('QT_TRANSLATE_NOOP("index-core", "%s"),\n' % (os.getenv('PACKAGE_NAME'),)) f.write('QT_TRANSLATE_NOOP("index-core", "%s"),\n' % (os.getenv('COPYRIGHT_HOLDERS'),)) if os.getenv('COPYRIGHT_HOLDERS_SUBSTITUTION') != os.getenv('PACKAGE_NAME'): f.write('QT_TRANSLATE_NOOP("index-core", "%s"),\n' % (os.getenv('COPYRIGHT_HOLDERS_SUBSTITUTION'),)) messages.sort(key=operator.itemgetter(0)) for (msgid, msgstr) in messages: if msgid != EMPTY: f.write('QT_TRANSLATE_NOOP("index-core", %s),\n' % ('\n'.join(msgid))) f.write('};\n') f.close()
true
true
f71d7805e1d138fa87506d9d152885ae11b2c0b8
8,756
py
Python
cottontail/rabbitmq_management.py
3lpsy/cottontail
fb7f364ea00bf6fe4b575818d562bd1df26407b9
[ "BSD-3-Clause" ]
21
2018-02-02T20:20:08.000Z
2021-04-12T13:12:45.000Z
cottontail/rabbitmq_management.py
3lpsy/cottontail
fb7f364ea00bf6fe4b575818d562bd1df26407b9
[ "BSD-3-Clause" ]
15
2017-08-21T08:41:03.000Z
2020-11-25T22:05:43.000Z
cottontail/rabbitmq_management.py
3lpsy/cottontail
fb7f364ea00bf6fe4b575818d562bd1df26407b9
[ "BSD-3-Clause" ]
6
2019-04-23T06:19:04.000Z
2021-02-14T01:48:37.000Z
#!/usr/bin/env python # -*- coding: utf-8 -*- # # Author: Quentin Kaiser <kaiserquentin@gmail.com> # # let's disable 'too many public methods' # pylint: disable=R0904 """ rabbitmq-management HTTP API client. Example: rbmq = RabbitMQManagementClient('localhost') rbmq.whoami() .. _Google Python Style Guide: http://google.github.io/styleguide/pyguide.html """ try: from urllib.parse import quote except ImportError: from urllib import quote import requests from requests.packages.urllib3.exceptions import InsecureRequestWarning requests.packages.urllib3.disable_warnings(InsecureRequestWarning) class UnauthorizedAccessException(Exception): """Custom exception for HTTP 401""" pass class RabbitMQManagementClient(object): """rabbitmq-management HTTP API client. Attributes: host (str): server host port (int, optional): servver port username (str, optional): account's username password (str, optional): account's password """ def __init__(self, host, port=15672, username="guest", password="guest",\ ssl=False): """Constructor Note: Do not include the `self` parameter in the ``Args`` section. Args: host (str): server host port (int, optional): servver port username (str, optional): account's username password (str, optional): account's password """ self._host = host self._port = port self._username = username self._password = password self._scheme = "https" if ssl else "http" def get_request(self, path): """Wrapper for GET requests to the API. Args: path (str): REST path appended to /api Returns: HTTP response JSON object. Raises: UnauthorizedException """ response = requests.get( "{}://{}:{}/api/{}".format(self._scheme, self._host, self._port, path), auth=(self._username, self._password), verify=False, timeout=5 ) if response.status_code == 200: return response.json() elif response.status_code == 401 or response.status_code == 403: raise UnauthorizedAccessException( "Authorization error: can't access /api/{}".format(path)) elif response.status_code == 404: return None else: raise Exception("An error occured") def post_request(self, path, data): """Wrapper for POST requests to the API Args: path (str): REST path appended to /api data (object): POST body Returns: HTTP response JSON object Raises: UnauthorizedException """ response = requests.post( "{}://{}:{}/api/{}".format(self._scheme, self._host, self._port, path), auth=(self._username, self._password), json=data, verify=False ) if response.status_code == 200: return response.json() elif response.status_code == 401 or response.status_code == 403: raise UnauthorizedAccessException( "Authorization error: can't access /api/{}".format(path)) else: raise Exception("An error occured") def get_amqp_listeners(self): """ Request the API for AMQP listeners. """ overview = self.get_overview() return [l for l in overview["listeners"] if "amqp" in l["protocol"]] def get_overview(self): """ Various random bits of information that describe the whole system. """ return self.get_request("overview") def get_cluster_name(self): """ Name identifying this RabbitMQ cluster. """ return self.get_request("cluster-name") def get_nodes(self): """ A list of nodes in the RabbitMQ cluster. """ return self.get_request("nodes") def get_node(self, name, memory=False, binary=False): """ An individual node in the RabbitMQ cluster. """ return self.get_request("nodes/{}?memory={}&binary={}".format( name, str(memory).lower(), str(binary).lower())) def get_definitions(self, vhost=None): """ The server definitions - exchanges, queues, bindings, users, virtual hosts, permissions and parameters. Everything apart from messages. """ if vhost is not None: return self.get_request("definitions/{}".format( quote(vhost, safe=''))) return self.get_request("definitions") def get_connections(self, vhost=None): """ A list of all open connections. """ if vhost is not None: return self.get_request("vhosts/{}/connections".format( quote(vhost, safe=''))) return self.get_request("connections") def get_connection(self, name): """ An individual connection. """ return self.get_request("connections/{}".format(name)) def get_channels(self, vhost=None): """ A list of all open channels. """ if vhost is not None: return self.get_request("vhosts/{}/channels".format( quote(vhost, safe=''))) return self.get_request("channels") def get_channel(self, name): """ Details about an individual channel. """ return self.get_request("channels/{}".format(name.replace(" ", "%20"))) def get_consumers(self, vhost=None): """ A list of all consumers (in a given vhosts). """ if vhost is not None: return self.get_request("consumers/{}".format( quote(vhost, safe=''))) return self.get_request("consumers") def get_exchanges(self, vhost=None): """ A list of all exchanges (in a given vhost). """ if vhost is not None: return self.get_request("exchanges/{}".format( quote(vhost, safe=''))) return self.get_request("exchanges") def get_exchange(self, vhost, name): """ An individual exchange. """ return self.get_request("exchanges/{}/{}".format( quote(vhost, safe=''), name)) def get_queues(self, vhost=None): """ A list of all queues. """ if vhost is not None: return self.get_request("queues/{}".format(quote(vhost, safe=''))) return self.get_request("queues") def get_queue(self, vhost, name): """ An individual queue. """ return self.get_request("queue/{}/{}".format(vhost, name)) def get_messages(self, vhost, queue, count=10, requeue=True): """ Get messages currently stored in queue. """ return self.post_request( "queues/{}/{}/get".format(quote(vhost, safe=''), queue), { "count": count, "encoding": "auto", "name": queue, "requeue": str(requeue).lower(), "vhost": vhost } ) def get_bindings(self, vhost=None): """ A list of all bindings (in a given virtual host). """ if vhost is not None: return self.get_request("bindings/{}".format( quote(vhost, safe=''))) return self.get_request("bindings") def get_vhosts(self): """ A list of all vhosts. """ return self.get_request("vhosts") def get_vhost(self, name): """ An individual virtual host. """ return self.get_request("vhosts/{}".format(quote(name, safe=''))) def get_permissions(self, name=None, username=None): """ A list of all permissions. """ if name is None: return self.get_request("permissions") else: if username is None: return self.get_request("permissions/{}".format(quote(name, safe=''))) else: return self.get_request("permissions/{}/{}".format( quote(name, safe=''), quote(username, safe=''))) def get_users(self): """ A list of all users. """ return self.get_request("users") def get_user(self, name): """ An individual user. """ return self.get_request("users/{}".format(name)) def whoami(self): """ Details of the currently authenticated user. """ return self.get_request("whoami")
29.681356
86
0.559502
# pylint: disable=R0904 try: from urllib.parse import quote except ImportError: from urllib import quote import requests from requests.packages.urllib3.exceptions import InsecureRequestWarning requests.packages.urllib3.disable_warnings(InsecureRequestWarning) class UnauthorizedAccessException(Exception): pass class RabbitMQManagementClient(object): def __init__(self, host, port=15672, username="guest", password="guest",\ ssl=False): self._host = host self._port = port self._username = username self._password = password self._scheme = "https" if ssl else "http" def get_request(self, path): response = requests.get( "{}://{}:{}/api/{}".format(self._scheme, self._host, self._port, path), auth=(self._username, self._password), verify=False, timeout=5 ) if response.status_code == 200: return response.json() elif response.status_code == 401 or response.status_code == 403: raise UnauthorizedAccessException( "Authorization error: can't access /api/{}".format(path)) elif response.status_code == 404: return None else: raise Exception("An error occured") def post_request(self, path, data): response = requests.post( "{}://{}:{}/api/{}".format(self._scheme, self._host, self._port, path), auth=(self._username, self._password), json=data, verify=False ) if response.status_code == 200: return response.json() elif response.status_code == 401 or response.status_code == 403: raise UnauthorizedAccessException( "Authorization error: can't access /api/{}".format(path)) else: raise Exception("An error occured") def get_amqp_listeners(self): overview = self.get_overview() return [l for l in overview["listeners"] if "amqp" in l["protocol"]] def get_overview(self): return self.get_request("overview") def get_cluster_name(self): return self.get_request("cluster-name") def get_nodes(self): return self.get_request("nodes") def get_node(self, name, memory=False, binary=False): return self.get_request("nodes/{}?memory={}&binary={}".format( name, str(memory).lower(), str(binary).lower())) def get_definitions(self, vhost=None): if vhost is not None: return self.get_request("definitions/{}".format( quote(vhost, safe=''))) return self.get_request("definitions") def get_connections(self, vhost=None): if vhost is not None: return self.get_request("vhosts/{}/connections".format( quote(vhost, safe=''))) return self.get_request("connections") def get_connection(self, name): return self.get_request("connections/{}".format(name)) def get_channels(self, vhost=None): if vhost is not None: return self.get_request("vhosts/{}/channels".format( quote(vhost, safe=''))) return self.get_request("channels") def get_channel(self, name): return self.get_request("channels/{}".format(name.replace(" ", "%20"))) def get_consumers(self, vhost=None): if vhost is not None: return self.get_request("consumers/{}".format( quote(vhost, safe=''))) return self.get_request("consumers") def get_exchanges(self, vhost=None): if vhost is not None: return self.get_request("exchanges/{}".format( quote(vhost, safe=''))) return self.get_request("exchanges") def get_exchange(self, vhost, name): return self.get_request("exchanges/{}/{}".format( quote(vhost, safe=''), name)) def get_queues(self, vhost=None): if vhost is not None: return self.get_request("queues/{}".format(quote(vhost, safe=''))) return self.get_request("queues") def get_queue(self, vhost, name): return self.get_request("queue/{}/{}".format(vhost, name)) def get_messages(self, vhost, queue, count=10, requeue=True): return self.post_request( "queues/{}/{}/get".format(quote(vhost, safe=''), queue), { "count": count, "encoding": "auto", "name": queue, "requeue": str(requeue).lower(), "vhost": vhost } ) def get_bindings(self, vhost=None): if vhost is not None: return self.get_request("bindings/{}".format( quote(vhost, safe=''))) return self.get_request("bindings") def get_vhosts(self): return self.get_request("vhosts") def get_vhost(self, name): return self.get_request("vhosts/{}".format(quote(name, safe=''))) def get_permissions(self, name=None, username=None): if name is None: return self.get_request("permissions") else: if username is None: return self.get_request("permissions/{}".format(quote(name, safe=''))) else: return self.get_request("permissions/{}/{}".format( quote(name, safe=''), quote(username, safe=''))) def get_users(self): return self.get_request("users") def get_user(self, name): return self.get_request("users/{}".format(name)) def whoami(self): return self.get_request("whoami")
true
true
f71d78df585dd1d4cbf186e5203991da862bdf93
1,237
py
Python
esp8266_devicecloud.py
faludi/ESP8266_DeviceCloud
3855e745d06050f4e988afe08208389ece7fbd15
[ "MIT" ]
null
null
null
esp8266_devicecloud.py
faludi/ESP8266_DeviceCloud
3855e745d06050f4e988afe08208389ece7fbd15
[ "MIT" ]
null
null
null
esp8266_devicecloud.py
faludi/ESP8266_DeviceCloud
3855e745d06050f4e988afe08208389ece7fbd15
[ "MIT" ]
null
null
null
""" Example for posting data to Device Cloud for data graphing, storage and analysis. (digi.com/products/cloud/digi-device-cloud) by Rob Faludi, faludi.com """ import time import httpclient import ubinascii version = '1.0.0' username = 'your username here' #enter your username! password = 'your password here' #enter your password! # Device Cloud connection info url = 'http://devicecloud.digi.com/ws/v1/streams/history' headers= {'authorization': 'Basic ' + auth} stream_id = 'myStream' stream_type = 'DOUBLE' auth = ubinascii.b2a_base64(username + ':' + password).decode().strip() #base64 encoding # posts data to Digi Device Cloud def dc_post(data): json={"stream_id": stream_id, "stream_type": stream_type, "value": str(data)} r = httpclient.post(url, headers=headers, json=json) r.close() return r.status_code # example program: posts 0 to 499 to a Device Cloud data stream if __name__ == "__main__": for data in range(500): try: status = dc_post(data) # post data to Device Cloud except Exception as e: status = type(e).__name__ + ': ' + str(e) print('exception:', e) print('post', data, 'status:', status) time.sleep(1)
27.488889
88
0.667745
import time import httpclient import ubinascii version = '1.0.0' username = 'your username here' password = 'your password here' url = 'http://devicecloud.digi.com/ws/v1/streams/history' headers= {'authorization': 'Basic ' + auth} stream_id = 'myStream' stream_type = 'DOUBLE' auth = ubinascii.b2a_base64(username + ':' + password).decode().strip() def dc_post(data): json={"stream_id": stream_id, "stream_type": stream_type, "value": str(data)} r = httpclient.post(url, headers=headers, json=json) r.close() return r.status_code if __name__ == "__main__": for data in range(500): try: status = dc_post(data) except Exception as e: status = type(e).__name__ + ': ' + str(e) print('exception:', e) print('post', data, 'status:', status) time.sleep(1)
true
true
f71d79ae1cce67c14af83bbfe117b78d09e46318
27,697
py
Python
fmsynth.py
Paul-31415/soundplay
0e7ea27c6d4bdf5f94e5034c7775a10c62d1583e
[ "MIT" ]
null
null
null
fmsynth.py
Paul-31415/soundplay
0e7ea27c6d4bdf5f94e5034c7775a10c62d1583e
[ "MIT" ]
null
null
null
fmsynth.py
Paul-31415/soundplay
0e7ea27c6d4bdf5f94e5034c7775a10c62d1583e
[ "MIT" ]
null
null
null
from itools import lmbdWr,lm import itertools from bisect import bisect_right import brailleG as gr def abs2(n): return (n*n.conjugate()).real def fsample(buf,m=1,b=0): index = 0 y = 0 while 1: index = (index+b+m*y)%len(buf) y = yield buf[(int(index)+1)%len(buf)]*(index%1)+buf[int(index)]*(1-(index%1)) def fsine(a=1,m=1/48000,b=0): s = 0 c = a y = 0 while 1: amt = b+m*y s += c*amt c -= s*amt y = yield s import math pi = math.pi eone = math.exp(2*pi) buffer_size = 8192 sinBuffer = [math.sin(i*2*math.pi/4/buffer_size) for i in range(buffer_size+1)] def nsin(a): a = 4*buffer_size*(a%1) if a<=buffer_size: return sinBuffer[math.floor(a)] elif a<=buffer_size*2: return sinBuffer[math.floor(buffer_size-a)-1] elif a<=buffer_size*3: return -sinBuffer[math.floor(a-buffer_size*2)] else: return -sinBuffer[math.floor(buffer_size*3-a)-1] def nsaw(a): return (a%1)*2-1 def ntri(a): return abs((a%1)-.5)*4-1 def nsquare(a,p=.5): return ((a%1)<p)*2-1 lsin = lm(nsin) lsaw = lm(nsaw) ltri = lm(ntri) lsqr = lm(nsquare) def pulse(w=.5): def p(v): return ((v%1)<w)*2-1 return p def tri(w=.5): def t(v): v %= 1 return 2*v/w-1 if v < w else 2*(w-v)/(1-w)+1 return t _reserved = [] def polyvars(varstr): return [Polynomial(i) for i in varstr] class Polynomial: def __init__(self,coef,var="x"): if type(coef) == str: var = coef coef = [0,1] self.a = coef self.var = var self.trim() def trim(self): while len(self.a): if self.a[-1] == 0: self.a = self.a[:-1] else: break def simplified(self,tv=None): if tv == None: tv = self.var if tv == self.var: r = Polynomial([],tv) x = Polynomial(tv) xa = 1 for t in self.a: if type(t) == Polynomial: r += t.simplified(tv)*xa else: r += t*xa xa *= x else: r = Polynomial([],tv) x = Polynomial(self.var) xa = 1 for t in self.a: if type(t) == Polynomial: r += t.simplified(tv).__mul__(xa) else: r += t*xa xa *= x return r def __call__(self,vrs): if type(vrs) != dict: vrs = {self.var:vrs} if self.var in vrs: x = vrs[self.var] v = 0 xa = 1 for t in self.a: if type(t) == Polynomial: t = t(vrs) v += xa*t xa *= x return v return Polynomial([t(vrs) if type(t) == Polynomial else t for t in self.a],self.var) def __getitem__(self,i): if i>=len(self): return 0 return self.a[i] def __setitem__(self,i,v): if i>=len(self): self.a += [0]*(i-len(self))+[v] else: self.a[i] = v self.trim() def __neg__(self): return Polynomial([-i for i in self.a],self.var) def __radd__(self,o): return self.__add__(o) def __add__(self,o): if type(o) == Polynomial and o.var == self.var: return self.padd(o) return self.npadd(o) def padd(self,o): return Polynomial(sumPolyn(self.a,o.a),self.var) def npadd(self,o): if len(self.a): return Polynomial([self.a[0]+o]+self.a[1:],self.var) return Polynomial([o],self.var) def __rsub__(self,o): return -self.__sub__(o) def __sub__(self,o): if type(o) == Polynomial and o.var == self.var: return self.psub(o) return self.npsub(o) def psub(self,o): return self.padd(-o) def npsub(self,o): if len(self.a): return Polynomial([self.a[0]-o]+self.a[1:],self.var) return Polynomial([-o],self.var) def __rmul__(self,o): return self.__mul__(o) def __mul__(self,o): if type(o) == Polynomial and o.var == self.var: return self.pmul(o) return self.npmul(o) def pmul(self,o): return Polynomial(prodPolyn(self.a,o.a),self.var) def npmul(self,o): if len(self.a): return Polynomial([e*o for e in self.a],self.var) return Polynomial([],self.var) #def __divmod__(self,o): #def __repr__(self,var=None): # if var == None: # var = self.var # return f"polyn({var}) = "+" + ".join((f"({self.a[i]})"+["",f"{var}"][i>0]+["",f"**{i}"][i>1] for i in range(len(self.a)))) def __repr__(self,var=None): if var == None: var = self.var return f"p({var})="*0+" + ".join(((f"({self.a[i]})" if self.a[i] != 1 else ["1",""][i>0])+["",f"{var}"][i>0]+["",f"**{i}"][i>1] for i in range(len(self.a)) if self.a[i] != 0)) def deriv(self): return Polynomial([self.a[i+1]*(i+1) for i in range(len(self.a)-1)],self.var) def integ(self,k=0): return Polynomial([k]+[self.a[i]*(1/(i+1)) for i in range(len(self.a))],self.var) def convolve(self,o): #integ of self(t-x)o(t) dt #want first arg to be x, second to be bounds #so, x = Polynomial('x') t = Polynomial('t') integrand = Polynomial([self(t-x)*o(t)],'t') return integrand.simplified('t').integ() def __len__(self): return len(self.a) def __eq__(self,o): if type(o) == Polynomial: if len(o) != len(self) or o.var != self.var: return False for i in range(len(self)): if self.a[i] != o.a[i]: return False return True if type(o) == float or type(o) == int or type(o) == complex: return len(self) <= 1 and (self.a+[0])[0] == o def __matmul__(self,o): return self.convolve(o) def plot(self,*args): plotPoly(self.a,*args) def evalPolyn(polyn,x): v = 0 xa = 1 for t in polyn: v += xa*t xa *= x return v def sumPolyn(p1,p2): res = [0 for i in range(max(len(p1),len(p2)))] for i in range(len(res)): if i < len(p1): if i < len(p2): res[i] = p1[i] + p2[i] else: res[i] = p1[i] else: res[i] = p2[i] return res def prodPolyn(p1,p2): if len(p1) == 0 or len(p2) == 0: return [] res = [0 for i in range(len(p1)+len(p2)-1)] for i in range(len(p1)): for j in range(len(p2)): res[i+j] += p1[i]*p2[j] return res def composePolyn(p1,p2): #retuns p1(p2(x)) px = [1] pr = [] for i in p1: pr = sumPolyn(pr,prodPolyn(px,[i])) px = prodPolyn(px,p2) return pr def fourierPolyn(p,freq): factor = 1/(2j*math.pi*freq) mask = [factor] result = [0 for i in p] for i in range(len(p)): facacc = factor for j in range(i,-1,-1): result[j] += facacc*p[i] facacc *= -factor*j return result def evalFourierPolyn(p,freq,phase,low,high): l = evalPolyn(p,low) h = evalPolyn(p,high) return h*(eone**(1j*(freq*high+phase)))-l*(eone**(1j*(freq*low+phase))) def convolvePolyn(p1,p2): pass def softGCD(a,b,f=.01): if abs(b)<=f: return a return softGCD(b,a%b,f) def convPolyFrags(p0,p1,l0,l1): #convolves 2 polynomial fragments if l0 > l1: return convPolyFrags(p1,p0,l1,l0) #l0 ≤ l1 times = [-l0,0,l1-l0] #moving = composePolyn(p0,[t-x]) def xify(v): return Polynomial([v],'x').simplified('x') p_0 = Polynomial(p0,'x') p_1 = Polynomial(p1,'x') x = Polynomial('x') conv = p_0@p_1 a,b,c = conv(l0+x)-conv(0),conv(l0+x)-conv(x),conv(l1)-conv(x) a,b,c = [xify(xify((a,b,c)[i])(x+times[i])) for i in range(3)] if l1 != l0: return PiecewizePoly([[],a.a,b.a,c.a,[]],[-math.inf]+times+[l1],0) return PiecewizePoly([[],a.a,c.a,[]],[-math.inf]+times[:2]+[l1],0) def plotPoly(p,t0=0,t1=1,res=50): import matplotlib.pyplot as plt fig, ax = plt.subplots(nrows=1, ncols=1) st = p[0] end = evalPolyn(p,t1-t0) mid = [] ts = [] if len(p) > 2: for j in range(1,res): t = (t1-t0)*j/res ts += [t+t0] mid += [evalPolyn(p,t)] ts = [t0]+ts+[t1] ys = [st]+mid+[end] plt.plot(ts,[i.real for i in ys],linestyle='-',color=(.3,.3,1), linewidth=2) plt.plot(ts,[i.imag for i in ys],linestyle='-',color=(1,.3,.3), linewidth=2) plt.show(block=0) #todo: closed form convolution # perhaps use @ (__matmul__) #todo: closed form composition? possible? not always: requires root finding class PiecewizePoly: def __init__(self,polys = [[]],times=[0],mod=1): self.times = times self.polys = polys self.mod = mod def __call__(self,x): if self.mod != 0: x %= self.mod #binary search for correct polyn l = bisect_right(self.times,x)-1 #eval polyn return evalPolyn(self.polys[l],x-self.times[l]) def deriv(self): #do derivitive on self res_t = [] res_p = [] for p in range(len(self.polys)): res_t += [self.times[p]] res_p += [[]] for i in range(len(self.polys[p])-1): res_p[-1] += [self.polys[p][i+1]*(i+1)] return PiecewizePoly(res_p,res_t,self.mod) def integ(self,start=0,scale=1): #do integral on self res_t = [] res_p = [] for p in range(len(self.polys)): res_t += [self.times[p]] res_p += [[start]] for i in range(len(self.polys[p])): res_p[-1] += [self.polys[p][i]/(i+1)*scale] #continuize segments after first for i in range(1,len(res_t)): val = evalPolyn(res_p[i-1],res_t[i]-res_t[i-1]) res_p[i][0] = val#-evalPolyn(res[i][1],res[i][0]) #not needed with new def return PiecewizePoly(res_p,res_t,self.mod) def timeshift(self,s): assert self.mod==0 for i in range(len(self.times)): self.times[i] -= s return self def timescale(self,s): self.mod *= s for i in range(len(self.times)): self.times[i] *= s self.polys[i] = composePolyn(self.polys[i],[0,1/s]) return self def convolve(self,o,fudgefactor = .001): ts = self.times + [self.mod if self.mod else math.inf] to = o.times + [o.mod if o.mod else math.inf] result = PiecewizePoly([[]],[-math.inf],0) for i in range(len(self.polys)): for j in range(len(o.polys)): pc = convPolyFrags(self.polys[i],o.polys[j],ts[i+1]-ts[i],to[j+1]-to[j]) result += pc.timeshift(ts[i]-to[j]) #now do moddy stuff return result def __matmul__(self,o,fudgefactor = .001): return self.convolve(o,fudgefactor) def __lmbdWr__(self): return lmbdWr(self) def __iterWr__(self): return iterWr(iter(lmbdWr(self))) def bias(self): intg = self.integ() return (intg.end()-intg(0))/self.mod def unbiased(self): #self shifted to have 0 dc bias bias = self.bias() res_t = [] res_p = [] for p in range(len(self.polys)): res_t += [self.times[p]] res_p += [sumPolyn([-bias],self.polys[p])] return PiecewizePoly(res_p,res_t,self.mod) def graph(self,w=40,h=20,lo=-2,hi=2): gr.graph(self,0,self.mod,lo,hi,w,h) def plot(self,res=50): import matplotlib.pyplot as plt fig, ax = plt.subplots(nrows=1, ncols=1) dash = 0 for i in range(len(self.polys)): dash = 1-dash t0 = self.times[i] if t0 == -math.inf: t0 = self.times[i+1]-1 t1 = (self.times+[self.mod if self.mod != 0 else self.times[-2]+1])[i+1] p = self.polys[i] st = (p+[0])[0] end = evalPolyn(p,t1-t0) mid = [] ts = [] if len(p) > 2: for j in range(1,res): t = (t1-t0)*j/res ts += [t+t0] mid += [evalPolyn(p,t)] ts = [t0]+ts+[t1] ys = [st]+mid+[end] plt.plot(ts,[i.real for i in ys],linestyle='-',color=(.3*dash,.3*dash,1), linewidth=2) plt.plot(ts,[i.imag for i in ys],linestyle='-',color=(1,.3*dash,.3*dash), linewidth=2) plt.show(block=0) def mag2(self): sqd = PiecewizePoly([prodPolyn(p,p) for p in self.polys],[t for t in self.times],self.mod+1).integ() return (sqd(self.mod)-sqd(0))/self.mod def norm(self,v=.5): #normalizes it so that integ(0,mod, of self^2) = v*mod target = v factor = target/self.mag2()**.5 return PiecewizePoly([[i*factor for i in p] for p in self.polys],[t for t in self.times],self.mod) def __add__(self,o,fudgefactor = .001): if type(o) == PiecewizePoly: if self.mod == 0: assert o.mod == 0 res_t = [-math.inf] res_p = [sumPolyn(self.polys[0],o.polys[0])] si = 0 oi = 0 sts = self.times + [math.inf] ots = o.times + [math.inf] sp = self.polys + [[]] op = o.polys + [[]] while si < len(self.times) and oi < len(o.times): st,ot = sts[si+1],ots[oi+1] if st < ot: si += 1 res_t += [st] res_p += [sumPolyn(sp[si], composePolyn(op[oi],[st-ot,1]))] elif st > ot: oi += 1 res_t += [ot] res_p += [sumPolyn(composePolyn(sp[si],[ot-st,1]), op[oi])] else: si += 1 oi += 1 res_t += [st] res_p += [sumPolyn(sp[si],op[oi])] return PiecewizePoly(res_p,res_t,0) else: assert o.mod != 0 gcd = softGCD(self.mod,o.mod,fudgefactor*(self.mod*o.mod)**.5) lcm = self.mod*o.mod/gcd t = 0 res_t = [] res_p = [] sto = 0 oto = 0 si = 0 oi = 0 while t < lcm: res_t += [t] res_p += [sumPolyn(composePolyn(self.polys[si],[t-(self.times[si]+sto),1]), composePolyn(o.polys[oi],[t-(o.times[oi]+oto),1]))] st = sto+(self.times+[self.times[0]+self.mod])[si+1] ot = oto+(o.times+[o.times[0]+o.mod])[oi+1] t = min(st,ot) if st <= t: si += 1 if si >= len(self.polys): si = 0 sto += self.mod if ot <= t: oi += 1 if oi >= len(o.polys): oi = 0 oto += o.mod return PiecewizePoly(res_p,res_t,lcm) else: return PiecewizePoly([sumPolyn(p,[o]) for p in self.polys],[t for t in self.times],self.mod) def __mul__(self,o,fudgefactor = .001): if type(o) == PiecewizePoly: gcd = softGCD(self.mod,o.mod,fudgefactor*(self.mod*o.mod)**.5) lcm = self.mod*o.mod/gcd t = 0 res_t = [] res_p = [] sto = 0 oto = 0 si = 0 oi = 0 while t < lcm: res_t += [t] res_p += [prodPolyn(composePolyn(self.polys[si],[t-(self.times[si]+sto),1]), composePolyn(o.polys[oi],[t-(o.times[oi]+oto),1]))] st = sto+(self.times+[self.times[0]+self.mod])[si+1] ot = oto+(o.times+[o.times[0]+o.mod])[oi+1] t = min(st,ot) if st <= t: si += 1 if si >= len(self.polys): si = 0 sto += self.mod if ot <= t: oi += 1 if oi >= len(o.polys): oi = 0 oto += o.mod return PiecewizePoly(res_p,res_t,lcm) else: return PiecewizePoly([prodPolyn(p,[o]) for p in self.polys],[t for t in self.times],self.mod) def __radd__(self,o): return self.__add__(o) def __rmul__(self,o): return self.__mul__(o) def __sub__(self,o): return self.__add__(o.__mul__(-1)) def __rsub__(self,o): return self.__mul__(-1).__add__(o) def t(self,v=1): return PiecewizePoly([[p[i]/(v**i) for i in range(len(p))] for p in self.polys],[t*v for t in self.times],self.mod*v) def isZero(self): for i in self.polys: for j in i: if j != 0: return False return True def end(self): x = self.mod l = -1 #eval polyn return evalPolyn(self.polys[l],x-self.times[l]) def freqComponent(self,f): if f == 0: return self.bias() result = 0 f /= self.mod for i in range(len(self.polys)): p = fourierPolyn(self.polys[i],f) result += evalFourierPolyn(p,f,f*self.times[i],0,(self.times+[self.mod])[i+1]-self.times[i]) return result def graphSpectrum(self,w=20,h=10,both=True): gr.graphLT(lambda x:abs(self.freqComponent(x)),both-h*2*both,h*(4-2*both)+both,0,1,w,h) def graphSpectrumLog(self,w=20,h=10,both = True,low=-10,hi=1): gr.graphLT(lambda x: (lambda v: (math.log(v) if v!=0 else -1e300))(abs(self.freqComponent(x))),both-h*2*both,h*(4-2*both)+both,low,hi,w,h) def bandLimit(self,t,bl=5,neg=False): tot = 0 for i in range(neg*(1-bl),bl): tot += eone**(1j*i*t)*self.freqComponent(i) return tot def getBandlimitedBuffer(self,denominator,numerator = 1,ff=0,fnd=2,neg=False): #f_nyquist = .5 # f_n = n*(num/den) < f_nyquist # n < .5*den/num d = softGCD(numerator,denominator,ff) numerator=int(round(numerator/d)) denominator=int(round(denominator/d)) return [self.bandLimit(numerator*i*self.mod/denominator,int(denominator/numerator/fnd),neg) for i in range(numerator*denominator)] def bandConj(self,t,bl=5): tot = 0 re = self.real() im = self.imag() for i in range(0,bl): f = eone**(1j*i*t) tot += (f*re.freqComponent(i)).imag+(f*im.freqComponent(i)).imag*1j return tot def real(self): return PiecewizePoly([[i.real for i in j]for j in self.polys],[t for t in self.times],self.mod) def imag(self): return PiecewizePoly([[i.imag for i in j]for j in self.polys],[t for t in self.times],self.mod) def oscope(self,w=40,h=20,s=.5+.5j,m=.5,n=256): scrn = gr.brailleScreen(w*2,h*4) for i in range(n): t = i*self.mod/n v = self(t).conjugate()*m+s if 0<=int(v.real*w*2)<w*2 and 0<=int(v.imag*h*4) < h*4: gr.brailleScreenSet(scrn,int(v.real*w*2),int(v.imag*h*4)) gr.brailleScreenPrint(scrn) def forever(v): while 1: yield v #NEW BWLSYNTH IDEA: # sample the nth integral then derivitate the signal n times # the high harmonics are suppressed in the integrals which means # when they alias they are tiny # but the reconstruction filter doesn't amplify them a ton because they were aliased # thus cheap and easy bwl synthesis def idbwlPoly(p,rate=440/48000,q=1,d=1): try: rate.__next__ except: rate = forever(rate) ds = [[0]*d for i in range(q)] rates = [0]*d trate = 0 for i in range(q): p = p.unbiased().integ() t = 0 di = 0 for i in range(q*d): di = (di+1)%d t += rate t %= 1 r = p(t) trate -= rates[di] rates[di] = next(rate) trate += rates[di] for i in range(q): r,ds[i][di] = (r-ds[i][di]) / trate,r while 1: di = (di+1)%d t += rate t %= 1 r = p(t) trate -= rates[di] rates[di] = next(rate) trate += rates[di] for i in range(q): r,ds[i][di] = (r-ds[i][di]) / trate,r yield r def ditherPoly(p,rate=440/48000,dd=1): from random import random t = 0 while 1: t += rate yield p(t+dd*rate*random()) def gaussApprox(mean=0,spread=1,iters=3): s = spread/iters blip = PiecewizePoly([[],[1/s],[]],[-math.inf,0,s],0) acc = blip for b in bin(iters)[3:]: acc.plot() acc @= acc if b == '1': acc @= blip return acc.timeshift(mean) def plinConnectDots(dat,speed=1): polys = [] times = [] t = 0 for i in range(len(dat)): leng = abs(dat[i-1]-dat[i]) polys += [[dat[i-1],(dat[i]-dat[i-1])/leng]] times += [t] t += leng return PiecewizePoly(polys,times,t) def pnlinConnectDots(dat,speed=1): r = plinConnectDots(dat,speed) return r.t(1/r.mod) def papprox(dat,integ=2): #derivitive the freqs integ times dcs = [] for intg in range(integ): dcs += [dat[-1]/(intg+1)] ddat = [(-dat[i-1]+dat[i])/(intg+1) for i in range(len(dat))] dat = ddat res = PiecewizePoly([[i] for i in dat],[i for i in range(len(dat))],len(dat)) for i in range(integ): res = res.integ(dcs[-i-1]) return res """bl = len(dat)//2 guess1 = PiecewizePoly([[i] for i in dat],[i/len(dat) for i in range(len(dat))],1) freqs = [guess1.freqComponent(i) for i in range(1-bl,bl)] dc = guess1.bias() #derivitive the freqs integ times for i in range(integ): for f in range(len(freqs)): freqs[f] *= (f+1-bl//2)*1j #come up with new samples to integrate repeatedly samps = [] for t in range(len(dat)): tot = 0 for i in range(1-bl,bl): tot += eone**(1j*i*t/len(dat))*freqs[i] samps += [tot] res = PiecewizePoly([[i] for i in samps],[i/len(samps) for i in range(len(samps))],1) for i in range(integ): res = res.unbiased().integ(0,1).unbiased() return res + dc """ def ppulse(width=.5,amplitude=1): return PiecewizePoly([[0,[-1]],[width,[1]]]).unbiased() psqr = PiecewizePoly([[-1],[1]],[0,.5]) #.5 -> 2 ptri = psqr.integ(0,4).unbiased() #.25*.5=1/8 ppar = ptri.integ(0,8) psaw = PiecewizePoly([[1,-2]],[0]) cf = pnlinConnectDots([-.75+1.5j,-.5+1j,.5+1j,.75+1.5j,1+1j,1-1j,-1j-1,1j-1])*.5 cfi = plinConnectDots([-.75+1.5j,-.5+1j,.5+1j,.75+1.5j,1+1j,1-1j,-1j-1,1j-1]) cfi.polys += [[-1/3+.5j,-1j],[1/3+.5j,-1j]] cfi.times += [cfi.mod,cfi.mod+.75] cfi.mod += 1.5 cfi = cfi.t(1/cfi.mod)*.5 def reorderTimes(times,order,top): newTimes = [] t = 0 for i in order: if i == len(times)-1: l = top-times[i] else: l = times[i+1]-times[i] newTimes += [t] t += l return newTimes def reorder(wave,goal,fs=20,wfd = lambda f,a,b: abs(abs2(a)-abs2(b))): l = [i for i in range(len(wave.polys))] goalF = [goal.freqComponent(i) for i in range(1-fs,fs)] best = wave bestD = 1e300 for p in itertools.permutations(l): guess = PiecewizePoly([wave.polys[i] for i in p],reorderTimes(wave.times,p,wave.mod),wave.mod) guessF = [guess.freqComponent(i) for i in range(1-fs,fs)] d = 0 for i in range(len(goalF)): d += wfd(1-fs+i,goalF[i],guessF[i]) if d < bestD: best = guess bestD = d return best def quickStar(n,s=2): return pnlinConnectDots([eone**(1j*i*s/n) for i in range(n)])*.5 def prettyStar(n,rl=.5): return pnlinConnectDots([eone**(1j*(i+.5*j)/n)*[1,rl][j] for i in range(n) for j in range(2)])*.5 def getPSineApprox(sects=2,integs=12): offs = integs%4 guess = PiecewizePoly([[math.sin(((i+.5)/sects+offs/4)*2*math.pi)] for i in range(sects)],[i/sects for i in range(sects)]).unbiased() for i in range(integs): guess = guess.integ(0,1).unbiased().norm() return guess def c(f,g): for i in g: yield f(i) def x(n,g): for i in g: yield n*i def p(n,g): for i in g: yield n+i def const(n): while 1: yield n def integ(g,a=0): for i in g: a += i yield a def deriv(g): p = next(g) for i in g: yield i-p p = i def clamp(n,v=1): return min(max(n,-v),v) def bderiv(g,b=1): p = next(g) d = 0 for i in g: d += i-p p = i v = clamp(d,b) yield v d -= v def send(g1,g2): next(g1) while 1: yield g1.send(next(g2)) class passFilter: def __init__(self): self.value = 0 def send(self,val,time=1): self.value = val return val class contRAvgFilt(passFilter): def __init__(self,a): self.alpha = math.log(a) self.value = 0 def send(self,val,time=1): self.value = val+(self.value-val)*math.exp(self.alpha*time) return self.value def getPerfSquareBuff(n,d=1): w = 1 outbuf = [0 for i in range(n)] while w < n/d/2: for i in range(n): outbuf[i] += math.sin(i*2*pi*d/n*w)/w w += 2 return outbuf def nearestDownSample(g,r=1): a = 0 for i in g: while a < 1: yield i a += r a -= 1 def linearDownSample(g,r=1): p = 0 a = 0 for i in g: while a < 1: yield a*i+(1-a)*p a += r p = i a -= 1 def fsamp(f,s=[(-1,.5),(1,.5)],filt=None,r=48000): if filt == None: filt = contRAvgFilt(1/r) a = 0 i = 0 if type(f)==int or type(f)==float: def g(v): while 1: yield v f = g(f) filtered = 0 while 1: t = next(f)/r while t > 0: dt = min(t,s[i][1]-a) a += dt t -= dt filt.send(s[i][0],dt) if a>=s[i][1]: a -= s[i][1] i = (i+1)%len(s) yield filt.value #actual fm stuff from filters import IIR import numpy as np def phaseModulate(g,d=.1,f=10000,sr=48000): t = 0 for i in g: t += f/sr yield nsin(t+i.real*d)+1j*(nsin(t+.25+i.imag*d)) def modulate(g,d=0.01,f=10000,sr=48000): t = .25 for i in g: t += (d*i+1+1j)*f/sr yield (nsin(t.real)+1j*nsin(t.imag)) """def stereoEncode(g,c=10000,sr=48000): t = 0 flt = IIR() flt.setPolys([1], for i in g: t += (c+i.imag)/sr yield nsin(t)+i.real def stereoDecode(g,c=15000,sr=48000): for i in g: r = """ #def fm(
29.433581
183
0.490559
from itools import lmbdWr,lm import itertools from bisect import bisect_right import brailleG as gr def abs2(n): return (n*n.conjugate()).real def fsample(buf,m=1,b=0): index = 0 y = 0 while 1: index = (index+b+m*y)%len(buf) y = yield buf[(int(index)+1)%len(buf)]*(index%1)+buf[int(index)]*(1-(index%1)) def fsine(a=1,m=1/48000,b=0): s = 0 c = a y = 0 while 1: amt = b+m*y s += c*amt c -= s*amt y = yield s import math pi = math.pi eone = math.exp(2*pi) buffer_size = 8192 sinBuffer = [math.sin(i*2*math.pi/4/buffer_size) for i in range(buffer_size+1)] def nsin(a): a = 4*buffer_size*(a%1) if a<=buffer_size: return sinBuffer[math.floor(a)] elif a<=buffer_size*2: return sinBuffer[math.floor(buffer_size-a)-1] elif a<=buffer_size*3: return -sinBuffer[math.floor(a-buffer_size*2)] else: return -sinBuffer[math.floor(buffer_size*3-a)-1] def nsaw(a): return (a%1)*2-1 def ntri(a): return abs((a%1)-.5)*4-1 def nsquare(a,p=.5): return ((a%1)<p)*2-1 lsin = lm(nsin) lsaw = lm(nsaw) ltri = lm(ntri) lsqr = lm(nsquare) def pulse(w=.5): def p(v): return ((v%1)<w)*2-1 return p def tri(w=.5): def t(v): v %= 1 return 2*v/w-1 if v < w else 2*(w-v)/(1-w)+1 return t _reserved = [] def polyvars(varstr): return [Polynomial(i) for i in varstr] class Polynomial: def __init__(self,coef,var="x"): if type(coef) == str: var = coef coef = [0,1] self.a = coef self.var = var self.trim() def trim(self): while len(self.a): if self.a[-1] == 0: self.a = self.a[:-1] else: break def simplified(self,tv=None): if tv == None: tv = self.var if tv == self.var: r = Polynomial([],tv) x = Polynomial(tv) xa = 1 for t in self.a: if type(t) == Polynomial: r += t.simplified(tv)*xa else: r += t*xa xa *= x else: r = Polynomial([],tv) x = Polynomial(self.var) xa = 1 for t in self.a: if type(t) == Polynomial: r += t.simplified(tv).__mul__(xa) else: r += t*xa xa *= x return r def __call__(self,vrs): if type(vrs) != dict: vrs = {self.var:vrs} if self.var in vrs: x = vrs[self.var] v = 0 xa = 1 for t in self.a: if type(t) == Polynomial: t = t(vrs) v += xa*t xa *= x return v return Polynomial([t(vrs) if type(t) == Polynomial else t for t in self.a],self.var) def __getitem__(self,i): if i>=len(self): return 0 return self.a[i] def __setitem__(self,i,v): if i>=len(self): self.a += [0]*(i-len(self))+[v] else: self.a[i] = v self.trim() def __neg__(self): return Polynomial([-i for i in self.a],self.var) def __radd__(self,o): return self.__add__(o) def __add__(self,o): if type(o) == Polynomial and o.var == self.var: return self.padd(o) return self.npadd(o) def padd(self,o): return Polynomial(sumPolyn(self.a,o.a),self.var) def npadd(self,o): if len(self.a): return Polynomial([self.a[0]+o]+self.a[1:],self.var) return Polynomial([o],self.var) def __rsub__(self,o): return -self.__sub__(o) def __sub__(self,o): if type(o) == Polynomial and o.var == self.var: return self.psub(o) return self.npsub(o) def psub(self,o): return self.padd(-o) def npsub(self,o): if len(self.a): return Polynomial([self.a[0]-o]+self.a[1:],self.var) return Polynomial([-o],self.var) def __rmul__(self,o): return self.__mul__(o) def __mul__(self,o): if type(o) == Polynomial and o.var == self.var: return self.pmul(o) return self.npmul(o) def pmul(self,o): return Polynomial(prodPolyn(self.a,o.a),self.var) def npmul(self,o): if len(self.a): return Polynomial([e*o for e in self.a],self.var) return Polynomial([],self.var) def __repr__(self,var=None): if var == None: var = self.var return f"p({var})="*0+" + ".join(((f"({self.a[i]})" if self.a[i] != 1 else ["1",""][i>0])+["",f"{var}"][i>0]+["",f"**{i}"][i>1] for i in range(len(self.a)) if self.a[i] != 0)) def deriv(self): return Polynomial([self.a[i+1]*(i+1) for i in range(len(self.a)-1)],self.var) def integ(self,k=0): return Polynomial([k]+[self.a[i]*(1/(i+1)) for i in range(len(self.a))],self.var) def convolve(self,o): x = Polynomial('x') t = Polynomial('t') integrand = Polynomial([self(t-x)*o(t)],'t') return integrand.simplified('t').integ() def __len__(self): return len(self.a) def __eq__(self,o): if type(o) == Polynomial: if len(o) != len(self) or o.var != self.var: return False for i in range(len(self)): if self.a[i] != o.a[i]: return False return True if type(o) == float or type(o) == int or type(o) == complex: return len(self) <= 1 and (self.a+[0])[0] == o def __matmul__(self,o): return self.convolve(o) def plot(self,*args): plotPoly(self.a,*args) def evalPolyn(polyn,x): v = 0 xa = 1 for t in polyn: v += xa*t xa *= x return v def sumPolyn(p1,p2): res = [0 for i in range(max(len(p1),len(p2)))] for i in range(len(res)): if i < len(p1): if i < len(p2): res[i] = p1[i] + p2[i] else: res[i] = p1[i] else: res[i] = p2[i] return res def prodPolyn(p1,p2): if len(p1) == 0 or len(p2) == 0: return [] res = [0 for i in range(len(p1)+len(p2)-1)] for i in range(len(p1)): for j in range(len(p2)): res[i+j] += p1[i]*p2[j] return res def composePolyn(p1,p2): px = [1] pr = [] for i in p1: pr = sumPolyn(pr,prodPolyn(px,[i])) px = prodPolyn(px,p2) return pr def fourierPolyn(p,freq): factor = 1/(2j*math.pi*freq) mask = [factor] result = [0 for i in p] for i in range(len(p)): facacc = factor for j in range(i,-1,-1): result[j] += facacc*p[i] facacc *= -factor*j return result def evalFourierPolyn(p,freq,phase,low,high): l = evalPolyn(p,low) h = evalPolyn(p,high) return h*(eone**(1j*(freq*high+phase)))-l*(eone**(1j*(freq*low+phase))) def convolvePolyn(p1,p2): pass def softGCD(a,b,f=.01): if abs(b)<=f: return a return softGCD(b,a%b,f) def convPolyFrags(p0,p1,l0,l1): if l0 > l1: return convPolyFrags(p1,p0,l1,l0) times = [-l0,0,l1-l0] def xify(v): return Polynomial([v],'x').simplified('x') p_0 = Polynomial(p0,'x') p_1 = Polynomial(p1,'x') x = Polynomial('x') conv = p_0@p_1 a,b,c = conv(l0+x)-conv(0),conv(l0+x)-conv(x),conv(l1)-conv(x) a,b,c = [xify(xify((a,b,c)[i])(x+times[i])) for i in range(3)] if l1 != l0: return PiecewizePoly([[],a.a,b.a,c.a,[]],[-math.inf]+times+[l1],0) return PiecewizePoly([[],a.a,c.a,[]],[-math.inf]+times[:2]+[l1],0) def plotPoly(p,t0=0,t1=1,res=50): import matplotlib.pyplot as plt fig, ax = plt.subplots(nrows=1, ncols=1) st = p[0] end = evalPolyn(p,t1-t0) mid = [] ts = [] if len(p) > 2: for j in range(1,res): t = (t1-t0)*j/res ts += [t+t0] mid += [evalPolyn(p,t)] ts = [t0]+ts+[t1] ys = [st]+mid+[end] plt.plot(ts,[i.real for i in ys],linestyle='-',color=(.3,.3,1), linewidth=2) plt.plot(ts,[i.imag for i in ys],linestyle='-',color=(1,.3,.3), linewidth=2) plt.show(block=0) class PiecewizePoly: def __init__(self,polys = [[]],times=[0],mod=1): self.times = times self.polys = polys self.mod = mod def __call__(self,x): if self.mod != 0: x %= self.mod l = bisect_right(self.times,x)-1 return evalPolyn(self.polys[l],x-self.times[l]) def deriv(self): res_t = [] res_p = [] for p in range(len(self.polys)): res_t += [self.times[p]] res_p += [[]] for i in range(len(self.polys[p])-1): res_p[-1] += [self.polys[p][i+1]*(i+1)] return PiecewizePoly(res_p,res_t,self.mod) def integ(self,start=0,scale=1): res_t = [] res_p = [] for p in range(len(self.polys)): res_t += [self.times[p]] res_p += [[start]] for i in range(len(self.polys[p])): res_p[-1] += [self.polys[p][i]/(i+1)*scale] for i in range(1,len(res_t)): val = evalPolyn(res_p[i-1],res_t[i]-res_t[i-1]) res_p[i][0] = valePoly(res_p,res_t,self.mod) def timeshift(self,s): assert self.mod==0 for i in range(len(self.times)): self.times[i] -= s return self def timescale(self,s): self.mod *= s for i in range(len(self.times)): self.times[i] *= s self.polys[i] = composePolyn(self.polys[i],[0,1/s]) return self def convolve(self,o,fudgefactor = .001): ts = self.times + [self.mod if self.mod else math.inf] to = o.times + [o.mod if o.mod else math.inf] result = PiecewizePoly([[]],[-math.inf],0) for i in range(len(self.polys)): for j in range(len(o.polys)): pc = convPolyFrags(self.polys[i],o.polys[j],ts[i+1]-ts[i],to[j+1]-to[j]) result += pc.timeshift(ts[i]-to[j]) return result def __matmul__(self,o,fudgefactor = .001): return self.convolve(o,fudgefactor) def __lmbdWr__(self): return lmbdWr(self) def __iterWr__(self): return iterWr(iter(lmbdWr(self))) def bias(self): intg = self.integ() return (intg.end()-intg(0))/self.mod def unbiased(self): bias = self.bias() res_t = [] res_p = [] for p in range(len(self.polys)): res_t += [self.times[p]] res_p += [sumPolyn([-bias],self.polys[p])] return PiecewizePoly(res_p,res_t,self.mod) def graph(self,w=40,h=20,lo=-2,hi=2): gr.graph(self,0,self.mod,lo,hi,w,h) def plot(self,res=50): import matplotlib.pyplot as plt fig, ax = plt.subplots(nrows=1, ncols=1) dash = 0 for i in range(len(self.polys)): dash = 1-dash t0 = self.times[i] if t0 == -math.inf: t0 = self.times[i+1]-1 t1 = (self.times+[self.mod if self.mod != 0 else self.times[-2]+1])[i+1] p = self.polys[i] st = (p+[0])[0] end = evalPolyn(p,t1-t0) mid = [] ts = [] if len(p) > 2: for j in range(1,res): t = (t1-t0)*j/res ts += [t+t0] mid += [evalPolyn(p,t)] ts = [t0]+ts+[t1] ys = [st]+mid+[end] plt.plot(ts,[i.real for i in ys],linestyle='-',color=(.3*dash,.3*dash,1), linewidth=2) plt.plot(ts,[i.imag for i in ys],linestyle='-',color=(1,.3*dash,.3*dash), linewidth=2) plt.show(block=0) def mag2(self): sqd = PiecewizePoly([prodPolyn(p,p) for p in self.polys],[t for t in self.times],self.mod+1).integ() return (sqd(self.mod)-sqd(0))/self.mod def norm(self,v=.5): target = v factor = target/self.mag2()**.5 return PiecewizePoly([[i*factor for i in p] for p in self.polys],[t for t in self.times],self.mod) def __add__(self,o,fudgefactor = .001): if type(o) == PiecewizePoly: if self.mod == 0: assert o.mod == 0 res_t = [-math.inf] res_p = [sumPolyn(self.polys[0],o.polys[0])] si = 0 oi = 0 sts = self.times + [math.inf] ots = o.times + [math.inf] sp = self.polys + [[]] op = o.polys + [[]] while si < len(self.times) and oi < len(o.times): st,ot = sts[si+1],ots[oi+1] if st < ot: si += 1 res_t += [st] res_p += [sumPolyn(sp[si], composePolyn(op[oi],[st-ot,1]))] elif st > ot: oi += 1 res_t += [ot] res_p += [sumPolyn(composePolyn(sp[si],[ot-st,1]), op[oi])] else: si += 1 oi += 1 res_t += [st] res_p += [sumPolyn(sp[si],op[oi])] return PiecewizePoly(res_p,res_t,0) else: assert o.mod != 0 gcd = softGCD(self.mod,o.mod,fudgefactor*(self.mod*o.mod)**.5) lcm = self.mod*o.mod/gcd t = 0 res_t = [] res_p = [] sto = 0 oto = 0 si = 0 oi = 0 while t < lcm: res_t += [t] res_p += [sumPolyn(composePolyn(self.polys[si],[t-(self.times[si]+sto),1]), composePolyn(o.polys[oi],[t-(o.times[oi]+oto),1]))] st = sto+(self.times+[self.times[0]+self.mod])[si+1] ot = oto+(o.times+[o.times[0]+o.mod])[oi+1] t = min(st,ot) if st <= t: si += 1 if si >= len(self.polys): si = 0 sto += self.mod if ot <= t: oi += 1 if oi >= len(o.polys): oi = 0 oto += o.mod return PiecewizePoly(res_p,res_t,lcm) else: return PiecewizePoly([sumPolyn(p,[o]) for p in self.polys],[t for t in self.times],self.mod) def __mul__(self,o,fudgefactor = .001): if type(o) == PiecewizePoly: gcd = softGCD(self.mod,o.mod,fudgefactor*(self.mod*o.mod)**.5) lcm = self.mod*o.mod/gcd t = 0 res_t = [] res_p = [] sto = 0 oto = 0 si = 0 oi = 0 while t < lcm: res_t += [t] res_p += [prodPolyn(composePolyn(self.polys[si],[t-(self.times[si]+sto),1]), composePolyn(o.polys[oi],[t-(o.times[oi]+oto),1]))] st = sto+(self.times+[self.times[0]+self.mod])[si+1] ot = oto+(o.times+[o.times[0]+o.mod])[oi+1] t = min(st,ot) if st <= t: si += 1 if si >= len(self.polys): si = 0 sto += self.mod if ot <= t: oi += 1 if oi >= len(o.polys): oi = 0 oto += o.mod return PiecewizePoly(res_p,res_t,lcm) else: return PiecewizePoly([prodPolyn(p,[o]) for p in self.polys],[t for t in self.times],self.mod) def __radd__(self,o): return self.__add__(o) def __rmul__(self,o): return self.__mul__(o) def __sub__(self,o): return self.__add__(o.__mul__(-1)) def __rsub__(self,o): return self.__mul__(-1).__add__(o) def t(self,v=1): return PiecewizePoly([[p[i]/(v**i) for i in range(len(p))] for p in self.polys],[t*v for t in self.times],self.mod*v) def isZero(self): for i in self.polys: for j in i: if j != 0: return False return True def end(self): x = self.mod l = -1 return evalPolyn(self.polys[l],x-self.times[l]) def freqComponent(self,f): if f == 0: return self.bias() result = 0 f /= self.mod for i in range(len(self.polys)): p = fourierPolyn(self.polys[i],f) result += evalFourierPolyn(p,f,f*self.times[i],0,(self.times+[self.mod])[i+1]-self.times[i]) return result def graphSpectrum(self,w=20,h=10,both=True): gr.graphLT(lambda x:abs(self.freqComponent(x)),both-h*2*both,h*(4-2*both)+both,0,1,w,h) def graphSpectrumLog(self,w=20,h=10,both = True,low=-10,hi=1): gr.graphLT(lambda x: (lambda v: (math.log(v) if v!=0 else -1e300))(abs(self.freqComponent(x))),both-h*2*both,h*(4-2*both)+both,low,hi,w,h) def bandLimit(self,t,bl=5,neg=False): tot = 0 for i in range(neg*(1-bl),bl): tot += eone**(1j*i*t)*self.freqComponent(i) return tot def getBandlimitedBuffer(self,denominator,numerator = 1,ff=0,fnd=2,neg=False): d = softGCD(numerator,denominator,ff) numerator=int(round(numerator/d)) denominator=int(round(denominator/d)) return [self.bandLimit(numerator*i*self.mod/denominator,int(denominator/numerator/fnd),neg) for i in range(numerator*denominator)] def bandConj(self,t,bl=5): tot = 0 re = self.real() im = self.imag() for i in range(0,bl): f = eone**(1j*i*t) tot += (f*re.freqComponent(i)).imag+(f*im.freqComponent(i)).imag*1j return tot def real(self): return PiecewizePoly([[i.real for i in j]for j in self.polys],[t for t in self.times],self.mod) def imag(self): return PiecewizePoly([[i.imag for i in j]for j in self.polys],[t for t in self.times],self.mod) def oscope(self,w=40,h=20,s=.5+.5j,m=.5,n=256): scrn = gr.brailleScreen(w*2,h*4) for i in range(n): t = i*self.mod/n v = self(t).conjugate()*m+s if 0<=int(v.real*w*2)<w*2 and 0<=int(v.imag*h*4) < h*4: gr.brailleScreenSet(scrn,int(v.real*w*2),int(v.imag*h*4)) gr.brailleScreenPrint(scrn) def forever(v): while 1: yield v # thus cheap and easy bwl synthesis def idbwlPoly(p,rate=440/48000,q=1,d=1): try: rate.__next__ except: rate = forever(rate) ds = [[0]*d for i in range(q)] rates = [0]*d trate = 0 for i in range(q): p = p.unbiased().integ() t = 0 di = 0 for i in range(q*d): di = (di+1)%d t += rate t %= 1 r = p(t) trate -= rates[di] rates[di] = next(rate) trate += rates[di] for i in range(q): r,ds[i][di] = (r-ds[i][di]) / trate,r while 1: di = (di+1)%d t += rate t %= 1 r = p(t) trate -= rates[di] rates[di] = next(rate) trate += rates[di] for i in range(q): r,ds[i][di] = (r-ds[i][di]) / trate,r yield r def ditherPoly(p,rate=440/48000,dd=1): from random import random t = 0 while 1: t += rate yield p(t+dd*rate*random()) def gaussApprox(mean=0,spread=1,iters=3): s = spread/iters blip = PiecewizePoly([[],[1/s],[]],[-math.inf,0,s],0) acc = blip for b in bin(iters)[3:]: acc.plot() acc @= acc if b == '1': acc @= blip return acc.timeshift(mean) def plinConnectDots(dat,speed=1): polys = [] times = [] t = 0 for i in range(len(dat)): leng = abs(dat[i-1]-dat[i]) polys += [[dat[i-1],(dat[i]-dat[i-1])/leng]] times += [t] t += leng return PiecewizePoly(polys,times,t) def pnlinConnectDots(dat,speed=1): r = plinConnectDots(dat,speed) return r.t(1/r.mod) def papprox(dat,integ=2): #derivitive the freqs integ times dcs = [] for intg in range(integ): dcs += [dat[-1]/(intg+1)] ddat = [(-dat[i-1]+dat[i])/(intg+1) for i in range(len(dat))] dat = ddat res = PiecewizePoly([[i] for i in dat],[i for i in range(len(dat))],len(dat)) for i in range(integ): res = res.integ(dcs[-i-1]) return res def ppulse(width=.5,amplitude=1): return PiecewizePoly([[0,[-1]],[width,[1]]]).unbiased() psqr = PiecewizePoly([[-1],[1]],[0,.5]) #.5 -> 2 ptri = psqr.integ(0,4).unbiased() #.25*.5=1/8 ppar = ptri.integ(0,8) psaw = PiecewizePoly([[1,-2]],[0]) cf = pnlinConnectDots([-.75+1.5j,-.5+1j,.5+1j,.75+1.5j,1+1j,1-1j,-1j-1,1j-1])*.5 cfi = plinConnectDots([-.75+1.5j,-.5+1j,.5+1j,.75+1.5j,1+1j,1-1j,-1j-1,1j-1]) cfi.polys += [[-1/3+.5j,-1j],[1/3+.5j,-1j]] cfi.times += [cfi.mod,cfi.mod+.75] cfi.mod += 1.5 cfi = cfi.t(1/cfi.mod)*.5 def reorderTimes(times,order,top): newTimes = [] t = 0 for i in order: if i == len(times)-1: l = top-times[i] else: l = times[i+1]-times[i] newTimes += [t] t += l return newTimes def reorder(wave,goal,fs=20,wfd = lambda f,a,b: abs(abs2(a)-abs2(b))): l = [i for i in range(len(wave.polys))] goalF = [goal.freqComponent(i) for i in range(1-fs,fs)] best = wave bestD = 1e300 for p in itertools.permutations(l): guess = PiecewizePoly([wave.polys[i] for i in p],reorderTimes(wave.times,p,wave.mod),wave.mod) guessF = [guess.freqComponent(i) for i in range(1-fs,fs)] d = 0 for i in range(len(goalF)): d += wfd(1-fs+i,goalF[i],guessF[i]) if d < bestD: best = guess bestD = d return best def quickStar(n,s=2): return pnlinConnectDots([eone**(1j*i*s/n) for i in range(n)])*.5 def prettyStar(n,rl=.5): return pnlinConnectDots([eone**(1j*(i+.5*j)/n)*[1,rl][j] for i in range(n) for j in range(2)])*.5 def getPSineApprox(sects=2,integs=12): offs = integs%4 guess = PiecewizePoly([[math.sin(((i+.5)/sects+offs/4)*2*math.pi)] for i in range(sects)],[i/sects for i in range(sects)]).unbiased() for i in range(integs): guess = guess.integ(0,1).unbiased().norm() return guess def c(f,g): for i in g: yield f(i) def x(n,g): for i in g: yield n*i def p(n,g): for i in g: yield n+i def const(n): while 1: yield n def integ(g,a=0): for i in g: a += i yield a def deriv(g): p = next(g) for i in g: yield i-p p = i def clamp(n,v=1): return min(max(n,-v),v) def bderiv(g,b=1): p = next(g) d = 0 for i in g: d += i-p p = i v = clamp(d,b) yield v d -= v def send(g1,g2): next(g1) while 1: yield g1.send(next(g2)) class passFilter: def __init__(self): self.value = 0 def send(self,val,time=1): self.value = val return val class contRAvgFilt(passFilter): def __init__(self,a): self.alpha = math.log(a) self.value = 0 def send(self,val,time=1): self.value = val+(self.value-val)*math.exp(self.alpha*time) return self.value def getPerfSquareBuff(n,d=1): w = 1 outbuf = [0 for i in range(n)] while w < n/d/2: for i in range(n): outbuf[i] += math.sin(i*2*pi*d/n*w)/w w += 2 return outbuf def nearestDownSample(g,r=1): a = 0 for i in g: while a < 1: yield i a += r a -= 1 def linearDownSample(g,r=1): p = 0 a = 0 for i in g: while a < 1: yield a*i+(1-a)*p a += r p = i a -= 1 def fsamp(f,s=[(-1,.5),(1,.5)],filt=None,r=48000): if filt == None: filt = contRAvgFilt(1/r) a = 0 i = 0 if type(f)==int or type(f)==float: def g(v): while 1: yield v f = g(f) filtered = 0 while 1: t = next(f)/r while t > 0: dt = min(t,s[i][1]-a) a += dt t -= dt filt.send(s[i][0],dt) if a>=s[i][1]: a -= s[i][1] i = (i+1)%len(s) yield filt.value #actual fm stuff from filters import IIR import numpy as np def phaseModulate(g,d=.1,f=10000,sr=48000): t = 0 for i in g: t += f/sr yield nsin(t+i.real*d)+1j*(nsin(t+.25+i.imag*d)) def modulate(g,d=0.01,f=10000,sr=48000): t = .25 for i in g: t += (d*i+1+1j)*f/sr yield (nsin(t.real)+1j*nsin(t.imag)) #def fm(
true
true
f71d7c018fbe014e4ecc1d9b47bd5d36caccc271
29,722
py
Python
certbot-nginx/certbot_nginx/_internal/parser.py
robszumski/certbot
d7050132c7468cbb08d3d717685a76b91d3c921a
[ "Apache-2.0" ]
1
2021-09-24T22:27:06.000Z
2021-09-24T22:27:06.000Z
certbot-nginx/certbot_nginx/_internal/parser.py
robszumski/certbot
d7050132c7468cbb08d3d717685a76b91d3c921a
[ "Apache-2.0" ]
1
2021-09-24T22:22:21.000Z
2021-09-24T22:22:21.000Z
certbot-nginx/certbot_nginx/_internal/parser.py
LaudateCorpus1/certbot
3ec8b552a25b75d00d7693d52e6df93e5bd02a5f
[ "Apache-2.0" ]
1
2021-09-24T22:22:11.000Z
2021-09-24T22:22:11.000Z
"""NginxParser is a member object of the NginxConfigurator class.""" import copy import functools import glob import logging import re import pyparsing import six from acme.magic_typing import Dict from acme.magic_typing import List from acme.magic_typing import Set from acme.magic_typing import Tuple from acme.magic_typing import Union from certbot import errors from certbot.compat import os from certbot_nginx._internal import nginxparser from certbot_nginx._internal import obj logger = logging.getLogger(__name__) class NginxParser(object): """Class handles the fine details of parsing the Nginx Configuration. :ivar str root: Normalized absolute path to the server root directory. Without trailing slash. :ivar dict parsed: Mapping of file paths to parsed trees """ def __init__(self, root): self.parsed = {} # type: Dict[str, Union[List, nginxparser.UnspacedList]] self.root = os.path.abspath(root) self.config_root = self._find_config_root() # Parse nginx.conf and included files. # TODO: Check sites-available/ as well. For now, the configurator does # not enable sites from there. self.load() def load(self): """Loads Nginx files into a parsed tree. """ self.parsed = {} self._parse_recursively(self.config_root) def _parse_recursively(self, filepath): """Parses nginx config files recursively by looking at 'include' directives inside 'http' and 'server' blocks. Note that this only reads Nginx files that potentially declare a virtual host. :param str filepath: The path to the files to parse, as a glob """ # pylint: disable=too-many-nested-blocks filepath = self.abs_path(filepath) trees = self._parse_files(filepath) for tree in trees: for entry in tree: if _is_include_directive(entry): # Parse the top-level included file self._parse_recursively(entry[1]) elif entry[0] == ['http'] or entry[0] == ['server']: # Look for includes in the top-level 'http'/'server' context for subentry in entry[1]: if _is_include_directive(subentry): self._parse_recursively(subentry[1]) elif entry[0] == ['http'] and subentry[0] == ['server']: # Look for includes in a 'server' context within # an 'http' context for server_entry in subentry[1]: if _is_include_directive(server_entry): self._parse_recursively(server_entry[1]) def abs_path(self, path): """Converts a relative path to an absolute path relative to the root. Does nothing for paths that are already absolute. :param str path: The path :returns: The absolute path :rtype: str """ if not os.path.isabs(path): return os.path.normpath(os.path.join(self.root, path)) return os.path.normpath(path) def _build_addr_to_ssl(self): """Builds a map from address to whether it listens on ssl in any server block """ servers = self._get_raw_servers() addr_to_ssl = {} # type: Dict[Tuple[str, str], bool] for filename in servers: for server, _ in servers[filename]: # Parse the server block to save addr info parsed_server = _parse_server_raw(server) for addr in parsed_server['addrs']: addr_tuple = addr.normalized_tuple() if addr_tuple not in addr_to_ssl: addr_to_ssl[addr_tuple] = addr.ssl addr_to_ssl[addr_tuple] = addr.ssl or addr_to_ssl[addr_tuple] return addr_to_ssl def _get_raw_servers(self): # pylint: disable=cell-var-from-loop # type: () -> Dict """Get a map of unparsed all server blocks """ servers = {} # type: Dict[str, Union[List, nginxparser.UnspacedList]] for filename in self.parsed: tree = self.parsed[filename] servers[filename] = [] srv = servers[filename] # workaround undefined loop var in lambdas # Find all the server blocks _do_for_subarray(tree, lambda x: len(x) >= 2 and x[0] == ['server'], lambda x, y: srv.append((x[1], y))) # Find 'include' statements in server blocks and append their trees for i, (server, path) in enumerate(servers[filename]): new_server = self._get_included_directives(server) servers[filename][i] = (new_server, path) return servers def get_vhosts(self): """Gets list of all 'virtual hosts' found in Nginx configuration. Technically this is a misnomer because Nginx does not have virtual hosts, it has 'server blocks'. :returns: List of :class:`~certbot_nginx._internal.obj.VirtualHost` objects found in configuration :rtype: list """ enabled = True # We only look at enabled vhosts for now servers = self._get_raw_servers() vhosts = [] for filename in servers: for server, path in servers[filename]: # Parse the server block into a VirtualHost object parsed_server = _parse_server_raw(server) vhost = obj.VirtualHost(filename, parsed_server['addrs'], parsed_server['ssl'], enabled, parsed_server['names'], server, path) vhosts.append(vhost) self._update_vhosts_addrs_ssl(vhosts) return vhosts def _update_vhosts_addrs_ssl(self, vhosts): """Update a list of raw parsed vhosts to include global address sslishness """ addr_to_ssl = self._build_addr_to_ssl() for vhost in vhosts: for addr in vhost.addrs: addr.ssl = addr_to_ssl[addr.normalized_tuple()] if addr.ssl: vhost.ssl = True def _get_included_directives(self, block): """Returns array with the "include" directives expanded out by concatenating the contents of the included file to the block. :param list block: :rtype: list """ result = copy.deepcopy(block) # Copy the list to keep self.parsed idempotent for directive in block: if _is_include_directive(directive): included_files = glob.glob( self.abs_path(directive[1])) for incl in included_files: try: result.extend(self.parsed[incl]) except KeyError: pass return result def _parse_files(self, filepath, override=False): """Parse files from a glob :param str filepath: Nginx config file path :param bool override: Whether to parse a file that has been parsed :returns: list of parsed tree structures :rtype: list """ files = glob.glob(filepath) # nginx on unix calls glob(3) for this # XXX Windows nginx uses FindFirstFile, and # should have a narrower call here trees = [] for item in files: if item in self.parsed and not override: continue try: with open(item) as _file: parsed = nginxparser.load(_file) self.parsed[item] = parsed trees.append(parsed) except IOError: logger.warning("Could not open file: %s", item) except pyparsing.ParseException as err: logger.debug("Could not parse file: %s due to %s", item, err) return trees def _find_config_root(self): """Return the Nginx Configuration Root file.""" location = ['nginx.conf'] for name in location: if os.path.isfile(os.path.join(self.root, name)): return os.path.join(self.root, name) raise errors.NoInstallationError( "Could not find Nginx root configuration file (nginx.conf)") def filedump(self, ext='tmp', lazy=True): """Dumps parsed configurations into files. :param str ext: The file extension to use for the dumped files. If empty, this overrides the existing conf files. :param bool lazy: Only write files that have been modified """ # Best-effort atomicity is enforced above us by reverter.py for filename in self.parsed: tree = self.parsed[filename] if ext: filename = filename + os.path.extsep + ext try: if lazy and not tree.is_dirty(): continue out = nginxparser.dumps(tree) logger.debug('Writing nginx conf tree to %s:\n%s', filename, out) with open(filename, 'w') as _file: _file.write(out) except IOError: logger.error("Could not open file for writing: %s", filename) def parse_server(self, server): """Parses a list of server directives, accounting for global address sslishness. :param list server: list of directives in a server block :rtype: dict """ addr_to_ssl = self._build_addr_to_ssl() parsed_server = _parse_server_raw(server) _apply_global_addr_ssl(addr_to_ssl, parsed_server) return parsed_server def has_ssl_on_directive(self, vhost): """Does vhost have ssl on for all ports? :param :class:`~certbot_nginx._internal.obj.VirtualHost` vhost: The vhost in question :returns: True if 'ssl on' directive is included :rtype: bool """ server = vhost.raw for directive in server: if not directive: continue if _is_ssl_on_directive(directive): return True return False def add_server_directives(self, vhost, directives, insert_at_top=False): """Add directives to the server block identified by vhost. This method modifies vhost to be fully consistent with the new directives. ..note :: It's an error to try and add a nonrepeatable directive that already exists in the config block with a conflicting value. ..todo :: Doesn't match server blocks whose server_name directives are split across multiple conf files. :param :class:`~certbot_nginx._internal.obj.VirtualHost` vhost: The vhost whose information we use to match on :param list directives: The directives to add :param bool insert_at_top: True if the directives need to be inserted at the top of the server block instead of the bottom """ self._modify_server_directives(vhost, functools.partial(_add_directives, directives, insert_at_top)) def update_or_add_server_directives(self, vhost, directives, insert_at_top=False): """Add or replace directives in the server block identified by vhost. This method modifies vhost to be fully consistent with the new directives. ..note :: When a directive with the same name already exists in the config block, the first instance will be replaced. Otherwise, the directive will be appended/prepended to the config block as in add_server_directives. ..todo :: Doesn't match server blocks whose server_name directives are split across multiple conf files. :param :class:`~certbot_nginx._internal.obj.VirtualHost` vhost: The vhost whose information we use to match on :param list directives: The directives to add :param bool insert_at_top: True if the directives need to be inserted at the top of the server block instead of the bottom """ self._modify_server_directives(vhost, functools.partial(_update_or_add_directives, directives, insert_at_top)) def remove_server_directives(self, vhost, directive_name, match_func=None): """Remove all directives of type directive_name. :param :class:`~certbot_nginx._internal.obj.VirtualHost` vhost: The vhost to remove directives from :param string directive_name: The directive type to remove :param callable match_func: Function of the directive that returns true for directives to be deleted. """ self._modify_server_directives(vhost, functools.partial(_remove_directives, directive_name, match_func)) def _update_vhost_based_on_new_directives(self, vhost, directives_list): new_server = self._get_included_directives(directives_list) parsed_server = self.parse_server(new_server) vhost.addrs = parsed_server['addrs'] vhost.ssl = parsed_server['ssl'] vhost.names = parsed_server['names'] vhost.raw = new_server def _modify_server_directives(self, vhost, block_func): filename = vhost.filep try: result = self.parsed[filename] for index in vhost.path: result = result[index] if not isinstance(result, list) or len(result) != 2: raise errors.MisconfigurationError("Not a server block.") result = result[1] block_func(result) self._update_vhost_based_on_new_directives(vhost, result) except errors.MisconfigurationError as err: raise errors.MisconfigurationError("Problem in %s: %s" % (filename, str(err))) def duplicate_vhost(self, vhost_template, remove_singleton_listen_params=False, only_directives=None): """Duplicate the vhost in the configuration files. :param :class:`~certbot_nginx._internal.obj.VirtualHost` vhost_template: The vhost whose information we copy :param bool remove_singleton_listen_params: If we should remove parameters from listen directives in the block that can only be used once per address :param list only_directives: If it exists, only duplicate the named directives. Only looks at first level of depth; does not expand includes. :returns: A vhost object for the newly created vhost :rtype: :class:`~certbot_nginx._internal.obj.VirtualHost` """ # TODO: https://github.com/certbot/certbot/issues/5185 # put it in the same file as the template, at the same level new_vhost = copy.deepcopy(vhost_template) enclosing_block = self.parsed[vhost_template.filep] for index in vhost_template.path[:-1]: enclosing_block = enclosing_block[index] raw_in_parsed = copy.deepcopy(enclosing_block[vhost_template.path[-1]]) if only_directives is not None: new_directives = nginxparser.UnspacedList([]) for directive in raw_in_parsed[1]: if directive and directive[0] in only_directives: new_directives.append(directive) raw_in_parsed[1] = new_directives self._update_vhost_based_on_new_directives(new_vhost, new_directives) enclosing_block.append(raw_in_parsed) new_vhost.path[-1] = len(enclosing_block) - 1 if remove_singleton_listen_params: for addr in new_vhost.addrs: addr.default = False addr.ipv6only = False for directive in enclosing_block[new_vhost.path[-1]][1]: if directive and directive[0] == 'listen': # Exclude one-time use parameters which will cause an error if repeated. # https://nginx.org/en/docs/http/ngx_http_core_module.html#listen exclude = set(('default_server', 'default', 'setfib', 'fastopen', 'backlog', 'rcvbuf', 'sndbuf', 'accept_filter', 'deferred', 'bind', 'ipv6only', 'reuseport', 'so_keepalive')) for param in exclude: # See: github.com/certbot/certbot/pull/6223#pullrequestreview-143019225 keys = [x.split('=')[0] for x in directive] if param in keys: del directive[keys.index(param)] return new_vhost def _parse_ssl_options(ssl_options): if ssl_options is not None: try: with open(ssl_options) as _file: return nginxparser.load(_file) except IOError: logger.warning("Missing NGINX TLS options file: %s", ssl_options) except pyparsing.ParseBaseException as err: logger.debug("Could not parse file: %s due to %s", ssl_options, err) return [] def _do_for_subarray(entry, condition, func, path=None): """Executes a function for a subarray of a nested array if it matches the given condition. :param list entry: The list to iterate over :param function condition: Returns true iff func should be executed on item :param function func: The function to call for each matching item """ if path is None: path = [] if isinstance(entry, list): if condition(entry): func(entry, path) else: for index, item in enumerate(entry): _do_for_subarray(item, condition, func, path + [index]) def get_best_match(target_name, names): """Finds the best match for target_name out of names using the Nginx name-matching rules (exact > longest wildcard starting with * > longest wildcard ending with * > regex). :param str target_name: The name to match :param set names: The candidate server names :returns: Tuple of (type of match, the name that matched) :rtype: tuple """ exact = [] wildcard_start = [] wildcard_end = [] regex = [] for name in names: if _exact_match(target_name, name): exact.append(name) elif _wildcard_match(target_name, name, True): wildcard_start.append(name) elif _wildcard_match(target_name, name, False): wildcard_end.append(name) elif _regex_match(target_name, name): regex.append(name) if exact: # There can be more than one exact match; e.g. eff.org, .eff.org match = min(exact, key=len) return ('exact', match) if wildcard_start: # Return the longest wildcard match = max(wildcard_start, key=len) return ('wildcard_start', match) if wildcard_end: # Return the longest wildcard match = max(wildcard_end, key=len) return ('wildcard_end', match) if regex: # Just return the first one for now match = regex[0] return ('regex', match) return (None, None) def _exact_match(target_name, name): return name in (target_name, '.' + target_name) def _wildcard_match(target_name, name, start): # Degenerate case if name == '*': return True parts = target_name.split('.') match_parts = name.split('.') # If the domain ends in a wildcard, do the match procedure in reverse if not start: parts.reverse() match_parts.reverse() # The first part must be a wildcard or blank, e.g. '.eff.org' first = match_parts.pop(0) if first not in ('*', ''): return False target_name = '.'.join(parts) name = '.'.join(match_parts) # Ex: www.eff.org matches *.eff.org, eff.org does not match *.eff.org return target_name.endswith('.' + name) def _regex_match(target_name, name): # Must start with a tilde if len(name) < 2 or name[0] != '~': return False # After tilde is a perl-compatible regex try: regex = re.compile(name[1:]) return re.match(regex, target_name) except re.error: # pragma: no cover # perl-compatible regexes are sometimes not recognized by python return False def _is_include_directive(entry): """Checks if an nginx parsed entry is an 'include' directive. :param list entry: the parsed entry :returns: Whether it's an 'include' directive :rtype: bool """ return (isinstance(entry, list) and len(entry) == 2 and entry[0] == 'include' and isinstance(entry[1], six.string_types)) def _is_ssl_on_directive(entry): """Checks if an nginx parsed entry is an 'ssl on' directive. :param list entry: the parsed entry :returns: Whether it's an 'ssl on' directive :rtype: bool """ return (isinstance(entry, list) and len(entry) == 2 and entry[0] == 'ssl' and entry[1] == 'on') def _add_directives(directives, insert_at_top, block): """Adds directives to a config block.""" for directive in directives: _add_directive(block, directive, insert_at_top) if block and '\n' not in block[-1]: # could be " \n " or ["\n"] ! block.append(nginxparser.UnspacedList('\n')) def _update_or_add_directives(directives, insert_at_top, block): """Adds or replaces directives in a config block.""" for directive in directives: _update_or_add_directive(block, directive, insert_at_top) if block and '\n' not in block[-1]: # could be " \n " or ["\n"] ! block.append(nginxparser.UnspacedList('\n')) INCLUDE = 'include' REPEATABLE_DIRECTIVES = set(['server_name', 'listen', INCLUDE, 'rewrite', 'add_header']) COMMENT = ' managed by Certbot' COMMENT_BLOCK = [' ', '#', COMMENT] def comment_directive(block, location): """Add a ``#managed by Certbot`` comment to the end of the line at location. :param list block: The block containing the directive to be commented :param int location: The location within ``block`` of the directive to be commented """ next_entry = block[location + 1] if location + 1 < len(block) else None if isinstance(next_entry, list) and next_entry: if len(next_entry) >= 2 and next_entry[-2] == "#" and COMMENT in next_entry[-1]: return if isinstance(next_entry, nginxparser.UnspacedList): next_entry = next_entry.spaced[0] else: next_entry = next_entry[0] block.insert(location + 1, COMMENT_BLOCK[:]) if next_entry is not None and "\n" not in next_entry: block.insert(location + 2, '\n') def _comment_out_directive(block, location, include_location): """Comment out the line at location, with a note of explanation.""" comment_message = ' duplicated in {0}'.format(include_location) # add the end comment # create a dumpable object out of block[location] (so it includes the ;) directive = block[location] new_dir_block = nginxparser.UnspacedList([]) # just a wrapper new_dir_block.append(directive) dumped = nginxparser.dumps(new_dir_block) commented = dumped + ' #' + comment_message # add the comment directly to the one-line string new_dir = nginxparser.loads(commented) # reload into UnspacedList # add the beginning comment insert_location = 0 if new_dir[0].spaced[0] != new_dir[0][0]: # if there's whitespace at the beginning insert_location = 1 new_dir[0].spaced.insert(insert_location, "# ") # comment out the line new_dir[0].spaced.append(";") # directly add in the ;, because now dumping won't work properly dumped = nginxparser.dumps(new_dir) new_dir = nginxparser.loads(dumped) # reload into an UnspacedList block[location] = new_dir[0] # set the now-single-line-comment directive back in place def _find_location(block, directive_name, match_func=None): """Finds the index of the first instance of directive_name in block. If no line exists, use None.""" return next((index for index, line in enumerate(block) \ if line and line[0] == directive_name and (match_func is None or match_func(line))), None) def _is_whitespace_or_comment(directive): """Is this directive either a whitespace or comment directive?""" return len(directive) == 0 or directive[0] == '#' def _add_directive(block, directive, insert_at_top): if not isinstance(directive, nginxparser.UnspacedList): directive = nginxparser.UnspacedList(directive) if _is_whitespace_or_comment(directive): # whitespace or comment block.append(directive) return location = _find_location(block, directive[0]) # Append or prepend directive. Fail if the name is not a repeatable directive name, # and there is already a copy of that directive with a different value # in the config file. # handle flat include files directive_name = directive[0] def can_append(loc, dir_name): """ Can we append this directive to the block? """ return loc is None or (isinstance(dir_name, six.string_types) and dir_name in REPEATABLE_DIRECTIVES) err_fmt = 'tried to insert directive "{0}" but found conflicting "{1}".' # Give a better error message about the specific directive than Nginx's "fail to restart" if directive_name == INCLUDE: # in theory, we might want to do this recursively, but in practice, that's really not # necessary because we know what file we're talking about (and if we don't recurse, we # just give a worse error message) included_directives = _parse_ssl_options(directive[1]) for included_directive in included_directives: included_dir_loc = _find_location(block, included_directive[0]) included_dir_name = included_directive[0] if (not _is_whitespace_or_comment(included_directive) and not can_append(included_dir_loc, included_dir_name)): if block[included_dir_loc] != included_directive: raise errors.MisconfigurationError(err_fmt.format(included_directive, block[included_dir_loc])) _comment_out_directive(block, included_dir_loc, directive[1]) if can_append(location, directive_name): if insert_at_top: # Add a newline so the comment doesn't comment # out existing directives block.insert(0, nginxparser.UnspacedList('\n')) block.insert(0, directive) comment_directive(block, 0) else: block.append(directive) comment_directive(block, len(block) - 1) elif block[location] != directive: raise errors.MisconfigurationError(err_fmt.format(directive, block[location])) def _update_directive(block, directive, location): block[location] = directive comment_directive(block, location) def _update_or_add_directive(block, directive, insert_at_top): if not isinstance(directive, nginxparser.UnspacedList): directive = nginxparser.UnspacedList(directive) if _is_whitespace_or_comment(directive): # whitespace or comment block.append(directive) return location = _find_location(block, directive[0]) # we can update directive if location is not None: _update_directive(block, directive, location) return _add_directive(block, directive, insert_at_top) def _is_certbot_comment(directive): return '#' in directive and COMMENT in directive def _remove_directives(directive_name, match_func, block): """Removes directives of name directive_name from a config block if match_func matches. """ while True: location = _find_location(block, directive_name, match_func=match_func) if location is None: return # if the directive was made by us, remove the comment following if location + 1 < len(block) and _is_certbot_comment(block[location + 1]): del block[location + 1] del block[location] def _apply_global_addr_ssl(addr_to_ssl, parsed_server): """Apply global sslishness information to the parsed server block """ for addr in parsed_server['addrs']: addr.ssl = addr_to_ssl[addr.normalized_tuple()] if addr.ssl: parsed_server['ssl'] = True def _parse_server_raw(server): """Parses a list of server directives. :param list server: list of directives in a server block :rtype: dict """ addrs = set() # type: Set[obj.Addr] ssl = False # type: bool names = set() # type: Set[str] apply_ssl_to_all_addrs = False for directive in server: if not directive: continue if directive[0] == 'listen': addr = obj.Addr.fromstring(" ".join(directive[1:])) if addr: addrs.add(addr) if addr.ssl: ssl = True elif directive[0] == 'server_name': names.update(x.strip('"\'') for x in directive[1:]) elif _is_ssl_on_directive(directive): ssl = True apply_ssl_to_all_addrs = True if apply_ssl_to_all_addrs: for addr in addrs: addr.ssl = True return { 'addrs': addrs, 'ssl': ssl, 'names': names }
38.903141
98
0.625866
import copy import functools import glob import logging import re import pyparsing import six from acme.magic_typing import Dict from acme.magic_typing import List from acme.magic_typing import Set from acme.magic_typing import Tuple from acme.magic_typing import Union from certbot import errors from certbot.compat import os from certbot_nginx._internal import nginxparser from certbot_nginx._internal import obj logger = logging.getLogger(__name__) class NginxParser(object): def __init__(self, root): self.parsed = {} self.root = os.path.abspath(root) self.config_root = self._find_config_root() self.load() def load(self): self.parsed = {} self._parse_recursively(self.config_root) def _parse_recursively(self, filepath): filepath = self.abs_path(filepath) trees = self._parse_files(filepath) for tree in trees: for entry in tree: if _is_include_directive(entry): self._parse_recursively(entry[1]) elif entry[0] == ['http'] or entry[0] == ['server']: for subentry in entry[1]: if _is_include_directive(subentry): self._parse_recursively(subentry[1]) elif entry[0] == ['http'] and subentry[0] == ['server']: for server_entry in subentry[1]: if _is_include_directive(server_entry): self._parse_recursively(server_entry[1]) def abs_path(self, path): if not os.path.isabs(path): return os.path.normpath(os.path.join(self.root, path)) return os.path.normpath(path) def _build_addr_to_ssl(self): servers = self._get_raw_servers() addr_to_ssl = {} for filename in servers: for server, _ in servers[filename]: parsed_server = _parse_server_raw(server) for addr in parsed_server['addrs']: addr_tuple = addr.normalized_tuple() if addr_tuple not in addr_to_ssl: addr_to_ssl[addr_tuple] = addr.ssl addr_to_ssl[addr_tuple] = addr.ssl or addr_to_ssl[addr_tuple] return addr_to_ssl def _get_raw_servers(self): servers = {} for filename in self.parsed: tree = self.parsed[filename] servers[filename] = [] srv = servers[filename] _do_for_subarray(tree, lambda x: len(x) >= 2 and x[0] == ['server'], lambda x, y: srv.append((x[1], y))) for i, (server, path) in enumerate(servers[filename]): new_server = self._get_included_directives(server) servers[filename][i] = (new_server, path) return servers def get_vhosts(self): enabled = True servers = self._get_raw_servers() vhosts = [] for filename in servers: for server, path in servers[filename]: parsed_server = _parse_server_raw(server) vhost = obj.VirtualHost(filename, parsed_server['addrs'], parsed_server['ssl'], enabled, parsed_server['names'], server, path) vhosts.append(vhost) self._update_vhosts_addrs_ssl(vhosts) return vhosts def _update_vhosts_addrs_ssl(self, vhosts): addr_to_ssl = self._build_addr_to_ssl() for vhost in vhosts: for addr in vhost.addrs: addr.ssl = addr_to_ssl[addr.normalized_tuple()] if addr.ssl: vhost.ssl = True def _get_included_directives(self, block): result = copy.deepcopy(block) for directive in block: if _is_include_directive(directive): included_files = glob.glob( self.abs_path(directive[1])) for incl in included_files: try: result.extend(self.parsed[incl]) except KeyError: pass return result def _parse_files(self, filepath, override=False): files = glob.glob(filepath) trees = [] for item in files: if item in self.parsed and not override: continue try: with open(item) as _file: parsed = nginxparser.load(_file) self.parsed[item] = parsed trees.append(parsed) except IOError: logger.warning("Could not open file: %s", item) except pyparsing.ParseException as err: logger.debug("Could not parse file: %s due to %s", item, err) return trees def _find_config_root(self): location = ['nginx.conf'] for name in location: if os.path.isfile(os.path.join(self.root, name)): return os.path.join(self.root, name) raise errors.NoInstallationError( "Could not find Nginx root configuration file (nginx.conf)") def filedump(self, ext='tmp', lazy=True): for filename in self.parsed: tree = self.parsed[filename] if ext: filename = filename + os.path.extsep + ext try: if lazy and not tree.is_dirty(): continue out = nginxparser.dumps(tree) logger.debug('Writing nginx conf tree to %s:\n%s', filename, out) with open(filename, 'w') as _file: _file.write(out) except IOError: logger.error("Could not open file for writing: %s", filename) def parse_server(self, server): addr_to_ssl = self._build_addr_to_ssl() parsed_server = _parse_server_raw(server) _apply_global_addr_ssl(addr_to_ssl, parsed_server) return parsed_server def has_ssl_on_directive(self, vhost): server = vhost.raw for directive in server: if not directive: continue if _is_ssl_on_directive(directive): return True return False def add_server_directives(self, vhost, directives, insert_at_top=False): self._modify_server_directives(vhost, functools.partial(_add_directives, directives, insert_at_top)) def update_or_add_server_directives(self, vhost, directives, insert_at_top=False): self._modify_server_directives(vhost, functools.partial(_update_or_add_directives, directives, insert_at_top)) def remove_server_directives(self, vhost, directive_name, match_func=None): self._modify_server_directives(vhost, functools.partial(_remove_directives, directive_name, match_func)) def _update_vhost_based_on_new_directives(self, vhost, directives_list): new_server = self._get_included_directives(directives_list) parsed_server = self.parse_server(new_server) vhost.addrs = parsed_server['addrs'] vhost.ssl = parsed_server['ssl'] vhost.names = parsed_server['names'] vhost.raw = new_server def _modify_server_directives(self, vhost, block_func): filename = vhost.filep try: result = self.parsed[filename] for index in vhost.path: result = result[index] if not isinstance(result, list) or len(result) != 2: raise errors.MisconfigurationError("Not a server block.") result = result[1] block_func(result) self._update_vhost_based_on_new_directives(vhost, result) except errors.MisconfigurationError as err: raise errors.MisconfigurationError("Problem in %s: %s" % (filename, str(err))) def duplicate_vhost(self, vhost_template, remove_singleton_listen_params=False, only_directives=None): new_vhost = copy.deepcopy(vhost_template) enclosing_block = self.parsed[vhost_template.filep] for index in vhost_template.path[:-1]: enclosing_block = enclosing_block[index] raw_in_parsed = copy.deepcopy(enclosing_block[vhost_template.path[-1]]) if only_directives is not None: new_directives = nginxparser.UnspacedList([]) for directive in raw_in_parsed[1]: if directive and directive[0] in only_directives: new_directives.append(directive) raw_in_parsed[1] = new_directives self._update_vhost_based_on_new_directives(new_vhost, new_directives) enclosing_block.append(raw_in_parsed) new_vhost.path[-1] = len(enclosing_block) - 1 if remove_singleton_listen_params: for addr in new_vhost.addrs: addr.default = False addr.ipv6only = False for directive in enclosing_block[new_vhost.path[-1]][1]: if directive and directive[0] == 'listen': exclude = set(('default_server', 'default', 'setfib', 'fastopen', 'backlog', 'rcvbuf', 'sndbuf', 'accept_filter', 'deferred', 'bind', 'ipv6only', 'reuseport', 'so_keepalive')) for param in exclude: s = [x.split('=')[0] for x in directive] if param in keys: del directive[keys.index(param)] return new_vhost def _parse_ssl_options(ssl_options): if ssl_options is not None: try: with open(ssl_options) as _file: return nginxparser.load(_file) except IOError: logger.warning("Missing NGINX TLS options file: %s", ssl_options) except pyparsing.ParseBaseException as err: logger.debug("Could not parse file: %s due to %s", ssl_options, err) return [] def _do_for_subarray(entry, condition, func, path=None): if path is None: path = [] if isinstance(entry, list): if condition(entry): func(entry, path) else: for index, item in enumerate(entry): _do_for_subarray(item, condition, func, path + [index]) def get_best_match(target_name, names): exact = [] wildcard_start = [] wildcard_end = [] regex = [] for name in names: if _exact_match(target_name, name): exact.append(name) elif _wildcard_match(target_name, name, True): wildcard_start.append(name) elif _wildcard_match(target_name, name, False): wildcard_end.append(name) elif _regex_match(target_name, name): regex.append(name) if exact: match = min(exact, key=len) return ('exact', match) if wildcard_start: match = max(wildcard_start, key=len) return ('wildcard_start', match) if wildcard_end: match = max(wildcard_end, key=len) return ('wildcard_end', match) if regex: match = regex[0] return ('regex', match) return (None, None) def _exact_match(target_name, name): return name in (target_name, '.' + target_name) def _wildcard_match(target_name, name, start): if name == '*': return True parts = target_name.split('.') match_parts = name.split('.') if not start: parts.reverse() match_parts.reverse() first = match_parts.pop(0) if first not in ('*', ''): return False target_name = '.'.join(parts) name = '.'.join(match_parts) return target_name.endswith('.' + name) def _regex_match(target_name, name): if len(name) < 2 or name[0] != '~': return False try: regex = re.compile(name[1:]) return re.match(regex, target_name) except re.error: return False def _is_include_directive(entry): return (isinstance(entry, list) and len(entry) == 2 and entry[0] == 'include' and isinstance(entry[1], six.string_types)) def _is_ssl_on_directive(entry): return (isinstance(entry, list) and len(entry) == 2 and entry[0] == 'ssl' and entry[1] == 'on') def _add_directives(directives, insert_at_top, block): for directive in directives: _add_directive(block, directive, insert_at_top) if block and '\n' not in block[-1]: block.append(nginxparser.UnspacedList('\n')) def _update_or_add_directives(directives, insert_at_top, block): for directive in directives: _update_or_add_directive(block, directive, insert_at_top) if block and '\n' not in block[-1]: block.append(nginxparser.UnspacedList('\n')) INCLUDE = 'include' REPEATABLE_DIRECTIVES = set(['server_name', 'listen', INCLUDE, 'rewrite', 'add_header']) COMMENT = ' managed by Certbot' COMMENT_BLOCK = [' ', '#', COMMENT] def comment_directive(block, location): next_entry = block[location + 1] if location + 1 < len(block) else None if isinstance(next_entry, list) and next_entry: if len(next_entry) >= 2 and next_entry[-2] == "#" and COMMENT in next_entry[-1]: return if isinstance(next_entry, nginxparser.UnspacedList): next_entry = next_entry.spaced[0] else: next_entry = next_entry[0] block.insert(location + 1, COMMENT_BLOCK[:]) if next_entry is not None and "\n" not in next_entry: block.insert(location + 2, '\n') def _comment_out_directive(block, location, include_location): comment_message = ' duplicated in {0}'.format(include_location) directive = block[location] new_dir_block = nginxparser.UnspacedList([]) new_dir_block.append(directive) dumped = nginxparser.dumps(new_dir_block) commented = dumped + ' #' + comment_message new_dir = nginxparser.loads(commented) insert_location = 0 if new_dir[0].spaced[0] != new_dir[0][0]: insert_location = 1 new_dir[0].spaced.insert(insert_location, "# ") # comment out the line new_dir[0].spaced.append(";") # directly add in the ;, because now dumping won't work properly dumped = nginxparser.dumps(new_dir) new_dir = nginxparser.loads(dumped) block[location] = new_dir[0] def _find_location(block, directive_name, match_func=None): return next((index for index, line in enumerate(block) \ if line and line[0] == directive_name and (match_func is None or match_func(line))), None) def _is_whitespace_or_comment(directive): return len(directive) == 0 or directive[0] == '#' def _add_directive(block, directive, insert_at_top): if not isinstance(directive, nginxparser.UnspacedList): directive = nginxparser.UnspacedList(directive) if _is_whitespace_or_comment(directive): block.append(directive) return location = _find_location(block, directive[0]) directive_name = directive[0] def can_append(loc, dir_name): return loc is None or (isinstance(dir_name, six.string_types) and dir_name in REPEATABLE_DIRECTIVES) err_fmt = 'tried to insert directive "{0}" but found conflicting "{1}".' if directive_name == INCLUDE: # in theory, we might want to do this recursively, but in practice, that's really not included_directives = _parse_ssl_options(directive[1]) for included_directive in included_directives: included_dir_loc = _find_location(block, included_directive[0]) included_dir_name = included_directive[0] if (not _is_whitespace_or_comment(included_directive) and not can_append(included_dir_loc, included_dir_name)): if block[included_dir_loc] != included_directive: raise errors.MisconfigurationError(err_fmt.format(included_directive, block[included_dir_loc])) _comment_out_directive(block, included_dir_loc, directive[1]) if can_append(location, directive_name): if insert_at_top: # out existing directives block.insert(0, nginxparser.UnspacedList('\n')) block.insert(0, directive) comment_directive(block, 0) else: block.append(directive) comment_directive(block, len(block) - 1) elif block[location] != directive: raise errors.MisconfigurationError(err_fmt.format(directive, block[location])) def _update_directive(block, directive, location): block[location] = directive comment_directive(block, location) def _update_or_add_directive(block, directive, insert_at_top): if not isinstance(directive, nginxparser.UnspacedList): directive = nginxparser.UnspacedList(directive) if _is_whitespace_or_comment(directive): # whitespace or comment block.append(directive) return location = _find_location(block, directive[0]) # we can update directive if location is not None: _update_directive(block, directive, location) return _add_directive(block, directive, insert_at_top) def _is_certbot_comment(directive): return ' def _remove_directives(directive_name, match_func, block): while True: location = _find_location(block, directive_name, match_func=match_func) if location is None: return # if the directive was made by us, remove the comment following if location + 1 < len(block) and _is_certbot_comment(block[location + 1]): del block[location + 1] del block[location] def _apply_global_addr_ssl(addr_to_ssl, parsed_server): for addr in parsed_server['addrs']: addr.ssl = addr_to_ssl[addr.normalized_tuple()] if addr.ssl: parsed_server['ssl'] = True def _parse_server_raw(server): addrs = set() # type: Set[obj.Addr] ssl = False # type: bool names = set() # type: Set[str] apply_ssl_to_all_addrs = False for directive in server: if not directive: continue if directive[0] == 'listen': addr = obj.Addr.fromstring(" ".join(directive[1:])) if addr: addrs.add(addr) if addr.ssl: ssl = True elif directive[0] == 'server_name': names.update(x.strip('"\'') for x in directive[1:]) elif _is_ssl_on_directive(directive): ssl = True apply_ssl_to_all_addrs = True if apply_ssl_to_all_addrs: for addr in addrs: addr.ssl = True return { 'addrs': addrs, 'ssl': ssl, 'names': names }
true
true
f71d7c6696990d261b06073315046765fa6f1c50
2,131
py
Python
src/predict-binary.py
accordinglyto/dferte
d4b8449c1633973dc538c9e72aca5d37802a4ee4
[ "MIT" ]
null
null
null
src/predict-binary.py
accordinglyto/dferte
d4b8449c1633973dc538c9e72aca5d37802a4ee4
[ "MIT" ]
8
2020-11-13T18:55:17.000Z
2022-03-12T00:34:40.000Z
src/predict-binary.py
accordinglyto/dferte
d4b8449c1633973dc538c9e72aca5d37802a4ee4
[ "MIT" ]
null
null
null
import os import numpy as np #os.environ["KERAS_BACKEND"] = "plaidml.keras.backend" from keras.preprocessing.image import ImageDataGenerator, load_img, img_to_array from keras.models import Sequential, load_model img_width, img_height = 48, 48 model_path = '../src/models/model.h5' weights_path = '../src/models/weights' model = load_model(model_path) test_path = '../data/test' def predict(file): x = load_img(file, target_size=(img_width,img_height)) x = img_to_array(x) x = np.expand_dims(x, axis=0) array = model.predict(x) result = array[0] if result[0] > result[1]: if result[0] > 0.9: print("Predicted answer: Buy") answer = 'buy' print(result) print(array) else: print("Predicted answer: Not confident") answer = 'n/a' print(result) else: if result[1] > 0.9: print("Predicted answer: Sell") answer = 'sell' print(result) else: print("Predicted answer: Not confident") answer = 'n/a' print(result) return answer tb = 0 ts = 0 fb = 0 fs = 0 na = 0 for i, ret in enumerate(os.walk(test_path + '/buy')): for i, filename in enumerate(ret[2]): if filename.startswith("."): continue print("Label: buy") result = predict(ret[0] + '/' + filename) if result == "buy": tb += 1 elif result == 'n/a': print('no action') na += 1 else: fb += 1 for i, ret in enumerate(os.walk(test_path + '/sell')): for i, filename in enumerate(ret[2]): if filename.startswith("."): continue print("Label: sell") result = predict(ret[0] + '/' + filename) if result == "sell": ts += 1 elif result == 'n/a': print('no action') na += 1 else: fs += 1 """ Check metrics """ print("True buy: ", tb) print("True sell: ", ts) print("False buy: ", fb) # important print("False sell: ", fs) print("No action", na) precision = (tb+ts) / (tb + ts + fb + fs) recall = tb / (tb + fs) print("Precision: ", precision) print("Recall: ", recall) f_measure = (2 * recall * precision) / (recall + precision) print("F-measure: ", f_measure)
22.670213
80
0.602065
import os import numpy as np from keras.preprocessing.image import ImageDataGenerator, load_img, img_to_array from keras.models import Sequential, load_model img_width, img_height = 48, 48 model_path = '../src/models/model.h5' weights_path = '../src/models/weights' model = load_model(model_path) test_path = '../data/test' def predict(file): x = load_img(file, target_size=(img_width,img_height)) x = img_to_array(x) x = np.expand_dims(x, axis=0) array = model.predict(x) result = array[0] if result[0] > result[1]: if result[0] > 0.9: print("Predicted answer: Buy") answer = 'buy' print(result) print(array) else: print("Predicted answer: Not confident") answer = 'n/a' print(result) else: if result[1] > 0.9: print("Predicted answer: Sell") answer = 'sell' print(result) else: print("Predicted answer: Not confident") answer = 'n/a' print(result) return answer tb = 0 ts = 0 fb = 0 fs = 0 na = 0 for i, ret in enumerate(os.walk(test_path + '/buy')): for i, filename in enumerate(ret[2]): if filename.startswith("."): continue print("Label: buy") result = predict(ret[0] + '/' + filename) if result == "buy": tb += 1 elif result == 'n/a': print('no action') na += 1 else: fb += 1 for i, ret in enumerate(os.walk(test_path + '/sell')): for i, filename in enumerate(ret[2]): if filename.startswith("."): continue print("Label: sell") result = predict(ret[0] + '/' + filename) if result == "sell": ts += 1 elif result == 'n/a': print('no action') na += 1 else: fs += 1 print("True buy: ", tb) print("True sell: ", ts) print("False buy: ", fb) print("False sell: ", fs) print("No action", na) precision = (tb+ts) / (tb + ts + fb + fs) recall = tb / (tb + fs) print("Precision: ", precision) print("Recall: ", recall) f_measure = (2 * recall * precision) / (recall + precision) print("F-measure: ", f_measure)
true
true
f71d7ce1e66742abde39bb83f3025bb50e93bbb1
56,871
py
Python
src/python/tests/core/bot/tasks/fuzz_task_test.py
vschs007/clusterfuzz
4b5e825abcd80d81d734a69b7457df59a6a9aa6e
[ "Apache-2.0" ]
null
null
null
src/python/tests/core/bot/tasks/fuzz_task_test.py
vschs007/clusterfuzz
4b5e825abcd80d81d734a69b7457df59a6a9aa6e
[ "Apache-2.0" ]
null
null
null
src/python/tests/core/bot/tasks/fuzz_task_test.py
vschs007/clusterfuzz
4b5e825abcd80d81d734a69b7457df59a6a9aa6e
[ "Apache-2.0" ]
null
null
null
# Copyright 2019 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """fuzz_task tests.""" # pylint: disable=protected-access from builtins import object from builtins import range import datetime import mock import os import parameterized import shutil import tempfile import time import unittest from pyfakefs import fake_filesystem_unittest import six from base import utils from bot import testcase_manager from bot.fuzzers import engine from bot.fuzzers.libFuzzer import engine as libfuzzer_engine from bot.tasks import fuzz_task from bot.untrusted_runner import file_host from build_management import build_manager from chrome import crash_uploader from crash_analysis.stack_parsing import stack_analyzer from datastore import data_handler from datastore import data_types from datastore import ndb from google_cloud_utils import big_query from metrics import monitor from metrics import monitoring_metrics from system import environment from tests.test_libs import helpers from tests.test_libs import test_utils from tests.test_libs import untrusted_runner_helpers class TrackFuzzerRunResultTest(unittest.TestCase): """Test _track_fuzzer_run_result.""" def setUp(self): monitor.metrics_store().reset_for_testing() def test_fuzzer_run_result(self): """Ensure _track_fuzzer_run_result set the right metrics.""" fuzz_task._track_fuzzer_run_result('name', 10, 100, 2) fuzz_task._track_fuzzer_run_result('name', 100, 200, 2) fuzz_task._track_fuzzer_run_result('name', 1000, 2000, 2) fuzz_task._track_fuzzer_run_result('name', 1000, 500, 0) fuzz_task._track_fuzzer_run_result('name', 0, 1000, -1) fuzz_task._track_fuzzer_run_result('name', 0, 0, 2) self.assertEqual( 4, monitoring_metrics.FUZZER_RETURN_CODE_COUNT.get({ 'fuzzer': 'name', 'return_code': 2 })) self.assertEqual( 1, monitoring_metrics.FUZZER_RETURN_CODE_COUNT.get({ 'fuzzer': 'name', 'return_code': 0 })) self.assertEqual( 1, monitoring_metrics.FUZZER_RETURN_CODE_COUNT.get({ 'fuzzer': 'name', 'return_code': -1 })) testcase_count_ratio = ( monitoring_metrics.FUZZER_TESTCASE_COUNT_RATIO.get({ 'fuzzer': 'name' })) self.assertEqual(3.1, testcase_count_ratio.sum) self.assertEqual(5, testcase_count_ratio.count) expected_buckets = [0 for _ in range(22)] expected_buckets[1] = 1 expected_buckets[3] = 1 expected_buckets[11] = 2 expected_buckets[21] = 1 self.assertListEqual(expected_buckets, testcase_count_ratio.buckets) class TrackBuildRunResultTest(unittest.TestCase): """Test _track_build_run_result.""" def setUp(self): monitor.metrics_store().reset_for_testing() def test_build_run_result(self): """Ensure _track_build_run_result set the right metrics.""" fuzz_task._track_build_run_result('name', 10000, True) fuzz_task._track_build_run_result('name', 10001, True) fuzz_task._track_build_run_result('name', 10002, False) self.assertEqual( 2, monitoring_metrics.JOB_BAD_BUILD_COUNT.get({ 'job': 'name', 'bad_build': True })) self.assertEqual( 1, monitoring_metrics.JOB_BAD_BUILD_COUNT.get({ 'job': 'name', 'bad_build': False })) class TrackTestcaseRunResultTest(unittest.TestCase): """Test _track_testcase_run_result.""" def setUp(self): monitor.metrics_store().reset_for_testing() def test_testcase_run_result(self): """Ensure _track_testcase_run_result sets the right metrics.""" fuzz_task._track_testcase_run_result('fuzzer', 'job', 2, 5) fuzz_task._track_testcase_run_result('fuzzer', 'job', 5, 10) self.assertEqual(7, monitoring_metrics.JOB_NEW_CRASH_COUNT.get({ 'job': 'job' })) self.assertEqual( 15, monitoring_metrics.JOB_KNOWN_CRASH_COUNT.get({ 'job': 'job' })) self.assertEqual( 7, monitoring_metrics.FUZZER_NEW_CRASH_COUNT.get({ 'fuzzer': 'fuzzer' })) self.assertEqual( 15, monitoring_metrics.FUZZER_KNOWN_CRASH_COUNT.get({ 'fuzzer': 'fuzzer' })) class TruncateFuzzerOutputTest(unittest.TestCase): """Truncate fuzzer output tests.""" def test_no_truncation(self): """No truncation.""" self.assertEqual('aaaa', fuzz_task.truncate_fuzzer_output('aaaa', 10)) def test_truncation(self): """Truncate.""" self.assertEqual( '123456\n...truncated...\n54321', fuzz_task.truncate_fuzzer_output( '123456xxxxxxxxxxxxxxxxxxxxxxxxxxx54321', 28)) def test_error(self): """Error if limit is too low.""" with self.assertRaises(AssertionError): self.assertEqual( '', fuzz_task.truncate_fuzzer_output('123456xxxxxx54321', 10)) class TrackFuzzTimeTest(unittest.TestCase): """Test _TrackFuzzTime.""" def setUp(self): monitor.metrics_store().reset_for_testing() def _test(self, timeout): """Test helper.""" time_module = helpers.MockTime() with fuzz_task._TrackFuzzTime('fuzzer', 'job', time_module) as tracker: time_module.advance(5) tracker.timeout = timeout fuzzer_total_time = monitoring_metrics.FUZZER_TOTAL_FUZZ_TIME.get({ 'fuzzer': 'fuzzer', 'timeout': timeout }) self.assertEqual(5, fuzzer_total_time) def test_success(self): """Test report metrics.""" self._test(False) def test_timeout(self): """Test timeout.""" self._test(True) class GetFuzzerMetadataFromOutputTest(unittest.TestCase): """Test get_fuzzer_metadata_from_output.""" def test_no_metadata(self): """Tests no metadata in output.""" data = 'abc\ndef\n123123' self.assertDictEqual(fuzz_task.get_fuzzer_metadata_from_output(data), {}) data = '' self.assertDictEqual(fuzz_task.get_fuzzer_metadata_from_output(data), {}) def test_metadata(self): """Tests parsing of metadata.""" data = ('abc\n' 'def\n' 'metadata:invalid: invalid\n' 'metadat::invalid: invalid\n' 'metadata::foo: bar\n' '123123\n' 'metadata::blah: 1\n' 'metadata::test:abcd\n' 'metadata::test2: def\n') self.assertDictEqual( fuzz_task.get_fuzzer_metadata_from_output(data), { 'blah': '1', 'test': 'abcd', 'test2': 'def', 'foo': 'bar' }) class GetRegressionTest(unittest.TestCase): """Test get_regression.""" def setUp(self): helpers.patch(self, ['build_management.build_manager.is_custom_binary']) def test_one_time_crasher(self): """Test when one_time_crasher_flag is True.""" self.mock.is_custom_binary.return_value = False self.assertEqual('NA', fuzz_task.get_regression(True)) def test_custom_binary(self): """Test for custom binary.""" self.mock.is_custom_binary.return_value = True self.assertEqual('NA', fuzz_task.get_regression(False)) def test_reproducible_non_custom_binary(self): """Test for reproducible non-custom binary.""" self.mock.is_custom_binary.return_value = False self.assertEqual('', fuzz_task.get_regression(False)) class GetFixedOrMinimizedKeyTest(unittest.TestCase): """Test get_fixed_or_minimized_key.""" def test_one_time_crasher(self): """Test when one_time_crasher_flag is True.""" self.assertEqual('NA', fuzz_task.get_fixed_or_minimized_key(True)) def test_reproducible(self): """Test for reproducible.""" self.assertEqual('', fuzz_task.get_fixed_or_minimized_key(False)) class CrashInitTest(fake_filesystem_unittest.TestCase): """Test Crash.__init__.""" def setUp(self): helpers.patch(self, [ 'chrome.crash_uploader.FileMetadataInfo', 'bot.tasks.setup.archive_testcase_and_dependencies_in_gcs', 'crash_analysis.stack_parsing.stack_analyzer.get_crash_data', 'bot.testcase_manager.get_additional_command_line_flags', 'bot.testcase_manager.get_command_line_for_application', 'base.utils.get_crash_stacktrace_output', 'crash_analysis.crash_analyzer.ignore_stacktrace', 'crash_analysis.crash_analyzer.is_security_issue', ]) helpers.patch_environ(self) test_utils.set_up_pyfakefs(self) self.mock.get_command_line_for_application.return_value = 'cmd' dummy_state = stack_analyzer.StackAnalyzerState() dummy_state.crash_type = 'type' dummy_state.crash_address = 'address' dummy_state.crash_state = 'state' dummy_state.crash_stacktrace = 'orig_trace' dummy_state.frames = ['frame 1', 'frame 2'] self.mock.get_crash_data.return_value = dummy_state self.mock.get_crash_stacktrace_output.return_value = 'trace' self.mock.archive_testcase_and_dependencies_in_gcs.return_value = ( 'fuzzed_key', True, 'absolute_path', 'archive_filename') environment.set_value('FILTER_FUNCTIONAL_BUGS', False) with open('/stack_file_path', 'w') as f: f.write('unsym') def test_error(self): """Test failing to reading stacktrace file.""" crash = fuzz_task.Crash.from_testcase_manager_crash( testcase_manager.Crash('dir/path-http-name', 123, 11, ['res'], 'ges', '/no_stack_file')) self.assertIsNone(crash) def _test_crash(self, should_be_ignored, security_flag): """Test crash.""" self.mock.get_command_line_for_application.reset_mock() self.mock.get_crash_data.reset_mock() self.mock.get_crash_stacktrace_output.reset_mock() self.mock.is_security_issue.reset_mock() self.mock.ignore_stacktrace.reset_mock() self.mock.is_security_issue.return_value = security_flag self.mock.ignore_stacktrace.return_value = should_be_ignored crash = fuzz_task.Crash.from_testcase_manager_crash( testcase_manager.Crash('dir/path-http-name', 123, 11, ['res'], 'ges', '/stack_file_path')) self.assertEqual('dir/path-http-name', crash.file_path) self.assertEqual(123, crash.crash_time) self.assertEqual(11, crash.return_code) self.assertListEqual(['res'], crash.resource_list) self.assertEqual('ges', crash.gestures) self.assertEqual('path-http-name', crash.filename) self.assertTrue(crash.http_flag) self.assertEqual('cmd', crash.application_command_line) self.mock.get_command_line_for_application.assert_called_once_with( 'dir/path-http-name', needs_http=True) self.assertEqual('unsym', crash.unsymbolized_crash_stacktrace) self.assertEqual('type', crash.crash_type) self.assertEqual('address', crash.crash_address) self.assertEqual('state', crash.crash_state) self.assertListEqual(['frame 1', 'frame 2'], crash.crash_frames) self.mock.get_crash_data.assert_called_once_with('unsym') self.assertEqual('trace', crash.crash_stacktrace) self.mock.get_crash_stacktrace_output.assert_called_once_with( 'cmd', 'orig_trace', 'unsym') self.assertEqual(security_flag, crash.security_flag) self.mock.is_security_issue.assert_called_once_with('unsym', 'type', 'address') self.assertEqual('type,state,%s' % security_flag, crash.key) self.assertEqual(should_be_ignored, crash.should_be_ignored) self.mock.ignore_stacktrace.assert_called_once_with('orig_trace') self.assertFalse(hasattr(crash, 'fuzzed_key')) return crash def _test_validity_and_get_functional_crash(self): """Test validity of different crashes and return functional crash.""" security_crash = self._test_crash( should_be_ignored=False, security_flag=True) self.assertIsNone(security_crash.get_error()) self.assertTrue(security_crash.is_valid()) ignored_crash = self._test_crash(should_be_ignored=True, security_flag=True) self.assertIn('False crash', ignored_crash.get_error()) self.assertFalse(ignored_crash.is_valid()) functional_crash = self._test_crash( should_be_ignored=False, security_flag=False) return functional_crash def test_valid_functional_bug(self): """Test valid because of functional bug.""" functional_crash = self._test_validity_and_get_functional_crash() self.assertIsNone(functional_crash.get_error()) self.assertTrue(functional_crash.is_valid()) def test_invalid_functional_bug(self): """Test invalid because of functional bug.""" environment.set_value('FILTER_FUNCTIONAL_BUGS', True) functional_crash = self._test_validity_and_get_functional_crash() self.assertIn('Functional crash', functional_crash.get_error()) self.assertFalse(functional_crash.is_valid()) def test_hydrate_fuzzed_key(self): """Test hydrating fuzzed_key.""" crash = self._test_crash(should_be_ignored=False, security_flag=True) self.assertFalse(crash.is_archived()) self.assertIsNone(crash.get_error()) self.assertTrue(crash.is_valid()) crash.archive_testcase_in_blobstore() self.assertTrue(crash.is_archived()) self.assertIsNone(crash.get_error()) self.assertTrue(crash.is_valid()) self.assertEqual('fuzzed_key', crash.fuzzed_key) self.assertTrue(crash.archived) self.assertEqual('absolute_path', crash.absolute_path) self.assertEqual('archive_filename', crash.archive_filename) def test_hydrate_fuzzed_key_failure(self): """Test fail to hydrate fuzzed_key.""" self.mock.archive_testcase_and_dependencies_in_gcs.return_value = (None, False, None, None) crash = self._test_crash(should_be_ignored=False, security_flag=True) self.assertFalse(crash.is_archived()) self.assertIsNone(crash.get_error()) self.assertTrue(crash.is_valid()) crash.archive_testcase_in_blobstore() self.assertTrue(crash.is_archived()) self.assertIn('Unable to store testcase in blobstore', crash.get_error()) self.assertFalse(crash.is_valid()) self.assertIsNone(crash.fuzzed_key) self.assertFalse(crash.archived) self.assertIsNone(crash.absolute_path) self.assertIsNone(crash.archive_filename) def test_args_from_testcase_manager(self): """Test args from testcase_manager.Crash.""" testcase_manager_crash = testcase_manager.Crash('path', 0, 0, [], [], '/stack_file_path') self.mock.get_additional_command_line_flags.return_value = 'minimized' environment.set_value('APP_ARGS', 'app') crash = fuzz_task.Crash.from_testcase_manager_crash(testcase_manager_crash) self.assertEqual('app minimized', crash.arguments) class CrashGroupTest(unittest.TestCase): """Test CrashGroup.""" def setUp(self): helpers.patch(self, [ 'bot.tasks.fuzz_task.find_main_crash', 'datastore.data_handler.find_testcase', 'datastore.data_handler.get_project_name', ]) self.mock.get_project_name.return_value = 'some_project' self.crashes = [self._make_crash('g1'), self._make_crash('g2')] self.context = mock.MagicMock( test_timeout=99, fuzzer_name='test', fuzz_target=None) self.reproducible_testcase = self._make_testcase( project_name='some_project', bug_information='', one_time_crasher_flag=False) self.unreproducible_testcase = self._make_testcase( project_name='some_project', bug_information='', one_time_crasher_flag=True) def _make_crash(self, gestures): crash = mock.MagicMock( crash_type='type', crash_state='state', security_flag=True, file_path='file_path', http_flag=True, gestures=gestures) return crash def _make_testcase(self, project_name, bug_information, one_time_crasher_flag, timestamp=datetime.datetime.now()): """Make testcase.""" testcase = data_types.Testcase() testcase.timestamp = timestamp testcase.one_time_crasher_flag = one_time_crasher_flag testcase.bug_information = bug_information testcase.project_name = project_name return testcase def test_no_existing_testcase(self): """is_new=True and should_create_testcase=True when there's no existing testcase.""" self.mock.find_testcase.return_value = None self.mock.find_main_crash.return_value = self.crashes[0], True group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertTrue(group.should_create_testcase()) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertIsNone(group.existing_testcase) self.assertEqual(self.crashes[0], group.main_crash) self.assertTrue(group.is_new()) def test_has_existing_reproducible_testcase(self): """should_create_testcase=False when there's an existing reproducible testcase.""" self.mock.find_testcase.return_value = self.reproducible_testcase self.mock.find_main_crash.return_value = (self.crashes[0], True) group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertEqual(self.crashes[0].gestures, group.main_crash.gestures) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertFalse(group.is_new()) self.assertFalse(group.should_create_testcase()) self.assertTrue(group.has_existing_reproducible_testcase()) def test_reproducible_crash(self): """should_create_testcase=True when the group is reproducible.""" self.mock.find_testcase.return_value = self.unreproducible_testcase self.mock.find_main_crash.return_value = (self.crashes[0], False) group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertEqual(self.crashes[0].gestures, group.main_crash.gestures) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertFalse(group.is_new()) self.assertTrue(group.should_create_testcase()) self.assertFalse(group.has_existing_reproducible_testcase()) self.assertFalse(group.one_time_crasher_flag) def test_has_existing_unreproducible_testcase(self): """should_create_testcase=False when the unreproducible testcase already exists.""" self.mock.find_testcase.return_value = self.unreproducible_testcase self.mock.find_main_crash.return_value = (self.crashes[0], True) group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertFalse(group.should_create_testcase()) self.assertEqual(self.crashes[0].gestures, group.main_crash.gestures) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertFalse(group.is_new()) self.assertFalse(group.has_existing_reproducible_testcase()) self.assertTrue(group.one_time_crasher_flag) class FindMainCrashTest(unittest.TestCase): """Test find_main_crash.""" def setUp(self): helpers.patch(self, [ 'bot.testcase_manager.test_for_reproducibility', ]) self.crashes = [ self._make_crash('g1'), self._make_crash('g2'), self._make_crash('g3'), self._make_crash('g4') ] self.reproducible_crashes = [] # pylint: disable=unused-argument def test_for_repro(fuzzer_name, full_fuzzer_name, file_path, state, security_flag, test_timeout, http_flag, gestures, arguments=None): """Mock test_for_reproducibility.""" for c in self.reproducible_crashes: if c.gestures == gestures: return True return False self.mock.test_for_reproducibility.side_effect = test_for_repro def _make_crash(self, gestures): crash = mock.MagicMock( file_path='file_path', crash_state='state', security_flag=True, test_timeout=999, gestures=gestures) return crash def test_reproducible_crash(self): """Find that the 2nd crash is reproducible.""" for c in self.crashes: c.is_valid.return_value = True self.crashes[0].is_valid.return_value = False self.reproducible_crashes = [self.crashes[2]] self.assertEqual((self.crashes[2], False), fuzz_task.find_main_crash(self.crashes, 'test', 'test', 99)) self.crashes[0].archive_testcase_in_blobstore.assert_called_once_with() self.crashes[1].archive_testcase_in_blobstore.assert_called_once_with() self.crashes[2].archive_testcase_in_blobstore.assert_called_once_with() self.crashes[3].archive_testcase_in_blobstore.assert_not_called() # Calls for self.crashes[1] and self.crashes[2]. self.assertEqual(2, self.mock.test_for_reproducibility.call_count) def test_unreproducible_crash(self): """No reproducible crash. Find the first valid one.""" for c in self.crashes: c.is_valid.return_value = True self.crashes[0].is_valid.return_value = False self.reproducible_crashes = [] self.assertEqual((self.crashes[1], True), fuzz_task.find_main_crash(self.crashes, 'test', 'test', 99)) for c in self.crashes: c.archive_testcase_in_blobstore.assert_called_once_with() # Calls for every crash except self.crashes[0] because it's invalid. self.assertEqual( len(self.crashes) - 1, self.mock.test_for_reproducibility.call_count) def test_no_valid_crash(self): """No valid crash.""" for c in self.crashes: c.is_valid.return_value = False self.reproducible_crashes = [] self.assertEqual((None, None), fuzz_task.find_main_crash(self.crashes, 'test', 'test', 99)) for c in self.crashes: c.archive_testcase_in_blobstore.assert_called_once_with() self.assertEqual(0, self.mock.test_for_reproducibility.call_count) @test_utils.with_cloud_emulators('datastore') class ProcessCrashesTest(fake_filesystem_unittest.TestCase): """Test process_crashes.""" def setUp(self): helpers.patch(self, [ 'chrome.crash_uploader.get_symbolized_stack_bytes', 'bot.tasks.task_creation.create_tasks', 'bot.tasks.setup.archive_testcase_and_dependencies_in_gcs', 'crash_analysis.stack_parsing.stack_analyzer.get_crash_data', 'build_management.revisions.get_real_revision', 'bot.testcase_manager.get_command_line_for_application', 'bot.testcase_manager.test_for_reproducibility', 'base.utils.get_crash_stacktrace_output', 'crash_analysis.crash_analyzer.ignore_stacktrace', 'crash_analysis.crash_analyzer.is_security_issue', 'datastore.data_handler.get_issue_tracker_name', 'datastore.data_handler.get_project_name', 'google.appengine.api.app_identity.get_application_id', 'google_cloud_utils.big_query.Client.insert', 'google_cloud_utils.big_query.get_api_client', 'time.sleep', 'time.time' ]) test_utils.set_up_pyfakefs(self) self.mock.time.return_value = 987 self.mock.get_issue_tracker_name.return_value = 'some_issue_tracker' self.mock.get_project_name.return_value = 'some_project' self.mock.archive_testcase_and_dependencies_in_gcs.return_value = ( 'fuzzed_key', True, 'absolute_path', 'archive_filename') def _make_crash(self, trace, state='state'): """Make crash.""" self.mock.get_real_revision.return_value = 'this.is.fake.ver' self.mock.get_command_line_for_application.return_value = 'cmd' dummy_state = stack_analyzer.StackAnalyzerState() dummy_state.crash_type = 'type' dummy_state.crash_address = 'address' dummy_state.crash_state = state dummy_state.crash_stacktrace = 'orig_trace' dummy_state.crash_frames = ['frame 1', 'frame 2'] self.mock.get_crash_data.return_value = dummy_state self.mock.get_symbolized_stack_bytes.return_value = 'f00df00d' self.mock.get_crash_stacktrace_output.return_value = trace self.mock.is_security_issue.return_value = True self.mock.ignore_stacktrace.return_value = False with open('/stack_file_path', 'w') as f: f.write('unsym') crash = fuzz_task.Crash.from_testcase_manager_crash( testcase_manager.Crash('dir/path-http-name', 123, 11, ['res'], ['ges'], '/stack_file_path')) return crash def test_existing_unreproducible_testcase(self): """Test existing unreproducible testcase.""" crashes = [self._make_crash('c1'), self._make_crash('c2')] self.mock.test_for_reproducibility.return_value = False existing_testcase = data_types.Testcase() existing_testcase.crash_stacktrace = 'existing' existing_testcase.crash_type = crashes[0].crash_type existing_testcase.crash_state = crashes[0].crash_state existing_testcase.security_flag = crashes[0].security_flag existing_testcase.one_time_crasher_flag = True existing_testcase.job_type = 'existing_job' existing_testcase.timestamp = datetime.datetime.now() existing_testcase.project_name = 'some_project' existing_testcase.put() variant = data_types.TestcaseVariant() variant.status = data_types.TestcaseVariantStatus.UNREPRODUCIBLE variant.job_type = 'job' variant.testcase_id = existing_testcase.key.id() variant.put() new_crash_count, known_crash_count, groups = fuzz_task.process_crashes( crashes=crashes, context=fuzz_task.Context( project_name='some_project', bot_name='bot', job_type='job', fuzz_target=data_types.FuzzTarget(engine='engine', binary='binary'), redzone=111, disable_ubsan=True, platform_id='platform', crash_revision=1234, fuzzer_name='fuzzer', window_argument='win_args', fuzzer_metadata={}, testcases_metadata={}, timeout_multiplier=1, test_timeout=2, thread_wait_timeout=3, data_directory='/data')) self.assertEqual(0, new_crash_count) self.assertEqual(2, known_crash_count) self.assertEqual(1, len(groups)) self.assertEqual(2, len(groups[0].crashes)) self.assertFalse(groups[0].is_new()) self.assertEqual(crashes[0].crash_type, groups[0].main_crash.crash_type) self.assertEqual(crashes[0].crash_state, groups[0].main_crash.crash_state) self.assertEqual(crashes[0].security_flag, groups[0].main_crash.security_flag) testcases = list(data_types.Testcase.query()) self.assertEqual(1, len(testcases)) self.assertEqual('existing', testcases[0].crash_stacktrace) variant = data_handler.get_testcase_variant(existing_testcase.key.id(), 'job') self.assertEqual(data_types.TestcaseVariantStatus.FLAKY, variant.status) self.assertEqual('fuzzed_key', variant.reproducer_key) self.assertEqual(1234, variant.revision) self.assertEqual('type', variant.crash_type) self.assertEqual('state', variant.crash_state) self.assertEqual(True, variant.security_flag) self.assertEqual(True, variant.is_similar) @parameterized.parameterized.expand(['some_project', 'chromium']) def test_create_many_groups(self, project_name): """Test creating many groups.""" self.mock.get_project_name.return_value = project_name self.mock.insert.return_value = {'insertErrors': [{'index': 0}]} # TODO(metzman): Add a seperate test for strategies. r2_stacktrace = ('r2\ncf::fuzzing_strategies: value_profile\n') crashes = [ self._make_crash('r1', state='reproducible1'), self._make_crash(r2_stacktrace, state='reproducible1'), self._make_crash('r3', state='reproducible1'), self._make_crash('r4', state='reproducible2'), self._make_crash('u1', state='unreproducible1'), self._make_crash('u2', state='unreproducible2'), self._make_crash('u3', state='unreproducible2'), self._make_crash('u4', state='unreproducible3') ] self.mock.test_for_reproducibility.side_effect = [ False, # For r1. It returns False. So, r1 is demoted. True, # For r2. It returns True. So, r2 becomes primary for its group. True, # For r4. False, # For u1. False, # For u2. False, # For u3. False ] # For u4. new_crash_count, known_crash_count, groups = fuzz_task.process_crashes( crashes=crashes, context=fuzz_task.Context( project_name=project_name, bot_name='bot', job_type='job', fuzz_target=data_types.FuzzTarget(engine='engine', binary='binary'), redzone=111, disable_ubsan=False, platform_id='platform', crash_revision=1234, fuzzer_name='fuzzer', window_argument='win_args', fuzzer_metadata={}, testcases_metadata={}, timeout_multiplier=1, test_timeout=2, thread_wait_timeout=3, data_directory='/data')) self.assertEqual(5, new_crash_count) self.assertEqual(3, known_crash_count) self.assertEqual(5, len(groups)) self.assertEqual([ 'reproducible1', 'reproducible2', 'unreproducible1', 'unreproducible2', 'unreproducible3' ], [group.main_crash.crash_state for group in groups]) self.assertEqual([True, True, True, True, True], [group.is_new() for group in groups]) self.assertEqual([3, 1, 1, 2, 1], [len(group.crashes) for group in groups]) testcases = list(data_types.Testcase.query()) self.assertEqual(5, len(testcases)) self.assertSetEqual( set([r2_stacktrace, 'r4', 'u1', 'u2', 'u4']), set(t.crash_stacktrace for t in testcases)) self.assertSetEqual( set([ '{"fuzzing_strategies": ["value_profile"]}', None, None, None, None ]), set(t.additional_metadata for t in testcases)) # r2 is a reproducible crash, so r3 doesn't # invoke archive_testcase_in_blobstore. Therefore, the # archive_testcase_in_blobstore is called `len(crashes) - 1`. self.assertEqual( len(crashes) - 1, self.mock.archive_testcase_and_dependencies_in_gcs.call_count) # Check only the desired testcases were saved. actual_crash_infos = [group.main_crash.crash_info for group in groups] if project_name != 'chromium': expected_crash_infos = [None] * len(actual_crash_infos) else: expected_saved_crash_info = crash_uploader.CrashReportInfo( product='Chrome_' + environment.platform().lower().capitalize(), version='this.is.fake.ver', serialized_crash_stack_frames='f00df00d') expected_crash_infos = [ expected_saved_crash_info, # r2 is main crash for group r1,r2,r3 expected_saved_crash_info, # r4 is main crash for its own group None, # u1 is not reproducible None, # u2, u3 are not reproducible None, # u4 is not reproducible ] self.assertEqual(len(expected_crash_infos), len(actual_crash_infos)) for expected, actual in zip(expected_crash_infos, actual_crash_infos): if not expected: self.assertIsNone(actual) continue self.assertEqual(expected.product, actual.product) self.assertEqual(expected.version, actual.version) self.assertEqual(expected.serialized_crash_stack_frames, actual.serialized_crash_stack_frames) def _make_big_query_json(crash, reproducible_flag, new_flag, testcase_id): return { 'crash_type': crash.crash_type, 'crash_state': crash.crash_state, 'created_at': 987, 'platform': 'platform', 'crash_time_in_ms': int(crash.crash_time * 1000), 'parent_fuzzer_name': 'engine', 'fuzzer_name': 'engine_binary', 'job_type': 'job', 'security_flag': crash.security_flag, 'reproducible_flag': reproducible_flag, 'revision': '1234', 'new_flag': new_flag, 'project': project_name, 'testcase_id': testcase_id } def _get_testcase_id(crash): rows = list( data_types.Testcase.query( data_types.Testcase.crash_type == crash.crash_type, data_types.Testcase.crash_state == crash.crash_state, data_types.Testcase.security_flag == crash.security_flag)) if not rows: return None return str(rows[0].key.id()) # Calls to write 5 groups of crashes to BigQuery. self.assertEqual(5, self.mock.insert.call_count) self.mock.insert.assert_has_calls([ mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[0], True, False, None), '%s:bot:987:0' % crashes[0].key), big_query.Insert( _make_big_query_json(crashes[1], True, True, _get_testcase_id(crashes[1])), '%s:bot:987:1' % crashes[0].key), big_query.Insert( _make_big_query_json(crashes[2], True, False, None), '%s:bot:987:2' % crashes[0].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[3], True, True, _get_testcase_id(crashes[3])), '%s:bot:987:0' % crashes[3].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[4], False, True, _get_testcase_id(crashes[4])), '%s:bot:987:0' % crashes[4].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[5], False, True, _get_testcase_id(crashes[5])), '%s:bot:987:0' % crashes[5].key), big_query.Insert( _make_big_query_json(crashes[6], False, False, None), '%s:bot:987:1' % crashes[5].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[7], False, True, _get_testcase_id(crashes[7])), '%s:bot:987:0' % crashes[7].key) ]), ]) class WriteCrashToBigQueryTest(unittest.TestCase): """Test write_crash_to_big_query.""" def setUp(self): self.client = mock.Mock(spec_set=big_query.Client) helpers.patch(self, [ 'system.environment.get_value', 'datastore.data_handler.get_project_name', 'google_cloud_utils.big_query.Client', 'time.time', ]) monitor.metrics_store().reset_for_testing() self.mock.get_project_name.return_value = 'some_project' self.mock.get_value.return_value = 'bot' self.mock.Client.return_value = self.client self.mock.time.return_value = 99 self.crashes = [ self._make_crash('c1'), self._make_crash('c2'), self._make_crash('c3') ] newly_created_testcase = mock.MagicMock() newly_created_testcase.key.id.return_value = 't' self.group = mock.MagicMock( crashes=self.crashes, main_crash=self.crashes[0], one_time_crasher_flag=False, newly_created_testcase=newly_created_testcase) self.group.is_new.return_value = True def _create_context(self, job_type, platform_id): return fuzz_task.Context( project_name='some_project', bot_name='bot', job_type=job_type, fuzz_target=data_types.FuzzTarget(engine='engine', binary='binary'), redzone=32, disable_ubsan=False, platform_id=platform_id, crash_revision=1234, fuzzer_name='engine', window_argument='windows_args', fuzzer_metadata={}, testcases_metadata={}, timeout_multiplier=1.0, test_timeout=5, thread_wait_timeout=6, data_directory='data') def _make_crash(self, state): crash = mock.Mock( crash_type='type', crash_state=state, crash_time=111, security_flag=True, key='key') return crash def _json(self, job, platform, state, new_flag, testcase_id): return { 'crash_type': 'type', 'crash_state': state, 'created_at': 99, 'platform': platform, 'crash_time_in_ms': 111000, 'parent_fuzzer_name': 'engine', 'fuzzer_name': 'engine_binary', 'job_type': job, 'security_flag': True, 'reproducible_flag': True, 'revision': '1234', 'new_flag': new_flag, 'project': 'some_project', 'testcase_id': testcase_id } def test_all_succeed(self): """Test writing succeeds.""" self.client.insert.return_value = {} context = self._create_context('job', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(3, success_count) self.assertEqual(0, failure_count) self.mock.Client.assert_called_once_with( dataset_id='main', table_id='crashes$19700101') self.client.insert.assert_called_once_with([ big_query.Insert( self._json('job', 'linux', 'c1', True, 't'), 'key:bot:99:0'), big_query.Insert( self._json('job', 'linux', 'c2', False, None), 'key:bot:99:1'), big_query.Insert( self._json('job', 'linux', 'c3', False, None), 'key:bot:99:2') ]) def test_succeed(self): """Test writing succeeds.""" self.client.insert.return_value = {'insertErrors': [{'index': 1}]} context = self._create_context('job', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(2, success_count) self.assertEqual(1, failure_count) self.mock.Client.assert_called_once_with( dataset_id='main', table_id='crashes$19700101') self.client.insert.assert_called_once_with([ big_query.Insert( self._json('job', 'linux', 'c1', True, 't'), 'key:bot:99:0'), big_query.Insert( self._json('job', 'linux', 'c2', False, None), 'key:bot:99:1'), big_query.Insert( self._json('job', 'linux', 'c3', False, None), 'key:bot:99:2') ]) def test_chromeos_platform(self): """Test ChromeOS platform is written in stats.""" self.client.insert.return_value = {'insertErrors': [{'index': 1}]} context = self._create_context('job_chromeos', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(2, success_count) self.assertEqual(1, failure_count) self.mock.Client.assert_called_once_with( dataset_id='main', table_id='crashes$19700101') self.client.insert.assert_called_once_with([ big_query.Insert( self._json('job_chromeos', 'chrome', 'c1', True, 't'), 'key:bot:99:0'), big_query.Insert( self._json('job_chromeos', 'chrome', 'c2', False, None), 'key:bot:99:1'), big_query.Insert( self._json('job_chromeos', 'chrome', 'c3', False, None), 'key:bot:99:2') ]) def test_exception(self): """Test writing raising an exception.""" self.client.insert.side_effect = Exception('error') context = self._create_context('job', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(0, success_count) self.assertEqual(3, failure_count) class ConvertGroupsToCrashesTest(object): """Test convert_groups_to_crashes.""" def test_convert(self): """Test converting.""" groups = [ mock.Mock( crashes=[mock.Mock(), mock.Mock()], main_crash=mock.Mock( crash_type='t1', crash_state='s1', security_flag=True)), mock.Mock( crashes=[mock.Mock()], main_crash=mock.Mock( crash_type='t2', crash_state='s2', security_flag=False)), ] groups[0].is_new.return_value = False groups[1].is_new.return_value = True self.assertEqual([ { 'is_new': False, 'count': 2, 'crash_type': 't1', 'crash_state': 's1', 'security_flag': True }, { 'is_new': True, 'count': 1, 'crash_type': 't2', 'crash_state': 's2', 'security_flag': False }, ], fuzz_task.convert_groups_to_crashes(groups)) class TestCorpusSync(fake_filesystem_unittest.TestCase): """Test corpus sync.""" def setUp(self): helpers.patch(self, [ 'fuzzing.corpus_manager.FuzzTargetCorpus.rsync_to_disk', 'fuzzing.corpus_manager.FuzzTargetCorpus.upload_files', 'google_cloud_utils.storage.last_updated', ]) helpers.patch_environ(self) os.environ['FAIL_RETRIES'] = '1' os.environ['CORPUS_BUCKET'] = 'bucket' self.mock.rsync_to_disk.return_value = True test_utils.set_up_pyfakefs(self) self.fs.create_dir('/dir') self.fs.create_dir('/dir1') def _write_corpus_files(self, *args, **kwargs): # pylint: disable=unused-argument self.fs.create_file('/dir/a') self.fs.create_file('/dir/b') return True def test_sync(self): """Test corpus sync.""" corpus = fuzz_task.GcsCorpus('parent', 'child', '/dir', '/dir1') self.mock.rsync_to_disk.side_effect = self._write_corpus_files self.assertTrue(corpus.sync_from_gcs()) self.assertTrue(os.path.exists('/dir1/.child_sync')) self.assertEqual(('/dir',), self.mock.rsync_to_disk.call_args[0][1:]) self.fs.create_file('/dir/c') self.assertListEqual(['/dir/c'], corpus.get_new_files()) corpus.upload_files(corpus.get_new_files()) self.assertEqual((['/dir/c'],), self.mock.upload_files.call_args[0][1:]) self.assertListEqual([], corpus.get_new_files()) def test_no_sync(self): """Test no corpus sync when bundle is not updated since last sync.""" corpus = fuzz_task.GcsCorpus('parent', 'child', '/dir', '/dir1') utils.write_data_to_file(time.time(), '/dir1/.child_sync') self.mock.last_updated.return_value = ( datetime.datetime.utcnow() - datetime.timedelta(days=1)) self.assertTrue(corpus.sync_from_gcs()) self.assertEqual(0, self.mock.rsync_to_disk.call_count) def test_sync_with_failed_last_update(self): """Test corpus sync when failed to get last update info from gcs.""" corpus = fuzz_task.GcsCorpus('parent', 'child', '/dir', '/dir1') utils.write_data_to_file(time.time(), '/dir1/.child_sync') self.mock.last_updated.return_value = None self.assertTrue(corpus.sync_from_gcs()) self.assertEqual(1, self.mock.rsync_to_disk.call_count) @test_utils.with_cloud_emulators('datastore') class RecordFuzzTargetTest(unittest.TestCase): """Tests for record_fuzz_target.""" def setUp(self): helpers.patch_environ(self) helpers.patch(self, [ 'base.utils.is_oss_fuzz', 'base.utils.utcnow', ]) self.mock.is_oss_fuzz.return_value = False self.mock.utcnow.return_value = datetime.datetime(2018, 1, 1) def test_record_fuzz_target(self): """Test that record_fuzz_target works.""" fuzz_task.record_fuzz_target('libFuzzer', 'child', 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_child').get() self.assertDictEqual({ 'binary': 'child', 'engine': 'libFuzzer', 'project': 'test-project', }, fuzz_target.to_dict()) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_child/job').get() self.assertDictEqual({ 'fuzz_target_name': 'libFuzzer_child', 'job': 'job', 'engine': 'libFuzzer', 'last_run': datetime.datetime(2018, 1, 1, 0, 0), 'weight': 1.0, }, job_mapping.to_dict()) self.assertEqual('libFuzzer_child', fuzz_target.fully_qualified_name()) self.assertEqual('child', fuzz_target.project_qualified_name()) def test_record_fuzz_target_existing(self): """Test that record_fuzz_target works when updating an existing entity.""" data_types.FuzzTarget( binary='child', engine='libFuzzer', project='test-project').put() data_types.FuzzTargetJob( fuzz_target_name='libFuzzer_child', job='job', engine='libFuzzer', last_run=datetime.datetime(2017, 12, 31, 0, 0)).put() fuzz_task.record_fuzz_target('libFuzzer', 'child', 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_child').get() self.assertDictEqual({ 'binary': 'child', 'engine': 'libFuzzer', 'project': 'test-project', }, fuzz_target.to_dict()) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_child/job').get() self.assertDictEqual({ 'fuzz_target_name': 'libFuzzer_child', 'job': 'job', 'engine': 'libFuzzer', 'last_run': datetime.datetime(2018, 1, 1, 0, 0), 'weight': 1.0, }, job_mapping.to_dict()) self.assertEqual('libFuzzer_child', fuzz_target.fully_qualified_name()) self.assertEqual('child', fuzz_target.project_qualified_name()) def test_record_fuzz_target_no_binary_name(self): """Test recording fuzz target with no binary.""" # Passing None to binary_name is an error. We shouldn't create any # FuzzTargets as a result. fuzz_task.record_fuzz_target('libFuzzer', None, 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_child').get() self.assertIsNone(fuzz_target) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_child/job').get() self.assertIsNone(job_mapping) @parameterized.parameterized.expand(['child', 'proj_child']) def test_record_fuzz_target_ossfuzz(self, binary_name): """Test that record_fuzz_target works with OSS-Fuzz projects.""" self.mock.is_oss_fuzz.return_value = True data_types.Job(name='job', environment_string='PROJECT_NAME = proj\n').put() fuzz_task.record_fuzz_target('libFuzzer', binary_name, 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_proj_child').get() self.assertDictEqual({ 'binary': binary_name, 'engine': 'libFuzzer', 'project': 'proj', }, fuzz_target.to_dict()) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_proj_child/job').get() self.assertDictEqual({ 'fuzz_target_name': 'libFuzzer_proj_child', 'job': 'job', 'engine': 'libFuzzer', 'last_run': datetime.datetime(2018, 1, 1, 0, 0), 'weight': 1.0, }, job_mapping.to_dict()) self.assertEqual('libFuzzer_proj_child', fuzz_target.fully_qualified_name()) self.assertEqual('proj_child', fuzz_target.project_qualified_name()) @test_utils.with_cloud_emulators('datastore') class DoEngineFuzzingTest(fake_filesystem_unittest.TestCase): """do_engine_fuzzing tests.""" def setUp(self): helpers.patch_environ(self) helpers.patch(self, [ 'bot.fuzzers.engine_common.current_timestamp', 'bot.tasks.fuzz_task.GcsCorpus.sync_from_gcs', 'bot.tasks.fuzz_task.GcsCorpus.upload_files', 'build_management.revisions.get_component_list', 'bot.testcase_manager.upload_log', 'bot.testcase_manager.upload_testcase', 'metrics.fuzzer_stats.upload_stats', ]) test_utils.set_up_pyfakefs(self) os.environ['JOB_NAME'] = 'libfuzzer_asan_test' os.environ['FUZZ_INPUTS'] = '/fuzz-inputs' os.environ['FUZZ_INPUTS_DISK'] = '/fuzz-inputs-disk' os.environ['BUILD_DIR'] = '/build_dir' os.environ['MAX_TESTCASES'] = '2' os.environ['AUTOMATIC_LABELS'] = 'auto_label,auto_label1' os.environ['AUTOMATIC_COMPONENTS'] = 'auto_component,auto_component1' self.fs.create_file('/build_dir/test_target') self.fs.create_file( '/build_dir/test_target.labels', contents='label1\nlabel2') self.fs.create_file( '/build_dir/test_target.owners', contents='owner1@email.com') self.fs.create_file( '/build_dir/test_target.components', contents='component1\ncomponent2') self.fs.create_file('/input') self.mock.sync_from_gcs.return_value = True self.mock.upload_files.return_value = True self.mock.get_component_list.return_value = [{ 'component': 'component', 'link_text': 'rev', }] self.mock.current_timestamp.return_value = 0.0 def test_basic(self): """Test basic fuzzing session.""" session = fuzz_task.FuzzingSession('libFuzzer', 'libfuzzer_asan_test', 60) session.testcase_directory = os.environ['FUZZ_INPUTS'] session.data_directory = '/data_dir' os.environ['FUZZ_TARGET'] = 'test_target' os.environ['APP_REVISION'] = '1' expected_crashes = [engine.Crash('/input', 'stack', ['args'], 1.0)] engine_impl = mock.Mock() engine_impl.name = 'libFuzzer' engine_impl.prepare.return_value = engine.FuzzOptions( '/corpus', ['arg'], { 'strategy_1': 1, 'strategy_2': 50, }) engine_impl.fuzz.side_effect = lambda *_: engine.FuzzResult( 'logs', ['cmd'], expected_crashes, {'stat': 1}, 42.0) crashes, fuzzer_metadata = session.do_engine_fuzzing(engine_impl) self.assertDictEqual({ 'fuzzer_binary_name': 'test_target', 'issue_components': 'component1,component2,auto_component,auto_component1', 'issue_labels': 'label1,label2,auto_label,auto_label1', 'issue_owners': 'owner1@email.com', }, fuzzer_metadata) log_time = datetime.datetime(1970, 1, 1, 0, 0) log_call = mock.call( 'Component revisions (build r1):\n' 'component: rev\n\n' 'Return code: 1\n\n' 'Command: cmd\nBot: None\nTime ran: 42.0\n\n' 'logs\n' 'cf::fuzzing_strategies: strategy_1:1,strategy_2:50', log_time) self.mock.upload_log.assert_has_calls([log_call, log_call]) self.mock.upload_testcase.assert_has_calls([ mock.call('/input', log_time), mock.call('/input', log_time), ]) self.assertEqual(2, len(crashes)) for i in range(2): self.assertEqual('/input', crashes[i].file_path) self.assertEqual(1, crashes[i].return_code) self.assertEqual('stack', crashes[i].unsymbolized_crash_stacktrace) self.assertEqual(1.0, crashes[i].crash_time) self.assertEqual('args', crashes[i].arguments) for i in range(2): upload_args = self.mock.upload_stats.call_args_list[i][0][0] testcase_run = upload_args[0] self.assertDictEqual({ 'build_revision': 1, 'command': ['cmd'], 'fuzzer': u'libFuzzer_test_target', 'job': 'libfuzzer_asan_test', 'kind': 'TestcaseRun', 'stat': 1, 'strategy_strategy_1': 1, 'strategy_strategy_2': 50, 'timestamp': 0.0, }, testcase_run.data) class UntrustedRunEngineFuzzerTest( untrusted_runner_helpers.UntrustedRunnerIntegrationTest): """Engine fuzzing tests for untrusted.""" def setUp(self): """Set up.""" super(UntrustedRunEngineFuzzerTest, self).setUp() environment.set_value('JOB_NAME', 'libfuzzer_asan_job') job = data_types.Job( name='libfuzzer_asan_job', environment_string=( 'RELEASE_BUILD_BUCKET_PATH = ' 'gs://clusterfuzz-test-data/test_libfuzzer_builds/' 'test-libfuzzer-build-([0-9]+).zip\n' 'REVISION_VARS_URL = https://commondatastorage.googleapis.com/' 'clusterfuzz-test-data/test_libfuzzer_builds/' 'test-libfuzzer-build-%s.srcmap.json\n')) job.put() self.temp_dir = tempfile.mkdtemp(dir=environment.get_value('FUZZ_INPUTS')) environment.set_value('USE_MINIJAIL', False) def tearDown(self): super(UntrustedRunEngineFuzzerTest, self).tearDown() shutil.rmtree(self.temp_dir, ignore_errors=True) def test_run_engine_fuzzer(self): """Test running engine fuzzer.""" self._setup_env(job_type='libfuzzer_asan_job') environment.set_value('FUZZ_TEST_TIMEOUT', 3600) build_manager.setup_build() corpus_directory = os.path.join(self.temp_dir, 'corpus') testcase_directory = os.path.join(self.temp_dir, 'artifacts') os.makedirs(file_host.rebase_to_worker_root(corpus_directory)) os.makedirs(file_host.rebase_to_worker_root(testcase_directory)) result, fuzzer_metadata = fuzz_task.run_engine_fuzzer( libfuzzer_engine.LibFuzzerEngine(), 'test_fuzzer', corpus_directory, testcase_directory) self.assertIn( 'ERROR: AddressSanitizer: SEGV on unknown address 0x000000000000', result.logs) self.assertEqual(1, len(result.crashes)) self.assertTrue(result.crashes[0].input_path.startswith( os.environ['ROOT_DIR'])) self.assertTrue(os.path.exists(result.crashes[0].input_path)) self.assertIsInstance(result.stats.get('number_of_executed_units'), int) self.assertIsInstance(result.stats.get('oom_count'), int) self.assertIsInstance( result.stats.get('strategy_selection_method'), six.string_types) self.assertDictEqual({'fuzzer_binary_name': 'test_fuzzer'}, fuzzer_metadata) class AddIssueMetadataFromEnvironmentTest(unittest.TestCase): """Tests for _add_issue_metadata_from_environment.""" def setUp(self): helpers.patch_environ(self) def test_add_no_existing(self): """Test adding issue metadata when there are none existing.""" os.environ['AUTOMATIC_LABELS'] = 'auto_label' os.environ['AUTOMATIC_LABELS_1'] = 'auto_label1' os.environ['AUTOMATIC_COMPONENTS'] = 'auto_component' os.environ['AUTOMATIC_COMPONENTS_1'] = 'auto_component1' metadata = {} fuzz_task._add_issue_metadata_from_environment(metadata) self.assertDictEqual({ 'issue_components': 'auto_component,auto_component1', 'issue_labels': 'auto_label,auto_label1', }, metadata) def test_add_append(self): """Test adding issue metadata when there are already existing metadata.""" os.environ['AUTOMATIC_LABELS'] = 'auto_label' os.environ['AUTOMATIC_LABELS_1'] = 'auto_label1' os.environ['AUTOMATIC_COMPONENTS'] = 'auto_component' os.environ['AUTOMATIC_COMPONENTS_1'] = 'auto_component1' metadata = { 'issue_components': 'existing_component', 'issue_labels': 'existing_label' } fuzz_task._add_issue_metadata_from_environment(metadata) self.assertDictEqual({ 'issue_components': 'existing_component,auto_component,auto_component1', 'issue_labels': 'existing_label,auto_label,auto_label1', }, metadata) def test_add_numeric(self): """Tests adding a numeric label.""" os.environ['AUTOMATIC_LABELS'] = '123' metadata = {} fuzz_task._add_issue_metadata_from_environment(metadata) self.assertDictEqual({ 'issue_labels': '123', }, metadata)
36.738372
84
0.672153
from builtins import object from builtins import range import datetime import mock import os import parameterized import shutil import tempfile import time import unittest from pyfakefs import fake_filesystem_unittest import six from base import utils from bot import testcase_manager from bot.fuzzers import engine from bot.fuzzers.libFuzzer import engine as libfuzzer_engine from bot.tasks import fuzz_task from bot.untrusted_runner import file_host from build_management import build_manager from chrome import crash_uploader from crash_analysis.stack_parsing import stack_analyzer from datastore import data_handler from datastore import data_types from datastore import ndb from google_cloud_utils import big_query from metrics import monitor from metrics import monitoring_metrics from system import environment from tests.test_libs import helpers from tests.test_libs import test_utils from tests.test_libs import untrusted_runner_helpers class TrackFuzzerRunResultTest(unittest.TestCase): def setUp(self): monitor.metrics_store().reset_for_testing() def test_fuzzer_run_result(self): fuzz_task._track_fuzzer_run_result('name', 10, 100, 2) fuzz_task._track_fuzzer_run_result('name', 100, 200, 2) fuzz_task._track_fuzzer_run_result('name', 1000, 2000, 2) fuzz_task._track_fuzzer_run_result('name', 1000, 500, 0) fuzz_task._track_fuzzer_run_result('name', 0, 1000, -1) fuzz_task._track_fuzzer_run_result('name', 0, 0, 2) self.assertEqual( 4, monitoring_metrics.FUZZER_RETURN_CODE_COUNT.get({ 'fuzzer': 'name', 'return_code': 2 })) self.assertEqual( 1, monitoring_metrics.FUZZER_RETURN_CODE_COUNT.get({ 'fuzzer': 'name', 'return_code': 0 })) self.assertEqual( 1, monitoring_metrics.FUZZER_RETURN_CODE_COUNT.get({ 'fuzzer': 'name', 'return_code': -1 })) testcase_count_ratio = ( monitoring_metrics.FUZZER_TESTCASE_COUNT_RATIO.get({ 'fuzzer': 'name' })) self.assertEqual(3.1, testcase_count_ratio.sum) self.assertEqual(5, testcase_count_ratio.count) expected_buckets = [0 for _ in range(22)] expected_buckets[1] = 1 expected_buckets[3] = 1 expected_buckets[11] = 2 expected_buckets[21] = 1 self.assertListEqual(expected_buckets, testcase_count_ratio.buckets) class TrackBuildRunResultTest(unittest.TestCase): def setUp(self): monitor.metrics_store().reset_for_testing() def test_build_run_result(self): fuzz_task._track_build_run_result('name', 10000, True) fuzz_task._track_build_run_result('name', 10001, True) fuzz_task._track_build_run_result('name', 10002, False) self.assertEqual( 2, monitoring_metrics.JOB_BAD_BUILD_COUNT.get({ 'job': 'name', 'bad_build': True })) self.assertEqual( 1, monitoring_metrics.JOB_BAD_BUILD_COUNT.get({ 'job': 'name', 'bad_build': False })) class TrackTestcaseRunResultTest(unittest.TestCase): def setUp(self): monitor.metrics_store().reset_for_testing() def test_testcase_run_result(self): fuzz_task._track_testcase_run_result('fuzzer', 'job', 2, 5) fuzz_task._track_testcase_run_result('fuzzer', 'job', 5, 10) self.assertEqual(7, monitoring_metrics.JOB_NEW_CRASH_COUNT.get({ 'job': 'job' })) self.assertEqual( 15, monitoring_metrics.JOB_KNOWN_CRASH_COUNT.get({ 'job': 'job' })) self.assertEqual( 7, monitoring_metrics.FUZZER_NEW_CRASH_COUNT.get({ 'fuzzer': 'fuzzer' })) self.assertEqual( 15, monitoring_metrics.FUZZER_KNOWN_CRASH_COUNT.get({ 'fuzzer': 'fuzzer' })) class TruncateFuzzerOutputTest(unittest.TestCase): def test_no_truncation(self): self.assertEqual('aaaa', fuzz_task.truncate_fuzzer_output('aaaa', 10)) def test_truncation(self): self.assertEqual( '123456\n...truncated...\n54321', fuzz_task.truncate_fuzzer_output( '123456xxxxxxxxxxxxxxxxxxxxxxxxxxx54321', 28)) def test_error(self): with self.assertRaises(AssertionError): self.assertEqual( '', fuzz_task.truncate_fuzzer_output('123456xxxxxx54321', 10)) class TrackFuzzTimeTest(unittest.TestCase): def setUp(self): monitor.metrics_store().reset_for_testing() def _test(self, timeout): time_module = helpers.MockTime() with fuzz_task._TrackFuzzTime('fuzzer', 'job', time_module) as tracker: time_module.advance(5) tracker.timeout = timeout fuzzer_total_time = monitoring_metrics.FUZZER_TOTAL_FUZZ_TIME.get({ 'fuzzer': 'fuzzer', 'timeout': timeout }) self.assertEqual(5, fuzzer_total_time) def test_success(self): self._test(False) def test_timeout(self): self._test(True) class GetFuzzerMetadataFromOutputTest(unittest.TestCase): def test_no_metadata(self): data = 'abc\ndef\n123123' self.assertDictEqual(fuzz_task.get_fuzzer_metadata_from_output(data), {}) data = '' self.assertDictEqual(fuzz_task.get_fuzzer_metadata_from_output(data), {}) def test_metadata(self): data = ('abc\n' 'def\n' 'metadata:invalid: invalid\n' 'metadat::invalid: invalid\n' 'metadata::foo: bar\n' '123123\n' 'metadata::blah: 1\n' 'metadata::test:abcd\n' 'metadata::test2: def\n') self.assertDictEqual( fuzz_task.get_fuzzer_metadata_from_output(data), { 'blah': '1', 'test': 'abcd', 'test2': 'def', 'foo': 'bar' }) class GetRegressionTest(unittest.TestCase): def setUp(self): helpers.patch(self, ['build_management.build_manager.is_custom_binary']) def test_one_time_crasher(self): self.mock.is_custom_binary.return_value = False self.assertEqual('NA', fuzz_task.get_regression(True)) def test_custom_binary(self): self.mock.is_custom_binary.return_value = True self.assertEqual('NA', fuzz_task.get_regression(False)) def test_reproducible_non_custom_binary(self): self.mock.is_custom_binary.return_value = False self.assertEqual('', fuzz_task.get_regression(False)) class GetFixedOrMinimizedKeyTest(unittest.TestCase): def test_one_time_crasher(self): self.assertEqual('NA', fuzz_task.get_fixed_or_minimized_key(True)) def test_reproducible(self): self.assertEqual('', fuzz_task.get_fixed_or_minimized_key(False)) class CrashInitTest(fake_filesystem_unittest.TestCase): def setUp(self): helpers.patch(self, [ 'chrome.crash_uploader.FileMetadataInfo', 'bot.tasks.setup.archive_testcase_and_dependencies_in_gcs', 'crash_analysis.stack_parsing.stack_analyzer.get_crash_data', 'bot.testcase_manager.get_additional_command_line_flags', 'bot.testcase_manager.get_command_line_for_application', 'base.utils.get_crash_stacktrace_output', 'crash_analysis.crash_analyzer.ignore_stacktrace', 'crash_analysis.crash_analyzer.is_security_issue', ]) helpers.patch_environ(self) test_utils.set_up_pyfakefs(self) self.mock.get_command_line_for_application.return_value = 'cmd' dummy_state = stack_analyzer.StackAnalyzerState() dummy_state.crash_type = 'type' dummy_state.crash_address = 'address' dummy_state.crash_state = 'state' dummy_state.crash_stacktrace = 'orig_trace' dummy_state.frames = ['frame 1', 'frame 2'] self.mock.get_crash_data.return_value = dummy_state self.mock.get_crash_stacktrace_output.return_value = 'trace' self.mock.archive_testcase_and_dependencies_in_gcs.return_value = ( 'fuzzed_key', True, 'absolute_path', 'archive_filename') environment.set_value('FILTER_FUNCTIONAL_BUGS', False) with open('/stack_file_path', 'w') as f: f.write('unsym') def test_error(self): crash = fuzz_task.Crash.from_testcase_manager_crash( testcase_manager.Crash('dir/path-http-name', 123, 11, ['res'], 'ges', '/no_stack_file')) self.assertIsNone(crash) def _test_crash(self, should_be_ignored, security_flag): self.mock.get_command_line_for_application.reset_mock() self.mock.get_crash_data.reset_mock() self.mock.get_crash_stacktrace_output.reset_mock() self.mock.is_security_issue.reset_mock() self.mock.ignore_stacktrace.reset_mock() self.mock.is_security_issue.return_value = security_flag self.mock.ignore_stacktrace.return_value = should_be_ignored crash = fuzz_task.Crash.from_testcase_manager_crash( testcase_manager.Crash('dir/path-http-name', 123, 11, ['res'], 'ges', '/stack_file_path')) self.assertEqual('dir/path-http-name', crash.file_path) self.assertEqual(123, crash.crash_time) self.assertEqual(11, crash.return_code) self.assertListEqual(['res'], crash.resource_list) self.assertEqual('ges', crash.gestures) self.assertEqual('path-http-name', crash.filename) self.assertTrue(crash.http_flag) self.assertEqual('cmd', crash.application_command_line) self.mock.get_command_line_for_application.assert_called_once_with( 'dir/path-http-name', needs_http=True) self.assertEqual('unsym', crash.unsymbolized_crash_stacktrace) self.assertEqual('type', crash.crash_type) self.assertEqual('address', crash.crash_address) self.assertEqual('state', crash.crash_state) self.assertListEqual(['frame 1', 'frame 2'], crash.crash_frames) self.mock.get_crash_data.assert_called_once_with('unsym') self.assertEqual('trace', crash.crash_stacktrace) self.mock.get_crash_stacktrace_output.assert_called_once_with( 'cmd', 'orig_trace', 'unsym') self.assertEqual(security_flag, crash.security_flag) self.mock.is_security_issue.assert_called_once_with('unsym', 'type', 'address') self.assertEqual('type,state,%s' % security_flag, crash.key) self.assertEqual(should_be_ignored, crash.should_be_ignored) self.mock.ignore_stacktrace.assert_called_once_with('orig_trace') self.assertFalse(hasattr(crash, 'fuzzed_key')) return crash def _test_validity_and_get_functional_crash(self): security_crash = self._test_crash( should_be_ignored=False, security_flag=True) self.assertIsNone(security_crash.get_error()) self.assertTrue(security_crash.is_valid()) ignored_crash = self._test_crash(should_be_ignored=True, security_flag=True) self.assertIn('False crash', ignored_crash.get_error()) self.assertFalse(ignored_crash.is_valid()) functional_crash = self._test_crash( should_be_ignored=False, security_flag=False) return functional_crash def test_valid_functional_bug(self): functional_crash = self._test_validity_and_get_functional_crash() self.assertIsNone(functional_crash.get_error()) self.assertTrue(functional_crash.is_valid()) def test_invalid_functional_bug(self): environment.set_value('FILTER_FUNCTIONAL_BUGS', True) functional_crash = self._test_validity_and_get_functional_crash() self.assertIn('Functional crash', functional_crash.get_error()) self.assertFalse(functional_crash.is_valid()) def test_hydrate_fuzzed_key(self): crash = self._test_crash(should_be_ignored=False, security_flag=True) self.assertFalse(crash.is_archived()) self.assertIsNone(crash.get_error()) self.assertTrue(crash.is_valid()) crash.archive_testcase_in_blobstore() self.assertTrue(crash.is_archived()) self.assertIsNone(crash.get_error()) self.assertTrue(crash.is_valid()) self.assertEqual('fuzzed_key', crash.fuzzed_key) self.assertTrue(crash.archived) self.assertEqual('absolute_path', crash.absolute_path) self.assertEqual('archive_filename', crash.archive_filename) def test_hydrate_fuzzed_key_failure(self): self.mock.archive_testcase_and_dependencies_in_gcs.return_value = (None, False, None, None) crash = self._test_crash(should_be_ignored=False, security_flag=True) self.assertFalse(crash.is_archived()) self.assertIsNone(crash.get_error()) self.assertTrue(crash.is_valid()) crash.archive_testcase_in_blobstore() self.assertTrue(crash.is_archived()) self.assertIn('Unable to store testcase in blobstore', crash.get_error()) self.assertFalse(crash.is_valid()) self.assertIsNone(crash.fuzzed_key) self.assertFalse(crash.archived) self.assertIsNone(crash.absolute_path) self.assertIsNone(crash.archive_filename) def test_args_from_testcase_manager(self): testcase_manager_crash = testcase_manager.Crash('path', 0, 0, [], [], '/stack_file_path') self.mock.get_additional_command_line_flags.return_value = 'minimized' environment.set_value('APP_ARGS', 'app') crash = fuzz_task.Crash.from_testcase_manager_crash(testcase_manager_crash) self.assertEqual('app minimized', crash.arguments) class CrashGroupTest(unittest.TestCase): def setUp(self): helpers.patch(self, [ 'bot.tasks.fuzz_task.find_main_crash', 'datastore.data_handler.find_testcase', 'datastore.data_handler.get_project_name', ]) self.mock.get_project_name.return_value = 'some_project' self.crashes = [self._make_crash('g1'), self._make_crash('g2')] self.context = mock.MagicMock( test_timeout=99, fuzzer_name='test', fuzz_target=None) self.reproducible_testcase = self._make_testcase( project_name='some_project', bug_information='', one_time_crasher_flag=False) self.unreproducible_testcase = self._make_testcase( project_name='some_project', bug_information='', one_time_crasher_flag=True) def _make_crash(self, gestures): crash = mock.MagicMock( crash_type='type', crash_state='state', security_flag=True, file_path='file_path', http_flag=True, gestures=gestures) return crash def _make_testcase(self, project_name, bug_information, one_time_crasher_flag, timestamp=datetime.datetime.now()): testcase = data_types.Testcase() testcase.timestamp = timestamp testcase.one_time_crasher_flag = one_time_crasher_flag testcase.bug_information = bug_information testcase.project_name = project_name return testcase def test_no_existing_testcase(self): self.mock.find_testcase.return_value = None self.mock.find_main_crash.return_value = self.crashes[0], True group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertTrue(group.should_create_testcase()) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertIsNone(group.existing_testcase) self.assertEqual(self.crashes[0], group.main_crash) self.assertTrue(group.is_new()) def test_has_existing_reproducible_testcase(self): self.mock.find_testcase.return_value = self.reproducible_testcase self.mock.find_main_crash.return_value = (self.crashes[0], True) group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertEqual(self.crashes[0].gestures, group.main_crash.gestures) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertFalse(group.is_new()) self.assertFalse(group.should_create_testcase()) self.assertTrue(group.has_existing_reproducible_testcase()) def test_reproducible_crash(self): self.mock.find_testcase.return_value = self.unreproducible_testcase self.mock.find_main_crash.return_value = (self.crashes[0], False) group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertEqual(self.crashes[0].gestures, group.main_crash.gestures) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertFalse(group.is_new()) self.assertTrue(group.should_create_testcase()) self.assertFalse(group.has_existing_reproducible_testcase()) self.assertFalse(group.one_time_crasher_flag) def test_has_existing_unreproducible_testcase(self): self.mock.find_testcase.return_value = self.unreproducible_testcase self.mock.find_main_crash.return_value = (self.crashes[0], True) group = fuzz_task.CrashGroup(self.crashes, self.context) self.assertFalse(group.should_create_testcase()) self.assertEqual(self.crashes[0].gestures, group.main_crash.gestures) self.mock.find_main_crash.assert_called_once_with( self.crashes, 'test', 'test', self.context.test_timeout) self.assertFalse(group.is_new()) self.assertFalse(group.has_existing_reproducible_testcase()) self.assertTrue(group.one_time_crasher_flag) class FindMainCrashTest(unittest.TestCase): def setUp(self): helpers.patch(self, [ 'bot.testcase_manager.test_for_reproducibility', ]) self.crashes = [ self._make_crash('g1'), self._make_crash('g2'), self._make_crash('g3'), self._make_crash('g4') ] self.reproducible_crashes = [] def test_for_repro(fuzzer_name, full_fuzzer_name, file_path, state, security_flag, test_timeout, http_flag, gestures, arguments=None): for c in self.reproducible_crashes: if c.gestures == gestures: return True return False self.mock.test_for_reproducibility.side_effect = test_for_repro def _make_crash(self, gestures): crash = mock.MagicMock( file_path='file_path', crash_state='state', security_flag=True, test_timeout=999, gestures=gestures) return crash def test_reproducible_crash(self): for c in self.crashes: c.is_valid.return_value = True self.crashes[0].is_valid.return_value = False self.reproducible_crashes = [self.crashes[2]] self.assertEqual((self.crashes[2], False), fuzz_task.find_main_crash(self.crashes, 'test', 'test', 99)) self.crashes[0].archive_testcase_in_blobstore.assert_called_once_with() self.crashes[1].archive_testcase_in_blobstore.assert_called_once_with() self.crashes[2].archive_testcase_in_blobstore.assert_called_once_with() self.crashes[3].archive_testcase_in_blobstore.assert_not_called() self.assertEqual(2, self.mock.test_for_reproducibility.call_count) def test_unreproducible_crash(self): for c in self.crashes: c.is_valid.return_value = True self.crashes[0].is_valid.return_value = False self.reproducible_crashes = [] self.assertEqual((self.crashes[1], True), fuzz_task.find_main_crash(self.crashes, 'test', 'test', 99)) for c in self.crashes: c.archive_testcase_in_blobstore.assert_called_once_with() self.assertEqual( len(self.crashes) - 1, self.mock.test_for_reproducibility.call_count) def test_no_valid_crash(self): for c in self.crashes: c.is_valid.return_value = False self.reproducible_crashes = [] self.assertEqual((None, None), fuzz_task.find_main_crash(self.crashes, 'test', 'test', 99)) for c in self.crashes: c.archive_testcase_in_blobstore.assert_called_once_with() self.assertEqual(0, self.mock.test_for_reproducibility.call_count) @test_utils.with_cloud_emulators('datastore') class ProcessCrashesTest(fake_filesystem_unittest.TestCase): def setUp(self): helpers.patch(self, [ 'chrome.crash_uploader.get_symbolized_stack_bytes', 'bot.tasks.task_creation.create_tasks', 'bot.tasks.setup.archive_testcase_and_dependencies_in_gcs', 'crash_analysis.stack_parsing.stack_analyzer.get_crash_data', 'build_management.revisions.get_real_revision', 'bot.testcase_manager.get_command_line_for_application', 'bot.testcase_manager.test_for_reproducibility', 'base.utils.get_crash_stacktrace_output', 'crash_analysis.crash_analyzer.ignore_stacktrace', 'crash_analysis.crash_analyzer.is_security_issue', 'datastore.data_handler.get_issue_tracker_name', 'datastore.data_handler.get_project_name', 'google.appengine.api.app_identity.get_application_id', 'google_cloud_utils.big_query.Client.insert', 'google_cloud_utils.big_query.get_api_client', 'time.sleep', 'time.time' ]) test_utils.set_up_pyfakefs(self) self.mock.time.return_value = 987 self.mock.get_issue_tracker_name.return_value = 'some_issue_tracker' self.mock.get_project_name.return_value = 'some_project' self.mock.archive_testcase_and_dependencies_in_gcs.return_value = ( 'fuzzed_key', True, 'absolute_path', 'archive_filename') def _make_crash(self, trace, state='state'): self.mock.get_real_revision.return_value = 'this.is.fake.ver' self.mock.get_command_line_for_application.return_value = 'cmd' dummy_state = stack_analyzer.StackAnalyzerState() dummy_state.crash_type = 'type' dummy_state.crash_address = 'address' dummy_state.crash_state = state dummy_state.crash_stacktrace = 'orig_trace' dummy_state.crash_frames = ['frame 1', 'frame 2'] self.mock.get_crash_data.return_value = dummy_state self.mock.get_symbolized_stack_bytes.return_value = 'f00df00d' self.mock.get_crash_stacktrace_output.return_value = trace self.mock.is_security_issue.return_value = True self.mock.ignore_stacktrace.return_value = False with open('/stack_file_path', 'w') as f: f.write('unsym') crash = fuzz_task.Crash.from_testcase_manager_crash( testcase_manager.Crash('dir/path-http-name', 123, 11, ['res'], ['ges'], '/stack_file_path')) return crash def test_existing_unreproducible_testcase(self): crashes = [self._make_crash('c1'), self._make_crash('c2')] self.mock.test_for_reproducibility.return_value = False existing_testcase = data_types.Testcase() existing_testcase.crash_stacktrace = 'existing' existing_testcase.crash_type = crashes[0].crash_type existing_testcase.crash_state = crashes[0].crash_state existing_testcase.security_flag = crashes[0].security_flag existing_testcase.one_time_crasher_flag = True existing_testcase.job_type = 'existing_job' existing_testcase.timestamp = datetime.datetime.now() existing_testcase.project_name = 'some_project' existing_testcase.put() variant = data_types.TestcaseVariant() variant.status = data_types.TestcaseVariantStatus.UNREPRODUCIBLE variant.job_type = 'job' variant.testcase_id = existing_testcase.key.id() variant.put() new_crash_count, known_crash_count, groups = fuzz_task.process_crashes( crashes=crashes, context=fuzz_task.Context( project_name='some_project', bot_name='bot', job_type='job', fuzz_target=data_types.FuzzTarget(engine='engine', binary='binary'), redzone=111, disable_ubsan=True, platform_id='platform', crash_revision=1234, fuzzer_name='fuzzer', window_argument='win_args', fuzzer_metadata={}, testcases_metadata={}, timeout_multiplier=1, test_timeout=2, thread_wait_timeout=3, data_directory='/data')) self.assertEqual(0, new_crash_count) self.assertEqual(2, known_crash_count) self.assertEqual(1, len(groups)) self.assertEqual(2, len(groups[0].crashes)) self.assertFalse(groups[0].is_new()) self.assertEqual(crashes[0].crash_type, groups[0].main_crash.crash_type) self.assertEqual(crashes[0].crash_state, groups[0].main_crash.crash_state) self.assertEqual(crashes[0].security_flag, groups[0].main_crash.security_flag) testcases = list(data_types.Testcase.query()) self.assertEqual(1, len(testcases)) self.assertEqual('existing', testcases[0].crash_stacktrace) variant = data_handler.get_testcase_variant(existing_testcase.key.id(), 'job') self.assertEqual(data_types.TestcaseVariantStatus.FLAKY, variant.status) self.assertEqual('fuzzed_key', variant.reproducer_key) self.assertEqual(1234, variant.revision) self.assertEqual('type', variant.crash_type) self.assertEqual('state', variant.crash_state) self.assertEqual(True, variant.security_flag) self.assertEqual(True, variant.is_similar) @parameterized.parameterized.expand(['some_project', 'chromium']) def test_create_many_groups(self, project_name): self.mock.get_project_name.return_value = project_name self.mock.insert.return_value = {'insertErrors': [{'index': 0}]} # TODO(metzman): Add a seperate test for strategies. r2_stacktrace = ('r2\ncf::fuzzing_strategies: value_profile\n') crashes = [ self._make_crash('r1', state='reproducible1'), self._make_crash(r2_stacktrace, state='reproducible1'), self._make_crash('r3', state='reproducible1'), self._make_crash('r4', state='reproducible2'), self._make_crash('u1', state='unreproducible1'), self._make_crash('u2', state='unreproducible2'), self._make_crash('u3', state='unreproducible2'), self._make_crash('u4', state='unreproducible3') ] self.mock.test_for_reproducibility.side_effect = [ False, # For r1. It returns False. So, r1 is demoted. True, # For r2. It returns True. So, r2 becomes primary for its group. True, # For r4. False, # For u1. False, # For u2. False, # For u3. False ] # For u4. new_crash_count, known_crash_count, groups = fuzz_task.process_crashes( crashes=crashes, context=fuzz_task.Context( project_name=project_name, bot_name='bot', job_type='job', fuzz_target=data_types.FuzzTarget(engine='engine', binary='binary'), redzone=111, disable_ubsan=False, platform_id='platform', crash_revision=1234, fuzzer_name='fuzzer', window_argument='win_args', fuzzer_metadata={}, testcases_metadata={}, timeout_multiplier=1, test_timeout=2, thread_wait_timeout=3, data_directory='/data')) self.assertEqual(5, new_crash_count) self.assertEqual(3, known_crash_count) self.assertEqual(5, len(groups)) self.assertEqual([ 'reproducible1', 'reproducible2', 'unreproducible1', 'unreproducible2', 'unreproducible3' ], [group.main_crash.crash_state for group in groups]) self.assertEqual([True, True, True, True, True], [group.is_new() for group in groups]) self.assertEqual([3, 1, 1, 2, 1], [len(group.crashes) for group in groups]) testcases = list(data_types.Testcase.query()) self.assertEqual(5, len(testcases)) self.assertSetEqual( set([r2_stacktrace, 'r4', 'u1', 'u2', 'u4']), set(t.crash_stacktrace for t in testcases)) self.assertSetEqual( set([ '{"fuzzing_strategies": ["value_profile"]}', None, None, None, None ]), set(t.additional_metadata for t in testcases)) # r2 is a reproducible crash, so r3 doesn't self.assertEqual( len(crashes) - 1, self.mock.archive_testcase_and_dependencies_in_gcs.call_count) actual_crash_infos = [group.main_crash.crash_info for group in groups] if project_name != 'chromium': expected_crash_infos = [None] * len(actual_crash_infos) else: expected_saved_crash_info = crash_uploader.CrashReportInfo( product='Chrome_' + environment.platform().lower().capitalize(), version='this.is.fake.ver', serialized_crash_stack_frames='f00df00d') expected_crash_infos = [ expected_saved_crash_info, expected_saved_crash_info, None, None, None, ] self.assertEqual(len(expected_crash_infos), len(actual_crash_infos)) for expected, actual in zip(expected_crash_infos, actual_crash_infos): if not expected: self.assertIsNone(actual) continue self.assertEqual(expected.product, actual.product) self.assertEqual(expected.version, actual.version) self.assertEqual(expected.serialized_crash_stack_frames, actual.serialized_crash_stack_frames) def _make_big_query_json(crash, reproducible_flag, new_flag, testcase_id): return { 'crash_type': crash.crash_type, 'crash_state': crash.crash_state, 'created_at': 987, 'platform': 'platform', 'crash_time_in_ms': int(crash.crash_time * 1000), 'parent_fuzzer_name': 'engine', 'fuzzer_name': 'engine_binary', 'job_type': 'job', 'security_flag': crash.security_flag, 'reproducible_flag': reproducible_flag, 'revision': '1234', 'new_flag': new_flag, 'project': project_name, 'testcase_id': testcase_id } def _get_testcase_id(crash): rows = list( data_types.Testcase.query( data_types.Testcase.crash_type == crash.crash_type, data_types.Testcase.crash_state == crash.crash_state, data_types.Testcase.security_flag == crash.security_flag)) if not rows: return None return str(rows[0].key.id()) self.assertEqual(5, self.mock.insert.call_count) self.mock.insert.assert_has_calls([ mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[0], True, False, None), '%s:bot:987:0' % crashes[0].key), big_query.Insert( _make_big_query_json(crashes[1], True, True, _get_testcase_id(crashes[1])), '%s:bot:987:1' % crashes[0].key), big_query.Insert( _make_big_query_json(crashes[2], True, False, None), '%s:bot:987:2' % crashes[0].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[3], True, True, _get_testcase_id(crashes[3])), '%s:bot:987:0' % crashes[3].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[4], False, True, _get_testcase_id(crashes[4])), '%s:bot:987:0' % crashes[4].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[5], False, True, _get_testcase_id(crashes[5])), '%s:bot:987:0' % crashes[5].key), big_query.Insert( _make_big_query_json(crashes[6], False, False, None), '%s:bot:987:1' % crashes[5].key) ]), mock.call(mock.ANY, [ big_query.Insert( _make_big_query_json(crashes[7], False, True, _get_testcase_id(crashes[7])), '%s:bot:987:0' % crashes[7].key) ]), ]) class WriteCrashToBigQueryTest(unittest.TestCase): def setUp(self): self.client = mock.Mock(spec_set=big_query.Client) helpers.patch(self, [ 'system.environment.get_value', 'datastore.data_handler.get_project_name', 'google_cloud_utils.big_query.Client', 'time.time', ]) monitor.metrics_store().reset_for_testing() self.mock.get_project_name.return_value = 'some_project' self.mock.get_value.return_value = 'bot' self.mock.Client.return_value = self.client self.mock.time.return_value = 99 self.crashes = [ self._make_crash('c1'), self._make_crash('c2'), self._make_crash('c3') ] newly_created_testcase = mock.MagicMock() newly_created_testcase.key.id.return_value = 't' self.group = mock.MagicMock( crashes=self.crashes, main_crash=self.crashes[0], one_time_crasher_flag=False, newly_created_testcase=newly_created_testcase) self.group.is_new.return_value = True def _create_context(self, job_type, platform_id): return fuzz_task.Context( project_name='some_project', bot_name='bot', job_type=job_type, fuzz_target=data_types.FuzzTarget(engine='engine', binary='binary'), redzone=32, disable_ubsan=False, platform_id=platform_id, crash_revision=1234, fuzzer_name='engine', window_argument='windows_args', fuzzer_metadata={}, testcases_metadata={}, timeout_multiplier=1.0, test_timeout=5, thread_wait_timeout=6, data_directory='data') def _make_crash(self, state): crash = mock.Mock( crash_type='type', crash_state=state, crash_time=111, security_flag=True, key='key') return crash def _json(self, job, platform, state, new_flag, testcase_id): return { 'crash_type': 'type', 'crash_state': state, 'created_at': 99, 'platform': platform, 'crash_time_in_ms': 111000, 'parent_fuzzer_name': 'engine', 'fuzzer_name': 'engine_binary', 'job_type': job, 'security_flag': True, 'reproducible_flag': True, 'revision': '1234', 'new_flag': new_flag, 'project': 'some_project', 'testcase_id': testcase_id } def test_all_succeed(self): self.client.insert.return_value = {} context = self._create_context('job', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(3, success_count) self.assertEqual(0, failure_count) self.mock.Client.assert_called_once_with( dataset_id='main', table_id='crashes$19700101') self.client.insert.assert_called_once_with([ big_query.Insert( self._json('job', 'linux', 'c1', True, 't'), 'key:bot:99:0'), big_query.Insert( self._json('job', 'linux', 'c2', False, None), 'key:bot:99:1'), big_query.Insert( self._json('job', 'linux', 'c3', False, None), 'key:bot:99:2') ]) def test_succeed(self): self.client.insert.return_value = {'insertErrors': [{'index': 1}]} context = self._create_context('job', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(2, success_count) self.assertEqual(1, failure_count) self.mock.Client.assert_called_once_with( dataset_id='main', table_id='crashes$19700101') self.client.insert.assert_called_once_with([ big_query.Insert( self._json('job', 'linux', 'c1', True, 't'), 'key:bot:99:0'), big_query.Insert( self._json('job', 'linux', 'c2', False, None), 'key:bot:99:1'), big_query.Insert( self._json('job', 'linux', 'c3', False, None), 'key:bot:99:2') ]) def test_chromeos_platform(self): self.client.insert.return_value = {'insertErrors': [{'index': 1}]} context = self._create_context('job_chromeos', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(2, success_count) self.assertEqual(1, failure_count) self.mock.Client.assert_called_once_with( dataset_id='main', table_id='crashes$19700101') self.client.insert.assert_called_once_with([ big_query.Insert( self._json('job_chromeos', 'chrome', 'c1', True, 't'), 'key:bot:99:0'), big_query.Insert( self._json('job_chromeos', 'chrome', 'c2', False, None), 'key:bot:99:1'), big_query.Insert( self._json('job_chromeos', 'chrome', 'c3', False, None), 'key:bot:99:2') ]) def test_exception(self): self.client.insert.side_effect = Exception('error') context = self._create_context('job', 'linux') fuzz_task.write_crashes_to_big_query(self.group, context) success_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': True }) failure_count = monitoring_metrics.BIG_QUERY_WRITE_COUNT.get({ 'success': False }) self.assertEqual(0, success_count) self.assertEqual(3, failure_count) class ConvertGroupsToCrashesTest(object): def test_convert(self): groups = [ mock.Mock( crashes=[mock.Mock(), mock.Mock()], main_crash=mock.Mock( crash_type='t1', crash_state='s1', security_flag=True)), mock.Mock( crashes=[mock.Mock()], main_crash=mock.Mock( crash_type='t2', crash_state='s2', security_flag=False)), ] groups[0].is_new.return_value = False groups[1].is_new.return_value = True self.assertEqual([ { 'is_new': False, 'count': 2, 'crash_type': 't1', 'crash_state': 's1', 'security_flag': True }, { 'is_new': True, 'count': 1, 'crash_type': 't2', 'crash_state': 's2', 'security_flag': False }, ], fuzz_task.convert_groups_to_crashes(groups)) class TestCorpusSync(fake_filesystem_unittest.TestCase): def setUp(self): helpers.patch(self, [ 'fuzzing.corpus_manager.FuzzTargetCorpus.rsync_to_disk', 'fuzzing.corpus_manager.FuzzTargetCorpus.upload_files', 'google_cloud_utils.storage.last_updated', ]) helpers.patch_environ(self) os.environ['FAIL_RETRIES'] = '1' os.environ['CORPUS_BUCKET'] = 'bucket' self.mock.rsync_to_disk.return_value = True test_utils.set_up_pyfakefs(self) self.fs.create_dir('/dir') self.fs.create_dir('/dir1') def _write_corpus_files(self, *args, **kwargs): self.fs.create_file('/dir/a') self.fs.create_file('/dir/b') return True def test_sync(self): corpus = fuzz_task.GcsCorpus('parent', 'child', '/dir', '/dir1') self.mock.rsync_to_disk.side_effect = self._write_corpus_files self.assertTrue(corpus.sync_from_gcs()) self.assertTrue(os.path.exists('/dir1/.child_sync')) self.assertEqual(('/dir',), self.mock.rsync_to_disk.call_args[0][1:]) self.fs.create_file('/dir/c') self.assertListEqual(['/dir/c'], corpus.get_new_files()) corpus.upload_files(corpus.get_new_files()) self.assertEqual((['/dir/c'],), self.mock.upload_files.call_args[0][1:]) self.assertListEqual([], corpus.get_new_files()) def test_no_sync(self): corpus = fuzz_task.GcsCorpus('parent', 'child', '/dir', '/dir1') utils.write_data_to_file(time.time(), '/dir1/.child_sync') self.mock.last_updated.return_value = ( datetime.datetime.utcnow() - datetime.timedelta(days=1)) self.assertTrue(corpus.sync_from_gcs()) self.assertEqual(0, self.mock.rsync_to_disk.call_count) def test_sync_with_failed_last_update(self): corpus = fuzz_task.GcsCorpus('parent', 'child', '/dir', '/dir1') utils.write_data_to_file(time.time(), '/dir1/.child_sync') self.mock.last_updated.return_value = None self.assertTrue(corpus.sync_from_gcs()) self.assertEqual(1, self.mock.rsync_to_disk.call_count) @test_utils.with_cloud_emulators('datastore') class RecordFuzzTargetTest(unittest.TestCase): def setUp(self): helpers.patch_environ(self) helpers.patch(self, [ 'base.utils.is_oss_fuzz', 'base.utils.utcnow', ]) self.mock.is_oss_fuzz.return_value = False self.mock.utcnow.return_value = datetime.datetime(2018, 1, 1) def test_record_fuzz_target(self): fuzz_task.record_fuzz_target('libFuzzer', 'child', 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_child').get() self.assertDictEqual({ 'binary': 'child', 'engine': 'libFuzzer', 'project': 'test-project', }, fuzz_target.to_dict()) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_child/job').get() self.assertDictEqual({ 'fuzz_target_name': 'libFuzzer_child', 'job': 'job', 'engine': 'libFuzzer', 'last_run': datetime.datetime(2018, 1, 1, 0, 0), 'weight': 1.0, }, job_mapping.to_dict()) self.assertEqual('libFuzzer_child', fuzz_target.fully_qualified_name()) self.assertEqual('child', fuzz_target.project_qualified_name()) def test_record_fuzz_target_existing(self): data_types.FuzzTarget( binary='child', engine='libFuzzer', project='test-project').put() data_types.FuzzTargetJob( fuzz_target_name='libFuzzer_child', job='job', engine='libFuzzer', last_run=datetime.datetime(2017, 12, 31, 0, 0)).put() fuzz_task.record_fuzz_target('libFuzzer', 'child', 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_child').get() self.assertDictEqual({ 'binary': 'child', 'engine': 'libFuzzer', 'project': 'test-project', }, fuzz_target.to_dict()) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_child/job').get() self.assertDictEqual({ 'fuzz_target_name': 'libFuzzer_child', 'job': 'job', 'engine': 'libFuzzer', 'last_run': datetime.datetime(2018, 1, 1, 0, 0), 'weight': 1.0, }, job_mapping.to_dict()) self.assertEqual('libFuzzer_child', fuzz_target.fully_qualified_name()) self.assertEqual('child', fuzz_target.project_qualified_name()) def test_record_fuzz_target_no_binary_name(self): # FuzzTargets as a result. fuzz_task.record_fuzz_target('libFuzzer', None, 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_child').get() self.assertIsNone(fuzz_target) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_child/job').get() self.assertIsNone(job_mapping) @parameterized.parameterized.expand(['child', 'proj_child']) def test_record_fuzz_target_ossfuzz(self, binary_name): self.mock.is_oss_fuzz.return_value = True data_types.Job(name='job', environment_string='PROJECT_NAME = proj\n').put() fuzz_task.record_fuzz_target('libFuzzer', binary_name, 'job') fuzz_target = ndb.Key(data_types.FuzzTarget, 'libFuzzer_proj_child').get() self.assertDictEqual({ 'binary': binary_name, 'engine': 'libFuzzer', 'project': 'proj', }, fuzz_target.to_dict()) job_mapping = ndb.Key(data_types.FuzzTargetJob, 'libFuzzer_proj_child/job').get() self.assertDictEqual({ 'fuzz_target_name': 'libFuzzer_proj_child', 'job': 'job', 'engine': 'libFuzzer', 'last_run': datetime.datetime(2018, 1, 1, 0, 0), 'weight': 1.0, }, job_mapping.to_dict()) self.assertEqual('libFuzzer_proj_child', fuzz_target.fully_qualified_name()) self.assertEqual('proj_child', fuzz_target.project_qualified_name()) @test_utils.with_cloud_emulators('datastore') class DoEngineFuzzingTest(fake_filesystem_unittest.TestCase): def setUp(self): helpers.patch_environ(self) helpers.patch(self, [ 'bot.fuzzers.engine_common.current_timestamp', 'bot.tasks.fuzz_task.GcsCorpus.sync_from_gcs', 'bot.tasks.fuzz_task.GcsCorpus.upload_files', 'build_management.revisions.get_component_list', 'bot.testcase_manager.upload_log', 'bot.testcase_manager.upload_testcase', 'metrics.fuzzer_stats.upload_stats', ]) test_utils.set_up_pyfakefs(self) os.environ['JOB_NAME'] = 'libfuzzer_asan_test' os.environ['FUZZ_INPUTS'] = '/fuzz-inputs' os.environ['FUZZ_INPUTS_DISK'] = '/fuzz-inputs-disk' os.environ['BUILD_DIR'] = '/build_dir' os.environ['MAX_TESTCASES'] = '2' os.environ['AUTOMATIC_LABELS'] = 'auto_label,auto_label1' os.environ['AUTOMATIC_COMPONENTS'] = 'auto_component,auto_component1' self.fs.create_file('/build_dir/test_target') self.fs.create_file( '/build_dir/test_target.labels', contents='label1\nlabel2') self.fs.create_file( '/build_dir/test_target.owners', contents='owner1@email.com') self.fs.create_file( '/build_dir/test_target.components', contents='component1\ncomponent2') self.fs.create_file('/input') self.mock.sync_from_gcs.return_value = True self.mock.upload_files.return_value = True self.mock.get_component_list.return_value = [{ 'component': 'component', 'link_text': 'rev', }] self.mock.current_timestamp.return_value = 0.0 def test_basic(self): session = fuzz_task.FuzzingSession('libFuzzer', 'libfuzzer_asan_test', 60) session.testcase_directory = os.environ['FUZZ_INPUTS'] session.data_directory = '/data_dir' os.environ['FUZZ_TARGET'] = 'test_target' os.environ['APP_REVISION'] = '1' expected_crashes = [engine.Crash('/input', 'stack', ['args'], 1.0)] engine_impl = mock.Mock() engine_impl.name = 'libFuzzer' engine_impl.prepare.return_value = engine.FuzzOptions( '/corpus', ['arg'], { 'strategy_1': 1, 'strategy_2': 50, }) engine_impl.fuzz.side_effect = lambda *_: engine.FuzzResult( 'logs', ['cmd'], expected_crashes, {'stat': 1}, 42.0) crashes, fuzzer_metadata = session.do_engine_fuzzing(engine_impl) self.assertDictEqual({ 'fuzzer_binary_name': 'test_target', 'issue_components': 'component1,component2,auto_component,auto_component1', 'issue_labels': 'label1,label2,auto_label,auto_label1', 'issue_owners': 'owner1@email.com', }, fuzzer_metadata) log_time = datetime.datetime(1970, 1, 1, 0, 0) log_call = mock.call( 'Component revisions (build r1):\n' 'component: rev\n\n' 'Return code: 1\n\n' 'Command: cmd\nBot: None\nTime ran: 42.0\n\n' 'logs\n' 'cf::fuzzing_strategies: strategy_1:1,strategy_2:50', log_time) self.mock.upload_log.assert_has_calls([log_call, log_call]) self.mock.upload_testcase.assert_has_calls([ mock.call('/input', log_time), mock.call('/input', log_time), ]) self.assertEqual(2, len(crashes)) for i in range(2): self.assertEqual('/input', crashes[i].file_path) self.assertEqual(1, crashes[i].return_code) self.assertEqual('stack', crashes[i].unsymbolized_crash_stacktrace) self.assertEqual(1.0, crashes[i].crash_time) self.assertEqual('args', crashes[i].arguments) for i in range(2): upload_args = self.mock.upload_stats.call_args_list[i][0][0] testcase_run = upload_args[0] self.assertDictEqual({ 'build_revision': 1, 'command': ['cmd'], 'fuzzer': u'libFuzzer_test_target', 'job': 'libfuzzer_asan_test', 'kind': 'TestcaseRun', 'stat': 1, 'strategy_strategy_1': 1, 'strategy_strategy_2': 50, 'timestamp': 0.0, }, testcase_run.data) class UntrustedRunEngineFuzzerTest( untrusted_runner_helpers.UntrustedRunnerIntegrationTest): def setUp(self): super(UntrustedRunEngineFuzzerTest, self).setUp() environment.set_value('JOB_NAME', 'libfuzzer_asan_job') job = data_types.Job( name='libfuzzer_asan_job', environment_string=( 'RELEASE_BUILD_BUCKET_PATH = ' 'gs://clusterfuzz-test-data/test_libfuzzer_builds/' 'test-libfuzzer-build-([0-9]+).zip\n' 'REVISION_VARS_URL = https://commondatastorage.googleapis.com/' 'clusterfuzz-test-data/test_libfuzzer_builds/' 'test-libfuzzer-build-%s.srcmap.json\n')) job.put() self.temp_dir = tempfile.mkdtemp(dir=environment.get_value('FUZZ_INPUTS')) environment.set_value('USE_MINIJAIL', False) def tearDown(self): super(UntrustedRunEngineFuzzerTest, self).tearDown() shutil.rmtree(self.temp_dir, ignore_errors=True) def test_run_engine_fuzzer(self): self._setup_env(job_type='libfuzzer_asan_job') environment.set_value('FUZZ_TEST_TIMEOUT', 3600) build_manager.setup_build() corpus_directory = os.path.join(self.temp_dir, 'corpus') testcase_directory = os.path.join(self.temp_dir, 'artifacts') os.makedirs(file_host.rebase_to_worker_root(corpus_directory)) os.makedirs(file_host.rebase_to_worker_root(testcase_directory)) result, fuzzer_metadata = fuzz_task.run_engine_fuzzer( libfuzzer_engine.LibFuzzerEngine(), 'test_fuzzer', corpus_directory, testcase_directory) self.assertIn( 'ERROR: AddressSanitizer: SEGV on unknown address 0x000000000000', result.logs) self.assertEqual(1, len(result.crashes)) self.assertTrue(result.crashes[0].input_path.startswith( os.environ['ROOT_DIR'])) self.assertTrue(os.path.exists(result.crashes[0].input_path)) self.assertIsInstance(result.stats.get('number_of_executed_units'), int) self.assertIsInstance(result.stats.get('oom_count'), int) self.assertIsInstance( result.stats.get('strategy_selection_method'), six.string_types) self.assertDictEqual({'fuzzer_binary_name': 'test_fuzzer'}, fuzzer_metadata) class AddIssueMetadataFromEnvironmentTest(unittest.TestCase): def setUp(self): helpers.patch_environ(self) def test_add_no_existing(self): os.environ['AUTOMATIC_LABELS'] = 'auto_label' os.environ['AUTOMATIC_LABELS_1'] = 'auto_label1' os.environ['AUTOMATIC_COMPONENTS'] = 'auto_component' os.environ['AUTOMATIC_COMPONENTS_1'] = 'auto_component1' metadata = {} fuzz_task._add_issue_metadata_from_environment(metadata) self.assertDictEqual({ 'issue_components': 'auto_component,auto_component1', 'issue_labels': 'auto_label,auto_label1', }, metadata) def test_add_append(self): os.environ['AUTOMATIC_LABELS'] = 'auto_label' os.environ['AUTOMATIC_LABELS_1'] = 'auto_label1' os.environ['AUTOMATIC_COMPONENTS'] = 'auto_component' os.environ['AUTOMATIC_COMPONENTS_1'] = 'auto_component1' metadata = { 'issue_components': 'existing_component', 'issue_labels': 'existing_label' } fuzz_task._add_issue_metadata_from_environment(metadata) self.assertDictEqual({ 'issue_components': 'existing_component,auto_component,auto_component1', 'issue_labels': 'existing_label,auto_label,auto_label1', }, metadata) def test_add_numeric(self): os.environ['AUTOMATIC_LABELS'] = '123' metadata = {} fuzz_task._add_issue_metadata_from_environment(metadata) self.assertDictEqual({ 'issue_labels': '123', }, metadata)
true
true
f71d7d078b07d7f6a9b3225e4d976e6989b07bd6
9,268
py
Python
faassupervisor/faas/aws_lambda/udocker.py
WinstonN/faas-supervisor
9dadf7a34459a5c66d2b2828e8a79badc55a8758
[ "Apache-2.0" ]
null
null
null
faassupervisor/faas/aws_lambda/udocker.py
WinstonN/faas-supervisor
9dadf7a34459a5c66d2b2828e8a79badc55a8758
[ "Apache-2.0" ]
null
null
null
faassupervisor/faas/aws_lambda/udocker.py
WinstonN/faas-supervisor
9dadf7a34459a5c66d2b2828e8a79badc55a8758
[ "Apache-2.0" ]
null
null
null
# Copyright (C) GRyCAP - I3M - UPV # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """In this module are defined all the methods and classes used to manage a udocker container in the lambda environment.""" import subprocess from faassupervisor.exceptions import ContainerImageNotFoundError from faassupervisor.utils import SysUtils, FileUtils, ConfigUtils from faassupervisor.logger import get_logger from faassupervisor.exceptions import ContainerTimeoutExpiredWarning from faassupervisor.faas.aws_lambda.function import get_function_ip def _parse_cont_env_var(key, value): return ["--env", str(key) + '=' + str(value)] if key and value else [] class Udocker(): """Class in charge of managing the udocker binary.""" _CONTAINER_OUTPUT_FILE = SysUtils.join_paths(FileUtils.get_tmp_dir(), "container-stdout") _CONTAINER_NAME = "udocker_container" _SCRIPT_EXEC = "/bin/sh" def __init__(self, lambda_instance): self.lambda_instance = lambda_instance # Create required udocker folder FileUtils.create_folder(SysUtils.get_env_var("UDOCKER_DIR")) # Init the udocker command that will be executed self.udocker_exec = [SysUtils.get_env_var("UDOCKER_EXEC")] self.cont_cmd = self.udocker_exec + ["--quiet", "run"] self.cont_img_id = ConfigUtils.read_cfg_var('container').get('image') if not self.cont_img_id: raise ContainerImageNotFoundError() def _list_udocker_images_cmd(self): return self.udocker_exec + ["images"] def _load_udocker_image_cmd(self): return self.udocker_exec + ["load", "-i", self.cont_img_id] def _download_udocker_image_cmd(self): return self.udocker_exec + ["-D", "pull", self.cont_img_id] def _list_udocker_containers_cmd(self): return self.udocker_exec + ["ps"] def _create_udocker_container_cmd(self): return self.udocker_exec + ["create", f"--name={self._CONTAINER_NAME}", self.cont_img_id] def _set_udocker_container_execution_mode_cmd(self): return self.udocker_exec + ["setup", "--execmode=F1", self._CONTAINER_NAME] def _is_container_image_downloaded(self): cmd_out = SysUtils.execute_cmd_and_return_output(self._list_udocker_images_cmd()) return self.cont_img_id in cmd_out def _load_local_container_image(self): get_logger().info("Loading container image '%s'", self.cont_img_id) SysUtils.execute_cmd(self._load_udocker_image_cmd()) def _download_container_image(self): get_logger().info("Pulling container '%s' from Docker Hub", self.cont_img_id) SysUtils.execute_cmd(self._download_udocker_image_cmd()) def _is_container_available(self): cmd_out = SysUtils.execute_cmd_and_return_output(self._list_udocker_containers_cmd()) return self._CONTAINER_NAME in cmd_out def _create_image(self): if self._is_container_image_downloaded(): get_logger().info("Container image '%s' already available", self.cont_img_id) else: if SysUtils.is_var_in_env("IMAGE_FILE"): self._load_local_container_image() else: self._download_container_image() def _create_container(self): if self._is_container_available(): get_logger().info("Container already available") else: get_logger().info("Creating container based on image '%s'.", self.cont_img_id) SysUtils.execute_cmd(self._create_udocker_container_cmd()) SysUtils.execute_cmd(self._set_udocker_container_execution_mode_cmd()) def _create_command(self): self._add_container_volumes() self._add_container_environment_variables() # Container running script if hasattr(self.lambda_instance, 'script_path'): # Add script in memory as entrypoint self.cont_cmd += [(f"--entrypoint={self._SCRIPT_EXEC} " f"{self.lambda_instance.script_path}"), self._CONTAINER_NAME] # Container with args elif hasattr(self.lambda_instance, 'cmd_args'): # Add args self.cont_cmd += [self._CONTAINER_NAME] self.cont_cmd += self.lambda_instance.cmd_args # Script to be executed every time (if defined) elif hasattr(self.lambda_instance, 'init_script_path'): # Add init script self.cont_cmd += [(f"--entrypoint={self._SCRIPT_EXEC} " f"{self.lambda_instance.init_script_path}"), self._CONTAINER_NAME] # Only container else: self.cont_cmd += [self._CONTAINER_NAME] def _add_container_volumes(self): self.cont_cmd.extend(["-v", SysUtils.get_env_var("TMP_INPUT_DIR")]) self.cont_cmd.extend(["-v", SysUtils.get_env_var("TMP_OUTPUT_DIR")]) self.cont_cmd.extend(["-v", "/dev", "-v", "/mnt", "-v", "/proc", "-v", "/etc/hosts", "--nosysdirs"]) if SysUtils.is_var_in_env('EXTRA_PAYLOAD'): self.cont_cmd.extend(["-v", self.lambda_instance.PERMANENT_FOLDER]) def _add_cont_env_vars(self): for key, value in SysUtils.get_cont_env_vars().items(): self.cont_cmd.extend(_parse_cont_env_var(key, value)) def _add_input_file(self): self.cont_cmd.extend(_parse_cont_env_var("INPUT_FILE_PATH", SysUtils.get_env_var("INPUT_FILE_PATH"))) def _add_output_dir(self): self.cont_cmd.extend(_parse_cont_env_var("TMP_OUTPUT_DIR", SysUtils.get_env_var("TMP_OUTPUT_DIR"))) def _add_storage_object_key(self): self.cont_cmd.extend(_parse_cont_env_var("STORAGE_OBJECT_KEY", SysUtils.get_env_var("STORAGE_OBJECT_KEY"))) def _add_extra_payload_path(self): self.cont_cmd.extend(_parse_cont_env_var("EXTRA_PAYLOAD", SysUtils.get_env_var("EXTRA_PAYLOAD"))) def _add_function_request_id(self): self.cont_cmd.extend(_parse_cont_env_var("REQUEST_ID", self.lambda_instance.get_request_id())) def _add_aws_access_keys(self): self.cont_cmd.extend(_parse_cont_env_var("AWS_ACCESS_KEY_ID", SysUtils.get_env_var("AWS_ACCESS_KEY_ID"))) self.cont_cmd.extend(_parse_cont_env_var("AWS_SECRET_ACCESS_KEY", SysUtils.get_env_var("AWS_SECRET_ACCESS_KEY"))) self.cont_cmd.extend(_parse_cont_env_var("AWS_SESSION_TOKEN", SysUtils.get_env_var("AWS_SESSION_TOKEN"))) def _add_function_ip(self): self.cont_cmd.extend(_parse_cont_env_var("INSTANCE_IP", get_function_ip())) def _add_container_environment_variables(self): self._add_function_request_id() self._add_function_ip() self._add_aws_access_keys() self._add_cont_env_vars() self._add_input_file() self._add_output_dir() self._add_storage_object_key() self._add_extra_payload_path() def prepare_container(self): """Prepares the environment to execute the udocker container.""" self._create_image() self._create_container() self._create_command() def launch_udocker_container(self): """Launches the udocker container. If the execution time of the container exceeds the defined execution time, the container is killed and a warning is raised.""" remaining_seconds = self.lambda_instance.get_remaining_time_in_seconds() get_logger().info("Executing udocker container. Timeout set to '%d' seconds", remaining_seconds) get_logger().debug("Udocker command: '%s'", self.cont_cmd) with open(self._CONTAINER_OUTPUT_FILE, "wb") as out: with subprocess.Popen(self.cont_cmd, stderr=subprocess.STDOUT, stdout=out, start_new_session=True) as process: try: process.wait(timeout=remaining_seconds) except subprocess.TimeoutExpired: get_logger().info("Stopping process '%s'", process) process.kill() raise ContainerTimeoutExpiredWarning() udocker_output = b'' if FileUtils.is_file(self._CONTAINER_OUTPUT_FILE): udocker_output = FileUtils.read_file(self._CONTAINER_OUTPUT_FILE, file_mode="rb") return udocker_output
45.431373
108
0.65451
import subprocess from faassupervisor.exceptions import ContainerImageNotFoundError from faassupervisor.utils import SysUtils, FileUtils, ConfigUtils from faassupervisor.logger import get_logger from faassupervisor.exceptions import ContainerTimeoutExpiredWarning from faassupervisor.faas.aws_lambda.function import get_function_ip def _parse_cont_env_var(key, value): return ["--env", str(key) + '=' + str(value)] if key and value else [] class Udocker(): _CONTAINER_OUTPUT_FILE = SysUtils.join_paths(FileUtils.get_tmp_dir(), "container-stdout") _CONTAINER_NAME = "udocker_container" _SCRIPT_EXEC = "/bin/sh" def __init__(self, lambda_instance): self.lambda_instance = lambda_instance FileUtils.create_folder(SysUtils.get_env_var("UDOCKER_DIR")) self.udocker_exec = [SysUtils.get_env_var("UDOCKER_EXEC")] self.cont_cmd = self.udocker_exec + ["--quiet", "run"] self.cont_img_id = ConfigUtils.read_cfg_var('container').get('image') if not self.cont_img_id: raise ContainerImageNotFoundError() def _list_udocker_images_cmd(self): return self.udocker_exec + ["images"] def _load_udocker_image_cmd(self): return self.udocker_exec + ["load", "-i", self.cont_img_id] def _download_udocker_image_cmd(self): return self.udocker_exec + ["-D", "pull", self.cont_img_id] def _list_udocker_containers_cmd(self): return self.udocker_exec + ["ps"] def _create_udocker_container_cmd(self): return self.udocker_exec + ["create", f"--name={self._CONTAINER_NAME}", self.cont_img_id] def _set_udocker_container_execution_mode_cmd(self): return self.udocker_exec + ["setup", "--execmode=F1", self._CONTAINER_NAME] def _is_container_image_downloaded(self): cmd_out = SysUtils.execute_cmd_and_return_output(self._list_udocker_images_cmd()) return self.cont_img_id in cmd_out def _load_local_container_image(self): get_logger().info("Loading container image '%s'", self.cont_img_id) SysUtils.execute_cmd(self._load_udocker_image_cmd()) def _download_container_image(self): get_logger().info("Pulling container '%s' from Docker Hub", self.cont_img_id) SysUtils.execute_cmd(self._download_udocker_image_cmd()) def _is_container_available(self): cmd_out = SysUtils.execute_cmd_and_return_output(self._list_udocker_containers_cmd()) return self._CONTAINER_NAME in cmd_out def _create_image(self): if self._is_container_image_downloaded(): get_logger().info("Container image '%s' already available", self.cont_img_id) else: if SysUtils.is_var_in_env("IMAGE_FILE"): self._load_local_container_image() else: self._download_container_image() def _create_container(self): if self._is_container_available(): get_logger().info("Container already available") else: get_logger().info("Creating container based on image '%s'.", self.cont_img_id) SysUtils.execute_cmd(self._create_udocker_container_cmd()) SysUtils.execute_cmd(self._set_udocker_container_execution_mode_cmd()) def _create_command(self): self._add_container_volumes() self._add_container_environment_variables() if hasattr(self.lambda_instance, 'script_path'): self.cont_cmd += [(f"--entrypoint={self._SCRIPT_EXEC} " f"{self.lambda_instance.script_path}"), self._CONTAINER_NAME] elif hasattr(self.lambda_instance, 'cmd_args'): self.cont_cmd += [self._CONTAINER_NAME] self.cont_cmd += self.lambda_instance.cmd_args elif hasattr(self.lambda_instance, 'init_script_path'): self.cont_cmd += [(f"--entrypoint={self._SCRIPT_EXEC} " f"{self.lambda_instance.init_script_path}"), self._CONTAINER_NAME] else: self.cont_cmd += [self._CONTAINER_NAME] def _add_container_volumes(self): self.cont_cmd.extend(["-v", SysUtils.get_env_var("TMP_INPUT_DIR")]) self.cont_cmd.extend(["-v", SysUtils.get_env_var("TMP_OUTPUT_DIR")]) self.cont_cmd.extend(["-v", "/dev", "-v", "/mnt", "-v", "/proc", "-v", "/etc/hosts", "--nosysdirs"]) if SysUtils.is_var_in_env('EXTRA_PAYLOAD'): self.cont_cmd.extend(["-v", self.lambda_instance.PERMANENT_FOLDER]) def _add_cont_env_vars(self): for key, value in SysUtils.get_cont_env_vars().items(): self.cont_cmd.extend(_parse_cont_env_var(key, value)) def _add_input_file(self): self.cont_cmd.extend(_parse_cont_env_var("INPUT_FILE_PATH", SysUtils.get_env_var("INPUT_FILE_PATH"))) def _add_output_dir(self): self.cont_cmd.extend(_parse_cont_env_var("TMP_OUTPUT_DIR", SysUtils.get_env_var("TMP_OUTPUT_DIR"))) def _add_storage_object_key(self): self.cont_cmd.extend(_parse_cont_env_var("STORAGE_OBJECT_KEY", SysUtils.get_env_var("STORAGE_OBJECT_KEY"))) def _add_extra_payload_path(self): self.cont_cmd.extend(_parse_cont_env_var("EXTRA_PAYLOAD", SysUtils.get_env_var("EXTRA_PAYLOAD"))) def _add_function_request_id(self): self.cont_cmd.extend(_parse_cont_env_var("REQUEST_ID", self.lambda_instance.get_request_id())) def _add_aws_access_keys(self): self.cont_cmd.extend(_parse_cont_env_var("AWS_ACCESS_KEY_ID", SysUtils.get_env_var("AWS_ACCESS_KEY_ID"))) self.cont_cmd.extend(_parse_cont_env_var("AWS_SECRET_ACCESS_KEY", SysUtils.get_env_var("AWS_SECRET_ACCESS_KEY"))) self.cont_cmd.extend(_parse_cont_env_var("AWS_SESSION_TOKEN", SysUtils.get_env_var("AWS_SESSION_TOKEN"))) def _add_function_ip(self): self.cont_cmd.extend(_parse_cont_env_var("INSTANCE_IP", get_function_ip())) def _add_container_environment_variables(self): self._add_function_request_id() self._add_function_ip() self._add_aws_access_keys() self._add_cont_env_vars() self._add_input_file() self._add_output_dir() self._add_storage_object_key() self._add_extra_payload_path() def prepare_container(self): self._create_image() self._create_container() self._create_command() def launch_udocker_container(self): remaining_seconds = self.lambda_instance.get_remaining_time_in_seconds() get_logger().info("Executing udocker container. Timeout set to '%d' seconds", remaining_seconds) get_logger().debug("Udocker command: '%s'", self.cont_cmd) with open(self._CONTAINER_OUTPUT_FILE, "wb") as out: with subprocess.Popen(self.cont_cmd, stderr=subprocess.STDOUT, stdout=out, start_new_session=True) as process: try: process.wait(timeout=remaining_seconds) except subprocess.TimeoutExpired: get_logger().info("Stopping process '%s'", process) process.kill() raise ContainerTimeoutExpiredWarning() udocker_output = b'' if FileUtils.is_file(self._CONTAINER_OUTPUT_FILE): udocker_output = FileUtils.read_file(self._CONTAINER_OUTPUT_FILE, file_mode="rb") return udocker_output
true
true
f71d7d40882346a998d1a79c9228b8c5ed1adc9f
2,158
py
Python
docs/conf.py
lengstrom/3db
1d4a19600bcc43cf5637f7ee1d16887cba6308d5
[ "MIT" ]
1
2021-07-07T08:35:46.000Z
2021-07-07T08:35:46.000Z
docs/conf.py
lengstrom/3db
1d4a19600bcc43cf5637f7ee1d16887cba6308d5
[ "MIT" ]
null
null
null
docs/conf.py
lengstrom/3db
1d4a19600bcc43cf5637f7ee1d16887cba6308d5
[ "MIT" ]
null
null
null
# Configuration file for the Sphinx documentation builder. # # This file only contains a selection of the most common options. For a full # list see the documentation: # https://www.sphinx-doc.org/en/master/usage/configuration.html # -- Path setup -------------------------------------------------------------- # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. # import os import sys sys.path.insert(0, os.path.abspath('..')) # -- Project information ----------------------------------------------------- project = '3DB' copyright = '2021, 3DB Team' author = '3DB Team' # -- General configuration --------------------------------------------------- # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.autosummary', 'sphinx.ext.napoleon', 'sphinxcontrib.images' ] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This pattern also affects html_static_path and html_extra_path. exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] # -- Options for HTML output ------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'sphinx_rtd_theme' html_theme_options = { 'collapse_navigation': False, 'navigation_depth': -1, 'includehidden': True, } # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] autodoc_member_order = 'bysource' autodoc_mock_imports = ['bpy', 'imagenet_c', 'cv2']
33.2
79
0.664504
import os import sys sys.path.insert(0, os.path.abspath('..')) project = '3DB' copyright = '2021, 3DB Team' author = '3DB Team' extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.autosummary', 'sphinx.ext.napoleon', 'sphinxcontrib.images' ] templates_path = ['_templates'] exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] html_theme = 'sphinx_rtd_theme' html_theme_options = { 'collapse_navigation': False, 'navigation_depth': -1, 'includehidden': True, } html_static_path = ['_static'] autodoc_member_order = 'bysource' autodoc_mock_imports = ['bpy', 'imagenet_c', 'cv2']
true
true
f71d7ddcd38a4dbbb52b93b7f2fc440f98a1ed76
9,835
py
Python
grr/client/components/chipsec_support/grr_chipsec_test.py
panhania/grr
fe16a7311a528e31fe0e315a880e98273b8df960
[ "Apache-2.0" ]
null
null
null
grr/client/components/chipsec_support/grr_chipsec_test.py
panhania/grr
fe16a7311a528e31fe0e315a880e98273b8df960
[ "Apache-2.0" ]
null
null
null
grr/client/components/chipsec_support/grr_chipsec_test.py
panhania/grr
fe16a7311a528e31fe0e315a880e98273b8df960
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/env python """Test Chipsec client actions.""" import collections import sys import mock from chipsec.helper import oshelper from grr.client import vfs from grr.client.components.chipsec_support.actions import chipsec_types from grr.lib import flags from grr.test_lib import client_test_lib from grr.test_lib import test_lib class MockUnknownChipsetError(RuntimeError): pass class MockSPI(mock.MagicMock): def get_SPI_region(self, unused_region): # pylint: disable=invalid-name return (0, 0xffff, 0) def read_spi(self, unused_offset, size): return "\xff" * size class UnsupportedChipset(mock.MagicMock): def init(self, unused_platform, unused_load_driver): msg = "Unsupported Platform: VID = 0x0000, DID = 0x0000" raise MockUnknownChipsetError(msg) class FailingOsHelperChipset(mock.MagicMock): def init(self, unused_platform, unused_load_driver): msg = "Unable to open /sys/bus/pci/devices/0000:00:00.0/config" raise oshelper.OsHelperError(msg, -1) class GRRChipsecTest(client_test_lib.EmptyActionTest): """Generic test class for GRR-Chipsec actions.""" def setUp(self): # Mock the interface for Chipsec self.chipsec_mock = mock.MagicMock() self.chipsec_mock.chipset = mock.MagicMock() self.chipsec_mock.chipset.UnknownChipsetError = MockUnknownChipsetError self.chipsec_mock.hal = mock.MagicMock() self.chipsec_mock.logger = mock.MagicMock() mock_modules = { "chipsec": self.chipsec_mock, "chipsec.hal": self.chipsec_mock.hal, } self.chipsec_patch = mock.patch.dict(sys.modules, mock_modules) self.chipsec_patch.start() # Import the ClientAction to test with the Chipsec mock in place. # pylint: disable=g-import-not-at-top, unused-variable from grr.client.components.chipsec_support.actions import grr_chipsec # pylint: enable=g-import-not-at-top, unused-variable # Keep a reference to the module so child classes may mock its content. self.grr_chipsec_module = grr_chipsec self.grr_chipsec_module.chipset = self.chipsec_mock.chipset self.grr_chipsec_module.logger = self.chipsec_mock.logger def tearDown(self): self.chipsec_patch.stop() class TestChipsecDumpFlashImage(GRRChipsecTest): """Test the client dump flash image action.""" def setUp(self): super(TestChipsecDumpFlashImage, self).setUp() self.chipsec_mock.hal.spi = mock.MagicMock() self.chipsec_mock.hal.spi.SPI = MockSPI self.grr_chipsec_module.spi = self.chipsec_mock.hal.spi def testDumpFlashImage(self): """Test the basic dump.""" args = chipsec_types.DumpFlashImageRequest() result = self.RunAction(self.grr_chipsec_module.DumpFlashImage, args)[0] with vfs.VFSOpen(result.path) as image: self.assertEqual(image.read(0x20000), "\xff" * 0x10000) def testDumpFlashImageVerbose(self): """Test the basic dump with the verbose mode enabled.""" args = chipsec_types.DumpFlashImageRequest(log_level=1) result = self.RunAction(self.grr_chipsec_module.DumpFlashImage, args)[0] with vfs.VFSOpen(result.path) as image: self.assertEqual(image.read(0x20000), "\xff" * 0x10000) self.assertNotEqual(self.chipsec_mock.logger.logger.call_count, 0) def testDumpFlashImageUnknownChipset(self): """By default, if the chipset is unknown, no exception is raised.""" self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpFlashImageRequest() self.RunAction(self.grr_chipsec_module.DumpFlashImage, args) def testDumpFlashImageUnknownChipsetVerbose(self): """Test unknown chipset with verbose mode. If the chipset is unknown but verbose enabled, no exception is raised and at least one response should be returned with non-empty logs. """ self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpFlashImageRequest(log_level=1) self.RunAction(self.grr_chipsec_module.DumpFlashImage, args) self.assertNotEquals(self.chipsec_mock.logger.logger.call_count, 0) self.assertGreaterEqual(len(self.results), 1) self.assertNotEquals(len(self.results[0].logs), 0) self.assertEquals(self.results[0].path.path, "") def testDumpFlashImageOsHelperErrorChipset(self): """If an exception is raised by the helper layer, handle it.""" self.chipsec_mock.chipset.cs = FailingOsHelperChipset args = chipsec_types.DumpFlashImageRequest() self.RunAction(self.grr_chipsec_module.DumpFlashImage, args) class MockACPI(object): def __init__(self, unused_chipset): self.tableList = { # pylint: disable=invalid-name "DSDT": [(0xAABBCCDDEEFF0011)], "FACP": [(0x1100FFEEDDCCBBAA)], "XSDT": [(0x1122334455667788)], "SSDT": [(0x1234567890ABCDEF), (0x2234567890ABCDEF), (0x3234567890ABCDEF)] } # Mimic the behaviour of tableList in Chipsec # pylint: disable=invalid-name self.tableList = collections.defaultdict(list, self.tableList) # pylint: enable=invalid-name # key: header, content self.table_content = { 0xAABBCCDDEEFF0011: ("\xFF" * 0xFF, "\xEE" * 0xFF), 0x1100FFEEDDCCBBAA: ("\xEE" * 0xFF, "\xFF" * 0xFF), 0x1122334455667788: ("\xAB" * 0xFF, "\xCD" * 0xFF), 0x1234567890ABCDEF: ("\xEF" * 0xFF, "\xFE" * 0xFF), 0x2234567890ABCDEF: ("\xDC" * 0xFF, "\xBA" * 0xFF), 0x3234567890ABCDEF: ("\xAA" * 0xFF, "\xBB" * 0xFF) } def get_ACPI_table(self, name): # pylint: disable=invalid-name return [self.table_content[address] for address in self.tableList[name]] class MockACPIReadingRestrictedArea(object): def __init__(self, unused_chipset): # Simulate /dev/mem error raise OSError("Operation not permitted") def get_ACPI_table(self, unused_name): # pylint: disable=invalid-name return [] class TestDumpACPITable(GRRChipsecTest): def setUp(self): super(TestDumpACPITable, self).setUp() self.chipsec_mock.hal.acpi = mock.MagicMock() self.chipsec_mock.hal.acpi.ACPI = MockACPI self.grr_chipsec_module.acpi = self.chipsec_mock.hal.acpi def testDumpValidSingleACPITable(self): """Tests basic valid ACPI table dump.""" args = chipsec_types.DumpACPITableRequest(table_signature="DSDT") result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertEqual(len(result.acpi_tables), 1) self.assertEqual(result.acpi_tables[0].table_address, 0xAABBCCDDEEFF0011) self.assertEqual(result.acpi_tables[0].table_blob, "\xFF" * 0xFF + "\xEE" * 0xFF) def testDumpValidMultipleACPITables(self): """Tests valid ACPI table dump that would yield several tables.""" args = chipsec_types.DumpACPITableRequest(table_signature="SSDT") result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertEqual(len(result.acpi_tables), 3) self.assertEqual(result.acpi_tables[0].table_address, 0x1234567890ABCDEF) self.assertEqual(result.acpi_tables[0].table_blob, "\xEF" * 0xFF + "\xFE" * 0xFF) self.assertEqual(result.acpi_tables[1].table_address, 0x2234567890ABCDEF) self.assertEqual(result.acpi_tables[1].table_blob, "\xDC" * 0xFF + "\xBA" * 0xFF) self.assertEqual(result.acpi_tables[2].table_address, 0x3234567890ABCDEF) self.assertEqual(result.acpi_tables[2].table_blob, "\xAA" * 0xFF + "\xBB" * 0xFF) def testDumpValidSingleACPITableVerbose(self): """Tests valid ACPI table dump with verbose mode enabled.""" args = chipsec_types.DumpACPITableRequest( table_signature="XSDT", logging=True) result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertEqual(result.acpi_tables[0].table_address, 0x1122334455667788) self.assertEqual(result.acpi_tables[0].table_blob, "\xAB" * 0xFF + "\xCD" * 0xFF) self.assertNotEquals(self.chipsec_mock.logger.logger.call_count, 0) def testDumpInvalidACPITable(self): """Tests dumping invalid ACPI table.""" args = chipsec_types.DumpACPITableRequest(table_signature="INVALID_TABLE") result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertNotEquals(len(result.logs), 0) def testDumpACPITableUnknownChipset(self): """By default, if the chipset is unknown, no exception is raised.""" self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpACPITableRequest(table_signature="FACP") self.RunAction(self.grr_chipsec_module.DumpACPITable, args) def testDumpACPITableUnknownChipsetVerbose(self): """Tests unknown chipset with verbose mode. If the chipset is unknown but verbose enabled, no exception is raised and at least one response should be returned with non-empty logs. """ self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpACPITableRequest( table_signature="FACP", logging=True) self.RunAction(self.grr_chipsec_module.DumpACPITable, args) self.assertNotEquals(self.chipsec_mock.logger.logger.call_count, 0) self.assertGreaterEqual(len(self.results), 1) self.assertNotEquals(len(self.results[0].logs), 0) def testDumpACPITableTriggeringDevMemError(self): """Tests the condition where OSError is triggered due to using /dev/mem. No exception should be raised, and the log describing the error should be returned. """ self.chipsec_mock.acpi.ACPI = MockACPIReadingRestrictedArea args = chipsec_types.DumpACPITableRequest(table_signature="FACP") self.RunAction(self.grr_chipsec_module.DumpACPITable, args) self.assertGreaterEqual(len(self.results), 1) self.assertNotEquals(len(self.results[0].logs), 0) def main(argv): test_lib.main(argv) if __name__ == "__main__": flags.StartMain(main)
38.268482
78
0.729029
import collections import sys import mock from chipsec.helper import oshelper from grr.client import vfs from grr.client.components.chipsec_support.actions import chipsec_types from grr.lib import flags from grr.test_lib import client_test_lib from grr.test_lib import test_lib class MockUnknownChipsetError(RuntimeError): pass class MockSPI(mock.MagicMock): def get_SPI_region(self, unused_region): return (0, 0xffff, 0) def read_spi(self, unused_offset, size): return "\xff" * size class UnsupportedChipset(mock.MagicMock): def init(self, unused_platform, unused_load_driver): msg = "Unsupported Platform: VID = 0x0000, DID = 0x0000" raise MockUnknownChipsetError(msg) class FailingOsHelperChipset(mock.MagicMock): def init(self, unused_platform, unused_load_driver): msg = "Unable to open /sys/bus/pci/devices/0000:00:00.0/config" raise oshelper.OsHelperError(msg, -1) class GRRChipsecTest(client_test_lib.EmptyActionTest): def setUp(self): self.chipsec_mock = mock.MagicMock() self.chipsec_mock.chipset = mock.MagicMock() self.chipsec_mock.chipset.UnknownChipsetError = MockUnknownChipsetError self.chipsec_mock.hal = mock.MagicMock() self.chipsec_mock.logger = mock.MagicMock() mock_modules = { "chipsec": self.chipsec_mock, "chipsec.hal": self.chipsec_mock.hal, } self.chipsec_patch = mock.patch.dict(sys.modules, mock_modules) self.chipsec_patch.start() from grr.client.components.chipsec_support.actions import grr_chipsec self.grr_chipsec_module = grr_chipsec self.grr_chipsec_module.chipset = self.chipsec_mock.chipset self.grr_chipsec_module.logger = self.chipsec_mock.logger def tearDown(self): self.chipsec_patch.stop() class TestChipsecDumpFlashImage(GRRChipsecTest): def setUp(self): super(TestChipsecDumpFlashImage, self).setUp() self.chipsec_mock.hal.spi = mock.MagicMock() self.chipsec_mock.hal.spi.SPI = MockSPI self.grr_chipsec_module.spi = self.chipsec_mock.hal.spi def testDumpFlashImage(self): args = chipsec_types.DumpFlashImageRequest() result = self.RunAction(self.grr_chipsec_module.DumpFlashImage, args)[0] with vfs.VFSOpen(result.path) as image: self.assertEqual(image.read(0x20000), "\xff" * 0x10000) def testDumpFlashImageVerbose(self): args = chipsec_types.DumpFlashImageRequest(log_level=1) result = self.RunAction(self.grr_chipsec_module.DumpFlashImage, args)[0] with vfs.VFSOpen(result.path) as image: self.assertEqual(image.read(0x20000), "\xff" * 0x10000) self.assertNotEqual(self.chipsec_mock.logger.logger.call_count, 0) def testDumpFlashImageUnknownChipset(self): self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpFlashImageRequest() self.RunAction(self.grr_chipsec_module.DumpFlashImage, args) def testDumpFlashImageUnknownChipsetVerbose(self): self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpFlashImageRequest(log_level=1) self.RunAction(self.grr_chipsec_module.DumpFlashImage, args) self.assertNotEquals(self.chipsec_mock.logger.logger.call_count, 0) self.assertGreaterEqual(len(self.results), 1) self.assertNotEquals(len(self.results[0].logs), 0) self.assertEquals(self.results[0].path.path, "") def testDumpFlashImageOsHelperErrorChipset(self): self.chipsec_mock.chipset.cs = FailingOsHelperChipset args = chipsec_types.DumpFlashImageRequest() self.RunAction(self.grr_chipsec_module.DumpFlashImage, args) class MockACPI(object): def __init__(self, unused_chipset): self.tableList = { "DSDT": [(0xAABBCCDDEEFF0011)], "FACP": [(0x1100FFEEDDCCBBAA)], "XSDT": [(0x1122334455667788)], "SSDT": [(0x1234567890ABCDEF), (0x2234567890ABCDEF), (0x3234567890ABCDEF)] } self.tableList = collections.defaultdict(list, self.tableList) self.table_content = { 0xAABBCCDDEEFF0011: ("\xFF" * 0xFF, "\xEE" * 0xFF), 0x1100FFEEDDCCBBAA: ("\xEE" * 0xFF, "\xFF" * 0xFF), 0x1122334455667788: ("\xAB" * 0xFF, "\xCD" * 0xFF), 0x1234567890ABCDEF: ("\xEF" * 0xFF, "\xFE" * 0xFF), 0x2234567890ABCDEF: ("\xDC" * 0xFF, "\xBA" * 0xFF), 0x3234567890ABCDEF: ("\xAA" * 0xFF, "\xBB" * 0xFF) } def get_ACPI_table(self, name): return [self.table_content[address] for address in self.tableList[name]] class MockACPIReadingRestrictedArea(object): def __init__(self, unused_chipset): raise OSError("Operation not permitted") def get_ACPI_table(self, unused_name): return [] class TestDumpACPITable(GRRChipsecTest): def setUp(self): super(TestDumpACPITable, self).setUp() self.chipsec_mock.hal.acpi = mock.MagicMock() self.chipsec_mock.hal.acpi.ACPI = MockACPI self.grr_chipsec_module.acpi = self.chipsec_mock.hal.acpi def testDumpValidSingleACPITable(self): args = chipsec_types.DumpACPITableRequest(table_signature="DSDT") result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertEqual(len(result.acpi_tables), 1) self.assertEqual(result.acpi_tables[0].table_address, 0xAABBCCDDEEFF0011) self.assertEqual(result.acpi_tables[0].table_blob, "\xFF" * 0xFF + "\xEE" * 0xFF) def testDumpValidMultipleACPITables(self): args = chipsec_types.DumpACPITableRequest(table_signature="SSDT") result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertEqual(len(result.acpi_tables), 3) self.assertEqual(result.acpi_tables[0].table_address, 0x1234567890ABCDEF) self.assertEqual(result.acpi_tables[0].table_blob, "\xEF" * 0xFF + "\xFE" * 0xFF) self.assertEqual(result.acpi_tables[1].table_address, 0x2234567890ABCDEF) self.assertEqual(result.acpi_tables[1].table_blob, "\xDC" * 0xFF + "\xBA" * 0xFF) self.assertEqual(result.acpi_tables[2].table_address, 0x3234567890ABCDEF) self.assertEqual(result.acpi_tables[2].table_blob, "\xAA" * 0xFF + "\xBB" * 0xFF) def testDumpValidSingleACPITableVerbose(self): args = chipsec_types.DumpACPITableRequest( table_signature="XSDT", logging=True) result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertEqual(result.acpi_tables[0].table_address, 0x1122334455667788) self.assertEqual(result.acpi_tables[0].table_blob, "\xAB" * 0xFF + "\xCD" * 0xFF) self.assertNotEquals(self.chipsec_mock.logger.logger.call_count, 0) def testDumpInvalidACPITable(self): args = chipsec_types.DumpACPITableRequest(table_signature="INVALID_TABLE") result = self.RunAction(self.grr_chipsec_module.DumpACPITable, args)[0] self.assertNotEquals(len(result.logs), 0) def testDumpACPITableUnknownChipset(self): self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpACPITableRequest(table_signature="FACP") self.RunAction(self.grr_chipsec_module.DumpACPITable, args) def testDumpACPITableUnknownChipsetVerbose(self): self.chipsec_mock.chipset.cs = UnsupportedChipset args = chipsec_types.DumpACPITableRequest( table_signature="FACP", logging=True) self.RunAction(self.grr_chipsec_module.DumpACPITable, args) self.assertNotEquals(self.chipsec_mock.logger.logger.call_count, 0) self.assertGreaterEqual(len(self.results), 1) self.assertNotEquals(len(self.results[0].logs), 0) def testDumpACPITableTriggeringDevMemError(self): self.chipsec_mock.acpi.ACPI = MockACPIReadingRestrictedArea args = chipsec_types.DumpACPITableRequest(table_signature="FACP") self.RunAction(self.grr_chipsec_module.DumpACPITable, args) self.assertGreaterEqual(len(self.results), 1) self.assertNotEquals(len(self.results[0].logs), 0) def main(argv): test_lib.main(argv) if __name__ == "__main__": flags.StartMain(main)
true
true
f71d7e44e4a12e49ae2b689e7ef43ea4b00aac94
3,032
py
Python
statsSend/jenkins/jenkinsStatisticsSender.py
luigiberrettini/build-deploy-stats
52a0bf5aeb8d2f8ef62e4e836eb0b9874dea500d
[ "MIT" ]
2
2017-07-04T14:30:35.000Z
2017-07-04T16:04:53.000Z
statsSend/jenkins/jenkinsStatisticsSender.py
luigiberrettini/build-deploy-stats
52a0bf5aeb8d2f8ef62e4e836eb0b9874dea500d
[ "MIT" ]
null
null
null
statsSend/jenkins/jenkinsStatisticsSender.py
luigiberrettini/build-deploy-stats
52a0bf5aeb8d2f8ef62e4e836eb0b9874dea500d
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 import xml.etree.ElementTree from datetime import datetime, timedelta, timezone from dateutil import parser from statsSend.session import Session from statsSend.utils import print_exception from statsSend.urlBuilder import UrlBuilder from statsSend.jenkins.jenkinsJob import JenkinsJob class JenkinsStatisticsSender: epoch = datetime(1970, 1, 1, tzinfo = timezone.utc) one_second = timedelta(seconds = 1) def __init__(self, settings, reporter): self.xml_api_url_suffix = settings['xml_api_url_suffix'] self.json_api_url_suffix = settings['json_api_url_suffix'] page_size = int(settings['page_size']) url_builder_factory = lambda suffix: UrlBuilder(settings['server_url'], '', suffix, page_size) headers = { 'Accept': 'application/json'} user = settings['user'] password_or_auth_token = settings['password_or_auth_token'] verify_ssl_certs = settings['verify_ssl_certs'] self.session_factory = lambda suffix: Session(url_builder_factory(suffix), headers, user, password_or_auth_token, verify_ssl_certs) self.job_name = settings['job_name'] self.since_posix_timestamp = (parser.parse(settings['since_timestamp']) - self.epoch) // self.one_second * 1000 self.reporter = reporter async def send(self): root_job_resource = await self.retrieve_root_job_resource() if ("report_categories" in dir(self.reporter)): async with self.session_factory(self.json_api_url_suffix) as session: try: job = JenkinsJob(session, root_job_resource) categories = [job.to_category() async for job in job.retrieve_buildable_descendants()] self.reporter.report_categories(categories) except Exception as err: print_exception('Error sending categories') async with self.session_factory(self.json_api_url_suffix) as session: try: job = JenkinsJob(session, root_job_resource) async for job in job.retrieve_buildable_descendants(): for build in job.retrieve_builds_since_posix_timestamp(self.since_posix_timestamp): try: activity = build.to_activity() self.reporter.report_activity(activity) except Exception as err: print_exception('Error reporting activity') except Exception as err: print_exception('Error reporting activities') async def retrieve_root_job_resource(self): async with self.session_factory(self.xml_api_url_suffix) as session: resource = "?xpath=//job[name='{:s}']/url".format(self.job_name) async with session.get_resource(resource) as response: text = await response.text() url_node = xml.etree.ElementTree.fromstring(text) return url_node.text
48.903226
139
0.66095
import xml.etree.ElementTree from datetime import datetime, timedelta, timezone from dateutil import parser from statsSend.session import Session from statsSend.utils import print_exception from statsSend.urlBuilder import UrlBuilder from statsSend.jenkins.jenkinsJob import JenkinsJob class JenkinsStatisticsSender: epoch = datetime(1970, 1, 1, tzinfo = timezone.utc) one_second = timedelta(seconds = 1) def __init__(self, settings, reporter): self.xml_api_url_suffix = settings['xml_api_url_suffix'] self.json_api_url_suffix = settings['json_api_url_suffix'] page_size = int(settings['page_size']) url_builder_factory = lambda suffix: UrlBuilder(settings['server_url'], '', suffix, page_size) headers = { 'Accept': 'application/json'} user = settings['user'] password_or_auth_token = settings['password_or_auth_token'] verify_ssl_certs = settings['verify_ssl_certs'] self.session_factory = lambda suffix: Session(url_builder_factory(suffix), headers, user, password_or_auth_token, verify_ssl_certs) self.job_name = settings['job_name'] self.since_posix_timestamp = (parser.parse(settings['since_timestamp']) - self.epoch) // self.one_second * 1000 self.reporter = reporter async def send(self): root_job_resource = await self.retrieve_root_job_resource() if ("report_categories" in dir(self.reporter)): async with self.session_factory(self.json_api_url_suffix) as session: try: job = JenkinsJob(session, root_job_resource) categories = [job.to_category() async for job in job.retrieve_buildable_descendants()] self.reporter.report_categories(categories) except Exception as err: print_exception('Error sending categories') async with self.session_factory(self.json_api_url_suffix) as session: try: job = JenkinsJob(session, root_job_resource) async for job in job.retrieve_buildable_descendants(): for build in job.retrieve_builds_since_posix_timestamp(self.since_posix_timestamp): try: activity = build.to_activity() self.reporter.report_activity(activity) except Exception as err: print_exception('Error reporting activity') except Exception as err: print_exception('Error reporting activities') async def retrieve_root_job_resource(self): async with self.session_factory(self.xml_api_url_suffix) as session: resource = "?xpath=//job[name='{:s}']/url".format(self.job_name) async with session.get_resource(resource) as response: text = await response.text() url_node = xml.etree.ElementTree.fromstring(text) return url_node.text
true
true
f71d7f51e7ed402cc9736ce8ab91a8fab33564d5
1,467
py
Python
general_tools/obs_tools.py
unfoldingWord-dev/tx-job-handler
5364ed079bbd5b6528eeb6d12f2ca5c696e84f4f
[ "MIT" ]
1
2020-11-25T04:07:37.000Z
2020-11-25T04:07:37.000Z
general_tools/obs_tools.py
unfoldingWord-dev/tx-job-handler
5364ed079bbd5b6528eeb6d12f2ca5c696e84f4f
[ "MIT" ]
52
2018-10-25T05:49:30.000Z
2022-03-16T22:31:57.000Z
general_tools/obs_tools.py
unfoldingWord-dev/tx-job-handler
5364ed079bbd5b6528eeb6d12f2ca5c696e84f4f
[ "MIT" ]
null
null
null
import os import markdown2 from bs4 import BeautifulSoup def get_obs_chapter_data(repo_dir, chapter_num): obs_chapter_data = { 'title': None, 'frames': [], 'bible_reference': None } obs_chapter_file = os.path.join(repo_dir, 'content', f'{chapter_num}.md') if not os.path.isfile(obs_chapter_file): obs_chapter_file = os.path.join(repo_dir, f'{chapter_num}.md') if os.path.isfile(obs_chapter_file): print(obs_chapter_file) soup = BeautifulSoup(markdown2.markdown_path(obs_chapter_file), 'html.parser') obs_chapter_data['title'] = soup.h1.text paragraphs = soup.find_all('p') frame = { 'image': '', 'text': '' } for idx, p in enumerate(paragraphs): if p.img: src = p.img['src'].split('?')[0] if frame['image']: obs_chapter_data['frames'].append(frame) frame = { 'image': '', 'text': '' } frame['image'] = src p.img.extract() if p.text: if idx == len(paragraphs) - 1 and frame['text']: obs_chapter_data['bible_reference'] = p.text else: frame['text'] += str(p) if frame['image']: obs_chapter_data['frames'].append(frame) return obs_chapter_data
34.116279
86
0.512611
import os import markdown2 from bs4 import BeautifulSoup def get_obs_chapter_data(repo_dir, chapter_num): obs_chapter_data = { 'title': None, 'frames': [], 'bible_reference': None } obs_chapter_file = os.path.join(repo_dir, 'content', f'{chapter_num}.md') if not os.path.isfile(obs_chapter_file): obs_chapter_file = os.path.join(repo_dir, f'{chapter_num}.md') if os.path.isfile(obs_chapter_file): print(obs_chapter_file) soup = BeautifulSoup(markdown2.markdown_path(obs_chapter_file), 'html.parser') obs_chapter_data['title'] = soup.h1.text paragraphs = soup.find_all('p') frame = { 'image': '', 'text': '' } for idx, p in enumerate(paragraphs): if p.img: src = p.img['src'].split('?')[0] if frame['image']: obs_chapter_data['frames'].append(frame) frame = { 'image': '', 'text': '' } frame['image'] = src p.img.extract() if p.text: if idx == len(paragraphs) - 1 and frame['text']: obs_chapter_data['bible_reference'] = p.text else: frame['text'] += str(p) if frame['image']: obs_chapter_data['frames'].append(frame) return obs_chapter_data
true
true
f71d7fa0ae2eee68a918e572b3e0809b5157731c
434
py
Python
awx/main/tests/unit/models/test_credential.py
gitEdouble/awx
5885654405ccaf465f08df4db998a6dafebd9b4d
[ "Apache-2.0" ]
1
2019-03-07T11:54:50.000Z
2019-03-07T11:54:50.000Z
awx/main/tests/unit/models/test_credential.py
gitEdouble/awx
5885654405ccaf465f08df4db998a6dafebd9b4d
[ "Apache-2.0" ]
1
2020-04-09T08:43:28.000Z
2020-04-09T08:43:28.000Z
awx/main/tests/unit/models/test_credential.py
gitEdouble/awx
5885654405ccaf465f08df4db998a6dafebd9b4d
[ "Apache-2.0" ]
2
2018-09-03T19:10:02.000Z
2019-06-12T07:07:16.000Z
# -*- coding: utf-8 -*- from awx.main.models import Credential, CredentialType def test_unique_hash_with_unicode(): ct = CredentialType(name=u'Väult', kind='vault') cred = Credential( id=4, name=u'Iñtërnâtiônàlizætiøn', credential_type=ct, inputs={ u'vault_id': u'🐉🐉🐉' }, credential_type_id=42 ) assert cred.unique_hash(display=True) == u'Väult (id=🐉🐉🐉)'
24.111111
62
0.596774
from awx.main.models import Credential, CredentialType def test_unique_hash_with_unicode(): ct = CredentialType(name=u'Väult', kind='vault') cred = Credential( id=4, name=u'Iñtërnâtiônàlizætiøn', credential_type=ct, inputs={ u'vault_id': u'🐉🐉🐉' }, credential_type_id=42 ) assert cred.unique_hash(display=True) == u'Väult (id=🐉🐉🐉)'
true
true
f71d7fe2e8cb699b6a0e6e27b481f5b65d9878c7
5,051
py
Python
tests/test_warnings.py
fao89/drf-spectacular
0dbd9d1c065f10aa1f8d472abd4795c05fb7b6c6
[ "BSD-3-Clause" ]
null
null
null
tests/test_warnings.py
fao89/drf-spectacular
0dbd9d1c065f10aa1f8d472abd4795c05fb7b6c6
[ "BSD-3-Clause" ]
null
null
null
tests/test_warnings.py
fao89/drf-spectacular
0dbd9d1c065f10aa1f8d472abd4795c05fb7b6c6
[ "BSD-3-Clause" ]
1
2021-06-14T16:42:20.000Z
2021-06-14T16:42:20.000Z
from django.db import models from rest_framework import mixins, serializers, views, viewsets from rest_framework.authentication import BaseAuthentication from rest_framework.decorators import action from rest_framework.views import APIView from drf_spectacular.utils import extend_schema from tests import generate_schema def test_serializer_name_reuse(warnings): from rest_framework import routers from drf_spectacular.generators import SchemaGenerator router = routers.SimpleRouter() def x1(): class XSerializer(serializers.Serializer): uuid = serializers.UUIDField() return XSerializer def x2(): class XSerializer(serializers.Serializer): integer = serializers.IntegerField return XSerializer class X1Viewset(mixins.ListModelMixin, viewsets.GenericViewSet): serializer_class = x1() router.register('x1', X1Viewset, basename='x1') class X2Viewset(mixins.ListModelMixin, viewsets.GenericViewSet): serializer_class = x2() router.register('x2', X2Viewset, basename='x2') generator = SchemaGenerator(patterns=router.urls) generator.get_schema(request=None, public=True) def test_owned_serializer_naming_override_with_ref_name_collision(warnings): class XSerializer(serializers.Serializer): x = serializers.UUIDField() class YSerializer(serializers.Serializer): x = serializers.IntegerField() class Meta: ref_name = 'X' # already used above class XAPIView(APIView): @extend_schema(request=XSerializer, responses=YSerializer) def post(self, request): pass # pragma: no cover generate_schema('x', view=XAPIView) def test_no_queryset_warn(capsys): class X1Serializer(serializers.Serializer): uuid = serializers.UUIDField() class X1Viewset(viewsets.ReadOnlyModelViewSet): serializer_class = X1Serializer generate_schema('x1', X1Viewset) assert 'no queryset' in capsys.readouterr().err def test_path_param_not_in_model(capsys): class M3(models.Model): pass # pragma: no cover class XSerializer(serializers.Serializer): uuid = serializers.UUIDField() class XViewset(viewsets.ReadOnlyModelViewSet): serializer_class = XSerializer queryset = M3.objects.none() @action(detail=True, url_path='meta/(?P<ephemeral>[^/.]+)', methods=['POST']) def meta_param(self, request, ephemeral, pk): pass # pragma: no cover generate_schema('x1', XViewset) assert 'no such field' in capsys.readouterr().err def test_no_authentication_scheme_registered(capsys): class XAuth(BaseAuthentication): pass # pragma: no cover class XSerializer(serializers.Serializer): uuid = serializers.UUIDField() class XViewset(mixins.ListModelMixin, viewsets.GenericViewSet): serializer_class = XSerializer authentication_classes = [XAuth] generate_schema('x', XViewset) assert 'no OpenApiAuthenticationExtension registered' in capsys.readouterr().err def test_serializer_not_found(capsys): class XViewset(mixins.ListModelMixin, viewsets.GenericViewSet): pass # pragma: no cover generate_schema('x', XViewset) assert 'Exception raised while getting serializer' in capsys.readouterr().err def test_extend_schema_unknown_class(capsys): class DoesNotCompute: pass # pragma: no cover class X1Viewset(viewsets.GenericViewSet): @extend_schema(responses={200: DoesNotCompute}) def list(self, request): pass # pragma: no cover generate_schema('x1', X1Viewset) assert 'Expected either a serializer' in capsys.readouterr().err def test_extend_schema_unknown_class2(capsys): class DoesNotCompute: pass # pragma: no cover class X1Viewset(viewsets.GenericViewSet): @extend_schema(responses=DoesNotCompute) def list(self, request): pass # pragma: no cover generate_schema('x1', X1Viewset) assert 'Expected either a serializer' in capsys.readouterr().err def test_no_serializer_class_on_apiview(capsys): class XView(views.APIView): def get(self, request): pass # pragma: no cover generate_schema('x', view=XView) assert 'Unable to guess serializer for' in capsys.readouterr().err def test_unable_to_follow_field_source_through_intermediate_property_warning(warnings): class FailingFieldSourceTraversalModel1(models.Model): @property def x(self): # missing type hint emits warning return # pragma: no cover class XSerializer(serializers.ModelSerializer): x = serializers.ReadOnlyField(source='x.y') class Meta: model = FailingFieldSourceTraversalModel1 fields = '__all__' class XAPIView(APIView): @extend_schema(responses=XSerializer) def get(self, request): pass # pragma: no cover generate_schema('x', view=XAPIView)
30.065476
87
0.706593
from django.db import models from rest_framework import mixins, serializers, views, viewsets from rest_framework.authentication import BaseAuthentication from rest_framework.decorators import action from rest_framework.views import APIView from drf_spectacular.utils import extend_schema from tests import generate_schema def test_serializer_name_reuse(warnings): from rest_framework import routers from drf_spectacular.generators import SchemaGenerator router = routers.SimpleRouter() def x1(): class XSerializer(serializers.Serializer): uuid = serializers.UUIDField() return XSerializer def x2(): class XSerializer(serializers.Serializer): integer = serializers.IntegerField return XSerializer class X1Viewset(mixins.ListModelMixin, viewsets.GenericViewSet): serializer_class = x1() router.register('x1', X1Viewset, basename='x1') class X2Viewset(mixins.ListModelMixin, viewsets.GenericViewSet): serializer_class = x2() router.register('x2', X2Viewset, basename='x2') generator = SchemaGenerator(patterns=router.urls) generator.get_schema(request=None, public=True) def test_owned_serializer_naming_override_with_ref_name_collision(warnings): class XSerializer(serializers.Serializer): x = serializers.UUIDField() class YSerializer(serializers.Serializer): x = serializers.IntegerField() class Meta: ref_name = 'X' class XAPIView(APIView): @extend_schema(request=XSerializer, responses=YSerializer) def post(self, request): pass generate_schema('x', view=XAPIView) def test_no_queryset_warn(capsys): class X1Serializer(serializers.Serializer): uuid = serializers.UUIDField() class X1Viewset(viewsets.ReadOnlyModelViewSet): serializer_class = X1Serializer generate_schema('x1', X1Viewset) assert 'no queryset' in capsys.readouterr().err def test_path_param_not_in_model(capsys): class M3(models.Model): pass class XSerializer(serializers.Serializer): uuid = serializers.UUIDField() class XViewset(viewsets.ReadOnlyModelViewSet): serializer_class = XSerializer queryset = M3.objects.none() @action(detail=True, url_path='meta/(?P<ephemeral>[^/.]+)', methods=['POST']) def meta_param(self, request, ephemeral, pk): pass generate_schema('x1', XViewset) assert 'no such field' in capsys.readouterr().err def test_no_authentication_scheme_registered(capsys): class XAuth(BaseAuthentication): pass class XSerializer(serializers.Serializer): uuid = serializers.UUIDField() class XViewset(mixins.ListModelMixin, viewsets.GenericViewSet): serializer_class = XSerializer authentication_classes = [XAuth] generate_schema('x', XViewset) assert 'no OpenApiAuthenticationExtension registered' in capsys.readouterr().err def test_serializer_not_found(capsys): class XViewset(mixins.ListModelMixin, viewsets.GenericViewSet): pass generate_schema('x', XViewset) assert 'Exception raised while getting serializer' in capsys.readouterr().err def test_extend_schema_unknown_class(capsys): class DoesNotCompute: pass class X1Viewset(viewsets.GenericViewSet): @extend_schema(responses={200: DoesNotCompute}) def list(self, request): pass generate_schema('x1', X1Viewset) assert 'Expected either a serializer' in capsys.readouterr().err def test_extend_schema_unknown_class2(capsys): class DoesNotCompute: pass class X1Viewset(viewsets.GenericViewSet): @extend_schema(responses=DoesNotCompute) def list(self, request): pass generate_schema('x1', X1Viewset) assert 'Expected either a serializer' in capsys.readouterr().err def test_no_serializer_class_on_apiview(capsys): class XView(views.APIView): def get(self, request): pass generate_schema('x', view=XView) assert 'Unable to guess serializer for' in capsys.readouterr().err def test_unable_to_follow_field_source_through_intermediate_property_warning(warnings): class FailingFieldSourceTraversalModel1(models.Model): @property def x(self): return class XSerializer(serializers.ModelSerializer): x = serializers.ReadOnlyField(source='x.y') class Meta: model = FailingFieldSourceTraversalModel1 fields = '__all__' class XAPIView(APIView): @extend_schema(responses=XSerializer) def get(self, request): pass generate_schema('x', view=XAPIView)
true
true
f71d7ff644e054571c43b78fa96b7e2e5f88fb9d
22,213
py
Python
sacred_mis/_sources/pomis2_57be95a71b575624c33c6ffe64e50d6e.py
T3p/baselines
5623c9160d1e86ebca3e673f142fe6b14a1db06c
[ "MIT" ]
2
2020-08-01T18:19:05.000Z
2021-06-30T06:37:23.000Z
sacred_mis/_sources/pomis2_57be95a71b575624c33c6ffe64e50d6e.py
T3p/baselines
5623c9160d1e86ebca3e673f142fe6b14a1db06c
[ "MIT" ]
null
null
null
sacred_mis/_sources/pomis2_57be95a71b575624c33c6ffe64e50d6e.py
T3p/baselines
5623c9160d1e86ebca3e673f142fe6b14a1db06c
[ "MIT" ]
5
2018-11-24T16:29:39.000Z
2021-12-10T03:07:07.000Z
import numpy as np import warnings import baselines.common.tf_util as U import tensorflow as tf import time from baselines.common import zipsame, colorize from contextlib import contextmanager from collections import deque from baselines import logger from baselines.common.cg import cg from baselines.pomis2.memory import Memory from baselines.common.centralized_sampler import traj_segment_generator from baselines.pois.utils import cluster_rewards @contextmanager def timed(msg): print(colorize(msg, color='magenta')) tstart = time.time() yield print(colorize('done in %.3f seconds'%(time.time() - tstart), color='magenta')) def update_epsilon(delta_bound, epsilon_old, max_increase=2.): if delta_bound > (1. - 1. / (2 * max_increase)) * epsilon_old: return epsilon_old * max_increase else: return epsilon_old ** 2 / (2 * (epsilon_old - delta_bound)) def line_search_parabola(theta_init, alpha, natural_gradient, set_parameter, evaluate_bound, delta_bound_tol=1e-4, max_line_search_ite=30): epsilon = 1. epsilon_old = 0. delta_bound_old = -np.inf bound_init = evaluate_bound() theta_old = theta_init for i in range(max_line_search_ite): theta = theta_init + epsilon * alpha * natural_gradient set_parameter(theta) bound = evaluate_bound() if np.isnan(bound): warnings.warn('Got NaN bound value: rolling back!') return theta_old, epsilon_old, delta_bound_old, i + 1 delta_bound = bound - bound_init epsilon_old = epsilon epsilon = update_epsilon(delta_bound, epsilon_old) if delta_bound <= delta_bound_old + delta_bound_tol: if delta_bound_old < 0.: return theta_init, 0., 0., i+1 else: return theta_old, epsilon_old, delta_bound_old, i+1 delta_bound_old = delta_bound theta_old = theta return theta_old, epsilon_old, delta_bound_old, i+1 def line_search_binary(theta_init, alpha, natural_gradient, set_parameter, evaluate_loss, delta_bound_tol=1e-4, max_line_search_ite=30): low = 0. high = None bound_init = evaluate_loss() delta_bound_old = 0. theta_opt = theta_init i_opt = 0 delta_bound_opt = 0. epsilon_opt = 0. epsilon = 1. for i in range(max_line_search_ite): theta = theta_init + epsilon * natural_gradient * alpha set_parameter(theta) bound = evaluate_loss() delta_bound = bound - bound_init if np.isnan(bound): warnings.warn('Got NaN bound value: rolling back!') if np.isnan(bound) or delta_bound <= delta_bound_opt: high = epsilon else: low = epsilon theta_opt = theta delta_bound_opt = delta_bound i_opt = i epsilon_opt = epsilon epsilon_old = epsilon if high is None: epsilon *= 2 else: epsilon = (low + high) / 2. if abs(epsilon_old - epsilon) < 1e-12: break return theta_opt, epsilon_opt, delta_bound_opt, i_opt+1 def optimize_offline(theta_init, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient=None, gradient_tol=1e-4, bound_tol=1e-4, max_offline_ite=100): theta = theta_old = theta_init improvement = improvement_old = 0. set_parameter(theta) ''' bound_init = evaluate_loss() import scipy.optimize as opt def func(x): set_parameter(x) return -evaluate_loss() def grad(x): set_parameter(x) return -evaluate_gradient().astype(np.float64) theta, bound, d = opt.fmin_l_bfgs_b(func=func, fprime=grad, x0=theta_init.astype(np.float64), maxiter=100, ) print(bound_init, bound) print(d) set_parameter(theta) improvement = bound_init + bound return theta, improvement ''' fmtstr = '%6i %10.3g %10.3g %18i %18.3g %18.3g %18.3g' titlestr = '%6s %10s %10s %18s %18s %18s %18s' print(titlestr % ('iter', 'epsilon', 'step size', 'num line search', 'gradient norm', 'delta bound ite', 'delta bound tot')) for i in range(max_offline_ite): bound = evaluate_loss() gradient = evaluate_gradient() if np.any(np.isnan(gradient)): warnings.warn('Got NaN gradient! Stopping!') set_parameter(theta_old) return theta_old, improvement if np.isnan(bound): warnings.warn('Got NaN bound! Stopping!') set_parameter(theta_old) return theta_old, improvement_old if evaluate_natural_gradient is not None: natural_gradient = evaluate_natural_gradient(gradient) else: natural_gradient = gradient if np.dot(gradient, natural_gradient) < 0: warnings.warn('NatGradient dot Gradient < 0! Using vanilla gradient') natural_gradient = gradient gradient_norm = np.sqrt(np.dot(gradient, natural_gradient)) if gradient_norm < gradient_tol: print('stopping - gradient norm < gradient_tol') return theta, improvement alpha = 1. / gradient_norm ** 2 theta_old = theta improvement_old = improvement theta, epsilon, delta_bound, num_line_search = line_search(theta, alpha, natural_gradient, set_parameter, evaluate_loss) set_parameter(theta) improvement += delta_bound print(fmtstr % (i+1, epsilon, alpha*epsilon, num_line_search, gradient_norm, delta_bound, improvement)) if delta_bound < bound_tol: print('stopping - delta bound < bound_tol') return theta, improvement return theta, improvement def learn(env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, #can be 'exact', 'approximate' fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=0, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None, clipping=False, entropy='none', positive_return=False, reward_clustering='none', capacity=10, warm_start=True): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() # Building the environment ob_space = env.observation_space ac_space = env.action_space # Creating the memory buffer memory = Memory(capacity=capacity, batch_size=n_episodes, horizon=horizon, ob_space=ob_space, ac_space=ac_space) # Building the target policy and saving its parameters pi = make_policy('pi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split('/')[1].startswith('pol')] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) # Building a set of behavioral policies behavioral_policies = memory.build_policies(make_policy, pi) # Placeholders ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([None], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(None), name='mask') rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='rew') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='disc_rew') clustered_rew_ = tf.placeholder(dtype=tf.float32, shape=(None)) gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') iter_number_ = tf.placeholder(dtype=tf.int32, name='iter_number') active_policies = tf.placeholder(dtype=tf.float32, shape=(capacity), name='active_policies') losses_with_name = [] # Total number of trajectories N_total = tf.reduce_sum(active_policies) * n_episodes # Split operations disc_rew_split = tf.reshape(disc_rew_ * mask_, [-1, horizon]) rew_split = tf.reshape(rew_ * mask_, [-1, horizon]) mask_split = tf.reshape(mask_, [-1, horizon]) # Policy densities target_log_pdf = pi.pd.logp(ac_) * mask_ target_log_pdf_split = tf.reshape(target_log_pdf, [-1, horizon]) behavioral_log_pdfs = tf.stack([bpi.pd.logp(ac_) * mask_ for bpi in memory.policies]) # Shape is (capacity, ntraj*horizon) behavioral_log_pdfs_split = tf.reshape(behavioral_log_pdfs, [memory.capacity, -1, horizon]) # Compute renyi divergencies and sum over time, then exponentiate emp_d2_split = tf.reshape(tf.stack([pi.pd.renyi(bpi.pd, 2) * mask_ for bpi in memory.policies]), [memory.capacity, -1, horizon]) emp_d2_split_cum = tf.exp(tf.reduce_sum(emp_d2_split, axis=2)) # Compute arithmetic and harmonic mean of emp_d2 emp_d2_mean = tf.reduce_mean(emp_d2_split_cum, axis=1) emp_d2_arithmetic = tf.reduce_sum(emp_d2_mean * active_policies) / tf.reduce_sum(active_policies) emp_d2_harmonic = tf.reduce_sum(active_policies) / tf.reduce_sum(1 / emp_d2_mean) # Return processing: clipping, centering, discounting ep_return = clustered_rew_ #tf.reduce_sum(mask_split * disc_rew_split, axis=1) if clipping: rew_split = tf.clip_by_value(rew_split, -1, 1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) rew_split = rew_split - (tf.reduce_sum(rew_split) / (tf.reduce_sum(mask_split) + 1e-24)) discounter = [pow(gamma, i) for i in range(0, horizon)] # Decreasing gamma discounter_tf = tf.constant(discounter) disc_rew_split = rew_split * discounter_tf # Reward statistics return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) return_step_max = tf.reduce_max(tf.abs(rew_split)) # Max step reward return_step_mean = tf.abs(tf.reduce_mean(rew_split)) positive_step_return_max = tf.maximum(0.0, tf.reduce_max(rew_split)) negative_step_return_max = tf.maximum(0.0, tf.reduce_max(-rew_split)) return_step_maxmin = tf.abs(positive_step_return_max - negative_step_return_max) losses_with_name.extend([(return_mean, 'InitialReturnMean'), (return_max, 'InitialReturnMax'), (return_min, 'InitialReturnMin'), (return_std, 'InitialReturnStd'), (emp_d2_arithmetic, 'EmpiricalD2Arithmetic'), (emp_d2_harmonic, 'EmpiricalD2Harmonic'), (return_step_max, 'ReturnStepMax'), (return_step_maxmin, 'ReturnStepMaxmin')]) if iw_method == 'is': # Sum the log prob over time. Shapes: target(Nep, H), behav (Cap, Nep, H) target_log_pdf_episode = tf.reduce_sum(target_log_pdf_split, axis=1) behavioral_log_pdf_episode = tf.reduce_sum(behavioral_log_pdfs_split, axis=2) # To avoid numerical instability, compute the inversed ratio log_ratio = target_log_pdf_split - behavioral_log_pdfs_split inverse_log_ratio_episode = - tf.reduce_sum(log_ratio, axis=2) iw = 1 / tf.reduce_sum(tf.exp(inverse_log_ratio_episode) * tf.expand_dims(active_policies, -1), axis=0) # Compute also the balance-heuristic weights iw_split = tf.reshape(iw, (memory.capacity, -1)) iw_by_behavioral = tf.reduce_mean(iw_split, axis=1) losses_with_name.append((iw_by_behavioral[0] / tf.reduce_sum(iw_by_behavioral), 'MultiIWFirstRatio')) losses_with_name.append((tf.reduce_max(iw_by_behavioral), 'MultiIWMax')) losses_with_name.append((tf.reduce_sum(iw_by_behavioral), 'MultiIWSum')) losses_with_name.append((tf.reduce_min(iw_by_behavioral), 'MultiIWMin')) # Get the probability by exponentiation #target_pdf_episode = tf.exp(target_log_pdf_episode) #behavioral_pdf_episode = tf.exp(behavioral_log_pdf_episode) # Get the denominator by averaging over behavioral policies #behavioral_pdf_mixture = tf.reduce_mean(behavioral_pdf_episode, axis=0) + 1e-24 #iw = target_pdf_episode / behavioral_pdf_mixture iwn = iw / n_episodes # Compute the J w_return_mean = tf.reduce_sum(ep_return * iwn) # Empirical D2 of the mixture and relative ESS ess_renyi_arithmetic = N_total / emp_d2_arithmetic ess_renyi_harmonic = N_total / emp_d2_harmonic # Log quantities losses_with_name.extend([(tf.reduce_max(iw), 'MaxIW'), (tf.reduce_min(iw), 'MinIW'), (tf.reduce_mean(iw), 'MeanIW'), (U.reduce_std(iw), 'StdIW'), (tf.reduce_min(target_log_pdf_episode), 'MinTargetPdf'), (tf.reduce_min(behavioral_log_pdf_episode), 'MinBehavPdf'), (ess_renyi_arithmetic, 'ESSRenyiArithmetic'), (ess_renyi_harmonic, 'ESSRenyiHarmonic')]) else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'max-d2-harmonic': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi_harmonic)) * return_abs_max elif bound == 'max-d2-arithmetic': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi_arithmetic)) * return_abs_max else: raise NotImplementedError() # Policy entropy for exploration ent = pi.pd.entropy() meanent = tf.reduce_mean(ent) losses_with_name.append((meanent, 'MeanEntropy')) # Add policy entropy bonus if entropy != 'none': scheme, v1, v2 = entropy.split(':') if scheme == 'step': entcoeff = tf.cond(iter_number_ < int(v2), lambda: float(v1), lambda: float(0.0)) losses_with_name.append((entcoeff, 'EntropyCoefficient')) entbonus = entcoeff * meanent bound_ = bound_ + entbonus elif scheme == 'lin': ip = tf.cast(iter_number_ / max_iters, tf.float32) entcoeff_decay = tf.maximum(0.0, float(v2) + (float(v1) - float(v2)) * (1.0 - ip)) losses_with_name.append((entcoeff_decay, 'EntropyCoefficient')) entbonus = entcoeff_decay * meanent bound_ = bound_ + entbonus elif scheme == 'exp': ent_f = tf.exp(-tf.abs(tf.reduce_mean(iw) - 1) * float(v2)) * float(v1) losses_with_name.append((ent_f, 'EntropyCoefficient')) bound_ = bound_ + ent_f * meanent else: raise Exception('Unrecognized entropy scheme.') losses_with_name.append((w_return_mean, 'ReturnMeanIW')) losses_with_name.append((bound_, 'Bound')) losses, loss_names = map(list, zip(*losses_with_name)) ''' if use_natural_gradient: p = tf.placeholder(dtype=tf.float32, shape=[None]) target_logpdf_episode = tf.reduce_sum(target_log_pdf_split * mask_split, axis=1) grad_logprob = U.flatgrad(tf.stop_gradient(iwn) * target_logpdf_episode, var_list) dot_product = tf.reduce_sum(grad_logprob * p) hess_logprob = U.flatgrad(dot_product, var_list) compute_linear_operator = U.function([p, ob_, ac_, disc_rew_, mask_], [-hess_logprob]) ''' assert_ops = tf.group(*tf.get_collection('asserts')) print_ops = tf.group(*tf.get_collection('prints')) compute_lossandgrad = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], losses + [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_grad = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_bound = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], [bound_, assert_ops, print_ops]) compute_losses = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], losses) #compute_temp = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], [log_inverse_ratio, abc, iw]) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) policy_reinit = tf.variables_initializer(var_list) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True, gamma=gamma) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() U.initialize() # Starting optimizing episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if iters_so_far == 50: print('=== CHANGED GAMMA TO 1.0') seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True, gamma=1.0) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finished...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) # Adding batch of trajectories to memory memory.add_trajectory_batch(seg) # Get multiple batches from memory seg_with_memory = memory.get_trajectories() # Get clustered reward reward_matrix = np.reshape(seg_with_memory['disc_rew'] * seg_with_memory['mask'], (-1, horizon)) ep_reward = np.sum(reward_matrix, axis=1) ep_reward = cluster_rewards(ep_reward, reward_clustering) args = ob, ac, rew, disc_rew, clustered_rew, mask, iter_number, active_policies = (seg_with_memory['ob'], seg_with_memory['ac'], seg_with_memory['rew'], seg_with_memory['disc_rew'], ep_reward, seg_with_memory['mask'], iters_so_far, memory.get_active_policies_mask()) def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Iteration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights > 0 and iters_so_far % save_weights == 0: logger.record_tabular('Weights', str(get_parameter())) import pickle file = open('checkpoint' + str(iters_so_far) + '.pkl', 'wb') pickle.dump(theta, file) if not warm_start or memory.get_current_load() == capacity: # Optimize with timed("offline optimization"): theta, improvement = optimize_offline(theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) print(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) else: # Reinitialize the policy tf.get_default_session().run(policy_reinit) logger.dump_tabular() env.close()
41.597378
183
0.620267
import numpy as np import warnings import baselines.common.tf_util as U import tensorflow as tf import time from baselines.common import zipsame, colorize from contextlib import contextmanager from collections import deque from baselines import logger from baselines.common.cg import cg from baselines.pomis2.memory import Memory from baselines.common.centralized_sampler import traj_segment_generator from baselines.pois.utils import cluster_rewards @contextmanager def timed(msg): print(colorize(msg, color='magenta')) tstart = time.time() yield print(colorize('done in %.3f seconds'%(time.time() - tstart), color='magenta')) def update_epsilon(delta_bound, epsilon_old, max_increase=2.): if delta_bound > (1. - 1. / (2 * max_increase)) * epsilon_old: return epsilon_old * max_increase else: return epsilon_old ** 2 / (2 * (epsilon_old - delta_bound)) def line_search_parabola(theta_init, alpha, natural_gradient, set_parameter, evaluate_bound, delta_bound_tol=1e-4, max_line_search_ite=30): epsilon = 1. epsilon_old = 0. delta_bound_old = -np.inf bound_init = evaluate_bound() theta_old = theta_init for i in range(max_line_search_ite): theta = theta_init + epsilon * alpha * natural_gradient set_parameter(theta) bound = evaluate_bound() if np.isnan(bound): warnings.warn('Got NaN bound value: rolling back!') return theta_old, epsilon_old, delta_bound_old, i + 1 delta_bound = bound - bound_init epsilon_old = epsilon epsilon = update_epsilon(delta_bound, epsilon_old) if delta_bound <= delta_bound_old + delta_bound_tol: if delta_bound_old < 0.: return theta_init, 0., 0., i+1 else: return theta_old, epsilon_old, delta_bound_old, i+1 delta_bound_old = delta_bound theta_old = theta return theta_old, epsilon_old, delta_bound_old, i+1 def line_search_binary(theta_init, alpha, natural_gradient, set_parameter, evaluate_loss, delta_bound_tol=1e-4, max_line_search_ite=30): low = 0. high = None bound_init = evaluate_loss() delta_bound_old = 0. theta_opt = theta_init i_opt = 0 delta_bound_opt = 0. epsilon_opt = 0. epsilon = 1. for i in range(max_line_search_ite): theta = theta_init + epsilon * natural_gradient * alpha set_parameter(theta) bound = evaluate_loss() delta_bound = bound - bound_init if np.isnan(bound): warnings.warn('Got NaN bound value: rolling back!') if np.isnan(bound) or delta_bound <= delta_bound_opt: high = epsilon else: low = epsilon theta_opt = theta delta_bound_opt = delta_bound i_opt = i epsilon_opt = epsilon epsilon_old = epsilon if high is None: epsilon *= 2 else: epsilon = (low + high) / 2. if abs(epsilon_old - epsilon) < 1e-12: break return theta_opt, epsilon_opt, delta_bound_opt, i_opt+1 def optimize_offline(theta_init, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient=None, gradient_tol=1e-4, bound_tol=1e-4, max_offline_ite=100): theta = theta_old = theta_init improvement = improvement_old = 0. set_parameter(theta) fmtstr = '%6i %10.3g %10.3g %18i %18.3g %18.3g %18.3g' titlestr = '%6s %10s %10s %18s %18s %18s %18s' print(titlestr % ('iter', 'epsilon', 'step size', 'num line search', 'gradient norm', 'delta bound ite', 'delta bound tot')) for i in range(max_offline_ite): bound = evaluate_loss() gradient = evaluate_gradient() if np.any(np.isnan(gradient)): warnings.warn('Got NaN gradient! Stopping!') set_parameter(theta_old) return theta_old, improvement if np.isnan(bound): warnings.warn('Got NaN bound! Stopping!') set_parameter(theta_old) return theta_old, improvement_old if evaluate_natural_gradient is not None: natural_gradient = evaluate_natural_gradient(gradient) else: natural_gradient = gradient if np.dot(gradient, natural_gradient) < 0: warnings.warn('NatGradient dot Gradient < 0! Using vanilla gradient') natural_gradient = gradient gradient_norm = np.sqrt(np.dot(gradient, natural_gradient)) if gradient_norm < gradient_tol: print('stopping - gradient norm < gradient_tol') return theta, improvement alpha = 1. / gradient_norm ** 2 theta_old = theta improvement_old = improvement theta, epsilon, delta_bound, num_line_search = line_search(theta, alpha, natural_gradient, set_parameter, evaluate_loss) set_parameter(theta) improvement += delta_bound print(fmtstr % (i+1, epsilon, alpha*epsilon, num_line_search, gradient_norm, delta_bound, improvement)) if delta_bound < bound_tol: print('stopping - delta bound < bound_tol') return theta, improvement return theta, improvement def learn(env, make_policy, *, n_episodes, horizon, delta, gamma, max_iters, sampler=None, use_natural_gradient=False, fisher_reg=1e-2, iw_method='is', iw_norm='none', bound='J', line_search_type='parabola', save_weights=0, improvement_tol=0., center_return=False, render_after=None, max_offline_iters=100, callback=None, clipping=False, entropy='none', positive_return=False, reward_clustering='none', capacity=10, warm_start=True): np.set_printoptions(precision=3) max_samples = horizon * n_episodes if line_search_type == 'binary': line_search = line_search_binary elif line_search_type == 'parabola': line_search = line_search_parabola else: raise ValueError() ob_space = env.observation_space ac_space = env.action_space memory = Memory(capacity=capacity, batch_size=n_episodes, horizon=horizon, ob_space=ob_space, ac_space=ac_space) pi = make_policy('pi', ob_space, ac_space) all_var_list = pi.get_trainable_variables() var_list = [v for v in all_var_list if v.name.split('/')[1].startswith('pol')] shapes = [U.intprod(var.get_shape().as_list()) for var in var_list] n_parameters = sum(shapes) behavioral_policies = memory.build_policies(make_policy, pi) ob_ = ob = U.get_placeholder_cached(name='ob') ac_ = pi.pdtype.sample_placeholder([None], name='ac') mask_ = tf.placeholder(dtype=tf.float32, shape=(None), name='mask') rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='rew') disc_rew_ = tf.placeholder(dtype=tf.float32, shape=(None), name='disc_rew') clustered_rew_ = tf.placeholder(dtype=tf.float32, shape=(None)) gradient_ = tf.placeholder(dtype=tf.float32, shape=(n_parameters, 1), name='gradient') iter_number_ = tf.placeholder(dtype=tf.int32, name='iter_number') active_policies = tf.placeholder(dtype=tf.float32, shape=(capacity), name='active_policies') losses_with_name = [] N_total = tf.reduce_sum(active_policies) * n_episodes disc_rew_split = tf.reshape(disc_rew_ * mask_, [-1, horizon]) rew_split = tf.reshape(rew_ * mask_, [-1, horizon]) mask_split = tf.reshape(mask_, [-1, horizon]) target_log_pdf = pi.pd.logp(ac_) * mask_ target_log_pdf_split = tf.reshape(target_log_pdf, [-1, horizon]) behavioral_log_pdfs = tf.stack([bpi.pd.logp(ac_) * mask_ for bpi in memory.policies]) behavioral_log_pdfs_split = tf.reshape(behavioral_log_pdfs, [memory.capacity, -1, horizon]) emp_d2_split = tf.reshape(tf.stack([pi.pd.renyi(bpi.pd, 2) * mask_ for bpi in memory.policies]), [memory.capacity, -1, horizon]) emp_d2_split_cum = tf.exp(tf.reduce_sum(emp_d2_split, axis=2)) emp_d2_mean = tf.reduce_mean(emp_d2_split_cum, axis=1) emp_d2_arithmetic = tf.reduce_sum(emp_d2_mean * active_policies) / tf.reduce_sum(active_policies) emp_d2_harmonic = tf.reduce_sum(active_policies) / tf.reduce_sum(1 / emp_d2_mean) ep_return = clustered_rew_ if clipping: rew_split = tf.clip_by_value(rew_split, -1, 1) if center_return: ep_return = ep_return - tf.reduce_mean(ep_return) rew_split = rew_split - (tf.reduce_sum(rew_split) / (tf.reduce_sum(mask_split) + 1e-24)) discounter = [pow(gamma, i) for i in range(0, horizon)] discounter_tf = tf.constant(discounter) disc_rew_split = rew_split * discounter_tf return_mean = tf.reduce_mean(ep_return) return_std = U.reduce_std(ep_return) return_max = tf.reduce_max(ep_return) return_min = tf.reduce_min(ep_return) return_abs_max = tf.reduce_max(tf.abs(ep_return)) return_step_max = tf.reduce_max(tf.abs(rew_split)) return_step_mean = tf.abs(tf.reduce_mean(rew_split)) positive_step_return_max = tf.maximum(0.0, tf.reduce_max(rew_split)) negative_step_return_max = tf.maximum(0.0, tf.reduce_max(-rew_split)) return_step_maxmin = tf.abs(positive_step_return_max - negative_step_return_max) losses_with_name.extend([(return_mean, 'InitialReturnMean'), (return_max, 'InitialReturnMax'), (return_min, 'InitialReturnMin'), (return_std, 'InitialReturnStd'), (emp_d2_arithmetic, 'EmpiricalD2Arithmetic'), (emp_d2_harmonic, 'EmpiricalD2Harmonic'), (return_step_max, 'ReturnStepMax'), (return_step_maxmin, 'ReturnStepMaxmin')]) if iw_method == 'is': target_log_pdf_episode = tf.reduce_sum(target_log_pdf_split, axis=1) behavioral_log_pdf_episode = tf.reduce_sum(behavioral_log_pdfs_split, axis=2) log_ratio = target_log_pdf_split - behavioral_log_pdfs_split inverse_log_ratio_episode = - tf.reduce_sum(log_ratio, axis=2) iw = 1 / tf.reduce_sum(tf.exp(inverse_log_ratio_episode) * tf.expand_dims(active_policies, -1), axis=0) iw_split = tf.reshape(iw, (memory.capacity, -1)) iw_by_behavioral = tf.reduce_mean(iw_split, axis=1) losses_with_name.append((iw_by_behavioral[0] / tf.reduce_sum(iw_by_behavioral), 'MultiIWFirstRatio')) losses_with_name.append((tf.reduce_max(iw_by_behavioral), 'MultiIWMax')) losses_with_name.append((tf.reduce_sum(iw_by_behavioral), 'MultiIWSum')) losses_with_name.append((tf.reduce_min(iw_by_behavioral), 'MultiIWMin')) iwn = iw / n_episodes w_return_mean = tf.reduce_sum(ep_return * iwn) ess_renyi_arithmetic = N_total / emp_d2_arithmetic ess_renyi_harmonic = N_total / emp_d2_harmonic losses_with_name.extend([(tf.reduce_max(iw), 'MaxIW'), (tf.reduce_min(iw), 'MinIW'), (tf.reduce_mean(iw), 'MeanIW'), (U.reduce_std(iw), 'StdIW'), (tf.reduce_min(target_log_pdf_episode), 'MinTargetPdf'), (tf.reduce_min(behavioral_log_pdf_episode), 'MinBehavPdf'), (ess_renyi_arithmetic, 'ESSRenyiArithmetic'), (ess_renyi_harmonic, 'ESSRenyiHarmonic')]) else: raise NotImplementedError() if bound == 'J': bound_ = w_return_mean elif bound == 'max-d2-harmonic': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi_harmonic)) * return_abs_max elif bound == 'max-d2-arithmetic': bound_ = w_return_mean - tf.sqrt((1 - delta) / (delta * ess_renyi_arithmetic)) * return_abs_max else: raise NotImplementedError() ent = pi.pd.entropy() meanent = tf.reduce_mean(ent) losses_with_name.append((meanent, 'MeanEntropy')) if entropy != 'none': scheme, v1, v2 = entropy.split(':') if scheme == 'step': entcoeff = tf.cond(iter_number_ < int(v2), lambda: float(v1), lambda: float(0.0)) losses_with_name.append((entcoeff, 'EntropyCoefficient')) entbonus = entcoeff * meanent bound_ = bound_ + entbonus elif scheme == 'lin': ip = tf.cast(iter_number_ / max_iters, tf.float32) entcoeff_decay = tf.maximum(0.0, float(v2) + (float(v1) - float(v2)) * (1.0 - ip)) losses_with_name.append((entcoeff_decay, 'EntropyCoefficient')) entbonus = entcoeff_decay * meanent bound_ = bound_ + entbonus elif scheme == 'exp': ent_f = tf.exp(-tf.abs(tf.reduce_mean(iw) - 1) * float(v2)) * float(v1) losses_with_name.append((ent_f, 'EntropyCoefficient')) bound_ = bound_ + ent_f * meanent else: raise Exception('Unrecognized entropy scheme.') losses_with_name.append((w_return_mean, 'ReturnMeanIW')) losses_with_name.append((bound_, 'Bound')) losses, loss_names = map(list, zip(*losses_with_name)) assert_ops = tf.group(*tf.get_collection('asserts')) print_ops = tf.group(*tf.get_collection('prints')) compute_lossandgrad = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], losses + [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_grad = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], [U.flatgrad(bound_, var_list), assert_ops, print_ops]) compute_bound = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], [bound_, assert_ops, print_ops]) compute_losses = U.function([ob_, ac_, rew_, disc_rew_, clustered_rew_, mask_, iter_number_, active_policies], losses) set_parameter = U.SetFromFlat(var_list) get_parameter = U.GetFlat(var_list) policy_reinit = tf.variables_initializer(var_list) if sampler is None: seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True, gamma=gamma) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() U.initialize() episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 tstart = time.time() lenbuffer = deque(maxlen=n_episodes) rewbuffer = deque(maxlen=n_episodes) while True: iters_so_far += 1 if iters_so_far == 50: print('=== CHANGED GAMMA TO 1.0') seg_gen = traj_segment_generator(pi, env, n_episodes, horizon, stochastic=True, gamma=1.0) sampler = type("SequentialSampler", (object,), {"collect": lambda self, _: seg_gen.__next__()})() if render_after is not None and iters_so_far % render_after == 0: if hasattr(env, 'render'): render(env, pi, horizon) if callback: callback(locals(), globals()) if iters_so_far >= max_iters: print('Finished...') break logger.log('********** Iteration %i ************' % iters_so_far) theta = get_parameter() with timed('sampling'): seg = sampler.collect(theta) lens, rets = seg['ep_lens'], seg['ep_rets'] lenbuffer.extend(lens) rewbuffer.extend(rets) episodes_so_far += len(lens) timesteps_so_far += sum(lens) memory.add_trajectory_batch(seg) seg_with_memory = memory.get_trajectories() reward_matrix = np.reshape(seg_with_memory['disc_rew'] * seg_with_memory['mask'], (-1, horizon)) ep_reward = np.sum(reward_matrix, axis=1) ep_reward = cluster_rewards(ep_reward, reward_clustering) args = ob, ac, rew, disc_rew, clustered_rew, mask, iter_number, active_policies = (seg_with_memory['ob'], seg_with_memory['ac'], seg_with_memory['rew'], seg_with_memory['disc_rew'], ep_reward, seg_with_memory['mask'], iters_so_far, memory.get_active_policies_mask()) def evaluate_loss(): loss = compute_bound(*args) return loss[0] def evaluate_gradient(): gradient = compute_grad(*args) return gradient[0] if use_natural_gradient: def evaluate_fisher_vector_prod(x): return compute_linear_operator(x, *args)[0] + fisher_reg * x def evaluate_natural_gradient(g): return cg(evaluate_fisher_vector_prod, g, cg_iters=10, verbose=0) else: evaluate_natural_gradient = None with timed('summaries before'): logger.record_tabular("Iteration", iters_so_far) logger.record_tabular("InitialBound", evaluate_loss()) logger.record_tabular("EpLenMean", np.mean(lenbuffer)) logger.record_tabular("EpRewMean", np.mean(rewbuffer)) logger.record_tabular("EpThisIter", len(lens)) logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", timesteps_so_far) logger.record_tabular("TimeElapsed", time.time() - tstart) if save_weights > 0 and iters_so_far % save_weights == 0: logger.record_tabular('Weights', str(get_parameter())) import pickle file = open('checkpoint' + str(iters_so_far) + '.pkl', 'wb') pickle.dump(theta, file) if not warm_start or memory.get_current_load() == capacity: with timed("offline optimization"): theta, improvement = optimize_offline(theta, set_parameter, line_search, evaluate_loss, evaluate_gradient, evaluate_natural_gradient, max_offline_ite=max_offline_iters) set_parameter(theta) print(theta) with timed('summaries after'): meanlosses = np.array(compute_losses(*args)) for (lossname, lossval) in zip(loss_names, meanlosses): logger.record_tabular(lossname, lossval) else: tf.get_default_session().run(policy_reinit) logger.dump_tabular() env.close()
true
true
f71d8034256591679beb03fa527db6b8505101de
2,465
py
Python
pymobiledevice3/services/web_protocol/cdp_server.py
iOSForensics/pymobiledevice3
6b148f4e58cc51cb44c18935913a3e6cec5b60d5
[ "MIT" ]
1
2022-01-20T16:53:15.000Z
2022-01-20T16:53:15.000Z
pymobiledevice3/services/web_protocol/cdp_server.py
iOSForensics/pymobiledevice3
6b148f4e58cc51cb44c18935913a3e6cec5b60d5
[ "MIT" ]
null
null
null
pymobiledevice3/services/web_protocol/cdp_server.py
iOSForensics/pymobiledevice3
6b148f4e58cc51cb44c18935913a3e6cec5b60d5
[ "MIT" ]
null
null
null
import asyncio import uuid from fastapi import FastAPI, WebSocket from fastapi.logger import logger from pymobiledevice3.services.web_protocol.cdp_target import CdpTarget from pymobiledevice3.services.web_protocol.session_protocol import SessionProtocol from pymobiledevice3.services.webinspector import WirTypes app = FastAPI() @app.on_event("startup") async def startup_event(): app.state.inspector.connect() @app.get('/json') async def available_targets(): app.state.inspector.get_open_pages() targets = [] for app_id in app.state.inspector.application_pages: for page_id, page in app.state.inspector.application_pages[app_id].items(): if page.type_ not in (WirTypes.WEB, WirTypes.WEB_PAGE): continue targets.append({ 'description': '', 'id': page_id, 'title': page.web_title, 'type': 'page', 'url': page.web_url, 'webSocketDebuggerUrl': f'ws://localhost:9222/devtools/page/{page_id}', 'devtoolsFrontendUrl': f'/devtools/inspector.html?ws://localhost:9222/devtools/page/{page_id}', }) return targets @app.get('/json/version') def version(): return { 'Browser': 'Safari', 'Protocol-Version': '1.1', 'User-Agent': 'pymobiledevice3', 'V8-Version': '7.2.233', 'WebKit-Version': '537.36 (@cfede9db1d154de0468cb0538479f34c0755a0f4)', 'webSocketDebuggerUrl': f'ws://localhost:9222/devtools/browser/{app.state.inspector.connection_id}' } async def from_cdp(target: CdpTarget, websocket): async for message in websocket.iter_json(): logger.debug(f'CDP INPUT: {message}') await target.send(message) async def to_cdp(target: CdpTarget, websocket): while True: message = await target.receive() logger.debug(f'CDP OUTPUT: {message}') await websocket.send_json(message) @app.websocket('/devtools/page/{page_id}') async def page_debugger(websocket: WebSocket, page_id: str): application, page = app.state.inspector.find_page_id(page_id) session_id = str(uuid.uuid4()).upper() protocol = SessionProtocol(app.state.inspector, session_id, application, page, method_prefix='') target = await CdpTarget.create(protocol) await websocket.accept() await asyncio.gather( from_cdp(target, websocket), to_cdp(target, websocket), )
32.866667
111
0.666531
import asyncio import uuid from fastapi import FastAPI, WebSocket from fastapi.logger import logger from pymobiledevice3.services.web_protocol.cdp_target import CdpTarget from pymobiledevice3.services.web_protocol.session_protocol import SessionProtocol from pymobiledevice3.services.webinspector import WirTypes app = FastAPI() @app.on_event("startup") async def startup_event(): app.state.inspector.connect() @app.get('/json') async def available_targets(): app.state.inspector.get_open_pages() targets = [] for app_id in app.state.inspector.application_pages: for page_id, page in app.state.inspector.application_pages[app_id].items(): if page.type_ not in (WirTypes.WEB, WirTypes.WEB_PAGE): continue targets.append({ 'description': '', 'id': page_id, 'title': page.web_title, 'type': 'page', 'url': page.web_url, 'webSocketDebuggerUrl': f'ws://localhost:9222/devtools/page/{page_id}', 'devtoolsFrontendUrl': f'/devtools/inspector.html?ws://localhost:9222/devtools/page/{page_id}', }) return targets @app.get('/json/version') def version(): return { 'Browser': 'Safari', 'Protocol-Version': '1.1', 'User-Agent': 'pymobiledevice3', 'V8-Version': '7.2.233', 'WebKit-Version': '537.36 (@cfede9db1d154de0468cb0538479f34c0755a0f4)', 'webSocketDebuggerUrl': f'ws://localhost:9222/devtools/browser/{app.state.inspector.connection_id}' } async def from_cdp(target: CdpTarget, websocket): async for message in websocket.iter_json(): logger.debug(f'CDP INPUT: {message}') await target.send(message) async def to_cdp(target: CdpTarget, websocket): while True: message = await target.receive() logger.debug(f'CDP OUTPUT: {message}') await websocket.send_json(message) @app.websocket('/devtools/page/{page_id}') async def page_debugger(websocket: WebSocket, page_id: str): application, page = app.state.inspector.find_page_id(page_id) session_id = str(uuid.uuid4()).upper() protocol = SessionProtocol(app.state.inspector, session_id, application, page, method_prefix='') target = await CdpTarget.create(protocol) await websocket.accept() await asyncio.gather( from_cdp(target, websocket), to_cdp(target, websocket), )
true
true
f71d8093d149be92f99d6a9576f78859def80b28
10,421
py
Python
nmt_rouge.py
shengqiangzhang/transformer-pointer-generator-for-english-dataset-
1ace22017647f06521db36de1ed99e02bce91355
[ "MIT" ]
7
2021-01-04T07:44:47.000Z
2022-02-27T08:48:48.000Z
nmt_rouge.py
shengqiangzhang/transformer-pointer-generator-for-english-dataset-
1ace22017647f06521db36de1ed99e02bce91355
[ "MIT" ]
1
2022-03-19T06:22:06.000Z
2022-03-19T06:22:06.000Z
nmt_rouge.py
shengqiangzhang/transformer-pointer-generator-for-english-dataset-
1ace22017647f06521db36de1ed99e02bce91355
[ "MIT" ]
2
2021-12-06T13:48:24.000Z
2021-12-19T18:08:36.000Z
"""ROUGE metric implementation. Copy from tf_seq2seq/seq2seq/metrics/rouge.py. This is a modified and slightly extended verison of https://github.com/miso-belica/sumy/blob/valid/sumy/evaluation/rouge.py. """ from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import itertools import numpy as np #pylint: disable=C0103 def _get_ngrams(n, text): """Calcualtes n-grams. Args: n: which n-grams to calculate text: An array of tokens Returns: A set of n-grams """ ngram_set = set() text_length = len(text) max_index_ngram_start = text_length - n for i in range(max_index_ngram_start + 1): ngram_set.add(tuple(text[i:i + n])) return ngram_set def _split_into_words(sentences): """Splits multiple sentences into words and flattens the result""" return list(itertools.chain(*[_.split(" ") for _ in sentences])) def _get_word_ngrams(n, sentences): """Calculates word n-grams for multiple sentences. """ assert len(sentences) > 0 assert n > 0 words = _split_into_words(sentences) return _get_ngrams(n, words) def _len_lcs(x, y): """ Returns the length of the Longest Common Subsequence between sequences x and y. Source: http://www.algorithmist.com/index.php/Longest_Common_Subsequence Args: x: sequence of words y: sequence of words Returns integer: Length of LCS between x and y """ table = _lcs(x, y) n, m = len(x), len(y) return table[n, m] def _lcs(x, y): """ Computes the length of the longest common subsequence (lcs) between two strings. The implementation below uses a DP programming algorithm and runs in O(nm) time where n = len(x) and m = len(y). Source: http://www.algorithmist.com/index.php/Longest_Common_Subsequence Args: x: collection of words y: collection of words Returns: Table of dictionary of coord and len lcs """ n, m = len(x), len(y) table = dict() for i in range(n + 1): for j in range(m + 1): if i == 0 or j == 0: table[i, j] = 0 elif x[i - 1] == y[j - 1]: table[i, j] = table[i - 1, j - 1] + 1 else: table[i, j] = max(table[i - 1, j], table[i, j - 1]) return table def _recon_lcs(x, y): """ Returns the Longest Subsequence between x and y. Source: http://www.algorithmist.com/index.php/Longest_Common_Subsequence Args: x: sequence of words y: sequence of words Returns: sequence: LCS of x and y """ i, j = len(x), len(y) table = _lcs(x, y) def _recon(i, j): """private recon calculation""" if i == 0 or j == 0: return [] elif x[i - 1] == y[j - 1]: return _recon(i - 1, j - 1) + [(x[i - 1], i)] elif table[i - 1, j] > table[i, j - 1]: return _recon(i - 1, j) else: return _recon(i, j - 1) recon_tuple = tuple(map(lambda x: x[0], _recon(i, j))) return recon_tuple def rouge_n(evaluated_sentences, reference_sentences, n=2): """ Computes ROUGE-N of two text collections of sentences. Sourece: http://research.microsoft.com/en-us/um/people/cyl/download/ papers/rouge-working-note-v1.3.1.pdf Args: evaluated_sentences: The sentences that have been picked by the summarizer reference_sentences: The sentences from the referene set n: Size of ngram. Defaults to 2. Returns: A tuple (f1, precision, recall) for ROUGE-N Raises: ValueError: raises exception if a param has len <= 0 """ if len(evaluated_sentences) <= 0 or len(reference_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") evaluated_ngrams = _get_word_ngrams(n, evaluated_sentences) reference_ngrams = _get_word_ngrams(n, reference_sentences) reference_count = len(reference_ngrams) evaluated_count = len(evaluated_ngrams) # Gets the overlapping ngrams between evaluated and reference overlapping_ngrams = evaluated_ngrams.intersection(reference_ngrams) overlapping_count = len(overlapping_ngrams) # Handle edge case. This isn't mathematically correct, but it's good enough if evaluated_count == 0: precision = 0.0 else: precision = overlapping_count / evaluated_count if reference_count == 0: recall = 0.0 else: recall = overlapping_count / reference_count f1_score = 2.0 * ((precision * recall) / (precision + recall + 1e-8)) # return overlapping_count / reference_count return f1_score, precision, recall def _f_p_r_lcs(llcs, m, n): """ Computes the LCS-based F-measure score Source: http://research.microsoft.com/en-us/um/people/cyl/download/papers/ rouge-working-note-v1.3.1.pdf Args: llcs: Length of LCS m: number of words in reference summary n: number of words in candidate summary Returns: Float. LCS-based F-measure score """ r_lcs = llcs / m p_lcs = llcs / n beta = p_lcs / (r_lcs + 1e-12) num = (1 + (beta**2)) * r_lcs * p_lcs denom = r_lcs + ((beta**2) * p_lcs) f_lcs = num / (denom + 1e-12) return f_lcs, p_lcs, r_lcs def rouge_l_sentence_level(evaluated_sentences, reference_sentences): """ Computes ROUGE-L (sentence level) of two text collections of sentences. http://research.microsoft.com/en-us/um/people/cyl/download/papers/ rouge-working-note-v1.3.1.pdf Calculated according to: R_lcs = LCS(X,Y)/m P_lcs = LCS(X,Y)/n F_lcs = ((1 + beta^2)*R_lcs*P_lcs) / (R_lcs + (beta^2) * P_lcs) where: X = reference summary Y = Candidate summary m = length of reference summary n = length of candidate summary Args: evaluated_sentences: The sentences that have been picked by the summarizer reference_sentences: The sentences from the referene set Returns: A float: F_lcs Raises: ValueError: raises exception if a param has len <= 0 """ if len(evaluated_sentences) <= 0 or len(reference_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") reference_words = _split_into_words(reference_sentences) evaluated_words = _split_into_words(evaluated_sentences) m = len(reference_words) n = len(evaluated_words) lcs = _len_lcs(evaluated_words, reference_words) return _f_p_r_lcs(lcs, m, n) def _union_lcs(evaluated_sentences, reference_sentence): """ Returns LCS_u(r_i, C) which is the LCS score of the union longest common subsequence between reference sentence ri and candidate summary C. For example if r_i= w1 w2 w3 w4 w5, and C contains two sentences: c1 = w1 w2 w6 w7 w8 and c2 = w1 w3 w8 w9 w5, then the longest common subsequence of r_i and c1 is "w1 w2" and the longest common subsequence of r_i and c2 is "w1 w3 w5". The union longest common subsequence of r_i, c1, and c2 is "w1 w2 w3 w5" and LCS_u(r_i, C) = 4/5. Args: evaluated_sentences: The sentences that have been picked by the summarizer reference_sentence: One of the sentences in the reference summaries Returns: float: LCS_u(r_i, C) ValueError: Raises exception if a param has len <= 0 """ if len(evaluated_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") lcs_union = set() reference_words = _split_into_words([reference_sentence]) combined_lcs_length = 0 for eval_s in evaluated_sentences: evaluated_words = _split_into_words([eval_s]) lcs = set(_recon_lcs(reference_words, evaluated_words)) combined_lcs_length += len(lcs) lcs_union = lcs_union.union(lcs) union_lcs_count = len(lcs_union) union_lcs_value = union_lcs_count / combined_lcs_length return union_lcs_value def rouge_l_summary_level(evaluated_sentences, reference_sentences): """ Computes ROUGE-L (summary level) of two text collections of sentences. http://research.microsoft.com/en-us/um/people/cyl/download/papers/ rouge-working-note-v1.3.1.pdf Calculated according to: R_lcs = SUM(1, u)[LCS<union>(r_i,C)]/m P_lcs = SUM(1, u)[LCS<union>(r_i,C)]/n F_lcs = ((1 + beta^2)*R_lcs*P_lcs) / (R_lcs + (beta^2) * P_lcs) where: SUM(i,u) = SUM from i through u u = number of sentences in reference summary C = Candidate summary made up of v sentences m = number of words in reference summary n = number of words in candidate summary Args: evaluated_sentences: The sentences that have been picked by the summarizer reference_sentence: One of the sentences in the reference summaries Returns: A float: F_lcs Raises: ValueError: raises exception if a param has len <= 0 """ if len(evaluated_sentences) <= 0 or len(reference_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") # total number of words in reference sentences m = len(_split_into_words(reference_sentences)) # total number of words in evaluated sentences n = len(_split_into_words(evaluated_sentences)) union_lcs_sum_across_all_references = 0 for ref_s in reference_sentences: union_lcs_sum_across_all_references += _union_lcs(evaluated_sentences, ref_s) return _f_p_r_lcs(union_lcs_sum_across_all_references, m, n) def rouge(hypotheses, references): """Calculates average rouge scores for a list of hypotheses and references""" # Filter out hyps that are of 0 length # hyps_and_refs = zip(hypotheses, references) # hyps_and_refs = [_ for _ in hyps_and_refs if len(_[0]) > 0] # hypotheses, references = zip(*hyps_and_refs) # Calculate ROUGE-1 F1, precision, recall scores rouge_1 = [ rouge_n([hyp], [ref], 1) for hyp, ref in zip(hypotheses, references) ] rouge_1_f, rouge_1_p, rouge_1_r = map(np.mean, zip(*rouge_1)) # Calculate ROUGE-2 F1, precision, recall scores rouge_2 = [ rouge_n([hyp], [ref], 2) for hyp, ref in zip(hypotheses, references) ] rouge_2_f, rouge_2_p, rouge_2_r = map(np.mean, zip(*rouge_2)) # Calculate ROUGE-L F1, precision, recall scores rouge_l = [ rouge_l_sentence_level([hyp], [ref]) for hyp, ref in zip(hypotheses, references) ] rouge_l_f, rouge_l_p, rouge_l_r = map(np.mean, zip(*rouge_l)) return { "rouge_1/f_score": rouge_1_f, "rouge_1/r_score": rouge_1_r, "rouge_1/p_score": rouge_1_p, "rouge_2/f_score": rouge_2_f, "rouge_2/r_score": rouge_2_r, "rouge_2/p_score": rouge_2_p, "rouge_l/f_score": rouge_l_f, "rouge_l/r_score": rouge_l_r, "rouge_l/p_score": rouge_l_p, }
29.521246
80
0.696286
from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import itertools import numpy as np def _get_ngrams(n, text): ngram_set = set() text_length = len(text) max_index_ngram_start = text_length - n for i in range(max_index_ngram_start + 1): ngram_set.add(tuple(text[i:i + n])) return ngram_set def _split_into_words(sentences): return list(itertools.chain(*[_.split(" ") for _ in sentences])) def _get_word_ngrams(n, sentences): assert len(sentences) > 0 assert n > 0 words = _split_into_words(sentences) return _get_ngrams(n, words) def _len_lcs(x, y): table = _lcs(x, y) n, m = len(x), len(y) return table[n, m] def _lcs(x, y): n, m = len(x), len(y) table = dict() for i in range(n + 1): for j in range(m + 1): if i == 0 or j == 0: table[i, j] = 0 elif x[i - 1] == y[j - 1]: table[i, j] = table[i - 1, j - 1] + 1 else: table[i, j] = max(table[i - 1, j], table[i, j - 1]) return table def _recon_lcs(x, y): i, j = len(x), len(y) table = _lcs(x, y) def _recon(i, j): if i == 0 or j == 0: return [] elif x[i - 1] == y[j - 1]: return _recon(i - 1, j - 1) + [(x[i - 1], i)] elif table[i - 1, j] > table[i, j - 1]: return _recon(i - 1, j) else: return _recon(i, j - 1) recon_tuple = tuple(map(lambda x: x[0], _recon(i, j))) return recon_tuple def rouge_n(evaluated_sentences, reference_sentences, n=2): if len(evaluated_sentences) <= 0 or len(reference_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") evaluated_ngrams = _get_word_ngrams(n, evaluated_sentences) reference_ngrams = _get_word_ngrams(n, reference_sentences) reference_count = len(reference_ngrams) evaluated_count = len(evaluated_ngrams) overlapping_ngrams = evaluated_ngrams.intersection(reference_ngrams) overlapping_count = len(overlapping_ngrams) if evaluated_count == 0: precision = 0.0 else: precision = overlapping_count / evaluated_count if reference_count == 0: recall = 0.0 else: recall = overlapping_count / reference_count f1_score = 2.0 * ((precision * recall) / (precision + recall + 1e-8)) return f1_score, precision, recall def _f_p_r_lcs(llcs, m, n): r_lcs = llcs / m p_lcs = llcs / n beta = p_lcs / (r_lcs + 1e-12) num = (1 + (beta**2)) * r_lcs * p_lcs denom = r_lcs + ((beta**2) * p_lcs) f_lcs = num / (denom + 1e-12) return f_lcs, p_lcs, r_lcs def rouge_l_sentence_level(evaluated_sentences, reference_sentences): if len(evaluated_sentences) <= 0 or len(reference_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") reference_words = _split_into_words(reference_sentences) evaluated_words = _split_into_words(evaluated_sentences) m = len(reference_words) n = len(evaluated_words) lcs = _len_lcs(evaluated_words, reference_words) return _f_p_r_lcs(lcs, m, n) def _union_lcs(evaluated_sentences, reference_sentence): if len(evaluated_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") lcs_union = set() reference_words = _split_into_words([reference_sentence]) combined_lcs_length = 0 for eval_s in evaluated_sentences: evaluated_words = _split_into_words([eval_s]) lcs = set(_recon_lcs(reference_words, evaluated_words)) combined_lcs_length += len(lcs) lcs_union = lcs_union.union(lcs) union_lcs_count = len(lcs_union) union_lcs_value = union_lcs_count / combined_lcs_length return union_lcs_value def rouge_l_summary_level(evaluated_sentences, reference_sentences): if len(evaluated_sentences) <= 0 or len(reference_sentences) <= 0: raise ValueError("Collections must contain at least 1 sentence.") m = len(_split_into_words(reference_sentences)) n = len(_split_into_words(evaluated_sentences)) union_lcs_sum_across_all_references = 0 for ref_s in reference_sentences: union_lcs_sum_across_all_references += _union_lcs(evaluated_sentences, ref_s) return _f_p_r_lcs(union_lcs_sum_across_all_references, m, n) def rouge(hypotheses, references): rouge_1 = [ rouge_n([hyp], [ref], 1) for hyp, ref in zip(hypotheses, references) ] rouge_1_f, rouge_1_p, rouge_1_r = map(np.mean, zip(*rouge_1)) rouge_2 = [ rouge_n([hyp], [ref], 2) for hyp, ref in zip(hypotheses, references) ] rouge_2_f, rouge_2_p, rouge_2_r = map(np.mean, zip(*rouge_2)) rouge_l = [ rouge_l_sentence_level([hyp], [ref]) for hyp, ref in zip(hypotheses, references) ] rouge_l_f, rouge_l_p, rouge_l_r = map(np.mean, zip(*rouge_l)) return { "rouge_1/f_score": rouge_1_f, "rouge_1/r_score": rouge_1_r, "rouge_1/p_score": rouge_1_p, "rouge_2/f_score": rouge_2_f, "rouge_2/r_score": rouge_2_r, "rouge_2/p_score": rouge_2_p, "rouge_l/f_score": rouge_l_f, "rouge_l/r_score": rouge_l_r, "rouge_l/p_score": rouge_l_p, }
true
true
f71d816cb43be30dc40087bc3974ad2ed7599d34
17,478
py
Python
readthedocs/api/v3/serializers.py
darrowco/readthedocs.org
fa7fc5a24306f1f6a27c7393f381c594ab29b357
[ "MIT" ]
1
2021-07-01T01:31:58.000Z
2021-07-01T01:31:58.000Z
readthedocs/api/v3/serializers.py
darrowco/readthedocs.org
fa7fc5a24306f1f6a27c7393f381c594ab29b357
[ "MIT" ]
4
2020-06-05T22:35:21.000Z
2021-12-13T20:10:17.000Z
readthedocs/api/v3/serializers.py
darrowco/readthedocs.org
fa7fc5a24306f1f6a27c7393f381c594ab29b357
[ "MIT" ]
null
null
null
import datetime import urllib from django.conf import settings from django.contrib.auth.models import User from django.core.urlresolvers import reverse from rest_flex_fields import FlexFieldsModelSerializer from rest_flex_fields.serializers import FlexFieldsSerializerMixin from rest_framework import serializers from readthedocs.builds.models import Build, Version from readthedocs.projects.constants import LANGUAGES, PROGRAMMING_LANGUAGES, REPO_CHOICES from readthedocs.projects.models import Project, EnvironmentVariable from readthedocs.redirects.models import Redirect, TYPE_CHOICES as REDIRECT_TYPE_CHOICES class UserSerializer(FlexFieldsModelSerializer): class Meta: model = User fields = [ 'username', ] class BaseLinksSerializer(serializers.Serializer): def _absolute_url(self, path): scheme = 'http' if settings.DEBUG else 'https' domain = settings.PRODUCTION_DOMAIN return urllib.parse.urlunparse((scheme, domain, path, '', '', '')) class BuildCreateSerializer(serializers.ModelSerializer): """ Used when triggering (create action) a ``Build`` for a specific ``Version``. This serializer validates that no field is sent at all in the request. """ class Meta: model = Build fields = [] class BuildLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() version = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-builds-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'build_pk': obj.pk, }, ) return self._absolute_url(path) def get_version(self, obj): path = reverse( 'projects-versions-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'version_slug': obj.version.slug, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class BuildConfigSerializer(FlexFieldsSerializerMixin, serializers.Serializer): """ Render ``Build.config`` property without modifying it. .. note:: Any change on the output of that property will be reflected here, which may produce incompatible changes in the API. """ def to_representation(self, instance): # For now, we want to return the ``config`` object as it is without # manipulating it. return instance class BuildStateSerializer(serializers.Serializer): code = serializers.CharField(source='state') name = serializers.SerializerMethodField() def get_name(self, obj): return obj.state.title() class BuildSerializer(FlexFieldsModelSerializer): project = serializers.SlugRelatedField(slug_field='slug', read_only=True) version = serializers.SlugRelatedField(slug_field='slug', read_only=True) created = serializers.DateTimeField(source='date') finished = serializers.SerializerMethodField() success = serializers.SerializerMethodField() duration = serializers.IntegerField(source='length') state = BuildStateSerializer(source='*') _links = BuildLinksSerializer(source='*') expandable_fields = dict( config=( BuildConfigSerializer, dict( source='config', ), ), ) class Meta: model = Build fields = [ 'id', 'version', 'project', 'created', 'finished', 'duration', 'state', 'success', 'error', 'commit', '_links', ] def get_finished(self, obj): if obj.date and obj.length: return obj.date + datetime.timedelta(seconds=obj.length) def get_success(self, obj): """ Return ``None`` if the build is not finished. This is needed becase ``default=True`` in the model field. """ if obj.finished: return obj.success return None class PrivacyLevelSerializer(serializers.Serializer): code = serializers.CharField(source='privacy_level') name = serializers.SerializerMethodField() def get_name(self, obj): return obj.privacy_level.title() class VersionLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() builds = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-versions-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'version_slug': obj.slug, }, ) return self._absolute_url(path) def get_builds(self, obj): path = reverse( 'projects-versions-builds-list', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'parent_lookup_version__slug': obj.slug, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class VersionURLsSerializer(serializers.Serializer): documentation = serializers.SerializerMethodField() vcs = serializers.URLField(source='vcs_url') def get_documentation(self, obj): return obj.project.get_docs_url(version_slug=obj.slug,) class VersionSerializer(FlexFieldsModelSerializer): privacy_level = PrivacyLevelSerializer(source='*') ref = serializers.CharField() downloads = serializers.SerializerMethodField() urls = VersionURLsSerializer(source='*') _links = VersionLinksSerializer(source='*') expandable_fields = dict( last_build=( BuildSerializer, dict( source='last_build', ), ), ) class Meta: model = Version fields = [ 'id', 'slug', 'verbose_name', 'identifier', 'ref', 'built', 'active', 'privacy_level', 'type', 'downloads', 'urls', '_links', ] def get_downloads(self, obj): downloads = obj.get_downloads() data = {} for k, v in downloads.items(): if k in ('htmlzip', 'pdf', 'epub'): data[k] = ('http:' if settings.DEBUG else 'https:') + v return data class VersionUpdateSerializer(serializers.ModelSerializer): """ Used when modifying (update action) a ``Version``. It only allows to make the Version active/non-active and private/public. """ class Meta: model = Version fields = [ 'active', 'privacy_level', ] class LanguageSerializer(serializers.Serializer): code = serializers.SerializerMethodField() name = serializers.SerializerMethodField() def get_code(self, language): return language def get_name(self, language): for code, name in LANGUAGES: if code == language: return name return 'Unknown' class ProgrammingLanguageSerializer(serializers.Serializer): code = serializers.SerializerMethodField() name = serializers.SerializerMethodField() def get_code(self, programming_language): return programming_language def get_name(self, programming_language): for code, name in PROGRAMMING_LANGUAGES: if code == programming_language: return name return 'Unknown' class ProjectURLsSerializer(BaseLinksSerializer, serializers.Serializer): """Serializer with all the user-facing URLs under Read the Docs.""" documentation = serializers.CharField(source='get_docs_url') home = serializers.SerializerMethodField() builds = serializers.SerializerMethodField() versions = serializers.SerializerMethodField() def get_home(self, obj): path = reverse('projects_detail', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) def get_builds(self, obj): path = reverse('builds_project_list', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) def get_versions(self, obj): path = reverse('project_version_list', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) class RepositorySerializer(serializers.Serializer): url = serializers.CharField(source='repo') type = serializers.ChoiceField( source='repo_type', choices=REPO_CHOICES, ) class ProjectLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() versions = serializers.SerializerMethodField() builds = serializers.SerializerMethodField() environmentvariables = serializers.SerializerMethodField() redirects = serializers.SerializerMethodField() subprojects = serializers.SerializerMethodField() superproject = serializers.SerializerMethodField() translations = serializers.SerializerMethodField() def get__self(self, obj): path = reverse('projects-detail', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) def get_versions(self, obj): path = reverse( 'projects-versions-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_environmentvariables(self, obj): path = reverse( 'projects-environmentvariables-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_redirects(self, obj): path = reverse( 'projects-redirects-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_builds(self, obj): path = reverse( 'projects-builds-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_subprojects(self, obj): path = reverse( 'projects-subprojects-list', kwargs={ 'parent_lookup_superprojects__parent__slug': obj.slug, }, ) return self._absolute_url(path) def get_superproject(self, obj): path = reverse( 'projects-superproject', kwargs={ 'project_slug': obj.slug, }, ) return self._absolute_url(path) def get_translations(self, obj): path = reverse( 'projects-translations-list', kwargs={ 'parent_lookup_main_language_project__slug': obj.slug, }, ) return self._absolute_url(path) class ProjectCreateSerializer(FlexFieldsModelSerializer): """Serializer used to Import a Project.""" repository = RepositorySerializer(source='*') homepage = serializers.URLField(source='project_url', required=False) class Meta: model = Project fields = ( 'name', 'language', 'programming_language', 'repository', 'homepage', ) class ProjectSerializer(FlexFieldsModelSerializer): homepage = serializers.SerializerMethodField() language = LanguageSerializer() programming_language = ProgrammingLanguageSerializer() repository = RepositorySerializer(source='*') privacy_level = PrivacyLevelSerializer(source='*') urls = ProjectURLsSerializer(source='*') subproject_of = serializers.SerializerMethodField() translation_of = serializers.SerializerMethodField() default_branch = serializers.CharField(source='get_default_branch') tags = serializers.StringRelatedField(many=True) users = UserSerializer(many=True) _links = ProjectLinksSerializer(source='*') # TODO: adapt these fields with the proper names in the db and then remove # them from here created = serializers.DateTimeField(source='pub_date') modified = serializers.DateTimeField(source='modified_date') expandable_fields = dict( active_versions=( VersionSerializer, dict( # NOTE: this has to be a Model method, can't be a # ``SerializerMethodField`` as far as I know source='active_versions', many=True, ), ), ) class Meta: model = Project fields = [ 'id', 'name', 'slug', 'created', 'modified', 'language', 'programming_language', 'homepage', 'repository', 'default_version', 'default_branch', 'privacy_level', 'subproject_of', 'translation_of', 'users', 'urls', 'tags', # NOTE: ``expandable_fields`` must not be included here. Otherwise, # they will be tried to be rendered and fail # 'users', # 'active_versions', '_links', ] def get_homepage(self, obj): # Overridden only to return ``None`` when the project_url is ``''`` return obj.project_url or None def get_translation_of(self, obj): if obj.main_language_project: return self.__class__(obj.main_language_project).data def get_subproject_of(self, obj): try: return self.__class__(obj.superprojects.first().parent).data except Exception: return None class RedirectLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-redirects-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'redirect_pk': obj.pk, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class RedirectSerializerBase(serializers.ModelSerializer): project = serializers.SlugRelatedField(slug_field='slug', read_only=True) created = serializers.DateTimeField(source='create_dt', read_only=True) modified = serializers.DateTimeField(source='update_dt', read_only=True) _links = RedirectLinksSerializer(source='*', read_only=True) type = serializers.ChoiceField(source='redirect_type', choices=REDIRECT_TYPE_CHOICES) class Meta: model = Redirect fields = [ 'pk', 'created', 'modified', 'project', 'type', 'from_url', 'to_url', '_links', ] class RedirectCreateSerializer(RedirectSerializerBase): pass class RedirectDetailSerializer(RedirectSerializerBase): """Override RedirectSerializerBase to sanitize the empty fields.""" from_url = serializers.SerializerMethodField() to_url = serializers.SerializerMethodField() def get_from_url(self, obj): # Overridden only to return ``None`` when the description is ``''`` return obj.from_url or None def get_to_url(self, obj): # Overridden only to return ``None`` when the description is ``''`` return obj.to_url or None class EnvironmentVariableLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-environmentvariables-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'environmentvariable_pk': obj.pk, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class EnvironmentVariableSerializer(serializers.ModelSerializer): value = serializers.CharField(write_only=True) project = serializers.SlugRelatedField(slug_field='slug', read_only=True) _links = EnvironmentVariableLinksSerializer(source='*', read_only=True) class Meta: model = EnvironmentVariable fields = [ 'pk', 'created', 'modified', 'name', 'value', 'project', '_links', ]
28.419512
89
0.612198
import datetime import urllib from django.conf import settings from django.contrib.auth.models import User from django.core.urlresolvers import reverse from rest_flex_fields import FlexFieldsModelSerializer from rest_flex_fields.serializers import FlexFieldsSerializerMixin from rest_framework import serializers from readthedocs.builds.models import Build, Version from readthedocs.projects.constants import LANGUAGES, PROGRAMMING_LANGUAGES, REPO_CHOICES from readthedocs.projects.models import Project, EnvironmentVariable from readthedocs.redirects.models import Redirect, TYPE_CHOICES as REDIRECT_TYPE_CHOICES class UserSerializer(FlexFieldsModelSerializer): class Meta: model = User fields = [ 'username', ] class BaseLinksSerializer(serializers.Serializer): def _absolute_url(self, path): scheme = 'http' if settings.DEBUG else 'https' domain = settings.PRODUCTION_DOMAIN return urllib.parse.urlunparse((scheme, domain, path, '', '', '')) class BuildCreateSerializer(serializers.ModelSerializer): class Meta: model = Build fields = [] class BuildLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() version = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-builds-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'build_pk': obj.pk, }, ) return self._absolute_url(path) def get_version(self, obj): path = reverse( 'projects-versions-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'version_slug': obj.version.slug, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class BuildConfigSerializer(FlexFieldsSerializerMixin, serializers.Serializer): def to_representation(self, instance): return instance class BuildStateSerializer(serializers.Serializer): code = serializers.CharField(source='state') name = serializers.SerializerMethodField() def get_name(self, obj): return obj.state.title() class BuildSerializer(FlexFieldsModelSerializer): project = serializers.SlugRelatedField(slug_field='slug', read_only=True) version = serializers.SlugRelatedField(slug_field='slug', read_only=True) created = serializers.DateTimeField(source='date') finished = serializers.SerializerMethodField() success = serializers.SerializerMethodField() duration = serializers.IntegerField(source='length') state = BuildStateSerializer(source='*') _links = BuildLinksSerializer(source='*') expandable_fields = dict( config=( BuildConfigSerializer, dict( source='config', ), ), ) class Meta: model = Build fields = [ 'id', 'version', 'project', 'created', 'finished', 'duration', 'state', 'success', 'error', 'commit', '_links', ] def get_finished(self, obj): if obj.date and obj.length: return obj.date + datetime.timedelta(seconds=obj.length) def get_success(self, obj): if obj.finished: return obj.success return None class PrivacyLevelSerializer(serializers.Serializer): code = serializers.CharField(source='privacy_level') name = serializers.SerializerMethodField() def get_name(self, obj): return obj.privacy_level.title() class VersionLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() builds = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-versions-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'version_slug': obj.slug, }, ) return self._absolute_url(path) def get_builds(self, obj): path = reverse( 'projects-versions-builds-list', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'parent_lookup_version__slug': obj.slug, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class VersionURLsSerializer(serializers.Serializer): documentation = serializers.SerializerMethodField() vcs = serializers.URLField(source='vcs_url') def get_documentation(self, obj): return obj.project.get_docs_url(version_slug=obj.slug,) class VersionSerializer(FlexFieldsModelSerializer): privacy_level = PrivacyLevelSerializer(source='*') ref = serializers.CharField() downloads = serializers.SerializerMethodField() urls = VersionURLsSerializer(source='*') _links = VersionLinksSerializer(source='*') expandable_fields = dict( last_build=( BuildSerializer, dict( source='last_build', ), ), ) class Meta: model = Version fields = [ 'id', 'slug', 'verbose_name', 'identifier', 'ref', 'built', 'active', 'privacy_level', 'type', 'downloads', 'urls', '_links', ] def get_downloads(self, obj): downloads = obj.get_downloads() data = {} for k, v in downloads.items(): if k in ('htmlzip', 'pdf', 'epub'): data[k] = ('http:' if settings.DEBUG else 'https:') + v return data class VersionUpdateSerializer(serializers.ModelSerializer): class Meta: model = Version fields = [ 'active', 'privacy_level', ] class LanguageSerializer(serializers.Serializer): code = serializers.SerializerMethodField() name = serializers.SerializerMethodField() def get_code(self, language): return language def get_name(self, language): for code, name in LANGUAGES: if code == language: return name return 'Unknown' class ProgrammingLanguageSerializer(serializers.Serializer): code = serializers.SerializerMethodField() name = serializers.SerializerMethodField() def get_code(self, programming_language): return programming_language def get_name(self, programming_language): for code, name in PROGRAMMING_LANGUAGES: if code == programming_language: return name return 'Unknown' class ProjectURLsSerializer(BaseLinksSerializer, serializers.Serializer): documentation = serializers.CharField(source='get_docs_url') home = serializers.SerializerMethodField() builds = serializers.SerializerMethodField() versions = serializers.SerializerMethodField() def get_home(self, obj): path = reverse('projects_detail', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) def get_builds(self, obj): path = reverse('builds_project_list', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) def get_versions(self, obj): path = reverse('project_version_list', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) class RepositorySerializer(serializers.Serializer): url = serializers.CharField(source='repo') type = serializers.ChoiceField( source='repo_type', choices=REPO_CHOICES, ) class ProjectLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() versions = serializers.SerializerMethodField() builds = serializers.SerializerMethodField() environmentvariables = serializers.SerializerMethodField() redirects = serializers.SerializerMethodField() subprojects = serializers.SerializerMethodField() superproject = serializers.SerializerMethodField() translations = serializers.SerializerMethodField() def get__self(self, obj): path = reverse('projects-detail', kwargs={'project_slug': obj.slug}) return self._absolute_url(path) def get_versions(self, obj): path = reverse( 'projects-versions-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_environmentvariables(self, obj): path = reverse( 'projects-environmentvariables-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_redirects(self, obj): path = reverse( 'projects-redirects-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_builds(self, obj): path = reverse( 'projects-builds-list', kwargs={ 'parent_lookup_project__slug': obj.slug, }, ) return self._absolute_url(path) def get_subprojects(self, obj): path = reverse( 'projects-subprojects-list', kwargs={ 'parent_lookup_superprojects__parent__slug': obj.slug, }, ) return self._absolute_url(path) def get_superproject(self, obj): path = reverse( 'projects-superproject', kwargs={ 'project_slug': obj.slug, }, ) return self._absolute_url(path) def get_translations(self, obj): path = reverse( 'projects-translations-list', kwargs={ 'parent_lookup_main_language_project__slug': obj.slug, }, ) return self._absolute_url(path) class ProjectCreateSerializer(FlexFieldsModelSerializer): repository = RepositorySerializer(source='*') homepage = serializers.URLField(source='project_url', required=False) class Meta: model = Project fields = ( 'name', 'language', 'programming_language', 'repository', 'homepage', ) class ProjectSerializer(FlexFieldsModelSerializer): homepage = serializers.SerializerMethodField() language = LanguageSerializer() programming_language = ProgrammingLanguageSerializer() repository = RepositorySerializer(source='*') privacy_level = PrivacyLevelSerializer(source='*') urls = ProjectURLsSerializer(source='*') subproject_of = serializers.SerializerMethodField() translation_of = serializers.SerializerMethodField() default_branch = serializers.CharField(source='get_default_branch') tags = serializers.StringRelatedField(many=True) users = UserSerializer(many=True) _links = ProjectLinksSerializer(source='*') created = serializers.DateTimeField(source='pub_date') modified = serializers.DateTimeField(source='modified_date') expandable_fields = dict( active_versions=( VersionSerializer, dict( # ``SerializerMethodField`` as far as I know source='active_versions', many=True, ), ), ) class Meta: model = Project fields = [ 'id', 'name', 'slug', 'created', 'modified', 'language', 'programming_language', 'homepage', 'repository', 'default_version', 'default_branch', 'privacy_level', 'subproject_of', 'translation_of', 'users', 'urls', 'tags', # NOTE: ``expandable_fields`` must not be included here. Otherwise, # they will be tried to be rendered and fail # 'users', # 'active_versions', '_links', ] def get_homepage(self, obj): # Overridden only to return ``None`` when the project_url is ``''`` return obj.project_url or None def get_translation_of(self, obj): if obj.main_language_project: return self.__class__(obj.main_language_project).data def get_subproject_of(self, obj): try: return self.__class__(obj.superprojects.first().parent).data except Exception: return None class RedirectLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-redirects-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'redirect_pk': obj.pk, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class RedirectSerializerBase(serializers.ModelSerializer): project = serializers.SlugRelatedField(slug_field='slug', read_only=True) created = serializers.DateTimeField(source='create_dt', read_only=True) modified = serializers.DateTimeField(source='update_dt', read_only=True) _links = RedirectLinksSerializer(source='*', read_only=True) type = serializers.ChoiceField(source='redirect_type', choices=REDIRECT_TYPE_CHOICES) class Meta: model = Redirect fields = [ 'pk', 'created', 'modified', 'project', 'type', 'from_url', 'to_url', '_links', ] class RedirectCreateSerializer(RedirectSerializerBase): pass class RedirectDetailSerializer(RedirectSerializerBase): from_url = serializers.SerializerMethodField() to_url = serializers.SerializerMethodField() def get_from_url(self, obj): # Overridden only to return ``None`` when the description is ``''`` return obj.from_url or None def get_to_url(self, obj): # Overridden only to return ``None`` when the description is ``''`` return obj.to_url or None class EnvironmentVariableLinksSerializer(BaseLinksSerializer): _self = serializers.SerializerMethodField() project = serializers.SerializerMethodField() def get__self(self, obj): path = reverse( 'projects-environmentvariables-detail', kwargs={ 'parent_lookup_project__slug': obj.project.slug, 'environmentvariable_pk': obj.pk, }, ) return self._absolute_url(path) def get_project(self, obj): path = reverse( 'projects-detail', kwargs={ 'project_slug': obj.project.slug, }, ) return self._absolute_url(path) class EnvironmentVariableSerializer(serializers.ModelSerializer): value = serializers.CharField(write_only=True) project = serializers.SlugRelatedField(slug_field='slug', read_only=True) _links = EnvironmentVariableLinksSerializer(source='*', read_only=True) class Meta: model = EnvironmentVariable fields = [ 'pk', 'created', 'modified', 'name', 'value', 'project', '_links', ]
true
true
f71d817086ba45a81765922769a674dd85882342
393
py
Python
modules/post-exploitation/koadic.py
decidedlygray/ptf
f17f50606fac5ef30f42c0b5e0fa57b58f696b99
[ "FTL" ]
4,391
2015-05-12T19:30:45.000Z
2022-03-30T13:39:27.000Z
modules/post-exploitation/koadic.py
decidedlygray/ptf
f17f50606fac5ef30f42c0b5e0fa57b58f696b99
[ "FTL" ]
340
2015-05-14T13:50:44.000Z
2022-01-13T14:40:14.000Z
modules/post-exploitation/koadic.py
decidedlygray/ptf
f17f50606fac5ef30f42c0b5e0fa57b58f696b99
[ "FTL" ]
1,290
2015-05-13T00:24:58.000Z
2022-03-30T08:20:22.000Z
AUTHOR="Jared Haight (@jaredhaight)" DESCRIPTION="This module will install/update Koadic C3 (COM Command and Control Framework)" INSTALL_TYPE="GIT" REPOSITORY_LOCATION="https://github.com/zerosum0x0/koadic" INSTALL_LOCATION="koadic" DEBIAN="python,python-pip" ARCHLINUX = "python,python-pip" BYPASS_UPDATE="NO" AFTER_COMMANDS="cd {INSTALL_LOCATION},pip install -r ./requirements.txt"
20.684211
91
0.78117
AUTHOR="Jared Haight (@jaredhaight)" DESCRIPTION="This module will install/update Koadic C3 (COM Command and Control Framework)" INSTALL_TYPE="GIT" REPOSITORY_LOCATION="https://github.com/zerosum0x0/koadic" INSTALL_LOCATION="koadic" DEBIAN="python,python-pip" ARCHLINUX = "python,python-pip" BYPASS_UPDATE="NO" AFTER_COMMANDS="cd {INSTALL_LOCATION},pip install -r ./requirements.txt"
true
true
f71d8259f8b4b230a161329e0a9ccdf462508567
851
py
Python
ml-agents/tests/yamato/standalone_build_tests.py
carlos-aguayo/ml-agents
8ad72c08d7d9408c4dda4601beec7f8e82f911ed
[ "Apache-2.0" ]
2
2020-12-01T20:46:13.000Z
2021-03-07T16:17:45.000Z
ml-agents/tests/yamato/standalone_build_tests.py
carlos-aguayo/ml-agents
8ad72c08d7d9408c4dda4601beec7f8e82f911ed
[ "Apache-2.0" ]
null
null
null
ml-agents/tests/yamato/standalone_build_tests.py
carlos-aguayo/ml-agents
8ad72c08d7d9408c4dda4601beec7f8e82f911ed
[ "Apache-2.0" ]
null
null
null
import sys import argparse from .yamato_utils import get_base_path, run_standalone_build def main(scene_path): base_path = get_base_path() print(f"Running in base path {base_path}") executable_name = None if scene_path is not None: executable_name = scene_path.strip(".unity") executable_name = executable_name.split("/")[-1] executable_name = "testPlayer-" + executable_name returncode = run_standalone_build( base_path, verbose=True, output_path=executable_name, scene_path=scene_path ) if returncode == 0: print("Test run SUCCEEDED!") else: print("Test run FAILED!") sys.exit(returncode) if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument("--scene", default=None) args = parser.parse_args() main(args.scene)
25.029412
83
0.683901
import sys import argparse from .yamato_utils import get_base_path, run_standalone_build def main(scene_path): base_path = get_base_path() print(f"Running in base path {base_path}") executable_name = None if scene_path is not None: executable_name = scene_path.strip(".unity") executable_name = executable_name.split("/")[-1] executable_name = "testPlayer-" + executable_name returncode = run_standalone_build( base_path, verbose=True, output_path=executable_name, scene_path=scene_path ) if returncode == 0: print("Test run SUCCEEDED!") else: print("Test run FAILED!") sys.exit(returncode) if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument("--scene", default=None) args = parser.parse_args() main(args.scene)
true
true
f71d82961476e1a195d28dbf87387de8e1e5007b
13,636
py
Python
stix2/test/v20/test_properties.py
emmanvg/cti-python-stix2
d4c01157352552e2ec05bcf7b0f79ef96e34022d
[ "BSD-3-Clause" ]
9
2017-07-03T19:01:23.000Z
2020-02-20T19:22:49.000Z
stix2/test/v20/test_properties.py
emmanvg/cti-python-stix2
d4c01157352552e2ec05bcf7b0f79ef96e34022d
[ "BSD-3-Clause" ]
1
2017-05-30T14:13:27.000Z
2017-05-30T14:13:27.000Z
stix2/test/v20/test_properties.py
emmanvg/cti-python-stix2
d4c01157352552e2ec05bcf7b0f79ef96e34022d
[ "BSD-3-Clause" ]
1
2017-05-26T19:17:14.000Z
2017-05-26T19:17:14.000Z
import uuid import pytest import stix2 from stix2.exceptions import ( AtLeastOnePropertyError, CustomContentError, DictionaryKeyError, ) from stix2.properties import ( BinaryProperty, BooleanProperty, DictionaryProperty, EmbeddedObjectProperty, EnumProperty, ExtensionsProperty, FloatProperty, HashesProperty, HexProperty, IDProperty, IntegerProperty, ListProperty, Property, ReferenceProperty, STIXObjectProperty, StringProperty, TimestampProperty, TypeProperty, ) from stix2.v20.common import MarkingProperty from . import constants def test_property(): p = Property() assert p.required is False assert p.clean('foo') == 'foo' assert p.clean(3) == 3 def test_basic_clean(): class Prop(Property): def clean(self, value): if value == 42: return value else: raise ValueError("Must be 42") p = Prop() assert p.clean(42) == 42 with pytest.raises(ValueError): p.clean(41) def test_property_default(): class Prop(Property): def default(self): return 77 p = Prop() assert p.default() == 77 def test_fixed_property(): p = Property(fixed="2.0") assert p.clean("2.0") with pytest.raises(ValueError): assert p.clean("x") is False with pytest.raises(ValueError): assert p.clean(2.0) is False assert p.default() == "2.0" assert p.clean(p.default()) def test_list_property(): p = ListProperty(StringProperty) assert p.clean(['abc', 'xyz']) with pytest.raises(ValueError): p.clean([]) def test_string_property(): prop = StringProperty() assert prop.clean('foobar') assert prop.clean(1) assert prop.clean([1, 2, 3]) def test_type_property(): prop = TypeProperty('my-type') assert prop.clean('my-type') with pytest.raises(ValueError): prop.clean('not-my-type') assert prop.clean(prop.default()) ID_PROP = IDProperty('my-type', spec_version="2.0") MY_ID = 'my-type--232c9d3f-49fc-4440-bb01-607f638778e7' @pytest.mark.parametrize( "value", [ MY_ID, 'my-type--00000000-0000-4000-8000-000000000000', ], ) def test_id_property_valid(value): assert ID_PROP.clean(value) == value CONSTANT_IDS = [ constants.ATTACK_PATTERN_ID, constants.CAMPAIGN_ID, constants.COURSE_OF_ACTION_ID, constants.IDENTITY_ID, constants.INDICATOR_ID, constants.INTRUSION_SET_ID, constants.MALWARE_ID, constants.MARKING_DEFINITION_ID, constants.OBSERVED_DATA_ID, constants.RELATIONSHIP_ID, constants.REPORT_ID, constants.SIGHTING_ID, constants.THREAT_ACTOR_ID, constants.TOOL_ID, constants.VULNERABILITY_ID, ] CONSTANT_IDS.extend(constants.MARKING_IDS) CONSTANT_IDS.extend(constants.RELATIONSHIP_IDS) @pytest.mark.parametrize("value", CONSTANT_IDS) def test_id_property_valid_for_type(value): type = value.split('--', 1)[0] assert IDProperty(type=type, spec_version="2.0").clean(value) == value def test_id_property_wrong_type(): with pytest.raises(ValueError) as excinfo: ID_PROP.clean('not-my-type--232c9d3f-49fc-4440-bb01-607f638778e7') assert str(excinfo.value) == "must start with 'my-type--'." @pytest.mark.parametrize( "value", [ 'my-type--foo', # Not a v4 UUID 'my-type--00000000-0000-0000-0000-000000000000', 'my-type--' + str(uuid.uuid1()), 'my-type--' + str(uuid.uuid3(uuid.NAMESPACE_DNS, "example.org")), 'my-type--' + str(uuid.uuid5(uuid.NAMESPACE_DNS, "example.org")), ], ) def test_id_property_not_a_valid_hex_uuid(value): with pytest.raises(ValueError): ID_PROP.clean(value) def test_id_property_default(): default = ID_PROP.default() assert ID_PROP.clean(default) == default @pytest.mark.parametrize( "value", [ 2, -1, 3.14, False, ], ) def test_integer_property_valid(value): int_prop = IntegerProperty() assert int_prop.clean(value) is not None @pytest.mark.parametrize( "value", [ -1, -100, -5 * 6, ], ) def test_integer_property_invalid_min_with_constraints(value): int_prop = IntegerProperty(min=0, max=180) with pytest.raises(ValueError) as excinfo: int_prop.clean(value) assert "minimum value is" in str(excinfo.value) @pytest.mark.parametrize( "value", [ 181, 200, 50 * 6, ], ) def test_integer_property_invalid_max_with_constraints(value): int_prop = IntegerProperty(min=0, max=180) with pytest.raises(ValueError) as excinfo: int_prop.clean(value) assert "maximum value is" in str(excinfo.value) @pytest.mark.parametrize( "value", [ "something", StringProperty(), ], ) def test_integer_property_invalid(value): int_prop = IntegerProperty() with pytest.raises(ValueError): int_prop.clean(value) @pytest.mark.parametrize( "value", [ 2, -1, 3.14, False, ], ) def test_float_property_valid(value): int_prop = FloatProperty() assert int_prop.clean(value) is not None @pytest.mark.parametrize( "value", [ "something", StringProperty(), ], ) def test_float_property_invalid(value): int_prop = FloatProperty() with pytest.raises(ValueError): int_prop.clean(value) @pytest.mark.parametrize( "value", [ True, False, 'True', 'False', 'true', 'false', 'TRUE', 'FALSE', 'T', 'F', 't', 'f', 1, 0, ], ) def test_boolean_property_valid(value): bool_prop = BooleanProperty() assert bool_prop.clean(value) is not None @pytest.mark.parametrize( "value", [ 'abc', ['false'], {'true': 'true'}, 2, -1, ], ) def test_boolean_property_invalid(value): bool_prop = BooleanProperty() with pytest.raises(ValueError): bool_prop.clean(value) def test_reference_property(): ref_prop = ReferenceProperty(valid_types="my-type", spec_version="2.0") assert ref_prop.clean("my-type--00000000-0000-4000-8000-000000000000") with pytest.raises(ValueError): ref_prop.clean("foo") # This is not a valid V4 UUID with pytest.raises(ValueError): ref_prop.clean("my-type--00000000-0000-0000-0000-000000000000") def test_reference_property_specific_type(): ref_prop = ReferenceProperty(valid_types="my-type", spec_version="2.0") with pytest.raises(ValueError): ref_prop.clean("not-my-type--8a8e8758-f92c-4058-ba38-f061cd42a0cf") assert ref_prop.clean("my-type--8a8e8758-f92c-4058-ba38-f061cd42a0cf") == \ "my-type--8a8e8758-f92c-4058-ba38-f061cd42a0cf" @pytest.mark.parametrize( "value", [ '2017-01-01T12:34:56Z', '2017-01-01 12:34:56', 'Jan 1 2017 12:34:56', ], ) def test_timestamp_property_valid(value): ts_prop = TimestampProperty() assert ts_prop.clean(value) == constants.FAKE_TIME def test_timestamp_property_invalid(): ts_prop = TimestampProperty() with pytest.raises(ValueError): ts_prop.clean(1) with pytest.raises(ValueError): ts_prop.clean("someday sometime") def test_binary_property(): bin_prop = BinaryProperty() assert bin_prop.clean("TG9yZW0gSXBzdW0=") with pytest.raises(ValueError): bin_prop.clean("foobar") def test_hex_property(): hex_prop = HexProperty() assert hex_prop.clean("4c6f72656d20497073756d") with pytest.raises(ValueError): hex_prop.clean("foobar") @pytest.mark.parametrize( "d", [ {'description': 'something'}, [('abc', 1), ('bcd', 2), ('cde', 3)], ], ) def test_dictionary_property_valid(d): dict_prop = DictionaryProperty(spec_version="2.0") assert dict_prop.clean(d) @pytest.mark.parametrize( "d", [ [{'a': 'something'}, "Invalid dictionary key a: (shorter than 3 characters)."], [ {'a'*300: 'something'}, "Invalid dictionary key aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaa: (longer than 256 characters).", ], [ {'Hey!': 'something'}, "Invalid dictionary key Hey!: (contains characters other than lowercase a-z, " "uppercase A-Z, numerals 0-9, hyphen (-), or underscore (_)).", ], ], ) def test_dictionary_property_invalid_key(d): dict_prop = DictionaryProperty(spec_version="2.0") with pytest.raises(DictionaryKeyError) as excinfo: dict_prop.clean(d[0]) assert str(excinfo.value) == d[1] @pytest.mark.parametrize( "d", [ # TODO: This error message could be made more helpful. The error is caused # because `json.loads()` doesn't like the *single* quotes around the key # name, even though they are valid in a Python dictionary. While technically # accurate (a string is not a dictionary), if we want to be able to load # string-encoded "dictionaries" that are, we need a better error message # or an alternative to `json.loads()` ... and preferably *not* `eval()`. :-) # Changing the following to `'{"description": "something"}'` does not cause # any ValueError to be raised. ("{'description': 'something'}", "The dictionary property must contain a dictionary"), ], ) def test_dictionary_property_invalid(d): dict_prop = DictionaryProperty(spec_version="2.0") with pytest.raises(ValueError) as excinfo: dict_prop.clean(d[0]) assert str(excinfo.value) == d[1] def test_property_list_of_dictionary(): @stix2.v20.CustomObject( 'x-new-obj', [ ('property1', ListProperty(DictionaryProperty(spec_version="2.0"), required=True)), ], ) class NewObj(): pass test_obj = NewObj(property1=[{'foo': 'bar'}]) assert test_obj.property1[0]['foo'] == 'bar' @pytest.mark.parametrize( "value", [ {"sha256": "6db12788c37247f2316052e142f42f4b259d6561751e5f401a1ae2a6df9c674b"}, [('MD5', '2dfb1bcc980200c6706feee399d41b3f'), ('RIPEMD-160', 'b3a8cd8a27c90af79b3c81754f267780f443dfef')], ], ) def test_hashes_property_valid(value): hash_prop = HashesProperty() assert hash_prop.clean(value) @pytest.mark.parametrize( "value", [ {"MD5": "a"}, {"SHA-256": "2dfb1bcc980200c6706feee399d41b3f"}, ], ) def test_hashes_property_invalid(value): hash_prop = HashesProperty() with pytest.raises(ValueError): hash_prop.clean(value) def test_embedded_property(): emb_prop = EmbeddedObjectProperty(type=stix2.v20.EmailMIMEComponent) mime = stix2.v20.EmailMIMEComponent( content_type="text/plain; charset=utf-8", content_disposition="inline", body="Cats are funny!", ) assert emb_prop.clean(mime) with pytest.raises(ValueError): emb_prop.clean("string") @pytest.mark.parametrize( "value", [ ['a', 'b', 'c'], ('a', 'b', 'c'), 'b', ], ) def test_enum_property_valid(value): enum_prop = EnumProperty(value) assert enum_prop.clean('b') def test_enum_property_invalid(): enum_prop = EnumProperty(['a', 'b', 'c']) with pytest.raises(ValueError): enum_prop.clean('z') def test_extension_property_valid(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='file') assert ext_prop({ 'windows-pebinary-ext': { 'pe_type': 'exe', }, }) def test_extension_property_invalid1(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='file') with pytest.raises(ValueError): ext_prop.clean(1) def test_extension_property_invalid2(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='file') with pytest.raises(CustomContentError): ext_prop.clean( { 'foobar-ext': { 'pe_type': 'exe', }, }, ) def test_extension_property_invalid_type(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='indicator') with pytest.raises(CustomContentError) as excinfo: ext_prop.clean( { 'windows-pebinary-ext': { 'pe_type': 'exe', }, }, ) assert "Can't parse unknown extension" in str(excinfo.value) def test_extension_at_least_one_property_constraint(): with pytest.raises(AtLeastOnePropertyError): stix2.v20.TCPExt() def test_marking_property_error(): mark_prop = MarkingProperty() with pytest.raises(ValueError) as excinfo: mark_prop.clean('my-marking') assert str(excinfo.value) == "must be a Statement, TLP Marking or a registered marking." def test_stix_property_not_compliant_spec(): # This is a 2.0 test only... indicator = stix2.v20.Indicator(spec_version="2.0", allow_custom=True, **constants.INDICATOR_KWARGS) stix_prop = STIXObjectProperty(spec_version="2.0") with pytest.raises(ValueError) as excinfo: stix_prop.clean(indicator) assert "Spec version 2.0 bundles don't yet support containing objects of a different spec version." in str(excinfo.value)
26.022901
125
0.650704
import uuid import pytest import stix2 from stix2.exceptions import ( AtLeastOnePropertyError, CustomContentError, DictionaryKeyError, ) from stix2.properties import ( BinaryProperty, BooleanProperty, DictionaryProperty, EmbeddedObjectProperty, EnumProperty, ExtensionsProperty, FloatProperty, HashesProperty, HexProperty, IDProperty, IntegerProperty, ListProperty, Property, ReferenceProperty, STIXObjectProperty, StringProperty, TimestampProperty, TypeProperty, ) from stix2.v20.common import MarkingProperty from . import constants def test_property(): p = Property() assert p.required is False assert p.clean('foo') == 'foo' assert p.clean(3) == 3 def test_basic_clean(): class Prop(Property): def clean(self, value): if value == 42: return value else: raise ValueError("Must be 42") p = Prop() assert p.clean(42) == 42 with pytest.raises(ValueError): p.clean(41) def test_property_default(): class Prop(Property): def default(self): return 77 p = Prop() assert p.default() == 77 def test_fixed_property(): p = Property(fixed="2.0") assert p.clean("2.0") with pytest.raises(ValueError): assert p.clean("x") is False with pytest.raises(ValueError): assert p.clean(2.0) is False assert p.default() == "2.0" assert p.clean(p.default()) def test_list_property(): p = ListProperty(StringProperty) assert p.clean(['abc', 'xyz']) with pytest.raises(ValueError): p.clean([]) def test_string_property(): prop = StringProperty() assert prop.clean('foobar') assert prop.clean(1) assert prop.clean([1, 2, 3]) def test_type_property(): prop = TypeProperty('my-type') assert prop.clean('my-type') with pytest.raises(ValueError): prop.clean('not-my-type') assert prop.clean(prop.default()) ID_PROP = IDProperty('my-type', spec_version="2.0") MY_ID = 'my-type--232c9d3f-49fc-4440-bb01-607f638778e7' @pytest.mark.parametrize( "value", [ MY_ID, 'my-type--00000000-0000-4000-8000-000000000000', ], ) def test_id_property_valid(value): assert ID_PROP.clean(value) == value CONSTANT_IDS = [ constants.ATTACK_PATTERN_ID, constants.CAMPAIGN_ID, constants.COURSE_OF_ACTION_ID, constants.IDENTITY_ID, constants.INDICATOR_ID, constants.INTRUSION_SET_ID, constants.MALWARE_ID, constants.MARKING_DEFINITION_ID, constants.OBSERVED_DATA_ID, constants.RELATIONSHIP_ID, constants.REPORT_ID, constants.SIGHTING_ID, constants.THREAT_ACTOR_ID, constants.TOOL_ID, constants.VULNERABILITY_ID, ] CONSTANT_IDS.extend(constants.MARKING_IDS) CONSTANT_IDS.extend(constants.RELATIONSHIP_IDS) @pytest.mark.parametrize("value", CONSTANT_IDS) def test_id_property_valid_for_type(value): type = value.split('--', 1)[0] assert IDProperty(type=type, spec_version="2.0").clean(value) == value def test_id_property_wrong_type(): with pytest.raises(ValueError) as excinfo: ID_PROP.clean('not-my-type--232c9d3f-49fc-4440-bb01-607f638778e7') assert str(excinfo.value) == "must start with 'my-type--'." @pytest.mark.parametrize( "value", [ 'my-type--foo', 'my-type--00000000-0000-0000-0000-000000000000', 'my-type--' + str(uuid.uuid1()), 'my-type--' + str(uuid.uuid3(uuid.NAMESPACE_DNS, "example.org")), 'my-type--' + str(uuid.uuid5(uuid.NAMESPACE_DNS, "example.org")), ], ) def test_id_property_not_a_valid_hex_uuid(value): with pytest.raises(ValueError): ID_PROP.clean(value) def test_id_property_default(): default = ID_PROP.default() assert ID_PROP.clean(default) == default @pytest.mark.parametrize( "value", [ 2, -1, 3.14, False, ], ) def test_integer_property_valid(value): int_prop = IntegerProperty() assert int_prop.clean(value) is not None @pytest.mark.parametrize( "value", [ -1, -100, -5 * 6, ], ) def test_integer_property_invalid_min_with_constraints(value): int_prop = IntegerProperty(min=0, max=180) with pytest.raises(ValueError) as excinfo: int_prop.clean(value) assert "minimum value is" in str(excinfo.value) @pytest.mark.parametrize( "value", [ 181, 200, 50 * 6, ], ) def test_integer_property_invalid_max_with_constraints(value): int_prop = IntegerProperty(min=0, max=180) with pytest.raises(ValueError) as excinfo: int_prop.clean(value) assert "maximum value is" in str(excinfo.value) @pytest.mark.parametrize( "value", [ "something", StringProperty(), ], ) def test_integer_property_invalid(value): int_prop = IntegerProperty() with pytest.raises(ValueError): int_prop.clean(value) @pytest.mark.parametrize( "value", [ 2, -1, 3.14, False, ], ) def test_float_property_valid(value): int_prop = FloatProperty() assert int_prop.clean(value) is not None @pytest.mark.parametrize( "value", [ "something", StringProperty(), ], ) def test_float_property_invalid(value): int_prop = FloatProperty() with pytest.raises(ValueError): int_prop.clean(value) @pytest.mark.parametrize( "value", [ True, False, 'True', 'False', 'true', 'false', 'TRUE', 'FALSE', 'T', 'F', 't', 'f', 1, 0, ], ) def test_boolean_property_valid(value): bool_prop = BooleanProperty() assert bool_prop.clean(value) is not None @pytest.mark.parametrize( "value", [ 'abc', ['false'], {'true': 'true'}, 2, -1, ], ) def test_boolean_property_invalid(value): bool_prop = BooleanProperty() with pytest.raises(ValueError): bool_prop.clean(value) def test_reference_property(): ref_prop = ReferenceProperty(valid_types="my-type", spec_version="2.0") assert ref_prop.clean("my-type--00000000-0000-4000-8000-000000000000") with pytest.raises(ValueError): ref_prop.clean("foo") with pytest.raises(ValueError): ref_prop.clean("my-type--00000000-0000-0000-0000-000000000000") def test_reference_property_specific_type(): ref_prop = ReferenceProperty(valid_types="my-type", spec_version="2.0") with pytest.raises(ValueError): ref_prop.clean("not-my-type--8a8e8758-f92c-4058-ba38-f061cd42a0cf") assert ref_prop.clean("my-type--8a8e8758-f92c-4058-ba38-f061cd42a0cf") == \ "my-type--8a8e8758-f92c-4058-ba38-f061cd42a0cf" @pytest.mark.parametrize( "value", [ '2017-01-01T12:34:56Z', '2017-01-01 12:34:56', 'Jan 1 2017 12:34:56', ], ) def test_timestamp_property_valid(value): ts_prop = TimestampProperty() assert ts_prop.clean(value) == constants.FAKE_TIME def test_timestamp_property_invalid(): ts_prop = TimestampProperty() with pytest.raises(ValueError): ts_prop.clean(1) with pytest.raises(ValueError): ts_prop.clean("someday sometime") def test_binary_property(): bin_prop = BinaryProperty() assert bin_prop.clean("TG9yZW0gSXBzdW0=") with pytest.raises(ValueError): bin_prop.clean("foobar") def test_hex_property(): hex_prop = HexProperty() assert hex_prop.clean("4c6f72656d20497073756d") with pytest.raises(ValueError): hex_prop.clean("foobar") @pytest.mark.parametrize( "d", [ {'description': 'something'}, [('abc', 1), ('bcd', 2), ('cde', 3)], ], ) def test_dictionary_property_valid(d): dict_prop = DictionaryProperty(spec_version="2.0") assert dict_prop.clean(d) @pytest.mark.parametrize( "d", [ [{'a': 'something'}, "Invalid dictionary key a: (shorter than 3 characters)."], [ {'a'*300: 'something'}, "Invalid dictionary key aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" "aaaaaaaaaaaaaaaaaaaaaaa: (longer than 256 characters).", ], [ {'Hey!': 'something'}, "Invalid dictionary key Hey!: (contains characters other than lowercase a-z, " "uppercase A-Z, numerals 0-9, hyphen (-), or underscore (_)).", ], ], ) def test_dictionary_property_invalid_key(d): dict_prop = DictionaryProperty(spec_version="2.0") with pytest.raises(DictionaryKeyError) as excinfo: dict_prop.clean(d[0]) assert str(excinfo.value) == d[1] @pytest.mark.parametrize( "d", [ # name, even though they are valid in a Python dictionary. While technically # accurate (a string is not a dictionary), if we want to be able to load # string-encoded "dictionaries" that are, we need a better error message # or an alternative to `json.loads()` ... and preferably *not* `eval()`. :-) # Changing the following to `'{"description": "something"}'` does not cause # any ValueError to be raised. ("{'description': 'something'}", "The dictionary property must contain a dictionary"), ], ) def test_dictionary_property_invalid(d): dict_prop = DictionaryProperty(spec_version="2.0") with pytest.raises(ValueError) as excinfo: dict_prop.clean(d[0]) assert str(excinfo.value) == d[1] def test_property_list_of_dictionary(): @stix2.v20.CustomObject( 'x-new-obj', [ ('property1', ListProperty(DictionaryProperty(spec_version="2.0"), required=True)), ], ) class NewObj(): pass test_obj = NewObj(property1=[{'foo': 'bar'}]) assert test_obj.property1[0]['foo'] == 'bar' @pytest.mark.parametrize( "value", [ {"sha256": "6db12788c37247f2316052e142f42f4b259d6561751e5f401a1ae2a6df9c674b"}, [('MD5', '2dfb1bcc980200c6706feee399d41b3f'), ('RIPEMD-160', 'b3a8cd8a27c90af79b3c81754f267780f443dfef')], ], ) def test_hashes_property_valid(value): hash_prop = HashesProperty() assert hash_prop.clean(value) @pytest.mark.parametrize( "value", [ {"MD5": "a"}, {"SHA-256": "2dfb1bcc980200c6706feee399d41b3f"}, ], ) def test_hashes_property_invalid(value): hash_prop = HashesProperty() with pytest.raises(ValueError): hash_prop.clean(value) def test_embedded_property(): emb_prop = EmbeddedObjectProperty(type=stix2.v20.EmailMIMEComponent) mime = stix2.v20.EmailMIMEComponent( content_type="text/plain; charset=utf-8", content_disposition="inline", body="Cats are funny!", ) assert emb_prop.clean(mime) with pytest.raises(ValueError): emb_prop.clean("string") @pytest.mark.parametrize( "value", [ ['a', 'b', 'c'], ('a', 'b', 'c'), 'b', ], ) def test_enum_property_valid(value): enum_prop = EnumProperty(value) assert enum_prop.clean('b') def test_enum_property_invalid(): enum_prop = EnumProperty(['a', 'b', 'c']) with pytest.raises(ValueError): enum_prop.clean('z') def test_extension_property_valid(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='file') assert ext_prop({ 'windows-pebinary-ext': { 'pe_type': 'exe', }, }) def test_extension_property_invalid1(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='file') with pytest.raises(ValueError): ext_prop.clean(1) def test_extension_property_invalid2(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='file') with pytest.raises(CustomContentError): ext_prop.clean( { 'foobar-ext': { 'pe_type': 'exe', }, }, ) def test_extension_property_invalid_type(): ext_prop = ExtensionsProperty(spec_version="2.0", enclosing_type='indicator') with pytest.raises(CustomContentError) as excinfo: ext_prop.clean( { 'windows-pebinary-ext': { 'pe_type': 'exe', }, }, ) assert "Can't parse unknown extension" in str(excinfo.value) def test_extension_at_least_one_property_constraint(): with pytest.raises(AtLeastOnePropertyError): stix2.v20.TCPExt() def test_marking_property_error(): mark_prop = MarkingProperty() with pytest.raises(ValueError) as excinfo: mark_prop.clean('my-marking') assert str(excinfo.value) == "must be a Statement, TLP Marking or a registered marking." def test_stix_property_not_compliant_spec(): indicator = stix2.v20.Indicator(spec_version="2.0", allow_custom=True, **constants.INDICATOR_KWARGS) stix_prop = STIXObjectProperty(spec_version="2.0") with pytest.raises(ValueError) as excinfo: stix_prop.clean(indicator) assert "Spec version 2.0 bundles don't yet support containing objects of a different spec version." in str(excinfo.value)
true
true
f71d846b2e00c72a66c869bc58ec2cd34e47a382
1,024
py
Python
main.py
yuntan/crypkograph
7715e195a1503f15d2e024dff5daf07c85cb63b1
[ "MIT" ]
26
2018-06-03T16:48:37.000Z
2021-12-28T08:20:07.000Z
main.py
yuntan/crypkograph
7715e195a1503f15d2e024dff5daf07c85cb63b1
[ "MIT" ]
1
2018-06-06T17:41:10.000Z
2018-06-06T17:41:10.000Z
main.py
yuntan/crypkograph
7715e195a1503f15d2e024dff5daf07c85cb63b1
[ "MIT" ]
7
2018-06-06T15:15:03.000Z
2021-12-28T08:20:06.000Z
from os import mkdir from bottle import route, get, request, static_file, run from settings import PORT, DIR_CACHE, DIR_GRAPH from crypkograph import render_graph @route('/') @route('/index.html') def serve_html(): return static_file('index.html', '.') @route('/static/<filename:path>') def serve_static(filename): return static_file(filename, 'static') @route('/generated/<filename:re:.*\.gv\.(png|pdf)>') def serve_generated(filename): ext = filename.split('.')[-1] if ext == 'png': return static_file(filename, DIR_GRAPH, mimetype='image/png') elif ext == 'pdf': return static_file(filename, DIR_GRAPH, download=filename) # /api/render?owner_addr={owner_addr} @get('/api/render') def render(): owner_addr = request.query['owner_addr'] if not owner_addr: raise Exception() render_graph(owner_addr, subdir=DIR_GRAPH) if __name__ == '__main__': try: mkdir(DIR_CACHE) except FileExistsError: pass run(host='0.0.0.0', port=PORT)
22.755556
69
0.673828
from os import mkdir from bottle import route, get, request, static_file, run from settings import PORT, DIR_CACHE, DIR_GRAPH from crypkograph import render_graph @route('/') @route('/index.html') def serve_html(): return static_file('index.html', '.') @route('/static/<filename:path>') def serve_static(filename): return static_file(filename, 'static') @route('/generated/<filename:re:.*\.gv\.(png|pdf)>') def serve_generated(filename): ext = filename.split('.')[-1] if ext == 'png': return static_file(filename, DIR_GRAPH, mimetype='image/png') elif ext == 'pdf': return static_file(filename, DIR_GRAPH, download=filename) @get('/api/render') def render(): owner_addr = request.query['owner_addr'] if not owner_addr: raise Exception() render_graph(owner_addr, subdir=DIR_GRAPH) if __name__ == '__main__': try: mkdir(DIR_CACHE) except FileExistsError: pass run(host='0.0.0.0', port=PORT)
true
true
f71d84bd199bff2d65b7447164541e907a3f533b
3,063
py
Python
weasyl/blocktag.py
Weasyl/weasyl
80c86942c6f20a815086e2895fdad51d3aa77eed
[ "Apache-2.0" ]
111
2016-05-18T04:18:18.000Z
2021-11-03T02:05:19.000Z
weasyl/blocktag.py
Weasyl/weasyl
80c86942c6f20a815086e2895fdad51d3aa77eed
[ "Apache-2.0" ]
1,103
2016-05-29T05:17:53.000Z
2022-03-31T18:12:40.000Z
weasyl/blocktag.py
Weasyl/weasyl
80c86942c6f20a815086e2895fdad51d3aa77eed
[ "Apache-2.0" ]
47
2016-05-29T20:48:37.000Z
2021-11-12T09:40:40.000Z
from libweasyl import ratings from libweasyl.cache import region from weasyl import define as d from weasyl import profile from weasyl import searchtag # For blocked tags, `rating` refers to the lowest rating for which that tag is # blocked; for example, (X, Y, 10) would block tag Y for all ratings, whereas # (X, Y, 30) would block tag Y for only adult ratings. def check(userid, submitid=None, charid=None, journalid=None): """ Returns True if the submission, character, or journal contains a search tag that the user has blocked, else False. """ if not userid: return False if submitid: map_table = "searchmapsubmit" content_table = "submission" id_field = "submitid" target = submitid elif charid: map_table = "searchmapchar" content_table = "character" id_field = "charid" target = charid else: map_table = "searchmapjournal" content_table = "journal" id_field = "journalid" target = journalid query = """ SELECT EXISTS ( SELECT 0 FROM {map_table} searchmap INNER JOIN {content_table} content ON searchmap.targetid = content.{id_field} WHERE searchmap.targetid = %(id)s AND content.userid != %(user)s AND searchmap.tagid IN ( SELECT blocktag.tagid FROM blocktag WHERE userid = %(user)s AND blocktag.rating <= content.rating)) AS block """.format(map_table=map_table, content_table=content_table, id_field=id_field) return d.engine.execute(query, id=target, user=userid).first().block def check_list(rating, tags, blocked_tags): return any(rating >= b['rating'] and b['tagid'] in tags for b in blocked_tags) def select(userid): return [{ "title": i[0], "rating": i[1], } for i in d.execute("SELECT st.title, bt.rating FROM searchtag st " " INNER JOIN blocktag bt ON st.tagid = bt.tagid" " WHERE bt.userid = %i" " ORDER BY st.title", [userid])] @region.cache_on_arguments() @d.record_timing def select_ids(userid): return [ dict(row) for row in d.engine.execute( 'SELECT tagid, rating FROM blocktag WHERE userid = %(user)s', user=userid) ] def insert(userid, title, rating): if rating not in ratings.CODE_MAP: rating = ratings.GENERAL.code profile.check_user_rating_allowed(userid, rating) d.engine.execute( 'INSERT INTO blocktag (userid, tagid, rating) VALUES (%(user)s, %(tag)s, %(rating)s) ON CONFLICT DO NOTHING', user=userid, tag=searchtag.get_or_create(title), rating=rating) select_ids.invalidate(userid) def remove(userid, title): d.engine.execute( "DELETE FROM blocktag WHERE (userid, tagid) = (%(user)s, (SELECT tagid FROM searchtag WHERE title = %(tag)s))", user=userid, tag=d.get_search_tag(title), ) select_ids.invalidate(userid)
31.57732
119
0.627163
from libweasyl import ratings from libweasyl.cache import region from weasyl import define as d from weasyl import profile from weasyl import searchtag def check(userid, submitid=None, charid=None, journalid=None): if not userid: return False if submitid: map_table = "searchmapsubmit" content_table = "submission" id_field = "submitid" target = submitid elif charid: map_table = "searchmapchar" content_table = "character" id_field = "charid" target = charid else: map_table = "searchmapjournal" content_table = "journal" id_field = "journalid" target = journalid query = """ SELECT EXISTS ( SELECT 0 FROM {map_table} searchmap INNER JOIN {content_table} content ON searchmap.targetid = content.{id_field} WHERE searchmap.targetid = %(id)s AND content.userid != %(user)s AND searchmap.tagid IN ( SELECT blocktag.tagid FROM blocktag WHERE userid = %(user)s AND blocktag.rating <= content.rating)) AS block """.format(map_table=map_table, content_table=content_table, id_field=id_field) return d.engine.execute(query, id=target, user=userid).first().block def check_list(rating, tags, blocked_tags): return any(rating >= b['rating'] and b['tagid'] in tags for b in blocked_tags) def select(userid): return [{ "title": i[0], "rating": i[1], } for i in d.execute("SELECT st.title, bt.rating FROM searchtag st " " INNER JOIN blocktag bt ON st.tagid = bt.tagid" " WHERE bt.userid = %i" " ORDER BY st.title", [userid])] @region.cache_on_arguments() @d.record_timing def select_ids(userid): return [ dict(row) for row in d.engine.execute( 'SELECT tagid, rating FROM blocktag WHERE userid = %(user)s', user=userid) ] def insert(userid, title, rating): if rating not in ratings.CODE_MAP: rating = ratings.GENERAL.code profile.check_user_rating_allowed(userid, rating) d.engine.execute( 'INSERT INTO blocktag (userid, tagid, rating) VALUES (%(user)s, %(tag)s, %(rating)s) ON CONFLICT DO NOTHING', user=userid, tag=searchtag.get_or_create(title), rating=rating) select_ids.invalidate(userid) def remove(userid, title): d.engine.execute( "DELETE FROM blocktag WHERE (userid, tagid) = (%(user)s, (SELECT tagid FROM searchtag WHERE title = %(tag)s))", user=userid, tag=d.get_search_tag(title), ) select_ids.invalidate(userid)
true
true
f71d8544221be449972f7b45e2325ab14304a5db
293
py
Python
CodeChef/PRACTICE/Factorial - FCTRL.py
IshanManchanda/competitive-python
e9ee5fc48eaea0497ec13e8af5f89da6ac050526
[ "MIT" ]
6
2019-06-06T15:16:05.000Z
2020-07-30T01:56:53.000Z
CodeChef/PRACTICE/Factorial - FCTRL.py
IshanManchanda/competitive-python
e9ee5fc48eaea0497ec13e8af5f89da6ac050526
[ "MIT" ]
null
null
null
CodeChef/PRACTICE/Factorial - FCTRL.py
IshanManchanda/competitive-python
e9ee5fc48eaea0497ec13e8af5f89da6ac050526
[ "MIT" ]
1
2020-03-22T21:41:53.000Z
2020-03-22T21:41:53.000Z
def main(): from sys import stdin, stdout rl = stdin.readline pl = stdout.write int1 = int str1 = str xr = range sum1 = sum arr = [5] for k in xr(1, 13): arr[k] = arr[k - 1] * 5 for _ in xr(int1(rl())): n = int1(rl()) c = sum1(n / i for i in arr) pl(str1(c) + "\n") main()
15.421053
30
0.549488
def main(): from sys import stdin, stdout rl = stdin.readline pl = stdout.write int1 = int str1 = str xr = range sum1 = sum arr = [5] for k in xr(1, 13): arr[k] = arr[k - 1] * 5 for _ in xr(int1(rl())): n = int1(rl()) c = sum1(n / i for i in arr) pl(str1(c) + "\n") main()
true
true
f71d86f566cba857829800b557598795af8fd8ab
1,145
py
Python
irc_hooky/base_object.py
byorgey/irc-hooky
e78942b7e13ce273c40815863d0384dddfa52243
[ "MIT" ]
19
2016-01-26T18:36:38.000Z
2022-03-12T02:32:01.000Z
irc_hooky/base_object.py
byorgey/irc-hooky
e78942b7e13ce273c40815863d0384dddfa52243
[ "MIT" ]
3
2016-01-29T19:43:25.000Z
2019-03-11T20:21:11.000Z
irc_hooky/base_object.py
byorgey/irc-hooky
e78942b7e13ce273c40815863d0384dddfa52243
[ "MIT" ]
2
2016-03-01T09:23:07.000Z
2020-04-01T21:53:51.000Z
from abc import ABCMeta import logging import json class BaseObject(object): __metaclass__ = ABCMeta def __init__(self, **kwargs): self.log = logging.getLogger("irchooky") for prop in self.properties: setattr(self, prop, kwargs.get(prop, "")) def load(self, object_dict): if not object_dict: return for prop in self.properties: default = getattr(self, prop) setattr(self, prop, object_dict.get(prop, default)) def __str__(self): return_dict = {} for prop in self.properties: return_dict.update({prop: str(getattr(self, prop))}) return json.dumps(return_dict) def __eq__(self, other): for prop in self.properties: if not getattr(self, prop) == getattr(other, prop): self.log.debug("Property %s is different" % prop) self.log.debug("%s != %s" % (getattr(self, prop), getattr(other, prop))) return False return True def __ne__(self, other): return not self.__eq__(other)
29.358974
67
0.567686
from abc import ABCMeta import logging import json class BaseObject(object): __metaclass__ = ABCMeta def __init__(self, **kwargs): self.log = logging.getLogger("irchooky") for prop in self.properties: setattr(self, prop, kwargs.get(prop, "")) def load(self, object_dict): if not object_dict: return for prop in self.properties: default = getattr(self, prop) setattr(self, prop, object_dict.get(prop, default)) def __str__(self): return_dict = {} for prop in self.properties: return_dict.update({prop: str(getattr(self, prop))}) return json.dumps(return_dict) def __eq__(self, other): for prop in self.properties: if not getattr(self, prop) == getattr(other, prop): self.log.debug("Property %s is different" % prop) self.log.debug("%s != %s" % (getattr(self, prop), getattr(other, prop))) return False return True def __ne__(self, other): return not self.__eq__(other)
true
true
f71d870777dd8e99b39f2797adf52d842534def1
13,524
py
Python
pyts/transformation/boss.py
NicolasHug/pyts
29659fb09f568df2e7f8190f2d5a1c383dc7e9fa
[ "BSD-3-Clause" ]
1
2019-10-19T12:03:20.000Z
2019-10-19T12:03:20.000Z
pyts/transformation/boss.py
arita37/pyts
29659fb09f568df2e7f8190f2d5a1c383dc7e9fa
[ "BSD-3-Clause" ]
null
null
null
pyts/transformation/boss.py
arita37/pyts
29659fb09f568df2e7f8190f2d5a1c383dc7e9fa
[ "BSD-3-Clause" ]
1
2020-01-09T11:34:35.000Z
2020-01-09T11:34:35.000Z
"""Code for Bag-of-SFA Symbols.""" # Author: Johann Faouzi <johann.faouzi@gmail.com> # License: BSD-3-Clause import numpy as np from math import ceil from scipy.sparse import csr_matrix from sklearn.base import BaseEstimator, TransformerMixin from sklearn.feature_extraction.text import CountVectorizer from sklearn.utils.validation import check_array, check_is_fitted from sklearn.utils.multiclass import check_classification_targets from ..approximation import SymbolicFourierApproximation from ..utils import windowed_view class BOSS(BaseEstimator, TransformerMixin): """Bag of Symbolic Fourier Approximation Symbols. For each time series, subseries are extracted using a slidind window. Then the subseries are transformed into a word using the Symbolic Fourier Approximation (SFA) algorithm. For each time series, the words are grouped together and a histogram counting the occurences of each word is created. Parameters ---------- word_size : int (default = 4) Size of each word. n_bins : int (default = 4) The number of bins to produce. It must be between 2 and 26. strategy : str (default = 'quantile') Strategy used to define the widths of the bins: - 'uniform': All bins in each sample have identical widths - 'quantile': All bins in each sample have the same number of points - 'normal': Bin edges are quantiles from a standard normal distribution - 'entropy': Bin edges are computed using information gain window_size : int or float (default = 10) Size of the sliding window. If float, it represents the percentage of the size of each time series and must be between 0 and 1. The window size will be computed as ``ceil(window_size * n_timestamps)``. window_step : int or float (default = 1) Step of the sliding window. If float, it represents the percentage of the size of each time series and must be between 0 and 1. The window size will be computed as ``ceil(window_step * n_timestamps)``. anova : bool (default = False) If True, the Fourier coefficient selection is done via a one-way ANOVA test. If False, the first Fourier coefficients are selected. drop_sum : bool (default = False) If True, the first Fourier coefficient (i.e. the sum of the subseries) is dropped. Otherwise, it is kept. norm_mean : bool (default = False) If True, center each subseries before scaling. norm_std : bool (default = False) If True, scale each subseries to unit variance. numerosity_reduction : bool (default = True) If True, delete sample-wise all but one occurence of back to back identical occurences of the same words. sparse : bool (default = True) Return a sparse matrix if True, else return an array. alphabet : None, 'ordinal' or array-like, shape = (n_bins,) Alphabet to use. If None, the first `n_bins` letters of the Latin alphabet are used. Attributes ---------- vocabulary_ : dict A mapping of feature indices to terms. References ---------- .. [1] P. Schäfer, "The BOSS is concerned with time series classification in the presence of noise". Data Mining and Knowledge Discovery, 29(6), 1505-1530 (2015). Examples -------- >>> from pyts.datasets import load_gunpoint >>> from pyts.transformation import BOSS >>> X_train, X_test, _, _ = load_gunpoint(return_X_y=True) >>> boss = BOSS(word_size=2, n_bins=2, sparse=False) >>> boss.fit(X_train) # doctest: +ELLIPSIS BOSS(...) >>> sorted(boss.vocabulary_.values()) ['aa', 'ab', 'ba', 'bb'] >>> boss.transform(X_test) # doctest: +ELLIPSIS array(...) """ def __init__(self, word_size=4, n_bins=4, strategy='quantile', window_size=10, window_step=1, anova=False, drop_sum=False, norm_mean=False, norm_std=False, numerosity_reduction=True, sparse=True, alphabet=None): self.word_size = word_size self.n_bins = n_bins self.strategy = strategy self.window_size = window_size self.window_step = window_step self.anova = anova self.drop_sum = drop_sum self.norm_mean = norm_mean self.norm_std = norm_std self.numerosity_reduction = numerosity_reduction self.sparse = sparse self.alphabet = alphabet def fit(self, X, y=None): """Fit the model according to the given training data. Parameters ---------- X : array-like, shape = (n_samples, n_timestamps) Training vector. y : None or array-like, shape = (n_samples,) Class labels for each data sample. Returns ------- self : object """ X = check_array(X) n_samples, n_timestamps = X.shape if y is not None: check_classification_targets(y) window_size, window_step = self._check_params(n_timestamps) n_windows = (n_timestamps - window_size + window_step) // window_step X_windowed = windowed_view( X, window_size=window_size, window_step=window_step ) X_windowed = X_windowed.reshape(n_samples * n_windows, window_size) sfa = SymbolicFourierApproximation( n_coefs=self.word_size, drop_sum=self.drop_sum, anova=self.anova, norm_mean=self.norm_mean, norm_std=self.norm_std, n_bins=self.n_bins, strategy=self.strategy, alphabet=self.alphabet ) if y is None: y_repeated = None else: y_repeated = np.repeat(y, n_windows) X_sfa = sfa.fit_transform(X_windowed, y_repeated) X_word = np.asarray([''.join(X_sfa[i]) for i in range(n_samples * n_windows)]) X_word = X_word.reshape(n_samples, n_windows) if self.numerosity_reduction: not_equal = np.c_[X_word[:, 1:] != X_word[:, :-1], np.full(n_samples, True)] X_bow = np.asarray([' '.join(X_word[i, not_equal[i]]) for i in range(n_samples)]) else: X_bow = np.asarray([' '.join(X_word[i]) for i in range(n_samples)]) vectorizer = CountVectorizer() vectorizer.fit(X_bow) self.vocabulary_ = {value: key for key, value in vectorizer.vocabulary_.items()} self._window_size = window_size self._window_step = window_step self._n_windows = n_windows self._sfa = sfa self._vectorizer = vectorizer return self def transform(self, X): """Transform the provided data. Parameters ---------- X : array-like, shape = (n_samples, n_timestamps) Test samples. Returns ------- X_new : sparse matrix, shape = (n_samples, n_words) Document-term matrix. """ check_is_fitted(self, ['_sfa', '_vectorizer', 'vocabulary_']) X = check_array(X) n_samples, n_timestamps = X.shape X_windowed = windowed_view( X, window_size=self._window_size, window_step=self._window_step ) X_windowed = X_windowed.reshape(-1, self._window_size) X_sfa = self._sfa.transform(X_windowed) X_word = np.asarray([''.join(X_sfa[i]) for i in range(X_sfa.shape[0])]) X_word = X_word.reshape(n_samples, self._n_windows) if self.numerosity_reduction: not_equal = np.c_[X_word[:, 1:] != X_word[:, :-1], np.full(n_samples, True)] X_bow = np.asarray([' '.join(X_word[i, not_equal[i]]) for i in range(n_samples)]) else: X_bow = np.asarray([' '.join(X_word[i]) for i in range(n_samples)]) X_boss = self._vectorizer.transform(X_bow) if not self.sparse: return X_boss.A return csr_matrix(X_boss) def fit_transform(self, X, y=None): """Fit the data then transform it. Parameters ---------- X : array-like, shape = (n_samples, n_timestamps) Training vector. y : None or array-like, shape = (n_samples,) Class labels for each data sample. Returns ------- X_new : sparse matrix, shape = (n_samples, n_words) Document-term matrix. """ X = check_array(X) n_samples, n_timestamps = X.shape if y is not None: check_classification_targets(y) window_size, window_step = self._check_params(n_timestamps) n_windows = (n_timestamps - window_size + window_step) // window_step X_windowed = windowed_view( X, window_size=window_size, window_step=window_step ) X_windowed = X_windowed.reshape(n_samples * n_windows, window_size) sfa = SymbolicFourierApproximation( n_coefs=self.word_size, drop_sum=self.drop_sum, anova=self.anova, norm_mean=self.norm_mean, norm_std=self.norm_std, n_bins=self.n_bins, strategy=self.strategy, alphabet=self.alphabet ) if y is None: y_repeated = None else: y_repeated = np.repeat(y, n_windows) X_sfa = sfa.fit_transform(X_windowed, y_repeated) X_word = np.asarray([''.join(X_sfa[i]) for i in range(n_samples * n_windows)]) X_word = X_word.reshape(n_samples, n_windows) if self.numerosity_reduction: not_equal = np.c_[X_word[:, 1:] != X_word[:, :-1], np.full(n_samples, True)] X_bow = np.asarray([' '.join(X_word[i, not_equal[i]]) for i in range(n_samples)]) else: X_bow = np.asarray([' '.join(X_word[i]) for i in range(n_samples)]) vectorizer = CountVectorizer() X_boss = vectorizer.fit_transform(X_bow) self.vocabulary_ = {value: key for key, value in vectorizer.vocabulary_.items()} self._window_size = window_size self._window_step = window_step self._n_windows = n_windows self._sfa = sfa self._vectorizer = vectorizer if not self.sparse: return X_boss.A return csr_matrix(X_boss) def _check_params(self, n_timestamps): if not isinstance(self.word_size, (int, np.integer)): raise TypeError("'word_size' must be an integer.") if not self.word_size >= 1: raise ValueError("'word_size' must be a positive integer.") if not isinstance(self.window_size, (int, np.integer, float, np.floating)): raise TypeError("'window_size' must be an integer or a float.") if isinstance(self.window_size, (int, np.integer)): if self.drop_sum: if not 1 <= self.window_size <= (n_timestamps - 1): raise ValueError( "If 'window_size' is an integer, it must be greater " "than or equal to 1 and lower than or equal to " "(n_timestamps - 1) if 'drop_sum=True'." ) else: if not 1 <= self.window_size <= n_timestamps: raise ValueError( "If 'window_size' is an integer, it must be greater " "than or equal to 1 and lower than or equal to " "n_timestamps if 'drop_sum=False'." ) window_size = self.window_size else: if not 0 < self.window_size <= 1: raise ValueError( "If 'window_size' is a float, it must be greater " "than 0 and lower than or equal to 1." ) window_size = ceil(self.window_size * n_timestamps) if not isinstance(self.window_step, (int, np.integer, float, np.floating)): raise TypeError("'window_step' must be an integer or a float.") if isinstance(self.window_step, (int, np.integer)): if not 1 <= self.window_step <= n_timestamps: raise ValueError( "If 'window_step' is an integer, it must be greater " "than or equal to 1 and lower than or equal to " "n_timestamps." ) window_step = self.window_step else: if not 0 < self.window_step <= 1: raise ValueError( "If 'window_step' is a float, it must be greater " "than 0 and lower than or equal to 1." ) window_step = ceil(self.window_step * n_timestamps) if self.drop_sum: if not self.word_size <= (window_size - 1): raise ValueError( "'word_size' must be lower than or equal to " "(window_size - 1) if 'drop_sum=True'." ) else: if not self.word_size <= window_size: raise ValueError( "'word_size' must be lower than or equal to " "window_size if 'drop_sum=False'." ) return window_size, window_step
38.311615
79
0.586957
import numpy as np from math import ceil from scipy.sparse import csr_matrix from sklearn.base import BaseEstimator, TransformerMixin from sklearn.feature_extraction.text import CountVectorizer from sklearn.utils.validation import check_array, check_is_fitted from sklearn.utils.multiclass import check_classification_targets from ..approximation import SymbolicFourierApproximation from ..utils import windowed_view class BOSS(BaseEstimator, TransformerMixin): def __init__(self, word_size=4, n_bins=4, strategy='quantile', window_size=10, window_step=1, anova=False, drop_sum=False, norm_mean=False, norm_std=False, numerosity_reduction=True, sparse=True, alphabet=None): self.word_size = word_size self.n_bins = n_bins self.strategy = strategy self.window_size = window_size self.window_step = window_step self.anova = anova self.drop_sum = drop_sum self.norm_mean = norm_mean self.norm_std = norm_std self.numerosity_reduction = numerosity_reduction self.sparse = sparse self.alphabet = alphabet def fit(self, X, y=None): X = check_array(X) n_samples, n_timestamps = X.shape if y is not None: check_classification_targets(y) window_size, window_step = self._check_params(n_timestamps) n_windows = (n_timestamps - window_size + window_step) // window_step X_windowed = windowed_view( X, window_size=window_size, window_step=window_step ) X_windowed = X_windowed.reshape(n_samples * n_windows, window_size) sfa = SymbolicFourierApproximation( n_coefs=self.word_size, drop_sum=self.drop_sum, anova=self.anova, norm_mean=self.norm_mean, norm_std=self.norm_std, n_bins=self.n_bins, strategy=self.strategy, alphabet=self.alphabet ) if y is None: y_repeated = None else: y_repeated = np.repeat(y, n_windows) X_sfa = sfa.fit_transform(X_windowed, y_repeated) X_word = np.asarray([''.join(X_sfa[i]) for i in range(n_samples * n_windows)]) X_word = X_word.reshape(n_samples, n_windows) if self.numerosity_reduction: not_equal = np.c_[X_word[:, 1:] != X_word[:, :-1], np.full(n_samples, True)] X_bow = np.asarray([' '.join(X_word[i, not_equal[i]]) for i in range(n_samples)]) else: X_bow = np.asarray([' '.join(X_word[i]) for i in range(n_samples)]) vectorizer = CountVectorizer() vectorizer.fit(X_bow) self.vocabulary_ = {value: key for key, value in vectorizer.vocabulary_.items()} self._window_size = window_size self._window_step = window_step self._n_windows = n_windows self._sfa = sfa self._vectorizer = vectorizer return self def transform(self, X): check_is_fitted(self, ['_sfa', '_vectorizer', 'vocabulary_']) X = check_array(X) n_samples, n_timestamps = X.shape X_windowed = windowed_view( X, window_size=self._window_size, window_step=self._window_step ) X_windowed = X_windowed.reshape(-1, self._window_size) X_sfa = self._sfa.transform(X_windowed) X_word = np.asarray([''.join(X_sfa[i]) for i in range(X_sfa.shape[0])]) X_word = X_word.reshape(n_samples, self._n_windows) if self.numerosity_reduction: not_equal = np.c_[X_word[:, 1:] != X_word[:, :-1], np.full(n_samples, True)] X_bow = np.asarray([' '.join(X_word[i, not_equal[i]]) for i in range(n_samples)]) else: X_bow = np.asarray([' '.join(X_word[i]) for i in range(n_samples)]) X_boss = self._vectorizer.transform(X_bow) if not self.sparse: return X_boss.A return csr_matrix(X_boss) def fit_transform(self, X, y=None): X = check_array(X) n_samples, n_timestamps = X.shape if y is not None: check_classification_targets(y) window_size, window_step = self._check_params(n_timestamps) n_windows = (n_timestamps - window_size + window_step) // window_step X_windowed = windowed_view( X, window_size=window_size, window_step=window_step ) X_windowed = X_windowed.reshape(n_samples * n_windows, window_size) sfa = SymbolicFourierApproximation( n_coefs=self.word_size, drop_sum=self.drop_sum, anova=self.anova, norm_mean=self.norm_mean, norm_std=self.norm_std, n_bins=self.n_bins, strategy=self.strategy, alphabet=self.alphabet ) if y is None: y_repeated = None else: y_repeated = np.repeat(y, n_windows) X_sfa = sfa.fit_transform(X_windowed, y_repeated) X_word = np.asarray([''.join(X_sfa[i]) for i in range(n_samples * n_windows)]) X_word = X_word.reshape(n_samples, n_windows) if self.numerosity_reduction: not_equal = np.c_[X_word[:, 1:] != X_word[:, :-1], np.full(n_samples, True)] X_bow = np.asarray([' '.join(X_word[i, not_equal[i]]) for i in range(n_samples)]) else: X_bow = np.asarray([' '.join(X_word[i]) for i in range(n_samples)]) vectorizer = CountVectorizer() X_boss = vectorizer.fit_transform(X_bow) self.vocabulary_ = {value: key for key, value in vectorizer.vocabulary_.items()} self._window_size = window_size self._window_step = window_step self._n_windows = n_windows self._sfa = sfa self._vectorizer = vectorizer if not self.sparse: return X_boss.A return csr_matrix(X_boss) def _check_params(self, n_timestamps): if not isinstance(self.word_size, (int, np.integer)): raise TypeError("'word_size' must be an integer.") if not self.word_size >= 1: raise ValueError("'word_size' must be a positive integer.") if not isinstance(self.window_size, (int, np.integer, float, np.floating)): raise TypeError("'window_size' must be an integer or a float.") if isinstance(self.window_size, (int, np.integer)): if self.drop_sum: if not 1 <= self.window_size <= (n_timestamps - 1): raise ValueError( "If 'window_size' is an integer, it must be greater " "than or equal to 1 and lower than or equal to " "(n_timestamps - 1) if 'drop_sum=True'." ) else: if not 1 <= self.window_size <= n_timestamps: raise ValueError( "If 'window_size' is an integer, it must be greater " "than or equal to 1 and lower than or equal to " "n_timestamps if 'drop_sum=False'." ) window_size = self.window_size else: if not 0 < self.window_size <= 1: raise ValueError( "If 'window_size' is a float, it must be greater " "than 0 and lower than or equal to 1." ) window_size = ceil(self.window_size * n_timestamps) if not isinstance(self.window_step, (int, np.integer, float, np.floating)): raise TypeError("'window_step' must be an integer or a float.") if isinstance(self.window_step, (int, np.integer)): if not 1 <= self.window_step <= n_timestamps: raise ValueError( "If 'window_step' is an integer, it must be greater " "than or equal to 1 and lower than or equal to " "n_timestamps." ) window_step = self.window_step else: if not 0 < self.window_step <= 1: raise ValueError( "If 'window_step' is a float, it must be greater " "than 0 and lower than or equal to 1." ) window_step = ceil(self.window_step * n_timestamps) if self.drop_sum: if not self.word_size <= (window_size - 1): raise ValueError( "'word_size' must be lower than or equal to " "(window_size - 1) if 'drop_sum=True'." ) else: if not self.word_size <= window_size: raise ValueError( "'word_size' must be lower than or equal to " "window_size if 'drop_sum=False'." ) return window_size, window_step
true
true
f71d87a97f28b6912c291299e2155b00941ed654
1,615
py
Python
imcsdk/__init__.py
kenrusse/imcsdk
c35ec5d41072c3ea82c64b1b66e0650d1d873657
[ "Apache-2.0" ]
null
null
null
imcsdk/__init__.py
kenrusse/imcsdk
c35ec5d41072c3ea82c64b1b66e0650d1d873657
[ "Apache-2.0" ]
null
null
null
imcsdk/__init__.py
kenrusse/imcsdk
c35ec5d41072c3ea82c64b1b66e0650d1d873657
[ "Apache-2.0" ]
null
null
null
# Copyright 2016 Cisco Systems, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import os import logging import logging.handlers log = logging.getLogger('imc') console = logging.StreamHandler() formatter = logging.Formatter( '%(asctime)s - %(name)s - %(levelname)s - %(message)s') console.setFormatter(formatter) def enable_file_logging(filename="imcsdk.log"): file_handler = logging.handlers.RotatingFileHandler( filename, maxBytes=10*1024*1024, backupCount=5) log.addHandler(file_handler) def set_log_level(level=logging.DEBUG): """ Allows setting log level Args: level: logging level - import logging and pass enums from it(INFO/DEBUG/ERROR/etc..) Returns: None Example: from imcsdk import set_log_level import logging set_log_level(logging.INFO) """ log.setLevel(level) console.setLevel(level) set_log_level(logging.DEBUG) log.addHandler(console) if os.path.exists('/tmp/imcsdk_debug'): enable_file_logging() __author__ = 'Cisco Systems' __email__ = 'ucs-python@cisco.com' __version__ = '0.9.11'
26.47541
92
0.721981
import os import logging import logging.handlers log = logging.getLogger('imc') console = logging.StreamHandler() formatter = logging.Formatter( '%(asctime)s - %(name)s - %(levelname)s - %(message)s') console.setFormatter(formatter) def enable_file_logging(filename="imcsdk.log"): file_handler = logging.handlers.RotatingFileHandler( filename, maxBytes=10*1024*1024, backupCount=5) log.addHandler(file_handler) def set_log_level(level=logging.DEBUG): log.setLevel(level) console.setLevel(level) set_log_level(logging.DEBUG) log.addHandler(console) if os.path.exists('/tmp/imcsdk_debug'): enable_file_logging() __author__ = 'Cisco Systems' __email__ = 'ucs-python@cisco.com' __version__ = '0.9.11'
true
true
f71d8838f9ddabbae871e9cf39c1127d06d5da3b
7,514
py
Python
pysnmp/ROOMALERT3E-MIB.py
agustinhenze/mibs.snmplabs.com
1fc5c07860542b89212f4c8ab807057d9a9206c7
[ "Apache-2.0" ]
11
2021-02-02T16:27:16.000Z
2021-08-31T06:22:49.000Z
pysnmp/ROOMALERT3E-MIB.py
agustinhenze/mibs.snmplabs.com
1fc5c07860542b89212f4c8ab807057d9a9206c7
[ "Apache-2.0" ]
75
2021-02-24T17:30:31.000Z
2021-12-08T00:01:18.000Z
pysnmp/ROOMALERT3E-MIB.py
agustinhenze/mibs.snmplabs.com
1fc5c07860542b89212f4c8ab807057d9a9206c7
[ "Apache-2.0" ]
10
2019-04-30T05:51:36.000Z
2022-02-16T03:33:41.000Z
# # PySNMP MIB module ROOMALERT3E-MIB (http://snmplabs.com/pysmi) # ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/ROOMALERT3E-MIB # Produced by pysmi-0.3.4 at Mon Apr 29 20:50:01 2019 # On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4 # Using Python version 3.7.3 (default, Mar 27 2019, 09:23:15) # Integer, OctetString, ObjectIdentifier = mibBuilder.importSymbols("ASN1", "Integer", "OctetString", "ObjectIdentifier") NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues") SingleValueConstraint, ConstraintsIntersection, ValueSizeConstraint, ConstraintsUnion, ValueRangeConstraint = mibBuilder.importSymbols("ASN1-REFINEMENT", "SingleValueConstraint", "ConstraintsIntersection", "ValueSizeConstraint", "ConstraintsUnion", "ValueRangeConstraint") ModuleCompliance, NotificationGroup = mibBuilder.importSymbols("SNMPv2-CONF", "ModuleCompliance", "NotificationGroup") NotificationType, Counter64, enterprises, Integer32, Counter32, Unsigned32, NotificationType, MibIdentifier, ObjectIdentity, Gauge32, Bits, MibScalar, MibTable, MibTableRow, MibTableColumn, IpAddress, TimeTicks, ModuleIdentity, iso = mibBuilder.importSymbols("SNMPv2-SMI", "NotificationType", "Counter64", "enterprises", "Integer32", "Counter32", "Unsigned32", "NotificationType", "MibIdentifier", "ObjectIdentity", "Gauge32", "Bits", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "IpAddress", "TimeTicks", "ModuleIdentity", "iso") DisplayString, TextualConvention = mibBuilder.importSymbols("SNMPv2-TC", "DisplayString", "TextualConvention") avtech = MibIdentifier((1, 3, 6, 1, 4, 1, 20916)) products = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1)) ROOMALERT3E = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9)) sensors = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1)) signaltower = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2)) traps = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 3)) digital = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1)) digital_sen1 = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1)).setLabel("digital-sen1") digital_sen2 = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2)).setLabel("digital-sen2") switch = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 2)) digital_sen1_1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen1-1").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen1_1.setStatus('mandatory') digital_sen1_2 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen1-2").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen1_2.setStatus('mandatory') digital_sen1_label = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1, 3), OctetString()).setLabel("digital-sen1-label").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen1_label.setStatus('mandatory') digital_sen2_1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-1").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_1.setStatus('mandatory') digital_sen2_2 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-2").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_2.setStatus('mandatory') digital_sen2_3 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-3").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_3.setStatus('mandatory') digital_sen2_4 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-4").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_4.setStatus('mandatory') digital_sen2_5 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-5").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_5.setStatus('mandatory') digital_sen2_label = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 6), OctetString()).setLabel("digital-sen2-label").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_label.setStatus('mandatory') switch_sen1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 2, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("switch-sen1").setMaxAccess("readonly") if mibBuilder.loadTexts: switch_sen1.setStatus('mandatory') switch_label = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 2, 2), OctetString()).setLabel("switch-label").setMaxAccess("readonly") if mibBuilder.loadTexts: switch_label.setStatus('mandatory') red_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("red-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: red_led.setStatus('current') amber_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("amber-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: amber_led.setStatus('current') green_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("green-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: green_led.setStatus('current') blue_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("blue-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: blue_led.setStatus('current') white_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("white-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: white_led.setStatus('current') alarm1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 6), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setMaxAccess("readwrite") if mibBuilder.loadTexts: alarm1.setStatus('current') alarm2 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setMaxAccess("readwrite") if mibBuilder.loadTexts: alarm2.setStatus('current') alarmmessage = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 3, 1), OctetString()).setMaxAccess("readonly") if mibBuilder.loadTexts: alarmmessage.setStatus('mandatory') room_alert_3e_snmp_trap = NotificationType((1, 3, 6, 1, 4, 1, 20916, 1, 9) + (0,2)).setLabel("room-alert-3e-snmp-trap").setObjects(("ROOMALERT3E-MIB", "alarmmessage")) mibBuilder.exportSymbols("ROOMALERT3E-MIB", signaltower=signaltower, digital_sen2_2=digital_sen2_2, traps=traps, digital_sen2_label=digital_sen2_label, alarm1=alarm1, switch_sen1=switch_sen1, ROOMALERT3E=ROOMALERT3E, digital_sen1_1=digital_sen1_1, alarmmessage=alarmmessage, avtech=avtech, digital=digital, digital_sen1_2=digital_sen1_2, sensors=sensors, amber_led=amber_led, digital_sen2_3=digital_sen2_3, green_led=green_led, digital_sen2_4=digital_sen2_4, digital_sen2=digital_sen2, digital_sen1_label=digital_sen1_label, alarm2=alarm2, blue_led=blue_led, room_alert_3e_snmp_trap=room_alert_3e_snmp_trap, switch_label=switch_label, digital_sen1=digital_sen1, products=products, digital_sen2_5=digital_sen2_5, digital_sen2_1=digital_sen2_1, white_led=white_led, switch=switch, red_led=red_led)
117.40625
795
0.746207
Integer, OctetString, ObjectIdentifier = mibBuilder.importSymbols("ASN1", "Integer", "OctetString", "ObjectIdentifier") NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues") SingleValueConstraint, ConstraintsIntersection, ValueSizeConstraint, ConstraintsUnion, ValueRangeConstraint = mibBuilder.importSymbols("ASN1-REFINEMENT", "SingleValueConstraint", "ConstraintsIntersection", "ValueSizeConstraint", "ConstraintsUnion", "ValueRangeConstraint") ModuleCompliance, NotificationGroup = mibBuilder.importSymbols("SNMPv2-CONF", "ModuleCompliance", "NotificationGroup") NotificationType, Counter64, enterprises, Integer32, Counter32, Unsigned32, NotificationType, MibIdentifier, ObjectIdentity, Gauge32, Bits, MibScalar, MibTable, MibTableRow, MibTableColumn, IpAddress, TimeTicks, ModuleIdentity, iso = mibBuilder.importSymbols("SNMPv2-SMI", "NotificationType", "Counter64", "enterprises", "Integer32", "Counter32", "Unsigned32", "NotificationType", "MibIdentifier", "ObjectIdentity", "Gauge32", "Bits", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "IpAddress", "TimeTicks", "ModuleIdentity", "iso") DisplayString, TextualConvention = mibBuilder.importSymbols("SNMPv2-TC", "DisplayString", "TextualConvention") avtech = MibIdentifier((1, 3, 6, 1, 4, 1, 20916)) products = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1)) ROOMALERT3E = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9)) sensors = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1)) signaltower = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2)) traps = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 3)) digital = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1)) digital_sen1 = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1)).setLabel("digital-sen1") digital_sen2 = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2)).setLabel("digital-sen2") switch = MibIdentifier((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 2)) digital_sen1_1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen1-1").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen1_1.setStatus('mandatory') digital_sen1_2 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen1-2").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen1_2.setStatus('mandatory') digital_sen1_label = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 1, 3), OctetString()).setLabel("digital-sen1-label").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen1_label.setStatus('mandatory') digital_sen2_1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-1").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_1.setStatus('mandatory') digital_sen2_2 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-2").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_2.setStatus('mandatory') digital_sen2_3 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-3").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_3.setStatus('mandatory') digital_sen2_4 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-4").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_4.setStatus('mandatory') digital_sen2_5 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 65535))).setLabel("digital-sen2-5").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_5.setStatus('mandatory') digital_sen2_label = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 1, 2, 6), OctetString()).setLabel("digital-sen2-label").setMaxAccess("readonly") if mibBuilder.loadTexts: digital_sen2_label.setStatus('mandatory') switch_sen1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 2, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("switch-sen1").setMaxAccess("readonly") if mibBuilder.loadTexts: switch_sen1.setStatus('mandatory') switch_label = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 1, 2, 2), OctetString()).setLabel("switch-label").setMaxAccess("readonly") if mibBuilder.loadTexts: switch_label.setStatus('mandatory') red_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 1), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("red-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: red_led.setStatus('current') amber_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 2), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("amber-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: amber_led.setStatus('current') green_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 3), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("green-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: green_led.setStatus('current') blue_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 4), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("blue-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: blue_led.setStatus('current') white_led = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 5), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setLabel("white-led").setMaxAccess("readwrite") if mibBuilder.loadTexts: white_led.setStatus('current') alarm1 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 6), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setMaxAccess("readwrite") if mibBuilder.loadTexts: alarm1.setStatus('current') alarm2 = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 2, 7), Integer32().subtype(subtypeSpec=ValueRangeConstraint(0, 1))).setMaxAccess("readwrite") if mibBuilder.loadTexts: alarm2.setStatus('current') alarmmessage = MibScalar((1, 3, 6, 1, 4, 1, 20916, 1, 9, 3, 1), OctetString()).setMaxAccess("readonly") if mibBuilder.loadTexts: alarmmessage.setStatus('mandatory') room_alert_3e_snmp_trap = NotificationType((1, 3, 6, 1, 4, 1, 20916, 1, 9) + (0,2)).setLabel("room-alert-3e-snmp-trap").setObjects(("ROOMALERT3E-MIB", "alarmmessage")) mibBuilder.exportSymbols("ROOMALERT3E-MIB", signaltower=signaltower, digital_sen2_2=digital_sen2_2, traps=traps, digital_sen2_label=digital_sen2_label, alarm1=alarm1, switch_sen1=switch_sen1, ROOMALERT3E=ROOMALERT3E, digital_sen1_1=digital_sen1_1, alarmmessage=alarmmessage, avtech=avtech, digital=digital, digital_sen1_2=digital_sen1_2, sensors=sensors, amber_led=amber_led, digital_sen2_3=digital_sen2_3, green_led=green_led, digital_sen2_4=digital_sen2_4, digital_sen2=digital_sen2, digital_sen1_label=digital_sen1_label, alarm2=alarm2, blue_led=blue_led, room_alert_3e_snmp_trap=room_alert_3e_snmp_trap, switch_label=switch_label, digital_sen1=digital_sen1, products=products, digital_sen2_5=digital_sen2_5, digital_sen2_1=digital_sen2_1, white_led=white_led, switch=switch, red_led=red_led)
true
true
f71d889ea9aa7b8f833a526c4ae748e8ab7f962a
708
py
Python
rh/apps/meta/migrations/0005_metaattributes_image.py
rapidpro/chpro-microsite
4e1d1210b49ec60ab0711d78235bf45eeb5c0275
[ "BSD-3-Clause" ]
null
null
null
rh/apps/meta/migrations/0005_metaattributes_image.py
rapidpro/chpro-microsite
4e1d1210b49ec60ab0711d78235bf45eeb5c0275
[ "BSD-3-Clause" ]
108
2018-01-30T15:26:18.000Z
2021-06-10T17:29:57.000Z
rh/apps/meta/migrations/0005_metaattributes_image.py
rapidpro/chpro-microsite
4e1d1210b49ec60ab0711d78235bf45eeb5c0275
[ "BSD-3-Clause" ]
null
null
null
# -*- coding: utf-8 -*- # Generated by Django 1.11.7 on 2018-04-04 05:44 from __future__ import unicode_literals from django.conf import settings from django.db import migrations import django.db.models.deletion import filer.fields.image class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.FILER_IMAGE_MODEL), ('meta', '0004_auto_20180322_1026'), ] operations = [ migrations.AddField( model_name='metaattributes', name='image', field=filer.fields.image.FilerImageField(blank=True, null=True, on_delete=django.db.models.deletion.CASCADE, to=settings.FILER_IMAGE_MODEL), ), ]
28.32
152
0.696328
from __future__ import unicode_literals from django.conf import settings from django.db import migrations import django.db.models.deletion import filer.fields.image class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.FILER_IMAGE_MODEL), ('meta', '0004_auto_20180322_1026'), ] operations = [ migrations.AddField( model_name='metaattributes', name='image', field=filer.fields.image.FilerImageField(blank=True, null=True, on_delete=django.db.models.deletion.CASCADE, to=settings.FILER_IMAGE_MODEL), ), ]
true
true
f71d8b088ea126f1b60b55d2095453b1d56c7fd9
207
py
Python
src/lm/datasets/seq2seq.py
NeuroArchitect/lm
036dcd9a49aa4f5b8b872f4e3a3b8821cbb0b060
[ "Apache-2.0" ]
1
2020-10-14T18:37:46.000Z
2020-10-14T18:37:46.000Z
src/lm/datasets/seq2seq.py
shawwn/lm
8f82f7e5933e8ec7498cbc147b801a729c80c7d3
[ "Apache-2.0" ]
2
2020-09-06T01:19:50.000Z
2020-09-06T20:17:38.000Z
src/lm/datasets/seq2seq.py
shawwn/lm
8f82f7e5933e8ec7498cbc147b801a729c80c7d3
[ "Apache-2.0" ]
1
2020-09-05T20:58:47.000Z
2020-09-05T20:58:47.000Z
from typing import Optional from pydantic import BaseModel class Seq2SeqFormat(BaseModel): vocab_size: int context_length: int has_eos: Optional[bool] = False keys = ["content", "target"]
18.818182
35
0.719807
from typing import Optional from pydantic import BaseModel class Seq2SeqFormat(BaseModel): vocab_size: int context_length: int has_eos: Optional[bool] = False keys = ["content", "target"]
true
true
f71d8b6368f70117f7b32ad062fc7597ae7b66dc
3,726
py
Python
cassette-calculator.py
BandW2011/cassette-calculator
b3a116a40a8c7a4872678ec4da6da5d1605584f8
[ "MIT" ]
null
null
null
cassette-calculator.py
BandW2011/cassette-calculator
b3a116a40a8c7a4872678ec4da6da5d1605584f8
[ "MIT" ]
null
null
null
cassette-calculator.py
BandW2011/cassette-calculator
b3a116a40a8c7a4872678ec4da6da5d1605584f8
[ "MIT" ]
null
null
null
#!/usr/bin/python3 import time def isTime(str): try: time.strptime(str, '%M:%S') return True except ValueError: return False def timeToSec(input): return int(input.split(":")[0]) * 60 + int(input.split(":")[1]) def secToTime(input): return str(input // 60) + ":" + '{:02d}'.format(input % 60) def main(): print("Select an option:") print("1) Enter tracks to find album length") print("2) Enter tracks to split album evenly") print(" ) Enter tracks to find ideal side length") print("4) Convert min:sec to seconds") print("5) Convert seconds to min:sec") print("6) Find average track length") print("Q) Exit calculator") choice = input("> ") if choice == "1": print("(Enter \'q\' to calculate)") total_time = 0 i = 0 while (True): i += 1 print("Track " + str(i) + " length (min:sec): ") choice = input("> ") if isTime(choice): total_time += timeToSec(choice) else: break print("Total album length is " + secToTime(total_time) + ".") elif choice == "2": print("(Enter \'q\' to calculate)") tracks = [] i = 0 while (True): i += 1 print("Track " + str(i) + " length (min:sec): ") choice = input("> ") if isTime(choice): tracks.append(timeToSec(choice)) else: break if len(tracks) == 0: print("It'll be really easy to divide the tracks in your album when there are none.") elif len(tracks) == 1: print("It'll be really easy to divide the tracks in your album when there\'s only one.") elif len(tracks) == 2: print("The total album length is " + secToTime(sum(tracks)) + ".") print("The album will most evenly be split if track 1 is on Side A (" + secToTime(tracks[0]) + "),") print("And track 2 is on Side B (" + secToTime(tracks[1]) + ").") else: halfway_time = sum(tracks) // 2 halfway_track = -1 k = 0 while (k != len(tracks)): if sum(tracks[:k + 1]) >= halfway_time: break k += 1 print(str(halfway_time)) print("The total album length is " + secToTime(sum(tracks)) + ".") print("The album will most evenly be split if tracks 1-" + str(k) + " are on Side A (" + secToTime(sum(tracks[:k])) + "),") print("And tracks " + str(k+1) + "-" + str(len(tracks)) + " are on Side B (" + secToTime(sum(tracks[k:])) + ").") elif choice == "4": print("Input time in format (min:sec): ") choice = input("> ") print(timeToSec(choice)) elif choice == "5": print("Input time in seconds: ") choice = input("> ") print(secToTime(int(choice))) elif choice == "6": print("(Enter \'q\' to calculate)") total_time = 0 i = 0 while (True): i += 1 print("Track " + str(i) + " length (min:sec): ") choice = input("> ") if isTime(choice): total_time += timeToSec(choice) else: break if total_time == 0: print("It doesn\'t seem as if you've input any tracks!") else: print("The average track length (" + secToTime(total_time) + " / " + str(i - 1) + " tracks) is " + secToTime(total_time // (i - 1)) + ".") elif choice == str.lower("q"): return 0 print("") main() print("* Cassette Calculator *") main()
32.973451
150
0.496511
import time def isTime(str): try: time.strptime(str, '%M:%S') return True except ValueError: return False def timeToSec(input): return int(input.split(":")[0]) * 60 + int(input.split(":")[1]) def secToTime(input): return str(input // 60) + ":" + '{:02d}'.format(input % 60) def main(): print("Select an option:") print("1) Enter tracks to find album length") print("2) Enter tracks to split album evenly") print(" ) Enter tracks to find ideal side length") print("4) Convert min:sec to seconds") print("5) Convert seconds to min:sec") print("6) Find average track length") print("Q) Exit calculator") choice = input("> ") if choice == "1": print("(Enter \'q\' to calculate)") total_time = 0 i = 0 while (True): i += 1 print("Track " + str(i) + " length (min:sec): ") choice = input("> ") if isTime(choice): total_time += timeToSec(choice) else: break print("Total album length is " + secToTime(total_time) + ".") elif choice == "2": print("(Enter \'q\' to calculate)") tracks = [] i = 0 while (True): i += 1 print("Track " + str(i) + " length (min:sec): ") choice = input("> ") if isTime(choice): tracks.append(timeToSec(choice)) else: break if len(tracks) == 0: print("It'll be really easy to divide the tracks in your album when there are none.") elif len(tracks) == 1: print("It'll be really easy to divide the tracks in your album when there\'s only one.") elif len(tracks) == 2: print("The total album length is " + secToTime(sum(tracks)) + ".") print("The album will most evenly be split if track 1 is on Side A (" + secToTime(tracks[0]) + "),") print("And track 2 is on Side B (" + secToTime(tracks[1]) + ").") else: halfway_time = sum(tracks) // 2 halfway_track = -1 k = 0 while (k != len(tracks)): if sum(tracks[:k + 1]) >= halfway_time: break k += 1 print(str(halfway_time)) print("The total album length is " + secToTime(sum(tracks)) + ".") print("The album will most evenly be split if tracks 1-" + str(k) + " are on Side A (" + secToTime(sum(tracks[:k])) + "),") print("And tracks " + str(k+1) + "-" + str(len(tracks)) + " are on Side B (" + secToTime(sum(tracks[k:])) + ").") elif choice == "4": print("Input time in format (min:sec): ") choice = input("> ") print(timeToSec(choice)) elif choice == "5": print("Input time in seconds: ") choice = input("> ") print(secToTime(int(choice))) elif choice == "6": print("(Enter \'q\' to calculate)") total_time = 0 i = 0 while (True): i += 1 print("Track " + str(i) + " length (min:sec): ") choice = input("> ") if isTime(choice): total_time += timeToSec(choice) else: break if total_time == 0: print("It doesn\'t seem as if you've input any tracks!") else: print("The average track length (" + secToTime(total_time) + " / " + str(i - 1) + " tracks) is " + secToTime(total_time // (i - 1)) + ".") elif choice == str.lower("q"): return 0 print("") main() print("* Cassette Calculator *") main()
true
true
f71d8cd840396855122bd25a3c882b5f3a776d40
1,908
py
Python
12.py
mramendi/advent-of-code-2021
7cd98e6006659f42654b8fc126f06ebfba5774c0
[ "CC0-1.0" ]
null
null
null
12.py
mramendi/advent-of-code-2021
7cd98e6006659f42654b8fc126f06ebfba5774c0
[ "CC0-1.0" ]
null
null
null
12.py
mramendi/advent-of-code-2021
7cd98e6006659f42654b8fc126f06ebfba5774c0
[ "CC0-1.0" ]
null
null
null
def how_many_paths_to_end(start_node,paths,no_go,exception_used,path_string): ''' recursive walk Parameters: start_node (string) - the node from which we walk paths (dict) - a dictionary where every node has a set of connected nodes no_go (set) - a set of nodes that can not be visited as they are "small caves" and were visited; an exception can be used to visit one small cave twice exception_used (boolean): if True, the exception for visiting a small cave twice was already used; for part 1 answer set to True from the start ''' new_path_string=path_string+" "+start_node if start_node == "end": # print(new_path_string) # UNCOMMENT TO PRINT PATHS return 1 # there is exactly one path from end to end new_no_go = no_go.copy() if start_node[0].islower(): new_no_go.add(start_node) # small caves can only be visited once count = 0 for connected_node in paths[start_node]: new_exception_used=exception_used if connected_node=="start": continue if connected_node in no_go: if exception_used: continue new_exception_used=True if start_node[0].isupper() and connected_node[0].isupper(): print("WARNING: path between two large caves, infinite loop likely: "+start_node+","+connected_node) count += how_many_paths_to_end(connected_node,paths,new_no_go,new_exception_used,new_path_string) return count paths = {} for s in open("input12.txt"): if s.strip()=="": continue p1,p2=s.split("-") p1=p1.strip() p2=p2.strip() if not p1 in paths: paths[p1]=set() if not p2 in paths: paths[p2]=set() paths[p1].add(p2) paths[p2].add(p1) print("Part 1: ",how_many_paths_to_end("start",paths,set(),True,"")) print("Part 2: ",how_many_paths_to_end("start",paths,set(),False,""))
36.692308
155
0.664046
def how_many_paths_to_end(start_node,paths,no_go,exception_used,path_string): new_path_string=path_string+" "+start_node if start_node == "end": w_no_go = no_go.copy() if start_node[0].islower(): new_no_go.add(start_node) count = 0 for connected_node in paths[start_node]: new_exception_used=exception_used if connected_node=="start": continue if connected_node in no_go: if exception_used: continue new_exception_used=True if start_node[0].isupper() and connected_node[0].isupper(): print("WARNING: path between two large caves, infinite loop likely: "+start_node+","+connected_node) count += how_many_paths_to_end(connected_node,paths,new_no_go,new_exception_used,new_path_string) return count paths = {} for s in open("input12.txt"): if s.strip()=="": continue p1,p2=s.split("-") p1=p1.strip() p2=p2.strip() if not p1 in paths: paths[p1]=set() if not p2 in paths: paths[p2]=set() paths[p1].add(p2) paths[p2].add(p1) print("Part 1: ",how_many_paths_to_end("start",paths,set(),True,"")) print("Part 2: ",how_many_paths_to_end("start",paths,set(),False,""))
true
true
f71d8cdeec3da4e234767b37f0ad7f8ee3dad966
1,502
py
Python
CODES/a_star_03.py
YashwanthYarala/MICROMOUSE
69ba518ee81e1e6b70a13f7480844459d240ed11
[ "MIT" ]
null
null
null
CODES/a_star_03.py
YashwanthYarala/MICROMOUSE
69ba518ee81e1e6b70a13f7480844459d240ed11
[ "MIT" ]
null
null
null
CODES/a_star_03.py
YashwanthYarala/MICROMOUSE
69ba518ee81e1e6b70a13f7480844459d240ed11
[ "MIT" ]
null
null
null
maze = [[0,0,0,0,0,0,0,0,0,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,0,0,0,0,0,0,0,0,0]] # we start at (1,1) a = 1 b = 1 h = k = 4 def cost(p,q): t = 1+abs(p-h)+abs(q-k) return t while(a!=4 and b!=4): # checking the posibility of motion maze[a][b] = '*' if(maze[a+1][b]==1): #checking for right t_r=cost(a+1,b) else: t_r = cost(a,b) if(maze[a][b+1]==1): t_d = cost(a,b+1) else: t_d = cost(a,b) if(maze[a-1][b]==1): t_l = cost(a-1,b) else: t_l = cost(a,b) if(maze[a][b-1]==1): t_u = cost(a,b-1) else: t_u = cost(a,b) # comparison between costs if (t_d > t_l or t_d > t_r or t_d > t_u): a = a b = b # then t_d is not the least values of cost else: # then t_d is the least value b = b + 1 if (t_r > t_l or t_r > t_u or t_r > t_d): a = a b = b else: a += 1 if (t_l > t_u or t_l > t_r or t_l > t_d): a = a b = b else: a = a - 1 if (t_u > t_l or t_u > t_r or t_r > t_d): a = a b = b else: b = b - 1 if (a == 4 and b == 4): maze[a][b] = "*" print(maze)
20.861111
54
0.388815
maze = [[0,0,0,0,0,0,0,0,0,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,1,1,1,1,1,1,1,1,0], [0,0,0,0,0,0,0,0,0,0]] a = 1 b = 1 h = k = 4 def cost(p,q): t = 1+abs(p-h)+abs(q-k) return t while(a!=4 and b!=4): maze[a][b] = '*' if(maze[a+1][b]==1): t_r=cost(a+1,b) else: t_r = cost(a,b) if(maze[a][b+1]==1): t_d = cost(a,b+1) else: t_d = cost(a,b) if(maze[a-1][b]==1): t_l = cost(a-1,b) else: t_l = cost(a,b) if(maze[a][b-1]==1): t_u = cost(a,b-1) else: t_u = cost(a,b) if (t_d > t_l or t_d > t_r or t_d > t_u): a = a b = b else: b = b + 1 if (t_r > t_l or t_r > t_u or t_r > t_d): a = a b = b else: a += 1 if (t_l > t_u or t_l > t_r or t_l > t_d): a = a b = b else: a = a - 1 if (t_u > t_l or t_u > t_r or t_r > t_d): a = a b = b else: b = b - 1 if (a == 4 and b == 4): maze[a][b] = "*" print(maze)
true
true
f71d8eaac6d3bc9bc701b395bc1f1700b57e561f
770
py
Python
examples/research/proj/C3H6.py
fishjojo/pydmfe
93cfc655314933d3531b5733521a1f95a044f6cb
[ "MIT" ]
3
2021-02-26T06:26:00.000Z
2022-02-20T08:58:20.000Z
examples/research/proj/C3H6.py
fishjojo/pydmfet
93cfc655314933d3531b5733521a1f95a044f6cb
[ "MIT" ]
null
null
null
examples/research/proj/C3H6.py
fishjojo/pydmfet
93cfc655314933d3531b5733521a1f95a044f6cb
[ "MIT" ]
null
null
null
from pydmfet import proj_ao from pydmfet.qcwrap.pyscf_rks_ao import rks_ao from pyscf import gto,scf import numpy as np from pyscf.tools import molden from pyscf import lo from pyscf.lo import iao,orth from functools import reduce import math bas ='ccpvdz' temp = 0.01 mol = gto.Mole() mol.atom = open('C3H6.xyz').read() mol.basis = bas mol.charge = 0 mol.build(max_memory = 4000, verbose=4) #mf = scf.RKS(mol) mf = rks_ao(mol,smear_sigma = temp) mf.xc = "pbe,pbe" mf.max_cycle = 50 DMguess = None mf.scf(dm0=DMguess) natoms = mol.natm impAtom = np.zeros([natoms], dtype=int) for i in range(5): impAtom[i] = 1 embed = proj_ao.proj_embed(mf,impAtom, Ne_env = 8) embed.pop_method = 'meta_lowdin' embed.make_frozen_orbs(norb = 11) #embed.embedding_potential()
19.25
50
0.733766
from pydmfet import proj_ao from pydmfet.qcwrap.pyscf_rks_ao import rks_ao from pyscf import gto,scf import numpy as np from pyscf.tools import molden from pyscf import lo from pyscf.lo import iao,orth from functools import reduce import math bas ='ccpvdz' temp = 0.01 mol = gto.Mole() mol.atom = open('C3H6.xyz').read() mol.basis = bas mol.charge = 0 mol.build(max_memory = 4000, verbose=4) mf = rks_ao(mol,smear_sigma = temp) mf.xc = "pbe,pbe" mf.max_cycle = 50 DMguess = None mf.scf(dm0=DMguess) natoms = mol.natm impAtom = np.zeros([natoms], dtype=int) for i in range(5): impAtom[i] = 1 embed = proj_ao.proj_embed(mf,impAtom, Ne_env = 8) embed.pop_method = 'meta_lowdin' embed.make_frozen_orbs(norb = 11)
true
true
f71d8ef2d5e34813e862d6041a815735fe0485fa
2,893
py
Python
src/python/pants/backend/python/pants_requirement.py
StephanErb/pants
a368267b6b4cf50138ba567f582409ed31bf5db9
[ "Apache-2.0" ]
null
null
null
src/python/pants/backend/python/pants_requirement.py
StephanErb/pants
a368267b6b4cf50138ba567f582409ed31bf5db9
[ "Apache-2.0" ]
null
null
null
src/python/pants/backend/python/pants_requirement.py
StephanErb/pants
a368267b6b4cf50138ba567f582409ed31bf5db9
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # Copyright 2015 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import absolute_import, division, print_function, unicode_literals import os from builtins import object from pants.backend.python.python_requirement import PythonRequirement from pants.base.build_environment import pants_version from pants.base.exceptions import TargetDefinitionException from pants.build_graph.address import Address from pants.util.meta import classproperty class PantsRequirement(object): """Exports a `python_requirement_library` pointing at the active pants' corresponding sdist. This requirement is useful for custom plugin authors who want to build and test their plugin with pants itself. Using the resulting target as a dependency of their plugin target ensures the dependency stays true to the surrounding repo's version of pants. NB: The requirement generated is for official pants releases on pypi; so may not be appropriate for use in a repo that tracks `pantsbuild/pants` or otherwise uses custom pants sdists. :API: public """ @classproperty def alias(self): return 'pants_requirement' def __init__(self, parse_context): self._parse_context = parse_context def __call__(self, name=None, dist=None): """ :param string name: The name to use for the target, defaults to the dist name if specified and otherwise the parent dir name. :param string dist: The pants dist to create a requirement for. This must be a 'pantsbuild.pants*' distribution; eg: 'pantsbuild.pants.contrib.python.checks'. """ name = name or dist or os.path.basename(self._parse_context.rel_path) dist = dist or 'pantsbuild.pants' if not (dist == 'pantsbuild.pants' or dist.startswith('pantsbuild.pants.')): target = Address(spec_path=self._parse_context.rel_path, target_name=name) raise TargetDefinitionException(target=target, msg='The {} target only works for pantsbuild.pants ' 'distributions, given {}'.format(self.alias, dist)) # Update the environment marker in lockstep with other changes as described in # https://github.com/pantsbuild/pants/issues/6450 env_marker = "python_version>='2.7' and python_version<'3'" requirement = PythonRequirement(requirement="{key}=={version} ; {env_marker}" .format(key=dist, version=pants_version(), env_marker=env_marker)) self._parse_context.create_object('python_requirement_library', name=name, requirements=[requirement])
44.507692
99
0.676115
from __future__ import absolute_import, division, print_function, unicode_literals import os from builtins import object from pants.backend.python.python_requirement import PythonRequirement from pants.base.build_environment import pants_version from pants.base.exceptions import TargetDefinitionException from pants.build_graph.address import Address from pants.util.meta import classproperty class PantsRequirement(object): @classproperty def alias(self): return 'pants_requirement' def __init__(self, parse_context): self._parse_context = parse_context def __call__(self, name=None, dist=None): name = name or dist or os.path.basename(self._parse_context.rel_path) dist = dist or 'pantsbuild.pants' if not (dist == 'pantsbuild.pants' or dist.startswith('pantsbuild.pants.')): target = Address(spec_path=self._parse_context.rel_path, target_name=name) raise TargetDefinitionException(target=target, msg='The {} target only works for pantsbuild.pants ' 'distributions, given {}'.format(self.alias, dist)) env_marker = "python_version>='2.7' and python_version<'3'" requirement = PythonRequirement(requirement="{key}=={version} ; {env_marker}" .format(key=dist, version=pants_version(), env_marker=env_marker)) self._parse_context.create_object('python_requirement_library', name=name, requirements=[requirement])
true
true
f71d9092e5371d5d2c143058ded24cb5f4ca1958
6,692
py
Python
youtube_dl/extractor/gdcvault.py
aalvarito68/https-github.com-rg3-youtube-dl
dfc80bdd2e4ef3d30f161a93f99f3050537944ab
[ "Unlicense" ]
24
2017-03-17T10:27:12.000Z
2022-02-16T05:55:50.000Z
youtube_dl/extractor/gdcvault.py
travis-south/youtube-dl
dc89f968330fe9b2f0e56b07febc8cd57005f2c0
[ "Unlicense" ]
8
2017-12-05T23:45:54.000Z
2022-02-09T23:28:51.000Z
youtube_dl/extractor/gdcvault.py
travis-south/youtube-dl
dc89f968330fe9b2f0e56b07febc8cd57005f2c0
[ "Unlicense" ]
6
2017-07-15T07:17:29.000Z
2018-03-13T07:31:18.000Z
from __future__ import unicode_literals import re from .common import InfoExtractor from ..utils import ( HEADRequest, sanitized_Request, urlencode_postdata, ) class GDCVaultIE(InfoExtractor): _VALID_URL = r'https?://(?:www\.)?gdcvault\.com/play/(?P<id>\d+)/(?P<name>(\w|-)+)?' _NETRC_MACHINE = 'gdcvault' _TESTS = [ { 'url': 'http://www.gdcvault.com/play/1019721/Doki-Doki-Universe-Sweet-Simple', 'md5': '7ce8388f544c88b7ac11c7ab1b593704', 'info_dict': { 'id': '1019721', 'display_id': 'Doki-Doki-Universe-Sweet-Simple', 'ext': 'mp4', 'title': 'Doki-Doki Universe: Sweet, Simple and Genuine (GDC Next 10)' } }, { 'url': 'http://www.gdcvault.com/play/1015683/Embracing-the-Dark-Art-of', 'info_dict': { 'id': '1015683', 'display_id': 'Embracing-the-Dark-Art-of', 'ext': 'flv', 'title': 'Embracing the Dark Art of Mathematical Modeling in AI' }, 'params': { 'skip_download': True, # Requires rtmpdump } }, { 'url': 'http://www.gdcvault.com/play/1015301/Thexder-Meets-Windows-95-or', 'md5': 'a5eb77996ef82118afbbe8e48731b98e', 'info_dict': { 'id': '1015301', 'display_id': 'Thexder-Meets-Windows-95-or', 'ext': 'flv', 'title': 'Thexder Meets Windows 95, or Writing Great Games in the Windows 95 Environment', }, 'skip': 'Requires login', }, { 'url': 'http://gdcvault.com/play/1020791/', 'only_matching': True, }, { # Hard-coded hostname 'url': 'http://gdcvault.com/play/1023460/Tenacious-Design-and-The-Interface', 'md5': 'a8efb6c31ed06ca8739294960b2dbabd', 'info_dict': { 'id': '1023460', 'ext': 'mp4', 'display_id': 'Tenacious-Design-and-The-Interface', 'title': 'Tenacious Design and The Interface of \'Destiny\'', }, }, { # Multiple audios 'url': 'http://www.gdcvault.com/play/1014631/Classic-Game-Postmortem-PAC', 'info_dict': { 'id': '1014631', 'ext': 'flv', 'title': 'How to Create a Good Game - From My Experience of Designing Pac-Man', }, 'params': { 'skip_download': True, # Requires rtmpdump 'format': 'jp', # The japanese audio } }, { # gdc-player.html 'url': 'http://www.gdcvault.com/play/1435/An-American-engine-in-Tokyo', 'info_dict': { 'id': '1435', 'display_id': 'An-American-engine-in-Tokyo', 'ext': 'flv', 'title': 'An American Engine in Tokyo:/nThe collaboration of Epic Games and Square Enix/nFor THE LAST REMINANT', }, 'params': { 'skip_download': True, # Requires rtmpdump }, }, ] def _login(self, webpage_url, display_id): (username, password) = self._get_login_info() if username is None or password is None: self.report_warning('It looks like ' + webpage_url + ' requires a login. Try specifying a username and password and try again.') return None mobj = re.match(r'(?P<root_url>https?://.*?/).*', webpage_url) login_url = mobj.group('root_url') + 'api/login.php' logout_url = mobj.group('root_url') + 'logout' login_form = { 'email': username, 'password': password, } request = sanitized_Request(login_url, urlencode_postdata(login_form)) request.add_header('Content-Type', 'application/x-www-form-urlencoded') self._download_webpage(request, display_id, 'Logging in') start_page = self._download_webpage(webpage_url, display_id, 'Getting authenticated video page') self._download_webpage(logout_url, display_id, 'Logging out') return start_page def _real_extract(self, url): mobj = re.match(self._VALID_URL, url) video_id = mobj.group('id') display_id = mobj.group('name') or video_id webpage_url = 'http://www.gdcvault.com/play/' + video_id start_page = self._download_webpage(webpage_url, display_id) direct_url = self._search_regex( r's1\.addVariable\("file",\s*encodeURIComponent\("(/[^"]+)"\)\);', start_page, 'url', default=None) if direct_url: title = self._html_search_regex( r'<td><strong>Session Name</strong></td>\s*<td>(.*?)</td>', start_page, 'title') video_url = 'http://www.gdcvault.com' + direct_url # resolve the url so that we can detect the correct extension head = self._request_webpage(HEADRequest(video_url), video_id) video_url = head.geturl() return { 'id': video_id, 'display_id': display_id, 'url': video_url, 'title': title, } PLAYER_REGEX = r'<iframe src="(?P<xml_root>.+?)/(?:gdc-)?player.*?\.html.*?".*?</iframe>' xml_root = self._html_search_regex( PLAYER_REGEX, start_page, 'xml root', default=None) if xml_root is None: # Probably need to authenticate login_res = self._login(webpage_url, display_id) if login_res is None: self.report_warning('Could not login.') else: start_page = login_res # Grab the url from the authenticated page xml_root = self._html_search_regex( PLAYER_REGEX, start_page, 'xml root') xml_name = self._html_search_regex( r'<iframe src=".*?\?xml=(.+?\.xml).*?".*?</iframe>', start_page, 'xml filename', default=None) if xml_name is None: # Fallback to the older format xml_name = self._html_search_regex( r'<iframe src=".*?\?xmlURL=xml/(?P<xml_file>.+?\.xml).*?".*?</iframe>', start_page, 'xml filename') return { '_type': 'url_transparent', 'id': video_id, 'display_id': display_id, 'url': '%s/xml/%s' % (xml_root, xml_name), 'ie_key': 'DigitallySpeaking', }
38.24
140
0.527794
from __future__ import unicode_literals import re from .common import InfoExtractor from ..utils import ( HEADRequest, sanitized_Request, urlencode_postdata, ) class GDCVaultIE(InfoExtractor): _VALID_URL = r'https?://(?:www\.)?gdcvault\.com/play/(?P<id>\d+)/(?P<name>(\w|-)+)?' _NETRC_MACHINE = 'gdcvault' _TESTS = [ { 'url': 'http://www.gdcvault.com/play/1019721/Doki-Doki-Universe-Sweet-Simple', 'md5': '7ce8388f544c88b7ac11c7ab1b593704', 'info_dict': { 'id': '1019721', 'display_id': 'Doki-Doki-Universe-Sweet-Simple', 'ext': 'mp4', 'title': 'Doki-Doki Universe: Sweet, Simple and Genuine (GDC Next 10)' } }, { 'url': 'http://www.gdcvault.com/play/1015683/Embracing-the-Dark-Art-of', 'info_dict': { 'id': '1015683', 'display_id': 'Embracing-the-Dark-Art-of', 'ext': 'flv', 'title': 'Embracing the Dark Art of Mathematical Modeling in AI' }, 'params': { 'skip_download': True, } }, { 'url': 'http://www.gdcvault.com/play/1015301/Thexder-Meets-Windows-95-or', 'md5': 'a5eb77996ef82118afbbe8e48731b98e', 'info_dict': { 'id': '1015301', 'display_id': 'Thexder-Meets-Windows-95-or', 'ext': 'flv', 'title': 'Thexder Meets Windows 95, or Writing Great Games in the Windows 95 Environment', }, 'skip': 'Requires login', }, { 'url': 'http://gdcvault.com/play/1020791/', 'only_matching': True, }, { 'url': 'http://gdcvault.com/play/1023460/Tenacious-Design-and-The-Interface', 'md5': 'a8efb6c31ed06ca8739294960b2dbabd', 'info_dict': { 'id': '1023460', 'ext': 'mp4', 'display_id': 'Tenacious-Design-and-The-Interface', 'title': 'Tenacious Design and The Interface of \'Destiny\'', }, }, { 'url': 'http://www.gdcvault.com/play/1014631/Classic-Game-Postmortem-PAC', 'info_dict': { 'id': '1014631', 'ext': 'flv', 'title': 'How to Create a Good Game - From My Experience of Designing Pac-Man', }, 'params': { 'skip_download': True, 'format': 'jp', } }, { 'url': 'http://www.gdcvault.com/play/1435/An-American-engine-in-Tokyo', 'info_dict': { 'id': '1435', 'display_id': 'An-American-engine-in-Tokyo', 'ext': 'flv', 'title': 'An American Engine in Tokyo:/nThe collaboration of Epic Games and Square Enix/nFor THE LAST REMINANT', }, 'params': { 'skip_download': True, }, }, ] def _login(self, webpage_url, display_id): (username, password) = self._get_login_info() if username is None or password is None: self.report_warning('It looks like ' + webpage_url + ' requires a login. Try specifying a username and password and try again.') return None mobj = re.match(r'(?P<root_url>https?://.*?/).*', webpage_url) login_url = mobj.group('root_url') + 'api/login.php' logout_url = mobj.group('root_url') + 'logout' login_form = { 'email': username, 'password': password, } request = sanitized_Request(login_url, urlencode_postdata(login_form)) request.add_header('Content-Type', 'application/x-www-form-urlencoded') self._download_webpage(request, display_id, 'Logging in') start_page = self._download_webpage(webpage_url, display_id, 'Getting authenticated video page') self._download_webpage(logout_url, display_id, 'Logging out') return start_page def _real_extract(self, url): mobj = re.match(self._VALID_URL, url) video_id = mobj.group('id') display_id = mobj.group('name') or video_id webpage_url = 'http://www.gdcvault.com/play/' + video_id start_page = self._download_webpage(webpage_url, display_id) direct_url = self._search_regex( r's1\.addVariable\("file",\s*encodeURIComponent\("(/[^"]+)"\)\);', start_page, 'url', default=None) if direct_url: title = self._html_search_regex( r'<td><strong>Session Name</strong></td>\s*<td>(.*?)</td>', start_page, 'title') video_url = 'http://www.gdcvault.com' + direct_url # resolve the url so that we can detect the correct extension head = self._request_webpage(HEADRequest(video_url), video_id) video_url = head.geturl() return { 'id': video_id, 'display_id': display_id, 'url': video_url, 'title': title, } PLAYER_REGEX = r'<iframe src="(?P<xml_root>.+?)/(?:gdc-)?player.*?\.html.*?".*?</iframe>' xml_root = self._html_search_regex( PLAYER_REGEX, start_page, 'xml root', default=None) if xml_root is None: # Probably need to authenticate login_res = self._login(webpage_url, display_id) if login_res is None: self.report_warning('Could not login.') else: start_page = login_res # Grab the url from the authenticated page xml_root = self._html_search_regex( PLAYER_REGEX, start_page, 'xml root') xml_name = self._html_search_regex( r'<iframe src=".*?\?xml=(.+?\.xml).*?".*?</iframe>', start_page, 'xml filename', default=None) if xml_name is None: # Fallback to the older format xml_name = self._html_search_regex( r'<iframe src=".*?\?xmlURL=xml/(?P<xml_file>.+?\.xml).*?".*?</iframe>', start_page, 'xml filename') return { '_type': 'url_transparent', 'id': video_id, 'display_id': display_id, 'url': '%s/xml/%s' % (xml_root, xml_name), 'ie_key': 'DigitallySpeaking', }
true
true
f71d90b544b5058b7fccd9644f2bf263c8823742
2,339
py
Python
Quantum Key Distribution/Mutation Testing/QKD Mutation Testing Cirq/Remove_mutant_2.py
Lilgabz/Quantum-Algorithm-Implementations
2bb5df522d76e94b300275dfefff2869ff31bc2c
[ "MIT" ]
1
2022-03-20T17:20:09.000Z
2022-03-20T17:20:09.000Z
Quantum Key Distribution/Mutation Testing/QKD Mutation Testing Cirq/Remove_mutant_2.py
Lilgabz/Quantum-Algorithm-Implementations
2bb5df522d76e94b300275dfefff2869ff31bc2c
[ "MIT" ]
null
null
null
Quantum Key Distribution/Mutation Testing/QKD Mutation Testing Cirq/Remove_mutant_2.py
Lilgabz/Quantum-Algorithm-Implementations
2bb5df522d76e94b300275dfefff2869ff31bc2c
[ "MIT" ]
2
2021-12-30T22:23:20.000Z
2022-03-20T17:20:22.000Z
import unittest import cirq from cirq.ops import H, X, I import random import matplotlib.pyplot as plt import numpy as np from numpy.random import randint import hypothesis.strategies as st from hypothesis import given, settings def generate_binary(len): return randint(2, size=len) def encode_message(bits, bases, messageLen): message = [] for i in range(messageLen): qubits = cirq.LineQubit.range(1) qc = cirq.Circuit() if bases[i] == 0: # Prepare qubit in Z-basis if bits[i] == 0: qc.append(cirq.I(qubits[0])) else: qc.append(cirq.X(qubits[0])) else: # Prepare qubit in X-basis if bits[i] == 0: ### mutant - remove ### qc.append(cirq.I(qubits[0])) else: qc.append(cirq.X(qubits[0])) qc.append(cirq.H(qubits[0])) message.append(qc) return message def measure_message(message, bases, messageLen): measurements = [] for q in range(messageLen): if bases[q] == 0: # measuring in Z-basis if (not message[q].has_measurements()): for qubit in message[q].all_qubits(): message[q].append(cirq.measure(qubit)) if bases[q] == 1: # measuring in X-basis if (not message[q].has_measurements()): for qubit in message[q].all_qubits(): message[q].append(cirq.H(qubit)) message[q].append(cirq.measure(qubit)) simulator = cirq.Simulator() measured_bit = simulator.run(message[q]) measurements.append((measured_bit.data.iat[0,0])) return measurements def remove_garbage(a_bases, b_bases, bits, messageLen): good_bits = [] for q in range(messageLen): if a_bases[q] == b_bases[q]: # If both used the same basis, add # this to the list of 'good' bits good_bits.append(bits[q]) return good_bits def sample_bits(bits, selection): sample = [] for i in selection: # use np.mod to make sure the # bit we sample is always in # the list range i = np.mod(i, len(bits)) # pop(i) removes the element of the # list at index 'i' sample.append(bits.pop(i)) return sample
32.486111
60
0.57546
import unittest import cirq from cirq.ops import H, X, I import random import matplotlib.pyplot as plt import numpy as np from numpy.random import randint import hypothesis.strategies as st from hypothesis import given, settings def generate_binary(len): return randint(2, size=len) def encode_message(bits, bases, messageLen): message = [] for i in range(messageLen): qubits = cirq.LineQubit.range(1) qc = cirq.Circuit() if bases[i] == 0: if bits[i] == 0: qc.append(cirq.I(qubits[0])) else: qc.append(cirq.X(qubits[0])) else: if bits[i] == 0: else: qc.append(cirq.X(qubits[0])) qc.append(cirq.H(qubits[0])) message.append(qc) return message def measure_message(message, bases, messageLen): measurements = [] for q in range(messageLen): if bases[q] == 0: if (not message[q].has_measurements()): for qubit in message[q].all_qubits(): message[q].append(cirq.measure(qubit)) if bases[q] == 1: if (not message[q].has_measurements()): for qubit in message[q].all_qubits(): message[q].append(cirq.H(qubit)) message[q].append(cirq.measure(qubit)) simulator = cirq.Simulator() measured_bit = simulator.run(message[q]) measurements.append((measured_bit.data.iat[0,0])) return measurements def remove_garbage(a_bases, b_bases, bits, messageLen): good_bits = [] for q in range(messageLen): if a_bases[q] == b_bases[q]: good_bits.append(bits[q]) return good_bits def sample_bits(bits, selection): sample = [] for i in selection: i = np.mod(i, len(bits)) sample.append(bits.pop(i)) return sample
true
true
f71d90e180f56bda6ddb0db33bef3d8021a809dc
1,803
py
Python
jotdx/parser/get_minute_time_data.py
jojoquant/jotdx
bc1cf478ddb262883d779d3c494877a767ebedd5
[ "MIT" ]
null
null
null
jotdx/parser/get_minute_time_data.py
jojoquant/jotdx
bc1cf478ddb262883d779d3c494877a767ebedd5
[ "MIT" ]
null
null
null
jotdx/parser/get_minute_time_data.py
jojoquant/jotdx
bc1cf478ddb262883d779d3c494877a767ebedd5
[ "MIT" ]
null
null
null
# coding=utf-8 from jotdx.parser.base import BaseParser from jotdx.helper import get_datetime, get_volume, get_price from collections import OrderedDict import struct import six class GetMinuteTimeData(BaseParser): def setParams(self, market, code): if type(code) is six.text_type: code = code.encode("utf-8") pkg = bytearray.fromhex(u'0c 1b 08 00 01 01 0e 00 0e 00 1d 05') pkg.extend(struct.pack("<H6sI", market, code, 0)) self.send_pkg = pkg """ b1cb74000c1b080001b61d05be03be03f0000000a208ce038d2c028302972f4124b11a00219821011183180014891c0009be0b4207b11000429c2041.... In [26]: get_price(b, 0) Out[26]: (0, 1) In [27]: get_price(b, 1) Out[27]: (0, 2) In [28]: get_price(b, 2) Out[28]: (546, 4) In [29]: get_price(b, 4) Out[29]: (-206, 6) In [30]: get_price(b, 6) Out[30]: (2829, 8) In [31]: get_price(b, 8) Out[31]: (2, 9) In [32]: get_price(b, 9) Out[32]: (131, 11) In [36]: get_price(b, 11) Out[36]: (3031, 13) In [37]: get_price(b, 13) Out[37]: (-1, 14) In [38]: get_price(b, 14) Out[38]: (36, 15) In [39]: get_price(b, 15) Out[39]: (1713, 17) In [40]: get_price(b, 17) Out[40]: (0, 18) """ def parseResponse(self, body_buf): pos = 0 (num, ) = struct.unpack("<H", body_buf[:2]) last_price = 0 pos += 4 prices = [] for i in range(num): price_raw, pos = get_price(body_buf, pos) reversed1, pos = get_price(body_buf, pos) vol, pos = get_price(body_buf, pos) last_price = last_price + price_raw price = OrderedDict( [ ("price", float(last_price)/100), ("vol", vol) ] ) prices.append(price) return prices
23.723684
128
0.576262
from jotdx.parser.base import BaseParser from jotdx.helper import get_datetime, get_volume, get_price from collections import OrderedDict import struct import six class GetMinuteTimeData(BaseParser): def setParams(self, market, code): if type(code) is six.text_type: code = code.encode("utf-8") pkg = bytearray.fromhex(u'0c 1b 08 00 01 01 0e 00 0e 00 1d 05') pkg.extend(struct.pack("<H6sI", market, code, 0)) self.send_pkg = pkg def parseResponse(self, body_buf): pos = 0 (num, ) = struct.unpack("<H", body_buf[:2]) last_price = 0 pos += 4 prices = [] for i in range(num): price_raw, pos = get_price(body_buf, pos) reversed1, pos = get_price(body_buf, pos) vol, pos = get_price(body_buf, pos) last_price = last_price + price_raw price = OrderedDict( [ ("price", float(last_price)/100), ("vol", vol) ] ) prices.append(price) return prices
true
true
f71d913ea75fe27913d288c4dcaf44d98ac472ac
46
py
Python
.history/ClassFiles/DataTypes/StringData_20201230222853.py
minefarmer/Comprehensive-Python
f97b9b83ec328fc4e4815607e6a65de90bb8de66
[ "Unlicense" ]
null
null
null
.history/ClassFiles/DataTypes/StringData_20201230222853.py
minefarmer/Comprehensive-Python
f97b9b83ec328fc4e4815607e6a65de90bb8de66
[ "Unlicense" ]
null
null
null
.history/ClassFiles/DataTypes/StringData_20201230222853.py
minefarmer/Comprehensive-Python
f97b9b83ec328fc4e4815607e6a65de90bb8de66
[ "Unlicense" ]
null
null
null
""" ThisString Data type(str) """
15.333333
33
0.456522
""" ThisString Data type(str) """
false
true
f71d91b6162a24bdd995d0f0381a0643a85de953
4,535
py
Python
Chapter03/Chapter_3/musegen/musegen.py
YMandCL/Hands-On-Deep-Learning-for-Games
0225661409c3bf59ae6b7996c254bb485ebd10cb
[ "MIT" ]
33
2018-12-29T15:39:20.000Z
2022-03-18T14:36:11.000Z
Chapter03/Chapter_3/musegen/musegen.py
YMandCL/Hands-On-Deep-Learning-for-Games
0225661409c3bf59ae6b7996c254bb485ebd10cb
[ "MIT" ]
4
2019-05-01T08:30:47.000Z
2020-08-14T21:13:53.000Z
Chapter03/Chapter_3/musegen/musegen.py
YMandCL/Hands-On-Deep-Learning-for-Games
0225661409c3bf59ae6b7996c254bb485ebd10cb
[ "MIT" ]
14
2019-01-13T15:52:08.000Z
2021-10-10T06:14:39.000Z
# Currently this script is configured to use the note-generator model. from config import sequence_length, output_dir, note_generator_dir from helper import loadChorales, loadModelAndWeights, createPitchSpecificVocabularies, createDurationVocabularySpecific from music21 import note, instrument, stream, duration import numpy as np import os # disable GPU processing os.environ["CUDA_DEVICE_ORDER"] = "PCI_BUS_ID" os.environ["CUDA_VISIBLE_DEVICES"] = "" # ---------------------------------------------- from keras.utils import to_categorical # select the epoch to use when loading the weights of the model generator generator_epoch = 43 # how many notes to generate ('end' marks are created along the way and the result is split into pieces) number_of_notes = 200 # load chorales to create the vocabularies print('loading chorales...') notes = loadChorales() # create the vocabulary note_vocab, note_names_vocab, note_vocab_categorical = createPitchSpecificVocabularies([x[0] for (x, _) in notes]) duration_vocab = createDurationVocabularySpecific([d for (_, d) in notes]) duration_vocab_categorical = to_categorical(range(len(duration_vocab))) note_to_int = dict((note, number) for number, note in enumerate(note_vocab)) int_to_note = dict((number, note) for number, note in enumerate(note_vocab)) duration_to_int = dict((dur, number) for number, dur in enumerate(duration_vocab)) duration_dim = duration_vocab.shape[0] pitch_dim = np.array(note_vocab).shape[0] print('loading networks...') dir_path = os.path.dirname(os.path.realpath(__file__)) generator = loadModelAndWeights(os.path.join(dir_path, note_generator_dir, 'model.json'), os.path.join(dir_path, note_generator_dir, 'weights-{:02d}.hdf5'.format(generator_epoch))) # make a melody!!! pitch_input = np.eye(pitch_dim)[np.random.choice(pitch_dim, size=sequence_length)] duration_input = np.eye(duration_dim)[np.random.choice(duration_dim, size=sequence_length)] print('generating output...') # generate notes generator_output = [] for _ in range(number_of_notes): # reshape inputs pi = np.reshape(pitch_input, (1, sequence_length, pitch_dim)) di = np.reshape(duration_input, (1, sequence_length, duration_dim)) # make prediction pitch_pred, dur_pred = generator.predict({'pitches_input': pi, 'durations_input': di}, verbose=0) generator_output.append((pitch_pred, dur_pred)) pitch_input = np.vstack([pitch_input, pitch_pred]) pitch_input = pitch_input[1:len(pitch_input)] duration_input = np.vstack([duration_input, dur_pred]) duration_input = duration_input[1:len(duration_input)] output_notes = [(int_to_note[np.argmax(n)], duration_vocab[np.argmax(d)]) for (n, d) in generator_output] output_notes = np.array(output_notes) output_notes = np.reshape(output_notes, (-1, 2)) # output_notes contains: pitch values in midi format (integers), 'rest' marks, 'end' marks # split the generated notes into pieces based on 'end' marks indices = [] for (ind, (n, _)) in enumerate(output_notes): if n == 'end': indices.append(ind) indices = np.insert(np.reshape(indices, (-1)), 0, 0) pieces = [output_notes] if len(indices) > 1: pieces = ([ output_notes[(indices[j] + 1):indices[j + 1] ] for j in range(len(indices) - 1)]) print('writing output to disk...') os.makedirs(os.path.join(dir_path, output_dir, 'note-generator'), exist_ok=True) # output pieces to midi files for index, notes in enumerate(pieces): midi_notes = [] offset = 0 for n, d in notes: # since a duration of 0 is included in the vocabulary (for the 'end' marks), the network may generate a 0 duration for other notes # naively correct and report this erroneous behaviour if abs(float(d)) < 0.001: print('found zero duration') d = '1.0' if n == 'rest': new_note = note.Rest() new_note.duration = duration.Duration(float(d)) new_note.offset = offset new_note.storedInstrument = instrument.Piano() midi_notes.append(new_note) else: new_note = note.Note(int(n)) new_note.duration = duration.Duration(float(d)) new_note.offset = offset new_note.storedInstrument = instrument.Piano() midi_notes.append(new_note) offset += float(d) midi_stream = stream.Stream(midi_notes) midi_stream.write('midi', fp=os.path.join(dir_path, output_dir, 'note-generator', 'sample-{}.mid'.format(index)))
39.094828
138
0.704961
from config import sequence_length, output_dir, note_generator_dir from helper import loadChorales, loadModelAndWeights, createPitchSpecificVocabularies, createDurationVocabularySpecific from music21 import note, instrument, stream, duration import numpy as np import os os.environ["CUDA_DEVICE_ORDER"] = "PCI_BUS_ID" os.environ["CUDA_VISIBLE_DEVICES"] = "" from keras.utils import to_categorical generator_epoch = 43 number_of_notes = 200 print('loading chorales...') notes = loadChorales() note_vocab, note_names_vocab, note_vocab_categorical = createPitchSpecificVocabularies([x[0] for (x, _) in notes]) duration_vocab = createDurationVocabularySpecific([d for (_, d) in notes]) duration_vocab_categorical = to_categorical(range(len(duration_vocab))) note_to_int = dict((note, number) for number, note in enumerate(note_vocab)) int_to_note = dict((number, note) for number, note in enumerate(note_vocab)) duration_to_int = dict((dur, number) for number, dur in enumerate(duration_vocab)) duration_dim = duration_vocab.shape[0] pitch_dim = np.array(note_vocab).shape[0] print('loading networks...') dir_path = os.path.dirname(os.path.realpath(__file__)) generator = loadModelAndWeights(os.path.join(dir_path, note_generator_dir, 'model.json'), os.path.join(dir_path, note_generator_dir, 'weights-{:02d}.hdf5'.format(generator_epoch))) pitch_input = np.eye(pitch_dim)[np.random.choice(pitch_dim, size=sequence_length)] duration_input = np.eye(duration_dim)[np.random.choice(duration_dim, size=sequence_length)] print('generating output...') generator_output = [] for _ in range(number_of_notes): pi = np.reshape(pitch_input, (1, sequence_length, pitch_dim)) di = np.reshape(duration_input, (1, sequence_length, duration_dim)) pitch_pred, dur_pred = generator.predict({'pitches_input': pi, 'durations_input': di}, verbose=0) generator_output.append((pitch_pred, dur_pred)) pitch_input = np.vstack([pitch_input, pitch_pred]) pitch_input = pitch_input[1:len(pitch_input)] duration_input = np.vstack([duration_input, dur_pred]) duration_input = duration_input[1:len(duration_input)] output_notes = [(int_to_note[np.argmax(n)], duration_vocab[np.argmax(d)]) for (n, d) in generator_output] output_notes = np.array(output_notes) output_notes = np.reshape(output_notes, (-1, 2)) indices = [] for (ind, (n, _)) in enumerate(output_notes): if n == 'end': indices.append(ind) indices = np.insert(np.reshape(indices, (-1)), 0, 0) pieces = [output_notes] if len(indices) > 1: pieces = ([ output_notes[(indices[j] + 1):indices[j + 1] ] for j in range(len(indices) - 1)]) print('writing output to disk...') os.makedirs(os.path.join(dir_path, output_dir, 'note-generator'), exist_ok=True) for index, notes in enumerate(pieces): midi_notes = [] offset = 0 for n, d in notes: if abs(float(d)) < 0.001: print('found zero duration') d = '1.0' if n == 'rest': new_note = note.Rest() new_note.duration = duration.Duration(float(d)) new_note.offset = offset new_note.storedInstrument = instrument.Piano() midi_notes.append(new_note) else: new_note = note.Note(int(n)) new_note.duration = duration.Duration(float(d)) new_note.offset = offset new_note.storedInstrument = instrument.Piano() midi_notes.append(new_note) offset += float(d) midi_stream = stream.Stream(midi_notes) midi_stream.write('midi', fp=os.path.join(dir_path, output_dir, 'note-generator', 'sample-{}.mid'.format(index)))
true
true
f71d92446ac29000ec218291728624b2d6598670
295
py
Python
feature_extraction.py
LFRusso/kinnect-keyboard
52c4a205528d524ae07eb15c15f3f08300110635
[ "MIT" ]
null
null
null
feature_extraction.py
LFRusso/kinnect-keyboard
52c4a205528d524ae07eb15c15f3f08300110635
[ "MIT" ]
null
null
null
feature_extraction.py
LFRusso/kinnect-keyboard
52c4a205528d524ae07eb15c15f3f08300110635
[ "MIT" ]
null
null
null
import mahotas as mt from skimage.feature import hog def extract_features(img_gray, img_mask): zernike = mt.features.zernike_moments(img_gray, 3) fd = hog(img_mask, orientations=9, pixels_per_cell=(8, 8), cells_per_block=(2, 2)) return list(zernike)+list(fd)
36.875
62
0.688136
import mahotas as mt from skimage.feature import hog def extract_features(img_gray, img_mask): zernike = mt.features.zernike_moments(img_gray, 3) fd = hog(img_mask, orientations=9, pixels_per_cell=(8, 8), cells_per_block=(2, 2)) return list(zernike)+list(fd)
true
true
f71d939ead9c998360910e553be21fdb201e464c
341
py
Python
setup.py
Edward-FitzSimons/TetrisAgent_ML
191a8c198941444d6dda8374eac796d8455ba003
[ "MIT" ]
null
null
null
setup.py
Edward-FitzSimons/TetrisAgent_ML
191a8c198941444d6dda8374eac796d8455ba003
[ "MIT" ]
null
null
null
setup.py
Edward-FitzSimons/TetrisAgent_ML
191a8c198941444d6dda8374eac796d8455ba003
[ "MIT" ]
null
null
null
from setuptools import setup, find_packages setup( name="tetrisRL", version="0.5", author="Jay Butera", author_email="buterajay@gmail.com", license="MIT", url="https://github.com/jaybutera/tetrisRL", packages=find_packages(), install_requires=[ 'numpy>=1.13', 'torch' ], )
21.3125
49
0.592375
from setuptools import setup, find_packages setup( name="tetrisRL", version="0.5", author="Jay Butera", author_email="buterajay@gmail.com", license="MIT", url="https://github.com/jaybutera/tetrisRL", packages=find_packages(), install_requires=[ 'numpy>=1.13', 'torch' ], )
true
true
f71d93e8560f437371b035f0098f804c534076a4
524
py
Python
hw1/connect_cisco_dict.py
rshetty07/pyneta
bb82d516ae3727161a5f77c3a6a5f4294f6e0ba1
[ "Apache-2.0" ]
null
null
null
hw1/connect_cisco_dict.py
rshetty07/pyneta
bb82d516ae3727161a5f77c3a6a5f4294f6e0ba1
[ "Apache-2.0" ]
null
null
null
hw1/connect_cisco_dict.py
rshetty07/pyneta
bb82d516ae3727161a5f77c3a6a5f4294f6e0ba1
[ "Apache-2.0" ]
null
null
null
from netmiko import ConnectHandler from getpass import getpass device1 = { "host": 'cisco3.lasthop.io', "username": 'pyclass', "password": getpass(), "device_type": 'cisco_ios', # "session_log": 'my_session.txt' } device2 = { "host": 'cisco4.lasthop.io', "username": 'pyclass', "password": getpass(), "device_type": 'cisco_ios', # "session_log": 'my_session.txt' } for device in (device1, device2): net_connect = ConnectHandler(**device) print(net_connect.find_prompt())
22.782609
42
0.645038
from netmiko import ConnectHandler from getpass import getpass device1 = { "host": 'cisco3.lasthop.io', "username": 'pyclass', "password": getpass(), "device_type": 'cisco_ios', } device2 = { "host": 'cisco4.lasthop.io', "username": 'pyclass', "password": getpass(), "device_type": 'cisco_ios', } for device in (device1, device2): net_connect = ConnectHandler(**device) print(net_connect.find_prompt())
true
true
f71d94a79dd3fc9185f2556c95a6d1391c0ca76d
4,023
py
Python
bin/GetUSGSNLCDForDEMExtent.py
selimnairb/EcohydroLib
38aa4020c88a57c9d2f1fb66acd393b6e989e897
[ "Unlicense" ]
12
2015-03-03T05:08:55.000Z
2021-01-27T12:38:33.000Z
bin/GetUSGSNLCDForDEMExtent.py
selimnairb/EcohydroLib
38aa4020c88a57c9d2f1fb66acd393b6e989e897
[ "Unlicense" ]
3
2016-01-04T15:05:43.000Z
2019-02-01T02:19:45.000Z
bin/GetUSGSNLCDForDEMExtent.py
selimnairb/EcohydroLib
38aa4020c88a57c9d2f1fb66acd393b6e989e897
[ "Unlicense" ]
5
2015-02-15T18:20:38.000Z
2017-05-21T13:14:32.000Z
#!/usr/bin/env python """@package GetUSGSNLCDForBoundingbox @brief Download NLCD 2006 or 2011 data hosted by U.S. Geological Survey Web Coverage Service (WCS) interface. This software is provided free of charge under the New BSD License. Please see the following license information: Copyright (c) 2015, University of North Carolina at Chapel Hill All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. * Neither the name of the University of North Carolina at Chapel Hill nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE UNIVERSITY OF NORTH CAROLINA AT CHAPEL HILL BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. @author Brian Miles <brian_miles@unc.edu> """ import sys import os import argparse import traceback from ecohydrolib.command.exceptions import * from ecohydrolib.command.landcover import USGSWCSNLCD, KNOWN_LC_TYPES, DEFAULT_LC_TYPE if __name__ == "__main__": # Handle command line options parser = argparse.ArgumentParser(description='Download NLCD data via USGS-hosted WCS web service') parser.add_argument('-i', '--configfile', dest='configfile', required=False, help='The configuration file.') parser.add_argument('-p', '--projectDir', dest='projectDir', required=True, help='The directory to which metadata, intermediate, and final files should be saved') parser.add_argument('-f', '--outfile', dest='outfile', required=False, help='The name of the DEM file to be written. File extension ".tif" will be added.') parser.add_argument('-t', '--lctype', dest='lctype', required=False, default=DEFAULT_LC_TYPE, choices=KNOWN_LC_TYPES, help='Type of NLCD landcover data to download. ' + "Defaults to '{0}'.".format(DEFAULT_LC_TYPE)) parser.add_argument('--overwrite', dest='overwrite', action='store_true', required=False, help='Overwrite existing data in project directory. If not specified, program will halt if a dataset already exists.') parser.add_argument('-v', '--verbose', dest='verbose', action='store_true', help='Print detailed information about what the program is doing') args = parser.parse_args() configFile = None if args.configfile: configFile = args.configfile command = USGSWCSNLCD(args.projectDir, configFile) exitCode = os.EX_OK try: command.run(lctype=args.lctype, outfile=args.outfile, verbose=args.verbose, overwrite=args.overwrite) except CommandException as e: traceback.print_exc(file=sys.stderr) exitCode = os.EX_DATAERR sys.exit(exitCode)
49.666667
143
0.712155
import sys import os import argparse import traceback from ecohydrolib.command.exceptions import * from ecohydrolib.command.landcover import USGSWCSNLCD, KNOWN_LC_TYPES, DEFAULT_LC_TYPE if __name__ == "__main__": parser = argparse.ArgumentParser(description='Download NLCD data via USGS-hosted WCS web service') parser.add_argument('-i', '--configfile', dest='configfile', required=False, help='The configuration file.') parser.add_argument('-p', '--projectDir', dest='projectDir', required=True, help='The directory to which metadata, intermediate, and final files should be saved') parser.add_argument('-f', '--outfile', dest='outfile', required=False, help='The name of the DEM file to be written. File extension ".tif" will be added.') parser.add_argument('-t', '--lctype', dest='lctype', required=False, default=DEFAULT_LC_TYPE, choices=KNOWN_LC_TYPES, help='Type of NLCD landcover data to download. ' + "Defaults to '{0}'.".format(DEFAULT_LC_TYPE)) parser.add_argument('--overwrite', dest='overwrite', action='store_true', required=False, help='Overwrite existing data in project directory. If not specified, program will halt if a dataset already exists.') parser.add_argument('-v', '--verbose', dest='verbose', action='store_true', help='Print detailed information about what the program is doing') args = parser.parse_args() configFile = None if args.configfile: configFile = args.configfile command = USGSWCSNLCD(args.projectDir, configFile) exitCode = os.EX_OK try: command.run(lctype=args.lctype, outfile=args.outfile, verbose=args.verbose, overwrite=args.overwrite) except CommandException as e: traceback.print_exc(file=sys.stderr) exitCode = os.EX_DATAERR sys.exit(exitCode)
true
true
f71d9562c12f81854e60e618863958ef2c14c867
2,016
py
Python
tests/pytests/functional/cli/test_salt_cloud.py
babs/salt
c536ea716d5308880b244e7980f4b659d86fc104
[ "Apache-2.0" ]
9,425
2015-01-01T05:59:24.000Z
2022-03-31T20:44:05.000Z
tests/pytests/functional/cli/test_salt_cloud.py
babs/salt
c536ea716d5308880b244e7980f4b659d86fc104
[ "Apache-2.0" ]
33,507
2015-01-01T00:19:56.000Z
2022-03-31T23:48:20.000Z
tests/pytests/functional/cli/test_salt_cloud.py
babs/salt
c536ea716d5308880b244e7980f4b659d86fc104
[ "Apache-2.0" ]
5,810
2015-01-01T19:11:45.000Z
2022-03-31T02:37:20.000Z
""" tests.pytests.integration.cli.test_salt_cloud ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ """ import pytest pytest.importorskip("libcloud", reason="salt-cloud requires >= libcloud 0.11.4") def test_function_arguments(salt_cloud_cli): ret = salt_cloud_cli.run("--function", "show_image", "-h") assert ret.exitcode != 0 assert ( "error: --function expects two arguments: <function-name> <provider>" in ret.stderr ) def test_list_providers_accepts_no_arguments(salt_cloud_cli): ret = salt_cloud_cli.run("--list-providers", "ec2") assert ret.exitcode != 0 assert "error: '--list-providers' does not accept any arguments" in ret.stderr @pytest.mark.parametrize( "query_option", ["--query", "--full-query", "--select-query", "--list-providers"] ) def test_mutually_exclusive_query_options(salt_cloud_cli, query_option): if query_option != "--query": conflicting_option = "--query" elif query_option != "--full-query": conflicting_option = "--full-query" elif query_option != "--select-query": conflicting_option = "--select-query" elif query_option != "--list-providers": conflicting_option = "--list-providers" ret = salt_cloud_cli.run(query_option, conflicting_option) assert ret.exitcode != 0 assert "are mutually exclusive. Please only choose one of them" in ret.stderr @pytest.mark.parametrize( "list_option", ["--list-locations", "--list-images", "--list-sizes"] ) def test_mutually_exclusive_list_options(salt_cloud_cli, list_option): if list_option != "--list-locations": conflicting__option = "--list-locations" elif list_option != "--list-images": conflicting__option = "--list-images" elif list_option != "--list-sizes": conflicting__option = "--list-sizes" ret = salt_cloud_cli.run(list_option, "ec2", conflicting__option, "ec2") assert ret.exitcode != 0 assert "are mutually exclusive. Please only choose one of them" in ret.stderr
35.368421
85
0.672619
import pytest pytest.importorskip("libcloud", reason="salt-cloud requires >= libcloud 0.11.4") def test_function_arguments(salt_cloud_cli): ret = salt_cloud_cli.run("--function", "show_image", "-h") assert ret.exitcode != 0 assert ( "error: --function expects two arguments: <function-name> <provider>" in ret.stderr ) def test_list_providers_accepts_no_arguments(salt_cloud_cli): ret = salt_cloud_cli.run("--list-providers", "ec2") assert ret.exitcode != 0 assert "error: '--list-providers' does not accept any arguments" in ret.stderr @pytest.mark.parametrize( "query_option", ["--query", "--full-query", "--select-query", "--list-providers"] ) def test_mutually_exclusive_query_options(salt_cloud_cli, query_option): if query_option != "--query": conflicting_option = "--query" elif query_option != "--full-query": conflicting_option = "--full-query" elif query_option != "--select-query": conflicting_option = "--select-query" elif query_option != "--list-providers": conflicting_option = "--list-providers" ret = salt_cloud_cli.run(query_option, conflicting_option) assert ret.exitcode != 0 assert "are mutually exclusive. Please only choose one of them" in ret.stderr @pytest.mark.parametrize( "list_option", ["--list-locations", "--list-images", "--list-sizes"] ) def test_mutually_exclusive_list_options(salt_cloud_cli, list_option): if list_option != "--list-locations": conflicting__option = "--list-locations" elif list_option != "--list-images": conflicting__option = "--list-images" elif list_option != "--list-sizes": conflicting__option = "--list-sizes" ret = salt_cloud_cli.run(list_option, "ec2", conflicting__option, "ec2") assert ret.exitcode != 0 assert "are mutually exclusive. Please only choose one of them" in ret.stderr
true
true
f71d9631429f556fd55add33baaf1526744d5702
22,864
py
Python
nipype/interfaces/slicer/generate_classes.py
koenhelwegen/nipype
87d04aeb4cb78c95345506a0e5e3571d380ed1d1
[ "Apache-2.0" ]
null
null
null
nipype/interfaces/slicer/generate_classes.py
koenhelwegen/nipype
87d04aeb4cb78c95345506a0e5e3571d380ed1d1
[ "Apache-2.0" ]
null
null
null
nipype/interfaces/slicer/generate_classes.py
koenhelwegen/nipype
87d04aeb4cb78c95345506a0e5e3571d380ed1d1
[ "Apache-2.0" ]
1
2020-10-22T12:50:23.000Z
2020-10-22T12:50:23.000Z
# -*- coding: utf-8 -*- """This script generates Slicer Interfaces based on the CLI modules XML. CLI modules are selected from the hardcoded list below and generated code is placed in the cli_modules.py file (and imported in __init__.py). For this to work correctly you must have your CLI executabes in $PATH""" import xml.dom.minidom import subprocess import os from shutil import rmtree import keyword python_keywords = ( keyword.kwlist ) # If c++ SEM module uses one of these key words as a command line parameter, we need to modify variable def force_to_valid_python_variable_name(old_name): """Valid c++ names are not always valid in python, so provide alternate naming >>> force_to_valid_python_variable_name('lambda') 'opt_lambda' >>> force_to_valid_python_variable_name('inputVolume') 'inputVolume' """ new_name = old_name new_name = new_name.lstrip().rstrip() if old_name in python_keywords: new_name = "opt_" + old_name return new_name def add_class_to_package(class_codes, class_names, module_name, package_dir): module_python_filename = os.path.join(package_dir, "%s.py" % module_name) f_m = open(module_python_filename, "w") f_i = open(os.path.join(package_dir, "__init__.py"), "a+") f_m.write( """# -*- coding: utf-8 -*- \"\"\"Autogenerated file - DO NOT EDIT If you spot a bug, please report it on the mailing list and/or change the generator.\"\"\"\n\n""" ) imports = """\ from ..base import (CommandLine, CommandLineInputSpec, SEMLikeCommandLine, TraitedSpec, File, Directory, traits, isdefined, InputMultiPath, OutputMultiPath) import os\n\n\n""" f_m.write(imports) f_m.write("\n\n".join(class_codes)) f_i.write("from %s import %s\n" % (module_name, ", ".join(class_names))) f_m.close() f_i.close() def crawl_code_struct(code_struct, package_dir): subpackages = [] for k, v in code_struct.items(): if isinstance(v, str) or isinstance(v, (str, bytes)): module_name = k.lower() class_name = k class_code = v add_class_to_package([class_code], [class_name], module_name, package_dir) else: l1 = {} l2 = {} for key in list(v.keys()): if isinstance(v[key], str) or isinstance(v[key], (str, bytes)): l1[key] = v[key] else: l2[key] = v[key] if l2: v = l2 subpackages.append(k.lower()) f_i = open(os.path.join(package_dir, "__init__.py"), "a+") f_i.write("from %s import *\n" % k.lower()) f_i.close() new_pkg_dir = os.path.join(package_dir, k.lower()) if os.path.exists(new_pkg_dir): rmtree(new_pkg_dir) os.mkdir(new_pkg_dir) crawl_code_struct(v, new_pkg_dir) if l1: for ik, iv in l1.items(): crawl_code_struct({ik: {ik: iv}}, new_pkg_dir) elif l1: v = l1 module_name = k.lower() add_class_to_package( list(v.values()), list(v.keys()), module_name, package_dir ) if subpackages: f = open(os.path.join(package_dir, "setup.py"), "w") f.write( """# emacs: -*- mode: python; py-indent-offset: 4; indent-tabs-mode: nil -*- # vi: set ft=python sts=4 ts=4 sw=4 et: def configuration(parent_package='',top_path=None): from numpy.distutils.misc_util import Configuration config = Configuration('{pkg_name}', parent_package, top_path) {sub_pks} return config if __name__ == '__main__': from numpy.distutils.core import setup setup(**configuration(top_path='').todict()) """.format( pkg_name=package_dir.split("/")[-1], sub_pks="\n ".join( [ "config.add_data_dir('%s')" % sub_pkg for sub_pkg in subpackages ] ), ) ) f.close() def generate_all_classes( modules_list=[], launcher=[], redirect_x=False, mipav_hacks=False ): """modules_list contains all the SEM compliant tools that should have wrappers created for them. launcher containtains the command line prefix wrapper arugments needed to prepare a proper environment for each of the modules. """ all_code = {} for module in modules_list: print("=" * 80) print("Generating Definition for module {0}".format(module)) print("^" * 80) package, code, module = generate_class( module, launcher, redirect_x=redirect_x, mipav_hacks=mipav_hacks ) cur_package = all_code module_name = package.strip().split(" ")[0].split(".")[-1] for package in package.strip().split(" ")[0].split(".")[:-1]: if package not in cur_package: cur_package[package] = {} cur_package = cur_package[package] if module_name not in cur_package: cur_package[module_name] = {} cur_package[module_name][module] = code if os.path.exists("__init__.py"): os.unlink("__init__.py") crawl_code_struct(all_code, os.getcwd()) def generate_class( module, launcher, strip_module_name_prefix=True, redirect_x=False, mipav_hacks=False ): dom = grab_xml(module, launcher, mipav_hacks=mipav_hacks) if strip_module_name_prefix: module_name = module.split(".")[-1] else: module_name = module inputTraits = [] outputTraits = [] outputs_filenames = {} # self._outputs_nodes = [] class_string = '"""' for desc_str in [ "title", "category", "description", "version", "documentation-url", "license", "contributor", "acknowledgements", ]: el = dom.getElementsByTagName(desc_str) if el and el[0].firstChild and el[0].firstChild.nodeValue.strip(): class_string += ( desc_str + ": " + el[0].firstChild.nodeValue.strip() + "\n\n" ) if desc_str == "category": category = el[0].firstChild.nodeValue.strip() class_string += '"""' for paramGroup in dom.getElementsByTagName("parameters"): indices = paramGroup.getElementsByTagName("index") max_index = 0 for index in indices: if int(index.firstChild.nodeValue) > max_index: max_index = int(index.firstChild.nodeValue) for param in paramGroup.childNodes: if param.nodeName in ["label", "description", "#text", "#comment"]: continue traitsParams = {} longFlagNode = param.getElementsByTagName("longflag") if longFlagNode: # Prefer to use longFlag as name if it is given, rather than the parameter name longFlagName = longFlagNode[0].firstChild.nodeValue # SEM automatically strips prefixed "--" or "-" from from xml before processing # we need to replicate that behavior here The following # two nodes in xml have the same behavior in the program # <longflag>--test</longflag> # <longflag>test</longflag> longFlagName = longFlagName.lstrip(" -").rstrip(" ") name = longFlagName name = force_to_valid_python_variable_name(name) traitsParams["argstr"] = "--" + longFlagName + " " else: name = param.getElementsByTagName("name")[0].firstChild.nodeValue name = force_to_valid_python_variable_name(name) if param.getElementsByTagName("index"): traitsParams["argstr"] = "" else: traitsParams["argstr"] = "--" + name + " " if ( param.getElementsByTagName("description") and param.getElementsByTagName("description")[0].firstChild ): traitsParams["desc"] = ( param.getElementsByTagName("description")[0] .firstChild.nodeValue.replace('"', '\\"') .replace("\n", ", ") ) argsDict = { "directory": "%s", "file": "%s", "integer": "%d", "double": "%f", "float": "%f", "image": "%s", "transform": "%s", "boolean": "", "string-enumeration": "%s", "string": "%s", "integer-enumeration": "%s", "table": "%s", "point": "%s", "region": "%s", "geometry": "%s", } if param.nodeName.endswith("-vector"): traitsParams["argstr"] += "%s" else: traitsParams["argstr"] += argsDict[param.nodeName] index = param.getElementsByTagName("index") if index: traitsParams["position"] = int(index[0].firstChild.nodeValue) - ( max_index + 1 ) desc = param.getElementsByTagName("description") if index: traitsParams["desc"] = desc[0].firstChild.nodeValue typesDict = { "integer": "traits.Int", "double": "traits.Float", "float": "traits.Float", "image": "File", "transform": "File", "boolean": "traits.Bool", "string": "traits.Str", "file": "File", "geometry": "File", "directory": "Directory", "table": "File", "point": "traits.List", "region": "traits.List", } if param.nodeName.endswith("-enumeration"): type = "traits.Enum" values = [ '"%s"' % str(el.firstChild.nodeValue).replace('"', "") for el in param.getElementsByTagName("element") ] elif param.nodeName.endswith("-vector"): type = "InputMultiPath" if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ]: values = [ "%s(exists=True)" % typesDict[param.nodeName.replace("-vector", "")] ] else: values = [typesDict[param.nodeName.replace("-vector", "")]] if mipav_hacks is True: traitsParams["sep"] = ";" else: traitsParams["sep"] = "," elif param.getAttribute("multiple") == "true": type = "InputMultiPath" if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ]: values = ["%s(exists=True)" % typesDict[param.nodeName]] elif param.nodeName in ["point", "region"]: values = [ "%s(traits.Float(), minlen=3, maxlen=3)" % typesDict[param.nodeName] ] else: values = [typesDict[param.nodeName]] traitsParams["argstr"] += "..." else: values = [] type = typesDict[param.nodeName] if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ]: if not param.getElementsByTagName("channel"): raise RuntimeError( "Insufficient XML specification: each element of type 'file', 'directory', 'image', 'geometry', 'transform', or 'table' requires 'channel' field.\n{0}".format( traitsParams ) ) elif ( param.getElementsByTagName("channel")[0].firstChild.nodeValue == "output" ): traitsParams["hash_files"] = False inputTraits.append( "%s = traits.Either(traits.Bool, %s(%s), %s)" % ( name, type, parse_values(values).replace("exists=True", ""), parse_params(traitsParams), ) ) traitsParams["exists"] = True traitsParams.pop("argstr") traitsParams.pop("hash_files") outputTraits.append( "%s = %s(%s%s)" % ( name, type.replace("Input", "Output"), parse_values(values), parse_params(traitsParams), ) ) outputs_filenames[name] = gen_filename_from_param(param, name) elif ( param.getElementsByTagName("channel")[0].firstChild.nodeValue == "input" ): if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ] and type not in ["InputMultiPath", "traits.List"]: traitsParams["exists"] = True inputTraits.append( "%s = %s(%s%s)" % (name, type, parse_values(values), parse_params(traitsParams)) ) else: raise RuntimeError( "Insufficient XML specification: each element of type 'file', 'directory', 'image', 'geometry', 'transform', or 'table' requires 'channel' field to be in ['input','output'].\n{0}".format( traitsParams ) ) else: # For all other parameter types, they are implicitly only input types inputTraits.append( "%s = %s(%s%s)" % (name, type, parse_values(values), parse_params(traitsParams)) ) if mipav_hacks: blacklisted_inputs = ["maxMemoryUsage"] inputTraits = [ trait for trait in inputTraits if trait.split()[0] not in blacklisted_inputs ] compulsory_inputs = [ 'xDefaultMem = traits.Int(desc="Set default maximum heap size", argstr="-xDefaultMem %d")', 'xMaxProcess = traits.Int(1, desc="Set default maximum number of processes.", argstr="-xMaxProcess %d", usedefault=True)', ] inputTraits += compulsory_inputs input_spec_code = "class " + module_name + "InputSpec(CommandLineInputSpec):\n" for trait in inputTraits: input_spec_code += " " + trait + "\n" output_spec_code = "class " + module_name + "OutputSpec(TraitedSpec):\n" if not outputTraits: output_spec_code += " pass\n" else: for trait in outputTraits: output_spec_code += " " + trait + "\n" output_filenames_code = "_outputs_filenames = {" output_filenames_code += ",".join( ["'%s':'%s'" % (key, value) for key, value in outputs_filenames.items()] ) output_filenames_code += "}" input_spec_code += "\n\n" output_spec_code += "\n\n" template = """class %module_name%(SEMLikeCommandLine): %class_str% input_spec = %module_name%InputSpec output_spec = %module_name%OutputSpec _cmd = "%launcher% %name% " %output_filenames_code%\n""" template += " _redirect_x = {0}\n".format(str(redirect_x)) main_class = ( template.replace("%class_str%", class_string) .replace("%module_name%", module_name) .replace("%name%", module) .replace("%output_filenames_code%", output_filenames_code) .replace("%launcher%", " ".join(launcher)) ) return category, input_spec_code + output_spec_code + main_class, module_name def grab_xml(module, launcher, mipav_hacks=False): # cmd = CommandLine(command = "Slicer3", args="--launch %s --xml"%module) # ret = cmd.run() command_list = launcher[:] # force copy to preserve original command_list.extend([module, "--xml"]) final_command = " ".join(command_list) xmlReturnValue = subprocess.Popen( final_command, stdout=subprocess.PIPE, shell=True ).communicate()[0] if mipav_hacks: # workaround for a jist bug https://www.nitrc.org/tracker/index.php?func=detail&aid=7234&group_id=228&atid=942 new_xml = "" replace_closing_tag = False for line in xmlReturnValue.splitlines(): if line.strip() == "<file collection: semi-colon delimited list>": new_xml += "<file-vector>\n" replace_closing_tag = True elif replace_closing_tag and line.strip() == "</file>": new_xml += "</file-vector>\n" replace_closing_tag = False else: new_xml += line + "\n" xmlReturnValue = new_xml # workaround for a JIST bug https://www.nitrc.org/tracker/index.php?func=detail&aid=7233&group_id=228&atid=942 if xmlReturnValue.strip().endswith("XML"): xmlReturnValue = xmlReturnValue.strip()[:-3] if xmlReturnValue.strip().startswith("Error: Unable to set default atlas"): xmlReturnValue = xmlReturnValue.strip()[ len("Error: Unable to set default atlas") : ] try: dom = xml.dom.minidom.parseString(xmlReturnValue.strip()) except Exception as e: print(xmlReturnValue.strip()) raise e return dom # if ret.runtime.returncode == 0: # return xml.dom.minidom.parseString(ret.runtime.stdout) # else: # raise Exception(cmd.cmdline + " failed:\n%s"%ret.runtime.stderr) def parse_params(params): list = [] for key, value in params.items(): if isinstance(value, (str, bytes)): list.append('%s="%s"' % (key, value.replace('"', "'"))) else: list.append("%s=%s" % (key, value)) return ", ".join(list) def parse_values(values): values = ["%s" % value for value in values] if len(values) > 0: retstr = ", ".join(values) + ", " else: retstr = "" return retstr def gen_filename_from_param(param, base): fileExtensions = param.getAttribute("fileExtensions") if fileExtensions: # It is possible that multiple file extensions can be specified in a # comma separated list, This will extract just the first extension firstFileExtension = fileExtensions.split(",")[0] ext = firstFileExtension else: ext = { "image": ".nii", "transform": ".mat", "file": "", "directory": "", "geometry": ".vtk", }[param.nodeName] return base + ext if __name__ == "__main__": # NOTE: For now either the launcher needs to be found on the default path, or # every tool in the modules list must be found on the default path # AND calling the module with --xml must be supported and compliant. modules_list = [ "MedianImageFilter", "CheckerBoardFilter", "EMSegmentCommandLine", "GrayscaleFillHoleImageFilter", # 'CreateDICOMSeries', #missing channel "TractographyLabelMapSeeding", "IntensityDifferenceMetric", "DWIToDTIEstimation", "MaskScalarVolume", "ImageLabelCombine", "DTIimport", "OtsuThresholdImageFilter", "ExpertAutomatedRegistration", "ThresholdScalarVolume", "DWIUnbiasedNonLocalMeansFilter", "BRAINSFit", "MergeModels", "ResampleDTIVolume", "MultiplyScalarVolumes", "LabelMapSmoothing", "RigidRegistration", "VotingBinaryHoleFillingImageFilter", "BRAINSROIAuto", "RobustStatisticsSegmenter", "GradientAnisotropicDiffusion", "ProbeVolumeWithModel", "ModelMaker", "ExtractSkeleton", "GrayscaleGrindPeakImageFilter", "N4ITKBiasFieldCorrection", "BRAINSResample", "DTIexport", "VBRAINSDemonWarp", "ResampleScalarVectorDWIVolume", "ResampleScalarVolume", "OtsuThresholdSegmentation", # 'ExecutionModelTour', "HistogramMatching", "BRAINSDemonWarp", "ModelToLabelMap", "GaussianBlurImageFilter", "DiffusionWeightedVolumeMasking", "GrayscaleModelMaker", "CastScalarVolume", "DicomToNrrdConverter", "AffineRegistration", "AddScalarVolumes", "LinearRegistration", "SimpleRegionGrowingSegmentation", "DWIJointRicianLMMSEFilter", "MultiResolutionAffineRegistration", "SubtractScalarVolumes", "DWIRicianLMMSEFilter", "OrientScalarVolume", "FiducialRegistration", "BSplineDeformableRegistration", "CurvatureAnisotropicDiffusion", "PETStandardUptakeValueComputation", "DiffusionTensorScalarMeasurements", "ACPCTransform", "EMSegmentTransformToNewFormat", "BSplineToDeformationField", ] # SlicerExecutionModel compliant tools that are usually statically built, and don't need the Slicer3 --launcher generate_all_classes(modules_list=modules_list, launcher=[]) # Tools compliant with SlicerExecutionModel called from the Slicer environment (for shared lib compatibility) # launcher = ['/home/raid3/gorgolewski/software/slicer/Slicer', '--launch'] # generate_all_classes(modules_list=modules_list, launcher=launcher) # generate_all_classes(modules_list=['BRAINSABC'], launcher=[] )
37.729373
212
0.532497
import xml.dom.minidom import subprocess import os from shutil import rmtree import keyword python_keywords = ( keyword.kwlist ) def force_to_valid_python_variable_name(old_name): new_name = old_name new_name = new_name.lstrip().rstrip() if old_name in python_keywords: new_name = "opt_" + old_name return new_name def add_class_to_package(class_codes, class_names, module_name, package_dir): module_python_filename = os.path.join(package_dir, "%s.py" % module_name) f_m = open(module_python_filename, "w") f_i = open(os.path.join(package_dir, "__init__.py"), "a+") f_m.write( """# -*- coding: utf-8 -*- \"\"\"Autogenerated file - DO NOT EDIT If you spot a bug, please report it on the mailing list and/or change the generator.\"\"\"\n\n""" ) imports = """\ from ..base import (CommandLine, CommandLineInputSpec, SEMLikeCommandLine, TraitedSpec, File, Directory, traits, isdefined, InputMultiPath, OutputMultiPath) import os\n\n\n""" f_m.write(imports) f_m.write("\n\n".join(class_codes)) f_i.write("from %s import %s\n" % (module_name, ", ".join(class_names))) f_m.close() f_i.close() def crawl_code_struct(code_struct, package_dir): subpackages = [] for k, v in code_struct.items(): if isinstance(v, str) or isinstance(v, (str, bytes)): module_name = k.lower() class_name = k class_code = v add_class_to_package([class_code], [class_name], module_name, package_dir) else: l1 = {} l2 = {} for key in list(v.keys()): if isinstance(v[key], str) or isinstance(v[key], (str, bytes)): l1[key] = v[key] else: l2[key] = v[key] if l2: v = l2 subpackages.append(k.lower()) f_i = open(os.path.join(package_dir, "__init__.py"), "a+") f_i.write("from %s import *\n" % k.lower()) f_i.close() new_pkg_dir = os.path.join(package_dir, k.lower()) if os.path.exists(new_pkg_dir): rmtree(new_pkg_dir) os.mkdir(new_pkg_dir) crawl_code_struct(v, new_pkg_dir) if l1: for ik, iv in l1.items(): crawl_code_struct({ik: {ik: iv}}, new_pkg_dir) elif l1: v = l1 module_name = k.lower() add_class_to_package( list(v.values()), list(v.keys()), module_name, package_dir ) if subpackages: f = open(os.path.join(package_dir, "setup.py"), "w") f.write( """# emacs: -*- mode: python; py-indent-offset: 4; indent-tabs-mode: nil -*- # vi: set ft=python sts=4 ts=4 sw=4 et: def configuration(parent_package='',top_path=None): from numpy.distutils.misc_util import Configuration config = Configuration('{pkg_name}', parent_package, top_path) {sub_pks} return config if __name__ == '__main__': from numpy.distutils.core import setup setup(**configuration(top_path='').todict()) """.format( pkg_name=package_dir.split("/")[-1], sub_pks="\n ".join( [ "config.add_data_dir('%s')" % sub_pkg for sub_pkg in subpackages ] ), ) ) f.close() def generate_all_classes( modules_list=[], launcher=[], redirect_x=False, mipav_hacks=False ): all_code = {} for module in modules_list: print("=" * 80) print("Generating Definition for module {0}".format(module)) print("^" * 80) package, code, module = generate_class( module, launcher, redirect_x=redirect_x, mipav_hacks=mipav_hacks ) cur_package = all_code module_name = package.strip().split(" ")[0].split(".")[-1] for package in package.strip().split(" ")[0].split(".")[:-1]: if package not in cur_package: cur_package[package] = {} cur_package = cur_package[package] if module_name not in cur_package: cur_package[module_name] = {} cur_package[module_name][module] = code if os.path.exists("__init__.py"): os.unlink("__init__.py") crawl_code_struct(all_code, os.getcwd()) def generate_class( module, launcher, strip_module_name_prefix=True, redirect_x=False, mipav_hacks=False ): dom = grab_xml(module, launcher, mipav_hacks=mipav_hacks) if strip_module_name_prefix: module_name = module.split(".")[-1] else: module_name = module inputTraits = [] outputTraits = [] outputs_filenames = {} class_string = '"""' for desc_str in [ "title", "category", "description", "version", "documentation-url", "license", "contributor", "acknowledgements", ]: el = dom.getElementsByTagName(desc_str) if el and el[0].firstChild and el[0].firstChild.nodeValue.strip(): class_string += ( desc_str + ": " + el[0].firstChild.nodeValue.strip() + "\n\n" ) if desc_str == "category": category = el[0].firstChild.nodeValue.strip() class_string += '"""' for paramGroup in dom.getElementsByTagName("parameters"): indices = paramGroup.getElementsByTagName("index") max_index = 0 for index in indices: if int(index.firstChild.nodeValue) > max_index: max_index = int(index.firstChild.nodeValue) for param in paramGroup.childNodes: if param.nodeName in ["label", "description", "#text", "#comment"]: continue traitsParams = {} longFlagNode = param.getElementsByTagName("longflag") if longFlagNode: longFlagName = longFlagNode[0].firstChild.nodeValue longFlagName = longFlagName.lstrip(" -").rstrip(" ") name = longFlagName name = force_to_valid_python_variable_name(name) traitsParams["argstr"] = "--" + longFlagName + " " else: name = param.getElementsByTagName("name")[0].firstChild.nodeValue name = force_to_valid_python_variable_name(name) if param.getElementsByTagName("index"): traitsParams["argstr"] = "" else: traitsParams["argstr"] = "--" + name + " " if ( param.getElementsByTagName("description") and param.getElementsByTagName("description")[0].firstChild ): traitsParams["desc"] = ( param.getElementsByTagName("description")[0] .firstChild.nodeValue.replace('"', '\\"') .replace("\n", ", ") ) argsDict = { "directory": "%s", "file": "%s", "integer": "%d", "double": "%f", "float": "%f", "image": "%s", "transform": "%s", "boolean": "", "string-enumeration": "%s", "string": "%s", "integer-enumeration": "%s", "table": "%s", "point": "%s", "region": "%s", "geometry": "%s", } if param.nodeName.endswith("-vector"): traitsParams["argstr"] += "%s" else: traitsParams["argstr"] += argsDict[param.nodeName] index = param.getElementsByTagName("index") if index: traitsParams["position"] = int(index[0].firstChild.nodeValue) - ( max_index + 1 ) desc = param.getElementsByTagName("description") if index: traitsParams["desc"] = desc[0].firstChild.nodeValue typesDict = { "integer": "traits.Int", "double": "traits.Float", "float": "traits.Float", "image": "File", "transform": "File", "boolean": "traits.Bool", "string": "traits.Str", "file": "File", "geometry": "File", "directory": "Directory", "table": "File", "point": "traits.List", "region": "traits.List", } if param.nodeName.endswith("-enumeration"): type = "traits.Enum" values = [ '"%s"' % str(el.firstChild.nodeValue).replace('"', "") for el in param.getElementsByTagName("element") ] elif param.nodeName.endswith("-vector"): type = "InputMultiPath" if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ]: values = [ "%s(exists=True)" % typesDict[param.nodeName.replace("-vector", "")] ] else: values = [typesDict[param.nodeName.replace("-vector", "")]] if mipav_hacks is True: traitsParams["sep"] = ";" else: traitsParams["sep"] = "," elif param.getAttribute("multiple") == "true": type = "InputMultiPath" if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ]: values = ["%s(exists=True)" % typesDict[param.nodeName]] elif param.nodeName in ["point", "region"]: values = [ "%s(traits.Float(), minlen=3, maxlen=3)" % typesDict[param.nodeName] ] else: values = [typesDict[param.nodeName]] traitsParams["argstr"] += "..." else: values = [] type = typesDict[param.nodeName] if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ]: if not param.getElementsByTagName("channel"): raise RuntimeError( "Insufficient XML specification: each element of type 'file', 'directory', 'image', 'geometry', 'transform', or 'table' requires 'channel' field.\n{0}".format( traitsParams ) ) elif ( param.getElementsByTagName("channel")[0].firstChild.nodeValue == "output" ): traitsParams["hash_files"] = False inputTraits.append( "%s = traits.Either(traits.Bool, %s(%s), %s)" % ( name, type, parse_values(values).replace("exists=True", ""), parse_params(traitsParams), ) ) traitsParams["exists"] = True traitsParams.pop("argstr") traitsParams.pop("hash_files") outputTraits.append( "%s = %s(%s%s)" % ( name, type.replace("Input", "Output"), parse_values(values), parse_params(traitsParams), ) ) outputs_filenames[name] = gen_filename_from_param(param, name) elif ( param.getElementsByTagName("channel")[0].firstChild.nodeValue == "input" ): if param.nodeName in [ "file", "directory", "image", "geometry", "transform", "table", ] and type not in ["InputMultiPath", "traits.List"]: traitsParams["exists"] = True inputTraits.append( "%s = %s(%s%s)" % (name, type, parse_values(values), parse_params(traitsParams)) ) else: raise RuntimeError( "Insufficient XML specification: each element of type 'file', 'directory', 'image', 'geometry', 'transform', or 'table' requires 'channel' field to be in ['input','output'].\n{0}".format( traitsParams ) ) else: # For all other parameter types, they are implicitly only input types inputTraits.append( "%s = %s(%s%s)" % (name, type, parse_values(values), parse_params(traitsParams)) ) if mipav_hacks: blacklisted_inputs = ["maxMemoryUsage"] inputTraits = [ trait for trait in inputTraits if trait.split()[0] not in blacklisted_inputs ] compulsory_inputs = [ 'xDefaultMem = traits.Int(desc="Set default maximum heap size", argstr="-xDefaultMem %d")', 'xMaxProcess = traits.Int(1, desc="Set default maximum number of processes.", argstr="-xMaxProcess %d", usedefault=True)', ] inputTraits += compulsory_inputs input_spec_code = "class " + module_name + "InputSpec(CommandLineInputSpec):\n" for trait in inputTraits: input_spec_code += " " + trait + "\n" output_spec_code = "class " + module_name + "OutputSpec(TraitedSpec):\n" if not outputTraits: output_spec_code += " pass\n" else: for trait in outputTraits: output_spec_code += " " + trait + "\n" output_filenames_code = "_outputs_filenames = {" output_filenames_code += ",".join( ["'%s':'%s'" % (key, value) for key, value in outputs_filenames.items()] ) output_filenames_code += "}" input_spec_code += "\n\n" output_spec_code += "\n\n" template = """class %module_name%(SEMLikeCommandLine): %class_str% input_spec = %module_name%InputSpec output_spec = %module_name%OutputSpec _cmd = "%launcher% %name% " %output_filenames_code%\n""" template += " _redirect_x = {0}\n".format(str(redirect_x)) main_class = ( template.replace("%class_str%", class_string) .replace("%module_name%", module_name) .replace("%name%", module) .replace("%output_filenames_code%", output_filenames_code) .replace("%launcher%", " ".join(launcher)) ) return category, input_spec_code + output_spec_code + main_class, module_name def grab_xml(module, launcher, mipav_hacks=False): # cmd = CommandLine(command = "Slicer3", args="--launch %s --xml"%module) # ret = cmd.run() command_list = launcher[:] # force copy to preserve original command_list.extend([module, "--xml"]) final_command = " ".join(command_list) xmlReturnValue = subprocess.Popen( final_command, stdout=subprocess.PIPE, shell=True ).communicate()[0] if mipav_hacks: # workaround for a jist bug https://www.nitrc.org/tracker/index.php?func=detail&aid=7234&group_id=228&atid=942 new_xml = "" replace_closing_tag = False for line in xmlReturnValue.splitlines(): if line.strip() == "<file collection: semi-colon delimited list>": new_xml += "<file-vector>\n" replace_closing_tag = True elif replace_closing_tag and line.strip() == "</file>": new_xml += "</file-vector>\n" replace_closing_tag = False else: new_xml += line + "\n" xmlReturnValue = new_xml # workaround for a JIST bug https://www.nitrc.org/tracker/index.php?func=detail&aid=7233&group_id=228&atid=942 if xmlReturnValue.strip().endswith("XML"): xmlReturnValue = xmlReturnValue.strip()[:-3] if xmlReturnValue.strip().startswith("Error: Unable to set default atlas"): xmlReturnValue = xmlReturnValue.strip()[ len("Error: Unable to set default atlas") : ] try: dom = xml.dom.minidom.parseString(xmlReturnValue.strip()) except Exception as e: print(xmlReturnValue.strip()) raise e return dom # if ret.runtime.returncode == 0: # return xml.dom.minidom.parseString(ret.runtime.stdout) # else: # raise Exception(cmd.cmdline + " failed:\n%s"%ret.runtime.stderr) def parse_params(params): list = [] for key, value in params.items(): if isinstance(value, (str, bytes)): list.append('%s="%s"' % (key, value.replace('"', "'"))) else: list.append("%s=%s" % (key, value)) return ", ".join(list) def parse_values(values): values = ["%s" % value for value in values] if len(values) > 0: retstr = ", ".join(values) + ", " else: retstr = "" return retstr def gen_filename_from_param(param, base): fileExtensions = param.getAttribute("fileExtensions") if fileExtensions: # It is possible that multiple file extensions can be specified in a # comma separated list, This will extract just the first extension firstFileExtension = fileExtensions.split(",")[0] ext = firstFileExtension else: ext = { "image": ".nii", "transform": ".mat", "file": "", "directory": "", "geometry": ".vtk", }[param.nodeName] return base + ext if __name__ == "__main__": # NOTE: For now either the launcher needs to be found on the default path, or # every tool in the modules list must be found on the default path # AND calling the module with --xml must be supported and compliant. modules_list = [ "MedianImageFilter", "CheckerBoardFilter", "EMSegmentCommandLine", "GrayscaleFillHoleImageFilter", # 'CreateDICOMSeries', #missing channel "TractographyLabelMapSeeding", "IntensityDifferenceMetric", "DWIToDTIEstimation", "MaskScalarVolume", "ImageLabelCombine", "DTIimport", "OtsuThresholdImageFilter", "ExpertAutomatedRegistration", "ThresholdScalarVolume", "DWIUnbiasedNonLocalMeansFilter", "BRAINSFit", "MergeModels", "ResampleDTIVolume", "MultiplyScalarVolumes", "LabelMapSmoothing", "RigidRegistration", "VotingBinaryHoleFillingImageFilter", "BRAINSROIAuto", "RobustStatisticsSegmenter", "GradientAnisotropicDiffusion", "ProbeVolumeWithModel", "ModelMaker", "ExtractSkeleton", "GrayscaleGrindPeakImageFilter", "N4ITKBiasFieldCorrection", "BRAINSResample", "DTIexport", "VBRAINSDemonWarp", "ResampleScalarVectorDWIVolume", "ResampleScalarVolume", "OtsuThresholdSegmentation", # 'ExecutionModelTour', "HistogramMatching", "BRAINSDemonWarp", "ModelToLabelMap", "GaussianBlurImageFilter", "DiffusionWeightedVolumeMasking", "GrayscaleModelMaker", "CastScalarVolume", "DicomToNrrdConverter", "AffineRegistration", "AddScalarVolumes", "LinearRegistration", "SimpleRegionGrowingSegmentation", "DWIJointRicianLMMSEFilter", "MultiResolutionAffineRegistration", "SubtractScalarVolumes", "DWIRicianLMMSEFilter", "OrientScalarVolume", "FiducialRegistration", "BSplineDeformableRegistration", "CurvatureAnisotropicDiffusion", "PETStandardUptakeValueComputation", "DiffusionTensorScalarMeasurements", "ACPCTransform", "EMSegmentTransformToNewFormat", "BSplineToDeformationField", ] # SlicerExecutionModel compliant tools that are usually statically built, and don't need the Slicer3 --launcher generate_all_classes(modules_list=modules_list, launcher=[])
true
true
f71d993fda551358cdcb47a5d1ebc884dfe12422
1,056
py
Python
trains_gtfs.py
rome2rio/TokyoGTFS
c641529cd4e1d84692e85060dacb710270bc235f
[ "MIT" ]
10
2018-10-24T13:49:18.000Z
2022-02-06T22:58:34.000Z
trains_gtfs.py
rome2rio/TokyoGTFS
c641529cd4e1d84692e85060dacb710270bc235f
[ "MIT" ]
null
null
null
trains_gtfs.py
rome2rio/TokyoGTFS
c641529cd4e1d84692e85060dacb710270bc235f
[ "MIT" ]
6
2019-04-17T03:57:29.000Z
2021-01-26T11:44:53.000Z
import argparse import time import sys import os from src.static_trains import TrainParser from src.const import HEADER if __name__ == "__main__": args_parser = argparse.ArgumentParser() args_parser.add_argument("-a", "--apikey", metavar="YOUR_APIKEY", help="apikey from developer-tokyochallenge.odpt.org") args = args_parser.parse_args() # Apikey checks if args.apikey: apikey = args.apikey elif os.path.exists("apikey.txt"): with open("apikey.txt", mode="r", encoding="utf8") as f: apikey = f.read().strip() else: sys.exit( "No apikey!\n" "Provide it inside command line argument '--apikey',\n" "Or put it inside a file named 'apikey.txt'." ) start_time = time.time() print(HEADER) print("=== Trains GTFS: Starting! ===") print("Warming up") TrainParser.parse(apikey) total_time = time.time() - start_time print("=== TokyoGTFS: Finished in {} s ===".format(round(total_time, 2)))
27.076923
82
0.609848
import argparse import time import sys import os from src.static_trains import TrainParser from src.const import HEADER if __name__ == "__main__": args_parser = argparse.ArgumentParser() args_parser.add_argument("-a", "--apikey", metavar="YOUR_APIKEY", help="apikey from developer-tokyochallenge.odpt.org") args = args_parser.parse_args() if args.apikey: apikey = args.apikey elif os.path.exists("apikey.txt"): with open("apikey.txt", mode="r", encoding="utf8") as f: apikey = f.read().strip() else: sys.exit( "No apikey!\n" "Provide it inside command line argument '--apikey',\n" "Or put it inside a file named 'apikey.txt'." ) start_time = time.time() print(HEADER) print("=== Trains GTFS: Starting! ===") print("Warming up") TrainParser.parse(apikey) total_time = time.time() - start_time print("=== TokyoGTFS: Finished in {} s ===".format(round(total_time, 2)))
true
true
f71d9afb951ff91df5b86f95e1126ec3220aa334
2,020
py
Python
treetensor/torch/__init__.py
opendilab/DI-treetensor
fe5f681123c3d6e8d7507fba38586d2edf12e693
[ "Apache-2.0" ]
45
2021-09-04T15:57:44.000Z
2022-03-11T19:28:56.000Z
treetensor/torch/__init__.py
opendilab/DI-treetensor
fe5f681123c3d6e8d7507fba38586d2edf12e693
[ "Apache-2.0" ]
7
2021-09-06T13:06:12.000Z
2022-03-03T13:38:05.000Z
treetensor/torch/__init__.py
opendilab/DI-treetensor
fe5f681123c3d6e8d7507fba38586d2edf12e693
[ "Apache-2.0" ]
1
2021-09-30T15:18:06.000Z
2021-09-30T15:18:06.000Z
import builtins from functools import lru_cache from types import ModuleType, FunctionType, BuiltinFunctionType from typing import Iterable import torch from .funcs import * from .funcs import __all__ as _funcs_all from .funcs.base import get_func_from_torch from .size import * from .size import __all__ as _size_all from .tensor import * from .tensor import __all__ as _tensor_all from ..config.meta import __VERSION__ __all__ = [ *_funcs_all, *_size_all, *_tensor_all, ] _basic_types = ( builtins.bool, builtins.bytearray, builtins.bytes, builtins.complex, builtins.dict, builtins.float, builtins.frozenset, builtins.int, builtins.list, builtins.range, builtins.set, builtins.slice, builtins.str, builtins.tuple, ) _torch_all = set(torch.__all__) class _Module(ModuleType): def __init__(self, module): ModuleType.__init__(self, module.__name__) for name in filter(lambda x: x.startswith('__') and x.endswith('__'), dir(module)): setattr(self, name, getattr(module, name)) self.__origin__ = module self.__torch_version__ = torch.__version__ self.__version__ = __VERSION__ @lru_cache() def __getattr__(self, name): if (name in self.__all__) or \ (hasattr(self.__origin__, name) and isinstance(getattr(self.__origin__, name), ModuleType)): return getattr(self.__origin__, name) else: item = getattr(torch, name) if isinstance(item, (FunctionType, BuiltinFunctionType)) and not name.startswith('_'): return get_func_from_torch(name) elif (isinstance(item, torch.dtype)) or \ isinstance(item, _basic_types) and name in _torch_all: return item else: raise AttributeError(f'Attribute {repr(name)} not found in {repr(__name__)}.') def __dir__(self) -> Iterable[str]: return self.__all__ import sys sys.modules[__name__] = _Module(sys.modules[__name__])
32.063492
108
0.681683
import builtins from functools import lru_cache from types import ModuleType, FunctionType, BuiltinFunctionType from typing import Iterable import torch from .funcs import * from .funcs import __all__ as _funcs_all from .funcs.base import get_func_from_torch from .size import * from .size import __all__ as _size_all from .tensor import * from .tensor import __all__ as _tensor_all from ..config.meta import __VERSION__ __all__ = [ *_funcs_all, *_size_all, *_tensor_all, ] _basic_types = ( builtins.bool, builtins.bytearray, builtins.bytes, builtins.complex, builtins.dict, builtins.float, builtins.frozenset, builtins.int, builtins.list, builtins.range, builtins.set, builtins.slice, builtins.str, builtins.tuple, ) _torch_all = set(torch.__all__) class _Module(ModuleType): def __init__(self, module): ModuleType.__init__(self, module.__name__) for name in filter(lambda x: x.startswith('__') and x.endswith('__'), dir(module)): setattr(self, name, getattr(module, name)) self.__origin__ = module self.__torch_version__ = torch.__version__ self.__version__ = __VERSION__ @lru_cache() def __getattr__(self, name): if (name in self.__all__) or \ (hasattr(self.__origin__, name) and isinstance(getattr(self.__origin__, name), ModuleType)): return getattr(self.__origin__, name) else: item = getattr(torch, name) if isinstance(item, (FunctionType, BuiltinFunctionType)) and not name.startswith('_'): return get_func_from_torch(name) elif (isinstance(item, torch.dtype)) or \ isinstance(item, _basic_types) and name in _torch_all: return item else: raise AttributeError(f'Attribute {repr(name)} not found in {repr(__name__)}.') def __dir__(self) -> Iterable[str]: return self.__all__ import sys sys.modules[__name__] = _Module(sys.modules[__name__])
true
true
f71d9c7d4d1edc3d1f3f51bfea2e872d5c549f44
1,047
py
Python
64-minimum-path-sum/64-minimum-path-sum.py
jurayev/data-structures-algorithms-solutions
7103294bafb60117fc77efe4913edcffbeb1ac7a
[ "MIT" ]
null
null
null
64-minimum-path-sum/64-minimum-path-sum.py
jurayev/data-structures-algorithms-solutions
7103294bafb60117fc77efe4913edcffbeb1ac7a
[ "MIT" ]
null
null
null
64-minimum-path-sum/64-minimum-path-sum.py
jurayev/data-structures-algorithms-solutions
7103294bafb60117fc77efe4913edcffbeb1ac7a
[ "MIT" ]
null
null
null
class Solution: def minPathSum(self, grid: List[List[int]]) -> int: """ [1,3,1] [1,5,1] [4,2,1] time O (nm) space O(nm) state -> sums[r][c] = min path sum till r, c position initial state -> sums[0][0…cols] = inf -> sums[0…cols][0] = inf transition function -> sum[r][c] = min(sum[r-1][c], sum[r][c-1]) + sum[r][c] calculation order: 1….rows-1; 1….cols-1 """ return self.find_min_path_sum(grid) def find_min_path_sum(self, grid): rows, cols = len(grid), len(grid[0]) if not rows or not cols: return -1 sums = [[float("inf") for _ in range(cols+1)] for _ in range(rows+1)] for r in range(1, rows+1): for c in range(1, cols+1): if r == 1 and c == 1: sums[r][c] = grid[r-1][c-1] else: sums[r][c] = min(sums[r-1][c], sums[r][c-1]) + grid[r-1][c-1] return sums[rows][cols]
31.727273
84
0.455587
class Solution: def minPathSum(self, grid: List[List[int]]) -> int: return self.find_min_path_sum(grid) def find_min_path_sum(self, grid): rows, cols = len(grid), len(grid[0]) if not rows or not cols: return -1 sums = [[float("inf") for _ in range(cols+1)] for _ in range(rows+1)] for r in range(1, rows+1): for c in range(1, cols+1): if r == 1 and c == 1: sums[r][c] = grid[r-1][c-1] else: sums[r][c] = min(sums[r-1][c], sums[r][c-1]) + grid[r-1][c-1] return sums[rows][cols]
true
true
f71d9d0a976dd2d6fab7c86d11a2c85c733baff5
11,274
py
Python
tfx/orchestration/kubeflow/executor_wrappers.py
HassanDayoub/tfx
dc9221abbb8dad991d1ae22fb91876da1290efae
[ "Apache-2.0" ]
2
2019-07-08T20:56:13.000Z
2020-08-04T17:07:26.000Z
tfx/orchestration/kubeflow/executor_wrappers.py
HassanDayoub/tfx
dc9221abbb8dad991d1ae22fb91876da1290efae
[ "Apache-2.0" ]
null
null
null
tfx/orchestration/kubeflow/executor_wrappers.py
HassanDayoub/tfx
dc9221abbb8dad991d1ae22fb91876da1290efae
[ "Apache-2.0" ]
null
null
null
# Copyright 2019 Google LLC. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Wrappers for TFX executors running as part of a Kubeflow pipeline.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import abc import argparse import json import os import re from future import utils import six import tensorflow as tf from typing import Any, Dict, List, Text from tensorflow.python.lib.io import file_io # pylint: disable=g-direct-tensorflow-import from tfx import version from tfx.components.base import base_executor from tfx.utils import import_utils from tfx.utils import types def parse_tfx_type(json_str: Text): """Parses a list of artifacts and their types from json.""" json_artifact_list = json.loads(json_str) tfx_types = [] for json_artifact in json_artifact_list: tfx_type = types.TfxArtifact.parse_from_json_dict(json_artifact) tfx_types.append(tfx_type) return tfx_types def to_snake_case(name: Text): s1 = re.sub('(.)([A-Z][a-z]+)', r'\1_\2', name) return re.sub('([a-z0-9])([A-Z])', r'\1_\2', s1).lower() class KubeflowExecutorWrapper(utils.with_metaclass(abc.ABCMeta), object): """Abstract base class for all Kubeflow Pipelines-based TFX components.""" def __init__( self, executor_class_path: Text, name: Text, input_dict: Dict[Text, List[types.TfxArtifact]], outputs: Text, exec_properties: Dict[Text, Any], ): self._input_dict = input_dict self._output_dict = types.parse_tfx_type_dict(outputs) self._component_name = to_snake_case(name) self._exec_properties = exec_properties self._output_dir = self._exec_properties['output_dir'] self._workflow_id = os.environ['WORKFLOW_ID'] raw_args = self._exec_properties.get('beam_pipeline_args', []) # Beam expects str types for it's pipeline args. Ensure unicode type is # converted to str if required. beam_pipeline_args = [] for arg in raw_args: # In order to support both Py2 and Py3: Py3 doesn't have `unicode` type. if six.PY2 and isinstance(arg, unicode): arg = arg.encode('ascii', 'ignore') beam_pipeline_args.append(arg) # TODO(zhitaoli): Revisit usage of setup_file here. module_dir = os.path.dirname(os.path.dirname(version.__file__)) setup_file = os.path.join(module_dir, 'setup.py') tf.logging.info('Using setup_file \'%s\' to capture TFX dependencies', setup_file) beam_pipeline_args.append('--setup_file={}'.format(setup_file)) executor_cls = import_utils.import_class_by_path(executor_class_path) # TODO(swoonna): Switch to execution_id when available unique_id = '{}_{}'.format(self._component_name, self._workflow_id) # TODO(swoonna): Add tmp_dir to additional_pipeline_args executor_context = base_executor.BaseExecutor.Context( beam_pipeline_args=beam_pipeline_args, tmp_dir=os.path.join(self._output_dir, '.temp', ''), unique_id=unique_id) self._executor = executor_cls(executor_context) def _set_outputs(self): tf.logging.info('Using workflow id {}'.format(self._workflow_id)) max_input_span = 0 for input_list in self._input_dict.values(): for single_input in input_list: max_input_span = max(max_input_span, single_input.span) for output_name, output_artifact_list in self._output_dict.items(): for output_artifact in output_artifact_list: output_artifact.uri = os.path.join(self._output_dir, self._component_name, output_name, self._workflow_id, output_artifact.split, '') output_artifact.span = max_input_span def run(self, output_basedir: Text = '/'): """Runs the wrapped Executor, and writes metadata of output artifacts. Args: output_basedir: Base directory to which output artifacts metadata is written. Useful for unit tests. """ self._executor.Do(self._input_dict, self._output_dict, self._exec_properties) output_dir = os.path.join(output_basedir, 'output/ml_metadata') tf.gfile.MakeDirs(output_dir) for output_name, output_artifact_list in self._output_dict.items(): filename = os.path.join(output_dir, output_name) with file_io.FileIO(filename, 'w') as f: output_list = [x.json_dict() for x in output_artifact_list] f.write(json.dumps(output_list)) # TODO(b/132197968): Get rid of all the individual wrapper classes below and # combine them into a single generic one that constructs the input dict from # the individual named arguments instead. In the future, the generic wrapper # can call into TFX drivers to handle component-specific logic as well. class CsvExampleGenWrapper(KubeflowExecutorWrapper): """Wrapper for CSVExampleGen component.""" def __init__(self, args: argparse.Namespace): super(CsvExampleGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='CSVExampleGen', input_dict={ 'input-base': parse_tfx_type(args.input_base), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_input_artifact_span() self._set_outputs() def _set_input_artifact_span(self): for input_artifact in self._input_dict['input-base']: matched = re.match(r'span_([0-9]+)', input_artifact.uri) span = matched.group(1) if matched else 1 input_artifact.span = span class BigQueryExampleGenWrapper(KubeflowExecutorWrapper): """Wrapper for BigQueryExampleGen component.""" def __init__(self, args: argparse.Namespace): super(BigQueryExampleGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='BigQueryExampleGen', input_dict={}, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class StatisticsGenWrapper(KubeflowExecutorWrapper): """Wrapper for StatisticsGen component.""" def __init__(self, args: argparse.Namespace): super(StatisticsGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='StatisticsGen', input_dict={ 'input_data': parse_tfx_type(args.input_data), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class SchemaGenWrapper(KubeflowExecutorWrapper): """Wrapper for SchemaGen component.""" def __init__(self, args: argparse.Namespace): super(SchemaGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='SchemaGen', input_dict={ 'stats': parse_tfx_type(args.stats), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class ExampleValidatorWrapper(KubeflowExecutorWrapper): """Wrapper for ExampleValidator component.""" def __init__(self, args: argparse.Namespace): super(ExampleValidatorWrapper, self).__init__( executor_class_path=args.executor_class_path, name='ExampleValidator', input_dict={ 'stats': parse_tfx_type(args.stats), 'schema': parse_tfx_type(args.schema), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class TransformWrapper(KubeflowExecutorWrapper): """Wrapper for Transform component.""" def __init__(self, args: argparse.Namespace): super(TransformWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Transform', input_dict={ 'input_data': parse_tfx_type(args.input_data), 'schema': parse_tfx_type(args.schema), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class TrainerWrapper(KubeflowExecutorWrapper): """Wrapper for Trainer component.""" def __init__(self, args: argparse.Namespace): super(TrainerWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Trainer', input_dict={ 'transformed_examples': parse_tfx_type(args.transformed_examples), 'transform_output': parse_tfx_type(args.transform_output), 'schema': parse_tfx_type(args.schema), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() # TODO(ajaygopinathan): Implement warm starting. self._exec_properties['warm_starting'] = False self._exec_properties['warm_start_from'] = None class EvaluatorWrapper(KubeflowExecutorWrapper): """Wrapper for Evaluator component.""" def __init__(self, args: argparse.Namespace): super(EvaluatorWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Evaluator', input_dict={ 'examples': parse_tfx_type(args.examples), 'model_exports': parse_tfx_type(args.model_exports), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class ModelValidatorWrapper(KubeflowExecutorWrapper): """Wrapper for ModelValidator component.""" def __init__(self, args: argparse.Namespace): super(ModelValidatorWrapper, self).__init__( executor_class_path=args.executor_class_path, name='ModelValidator', input_dict={ 'examples': parse_tfx_type(args.examples), 'model': parse_tfx_type(args.model), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() # TODO(ajaygopinathan): Implement latest blessed model determination. self._exec_properties['latest_blessed_model'] = None self._exec_properties['latest_blessed_model_id'] = None class PusherWrapper(KubeflowExecutorWrapper): """Wrapper for Pusher component.""" def __init__(self, args: argparse.Namespace): super(PusherWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Pusher', input_dict={ 'model_export': parse_tfx_type(args.model_export), 'model_blessing': parse_tfx_type(args.model_blessing), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() # TODO(ajaygopinathan): Implement latest pushed model self._exec_properties['latest_pushed_model'] = None
35.23125
90
0.699219
from __future__ import absolute_import from __future__ import division from __future__ import print_function import abc import argparse import json import os import re from future import utils import six import tensorflow as tf from typing import Any, Dict, List, Text from tensorflow.python.lib.io import file_io from tfx import version from tfx.components.base import base_executor from tfx.utils import import_utils from tfx.utils import types def parse_tfx_type(json_str: Text): json_artifact_list = json.loads(json_str) tfx_types = [] for json_artifact in json_artifact_list: tfx_type = types.TfxArtifact.parse_from_json_dict(json_artifact) tfx_types.append(tfx_type) return tfx_types def to_snake_case(name: Text): s1 = re.sub('(.)([A-Z][a-z]+)', r'\1_\2', name) return re.sub('([a-z0-9])([A-Z])', r'\1_\2', s1).lower() class KubeflowExecutorWrapper(utils.with_metaclass(abc.ABCMeta), object): def __init__( self, executor_class_path: Text, name: Text, input_dict: Dict[Text, List[types.TfxArtifact]], outputs: Text, exec_properties: Dict[Text, Any], ): self._input_dict = input_dict self._output_dict = types.parse_tfx_type_dict(outputs) self._component_name = to_snake_case(name) self._exec_properties = exec_properties self._output_dir = self._exec_properties['output_dir'] self._workflow_id = os.environ['WORKFLOW_ID'] raw_args = self._exec_properties.get('beam_pipeline_args', []) # converted to str if required. beam_pipeline_args = [] for arg in raw_args: # In order to support both Py2 and Py3: Py3 doesn't have `unicode` type. if six.PY2 and isinstance(arg, unicode): arg = arg.encode('ascii', 'ignore') beam_pipeline_args.append(arg) module_dir = os.path.dirname(os.path.dirname(version.__file__)) setup_file = os.path.join(module_dir, 'setup.py') tf.logging.info('Using setup_file \'%s\' to capture TFX dependencies', setup_file) beam_pipeline_args.append('--setup_file={}'.format(setup_file)) executor_cls = import_utils.import_class_by_path(executor_class_path) unique_id = '{}_{}'.format(self._component_name, self._workflow_id) executor_context = base_executor.BaseExecutor.Context( beam_pipeline_args=beam_pipeline_args, tmp_dir=os.path.join(self._output_dir, '.temp', ''), unique_id=unique_id) self._executor = executor_cls(executor_context) def _set_outputs(self): tf.logging.info('Using workflow id {}'.format(self._workflow_id)) max_input_span = 0 for input_list in self._input_dict.values(): for single_input in input_list: max_input_span = max(max_input_span, single_input.span) for output_name, output_artifact_list in self._output_dict.items(): for output_artifact in output_artifact_list: output_artifact.uri = os.path.join(self._output_dir, self._component_name, output_name, self._workflow_id, output_artifact.split, '') output_artifact.span = max_input_span def run(self, output_basedir: Text = '/'): self._executor.Do(self._input_dict, self._output_dict, self._exec_properties) output_dir = os.path.join(output_basedir, 'output/ml_metadata') tf.gfile.MakeDirs(output_dir) for output_name, output_artifact_list in self._output_dict.items(): filename = os.path.join(output_dir, output_name) with file_io.FileIO(filename, 'w') as f: output_list = [x.json_dict() for x in output_artifact_list] f.write(json.dumps(output_list)) class CsvExampleGenWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(CsvExampleGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='CSVExampleGen', input_dict={ 'input-base': parse_tfx_type(args.input_base), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_input_artifact_span() self._set_outputs() def _set_input_artifact_span(self): for input_artifact in self._input_dict['input-base']: matched = re.match(r'span_([0-9]+)', input_artifact.uri) span = matched.group(1) if matched else 1 input_artifact.span = span class BigQueryExampleGenWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(BigQueryExampleGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='BigQueryExampleGen', input_dict={}, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class StatisticsGenWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(StatisticsGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='StatisticsGen', input_dict={ 'input_data': parse_tfx_type(args.input_data), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class SchemaGenWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(SchemaGenWrapper, self).__init__( executor_class_path=args.executor_class_path, name='SchemaGen', input_dict={ 'stats': parse_tfx_type(args.stats), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class ExampleValidatorWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(ExampleValidatorWrapper, self).__init__( executor_class_path=args.executor_class_path, name='ExampleValidator', input_dict={ 'stats': parse_tfx_type(args.stats), 'schema': parse_tfx_type(args.schema), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class TransformWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(TransformWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Transform', input_dict={ 'input_data': parse_tfx_type(args.input_data), 'schema': parse_tfx_type(args.schema), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class TrainerWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(TrainerWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Trainer', input_dict={ 'transformed_examples': parse_tfx_type(args.transformed_examples), 'transform_output': parse_tfx_type(args.transform_output), 'schema': parse_tfx_type(args.schema), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() self._exec_properties['warm_starting'] = False self._exec_properties['warm_start_from'] = None class EvaluatorWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(EvaluatorWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Evaluator', input_dict={ 'examples': parse_tfx_type(args.examples), 'model_exports': parse_tfx_type(args.model_exports), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() class ModelValidatorWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(ModelValidatorWrapper, self).__init__( executor_class_path=args.executor_class_path, name='ModelValidator', input_dict={ 'examples': parse_tfx_type(args.examples), 'model': parse_tfx_type(args.model), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() self._exec_properties['latest_blessed_model'] = None self._exec_properties['latest_blessed_model_id'] = None class PusherWrapper(KubeflowExecutorWrapper): def __init__(self, args: argparse.Namespace): super(PusherWrapper, self).__init__( executor_class_path=args.executor_class_path, name='Pusher', input_dict={ 'model_export': parse_tfx_type(args.model_export), 'model_blessing': parse_tfx_type(args.model_blessing), }, outputs=args.outputs, exec_properties=json.loads(args.exec_properties), ) self._set_outputs() self._exec_properties['latest_pushed_model'] = None
true
true
f71d9d8f6b820ccbcff9a86dd6bbf0941792f053
2,110
py
Python
src/djask/admin/views.py
greyli/Djask
b886610c792aaa40d6a3975fd26c44fc7825c8b6
[ "MIT" ]
null
null
null
src/djask/admin/views.py
greyli/Djask
b886610c792aaa40d6a3975fd26c44fc7825c8b6
[ "MIT" ]
null
null
null
src/djask/admin/views.py
greyli/Djask
b886610c792aaa40d6a3975fd26c44fc7825c8b6
[ "MIT" ]
null
null
null
from typing import Optional from flask import render_template, abort, flash, redirect, url_for from flask_login.utils import login_user, logout_user from .forms import LoginForm from .decorators import admin_required from ..auth.models import User from ..blueprints import Blueprint from ..globals import current_app, request admin_bp = Blueprint("admin", __name__, url_prefix="/admin") @admin_bp.route("/") @admin_required def index(): blueprints = current_app.blueprint_objects return render_template( "admin/dashboard.html", User=User, models=current_app.models, blueprints=blueprints, ) @admin_bp.route("/login", methods=["GET", "POST"]) def login(): form = LoginForm() if form.validate_on_submit(): user = User.query.filter_by(username=form.username.data).first() # identify the user if not user: flash("User not found.", "danger") elif not user.is_admin: flash("User not administrative.", "danger") elif not user.check_password(form.password.data): flash("Wrong password.", "danger") else: login_user(user, form.remember_me.data) next: Optional[str] = request.args.get("next") return redirect(next or url_for("admin.index")) return render_template("admin/login.html", form=form) @admin_bp.route("/logout") def logout(): logout_user() return redirect(url_for("admin.login")) @admin_bp.route("/<model_name>") @admin_required def specific_model(model_name: str): model_name = model_name.lower() models = current_app.models registered_models = [model.__name__.lower() for model in models] if model_name not in registered_models: abort(404, "Data model not defined or registered.") model = models[registered_models.index(model_name)] return render_template("admin/model.html", model=model, model_name=model.__name__) @admin_bp.route("/<model_name>/add") @admin_required def add_model(model_name: str): # TODO: Write add_model view return "Hello World" # pragma: no cover
30.57971
86
0.690521
from typing import Optional from flask import render_template, abort, flash, redirect, url_for from flask_login.utils import login_user, logout_user from .forms import LoginForm from .decorators import admin_required from ..auth.models import User from ..blueprints import Blueprint from ..globals import current_app, request admin_bp = Blueprint("admin", __name__, url_prefix="/admin") @admin_bp.route("/") @admin_required def index(): blueprints = current_app.blueprint_objects return render_template( "admin/dashboard.html", User=User, models=current_app.models, blueprints=blueprints, ) @admin_bp.route("/login", methods=["GET", "POST"]) def login(): form = LoginForm() if form.validate_on_submit(): user = User.query.filter_by(username=form.username.data).first() if not user: flash("User not found.", "danger") elif not user.is_admin: flash("User not administrative.", "danger") elif not user.check_password(form.password.data): flash("Wrong password.", "danger") else: login_user(user, form.remember_me.data) next: Optional[str] = request.args.get("next") return redirect(next or url_for("admin.index")) return render_template("admin/login.html", form=form) @admin_bp.route("/logout") def logout(): logout_user() return redirect(url_for("admin.login")) @admin_bp.route("/<model_name>") @admin_required def specific_model(model_name: str): model_name = model_name.lower() models = current_app.models registered_models = [model.__name__.lower() for model in models] if model_name not in registered_models: abort(404, "Data model not defined or registered.") model = models[registered_models.index(model_name)] return render_template("admin/model.html", model=model, model_name=model.__name__) @admin_bp.route("/<model_name>/add") @admin_required def add_model(model_name: str): return "Hello World"
true
true
f71d9ef0e4be00ca05ee0dfe3d9ea824198afb50
57,881
py
Python
kafka/admin/client.py
jtribble/kafka-python
bbb8c90391e446de81833bc38dba4233a781fa5b
[ "Apache-2.0" ]
null
null
null
kafka/admin/client.py
jtribble/kafka-python
bbb8c90391e446de81833bc38dba4233a781fa5b
[ "Apache-2.0" ]
null
null
null
kafka/admin/client.py
jtribble/kafka-python
bbb8c90391e446de81833bc38dba4233a781fa5b
[ "Apache-2.0" ]
null
null
null
from __future__ import absolute_import from collections import defaultdict import copy import logging import socket from . import ConfigResourceType from kafka.vendor import six from kafka.client_async import KafkaClient, selectors import kafka.errors as Errors from kafka.errors import ( IncompatibleBrokerVersion, KafkaConfigurationError, NotControllerError, UnrecognizedBrokerVersion, IllegalArgumentError) from kafka.metrics import MetricConfig, Metrics from kafka.protocol.admin import ( CreateTopicsRequest, DeleteTopicsRequest, DescribeConfigsRequest, AlterConfigsRequest, CreatePartitionsRequest, ListGroupsRequest, DescribeGroupsRequest, DescribeAclsRequest, CreateAclsRequest, DeleteAclsRequest) from kafka.protocol.commit import GroupCoordinatorRequest, OffsetFetchRequest from kafka.protocol.metadata import MetadataRequest from kafka.structs import TopicPartition, OffsetAndMetadata from kafka.admin.acl_resource import ACLOperation, ACLPermissionType, ACLFilter, ACL, ResourcePattern, ResourceType, \ ACLResourcePatternType from kafka.version import __version__ log = logging.getLogger(__name__) class KafkaAdminClient(object): """A class for administering the Kafka cluster. Warning: This is an unstable interface that was recently added and is subject to change without warning. In particular, many methods currently return raw protocol tuples. In future releases, we plan to make these into nicer, more pythonic objects. Unfortunately, this will likely break those interfaces. The KafkaAdminClient class will negotiate for the latest version of each message protocol format supported by both the kafka-python client library and the Kafka broker. Usage of optional fields from protocol versions that are not supported by the broker will result in IncompatibleBrokerVersion exceptions. Use of this class requires a minimum broker version >= 0.10.0.0. Keyword Arguments: bootstrap_servers: 'host[:port]' string (or list of 'host[:port]' strings) that the consumer should contact to bootstrap initial cluster metadata. This does not have to be the full node list. It just needs to have at least one broker that will respond to a Metadata API Request. Default port is 9092. If no servers are specified, will default to localhost:9092. client_id (str): a name for this client. This string is passed in each request to servers and can be used to identify specific server-side log entries that correspond to this client. Also submitted to GroupCoordinator for logging with respect to consumer group administration. Default: 'kafka-python-{version}' reconnect_backoff_ms (int): The amount of time in milliseconds to wait before attempting to reconnect to a given host. Default: 50. reconnect_backoff_max_ms (int): The maximum amount of time in milliseconds to backoff/wait when reconnecting to a broker that has repeatedly failed to connect. If provided, the backoff per host will increase exponentially for each consecutive connection failure, up to this maximum. Once the maximum is reached, reconnection attempts will continue periodically with this fixed rate. To avoid connection storms, a randomization factor of 0.2 will be applied to the backoff resulting in a random range between 20% below and 20% above the computed value. Default: 1000. request_timeout_ms (int): Client request timeout in milliseconds. Default: 30000. connections_max_idle_ms: Close idle connections after the number of milliseconds specified by this config. The broker closes idle connections after connections.max.idle.ms, so this avoids hitting unexpected socket disconnected errors on the client. Default: 540000 retry_backoff_ms (int): Milliseconds to backoff when retrying on errors. Default: 100. max_in_flight_requests_per_connection (int): Requests are pipelined to kafka brokers up to this number of maximum requests per broker connection. Default: 5. receive_buffer_bytes (int): The size of the TCP receive buffer (SO_RCVBUF) to use when reading data. Default: None (relies on system defaults). Java client defaults to 32768. send_buffer_bytes (int): The size of the TCP send buffer (SO_SNDBUF) to use when sending data. Default: None (relies on system defaults). Java client defaults to 131072. socket_options (list): List of tuple-arguments to socket.setsockopt to apply to broker connection sockets. Default: [(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1)] metadata_max_age_ms (int): The period of time in milliseconds after which we force a refresh of metadata even if we haven't seen any partition leadership changes to proactively discover any new brokers or partitions. Default: 300000 security_protocol (str): Protocol used to communicate with brokers. Valid values are: PLAINTEXT, SSL, SASL_PLAINTEXT, SASL_SSL. Default: PLAINTEXT. ssl_context (ssl.SSLContext): Pre-configured SSLContext for wrapping socket connections. If provided, all other ssl_* configurations will be ignored. Default: None. ssl_check_hostname (bool): Flag to configure whether SSL handshake should verify that the certificate matches the broker's hostname. Default: True. ssl_cafile (str): Optional filename of CA file to use in certificate verification. Default: None. ssl_certfile (str): Optional filename of file in PEM format containing the client certificate, as well as any CA certificates needed to establish the certificate's authenticity. Default: None. ssl_keyfile (str): Optional filename containing the client private key. Default: None. ssl_password (str): Optional password to be used when loading the certificate chain. Default: None. ssl_crlfile (str): Optional filename containing the CRL to check for certificate expiration. By default, no CRL check is done. When providing a file, only the leaf certificate will be checked against this CRL. The CRL can only be checked with Python 3.4+ or 2.7.9+. Default: None. api_version (tuple): Specify which Kafka API version to use. If set to None, KafkaClient will attempt to infer the broker version by probing various APIs. Example: (0, 10, 2). Default: None api_version_auto_timeout_ms (int): number of milliseconds to throw a timeout exception from the constructor when checking the broker api version. Only applies if api_version is None selector (selectors.BaseSelector): Provide a specific selector implementation to use for I/O multiplexing. Default: selectors.DefaultSelector metrics (kafka.metrics.Metrics): Optionally provide a metrics instance for capturing network IO stats. Default: None. metric_group_prefix (str): Prefix for metric names. Default: '' sasl_mechanism (str): Authentication mechanism when security_protocol is configured for SASL_PLAINTEXT or SASL_SSL. Valid values are: PLAIN, GSSAPI, OAUTHBEARER, SCRAM-SHA-256, SCRAM-SHA-512. sasl_plain_username (str): username for sasl PLAIN and SCRAM authentication. Required if sasl_mechanism is PLAIN or one of the SCRAM mechanisms. sasl_plain_password (str): password for sasl PLAIN and SCRAM authentication. Required if sasl_mechanism is PLAIN or one of the SCRAM mechanisms. sasl_kerberos_service_name (str): Service name to include in GSSAPI sasl mechanism handshake. Default: 'kafka' sasl_kerberos_domain_name (str): kerberos domain name to use in GSSAPI sasl mechanism handshake. Default: one of bootstrap servers sasl_oauth_token_provider (AbstractTokenProvider): OAuthBearer token provider instance. (See kafka.oauth.abstract). Default: None """ DEFAULT_CONFIG = { # client configs 'bootstrap_servers': 'localhost', 'client_id': 'kafka-python-' + __version__, 'request_timeout_ms': 30000, 'connections_max_idle_ms': 9 * 60 * 1000, 'reconnect_backoff_ms': 50, 'reconnect_backoff_max_ms': 1000, 'max_in_flight_requests_per_connection': 5, 'receive_buffer_bytes': None, 'send_buffer_bytes': None, 'socket_options': [(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1)], 'sock_chunk_bytes': 4096, # undocumented experimental option 'sock_chunk_buffer_count': 1000, # undocumented experimental option 'retry_backoff_ms': 100, 'metadata_max_age_ms': 300000, 'security_protocol': 'PLAINTEXT', 'ssl_context': None, 'ssl_check_hostname': True, 'ssl_cafile': None, 'ssl_certfile': None, 'ssl_keyfile': None, 'ssl_password': None, 'ssl_crlfile': None, 'api_version': None, 'api_version_auto_timeout_ms': 2000, 'selector': selectors.DefaultSelector, 'sasl_mechanism': None, 'sasl_plain_username': None, 'sasl_plain_password': None, 'sasl_kerberos_service_name': 'kafka', 'sasl_kerberos_domain_name': None, 'sasl_oauth_token_provider': None, # metrics configs 'metric_reporters': [], 'metrics_num_samples': 2, 'metrics_sample_window_ms': 30000, } def __init__(self, **configs): log.debug("Starting KafkaAdminClient with configuration: %s", configs) extra_configs = set(configs).difference(self.DEFAULT_CONFIG) if extra_configs: raise KafkaConfigurationError("Unrecognized configs: {}".format(extra_configs)) self.config = copy.copy(self.DEFAULT_CONFIG) self.config.update(configs) # Configure metrics metrics_tags = {'client-id': self.config['client_id']} metric_config = MetricConfig(samples=self.config['metrics_num_samples'], time_window_ms=self.config['metrics_sample_window_ms'], tags=metrics_tags) reporters = [reporter() for reporter in self.config['metric_reporters']] self._metrics = Metrics(metric_config, reporters) self._client = KafkaClient(metrics=self._metrics, metric_group_prefix='admin', **self.config) self._client.check_version() # Get auto-discovered version from client if necessary if self.config['api_version'] is None: self.config['api_version'] = self._client.config['api_version'] self._closed = False self._refresh_controller_id() log.debug("KafkaAdminClient started.") def close(self): """Close the KafkaAdminClient connection to the Kafka broker.""" if not hasattr(self, '_closed') or self._closed: log.info("KafkaAdminClient already closed.") return self._metrics.close() self._client.close() self._closed = True log.debug("KafkaAdminClient is now closed.") def _matching_api_version(self, operation): """Find the latest version of the protocol operation supported by both this library and the broker. This resolves to the lesser of either the latest api version this library supports, or the max version supported by the broker. :param operation: A list of protocol operation versions from kafka.protocol. :return: The max matching version number between client and broker. """ broker_api_versions = self._client.get_api_versions() api_key = operation[0].API_KEY if broker_api_versions is None or api_key not in broker_api_versions: raise IncompatibleBrokerVersion( "Kafka broker does not support the '{}' Kafka protocol." .format(operation[0].__name__)) min_version, max_version = broker_api_versions[api_key] version = min(len(operation) - 1, max_version) if version < min_version: # max library version is less than min broker version. Currently, # no Kafka versions specify a min msg version. Maybe in the future? raise IncompatibleBrokerVersion( "No version of the '{}' Kafka protocol is supported by both the client and broker." .format(operation[0].__name__)) return version def _validate_timeout(self, timeout_ms): """Validate the timeout is set or use the configuration default. :param timeout_ms: The timeout provided by api call, in milliseconds. :return: The timeout to use for the operation. """ return timeout_ms or self.config['request_timeout_ms'] def _refresh_controller_id(self): """Determine the Kafka cluster controller.""" version = self._matching_api_version(MetadataRequest) if 1 <= version <= 6: request = MetadataRequest[version]() future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value controller_id = response.controller_id # verify the controller is new enough to support our requests controller_version = self._client.check_version(controller_id) if controller_version < (0, 10, 0): raise IncompatibleBrokerVersion( "The controller appears to be running Kafka {}. KafkaAdminClient requires brokers >= 0.10.0.0." .format(controller_version)) self._controller_id = controller_id else: raise UnrecognizedBrokerVersion( "Kafka Admin interface cannot determine the controller using MetadataRequest_v{}." .format(version)) def _find_coordinator_id_send_request(self, group_id): """Send a FindCoordinatorRequest to a broker. :param group_id: The consumer group ID. This is typically the group name as a string. :return: A message future """ # TODO add support for dynamically picking version of # GroupCoordinatorRequest which was renamed to FindCoordinatorRequest. # When I experimented with this, the coordinator value returned in # GroupCoordinatorResponse_v1 didn't match the value returned by # GroupCoordinatorResponse_v0 and I couldn't figure out why. version = 0 # version = self._matching_api_version(GroupCoordinatorRequest) if version <= 0: request = GroupCoordinatorRequest[version](group_id) else: raise NotImplementedError( "Support for GroupCoordinatorRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(self._client.least_loaded_node(), request) def _find_coordinator_id_process_response(self, response): """Process a FindCoordinatorResponse. :param response: a FindCoordinatorResponse. :return: The node_id of the broker that is the coordinator. """ if response.API_VERSION <= 0: error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: # Note: When error_type.retriable, Java will retry... see # KafkaAdminClient's handleFindCoordinatorError method raise error_type( "FindCoordinatorRequest failed with response '{}'." .format(response)) else: raise NotImplementedError( "Support for FindCoordinatorRequest_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return response.coordinator_id def _find_coordinator_id(self, group_id): """Find the broker node_id of the coordinator of the given group. Sends a FindCoordinatorRequest message to the cluster. Will block until the FindCoordinatorResponse is received. Any errors are immediately raised. :param group_id: The consumer group ID. This is typically the group name as a string. :return: The node_id of the broker that is the coordinator. """ # Note: Java may change how this is implemented in KAFKA-6791. future = self._find_coordinator_id_send_request(group_id) self._wait_for_futures([future]) response = future.value return self._find_coordinator_id_process_response(response) def _send_request_to_node(self, node_id, request): """Send a Kafka protocol message to a specific broker. Returns a future that may be polled for status and results. :param node_id: The broker id to which to send the message. :param request: The message to send. :return: A future object that may be polled for status and results. :exception: The exception if the message could not be sent. """ while not self._client.ready(node_id): # poll until the connection to broker is ready, otherwise send() # will fail with NodeNotReadyError self._client.poll() return self._client.send(node_id, request) def _send_request_to_controller(self, request): """Send a Kafka protocol message to the cluster controller. Will block until the message result is received. :param request: The message to send. :return: The Kafka protocol response for the message. """ tries = 2 # in case our cached self._controller_id is outdated while tries: tries -= 1 future = self._send_request_to_node(self._controller_id, request) self._wait_for_futures([future]) response = future.value # In Java, the error fieldname is inconsistent: # - CreateTopicsResponse / CreatePartitionsResponse uses topic_errors # - DeleteTopicsResponse uses topic_error_codes # So this is a little brittle in that it assumes all responses have # one of these attributes and that they always unpack into # (topic, error_code) tuples. topic_error_tuples = (response.topic_errors if hasattr(response, 'topic_errors') else response.topic_error_codes) # Also small py2/py3 compatibility -- py3 can ignore extra values # during unpack via: for x, y, *rest in list_of_values. py2 cannot. # So for now we have to map across the list and explicitly drop any # extra values (usually the error_message) for topic, error_code in map(lambda e: e[:2], topic_error_tuples): error_type = Errors.for_code(error_code) if tries and error_type is NotControllerError: # No need to inspect the rest of the errors for # non-retriable errors because NotControllerError should # either be thrown for all errors or no errors. self._refresh_controller_id() break elif error_type is not Errors.NoError: raise error_type( "Request '{}' failed with response '{}'." .format(request, response)) else: return response raise RuntimeError("This should never happen, please file a bug with full stacktrace if encountered") @staticmethod def _convert_new_topic_request(new_topic): return ( new_topic.name, new_topic.num_partitions, new_topic.replication_factor, [ (partition_id, replicas) for partition_id, replicas in new_topic.replica_assignments.items() ], [ (config_key, config_value) for config_key, config_value in new_topic.topic_configs.items() ] ) def create_topics(self, new_topics, timeout_ms=None, validate_only=False): """Create new topics in the cluster. :param new_topics: A list of NewTopic objects. :param timeout_ms: Milliseconds to wait for new topics to be created before the broker returns. :param validate_only: If True, don't actually create new topics. Not supported by all versions. Default: False :return: Appropriate version of CreateTopicResponse class. """ version = self._matching_api_version(CreateTopicsRequest) timeout_ms = self._validate_timeout(timeout_ms) if version == 0: if validate_only: raise IncompatibleBrokerVersion( "validate_only requires CreateTopicsRequest >= v1, which is not supported by Kafka {}." .format(self.config['api_version'])) request = CreateTopicsRequest[version]( create_topic_requests=[self._convert_new_topic_request(new_topic) for new_topic in new_topics], timeout=timeout_ms ) elif version <= 3: request = CreateTopicsRequest[version]( create_topic_requests=[self._convert_new_topic_request(new_topic) for new_topic in new_topics], timeout=timeout_ms, validate_only=validate_only ) else: raise NotImplementedError( "Support for CreateTopics v{} has not yet been added to KafkaAdminClient." .format(version)) # TODO convert structs to a more pythonic interface # TODO raise exceptions if errors return self._send_request_to_controller(request) def delete_topics(self, topics, timeout_ms=None): """Delete topics from the cluster. :param topics: A list of topic name strings. :param timeout_ms: Milliseconds to wait for topics to be deleted before the broker returns. :return: Appropriate version of DeleteTopicsResponse class. """ version = self._matching_api_version(DeleteTopicsRequest) timeout_ms = self._validate_timeout(timeout_ms) if version <= 3: request = DeleteTopicsRequest[version]( topics=topics, timeout=timeout_ms ) response = self._send_request_to_controller(request) else: raise NotImplementedError( "Support for DeleteTopics v{} has not yet been added to KafkaAdminClient." .format(version)) return response def _get_cluster_metadata(self, topics=None, auto_topic_creation=False, use_controller=False): """ topics == None means "get all topics" """ version = self._matching_api_version(MetadataRequest) if version <= 3: if auto_topic_creation: raise IncompatibleBrokerVersion( "auto_topic_creation requires MetadataRequest >= v4, which" " is not supported by Kafka {}" .format(self.config['api_version'])) request = MetadataRequest[version](topics=topics) elif version <= 5: request = MetadataRequest[version]( topics=topics, allow_auto_topic_creation=auto_topic_creation ) if use_controller: return self._send_request_to_controller(request) future = self._send_request_to_node( self._client.least_loaded_node(), request ) self._wait_for_futures([future]) return future.value def list_topics(self): metadata = self._get_cluster_metadata(topics=None) obj = metadata.to_object() return [t['topic'] for t in obj['topics']] def describe_topics(self, topics=None): metadata = self._get_cluster_metadata(topics=topics, use_controller=True) obj = metadata.to_object() return obj['topics'] def describe_cluster(self): metadata = self._get_cluster_metadata() obj = metadata.to_object() obj.pop('topics') # We have 'describe_topics' for this return obj @staticmethod def _convert_describe_acls_response_to_acls(describe_response): version = describe_response.API_VERSION error = Errors.for_code(describe_response.error_code) acl_list = [] for resources in describe_response.resources: if version == 0: resource_type, resource_name, acls = resources resource_pattern_type = ACLResourcePatternType.LITERAL.value elif version <= 1: resource_type, resource_name, resource_pattern_type, acls = resources else: raise NotImplementedError( "Support for DescribeAcls Response v{} has not yet been added to KafkaAdmin." .format(version) ) for acl in acls: principal, host, operation, permission_type = acl conv_acl = ACL( principal=principal, host=host, operation=ACLOperation(operation), permission_type=ACLPermissionType(permission_type), resource_pattern=ResourcePattern( ResourceType(resource_type), resource_name, ACLResourcePatternType(resource_pattern_type) ) ) acl_list.append(conv_acl) return (acl_list, error,) def describe_acls(self, acl_filter): """Describe a set of ACLs Used to return a set of ACLs matching the supplied ACLFilter. The cluster must be configured with an authorizer for this to work, or you will get a SecurityDisabledError :param acl_filter: an ACLFilter object :return: tuple of a list of matching ACL objects and a KafkaError (NoError if successful) """ version = self._matching_api_version(DescribeAclsRequest) if version == 0: request = DescribeAclsRequest[version]( resource_type=acl_filter.resource_pattern.resource_type, resource_name=acl_filter.resource_pattern.resource_name, principal=acl_filter.principal, host=acl_filter.host, operation=acl_filter.operation, permission_type=acl_filter.permission_type ) elif version <= 1: request = DescribeAclsRequest[version]( resource_type=acl_filter.resource_pattern.resource_type, resource_name=acl_filter.resource_pattern.resource_name, resource_pattern_type_filter=acl_filter.resource_pattern.pattern_type, principal=acl_filter.principal, host=acl_filter.host, operation=acl_filter.operation, permission_type=acl_filter.permission_type ) else: raise NotImplementedError( "Support for DescribeAcls v{} has not yet been added to KafkaAdmin." .format(version) ) future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: # optionally we could retry if error_type.retriable raise error_type( "Request '{}' failed with response '{}'." .format(request, response)) return self._convert_describe_acls_response_to_acls(response) @staticmethod def _convert_create_acls_resource_request_v0(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_create_acls_resource_request_v1(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.resource_pattern.pattern_type, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_create_acls_response_to_acls(acls, create_response): version = create_response.API_VERSION creations_error = [] creations_success = [] for i, creations in enumerate(create_response.creation_responses): if version <= 1: error_code, error_message = creations acl = acls[i] error = Errors.for_code(error_code) else: raise NotImplementedError( "Support for DescribeAcls Response v{} has not yet been added to KafkaAdmin." .format(version) ) if error is Errors.NoError: creations_success.append(acl) else: creations_error.append((acl, error,)) return {"succeeded": creations_success, "failed": creations_error} def create_acls(self, acls): """Create a list of ACLs This endpoint only accepts a list of concrete ACL objects, no ACLFilters. Throws TopicAlreadyExistsError if topic is already present. :param acls: a list of ACL objects :return: dict of successes and failures """ for acl in acls: if not isinstance(acl, ACL): raise IllegalArgumentError("acls must contain ACL objects") version = self._matching_api_version(CreateAclsRequest) if version == 0: request = CreateAclsRequest[version]( creations=[self._convert_create_acls_resource_request_v0(acl) for acl in acls] ) elif version <= 1: request = CreateAclsRequest[version]( creations=[self._convert_create_acls_resource_request_v1(acl) for acl in acls] ) else: raise NotImplementedError( "Support for CreateAcls v{} has not yet been added to KafkaAdmin." .format(version) ) future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value return self._convert_create_acls_response_to_acls(acls, response) @staticmethod def _convert_delete_acls_resource_request_v0(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_delete_acls_resource_request_v1(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.resource_pattern.pattern_type, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_delete_acls_response_to_matching_acls(acl_filters, delete_response): version = delete_response.API_VERSION filter_result_list = [] for i, filter_responses in enumerate(delete_response.filter_responses): filter_error_code, filter_error_message, matching_acls = filter_responses filter_error = Errors.for_code(filter_error_code) acl_result_list = [] for acl in matching_acls: if version == 0: error_code, error_message, resource_type, resource_name, principal, host, operation, permission_type = acl resource_pattern_type = ACLResourcePatternType.LITERAL.value elif version == 1: error_code, error_message, resource_type, resource_name, resource_pattern_type, principal, host, operation, permission_type = acl else: raise NotImplementedError( "Support for DescribeAcls Response v{} has not yet been added to KafkaAdmin." .format(version) ) acl_error = Errors.for_code(error_code) conv_acl = ACL( principal=principal, host=host, operation=ACLOperation(operation), permission_type=ACLPermissionType(permission_type), resource_pattern=ResourcePattern( ResourceType(resource_type), resource_name, ACLResourcePatternType(resource_pattern_type) ) ) acl_result_list.append((conv_acl, acl_error,)) filter_result_list.append((acl_filters[i], acl_result_list, filter_error,)) return filter_result_list def delete_acls(self, acl_filters): """Delete a set of ACLs Deletes all ACLs matching the list of input ACLFilter :param acl_filters: a list of ACLFilter :return: a list of 3-tuples corresponding to the list of input filters. The tuples hold (the input ACLFilter, list of affected ACLs, KafkaError instance) """ for acl in acl_filters: if not isinstance(acl, ACLFilter): raise IllegalArgumentError("acl_filters must contain ACLFilter type objects") version = self._matching_api_version(DeleteAclsRequest) if version == 0: request = DeleteAclsRequest[version]( filters=[self._convert_delete_acls_resource_request_v0(acl) for acl in acl_filters] ) elif version <= 1: request = DeleteAclsRequest[version]( filters=[self._convert_delete_acls_resource_request_v1(acl) for acl in acl_filters] ) else: raise NotImplementedError( "Support for DeleteAcls v{} has not yet been added to KafkaAdmin." .format(version) ) future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value return self._convert_delete_acls_response_to_matching_acls(acl_filters, response) @staticmethod def _convert_describe_config_resource_request(config_resource): return ( config_resource.resource_type, config_resource.name, [ config_key for config_key, config_value in config_resource.configs.items() ] if config_resource.configs else None ) def describe_configs(self, config_resources, include_synonyms=False): """Fetch configuration parameters for one or more Kafka resources. :param config_resources: An list of ConfigResource objects. Any keys in ConfigResource.configs dict will be used to filter the result. Setting the configs dict to None will get all values. An empty dict will get zero values (as per Kafka protocol). :param include_synonyms: If True, return synonyms in response. Not supported by all versions. Default: False. :return: Appropriate version of DescribeConfigsResponse class. """ # Break up requests by type - a broker config request must be sent to the specific broker. # All other (currently just topic resources) can be sent to any broker. broker_resources = [] topic_resources = [] for config_resource in config_resources: if config_resource.resource_type == ConfigResourceType.BROKER: broker_resources.append(self._convert_describe_config_resource_request(config_resource)) else: topic_resources.append(self._convert_describe_config_resource_request(config_resource)) futures = [] version = self._matching_api_version(DescribeConfigsRequest) if version == 0: if include_synonyms: raise IncompatibleBrokerVersion( "include_synonyms requires DescribeConfigsRequest >= v1, which is not supported by Kafka {}." .format(self.config['api_version'])) if len(broker_resources) > 0: for broker_resource in broker_resources: try: broker_id = int(broker_resource[1]) except ValueError: raise ValueError("Broker resource names must be an integer or a string represented integer") futures.append(self._send_request_to_node( broker_id, DescribeConfigsRequest[version](resources=[broker_resource]) )) if len(topic_resources) > 0: futures.append(self._send_request_to_node( self._client.least_loaded_node(), DescribeConfigsRequest[version](resources=topic_resources) )) elif version <= 2: if len(broker_resources) > 0: for broker_resource in broker_resources: try: broker_id = int(broker_resource[1]) except ValueError: raise ValueError("Broker resource names must be an integer or a string represented integer") futures.append(self._send_request_to_node( broker_id, DescribeConfigsRequest[version]( resources=[broker_resource], include_synonyms=include_synonyms) )) if len(topic_resources) > 0: futures.append(self._send_request_to_node( self._client.least_loaded_node(), DescribeConfigsRequest[version](resources=topic_resources, include_synonyms=include_synonyms) )) else: raise NotImplementedError( "Support for DescribeConfigs v{} has not yet been added to KafkaAdminClient.".format(version)) self._wait_for_futures(futures) return [f.value for f in futures] @staticmethod def _convert_alter_config_resource_request(config_resource): return ( config_resource.resource_type, config_resource.name, [ (config_key, config_value) for config_key, config_value in config_resource.configs.items() ] ) def alter_configs(self, config_resources): """Alter configuration parameters of one or more Kafka resources. Warning: This is currently broken for BROKER resources because those must be sent to that specific broker, versus this always picks the least-loaded node. See the comment in the source code for details. We would happily accept a PR fixing this. :param config_resources: A list of ConfigResource objects. :return: Appropriate version of AlterConfigsResponse class. """ version = self._matching_api_version(AlterConfigsRequest) if version <= 1: request = AlterConfigsRequest[version]( resources=[self._convert_alter_config_resource_request(config_resource) for config_resource in config_resources] ) else: raise NotImplementedError( "Support for AlterConfigs v{} has not yet been added to KafkaAdminClient." .format(version)) # TODO the Java client has the note: # // We must make a separate AlterConfigs request for every BROKER resource we want to alter # // and send the request to that specific broker. Other resources are grouped together into # // a single request that may be sent to any broker. # # So this is currently broken as it always sends to the least_loaded_node() future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value return response # alter replica logs dir protocol not yet implemented # Note: have to lookup the broker with the replica assignment and send the request to that broker # describe log dirs protocol not yet implemented # Note: have to lookup the broker with the replica assignment and send the request to that broker @staticmethod def _convert_create_partitions_request(topic_name, new_partitions): return ( topic_name, ( new_partitions.total_count, new_partitions.new_assignments ) ) def create_partitions(self, topic_partitions, timeout_ms=None, validate_only=False): """Create additional partitions for an existing topic. :param topic_partitions: A map of topic name strings to NewPartition objects. :param timeout_ms: Milliseconds to wait for new partitions to be created before the broker returns. :param validate_only: If True, don't actually create new partitions. Default: False :return: Appropriate version of CreatePartitionsResponse class. """ version = self._matching_api_version(CreatePartitionsRequest) timeout_ms = self._validate_timeout(timeout_ms) if version <= 1: request = CreatePartitionsRequest[version]( topic_partitions=[self._convert_create_partitions_request(topic_name, new_partitions) for topic_name, new_partitions in topic_partitions.items()], timeout=timeout_ms, validate_only=validate_only ) else: raise NotImplementedError( "Support for CreatePartitions v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_controller(request) # delete records protocol not yet implemented # Note: send the request to the partition leaders # create delegation token protocol not yet implemented # Note: send the request to the least_loaded_node() # renew delegation token protocol not yet implemented # Note: send the request to the least_loaded_node() # expire delegation_token protocol not yet implemented # Note: send the request to the least_loaded_node() # describe delegation_token protocol not yet implemented # Note: send the request to the least_loaded_node() def _describe_consumer_groups_send_request(self, group_id, group_coordinator_id, include_authorized_operations=False): """Send a DescribeGroupsRequest to the group's coordinator. :param group_id: The group name as a string :param group_coordinator_id: The node_id of the groups' coordinator broker. :return: A message future. """ version = self._matching_api_version(DescribeGroupsRequest) if version <= 2: if include_authorized_operations: raise IncompatibleBrokerVersion( "include_authorized_operations requests " "DescribeGroupsRequest >= v3, which is not " "supported by Kafka {}".format(version) ) # Note: KAFKA-6788 A potential optimization is to group the # request per coordinator and send one request with a list of # all consumer groups. Java still hasn't implemented this # because the error checking is hard to get right when some # groups error and others don't. request = DescribeGroupsRequest[version](groups=(group_id,)) elif version <= 3: request = DescribeGroupsRequest[version]( groups=(group_id,), include_authorized_operations=include_authorized_operations ) else: raise NotImplementedError( "Support for DescribeGroupsRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(group_coordinator_id, request) def _describe_consumer_groups_process_response(self, response): """Process a DescribeGroupsResponse into a group description.""" if response.API_VERSION <= 3: assert len(response.groups) == 1 # TODO need to implement converting the response tuple into # a more accessible interface like a namedtuple and then stop # hardcoding tuple indices here. Several Java examples, # including KafkaAdminClient.java group_description = response.groups[0] error_code = group_description[0] error_type = Errors.for_code(error_code) # Java has the note: KAFKA-6789, we can retry based on the error code if error_type is not Errors.NoError: raise error_type( "DescribeGroupsResponse failed with response '{}'." .format(response)) # TODO Java checks the group protocol type, and if consumer # (ConsumerProtocol.PROTOCOL_TYPE) or empty string, it decodes # the members' partition assignments... that hasn't yet been # implemented here so just return the raw struct results else: raise NotImplementedError( "Support for DescribeGroupsResponse_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return group_description def describe_consumer_groups(self, group_ids, group_coordinator_id=None, include_authorized_operations=False): """Describe a set of consumer groups. Any errors are immediately raised. :param group_ids: A list of consumer group IDs. These are typically the group names as strings. :param group_coordinator_id: The node_id of the groups' coordinator broker. If set to None, it will query the cluster for each group to find that group's coordinator. Explicitly specifying this can be useful for avoiding extra network round trips if you already know the group coordinator. This is only useful when all the group_ids have the same coordinator, otherwise it will error. Default: None. :param include_authorized_operations: Whether or not to include information about the operations a group is allowed to perform. Only supported on API version >= v3. Default: False. :return: A list of group descriptions. For now the group descriptions are the raw results from the DescribeGroupsResponse. Long-term, we plan to change this to return namedtuples as well as decoding the partition assignments. """ group_descriptions = [] futures = [] for group_id in group_ids: if group_coordinator_id is not None: this_groups_coordinator_id = group_coordinator_id else: this_groups_coordinator_id = self._find_coordinator_id(group_id) f = self._describe_consumer_groups_send_request( group_id, this_groups_coordinator_id, include_authorized_operations) futures.append(f) self._wait_for_futures(futures) for future in futures: response = future.value group_description = self._describe_consumer_groups_process_response(response) group_descriptions.append(group_description) return group_descriptions def _list_consumer_groups_send_request(self, broker_id): """Send a ListGroupsRequest to a broker. :param broker_id: The broker's node_id. :return: A message future """ version = self._matching_api_version(ListGroupsRequest) if version <= 2: request = ListGroupsRequest[version]() else: raise NotImplementedError( "Support for ListGroupsRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(broker_id, request) def _list_consumer_groups_process_response(self, response): """Process a ListGroupsResponse into a list of groups.""" if response.API_VERSION <= 2: error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: raise error_type( "ListGroupsRequest failed with response '{}'." .format(response)) else: raise NotImplementedError( "Support for ListGroupsResponse_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return response.groups def list_consumer_groups(self, broker_ids=None): """List all consumer groups known to the cluster. This returns a list of Consumer Group tuples. The tuples are composed of the consumer group name and the consumer group protocol type. Only consumer groups that store their offsets in Kafka are returned. The protocol type will be an empty string for groups created using Kafka < 0.9 APIs because, although they store their offsets in Kafka, they don't use Kafka for group coordination. For groups created using Kafka >= 0.9, the protocol type will typically be "consumer". As soon as any error is encountered, it is immediately raised. :param broker_ids: A list of broker node_ids to query for consumer groups. If set to None, will query all brokers in the cluster. Explicitly specifying broker(s) can be useful for determining which consumer groups are coordinated by those broker(s). Default: None :return list: List of tuples of Consumer Groups. :exception GroupCoordinatorNotAvailableError: The coordinator is not available, so cannot process requests. :exception GroupLoadInProgressError: The coordinator is loading and hence can't process requests. """ # While we return a list, internally use a set to prevent duplicates # because if a group coordinator fails after being queried, and its # consumer groups move to new brokers that haven't yet been queried, # then the same group could be returned by multiple brokers. consumer_groups = set() if broker_ids is None: broker_ids = [broker.nodeId for broker in self._client.cluster.brokers()] futures = [self._list_consumer_groups_send_request(b) for b in broker_ids] self._wait_for_futures(futures) for f in futures: response = f.value consumer_groups.update(self._list_consumer_groups_process_response(response)) return list(consumer_groups) def _list_consumer_group_offsets_send_request(self, group_id, group_coordinator_id, partitions=None): """Send an OffsetFetchRequest to a broker. :param group_id: The consumer group id name for which to fetch offsets. :param group_coordinator_id: The node_id of the group's coordinator broker. :return: A message future """ version = self._matching_api_version(OffsetFetchRequest) if version <= 3: if partitions is None: if version <= 1: raise ValueError( """OffsetFetchRequest_v{} requires specifying the partitions for which to fetch offsets. Omitting the partitions is only supported on brokers >= 0.10.2. For details, see KIP-88.""".format(version)) topics_partitions = None else: # transform from [TopicPartition("t1", 1), TopicPartition("t1", 2)] to [("t1", [1, 2])] topics_partitions_dict = defaultdict(set) for topic, partition in partitions: topics_partitions_dict[topic].add(partition) topics_partitions = list(six.iteritems(topics_partitions_dict)) request = OffsetFetchRequest[version](group_id, topics_partitions) else: raise NotImplementedError( "Support for OffsetFetchRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(group_coordinator_id, request) def _list_consumer_group_offsets_process_response(self, response): """Process an OffsetFetchResponse. :param response: an OffsetFetchResponse. :return: A dictionary composed of TopicPartition keys and OffsetAndMetada values. """ if response.API_VERSION <= 3: # OffsetFetchResponse_v1 lacks a top-level error_code if response.API_VERSION > 1: error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: # optionally we could retry if error_type.retriable raise error_type( "OffsetFetchResponse failed with response '{}'." .format(response)) # transform response into a dictionary with TopicPartition keys and # OffsetAndMetada values--this is what the Java AdminClient returns offsets = {} for topic, partitions in response.topics: for partition, offset, metadata, error_code in partitions: error_type = Errors.for_code(error_code) if error_type is not Errors.NoError: raise error_type( "Unable to fetch consumer group offsets for topic {}, partition {}" .format(topic, partition)) offsets[TopicPartition(topic, partition)] = OffsetAndMetadata(offset, metadata) else: raise NotImplementedError( "Support for OffsetFetchResponse_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return offsets def list_consumer_group_offsets(self, group_id, group_coordinator_id=None, partitions=None): """Fetch Consumer Offsets for a single consumer group. Note: This does not verify that the group_id or partitions actually exist in the cluster. As soon as any error is encountered, it is immediately raised. :param group_id: The consumer group id name for which to fetch offsets. :param group_coordinator_id: The node_id of the group's coordinator broker. If set to None, will query the cluster to find the group coordinator. Explicitly specifying this can be useful to prevent that extra network round trip if you already know the group coordinator. Default: None. :param partitions: A list of TopicPartitions for which to fetch offsets. On brokers >= 0.10.2, this can be set to None to fetch all known offsets for the consumer group. Default: None. :return dictionary: A dictionary with TopicPartition keys and OffsetAndMetada values. Partitions that are not specified and for which the group_id does not have a recorded offset are omitted. An offset value of `-1` indicates the group_id has no offset for that TopicPartition. A `-1` can only happen for partitions that are explicitly specified. """ if group_coordinator_id is None: group_coordinator_id = self._find_coordinator_id(group_id) future = self._list_consumer_group_offsets_send_request( group_id, group_coordinator_id, partitions) self._wait_for_futures([future]) response = future.value return self._list_consumer_group_offsets_process_response(response) # delete groups protocol not yet implemented # Note: send the request to the group's coordinator. def _wait_for_futures(self, futures): while not all(future.succeeded() for future in futures): for future in futures: self._client.poll(future=future) if future.failed(): raise future.exception # pylint: disable-msg=raising-bad-type
46.3048
162
0.640988
from __future__ import absolute_import from collections import defaultdict import copy import logging import socket from . import ConfigResourceType from kafka.vendor import six from kafka.client_async import KafkaClient, selectors import kafka.errors as Errors from kafka.errors import ( IncompatibleBrokerVersion, KafkaConfigurationError, NotControllerError, UnrecognizedBrokerVersion, IllegalArgumentError) from kafka.metrics import MetricConfig, Metrics from kafka.protocol.admin import ( CreateTopicsRequest, DeleteTopicsRequest, DescribeConfigsRequest, AlterConfigsRequest, CreatePartitionsRequest, ListGroupsRequest, DescribeGroupsRequest, DescribeAclsRequest, CreateAclsRequest, DeleteAclsRequest) from kafka.protocol.commit import GroupCoordinatorRequest, OffsetFetchRequest from kafka.protocol.metadata import MetadataRequest from kafka.structs import TopicPartition, OffsetAndMetadata from kafka.admin.acl_resource import ACLOperation, ACLPermissionType, ACLFilter, ACL, ResourcePattern, ResourceType, \ ACLResourcePatternType from kafka.version import __version__ log = logging.getLogger(__name__) class KafkaAdminClient(object): DEFAULT_CONFIG = { 'bootstrap_servers': 'localhost', 'client_id': 'kafka-python-' + __version__, 'request_timeout_ms': 30000, 'connections_max_idle_ms': 9 * 60 * 1000, 'reconnect_backoff_ms': 50, 'reconnect_backoff_max_ms': 1000, 'max_in_flight_requests_per_connection': 5, 'receive_buffer_bytes': None, 'send_buffer_bytes': None, 'socket_options': [(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1)], 'sock_chunk_bytes': 4096, 'sock_chunk_buffer_count': 1000, 'retry_backoff_ms': 100, 'metadata_max_age_ms': 300000, 'security_protocol': 'PLAINTEXT', 'ssl_context': None, 'ssl_check_hostname': True, 'ssl_cafile': None, 'ssl_certfile': None, 'ssl_keyfile': None, 'ssl_password': None, 'ssl_crlfile': None, 'api_version': None, 'api_version_auto_timeout_ms': 2000, 'selector': selectors.DefaultSelector, 'sasl_mechanism': None, 'sasl_plain_username': None, 'sasl_plain_password': None, 'sasl_kerberos_service_name': 'kafka', 'sasl_kerberos_domain_name': None, 'sasl_oauth_token_provider': None, 'metric_reporters': [], 'metrics_num_samples': 2, 'metrics_sample_window_ms': 30000, } def __init__(self, **configs): log.debug("Starting KafkaAdminClient with configuration: %s", configs) extra_configs = set(configs).difference(self.DEFAULT_CONFIG) if extra_configs: raise KafkaConfigurationError("Unrecognized configs: {}".format(extra_configs)) self.config = copy.copy(self.DEFAULT_CONFIG) self.config.update(configs) metrics_tags = {'client-id': self.config['client_id']} metric_config = MetricConfig(samples=self.config['metrics_num_samples'], time_window_ms=self.config['metrics_sample_window_ms'], tags=metrics_tags) reporters = [reporter() for reporter in self.config['metric_reporters']] self._metrics = Metrics(metric_config, reporters) self._client = KafkaClient(metrics=self._metrics, metric_group_prefix='admin', **self.config) self._client.check_version() if self.config['api_version'] is None: self.config['api_version'] = self._client.config['api_version'] self._closed = False self._refresh_controller_id() log.debug("KafkaAdminClient started.") def close(self): if not hasattr(self, '_closed') or self._closed: log.info("KafkaAdminClient already closed.") return self._metrics.close() self._client.close() self._closed = True log.debug("KafkaAdminClient is now closed.") def _matching_api_version(self, operation): broker_api_versions = self._client.get_api_versions() api_key = operation[0].API_KEY if broker_api_versions is None or api_key not in broker_api_versions: raise IncompatibleBrokerVersion( "Kafka broker does not support the '{}' Kafka protocol." .format(operation[0].__name__)) min_version, max_version = broker_api_versions[api_key] version = min(len(operation) - 1, max_version) if version < min_version: raise IncompatibleBrokerVersion( "No version of the '{}' Kafka protocol is supported by both the client and broker." .format(operation[0].__name__)) return version def _validate_timeout(self, timeout_ms): return timeout_ms or self.config['request_timeout_ms'] def _refresh_controller_id(self): version = self._matching_api_version(MetadataRequest) if 1 <= version <= 6: request = MetadataRequest[version]() future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value controller_id = response.controller_id controller_version = self._client.check_version(controller_id) if controller_version < (0, 10, 0): raise IncompatibleBrokerVersion( "The controller appears to be running Kafka {}. KafkaAdminClient requires brokers >= 0.10.0.0." .format(controller_version)) self._controller_id = controller_id else: raise UnrecognizedBrokerVersion( "Kafka Admin interface cannot determine the controller using MetadataRequest_v{}." .format(version)) def _find_coordinator_id_send_request(self, group_id): # GroupCoordinatorResponse_v0 and I couldn't figure out why. version = 0 if version <= 0: request = GroupCoordinatorRequest[version](group_id) else: raise NotImplementedError( "Support for GroupCoordinatorRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(self._client.least_loaded_node(), request) def _find_coordinator_id_process_response(self, response): if response.API_VERSION <= 0: error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: raise error_type( "FindCoordinatorRequest failed with response '{}'." .format(response)) else: raise NotImplementedError( "Support for FindCoordinatorRequest_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return response.coordinator_id def _find_coordinator_id(self, group_id): # Note: Java may change how this is implemented in KAFKA-6791. future = self._find_coordinator_id_send_request(group_id) self._wait_for_futures([future]) response = future.value return self._find_coordinator_id_process_response(response) def _send_request_to_node(self, node_id, request): while not self._client.ready(node_id): # poll until the connection to broker is ready, otherwise send() # will fail with NodeNotReadyError self._client.poll() return self._client.send(node_id, request) def _send_request_to_controller(self, request): tries = 2 # in case our cached self._controller_id is outdated while tries: tries -= 1 future = self._send_request_to_node(self._controller_id, request) self._wait_for_futures([future]) response = future.value # In Java, the error fieldname is inconsistent: # - CreateTopicsResponse / CreatePartitionsResponse uses topic_errors # - DeleteTopicsResponse uses topic_error_codes # So this is a little brittle in that it assumes all responses have # one of these attributes and that they always unpack into # (topic, error_code) tuples. topic_error_tuples = (response.topic_errors if hasattr(response, 'topic_errors') else response.topic_error_codes) # Also small py2/py3 compatibility -- py3 can ignore extra values # during unpack via: for x, y, *rest in list_of_values. py2 cannot. # So for now we have to map across the list and explicitly drop any # extra values (usually the error_message) for topic, error_code in map(lambda e: e[:2], topic_error_tuples): error_type = Errors.for_code(error_code) if tries and error_type is NotControllerError: # No need to inspect the rest of the errors for # non-retriable errors because NotControllerError should # either be thrown for all errors or no errors. self._refresh_controller_id() break elif error_type is not Errors.NoError: raise error_type( "Request '{}' failed with response '{}'." .format(request, response)) else: return response raise RuntimeError("This should never happen, please file a bug with full stacktrace if encountered") @staticmethod def _convert_new_topic_request(new_topic): return ( new_topic.name, new_topic.num_partitions, new_topic.replication_factor, [ (partition_id, replicas) for partition_id, replicas in new_topic.replica_assignments.items() ], [ (config_key, config_value) for config_key, config_value in new_topic.topic_configs.items() ] ) def create_topics(self, new_topics, timeout_ms=None, validate_only=False): version = self._matching_api_version(CreateTopicsRequest) timeout_ms = self._validate_timeout(timeout_ms) if version == 0: if validate_only: raise IncompatibleBrokerVersion( "validate_only requires CreateTopicsRequest >= v1, which is not supported by Kafka {}." .format(self.config['api_version'])) request = CreateTopicsRequest[version]( create_topic_requests=[self._convert_new_topic_request(new_topic) for new_topic in new_topics], timeout=timeout_ms ) elif version <= 3: request = CreateTopicsRequest[version]( create_topic_requests=[self._convert_new_topic_request(new_topic) for new_topic in new_topics], timeout=timeout_ms, validate_only=validate_only ) else: raise NotImplementedError( "Support for CreateTopics v{} has not yet been added to KafkaAdminClient." .format(version)) # TODO convert structs to a more pythonic interface # TODO raise exceptions if errors return self._send_request_to_controller(request) def delete_topics(self, topics, timeout_ms=None): version = self._matching_api_version(DeleteTopicsRequest) timeout_ms = self._validate_timeout(timeout_ms) if version <= 3: request = DeleteTopicsRequest[version]( topics=topics, timeout=timeout_ms ) response = self._send_request_to_controller(request) else: raise NotImplementedError( "Support for DeleteTopics v{} has not yet been added to KafkaAdminClient." .format(version)) return response def _get_cluster_metadata(self, topics=None, auto_topic_creation=False, use_controller=False): version = self._matching_api_version(MetadataRequest) if version <= 3: if auto_topic_creation: raise IncompatibleBrokerVersion( "auto_topic_creation requires MetadataRequest >= v4, which" " is not supported by Kafka {}" .format(self.config['api_version'])) request = MetadataRequest[version](topics=topics) elif version <= 5: request = MetadataRequest[version]( topics=topics, allow_auto_topic_creation=auto_topic_creation ) if use_controller: return self._send_request_to_controller(request) future = self._send_request_to_node( self._client.least_loaded_node(), request ) self._wait_for_futures([future]) return future.value def list_topics(self): metadata = self._get_cluster_metadata(topics=None) obj = metadata.to_object() return [t['topic'] for t in obj['topics']] def describe_topics(self, topics=None): metadata = self._get_cluster_metadata(topics=topics, use_controller=True) obj = metadata.to_object() return obj['topics'] def describe_cluster(self): metadata = self._get_cluster_metadata() obj = metadata.to_object() obj.pop('topics') # We have 'describe_topics' for this return obj @staticmethod def _convert_describe_acls_response_to_acls(describe_response): version = describe_response.API_VERSION error = Errors.for_code(describe_response.error_code) acl_list = [] for resources in describe_response.resources: if version == 0: resource_type, resource_name, acls = resources resource_pattern_type = ACLResourcePatternType.LITERAL.value elif version <= 1: resource_type, resource_name, resource_pattern_type, acls = resources else: raise NotImplementedError( "Support for DescribeAcls Response v{} has not yet been added to KafkaAdmin." .format(version) ) for acl in acls: principal, host, operation, permission_type = acl conv_acl = ACL( principal=principal, host=host, operation=ACLOperation(operation), permission_type=ACLPermissionType(permission_type), resource_pattern=ResourcePattern( ResourceType(resource_type), resource_name, ACLResourcePatternType(resource_pattern_type) ) ) acl_list.append(conv_acl) return (acl_list, error,) def describe_acls(self, acl_filter): version = self._matching_api_version(DescribeAclsRequest) if version == 0: request = DescribeAclsRequest[version]( resource_type=acl_filter.resource_pattern.resource_type, resource_name=acl_filter.resource_pattern.resource_name, principal=acl_filter.principal, host=acl_filter.host, operation=acl_filter.operation, permission_type=acl_filter.permission_type ) elif version <= 1: request = DescribeAclsRequest[version]( resource_type=acl_filter.resource_pattern.resource_type, resource_name=acl_filter.resource_pattern.resource_name, resource_pattern_type_filter=acl_filter.resource_pattern.pattern_type, principal=acl_filter.principal, host=acl_filter.host, operation=acl_filter.operation, permission_type=acl_filter.permission_type ) else: raise NotImplementedError( "Support for DescribeAcls v{} has not yet been added to KafkaAdmin." .format(version) ) future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: # optionally we could retry if error_type.retriable raise error_type( "Request '{}' failed with response '{}'." .format(request, response)) return self._convert_describe_acls_response_to_acls(response) @staticmethod def _convert_create_acls_resource_request_v0(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_create_acls_resource_request_v1(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.resource_pattern.pattern_type, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_create_acls_response_to_acls(acls, create_response): version = create_response.API_VERSION creations_error = [] creations_success = [] for i, creations in enumerate(create_response.creation_responses): if version <= 1: error_code, error_message = creations acl = acls[i] error = Errors.for_code(error_code) else: raise NotImplementedError( "Support for DescribeAcls Response v{} has not yet been added to KafkaAdmin." .format(version) ) if error is Errors.NoError: creations_success.append(acl) else: creations_error.append((acl, error,)) return {"succeeded": creations_success, "failed": creations_error} def create_acls(self, acls): for acl in acls: if not isinstance(acl, ACL): raise IllegalArgumentError("acls must contain ACL objects") version = self._matching_api_version(CreateAclsRequest) if version == 0: request = CreateAclsRequest[version]( creations=[self._convert_create_acls_resource_request_v0(acl) for acl in acls] ) elif version <= 1: request = CreateAclsRequest[version]( creations=[self._convert_create_acls_resource_request_v1(acl) for acl in acls] ) else: raise NotImplementedError( "Support for CreateAcls v{} has not yet been added to KafkaAdmin." .format(version) ) future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value return self._convert_create_acls_response_to_acls(acls, response) @staticmethod def _convert_delete_acls_resource_request_v0(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_delete_acls_resource_request_v1(acl): return ( acl.resource_pattern.resource_type, acl.resource_pattern.resource_name, acl.resource_pattern.pattern_type, acl.principal, acl.host, acl.operation, acl.permission_type ) @staticmethod def _convert_delete_acls_response_to_matching_acls(acl_filters, delete_response): version = delete_response.API_VERSION filter_result_list = [] for i, filter_responses in enumerate(delete_response.filter_responses): filter_error_code, filter_error_message, matching_acls = filter_responses filter_error = Errors.for_code(filter_error_code) acl_result_list = [] for acl in matching_acls: if version == 0: error_code, error_message, resource_type, resource_name, principal, host, operation, permission_type = acl resource_pattern_type = ACLResourcePatternType.LITERAL.value elif version == 1: error_code, error_message, resource_type, resource_name, resource_pattern_type, principal, host, operation, permission_type = acl else: raise NotImplementedError( "Support for DescribeAcls Response v{} has not yet been added to KafkaAdmin." .format(version) ) acl_error = Errors.for_code(error_code) conv_acl = ACL( principal=principal, host=host, operation=ACLOperation(operation), permission_type=ACLPermissionType(permission_type), resource_pattern=ResourcePattern( ResourceType(resource_type), resource_name, ACLResourcePatternType(resource_pattern_type) ) ) acl_result_list.append((conv_acl, acl_error,)) filter_result_list.append((acl_filters[i], acl_result_list, filter_error,)) return filter_result_list def delete_acls(self, acl_filters): for acl in acl_filters: if not isinstance(acl, ACLFilter): raise IllegalArgumentError("acl_filters must contain ACLFilter type objects") version = self._matching_api_version(DeleteAclsRequest) if version == 0: request = DeleteAclsRequest[version]( filters=[self._convert_delete_acls_resource_request_v0(acl) for acl in acl_filters] ) elif version <= 1: request = DeleteAclsRequest[version]( filters=[self._convert_delete_acls_resource_request_v1(acl) for acl in acl_filters] ) else: raise NotImplementedError( "Support for DeleteAcls v{} has not yet been added to KafkaAdmin." .format(version) ) future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value return self._convert_delete_acls_response_to_matching_acls(acl_filters, response) @staticmethod def _convert_describe_config_resource_request(config_resource): return ( config_resource.resource_type, config_resource.name, [ config_key for config_key, config_value in config_resource.configs.items() ] if config_resource.configs else None ) def describe_configs(self, config_resources, include_synonyms=False): # Break up requests by type - a broker config request must be sent to the specific broker. # All other (currently just topic resources) can be sent to any broker. broker_resources = [] topic_resources = [] for config_resource in config_resources: if config_resource.resource_type == ConfigResourceType.BROKER: broker_resources.append(self._convert_describe_config_resource_request(config_resource)) else: topic_resources.append(self._convert_describe_config_resource_request(config_resource)) futures = [] version = self._matching_api_version(DescribeConfigsRequest) if version == 0: if include_synonyms: raise IncompatibleBrokerVersion( "include_synonyms requires DescribeConfigsRequest >= v1, which is not supported by Kafka {}." .format(self.config['api_version'])) if len(broker_resources) > 0: for broker_resource in broker_resources: try: broker_id = int(broker_resource[1]) except ValueError: raise ValueError("Broker resource names must be an integer or a string represented integer") futures.append(self._send_request_to_node( broker_id, DescribeConfigsRequest[version](resources=[broker_resource]) )) if len(topic_resources) > 0: futures.append(self._send_request_to_node( self._client.least_loaded_node(), DescribeConfigsRequest[version](resources=topic_resources) )) elif version <= 2: if len(broker_resources) > 0: for broker_resource in broker_resources: try: broker_id = int(broker_resource[1]) except ValueError: raise ValueError("Broker resource names must be an integer or a string represented integer") futures.append(self._send_request_to_node( broker_id, DescribeConfigsRequest[version]( resources=[broker_resource], include_synonyms=include_synonyms) )) if len(topic_resources) > 0: futures.append(self._send_request_to_node( self._client.least_loaded_node(), DescribeConfigsRequest[version](resources=topic_resources, include_synonyms=include_synonyms) )) else: raise NotImplementedError( "Support for DescribeConfigs v{} has not yet been added to KafkaAdminClient.".format(version)) self._wait_for_futures(futures) return [f.value for f in futures] @staticmethod def _convert_alter_config_resource_request(config_resource): return ( config_resource.resource_type, config_resource.name, [ (config_key, config_value) for config_key, config_value in config_resource.configs.items() ] ) def alter_configs(self, config_resources): version = self._matching_api_version(AlterConfigsRequest) if version <= 1: request = AlterConfigsRequest[version]( resources=[self._convert_alter_config_resource_request(config_resource) for config_resource in config_resources] ) else: raise NotImplementedError( "Support for AlterConfigs v{} has not yet been added to KafkaAdminClient." .format(version)) # TODO the Java client has the note: # // We must make a separate AlterConfigs request for every BROKER resource we want to alter # // and send the request to that specific broker. Other resources are grouped together into # // a single request that may be sent to any broker. # # So this is currently broken as it always sends to the least_loaded_node() future = self._send_request_to_node(self._client.least_loaded_node(), request) self._wait_for_futures([future]) response = future.value return response # alter replica logs dir protocol not yet implemented # Note: have to lookup the broker with the replica assignment and send the request to that broker # describe log dirs protocol not yet implemented # Note: have to lookup the broker with the replica assignment and send the request to that broker @staticmethod def _convert_create_partitions_request(topic_name, new_partitions): return ( topic_name, ( new_partitions.total_count, new_partitions.new_assignments ) ) def create_partitions(self, topic_partitions, timeout_ms=None, validate_only=False): version = self._matching_api_version(CreatePartitionsRequest) timeout_ms = self._validate_timeout(timeout_ms) if version <= 1: request = CreatePartitionsRequest[version]( topic_partitions=[self._convert_create_partitions_request(topic_name, new_partitions) for topic_name, new_partitions in topic_partitions.items()], timeout=timeout_ms, validate_only=validate_only ) else: raise NotImplementedError( "Support for CreatePartitions v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_controller(request) # delete records protocol not yet implemented # Note: send the request to the partition leaders # create delegation token protocol not yet implemented # Note: send the request to the least_loaded_node() # renew delegation token protocol not yet implemented # Note: send the request to the least_loaded_node() # expire delegation_token protocol not yet implemented # Note: send the request to the least_loaded_node() # describe delegation_token protocol not yet implemented # Note: send the request to the least_loaded_node() def _describe_consumer_groups_send_request(self, group_id, group_coordinator_id, include_authorized_operations=False): version = self._matching_api_version(DescribeGroupsRequest) if version <= 2: if include_authorized_operations: raise IncompatibleBrokerVersion( "include_authorized_operations requests " "DescribeGroupsRequest >= v3, which is not " "supported by Kafka {}".format(version) ) # Note: KAFKA-6788 A potential optimization is to group the # request per coordinator and send one request with a list of # all consumer groups. Java still hasn't implemented this request = DescribeGroupsRequest[version](groups=(group_id,)) elif version <= 3: request = DescribeGroupsRequest[version]( groups=(group_id,), include_authorized_operations=include_authorized_operations ) else: raise NotImplementedError( "Support for DescribeGroupsRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(group_coordinator_id, request) def _describe_consumer_groups_process_response(self, response): if response.API_VERSION <= 3: assert len(response.groups) == 1 # TODO need to implement converting the response tuple into # a more accessible interface like a namedtuple and then stop # hardcoding tuple indices here. Several Java examples, # including KafkaAdminClient.java group_description = response.groups[0] error_code = group_description[0] error_type = Errors.for_code(error_code) # Java has the note: KAFKA-6789, we can retry based on the error code if error_type is not Errors.NoError: raise error_type( "DescribeGroupsResponse failed with response '{}'." .format(response)) # TODO Java checks the group protocol type, and if consumer # (ConsumerProtocol.PROTOCOL_TYPE) or empty string, it decodes # the members' partition assignments... that hasn't yet been # implemented here so just return the raw struct results else: raise NotImplementedError( "Support for DescribeGroupsResponse_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return group_description def describe_consumer_groups(self, group_ids, group_coordinator_id=None, include_authorized_operations=False): group_descriptions = [] futures = [] for group_id in group_ids: if group_coordinator_id is not None: this_groups_coordinator_id = group_coordinator_id else: this_groups_coordinator_id = self._find_coordinator_id(group_id) f = self._describe_consumer_groups_send_request( group_id, this_groups_coordinator_id, include_authorized_operations) futures.append(f) self._wait_for_futures(futures) for future in futures: response = future.value group_description = self._describe_consumer_groups_process_response(response) group_descriptions.append(group_description) return group_descriptions def _list_consumer_groups_send_request(self, broker_id): version = self._matching_api_version(ListGroupsRequest) if version <= 2: request = ListGroupsRequest[version]() else: raise NotImplementedError( "Support for ListGroupsRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(broker_id, request) def _list_consumer_groups_process_response(self, response): if response.API_VERSION <= 2: error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: raise error_type( "ListGroupsRequest failed with response '{}'." .format(response)) else: raise NotImplementedError( "Support for ListGroupsResponse_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return response.groups def list_consumer_groups(self, broker_ids=None): # While we return a list, internally use a set to prevent duplicates # because if a group coordinator fails after being queried, and its # consumer groups move to new brokers that haven't yet been queried, consumer_groups = set() if broker_ids is None: broker_ids = [broker.nodeId for broker in self._client.cluster.brokers()] futures = [self._list_consumer_groups_send_request(b) for b in broker_ids] self._wait_for_futures(futures) for f in futures: response = f.value consumer_groups.update(self._list_consumer_groups_process_response(response)) return list(consumer_groups) def _list_consumer_group_offsets_send_request(self, group_id, group_coordinator_id, partitions=None): version = self._matching_api_version(OffsetFetchRequest) if version <= 3: if partitions is None: if version <= 1: raise ValueError( """OffsetFetchRequest_v{} requires specifying the partitions for which to fetch offsets. Omitting the partitions is only supported on brokers >= 0.10.2. For details, see KIP-88.""".format(version)) topics_partitions = None else: topics_partitions_dict = defaultdict(set) for topic, partition in partitions: topics_partitions_dict[topic].add(partition) topics_partitions = list(six.iteritems(topics_partitions_dict)) request = OffsetFetchRequest[version](group_id, topics_partitions) else: raise NotImplementedError( "Support for OffsetFetchRequest_v{} has not yet been added to KafkaAdminClient." .format(version)) return self._send_request_to_node(group_coordinator_id, request) def _list_consumer_group_offsets_process_response(self, response): if response.API_VERSION <= 3: if response.API_VERSION > 1: error_type = Errors.for_code(response.error_code) if error_type is not Errors.NoError: raise error_type( "OffsetFetchResponse failed with response '{}'." .format(response)) offsets = {} for topic, partitions in response.topics: for partition, offset, metadata, error_code in partitions: error_type = Errors.for_code(error_code) if error_type is not Errors.NoError: raise error_type( "Unable to fetch consumer group offsets for topic {}, partition {}" .format(topic, partition)) offsets[TopicPartition(topic, partition)] = OffsetAndMetadata(offset, metadata) else: raise NotImplementedError( "Support for OffsetFetchResponse_v{} has not yet been added to KafkaAdminClient." .format(response.API_VERSION)) return offsets def list_consumer_group_offsets(self, group_id, group_coordinator_id=None, partitions=None): if group_coordinator_id is None: group_coordinator_id = self._find_coordinator_id(group_id) future = self._list_consumer_group_offsets_send_request( group_id, group_coordinator_id, partitions) self._wait_for_futures([future]) response = future.value return self._list_consumer_group_offsets_process_response(response) def _wait_for_futures(self, futures): while not all(future.succeeded() for future in futures): for future in futures: self._client.poll(future=future) if future.failed(): raise future.exception # pylint: disable-msg=raising-bad-type
true
true
f71d9f5f3241fcead0f224c1faf1af11464dc292
1,236
py
Python
feincms/module/extensions/seo.py
barseghyanartur/feincms
7a319f78c5a5cd0c60e6141d1221f3c7a0d4a7f0
[ "BSD-3-Clause" ]
1
2016-05-07T11:50:28.000Z
2016-05-07T11:50:28.000Z
feincms/module/extensions/seo.py
barseghyanartur/feincms
7a319f78c5a5cd0c60e6141d1221f3c7a0d4a7f0
[ "BSD-3-Clause" ]
null
null
null
feincms/module/extensions/seo.py
barseghyanartur/feincms
7a319f78c5a5cd0c60e6141d1221f3c7a0d4a7f0
[ "BSD-3-Clause" ]
1
2019-03-15T19:36:34.000Z
2019-03-15T19:36:34.000Z
""" Add a keyword and a description field which are helpful for SEO optimization. """ from __future__ import absolute_import, unicode_literals from django.db import models from django.utils.translation import ugettext_lazy as _ from feincms import extensions class Extension(extensions.Extension): def handle_model(self): self.model.add_to_class('meta_keywords', models.TextField( _('meta keywords'), blank=True, help_text=_('Keywords are ignored by most search engines.'))) self.model.add_to_class('meta_description', models.TextField( _('meta description'), blank=True, help_text=_('This text is displayed on the search results page. ' 'It is however not used for the SEO ranking. ' 'Text longer than 140 characters is truncated.'))) def handle_modeladmin(self, modeladmin): modeladmin.extend_list( 'search_fields', ['meta_keywords', 'meta_description'], ) modeladmin.add_extension_options(_('Search engine optimization'), { 'fields': ('meta_keywords', 'meta_description'), 'classes': ('collapse',), })
34.333333
77
0.636731
from __future__ import absolute_import, unicode_literals from django.db import models from django.utils.translation import ugettext_lazy as _ from feincms import extensions class Extension(extensions.Extension): def handle_model(self): self.model.add_to_class('meta_keywords', models.TextField( _('meta keywords'), blank=True, help_text=_('Keywords are ignored by most search engines.'))) self.model.add_to_class('meta_description', models.TextField( _('meta description'), blank=True, help_text=_('This text is displayed on the search results page. ' 'It is however not used for the SEO ranking. ' 'Text longer than 140 characters is truncated.'))) def handle_modeladmin(self, modeladmin): modeladmin.extend_list( 'search_fields', ['meta_keywords', 'meta_description'], ) modeladmin.add_extension_options(_('Search engine optimization'), { 'fields': ('meta_keywords', 'meta_description'), 'classes': ('collapse',), })
true
true
f71da02dc1dd8dc3b72ea75a423abc1e89aa3bf5
293
py
Python
eggs/bx_python-0.7.1_7b95ff194725-py2.7-linux-x86_64-ucs4.egg/bx/pwm/_position_weight_matrix.py
bopopescu/phyG
023f505b705ab953f502cbc55e90612047867583
[ "CC-BY-3.0" ]
1
2019-07-29T02:53:51.000Z
2019-07-29T02:53:51.000Z
eggs/bx_python-0.7.1_7b95ff194725-py2.7-linux-x86_64-ucs4.egg/bx/pwm/_position_weight_matrix.py
bopopescu/phyG
023f505b705ab953f502cbc55e90612047867583
[ "CC-BY-3.0" ]
1
2021-09-11T14:30:32.000Z
2021-09-11T14:30:32.000Z
eggs/bx_python-0.7.1_7b95ff194725-py2.7-linux-x86_64-ucs4.egg/bx/pwm/_position_weight_matrix.py
bopopescu/phyG
023f505b705ab953f502cbc55e90612047867583
[ "CC-BY-3.0" ]
2
2016-12-19T02:27:46.000Z
2019-07-29T02:53:54.000Z
def __bootstrap__(): global __bootstrap__, __loader__, __file__ import sys, pkg_resources, imp __file__ = pkg_resources.resource_filename(__name__,'_position_weight_matrix.so') __loader__ = None; del __bootstrap__, __loader__ imp.load_dynamic(__name__,__file__) __bootstrap__()
36.625
84
0.795222
def __bootstrap__(): global __bootstrap__, __loader__, __file__ import sys, pkg_resources, imp __file__ = pkg_resources.resource_filename(__name__,'_position_weight_matrix.so') __loader__ = None; del __bootstrap__, __loader__ imp.load_dynamic(__name__,__file__) __bootstrap__()
true
true
f71da18676c625d83bf9f11496ad2774d4ad9b06
348
py
Python
main.py
filiptronicek/github-rank-action
d3f675233ccc26162cf0b70e825cd717f3b2b1d3
[ "MIT" ]
1
2020-07-22T21:46:10.000Z
2020-07-22T21:46:10.000Z
main.py
filiptronicek/github-rank-action
d3f675233ccc26162cf0b70e825cd717f3b2b1d3
[ "MIT" ]
null
null
null
main.py
filiptronicek/github-rank-action
d3f675233ccc26162cf0b70e825cd717f3b2b1d3
[ "MIT" ]
null
null
null
import requests, json from sys import argv from modify import write country = "czech_republic" url = f"https://top-ghusers.vercel.app/api?c={country}" responce = requests.get(url) resJson = json.loads(responce.text) for user in resJson['users']: if user['user']['username'] == argv[1]: write(user['rank']) print(user['rank'])
24.857143
55
0.678161
import requests, json from sys import argv from modify import write country = "czech_republic" url = f"https://top-ghusers.vercel.app/api?c={country}" responce = requests.get(url) resJson = json.loads(responce.text) for user in resJson['users']: if user['user']['username'] == argv[1]: write(user['rank']) print(user['rank'])
true
true
f71da18e1e0bbfc1e0daede493d7642be9502b6b
18,868
py
Python
src/msc/datagroups/__init__.py
magicbadger/python-dabmsc
fe4f2e195ffe0b0d75f4766893df687563e857a1
[ "Apache-2.0" ]
null
null
null
src/msc/datagroups/__init__.py
magicbadger/python-dabmsc
fe4f2e195ffe0b0d75f4766893df687563e857a1
[ "Apache-2.0" ]
null
null
null
src/msc/datagroups/__init__.py
magicbadger/python-dabmsc
fe4f2e195ffe0b0d75f4766893df687563e857a1
[ "Apache-2.0" ]
2
2021-10-15T01:29:38.000Z
2022-03-22T06:05:35.000Z
from msc import bitarray_to_hex, int_to_bitarray, calculate_crc, InvalidCrcError, generate_transport_id from mot import DirectoryEncoder, SortedHeaderInformation from bitarray import bitarray import logging import types import itertools logger = logging.getLogger('msc.datagroups') MAX_SEGMENT_SIZE=8189 # maximum data segment size in bytes # datagroup types HEADER = 3 BODY = 4 DIRECTORY_UNCOMPRESSED = 6 DIRECTORY_COMPRESSED = 7 class SegmentingStrategy: def get_next_segment_size(self, data, position, segments): """Returns the suggested maximum size of the next segment""" raise NotImplementedError('strategy has not been implemented properly - expected method: get_next_segment_size(self, data, position, segments)') class ConstantSegmentSize(SegmentingStrategy): """Strategy to ensure that each segment is the same size, apart from the last one, which may be smaller""" def __init__(self, maximum_segment_size=MAX_SEGMENT_SIZE): self.maximum_segment_size = maximum_segment_size def get_next_segment_size(self, data, position, segments): return self.maximum_segment_size class CompletionTriggerSegmentingStrategy(SegmentingStrategy): """Strategy to ensure the last datagroup is small enough to be held within a single packet for triggering via the completion of the total set of datagroups. This is to enable synchronised imagery""" def __init__(self, target_final_segment_size, maximum_segment_size=MAX_SEGMENT_SIZE, ): if target_final_segment_size > maximum_segment_size: raise ValueError('target final segment size must be less than the maximum segment size') self.maximum_segment_size = maximum_segment_size # # calculate the estimated final segment size from parameters # estimated_final_segment_size = target_final_packet_size # estimated_final_segment_size -= 2 # packet CRC # estimated_final_segment_size -= 3 # packet header # estimated_final_segment_size -= 2 # datagroup CRC # estimated_final_segment_size -= 7 # datagroup header (typical minimal config) self.target_final_segment_size = target_final_segment_size def calculate_segment_sizes(self, length): # need to try for the exact target final segment size, or less # with equal sizes of the preceding segments - therefore they # will need to be exactly fitting X = self.maximum_segment_size Y = self.target_final_segment_size while Y > 0: while X > 0: if (length - Y + 2) % X == 0: return X, Y X -= 1 Y -= 1 def get_next_segment_size(self, data, position, segments): if not len(segments): # no calculation done yet X, Y = self.calculate_segment_sizes(len(data)) else: X = len(segments[0]) - 2 n = 1 Y = (len(data) / X) % n - 2 while Y > self.target_final_segment_size: n += 1 if len(data) - position > Y: return X else: return Y def _segment(data, strategy): segments = [] # partition the segments up using the maximum segment size i = 0 if not data: return segments while i < len(data): segment_size = strategy.get_next_segment_size(data, i, segments) # get segment data segment_data = data[i:i+segment_size if i+segment_size < len(data) else len(data)] # segment header bits = bitarray() bits += int_to_bitarray(0, 3) # (0-2): Repetition Count remaining (0 = only broadcast) bits += int_to_bitarray(len(segment_data), 13) # (3-16): SegmentSize segments.append((bits.tobytes()) + segment_data) i += segment_size return segments; def encode_headermode(objects, segmenting_strategy=None): """ Encode a set of MOT Objects into header mode segments """ datagroups = [] if not segmenting_strategy: segmenting_strategy=ConstantSegmentSize() # backward compatibility if not isinstance(objects, list): objects = [objects] logger.debug('encoding %d MOT objects to header mode datagroups', len(objects)) for object in objects: if not object: raise ValueError('object returned is null') # split body data into segments body_data = object.get_body() body_segments = _segment(body_data, segmenting_strategy) # encode header extension parameters extension_bits = bitarray() for parameter in object.get_parameters(): extension_bits += parameter.encode() # insert the core parameters into the header bits = bitarray() bits += int_to_bitarray(len(body_data) if body_data else 0, 28) # (0-27): BodySize in bytes bits += int_to_bitarray(len(extension_bits) / 8 + 7, 13) # (28-40): HeaderSize in bytes (core=7 + extension) bits += int_to_bitarray(object.get_type().type, 6) # (41-46): ContentType bits += int_to_bitarray(object.get_type().subtype, 9) # (47-55): ContentSubType bits += extension_bits # (56-n): Header extension data header_segments = _segment(bits.tobytes(), segmenting_strategy) # add header datagroups for i, segment in enumerate(header_segments): header_group = Datagroup(object.get_transport_id(), HEADER, segment, i, i%16, last=True if i == len(header_segments) - 1 else False) datagroups.append(header_group) # add body datagroups for i, segment in enumerate(body_segments): body_group = Datagroup(object.get_transport_id(), BODY, segment, i, i%16, last=True if i == len(body_segments) - 1 else False) datagroups.append(body_group) return datagroups; def encode_directorymode(objects, directory_parameters=None, segmenting_strategy=None): """ Encode a set of MOT objects into directory mode segments, along with a segmented directory object """ datagroups = [] if not segmenting_strategy: segmenting_strategy=ConstantSegmentSize() # build the directory entries entries = bitarray() for object in objects: # encode header extension parameters extension_bits = bitarray() for parameter in object.get_parameters(): extension_bits += parameter.encode() # transport ID in first 2 bytes entries += int_to_bitarray(object.get_transport_id(), 16) # add the core parameters into the header entries += int_to_bitarray(len(object.get_body()), 28) # (0-27): BodySize in bytes entries += int_to_bitarray(len(extension_bits) / 8 + 7, 13) # (28-40): HeaderSize in bytes (core=7 + extension) entries += int_to_bitarray(object.get_type().type, 6) # (41-46): ContentType entries += int_to_bitarray(object.get_type().subtype, 9) # (47-55): ContentSubType entries += extension_bits # (56-n): Header extension data # build directory parameters directory_params = bitarray() if directory_parameters is not None: for parameter in directory_parameters: directory_params += parameter.encode() # build directory header bits = bitarray() bits += bitarray('0') # (0): CompressionFlag: This bit shall be set to 0 bits += bitarray('0') # (1): RFU bits += int_to_bitarray(len(entries.tobytes()) + 13 + len(directory_params.tobytes()), 30) # (2-31): DirectorySize: total size of the MOT directory in bytes, including the 13 header bytes and length of the directory parameter bytes bits += int_to_bitarray(len(objects), 16) # (32-47): NumberOfObjects: Total number of objects described by the directory bits += int_to_bitarray(0, 24) # (48-71): DataCarouselPeriod: Max time in tenths of seconds for the data carousel to complete a cycle. Value of zero for undefined bits += bitarray('000') # (72-74): RFU bits += int_to_bitarray(0, 13) # (75-87): SegmentSize: Size in bytes that will be used for the segmentation of objects within the MOT carousel. Value of zero indicates that objects can have different segmentation sizes. The last segment of an obect may be smaller than this size. bits += int_to_bitarray(len(directory_params.tobytes()), 16) # (88-103): DirectoryExtensionLength: Length of following directory extension bytes # add directory parameters bits += directory_params # add directory entries bits += entries # segment and add directory datagroups with a new transport ID directory_transport_id = generate_transport_id() segments = _segment(bits.tobytes(), segmenting_strategy) for i, segment in enumerate(segments): header_group = Datagroup(directory_transport_id, DIRECTORY_UNCOMPRESSED, segment, i, i%16, last=True if i == len(segments) - 1 else False) tmp = bitarray() tmp.frombytes(header_group.tobytes()) tmp.frombytes(header_group.tobytes()) datagroups.append(header_group) # add body datagroups for object in objects: segments = _segment(object.get_body(), segmenting_strategy) for i, segment in enumerate(segments): body_group = Datagroup(object.get_transport_id(), BODY, segment, i, i%16, last=True if i == len(segments) - 1 else False) datagroups.append(body_group) return datagroups import select def read(fd, n = 1): poll = select.poll() poll.register(fd.fileno(), select.POLLIN or select.POLLPRI) p = poll.poll() if len(p): f = p[0] if f[1] > 0: return fd.read(n) def decode_datagroups(data, error_callback=None, check_crc=True, resync=True): """ Generator function to decode datagroups from a bitstream The bitstream may be presented as either a bitarray, a file object or a generator """ if isinstance(data, bitarray): i = 0 while i < len(data): datagroup = Datagroup.frombits(data, i=i, check_crc=check_crc) yield datagroup i += (datagroup.size * 8) elif isinstance(data, file): logger.debug('decoding datagroups from file: %s', data) buf = bitarray() reading = True while reading: try: r = data.read(8) buf.frombytes(r) except: reading = False logger.exception("error") if not len(buf): logger.debug('buffer is at zero length') return i = 0 #logger.debug('chunking buffer of length %d bytes', len(buf)/8) length = len(buf)/8 if length < 9: continue size = int(buf[59:72].to01(), 2) if length < size: #logger.debug('buffer still not at right size for datagroup size of %d bytes', size) continue while i < len(buf): try: datagroup = Datagroup.frombits(buf, i=i, check_crc=check_crc) yield datagroup i = (datagroup.size * 8) buf = buf[i:] except IncompleteDatagroupError: break except (InvalidCrcError, ice): if error_callback: error_callback(ice) buf = buf[8:] # attempt to resync? #i += 8 elif isinstance(data, types.GeneratorType): logger.debug('decoding datagroups from generator: %s', data) buf = bitarray() i = 0 in_packet = False for p in data: if not in_packet and p.first: in_packet = True elif not in_packet: continue buf.frombytes(p.data) if p.last: logger.debug('got packet %s - buffer now %d bytes', p, len(buf)/8) try: datagroup = Datagroup.frombits(buf, i=i, check_crc=check_crc) logger.debug('yielding datagroup: %s', datagroup) yield datagroup except (IncompleteDatagroupError, ide): if error_callback: error_callback(ide) except (InvalidCrcError, ice): if error_callback: error_callback(ice) del buf buf = bitarray() in_packet = False class IncompleteDatagroupError(Exception): pass class PaddingDatagroup: def __init__(self, delay=0): self.delay = delay class Datagroup: def __init__(self, transport_id, type, data, segment_index, continuity, crc_enabled=True, repetition=0, last=False): self._transport_id = transport_id self._type = type self._data = data self.crc_enabled = crc_enabled self.continuity = continuity self.repetition = repetition self.segment_index = segment_index self.last = last self.size = 7 + 2 + len(self._data) + 2 # encoded datagroup size for chunking = [dg header] + [segment header] + [data] + [crc] def __eq__(self, other): if not isinstance(other, Datagroup): return False return self.get_transport_id() == other.get_transport_id() and self.get_type() == other.get_type() and self.segment_index == other.segment_index def get_transport_id(self): return self._transport_id def get_type(self): return self._type def get_data(self): return self._data def tobytes(self): bits = bitarray() # datagroup header bits += bitarray('0') # (0): ExtensionFlag - 0=no extension bits += bitarray('1' if self.crc_enabled else '0') # (1): CrcFlag - true if there is a CRC at the end of the datagroup bits += bitarray('1') # (2): SegmentFlag - 1=segment header included bits += bitarray('1') # (3): UserAccessFlag - true bits += int_to_bitarray(self._type, 4) # (4-7): DataGroupType bits += int_to_bitarray(self.continuity % 16, 4) # (8-11): ContinuityIndex bits += int_to_bitarray(self.repetition, 4) # (12-15): RepetitionIndex - remaining = 0 (only this once) # session header # segment field bits += bitarray('1' if self.last else '0') # (16): Last - true if the last segment bits += int_to_bitarray(self.segment_index, 15) # (17-32): SegmentNumber # user access field bits += bitarray('000') # (33-35): RFA bits += bitarray('1') # (36): TransportId - true to include Transport ID bits += int_to_bitarray(2, 4) # (37-40): LengthIndicator - length of transport Id and End user address fields (will be 2 bytes as only transport ID defined) bits += int_to_bitarray(self._transport_id, 16) # (41-56) transport ID # data field tmp = bitarray() tmp.frombytes(self._data) bits += tmp # CRC crc = 0; if self.crc_enabled: crc = calculate_crc(bits.tobytes()) bits += int_to_bitarray(crc, 16) return bits.tobytes() @staticmethod def frombits(bits, i=0, check_crc=True): """Parse a datagroup from a bitarray, with an optional offset""" # check we have enough header first if (len(bits) - i) < ((9 + 2) * 8): raise IncompleteDatagroupError # datagroup header type = int(bits[4:8].to01(), 2) continuity = int(bits[8:12].to01(), 2) repetition = int(bits[12:16].to01(), 2) # session header # segment field last = bits[16] segment_index = int(bits[17:32].to01(), 2) # user access field transport_id = int(bits[40:56].to01(), 2) # data segment header size = int(bits[59:72].to01(), 2) # get size to check we have a complete datagroup if len(bits) < 72 + size * 8 + 16: raise IncompleteDatagroupError data = bits[72 : 72 + (size*8)] if check_crc: crc = int(bits[72 + len(data) : 72 + len(data) + 16].to01(), 2) calculated = calculate_crc(bits[:72+len(data)].tobytes()) if crc != calculated: raise InvalidCrcError(crc, bits[:72+len(data) + 16].tobytes()) datagroup = Datagroup(transport_id, type, data.tobytes(), segment_index, continuity, True, repetition, last) logger.debug('parsed datagroup: %s', datagroup) return datagroup def __str__(self): if self._type == 3: type_description = 'MOT Header' elif self._type == 4: type_description = 'MOT Body' elif self._type == 6: type_description = 'MOT Directory (uncompressed)' elif self._type == 7: type_description = 'MOT Directory (compressed)' else: type_description = 'unknown' return '[segment=%d bytes], type=%d [%s], transportid=%d, segmentindex=%d, continuity=%d, last=%s' % (len(self._data), self._type, type_description, self._transport_id, self.segment_index, self.continuity, self.last) def __repr__(self): return '<DataGroup: %s>' % str(self) class DirectoryDatagroupEncoder(DirectoryEncoder): def __init__(self, segmenting_strategy=None, single=False): DirectoryEncoder.__init__(self) self.segmenting_strategy = segmenting_strategy self.single = single self.datagroups = [] self.regenerate() def add(self, object): if object in self.objects: return False self.objects.append(object) self.regenerate() return True def remove(self, object): if object not in self.objects: return False self.objects.remove(object) self.regenerate() return True def clear(self): self.objects = [] self.regenerate() return True def set(self, objects): if objects == self.objects: return False self.objects = objects self.regenerate() return True def regenerate(self): """called when the directory needs to regenerate""" self.datagroups = encode_directorymode(self.objects, directory_parameters=[SortedHeaderInformation()], segmenting_strategy=self.segmenting_strategy) if self.single: self.iterator = iter(self.datagroups) else: self.iterator = itertools.cycle(self.datagroups) def __iter__(self): return self.iterator def __next__(self): return next(self.iterator)
40.928416
283
0.621741
from msc import bitarray_to_hex, int_to_bitarray, calculate_crc, InvalidCrcError, generate_transport_id from mot import DirectoryEncoder, SortedHeaderInformation from bitarray import bitarray import logging import types import itertools logger = logging.getLogger('msc.datagroups') MAX_SEGMENT_SIZE=8189 HEADER = 3 BODY = 4 DIRECTORY_UNCOMPRESSED = 6 DIRECTORY_COMPRESSED = 7 class SegmentingStrategy: def get_next_segment_size(self, data, position, segments): raise NotImplementedError('strategy has not been implemented properly - expected method: get_next_segment_size(self, data, position, segments)') class ConstantSegmentSize(SegmentingStrategy): def __init__(self, maximum_segment_size=MAX_SEGMENT_SIZE): self.maximum_segment_size = maximum_segment_size def get_next_segment_size(self, data, position, segments): return self.maximum_segment_size class CompletionTriggerSegmentingStrategy(SegmentingStrategy): def __init__(self, target_final_segment_size, maximum_segment_size=MAX_SEGMENT_SIZE, ): if target_final_segment_size > maximum_segment_size: raise ValueError('target final segment size must be less than the maximum segment size') self.maximum_segment_size = maximum_segment_size X = self.maximum_segment_size Y = self.target_final_segment_size while Y > 0: while X > 0: if (length - Y + 2) % X == 0: return X, Y X -= 1 Y -= 1 def get_next_segment_size(self, data, position, segments): if not len(segments): X, Y = self.calculate_segment_sizes(len(data)) else: X = len(segments[0]) - 2 n = 1 Y = (len(data) / X) % n - 2 while Y > self.target_final_segment_size: n += 1 if len(data) - position > Y: return X else: return Y def _segment(data, strategy): segments = [] i = 0 if not data: return segments while i < len(data): segment_size = strategy.get_next_segment_size(data, i, segments) segment_data = data[i:i+segment_size if i+segment_size < len(data) else len(data)] bits = bitarray() bits += int_to_bitarray(0, 3) bits += int_to_bitarray(len(segment_data), 13) segments.append((bits.tobytes()) + segment_data) i += segment_size return segments; def encode_headermode(objects, segmenting_strategy=None): datagroups = [] if not segmenting_strategy: segmenting_strategy=ConstantSegmentSize() if not isinstance(objects, list): objects = [objects] logger.debug('encoding %d MOT objects to header mode datagroups', len(objects)) for object in objects: if not object: raise ValueError('object returned is null') body_data = object.get_body() body_segments = _segment(body_data, segmenting_strategy) extension_bits = bitarray() for parameter in object.get_parameters(): extension_bits += parameter.encode() bits = bitarray() bits += int_to_bitarray(len(body_data) if body_data else 0, 28) bits += int_to_bitarray(len(extension_bits) / 8 + 7, 13) bits += int_to_bitarray(object.get_type().type, 6) bits += int_to_bitarray(object.get_type().subtype, 9) bits += extension_bits header_segments = _segment(bits.tobytes(), segmenting_strategy) for i, segment in enumerate(header_segments): header_group = Datagroup(object.get_transport_id(), HEADER, segment, i, i%16, last=True if i == len(header_segments) - 1 else False) datagroups.append(header_group) for i, segment in enumerate(body_segments): body_group = Datagroup(object.get_transport_id(), BODY, segment, i, i%16, last=True if i == len(body_segments) - 1 else False) datagroups.append(body_group) return datagroups; def encode_directorymode(objects, directory_parameters=None, segmenting_strategy=None): datagroups = [] if not segmenting_strategy: segmenting_strategy=ConstantSegmentSize() entries = bitarray() for object in objects: extension_bits = bitarray() for parameter in object.get_parameters(): extension_bits += parameter.encode() entries += int_to_bitarray(object.get_transport_id(), 16) entries += int_to_bitarray(len(object.get_body()), 28) entries += int_to_bitarray(len(extension_bits) / 8 + 7, 13) entries += int_to_bitarray(object.get_type().type, 6) entries += int_to_bitarray(object.get_type().subtype, 9) entries += extension_bits directory_params = bitarray() if directory_parameters is not None: for parameter in directory_parameters: directory_params += parameter.encode() bits = bitarray() bits += bitarray('0') bits += bitarray('0') bits += int_to_bitarray(len(entries.tobytes()) + 13 + len(directory_params.tobytes()), 30) bits += int_to_bitarray(len(objects), 16) bits += int_to_bitarray(0, 24) bits += bitarray('000') bits += int_to_bitarray(0, 13) bits += int_to_bitarray(len(directory_params.tobytes()), 16) bits += directory_params bits += entries directory_transport_id = generate_transport_id() segments = _segment(bits.tobytes(), segmenting_strategy) for i, segment in enumerate(segments): header_group = Datagroup(directory_transport_id, DIRECTORY_UNCOMPRESSED, segment, i, i%16, last=True if i == len(segments) - 1 else False) tmp = bitarray() tmp.frombytes(header_group.tobytes()) tmp.frombytes(header_group.tobytes()) datagroups.append(header_group) for object in objects: segments = _segment(object.get_body(), segmenting_strategy) for i, segment in enumerate(segments): body_group = Datagroup(object.get_transport_id(), BODY, segment, i, i%16, last=True if i == len(segments) - 1 else False) datagroups.append(body_group) return datagroups import select def read(fd, n = 1): poll = select.poll() poll.register(fd.fileno(), select.POLLIN or select.POLLPRI) p = poll.poll() if len(p): f = p[0] if f[1] > 0: return fd.read(n) def decode_datagroups(data, error_callback=None, check_crc=True, resync=True): if isinstance(data, bitarray): i = 0 while i < len(data): datagroup = Datagroup.frombits(data, i=i, check_crc=check_crc) yield datagroup i += (datagroup.size * 8) elif isinstance(data, file): logger.debug('decoding datagroups from file: %s', data) buf = bitarray() reading = True while reading: try: r = data.read(8) buf.frombytes(r) except: reading = False logger.exception("error") if not len(buf): logger.debug('buffer is at zero length') return i = 0 length = len(buf)/8 if length < 9: continue size = int(buf[59:72].to01(), 2) if length < size: continue while i < len(buf): try: datagroup = Datagroup.frombits(buf, i=i, check_crc=check_crc) yield datagroup i = (datagroup.size * 8) buf = buf[i:] except IncompleteDatagroupError: break except (InvalidCrcError, ice): if error_callback: error_callback(ice) buf = buf[8:] elif isinstance(data, types.GeneratorType): logger.debug('decoding datagroups from generator: %s', data) buf = bitarray() i = 0 in_packet = False for p in data: if not in_packet and p.first: in_packet = True elif not in_packet: continue buf.frombytes(p.data) if p.last: logger.debug('got packet %s - buffer now %d bytes', p, len(buf)/8) try: datagroup = Datagroup.frombits(buf, i=i, check_crc=check_crc) logger.debug('yielding datagroup: %s', datagroup) yield datagroup except (IncompleteDatagroupError, ide): if error_callback: error_callback(ide) except (InvalidCrcError, ice): if error_callback: error_callback(ice) del buf buf = bitarray() in_packet = False class IncompleteDatagroupError(Exception): pass class PaddingDatagroup: def __init__(self, delay=0): self.delay = delay class Datagroup: def __init__(self, transport_id, type, data, segment_index, continuity, crc_enabled=True, repetition=0, last=False): self._transport_id = transport_id self._type = type self._data = data self.crc_enabled = crc_enabled self.continuity = continuity self.repetition = repetition self.segment_index = segment_index self.last = last self.size = 7 + 2 + len(self._data) + 2 def __eq__(self, other): if not isinstance(other, Datagroup): return False return self.get_transport_id() == other.get_transport_id() and self.get_type() == other.get_type() and self.segment_index == other.segment_index def get_transport_id(self): return self._transport_id def get_type(self): return self._type def get_data(self): return self._data def tobytes(self): bits = bitarray() bits += bitarray('0') bits += bitarray('1' if self.crc_enabled else '0') bits += bitarray('1') bits += bitarray('1') bits += int_to_bitarray(self._type, 4) bits += int_to_bitarray(self.continuity % 16, 4) bits += int_to_bitarray(self.repetition, 4) bits += bitarray('1' if self.last else '0') bits += int_to_bitarray(self.segment_index, 15) bits += bitarray('000') bits += bitarray('1') bits += int_to_bitarray(2, 4) bits += int_to_bitarray(self._transport_id, 16) tmp = bitarray() tmp.frombytes(self._data) bits += tmp crc = 0; if self.crc_enabled: crc = calculate_crc(bits.tobytes()) bits += int_to_bitarray(crc, 16) return bits.tobytes() @staticmethod def frombits(bits, i=0, check_crc=True): if (len(bits) - i) < ((9 + 2) * 8): raise IncompleteDatagroupError type = int(bits[4:8].to01(), 2) continuity = int(bits[8:12].to01(), 2) repetition = int(bits[12:16].to01(), 2) last = bits[16] segment_index = int(bits[17:32].to01(), 2) transport_id = int(bits[40:56].to01(), 2) size = int(bits[59:72].to01(), 2) if len(bits) < 72 + size * 8 + 16: raise IncompleteDatagroupError data = bits[72 : 72 + (size*8)] if check_crc: crc = int(bits[72 + len(data) : 72 + len(data) + 16].to01(), 2) calculated = calculate_crc(bits[:72+len(data)].tobytes()) if crc != calculated: raise InvalidCrcError(crc, bits[:72+len(data) + 16].tobytes()) datagroup = Datagroup(transport_id, type, data.tobytes(), segment_index, continuity, True, repetition, last) logger.debug('parsed datagroup: %s', datagroup) return datagroup def __str__(self): if self._type == 3: type_description = 'MOT Header' elif self._type == 4: type_description = 'MOT Body' elif self._type == 6: type_description = 'MOT Directory (uncompressed)' elif self._type == 7: type_description = 'MOT Directory (compressed)' else: type_description = 'unknown' return '[segment=%d bytes], type=%d [%s], transportid=%d, segmentindex=%d, continuity=%d, last=%s' % (len(self._data), self._type, type_description, self._transport_id, self.segment_index, self.continuity, self.last) def __repr__(self): return '<DataGroup: %s>' % str(self) class DirectoryDatagroupEncoder(DirectoryEncoder): def __init__(self, segmenting_strategy=None, single=False): DirectoryEncoder.__init__(self) self.segmenting_strategy = segmenting_strategy self.single = single self.datagroups = [] self.regenerate() def add(self, object): if object in self.objects: return False self.objects.append(object) self.regenerate() return True def remove(self, object): if object not in self.objects: return False self.objects.remove(object) self.regenerate() return True def clear(self): self.objects = [] self.regenerate() return True def set(self, objects): if objects == self.objects: return False self.objects = objects self.regenerate() return True def regenerate(self): self.datagroups = encode_directorymode(self.objects, directory_parameters=[SortedHeaderInformation()], segmenting_strategy=self.segmenting_strategy) if self.single: self.iterator = iter(self.datagroups) else: self.iterator = itertools.cycle(self.datagroups) def __iter__(self): return self.iterator def __next__(self): return next(self.iterator)
true
true
f71da1cb4f5c3c2a1b177350a4e50eb0d6673de5
3,568
py
Python
benchmark/benchmark_SingleOrigin.py
maptube/UMaaS
0758d8352213f332546d728f3eb02411c16c97ac
[ "MIT" ]
null
null
null
benchmark/benchmark_SingleOrigin.py
maptube/UMaaS
0758d8352213f332546d728f3eb02411c16c97ac
[ "MIT" ]
null
null
null
benchmark/benchmark_SingleOrigin.py
maptube/UMaaS
0758d8352213f332546d728f3eb02411c16c97ac
[ "MIT" ]
null
null
null
import timeit import os.path import numpy as np from math import exp, fabs from sys import float_info from globals import * from utils import loadMatrix, resizeMatrix from models.SingleOrigin import SingleOrigin """ Benchmarks for the Single Origin Constrained model (models/SingleOrigin.py) All code here is lifted from the original model code and changed to be self-contained (no setup) so that timings of various optimisations are easy. Code here is designed to be a test of timings, NOT necessarily a test of return values, although real data has been used wherever possible i.e. instead of an NxN matrix containing random values, I try to load in a real matrix instead. """ #modelRunsDir = '../model-runs' #TObsFilename = 'TObs.bin' #1 mode #CijRoadMinFilename = 'Cij_road_min.bin' #load and init Tij=loadMatrix(os.path.join(modelRunsDir,TObs31Filename)) cij=loadMatrix(os.path.join(modelRunsDir,CijRoadMinFilename)) #end load and init ############################################################################### """ calculateCBar_slow Mean trips calculation, straight conversion from original C# code, no python optimisation @returns float """ def benchmark_calculateCBar_slow(): #main code (M, N) = np.shape(Tij) CNumerator = 0.0 CDenominator = 0.0 for i in range(0,N): for j in range(0,N): CNumerator += Tij[i, j] * cij[i, j] CDenominator += Tij[i, j] CBar = CNumerator / CDenominator print("CBar=",CBar) return CBar ############################################################################### """ calculateCBar_fast Mean trips calculation, python optimised version of "_slow" @returns float (NOTE: the return value MUST be identical to the _slow version, to prove they're functionally identical) """ def benchmark_calculateCBar_fast(): #load and init Tij=loadMatrix(os.path.join(modelRunsDir,TObs31Filename)) cij=loadMatrix(os.path.join(modelRunsDir,CijRoadMinFilename)) #end load and init #main code CNumerator2 = np.sum(Tij*cij) CDenominator2 = np.sum(Tij) CBar2=CNumerator2/CDenominator2 print("CBar2=",CBar2) return CBar2 ############################################################################### """ This is a benchmark of the simple Python code for SingleOrigin using different matrix sizes. It is a test for how long a single execution of the main loop takes. Timings are printed to the console based on 1000 runs of the model code i.e. the timing you see in seconds must be divided by 1000. NOTE: this could take a VERY long time to run if you pass in a high number for Nfinish """ def benchmarkSingleOriginMatrixSizes(Nstart,Nfinish,Nstep): print("benchmark_SingleDest running matrix Nstart=",Nstart," Nfinish=",Nfinish, " Nstep=",Nstep) #load testing matrices TObs1 = loadMatrix(os.path.join(modelRunsDir,TObs31Filename)) Cij1 = loadMatrix(os.path.join(modelRunsDir,CijRoadMinFilename)) for N in range(Nstart,Nfinish,Nstep): #print("TPred runModel N=",N) #set up the model testModel = SingleOrigin() (TPred, secs)=testModel.benchmarkRun(1000,resizeMatrix(TObs1,N),resizeMatrix(Cij1,N),1.0) #NOTE: timing printed to console based on 1000 iterations of the main loop in the above code #Should not contain any setup timings - only the actual algorithm run time. print(N,",1000,",secs) #all console logging from here - makes it nice and easy to import into excel ###############################################################################
35.68
119
0.668442
import timeit import os.path import numpy as np from math import exp, fabs from sys import float_info from globals import * from utils import loadMatrix, resizeMatrix from models.SingleOrigin import SingleOrigin =loadMatrix(os.path.join(modelRunsDir,TObs31Filename)) cij=loadMatrix(os.path.join(modelRunsDir,CijRoadMinFilename))
true
true
f71da3dcf19d3269f76e23ee85ee43c5f96e9665
1,047
py
Python
lib/surface/healthcare/consent_stores/__init__.py
google-cloud-sdk-unofficial/google-cloud-sdk
2a48a04df14be46c8745050f98768e30474a1aac
[ "Apache-2.0" ]
2
2019-11-10T09:17:07.000Z
2019-12-18T13:44:08.000Z
lib/surface/healthcare/consent_stores/__init__.py
google-cloud-sdk-unofficial/google-cloud-sdk
2a48a04df14be46c8745050f98768e30474a1aac
[ "Apache-2.0" ]
null
null
null
lib/surface/healthcare/consent_stores/__init__.py
google-cloud-sdk-unofficial/google-cloud-sdk
2a48a04df14be46c8745050f98768e30474a1aac
[ "Apache-2.0" ]
1
2020-07-25T01:40:19.000Z
2020-07-25T01:40:19.000Z
# -*- coding: utf-8 -*- # # Copyright 2020 Google LLC. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """The consent stores command group for the Cloud Healthcare API CLI.""" from __future__ import absolute_import from __future__ import division from __future__ import unicode_literals from googlecloudsdk.calliope import base @base.ReleaseTracks(base.ReleaseTrack.ALPHA, base.ReleaseTrack.BETA, base.ReleaseTrack.GA) class ConsentStores(base.Group): """Manage Cloud Healthcare API consent stores."""
36.103448
74
0.759312
from __future__ import absolute_import from __future__ import division from __future__ import unicode_literals from googlecloudsdk.calliope import base @base.ReleaseTracks(base.ReleaseTrack.ALPHA, base.ReleaseTrack.BETA, base.ReleaseTrack.GA) class ConsentStores(base.Group):
true
true
f71da4622f2c54b555de3eae3160f218b25dc007
4,261
py
Python
io_scene_niftools/properties/collision.py
reddraconi/blender_nif_plugin
a4cd7545ccff952fa99bdf66dc043e00372de2ee
[ "BSD-3-Clause" ]
1
2021-10-18T00:35:25.000Z
2021-10-18T00:35:25.000Z
io_scene_niftools/properties/collision.py
luxaritas/blender_niftools_addon
704c40d7edabea292ddb2da875fd3ff1bf354d4a
[ "BSD-3-Clause" ]
2
2020-11-06T21:37:09.000Z
2020-12-06T20:33:59.000Z
io_scene_niftools/properties/collision.py
luxaritas/blender_niftools_addon
704c40d7edabea292ddb2da875fd3ff1bf354d4a
[ "BSD-3-Clause" ]
null
null
null
"""Nif User Interface, custom nif properties store for collisions settings""" # ***** BEGIN LICENSE BLOCK ***** # # Copyright © 2014, NIF File Format Library and Tools contributors. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions # are met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following # disclaimer in the documentation and/or other materials provided # with the distribution. # # * Neither the name of the NIF File Format Library and Tools # project nor the names of its contributors may be used to endorse # or promote products derived from this software without specific # prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS # FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE # COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, # INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, # BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; # LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER # CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT # LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN # ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. # # ***** END LICENSE BLOCK ***** from bpy.props import (PointerProperty, IntProperty, BoolProperty, EnumProperty, FloatProperty, ) from bpy.types import PropertyGroup from pyffi.formats.nif import NifFormat class CollisionProperty(PropertyGroup): """Group of Havok related properties, which gets attached to objects through a property pointer.""" motion_system: EnumProperty( name='Motion System', description='Havok Motion System settings for bhkRigidBody(t)', items=[(item, item, "", i) for i, item in enumerate(NifFormat.MotionSystem._enumkeys)], # default = 'MO_SYS_FIXED', ) oblivion_layer: EnumProperty( name='Oblivion Layer', description='Mesh color, used in Editor', items=[(item, item, "", i) for i, item in enumerate(NifFormat.OblivionLayer._enumkeys)], # default = 'OL_STATIC', ) deactivator_type: EnumProperty( name='Deactivator Type', description='Motion deactivation setting', items=[(item, item, "", i) for i, item in enumerate(NifFormat.DeactivatorType._enumkeys)], ) solver_deactivation: EnumProperty( name='Solver Deactivation', description='Motion deactivation setting', items=[(item, item, "", i) for i, item in enumerate(NifFormat.SolverDeactivation._enumkeys)], ) quality_type: EnumProperty( name='Quality Type', description='Determines quality of motion', items=[(item, item, "", i) for i, item in enumerate(NifFormat.MotionQuality._enumkeys)], # default = 'MO_QUAL_FIXED', ) col_filter: IntProperty( name='Col Filter', description='Flags for bhkRigidBody(t)', default=0 ) max_linear_velocity: FloatProperty( name='Max Linear Velocity', description='Linear velocity limit for bhkRigidBody(t)', default=0 ) max_angular_velocity: FloatProperty( name='Max Angular Velocity', description='Angular velocity limit for bhkRigidBody(t)', default=0 ) export_bhklist: BoolProperty( name='Export BHKList', description='None', default=False ) use_blender_properties: BoolProperty( name='Use Blender Properties', description='Whether or not to export collision settings via blender properties', default=False, )
36.732759
103
0.681295
from bpy.props import (PointerProperty, IntProperty, BoolProperty, EnumProperty, FloatProperty, ) from bpy.types import PropertyGroup from pyffi.formats.nif import NifFormat class CollisionProperty(PropertyGroup): motion_system: EnumProperty( name='Motion System', description='Havok Motion System settings for bhkRigidBody(t)', items=[(item, item, "", i) for i, item in enumerate(NifFormat.MotionSystem._enumkeys)], ) oblivion_layer: EnumProperty( name='Oblivion Layer', description='Mesh color, used in Editor', items=[(item, item, "", i) for i, item in enumerate(NifFormat.OblivionLayer._enumkeys)], ) deactivator_type: EnumProperty( name='Deactivator Type', description='Motion deactivation setting', items=[(item, item, "", i) for i, item in enumerate(NifFormat.DeactivatorType._enumkeys)], ) solver_deactivation: EnumProperty( name='Solver Deactivation', description='Motion deactivation setting', items=[(item, item, "", i) for i, item in enumerate(NifFormat.SolverDeactivation._enumkeys)], ) quality_type: EnumProperty( name='Quality Type', description='Determines quality of motion', items=[(item, item, "", i) for i, item in enumerate(NifFormat.MotionQuality._enumkeys)], ) col_filter: IntProperty( name='Col Filter', description='Flags for bhkRigidBody(t)', default=0 ) max_linear_velocity: FloatProperty( name='Max Linear Velocity', description='Linear velocity limit for bhkRigidBody(t)', default=0 ) max_angular_velocity: FloatProperty( name='Max Angular Velocity', description='Angular velocity limit for bhkRigidBody(t)', default=0 ) export_bhklist: BoolProperty( name='Export BHKList', description='None', default=False ) use_blender_properties: BoolProperty( name='Use Blender Properties', description='Whether or not to export collision settings via blender properties', default=False, )
true
true
f71da48478c4aa6e386c6265a0ace72a8f997f99
2,394
py
Python
month05/Spider/day07_course/day07_code/Tencent-demo/Tencent/spiders/tencent.py
chaofan-zheng/python_learning_code
5d05848911d55aa49eaee4afd7ffd80536fad7aa
[ "Apache-2.0" ]
4
2021-01-07T14:25:15.000Z
2021-02-01T10:36:10.000Z
month05/Spider/day07_course/day07_code/Tencent-demo/Tencent/spiders/tencent.py
chaofan-zheng/python_learning_code
5d05848911d55aa49eaee4afd7ffd80536fad7aa
[ "Apache-2.0" ]
null
null
null
month05/Spider/day07_course/day07_code/Tencent-demo/Tencent/spiders/tencent.py
chaofan-zheng/python_learning_code
5d05848911d55aa49eaee4afd7ffd80536fad7aa
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- import scrapy import requests from ..items import TencentItem import json class TencentSpider(scrapy.Spider): name = 'tencent' allowed_domains = ['careers.tencent.com'] one_url = 'https://careers.tencent.com/tencentcareer/api/post/Query?timestamp=1608216394591&countryId=&cityId=&bgIds=&productId=&categoryId=&parentCategoryId=&attrId=&keyword={}&pageIndex={}&pageSize=10&language=zh-cn&area=cn' two_url = 'https://careers.tencent.com/tencentcareer/api/post/ByPostId?timestamp=1608216394591&postId={}&language=zh-cn' keyword = input('请输入关键字:') # 某个类别下第一页的url地址 start_urls = [one_url.format(keyword, 1)] def get_total(self): """获取某个类别下的总页数""" headers = {'User-Agent':'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/85.0.4183.102 Safari/537.36'} html = requests.get(url=self.one_url.format(self.keyword, 1), headers=headers).json() count = html['Data']['Count'] total = count // 10 if count % 10 == 0 else count // 10 + 1 return total def parse(self, response): """生成所有页的一级页面的url地址,交给调度器入队列""" total = self.get_total() for index in range(1, total + 1): page_url = self.one_url.format(self.keyword, index) # dont_filter: 让交给调度器的此请求不参与去重 yield scrapy.Request(url=page_url, dont_filter=True, callback=self.parse_one_page) def parse_one_page(self, response): """一级页面解析: 提取postId的值,用于拼接职位详情页的地址""" one_html = json.loads(response.text) for one_job_dict in one_html['Data']['Posts']: post_id = one_job_dict['PostId'] job_info_url = self.two_url.format(post_id) # 把详情页的Url地址交给调度器入队列 yield scrapy.Request(url=job_info_url, callback=self.parse_two_page) def parse_two_page(self, response): # 获取响应内容,并转为python数据类型 html = json.loads(response.text) # 提取具体数据 item = TencentItem() item['job_name'] = html['Data']['RecruitPostName'] item['job_type'] = html['Data']['CategoryName'] item['job_duty'] = html['Data']['Responsibility'] item['job_require'] = html['Data']['Requirement'] item['job_add'] = html['Data']['LocationName'] item['job_time'] = html['Data']['LastUpdateTime'] # 至此,一条完整数据提取完成,交给项目管道去处理 yield item
39.9
230
0.645781
import scrapy import requests from ..items import TencentItem import json class TencentSpider(scrapy.Spider): name = 'tencent' allowed_domains = ['careers.tencent.com'] one_url = 'https://careers.tencent.com/tencentcareer/api/post/Query?timestamp=1608216394591&countryId=&cityId=&bgIds=&productId=&categoryId=&parentCategoryId=&attrId=&keyword={}&pageIndex={}&pageSize=10&language=zh-cn&area=cn' two_url = 'https://careers.tencent.com/tencentcareer/api/post/ByPostId?timestamp=1608216394591&postId={}&language=zh-cn' keyword = input('请输入关键字:') start_urls = [one_url.format(keyword, 1)] def get_total(self): headers = {'User-Agent':'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/85.0.4183.102 Safari/537.36'} html = requests.get(url=self.one_url.format(self.keyword, 1), headers=headers).json() count = html['Data']['Count'] total = count // 10 if count % 10 == 0 else count // 10 + 1 return total def parse(self, response): total = self.get_total() for index in range(1, total + 1): page_url = self.one_url.format(self.keyword, index) yield scrapy.Request(url=page_url, dont_filter=True, callback=self.parse_one_page) def parse_one_page(self, response): one_html = json.loads(response.text) for one_job_dict in one_html['Data']['Posts']: post_id = one_job_dict['PostId'] job_info_url = self.two_url.format(post_id) yield scrapy.Request(url=job_info_url, callback=self.parse_two_page) def parse_two_page(self, response): html = json.loads(response.text) item = TencentItem() item['job_name'] = html['Data']['RecruitPostName'] item['job_type'] = html['Data']['CategoryName'] item['job_duty'] = html['Data']['Responsibility'] item['job_require'] = html['Data']['Requirement'] item['job_add'] = html['Data']['LocationName'] item['job_time'] = html['Data']['LastUpdateTime'] yield item
true
true
f71da4be567bb4884b3e8f840b280ee3f5884d41
35,504
py
Python
sympy/solvers/pde.py
harsh-98/sympy
53fc684467088cdf0acccb6ad770cbde97e32268
[ "BSD-3-Clause" ]
null
null
null
sympy/solvers/pde.py
harsh-98/sympy
53fc684467088cdf0acccb6ad770cbde97e32268
[ "BSD-3-Clause" ]
null
null
null
sympy/solvers/pde.py
harsh-98/sympy
53fc684467088cdf0acccb6ad770cbde97e32268
[ "BSD-3-Clause" ]
null
null
null
""" This module contains pdsolve() and different helper functions that it uses. It is heavily inspired by the ode module and hence the basic infrastructure remains the same. **Functions in this module** These are the user functions in this module: - pdsolve() - Solves PDE's - classify_pde() - Classifies PDEs into possible hints for dsolve(). - pde_separate() - Separate variables in partial differential equation either by additive or multiplicative separation approach. These are the helper functions in this module: - pde_separate_add() - Helper function for searching additive separable solutions. - pde_separate_mul() - Helper function for searching multiplicative separable solutions. **Currently implemented solver methods** The following methods are implemented for solving partial differential equations. See the docstrings of the various pde_hint() functions for more information on each (run help(pde)): - 1st order linear homogeneous partial differential equations with constant coefficients. - 1st order linear general partial differential equations with constant coefficients. - 1st order linear partial differential equations with variable coefficients. """ from __future__ import print_function, division from itertools import combinations_with_replacement from sympy.simplify import simplify from sympy.core import Add, S from sympy.core.compatibility import (reduce, is_sequence, range) from sympy.core.function import Function, expand, AppliedUndef, Subs from sympy.core.relational import Equality, Eq from sympy.core.symbol import Symbol, Wild, symbols from sympy.functions import exp from sympy.integrals.integrals import Integral from sympy.utilities.iterables import has_dups from sympy.utilities.misc import filldedent from sympy.solvers.deutils import _preprocess, ode_order, _desolve from sympy.solvers.solvers import solve from sympy.simplify.radsimp import collect import operator allhints = ( "1st_linear_constant_coeff_homogeneous", "1st_linear_constant_coeff", "1st_linear_constant_coeff_Integral", "1st_linear_variable_coeff" ) def pdsolve(eq, func=None, hint='default', dict=False, solvefun=None, **kwargs): """ Solves any (supported) kind of partial differential equation. **Usage** pdsolve(eq, f(x,y), hint) -> Solve partial differential equation eq for function f(x,y), using method hint. **Details** ``eq`` can be any supported partial differential equation (see the pde docstring for supported methods). This can either be an Equality, or an expression, which is assumed to be equal to 0. ``f(x,y)`` is a function of two variables whose derivatives in that variable make up the partial differential equation. In many cases it is not necessary to provide this; it will be autodetected (and an error raised if it couldn't be detected). ``hint`` is the solving method that you want pdsolve to use. Use classify_pde(eq, f(x,y)) to get all of the possible hints for a PDE. The default hint, 'default', will use whatever hint is returned first by classify_pde(). See Hints below for more options that you can use for hint. ``solvefun`` is the convention used for arbitrary functions returned by the PDE solver. If not set by the user, it is set by default to be F. **Hints** Aside from the various solving methods, there are also some meta-hints that you can pass to pdsolve(): "default": This uses whatever hint is returned first by classify_pde(). This is the default argument to pdsolve(). "all": To make pdsolve apply all relevant classification hints, use pdsolve(PDE, func, hint="all"). This will return a dictionary of hint:solution terms. If a hint causes pdsolve to raise the NotImplementedError, value of that hint's key will be the exception object raised. The dictionary will also include some special keys: - order: The order of the PDE. See also ode_order() in deutils.py - default: The solution that would be returned by default. This is the one produced by the hint that appears first in the tuple returned by classify_pde(). "all_Integral": This is the same as "all", except if a hint also has a corresponding "_Integral" hint, it only returns the "_Integral" hint. This is useful if "all" causes pdsolve() to hang because of a difficult or impossible integral. This meta-hint will also be much faster than "all", because integrate() is an expensive routine. See also the classify_pde() docstring for more info on hints, and the pde docstring for a list of all supported hints. **Tips** - You can declare the derivative of an unknown function this way: >>> from sympy import Function, Derivative >>> from sympy.abc import x, y # x and y are the independent variables >>> f = Function("f")(x, y) # f is a function of x and y >>> # fx will be the partial derivative of f with respect to x >>> fx = Derivative(f, x) >>> # fy will be the partial derivative of f with respect to y >>> fy = Derivative(f, y) - See test_pde.py for many tests, which serves also as a set of examples for how to use pdsolve(). - pdsolve always returns an Equality class (except for the case when the hint is "all" or "all_Integral"). Note that it is not possible to get an explicit solution for f(x, y) as in the case of ODE's - Do help(pde.pde_hintname) to get help more information on a specific hint Examples ======== >>> from sympy.solvers.pde import pdsolve >>> from sympy import Function, diff, Eq >>> from sympy.abc import x, y >>> f = Function('f') >>> u = f(x, y) >>> ux = u.diff(x) >>> uy = u.diff(y) >>> eq = Eq(1 + (2*(ux/u)) + (3*(uy/u))) >>> pdsolve(eq) Eq(f(x, y), F(3*x - 2*y)*exp(-2*x/13 - 3*y/13)) """ given_hint = hint # hint given by the user. if not solvefun: solvefun = Function('F') # See the docstring of _desolve for more details. hints = _desolve(eq, func=func, hint=hint, simplify=True, type='pde', **kwargs) eq = hints.pop('eq', False) all_ = hints.pop('all', False) if all_: # TODO : 'best' hint should be implemented when adequate # number of hints are added. pdedict = {} failed_hints = {} gethints = classify_pde(eq, dict=True) pdedict.update({'order': gethints['order'], 'default': gethints['default']}) for hint in hints: try: rv = _helper_simplify(eq, hint, hints[hint]['func'], hints[hint]['order'], hints[hint][hint], solvefun) except NotImplementedError as detail: failed_hints[hint] = detail else: pdedict[hint] = rv pdedict.update(failed_hints) return pdedict else: return _helper_simplify(eq, hints['hint'], hints['func'], hints['order'], hints[hints['hint']], solvefun) def _helper_simplify(eq, hint, func, order, match, solvefun): """Helper function of pdsolve that calls the respective pde functions to solve for the partial differential equations. This minimizes the computation in calling _desolve multiple times. """ if hint.endswith("_Integral"): solvefunc = globals()[ "pde_" + hint[:-len("_Integral")]] else: solvefunc = globals()["pde_" + hint] return _handle_Integral(solvefunc(eq, func, order, match, solvefun), func, order, hint) def _handle_Integral(expr, func, order, hint): r""" Converts a solution with integrals in it into an actual solution. Simplifies the integral mainly using doit() """ if hint.endswith("_Integral"): return expr elif hint == "1st_linear_constant_coeff": return simplify(expr.doit()) else: return expr def classify_pde(eq, func=None, dict=False, **kwargs): """ Returns a tuple of possible pdsolve() classifications for a PDE. The tuple is ordered so that first item is the classification that pdsolve() uses to solve the PDE by default. In general, classifications near the beginning of the list will produce better solutions faster than those near the end, though there are always exceptions. To make pdsolve use a different classification, use pdsolve(PDE, func, hint=<classification>). See also the pdsolve() docstring for different meta-hints you can use. If ``dict`` is true, classify_pde() will return a dictionary of hint:match expression terms. This is intended for internal use by pdsolve(). Note that because dictionaries are ordered arbitrarily, this will most likely not be in the same order as the tuple. You can get help on different hints by doing help(pde.pde_hintname), where hintname is the name of the hint without "_Integral". See sympy.pde.allhints or the sympy.pde docstring for a list of all supported hints that can be returned from classify_pde. Examples ======== >>> from sympy.solvers.pde import classify_pde >>> from sympy import Function, diff, Eq >>> from sympy.abc import x, y >>> f = Function('f') >>> u = f(x, y) >>> ux = u.diff(x) >>> uy = u.diff(y) >>> eq = Eq(1 + (2*(ux/u)) + (3*(uy/u))) >>> classify_pde(eq) ('1st_linear_constant_coeff_homogeneous',) """ prep = kwargs.pop('prep', True) if func and len(func.args) != 2: raise NotImplementedError("Right now only partial " "differential equations of two variables are supported") if prep or func is None: prep, func_ = _preprocess(eq, func) if func is None: func = func_ if isinstance(eq, Equality): if eq.rhs != 0: return classify_pde(eq.lhs - eq.rhs, func) eq = eq.lhs f = func.func x = func.args[0] y = func.args[1] fx = f(x,y).diff(x) fy = f(x,y).diff(y) # TODO : For now pde.py uses support offered by the ode_order function # to find the order with respect to a multi-variable function. An # improvement could be to classify the order of the PDE on the basis of # individual variables. order = ode_order(eq, f(x,y)) # hint:matchdict or hint:(tuple of matchdicts) # Also will contain "default":<default hint> and "order":order items. matching_hints = {'order': order} if not order: if dict: matching_hints["default"] = None return matching_hints else: return () eq = expand(eq) a = Wild('a', exclude = [f(x,y)]) b = Wild('b', exclude = [f(x,y), fx, fy, x, y]) c = Wild('c', exclude = [f(x,y), fx, fy, x, y]) d = Wild('d', exclude = [f(x,y), fx, fy, x, y]) e = Wild('e', exclude = [f(x,y), fx, fy]) n = Wild('n', exclude = [x, y]) # Try removing the smallest power of f(x,y) # from the highest partial derivatives of f(x,y) reduced_eq = None if eq.is_Add: var = set(combinations_with_replacement((x,y), order)) dummyvar = var.copy() power = None for i in var: coeff = eq.coeff(f(x,y).diff(*i)) if coeff != 1: match = coeff.match(a*f(x,y)**n) if match and match[a]: power = match[n] dummyvar.remove(i) break dummyvar.remove(i) for i in dummyvar: coeff = eq.coeff(f(x,y).diff(*i)) if coeff != 1: match = coeff.match(a*f(x,y)**n) if match and match[a] and match[n] < power: power = match[n] if power: den = f(x,y)**power reduced_eq = Add(*[arg/den for arg in eq.args]) if not reduced_eq: reduced_eq = eq if order == 1: reduced_eq = collect(reduced_eq, f(x, y)) r = reduced_eq.match(b*fx + c*fy + d*f(x,y) + e) if r: if not r[e]: ## Linear first-order homogeneous partial-differential ## equation with constant coefficients r.update({'b': b, 'c': c, 'd': d}) matching_hints["1st_linear_constant_coeff_homogeneous"] = r else: if r[b]**2 + r[c]**2 != 0: ## Linear first-order general partial-differential ## equation with constant coefficients r.update({'b': b, 'c': c, 'd': d, 'e': e}) matching_hints["1st_linear_constant_coeff"] = r matching_hints[ "1st_linear_constant_coeff_Integral"] = r else: b = Wild('b', exclude=[f(x, y), fx, fy]) c = Wild('c', exclude=[f(x, y), fx, fy]) d = Wild('d', exclude=[f(x, y), fx, fy]) r = reduced_eq.match(b*fx + c*fy + d*f(x,y) + e) if r: r.update({'b': b, 'c': c, 'd': d, 'e': e}) matching_hints["1st_linear_variable_coeff"] = r # Order keys based on allhints. retlist = [] for i in allhints: if i in matching_hints: retlist.append(i) if dict: # Dictionaries are ordered arbitrarily, so make note of which # hint would come first for pdsolve(). Use an ordered dict in Py 3. matching_hints["default"] = None matching_hints["ordered_hints"] = tuple(retlist) for i in allhints: if i in matching_hints: matching_hints["default"] = i break return matching_hints else: return tuple(retlist) def checkpdesol(pde, sol, func=None, solve_for_func=True): """ Checks if the given solution satisfies the partial differential equation. pde is the partial differential equation which can be given in the form of an equation or an expression. sol is the solution for which the pde is to be checked. This can also be given in an equation or an expression form. If the function is not provided, the helper function _preprocess from deutils is used to identify the function. If a sequence of solutions is passed, the same sort of container will be used to return the result for each solution. The following methods are currently being implemented to check if the solution satisfies the PDE: 1. Directly substitute the solution in the PDE and check. If the solution hasn't been solved for f, then it will solve for f provided solve_for_func hasn't been set to False. If the solution satisfies the PDE, then a tuple (True, 0) is returned. Otherwise a tuple (False, expr) where expr is the value obtained after substituting the solution in the PDE. However if a known solution returns False, it may be due to the inability of doit() to simplify it to zero. Examples ======== >>> from sympy import Function, symbols, diff >>> from sympy.solvers.pde import checkpdesol, pdsolve >>> x, y = symbols('x y') >>> f = Function('f') >>> eq = 2*f(x,y) + 3*f(x,y).diff(x) + 4*f(x,y).diff(y) >>> sol = pdsolve(eq) >>> assert checkpdesol(eq, sol)[0] >>> eq = x*f(x,y) + f(x,y).diff(x) >>> checkpdesol(eq, sol) (False, (x*F(4*x - 3*y) - 6*F(4*x - 3*y)/25 + 4*Subs(Derivative(F(_xi_1), _xi_1), (_xi_1,), (4*x - 3*y,)))*exp(-6*x/25 - 8*y/25)) """ # Converting the pde into an equation if not isinstance(pde, Equality): pde = Eq(pde, 0) # If no function is given, try finding the function present. if func is None: try: _, func = _preprocess(pde.lhs) except ValueError: funcs = [s.atoms(AppliedUndef) for s in ( sol if is_sequence(sol, set) else [sol])] funcs = set().union(funcs) if len(funcs) != 1: raise ValueError( 'must pass func arg to checkpdesol for this case.') func = funcs.pop() # If the given solution is in the form of a list or a set # then return a list or set of tuples. if is_sequence(sol, set): return type(sol)([checkpdesol( pde, i, func=func, solve_for_func=solve_for_func) for i in sol]) # Convert solution into an equation if not isinstance(sol, Equality): sol = Eq(func, sol) elif sol.rhs == func: sol = sol.reversed # Try solving for the function solved = sol.lhs == func and not sol.rhs.has(func) if solve_for_func and not solved: solved = solve(sol, func) if solved: if len(solved) == 1: return checkpdesol(pde, Eq(func, solved[0]), func=func, solve_for_func=False) else: return checkpdesol(pde, [Eq(func, t) for t in solved], func=func, solve_for_func=False) # try direct substitution of the solution into the PDE and simplify if sol.lhs == func: pde = pde.lhs - pde.rhs s = simplify(pde.subs(func, sol.rhs).doit()) return s is S.Zero, s raise NotImplementedError(filldedent(''' Unable to test if %s is a solution to %s.''' % (sol, pde))) def pde_1st_linear_constant_coeff_homogeneous(eq, func, order, match, solvefun): r""" Solves a first order linear homogeneous partial differential equation with constant coefficients. The general form of this partial differential equation is .. math:: a \frac{df(x,y)}{dx} + b \frac{df(x,y)}{dy} + c f(x,y) = 0 where `a`, `b` and `c` are constants. The general solution is of the form:: >>> from sympy.solvers import pdsolve >>> from sympy.abc import x, y, a, b, c >>> from sympy import Function, pprint >>> f = Function('f') >>> u = f(x,y) >>> ux = u.diff(x) >>> uy = u.diff(y) >>> genform = a*ux + b*uy + c*u >>> pprint(genform) d d a*--(f(x, y)) + b*--(f(x, y)) + c*f(x, y) dx dy >>> pprint(pdsolve(genform)) -c*(a*x + b*y) --------------- 2 2 a + b f(x, y) = F(-a*y + b*x)*e Examples ======== >>> from sympy.solvers.pde import ( ... pde_1st_linear_constant_coeff_homogeneous) >>> from sympy import pdsolve >>> from sympy import Function, diff, pprint >>> from sympy.abc import x,y >>> f = Function('f') >>> pdsolve(f(x,y) + f(x,y).diff(x) + f(x,y).diff(y)) Eq(f(x, y), F(x - y)*exp(-x/2 - y/2)) >>> pprint(pdsolve(f(x,y) + f(x,y).diff(x) + f(x,y).diff(y))) x y - - - - 2 2 f(x, y) = F(x - y)*e References ========== - Viktor Grigoryan, "Partial Differential Equations" Math 124A - Fall 2010, pp.7 """ # TODO : For now homogeneous first order linear PDE's having # two variables are implemented. Once there is support for # solving systems of ODE's, this can be extended to n variables. f = func.func x = func.args[0] y = func.args[1] b = match[match['b']] c = match[match['c']] d = match[match['d']] return Eq(f(x,y), exp(-S(d)/(b**2 + c**2)*(b*x + c*y))*solvefun(c*x - b*y)) def pde_1st_linear_constant_coeff(eq, func, order, match, solvefun): r""" Solves a first order linear partial differential equation with constant coefficients. The general form of this partial differential equation is .. math:: a \frac{df(x,y)}{dx} + b \frac{df(x,y)}{dy} + c f(x,y) = G(x,y) where `a`, `b` and `c` are constants and `G(x, y)` can be an arbitrary function in `x` and `y`. The general solution of the PDE is:: >>> from sympy.solvers import pdsolve >>> from sympy.abc import x, y, a, b, c >>> from sympy import Function, pprint >>> f = Function('f') >>> G = Function('G') >>> u = f(x,y) >>> ux = u.diff(x) >>> uy = u.diff(y) >>> genform = a*u + b*ux + c*uy - G(x,y) >>> pprint(genform) d d a*f(x, y) + b*--(f(x, y)) + c*--(f(x, y)) - G(x, y) dx dy >>> pprint(pdsolve(genform, hint='1st_linear_constant_coeff_Integral')) // b*x + c*y \ || / | || | | || | a*xi | || | ------- | || | 2 2 | || | /b*xi + c*eta -b*eta + c*xi\ b + c | || | G|------------, -------------|*e d(xi)| || | | 2 2 2 2 | | || | \ b + c b + c / | || | | || / | || | f(x, y) = ||F(eta) + -------------------------------------------------------|* || 2 2 | \\ b + c / <BLANKLINE> \| || || || || || || || || -a*xi || -------|| 2 2|| b + c || e || || /|eta=-b*y + c*x, xi=b*x + c*y Examples ======== >>> from sympy.solvers.pde import pdsolve >>> from sympy import Function, diff, pprint, exp >>> from sympy.abc import x,y >>> f = Function('f') >>> eq = -2*f(x,y).diff(x) + 4*f(x,y).diff(y) + 5*f(x,y) - exp(x + 3*y) >>> pdsolve(eq) Eq(f(x, y), (F(4*x + 2*y) + exp(x/2 + 4*y)/15)*exp(x/2 - y)) References ========== - Viktor Grigoryan, "Partial Differential Equations" Math 124A - Fall 2010, pp.7 """ # TODO : For now homogeneous first order linear PDE's having # two variables are implemented. Once there is support for # solving systems of ODE's, this can be extended to n variables. xi, eta = symbols("xi eta") f = func.func x = func.args[0] y = func.args[1] b = match[match['b']] c = match[match['c']] d = match[match['d']] e = -match[match['e']] expterm = exp(-S(d)/(b**2 + c**2)*xi) functerm = solvefun(eta) solvedict = solve((b*x + c*y - xi, c*x - b*y - eta), x, y) # Integral should remain as it is in terms of xi, # doit() should be done in _handle_Integral. genterm = (1/S(b**2 + c**2))*Integral( (1/expterm*e).subs(solvedict), (xi, b*x + c*y)) return Eq(f(x,y), Subs(expterm*(functerm + genterm), (eta, xi), (c*x - b*y, b*x + c*y))) def pde_1st_linear_variable_coeff(eq, func, order, match, solvefun): r""" Solves a first order linear partial differential equation with variable coefficients. The general form of this partial differential equation is .. math:: a(x, y) \frac{df(x, y)}{dx} + a(x, y) \frac{df(x, y)}{dy} + c(x, y) f(x, y) - G(x, y) where `a(x, y)`, `b(x, y)`, `c(x, y)` and `G(x, y)` are arbitrary functions in `x` and `y`. This PDE is converted into an ODE by making the following transformation. 1] `\xi` as `x` 2] `\eta` as the constant in the solution to the differential equation `\frac{dy}{dx} = -\frac{b}{a}` Making the following substitutions reduces it to the linear ODE .. math:: a(\xi, \eta)\frac{du}{d\xi} + c(\xi, \eta)u - d(\xi, \eta) = 0 which can be solved using dsolve. The general form of this PDE is:: >>> from sympy.solvers.pde import pdsolve >>> from sympy.abc import x, y >>> from sympy import Function, pprint >>> a, b, c, G, f= [Function(i) for i in ['a', 'b', 'c', 'G', 'f']] >>> u = f(x,y) >>> ux = u.diff(x) >>> uy = u.diff(y) >>> genform = a(x, y)*u + b(x, y)*ux + c(x, y)*uy - G(x,y) >>> pprint(genform) d d -G(x, y) + a(x, y)*f(x, y) + b(x, y)*--(f(x, y)) + c(x, y)*--(f(x, y)) dx dy Examples ======== >>> from sympy.solvers.pde import pdsolve >>> from sympy import Function, diff, pprint, exp >>> from sympy.abc import x,y >>> f = Function('f') >>> eq = x*(u.diff(x)) - y*(u.diff(y)) + y**2*u - y**2 >>> pdsolve(eq) Eq(f(x, y), F(x*y)*exp(y**2/2) + 1) References ========== - Viktor Grigoryan, "Partial Differential Equations" Math 124A - Fall 2010, pp.7 """ from sympy.integrals.integrals import integrate from sympy.solvers.ode import dsolve xi, eta = symbols("xi eta") f = func.func x = func.args[0] y = func.args[1] b = match[match['b']] c = match[match['c']] d = match[match['d']] e = -match[match['e']] if not d: # To deal with cases like b*ux = e or c*uy = e if not (b and c): if c: try: tsol = integrate(e/c, y) except NotImplementedError: raise NotImplementedError("Unable to find a solution" " due to inability of integrate") else: return Eq(f(x,y), solvefun(x) + tsol) if b: try: tsol = integrate(e/b, x) except NotImplementedError: raise NotImplementedError("Unable to find a solution" " due to inability of integrate") else: return Eq(f(x,y), solvefun(y) + tsol) if not c: # To deal with cases when c is 0, a simpler method is used. # The PDE reduces to b*(u.diff(x)) + d*u = e, which is a linear ODE in x plode = f(x).diff(x)*b + d*f(x) - e sol = dsolve(plode, f(x)) syms = sol.free_symbols - plode.free_symbols - {x, y} rhs = _simplify_variable_coeff(sol.rhs, syms, solvefun, y) return Eq(f(x, y), rhs) if not b: # To deal with cases when b is 0, a simpler method is used. # The PDE reduces to c*(u.diff(y)) + d*u = e, which is a linear ODE in y plode = f(y).diff(y)*c + d*f(y) - e sol = dsolve(plode, f(y)) syms = sol.free_symbols - plode.free_symbols - {x, y} rhs = _simplify_variable_coeff(sol.rhs, syms, solvefun, x) return Eq(f(x, y), rhs) dummy = Function('d') h = (c/b).subs(y, dummy(x)) sol = dsolve(dummy(x).diff(x) - h, dummy(x)) if isinstance(sol, list): sol = sol[0] solsym = sol.free_symbols - h.free_symbols - {x, y} if len(solsym) == 1: solsym = solsym.pop() etat = (solve(sol, solsym)[0]).subs(dummy(x), y) ysub = solve(eta - etat, y)[0] deq = (b*(f(x).diff(x)) + d*f(x) - e).subs(y, ysub) final = (dsolve(deq, f(x), hint='1st_linear')).rhs if isinstance(final, list): final = final[0] finsyms = final.free_symbols - deq.free_symbols - {x, y} rhs = _simplify_variable_coeff(final, finsyms, solvefun, etat) return Eq(f(x, y), rhs) else: raise NotImplementedError("Cannot solve the partial differential equation due" " to inability of constantsimp") def _simplify_variable_coeff(sol, syms, func, funcarg): r""" Helper function to replace constants by functions in 1st_linear_variable_coeff """ eta = Symbol("eta") if len(syms) == 1: sym = syms.pop() final = sol.subs(sym, func(funcarg)) else: fname = func.__name__ for key, sym in enumerate(syms): tempfun = Function(fname + str(key)) final = sol.subs(sym, func(funcarg)) return simplify(final.subs(eta, funcarg)) def pde_separate(eq, fun, sep, strategy='mul'): """Separate variables in partial differential equation either by additive or multiplicative separation approach. It tries to rewrite an equation so that one of the specified variables occurs on a different side of the equation than the others. :param eq: Partial differential equation :param fun: Original function F(x, y, z) :param sep: List of separated functions [X(x), u(y, z)] :param strategy: Separation strategy. You can choose between additive separation ('add') and multiplicative separation ('mul') which is default. Examples ======== >>> from sympy import E, Eq, Function, pde_separate, Derivative as D >>> from sympy.abc import x, t >>> u, X, T = map(Function, 'uXT') >>> eq = Eq(D(u(x, t), x), E**(u(x, t))*D(u(x, t), t)) >>> pde_separate(eq, u(x, t), [X(x), T(t)], strategy='add') [exp(-X(x))*Derivative(X(x), x), exp(T(t))*Derivative(T(t), t)] >>> eq = Eq(D(u(x, t), x, 2), D(u(x, t), t, 2)) >>> pde_separate(eq, u(x, t), [X(x), T(t)], strategy='mul') [Derivative(X(x), x, x)/X(x), Derivative(T(t), t, t)/T(t)] See Also ======== pde_separate_add, pde_separate_mul """ do_add = False if strategy == 'add': do_add = True elif strategy == 'mul': do_add = False else: raise ValueError('Unknown strategy: %s' % strategy) if isinstance(eq, Equality): if eq.rhs != 0: return pde_separate(Eq(eq.lhs - eq.rhs), fun, sep, strategy) else: return pde_separate(Eq(eq, 0), fun, sep, strategy) if eq.rhs != 0: raise ValueError("Value should be 0") # Handle arguments orig_args = list(fun.args) subs_args = [] for s in sep: for j in range(0, len(s.args)): subs_args.append(s.args[j]) if do_add: functions = reduce(operator.add, sep) else: functions = reduce(operator.mul, sep) # Check whether variables match if len(subs_args) != len(orig_args): raise ValueError("Variable counts do not match") # Check for duplicate arguments like [X(x), u(x, y)] if has_dups(subs_args): raise ValueError("Duplicate substitution arguments detected") # Check whether the variables match if set(orig_args) != set(subs_args): raise ValueError("Arguments do not match") # Substitute original function with separated... result = eq.lhs.subs(fun, functions).doit() # Divide by terms when doing multiplicative separation if not do_add: eq = 0 for i in result.args: eq += i/functions result = eq svar = subs_args[0] dvar = subs_args[1:] return _separate(result, svar, dvar) def pde_separate_add(eq, fun, sep): """ Helper function for searching additive separable solutions. Consider an equation of two independent variables x, y and a dependent variable w, we look for the product of two functions depending on different arguments: `w(x, y, z) = X(x) + y(y, z)` Examples ======== >>> from sympy import E, Eq, Function, pde_separate_add, Derivative as D >>> from sympy.abc import x, t >>> u, X, T = map(Function, 'uXT') >>> eq = Eq(D(u(x, t), x), E**(u(x, t))*D(u(x, t), t)) >>> pde_separate_add(eq, u(x, t), [X(x), T(t)]) [exp(-X(x))*Derivative(X(x), x), exp(T(t))*Derivative(T(t), t)] """ return pde_separate(eq, fun, sep, strategy='add') def pde_separate_mul(eq, fun, sep): """ Helper function for searching multiplicative separable solutions. Consider an equation of two independent variables x, y and a dependent variable w, we look for the product of two functions depending on different arguments: `w(x, y, z) = X(x)*u(y, z)` Examples ======== >>> from sympy import Function, Eq, pde_separate_mul, Derivative as D >>> from sympy.abc import x, y >>> u, X, Y = map(Function, 'uXY') >>> eq = Eq(D(u(x, y), x, 2), D(u(x, y), y, 2)) >>> pde_separate_mul(eq, u(x, y), [X(x), Y(y)]) [Derivative(X(x), x, x)/X(x), Derivative(Y(y), y, y)/Y(y)] """ return pde_separate(eq, fun, sep, strategy='mul') def _separate(eq, dep, others): """Separate expression into two parts based on dependencies of variables.""" # FIRST PASS # Extract derivatives depending our separable variable... terms = set() for term in eq.args: if term.is_Mul: for i in term.args: if i.is_Derivative and not i.has(*others): terms.add(term) continue elif term.is_Derivative and not term.has(*others): terms.add(term) # Find the factor that we need to divide by div = set() for term in terms: ext, sep = term.expand().as_independent(dep) # Failed? if sep.has(*others): return None div.add(ext) # FIXME: Find lcm() of all the divisors and divide with it, instead of # current hack :( # https://github.com/sympy/sympy/issues/4597 if len(div) > 0: final = 0 for term in eq.args: eqn = 0 for i in div: eqn += term / i final += simplify(eqn) eq = final # SECOND PASS - separate the derivatives div = set() lhs = rhs = 0 for term in eq.args: # Check, whether we have already term with independent variable... if not term.has(*others): lhs += term continue # ...otherwise, try to separate temp, sep = term.expand().as_independent(dep) # Failed? if sep.has(*others): return None # Extract the divisors div.add(sep) rhs -= term.expand() # Do the division fulldiv = reduce(operator.add, div) lhs = simplify(lhs/fulldiv).expand() rhs = simplify(rhs/fulldiv).expand() # ...and check whether we were successful :) if lhs.has(*others) or rhs.has(dep): return None return [lhs, rhs]
35.2572
133
0.550614
from __future__ import print_function, division from itertools import combinations_with_replacement from sympy.simplify import simplify from sympy.core import Add, S from sympy.core.compatibility import (reduce, is_sequence, range) from sympy.core.function import Function, expand, AppliedUndef, Subs from sympy.core.relational import Equality, Eq from sympy.core.symbol import Symbol, Wild, symbols from sympy.functions import exp from sympy.integrals.integrals import Integral from sympy.utilities.iterables import has_dups from sympy.utilities.misc import filldedent from sympy.solvers.deutils import _preprocess, ode_order, _desolve from sympy.solvers.solvers import solve from sympy.simplify.radsimp import collect import operator allhints = ( "1st_linear_constant_coeff_homogeneous", "1st_linear_constant_coeff", "1st_linear_constant_coeff_Integral", "1st_linear_variable_coeff" ) def pdsolve(eq, func=None, hint='default', dict=False, solvefun=None, **kwargs): given_hint = hint if not solvefun: solvefun = Function('F') hints = _desolve(eq, func=func, hint=hint, simplify=True, type='pde', **kwargs) eq = hints.pop('eq', False) all_ = hints.pop('all', False) if all_: pdedict = {} failed_hints = {} gethints = classify_pde(eq, dict=True) pdedict.update({'order': gethints['order'], 'default': gethints['default']}) for hint in hints: try: rv = _helper_simplify(eq, hint, hints[hint]['func'], hints[hint]['order'], hints[hint][hint], solvefun) except NotImplementedError as detail: failed_hints[hint] = detail else: pdedict[hint] = rv pdedict.update(failed_hints) return pdedict else: return _helper_simplify(eq, hints['hint'], hints['func'], hints['order'], hints[hints['hint']], solvefun) def _helper_simplify(eq, hint, func, order, match, solvefun): if hint.endswith("_Integral"): solvefunc = globals()[ "pde_" + hint[:-len("_Integral")]] else: solvefunc = globals()["pde_" + hint] return _handle_Integral(solvefunc(eq, func, order, match, solvefun), func, order, hint) def _handle_Integral(expr, func, order, hint): if hint.endswith("_Integral"): return expr elif hint == "1st_linear_constant_coeff": return simplify(expr.doit()) else: return expr def classify_pde(eq, func=None, dict=False, **kwargs): prep = kwargs.pop('prep', True) if func and len(func.args) != 2: raise NotImplementedError("Right now only partial " "differential equations of two variables are supported") if prep or func is None: prep, func_ = _preprocess(eq, func) if func is None: func = func_ if isinstance(eq, Equality): if eq.rhs != 0: return classify_pde(eq.lhs - eq.rhs, func) eq = eq.lhs f = func.func x = func.args[0] y = func.args[1] fx = f(x,y).diff(x) fy = f(x,y).diff(y) order = ode_order(eq, f(x,y)) matching_hints = {'order': order} if not order: if dict: matching_hints["default"] = None return matching_hints else: return () eq = expand(eq) a = Wild('a', exclude = [f(x,y)]) b = Wild('b', exclude = [f(x,y), fx, fy, x, y]) c = Wild('c', exclude = [f(x,y), fx, fy, x, y]) d = Wild('d', exclude = [f(x,y), fx, fy, x, y]) e = Wild('e', exclude = [f(x,y), fx, fy]) n = Wild('n', exclude = [x, y]) reduced_eq = None if eq.is_Add: var = set(combinations_with_replacement((x,y), order)) dummyvar = var.copy() power = None for i in var: coeff = eq.coeff(f(x,y).diff(*i)) if coeff != 1: match = coeff.match(a*f(x,y)**n) if match and match[a]: power = match[n] dummyvar.remove(i) break dummyvar.remove(i) for i in dummyvar: coeff = eq.coeff(f(x,y).diff(*i)) if coeff != 1: match = coeff.match(a*f(x,y)**n) if match and match[a] and match[n] < power: power = match[n] if power: den = f(x,y)**power reduced_eq = Add(*[arg/den for arg in eq.args]) if not reduced_eq: reduced_eq = eq if order == 1: reduced_eq = collect(reduced_eq, f(x, y)) r = reduced_eq.match(b*fx + c*fy + d*f(x,y) + e) if r: if not r[e]: ing_hints["1st_linear_constant_coeff_homogeneous"] = r else: if r[b]**2 + r[c]**2 != 0: matching_hints["1st_linear_constant_coeff"] = r matching_hints[ "1st_linear_constant_coeff_Integral"] = r else: b = Wild('b', exclude=[f(x, y), fx, fy]) c = Wild('c', exclude=[f(x, y), fx, fy]) d = Wild('d', exclude=[f(x, y), fx, fy]) r = reduced_eq.match(b*fx + c*fy + d*f(x,y) + e) if r: r.update({'b': b, 'c': c, 'd': d, 'e': e}) matching_hints["1st_linear_variable_coeff"] = r retlist = [] for i in allhints: if i in matching_hints: retlist.append(i) if dict: matching_hints["default"] = None matching_hints["ordered_hints"] = tuple(retlist) for i in allhints: if i in matching_hints: matching_hints["default"] = i break return matching_hints else: return tuple(retlist) def checkpdesol(pde, sol, func=None, solve_for_func=True): if not isinstance(pde, Equality): pde = Eq(pde, 0) if func is None: try: _, func = _preprocess(pde.lhs) except ValueError: funcs = [s.atoms(AppliedUndef) for s in ( sol if is_sequence(sol, set) else [sol])] funcs = set().union(funcs) if len(funcs) != 1: raise ValueError( 'must pass func arg to checkpdesol for this case.') func = funcs.pop() if is_sequence(sol, set): return type(sol)([checkpdesol( pde, i, func=func, solve_for_func=solve_for_func) for i in sol]) if not isinstance(sol, Equality): sol = Eq(func, sol) elif sol.rhs == func: sol = sol.reversed solved = sol.lhs == func and not sol.rhs.has(func) if solve_for_func and not solved: solved = solve(sol, func) if solved: if len(solved) == 1: return checkpdesol(pde, Eq(func, solved[0]), func=func, solve_for_func=False) else: return checkpdesol(pde, [Eq(func, t) for t in solved], func=func, solve_for_func=False) if sol.lhs == func: pde = pde.lhs - pde.rhs s = simplify(pde.subs(func, sol.rhs).doit()) return s is S.Zero, s raise NotImplementedError(filldedent(''' Unable to test if %s is a solution to %s.''' % (sol, pde))) def pde_1st_linear_constant_coeff_homogeneous(eq, func, order, match, solvefun): # two variables are implemented. Once there is support for # solving systems of ODE's, this can be extended to n variables. f = func.func x = func.args[0] y = func.args[1] b = match[match['b']] c = match[match['c']] d = match[match['d']] return Eq(f(x,y), exp(-S(d)/(b**2 + c**2)*(b*x + c*y))*solvefun(c*x - b*y)) def pde_1st_linear_constant_coeff(eq, func, order, match, solvefun): # two variables are implemented. Once there is support for # solving systems of ODE's, this can be extended to n variables. xi, eta = symbols("xi eta") f = func.func x = func.args[0] y = func.args[1] b = match[match['b']] c = match[match['c']] d = match[match['d']] e = -match[match['e']] expterm = exp(-S(d)/(b**2 + c**2)*xi) functerm = solvefun(eta) solvedict = solve((b*x + c*y - xi, c*x - b*y - eta), x, y) genterm = (1/S(b**2 + c**2))*Integral( (1/expterm*e).subs(solvedict), (xi, b*x + c*y)) return Eq(f(x,y), Subs(expterm*(functerm + genterm), (eta, xi), (c*x - b*y, b*x + c*y))) def pde_1st_linear_variable_coeff(eq, func, order, match, solvefun): from sympy.integrals.integrals import integrate from sympy.solvers.ode import dsolve xi, eta = symbols("xi eta") f = func.func x = func.args[0] y = func.args[1] b = match[match['b']] c = match[match['c']] d = match[match['d']] e = -match[match['e']] if not d: if not (b and c): if c: try: tsol = integrate(e/c, y) except NotImplementedError: raise NotImplementedError("Unable to find a solution" " due to inability of integrate") else: return Eq(f(x,y), solvefun(x) + tsol) if b: try: tsol = integrate(e/b, x) except NotImplementedError: raise NotImplementedError("Unable to find a solution" " due to inability of integrate") else: return Eq(f(x,y), solvefun(y) + tsol) if not c: plode = f(x).diff(x)*b + d*f(x) - e sol = dsolve(plode, f(x)) syms = sol.free_symbols - plode.free_symbols - {x, y} rhs = _simplify_variable_coeff(sol.rhs, syms, solvefun, y) return Eq(f(x, y), rhs) if not b: plode = f(y).diff(y)*c + d*f(y) - e sol = dsolve(plode, f(y)) syms = sol.free_symbols - plode.free_symbols - {x, y} rhs = _simplify_variable_coeff(sol.rhs, syms, solvefun, x) return Eq(f(x, y), rhs) dummy = Function('d') h = (c/b).subs(y, dummy(x)) sol = dsolve(dummy(x).diff(x) - h, dummy(x)) if isinstance(sol, list): sol = sol[0] solsym = sol.free_symbols - h.free_symbols - {x, y} if len(solsym) == 1: solsym = solsym.pop() etat = (solve(sol, solsym)[0]).subs(dummy(x), y) ysub = solve(eta - etat, y)[0] deq = (b*(f(x).diff(x)) + d*f(x) - e).subs(y, ysub) final = (dsolve(deq, f(x), hint='1st_linear')).rhs if isinstance(final, list): final = final[0] finsyms = final.free_symbols - deq.free_symbols - {x, y} rhs = _simplify_variable_coeff(final, finsyms, solvefun, etat) return Eq(f(x, y), rhs) else: raise NotImplementedError("Cannot solve the partial differential equation due" " to inability of constantsimp") def _simplify_variable_coeff(sol, syms, func, funcarg): eta = Symbol("eta") if len(syms) == 1: sym = syms.pop() final = sol.subs(sym, func(funcarg)) else: fname = func.__name__ for key, sym in enumerate(syms): tempfun = Function(fname + str(key)) final = sol.subs(sym, func(funcarg)) return simplify(final.subs(eta, funcarg)) def pde_separate(eq, fun, sep, strategy='mul'): do_add = False if strategy == 'add': do_add = True elif strategy == 'mul': do_add = False else: raise ValueError('Unknown strategy: %s' % strategy) if isinstance(eq, Equality): if eq.rhs != 0: return pde_separate(Eq(eq.lhs - eq.rhs), fun, sep, strategy) else: return pde_separate(Eq(eq, 0), fun, sep, strategy) if eq.rhs != 0: raise ValueError("Value should be 0") orig_args = list(fun.args) subs_args = [] for s in sep: for j in range(0, len(s.args)): subs_args.append(s.args[j]) if do_add: functions = reduce(operator.add, sep) else: functions = reduce(operator.mul, sep) if len(subs_args) != len(orig_args): raise ValueError("Variable counts do not match") if has_dups(subs_args): raise ValueError("Duplicate substitution arguments detected") if set(orig_args) != set(subs_args): raise ValueError("Arguments do not match") result = eq.lhs.subs(fun, functions).doit() if not do_add: eq = 0 for i in result.args: eq += i/functions result = eq svar = subs_args[0] dvar = subs_args[1:] return _separate(result, svar, dvar) def pde_separate_add(eq, fun, sep): return pde_separate(eq, fun, sep, strategy='add') def pde_separate_mul(eq, fun, sep): return pde_separate(eq, fun, sep, strategy='mul') def _separate(eq, dep, others): terms = set() for term in eq.args: if term.is_Mul: for i in term.args: if i.is_Derivative and not i.has(*others): terms.add(term) continue elif term.is_Derivative and not term.has(*others): terms.add(term) div = set() for term in terms: ext, sep = term.expand().as_independent(dep) if sep.has(*others): return None div.add(ext) if len(div) > 0: final = 0 for term in eq.args: eqn = 0 for i in div: eqn += term / i final += simplify(eqn) eq = final div = set() lhs = rhs = 0 for term in eq.args: if not term.has(*others): lhs += term continue temp, sep = term.expand().as_independent(dep) if sep.has(*others): return None div.add(sep) rhs -= term.expand() fulldiv = reduce(operator.add, div) lhs = simplify(lhs/fulldiv).expand() rhs = simplify(rhs/fulldiv).expand() if lhs.has(*others) or rhs.has(dep): return None return [lhs, rhs]
true
true
f71da5ee1e04a350be35e6e930db6f799a4b2850
2,221
py
Python
tests/fixtures/transaction.py
nickderobertis/flexlate
81d6dbc2d87219a2a89266d6e8fb03310a24a3a1
[ "MIT" ]
null
null
null
tests/fixtures/transaction.py
nickderobertis/flexlate
81d6dbc2d87219a2a89266d6e8fb03310a24a3a1
[ "MIT" ]
25
2021-12-05T18:57:53.000Z
2022-03-29T13:45:47.000Z
tests/fixtures/transaction.py
nickderobertis/flexlate
81d6dbc2d87219a2a89266d6e8fb03310a24a3a1
[ "MIT" ]
null
null
null
from uuid import UUID import pytest from flexlate.transactions.transaction import FlexlateTransaction, TransactionType ADD_SOURCE_ID = UUID("93f984ca-6e8f-45e9-b9b0-aebebfe798c1") ADD_OUTPUT_ID = UUID("86465f4d-9752-4ae5-aaa7-791b4c814e8d") ADD_SOURCE_AND_OUTPUT_ID = UUID("bf4cd42c-10b1-4bf9-a15f-294f5be738b0") REMOVE_SOURCE_ID = UUID("c034ec63-d2b5-4d8c-aef1-f96e29a6f5d1") REMOVE_OUTPUT_ID = UUID("79715a11-a3c4-40b1-a49b-9d8388e5c28d") UPDATE_TRANSACTION_ID = UUID("347711b7-3bf9-484e-be52-df488f3cf598") SYNC_TRANSACTION_ID = UUID("4825ce35-1a03-43de-ad8a-1ecc0ed68b62") BOOTSTRAP_TRANSACTION_ID = UUID("37c61224-2b8d-4ee5-8846-49d5474a40bd") UPDATE_TARGET_VERSION_ID = UUID("a5632854-48b4-4f82-904b-bff81dc40b02") @pytest.fixture def add_source_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.ADD_SOURCE, id=ADD_SOURCE_ID) @pytest.fixture def add_output_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.ADD_OUTPUT, id=ADD_OUTPUT_ID) @pytest.fixture def add_source_and_output_transaction() -> FlexlateTransaction: yield FlexlateTransaction( type=TransactionType.ADD_SOURCE_AND_OUTPUT, id=ADD_SOURCE_AND_OUTPUT_ID ) @pytest.fixture def remove_source_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.REMOVE_SOURCE, id=REMOVE_SOURCE_ID) @pytest.fixture def remove_output_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.REMOVE_OUTPUT, id=REMOVE_OUTPUT_ID) @pytest.fixture def update_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.UPDATE, id=UPDATE_TRANSACTION_ID) @pytest.fixture def sync_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.SYNC, id=SYNC_TRANSACTION_ID) @pytest.fixture def bootstrap_transaction() -> FlexlateTransaction: yield FlexlateTransaction( type=TransactionType.BOOTSTRAP, id=BOOTSTRAP_TRANSACTION_ID ) @pytest.fixture def update_target_version_transaction() -> FlexlateTransaction: yield FlexlateTransaction( type=TransactionType.UPDATE_TARGET_VERSION, id=UPDATE_TARGET_VERSION_ID )
33.149254
86
0.815398
from uuid import UUID import pytest from flexlate.transactions.transaction import FlexlateTransaction, TransactionType ADD_SOURCE_ID = UUID("93f984ca-6e8f-45e9-b9b0-aebebfe798c1") ADD_OUTPUT_ID = UUID("86465f4d-9752-4ae5-aaa7-791b4c814e8d") ADD_SOURCE_AND_OUTPUT_ID = UUID("bf4cd42c-10b1-4bf9-a15f-294f5be738b0") REMOVE_SOURCE_ID = UUID("c034ec63-d2b5-4d8c-aef1-f96e29a6f5d1") REMOVE_OUTPUT_ID = UUID("79715a11-a3c4-40b1-a49b-9d8388e5c28d") UPDATE_TRANSACTION_ID = UUID("347711b7-3bf9-484e-be52-df488f3cf598") SYNC_TRANSACTION_ID = UUID("4825ce35-1a03-43de-ad8a-1ecc0ed68b62") BOOTSTRAP_TRANSACTION_ID = UUID("37c61224-2b8d-4ee5-8846-49d5474a40bd") UPDATE_TARGET_VERSION_ID = UUID("a5632854-48b4-4f82-904b-bff81dc40b02") @pytest.fixture def add_source_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.ADD_SOURCE, id=ADD_SOURCE_ID) @pytest.fixture def add_output_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.ADD_OUTPUT, id=ADD_OUTPUT_ID) @pytest.fixture def add_source_and_output_transaction() -> FlexlateTransaction: yield FlexlateTransaction( type=TransactionType.ADD_SOURCE_AND_OUTPUT, id=ADD_SOURCE_AND_OUTPUT_ID ) @pytest.fixture def remove_source_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.REMOVE_SOURCE, id=REMOVE_SOURCE_ID) @pytest.fixture def remove_output_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.REMOVE_OUTPUT, id=REMOVE_OUTPUT_ID) @pytest.fixture def update_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.UPDATE, id=UPDATE_TRANSACTION_ID) @pytest.fixture def sync_transaction() -> FlexlateTransaction: yield FlexlateTransaction(type=TransactionType.SYNC, id=SYNC_TRANSACTION_ID) @pytest.fixture def bootstrap_transaction() -> FlexlateTransaction: yield FlexlateTransaction( type=TransactionType.BOOTSTRAP, id=BOOTSTRAP_TRANSACTION_ID ) @pytest.fixture def update_target_version_transaction() -> FlexlateTransaction: yield FlexlateTransaction( type=TransactionType.UPDATE_TARGET_VERSION, id=UPDATE_TARGET_VERSION_ID )
true
true
f71da789b8896079130d361bbef9e9e5d5278187
55
py
Python
aox/boilerplate/boilerplates/__init__.py
costas-basdekis/aox
63a90fb722f29d9b2d26041f9035f99b6b21615e
[ "MIT" ]
2
2021-11-10T22:38:49.000Z
2021-12-03T08:09:01.000Z
aox/boilerplate/boilerplates/__init__.py
costas-basdekis/aox
63a90fb722f29d9b2d26041f9035f99b6b21615e
[ "MIT" ]
null
null
null
aox/boilerplate/boilerplates/__init__.py
costas-basdekis/aox
63a90fb722f29d9b2d26041f9035f99b6b21615e
[ "MIT" ]
null
null
null
from .default_boilerplate import * # noqa: F401, F403
27.5
54
0.745455
from .default_boilerplate import *
true
true
f71da79286c09974c9ab43177fa4bb6812abe8c6
858
py
Python
ihatefacebook/facebook/page.py
hot3eed/ihatefacebook
fd199d9597fca53010ff5132404d8f4ac6efe1a8
[ "Apache-2.0" ]
1
2020-06-18T05:31:03.000Z
2020-06-18T05:31:03.000Z
ihatefacebook/facebook/page.py
hot3eed/ihatefacebook
fd199d9597fca53010ff5132404d8f4ac6efe1a8
[ "Apache-2.0" ]
null
null
null
ihatefacebook/facebook/page.py
hot3eed/ihatefacebook
fd199d9597fca53010ff5132404d8f4ac6efe1a8
[ "Apache-2.0" ]
null
null
null
import re import sys from selenium import webdriver def get_page_title(page_id): """ Get the title of a Facebook page. Reports an error and exits if no page was found. :param page_id: Facebook ID of the page :return: string of the title of the page, if found """ options = webdriver.ChromeOptions() options.add_argument('headless') options.add_experimental_option("prefs", {'profile.managed_default_content_settings.javascript': 2}) options.add_experimental_option("prefs", {'profile.managed_default_content_settings.images': 2}) driver = webdriver.Chrome(options=options) url = "https://www.facebook.com/%s/" % page_id driver.get(url) try: title = re.search('(.+)\s-', driver.title).group(1) return title except: print("ERROR: Page not found.") sys.exit(1)
30.642857
104
0.677156
import re import sys from selenium import webdriver def get_page_title(page_id): options = webdriver.ChromeOptions() options.add_argument('headless') options.add_experimental_option("prefs", {'profile.managed_default_content_settings.javascript': 2}) options.add_experimental_option("prefs", {'profile.managed_default_content_settings.images': 2}) driver = webdriver.Chrome(options=options) url = "https://www.facebook.com/%s/" % page_id driver.get(url) try: title = re.search('(.+)\s-', driver.title).group(1) return title except: print("ERROR: Page not found.") sys.exit(1)
true
true
f71da7e411b828d81ea079e642da4185b3730145
2,156
py
Python
main.py
KazakovM/qbittorrent_rechecker
0fa08903c63b45a54ccda7688c0f48f33b82533f
[ "MIT" ]
null
null
null
main.py
KazakovM/qbittorrent_rechecker
0fa08903c63b45a54ccda7688c0f48f33b82533f
[ "MIT" ]
null
null
null
main.py
KazakovM/qbittorrent_rechecker
0fa08903c63b45a54ccda7688c0f48f33b82533f
[ "MIT" ]
null
null
null
import json from time import sleep, strftime, localtime from qbittorrent import Client def load_configs(): with open('config.json', 'r', encoding="UTF-8") as file: js = json.load(file) global HOST, PORT, LOGIN, PASSWORD, MIN_SIZE, MAX_SIZE HOST = js["HOST"] PORT = js["PORT"] LOGIN = js["LOGIN"] PASSWORD = js["PASSWORD"] MIN_SIZE = float(js["MIN_SIZE"]) MAX_SIZE = float(js["MAX_SIZE"]) def get_time(): return strftime("%Y-%m-%d %H:%M:%S", localtime()) def main(): try: qb = Client(f'http://{HOST}:{PORT}/') qb.login(LOGIN, PASSWORD) try: if qb is not None: while True: torrents = qb.torrents() for torrent in torrents: sleep(2) #без задержки может вернуть "-1" if (MIN_SIZE*1073741824 > torrent['size'] or torrent['size'] > MAX_SIZE*1073741824) and float(str(torrent["progress"])[0]) != 1: if torrent['size'] != 0: print(f'{get_time()}: Torrent "{torrent["name"]}" is out of size limit: {round(torrent["size"]/1073741824, 2)} GB. Deleting...') qb.delete_permanently(torrent['hash']) sleep(3) if torrent['state'] == 'stalledDL' and float(str(torrent["progress"])[0:4]) > 0.98: print(f'{get_time()}: Torrent "{torrent["name"]}" is stuck. Rechecking...') qb.recheck(torrent['hash']) qb.increase_priority(torrent['hash']) sleep(300) #после проверки торрент может недолго быть в stalled, нужна задержка except Exception as e: print(f'{get_time()}: Failed to get torrent list or recheck stuck torrent: {e}') except Exception as e: print(f'{get_time()}: Failed to establish connection: {e}') if __name__ == "__main__": print(f'{get_time()}: Starting script...') load_configs() main()
42.27451
161
0.512059
import json from time import sleep, strftime, localtime from qbittorrent import Client def load_configs(): with open('config.json', 'r', encoding="UTF-8") as file: js = json.load(file) global HOST, PORT, LOGIN, PASSWORD, MIN_SIZE, MAX_SIZE HOST = js["HOST"] PORT = js["PORT"] LOGIN = js["LOGIN"] PASSWORD = js["PASSWORD"] MIN_SIZE = float(js["MIN_SIZE"]) MAX_SIZE = float(js["MAX_SIZE"]) def get_time(): return strftime("%Y-%m-%d %H:%M:%S", localtime()) def main(): try: qb = Client(f'http://{HOST}:{PORT}/') qb.login(LOGIN, PASSWORD) try: if qb is not None: while True: torrents = qb.torrents() for torrent in torrents: sleep(2) if (MIN_SIZE*1073741824 > torrent['size'] or torrent['size'] > MAX_SIZE*1073741824) and float(str(torrent["progress"])[0]) != 1: if torrent['size'] != 0: print(f'{get_time()}: Torrent "{torrent["name"]}" is out of size limit: {round(torrent["size"]/1073741824, 2)} GB. Deleting...') qb.delete_permanently(torrent['hash']) sleep(3) if torrent['state'] == 'stalledDL' and float(str(torrent["progress"])[0:4]) > 0.98: print(f'{get_time()}: Torrent "{torrent["name"]}" is stuck. Rechecking...') qb.recheck(torrent['hash']) qb.increase_priority(torrent['hash']) sleep(300) except Exception as e: print(f'{get_time()}: Failed to get torrent list or recheck stuck torrent: {e}') except Exception as e: print(f'{get_time()}: Failed to establish connection: {e}') if __name__ == "__main__": print(f'{get_time()}: Starting script...') load_configs() main()
true
true