hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
958k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f71e2f8d7692afc5941b35ae1ab1c5e9f76147ef
1,438
py
Python
setup.py
YuraHavrylko/revenuecat_python
a25b234933b6e80e1ff09b6a82d73a0e3df91caa
[ "MIT" ]
1
2020-12-11T09:31:02.000Z
2020-12-11T09:31:02.000Z
setup.py
YuraHavrylko/revenuecat_python
a25b234933b6e80e1ff09b6a82d73a0e3df91caa
[ "MIT" ]
null
null
null
setup.py
YuraHavrylko/revenuecat_python
a25b234933b6e80e1ff09b6a82d73a0e3df91caa
[ "MIT" ]
null
null
null
#!/usr/bin/env python """The setup script.""" from setuptools import setup, find_packages with open('README.md') as readme_file: readme = readme_file.read() with open('HISTORY.rst') as history_file: history = history_file.read() requirements = ['httpx', ] setup_requirements = ['pytest-runner', ] test_requirements = ['pytest>=3', ] setup( author="Yurii Havrylko", author_email='yurii.havrylko@gmail.com', python_requires='>=3.5', classifiers=[ 'Development Status :: 2 - Pre-Alpha', 'Intended Audience :: Developers', 'License :: OSI Approved :: MIT License', 'Natural Language :: English', 'Programming Language :: Python :: 3', 'Programming Language :: Python :: 3.5', 'Programming Language :: Python :: 3.6', 'Programming Language :: Python :: 3.7', 'Programming Language :: Python :: 3.8', ], description="Python RevenueCat lib", install_requires=requirements, license="MIT license", long_description=readme + '\n\n' + history, include_package_data=True, keywords='revenuecat_python', name='revenuecat_python', packages=find_packages(include=['revenuecat_python', 'revenuecat_python.*']), setup_requires=setup_requirements, test_suite='tests', tests_require=test_requirements, url='https://github.com/YuraHavrylko/revenuecat_python', version='0.2.0', zip_safe=False, )
29.346939
81
0.659249
from setuptools import setup, find_packages with open('README.md') as readme_file: readme = readme_file.read() with open('HISTORY.rst') as history_file: history = history_file.read() requirements = ['httpx', ] setup_requirements = ['pytest-runner', ] test_requirements = ['pytest>=3', ] setup( author="Yurii Havrylko", author_email='yurii.havrylko@gmail.com', python_requires='>=3.5', classifiers=[ 'Development Status :: 2 - Pre-Alpha', 'Intended Audience :: Developers', 'License :: OSI Approved :: MIT License', 'Natural Language :: English', 'Programming Language :: Python :: 3', 'Programming Language :: Python :: 3.5', 'Programming Language :: Python :: 3.6', 'Programming Language :: Python :: 3.7', 'Programming Language :: Python :: 3.8', ], description="Python RevenueCat lib", install_requires=requirements, license="MIT license", long_description=readme + '\n\n' + history, include_package_data=True, keywords='revenuecat_python', name='revenuecat_python', packages=find_packages(include=['revenuecat_python', 'revenuecat_python.*']), setup_requires=setup_requirements, test_suite='tests', tests_require=test_requirements, url='https://github.com/YuraHavrylko/revenuecat_python', version='0.2.0', zip_safe=False, )
true
true
f71e32462865ab179efbd73d661ab16a1fde5483
12,404
py
Python
cdk/app.py
liangfb/aws-dynamodb-cross-region-replication
24a354158cb19c87785bdb59400c5522d706a9a1
[ "MIT-0" ]
12
2020-06-05T02:46:42.000Z
2022-02-24T11:19:55.000Z
cdk/app.py
liangfb/aws-dynamodb-cross-region-replication
24a354158cb19c87785bdb59400c5522d706a9a1
[ "MIT-0" ]
null
null
null
cdk/app.py
liangfb/aws-dynamodb-cross-region-replication
24a354158cb19c87785bdb59400c5522d706a9a1
[ "MIT-0" ]
4
2020-06-07T15:29:53.000Z
2021-06-10T18:59:38.000Z
from aws_cdk import ( aws_lambda as lambda_, aws_sqs as sqs, aws_dynamodb as ddb, aws_ec2 as ec2, aws_kinesis as kinesis, aws_ssm as ssm, core ) from aws_cdk.aws_dynamodb import StreamViewType from aws_cdk.aws_ec2 import SubnetSelection, SubnetType from aws_cdk.aws_iam import PolicyStatement, Effect from aws_cdk.aws_lambda_event_sources import DynamoEventSource, SqsDlq, KinesisEventSource from aws_cdk.core import RemovalPolicy ''' 0. Specify the regions in REGION_A and REGION_B for replication ''' REGION_A = 'ap-southeast-1' REGION_B = 'cn-north-1' ''' 1. Credential setting in SSM Parameter Store for the target region. CDK is not allowed to deploy secure string for AKSK, you will need to set up parameter store in SSM manually and provide the parameter prefix here, e.g. for access_key, "/DDBReplication/TableCN/Access_Key" (StringType) for secret_key, "/DDBReplication/TableCN/Secret_Key" (SecureStringType) ''' PARAMETER_STORE_PREFIX = { REGION_A:'/DDBReplication/TableCN/', # IMPORTANT! This is path to the AKSK to access REGION_B REGION_B:'/DDBReplication/TableSG/' # IMPORTANT! This is path to the AKSK to access REGION_A } ''' 2. Specify the existing key name here for SSH. ''' KEY_NAME = { REGION_A:'<key_pair_name_A>', # Key pair for loader EC2 in REGION_A REGION_B:'<key_pair_name_B>' # Key pair for loader EC2 in REGION_B } ''' 3. (Optional) Specify proxy server here if used. ''' PROXY_SERVER = { REGION_A:"<proxy_server_ip>:<port>", REGION_B:"<proxy_server_ip>:<port>" } TABLE_NAME_PREFIX = 'user_cdk' STREAM_NAME = 'ddb_replication_stream' LOADER_STATS_TABLE_NAME = 'loader_stats' REPLICATOR_STATS_TABLE_NAME = 'replicator_stats' region_list = [REGION_A, REGION_B] TABLE_NAME = { region:''.join([TABLE_NAME_PREFIX,'-',region]) for region in region_list } class SourceDynamoStack(core.Stack): def __init__(self, scope: core.Construct, _id: str, key_name, table_name, parameter_store_prefix, target_region, proxy_server, **kwargs) -> None: super().__init__(scope, _id, **kwargs) # Create VPC, NAT Gateway vpc = ec2.Vpc(self, "VPC", max_azs=2, cidr="10.10.0.0/16", # configuration will create 2 public subnets and 2 private subnets subnet_configuration=[ec2.SubnetConfiguration( subnet_type=SubnetType.PUBLIC, name="Public", cidr_mask=24 ), ec2.SubnetConfiguration( subnet_type=SubnetType.PRIVATE, name="Private", cidr_mask=24 ) ], nat_gateways=1, ) # Create source table source_ddb_table = ddb.Table(self, table_name, table_name=table_name, partition_key=ddb.Attribute(name="PK", type=ddb.AttributeType.STRING), billing_mode=ddb.BillingMode.PAY_PER_REQUEST, stream=StreamViewType.NEW_AND_OLD_IMAGES, removal_policy=RemovalPolicy.DESTROY) # Create loader_stats table for statistics of source table source_loader_stats_table = ddb.Table(self, LOADER_STATS_TABLE_NAME, table_name=LOADER_STATS_TABLE_NAME, partition_key=ddb.Attribute(name="PK", type=ddb.AttributeType.STRING), billing_mode=ddb.BillingMode.PAY_PER_REQUEST, removal_policy=RemovalPolicy.DESTROY ) # Create EC2 instance for load testing public_subnets = vpc.public_subnets amzn_linux = ec2.MachineImage.latest_amazon_linux( generation=ec2.AmazonLinuxGeneration.AMAZON_LINUX_2, edition=ec2.AmazonLinuxEdition.STANDARD, virtualization=ec2.AmazonLinuxVirt.HVM, storage=ec2.AmazonLinuxStorage.GENERAL_PURPOSE ) loader_instance = ec2.Instance(self, 'loader-dynamodb', instance_type=ec2.InstanceType("c5.large"), machine_image=amzn_linux, vpc=vpc, vpc_subnets=SubnetSelection(subnets=public_subnets), key_name=key_name ) loader_instance.connections.allow_from_any_ipv4(ec2.Port.tcp(22), "Allow from SSH") # The loader EC2 will write to source table and loader statistics table source_ddb_table.grant_read_write_data(loader_instance) source_loader_stats_table.grant_read_write_data(loader_instance) # The loader EC2 also needs to put metrics in Cloudwatch put_metrics_policy = PolicyStatement( actions=['cloudwatch:PutMetricData'], effect=Effect.ALLOW, resources=['*'] ) loader_instance.add_to_role_policy(put_metrics_policy) # Create Lambda function send_to_kinesis in private subnet of VPC and set up environment variables private_subnets = vpc.private_subnets dest_sqs = sqs.Queue(self, 'send_to_kinesis_dest_Q') send_to_kinesis_lambda = lambda_.Function(self, 'ddb_send_to_kinesis', code=lambda_.Code.asset("../lambda_send_to_kinesis"), runtime=lambda_.Runtime.PYTHON_3_7, handler='send_to_kinesis.lambda_handler', timeout=core.Duration.seconds(60), vpc=vpc, vpc_subnets=SubnetSelection(subnets=private_subnets), environment={ 'PARAMETER_STORE_PATH_PREFIX':parameter_store_prefix, 'TARGET_REGION':target_region, 'TARGET_STREAM':STREAM_NAME, 'USE_PROXY':"FALSE", 'PROXY_SERVER':proxy_server} ) # Add event source of DynamoDB source table to lambda function send_to_kinesis_lambda.add_event_source(DynamoEventSource(table=source_ddb_table, starting_position=lambda_.StartingPosition.LATEST, batch_size=500, retry_attempts=300, parallelization_factor=10, on_failure=SqsDlq(dest_sqs), bisect_batch_on_error=True )) # allow lambda to access the AKSK in SSM parameter store access_key_parameter_name = ''.join([parameter_store_prefix,'AccessKey']) secret_key_parameter_name = ''.join([parameter_store_prefix,'SecretKey']) ak = ssm.StringParameter.from_string_parameter_attributes(self, access_key_parameter_name, parameter_name=access_key_parameter_name, version=1) ak.grant_read(send_to_kinesis_lambda) sk = ssm.StringParameter.from_secure_string_parameter_attributes(self, secret_key_parameter_name, parameter_name=secret_key_parameter_name, version=1) sk.grant_read(send_to_kinesis_lambda) # Output public DNS name of the loader core.CfnOutput(self, "loader_instance", value=loader_instance.instance_public_dns_name) core.CfnOutput(self, "source_table", value=source_ddb_table.table_name) core.CfnOutput(self, "source_stats_table", value=source_loader_stats_table.table_name) class ReplicatorStack(core.Stack): def __init__(self, scope: core.Construct, _id: str, **kwargs) -> None: new_kwargs = {'env':kwargs['env']} super().__init__(scope, _id, **new_kwargs) # Create staging Kinesis Data Stream, set to 1 shard in this sample code kinesis_stream = kinesis.Stream(self, STREAM_NAME, stream_name=STREAM_NAME, shard_count=1) # Create replicator lambda function that consumes the Kinesis stream and writes to target DDB table target_table_name = kwargs['target_table_name'] dlq_sqs = sqs.Queue(self, 'replicator_failure_Q') replicator_lambda = lambda_.Function(self, 'replicator_kinesis', code=lambda_.Code.asset("../lambda_replicator"), runtime=lambda_.Runtime.PYTHON_3_7, handler='replicator_kinesis.lambda_handler', timeout=core.Duration.seconds(60), environment={ 'TARGET_TABLE':target_table_name } ) kinesis_stream.grant_read(replicator_lambda) replicator_lambda.add_event_source(KinesisEventSource( stream=kinesis_stream, starting_position=lambda_.StartingPosition.LATEST, batch_size=500, retry_attempts=100, parallelization_factor=10, on_failure=SqsDlq(dlq_sqs) )) target_table = ddb.Table.from_table_name(self,target_table_name,target_table_name) target_table.grant_read_write_data(replicator_lambda) # The replicator lambda will put metrics to Cloudwatch put_metrics_policy = PolicyStatement( actions=['cloudwatch:PutMetricData'], effect=Effect.ALLOW, resources=['*'] ) replicator_lambda.add_to_role_policy(put_metrics_policy) # Create replicator-stats table for statistics of replicator replicator_stats_table = ddb.Table(self, REPLICATOR_STATS_TABLE_NAME, table_name=REPLICATOR_STATS_TABLE_NAME, partition_key=ddb.Attribute(name="PK", type=ddb.AttributeType.STRING), billing_mode=ddb.BillingMode.PAY_PER_REQUEST, removal_policy=RemovalPolicy.DESTROY ) replicator_stats_table.grant_read_write_data(replicator_lambda) core.CfnOutput(self, "replicator_stats_table", value=replicator_stats_table.table_name) app = core.App() for region in region_list: SourceDynamoStack(app, "source-dynamo-"+region, key_name = KEY_NAME[region], table_name=TABLE_NAME[region], target_region=(set(region_list) - set([region])).pop(), parameter_store_prefix=PARAMETER_STORE_PREFIX[region], proxy_server=PROXY_SERVER[region], env = {'region':region} ) ReplicatorStack(app, "replicator-"+region, env={'region':region}, target_table_name = TABLE_NAME[region]) app.synth()
49.815261
116
0.545066
from aws_cdk import ( aws_lambda as lambda_, aws_sqs as sqs, aws_dynamodb as ddb, aws_ec2 as ec2, aws_kinesis as kinesis, aws_ssm as ssm, core ) from aws_cdk.aws_dynamodb import StreamViewType from aws_cdk.aws_ec2 import SubnetSelection, SubnetType from aws_cdk.aws_iam import PolicyStatement, Effect from aws_cdk.aws_lambda_event_sources import DynamoEventSource, SqsDlq, KinesisEventSource from aws_cdk.core import RemovalPolicy REGION_A = 'ap-southeast-1' REGION_B = 'cn-north-1' PARAMETER_STORE_PREFIX = { REGION_A:'/DDBReplication/TableCN/', REGION_B:'/DDBReplication/TableSG/' } KEY_NAME = { REGION_A:'<key_pair_name_A>', REGION_B:'<key_pair_name_B>' } PROXY_SERVER = { REGION_A:"<proxy_server_ip>:<port>", REGION_B:"<proxy_server_ip>:<port>" } TABLE_NAME_PREFIX = 'user_cdk' STREAM_NAME = 'ddb_replication_stream' LOADER_STATS_TABLE_NAME = 'loader_stats' REPLICATOR_STATS_TABLE_NAME = 'replicator_stats' region_list = [REGION_A, REGION_B] TABLE_NAME = { region:''.join([TABLE_NAME_PREFIX,'-',region]) for region in region_list } class SourceDynamoStack(core.Stack): def __init__(self, scope: core.Construct, _id: str, key_name, table_name, parameter_store_prefix, target_region, proxy_server, **kwargs) -> None: super().__init__(scope, _id, **kwargs) vpc = ec2.Vpc(self, "VPC", max_azs=2, cidr="10.10.0.0/16", subnet_configuration=[ec2.SubnetConfiguration( subnet_type=SubnetType.PUBLIC, name="Public", cidr_mask=24 ), ec2.SubnetConfiguration( subnet_type=SubnetType.PRIVATE, name="Private", cidr_mask=24 ) ], nat_gateways=1, ) source_ddb_table = ddb.Table(self, table_name, table_name=table_name, partition_key=ddb.Attribute(name="PK", type=ddb.AttributeType.STRING), billing_mode=ddb.BillingMode.PAY_PER_REQUEST, stream=StreamViewType.NEW_AND_OLD_IMAGES, removal_policy=RemovalPolicy.DESTROY) source_loader_stats_table = ddb.Table(self, LOADER_STATS_TABLE_NAME, table_name=LOADER_STATS_TABLE_NAME, partition_key=ddb.Attribute(name="PK", type=ddb.AttributeType.STRING), billing_mode=ddb.BillingMode.PAY_PER_REQUEST, removal_policy=RemovalPolicy.DESTROY ) public_subnets = vpc.public_subnets amzn_linux = ec2.MachineImage.latest_amazon_linux( generation=ec2.AmazonLinuxGeneration.AMAZON_LINUX_2, edition=ec2.AmazonLinuxEdition.STANDARD, virtualization=ec2.AmazonLinuxVirt.HVM, storage=ec2.AmazonLinuxStorage.GENERAL_PURPOSE ) loader_instance = ec2.Instance(self, 'loader-dynamodb', instance_type=ec2.InstanceType("c5.large"), machine_image=amzn_linux, vpc=vpc, vpc_subnets=SubnetSelection(subnets=public_subnets), key_name=key_name ) loader_instance.connections.allow_from_any_ipv4(ec2.Port.tcp(22), "Allow from SSH") source_ddb_table.grant_read_write_data(loader_instance) source_loader_stats_table.grant_read_write_data(loader_instance) put_metrics_policy = PolicyStatement( actions=['cloudwatch:PutMetricData'], effect=Effect.ALLOW, resources=['*'] ) loader_instance.add_to_role_policy(put_metrics_policy) private_subnets = vpc.private_subnets dest_sqs = sqs.Queue(self, 'send_to_kinesis_dest_Q') send_to_kinesis_lambda = lambda_.Function(self, 'ddb_send_to_kinesis', code=lambda_.Code.asset("../lambda_send_to_kinesis"), runtime=lambda_.Runtime.PYTHON_3_7, handler='send_to_kinesis.lambda_handler', timeout=core.Duration.seconds(60), vpc=vpc, vpc_subnets=SubnetSelection(subnets=private_subnets), environment={ 'PARAMETER_STORE_PATH_PREFIX':parameter_store_prefix, 'TARGET_REGION':target_region, 'TARGET_STREAM':STREAM_NAME, 'USE_PROXY':"FALSE", 'PROXY_SERVER':proxy_server} ) send_to_kinesis_lambda.add_event_source(DynamoEventSource(table=source_ddb_table, starting_position=lambda_.StartingPosition.LATEST, batch_size=500, retry_attempts=300, parallelization_factor=10, on_failure=SqsDlq(dest_sqs), bisect_batch_on_error=True )) access_key_parameter_name = ''.join([parameter_store_prefix,'AccessKey']) secret_key_parameter_name = ''.join([parameter_store_prefix,'SecretKey']) ak = ssm.StringParameter.from_string_parameter_attributes(self, access_key_parameter_name, parameter_name=access_key_parameter_name, version=1) ak.grant_read(send_to_kinesis_lambda) sk = ssm.StringParameter.from_secure_string_parameter_attributes(self, secret_key_parameter_name, parameter_name=secret_key_parameter_name, version=1) sk.grant_read(send_to_kinesis_lambda) core.CfnOutput(self, "loader_instance", value=loader_instance.instance_public_dns_name) core.CfnOutput(self, "source_table", value=source_ddb_table.table_name) core.CfnOutput(self, "source_stats_table", value=source_loader_stats_table.table_name) class ReplicatorStack(core.Stack): def __init__(self, scope: core.Construct, _id: str, **kwargs) -> None: new_kwargs = {'env':kwargs['env']} super().__init__(scope, _id, **new_kwargs) kinesis_stream = kinesis.Stream(self, STREAM_NAME, stream_name=STREAM_NAME, shard_count=1) target_table_name = kwargs['target_table_name'] dlq_sqs = sqs.Queue(self, 'replicator_failure_Q') replicator_lambda = lambda_.Function(self, 'replicator_kinesis', code=lambda_.Code.asset("../lambda_replicator"), runtime=lambda_.Runtime.PYTHON_3_7, handler='replicator_kinesis.lambda_handler', timeout=core.Duration.seconds(60), environment={ 'TARGET_TABLE':target_table_name } ) kinesis_stream.grant_read(replicator_lambda) replicator_lambda.add_event_source(KinesisEventSource( stream=kinesis_stream, starting_position=lambda_.StartingPosition.LATEST, batch_size=500, retry_attempts=100, parallelization_factor=10, on_failure=SqsDlq(dlq_sqs) )) target_table = ddb.Table.from_table_name(self,target_table_name,target_table_name) target_table.grant_read_write_data(replicator_lambda) put_metrics_policy = PolicyStatement( actions=['cloudwatch:PutMetricData'], effect=Effect.ALLOW, resources=['*'] ) replicator_lambda.add_to_role_policy(put_metrics_policy) replicator_stats_table = ddb.Table(self, REPLICATOR_STATS_TABLE_NAME, table_name=REPLICATOR_STATS_TABLE_NAME, partition_key=ddb.Attribute(name="PK", type=ddb.AttributeType.STRING), billing_mode=ddb.BillingMode.PAY_PER_REQUEST, removal_policy=RemovalPolicy.DESTROY ) replicator_stats_table.grant_read_write_data(replicator_lambda) core.CfnOutput(self, "replicator_stats_table", value=replicator_stats_table.table_name) app = core.App() for region in region_list: SourceDynamoStack(app, "source-dynamo-"+region, key_name = KEY_NAME[region], table_name=TABLE_NAME[region], target_region=(set(region_list) - set([region])).pop(), parameter_store_prefix=PARAMETER_STORE_PREFIX[region], proxy_server=PROXY_SERVER[region], env = {'region':region} ) ReplicatorStack(app, "replicator-"+region, env={'region':region}, target_table_name = TABLE_NAME[region]) app.synth()
true
true
f71e32526c89d04a91ff2d8fb4b429508b64ebc4
316
py
Python
30 Days of Code/Day 5 Loops/Solution.py
iamnambiar/HackerRank-Solutions
6fdcab79b18e66a6d7278b979a8be087f8f6c696
[ "MIT" ]
2
2020-04-06T10:32:08.000Z
2021-04-23T04:32:45.000Z
30 Days of Code/Day 5 Loops/Solution.py
iamnambiar/HackerRank-Solutions
6fdcab79b18e66a6d7278b979a8be087f8f6c696
[ "MIT" ]
null
null
null
30 Days of Code/Day 5 Loops/Solution.py
iamnambiar/HackerRank-Solutions
6fdcab79b18e66a6d7278b979a8be087f8f6c696
[ "MIT" ]
null
null
null
# https://www.hackerrank.com/challenges/30-loops/problem #!/bin/python3 import math import os import random import re import sys def printMultiples(number): for i in range(1,11): print(str(number)+" x "+str(i)+" = "+str(number*i)) if __name__ == '__main__': n = int(input()) printMultiples(n)
18.588235
59
0.664557
import math import os import random import re import sys def printMultiples(number): for i in range(1,11): print(str(number)+" x "+str(i)+" = "+str(number*i)) if __name__ == '__main__': n = int(input()) printMultiples(n)
true
true
f71e331cef3b1394d9e7e053e583141c9058ad7e
2,466
py
Python
tests/test_vault.py
zx2c4-forks/angr
e15619d99a093af77943b28b5b368e6607a2f336
[ "BSD-2-Clause" ]
2
2020-04-29T02:39:42.000Z
2020-04-29T08:07:44.000Z
tests/test_vault.py
hhuihuang/helios-angr
1978fa5392d65901633191b61c01017627ab7755
[ "BSD-2-Clause" ]
null
null
null
tests/test_vault.py
hhuihuang/helios-angr
1978fa5392d65901633191b61c01017627ab7755
[ "BSD-2-Clause" ]
null
null
null
import claripy import angr class A: n = 0 def do_vault_identity(v_factory): v = v_factory() v.uuid_dedup.add(A) assert len(v.keys()) == 0 a = A() b = A() b.n = 1 c = A() c.n = 2 aid = v.store(a) assert len(v.keys()) == 1 bid = v.store(b) assert len(v.keys()) == 2 cid = v.store(c) assert len(v.keys()) == 3 aa = v.load(aid) bb = v.load(bid) cc = v.load(cid) assert aa is a assert bb is b assert cc is c bb.n = 1337 del bb del b import gc gc.collect() bbb = v.load(bid) assert bbb.n == 1 def do_vault_noidentity(v_factory): v = v_factory() assert len(v.keys()) == 0 a = A() b = A() b.n = 1 c = A() c.n = 2 aid = v.store(a) assert len(v.keys()) == 1 bid = v.store(b) assert len(v.keys()) == 2 cid = v.store(c) assert len(v.keys()) == 3 aa = v.load(aid) bb = v.load(bid) cc = v.load(cid) assert aa is not a assert bb is not b assert cc is not c v.store(aa) assert len(v.keys()) == 4 v.store(bb) assert len(v.keys()) == 5 v.store(cc) assert len(v.keys()) == 6 def do_ast_vault(v_factory): v = v_factory() x = claripy.BVS("x", 32) y = claripy.BVS("y", 32) z = x + y v.store(x) assert len(v.keys()) == 1 zid = v.store(z) assert len(v.keys()) == 3 zz = v.load(zid) assert z is zz zs = v.dumps(z) zzz = v.loads(zs) assert zzz is z def test_vault(): yield do_vault_noidentity, angr.vaults.VaultDir yield do_vault_noidentity, angr.vaults.VaultShelf yield do_vault_noidentity, angr.vaults.VaultDict yield do_vault_identity, angr.vaults.VaultDir yield do_vault_identity, angr.vaults.VaultShelf yield do_vault_identity, angr.vaults.VaultDict def test_ast_vault(): yield do_ast_vault, angr.vaults.VaultDir yield do_ast_vault, angr.vaults.VaultShelf yield do_ast_vault, angr.vaults.VaultDict def test_project(): v = angr.vaults.VaultDir() p = angr.Project("/bin/false") ps = v.store(p) pp = v.load(ps) assert p is pp assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 pstring = v.dumps(p) assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 pp2 = v.loads(pstring) assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 assert p is pp p._asdf = 'fdsa' del pp2 del pp del p import gc gc.collect() p = v.load(ps) #assert not hasattr(p, '_asdf') assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 if __name__ == '__main__': for _a,_b in test_vault(): _a(_b) for _a,_b in test_ast_vault(): _a(_b) test_project()
18.132353
64
0.643958
import claripy import angr class A: n = 0 def do_vault_identity(v_factory): v = v_factory() v.uuid_dedup.add(A) assert len(v.keys()) == 0 a = A() b = A() b.n = 1 c = A() c.n = 2 aid = v.store(a) assert len(v.keys()) == 1 bid = v.store(b) assert len(v.keys()) == 2 cid = v.store(c) assert len(v.keys()) == 3 aa = v.load(aid) bb = v.load(bid) cc = v.load(cid) assert aa is a assert bb is b assert cc is c bb.n = 1337 del bb del b import gc gc.collect() bbb = v.load(bid) assert bbb.n == 1 def do_vault_noidentity(v_factory): v = v_factory() assert len(v.keys()) == 0 a = A() b = A() b.n = 1 c = A() c.n = 2 aid = v.store(a) assert len(v.keys()) == 1 bid = v.store(b) assert len(v.keys()) == 2 cid = v.store(c) assert len(v.keys()) == 3 aa = v.load(aid) bb = v.load(bid) cc = v.load(cid) assert aa is not a assert bb is not b assert cc is not c v.store(aa) assert len(v.keys()) == 4 v.store(bb) assert len(v.keys()) == 5 v.store(cc) assert len(v.keys()) == 6 def do_ast_vault(v_factory): v = v_factory() x = claripy.BVS("x", 32) y = claripy.BVS("y", 32) z = x + y v.store(x) assert len(v.keys()) == 1 zid = v.store(z) assert len(v.keys()) == 3 zz = v.load(zid) assert z is zz zs = v.dumps(z) zzz = v.loads(zs) assert zzz is z def test_vault(): yield do_vault_noidentity, angr.vaults.VaultDir yield do_vault_noidentity, angr.vaults.VaultShelf yield do_vault_noidentity, angr.vaults.VaultDict yield do_vault_identity, angr.vaults.VaultDir yield do_vault_identity, angr.vaults.VaultShelf yield do_vault_identity, angr.vaults.VaultDict def test_ast_vault(): yield do_ast_vault, angr.vaults.VaultDir yield do_ast_vault, angr.vaults.VaultShelf yield do_ast_vault, angr.vaults.VaultDict def test_project(): v = angr.vaults.VaultDir() p = angr.Project("/bin/false") ps = v.store(p) pp = v.load(ps) assert p is pp assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 pstring = v.dumps(p) assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 pp2 = v.loads(pstring) assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 assert p is pp p._asdf = 'fdsa' del pp2 del pp del p import gc gc.collect() p = v.load(ps) assert sum(1 for k in v.keys() if k.startswith('Project')) == 1 if __name__ == '__main__': for _a,_b in test_vault(): _a(_b) for _a,_b in test_ast_vault(): _a(_b) test_project()
true
true
f71e33bd084310d0aeba71a25aac58cd5fcf8bbb
1,082
py
Python
line.py
kavach-feature/Advanced_lane_finding
12e4e330e338734fdb35655c7581b98ba1eb490b
[ "MIT" ]
null
null
null
line.py
kavach-feature/Advanced_lane_finding
12e4e330e338734fdb35655c7581b98ba1eb490b
[ "MIT" ]
null
null
null
line.py
kavach-feature/Advanced_lane_finding
12e4e330e338734fdb35655c7581b98ba1eb490b
[ "MIT" ]
null
null
null
import numpy as np import cv2 import matplotlib.pyplot as plt import matplotlib.image as mpimg import pickle class Line(): def __init__(self,n): self.n=n self.detected =False #Polynomial coefficients of the lines self.A=[] self.B=[] self.C=[] #Running average of coefficients self.A_avg=0. self.B_avg=0. self.C_avg=0. def obtain_fit(self): return (self.A_avg,self.B_avg,self.C_avg) def update_fit(self,fit_coeffs): """Obtain the fit coefficients from the latest frame and apply over each of 2nd polynomial coefficients for the purpose of smoothing """ full_Q= len(self.A) >= self.n #Append line fit coefficients self.A.append(fit_coeffs[0]) self.B.append(fit_coeffs[1]) self.C.append(fit_coeffs[2]) if full_Q: _=self.A.pop(0) _=self.B.pop(0) _=self.C.pop(0) # Compute the average of the polynomial coefficients self.A_avg = np.mean(self.A) self.B_avg = np.mean(self.B) self.C_avg = np.mean(self.C) return (self.A_avg,self.B_avg,self.C_avg)
18.655172
106
0.660813
import numpy as np import cv2 import matplotlib.pyplot as plt import matplotlib.image as mpimg import pickle class Line(): def __init__(self,n): self.n=n self.detected =False self.A=[] self.B=[] self.C=[] self.A_avg=0. self.B_avg=0. self.C_avg=0. def obtain_fit(self): return (self.A_avg,self.B_avg,self.C_avg) def update_fit(self,fit_coeffs): full_Q= len(self.A) >= self.n self.A.append(fit_coeffs[0]) self.B.append(fit_coeffs[1]) self.C.append(fit_coeffs[2]) if full_Q: _=self.A.pop(0) _=self.B.pop(0) _=self.C.pop(0) self.A_avg = np.mean(self.A) self.B_avg = np.mean(self.B) self.C_avg = np.mean(self.C) return (self.A_avg,self.B_avg,self.C_avg)
true
true
f71e34484d2699805f3e8b41dc2369ce69733744
5,651
py
Python
devstack/files/grafana/grafana-init.py
zhangjianweibj/monasca-api
26133aefe413546f91aaa13c981fe93a69dfc2eb
[ "Apache-2.0" ]
null
null
null
devstack/files/grafana/grafana-init.py
zhangjianweibj/monasca-api
26133aefe413546f91aaa13c981fe93a69dfc2eb
[ "Apache-2.0" ]
5
2019-08-14T06:46:03.000Z
2021-12-13T20:01:25.000Z
devstack/files/grafana/grafana-init.py
zhangjianweibj/monasca-api
26133aefe413546f91aaa13c981fe93a69dfc2eb
[ "Apache-2.0" ]
2
2020-03-15T01:24:15.000Z
2020-07-22T20:34:26.000Z
#!/usr/bin/env python # coding=utf-8 # (C) Copyright 2017 Hewlett Packard Enterprise Development LP # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import glob import json import logging import os import sys import time from requests import RequestException from requests import Session LOG_LEVEL = logging.getLevelName(os.environ.get('LOG_LEVEL', 'INFO')) logging.basicConfig(level=LOG_LEVEL) logger = logging.getLogger(__name__) GRAFANA_URL = os.environ.get('GRAFANA_URL', 'http://localhost:3000') GRAFANA_USERNAME = os.environ.get('GRAFANA_USERNAME', 'mini-mon') GRAFANA_PASSWORD = os.environ.get('GRAFANA_PASSWORD', 'password') GRAFANA_USERS = [{'user': GRAFANA_USERNAME, 'password': GRAFANA_PASSWORD, 'email': ''}] DATASOURCE_NAME = os.environ.get('DATASOURCE_NAME', 'monasca') DATASOURCE_URL = os.environ.get('DATASOURCE_URL', 'http://localhost/metrics') DATASOURCE_ACCESS_MODE = os.environ.get('DATASOURCE_ACCESS_MODE', 'proxy') DATASOURCE_AUTH = os.environ.get('DATASOURCE_AUTH', 'Keystone').capitalize() DATASOURCE_AUTH_TOKEN = os.environ.get('DATASOURCE_AUTH_TOKEN', '') DASHBOARDS_DIR = os.environ.get('DASHBOARDS_DIR', '/dashboards.d') def retry(retries=5, delay=2.0, exc_types=(RequestException,)): def decorator(func): def f_retry(*args, **kwargs): for i in range(retries): try: return func(*args, **kwargs) except exc_types as exc: if i < retries - 1: logger.debug('Caught exception, retrying...', exc_info=True) time.sleep(delay) else: logger.exception('Failed after %d attempts', retries) if isinstance(exc, RequestException): logger.debug('Response was: %r', exc.response.text) raise return f_retry return decorator def create_login_payload(): if os.environ.get('GRAFANA_USERS'): try: json.loads(os.environ.get('GRAFANA_USERS')) except ValueError: print("Invalid type GRAFANA_USERS") raise grafana_users = json.loads(os.environ.get('GRAFANA_USERS')) else: grafana_users = GRAFANA_USERS return grafana_users @retry(retries=24, delay=5.0) def login(session, user): r = session.post('{url}/login'.format(url=GRAFANA_URL), json=user, timeout=5) r.raise_for_status() @retry(retries=12, delay=5.0) def check_initialized(session): r = session.get('{url}/api/datasources'.format(url=GRAFANA_URL), timeout=5) r.raise_for_status() logging.debug('existing datasources = %r', r.json()) for datasource in r.json(): if datasource['name'] == DATASOURCE_NAME: return True return False def create_datasource_payload(): payload = { 'name': DATASOURCE_NAME, 'url': DATASOURCE_URL, 'access': DATASOURCE_ACCESS_MODE, 'isDefault': True, } if DATASOURCE_AUTH not in ['Keystone', 'Horizon', 'Token']: logger.error('Unknown Keystone authentication option: %s', DATASOURCE_AUTH) sys.exit(1) keystone_auth = False if DATASOURCE_AUTH in ['Keystone']: keystone_auth = True payload.update({ 'monasca': { 'type': 'monasca-datasource', 'jsonData': { 'authMode': DATASOURCE_AUTH, 'keystoneAuth': keystone_auth, 'token': DATASOURCE_AUTH_TOKEN, } } }.get(DATASOURCE_NAME, {})) logging.debug('payload = %r', payload) return payload def create_dashboard_payload(json_path): with open(json_path, 'r') as f: dashboard = json.load(f) dashboard['id'] = None return { 'dashboard': dashboard, 'overwrite': False } def main(): for user in create_login_payload(): logging.info('Opening a Grafana session...') session = Session() login(session, user) if check_initialized(session): logging.info('Grafana has already been initialized, skipping!') return logging.info('Attempting to add configured datasource...') r = session.post('{url}/api/datasources'.format(url=GRAFANA_URL), json=create_datasource_payload()) logging.debug('Response: %r', r.json()) r.raise_for_status() for path in sorted(glob.glob('{dir}/*.json'.format(dir=DASHBOARDS_DIR))): logging.info('Creating dashboard from file: {path}'.format(path=path)) r = session.post('{url}/api/dashboards/db'.format(url=GRAFANA_URL), json=create_dashboard_payload(path)) logging.debug('Response: %r', r.json()) r.raise_for_status() logging.info('Ending %r session...', user.get('user')) session.get('{url}/logout'.format(url=GRAFANA_URL)) logging.info('Finished successfully.') if __name__ == '__main__': main()
31.747191
87
0.623076
import glob import json import logging import os import sys import time from requests import RequestException from requests import Session LOG_LEVEL = logging.getLevelName(os.environ.get('LOG_LEVEL', 'INFO')) logging.basicConfig(level=LOG_LEVEL) logger = logging.getLogger(__name__) GRAFANA_URL = os.environ.get('GRAFANA_URL', 'http://localhost:3000') GRAFANA_USERNAME = os.environ.get('GRAFANA_USERNAME', 'mini-mon') GRAFANA_PASSWORD = os.environ.get('GRAFANA_PASSWORD', 'password') GRAFANA_USERS = [{'user': GRAFANA_USERNAME, 'password': GRAFANA_PASSWORD, 'email': ''}] DATASOURCE_NAME = os.environ.get('DATASOURCE_NAME', 'monasca') DATASOURCE_URL = os.environ.get('DATASOURCE_URL', 'http://localhost/metrics') DATASOURCE_ACCESS_MODE = os.environ.get('DATASOURCE_ACCESS_MODE', 'proxy') DATASOURCE_AUTH = os.environ.get('DATASOURCE_AUTH', 'Keystone').capitalize() DATASOURCE_AUTH_TOKEN = os.environ.get('DATASOURCE_AUTH_TOKEN', '') DASHBOARDS_DIR = os.environ.get('DASHBOARDS_DIR', '/dashboards.d') def retry(retries=5, delay=2.0, exc_types=(RequestException,)): def decorator(func): def f_retry(*args, **kwargs): for i in range(retries): try: return func(*args, **kwargs) except exc_types as exc: if i < retries - 1: logger.debug('Caught exception, retrying...', exc_info=True) time.sleep(delay) else: logger.exception('Failed after %d attempts', retries) if isinstance(exc, RequestException): logger.debug('Response was: %r', exc.response.text) raise return f_retry return decorator def create_login_payload(): if os.environ.get('GRAFANA_USERS'): try: json.loads(os.environ.get('GRAFANA_USERS')) except ValueError: print("Invalid type GRAFANA_USERS") raise grafana_users = json.loads(os.environ.get('GRAFANA_USERS')) else: grafana_users = GRAFANA_USERS return grafana_users @retry(retries=24, delay=5.0) def login(session, user): r = session.post('{url}/login'.format(url=GRAFANA_URL), json=user, timeout=5) r.raise_for_status() @retry(retries=12, delay=5.0) def check_initialized(session): r = session.get('{url}/api/datasources'.format(url=GRAFANA_URL), timeout=5) r.raise_for_status() logging.debug('existing datasources = %r', r.json()) for datasource in r.json(): if datasource['name'] == DATASOURCE_NAME: return True return False def create_datasource_payload(): payload = { 'name': DATASOURCE_NAME, 'url': DATASOURCE_URL, 'access': DATASOURCE_ACCESS_MODE, 'isDefault': True, } if DATASOURCE_AUTH not in ['Keystone', 'Horizon', 'Token']: logger.error('Unknown Keystone authentication option: %s', DATASOURCE_AUTH) sys.exit(1) keystone_auth = False if DATASOURCE_AUTH in ['Keystone']: keystone_auth = True payload.update({ 'monasca': { 'type': 'monasca-datasource', 'jsonData': { 'authMode': DATASOURCE_AUTH, 'keystoneAuth': keystone_auth, 'token': DATASOURCE_AUTH_TOKEN, } } }.get(DATASOURCE_NAME, {})) logging.debug('payload = %r', payload) return payload def create_dashboard_payload(json_path): with open(json_path, 'r') as f: dashboard = json.load(f) dashboard['id'] = None return { 'dashboard': dashboard, 'overwrite': False } def main(): for user in create_login_payload(): logging.info('Opening a Grafana session...') session = Session() login(session, user) if check_initialized(session): logging.info('Grafana has already been initialized, skipping!') return logging.info('Attempting to add configured datasource...') r = session.post('{url}/api/datasources'.format(url=GRAFANA_URL), json=create_datasource_payload()) logging.debug('Response: %r', r.json()) r.raise_for_status() for path in sorted(glob.glob('{dir}/*.json'.format(dir=DASHBOARDS_DIR))): logging.info('Creating dashboard from file: {path}'.format(path=path)) r = session.post('{url}/api/dashboards/db'.format(url=GRAFANA_URL), json=create_dashboard_payload(path)) logging.debug('Response: %r', r.json()) r.raise_for_status() logging.info('Ending %r session...', user.get('user')) session.get('{url}/logout'.format(url=GRAFANA_URL)) logging.info('Finished successfully.') if __name__ == '__main__': main()
true
true
f71e344d83b88a33fee568792a59d599f2f0eac4
699
py
Python
scripts/fhr/count_facets.py
bcolloran/jydoop
0267cbf8f467a77fae97c1604e2cbb70f4aba7d4
[ "Apache-2.0" ]
1
2017-09-28T08:35:26.000Z
2017-09-28T08:35:26.000Z
scripts/fhr/count_facets.py
bcolloran/jydoop
0267cbf8f467a77fae97c1604e2cbb70f4aba7d4
[ "Apache-2.0" ]
null
null
null
scripts/fhr/count_facets.py
bcolloran/jydoop
0267cbf8f467a77fae97c1604e2cbb70f4aba7d4
[ "Apache-2.0" ]
null
null
null
import json import jydoop import healthreportutils setupjob = healthreportutils.setupjob combine = jydoop.sumreducer def map(key, value, context): try: payload = json.loads(value) except: context.write("Bogus\tBogus\tBogus\tBogus", 1) return output = [] try: info = payload['geckoAppInfo'] if type(info) == dict: output.append(info['name']) output.append(info['os']) output.append(info['updateChannel']) output.append(info['version']) except KeyError: pass if len(output) == 4: outkey = "\t".join(output) context.write(outkey, 1) reduce = jydoop.sumreducer
21.84375
54
0.597997
import json import jydoop import healthreportutils setupjob = healthreportutils.setupjob combine = jydoop.sumreducer def map(key, value, context): try: payload = json.loads(value) except: context.write("Bogus\tBogus\tBogus\tBogus", 1) return output = [] try: info = payload['geckoAppInfo'] if type(info) == dict: output.append(info['name']) output.append(info['os']) output.append(info['updateChannel']) output.append(info['version']) except KeyError: pass if len(output) == 4: outkey = "\t".join(output) context.write(outkey, 1) reduce = jydoop.sumreducer
true
true
f71e348b15e2cb995ca29be30b12308864a64f38
5,124
py
Python
kanmail/window.py
frznvm0/Kanmail
98699a14fa32aa1fd6d7384328ca30da6aae7a01
[ "OpenSSL" ]
null
null
null
kanmail/window.py
frznvm0/Kanmail
98699a14fa32aa1fd6d7384328ca30da6aae7a01
[ "OpenSSL" ]
null
null
null
kanmail/window.py
frznvm0/Kanmail
98699a14fa32aa1fd6d7384328ca30da6aae7a01
[ "OpenSSL" ]
null
null
null
from typing import Dict, Optional, Union from uuid import uuid4 import webview from kanmail.log import logger from kanmail.server.app import server from kanmail.settings.constants import DEBUG, FRAMELESS, IS_APP, SERVER_HOST, SESSION_TOKEN ID_TO_WINDOW = {} # internal ID -> window object UNIQUE_NAME_TO_ID = {} # name -> internal ID for unique windows def create_window( endpoint: str = '/', unique_key: Optional[str] = None, **kwargs, ) -> Union[str, bool]: if not IS_APP: logger.warning('Cannot open window in server mode!') return False internal_id = str(uuid4()) link = ( f'http://{SERVER_HOST}:{server.get_port()}{endpoint}' f'?window_id={internal_id}' f'&Kanmail-Session-Token={SESSION_TOKEN}' ) logger.debug( f'Opening window (#{internal_id}) ' f'url={endpoint} kwargs={kwargs}', ) # Nuke any existing unique window if unique_key and unique_key in UNIQUE_NAME_TO_ID: old_window_id = UNIQUE_NAME_TO_ID.get(unique_key) if old_window_id: destroy_window(old_window_id) window = webview.create_window( 'Kanmail', link, frameless=FRAMELESS, easy_drag=False, text_select=True, **kwargs, ) ID_TO_WINDOW[internal_id] = window if unique_key: UNIQUE_NAME_TO_ID[unique_key] = internal_id return internal_id def destroy_window(internal_id: str) -> None: window = ID_TO_WINDOW.pop(internal_id, None) if window: try: window.destroy() except KeyError: # happens if the window has already been destroyed (user close) pass else: return logger.warning(f'Tried to destroy non-existant window: {internal_id}') def resize_window(internal_id: str, width: int, height: int) -> None: window = ID_TO_WINDOW[internal_id] if window: window.resize(width, height) logger.warning(f'Tried to resize non-existant window: {internal_id}') def reload_main_window() -> None: if IS_APP: window = get_main_window() window.evaluate_js('window.location.reload()') def get_main_window() -> webview.Window: return ID_TO_WINDOW[UNIQUE_NAME_TO_ID['main']] def destroy_main_window() -> None: destroy_window(UNIQUE_NAME_TO_ID['main']) def get_main_window_size_position() -> Dict[str, int]: window = get_main_window() return { 'left': window.x, 'top': window.y, 'width': window.width, 'height': window.height, } def show_traffic_light_buttons(window): import AppKit buttons = [ window.standardWindowButton_(AppKit.NSWindowCloseButton), window.standardWindowButton_(AppKit.NSWindowZoomButton), window.standardWindowButton_(AppKit.NSWindowMiniaturizeButton), ] for button in buttons: button.setHidden_(False) def reposition_traffic_light_buttons(window): import AppKit button = window.standardWindowButton_(AppKit.NSWindowCloseButton) titlebar_container_view = button.superview().superview() titlebar_container_rect = titlebar_container_view.frame() titlebar_container_rect.size.height += 22 titlebar_container_rect.origin.y -= 13 titlebar_container_rect.size.width += 22 titlebar_container_rect.origin.x += 13 titlebar_container_view._.frame = AppKit.NSValue.valueWithRect_(titlebar_container_rect) def init_window_hacks() -> None: # Although this is supported in the pywebview API - we're overriding the defaults # for all windows with context of one (settings) window. Currently this is the # only place we wish to confirm exit, so it's not an issue. # TODO Issue to track per-window customization: https://github.com/r0x0r/pywebview/issues/697 webview.localization.localization['global.quit'] = 'Close without saving' webview.localization.localization['global.cancel'] = 'Return to settings' webview.localization.localization['global.quitConfirmation'] = ( 'Any changes will be lost, do you still want to close the window?' ) try: from webview.platforms import cocoa except ImportError: pass else: # This cocoa specific hack shows the traffic light buttons (pywebview hides these # in frameless mode by default) and also moves them so they look better placed # in the sidebar header. # Normally set by webview.start but importing cocoa before breaks that cocoa._debug = {'mode': DEBUG} class CustomBrowserView(cocoa.BrowserView): def first_show(self, *args, **kwargs): show_traffic_light_buttons(self.window) reposition_traffic_light_buttons(self.window) super().first_show(*args, **kwargs) class CustomWindowDelegate(cocoa.BrowserView.WindowDelegate): def windowDidResize_(self, notification): reposition_traffic_light_buttons(notification.object()) cocoa.BrowserView = CustomBrowserView cocoa.BrowserView.WindowDelegate = CustomWindowDelegate
31.054545
97
0.685402
from typing import Dict, Optional, Union from uuid import uuid4 import webview from kanmail.log import logger from kanmail.server.app import server from kanmail.settings.constants import DEBUG, FRAMELESS, IS_APP, SERVER_HOST, SESSION_TOKEN ID_TO_WINDOW = {} UNIQUE_NAME_TO_ID = {} def create_window( endpoint: str = '/', unique_key: Optional[str] = None, **kwargs, ) -> Union[str, bool]: if not IS_APP: logger.warning('Cannot open window in server mode!') return False internal_id = str(uuid4()) link = ( f'http://{SERVER_HOST}:{server.get_port()}{endpoint}' f'?window_id={internal_id}' f'&Kanmail-Session-Token={SESSION_TOKEN}' ) logger.debug( f'Opening window (#{internal_id}) ' f'url={endpoint} kwargs={kwargs}', ) if unique_key and unique_key in UNIQUE_NAME_TO_ID: old_window_id = UNIQUE_NAME_TO_ID.get(unique_key) if old_window_id: destroy_window(old_window_id) window = webview.create_window( 'Kanmail', link, frameless=FRAMELESS, easy_drag=False, text_select=True, **kwargs, ) ID_TO_WINDOW[internal_id] = window if unique_key: UNIQUE_NAME_TO_ID[unique_key] = internal_id return internal_id def destroy_window(internal_id: str) -> None: window = ID_TO_WINDOW.pop(internal_id, None) if window: try: window.destroy() except KeyError: pass else: return logger.warning(f'Tried to destroy non-existant window: {internal_id}') def resize_window(internal_id: str, width: int, height: int) -> None: window = ID_TO_WINDOW[internal_id] if window: window.resize(width, height) logger.warning(f'Tried to resize non-existant window: {internal_id}') def reload_main_window() -> None: if IS_APP: window = get_main_window() window.evaluate_js('window.location.reload()') def get_main_window() -> webview.Window: return ID_TO_WINDOW[UNIQUE_NAME_TO_ID['main']] def destroy_main_window() -> None: destroy_window(UNIQUE_NAME_TO_ID['main']) def get_main_window_size_position() -> Dict[str, int]: window = get_main_window() return { 'left': window.x, 'top': window.y, 'width': window.width, 'height': window.height, } def show_traffic_light_buttons(window): import AppKit buttons = [ window.standardWindowButton_(AppKit.NSWindowCloseButton), window.standardWindowButton_(AppKit.NSWindowZoomButton), window.standardWindowButton_(AppKit.NSWindowMiniaturizeButton), ] for button in buttons: button.setHidden_(False) def reposition_traffic_light_buttons(window): import AppKit button = window.standardWindowButton_(AppKit.NSWindowCloseButton) titlebar_container_view = button.superview().superview() titlebar_container_rect = titlebar_container_view.frame() titlebar_container_rect.size.height += 22 titlebar_container_rect.origin.y -= 13 titlebar_container_rect.size.width += 22 titlebar_container_rect.origin.x += 13 titlebar_container_view._.frame = AppKit.NSValue.valueWithRect_(titlebar_container_rect) def init_window_hacks() -> None: # for all windows with context of one (settings) window. Currently this is the # only place we wish to confirm exit, so it's not an issue. webview.localization.localization['global.quit'] = 'Close without saving' webview.localization.localization['global.cancel'] = 'Return to settings' webview.localization.localization['global.quitConfirmation'] = ( 'Any changes will be lost, do you still want to close the window?' ) try: from webview.platforms import cocoa except ImportError: pass else: cocoa._debug = {'mode': DEBUG} class CustomBrowserView(cocoa.BrowserView): def first_show(self, *args, **kwargs): show_traffic_light_buttons(self.window) reposition_traffic_light_buttons(self.window) super().first_show(*args, **kwargs) class CustomWindowDelegate(cocoa.BrowserView.WindowDelegate): def windowDidResize_(self, notification): reposition_traffic_light_buttons(notification.object()) cocoa.BrowserView = CustomBrowserView cocoa.BrowserView.WindowDelegate = CustomWindowDelegate
true
true
f71e34be826358ffa5149b16e2c58f61431da420
6,693
py
Python
torchlib/deep_rl/algorithm/ppo/utils.py
vermouth1992/torchlib
63b2bedb40f670b2d9fbfc0daeab4a8d44623095
[ "MIT" ]
3
2019-07-23T21:32:36.000Z
2022-02-04T23:13:30.000Z
torchlib/deep_rl/algorithm/ppo/utils.py
vermouth1992/torchlib
63b2bedb40f670b2d9fbfc0daeab4a8d44623095
[ "MIT" ]
null
null
null
torchlib/deep_rl/algorithm/ppo/utils.py
vermouth1992/torchlib
63b2bedb40f670b2d9fbfc0daeab4a8d44623095
[ "MIT" ]
1
2019-07-23T21:32:23.000Z
2019-07-23T21:32:23.000Z
""" Common utilities to implement policy gradient algorithms """ from collections import namedtuple, deque import numpy as np from scipy import signal from torchlib.dataset.utils import create_data_loader from torchlib.deep_rl.utils.replay.replay import ReplayBuffer from torchlib.deep_rl.utils.replay.sampler import Sampler from torchlib.utils.math import unnormalize, normalize Trajectory = namedtuple('Trajectory', ('state', 'action', 'reward_to_go', 'advantage', 'old_log_prob')) class PPOReplayBuffer(ReplayBuffer): def __init__(self, gamma, lam, policy, alpha=0.9): """ Args: gamma: discount factor lam: generalized advantage estimation policy: PPO policy alpha: value moving average ratio """ super(PPOReplayBuffer, self).__init__(None, None, None, None, None) self.gamma = gamma self.lam = lam self.alpha = alpha self.policy = policy def _initialize(self): self.memory = deque() self.running_value_mean = 0. self.running_value_std = 0. def clear(self): self._size = 0 self.memory.clear() def _finish_trajectory(self, states, actions, rewards, last_value): """Compute path accessory information including (reward_to_go, old_log_prob, advantage) Returns: """ predicted_state_values = self.policy.predict_state_value_batch(states) predicted_state_values = unnormalize(predicted_state_values, self.running_value_mean, self.running_value_std) rewards_last_state = np.append(rewards, last_value) predicted_state_values = np.append(predicted_state_values, last_value) # Used for fit value function reward_to_go = discount(rewards_last_state, self.gamma).astype(np.float32)[:-1] temporal_difference = rewards + predicted_state_values[1:] * self.gamma - predicted_state_values[:-1] # calculate reward-to-go gae = discount(temporal_difference, self.gamma * self.lam).astype(np.float32) old_log_prob = self.policy.predict_log_prob_batch(states, actions) return reward_to_go, gae, old_log_prob def add_trajectory(self, states, actions, rewards, last_value): """If last_state is not None, this trajectory is truncated. Args: states: (T, ob_dim) actions: (T, ac_dim) rewards: (T,) last_state: (ob_dim) Returns: """ reward_to_go, gae, old_log_prob = self._finish_trajectory(states, actions, rewards, last_value) self.memory.append(Trajectory( state=states, action=actions, reward_to_go=reward_to_go, advantage=gae, old_log_prob=old_log_prob )) self._size += actions.shape[0] def random_iterator(self, batch_size): """Create an iterator of all the dataset and update value mean and std Args: batch_size: Returns: """ states = np.concatenate([trajectory.state for trajectory in self.memory], axis=0) actions = np.concatenate([trajectory.action for trajectory in self.memory], axis=0) reward_to_go = np.concatenate([trajectory.reward_to_go for trajectory in self.memory], axis=0) gaes = np.concatenate([trajectory.advantage for trajectory in self.memory], axis=0) old_log_prob = np.concatenate([trajectory.old_log_prob for trajectory in self.memory], axis=0) value_mean, value_std = np.mean(reward_to_go), np.std(reward_to_go) reward_to_go = normalize(reward_to_go, value_mean, value_std) self.running_value_mean = self.running_value_mean * self.alpha + value_mean * (1 - self.alpha) self.running_value_std = self.running_value_std * self.alpha + value_std * (1 - self.alpha) gaes = normalize(gaes, np.mean(gaes), np.std(gaes)) batch_size = min(batch_size, states.shape[0]) data_loader = create_data_loader((states, actions, reward_to_go, gaes, old_log_prob), batch_size=batch_size, shuffle=True, drop_last=True) return data_loader class PPOSampler(Sampler): def __init__(self, min_steps_per_batch, logger=None): super(PPOSampler, self).__init__() self.min_steps_per_batch = min_steps_per_batch self.logger = logger def sample_trajectories(self, policy=None): obs_lst = [] action_lst = [] reward_lst = [] done_lst = [] policy = self.policy if policy is None else policy obs = self.env.reset() for _ in range(self.min_steps_per_batch // obs.shape[0]): action = policy.predict_batch(obs) obs_lst.append(obs) action_lst.append(action) obs, rewards, dones, infos = self.env.step(action) reward_lst.append(rewards) done_lst.append(dones) # compute last state value for the last trajectory in each environment last_state_lst = obs last_value_lst = self.policy.predict_state_value_batch(last_state_lst) last_value_lst = unnormalize(last_value_lst, self.pool.running_value_mean, self.pool.running_value_std) obs_lst = np.stack(obs_lst, axis=1) action_lst = np.stack(action_lst, axis=1) reward_lst = np.stack(reward_lst, axis=1) done_lst = np.stack(done_lst, axis=1) # separate trajectories and add to pool for i in range(self.env.num_envs): done_index = np.where(done_lst[i])[0] + 1 if done_lst[i][-1] == True: done_index = done_index[:-1] # ignore the last one last_value = 0. else: last_value = last_value_lst[i] sub_obs_lst = np.split(obs_lst[i], done_index) sub_action_lst = np.split(action_lst[i], done_index) sub_reward_lst = np.split(reward_lst[i], done_index) sub_last_value_lst = [0.] * (len(sub_obs_lst) - 1) + [last_value] for j in range(len(sub_obs_lst)): self.pool.add_trajectory(states=sub_obs_lst[j], actions=sub_action_lst[j], rewards=sub_reward_lst[j], last_value=sub_last_value_lst[j]) if self.logger: self.logger.store(EpReward=np.sum(sub_reward_lst[j]) + sub_last_value_lst[j]) self.logger.store(EpLength=sub_obs_lst[j].shape[0]) def discount(x, gamma): return signal.lfilter([1.0], [1.0, -gamma], x[::-1])[::-1]
37.183333
117
0.635739
from collections import namedtuple, deque import numpy as np from scipy import signal from torchlib.dataset.utils import create_data_loader from torchlib.deep_rl.utils.replay.replay import ReplayBuffer from torchlib.deep_rl.utils.replay.sampler import Sampler from torchlib.utils.math import unnormalize, normalize Trajectory = namedtuple('Trajectory', ('state', 'action', 'reward_to_go', 'advantage', 'old_log_prob')) class PPOReplayBuffer(ReplayBuffer): def __init__(self, gamma, lam, policy, alpha=0.9): super(PPOReplayBuffer, self).__init__(None, None, None, None, None) self.gamma = gamma self.lam = lam self.alpha = alpha self.policy = policy def _initialize(self): self.memory = deque() self.running_value_mean = 0. self.running_value_std = 0. def clear(self): self._size = 0 self.memory.clear() def _finish_trajectory(self, states, actions, rewards, last_value): predicted_state_values = self.policy.predict_state_value_batch(states) predicted_state_values = unnormalize(predicted_state_values, self.running_value_mean, self.running_value_std) rewards_last_state = np.append(rewards, last_value) predicted_state_values = np.append(predicted_state_values, last_value) reward_to_go = discount(rewards_last_state, self.gamma).astype(np.float32)[:-1] temporal_difference = rewards + predicted_state_values[1:] * self.gamma - predicted_state_values[:-1] gae = discount(temporal_difference, self.gamma * self.lam).astype(np.float32) old_log_prob = self.policy.predict_log_prob_batch(states, actions) return reward_to_go, gae, old_log_prob def add_trajectory(self, states, actions, rewards, last_value): reward_to_go, gae, old_log_prob = self._finish_trajectory(states, actions, rewards, last_value) self.memory.append(Trajectory( state=states, action=actions, reward_to_go=reward_to_go, advantage=gae, old_log_prob=old_log_prob )) self._size += actions.shape[0] def random_iterator(self, batch_size): states = np.concatenate([trajectory.state for trajectory in self.memory], axis=0) actions = np.concatenate([trajectory.action for trajectory in self.memory], axis=0) reward_to_go = np.concatenate([trajectory.reward_to_go for trajectory in self.memory], axis=0) gaes = np.concatenate([trajectory.advantage for trajectory in self.memory], axis=0) old_log_prob = np.concatenate([trajectory.old_log_prob for trajectory in self.memory], axis=0) value_mean, value_std = np.mean(reward_to_go), np.std(reward_to_go) reward_to_go = normalize(reward_to_go, value_mean, value_std) self.running_value_mean = self.running_value_mean * self.alpha + value_mean * (1 - self.alpha) self.running_value_std = self.running_value_std * self.alpha + value_std * (1 - self.alpha) gaes = normalize(gaes, np.mean(gaes), np.std(gaes)) batch_size = min(batch_size, states.shape[0]) data_loader = create_data_loader((states, actions, reward_to_go, gaes, old_log_prob), batch_size=batch_size, shuffle=True, drop_last=True) return data_loader class PPOSampler(Sampler): def __init__(self, min_steps_per_batch, logger=None): super(PPOSampler, self).__init__() self.min_steps_per_batch = min_steps_per_batch self.logger = logger def sample_trajectories(self, policy=None): obs_lst = [] action_lst = [] reward_lst = [] done_lst = [] policy = self.policy if policy is None else policy obs = self.env.reset() for _ in range(self.min_steps_per_batch // obs.shape[0]): action = policy.predict_batch(obs) obs_lst.append(obs) action_lst.append(action) obs, rewards, dones, infos = self.env.step(action) reward_lst.append(rewards) done_lst.append(dones) last_state_lst = obs last_value_lst = self.policy.predict_state_value_batch(last_state_lst) last_value_lst = unnormalize(last_value_lst, self.pool.running_value_mean, self.pool.running_value_std) obs_lst = np.stack(obs_lst, axis=1) action_lst = np.stack(action_lst, axis=1) reward_lst = np.stack(reward_lst, axis=1) done_lst = np.stack(done_lst, axis=1) for i in range(self.env.num_envs): done_index = np.where(done_lst[i])[0] + 1 if done_lst[i][-1] == True: done_index = done_index[:-1] last_value = 0. else: last_value = last_value_lst[i] sub_obs_lst = np.split(obs_lst[i], done_index) sub_action_lst = np.split(action_lst[i], done_index) sub_reward_lst = np.split(reward_lst[i], done_index) sub_last_value_lst = [0.] * (len(sub_obs_lst) - 1) + [last_value] for j in range(len(sub_obs_lst)): self.pool.add_trajectory(states=sub_obs_lst[j], actions=sub_action_lst[j], rewards=sub_reward_lst[j], last_value=sub_last_value_lst[j]) if self.logger: self.logger.store(EpReward=np.sum(sub_reward_lst[j]) + sub_last_value_lst[j]) self.logger.store(EpLength=sub_obs_lst[j].shape[0]) def discount(x, gamma): return signal.lfilter([1.0], [1.0, -gamma], x[::-1])[::-1]
true
true
f71e35702cffecb31e78b3aa2858556b28764eb9
3,500
py
Python
kubernetes/test/test_policy_v1beta1_api.py
fooka03/python
073cf4d89e532f92b57e8955b4efc3d5d5eb80cf
[ "Apache-2.0" ]
2
2020-07-02T05:47:41.000Z
2020-07-02T05:50:34.000Z
kubernetes/test/test_policy_v1beta1_api.py
fooka03/python
073cf4d89e532f92b57e8955b4efc3d5d5eb80cf
[ "Apache-2.0" ]
1
2021-03-25T23:44:49.000Z
2021-03-25T23:44:49.000Z
k8sdeployment/k8sstat/python/kubernetes/test/test_policy_v1beta1_api.py
JeffYFHuang/gpuaccounting
afa934350ebbd0634beb60b9df4a147426ea0006
[ "MIT" ]
1
2021-10-13T17:45:37.000Z
2021-10-13T17:45:37.000Z
# coding: utf-8 """ Kubernetes No description provided (generated by Openapi Generator https://github.com/openapitools/openapi-generator) # noqa: E501 OpenAPI spec version: v1.15.6 Generated by: https://openapi-generator.tech """ from __future__ import absolute_import import unittest import kubernetes.client from kubernetes.client.api.policy_v1beta1_api import PolicyV1beta1Api # noqa: E501 from kubernetes.client.rest import ApiException class TestPolicyV1beta1Api(unittest.TestCase): """PolicyV1beta1Api unit test stubs""" def setUp(self): self.api = kubernetes.client.api.policy_v1beta1_api.PolicyV1beta1Api() # noqa: E501 def tearDown(self): pass def test_create_namespaced_pod_disruption_budget(self): """Test case for create_namespaced_pod_disruption_budget """ pass def test_create_pod_security_policy(self): """Test case for create_pod_security_policy """ pass def test_delete_collection_namespaced_pod_disruption_budget(self): """Test case for delete_collection_namespaced_pod_disruption_budget """ pass def test_delete_collection_pod_security_policy(self): """Test case for delete_collection_pod_security_policy """ pass def test_delete_namespaced_pod_disruption_budget(self): """Test case for delete_namespaced_pod_disruption_budget """ pass def test_delete_pod_security_policy(self): """Test case for delete_pod_security_policy """ pass def test_get_api_resources(self): """Test case for get_api_resources """ pass def test_list_namespaced_pod_disruption_budget(self): """Test case for list_namespaced_pod_disruption_budget """ pass def test_list_pod_disruption_budget_for_all_namespaces(self): """Test case for list_pod_disruption_budget_for_all_namespaces """ pass def test_list_pod_security_policy(self): """Test case for list_pod_security_policy """ pass def test_patch_namespaced_pod_disruption_budget(self): """Test case for patch_namespaced_pod_disruption_budget """ pass def test_patch_namespaced_pod_disruption_budget_status(self): """Test case for patch_namespaced_pod_disruption_budget_status """ pass def test_patch_pod_security_policy(self): """Test case for patch_pod_security_policy """ pass def test_read_namespaced_pod_disruption_budget(self): """Test case for read_namespaced_pod_disruption_budget """ pass def test_read_namespaced_pod_disruption_budget_status(self): """Test case for read_namespaced_pod_disruption_budget_status """ pass def test_read_pod_security_policy(self): """Test case for read_pod_security_policy """ pass def test_replace_namespaced_pod_disruption_budget(self): """Test case for replace_namespaced_pod_disruption_budget """ pass def test_replace_namespaced_pod_disruption_budget_status(self): """Test case for replace_namespaced_pod_disruption_budget_status """ pass def test_replace_pod_security_policy(self): """Test case for replace_pod_security_policy """ pass if __name__ == '__main__': unittest.main()
23.648649
124
0.687714
from __future__ import absolute_import import unittest import kubernetes.client from kubernetes.client.api.policy_v1beta1_api import PolicyV1beta1Api from kubernetes.client.rest import ApiException class TestPolicyV1beta1Api(unittest.TestCase): def setUp(self): self.api = kubernetes.client.api.policy_v1beta1_api.PolicyV1beta1Api() def tearDown(self): pass def test_create_namespaced_pod_disruption_budget(self): pass def test_create_pod_security_policy(self): pass def test_delete_collection_namespaced_pod_disruption_budget(self): pass def test_delete_collection_pod_security_policy(self): pass def test_delete_namespaced_pod_disruption_budget(self): pass def test_delete_pod_security_policy(self): pass def test_get_api_resources(self): pass def test_list_namespaced_pod_disruption_budget(self): pass def test_list_pod_disruption_budget_for_all_namespaces(self): pass def test_list_pod_security_policy(self): pass def test_patch_namespaced_pod_disruption_budget(self): pass def test_patch_namespaced_pod_disruption_budget_status(self): pass def test_patch_pod_security_policy(self): pass def test_read_namespaced_pod_disruption_budget(self): pass def test_read_namespaced_pod_disruption_budget_status(self): pass def test_read_pod_security_policy(self): pass def test_replace_namespaced_pod_disruption_budget(self): pass def test_replace_namespaced_pod_disruption_budget_status(self): pass def test_replace_pod_security_policy(self): pass if __name__ == '__main__': unittest.main()
true
true
f71e3841de6840322ca7bb77900844dca913abf4
29
py
Python
BatalhaNaval.py
rafaelclemes81/Python
0e685b4e528a29bb23ecf11c9ccdbae8730b3ac3
[ "MIT" ]
null
null
null
BatalhaNaval.py
rafaelclemes81/Python
0e685b4e528a29bb23ecf11c9ccdbae8730b3ac3
[ "MIT" ]
null
null
null
BatalhaNaval.py
rafaelclemes81/Python
0e685b4e528a29bb23ecf11c9ccdbae8730b3ac3
[ "MIT" ]
null
null
null
''' Jogo Batalha Naval '''
7.25
26
0.551724
true
true
f71e38c13ec8321f0a922bfca3d6d3b50576bfd0
2,147
py
Python
import_export/results.py
michelekihiu/superintendence_tracking
325513059eeec25fdffd5ccb36befc0a9e8235ac
[ "BSD-2-Clause" ]
1
2017-10-31T02:37:37.000Z
2017-10-31T02:37:37.000Z
import_export/results.py
michelekihiu/superintendence_tracking
325513059eeec25fdffd5ccb36befc0a9e8235ac
[ "BSD-2-Clause" ]
2
2021-06-01T22:03:20.000Z
2022-01-13T00:43:38.000Z
import_export/results.py
michelekihiu/superintendence_tracking
325513059eeec25fdffd5ccb36befc0a9e8235ac
[ "BSD-2-Clause" ]
1
2020-11-04T08:39:52.000Z
2020-11-04T08:39:52.000Z
from __future__ import unicode_literals try: from collections import OrderedDict except ImportError: from django.utils.datastructures import SortedDict as OrderedDict from tablib import Dataset class Error(object): def __init__(self, error, traceback=None, row=None): self.error = error self.traceback = traceback self.row = row class RowResult(object): IMPORT_TYPE_UPDATE = 'update' IMPORT_TYPE_NEW = 'new' IMPORT_TYPE_DELETE = 'delete' IMPORT_TYPE_SKIP = 'skip' IMPORT_TYPE_ERROR = 'error' def __init__(self): self.errors = [] self.diff = None self.import_type = None class Result(object): def __init__(self, *args, **kwargs): super(Result, self).__init__() self.base_errors = [] self.diff_headers = [] self.rows = [] # RowResults self.failed_dataset = Dataset() self.totals = OrderedDict([(RowResult.IMPORT_TYPE_NEW, 0), (RowResult.IMPORT_TYPE_UPDATE, 0), (RowResult.IMPORT_TYPE_DELETE, 0), (RowResult.IMPORT_TYPE_SKIP, 0), (RowResult.IMPORT_TYPE_ERROR, 0)]) self.total_rows = 0 def append_row_result(self, row_result): self.rows.append(row_result) def append_base_error(self, error): self.base_errors.append(error) def add_dataset_headers(self, headers): self.failed_dataset.headers = headers + ["Error"] def append_failed_row(self, row, error): row_values = [v for (k, v) in row.items()] row_values.append(error.error.message) self.failed_dataset.append(row_values) def increment_row_result_total(self, row_result): if row_result.import_type: self.totals[row_result.import_type] += 1 def row_errors(self): return [(i + 1, row.errors) for i, row in enumerate(self.rows) if row.errors] def has_errors(self): return bool(self.base_errors or self.row_errors()) def __iter__(self): return iter(self.rows)
29.819444
69
0.620401
from __future__ import unicode_literals try: from collections import OrderedDict except ImportError: from django.utils.datastructures import SortedDict as OrderedDict from tablib import Dataset class Error(object): def __init__(self, error, traceback=None, row=None): self.error = error self.traceback = traceback self.row = row class RowResult(object): IMPORT_TYPE_UPDATE = 'update' IMPORT_TYPE_NEW = 'new' IMPORT_TYPE_DELETE = 'delete' IMPORT_TYPE_SKIP = 'skip' IMPORT_TYPE_ERROR = 'error' def __init__(self): self.errors = [] self.diff = None self.import_type = None class Result(object): def __init__(self, *args, **kwargs): super(Result, self).__init__() self.base_errors = [] self.diff_headers = [] self.rows = [] self.failed_dataset = Dataset() self.totals = OrderedDict([(RowResult.IMPORT_TYPE_NEW, 0), (RowResult.IMPORT_TYPE_UPDATE, 0), (RowResult.IMPORT_TYPE_DELETE, 0), (RowResult.IMPORT_TYPE_SKIP, 0), (RowResult.IMPORT_TYPE_ERROR, 0)]) self.total_rows = 0 def append_row_result(self, row_result): self.rows.append(row_result) def append_base_error(self, error): self.base_errors.append(error) def add_dataset_headers(self, headers): self.failed_dataset.headers = headers + ["Error"] def append_failed_row(self, row, error): row_values = [v for (k, v) in row.items()] row_values.append(error.error.message) self.failed_dataset.append(row_values) def increment_row_result_total(self, row_result): if row_result.import_type: self.totals[row_result.import_type] += 1 def row_errors(self): return [(i + 1, row.errors) for i, row in enumerate(self.rows) if row.errors] def has_errors(self): return bool(self.base_errors or self.row_errors()) def __iter__(self): return iter(self.rows)
true
true
f71e391a2a15cf39c959d5d3a8f6cd170aa714bd
909
py
Python
badgify/tests/test_models.py
BrendanBerkley/django-badgify
61203e92cb76982f778caf168d371a72a401db10
[ "MIT" ]
78
2015-03-04T13:41:31.000Z
2021-12-21T14:30:27.000Z
badgify/tests/test_models.py
BrendanBerkley/django-badgify
61203e92cb76982f778caf168d371a72a401db10
[ "MIT" ]
11
2015-06-18T18:38:53.000Z
2019-12-27T14:08:29.000Z
badgify/tests/test_models.py
BrendanBerkley/django-badgify
61203e92cb76982f778caf168d371a72a401db10
[ "MIT" ]
12
2015-06-18T16:05:38.000Z
2018-07-13T12:50:34.000Z
from django.db import IntegrityError from django.test import TestCase from ..models import Badge, Award from .mixins import UserFixturesMixin class BadgeTestCase(TestCase): """ Badge model test case. """ def test_autocreate_slug(self): badge = Badge.objects.create(name='Super Chouette') self.assertEqual(badge.slug, 'super-chouette') class AwardTestCase(TestCase, UserFixturesMixin): """ Award model test case. """ def setUp(self): self.create_users() def test_create(self): badge = Badge.objects.create(name='Super Chouette') Award.objects.create(user=self.user1, badge=badge) Award.objects.create(user=self.user2, badge=badge) self.assertEqual(badge.users.count(), 2) self.assertRaises(IntegrityError, Award.objects.create, **{ 'user': self.user1, 'badge': badge })
25.971429
67
0.657866
from django.db import IntegrityError from django.test import TestCase from ..models import Badge, Award from .mixins import UserFixturesMixin class BadgeTestCase(TestCase): def test_autocreate_slug(self): badge = Badge.objects.create(name='Super Chouette') self.assertEqual(badge.slug, 'super-chouette') class AwardTestCase(TestCase, UserFixturesMixin): def setUp(self): self.create_users() def test_create(self): badge = Badge.objects.create(name='Super Chouette') Award.objects.create(user=self.user1, badge=badge) Award.objects.create(user=self.user2, badge=badge) self.assertEqual(badge.users.count(), 2) self.assertRaises(IntegrityError, Award.objects.create, **{ 'user': self.user1, 'badge': badge })
true
true
f71e3bf6b5a4e1db0bd1e025dcf8b861aeb828af
922
py
Python
test/test_steps.py
jladdjr/ansible-builder
7520396f8921b98a033a8f25248dbadb9cd83901
[ "Apache-2.0" ]
null
null
null
test/test_steps.py
jladdjr/ansible-builder
7520396f8921b98a033a8f25248dbadb9cd83901
[ "Apache-2.0" ]
null
null
null
test/test_steps.py
jladdjr/ansible-builder
7520396f8921b98a033a8f25248dbadb9cd83901
[ "Apache-2.0" ]
null
null
null
import pytest import textwrap from ansible_builder.steps import AdditionalBuildSteps, PipSteps, BindepSteps def test_steps_for_collection_dependencies(): assert list(PipSteps('requirements.txt')) == [ 'ADD requirements.txt /build/', 'RUN pip3 install --upgrade -r /build/requirements.txt' ] @pytest.mark.parametrize('verb', ['prepend', 'append']) def test_additional_build_steps(verb): additional_build_steps = { 'prepend': ["RUN echo This is the prepend test", "RUN whoami"], 'append': textwrap.dedent(""" RUN echo This is the append test RUN whoami """) } steps = AdditionalBuildSteps(additional_build_steps[verb]) assert len(list(steps)) == 2 def test_system_steps(): assert list(BindepSteps('bindep_output.txt')) == [ 'ADD bindep_output.txt /build/', 'RUN dnf -y install $(cat /build/bindep_output.txt)' ]
27.939394
77
0.667028
import pytest import textwrap from ansible_builder.steps import AdditionalBuildSteps, PipSteps, BindepSteps def test_steps_for_collection_dependencies(): assert list(PipSteps('requirements.txt')) == [ 'ADD requirements.txt /build/', 'RUN pip3 install --upgrade -r /build/requirements.txt' ] @pytest.mark.parametrize('verb', ['prepend', 'append']) def test_additional_build_steps(verb): additional_build_steps = { 'prepend': ["RUN echo This is the prepend test", "RUN whoami"], 'append': textwrap.dedent(""" RUN echo This is the append test RUN whoami """) } steps = AdditionalBuildSteps(additional_build_steps[verb]) assert len(list(steps)) == 2 def test_system_steps(): assert list(BindepSteps('bindep_output.txt')) == [ 'ADD bindep_output.txt /build/', 'RUN dnf -y install $(cat /build/bindep_output.txt)' ]
true
true
f71e3ce1316873d9471482dae170853222e1b3db
1,417
py
Python
download_heroicons.py
zerolab/heroicons
1a95b8e7316b315377a8773569476aa7bcb8f9e1
[ "MIT" ]
null
null
null
download_heroicons.py
zerolab/heroicons
1a95b8e7316b315377a8773569476aa7bcb8f9e1
[ "MIT" ]
null
null
null
download_heroicons.py
zerolab/heroicons
1a95b8e7316b315377a8773569476aa7bcb8f9e1
[ "MIT" ]
null
null
null
#!/usr/bin/env python """ Download the latest heroicons zip file and select only the optimized icons. """ import argparse import os import sys from io import BytesIO from zipfile import ZIP_DEFLATED, ZipFile import requests def main(args=None): parser = argparse.ArgumentParser() parser.add_argument("version", help="e.g. 1.0.1") args = parser.parse_args(args) version = args.version zip_url = ( f"https://github.com/tailwindlabs/heroicons/archive/refs/tags/v{version}.zip" ) response = requests.get(zip_url) if response.status_code != 200: print(f"Got status code {response.status_code} for {zip_url}", file=sys.stderr) return 1 input_zip = ZipFile(BytesIO(response.content)) input_prefix = f"heroicons-{version}/optimized/" output_path = "src/heroicons/heroicons.zip" try: os.remove(output_path) except FileNotFoundError: pass with ZipFile( output_path, "w", compression=ZIP_DEFLATED, compresslevel=9 ) as output_zip: for name in input_zip.namelist(): if name.startswith(input_prefix) and name.endswith(".svg"): data = input_zip.read(name) new_name = name[len(input_prefix) :] output_zip.writestr(new_name, data) print(new_name) print("\n✅ Written!") return 0 if __name__ == "__main__": exit(main())
26.240741
87
0.652788
import argparse import os import sys from io import BytesIO from zipfile import ZIP_DEFLATED, ZipFile import requests def main(args=None): parser = argparse.ArgumentParser() parser.add_argument("version", help="e.g. 1.0.1") args = parser.parse_args(args) version = args.version zip_url = ( f"https://github.com/tailwindlabs/heroicons/archive/refs/tags/v{version}.zip" ) response = requests.get(zip_url) if response.status_code != 200: print(f"Got status code {response.status_code} for {zip_url}", file=sys.stderr) return 1 input_zip = ZipFile(BytesIO(response.content)) input_prefix = f"heroicons-{version}/optimized/" output_path = "src/heroicons/heroicons.zip" try: os.remove(output_path) except FileNotFoundError: pass with ZipFile( output_path, "w", compression=ZIP_DEFLATED, compresslevel=9 ) as output_zip: for name in input_zip.namelist(): if name.startswith(input_prefix) and name.endswith(".svg"): data = input_zip.read(name) new_name = name[len(input_prefix) :] output_zip.writestr(new_name, data) print(new_name) print("\n✅ Written!") return 0 if __name__ == "__main__": exit(main())
true
true
f71e3e92f9777ec601bc7079991566c4790da4b1
48,021
py
Python
python/ray/_private/utils.py
jianoaix/ray
1701b923bc83905f8961c06a6a173e3eba46a936
[ "Apache-2.0" ]
null
null
null
python/ray/_private/utils.py
jianoaix/ray
1701b923bc83905f8961c06a6a173e3eba46a936
[ "Apache-2.0" ]
41
2021-09-21T01:13:48.000Z
2022-03-19T07:12:22.000Z
python/ray/_private/utils.py
jianoaix/ray
1701b923bc83905f8961c06a6a173e3eba46a936
[ "Apache-2.0" ]
1
2019-09-24T16:24:49.000Z
2019-09-24T16:24:49.000Z
import binascii import errno import functools import hashlib import importlib import logging import multiprocessing import os import signal import subprocess import sys import tempfile import threading import time from typing import Optional, Sequence, Tuple, Any, Union, Dict import uuid import grpc import warnings try: from grpc import aio as aiogrpc except ImportError: from grpc.experimental import aio as aiogrpc import inspect from inspect import signature from pathlib import Path import numpy as np import ray from ray.core.generated.gcs_pb2 import ErrorTableData import ray.ray_constants as ray_constants from ray._private.tls_utils import load_certs_from_env # Import psutil after ray so the packaged version is used. import psutil pwd = None if sys.platform != "win32": import pwd logger = logging.getLogger(__name__) # Linux can bind child processes' lifetimes to that of their parents via prctl. # prctl support is detected dynamically once, and assumed thereafter. linux_prctl = None # Windows can bind processes' lifetimes to that of kernel-level "job objects". # We keep a global job object to tie its lifetime to that of our own process. win32_job = None win32_AssignProcessToJobObject = None def get_user_temp_dir(): if "RAY_TMPDIR" in os.environ: return os.environ["RAY_TMPDIR"] elif sys.platform.startswith("linux") and "TMPDIR" in os.environ: return os.environ["TMPDIR"] elif sys.platform.startswith("darwin") or sys.platform.startswith("linux"): # Ideally we wouldn't need this fallback, but keep it for now for # for compatibility tempdir = os.path.join(os.sep, "tmp") else: tempdir = tempfile.gettempdir() return tempdir def get_ray_temp_dir(): return os.path.join(get_user_temp_dir(), "ray") def _random_string(): id_hash = hashlib.shake_128() id_hash.update(uuid.uuid4().bytes) id_bytes = id_hash.digest(ray_constants.ID_SIZE) assert len(id_bytes) == ray_constants.ID_SIZE return id_bytes def format_error_message(exception_message: str, task_exception: bool = False): """Improve the formatting of an exception thrown by a remote function. This method takes a traceback from an exception and makes it nicer by removing a few uninformative lines and adding some space to indent the remaining lines nicely. Args: exception_message: A message generated by traceback.format_exc(). Returns: A string of the formatted exception message. """ lines = exception_message.split("\n") if task_exception: # For errors that occur inside of tasks, remove lines 1 and 2 which are # always the same, they just contain information about the worker code. lines = lines[0:1] + lines[3:] pass return "\n".join(lines) def push_error_to_driver( worker, error_type: str, message: str, job_id: Optional[str] = None ): """Push an error message to the driver to be printed in the background. Args: worker: The worker to use. error_type: The type of the error. message: The message that will be printed in the background on the driver. job_id: The ID of the driver to push the error message to. If this is None, then the message will be pushed to all drivers. """ if job_id is None: job_id = ray.JobID.nil() assert isinstance(job_id, ray.JobID) worker.core_worker.push_error(job_id, error_type, message, time.time()) def construct_error_message(job_id, error_type, message, timestamp): """Construct an ErrorTableData object. Args: job_id: The ID of the job that the error should go to. If this is nil, then the error will go to all drivers. error_type: The type of the error. message: The error message. timestamp: The time of the error. Returns: The ErrorTableData object. """ data = ErrorTableData() data.job_id = job_id.binary() data.type = error_type data.error_message = message data.timestamp = timestamp return data def publish_error_to_driver( error_type: str, message: str, gcs_publisher, job_id=None, ): """Push an error message to the driver to be printed in the background. Normally the push_error_to_driver function should be used. However, in some instances, the raylet client is not available, e.g., because the error happens in Python before the driver or worker has connected to the backend processes. Args: error_type: The type of the error. message: The message that will be printed in the background on the driver. gcs_publisher: The GCS publisher to use. job_id: The ID of the driver to push the error message to. If this is None, then the message will be pushed to all drivers. """ if job_id is None: job_id = ray.JobID.nil() assert isinstance(job_id, ray.JobID) error_data = construct_error_message(job_id, error_type, message, time.time()) try: gcs_publisher.publish_error(job_id.hex().encode(), error_data) except Exception: logger.exception(f"Failed to publish error {error_data}") def random_string(): """Generate a random string to use as an ID. Note that users may seed numpy, which could cause this function to generate duplicate IDs. Therefore, we need to seed numpy ourselves, but we can't interfere with the state of the user's random number generator, so we extract the state of the random number generator and reset it after we are done. TODO(rkn): If we want to later guarantee that these are generated in a deterministic manner, then we will need to make some changes here. Returns: A random byte string of length ray_constants.ID_SIZE. """ # Get the state of the numpy random number generator. numpy_state = np.random.get_state() # Try to use true randomness. np.random.seed(None) # Generate the random ID. random_id = np.random.bytes(ray_constants.ID_SIZE) # Reset the state of the numpy random number generator. np.random.set_state(numpy_state) return random_id def decode(byte_str: str, allow_none: bool = False, encode_type: str = "utf-8"): """Make this unicode in Python 3, otherwise leave it as bytes. Args: byte_str: The byte string to decode. allow_none: If true, then we will allow byte_str to be None in which case we will return an empty string. TODO(rkn): Remove this flag. This is only here to simplify upgrading to flatbuffers 1.10.0. Returns: A byte string in Python 2 and a unicode string in Python 3. """ if byte_str is None and allow_none: return "" if not isinstance(byte_str, bytes): raise ValueError(f"The argument {byte_str} must be a bytes object.") if sys.version_info >= (3, 0): return byte_str.decode(encode_type) else: return byte_str def ensure_str(s, encoding="utf-8", errors="strict"): """Coerce *s* to `str`. - `str` -> `str` - `bytes` -> decoded to `str` """ if isinstance(s, str): return s else: assert isinstance(s, bytes) return s.decode(encoding, errors) def binary_to_object_ref(binary_object_ref): return ray.ObjectRef(binary_object_ref) def binary_to_task_id(binary_task_id): return ray.TaskID(binary_task_id) def binary_to_hex(identifier): hex_identifier = binascii.hexlify(identifier) if sys.version_info >= (3, 0): hex_identifier = hex_identifier.decode() return hex_identifier def hex_to_binary(hex_identifier): return binascii.unhexlify(hex_identifier) # TODO(qwang): Remove these hepler functions # once we separate `WorkerID` from `UniqueID`. def compute_job_id_from_driver(driver_id): assert isinstance(driver_id, ray.WorkerID) return ray.JobID(driver_id.binary()[0 : ray.JobID.size()]) def compute_driver_id_from_job(job_id): assert isinstance(job_id, ray.JobID) rest_length = ray_constants.ID_SIZE - job_id.size() driver_id_str = job_id.binary() + (rest_length * b"\xff") return ray.WorkerID(driver_id_str) def get_cuda_visible_devices(): """Get the device IDs in the CUDA_VISIBLE_DEVICES environment variable. Returns: devices (List[str]): If CUDA_VISIBLE_DEVICES is set, returns a list of strings representing the IDs of the visible GPUs. If it is not set or is set to NoDevFiles, returns empty list. """ gpu_ids_str = os.environ.get("CUDA_VISIBLE_DEVICES", None) if gpu_ids_str is None: return None if gpu_ids_str == "": return [] if gpu_ids_str == "NoDevFiles": return [] # GPU identifiers are given as strings representing integers or UUIDs. return list(gpu_ids_str.split(",")) last_set_gpu_ids = None def set_cuda_visible_devices(gpu_ids): """Set the CUDA_VISIBLE_DEVICES environment variable. Args: gpu_ids (List[str]): List of strings representing GPU IDs. """ if os.environ.get(ray_constants.NOSET_CUDA_VISIBLE_DEVICES_ENV_VAR): return global last_set_gpu_ids if last_set_gpu_ids == gpu_ids: return # optimization: already set os.environ["CUDA_VISIBLE_DEVICES"] = ",".join([str(i) for i in gpu_ids]) last_set_gpu_ids = gpu_ids def resources_from_ray_options(options_dict: Dict[str, Any]) -> Dict[str, Any]: """Determine a task's resource requirements. Args: options_dict: The dictionary that contains resources requirements. Returns: A dictionary of the resource requirements for the task. """ resources = (options_dict.get("resources") or {}).copy() if "CPU" in resources or "GPU" in resources: raise ValueError( "The resources dictionary must not contain the key 'CPU' or 'GPU'" ) elif "memory" in resources or "object_store_memory" in resources: raise ValueError( "The resources dictionary must not " "contain the key 'memory' or 'object_store_memory'" ) num_cpus = options_dict.get("num_cpus") num_gpus = options_dict.get("num_gpus") memory = options_dict.get("memory") object_store_memory = options_dict.get("object_store_memory") accelerator_type = options_dict.get("accelerator_type") if num_cpus is not None: resources["CPU"] = num_cpus if num_gpus is not None: resources["GPU"] = num_gpus if memory is not None: resources["memory"] = ray_constants.to_memory_units(memory, round_up=True) if object_store_memory is not None: resources["object_store_memory"] = ray_constants.to_memory_units( object_store_memory, round_up=True ) if accelerator_type is not None: resources[ f"{ray_constants.RESOURCE_CONSTRAINT_PREFIX}{accelerator_type}" ] = 0.001 return resources class Unbuffered(object): """There's no "built-in" solution to programatically disabling buffering of text files. Ray expects stdout/err to be text files, so creating an unbuffered binary file is unacceptable. See https://mail.python.org/pipermail/tutor/2003-November/026645.html. https://docs.python.org/3/library/functions.html#open """ def __init__(self, stream): self.stream = stream def write(self, data): self.stream.write(data) self.stream.flush() def writelines(self, datas): self.stream.writelines(datas) self.stream.flush() def __getattr__(self, attr): return getattr(self.stream, attr) def open_log(path, unbuffered=False, **kwargs): """ Opens the log file at `path`, with the provided kwargs being given to `open`. """ # Disable buffering, see test_advanced_3.py::test_logging_to_driver kwargs.setdefault("buffering", 1) kwargs.setdefault("mode", "a") kwargs.setdefault("encoding", "utf-8") stream = open(path, **kwargs) if unbuffered: return Unbuffered(stream) else: return stream def get_system_memory( # For cgroups v1: memory_limit_filename="/sys/fs/cgroup/memory/memory.limit_in_bytes", # For cgroups v2: memory_limit_filename_v2="/sys/fs/cgroup/memory.max", ): """Return the total amount of system memory in bytes. Returns: The total amount of system memory in bytes. """ # Try to accurately figure out the memory limit if we are in a docker # container. Note that this file is not specific to Docker and its value is # often much larger than the actual amount of memory. docker_limit = None if os.path.exists(memory_limit_filename): with open(memory_limit_filename, "r") as f: docker_limit = int(f.read()) elif os.path.exists(memory_limit_filename_v2): with open(memory_limit_filename_v2, "r") as f: max_file = f.read() if max_file.isnumeric(): docker_limit = int(max_file) else: # max_file is "max", i.e. is unset. docker_limit = None # Use psutil if it is available. psutil_memory_in_bytes = psutil.virtual_memory().total if docker_limit is not None: # We take the min because the cgroup limit is very large if we aren't # in Docker. return min(docker_limit, psutil_memory_in_bytes) return psutil_memory_in_bytes def _get_docker_cpus( cpu_quota_file_name="/sys/fs/cgroup/cpu/cpu.cfs_quota_us", cpu_period_file_name="/sys/fs/cgroup/cpu/cpu.cfs_period_us", cpuset_file_name="/sys/fs/cgroup/cpuset/cpuset.cpus", cpu_max_file_name="/sys/fs/cgroup/cpu.max", ) -> Optional[float]: # TODO (Alex): Don't implement this logic oursleves. # Docker has 2 underyling ways of implementing CPU limits: # https://docs.docker.com/config/containers/resource_constraints/#configure-the-default-cfs-scheduler # 1. --cpuset-cpus 2. --cpus or --cpu-quota/--cpu-period (--cpu-shares is a # soft limit so we don't worry about it). For Ray's purposes, if we use # docker, the number of vCPUs on a machine is whichever is set (ties broken # by smaller value). cpu_quota = None # See: https://bugs.openjdk.java.net/browse/JDK-8146115 if os.path.exists(cpu_quota_file_name) and os.path.exists(cpu_period_file_name): try: with open(cpu_quota_file_name, "r") as quota_file, open( cpu_period_file_name, "r" ) as period_file: cpu_quota = float(quota_file.read()) / float(period_file.read()) except Exception: logger.exception("Unexpected error calculating docker cpu quota.") # Look at cpu.max for cgroups v2 elif os.path.exists(cpu_max_file_name): try: max_file = open(cpu_max_file_name).read() quota_str, period_str = max_file.split() if quota_str.isnumeric() and period_str.isnumeric(): cpu_quota = float(quota_str) / float(period_str) else: # quota_str is "max" meaning the cpu quota is unset cpu_quota = None except Exception: logger.exception("Unexpected error calculating docker cpu quota.") if (cpu_quota is not None) and (cpu_quota < 0): cpu_quota = None elif cpu_quota == 0: # Round up in case the cpu limit is less than 1. cpu_quota = 1 cpuset_num = None if os.path.exists(cpuset_file_name): try: with open(cpuset_file_name) as cpuset_file: ranges_as_string = cpuset_file.read() ranges = ranges_as_string.split(",") cpu_ids = [] for num_or_range in ranges: if "-" in num_or_range: start, end = num_or_range.split("-") cpu_ids.extend(list(range(int(start), int(end) + 1))) else: cpu_ids.append(int(num_or_range)) cpuset_num = len(cpu_ids) except Exception: logger.exception("Unexpected error calculating docker cpuset ids.") # Possible to-do: Parse cgroups v2's cpuset.cpus.effective for the number # of accessible CPUs. if cpu_quota and cpuset_num: return min(cpu_quota, cpuset_num) return cpu_quota or cpuset_num def get_num_cpus() -> int: cpu_count = multiprocessing.cpu_count() if os.environ.get("RAY_USE_MULTIPROCESSING_CPU_COUNT"): logger.info( "Detected RAY_USE_MULTIPROCESSING_CPU_COUNT=1: Using " "multiprocessing.cpu_count() to detect the number of CPUs. " "This may be inconsistent when used inside docker. " "To correctly detect CPUs, unset the env var: " "`RAY_USE_MULTIPROCESSING_CPU_COUNT`." ) return cpu_count try: # Not easy to get cpu count in docker, see: # https://bugs.python.org/issue36054 docker_count = _get_docker_cpus() if docker_count is not None and docker_count != cpu_count: # Don't log this warning if we're on K8s or if the warning is # explicitly disabled. if ( "RAY_DISABLE_DOCKER_CPU_WARNING" not in os.environ and "KUBERNETES_SERVICE_HOST" not in os.environ ): logger.warning( "Detecting docker specified CPUs. In " "previous versions of Ray, CPU detection in containers " "was incorrect. Please ensure that Ray has enough CPUs " "allocated. As a temporary workaround to revert to the " "prior behavior, set " "`RAY_USE_MULTIPROCESSING_CPU_COUNT=1` as an env var " "before starting Ray. Set the env var: " "`RAY_DISABLE_DOCKER_CPU_WARNING=1` to mute this warning." ) # TODO (Alex): We should probably add support for fractional cpus. if int(docker_count) != float(docker_count): logger.warning( f"Ray currently does not support initializing Ray" f"with fractional cpus. Your num_cpus will be " f"truncated from {docker_count} to " f"{int(docker_count)}." ) docker_count = int(docker_count) cpu_count = docker_count except Exception: # `nproc` and cgroup are linux-only. If docker only works on linux # (will run in a linux VM on other platforms), so this is fine. pass return cpu_count def get_used_memory(): """Return the currently used system memory in bytes Returns: The total amount of used memory """ # Try to accurately figure out the memory usage if we are in a docker # container. docker_usage = None # For cgroups v1: memory_usage_filename = "/sys/fs/cgroup/memory/memory.usage_in_bytes" # For cgroups v2: memory_usage_filename_v2 = "/sys/fs/cgroup/memory.current" if os.path.exists(memory_usage_filename): with open(memory_usage_filename, "r") as f: docker_usage = int(f.read()) elif os.path.exists(memory_usage_filename_v2): with open(memory_usage_filename_v2, "r") as f: docker_usage = int(f.read()) # Use psutil if it is available. psutil_memory_in_bytes = psutil.virtual_memory().used if docker_usage is not None: # We take the min because the cgroup limit is very large if we aren't # in Docker. return min(docker_usage, psutil_memory_in_bytes) return psutil_memory_in_bytes def estimate_available_memory(): """Return the currently available amount of system memory in bytes. Returns: The total amount of available memory in bytes. Based on the used and total memory. """ return get_system_memory() - get_used_memory() def get_shared_memory_bytes(): """Get the size of the shared memory file system. Returns: The size of the shared memory file system in bytes. """ # Make sure this is only called on Linux. assert sys.platform == "linux" or sys.platform == "linux2" shm_fd = os.open("/dev/shm", os.O_RDONLY) try: shm_fs_stats = os.fstatvfs(shm_fd) # The value shm_fs_stats.f_bsize is the block size and the # value shm_fs_stats.f_bavail is the number of available # blocks. shm_avail = shm_fs_stats.f_bsize * shm_fs_stats.f_bavail finally: os.close(shm_fd) return shm_avail def check_oversized_function( pickled: bytes, name: str, obj_type: str, worker: "ray.Worker" ) -> None: """Send a warning message if the pickled function is too large. Args: pickled: the pickled function. name: name of the pickled object. obj_type: type of the pickled object, can be 'function', 'remote function', or 'actor'. worker: the worker used to send warning message. message will be logged locally if None. """ length = len(pickled) if length <= ray_constants.FUNCTION_SIZE_WARN_THRESHOLD: return elif length < ray_constants.FUNCTION_SIZE_ERROR_THRESHOLD: warning_message = ( "The {} {} is very large ({} MiB). " "Check that its definition is not implicitly capturing a large " "array or other object in scope. Tip: use ray.put() to put large " "objects in the Ray object store." ).format(obj_type, name, length // (1024 * 1024)) if worker: push_error_to_driver( worker, ray_constants.PICKLING_LARGE_OBJECT_PUSH_ERROR, "Warning: " + warning_message, job_id=worker.current_job_id, ) else: error = ( "The {} {} is too large ({} MiB > FUNCTION_SIZE_ERROR_THRESHOLD={}" " MiB). Check that its definition is not implicitly capturing a " "large array or other object in scope. Tip: use ray.put() to " "put large objects in the Ray object store." ).format( obj_type, name, length // (1024 * 1024), ray_constants.FUNCTION_SIZE_ERROR_THRESHOLD // (1024 * 1024), ) raise ValueError(error) def is_main_thread(): return threading.current_thread().getName() == "MainThread" def detect_fate_sharing_support_win32(): global win32_job, win32_AssignProcessToJobObject if win32_job is None and sys.platform == "win32": import ctypes try: from ctypes.wintypes import BOOL, DWORD, HANDLE, LPVOID, LPCWSTR kernel32 = ctypes.WinDLL("kernel32") kernel32.CreateJobObjectW.argtypes = (LPVOID, LPCWSTR) kernel32.CreateJobObjectW.restype = HANDLE sijo_argtypes = (HANDLE, ctypes.c_int, LPVOID, DWORD) kernel32.SetInformationJobObject.argtypes = sijo_argtypes kernel32.SetInformationJobObject.restype = BOOL kernel32.AssignProcessToJobObject.argtypes = (HANDLE, HANDLE) kernel32.AssignProcessToJobObject.restype = BOOL kernel32.IsDebuggerPresent.argtypes = () kernel32.IsDebuggerPresent.restype = BOOL except (AttributeError, TypeError, ImportError): kernel32 = None job = kernel32.CreateJobObjectW(None, None) if kernel32 else None job = subprocess.Handle(job) if job else job if job: from ctypes.wintypes import DWORD, LARGE_INTEGER, ULARGE_INTEGER class JOBOBJECT_BASIC_LIMIT_INFORMATION(ctypes.Structure): _fields_ = [ ("PerProcessUserTimeLimit", LARGE_INTEGER), ("PerJobUserTimeLimit", LARGE_INTEGER), ("LimitFlags", DWORD), ("MinimumWorkingSetSize", ctypes.c_size_t), ("MaximumWorkingSetSize", ctypes.c_size_t), ("ActiveProcessLimit", DWORD), ("Affinity", ctypes.c_size_t), ("PriorityClass", DWORD), ("SchedulingClass", DWORD), ] class IO_COUNTERS(ctypes.Structure): _fields_ = [ ("ReadOperationCount", ULARGE_INTEGER), ("WriteOperationCount", ULARGE_INTEGER), ("OtherOperationCount", ULARGE_INTEGER), ("ReadTransferCount", ULARGE_INTEGER), ("WriteTransferCount", ULARGE_INTEGER), ("OtherTransferCount", ULARGE_INTEGER), ] class JOBOBJECT_EXTENDED_LIMIT_INFORMATION(ctypes.Structure): _fields_ = [ ("BasicLimitInformation", JOBOBJECT_BASIC_LIMIT_INFORMATION), ("IoInfo", IO_COUNTERS), ("ProcessMemoryLimit", ctypes.c_size_t), ("JobMemoryLimit", ctypes.c_size_t), ("PeakProcessMemoryUsed", ctypes.c_size_t), ("PeakJobMemoryUsed", ctypes.c_size_t), ] debug = kernel32.IsDebuggerPresent() # Defined in <WinNT.h>; also available here: # https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/nf-jobapi2-setinformationjobobject JobObjectExtendedLimitInformation = 9 JOB_OBJECT_LIMIT_BREAKAWAY_OK = 0x00000800 JOB_OBJECT_LIMIT_DIE_ON_UNHANDLED_EXCEPTION = 0x00000400 JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE = 0x00002000 buf = JOBOBJECT_EXTENDED_LIMIT_INFORMATION() buf.BasicLimitInformation.LimitFlags = ( (0 if debug else JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE) | JOB_OBJECT_LIMIT_DIE_ON_UNHANDLED_EXCEPTION | JOB_OBJECT_LIMIT_BREAKAWAY_OK ) infoclass = JobObjectExtendedLimitInformation if not kernel32.SetInformationJobObject( job, infoclass, ctypes.byref(buf), ctypes.sizeof(buf) ): job = None win32_AssignProcessToJobObject = ( kernel32.AssignProcessToJobObject if kernel32 is not None else False ) win32_job = job if job else False return bool(win32_job) def detect_fate_sharing_support_linux(): global linux_prctl if linux_prctl is None and sys.platform.startswith("linux"): try: from ctypes import c_int, c_ulong, CDLL prctl = CDLL(None).prctl prctl.restype = c_int prctl.argtypes = [c_int, c_ulong, c_ulong, c_ulong, c_ulong] except (AttributeError, TypeError): prctl = None linux_prctl = prctl if prctl else False return bool(linux_prctl) def detect_fate_sharing_support(): result = None if sys.platform == "win32": result = detect_fate_sharing_support_win32() elif sys.platform.startswith("linux"): result = detect_fate_sharing_support_linux() return result def set_kill_on_parent_death_linux(): """Ensures this process dies if its parent dies (fate-sharing). Linux-only. Must be called in preexec_fn (i.e. by the child). """ if detect_fate_sharing_support_linux(): import signal PR_SET_PDEATHSIG = 1 if linux_prctl(PR_SET_PDEATHSIG, signal.SIGKILL, 0, 0, 0) != 0: import ctypes raise OSError(ctypes.get_errno(), "prctl(PR_SET_PDEATHSIG) failed") else: assert False, "PR_SET_PDEATHSIG used despite being unavailable" def set_kill_child_on_death_win32(child_proc): """Ensures the child process dies if this process dies (fate-sharing). Windows-only. Must be called by the parent, after spawning the child. Args: child_proc: The subprocess.Popen or subprocess.Handle object. """ if isinstance(child_proc, subprocess.Popen): child_proc = child_proc._handle assert isinstance(child_proc, subprocess.Handle) if detect_fate_sharing_support_win32(): if not win32_AssignProcessToJobObject(win32_job, int(child_proc)): import ctypes raise OSError(ctypes.get_last_error(), "AssignProcessToJobObject() failed") else: assert False, "AssignProcessToJobObject used despite being unavailable" def set_sigterm_handler(sigterm_handler): """Registers a handler for SIGTERM in a platform-compatible manner.""" if sys.platform == "win32": # Note that these signal handlers only work for console applications. # TODO(mehrdadn): implement graceful process termination mechanism # SIGINT is Ctrl+C, SIGBREAK is Ctrl+Break. signal.signal(signal.SIGBREAK, sigterm_handler) else: signal.signal(signal.SIGTERM, sigterm_handler) def try_make_directory_shared(directory_path): try: os.chmod(directory_path, 0o0777) except OSError as e: # Silently suppress the PermissionError that is thrown by the chmod. # This is done because the user attempting to change the permissions # on a directory may not own it. The chmod is attempted whether the # directory is new or not to avoid race conditions. # ray-project/ray/#3591 if e.errno in [errno.EACCES, errno.EPERM]: pass else: raise def try_to_create_directory(directory_path): """Attempt to create a directory that is globally readable/writable. Args: directory_path: The path of the directory to create. """ directory_path = os.path.expanduser(directory_path) os.makedirs(directory_path, exist_ok=True) # Change the log directory permissions so others can use it. This is # important when multiple people are using the same machine. try_make_directory_shared(directory_path) def try_to_symlink(symlink_path, target_path): """Attempt to create a symlink. If the symlink path exists and isn't a symlink, the symlink will not be created. If a symlink exists in the path, it will be attempted to be removed and replaced. Args: symlink_path: The path at which to create the symlink. target_path: The path the symlink should point to. """ symlink_path = os.path.expanduser(symlink_path) target_path = os.path.expanduser(target_path) if os.path.exists(symlink_path): if os.path.islink(symlink_path): # Try to remove existing symlink. try: os.remove(symlink_path) except OSError: return else: # There's an existing non-symlink file, don't overwrite it. return try: os.symlink(target_path, symlink_path) except OSError: return def get_user(): if pwd is None: return "" try: return pwd.getpwuid(os.getuid()).pw_name except Exception: return "" def get_function_args(callable): all_parameters = frozenset(signature(callable).parameters) return list(all_parameters) def get_conda_bin_executable(executable_name): """ Return path to the specified executable, assumed to be discoverable within the 'bin' subdirectory of a conda installation. Adapted from https://github.com/mlflow/mlflow. """ # Use CONDA_EXE as per https://github.com/conda/conda/issues/7126 if "CONDA_EXE" in os.environ: conda_bin_dir = os.path.dirname(os.environ["CONDA_EXE"]) return os.path.join(conda_bin_dir, executable_name) return executable_name def get_conda_env_dir(env_name): """Find and validate the conda directory for a given conda environment. For example, given the environment name `tf1`, this function checks the existence of the corresponding conda directory, e.g. `/Users/scaly/anaconda3/envs/tf1`, and returns it. """ conda_prefix = os.environ.get("CONDA_PREFIX") if conda_prefix is None: # The caller is neither in a conda env or in (base) env. This is rare # because by default, new terminals start in (base), but we can still # support this case. conda_exe = os.environ.get("CONDA_EXE") if conda_exe is None: raise ValueError( "Cannot find environment variables set by conda. " "Please verify conda is installed." ) # Example: CONDA_EXE=$HOME/anaconda3/bin/python # Strip out /bin/python by going up two parent directories. conda_prefix = str(Path(conda_exe).parent.parent) # There are two cases: # 1. We are in a conda (base) env: CONDA_DEFAULT_ENV=base and # CONDA_PREFIX=$HOME/anaconda3 # 2. We are in a user-created conda env: CONDA_DEFAULT_ENV=$env_name and # CONDA_PREFIX=$HOME/anaconda3/envs/$current_env_name if os.environ.get("CONDA_DEFAULT_ENV") == "base": # Caller's curent environment is (base). # Not recommended by conda, but we can still support it. if env_name == "base": # Desired environment is (base), located at e.g. $HOME/anaconda3 env_dir = conda_prefix else: # Desired environment is user-created, e.g. # $HOME/anaconda3/envs/$env_name env_dir = os.path.join(conda_prefix, "envs", env_name) else: # Now `conda_prefix` should be something like # $HOME/anaconda3/envs/$current_env_name # We want to replace the last component with the desired env name. conda_envs_dir = os.path.split(conda_prefix)[0] env_dir = os.path.join(conda_envs_dir, env_name) if not os.path.isdir(env_dir): raise ValueError( "conda env " + env_name + " not found in conda envs directory. Run `conda env list` to " + "verify the name is correct." ) return env_dir def get_call_location(back: int = 1): """ Get the location (filename and line number) of a function caller, `back` frames up the stack. Args: back: The number of frames to go up the stack, not including this function. """ stack = inspect.stack() try: frame = stack[back + 1] return f"{frame.filename}:{frame.lineno}" except IndexError: return "UNKNOWN" # Used to only print a deprecation warning once for a given function if we # don't wish to spam the caller. _PRINTED_WARNING = set() # The following is inspired by # https://github.com/tensorflow/tensorflow/blob/dec8e0b11f4f87693b67e125e67dfbc68d26c205/tensorflow/python/util/deprecation.py#L274-L329 def deprecated( instructions: Optional[str] = None, removal_release: Optional[str] = None, removal_date: Optional[str] = None, warn_once: bool = True, ): """ Creates a decorator for marking functions as deprecated. The decorator will log a deprecation warning on the first (or all, see `warn_once` arg) invocations, and will otherwise leave the wrapped function unchanged. Args: instructions: Instructions for the caller to update their code. removal_release: The release in which this deprecated function will be removed. Only one of removal_release and removal_date should be specified. If neither is specfieid, we'll warning that the function will be removed "in a future release". removal_date: The date on which this deprecated function will be removed. Only one of removal_release and removal_date should be specified. If neither is specfieid, we'll warning that the function will be removed "in a future release". warn_once: If true, the deprecation warning will only be logged on the first invocation. Otherwise, the deprecation warning will be logged on every invocation. Defaults to True. Returns: A decorator to be used for wrapping deprecated functions. """ if removal_release is not None and removal_date is not None: raise ValueError( "Only one of removal_release and removal_date should be specified." ) def deprecated_wrapper(func): @functools.wraps(func) def new_func(*args, **kwargs): global _PRINTED_WARNING if func not in _PRINTED_WARNING: if warn_once: _PRINTED_WARNING.add(func) msg = ( "From {}: {} (from {}) is deprecated and will ".format( get_call_location(), func.__name__, func.__module__ ) + "be removed " + ( f"in version {removal_release}." if removal_release is not None else f"after {removal_date}" if removal_date is not None else "in a future version" ) + (f" {instructions}" if instructions is not None else "") ) warnings.warn(msg) return func(*args, **kwargs) return new_func return deprecated_wrapper def import_attr(full_path: str): """Given a full import path to a module attr, return the imported attr. For example, the following are equivalent: MyClass = import_attr("module.submodule:MyClass") MyClass = import_attr("module.submodule.MyClass") from module.submodule import MyClass Returns: Imported attr """ if full_path is None: raise TypeError("import path cannot be None") if ":" in full_path: if full_path.count(":") > 1: raise ValueError( f'Got invalid import path "{full_path}". An ' "import path may have at most one colon." ) module_name, attr_name = full_path.split(":") else: last_period_idx = full_path.rfind(".") module_name = full_path[:last_period_idx] attr_name = full_path[last_period_idx + 1 :] module = importlib.import_module(module_name) return getattr(module, attr_name) def get_wheel_filename( sys_platform: str = sys.platform, ray_version: str = ray.__version__, py_version: str = f"{sys.version_info.major}{sys.version_info.minor}", ) -> str: """Returns the filename used for the nightly Ray wheel. Args: sys_platform: The platform as returned by sys.platform. Examples: "darwin", "linux", "win32" ray_version: The Ray version as returned by ray.__version__ or `ray --version`. Examples: "3.0.0.dev0" py_version (str): The major and minor Python versions concatenated. Examples: "36", "37", "38", "39" Returns: The wheel file name. Examples: ray-3.0.0.dev0-cp38-cp38-manylinux2014_x86_64.whl """ assert py_version in ["36", "37", "38", "39"], py_version os_strings = { "darwin": "macosx_10_15_x86_64" if py_version in ["38", "39"] else "macosx_10_15_intel", "linux": "manylinux2014_x86_64", "win32": "win_amd64", } assert sys_platform in os_strings, sys_platform wheel_filename = ( f"ray-{ray_version}-cp{py_version}-" f"cp{py_version}{'m' if py_version in ['36', '37'] else ''}" f"-{os_strings[sys_platform]}.whl" ) return wheel_filename def get_master_wheel_url( ray_commit: str = ray.__commit__, sys_platform: str = sys.platform, ray_version: str = ray.__version__, py_version: str = f"{sys.version_info.major}{sys.version_info.minor}", ) -> str: """Return the URL for the wheel from a specific commit.""" filename = get_wheel_filename( sys_platform=sys_platform, ray_version=ray_version, py_version=py_version ) return ( f"https://s3-us-west-2.amazonaws.com/ray-wheels/master/" f"{ray_commit}/{filename}" ) def get_release_wheel_url( ray_commit: str = ray.__commit__, sys_platform: str = sys.platform, ray_version: str = ray.__version__, py_version: str = f"{sys.version_info.major}{sys.version_info.minor}", ) -> str: """Return the URL for the wheel for a specific release.""" filename = get_wheel_filename( sys_platform=sys_platform, ray_version=ray_version, py_version=py_version ) return ( f"https://ray-wheels.s3-us-west-2.amazonaws.com/releases/" f"{ray_version}/{ray_commit}/{filename}" ) # e.g. https://ray-wheels.s3-us-west-2.amazonaws.com/releases/1.4.0rc1/e7c7 # f6371a69eb727fa469e4cd6f4fbefd143b4c/ray-1.4.0rc1-cp36-cp36m-manylinux201 # 4_x86_64.whl def validate_namespace(namespace: str): if not isinstance(namespace, str): raise TypeError("namespace must be None or a string.") elif namespace == "": raise ValueError( '"" is not a valid namespace. ' "Pass None to not specify a namespace." ) def init_grpc_channel( address: str, options: Optional[Sequence[Tuple[str, Any]]] = None, asynchronous: bool = False, ): grpc_module = aiogrpc if asynchronous else grpc if os.environ.get("RAY_USE_TLS", "0").lower() in ("1", "true"): server_cert_chain, private_key, ca_cert = load_certs_from_env() credentials = grpc.ssl_channel_credentials( certificate_chain=server_cert_chain, private_key=private_key, root_certificates=ca_cert, ) channel = grpc_module.secure_channel(address, credentials, options=options) else: channel = grpc_module.insecure_channel(address, options=options) return channel def check_dashboard_dependencies_installed() -> bool: """Returns True if Ray Dashboard dependencies are installed. Checks to see if we should start the dashboard agent or not based on the Ray installation version the user has installed (ray vs. ray[default]). Unfortunately there doesn't seem to be a cleaner way to detect this other than just blindly importing the relevant packages. """ try: import ray.dashboard.optional_deps # noqa: F401 return True except ImportError: return False def internal_kv_list_with_retry(gcs_client, prefix, namespace, num_retries=20): result = None if isinstance(prefix, str): prefix = prefix.encode() if isinstance(namespace, str): namespace = namespace.encode() for _ in range(num_retries): try: result = gcs_client.internal_kv_keys(prefix, namespace) except Exception as e: if isinstance(e, grpc.RpcError) and e.code() in ( grpc.StatusCode.UNAVAILABLE, grpc.StatusCode.UNKNOWN, ): logger.warning( f"Unable to connect to GCS at {gcs_client.address}. " "Check that (1) Ray GCS with matching version started " "successfully at the specified address, and (2) there is " "no firewall setting preventing access." ) else: logger.exception("Internal KV List failed") result = None if result is not None: break else: logger.debug(f"Fetched {prefix}=None from KV. Retrying.") time.sleep(2) if result is None: raise RuntimeError( f"Could not list '{prefix}' from GCS. Did GCS start successfully?" ) return result def internal_kv_get_with_retry(gcs_client, key, namespace, num_retries=20): result = None if isinstance(key, str): key = key.encode() for _ in range(num_retries): try: result = gcs_client.internal_kv_get(key, namespace) except Exception as e: if isinstance(e, grpc.RpcError) and e.code() in ( grpc.StatusCode.UNAVAILABLE, grpc.StatusCode.UNKNOWN, ): logger.warning( f"Unable to connect to GCS at {gcs_client.address}. " "Check that (1) Ray GCS with matching version started " "successfully at the specified address, and (2) there is " "no firewall setting preventing access." ) else: logger.exception("Internal KV Get failed") result = None if result is not None: break else: logger.debug(f"Fetched {key}=None from KV. Retrying.") time.sleep(2) if not result: raise RuntimeError( f"Could not read '{key.decode()}' from GCS. Did GCS start successfully?" ) return result def internal_kv_put_with_retry(gcs_client, key, value, namespace, num_retries=20): if isinstance(key, str): key = key.encode() if isinstance(value, str): value = value.encode() if isinstance(namespace, str): namespace = namespace.encode() error = None for _ in range(num_retries): try: return gcs_client.internal_kv_put( key, value, overwrite=True, namespace=namespace ) except grpc.RpcError as e: if e.code() in ( grpc.StatusCode.UNAVAILABLE, grpc.StatusCode.UNKNOWN, ): logger.warning( f"Unable to connect to GCS at {gcs_client.address}. " "Check that (1) Ray GCS with matching version started " "successfully at the specified address, and (2) there is " "no firewall setting preventing access." ) else: logger.exception("Internal KV Put failed") time.sleep(2) error = e # Reraise the last grpc.RpcError. raise error def compute_version_info(): """Compute the versions of Python, and Ray. Returns: A tuple containing the version information. """ ray_version = ray.__version__ python_version = ".".join(map(str, sys.version_info[:3])) return ray_version, python_version def get_directory_size_bytes(path: Union[str, Path] = ".") -> int: """Get the total size of a directory in bytes, including subdirectories.""" total_size_bytes = 0 for dirpath, dirnames, filenames in os.walk(path): for f in filenames: fp = os.path.join(dirpath, f) # skip if it is a symbolic link or a .pyc file if not os.path.islink(fp) and not f.endswith(".pyc"): total_size_bytes += os.path.getsize(fp) return total_size_bytes def check_version_info(cluster_metadata): """Check if the Python and Ray versions stored in GCS matches this process. Args: cluster_metadata: Ray cluster metadata from GCS. Raises: Exception: An exception is raised if there is a version mismatch. """ cluster_version_info = ( cluster_metadata["ray_version"], cluster_metadata["python_version"], ) version_info = compute_version_info() if version_info != cluster_version_info: node_ip_address = ray._private.services.get_node_ip_address() error_message = ( "Version mismatch: The cluster was started with:\n" " Ray: " + cluster_version_info[0] + "\n" " Python: " + cluster_version_info[1] + "\n" "This process on node " + node_ip_address + " was started with:" + "\n" " Ray: " + version_info[0] + "\n" " Python: " + version_info[1] + "\n" ) raise RuntimeError(error_message)
35.518491
136
0.640616
import binascii import errno import functools import hashlib import importlib import logging import multiprocessing import os import signal import subprocess import sys import tempfile import threading import time from typing import Optional, Sequence, Tuple, Any, Union, Dict import uuid import grpc import warnings try: from grpc import aio as aiogrpc except ImportError: from grpc.experimental import aio as aiogrpc import inspect from inspect import signature from pathlib import Path import numpy as np import ray from ray.core.generated.gcs_pb2 import ErrorTableData import ray.ray_constants as ray_constants from ray._private.tls_utils import load_certs_from_env import psutil pwd = None if sys.platform != "win32": import pwd logger = logging.getLogger(__name__) # prctl support is detected dynamically once, and assumed thereafter. linux_prctl = None # Windows can bind processes' lifetimes to that of kernel-level "job objects". win32_job = None win32_AssignProcessToJobObject = None def get_user_temp_dir(): if "RAY_TMPDIR" in os.environ: return os.environ["RAY_TMPDIR"] elif sys.platform.startswith("linux") and "TMPDIR" in os.environ: return os.environ["TMPDIR"] elif sys.platform.startswith("darwin") or sys.platform.startswith("linux"): # for compatibility tempdir = os.path.join(os.sep, "tmp") else: tempdir = tempfile.gettempdir() return tempdir def get_ray_temp_dir(): return os.path.join(get_user_temp_dir(), "ray") def _random_string(): id_hash = hashlib.shake_128() id_hash.update(uuid.uuid4().bytes) id_bytes = id_hash.digest(ray_constants.ID_SIZE) assert len(id_bytes) == ray_constants.ID_SIZE return id_bytes def format_error_message(exception_message: str, task_exception: bool = False): lines = exception_message.split("\n") if task_exception: # For errors that occur inside of tasks, remove lines 1 and 2 which are # always the same, they just contain information about the worker code. lines = lines[0:1] + lines[3:] pass return "\n".join(lines) def push_error_to_driver( worker, error_type: str, message: str, job_id: Optional[str] = None ): if job_id is None: job_id = ray.JobID.nil() assert isinstance(job_id, ray.JobID) worker.core_worker.push_error(job_id, error_type, message, time.time()) def construct_error_message(job_id, error_type, message, timestamp): data = ErrorTableData() data.job_id = job_id.binary() data.type = error_type data.error_message = message data.timestamp = timestamp return data def publish_error_to_driver( error_type: str, message: str, gcs_publisher, job_id=None, ): if job_id is None: job_id = ray.JobID.nil() assert isinstance(job_id, ray.JobID) error_data = construct_error_message(job_id, error_type, message, time.time()) try: gcs_publisher.publish_error(job_id.hex().encode(), error_data) except Exception: logger.exception(f"Failed to publish error {error_data}") def random_string(): # Get the state of the numpy random number generator. numpy_state = np.random.get_state() # Try to use true randomness. np.random.seed(None) # Generate the random ID. random_id = np.random.bytes(ray_constants.ID_SIZE) # Reset the state of the numpy random number generator. np.random.set_state(numpy_state) return random_id def decode(byte_str: str, allow_none: bool = False, encode_type: str = "utf-8"): if byte_str is None and allow_none: return "" if not isinstance(byte_str, bytes): raise ValueError(f"The argument {byte_str} must be a bytes object.") if sys.version_info >= (3, 0): return byte_str.decode(encode_type) else: return byte_str def ensure_str(s, encoding="utf-8", errors="strict"): if isinstance(s, str): return s else: assert isinstance(s, bytes) return s.decode(encoding, errors) def binary_to_object_ref(binary_object_ref): return ray.ObjectRef(binary_object_ref) def binary_to_task_id(binary_task_id): return ray.TaskID(binary_task_id) def binary_to_hex(identifier): hex_identifier = binascii.hexlify(identifier) if sys.version_info >= (3, 0): hex_identifier = hex_identifier.decode() return hex_identifier def hex_to_binary(hex_identifier): return binascii.unhexlify(hex_identifier) # TODO(qwang): Remove these hepler functions # once we separate `WorkerID` from `UniqueID`. def compute_job_id_from_driver(driver_id): assert isinstance(driver_id, ray.WorkerID) return ray.JobID(driver_id.binary()[0 : ray.JobID.size()]) def compute_driver_id_from_job(job_id): assert isinstance(job_id, ray.JobID) rest_length = ray_constants.ID_SIZE - job_id.size() driver_id_str = job_id.binary() + (rest_length * b"\xff") return ray.WorkerID(driver_id_str) def get_cuda_visible_devices(): gpu_ids_str = os.environ.get("CUDA_VISIBLE_DEVICES", None) if gpu_ids_str is None: return None if gpu_ids_str == "": return [] if gpu_ids_str == "NoDevFiles": return [] # GPU identifiers are given as strings representing integers or UUIDs. return list(gpu_ids_str.split(",")) last_set_gpu_ids = None def set_cuda_visible_devices(gpu_ids): if os.environ.get(ray_constants.NOSET_CUDA_VISIBLE_DEVICES_ENV_VAR): return global last_set_gpu_ids if last_set_gpu_ids == gpu_ids: return # optimization: already set os.environ["CUDA_VISIBLE_DEVICES"] = ",".join([str(i) for i in gpu_ids]) last_set_gpu_ids = gpu_ids def resources_from_ray_options(options_dict: Dict[str, Any]) -> Dict[str, Any]: resources = (options_dict.get("resources") or {}).copy() if "CPU" in resources or "GPU" in resources: raise ValueError( "The resources dictionary must not contain the key 'CPU' or 'GPU'" ) elif "memory" in resources or "object_store_memory" in resources: raise ValueError( "The resources dictionary must not " "contain the key 'memory' or 'object_store_memory'" ) num_cpus = options_dict.get("num_cpus") num_gpus = options_dict.get("num_gpus") memory = options_dict.get("memory") object_store_memory = options_dict.get("object_store_memory") accelerator_type = options_dict.get("accelerator_type") if num_cpus is not None: resources["CPU"] = num_cpus if num_gpus is not None: resources["GPU"] = num_gpus if memory is not None: resources["memory"] = ray_constants.to_memory_units(memory, round_up=True) if object_store_memory is not None: resources["object_store_memory"] = ray_constants.to_memory_units( object_store_memory, round_up=True ) if accelerator_type is not None: resources[ f"{ray_constants.RESOURCE_CONSTRAINT_PREFIX}{accelerator_type}" ] = 0.001 return resources class Unbuffered(object): def __init__(self, stream): self.stream = stream def write(self, data): self.stream.write(data) self.stream.flush() def writelines(self, datas): self.stream.writelines(datas) self.stream.flush() def __getattr__(self, attr): return getattr(self.stream, attr) def open_log(path, unbuffered=False, **kwargs): # Disable buffering, see test_advanced_3.py::test_logging_to_driver kwargs.setdefault("buffering", 1) kwargs.setdefault("mode", "a") kwargs.setdefault("encoding", "utf-8") stream = open(path, **kwargs) if unbuffered: return Unbuffered(stream) else: return stream def get_system_memory( # For cgroups v1: memory_limit_filename="/sys/fs/cgroup/memory/memory.limit_in_bytes", # For cgroups v2: memory_limit_filename_v2="/sys/fs/cgroup/memory.max", ): # Try to accurately figure out the memory limit if we are in a docker # container. Note that this file is not specific to Docker and its value is # often much larger than the actual amount of memory. docker_limit = None if os.path.exists(memory_limit_filename): with open(memory_limit_filename, "r") as f: docker_limit = int(f.read()) elif os.path.exists(memory_limit_filename_v2): with open(memory_limit_filename_v2, "r") as f: max_file = f.read() if max_file.isnumeric(): docker_limit = int(max_file) else: # max_file is "max", i.e. is unset. docker_limit = None # Use psutil if it is available. psutil_memory_in_bytes = psutil.virtual_memory().total if docker_limit is not None: # We take the min because the cgroup limit is very large if we aren't return min(docker_limit, psutil_memory_in_bytes) return psutil_memory_in_bytes def _get_docker_cpus( cpu_quota_file_name="/sys/fs/cgroup/cpu/cpu.cfs_quota_us", cpu_period_file_name="/sys/fs/cgroup/cpu/cpu.cfs_period_us", cpuset_file_name="/sys/fs/cgroup/cpuset/cpuset.cpus", cpu_max_file_name="/sys/fs/cgroup/cpu.max", ) -> Optional[float]: # Docker has 2 underyling ways of implementing CPU limits: # https://docs.docker.com/config/containers/resource_constraints/#configure-the-default-cfs-scheduler # 1. --cpuset-cpus 2. --cpus or --cpu-quota/--cpu-period (--cpu-shares is a # soft limit so we don't worry about it). For Ray's purposes, if we use # docker, the number of vCPUs on a machine is whichever is set (ties broken # by smaller value). cpu_quota = None # See: https://bugs.openjdk.java.net/browse/JDK-8146115 if os.path.exists(cpu_quota_file_name) and os.path.exists(cpu_period_file_name): try: with open(cpu_quota_file_name, "r") as quota_file, open( cpu_period_file_name, "r" ) as period_file: cpu_quota = float(quota_file.read()) / float(period_file.read()) except Exception: logger.exception("Unexpected error calculating docker cpu quota.") # Look at cpu.max for cgroups v2 elif os.path.exists(cpu_max_file_name): try: max_file = open(cpu_max_file_name).read() quota_str, period_str = max_file.split() if quota_str.isnumeric() and period_str.isnumeric(): cpu_quota = float(quota_str) / float(period_str) else: # quota_str is "max" meaning the cpu quota is unset cpu_quota = None except Exception: logger.exception("Unexpected error calculating docker cpu quota.") if (cpu_quota is not None) and (cpu_quota < 0): cpu_quota = None elif cpu_quota == 0: # Round up in case the cpu limit is less than 1. cpu_quota = 1 cpuset_num = None if os.path.exists(cpuset_file_name): try: with open(cpuset_file_name) as cpuset_file: ranges_as_string = cpuset_file.read() ranges = ranges_as_string.split(",") cpu_ids = [] for num_or_range in ranges: if "-" in num_or_range: start, end = num_or_range.split("-") cpu_ids.extend(list(range(int(start), int(end) + 1))) else: cpu_ids.append(int(num_or_range)) cpuset_num = len(cpu_ids) except Exception: logger.exception("Unexpected error calculating docker cpuset ids.") # Possible to-do: Parse cgroups v2's cpuset.cpus.effective for the number if cpu_quota and cpuset_num: return min(cpu_quota, cpuset_num) return cpu_quota or cpuset_num def get_num_cpus() -> int: cpu_count = multiprocessing.cpu_count() if os.environ.get("RAY_USE_MULTIPROCESSING_CPU_COUNT"): logger.info( "Detected RAY_USE_MULTIPROCESSING_CPU_COUNT=1: Using " "multiprocessing.cpu_count() to detect the number of CPUs. " "This may be inconsistent when used inside docker. " "To correctly detect CPUs, unset the env var: " "`RAY_USE_MULTIPROCESSING_CPU_COUNT`." ) return cpu_count try: docker_count = _get_docker_cpus() if docker_count is not None and docker_count != cpu_count: if ( "RAY_DISABLE_DOCKER_CPU_WARNING" not in os.environ and "KUBERNETES_SERVICE_HOST" not in os.environ ): logger.warning( "Detecting docker specified CPUs. In " "previous versions of Ray, CPU detection in containers " "was incorrect. Please ensure that Ray has enough CPUs " "allocated. As a temporary workaround to revert to the " "prior behavior, set " "`RAY_USE_MULTIPROCESSING_CPU_COUNT=1` as an env var " "before starting Ray. Set the env var: " "`RAY_DISABLE_DOCKER_CPU_WARNING=1` to mute this warning." ) if int(docker_count) != float(docker_count): logger.warning( f"Ray currently does not support initializing Ray" f"with fractional cpus. Your num_cpus will be " f"truncated from {docker_count} to " f"{int(docker_count)}." ) docker_count = int(docker_count) cpu_count = docker_count except Exception: pass return cpu_count def get_used_memory(): docker_usage = None memory_usage_filename = "/sys/fs/cgroup/memory/memory.usage_in_bytes" memory_usage_filename_v2 = "/sys/fs/cgroup/memory.current" if os.path.exists(memory_usage_filename): with open(memory_usage_filename, "r") as f: docker_usage = int(f.read()) elif os.path.exists(memory_usage_filename_v2): with open(memory_usage_filename_v2, "r") as f: docker_usage = int(f.read()) psutil_memory_in_bytes = psutil.virtual_memory().used if docker_usage is not None: # in Docker. return min(docker_usage, psutil_memory_in_bytes) return psutil_memory_in_bytes def estimate_available_memory(): return get_system_memory() - get_used_memory() def get_shared_memory_bytes(): # Make sure this is only called on Linux. assert sys.platform == "linux" or sys.platform == "linux2" shm_fd = os.open("/dev/shm", os.O_RDONLY) try: shm_fs_stats = os.fstatvfs(shm_fd) # The value shm_fs_stats.f_bsize is the block size and the # value shm_fs_stats.f_bavail is the number of available # blocks. shm_avail = shm_fs_stats.f_bsize * shm_fs_stats.f_bavail finally: os.close(shm_fd) return shm_avail def check_oversized_function( pickled: bytes, name: str, obj_type: str, worker: "ray.Worker" ) -> None: length = len(pickled) if length <= ray_constants.FUNCTION_SIZE_WARN_THRESHOLD: return elif length < ray_constants.FUNCTION_SIZE_ERROR_THRESHOLD: warning_message = ( "The {} {} is very large ({} MiB). " "Check that its definition is not implicitly capturing a large " "array or other object in scope. Tip: use ray.put() to put large " "objects in the Ray object store." ).format(obj_type, name, length // (1024 * 1024)) if worker: push_error_to_driver( worker, ray_constants.PICKLING_LARGE_OBJECT_PUSH_ERROR, "Warning: " + warning_message, job_id=worker.current_job_id, ) else: error = ( "The {} {} is too large ({} MiB > FUNCTION_SIZE_ERROR_THRESHOLD={}" " MiB). Check that its definition is not implicitly capturing a " "large array or other object in scope. Tip: use ray.put() to " "put large objects in the Ray object store." ).format( obj_type, name, length // (1024 * 1024), ray_constants.FUNCTION_SIZE_ERROR_THRESHOLD // (1024 * 1024), ) raise ValueError(error) def is_main_thread(): return threading.current_thread().getName() == "MainThread" def detect_fate_sharing_support_win32(): global win32_job, win32_AssignProcessToJobObject if win32_job is None and sys.platform == "win32": import ctypes try: from ctypes.wintypes import BOOL, DWORD, HANDLE, LPVOID, LPCWSTR kernel32 = ctypes.WinDLL("kernel32") kernel32.CreateJobObjectW.argtypes = (LPVOID, LPCWSTR) kernel32.CreateJobObjectW.restype = HANDLE sijo_argtypes = (HANDLE, ctypes.c_int, LPVOID, DWORD) kernel32.SetInformationJobObject.argtypes = sijo_argtypes kernel32.SetInformationJobObject.restype = BOOL kernel32.AssignProcessToJobObject.argtypes = (HANDLE, HANDLE) kernel32.AssignProcessToJobObject.restype = BOOL kernel32.IsDebuggerPresent.argtypes = () kernel32.IsDebuggerPresent.restype = BOOL except (AttributeError, TypeError, ImportError): kernel32 = None job = kernel32.CreateJobObjectW(None, None) if kernel32 else None job = subprocess.Handle(job) if job else job if job: from ctypes.wintypes import DWORD, LARGE_INTEGER, ULARGE_INTEGER class JOBOBJECT_BASIC_LIMIT_INFORMATION(ctypes.Structure): _fields_ = [ ("PerProcessUserTimeLimit", LARGE_INTEGER), ("PerJobUserTimeLimit", LARGE_INTEGER), ("LimitFlags", DWORD), ("MinimumWorkingSetSize", ctypes.c_size_t), ("MaximumWorkingSetSize", ctypes.c_size_t), ("ActiveProcessLimit", DWORD), ("Affinity", ctypes.c_size_t), ("PriorityClass", DWORD), ("SchedulingClass", DWORD), ] class IO_COUNTERS(ctypes.Structure): _fields_ = [ ("ReadOperationCount", ULARGE_INTEGER), ("WriteOperationCount", ULARGE_INTEGER), ("OtherOperationCount", ULARGE_INTEGER), ("ReadTransferCount", ULARGE_INTEGER), ("WriteTransferCount", ULARGE_INTEGER), ("OtherTransferCount", ULARGE_INTEGER), ] class JOBOBJECT_EXTENDED_LIMIT_INFORMATION(ctypes.Structure): _fields_ = [ ("BasicLimitInformation", JOBOBJECT_BASIC_LIMIT_INFORMATION), ("IoInfo", IO_COUNTERS), ("ProcessMemoryLimit", ctypes.c_size_t), ("JobMemoryLimit", ctypes.c_size_t), ("PeakProcessMemoryUsed", ctypes.c_size_t), ("PeakJobMemoryUsed", ctypes.c_size_t), ] debug = kernel32.IsDebuggerPresent() # Defined in <WinNT.h>; also available here: # https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/nf-jobapi2-setinformationjobobject JobObjectExtendedLimitInformation = 9 JOB_OBJECT_LIMIT_BREAKAWAY_OK = 0x00000800 JOB_OBJECT_LIMIT_DIE_ON_UNHANDLED_EXCEPTION = 0x00000400 JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE = 0x00002000 buf = JOBOBJECT_EXTENDED_LIMIT_INFORMATION() buf.BasicLimitInformation.LimitFlags = ( (0 if debug else JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE) | JOB_OBJECT_LIMIT_DIE_ON_UNHANDLED_EXCEPTION | JOB_OBJECT_LIMIT_BREAKAWAY_OK ) infoclass = JobObjectExtendedLimitInformation if not kernel32.SetInformationJobObject( job, infoclass, ctypes.byref(buf), ctypes.sizeof(buf) ): job = None win32_AssignProcessToJobObject = ( kernel32.AssignProcessToJobObject if kernel32 is not None else False ) win32_job = job if job else False return bool(win32_job) def detect_fate_sharing_support_linux(): global linux_prctl if linux_prctl is None and sys.platform.startswith("linux"): try: from ctypes import c_int, c_ulong, CDLL prctl = CDLL(None).prctl prctl.restype = c_int prctl.argtypes = [c_int, c_ulong, c_ulong, c_ulong, c_ulong] except (AttributeError, TypeError): prctl = None linux_prctl = prctl if prctl else False return bool(linux_prctl) def detect_fate_sharing_support(): result = None if sys.platform == "win32": result = detect_fate_sharing_support_win32() elif sys.platform.startswith("linux"): result = detect_fate_sharing_support_linux() return result def set_kill_on_parent_death_linux(): if detect_fate_sharing_support_linux(): import signal PR_SET_PDEATHSIG = 1 if linux_prctl(PR_SET_PDEATHSIG, signal.SIGKILL, 0, 0, 0) != 0: import ctypes raise OSError(ctypes.get_errno(), "prctl(PR_SET_PDEATHSIG) failed") else: assert False, "PR_SET_PDEATHSIG used despite being unavailable" def set_kill_child_on_death_win32(child_proc): if isinstance(child_proc, subprocess.Popen): child_proc = child_proc._handle assert isinstance(child_proc, subprocess.Handle) if detect_fate_sharing_support_win32(): if not win32_AssignProcessToJobObject(win32_job, int(child_proc)): import ctypes raise OSError(ctypes.get_last_error(), "AssignProcessToJobObject() failed") else: assert False, "AssignProcessToJobObject used despite being unavailable" def set_sigterm_handler(sigterm_handler): if sys.platform == "win32": # Note that these signal handlers only work for console applications. # TODO(mehrdadn): implement graceful process termination mechanism # SIGINT is Ctrl+C, SIGBREAK is Ctrl+Break. signal.signal(signal.SIGBREAK, sigterm_handler) else: signal.signal(signal.SIGTERM, sigterm_handler) def try_make_directory_shared(directory_path): try: os.chmod(directory_path, 0o0777) except OSError as e: # Silently suppress the PermissionError that is thrown by the chmod. # This is done because the user attempting to change the permissions # on a directory may not own it. The chmod is attempted whether the # directory is new or not to avoid race conditions. # ray-project/ray/#3591 if e.errno in [errno.EACCES, errno.EPERM]: pass else: raise def try_to_create_directory(directory_path): directory_path = os.path.expanduser(directory_path) os.makedirs(directory_path, exist_ok=True) # Change the log directory permissions so others can use it. This is # important when multiple people are using the same machine. try_make_directory_shared(directory_path) def try_to_symlink(symlink_path, target_path): symlink_path = os.path.expanduser(symlink_path) target_path = os.path.expanduser(target_path) if os.path.exists(symlink_path): if os.path.islink(symlink_path): # Try to remove existing symlink. try: os.remove(symlink_path) except OSError: return else: # There's an existing non-symlink file, don't overwrite it. return try: os.symlink(target_path, symlink_path) except OSError: return def get_user(): if pwd is None: return "" try: return pwd.getpwuid(os.getuid()).pw_name except Exception: return "" def get_function_args(callable): all_parameters = frozenset(signature(callable).parameters) return list(all_parameters) def get_conda_bin_executable(executable_name): # Use CONDA_EXE as per https://github.com/conda/conda/issues/7126 if "CONDA_EXE" in os.environ: conda_bin_dir = os.path.dirname(os.environ["CONDA_EXE"]) return os.path.join(conda_bin_dir, executable_name) return executable_name def get_conda_env_dir(env_name): conda_prefix = os.environ.get("CONDA_PREFIX") if conda_prefix is None: # The caller is neither in a conda env or in (base) env. This is rare # because by default, new terminals start in (base), but we can still # support this case. conda_exe = os.environ.get("CONDA_EXE") if conda_exe is None: raise ValueError( "Cannot find environment variables set by conda. " "Please verify conda is installed." ) # Example: CONDA_EXE=$HOME/anaconda3/bin/python # Strip out /bin/python by going up two parent directories. conda_prefix = str(Path(conda_exe).parent.parent) # There are two cases: # 1. We are in a conda (base) env: CONDA_DEFAULT_ENV=base and # CONDA_PREFIX=$HOME/anaconda3 # 2. We are in a user-created conda env: CONDA_DEFAULT_ENV=$env_name and # CONDA_PREFIX=$HOME/anaconda3/envs/$current_env_name if os.environ.get("CONDA_DEFAULT_ENV") == "base": # Caller's curent environment is (base). if env_name == "base": env_dir = conda_prefix else: env_dir = os.path.join(conda_prefix, "envs", env_name) else: conda_envs_dir = os.path.split(conda_prefix)[0] env_dir = os.path.join(conda_envs_dir, env_name) if not os.path.isdir(env_dir): raise ValueError( "conda env " + env_name + " not found in conda envs directory. Run `conda env list` to " + "verify the name is correct." ) return env_dir def get_call_location(back: int = 1): stack = inspect.stack() try: frame = stack[back + 1] return f"{frame.filename}:{frame.lineno}" except IndexError: return "UNKNOWN" _PRINTED_WARNING = set() # The following is inspired by # https://github.com/tensorflow/tensorflow/blob/dec8e0b11f4f87693b67e125e67dfbc68d26c205/tensorflow/python/util/deprecation.py#L274-L329 def deprecated( instructions: Optional[str] = None, removal_release: Optional[str] = None, removal_date: Optional[str] = None, warn_once: bool = True, ): if removal_release is not None and removal_date is not None: raise ValueError( "Only one of removal_release and removal_date should be specified." ) def deprecated_wrapper(func): @functools.wraps(func) def new_func(*args, **kwargs): global _PRINTED_WARNING if func not in _PRINTED_WARNING: if warn_once: _PRINTED_WARNING.add(func) msg = ( "From {}: {} (from {}) is deprecated and will ".format( get_call_location(), func.__name__, func.__module__ ) + "be removed " + ( f"in version {removal_release}." if removal_release is not None else f"after {removal_date}" if removal_date is not None else "in a future version" ) + (f" {instructions}" if instructions is not None else "") ) warnings.warn(msg) return func(*args, **kwargs) return new_func return deprecated_wrapper def import_attr(full_path: str): if full_path is None: raise TypeError("import path cannot be None") if ":" in full_path: if full_path.count(":") > 1: raise ValueError( f'Got invalid import path "{full_path}". An ' "import path may have at most one colon." ) module_name, attr_name = full_path.split(":") else: last_period_idx = full_path.rfind(".") module_name = full_path[:last_period_idx] attr_name = full_path[last_period_idx + 1 :] module = importlib.import_module(module_name) return getattr(module, attr_name) def get_wheel_filename( sys_platform: str = sys.platform, ray_version: str = ray.__version__, py_version: str = f"{sys.version_info.major}{sys.version_info.minor}", ) -> str: assert py_version in ["36", "37", "38", "39"], py_version os_strings = { "darwin": "macosx_10_15_x86_64" if py_version in ["38", "39"] else "macosx_10_15_intel", "linux": "manylinux2014_x86_64", "win32": "win_amd64", } assert sys_platform in os_strings, sys_platform wheel_filename = ( f"ray-{ray_version}-cp{py_version}-" f"cp{py_version}{'m' if py_version in ['36', '37'] else ''}" f"-{os_strings[sys_platform]}.whl" ) return wheel_filename def get_master_wheel_url( ray_commit: str = ray.__commit__, sys_platform: str = sys.platform, ray_version: str = ray.__version__, py_version: str = f"{sys.version_info.major}{sys.version_info.minor}", ) -> str: filename = get_wheel_filename( sys_platform=sys_platform, ray_version=ray_version, py_version=py_version ) return ( f"https://s3-us-west-2.amazonaws.com/ray-wheels/master/" f"{ray_commit}/{filename}" ) def get_release_wheel_url( ray_commit: str = ray.__commit__, sys_platform: str = sys.platform, ray_version: str = ray.__version__, py_version: str = f"{sys.version_info.major}{sys.version_info.minor}", ) -> str: filename = get_wheel_filename( sys_platform=sys_platform, ray_version=ray_version, py_version=py_version ) return ( f"https://ray-wheels.s3-us-west-2.amazonaws.com/releases/" f"{ray_version}/{ray_commit}/{filename}" ) # e.g. https://ray-wheels.s3-us-west-2.amazonaws.com/releases/1.4.0rc1/e7c7 # f6371a69eb727fa469e4cd6f4fbefd143b4c/ray-1.4.0rc1-cp36-cp36m-manylinux201 # 4_x86_64.whl def validate_namespace(namespace: str): if not isinstance(namespace, str): raise TypeError("namespace must be None or a string.") elif namespace == "": raise ValueError( '"" is not a valid namespace. ' "Pass None to not specify a namespace." ) def init_grpc_channel( address: str, options: Optional[Sequence[Tuple[str, Any]]] = None, asynchronous: bool = False, ): grpc_module = aiogrpc if asynchronous else grpc if os.environ.get("RAY_USE_TLS", "0").lower() in ("1", "true"): server_cert_chain, private_key, ca_cert = load_certs_from_env() credentials = grpc.ssl_channel_credentials( certificate_chain=server_cert_chain, private_key=private_key, root_certificates=ca_cert, ) channel = grpc_module.secure_channel(address, credentials, options=options) else: channel = grpc_module.insecure_channel(address, options=options) return channel def check_dashboard_dependencies_installed() -> bool: try: import ray.dashboard.optional_deps # noqa: F401 return True except ImportError: return False def internal_kv_list_with_retry(gcs_client, prefix, namespace, num_retries=20): result = None if isinstance(prefix, str): prefix = prefix.encode() if isinstance(namespace, str): namespace = namespace.encode() for _ in range(num_retries): try: result = gcs_client.internal_kv_keys(prefix, namespace) except Exception as e: if isinstance(e, grpc.RpcError) and e.code() in ( grpc.StatusCode.UNAVAILABLE, grpc.StatusCode.UNKNOWN, ): logger.warning( f"Unable to connect to GCS at {gcs_client.address}. " "Check that (1) Ray GCS with matching version started " "successfully at the specified address, and (2) there is " "no firewall setting preventing access." ) else: logger.exception("Internal KV List failed") result = None if result is not None: break else: logger.debug(f"Fetched {prefix}=None from KV. Retrying.") time.sleep(2) if result is None: raise RuntimeError( f"Could not list '{prefix}' from GCS. Did GCS start successfully?" ) return result def internal_kv_get_with_retry(gcs_client, key, namespace, num_retries=20): result = None if isinstance(key, str): key = key.encode() for _ in range(num_retries): try: result = gcs_client.internal_kv_get(key, namespace) except Exception as e: if isinstance(e, grpc.RpcError) and e.code() in ( grpc.StatusCode.UNAVAILABLE, grpc.StatusCode.UNKNOWN, ): logger.warning( f"Unable to connect to GCS at {gcs_client.address}. " "Check that (1) Ray GCS with matching version started " "successfully at the specified address, and (2) there is " "no firewall setting preventing access." ) else: logger.exception("Internal KV Get failed") result = None if result is not None: break else: logger.debug(f"Fetched {key}=None from KV. Retrying.") time.sleep(2) if not result: raise RuntimeError( f"Could not read '{key.decode()}' from GCS. Did GCS start successfully?" ) return result def internal_kv_put_with_retry(gcs_client, key, value, namespace, num_retries=20): if isinstance(key, str): key = key.encode() if isinstance(value, str): value = value.encode() if isinstance(namespace, str): namespace = namespace.encode() error = None for _ in range(num_retries): try: return gcs_client.internal_kv_put( key, value, overwrite=True, namespace=namespace ) except grpc.RpcError as e: if e.code() in ( grpc.StatusCode.UNAVAILABLE, grpc.StatusCode.UNKNOWN, ): logger.warning( f"Unable to connect to GCS at {gcs_client.address}. " "Check that (1) Ray GCS with matching version started " "successfully at the specified address, and (2) there is " "no firewall setting preventing access." ) else: logger.exception("Internal KV Put failed") time.sleep(2) error = e # Reraise the last grpc.RpcError. raise error def compute_version_info(): ray_version = ray.__version__ python_version = ".".join(map(str, sys.version_info[:3])) return ray_version, python_version def get_directory_size_bytes(path: Union[str, Path] = ".") -> int: total_size_bytes = 0 for dirpath, dirnames, filenames in os.walk(path): for f in filenames: fp = os.path.join(dirpath, f) # skip if it is a symbolic link or a .pyc file if not os.path.islink(fp) and not f.endswith(".pyc"): total_size_bytes += os.path.getsize(fp) return total_size_bytes def check_version_info(cluster_metadata): cluster_version_info = ( cluster_metadata["ray_version"], cluster_metadata["python_version"], ) version_info = compute_version_info() if version_info != cluster_version_info: node_ip_address = ray._private.services.get_node_ip_address() error_message = ( "Version mismatch: The cluster was started with:\n" " Ray: " + cluster_version_info[0] + "\n" " Python: " + cluster_version_info[1] + "\n" "This process on node " + node_ip_address + " was started with:" + "\n" " Ray: " + version_info[0] + "\n" " Python: " + version_info[1] + "\n" ) raise RuntimeError(error_message)
true
true
f71e3ee179bc25f0ee46fadb17b0041bb26da0fb
10,260
py
Python
tests/components/homematicip_cloud/test_switch.py
pcaston/core
e74d946cef7a9d4e232ae9e0ba150d18018cfe33
[ "Apache-2.0" ]
1
2021-07-08T20:09:55.000Z
2021-07-08T20:09:55.000Z
tests/components/homematicip_cloud/test_switch.py
pcaston/core
e74d946cef7a9d4e232ae9e0ba150d18018cfe33
[ "Apache-2.0" ]
47
2021-02-21T23:43:07.000Z
2022-03-31T06:07:10.000Z
tests/components/homematicip_cloud/test_switch.py
OpenPeerPower/core
f673dfac9f2d0c48fa30af37b0a99df9dd6640ee
[ "Apache-2.0" ]
null
null
null
"""Tests for HomematicIP Cloud switch.""" from openpeerpower.components.homematicip_cloud import DOMAIN as HMIPC_DOMAIN from openpeerpower.components.homematicip_cloud.generic_entity import ( ATTR_GROUP_MEMBER_UNREACHABLE, ) from openpeerpower.components.switch import ( ATTR_CURRENT_POWER_W, ATTR_TODAY_ENERGY_KWH, DOMAIN as SWITCH_DOMAIN, ) from openpeerpower.const import STATE_OFF, STATE_ON from openpeerpower.setup import async_setup_component from .helper import async_manipulate_test_data, get_and_check_entity_basics async def test_manually_configured_platform(opp): """Test that we do not set up an access point.""" assert await async_setup_component( opp, SWITCH_DOMAIN, {SWITCH_DOMAIN: {"platform": HMIPC_DOMAIN}} ) assert not opp.data.get(HMIPC_DOMAIN) async def test_hmip_switch(opp, default_mock_hap_factory): """Test HomematicipSwitch.""" entity_id = "switch.schrank" entity_name = "Schrank" device_model = "HMIP-PS" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[entity_name] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON async def test_hmip_switch_input(opp, default_mock_hap_factory): """Test HomematicipSwitch.""" entity_id = "switch.wohnzimmer_beleuchtung" entity_name = "Wohnzimmer Beleuchtung" device_model = "HmIP-FSI16" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[entity_name] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON async def test_hmip_switch_measuring(opp, default_mock_hap_factory): """Test HomematicipSwitchMeasuring.""" entity_id = "switch.pc" entity_name = "Pc" device_model = "HMIP-PSM" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[entity_name] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) await async_manipulate_test_data(opp, hmip_device, "currentPowerConsumption", 50) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON assert ha_state.attributes[ATTR_CURRENT_POWER_W] == 50 assert ha_state.attributes[ATTR_TODAY_ENERGY_KWH] == 36 await async_manipulate_test_data(opp, hmip_device, "energyCounter", None) ha_state = opp.states.get(entity_id) assert not ha_state.attributes.get(ATTR_TODAY_ENERGY_KWH) async def test_hmip_group_switch(opp, default_mock_hap_factory): """Test HomematicipGroupSwitch.""" entity_id = "switch.strom_group" entity_name = "Strom Group" device_model = None mock_hap = await default_mock_hap_factory.async_get_mock_hap(test_groups=["Strom"]) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == () await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == () await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON assert not ha_state.attributes.get(ATTR_GROUP_MEMBER_UNREACHABLE) await async_manipulate_test_data(opp, hmip_device, "unreach", True) ha_state = opp.states.get(entity_id) assert ha_state.attributes[ATTR_GROUP_MEMBER_UNREACHABLE] async def test_hmip_multi_switch(opp, default_mock_hap_factory): """Test HomematicipMultiSwitch.""" entity_id = "switch.jalousien_1_kizi_2_schlazi_channel1" entity_name = "Jalousien - 1 KiZi, 2 SchlaZi Channel1" device_model = "HmIP-PCBS2" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[ "Jalousien - 1 KiZi, 2 SchlaZi", "Multi IO Box", "Heizungsaktor", "ioBroker", "Schaltaktor Verteiler", ] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_OFF service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, "switch.schaltaktor_verteiler_channel3", "Schaltaktor Verteiler Channel3", "HmIP-DRSI4", ) assert ha_state.state == STATE_OFF async def test_hmip_wired_multi_switch(opp, default_mock_hap_factory): """Test HomematicipMultiSwitch.""" entity_id = "switch.fernseher_wohnzimmer" entity_name = "Fernseher (Wohnzimmer)" device_model = "HmIPW-DRS8" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[ "Wired Schaltaktor – 8-fach", ] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON
37.582418
87
0.710721
from openpeerpower.components.homematicip_cloud import DOMAIN as HMIPC_DOMAIN from openpeerpower.components.homematicip_cloud.generic_entity import ( ATTR_GROUP_MEMBER_UNREACHABLE, ) from openpeerpower.components.switch import ( ATTR_CURRENT_POWER_W, ATTR_TODAY_ENERGY_KWH, DOMAIN as SWITCH_DOMAIN, ) from openpeerpower.const import STATE_OFF, STATE_ON from openpeerpower.setup import async_setup_component from .helper import async_manipulate_test_data, get_and_check_entity_basics async def test_manually_configured_platform(opp): assert await async_setup_component( opp, SWITCH_DOMAIN, {SWITCH_DOMAIN: {"platform": HMIPC_DOMAIN}} ) assert not opp.data.get(HMIPC_DOMAIN) async def test_hmip_switch(opp, default_mock_hap_factory): entity_id = "switch.schrank" entity_name = "Schrank" device_model = "HMIP-PS" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[entity_name] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON async def test_hmip_switch_input(opp, default_mock_hap_factory): entity_id = "switch.wohnzimmer_beleuchtung" entity_name = "Wohnzimmer Beleuchtung" device_model = "HmIP-FSI16" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[entity_name] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON async def test_hmip_switch_measuring(opp, default_mock_hap_factory): entity_id = "switch.pc" entity_name = "Pc" device_model = "HMIP-PSM" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[entity_name] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) await async_manipulate_test_data(opp, hmip_device, "currentPowerConsumption", 50) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON assert ha_state.attributes[ATTR_CURRENT_POWER_W] == 50 assert ha_state.attributes[ATTR_TODAY_ENERGY_KWH] == 36 await async_manipulate_test_data(opp, hmip_device, "energyCounter", None) ha_state = opp.states.get(entity_id) assert not ha_state.attributes.get(ATTR_TODAY_ENERGY_KWH) async def test_hmip_group_switch(opp, default_mock_hap_factory): entity_id = "switch.strom_group" entity_name = "Strom Group" device_model = None mock_hap = await default_mock_hap_factory.async_get_mock_hap(test_groups=["Strom"]) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == () await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == () await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON assert not ha_state.attributes.get(ATTR_GROUP_MEMBER_UNREACHABLE) await async_manipulate_test_data(opp, hmip_device, "unreach", True) ha_state = opp.states.get(entity_id) assert ha_state.attributes[ATTR_GROUP_MEMBER_UNREACHABLE] async def test_hmip_multi_switch(opp, default_mock_hap_factory): entity_id = "switch.jalousien_1_kizi_2_schlazi_channel1" entity_name = "Jalousien - 1 KiZi, 2 SchlaZi Channel1" device_model = "HmIP-PCBS2" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[ "Jalousien - 1 KiZi, 2 SchlaZi", "Multi IO Box", "Heizungsaktor", "ioBroker", "Schaltaktor Verteiler", ] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_OFF service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, "switch.schaltaktor_verteiler_channel3", "Schaltaktor Verteiler Channel3", "HmIP-DRSI4", ) assert ha_state.state == STATE_OFF async def test_hmip_wired_multi_switch(opp, default_mock_hap_factory): entity_id = "switch.fernseher_wohnzimmer" entity_name = "Fernseher (Wohnzimmer)" device_model = "HmIPW-DRS8" mock_hap = await default_mock_hap_factory.async_get_mock_hap( test_devices=[ "Wired Schaltaktor – 8-fach", ] ) ha_state, hmip_device = get_and_check_entity_basics( opp, mock_hap, entity_id, entity_name, device_model ) assert ha_state.state == STATE_ON service_call_counter = len(hmip_device.mock_calls) await opp.services.async_call( "switch", "turn_off", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 1 assert hmip_device.mock_calls[-1][0] == "turn_off" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", False) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_OFF await opp.services.async_call( "switch", "turn_on", {"entity_id": entity_id}, blocking=True ) assert len(hmip_device.mock_calls) == service_call_counter + 3 assert hmip_device.mock_calls[-1][0] == "turn_on" assert hmip_device.mock_calls[-1][1] == (1,) await async_manipulate_test_data(opp, hmip_device, "on", True) ha_state = opp.states.get(entity_id) assert ha_state.state == STATE_ON
true
true
f71e401b78d23a22bfd8c5eeb5995f8f22fe4239
299
py
Python
backend/mp/apps/base/migrations/0012_delete_questionnaire.py
shidashui/mymp
75d81906908395ece1c8d12249d6afc4bd2d0704
[ "MIT" ]
1
2020-03-14T12:33:24.000Z
2020-03-14T12:33:24.000Z
backend/mp/apps/base/migrations/0012_delete_questionnaire.py
shidashui/mymp
75d81906908395ece1c8d12249d6afc4bd2d0704
[ "MIT" ]
8
2021-03-19T00:59:11.000Z
2022-03-12T00:19:38.000Z
backend/mp/apps/base/migrations/0012_delete_questionnaire.py
shidashui/mymp
75d81906908395ece1c8d12249d6afc4bd2d0704
[ "MIT" ]
null
null
null
# Generated by Django 3.0.4 on 2020-03-26 11:08 from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('base', '0011_auto_20200326_1107'), ] operations = [ migrations.DeleteModel( name='Questionnaire', ), ]
17.588235
47
0.608696
from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('base', '0011_auto_20200326_1107'), ] operations = [ migrations.DeleteModel( name='Questionnaire', ), ]
true
true
f71e40329e3d37616481697f5bfc504ea2916179
367
py
Python
app/classes/run_options.py
robjporter/PYTHON-APIServer-1
57df8e8189834504b3f473993ae12586ec32d5c9
[ "MIT" ]
null
null
null
app/classes/run_options.py
robjporter/PYTHON-APIServer-1
57df8e8189834504b3f473993ae12586ec32d5c9
[ "MIT" ]
null
null
null
app/classes/run_options.py
robjporter/PYTHON-APIServer-1
57df8e8189834504b3f473993ae12586ec32d5c9
[ "MIT" ]
null
null
null
# Run options # gunicorn -w 4 -b 127.0.0.1:5000 main:app # waitress main:app # python3 main.py runserver # uwsgi --http 0.0.0.0:8000 --home env --wsgi-file main.py --callable app --master --enable-threads --thunder-lock # virtualenv -p /usr/local/bin/python3 env # source env/bin/activate # pip3 install --upgrade pip # pip3 install -r requirements.txt
36.7
115
0.692098
true
true
f71e41255f5f877f4e6d025f4be916412433703c
7,454
py
Python
kubernetes/client/models/v1_pod_affinity_term.py
henrywu2019/python
fb7214144395c05349e70a58ea129576f6b11fc4
[ "Apache-2.0" ]
4,417
2018-01-13T04:30:48.000Z
2022-03-31T15:33:59.000Z
kubernetes/client/models/v1_pod_affinity_term.py
henrywu2019/python
fb7214144395c05349e70a58ea129576f6b11fc4
[ "Apache-2.0" ]
1,414
2018-01-12T19:31:56.000Z
2022-03-31T22:01:02.000Z
kubernetes/client/models/v1_pod_affinity_term.py
henrywu2019/python
fb7214144395c05349e70a58ea129576f6b11fc4
[ "Apache-2.0" ]
2,854
2018-01-14T08:57:33.000Z
2022-03-31T01:41:56.000Z
# coding: utf-8 """ Kubernetes No description provided (generated by Openapi Generator https://github.com/openapitools/openapi-generator) # noqa: E501 The version of the OpenAPI document: release-1.21 Generated by: https://openapi-generator.tech """ import pprint import re # noqa: F401 import six from kubernetes.client.configuration import Configuration class V1PodAffinityTerm(object): """NOTE: This class is auto generated by OpenAPI Generator. Ref: https://openapi-generator.tech Do not edit the class manually. """ """ Attributes: openapi_types (dict): The key is attribute name and the value is attribute type. attribute_map (dict): The key is attribute name and the value is json key in definition. """ openapi_types = { 'label_selector': 'V1LabelSelector', 'namespace_selector': 'V1LabelSelector', 'namespaces': 'list[str]', 'topology_key': 'str' } attribute_map = { 'label_selector': 'labelSelector', 'namespace_selector': 'namespaceSelector', 'namespaces': 'namespaces', 'topology_key': 'topologyKey' } def __init__(self, label_selector=None, namespace_selector=None, namespaces=None, topology_key=None, local_vars_configuration=None): # noqa: E501 """V1PodAffinityTerm - a model defined in OpenAPI""" # noqa: E501 if local_vars_configuration is None: local_vars_configuration = Configuration() self.local_vars_configuration = local_vars_configuration self._label_selector = None self._namespace_selector = None self._namespaces = None self._topology_key = None self.discriminator = None if label_selector is not None: self.label_selector = label_selector if namespace_selector is not None: self.namespace_selector = namespace_selector if namespaces is not None: self.namespaces = namespaces self.topology_key = topology_key @property def label_selector(self): """Gets the label_selector of this V1PodAffinityTerm. # noqa: E501 :return: The label_selector of this V1PodAffinityTerm. # noqa: E501 :rtype: V1LabelSelector """ return self._label_selector @label_selector.setter def label_selector(self, label_selector): """Sets the label_selector of this V1PodAffinityTerm. :param label_selector: The label_selector of this V1PodAffinityTerm. # noqa: E501 :type: V1LabelSelector """ self._label_selector = label_selector @property def namespace_selector(self): """Gets the namespace_selector of this V1PodAffinityTerm. # noqa: E501 :return: The namespace_selector of this V1PodAffinityTerm. # noqa: E501 :rtype: V1LabelSelector """ return self._namespace_selector @namespace_selector.setter def namespace_selector(self, namespace_selector): """Sets the namespace_selector of this V1PodAffinityTerm. :param namespace_selector: The namespace_selector of this V1PodAffinityTerm. # noqa: E501 :type: V1LabelSelector """ self._namespace_selector = namespace_selector @property def namespaces(self): """Gets the namespaces of this V1PodAffinityTerm. # noqa: E501 namespaces specifies a static list of namespace names that the term applies to. The term is applied to the union of the namespaces listed in this field and the ones selected by namespaceSelector. null or empty namespaces list and null namespaceSelector means \"this pod's namespace\" # noqa: E501 :return: The namespaces of this V1PodAffinityTerm. # noqa: E501 :rtype: list[str] """ return self._namespaces @namespaces.setter def namespaces(self, namespaces): """Sets the namespaces of this V1PodAffinityTerm. namespaces specifies a static list of namespace names that the term applies to. The term is applied to the union of the namespaces listed in this field and the ones selected by namespaceSelector. null or empty namespaces list and null namespaceSelector means \"this pod's namespace\" # noqa: E501 :param namespaces: The namespaces of this V1PodAffinityTerm. # noqa: E501 :type: list[str] """ self._namespaces = namespaces @property def topology_key(self): """Gets the topology_key of this V1PodAffinityTerm. # noqa: E501 This pod should be co-located (affinity) or not co-located (anti-affinity) with the pods matching the labelSelector in the specified namespaces, where co-located is defined as running on a node whose value of the label with key topologyKey matches that of any node on which any of the selected pods is running. Empty topologyKey is not allowed. # noqa: E501 :return: The topology_key of this V1PodAffinityTerm. # noqa: E501 :rtype: str """ return self._topology_key @topology_key.setter def topology_key(self, topology_key): """Sets the topology_key of this V1PodAffinityTerm. This pod should be co-located (affinity) or not co-located (anti-affinity) with the pods matching the labelSelector in the specified namespaces, where co-located is defined as running on a node whose value of the label with key topologyKey matches that of any node on which any of the selected pods is running. Empty topologyKey is not allowed. # noqa: E501 :param topology_key: The topology_key of this V1PodAffinityTerm. # noqa: E501 :type: str """ if self.local_vars_configuration.client_side_validation and topology_key is None: # noqa: E501 raise ValueError("Invalid value for `topology_key`, must not be `None`") # noqa: E501 self._topology_key = topology_key def to_dict(self): """Returns the model properties as a dict""" result = {} for attr, _ in six.iteritems(self.openapi_types): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value return result def to_str(self): """Returns the string representation of the model""" return pprint.pformat(self.to_dict()) def __repr__(self): """For `print` and `pprint`""" return self.to_str() def __eq__(self, other): """Returns true if both objects are equal""" if not isinstance(other, V1PodAffinityTerm): return False return self.to_dict() == other.to_dict() def __ne__(self, other): """Returns true if both objects are not equal""" if not isinstance(other, V1PodAffinityTerm): return True return self.to_dict() != other.to_dict()
36.539216
366
0.652267
import pprint import re import six from kubernetes.client.configuration import Configuration class V1PodAffinityTerm(object): openapi_types = { 'label_selector': 'V1LabelSelector', 'namespace_selector': 'V1LabelSelector', 'namespaces': 'list[str]', 'topology_key': 'str' } attribute_map = { 'label_selector': 'labelSelector', 'namespace_selector': 'namespaceSelector', 'namespaces': 'namespaces', 'topology_key': 'topologyKey' } def __init__(self, label_selector=None, namespace_selector=None, namespaces=None, topology_key=None, local_vars_configuration=None): if local_vars_configuration is None: local_vars_configuration = Configuration() self.local_vars_configuration = local_vars_configuration self._label_selector = None self._namespace_selector = None self._namespaces = None self._topology_key = None self.discriminator = None if label_selector is not None: self.label_selector = label_selector if namespace_selector is not None: self.namespace_selector = namespace_selector if namespaces is not None: self.namespaces = namespaces self.topology_key = topology_key @property def label_selector(self): return self._label_selector @label_selector.setter def label_selector(self, label_selector): self._label_selector = label_selector @property def namespace_selector(self): return self._namespace_selector @namespace_selector.setter def namespace_selector(self, namespace_selector): self._namespace_selector = namespace_selector @property def namespaces(self): return self._namespaces @namespaces.setter def namespaces(self, namespaces): self._namespaces = namespaces @property def topology_key(self): return self._topology_key @topology_key.setter def topology_key(self, topology_key): if self.local_vars_configuration.client_side_validation and topology_key is None: raise ValueError("Invalid value for `topology_key`, must not be `None`") self._topology_key = topology_key def to_dict(self): result = {} for attr, _ in six.iteritems(self.openapi_types): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value return result def to_str(self): return pprint.pformat(self.to_dict()) def __repr__(self): return self.to_str() def __eq__(self, other): if not isinstance(other, V1PodAffinityTerm): return False return self.to_dict() == other.to_dict() def __ne__(self, other): if not isinstance(other, V1PodAffinityTerm): return True return self.to_dict() != other.to_dict()
true
true
f71e43441726991507a806be6346c189869dd316
7,835
py
Python
great_expectations/expectations/core/expect_column_values_to_be_null.py
victorcouste/great_expectations
9ee46d83feb87e13c769e2ae35b899b3f18d73a4
[ "Apache-2.0" ]
2
2022-01-28T15:51:32.000Z
2022-02-02T05:07:58.000Z
great_expectations/expectations/core/expect_column_values_to_be_null.py
victorcouste/great_expectations
9ee46d83feb87e13c769e2ae35b899b3f18d73a4
[ "Apache-2.0" ]
null
null
null
great_expectations/expectations/core/expect_column_values_to_be_null.py
victorcouste/great_expectations
9ee46d83feb87e13c769e2ae35b899b3f18d73a4
[ "Apache-2.0" ]
1
2021-10-08T01:24:50.000Z
2021-10-08T01:24:50.000Z
from typing import Dict, Optional from great_expectations.core import ExpectationConfiguration from great_expectations.core.expectation_configuration import parse_result_format from great_expectations.execution_engine import ExecutionEngine from great_expectations.expectations.expectation import ( ColumnMapExpectation, _format_map_output, ) from great_expectations.expectations.util import render_evaluation_parameter_string from great_expectations.render.renderer.renderer import renderer from great_expectations.render.types import RenderedStringTemplateContent from great_expectations.render.util import ( num_to_str, parse_row_condition_string_pandas_engine, substitute_none_for_missing, ) from great_expectations.validator.validation_graph import MetricConfiguration class ExpectColumnValuesToBeNull(ColumnMapExpectation): """Expect column values to be null. expect_column_values_to_be_null is a \ :func:`column_map_expectation <great_expectations.execution_engine.execution_engine.MetaExecutionEngine .column_map_expectation>`. Args: column (str): \ The column name. Keyword Args: mostly (None or a float between 0 and 1): \ Return `"success": True` if at least mostly fraction of values match the expectation. \ For more detail, see :ref:`mostly`. Other Parameters: result_format (str or None): \ Which output mode to use: `BOOLEAN_ONLY`, `BASIC`, `COMPLETE`, or `SUMMARY`. For more detail, see :ref:`result_format <result_format>`. include_config (boolean): \ If True, then include the expectation config as part of the result object. \ For more detail, see :ref:`include_config`. catch_exceptions (boolean or None): \ If True, then catch exceptions and include them as part of the result object. \ For more detail, see :ref:`catch_exceptions`. meta (dict or None): \ A JSON-serializable dictionary (nesting allowed) that will be included in the output without \ modification. For more detail, see :ref:`meta`. Returns: An ExpectationSuiteValidationResult Exact fields vary depending on the values passed to :ref:`result_format <result_format>` and :ref:`include_config`, :ref:`catch_exceptions`, and :ref:`meta`. See Also: :func:`expect_column_values_to_not_be_null \ <great_expectations.execution_engine.execution_engine.ExecutionEngine.expect_column_values_to_not_be_null>` """ # This dictionary contains metadata for display in the public gallery library_metadata = { "maturity": "production", "package": "great_expectations", "tags": ["core expectation", "column map expectation"], "contributors": ["@great_expectations"], "requirements": [], } map_metric = "column_values.null" @classmethod @renderer(renderer_type="renderer.prescriptive") @render_evaluation_parameter_string def _prescriptive_renderer( cls, configuration=None, result=None, language=None, runtime_configuration=None, **kwargs ): runtime_configuration = runtime_configuration or {} include_column_name = runtime_configuration.get("include_column_name", True) include_column_name = ( include_column_name if include_column_name is not None else True ) styling = runtime_configuration.get("styling") params = substitute_none_for_missing( configuration.kwargs, ["column", "mostly", "row_condition", "condition_parser"], ) if params["mostly"] is not None: params["mostly_pct"] = num_to_str( params["mostly"] * 100, precision=15, no_scientific=True ) # params["mostly_pct"] = "{:.14f}".format(params["mostly"]*100).rstrip("0").rstrip(".") template_str = "values must be null, at least $mostly_pct % of the time." else: template_str = "values must be null." if include_column_name: template_str = "$column " + template_str if params["row_condition"] is not None: ( conditional_template_str, conditional_params, ) = parse_row_condition_string_pandas_engine(params["row_condition"]) template_str = conditional_template_str + ", then " + template_str params.update(conditional_params) return [ RenderedStringTemplateContent( **{ "content_block_type": "string_template", "string_template": { "template": template_str, "params": params, "styling": styling, }, } ) ] @classmethod @renderer(renderer_type="renderer.diagnostic.observed_value") def _diagnostic_observed_value_renderer( cls, configuration=None, result=None, language=None, runtime_configuration=None, **kwargs ): result_dict = result.result try: notnull_percent = result_dict["unexpected_percent"] return ( num_to_str(100 - notnull_percent, precision=5, use_locale=True) + "% null" ) except KeyError: return "unknown % null" except TypeError: return "NaN% null" def get_validation_dependencies( self, configuration: Optional[ExpectationConfiguration] = None, execution_engine: Optional[ExecutionEngine] = None, runtime_configuration: Optional[dict] = None, ): dependencies = super().get_validation_dependencies( configuration, execution_engine, runtime_configuration ) # We do not need this metric for a null metric del dependencies["metrics"]["column_values.nonnull.unexpected_count"] return dependencies def _validate( self, configuration: ExpectationConfiguration, metrics: Dict, runtime_configuration: dict = None, execution_engine: ExecutionEngine = None, ): if runtime_configuration: result_format = runtime_configuration.get( "result_format", configuration.kwargs.get( "result_format", self.default_kwarg_values.get("result_format") ), ) else: result_format = configuration.kwargs.get( "result_format", self.default_kwarg_values.get("result_format") ) mostly = self.get_success_kwargs().get( "mostly", self.default_kwarg_values.get("mostly") ) total_count = metrics.get("table.row_count") unexpected_count = metrics.get(self.map_metric + ".unexpected_count") if total_count is None or total_count == 0: # Vacuously true success = True else: success_ratio = (total_count - unexpected_count) / total_count success = success_ratio >= mostly nonnull_count = None return _format_map_output( result_format=parse_result_format(result_format), success=success, element_count=metrics.get("table.row_count"), nonnull_count=nonnull_count, unexpected_count=metrics.get(self.map_metric + ".unexpected_count"), unexpected_list=metrics.get(self.map_metric + ".unexpected_values"), unexpected_index_list=metrics.get( self.map_metric + ".unexpected_index_list" ), )
37.309524
115
0.636631
from typing import Dict, Optional from great_expectations.core import ExpectationConfiguration from great_expectations.core.expectation_configuration import parse_result_format from great_expectations.execution_engine import ExecutionEngine from great_expectations.expectations.expectation import ( ColumnMapExpectation, _format_map_output, ) from great_expectations.expectations.util import render_evaluation_parameter_string from great_expectations.render.renderer.renderer import renderer from great_expectations.render.types import RenderedStringTemplateContent from great_expectations.render.util import ( num_to_str, parse_row_condition_string_pandas_engine, substitute_none_for_missing, ) from great_expectations.validator.validation_graph import MetricConfiguration class ExpectColumnValuesToBeNull(ColumnMapExpectation): library_metadata = { "maturity": "production", "package": "great_expectations", "tags": ["core expectation", "column map expectation"], "contributors": ["@great_expectations"], "requirements": [], } map_metric = "column_values.null" @classmethod @renderer(renderer_type="renderer.prescriptive") @render_evaluation_parameter_string def _prescriptive_renderer( cls, configuration=None, result=None, language=None, runtime_configuration=None, **kwargs ): runtime_configuration = runtime_configuration or {} include_column_name = runtime_configuration.get("include_column_name", True) include_column_name = ( include_column_name if include_column_name is not None else True ) styling = runtime_configuration.get("styling") params = substitute_none_for_missing( configuration.kwargs, ["column", "mostly", "row_condition", "condition_parser"], ) if params["mostly"] is not None: params["mostly_pct"] = num_to_str( params["mostly"] * 100, precision=15, no_scientific=True ) template_str = "values must be null, at least $mostly_pct % of the time." else: template_str = "values must be null." if include_column_name: template_str = "$column " + template_str if params["row_condition"] is not None: ( conditional_template_str, conditional_params, ) = parse_row_condition_string_pandas_engine(params["row_condition"]) template_str = conditional_template_str + ", then " + template_str params.update(conditional_params) return [ RenderedStringTemplateContent( **{ "content_block_type": "string_template", "string_template": { "template": template_str, "params": params, "styling": styling, }, } ) ] @classmethod @renderer(renderer_type="renderer.diagnostic.observed_value") def _diagnostic_observed_value_renderer( cls, configuration=None, result=None, language=None, runtime_configuration=None, **kwargs ): result_dict = result.result try: notnull_percent = result_dict["unexpected_percent"] return ( num_to_str(100 - notnull_percent, precision=5, use_locale=True) + "% null" ) except KeyError: return "unknown % null" except TypeError: return "NaN% null" def get_validation_dependencies( self, configuration: Optional[ExpectationConfiguration] = None, execution_engine: Optional[ExecutionEngine] = None, runtime_configuration: Optional[dict] = None, ): dependencies = super().get_validation_dependencies( configuration, execution_engine, runtime_configuration ) del dependencies["metrics"]["column_values.nonnull.unexpected_count"] return dependencies def _validate( self, configuration: ExpectationConfiguration, metrics: Dict, runtime_configuration: dict = None, execution_engine: ExecutionEngine = None, ): if runtime_configuration: result_format = runtime_configuration.get( "result_format", configuration.kwargs.get( "result_format", self.default_kwarg_values.get("result_format") ), ) else: result_format = configuration.kwargs.get( "result_format", self.default_kwarg_values.get("result_format") ) mostly = self.get_success_kwargs().get( "mostly", self.default_kwarg_values.get("mostly") ) total_count = metrics.get("table.row_count") unexpected_count = metrics.get(self.map_metric + ".unexpected_count") if total_count is None or total_count == 0: success = True else: success_ratio = (total_count - unexpected_count) / total_count success = success_ratio >= mostly nonnull_count = None return _format_map_output( result_format=parse_result_format(result_format), success=success, element_count=metrics.get("table.row_count"), nonnull_count=nonnull_count, unexpected_count=metrics.get(self.map_metric + ".unexpected_count"), unexpected_list=metrics.get(self.map_metric + ".unexpected_values"), unexpected_index_list=metrics.get( self.map_metric + ".unexpected_index_list" ), )
true
true
f71e44aad927f5ef6129ca72ac718a82de543b96
842
py
Python
dojo/unittests/tools/test_acunetix_parser.py
brunoduruzup/django-DefectDojo
cd598b44f1c44ca2a05fdf95f99c0d526509f656
[ "BSD-3-Clause" ]
2
2021-09-19T23:19:12.000Z
2022-03-26T10:20:49.000Z
dojo/unittests/tools/test_acunetix_parser.py
brunoduruzup/django-DefectDojo
cd598b44f1c44ca2a05fdf95f99c0d526509f656
[ "BSD-3-Clause" ]
167
2021-03-15T13:49:54.000Z
2022-03-31T09:10:30.000Z
dojo/unittests/tools/test_acunetix_parser.py
Hijerboa/django-DefectDojo
3aea3bc3406f860c0842b0bf8800efe2c86bf81b
[ "BSD-3-Clause" ]
4
2016-09-19T17:33:39.000Z
2018-12-10T07:55:45.000Z
from django.test import TestCase from dojo.tools.acunetix.parser import AcunetixParser from dojo.models import Test class TestAcunetixParser(TestCase): def test_parse_without_file(self): parser = AcunetixParser() findings = parser.get_findings(None, Test()) self.assertEqual(0, len(findings)) def test_parse_file_with_one_finding(self): testfile = open("dojo/unittests/scans/acunetix/one_finding.xml") parser = AcunetixParser() findings = parser.get_findings(testfile, Test()) self.assertEqual(1, len(findings)) def test_parse_file_with_multiple_finding(self): testfile = open("dojo/unittests/scans/acunetix/many_findings.xml") parser = AcunetixParser() findings = parser.get_findings(testfile, Test()) self.assertEqual(4, len(findings))
36.608696
74
0.712589
from django.test import TestCase from dojo.tools.acunetix.parser import AcunetixParser from dojo.models import Test class TestAcunetixParser(TestCase): def test_parse_without_file(self): parser = AcunetixParser() findings = parser.get_findings(None, Test()) self.assertEqual(0, len(findings)) def test_parse_file_with_one_finding(self): testfile = open("dojo/unittests/scans/acunetix/one_finding.xml") parser = AcunetixParser() findings = parser.get_findings(testfile, Test()) self.assertEqual(1, len(findings)) def test_parse_file_with_multiple_finding(self): testfile = open("dojo/unittests/scans/acunetix/many_findings.xml") parser = AcunetixParser() findings = parser.get_findings(testfile, Test()) self.assertEqual(4, len(findings))
true
true
f71e44f724dfe3403874adb309cf00523e7e6a93
29
py
Python
src/all_models/models/__init__.py
sinnamone/PcaprofilerDjango
72c704c7011dc979b9a0638f7e948c0328bd20ea
[ "MIT" ]
null
null
null
src/all_models/models/__init__.py
sinnamone/PcaprofilerDjango
72c704c7011dc979b9a0638f7e948c0328bd20ea
[ "MIT" ]
null
null
null
src/all_models/models/__init__.py
sinnamone/PcaprofilerDjango
72c704c7011dc979b9a0638f7e948c0328bd20ea
[ "MIT" ]
null
null
null
from .custom_user import User
29
29
0.862069
from .custom_user import User
true
true
f71e45004f351efc76d9ab4441cdedbda91aec6a
2,668
py
Python
opps/images/templatetags/images_tags.py
jeanmask/opps
031c6136c38d43aa6d1ccb25a94f7bcd65ccbf87
[ "MIT" ]
159
2015-01-03T16:36:35.000Z
2022-03-29T20:50:13.000Z
opps/images/templatetags/images_tags.py
jeanmask/opps
031c6136c38d43aa6d1ccb25a94f7bcd65ccbf87
[ "MIT" ]
81
2015-01-02T21:26:16.000Z
2021-05-29T12:24:52.000Z
opps/images/templatetags/images_tags.py
jeanmask/opps
031c6136c38d43aa6d1ccb25a94f7bcd65ccbf87
[ "MIT" ]
75
2015-01-23T13:41:03.000Z
2021-09-24T03:45:23.000Z
# -*- coding: utf-8 -*- from django import template from django.template import Node, TemplateSyntaxError, Variable from django.conf import settings from django.utils.translation import ugettext as _ from ..generate import image_url as url register = template.Library() class AllImagesCheckPermissionForObjectsNode(Node): def __init__(self, obj, name): self.obj = Variable(obj) self.name = name def render(self, context): check_published = True try: user = context['request'].user if user.is_staff or user.is_superuser: check_published = False except: pass obj = self.obj.resolve(context) context[self.name] = obj.all_images(check_published) return '' @register.tag(name='all_images_check_permission') def all_images_check_permission(parser, token): """ {% all_images_check_permission object as images %} """ try: parans = token.split_contents() except ValueError: raise TemplateSyntaxError( _('tag requires exactly two arguments')) if len(parans) != 4: raise TemplateSyntaxError( _('tag requires exactly three arguments')) if parans[2] != 'as': raise TemplateSyntaxError( _("second argument to tag must be 'as'")) return AllImagesCheckPermissionForObjectsNode(parans[1], parans[3]) @register.simple_tag def image_url(image_url, **kwargs): return url(image_url=image_url, **kwargs) @register.simple_tag def image_obj(image, **kwargs): HALIGN_VALUES = ("left", "center", "right") VALIGN_VALUES = ("top", "middle", "bottom") if image == "" or not image: return "" if settings.THUMBOR_ENABLED: new = {} new['flip'] = image.flip new['flop'] = image.flop if image.halign and image.halign in HALIGN_VALUES: new['halign'] = image.halign if image.valign and image.valign in VALIGN_VALUES: new['valign'] = image.valign new['fit_in'] = image.fit_in new['smart'] = image.smart if 'filters' in kwargs: kw = [kwargs['filters']] new['filters'] = kw del kwargs['filters'] if image.crop_x1 > 0 or image.crop_x2 > 0 or image.crop_y1 > 0 or \ image.crop_y2 > 0: new['crop'] = ((image.crop_x1, image.crop_y1), (image.crop_x2, image.crop_y2)) kwargs = dict(new, **kwargs) if image.archive_link and image.archive_link != "": return url(image_url=image.archive_link, **kwargs) return image.image_url(**kwargs)
28.688172
75
0.616942
from django import template from django.template import Node, TemplateSyntaxError, Variable from django.conf import settings from django.utils.translation import ugettext as _ from ..generate import image_url as url register = template.Library() class AllImagesCheckPermissionForObjectsNode(Node): def __init__(self, obj, name): self.obj = Variable(obj) self.name = name def render(self, context): check_published = True try: user = context['request'].user if user.is_staff or user.is_superuser: check_published = False except: pass obj = self.obj.resolve(context) context[self.name] = obj.all_images(check_published) return '' @register.tag(name='all_images_check_permission') def all_images_check_permission(parser, token): try: parans = token.split_contents() except ValueError: raise TemplateSyntaxError( _('tag requires exactly two arguments')) if len(parans) != 4: raise TemplateSyntaxError( _('tag requires exactly three arguments')) if parans[2] != 'as': raise TemplateSyntaxError( _("second argument to tag must be 'as'")) return AllImagesCheckPermissionForObjectsNode(parans[1], parans[3]) @register.simple_tag def image_url(image_url, **kwargs): return url(image_url=image_url, **kwargs) @register.simple_tag def image_obj(image, **kwargs): HALIGN_VALUES = ("left", "center", "right") VALIGN_VALUES = ("top", "middle", "bottom") if image == "" or not image: return "" if settings.THUMBOR_ENABLED: new = {} new['flip'] = image.flip new['flop'] = image.flop if image.halign and image.halign in HALIGN_VALUES: new['halign'] = image.halign if image.valign and image.valign in VALIGN_VALUES: new['valign'] = image.valign new['fit_in'] = image.fit_in new['smart'] = image.smart if 'filters' in kwargs: kw = [kwargs['filters']] new['filters'] = kw del kwargs['filters'] if image.crop_x1 > 0 or image.crop_x2 > 0 or image.crop_y1 > 0 or \ image.crop_y2 > 0: new['crop'] = ((image.crop_x1, image.crop_y1), (image.crop_x2, image.crop_y2)) kwargs = dict(new, **kwargs) if image.archive_link and image.archive_link != "": return url(image_url=image.archive_link, **kwargs) return image.image_url(**kwargs)
true
true
f71e451920124e5a0a23bd63a7f8d86f5311f631
3,319
py
Python
subset/dot1x/authenticator/eap_socket.py
sicada/faucetsdn-daq
04967711fc58c3101c2449d09dbc9dcef95df21e
[ "Apache-2.0" ]
41
2018-06-11T06:34:37.000Z
2022-01-14T18:07:49.000Z
subset/dot1x/authenticator/eap_socket.py
sicada/faucetsdn-daq
04967711fc58c3101c2449d09dbc9dcef95df21e
[ "Apache-2.0" ]
843
2018-09-03T05:28:16.000Z
2022-03-22T20:11:20.000Z
subset/dot1x/authenticator/eap_socket.py
grafnu/daq-staging
47c1015dbfd1a5bbcaa373f6b6d5cf2e53402b4f
[ "Apache-2.0" ]
33
2018-05-22T15:33:57.000Z
2022-02-15T21:55:56.000Z
"""Handle the EAP socket""" from __future__ import absolute_import import struct from abc import ABC, abstractmethod from fcntl import ioctl import errno import socket from mac_address import MacAddress from utils import get_logger, get_interface_mac class PromiscuousSocket(ABC): """Abstract Raw Socket in Promiscuous Mode""" SIOCGIFINDEX = 0x8933 PACKET_MR_PROMISC = 1 SOL_PACKET = 263 PACKET_ADD_MEMBERSHIP = 1 @abstractmethod def send(self, data): # pylint: disable=missing-docstring pass @abstractmethod def receive(self): # pylint: disable=missing-docstring pass @abstractmethod def setup(self): # pylint: disable=missing-docstring pass def __init__(self, interface_name, log_prefix): self.socket = None self.interface_index = None self.interface_name = interface_name self.logger = get_logger(log_prefix) self.eap_address = MacAddress.from_string(get_interface_mac(interface_name)) def _setup(self, socket_filter): """Set up the socket""" self.logger.debug("Setting up socket on interface: %s", self.interface_name) try: self.open(socket_filter) self.get_interface_index() self.set_interface_promiscuous() except socket.error as err: self.logger.error("Unable to setup socket: %s", str(err)) raise err def open(self, socket_filter): """Setup EAP socket""" self.socket = socket.socket(socket.PF_PACKET, socket.SOCK_RAW, socket_filter) self.socket.bind((self.interface_name, 0)) def get_interface_index(self): """Get the interface index of the EAP Socket""" # http://man7.org/linux/man-pages/man7/netdevice.7.html request = struct.pack('16sI', self.interface_name.encode("utf-8"), 0) response = ioctl(self.socket, self.SIOCGIFINDEX, request) _ifname, self.interface_index = struct.unpack('16sI', response) def set_interface_promiscuous(self): """Sets the EAP interface to be able to receive EAP messages""" request = struct.pack("IHH8s", self.interface_index, self.PACKET_MR_PROMISC, len(self.eap_address.address), self.eap_address.address) self.socket.setsockopt(self.SOL_PACKET, self.PACKET_ADD_MEMBERSHIP, request) def shutdown(self): """Shutdown socket""" self.socket.close() class EapSocket(PromiscuousSocket): """Handle the EAP socket""" def setup(self): """Set up the socket""" self._setup(socket.htons(0x888e)) self.socket.settimeout(2.0) def send(self, data): """send on eap socket. data (bytes): data to send""" self.socket.send(data) def receive(self): """receive from eap socket""" # While socket hasn't been closed while self.socket.fileno() != -1: try: return self.socket.recv(4096) except socket.timeout: # Socket timed out. Expected. Move on. continue except OSError as exception: # socket closed if exception.errno == errno.EBADFD: break except Exception: raise
32.539216
86
0.632419
from __future__ import absolute_import import struct from abc import ABC, abstractmethod from fcntl import ioctl import errno import socket from mac_address import MacAddress from utils import get_logger, get_interface_mac class PromiscuousSocket(ABC): SIOCGIFINDEX = 0x8933 PACKET_MR_PROMISC = 1 SOL_PACKET = 263 PACKET_ADD_MEMBERSHIP = 1 @abstractmethod def send(self, data): pass @abstractmethod def receive(self): pass @abstractmethod def setup(self): pass def __init__(self, interface_name, log_prefix): self.socket = None self.interface_index = None self.interface_name = interface_name self.logger = get_logger(log_prefix) self.eap_address = MacAddress.from_string(get_interface_mac(interface_name)) def _setup(self, socket_filter): self.logger.debug("Setting up socket on interface: %s", self.interface_name) try: self.open(socket_filter) self.get_interface_index() self.set_interface_promiscuous() except socket.error as err: self.logger.error("Unable to setup socket: %s", str(err)) raise err def open(self, socket_filter): self.socket = socket.socket(socket.PF_PACKET, socket.SOCK_RAW, socket_filter) self.socket.bind((self.interface_name, 0)) def get_interface_index(self): request = struct.pack('16sI', self.interface_name.encode("utf-8"), 0) response = ioctl(self.socket, self.SIOCGIFINDEX, request) _ifname, self.interface_index = struct.unpack('16sI', response) def set_interface_promiscuous(self): request = struct.pack("IHH8s", self.interface_index, self.PACKET_MR_PROMISC, len(self.eap_address.address), self.eap_address.address) self.socket.setsockopt(self.SOL_PACKET, self.PACKET_ADD_MEMBERSHIP, request) def shutdown(self): self.socket.close() class EapSocket(PromiscuousSocket): def setup(self): self._setup(socket.htons(0x888e)) self.socket.settimeout(2.0) def send(self, data): self.socket.send(data) def receive(self): while self.socket.fileno() != -1: try: return self.socket.recv(4096) except socket.timeout: # Socket timed out. Expected. Move on. continue except OSError as exception: # socket closed if exception.errno == errno.EBADFD: break except Exception: raise
true
true
f71e45861229ef6c6f9868dcd6df59532c6cf2a6
9,410
py
Python
liftoff/common/options_parser.py
tudor-berariu/liftoff
4a0734006fb15c6da5013d437263161d3facf3d8
[ "MIT" ]
9
2018-04-09T16:41:38.000Z
2021-09-15T13:53:23.000Z
liftoff/common/options_parser.py
tudor-berariu/liftoff
4a0734006fb15c6da5013d437263161d3facf3d8
[ "MIT" ]
14
2018-09-26T11:44:30.000Z
2021-09-26T07:46:10.000Z
liftoff/common/options_parser.py
tudor-berariu/liftoff
4a0734006fb15c6da5013d437263161d3facf3d8
[ "MIT" ]
2
2018-04-23T10:26:00.000Z
2021-02-24T19:32:07.000Z
""" In order to reuse and have a consistent set of arguments we use the functions in this file to build argument parsers for all scripts. TODO: change to class methods to common methods if there is no need to call those functions outside an instance of OptionParser. """ from argparse import ArgumentParser, Namespace from typing import List import uuid from .liftoff_config import LiftoffConfig class OptionParser: """ This class facilitates combining command line arguments and liftoff settings. """ def __init__(self, name, arguments: List[str]) -> None: self.liftoff_config = LiftoffConfig() self.arg_parser = ArgumentParser(name) self.arguments = [str(arg) for arg in arguments] for arg in self.arguments: getattr(self, f"_add_{arg:s}")() def parse_args(self, args: List[str] = None, strict: bool = True) -> Namespace: """ Parses command-line arguments and completes options with values from liftoff configuration files. """ if strict: opts = self.arg_parser.parse_args(args=args) else: opts = self.arg_parser.parse_known_args(args=args) for arg in self.arguments: if not hasattr(opts, arg) or getattr(opts, arg) is None: setattr(opts, arg, self.liftoff_config.get(arg)) if hasattr(opts, "verbose") and isinstance(opts.verbose, list): opts.verbose = len(opts.verbose) opts.session_id = str(uuid.uuid4()) return opts def _add_all(self) -> None: self.arg_parser.add_argument( "-a", "--all", action="store_true", dest="all", help="Target all experiments not just the latest.", ) def _add_append_to(self) -> None: self.arg_parser.add_argument( "--append-to", dest="append_to", required=False, type=str, help="Append files to some existing experiment.", ) def _add_args(self) -> None: self.arg_parser.add_argument( "--args", dest="args", type=str, nargs="*", help="Use these values to overwrite the config file.", ) def _add_copy_to_clipboard(self) -> None: self.arg_parser.add_argument( "--cc", action="store_true", dest="copy_to_clipboard", help="Copy experiment path to clipboard", ) def _add_config_path(self) -> None: self.arg_parser.add_argument( "config_path", type=str, help="Give a specific name to the experiment." ) def _add_do(self) -> None: self.arg_parser.add_argument( "--do", action="store_true", dest="do", help="Apply the actions (do not only simulate).", ) def _add_crashed_only(self) -> None: self.arg_parser.add_argument( "--crashed-only", action="store_true", dest="crashed_only", help="Apply the actions only to crashed subexperiments.", ) def _add_experiment(self) -> None: self.arg_parser.add_argument( "experiment", nargs="?", type=str, help="Give a specific name to the experiment.", ) def _add_filters(self) -> None: self.arg_parser.add_argument( "--filters", dest="filters", type=str, nargs="*", help="Use these values to filter experiments to be run.", ) def _add_gpus(self) -> None: self.arg_parser.add_argument( "--gpus", dest="gpus", nargs="*", default=[], help="Available GPUs" ) def _add_name(self) -> None: self.arg_parser.add_argument( "--name", dest="name", required=False, type=str, help="Give a specific name to the experiment.", ) def _add_optimize(self) -> None: self.arg_parser.add_argument( "-O", action="store_true", dest="optimize", help="Send -OO to python process.", ) def _add_overwrite(self) -> None: self.arg_parser.add_argument( "--overwrite", action="store_true", dest="overwrite", help="Overwrite files if you find them (not if .__end is there", ) def _add_no_detach(self) -> None: self.arg_parser.add_argument( "--no-detach", action="store_true", dest="no_detach", help="Do not detach the process with nohup.", ) def _add_per_gpu(self) -> None: self.arg_parser.add_argument( "--per-gpu", dest="per_gpu", nargs="*", type=int, default=[], help="Maximum procs to load on each GPU.", ) def _add_pid(self) -> None: self.arg_parser.add_argument("pid", type=int, help="PID of liftoff to kill.") def _add_procs_no(self) -> None: default_value = self.liftoff_config.get("procs_no") if default_value is None: default_value = 1 default_value = int(default_value) self.arg_parser.add_argument( "--procs-no", dest="procs_no", required=False, type=int, default=default_value, help="Number of runs for each sub-experiment", ) def _add_results_path(self) -> None: default_value = self.liftoff_config.get("results_path") if default_value is None: default_value = "./results" default_value = str(default_value) self.arg_parser.add_argument( "--results-path", dest="results_path", required=False, type=str, default=default_value, help="Specify the results folder.", ) def _add_runs_no(self) -> None: default_value = self.liftoff_config.get("runs_no") if default_value is None: default_value = 1 default_value = int(default_value) self.arg_parser.add_argument( "--runs-no", dest="runs_no", required=False, type=int, default=default_value, help="Number of runs for each sub-experiment", ) def _add_runs(self) -> None: self.arg_parser.add_argument( "--runs", dest="runs", required=True, type=int, nargs="+", help="Runs we refer to here.", ) def _add_safe(self) -> None: self.arg_parser.add_argument( "--safe", action="store_true", dest="safe", help="Do not clean ended, but locked ones.", ) def _add_script(self) -> None: self.arg_parser.add_argument( "script", type=str, help="Script to be executed with all those configs." ) def _add_clean_all(self) -> None: self.arg_parser.add_argument( "--clean-all", action="store_true", dest="clean_all", help="Clean *all* the files an experiment run produced.", ) def _add_timestamp_fmt(self) -> None: default_value = self.liftoff_config.get("timestamp_fmt") if default_value is None: default_value = "%Y%b%d-%H%M%S" default_value = str(default_value) self.arg_parser.add_argument( "--timestamp-fmt", type=str, dest="timestamp_fmt", default=default_value, help="Timestamp format to be used.", ) def _add_verbose(self) -> None: self.arg_parser.add_argument( "-v", const=1, dest="verbose", action="append_const", help="Verbose level (default: 0) e.g. -v / -vv / -vvv", ) def _add_session_id(self) -> None: self.arg_parser.add_argument( "--session-id", type=str, dest="session_id", required=True, help="Seesion id (needed to identify process by command).", ) def _add_time_limit(self) -> None: self.arg_parser.add_argument( "--time-limit", type=int, dest="time_limit", default=0, help="Stop if this time limit (in miuntes) is exceeded.", ) def _add_start_by(self) -> None: self.arg_parser.add_argument( "--start-by", type=int, dest="start_by", default=0, help="Do not launch processes if this time (in seconds) has been exceeded.", ) def _add_end_by(self) -> None: self.arg_parser.add_argument( "--end-by", type=int, dest="end_by", default=0, help="Pass this to the processes using ENDBY variable.", ) def _add_max_runs(self) -> None: self.arg_parser.add_argument( "--max-runs", type=int, dest="max_runs", default=0, help="Stop if max runs have been exceeded. (default 0 - run all).", )
30.063898
88
0.541339
from argparse import ArgumentParser, Namespace from typing import List import uuid from .liftoff_config import LiftoffConfig class OptionParser: def __init__(self, name, arguments: List[str]) -> None: self.liftoff_config = LiftoffConfig() self.arg_parser = ArgumentParser(name) self.arguments = [str(arg) for arg in arguments] for arg in self.arguments: getattr(self, f"_add_{arg:s}")() def parse_args(self, args: List[str] = None, strict: bool = True) -> Namespace: if strict: opts = self.arg_parser.parse_args(args=args) else: opts = self.arg_parser.parse_known_args(args=args) for arg in self.arguments: if not hasattr(opts, arg) or getattr(opts, arg) is None: setattr(opts, arg, self.liftoff_config.get(arg)) if hasattr(opts, "verbose") and isinstance(opts.verbose, list): opts.verbose = len(opts.verbose) opts.session_id = str(uuid.uuid4()) return opts def _add_all(self) -> None: self.arg_parser.add_argument( "-a", "--all", action="store_true", dest="all", help="Target all experiments not just the latest.", ) def _add_append_to(self) -> None: self.arg_parser.add_argument( "--append-to", dest="append_to", required=False, type=str, help="Append files to some existing experiment.", ) def _add_args(self) -> None: self.arg_parser.add_argument( "--args", dest="args", type=str, nargs="*", help="Use these values to overwrite the config file.", ) def _add_copy_to_clipboard(self) -> None: self.arg_parser.add_argument( "--cc", action="store_true", dest="copy_to_clipboard", help="Copy experiment path to clipboard", ) def _add_config_path(self) -> None: self.arg_parser.add_argument( "config_path", type=str, help="Give a specific name to the experiment." ) def _add_do(self) -> None: self.arg_parser.add_argument( "--do", action="store_true", dest="do", help="Apply the actions (do not only simulate).", ) def _add_crashed_only(self) -> None: self.arg_parser.add_argument( "--crashed-only", action="store_true", dest="crashed_only", help="Apply the actions only to crashed subexperiments.", ) def _add_experiment(self) -> None: self.arg_parser.add_argument( "experiment", nargs="?", type=str, help="Give a specific name to the experiment.", ) def _add_filters(self) -> None: self.arg_parser.add_argument( "--filters", dest="filters", type=str, nargs="*", help="Use these values to filter experiments to be run.", ) def _add_gpus(self) -> None: self.arg_parser.add_argument( "--gpus", dest="gpus", nargs="*", default=[], help="Available GPUs" ) def _add_name(self) -> None: self.arg_parser.add_argument( "--name", dest="name", required=False, type=str, help="Give a specific name to the experiment.", ) def _add_optimize(self) -> None: self.arg_parser.add_argument( "-O", action="store_true", dest="optimize", help="Send -OO to python process.", ) def _add_overwrite(self) -> None: self.arg_parser.add_argument( "--overwrite", action="store_true", dest="overwrite", help="Overwrite files if you find them (not if .__end is there", ) def _add_no_detach(self) -> None: self.arg_parser.add_argument( "--no-detach", action="store_true", dest="no_detach", help="Do not detach the process with nohup.", ) def _add_per_gpu(self) -> None: self.arg_parser.add_argument( "--per-gpu", dest="per_gpu", nargs="*", type=int, default=[], help="Maximum procs to load on each GPU.", ) def _add_pid(self) -> None: self.arg_parser.add_argument("pid", type=int, help="PID of liftoff to kill.") def _add_procs_no(self) -> None: default_value = self.liftoff_config.get("procs_no") if default_value is None: default_value = 1 default_value = int(default_value) self.arg_parser.add_argument( "--procs-no", dest="procs_no", required=False, type=int, default=default_value, help="Number of runs for each sub-experiment", ) def _add_results_path(self) -> None: default_value = self.liftoff_config.get("results_path") if default_value is None: default_value = "./results" default_value = str(default_value) self.arg_parser.add_argument( "--results-path", dest="results_path", required=False, type=str, default=default_value, help="Specify the results folder.", ) def _add_runs_no(self) -> None: default_value = self.liftoff_config.get("runs_no") if default_value is None: default_value = 1 default_value = int(default_value) self.arg_parser.add_argument( "--runs-no", dest="runs_no", required=False, type=int, default=default_value, help="Number of runs for each sub-experiment", ) def _add_runs(self) -> None: self.arg_parser.add_argument( "--runs", dest="runs", required=True, type=int, nargs="+", help="Runs we refer to here.", ) def _add_safe(self) -> None: self.arg_parser.add_argument( "--safe", action="store_true", dest="safe", help="Do not clean ended, but locked ones.", ) def _add_script(self) -> None: self.arg_parser.add_argument( "script", type=str, help="Script to be executed with all those configs." ) def _add_clean_all(self) -> None: self.arg_parser.add_argument( "--clean-all", action="store_true", dest="clean_all", help="Clean *all* the files an experiment run produced.", ) def _add_timestamp_fmt(self) -> None: default_value = self.liftoff_config.get("timestamp_fmt") if default_value is None: default_value = "%Y%b%d-%H%M%S" default_value = str(default_value) self.arg_parser.add_argument( "--timestamp-fmt", type=str, dest="timestamp_fmt", default=default_value, help="Timestamp format to be used.", ) def _add_verbose(self) -> None: self.arg_parser.add_argument( "-v", const=1, dest="verbose", action="append_const", help="Verbose level (default: 0) e.g. -v / -vv / -vvv", ) def _add_session_id(self) -> None: self.arg_parser.add_argument( "--session-id", type=str, dest="session_id", required=True, help="Seesion id (needed to identify process by command).", ) def _add_time_limit(self) -> None: self.arg_parser.add_argument( "--time-limit", type=int, dest="time_limit", default=0, help="Stop if this time limit (in miuntes) is exceeded.", ) def _add_start_by(self) -> None: self.arg_parser.add_argument( "--start-by", type=int, dest="start_by", default=0, help="Do not launch processes if this time (in seconds) has been exceeded.", ) def _add_end_by(self) -> None: self.arg_parser.add_argument( "--end-by", type=int, dest="end_by", default=0, help="Pass this to the processes using ENDBY variable.", ) def _add_max_runs(self) -> None: self.arg_parser.add_argument( "--max-runs", type=int, dest="max_runs", default=0, help="Stop if max runs have been exceeded. (default 0 - run all).", )
true
true
f71e45e2769e046b231ac437204558ee5ddd0b98
2,984
py
Python
vaas-app/src/vaas/configuration/tests/test_loader.py
allegro/vaas
3d2d1f1a9dae6ac69a13563a37f9bfdf4f986ae2
[ "Apache-2.0" ]
251
2015-09-02T10:50:51.000Z
2022-03-16T08:00:35.000Z
vaas-app/src/vaas/configuration/tests/test_loader.py
allegro/vaas
3d2d1f1a9dae6ac69a13563a37f9bfdf4f986ae2
[ "Apache-2.0" ]
154
2015-09-02T14:54:08.000Z
2022-03-16T08:34:17.000Z
vaas-app/src/vaas/configuration/tests/test_loader.py
allegro/vaas
3d2d1f1a9dae6ac69a13563a37f9bfdf4f986ae2
[ "Apache-2.0" ]
31
2015-09-03T07:51:05.000Z
2020-09-24T09:02:40.000Z
# -*- coding: utf-8 -*- from __future__ import unicode_literals, absolute_import from unittest.mock import patch, mock_open from nose.tools import assert_equals from django.test import TestCase from vaas.configuration.loader import YamlConfigLoader USER_HOME_PATH = '/user/path/.vaas' VAAS_APP_RESOURCES_PATH = '/vaas/app/resources' class YamlConfigLoaderTest(TestCase): def file_exists_side_effect(self, arg): return arg in self.file_existence and self.file_existence[arg] def setUp(self): self.file_existence = {} exists_patcher = patch('os.path.exists') file_exists_mock = exists_patcher.start() file_exists_mock.side_effect = self.file_exists_side_effect expand_patcher = patch('os.path.expanduser') expanduser_mock = expand_patcher.start() expanduser_mock.return_value = USER_HOME_PATH abspath_patcher = patch('os.path.abspath') abspath_mock = abspath_patcher.start() abspath_mock.return_value = VAAS_APP_RESOURCES_PATH self.addCleanup(exists_patcher.stop) self.addCleanup(expand_patcher.stop) self.addCleanup(abspath_patcher.stop) def test_should_init_search_paths_with_user_and_resources_paths_if_user_path_exists(self): self.file_existence = { USER_HOME_PATH: True } directories = YamlConfigLoader().config_directories assert_equals(2, len(directories)) assert_equals([USER_HOME_PATH, VAAS_APP_RESOURCES_PATH], directories) def test_should_determine_file_from_users_location_if_exists(self): expected_path = "{}/{}".format(USER_HOME_PATH, 'test.yaml') self.file_existence = { USER_HOME_PATH: True, expected_path: True } assert_equals(expected_path, YamlConfigLoader().determine_config_file('test.yaml')) def test_should_determine_file_from_resource_location_if_exists(self): expected_path = "{}/{}".format(VAAS_APP_RESOURCES_PATH, 'test.yaml') self.file_existence = { USER_HOME_PATH: False, expected_path: True } assert_equals(expected_path, YamlConfigLoader().determine_config_file('test.yaml')) def test_should_not_determine_file_if_not_exists_in_any_location(self): resource_path = "{}/{}".format(VAAS_APP_RESOURCES_PATH, 'test.yaml') self.file_existence = { USER_HOME_PATH: False, resource_path: False } assert_equals(None, YamlConfigLoader().determine_config_file('test.yaml')) @patch('builtins.open', mock_open(read_data="key1: value1\nkey2: value2")) def test_should_return_config_tree(self): expected_tree = {'key1': 'value1', 'key2': 'value2'} self.file_existence = { USER_HOME_PATH: False, "{}/{}".format(VAAS_APP_RESOURCES_PATH, 'test.yaml'): True } assert_equals(expected_tree, YamlConfigLoader().get_config_tree('test.yaml'))
37.772152
94
0.699397
from __future__ import unicode_literals, absolute_import from unittest.mock import patch, mock_open from nose.tools import assert_equals from django.test import TestCase from vaas.configuration.loader import YamlConfigLoader USER_HOME_PATH = '/user/path/.vaas' VAAS_APP_RESOURCES_PATH = '/vaas/app/resources' class YamlConfigLoaderTest(TestCase): def file_exists_side_effect(self, arg): return arg in self.file_existence and self.file_existence[arg] def setUp(self): self.file_existence = {} exists_patcher = patch('os.path.exists') file_exists_mock = exists_patcher.start() file_exists_mock.side_effect = self.file_exists_side_effect expand_patcher = patch('os.path.expanduser') expanduser_mock = expand_patcher.start() expanduser_mock.return_value = USER_HOME_PATH abspath_patcher = patch('os.path.abspath') abspath_mock = abspath_patcher.start() abspath_mock.return_value = VAAS_APP_RESOURCES_PATH self.addCleanup(exists_patcher.stop) self.addCleanup(expand_patcher.stop) self.addCleanup(abspath_patcher.stop) def test_should_init_search_paths_with_user_and_resources_paths_if_user_path_exists(self): self.file_existence = { USER_HOME_PATH: True } directories = YamlConfigLoader().config_directories assert_equals(2, len(directories)) assert_equals([USER_HOME_PATH, VAAS_APP_RESOURCES_PATH], directories) def test_should_determine_file_from_users_location_if_exists(self): expected_path = "{}/{}".format(USER_HOME_PATH, 'test.yaml') self.file_existence = { USER_HOME_PATH: True, expected_path: True } assert_equals(expected_path, YamlConfigLoader().determine_config_file('test.yaml')) def test_should_determine_file_from_resource_location_if_exists(self): expected_path = "{}/{}".format(VAAS_APP_RESOURCES_PATH, 'test.yaml') self.file_existence = { USER_HOME_PATH: False, expected_path: True } assert_equals(expected_path, YamlConfigLoader().determine_config_file('test.yaml')) def test_should_not_determine_file_if_not_exists_in_any_location(self): resource_path = "{}/{}".format(VAAS_APP_RESOURCES_PATH, 'test.yaml') self.file_existence = { USER_HOME_PATH: False, resource_path: False } assert_equals(None, YamlConfigLoader().determine_config_file('test.yaml')) @patch('builtins.open', mock_open(read_data="key1: value1\nkey2: value2")) def test_should_return_config_tree(self): expected_tree = {'key1': 'value1', 'key2': 'value2'} self.file_existence = { USER_HOME_PATH: False, "{}/{}".format(VAAS_APP_RESOURCES_PATH, 'test.yaml'): True } assert_equals(expected_tree, YamlConfigLoader().get_config_tree('test.yaml'))
true
true
f71e4676c5acc3e5917505e1ba0ea632737ca9e1
1,666
py
Python
config/wsgi.py
Maharshi-Pathak/gumroad-clone
97ab1bd71585ee7a4279ad0189980e1b69c31948
[ "MIT" ]
11
2021-04-22T06:26:42.000Z
2022-03-27T21:19:57.000Z
config/wsgi.py
Maharshi-Pathak/gumroad-clone
97ab1bd71585ee7a4279ad0189980e1b69c31948
[ "MIT" ]
null
null
null
config/wsgi.py
Maharshi-Pathak/gumroad-clone
97ab1bd71585ee7a4279ad0189980e1b69c31948
[ "MIT" ]
6
2021-02-10T18:12:27.000Z
2022-03-14T02:17:38.000Z
""" WSGI config for djgumroad project. This module contains the WSGI application used by Django's development server and any production WSGI deployments. It should expose a module-level variable named ``application``. Django's ``runserver`` and ``runfcgi`` commands discover this application via the ``WSGI_APPLICATION`` setting. Usually you will have the standard Django WSGI application here, but it also might make sense to replace the whole Django WSGI application with a custom one that later delegates to the Django one. For example, you could introduce WSGI middleware here, or combine a Django application with an application of another framework. """ import os import sys from pathlib import Path from django.core.wsgi import get_wsgi_application # This allows easy placement of apps within the interior # djgumroad directory. ROOT_DIR = Path(__file__).resolve(strict=True).parent.parent sys.path.append(str(ROOT_DIR / "djgumroad")) # We defer to a DJANGO_SETTINGS_MODULE already in the environment. This breaks # if running multiple sites in the same mod_wsgi process. To fix this, use # mod_wsgi daemon mode with each site in its own daemon process, or use # os.environ["DJANGO_SETTINGS_MODULE"] = "config.settings.production" os.environ.setdefault("DJANGO_SETTINGS_MODULE", "config.settings.production") # This application object is used by any WSGI server configured to use this # file. This includes Django's development server, if the WSGI_APPLICATION # setting points here. application = get_wsgi_application() # Apply WSGI middleware here. # from helloworld.wsgi import HelloWorldApplication # application = HelloWorldApplication(application)
42.717949
79
0.803121
import os import sys from pathlib import Path from django.core.wsgi import get_wsgi_application ROOT_DIR = Path(__file__).resolve(strict=True).parent.parent sys.path.append(str(ROOT_DIR / "djgumroad")) os.environ.setdefault("DJANGO_SETTINGS_MODULE", "config.settings.production") # setting points here. application = get_wsgi_application() # Apply WSGI middleware here. # from helloworld.wsgi import HelloWorldApplication # application = HelloWorldApplication(application)
true
true
f71e473268e1bb2e5e8d4a270d302baf99209cad
196
py
Python
Python Projects/Find the area of a circle.py
perfect104/python-codes
b8994b1f92f88068c2a36a82e32784b093a8d0df
[ "MIT" ]
4
2019-10-24T03:56:53.000Z
2020-01-07T08:16:42.000Z
Python Projects/Find the area of a circle.py
perfect104/python-codes
b8994b1f92f88068c2a36a82e32784b093a8d0df
[ "MIT" ]
null
null
null
Python Projects/Find the area of a circle.py
perfect104/python-codes
b8994b1f92f88068c2a36a82e32784b093a8d0df
[ "MIT" ]
4
2019-12-30T08:10:27.000Z
2020-03-02T05:06:23.000Z
''' Formula for area of circle Area = pi * r^2 where pi is constant and r is the radius of the circle ''' def findarea(r): PI = 3.142 return PI * (r*r); print("Area is %.6f" % findarea(5));
15.076923
55
0.627551
def findarea(r): PI = 3.142 return PI * (r*r); print("Area is %.6f" % findarea(5));
true
true
f71e48b11e64356393129e207a4d9e71cf25e746
45
py
Python
barrelseq/analysis/__init__.py
BeckResearchLab/barrelseq
044b9f69f10b4b0413231d821ea80af1c7c31544
[ "MIT" ]
1
2021-11-27T08:35:15.000Z
2021-11-27T08:35:15.000Z
barrelseq/analysis/__init__.py
BeckResearchLab/barrelseq
044b9f69f10b4b0413231d821ea80af1c7c31544
[ "MIT" ]
5
2018-09-19T21:50:01.000Z
2019-07-16T22:14:52.000Z
barrelseq/analysis/__init__.py
BeckResearchLab/barrelseq
044b9f69f10b4b0413231d821ea80af1c7c31544
[ "MIT" ]
null
null
null
from .deseq2 import * from .example import *
15
22
0.733333
from .deseq2 import * from .example import *
true
true
f71e48d15d84ca1874a3d3991f474a16272b83ef
5,583
py
Python
GuoxiSuspensionBridge01/GuoxiSuspensionBridge01/StructureSketch.py
zjkl19/AbaqusPython
d9c72d15f8928f1938cee46a4b39e2c44b03b62f
[ "MIT" ]
16
2018-05-06T06:09:52.000Z
2022-03-29T08:50:00.000Z
GuoxiSuspensionBridge01/GuoxiSuspensionBridge01/StructureSketch.py
zjkl19/AbaqusPython
d9c72d15f8928f1938cee46a4b39e2c44b03b62f
[ "MIT" ]
null
null
null
GuoxiSuspensionBridge01/GuoxiSuspensionBridge01/StructureSketch.py
zjkl19/AbaqusPython
d9c72d15f8928f1938cee46a4b39e2c44b03b62f
[ "MIT" ]
12
2018-04-04T08:32:56.000Z
2021-08-24T11:34:36.000Z
class StructureSketch(object): """Create 'Sketch' of the structure""" def __init__(self,structureModel,structureGeometry): """init Required argument: Optional arguments: None. Return value: Exceptions: None. """ self.structureGeometry=structureGeometry self.structureModel=structureModel def CreateSketch(self): """Create Sketch function summary Args: structureGeometry: structureGeometry instance Returns: Raises: """ #design pattern: builder self.__CreateTowerSketch() self.__CreateStiffeningGirderSketch() self.__CreateGirderRigidarmSketch() self.__CreateCableSketch() self.__CreateSuspenderSketch(); def __CreateTowerSketch(self): """CreateTowerSketch function summary Args: Returns: Raises: """ #Tower: dTB=self.structureGeometry.downTowerBottomCoordinate rUD=self.structureGeometry.rUpDownTowerCoordinate uTT=self.structureGeometry.upTowerTopCoordinate self.towerSketch=[] for i in range(0,2): mySketch = self.structureModel.ConstrainedSketch(name='towerSketch'+str(i+1),sheetSize=10.0) #dTB[0][0][0]: 1# tower, 1# tower column, x coordinate mySketch.Line(point1=(dTB[i][0][0],dTB[i][0][1]), point2=(rUD[i][0][0],rUD[i][0][1])) mySketch.Line(point1=(rUD[i][0][0],rUD[i][0][1]), point2=(uTT[i][0][0],uTT[i][0][1])) mySketch.Line(point1=(uTT[i][0][0],uTT[i][0][1]), point2=(uTT[i][1][0]+(uTT[i][1][2]-uTT[i][0][2]),uTT[i][1][1])) mySketch.Line(point1=(uTT[i][1][0]+(uTT[i][1][2]-uTT[i][0][2]),uTT[i][1][1]), point2=(rUD[i][1][0]+(rUD[i][1][2]-rUD[i][0][2]),rUD[i][1][1])) mySketch.Line(point1=(rUD[i][1][0]+(rUD[i][1][2]-rUD[i][0][2]),rUD[i][1][1]), point2=(dTB[i][1][0]+(dTB[i][1][2]-dTB[i][0][2]),dTB[i][1][1])) self.towerSketch.append(mySketch) self.towerSketch=tuple(self.towerSketch) def __CreateStiffeningGirderSketch(self): """Create Stiffening Girder Sketch function summary Args: Returns: Raises: """ eP=self.structureGeometry.EndPointCoordinate rGR=self.structureGeometry.rGirderRigidarmCoordinate rRS=self.structureGeometry.rRigidarmSuspenderCoordinate #stiffeningGirderCoordinate=(eP[0],rGRC[0],eP[1]) lst=[] lst.append(eP[0]) for i in range(len(rGR)): lst.append(rGR[i]) lst.append(eP[1]) stiffeningGirderCoordinate=tuple(lst) sG=stiffeningGirderCoordinate mySketch = self.structureModel.ConstrainedSketch(name='stiffeningGirderSketch',sheetSize=10.0) for i in range(len(sG)-1): mySketch.Line(point1=(sG[i][0],sG[i][1]), point2=(sG[i+1][0],sG[i+1][1])) self.stiffeningGirderSketch=mySketch def __CreateGirderRigidarmSketch(self): """Create Girder Rigidarm Sketch function summary Args: Returns: Raises: """ rGR=self.structureGeometry.rGirderRigidarmCoordinate rRS=self.structureGeometry.rRigidarmSuspenderCoordinate #create GirderRigidarm Sketch girderRigidarmSketch=[] for i in range(len(rGR)): mySketch = self.structureModel.ConstrainedSketch(name='girderRigidarmSketch'+str(i+1),sheetSize=10.0) mySketch.Line(point1=(rRS[0][i][0]+rRS[0][i][2],rRS[0][i][1]), point2=(rGR[i][0],rGR[i][1])) mySketch.Line(point1=(rGR[i][0],rGR[i][1]), point2=(rRS[1][i][0]+rRS[1][i][2],rRS[1][i][1])) girderRigidarmSketch.append(mySketch) #rRS[0][i][2] is negative self.girderRigidarmSketch=tuple(girderRigidarmSketch) def __CreateCableSketch(self): """Create Cable Sketch function summary Args: Returns: Raises: """ #cable cableCoordinate=self.structureGeometry.cableCoordinate self.cableSketch=[] cableSketch=[] for i in range(len(cableCoordinate)): mySketch = self.structureModel.ConstrainedSketch(name='cableSketch'+str(i+1),sheetSize=10.0) for j in range(len(cableCoordinate[i])-1): mySketch.Line(point1=(cableCoordinate[i][j][0],cableCoordinate[i][j][1]), point2=(cableCoordinate[i][j+1][0],cableCoordinate[i][j+1][1])) cableSketch.append(mySketch) self.cableSketch=tuple(cableSketch) def __CreateSuspenderSketch(self): """Create Suspender Sketch function summary Args: Returns: Raises: """ hP=self.structureGeometry.hangingPointCoordinate rRS=self.structureGeometry.rRigidarmSuspenderCoordinate self.suspenderSketch=[] suspenderSketch=[] for i in range(len(rRS)): for j in range(len(rRS[0])): mySketch = self.structureModel.ConstrainedSketch(name='girderRigidarmSketch'+str(i+1)+'-'+str(j+1),sheetSize=10.0) mySketch.Line(point1=(hP[i][j][0],hP[i][j][1]), point2=(rRS[i][j][0],rRS[i][j][1])) suspenderSketch.append(mySketch) self.suspenderSketch.append(tuple(suspenderSketch)) self.suspenderSketch=tuple(self.suspenderSketch)
31.016667
153
0.587319
class StructureSketch(object): def __init__(self,structureModel,structureGeometry): self.structureGeometry=structureGeometry self.structureModel=structureModel def CreateSketch(self): self.__CreateTowerSketch() self.__CreateStiffeningGirderSketch() self.__CreateGirderRigidarmSketch() self.__CreateCableSketch() self.__CreateSuspenderSketch(); def __CreateTowerSketch(self): dTB=self.structureGeometry.downTowerBottomCoordinate rUD=self.structureGeometry.rUpDownTowerCoordinate uTT=self.structureGeometry.upTowerTopCoordinate self.towerSketch=[] for i in range(0,2): mySketch = self.structureModel.ConstrainedSketch(name='towerSketch'+str(i+1),sheetSize=10.0) nt2=(rUD[i][0][0],rUD[i][0][1])) mySketch.Line(point1=(rUD[i][0][0],rUD[i][0][1]), point2=(uTT[i][0][0],uTT[i][0][1])) mySketch.Line(point1=(uTT[i][0][0],uTT[i][0][1]), point2=(uTT[i][1][0]+(uTT[i][1][2]-uTT[i][0][2]),uTT[i][1][1])) mySketch.Line(point1=(uTT[i][1][0]+(uTT[i][1][2]-uTT[i][0][2]),uTT[i][1][1]), point2=(rUD[i][1][0]+(rUD[i][1][2]-rUD[i][0][2]),rUD[i][1][1])) mySketch.Line(point1=(rUD[i][1][0]+(rUD[i][1][2]-rUD[i][0][2]),rUD[i][1][1]), point2=(dTB[i][1][0]+(dTB[i][1][2]-dTB[i][0][2]),dTB[i][1][1])) self.towerSketch.append(mySketch) self.towerSketch=tuple(self.towerSketch) def __CreateStiffeningGirderSketch(self): eP=self.structureGeometry.EndPointCoordinate rGR=self.structureGeometry.rGirderRigidarmCoordinate rRS=self.structureGeometry.rRigidarmSuspenderCoordinate lst=[] lst.append(eP[0]) for i in range(len(rGR)): lst.append(rGR[i]) lst.append(eP[1]) stiffeningGirderCoordinate=tuple(lst) sG=stiffeningGirderCoordinate mySketch = self.structureModel.ConstrainedSketch(name='stiffeningGirderSketch',sheetSize=10.0) for i in range(len(sG)-1): mySketch.Line(point1=(sG[i][0],sG[i][1]), point2=(sG[i+1][0],sG[i+1][1])) self.stiffeningGirderSketch=mySketch def __CreateGirderRigidarmSketch(self): rGR=self.structureGeometry.rGirderRigidarmCoordinate rRS=self.structureGeometry.rRigidarmSuspenderCoordinate girderRigidarmSketch=[] for i in range(len(rGR)): mySketch = self.structureModel.ConstrainedSketch(name='girderRigidarmSketch'+str(i+1),sheetSize=10.0) mySketch.Line(point1=(rRS[0][i][0]+rRS[0][i][2],rRS[0][i][1]), point2=(rGR[i][0],rGR[i][1])) mySketch.Line(point1=(rGR[i][0],rGR[i][1]), point2=(rRS[1][i][0]+rRS[1][i][2],rRS[1][i][1])) girderRigidarmSketch.append(mySketch) self.girderRigidarmSketch=tuple(girderRigidarmSketch) def __CreateCableSketch(self): cableCoordinate=self.structureGeometry.cableCoordinate self.cableSketch=[] cableSketch=[] for i in range(len(cableCoordinate)): mySketch = self.structureModel.ConstrainedSketch(name='cableSketch'+str(i+1),sheetSize=10.0) for j in range(len(cableCoordinate[i])-1): mySketch.Line(point1=(cableCoordinate[i][j][0],cableCoordinate[i][j][1]), point2=(cableCoordinate[i][j+1][0],cableCoordinate[i][j+1][1])) cableSketch.append(mySketch) self.cableSketch=tuple(cableSketch) def __CreateSuspenderSketch(self): hP=self.structureGeometry.hangingPointCoordinate rRS=self.structureGeometry.rRigidarmSuspenderCoordinate self.suspenderSketch=[] suspenderSketch=[] for i in range(len(rRS)): for j in range(len(rRS[0])): mySketch = self.structureModel.ConstrainedSketch(name='girderRigidarmSketch'+str(i+1)+'-'+str(j+1),sheetSize=10.0) mySketch.Line(point1=(hP[i][j][0],hP[i][j][1]), point2=(rRS[i][j][0],rRS[i][j][1])) suspenderSketch.append(mySketch) self.suspenderSketch.append(tuple(suspenderSketch)) self.suspenderSketch=tuple(self.suspenderSketch)
true
true
f71e48d95b34d49d935b2dc902be37364d27fbf9
3,413
py
Python
marmot/features/source_lm_feature_extractor.py
qe-team/marmot
38e09ff1d0a3025a6b7edeaaf6086ed047ec45ff
[ "0BSD" ]
19
2015-08-21T13:06:37.000Z
2021-07-26T09:56:29.000Z
marmot/features/source_lm_feature_extractor.py
qe-team/marmot
38e09ff1d0a3025a6b7edeaaf6086ed047ec45ff
[ "0BSD" ]
36
2015-01-13T13:01:07.000Z
2016-06-22T06:59:59.000Z
marmot/features/source_lm_feature_extractor.py
qe-team/marmot
38e09ff1d0a3025a6b7edeaaf6086ed047ec45ff
[ "0BSD" ]
8
2015-12-11T16:41:47.000Z
2019-04-08T16:28:40.000Z
import codecs from subprocess import call import os from collections import defaultdict from marmot.features.feature_extractor import FeatureExtractor from marmot.util.ngram_window_extractor import left_context, right_context from marmot.experiment.import_utils import mk_tmp_dir from marmot.exceptions.no_data_error import NoDataError # Class that extracts various LM features for source class SourceLMFeatureExtractor(FeatureExtractor): def __init__(self, ngram_file=None, corpus_file=None, srilm=None, tmp_dir=None, order=5): # generate ngram counts if ngram_file is None: if srilm is None: if 'SRILM' in os.environ: srilm = os.environ['SRILM'] else: print("No SRILM found") return if corpus_file is None: print ("No corpus for LM generation") return srilm_ngram_count = os.path.join(srilm, 'ngram-count') tmp_dir = mk_tmp_dir(tmp_dir) lm_file = os.path.join(tmp_dir, 'lm_file') ngram_file = os.path.join(tmp_dir, 'ngram_count_file') call([srilm_ngram_count, '-text', corpus_file, '-lm', lm_file, '-order', str(order), '-write', ngram_file]) self.lm = defaultdict(int) for line in codecs.open(ngram_file, encoding='utf-8'): chunks = line[:-1].split('\t') if len(chunks) == 2: new_tuple = tuple(chunks[0].split()) new_number = int(chunks[1]) self.lm[new_tuple] = new_number else: print("Wrong ngram-counts file format at line '", line[:-1], "'") self.order = order def check_lm(self, ngram, side='left'): for i in range(self.order, 0, -1): if side == 'left': cur_ngram = ngram[len(ngram)-i:] elif side == 'right': cur_ngram = ngram[:i] else: print("Unknown parameter 'side'", side) return 0 if tuple(cur_ngram) in self.lm: return i return 0 # returns a set of features related to LM # currently extracting: highest order ngram including the word and its LEFT context, # highest order ngram including the word and its RIGHT context def get_features(self, context_obj): if 'source' not in context_obj: raise NoDataError('source', context_obj, 'SourceLMFeatureExtractor') if 'alignments' not in context_obj: raise NoDataError('alignments', context_obj, 'SourceLMFeatureExtractor') align_idx = context_obj['alignments'][context_obj['index']] # unaligned if align_idx is None: return [0, 0] align_token = context_obj['source'][align_idx] left_ngram = left_context(context_obj['source'], align_token, context_size=2, idx=align_idx) + [align_token] right_ngram = [align_token] + right_context(context_obj['source'], align_token, context_size=2, idx=align_idx) left_ngram_order = self.check_lm(left_ngram, side='left') right_ngram_order = self.check_lm(right_ngram, side='right') return [left_ngram_order, right_ngram_order] def get_feature_names(self): return ['source_highest_order_ngram_left', 'source_highest_order_ngram_right']
41.621951
119
0.619982
import codecs from subprocess import call import os from collections import defaultdict from marmot.features.feature_extractor import FeatureExtractor from marmot.util.ngram_window_extractor import left_context, right_context from marmot.experiment.import_utils import mk_tmp_dir from marmot.exceptions.no_data_error import NoDataError class SourceLMFeatureExtractor(FeatureExtractor): def __init__(self, ngram_file=None, corpus_file=None, srilm=None, tmp_dir=None, order=5): if ngram_file is None: if srilm is None: if 'SRILM' in os.environ: srilm = os.environ['SRILM'] else: print("No SRILM found") return if corpus_file is None: print ("No corpus for LM generation") return srilm_ngram_count = os.path.join(srilm, 'ngram-count') tmp_dir = mk_tmp_dir(tmp_dir) lm_file = os.path.join(tmp_dir, 'lm_file') ngram_file = os.path.join(tmp_dir, 'ngram_count_file') call([srilm_ngram_count, '-text', corpus_file, '-lm', lm_file, '-order', str(order), '-write', ngram_file]) self.lm = defaultdict(int) for line in codecs.open(ngram_file, encoding='utf-8'): chunks = line[:-1].split('\t') if len(chunks) == 2: new_tuple = tuple(chunks[0].split()) new_number = int(chunks[1]) self.lm[new_tuple] = new_number else: print("Wrong ngram-counts file format at line '", line[:-1], "'") self.order = order def check_lm(self, ngram, side='left'): for i in range(self.order, 0, -1): if side == 'left': cur_ngram = ngram[len(ngram)-i:] elif side == 'right': cur_ngram = ngram[:i] else: print("Unknown parameter 'side'", side) return 0 if tuple(cur_ngram) in self.lm: return i return 0 def get_features(self, context_obj): if 'source' not in context_obj: raise NoDataError('source', context_obj, 'SourceLMFeatureExtractor') if 'alignments' not in context_obj: raise NoDataError('alignments', context_obj, 'SourceLMFeatureExtractor') align_idx = context_obj['alignments'][context_obj['index']] if align_idx is None: return [0, 0] align_token = context_obj['source'][align_idx] left_ngram = left_context(context_obj['source'], align_token, context_size=2, idx=align_idx) + [align_token] right_ngram = [align_token] + right_context(context_obj['source'], align_token, context_size=2, idx=align_idx) left_ngram_order = self.check_lm(left_ngram, side='left') right_ngram_order = self.check_lm(right_ngram, side='right') return [left_ngram_order, right_ngram_order] def get_feature_names(self): return ['source_highest_order_ngram_left', 'source_highest_order_ngram_right']
true
true
f71e495c79f4bb1a1505cad9bdde64d7e37c7ba1
1,293
py
Python
proxy/core/tls/certificate.py
fisabiliyusri/proxy
29934503251b704813ef3e7ed8c2a5ae69448c8a
[ "BSD-3-Clause" ]
null
null
null
proxy/core/tls/certificate.py
fisabiliyusri/proxy
29934503251b704813ef3e7ed8c2a5ae69448c8a
[ "BSD-3-Clause" ]
8
2022-01-23T10:51:59.000Z
2022-03-29T22:11:57.000Z
proxy/core/tls/certificate.py
fisabiliyusri/proxy
29934503251b704813ef3e7ed8c2a5ae69448c8a
[ "BSD-3-Clause" ]
null
null
null
# -*- coding: utf-8 -*- """ proxy.py ~~~~~~~~ ⚡⚡⚡ Fast, Lightweight, Pluggable, TLS interception capable proxy server focused on Network monitoring, controls & Application development, testing, debugging. :copyright: (c) 2013-present by Abhinav Singh and contributors. :license: BSD, see LICENSE for more details. """ from typing import Tuple, Optional class TlsCertificate: """TLS Certificate""" def __init__(self) -> None: self.data: Optional[bytes] = None def parse(self, raw: bytes) -> Tuple[bool, bytes]: self.data = raw return True, raw def build(self) -> bytes: assert self.data return self.data class TlsCertificateRequest: """TLS Certificate Request""" def __init__(self) -> None: self.data: Optional[bytes] = None def parse(self, raw: bytes) -> Tuple[bool, bytes]: return False, raw def build(self) -> bytes: assert self.data return self.data class TlsCertificateVerify: """TLS Certificate Verify""" def __init__(self) -> None: self.data: Optional[bytes] = None def parse(self, raw: bytes) -> Tuple[bool, bytes]: return False, raw def build(self) -> bytes: assert self.data return self.data
23.509091
86
0.622583
from typing import Tuple, Optional class TlsCertificate: def __init__(self) -> None: self.data: Optional[bytes] = None def parse(self, raw: bytes) -> Tuple[bool, bytes]: self.data = raw return True, raw def build(self) -> bytes: assert self.data return self.data class TlsCertificateRequest: def __init__(self) -> None: self.data: Optional[bytes] = None def parse(self, raw: bytes) -> Tuple[bool, bytes]: return False, raw def build(self) -> bytes: assert self.data return self.data class TlsCertificateVerify: def __init__(self) -> None: self.data: Optional[bytes] = None def parse(self, raw: bytes) -> Tuple[bool, bytes]: return False, raw def build(self) -> bytes: assert self.data return self.data
true
true
f71e4a16ec710380ca862000c177dc158aa1e97f
3,879
py
Python
template_registrator.py
Nepmia/N4-Framework
84d98f3fe05ca02f938332e5970bca5482ef8ce7
[ "MIT" ]
null
null
null
template_registrator.py
Nepmia/N4-Framework
84d98f3fe05ca02f938332e5970bca5482ef8ce7
[ "MIT" ]
null
null
null
template_registrator.py
Nepmia/N4-Framework
84d98f3fe05ca02f938332e5970bca5482ef8ce7
[ "MIT" ]
null
null
null
import os import app from termcolor import colored from write import write import re from pathlib import Path from template_handler import templates_lister def template_registrator(): """Get templateRegistrator module path and call template module and exporter functions """ module_path = f"{app.MODULE_FOLDER}/TemplateRegistrator/templates.js" print( colored("[N4] ", "blue"), colored("Begining TemplateRegistrator module...", "cyan") ) print( colored("[N4] ", "blue"), colored("Module folder is", "cyan"), colored(module_path, "red") ) templates_list = templates_lister() templates_module(module_path) templates_exporter(templates_list, module_path) def templates_module(module_path): """Tests if template.js exists and clear it then rewrites a blank const template Args: module_path (string): path to templateRegistrator module """ base_template = "const Templates = {\n" # Basic JS const list template print( colored("[N4] ", "blue") ,colored("Testing", "cyan") ,colored("template.js", "red") ) if os.path.exists(module_path): # Test if template.js already exists, if it does then it clears it. print( colored("[N4] ", "blue"), colored("test positive, clearing content to rewrite updated templates list...", "cyan") ) os.remove(module_path) write(module_path, base_template, "w") else: print( colored("[N4] ", "blue"), colored("test negaticve, creating and writing templates list", "cyan") ) write(module_path, base_template, "w") def templates_exporter(templates_list, module_path): """Writes template.js by extracting titles of templates in template_list. It writes them in a js list like "home" : Tiltle, "page": Title and then close the list. Args: templates_list (list): List containing templates file names module_path (string): path to templateRegistrator module """ for item in templates_list: title = title_extractor(f"{app.PAGES_FOLDER}/{item}") # Get template title using title_extractor() parsed_item = item.replace(".html", "") if title == None: print( colored("[N4] ", "blue"), colored("Given value is incorect, skipping.", "cyan") ) pass else: write(module_path, f" {parsed_item} : \"{title}\",\n", "a") write(module_path, "},", "a") print( colored("[N4] ", "blue"), colored("Finished to build template list for InstantNav, building pages..", "cyan") ) def title_extractor(file): """Extracts titles from template using regex Args: file (string): path to the file the function need to work on, usually a template Returns: [string]: return a correctly parsed title so it can be writen in template.js """ print( colored("[N4] ", "blue"), colored("Extracting title of", "cyan"), colored(file,"red") ) try: raw_read = Path(file).read_text() var_match = re.search(app.PAGE_TITLE_REGEX, raw_read) var_content = var_match[0].replace("pageTitle=", "").replace("_", " ").replace("-", " ").replace("\"","") print( colored("[N4] ", "blue"), colored(var_content, "red"), colored("extracted.", "cyan") ) return var_content except TypeError: print( colored("[N4] ", "blue"), colored("TypeError!", "red"), colored("Couldn't extract the title, make sure it respect the syntax as following:", "cyan"), colored("pageTitle=\"YourTitle\"", "green") )
34.945946
169
0.593194
import os import app from termcolor import colored from write import write import re from pathlib import Path from template_handler import templates_lister def template_registrator(): module_path = f"{app.MODULE_FOLDER}/TemplateRegistrator/templates.js" print( colored("[N4] ", "blue"), colored("Begining TemplateRegistrator module...", "cyan") ) print( colored("[N4] ", "blue"), colored("Module folder is", "cyan"), colored(module_path, "red") ) templates_list = templates_lister() templates_module(module_path) templates_exporter(templates_list, module_path) def templates_module(module_path): base_template = "const Templates = {\n" print( colored("[N4] ", "blue") ,colored("Testing", "cyan") ,colored("template.js", "red") ) if os.path.exists(module_path): print( colored("[N4] ", "blue"), colored("test positive, clearing content to rewrite updated templates list...", "cyan") ) os.remove(module_path) write(module_path, base_template, "w") else: print( colored("[N4] ", "blue"), colored("test negaticve, creating and writing templates list", "cyan") ) write(module_path, base_template, "w") def templates_exporter(templates_list, module_path): for item in templates_list: title = title_extractor(f"{app.PAGES_FOLDER}/{item}") parsed_item = item.replace(".html", "") if title == None: print( colored("[N4] ", "blue"), colored("Given value is incorect, skipping.", "cyan") ) pass else: write(module_path, f" {parsed_item} : \"{title}\",\n", "a") write(module_path, "},", "a") print( colored("[N4] ", "blue"), colored("Finished to build template list for InstantNav, building pages..", "cyan") ) def title_extractor(file): print( colored("[N4] ", "blue"), colored("Extracting title of", "cyan"), colored(file,"red") ) try: raw_read = Path(file).read_text() var_match = re.search(app.PAGE_TITLE_REGEX, raw_read) var_content = var_match[0].replace("pageTitle=", "").replace("_", " ").replace("-", " ").replace("\"","") print( colored("[N4] ", "blue"), colored(var_content, "red"), colored("extracted.", "cyan") ) return var_content except TypeError: print( colored("[N4] ", "blue"), colored("TypeError!", "red"), colored("Couldn't extract the title, make sure it respect the syntax as following:", "cyan"), colored("pageTitle=\"YourTitle\"", "green") )
true
true
f71e4ba69c62e1f2c427e125b8d3019de0eb2970
28
py
Python
try.py
zf-nobody/pyaudio_portaudio
8f703866e6b3d9aad30792fbd07fa63d504505f2
[ "MIT" ]
null
null
null
try.py
zf-nobody/pyaudio_portaudio
8f703866e6b3d9aad30792fbd07fa63d504505f2
[ "MIT" ]
null
null
null
try.py
zf-nobody/pyaudio_portaudio
8f703866e6b3d9aad30792fbd07fa63d504505f2
[ "MIT" ]
null
null
null
print("I am having a try.")
14
27
0.642857
print("I am having a try.")
true
true
f71e4c36153dcf173b1175cf8407c1244cc5dba5
19,855
py
Python
isapi_wsgi.py
vbolshakov/isapi-wsgi
0b3f7c9dbc72b4aa10203abbfa15fc51c2f11386
[ "MIT" ]
14
2015-03-16T13:39:05.000Z
2022-03-28T15:26:46.000Z
isapi_wsgi.py
vbolshakov/isapi-wsgi
0b3f7c9dbc72b4aa10203abbfa15fc51c2f11386
[ "MIT" ]
4
2015-03-14T03:58:08.000Z
2019-07-05T12:28:06.000Z
isapi_wsgi.py
vbolshakov/isapi-wsgi
0b3f7c9dbc72b4aa10203abbfa15fc51c2f11386
[ "MIT" ]
6
2016-02-16T15:57:53.000Z
2020-10-05T11:36:38.000Z
""" $Id$ This is a ISAPI extension for a wsgi with 2 handlers classes. - ISAPISimpleHandler which creates a new IsapiWsgiHandler object for each request. - ISAPIThreadPoolHandler where the wsgi requests are run on worker threads from the thread pool. Dependecies: - python 2.2+ - win32 extensions - wsgiref library from http://cvs.eby-sarna.com/wsgiref/ Based on isapi/test/extension_simple.py, PEP 333 etc """ __author__ = "Mark Rees <mark.john.rees@gmail.com>" __release__ = "0.4" __version__ = "$Rev$ $LastChangedDate$" __url__ = "http://isapi-wsgi.googlecode.com" __description__ = "ISAPI WSGI Handler" __license__ = "MIT" #this is first so that we can see import errors import sys if hasattr(sys, "isapidllhandle"): import win32traceutil try: import isapi except ImportError: raise ImportError("Could not find module isapi. isapi_wsgi requires pywin32") from isapi import isapicon, ExtensionError from isapi.simple import SimpleExtension from isapi.threaded_extension import ThreadPoolExtension from wsgiref.handlers import BaseHandler from wsgiref.util import shift_path_info import sys import os import stat import string import re try: from cStringIO import StringIO except ImportError: from StringIO import StringIO traceon = 0 def trace(*msgs): """Write trace message(s) so win32traceutil can display them""" if not traceon: return for msg in msgs: print(msg) class FoldedCaseString(str): """ From jaraco.util.string.FoldedCase: A case insensitive string class; behaves just like str except compares equal when the only variation is case. >>> s = FoldedCaseString('hello world') >>> s == 'Hello World' True >>> 'Hello World' == s True >>> s.index('O') 4 >>> s.split('O') ['hell', ' w', 'rld'] >>> sorted(map(FoldedCaseString, ['GAMMA', 'alpha', 'Beta'])) ['alpha', 'Beta', 'GAMMA'] """ def __lt__(self, other): return self.lower() < other.lower() def __gt__(self, other): return self.lower() > other.lower() def __eq__(self, other): return self.lower() == other.lower() def __hash__(self): return hash(self.lower()) # cache lower since it's likely to be called frequently. def lower(self): self._lower = super(FoldedCaseString, self).lower() self.lower = lambda: self._lower return self._lower def index(self, sub): return self.lower().index(sub.lower()) def split(self, splitter=' ', maxsplit=0): pattern = re.compile(re.escape(splitter), re.I) return pattern.split(self, maxsplit) class ECBDictAdapter(object): """ Adapt ECB to a read-only dictionary interface >>> from fakeecb import FakeECB >>> ecb = FakeECB() >>> ecb_dict = ECBDictAdapter(ecb) >>> ecb_dict['SCRIPT_NAME'] '/' >>> ecb_dict['PATH_INFO'] '/' """ def __init__(self, ecb): self.ecb = ecb if sys.version_info > (3,0): if ecb.Version >= 0x00060000: # we can handle UNICODE_* variables. self._get_variable = self._get_variable_py3k else: self._get_variable = self._get_variable_py3k_iis5 else: self._get_variable = self._get_variable_py2k def __getitem__(self, key): try: return self._get_variable(key) except ExtensionError: raise KeyError, key # a few helpers specific to the IIS and python version. def _get_variable(self, key): raise RuntimeError("not reached: replaced at runtime in the ctor") def _get_variable_py3k_iis5(self, key): # IIS5 doesn't support UNICODE_* variable names... return self.ecb.GetServerVariable(key).decode('latin-1') def _get_variable_py3k(self, key): # IIS6 and later on py3k - ask IIS for the unicode version. return self.ecb.GetServerVariable('UNICODE_' + key) def _get_variable_py2k(self, key): # py2k - just use normal string objects. return self.ecb.GetServerVariable(key) def path_references_application(path, apps): """ Return true if the first element in the path matches any string in the apps list. >>> path_references_application('/foo/bar', ['foo','baz']) True """ # assume separator is / nodes = filter(None, path.split('/')) return nodes and nodes[0] in apps def interpretPathInfo(ecb_server_vars, app_names=[]): """ Based on the a dictionary of ECB server variables and list of valid subapplication names, determine the correct PATH_INFO, SCRIPT_NAME, and IIS_EXTENSION_PATH. By valid, I mean SCRIPT_NAME + PATH_INFO is always the request path and SCRIPT_NAME is the path to the WSGi application and PATH_INFO is the path that the WSGI application expects to handle. In IIS, the path to the extension sometimes varies from the script name, particularly when the script map extenison is not '*'. IIS_EXTENSION_PATH is set to the path that leads to the extension. Return these values as a dict. For the following doctests, I use a convention: vappname : the IIS application appname : the wsgi application (may be ) subappX : a wsgi sub application (must always follow appname) proc : a method within the WSGI app (something that should appear in PATH_INFO) -------------------------- First some common examples Following is an example case where the extension is installed at the root of the site, the requested URL is /proc >>> ecb_vars = dict(SCRIPT_NAME='/proc', PATH_INFO='/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='', PATH_INFO='/proc', IIS_EXTENSION_PATH='') True An example where the extension is installed to a virtual directory below the root. URL is /vappname/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/proc', PATH_INFO='/vappname/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='/vappname', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname') True An example where the extension is installed to a virtual directory below the root, and some subapps are present >>> subapps = ('subapp1', 'subapp2') URL is /vappname/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/proc', PATH_INFO='/vappname/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/vappname', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname') True URL is /vappname/subapp1/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/subapp1/proc', PATH_INFO='/vappname/subapp1/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/vappname/subapp1', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname', WSGI_SUBAPP='subapp1') True ------------------------------ Now some less common scenarios An example where the extension is installed only to the .wsgi extension to a virtual directory below the root. URL is /vappname/any.wsgi/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/any.wsgi', PATH_INFO='/vappname/any.wsgi/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='/vappname/any.wsgi', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname') True An example where the extension is installed only to the .wsgi extension at the root. URL is /any_path/any.wsgi/proc >>> ecb_vars = dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/any_path/any.wsgi/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/proc', IIS_EXTENSION_PATH='') True How about an extension installed at the root to the .wsgi extension with subapps URL is /any_path/any.wsgi/subapp1/proc/foo >>> ecb_vars = dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/any_path/any.wsgi/subapp1/proc/foo', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/any_path/any.wsgi/subapp1', PATH_INFO='/proc/foo', IIS_EXTENSION_PATH='', WSGI_SUBAPP='subapp1') True How about an extension installed at the root to the .wsgi extension with subapps... this time default to the root app. URL is /any_path/any.wsgi/proc/foo >>> ecb_vars = dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/any_path/any.wsgi/proc/foo', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/proc/foo', IIS_EXTENSION_PATH='') True """ PATH_INFO = ecb_server_vars['PATH_INFO'] SCRIPT_NAME = ecb_server_vars['SCRIPT_NAME'] IIS_EXTENSION_PATH = getISAPIExtensionPath(ecb_server_vars) if SCRIPT_NAME == PATH_INFO: # since they're the same, we're in a * mapped extension; use # the application path SCRIPT_NAME = IIS_EXTENSION_PATH # remove the script name from the path info if SCRIPT_NAME and PATH_INFO.startswith(SCRIPT_NAME): _, PATH_INFO = PATH_INFO.split(SCRIPT_NAME, 1) result = dict( SCRIPT_NAME=SCRIPT_NAME, PATH_INFO=PATH_INFO, IIS_EXTENSION_PATH=IIS_EXTENSION_PATH, ) # finally, adjust the result if the path info begins with a subapp if path_references_application(PATH_INFO, app_names): result.update(WSGI_SUBAPP = shift_path_info(result)) return result def getISAPIExtensionPath(ecb_server_vars): """Returns the path to our extension DLL. This will be blank ('') if installed at the root, or something like '/foo' or '/bar/foo' if 'foo' is the name of the virtual directory where this extension is installed. >>> getISAPIExtensionPath(dict(APPL_MD_PATH='/LM/W3SVC/1/ROOT/test')) '/test' >>> getISAPIExtensionPath(dict(APPL_MD_PATH='/LM/W3SVC/1/ROOT')) '' This test exercises the less common mixed-case metadata path >>> getISAPIExtensionPath(dict(APPL_MD_PATH='/LM/W3SVC/1/Root')) '' """ # Only way I see how to do this is to fetch the location of our ISAPI # extension in the metabase then assume that '/ROOT/' is the root! # It will be something like MD='/LM/W3SVC/1/ROOT/test' appl_md_path = ecb_server_vars["APPL_MD_PATH"] appl_md_path = FoldedCaseString(appl_md_path) site, pos = appl_md_path.split("/ROOT", 1) return pos class ISAPIInputWrapper: # Based on ModPythonInputWrapper in mp_wsgi_handler.py def __init__(self, ecb): self._in = StringIO() self._ecb = ecb if self._ecb.AvailableBytes > 0: data = self._ecb.AvailableData # Check if more data from client than what is in ecb.AvailableData excess = self._ecb.TotalBytes - self._ecb.AvailableBytes if excess > 0: extra = self._ecb.ReadClient(excess) data = data + extra self._in.write(data) # rewind to start self._in.seek(0) def next(self): return self._in.next() def read(self, size=-1): return self._in.read(size) def readline(self, size=-1): return self._in.readline(size) def readlines(self, hint=-1): return self._in.readlines() def reset(self): self._in.reset() def seek(self, *args, **kwargs): self._in.seek(*args, **kwargs) def tell(self): return self._in.tell() def __iter__(self): return iter(self._in.readlines()) class ISAPIOutputWrapper: def __init__(self, ecb): self.ecb = ecb def write(self, msg): self.ecb.WriteClient(msg) def flush(self): pass class ISAPIErrorWrapper: def write(self, msg): trace(msg) def flush(self): pass class IsapiWsgiHandler(BaseHandler): def __init__(self, ecb, path_info): self.ecb = ecb self.path_info = path_info self.stdin = ISAPIInputWrapper(self.ecb) self.stdout = ISAPIOutputWrapper(self.ecb) self.stderr = sys.stderr #this will go to the win32traceutil self.headers = None self.headers_sent = False self.wsgi_multithread = False self.wsgi_multiprocess = False self.base_env = [] def send_preamble(self): """Since ISAPI sends preamble itself, do nothing""" trace("send_preamble") def send_headers(self): """Transmit headers to the client, via self._write()""" trace("send_headers", str(self.headers)) self.cleanup_headers() self.headers_sent = True if not self.origin_server or self.client_is_modern(): trace("SendResponseHeaders") self.ecb.SendResponseHeaders(self.status, str(self.headers), False) def _write(self, data): trace("_write", data) self.ecb.WriteClient(data) def _flush(self): trace("_flush") def get_stdin(self): trace("get_stdin") return self.stdin def get_stderr(self): trace("get_stderr") return self.stderr def add_cgi_vars(self): trace("add_cgi_vars") # get standard windows os environment environ = dict(os.environ.items()) # set standard CGI variables required_cgienv_vars = ['REQUEST_METHOD', 'SCRIPT_NAME', 'PATH_INFO', 'QUERY_STRING', 'CONTENT_TYPE', 'CONTENT_LENGTH', 'SERVER_NAME', 'SERVER_PORT', 'SERVER_PROTOCOL', 'REMOTE_ADDR' ] ecb_dict = ECBDictAdapter(self.ecb) for cgivar in required_cgienv_vars: try: environ[cgivar] = ecb_dict[cgivar] except KeyError: raise AssertionError("missing CGI environment variable %s" % cgivar) environ.update(self.path_info) http_cgienv_vars = ecb_dict['ALL_HTTP'].split("\n") for cgivar in http_cgienv_vars: pair = cgivar.split(":",1) try: environ[pair[0]] = pair[1] except: # Handle last list which is not a pair pass # Other useful CGI variables optional_cgienv_vars = ['REMOTE_USER', 'HTTPS',] for cgivar in optional_cgienv_vars: try: environ[cgivar] = ecb_dict[cgivar] except KeyError: pass # and some custom ones. environ['isapi.ecb'] = self.ecb self.environ.update(environ) def _run_app(rootapp, apps, ecb): ecb_dict = ECBDictAdapter(ecb) path_info = interpretPathInfo(ecb_dict, apps.keys()) loc = path_info.get('WSGI_SUBAPP') application = apps.get(loc, rootapp) # we have to pass path_info because otherwise the handler can't determine # what the correct path is (because it doesn't know whether it's a # subapp or not) handler = IsapiWsgiHandler(ecb, path_info) trace("Handler") try: if application is not None: handler.run(application) else: handler.run(isapi_error) except ExtensionError: # error normally happens when client disconnects before # extension i/o completed pass except: # ToDo:Other exceptions should generate a nice page trace("Caught App Exception") pass # The ISAPI extension - handles requests in our virtual dir, and sends the # response to the client. class ISAPISimpleHandler(SimpleExtension): '''Python Simple WSGI ISAPI Extension''' def __init__(self, rootapp=None, **apps): trace("ISAPISimpleHandler.__init__") self.rootapp = rootapp self.apps = apps SimpleExtension.__init__(self) def HttpExtensionProc(self, ecb): trace("Enter HttpExtensionProc") _run_app(self.rootapp, self.apps, ecb) ecb.close() trace("Exit HttpExtensionProc") return isapicon.HSE_STATUS_SUCCESS def TerminateExtension(self, status): trace("TerminateExtension") class ISAPIThreadPoolHandler(ThreadPoolExtension): '''Python Thread Pool WSGI ISAPI Extension''' def __init__(self, rootapp=None, **apps): trace("ISAPIThreadPoolHandler.__init__") self.rootapp = rootapp self.apps = apps ThreadPoolExtension.__init__(self) def Dispatch(self, ecb): trace("Enter Dispatch") _run_app(self.rootapp, self.apps, ecb) ecb.DoneWithSession() trace("Exit Dispatch") def isapi_error(environ, start_response): '''Send a nice error page to the client''' status = '404 OK' start_response(status, [('Content-type', 'text/plain')]) return ['Page not found'] #----------------------------------------------------------------------------- def test(environ, start_response): '''Simple app as per PEP 333''' status = '200 OK' start_response(status, [('Content-type', 'text/plain')]) return ['Hello world from isapi!'] # The entry points for the ISAPI extension. def __ExtensionFactory__(): return ISAPISimpleHandler(test) # Our special command line customization. # Pre-install hook for our virtual directory. def PreInstallDirectory(params, options): # If the user used our special '--description' option, # then we override our default. if options.description: params.Description = options.description # Post install hook for our entire script def PostInstall(params, options): print "Extension installed" # Handler for our custom 'status' argument. def status_handler(options, log, arg): "Query the status of something" print "Everything seems to be fine!" custom_arg_handlers = {"status": status_handler} if __name__=='__main__': # If run from the command-line, install ourselves. from isapi.install import * params = ISAPIParameters(PostInstall = PostInstall) # Setup the virtual directories - this is a list of directories our # extension uses - in this case only 1. # Each extension has a "script map" - this is the mapping of ISAPI # extensions. sm = [ ScriptMapParams(Extension="*", Flags=0) ] vd = VirtualDirParameters(Name="isapi-wsgi-test", Description = "ISAPI-WSGI Test", ScriptMaps = sm, ScriptMapUpdate = "replace", # specify the pre-install hook. PreInstall = PreInstallDirectory ) params.VirtualDirs = [vd] # Setup our custom option parser. from optparse import OptionParser parser = OptionParser('') # black usage, so isapi sets it. parser.add_option("", "--description", action="store", help="custom description to use for the virtual directory") HandleCommandLine(params, opt_parser=parser, custom_arg_handlers = custom_arg_handlers)
35.203901
164
0.627802
""" $Id$ This is a ISAPI extension for a wsgi with 2 handlers classes. - ISAPISimpleHandler which creates a new IsapiWsgiHandler object for each request. - ISAPIThreadPoolHandler where the wsgi requests are run on worker threads from the thread pool. Dependecies: - python 2.2+ - win32 extensions - wsgiref library from http://cvs.eby-sarna.com/wsgiref/ Based on isapi/test/extension_simple.py, PEP 333 etc """ __author__ = "Mark Rees <mark.john.rees@gmail.com>" __release__ = "0.4" __version__ = "$Rev$ $LastChangedDate$" __url__ = "http://isapi-wsgi.googlecode.com" __description__ = "ISAPI WSGI Handler" __license__ = "MIT" import sys if hasattr(sys, "isapidllhandle"): import win32traceutil try: import isapi except ImportError: raise ImportError("Could not find module isapi. isapi_wsgi requires pywin32") from isapi import isapicon, ExtensionError from isapi.simple import SimpleExtension from isapi.threaded_extension import ThreadPoolExtension from wsgiref.handlers import BaseHandler from wsgiref.util import shift_path_info import sys import os import stat import string import re try: from cStringIO import StringIO except ImportError: from StringIO import StringIO traceon = 0 def trace(*msgs): """Write trace message(s) so win32traceutil can display them""" if not traceon: return for msg in msgs: print(msg) class FoldedCaseString(str): """ From jaraco.util.string.FoldedCase: A case insensitive string class; behaves just like str except compares equal when the only variation is case. >>> s = FoldedCaseString('hello world') >>> s == 'Hello World' True >>> 'Hello World' == s True >>> s.index('O') 4 >>> s.split('O') ['hell', ' w', 'rld'] >>> sorted(map(FoldedCaseString, ['GAMMA', 'alpha', 'Beta'])) ['alpha', 'Beta', 'GAMMA'] """ def __lt__(self, other): return self.lower() < other.lower() def __gt__(self, other): return self.lower() > other.lower() def __eq__(self, other): return self.lower() == other.lower() def __hash__(self): return hash(self.lower()) def lower(self): self._lower = super(FoldedCaseString, self).lower() self.lower = lambda: self._lower return self._lower def index(self, sub): return self.lower().index(sub.lower()) def split(self, splitter=' ', maxsplit=0): pattern = re.compile(re.escape(splitter), re.I) return pattern.split(self, maxsplit) class ECBDictAdapter(object): """ Adapt ECB to a read-only dictionary interface >>> from fakeecb import FakeECB >>> ecb = FakeECB() >>> ecb_dict = ECBDictAdapter(ecb) >>> ecb_dict['SCRIPT_NAME'] '/' >>> ecb_dict['PATH_INFO'] '/' """ def __init__(self, ecb): self.ecb = ecb if sys.version_info > (3,0): if ecb.Version >= 0x00060000: # we can handle UNICODE_* variables. self._get_variable = self._get_variable_py3k else: self._get_variable = self._get_variable_py3k_iis5 else: self._get_variable = self._get_variable_py2k def __getitem__(self, key): try: return self._get_variable(key) except ExtensionError: raise KeyError, key # a few helpers specific to the IIS and python version. def _get_variable(self, key): raise RuntimeError("not reached: replaced at runtime in the ctor") def _get_variable_py3k_iis5(self, key): # IIS5 doesn't support UNICODE_* variable names... return self.ecb.GetServerVariable(key).decode('latin-1') def _get_variable_py3k(self, key): return self.ecb.GetServerVariable('UNICODE_' + key) def _get_variable_py2k(self, key): return self.ecb.GetServerVariable(key) def path_references_application(path, apps): """ Return true if the first element in the path matches any string in the apps list. >>> path_references_application('/foo/bar', ['foo','baz']) True """ nodes = filter(None, path.split('/')) return nodes and nodes[0] in apps def interpretPathInfo(ecb_server_vars, app_names=[]): """ Based on the a dictionary of ECB server variables and list of valid subapplication names, determine the correct PATH_INFO, SCRIPT_NAME, and IIS_EXTENSION_PATH. By valid, I mean SCRIPT_NAME + PATH_INFO is always the request path and SCRIPT_NAME is the path to the WSGi application and PATH_INFO is the path that the WSGI application expects to handle. In IIS, the path to the extension sometimes varies from the script name, particularly when the script map extenison is not '*'. IIS_EXTENSION_PATH is set to the path that leads to the extension. Return these values as a dict. For the following doctests, I use a convention: vappname : the IIS application appname : the wsgi application (may be ) subappX : a wsgi sub application (must always follow appname) proc : a method within the WSGI app (something that should appear in PATH_INFO) -------------------------- First some common examples Following is an example case where the extension is installed at the root of the site, the requested URL is /proc >>> ecb_vars = dict(SCRIPT_NAME='/proc', PATH_INFO='/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='', PATH_INFO='/proc', IIS_EXTENSION_PATH='') True An example where the extension is installed to a virtual directory below the root. URL is /vappname/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/proc', PATH_INFO='/vappname/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='/vappname', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname') True An example where the extension is installed to a virtual directory below the root, and some subapps are present >>> subapps = ('subapp1', 'subapp2') URL is /vappname/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/proc', PATH_INFO='/vappname/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/vappname', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname') True URL is /vappname/subapp1/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/subapp1/proc', PATH_INFO='/vappname/subapp1/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/vappname/subapp1', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname', WSGI_SUBAPP='subapp1') True ------------------------------ Now some less common scenarios An example where the extension is installed only to the .wsgi extension to a virtual directory below the root. URL is /vappname/any.wsgi/proc >>> ecb_vars = dict(SCRIPT_NAME='/vappname/any.wsgi', PATH_INFO='/vappname/any.wsgi/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT/vappname') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='/vappname/any.wsgi', PATH_INFO='/proc', IIS_EXTENSION_PATH='/vappname') True An example where the extension is installed only to the .wsgi extension at the root. URL is /any_path/any.wsgi/proc >>> ecb_vars = dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/any_path/any.wsgi/proc', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars) == dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/proc', IIS_EXTENSION_PATH='') True How about an extension installed at the root to the .wsgi extension with subapps URL is /any_path/any.wsgi/subapp1/proc/foo >>> ecb_vars = dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/any_path/any.wsgi/subapp1/proc/foo', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/any_path/any.wsgi/subapp1', PATH_INFO='/proc/foo', IIS_EXTENSION_PATH='', WSGI_SUBAPP='subapp1') True How about an extension installed at the root to the .wsgi extension with subapps... this time default to the root app. URL is /any_path/any.wsgi/proc/foo >>> ecb_vars = dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/any_path/any.wsgi/proc/foo', APPL_MD_PATH='/LM/W3SVC/1/ROOT') >>> interpretPathInfo(ecb_vars, subapps) == dict(SCRIPT_NAME='/any_path/any.wsgi', PATH_INFO='/proc/foo', IIS_EXTENSION_PATH='') True """ PATH_INFO = ecb_server_vars['PATH_INFO'] SCRIPT_NAME = ecb_server_vars['SCRIPT_NAME'] IIS_EXTENSION_PATH = getISAPIExtensionPath(ecb_server_vars) if SCRIPT_NAME == PATH_INFO: SCRIPT_NAME = IIS_EXTENSION_PATH if SCRIPT_NAME and PATH_INFO.startswith(SCRIPT_NAME): _, PATH_INFO = PATH_INFO.split(SCRIPT_NAME, 1) result = dict( SCRIPT_NAME=SCRIPT_NAME, PATH_INFO=PATH_INFO, IIS_EXTENSION_PATH=IIS_EXTENSION_PATH, ) if path_references_application(PATH_INFO, app_names): result.update(WSGI_SUBAPP = shift_path_info(result)) return result def getISAPIExtensionPath(ecb_server_vars): """Returns the path to our extension DLL. This will be blank ('') if installed at the root, or something like '/foo' or '/bar/foo' if 'foo' is the name of the virtual directory where this extension is installed. >>> getISAPIExtensionPath(dict(APPL_MD_PATH='/LM/W3SVC/1/ROOT/test')) '/test' >>> getISAPIExtensionPath(dict(APPL_MD_PATH='/LM/W3SVC/1/ROOT')) '' This test exercises the less common mixed-case metadata path >>> getISAPIExtensionPath(dict(APPL_MD_PATH='/LM/W3SVC/1/Root')) '' """ appl_md_path = ecb_server_vars["APPL_MD_PATH"] appl_md_path = FoldedCaseString(appl_md_path) site, pos = appl_md_path.split("/ROOT", 1) return pos class ISAPIInputWrapper: def __init__(self, ecb): self._in = StringIO() self._ecb = ecb if self._ecb.AvailableBytes > 0: data = self._ecb.AvailableData excess = self._ecb.TotalBytes - self._ecb.AvailableBytes if excess > 0: extra = self._ecb.ReadClient(excess) data = data + extra self._in.write(data) self._in.seek(0) def next(self): return self._in.next() def read(self, size=-1): return self._in.read(size) def readline(self, size=-1): return self._in.readline(size) def readlines(self, hint=-1): return self._in.readlines() def reset(self): self._in.reset() def seek(self, *args, **kwargs): self._in.seek(*args, **kwargs) def tell(self): return self._in.tell() def __iter__(self): return iter(self._in.readlines()) class ISAPIOutputWrapper: def __init__(self, ecb): self.ecb = ecb def write(self, msg): self.ecb.WriteClient(msg) def flush(self): pass class ISAPIErrorWrapper: def write(self, msg): trace(msg) def flush(self): pass class IsapiWsgiHandler(BaseHandler): def __init__(self, ecb, path_info): self.ecb = ecb self.path_info = path_info self.stdin = ISAPIInputWrapper(self.ecb) self.stdout = ISAPIOutputWrapper(self.ecb) self.stderr = sys.stderr self.headers = None self.headers_sent = False self.wsgi_multithread = False self.wsgi_multiprocess = False self.base_env = [] def send_preamble(self): """Since ISAPI sends preamble itself, do nothing""" trace("send_preamble") def send_headers(self): """Transmit headers to the client, via self._write()""" trace("send_headers", str(self.headers)) self.cleanup_headers() self.headers_sent = True if not self.origin_server or self.client_is_modern(): trace("SendResponseHeaders") self.ecb.SendResponseHeaders(self.status, str(self.headers), False) def _write(self, data): trace("_write", data) self.ecb.WriteClient(data) def _flush(self): trace("_flush") def get_stdin(self): trace("get_stdin") return self.stdin def get_stderr(self): trace("get_stderr") return self.stderr def add_cgi_vars(self): trace("add_cgi_vars") environ = dict(os.environ.items()) required_cgienv_vars = ['REQUEST_METHOD', 'SCRIPT_NAME', 'PATH_INFO', 'QUERY_STRING', 'CONTENT_TYPE', 'CONTENT_LENGTH', 'SERVER_NAME', 'SERVER_PORT', 'SERVER_PROTOCOL', 'REMOTE_ADDR' ] ecb_dict = ECBDictAdapter(self.ecb) for cgivar in required_cgienv_vars: try: environ[cgivar] = ecb_dict[cgivar] except KeyError: raise AssertionError("missing CGI environment variable %s" % cgivar) environ.update(self.path_info) http_cgienv_vars = ecb_dict['ALL_HTTP'].split("\n") for cgivar in http_cgienv_vars: pair = cgivar.split(":",1) try: environ[pair[0]] = pair[1] except: pass optional_cgienv_vars = ['REMOTE_USER', 'HTTPS',] for cgivar in optional_cgienv_vars: try: environ[cgivar] = ecb_dict[cgivar] except KeyError: pass environ['isapi.ecb'] = self.ecb self.environ.update(environ) def _run_app(rootapp, apps, ecb): ecb_dict = ECBDictAdapter(ecb) path_info = interpretPathInfo(ecb_dict, apps.keys()) loc = path_info.get('WSGI_SUBAPP') application = apps.get(loc, rootapp) # what the correct path is (because it doesn't know whether it's a # subapp or not) handler = IsapiWsgiHandler(ecb, path_info) trace("Handler") try: if application is not None: handler.run(application) else: handler.run(isapi_error) except ExtensionError: # error normally happens when client disconnects before # extension i/o completed pass except: # ToDo:Other exceptions should generate a nice page trace("Caught App Exception") pass # The ISAPI extension - handles requests in our virtual dir, and sends the # response to the client. class ISAPISimpleHandler(SimpleExtension): '''Python Simple WSGI ISAPI Extension''' def __init__(self, rootapp=None, **apps): trace("ISAPISimpleHandler.__init__") self.rootapp = rootapp self.apps = apps SimpleExtension.__init__(self) def HttpExtensionProc(self, ecb): trace("Enter HttpExtensionProc") _run_app(self.rootapp, self.apps, ecb) ecb.close() trace("Exit HttpExtensionProc") return isapicon.HSE_STATUS_SUCCESS def TerminateExtension(self, status): trace("TerminateExtension") class ISAPIThreadPoolHandler(ThreadPoolExtension): '''Python Thread Pool WSGI ISAPI Extension''' def __init__(self, rootapp=None, **apps): trace("ISAPIThreadPoolHandler.__init__") self.rootapp = rootapp self.apps = apps ThreadPoolExtension.__init__(self) def Dispatch(self, ecb): trace("Enter Dispatch") _run_app(self.rootapp, self.apps, ecb) ecb.DoneWithSession() trace("Exit Dispatch") def isapi_error(environ, start_response): '''Send a nice error page to the client''' status = '404 OK' start_response(status, [('Content-type', 'text/plain')]) return ['Page not found'] #----------------------------------------------------------------------------- def test(environ, start_response): '''Simple app as per PEP 333''' status = '200 OK' start_response(status, [('Content-type', 'text/plain')]) return ['Hello world from isapi!'] # The entry points for the ISAPI extension. def __ExtensionFactory__(): return ISAPISimpleHandler(test) # Our special command line customization. # Pre-install hook for our virtual directory. def PreInstallDirectory(params, options): # If the user used our special '--description' option, # then we override our default. if options.description: params.Description = options.description # Post install hook for our entire script def PostInstall(params, options): print "Extension installed" # Handler for our custom 'status' argument. def status_handler(options, log, arg): "Query the status of something" print "Everything seems to be fine!" custom_arg_handlers = {"status": status_handler} if __name__=='__main__': # If run from the command-line, install ourselves. from isapi.install import * params = ISAPIParameters(PostInstall = PostInstall) # Setup the virtual directories - this is a list of directories our # extension uses - in this case only 1. # Each extension has a "script map" - this is the mapping of ISAPI # extensions. sm = [ ScriptMapParams(Extension="*", Flags=0) ] vd = VirtualDirParameters(Name="isapi-wsgi-test", Description = "ISAPI-WSGI Test", ScriptMaps = sm, ScriptMapUpdate = "replace", # specify the pre-install hook. PreInstall = PreInstallDirectory ) params.VirtualDirs = [vd] # Setup our custom option parser. from optparse import OptionParser parser = OptionParser('') # black usage, so isapi sets it. parser.add_option("", "--description", action="store", help="custom description to use for the virtual directory") HandleCommandLine(params, opt_parser=parser, custom_arg_handlers = custom_arg_handlers)
false
true
f71e4ce28aaa6929ef3046b41295678e3e7ad09e
2,291
py
Python
src/backend/apps/chat/views.py
Vixx-X/ati-project
0ef80772a6fc3807e401cf58b9e15f3628373383
[ "MIT" ]
null
null
null
src/backend/apps/chat/views.py
Vixx-X/ati-project
0ef80772a6fc3807e401cf58b9e15f3628373383
[ "MIT" ]
61
2021-06-10T03:27:06.000Z
2022-03-12T01:01:34.000Z
src/backend/apps/chat/views.py
Vixx-X/ati-project
0ef80772a6fc3807e401cf58b9e15f3628373383
[ "MIT" ]
null
null
null
""" Views for the media module. """ import functools import json from flask import session from flask_socketio import disconnect, emit, join_room, leave_room from flask_user import current_user from flask_user.decorators import login_required from backend import socketio from backend.apps.chat.models import Message from backend.utils.views import DetailView, TemplateView from .models import Chat def authenticated_only(f): """ Decorator that disconnect unauthenticated users """ @functools.wraps(f) def wrapped(*args, **kwargs): if not current_user.is_authenticated: disconnect() else: return f(*args, **kwargs) return wrapped @socketio.on("connect") @authenticated_only def handle_connect(): """ Connecting user to pull of online users """ room = session.get("room") join_room(room) if room == "UNIVERSE": emit("user_connected", {"username": current_user.username}, room=room) @socketio.on("message") @authenticated_only def handle_messages(message): """ Get messages send by client and sent it to all in room """ room = session.get("room") data = json.loads(message) # Save message to db msg = Message(content=data["message"], author=current_user) chat = Chat.objects.get_or_404(pk=room) chat.add_message(msg) chat.save() emit( "message", { "content": msg.content, "time": str(msg.time), "author": str(current_user.pk), }, room=room, ) @socketio.on("disconnect") @authenticated_only def handle_disconnect(): """ Left room """ room = session.get("room") leave_room(room) if room == "UNIVERSE": emit("user_disconnected", {"username": current_user.username}, room=room) class ChatView(DetailView): """ Chat View """ model = Chat decorators = [login_required] template_name = "chat/chat.html" pk_or_slug_url = "pk" def get_context_data(self, **kwargs): session["room"] = str(self.object.pk) return super().get_context_data(**kwargs) class ChatListView(TemplateView): """ Chat list """ decorators = [login_required] template_name = "chat/chat.html"
20.096491
81
0.643824
import functools import json from flask import session from flask_socketio import disconnect, emit, join_room, leave_room from flask_user import current_user from flask_user.decorators import login_required from backend import socketio from backend.apps.chat.models import Message from backend.utils.views import DetailView, TemplateView from .models import Chat def authenticated_only(f): @functools.wraps(f) def wrapped(*args, **kwargs): if not current_user.is_authenticated: disconnect() else: return f(*args, **kwargs) return wrapped @socketio.on("connect") @authenticated_only def handle_connect(): room = session.get("room") join_room(room) if room == "UNIVERSE": emit("user_connected", {"username": current_user.username}, room=room) @socketio.on("message") @authenticated_only def handle_messages(message): room = session.get("room") data = json.loads(message) msg = Message(content=data["message"], author=current_user) chat = Chat.objects.get_or_404(pk=room) chat.add_message(msg) chat.save() emit( "message", { "content": msg.content, "time": str(msg.time), "author": str(current_user.pk), }, room=room, ) @socketio.on("disconnect") @authenticated_only def handle_disconnect(): room = session.get("room") leave_room(room) if room == "UNIVERSE": emit("user_disconnected", {"username": current_user.username}, room=room) class ChatView(DetailView): model = Chat decorators = [login_required] template_name = "chat/chat.html" pk_or_slug_url = "pk" def get_context_data(self, **kwargs): session["room"] = str(self.object.pk) return super().get_context_data(**kwargs) class ChatListView(TemplateView): decorators = [login_required] template_name = "chat/chat.html"
true
true
f71e4d0c6f7a17183fe5fe1f40071fec474e71ae
2,532
py
Python
mlmodels/model_tf/misc/tf_nlp/speech-to-text/1.tacotron/train.py
gitter-badger/mlmodels
f08cc9b6ec202d4ad25ecdda2f44487da387569d
[ "MIT" ]
1
2022-03-11T07:57:48.000Z
2022-03-11T07:57:48.000Z
mlmodels/model_tf/misc/tf_nlp/speech-to-text/1.tacotron/train.py
whitetiger1002/mlmodels
f70f1da7434e8855eed50adc67b49cc169f2ea24
[ "MIT" ]
null
null
null
mlmodels/model_tf/misc/tf_nlp/speech-to-text/1.tacotron/train.py
whitetiger1002/mlmodels
f70f1da7434e8855eed50adc67b49cc169f2ea24
[ "MIT" ]
null
null
null
# coding: utf-8 # In[1]: import os import numpy as np import tensorflow as tf from tqdm import tqdm from model import Model from setting import batch_size, get_cached, idx2char, n_mels, reduction_factor, text2idx # In[2]: paths, lengths, texts = [], [], [] text_files = [f for f in os.listdir("spectrogram") if f.endswith(".npy")] for fpath in text_files: with open("../data/" + fpath.replace("npy", "txt")) as fopen: text, converted = text2idx(fopen.read()) texts.append(converted) lengths.append(len(text)) paths.append(fpath.replace(".npy", "")) # In[3]: def dynamic_batching(paths): spectrograms, max_x = [], 0 for path in paths: spectrograms.append(np.load("spectrogram/" + path + ".npy")) if spectrograms[-1].shape[0] > max_x: max_x = spectrograms[-1].shape[0] return spectrograms, max_x # In[4]: tf.reset_default_graph() sess = tf.InteractiveSession() model = Model() sess.run(tf.global_variables_initializer()) # In[5]: for e in range(30): pbar = tqdm(range(0, len(text_files), batch_size), desc="minibatch loop") total_cost, total_acc = 0, 0 for k in pbar: index = min(k + batch_size, len(text_files)) files, max_x = dynamic_batching(paths[k:index]) max_y = max(lengths[k:index]) batch_x = np.zeros((len(files), max_x, n_mels * reduction_factor)) batch_y = np.zeros((len(files), max_y)) for n in range(len(files)): batch_x[n] = np.pad(files[n], ((max_x - files[n].shape[0], 0), (0, 0)), mode="constant") batch_y[n] = np.pad(texts[k + n], ((0, max_y - len(texts[k + n]))), mode="constant") _, acc, cost = sess.run( [model.optimizer, model.accuracy, model.cost], feed_dict={model.X: batch_x, model.Y: batch_y, model.Y_seq_len: lengths[k:index]}, ) total_cost += cost total_acc += acc pbar.set_postfix(cost=cost, accuracy=acc) total_cost /= len(text_files) / batch_size total_acc /= len(text_files) / batch_size print("epoch %d, avg loss %f, avg acc %f" % (e + 1, total_cost, total_acc)) empty_y = np.zeros((1, len(batch_y[0]))) predicted = "".join( [ idx2char[c] for c in sess.run(model.preds, feed_dict={model.X: batch_x[:1], model.Y: empty_y})[0] if idx2char[c] not in ["S", "E"] ] ) ground_truth = "".join([idx2char[c] for c in batch_y[0] if idx2char[c] not in ["S", "E"]]) print("predicted: %s, ground truth: %s" % (predicted, ground_truth))
29.103448
100
0.617299
import os import numpy as np import tensorflow as tf from tqdm import tqdm from model import Model from setting import batch_size, get_cached, idx2char, n_mels, reduction_factor, text2idx paths, lengths, texts = [], [], [] text_files = [f for f in os.listdir("spectrogram") if f.endswith(".npy")] for fpath in text_files: with open("../data/" + fpath.replace("npy", "txt")) as fopen: text, converted = text2idx(fopen.read()) texts.append(converted) lengths.append(len(text)) paths.append(fpath.replace(".npy", "")) def dynamic_batching(paths): spectrograms, max_x = [], 0 for path in paths: spectrograms.append(np.load("spectrogram/" + path + ".npy")) if spectrograms[-1].shape[0] > max_x: max_x = spectrograms[-1].shape[0] return spectrograms, max_x tf.reset_default_graph() sess = tf.InteractiveSession() model = Model() sess.run(tf.global_variables_initializer()) for e in range(30): pbar = tqdm(range(0, len(text_files), batch_size), desc="minibatch loop") total_cost, total_acc = 0, 0 for k in pbar: index = min(k + batch_size, len(text_files)) files, max_x = dynamic_batching(paths[k:index]) max_y = max(lengths[k:index]) batch_x = np.zeros((len(files), max_x, n_mels * reduction_factor)) batch_y = np.zeros((len(files), max_y)) for n in range(len(files)): batch_x[n] = np.pad(files[n], ((max_x - files[n].shape[0], 0), (0, 0)), mode="constant") batch_y[n] = np.pad(texts[k + n], ((0, max_y - len(texts[k + n]))), mode="constant") _, acc, cost = sess.run( [model.optimizer, model.accuracy, model.cost], feed_dict={model.X: batch_x, model.Y: batch_y, model.Y_seq_len: lengths[k:index]}, ) total_cost += cost total_acc += acc pbar.set_postfix(cost=cost, accuracy=acc) total_cost /= len(text_files) / batch_size total_acc /= len(text_files) / batch_size print("epoch %d, avg loss %f, avg acc %f" % (e + 1, total_cost, total_acc)) empty_y = np.zeros((1, len(batch_y[0]))) predicted = "".join( [ idx2char[c] for c in sess.run(model.preds, feed_dict={model.X: batch_x[:1], model.Y: empty_y})[0] if idx2char[c] not in ["S", "E"] ] ) ground_truth = "".join([idx2char[c] for c in batch_y[0] if idx2char[c] not in ["S", "E"]]) print("predicted: %s, ground truth: %s" % (predicted, ground_truth))
true
true
f71e4d6dbc4f9dd0c1e78dea1d539666e3d83bf0
846
py
Python
sumo/tools/projects/TaxiFCD_Krieg/src/fcdToRoutes/GenerateTaxiRoutesMain.py
iltempe/osmosi
c0f54ecdbb7c7b5602d587768617d0dc50f1d75d
[ "MIT" ]
null
null
null
sumo/tools/projects/TaxiFCD_Krieg/src/fcdToRoutes/GenerateTaxiRoutesMain.py
iltempe/osmosi
c0f54ecdbb7c7b5602d587768617d0dc50f1d75d
[ "MIT" ]
null
null
null
sumo/tools/projects/TaxiFCD_Krieg/src/fcdToRoutes/GenerateTaxiRoutesMain.py
iltempe/osmosi
c0f54ecdbb7c7b5602d587768617d0dc50f1d75d
[ "MIT" ]
2
2017-12-14T16:41:59.000Z
2020-10-16T17:51:27.000Z
#!/usr/bin/env python # -*- coding: Latin-1 -*- """ @file GenerateTaxiRoutesMain.py @author Sascha Krieg @author Daniel Krajzewicz @author Michael Behrisch @date 2008-04-17 @version $Id$ Main of GenerateTaxiRoutes. SUMO, Simulation of Urban MObility; see http://sumo.dlr.de/ Copyright (C) 2008-2017 DLR (http://www.dlr.de/) and contributors This file is part of SUMO. SUMO is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 3 of the License, or (at your option) any later version. """ from __future__ import absolute_import from __future__ import print_function from .GenerateTaxiRoutes import * def main(): print("start program") readFCD() writeRoutes() print("end") # start the program main()
23.5
68
0.737589
from __future__ import absolute_import from __future__ import print_function from .GenerateTaxiRoutes import * def main(): print("start program") readFCD() writeRoutes() print("end") main()
true
true
f71e4e1ab1212fcc12550d50d95595bbcbba1151
22,970
py
Python
saleor/plugins/avatax/plugin.py
batout/saleor
29830d2a3195c2d83d0a2b0dfdc48ebc18d26dbc
[ "CC-BY-4.0" ]
1
2022-02-19T13:27:40.000Z
2022-02-19T13:27:40.000Z
saleor/plugins/avatax/plugin.py
autobotasia/saleor
e03e9f6ab1bddac308a6609d6b576a87e90ae655
[ "CC-BY-4.0" ]
null
null
null
saleor/plugins/avatax/plugin.py
autobotasia/saleor
e03e9f6ab1bddac308a6609d6b576a87e90ae655
[ "CC-BY-4.0" ]
2
2021-12-03T16:59:37.000Z
2022-02-19T13:05:42.000Z
import logging from dataclasses import asdict from decimal import Decimal from typing import TYPE_CHECKING, Any, Dict, Iterable, List, Optional, Union from urllib.parse import urljoin import opentracing import opentracing.tags from django.core.exceptions import ValidationError from prices import Money, TaxedMoney, TaxedMoneyRange from ...checkout import base_calculations from ...checkout.fetch import fetch_checkout_lines from ...core.taxes import TaxError, TaxType, charge_taxes_on_shipping, zero_taxed_money from ...discount import DiscountInfo from ...product.models import ProductType from ..base_plugin import BasePlugin, ConfigurationTypeField from ..error_codes import PluginErrorCode from . import ( DEFAULT_TAX_CODE, DEFAULT_TAX_DESCRIPTION, META_CODE_KEY, META_DESCRIPTION_KEY, AvataxConfiguration, CustomerErrors, TransactionType, _validate_checkout, _validate_order, api_get_request, api_post_request, generate_request_data_from_checkout, get_api_url, get_cached_tax_codes_or_fetch, get_checkout_tax_data, get_order_request_data, get_order_tax_data, ) from .tasks import api_post_request_task if TYPE_CHECKING: # flake8: noqa from ...account.models import Address from ...channel.models import Channel from ...checkout.fetch import CheckoutInfo, CheckoutLineInfo from ...checkout.models import Checkout, CheckoutLine from ...order.models import Order, OrderLine from ...product.models import Product, ProductVariant from ..models import PluginConfiguration logger = logging.getLogger(__name__) class AvataxPlugin(BasePlugin): PLUGIN_NAME = "Avalara" PLUGIN_ID = "mirumee.taxes.avalara" DEFAULT_CONFIGURATION = [ {"name": "Username or account", "value": None}, {"name": "Password or license", "value": None}, {"name": "Use sandbox", "value": True}, {"name": "Company name", "value": "DEFAULT"}, {"name": "Autocommit", "value": False}, ] CONFIG_STRUCTURE = { "Username or account": { "type": ConfigurationTypeField.STRING, "help_text": "Provide user or account details", "label": "Username or account", }, "Password or license": { "type": ConfigurationTypeField.PASSWORD, "help_text": "Provide password or license details", "label": "Password or license", }, "Use sandbox": { "type": ConfigurationTypeField.BOOLEAN, "help_text": "Determines if Saleor should use Avatax sandbox API.", "label": "Use sandbox", }, "Company name": { "type": ConfigurationTypeField.STRING, "help_text": "Avalara needs to receive company code. Some more " "complicated systems can use more than one company " "code, in that case, this variable should be changed " "based on data from Avalara's admin panel", "label": "Company name", }, "Autocommit": { "type": ConfigurationTypeField.BOOLEAN, "help_text": "Determines, if all transactions sent to Avalara " "should be committed by default.", "label": "Autocommit", }, } def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) # Convert to dict to easier take config elements configuration = {item["name"]: item["value"] for item in self.configuration} self.config = AvataxConfiguration( username_or_account=configuration["Username or account"], password_or_license=configuration["Password or license"], use_sandbox=configuration["Use sandbox"], company_name=configuration["Company name"], autocommit=configuration["Autocommit"], ) def _skip_plugin( self, previous_value: Union[TaxedMoney, TaxedMoneyRange, Decimal] ) -> bool: if not (self.config.username_or_account and self.config.password_or_license): return True if not self.active: return True # The previous plugin already calculated taxes so we can skip our logic if isinstance(previous_value, TaxedMoneyRange): start = previous_value.start stop = previous_value.stop return start.net != start.gross and stop.net != stop.gross if isinstance(previous_value, TaxedMoney): return previous_value.net != previous_value.gross return False def _append_prices_of_not_taxed_lines( self, price: TaxedMoney, lines: Iterable["CheckoutLineInfo"], channel: "Channel", discounts: Iterable[DiscountInfo], ): for line_info in lines: if line_info.variant.product.charge_taxes: continue line_price = base_calculations.base_checkout_line_total( line_info, channel, discounts, ) price.gross.amount += line_price.gross.amount price.net.amount += line_price.net.amount return price def calculate_checkout_total( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: TaxedMoney, ) -> TaxedMoney: if self._skip_plugin(previous_value): return previous_value checkout_total = previous_value if not _validate_checkout(checkout_info, lines): return checkout_total response = get_checkout_tax_data(checkout_info, lines, discounts, self.config) if not response or "error" in response: return checkout_total currency = response.get("currencyCode") tax = Decimal(response.get("totalTax", 0.0)) total_net = Decimal(response.get("totalAmount", 0.0)) total_gross = Money(amount=total_net + tax, currency=currency) total_net = Money(amount=total_net, currency=currency) taxed_total = TaxedMoney(net=total_net, gross=total_gross) total = self._append_prices_of_not_taxed_lines( taxed_total, lines, checkout_info.channel, discounts ) voucher_value = checkout_info.checkout.discount if voucher_value: total -= voucher_value return max(total, zero_taxed_money(total.currency)) def _calculate_checkout_shipping( self, currency: str, lines: List[Dict], shipping_price: TaxedMoney ) -> TaxedMoney: shipping_tax = Decimal(0.0) shipping_net = shipping_price.net.amount for line in lines: if line["itemCode"] == "Shipping": shipping_net = Decimal(line["lineAmount"]) shipping_tax = Decimal(line["tax"]) break shipping_gross = Money(amount=shipping_net + shipping_tax, currency=currency) shipping_net = Money(amount=shipping_net, currency=currency) return TaxedMoney(net=shipping_net, gross=shipping_gross) def calculate_checkout_shipping( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: TaxedMoney, ) -> TaxedMoney: base_shipping_price = previous_value if not charge_taxes_on_shipping(): return base_shipping_price if self._skip_plugin(previous_value): return base_shipping_price if not _validate_checkout(checkout_info, lines): return base_shipping_price response = get_checkout_tax_data(checkout_info, lines, discounts, self.config) if not response or "error" in response: return base_shipping_price currency = str(response.get("currencyCode")) return self._calculate_checkout_shipping( currency, response.get("lines", []), base_shipping_price ) def preprocess_order_creation( self, checkout_info: "CheckoutInfo", discounts: Iterable[DiscountInfo], lines: Optional[Iterable["CheckoutLineInfo"]], previous_value: Any, ): """Ensure all the data is correct and we can proceed with creation of order. Raise an error when can't receive taxes. """ if lines is None: lines = fetch_checkout_lines(checkout_info.checkout) if self._skip_plugin(previous_value): return previous_value data = generate_request_data_from_checkout( checkout_info, lines, self.config, transaction_token=str(checkout_info.checkout.token), transaction_type=TransactionType.ORDER, discounts=discounts, ) if not data.get("createTransactionModel", {}).get("lines"): return previous_value transaction_url = urljoin( get_api_url(self.config.use_sandbox), "transactions/createoradjust" ) with opentracing.global_tracer().start_active_span( "avatax.transactions.crateoradjust" ) as scope: span = scope.span span.set_tag(opentracing.tags.COMPONENT, "tax") span.set_tag("service.name", "avatax") response = api_post_request(transaction_url, data, self.config) if not response or "error" in response: msg = response.get("error", {}).get("message", "") error_code = response.get("error", {}).get("code", "") logger.warning( "Unable to calculate taxes for checkout %s, error_code: %s, " "error_msg: %s", checkout_info.checkout.token, error_code, msg, ) customer_msg = CustomerErrors.get_error_msg(response.get("error", {})) raise TaxError(customer_msg) return previous_value def order_created(self, order: "Order", previous_value: Any) -> Any: if not self.active: return previous_value request_data = get_order_request_data(order, self.config) transaction_url = urljoin( get_api_url(self.config.use_sandbox), "transactions/createoradjust" ) api_post_request_task.delay( transaction_url, request_data, asdict(self.config), order.id ) return previous_value def calculate_checkout_line_total( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], checkout_line_info: "CheckoutLineInfo", address: Optional["Address"], discounts: Iterable["DiscountInfo"], previous_value: TaxedMoney, ) -> TaxedMoney: if self._skip_plugin(previous_value): return previous_value base_total = previous_value if not checkout_line_info.product.charge_taxes: return base_total if not _validate_checkout(checkout_info, lines): return base_total taxes_data = get_checkout_tax_data(checkout_info, lines, discounts, self.config) if not taxes_data or "error" in taxes_data: return base_total currency = taxes_data.get("currencyCode") for line in taxes_data.get("lines", []): if line.get("itemCode") == checkout_line_info.variant.sku: tax = Decimal(line.get("tax", 0.0)) line_net = Decimal(line["lineAmount"]) line_gross = Money(amount=line_net + tax, currency=currency) line_net = Money(amount=line_net, currency=currency) return TaxedMoney(net=line_net, gross=line_gross) return base_total def calculate_checkout_line_unit_price( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], checkout_line_info: "CheckoutLineInfo", address: Optional["Address"], discounts: Iterable["DiscountInfo"], previous_value: TaxedMoney, ): if not checkout_line_info.product.charge_taxes: return previous_value return self._calculate_unit_price( checkout_info, checkout_line_info.line, lines, checkout_line_info.variant, previous_value, discounts, is_order=False, ) def calculate_order_line_unit( self, order: "Order", order_line: "OrderLine", variant: "ProductVariant", product: "Product", previous_value: TaxedMoney, ) -> TaxedMoney: if not variant or (variant and not product.charge_taxes): return previous_value return self._calculate_unit_price( order, order_line, [], variant, previous_value, is_order=True ) def _calculate_unit_price( self, instance: Union["CheckoutInfo", "Order"], line: Union["CheckoutLine", "OrderLine"], lines_info: Iterable["CheckoutLineInfo"], variant: "ProductVariant", base_value: TaxedMoney, discounts: Optional[Iterable[DiscountInfo]] = [], *, is_order: bool, ): taxes_data = self._get_tax_data( instance, base_value, is_order, discounts, lines_info ) if taxes_data is None: return base_value currency = taxes_data.get("currencyCode") for line_data in taxes_data.get("lines", []): if line_data.get("itemCode") == variant.sku: tax = Decimal(line_data.get("tax", 0.0)) / line.quantity net = Decimal(line_data.get("lineAmount", 0.0)) / line.quantity gross = Money(amount=net + tax, currency=currency) net = Money(amount=net, currency=currency) return TaxedMoney(net=net, gross=gross) return base_value def calculate_order_shipping( self, order: "Order", previous_value: TaxedMoney ) -> TaxedMoney: if self._skip_plugin(previous_value): return previous_value if not charge_taxes_on_shipping(): return previous_value if not _validate_order(order): return zero_taxed_money(order.total.currency) taxes_data = get_order_tax_data(order, self.config, False) currency = taxes_data.get("currencyCode") for line in taxes_data.get("lines", []): if line["itemCode"] == "Shipping": tax = Decimal(line.get("tax", 0.0)) net = Decimal(line.get("lineAmount", 0.0)) gross = Money(amount=net + tax, currency=currency) net = Money(amount=net, currency=currency) return TaxedMoney(net=net, gross=gross) return TaxedMoney( # Ignore typing checks because it is checked in _validate_order net=order.shipping_method.price, # type: ignore gross=order.shipping_method.price, # type: ignore ) def get_tax_rate_type_choices(self, previous_value: Any) -> List[TaxType]: if not self.active: return previous_value return [ TaxType(code=tax_code, description=desc) for tax_code, desc in get_cached_tax_codes_or_fetch(self.config).items() ] def get_checkout_line_tax_rate( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], checkout_line_info: "CheckoutLineInfo", address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: Decimal, ) -> Decimal: return self._get_unit_tax_rate( checkout_info, previous_value, False, discounts, lines ) def get_order_line_tax_rate( self, order: "Order", product: "Product", address: Optional["Address"], previous_value: Decimal, ) -> Decimal: return self._get_unit_tax_rate(order, previous_value, True) def get_checkout_shipping_tax_rate( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: Decimal, ): return self._get_shipping_tax_rate( checkout_info, previous_value, False, discounts, lines, ) def get_order_shipping_tax_rate(self, order: "Order", previous_value: Decimal): return self._get_shipping_tax_rate(order, previous_value, True) def _get_unit_tax_rate( self, instance: Union["Order", "CheckoutInfo"], base_rate: Decimal, is_order: bool, discounts: Optional[Iterable[DiscountInfo]] = None, lines_info: Iterable["CheckoutLineInfo"] = [], ): response = self._get_tax_data( instance, base_rate, is_order, discounts, lines_info ) if response is None: return base_rate rate = None response_summary = response.get("summary") if response_summary: rate = Decimal(response_summary[0].get("rate", 0.0)) return rate or base_rate def _get_shipping_tax_rate( self, instance: Union["Order", "CheckoutInfo"], base_rate: Decimal, is_order: bool, discounts: Optional[Iterable[DiscountInfo]] = None, lines_info: Iterable["CheckoutLineInfo"] = [], ): response = self._get_tax_data( instance, base_rate, is_order, discounts, lines_info ) if response is None: return base_rate lines_data = response.get("lines", []) for line in lines_data: if line["itemCode"] == "Shipping": line_details = line.get("details") if not line_details: return return Decimal(line_details[0].get("rate", 0.0)) return base_rate def _get_tax_data( self, instance: Union["Order", "CheckoutInfo"], base_value: Decimal, is_order: bool, discounts: Optional[Iterable[DiscountInfo]] = None, lines_info: Iterable["CheckoutLineInfo"] = [], ): if self._skip_plugin(base_value): return None valid = ( _validate_order(instance) # type: ignore if is_order else _validate_checkout(instance, lines_info) # type: ignore ) if not valid: return None response = ( get_order_tax_data(instance, self.config, False) # type: ignore if is_order else get_checkout_tax_data(instance, lines_info, discounts, self.config) # type: ignore ) if not response or "error" in response: return None return response def assign_tax_code_to_object_meta( self, obj: Union["Product", "ProductType"], tax_code: Optional[str], previous_value: Any, ): if not self.active: return previous_value if tax_code is None and obj.pk: obj.delete_value_from_metadata(META_CODE_KEY) obj.delete_value_from_metadata(META_DESCRIPTION_KEY) return previous_value codes = get_cached_tax_codes_or_fetch(self.config) if tax_code not in codes: return previous_value tax_description = codes.get(tax_code) tax_item = {META_CODE_KEY: tax_code, META_DESCRIPTION_KEY: tax_description} obj.store_value_in_metadata(items=tax_item) return previous_value def get_tax_code_from_object_meta( self, obj: Union["Product", "ProductType"], previous_value: Any ) -> TaxType: if not self.active: return previous_value # Product has None as it determines if we overwrite taxes for the product default_tax_code = None default_tax_description = None if isinstance(obj, ProductType): default_tax_code = DEFAULT_TAX_CODE default_tax_description = DEFAULT_TAX_DESCRIPTION tax_code = obj.get_value_from_metadata(META_CODE_KEY, default_tax_code) tax_description = obj.get_value_from_metadata( META_DESCRIPTION_KEY, default_tax_description ) return TaxType( code=tax_code, description=tax_description, ) def show_taxes_on_storefront(self, previous_value: bool) -> bool: if not self.active: return previous_value return False def fetch_taxes_data(self, previous_value): if not self.active: return previous_value get_cached_tax_codes_or_fetch(self.config) return True @classmethod def validate_authentication(cls, plugin_configuration: "PluginConfiguration"): conf = { data["name"]: data["value"] for data in plugin_configuration.configuration } url = urljoin(get_api_url(conf["Use sandbox"]), "utilities/ping") with opentracing.global_tracer().start_active_span( "avatax.utilities.ping" ) as scope: span = scope.span span.set_tag(opentracing.tags.COMPONENT, "tax") span.set_tag("service.name", "avatax") response = api_get_request( url, username_or_account=conf["Username or account"], password_or_license=conf["Password or license"], ) if not response.get("authenticated"): raise ValidationError( "Authentication failed. Please check provided data.", code=PluginErrorCode.PLUGIN_MISCONFIGURED.value, ) @classmethod def validate_plugin_configuration(cls, plugin_configuration: "PluginConfiguration"): """Validate if provided configuration is correct.""" missing_fields = [] configuration = plugin_configuration.configuration configuration = {item["name"]: item["value"] for item in configuration} if not configuration["Username or account"]: missing_fields.append("Username or account") if not configuration["Password or license"]: missing_fields.append("Password or license") if plugin_configuration.active: if missing_fields: error_msg = ( "To enable a plugin, you need to provide values for the " "following fields: " ) raise ValidationError( error_msg + ", ".join(missing_fields), code=PluginErrorCode.PLUGIN_MISCONFIGURED.value, ) cls.validate_authentication(plugin_configuration)
36.402536
100
0.623291
import logging from dataclasses import asdict from decimal import Decimal from typing import TYPE_CHECKING, Any, Dict, Iterable, List, Optional, Union from urllib.parse import urljoin import opentracing import opentracing.tags from django.core.exceptions import ValidationError from prices import Money, TaxedMoney, TaxedMoneyRange from ...checkout import base_calculations from ...checkout.fetch import fetch_checkout_lines from ...core.taxes import TaxError, TaxType, charge_taxes_on_shipping, zero_taxed_money from ...discount import DiscountInfo from ...product.models import ProductType from ..base_plugin import BasePlugin, ConfigurationTypeField from ..error_codes import PluginErrorCode from . import ( DEFAULT_TAX_CODE, DEFAULT_TAX_DESCRIPTION, META_CODE_KEY, META_DESCRIPTION_KEY, AvataxConfiguration, CustomerErrors, TransactionType, _validate_checkout, _validate_order, api_get_request, api_post_request, generate_request_data_from_checkout, get_api_url, get_cached_tax_codes_or_fetch, get_checkout_tax_data, get_order_request_data, get_order_tax_data, ) from .tasks import api_post_request_task if TYPE_CHECKING: from ...account.models import Address from ...channel.models import Channel from ...checkout.fetch import CheckoutInfo, CheckoutLineInfo from ...checkout.models import Checkout, CheckoutLine from ...order.models import Order, OrderLine from ...product.models import Product, ProductVariant from ..models import PluginConfiguration logger = logging.getLogger(__name__) class AvataxPlugin(BasePlugin): PLUGIN_NAME = "Avalara" PLUGIN_ID = "mirumee.taxes.avalara" DEFAULT_CONFIGURATION = [ {"name": "Username or account", "value": None}, {"name": "Password or license", "value": None}, {"name": "Use sandbox", "value": True}, {"name": "Company name", "value": "DEFAULT"}, {"name": "Autocommit", "value": False}, ] CONFIG_STRUCTURE = { "Username or account": { "type": ConfigurationTypeField.STRING, "help_text": "Provide user or account details", "label": "Username or account", }, "Password or license": { "type": ConfigurationTypeField.PASSWORD, "help_text": "Provide password or license details", "label": "Password or license", }, "Use sandbox": { "type": ConfigurationTypeField.BOOLEAN, "help_text": "Determines if Saleor should use Avatax sandbox API.", "label": "Use sandbox", }, "Company name": { "type": ConfigurationTypeField.STRING, "help_text": "Avalara needs to receive company code. Some more " "complicated systems can use more than one company " "code, in that case, this variable should be changed " "based on data from Avalara's admin panel", "label": "Company name", }, "Autocommit": { "type": ConfigurationTypeField.BOOLEAN, "help_text": "Determines, if all transactions sent to Avalara " "should be committed by default.", "label": "Autocommit", }, } def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) # Convert to dict to easier take config elements configuration = {item["name"]: item["value"] for item in self.configuration} self.config = AvataxConfiguration( username_or_account=configuration["Username or account"], password_or_license=configuration["Password or license"], use_sandbox=configuration["Use sandbox"], company_name=configuration["Company name"], autocommit=configuration["Autocommit"], ) def _skip_plugin( self, previous_value: Union[TaxedMoney, TaxedMoneyRange, Decimal] ) -> bool: if not (self.config.username_or_account and self.config.password_or_license): return True if not self.active: return True # The previous plugin already calculated taxes so we can skip our logic if isinstance(previous_value, TaxedMoneyRange): start = previous_value.start stop = previous_value.stop return start.net != start.gross and stop.net != stop.gross if isinstance(previous_value, TaxedMoney): return previous_value.net != previous_value.gross return False def _append_prices_of_not_taxed_lines( self, price: TaxedMoney, lines: Iterable["CheckoutLineInfo"], channel: "Channel", discounts: Iterable[DiscountInfo], ): for line_info in lines: if line_info.variant.product.charge_taxes: continue line_price = base_calculations.base_checkout_line_total( line_info, channel, discounts, ) price.gross.amount += line_price.gross.amount price.net.amount += line_price.net.amount return price def calculate_checkout_total( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: TaxedMoney, ) -> TaxedMoney: if self._skip_plugin(previous_value): return previous_value checkout_total = previous_value if not _validate_checkout(checkout_info, lines): return checkout_total response = get_checkout_tax_data(checkout_info, lines, discounts, self.config) if not response or "error" in response: return checkout_total currency = response.get("currencyCode") tax = Decimal(response.get("totalTax", 0.0)) total_net = Decimal(response.get("totalAmount", 0.0)) total_gross = Money(amount=total_net + tax, currency=currency) total_net = Money(amount=total_net, currency=currency) taxed_total = TaxedMoney(net=total_net, gross=total_gross) total = self._append_prices_of_not_taxed_lines( taxed_total, lines, checkout_info.channel, discounts ) voucher_value = checkout_info.checkout.discount if voucher_value: total -= voucher_value return max(total, zero_taxed_money(total.currency)) def _calculate_checkout_shipping( self, currency: str, lines: List[Dict], shipping_price: TaxedMoney ) -> TaxedMoney: shipping_tax = Decimal(0.0) shipping_net = shipping_price.net.amount for line in lines: if line["itemCode"] == "Shipping": shipping_net = Decimal(line["lineAmount"]) shipping_tax = Decimal(line["tax"]) break shipping_gross = Money(amount=shipping_net + shipping_tax, currency=currency) shipping_net = Money(amount=shipping_net, currency=currency) return TaxedMoney(net=shipping_net, gross=shipping_gross) def calculate_checkout_shipping( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: TaxedMoney, ) -> TaxedMoney: base_shipping_price = previous_value if not charge_taxes_on_shipping(): return base_shipping_price if self._skip_plugin(previous_value): return base_shipping_price if not _validate_checkout(checkout_info, lines): return base_shipping_price response = get_checkout_tax_data(checkout_info, lines, discounts, self.config) if not response or "error" in response: return base_shipping_price currency = str(response.get("currencyCode")) return self._calculate_checkout_shipping( currency, response.get("lines", []), base_shipping_price ) def preprocess_order_creation( self, checkout_info: "CheckoutInfo", discounts: Iterable[DiscountInfo], lines: Optional[Iterable["CheckoutLineInfo"]], previous_value: Any, ): if lines is None: lines = fetch_checkout_lines(checkout_info.checkout) if self._skip_plugin(previous_value): return previous_value data = generate_request_data_from_checkout( checkout_info, lines, self.config, transaction_token=str(checkout_info.checkout.token), transaction_type=TransactionType.ORDER, discounts=discounts, ) if not data.get("createTransactionModel", {}).get("lines"): return previous_value transaction_url = urljoin( get_api_url(self.config.use_sandbox), "transactions/createoradjust" ) with opentracing.global_tracer().start_active_span( "avatax.transactions.crateoradjust" ) as scope: span = scope.span span.set_tag(opentracing.tags.COMPONENT, "tax") span.set_tag("service.name", "avatax") response = api_post_request(transaction_url, data, self.config) if not response or "error" in response: msg = response.get("error", {}).get("message", "") error_code = response.get("error", {}).get("code", "") logger.warning( "Unable to calculate taxes for checkout %s, error_code: %s, " "error_msg: %s", checkout_info.checkout.token, error_code, msg, ) customer_msg = CustomerErrors.get_error_msg(response.get("error", {})) raise TaxError(customer_msg) return previous_value def order_created(self, order: "Order", previous_value: Any) -> Any: if not self.active: return previous_value request_data = get_order_request_data(order, self.config) transaction_url = urljoin( get_api_url(self.config.use_sandbox), "transactions/createoradjust" ) api_post_request_task.delay( transaction_url, request_data, asdict(self.config), order.id ) return previous_value def calculate_checkout_line_total( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], checkout_line_info: "CheckoutLineInfo", address: Optional["Address"], discounts: Iterable["DiscountInfo"], previous_value: TaxedMoney, ) -> TaxedMoney: if self._skip_plugin(previous_value): return previous_value base_total = previous_value if not checkout_line_info.product.charge_taxes: return base_total if not _validate_checkout(checkout_info, lines): return base_total taxes_data = get_checkout_tax_data(checkout_info, lines, discounts, self.config) if not taxes_data or "error" in taxes_data: return base_total currency = taxes_data.get("currencyCode") for line in taxes_data.get("lines", []): if line.get("itemCode") == checkout_line_info.variant.sku: tax = Decimal(line.get("tax", 0.0)) line_net = Decimal(line["lineAmount"]) line_gross = Money(amount=line_net + tax, currency=currency) line_net = Money(amount=line_net, currency=currency) return TaxedMoney(net=line_net, gross=line_gross) return base_total def calculate_checkout_line_unit_price( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], checkout_line_info: "CheckoutLineInfo", address: Optional["Address"], discounts: Iterable["DiscountInfo"], previous_value: TaxedMoney, ): if not checkout_line_info.product.charge_taxes: return previous_value return self._calculate_unit_price( checkout_info, checkout_line_info.line, lines, checkout_line_info.variant, previous_value, discounts, is_order=False, ) def calculate_order_line_unit( self, order: "Order", order_line: "OrderLine", variant: "ProductVariant", product: "Product", previous_value: TaxedMoney, ) -> TaxedMoney: if not variant or (variant and not product.charge_taxes): return previous_value return self._calculate_unit_price( order, order_line, [], variant, previous_value, is_order=True ) def _calculate_unit_price( self, instance: Union["CheckoutInfo", "Order"], line: Union["CheckoutLine", "OrderLine"], lines_info: Iterable["CheckoutLineInfo"], variant: "ProductVariant", base_value: TaxedMoney, discounts: Optional[Iterable[DiscountInfo]] = [], *, is_order: bool, ): taxes_data = self._get_tax_data( instance, base_value, is_order, discounts, lines_info ) if taxes_data is None: return base_value currency = taxes_data.get("currencyCode") for line_data in taxes_data.get("lines", []): if line_data.get("itemCode") == variant.sku: tax = Decimal(line_data.get("tax", 0.0)) / line.quantity net = Decimal(line_data.get("lineAmount", 0.0)) / line.quantity gross = Money(amount=net + tax, currency=currency) net = Money(amount=net, currency=currency) return TaxedMoney(net=net, gross=gross) return base_value def calculate_order_shipping( self, order: "Order", previous_value: TaxedMoney ) -> TaxedMoney: if self._skip_plugin(previous_value): return previous_value if not charge_taxes_on_shipping(): return previous_value if not _validate_order(order): return zero_taxed_money(order.total.currency) taxes_data = get_order_tax_data(order, self.config, False) currency = taxes_data.get("currencyCode") for line in taxes_data.get("lines", []): if line["itemCode"] == "Shipping": tax = Decimal(line.get("tax", 0.0)) net = Decimal(line.get("lineAmount", 0.0)) gross = Money(amount=net + tax, currency=currency) net = Money(amount=net, currency=currency) return TaxedMoney(net=net, gross=gross) return TaxedMoney( # Ignore typing checks because it is checked in _validate_order net=order.shipping_method.price, # type: ignore gross=order.shipping_method.price, # type: ignore ) def get_tax_rate_type_choices(self, previous_value: Any) -> List[TaxType]: if not self.active: return previous_value return [ TaxType(code=tax_code, description=desc) for tax_code, desc in get_cached_tax_codes_or_fetch(self.config).items() ] def get_checkout_line_tax_rate( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], checkout_line_info: "CheckoutLineInfo", address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: Decimal, ) -> Decimal: return self._get_unit_tax_rate( checkout_info, previous_value, False, discounts, lines ) def get_order_line_tax_rate( self, order: "Order", product: "Product", address: Optional["Address"], previous_value: Decimal, ) -> Decimal: return self._get_unit_tax_rate(order, previous_value, True) def get_checkout_shipping_tax_rate( self, checkout_info: "CheckoutInfo", lines: Iterable["CheckoutLineInfo"], address: Optional["Address"], discounts: Iterable[DiscountInfo], previous_value: Decimal, ): return self._get_shipping_tax_rate( checkout_info, previous_value, False, discounts, lines, ) def get_order_shipping_tax_rate(self, order: "Order", previous_value: Decimal): return self._get_shipping_tax_rate(order, previous_value, True) def _get_unit_tax_rate( self, instance: Union["Order", "CheckoutInfo"], base_rate: Decimal, is_order: bool, discounts: Optional[Iterable[DiscountInfo]] = None, lines_info: Iterable["CheckoutLineInfo"] = [], ): response = self._get_tax_data( instance, base_rate, is_order, discounts, lines_info ) if response is None: return base_rate rate = None response_summary = response.get("summary") if response_summary: rate = Decimal(response_summary[0].get("rate", 0.0)) return rate or base_rate def _get_shipping_tax_rate( self, instance: Union["Order", "CheckoutInfo"], base_rate: Decimal, is_order: bool, discounts: Optional[Iterable[DiscountInfo]] = None, lines_info: Iterable["CheckoutLineInfo"] = [], ): response = self._get_tax_data( instance, base_rate, is_order, discounts, lines_info ) if response is None: return base_rate lines_data = response.get("lines", []) for line in lines_data: if line["itemCode"] == "Shipping": line_details = line.get("details") if not line_details: return return Decimal(line_details[0].get("rate", 0.0)) return base_rate def _get_tax_data( self, instance: Union["Order", "CheckoutInfo"], base_value: Decimal, is_order: bool, discounts: Optional[Iterable[DiscountInfo]] = None, lines_info: Iterable["CheckoutLineInfo"] = [], ): if self._skip_plugin(base_value): return None valid = ( _validate_order(instance) # type: ignore if is_order else _validate_checkout(instance, lines_info) # type: ignore ) if not valid: return None response = ( get_order_tax_data(instance, self.config, False) # type: ignore if is_order else get_checkout_tax_data(instance, lines_info, discounts, self.config) # type: ignore ) if not response or "error" in response: return None return response def assign_tax_code_to_object_meta( self, obj: Union["Product", "ProductType"], tax_code: Optional[str], previous_value: Any, ): if not self.active: return previous_value if tax_code is None and obj.pk: obj.delete_value_from_metadata(META_CODE_KEY) obj.delete_value_from_metadata(META_DESCRIPTION_KEY) return previous_value codes = get_cached_tax_codes_or_fetch(self.config) if tax_code not in codes: return previous_value tax_description = codes.get(tax_code) tax_item = {META_CODE_KEY: tax_code, META_DESCRIPTION_KEY: tax_description} obj.store_value_in_metadata(items=tax_item) return previous_value def get_tax_code_from_object_meta( self, obj: Union["Product", "ProductType"], previous_value: Any ) -> TaxType: if not self.active: return previous_value # Product has None as it determines if we overwrite taxes for the product default_tax_code = None default_tax_description = None if isinstance(obj, ProductType): default_tax_code = DEFAULT_TAX_CODE default_tax_description = DEFAULT_TAX_DESCRIPTION tax_code = obj.get_value_from_metadata(META_CODE_KEY, default_tax_code) tax_description = obj.get_value_from_metadata( META_DESCRIPTION_KEY, default_tax_description ) return TaxType( code=tax_code, description=tax_description, ) def show_taxes_on_storefront(self, previous_value: bool) -> bool: if not self.active: return previous_value return False def fetch_taxes_data(self, previous_value): if not self.active: return previous_value get_cached_tax_codes_or_fetch(self.config) return True @classmethod def validate_authentication(cls, plugin_configuration: "PluginConfiguration"): conf = { data["name"]: data["value"] for data in plugin_configuration.configuration } url = urljoin(get_api_url(conf["Use sandbox"]), "utilities/ping") with opentracing.global_tracer().start_active_span( "avatax.utilities.ping" ) as scope: span = scope.span span.set_tag(opentracing.tags.COMPONENT, "tax") span.set_tag("service.name", "avatax") response = api_get_request( url, username_or_account=conf["Username or account"], password_or_license=conf["Password or license"], ) if not response.get("authenticated"): raise ValidationError( "Authentication failed. Please check provided data.", code=PluginErrorCode.PLUGIN_MISCONFIGURED.value, ) @classmethod def validate_plugin_configuration(cls, plugin_configuration: "PluginConfiguration"): missing_fields = [] configuration = plugin_configuration.configuration configuration = {item["name"]: item["value"] for item in configuration} if not configuration["Username or account"]: missing_fields.append("Username or account") if not configuration["Password or license"]: missing_fields.append("Password or license") if plugin_configuration.active: if missing_fields: error_msg = ( "To enable a plugin, you need to provide values for the " "following fields: " ) raise ValidationError( error_msg + ", ".join(missing_fields), code=PluginErrorCode.PLUGIN_MISCONFIGURED.value, ) cls.validate_authentication(plugin_configuration)
true
true
f71e4eb8f2d77ec51105db33c6cf3421c481bf57
2,194
py
Python
utils.py
uhh-lt/semeval2019-hhmm
b746b0fb8ab3b957d399276cb354e950f0ef30ed
[ "Apache-2.0" ]
null
null
null
utils.py
uhh-lt/semeval2019-hhmm
b746b0fb8ab3b957d399276cb354e950f0ef30ed
[ "Apache-2.0" ]
null
null
null
utils.py
uhh-lt/semeval2019-hhmm
b746b0fb8ab3b957d399276cb354e950f0ef30ed
[ "Apache-2.0" ]
null
null
null
import pandas as pd from pathlib import Path def df_to_csv(df, path): df.to_csv(path, sep='\t', index=False, encoding='utf-8') def csv_to_df(path): df = pd.read_csv(path, sep='\t', dtype=str, encoding='utf-8') return df def max_arguments(task): fp = open(task, 'r') lines_args = fp.readlines() maxT = 0 for line in lines_args: tokens = len(line.split(' ')) if tokens > maxT: maxT = tokens return maxT - 3 # context_id, verb pos, verb-frame def max_frameArguments(dataset): dir = "./semeval_data" task21_auto = dir + "/dev/auto/task-2.1.auto.txt" task21_dev = dir + "/dev/task-2.1.txt" task21_test =dir+"/test/task-2.1.txt" if dataset == 'dev': task21 = task21_dev elif dataset == 'auto': task21 = task21_auto elif dataset == 'test': task21 = task21_test return max_arguments(task21) # ------------------------------------------------------------- df input from txt import ud2csv dir = "./semeval_data" ud_gold = dir+"/dep-stx/pos-gold-dep-auto.conll.txt" # ----------------------------------- def task_to_df(task, dataset): if Path('./input/train_task{}_{}.csv'.format(task, dataset)).exists(): return csv_to_df('./input/train_task{}_{}.csv'.format(task, dataset)) else: if task==1: return ud2csv.task1_to_df(dir+'/{}/task-1.txt'.format(dataset), ud_gold) if task ==22: return ud2csv.task22_to_df(dir + '/{}/task-2.2.txt'.format(dataset), ud_gold) def task1_to_df_gd(dataset): if Path('./input/train_task{}_{}.csv'.format(1, dataset)).exists(): return csv_to_df('./input/gd_task{}_{}.csv'.format(1, dataset)) else: return ud2csv.task1_to_df_gd(dir+'/{}/task-1.txt'.format(dataset), ud_gold) def task22_baselines(dataset, gr='in'): if Path('./input/all_grammaticalLabels_{}.csv'.format(dataset)).exists(): df_task22 = csv_to_df('./input/all_grammaticalLabels_{}.csv'.format(dataset)) else: df_task22 = ud2csv.task22_to_df_withFrameArgsDependencies(dir+'/{}/task-2.2.txt'.format(dataset), ud_gold) return ud2csv.getGrammaticalBaseline(df_task22, gr)
29.648649
114
0.611668
import pandas as pd from pathlib import Path def df_to_csv(df, path): df.to_csv(path, sep='\t', index=False, encoding='utf-8') def csv_to_df(path): df = pd.read_csv(path, sep='\t', dtype=str, encoding='utf-8') return df def max_arguments(task): fp = open(task, 'r') lines_args = fp.readlines() maxT = 0 for line in lines_args: tokens = len(line.split(' ')) if tokens > maxT: maxT = tokens return maxT - 3 def max_frameArguments(dataset): dir = "./semeval_data" task21_auto = dir + "/dev/auto/task-2.1.auto.txt" task21_dev = dir + "/dev/task-2.1.txt" task21_test =dir+"/test/task-2.1.txt" if dataset == 'dev': task21 = task21_dev elif dataset == 'auto': task21 = task21_auto elif dataset == 'test': task21 = task21_test return max_arguments(task21) import ud2csv dir = "./semeval_data" ud_gold = dir+"/dep-stx/pos-gold-dep-auto.conll.txt" def task_to_df(task, dataset): if Path('./input/train_task{}_{}.csv'.format(task, dataset)).exists(): return csv_to_df('./input/train_task{}_{}.csv'.format(task, dataset)) else: if task==1: return ud2csv.task1_to_df(dir+'/{}/task-1.txt'.format(dataset), ud_gold) if task ==22: return ud2csv.task22_to_df(dir + '/{}/task-2.2.txt'.format(dataset), ud_gold) def task1_to_df_gd(dataset): if Path('./input/train_task{}_{}.csv'.format(1, dataset)).exists(): return csv_to_df('./input/gd_task{}_{}.csv'.format(1, dataset)) else: return ud2csv.task1_to_df_gd(dir+'/{}/task-1.txt'.format(dataset), ud_gold) def task22_baselines(dataset, gr='in'): if Path('./input/all_grammaticalLabels_{}.csv'.format(dataset)).exists(): df_task22 = csv_to_df('./input/all_grammaticalLabels_{}.csv'.format(dataset)) else: df_task22 = ud2csv.task22_to_df_withFrameArgsDependencies(dir+'/{}/task-2.2.txt'.format(dataset), ud_gold) return ud2csv.getGrammaticalBaseline(df_task22, gr)
true
true
f71e4ebc41a1f3a94f4f8f73cf4f5d5320ba4866
7,375
py
Python
activemri/experimental/cvpr19_models/data/masking_utils.py
qinliuliuqin/active-mri-acquisition
b561f838667f4bc7753b1f89dfbdd545d0f00ada
[ "MIT" ]
32
2020-10-05T19:46:56.000Z
2022-02-15T10:37:13.000Z
activemri/experimental/cvpr19_models/data/masking_utils.py
qinliuliuqin/active-mri-acquisition
b561f838667f4bc7753b1f89dfbdd545d0f00ada
[ "MIT" ]
2
2020-12-28T21:05:57.000Z
2022-01-22T17:56:50.000Z
activemri/experimental/cvpr19_models/data/masking_utils.py
qinliuliuqin/active-mri-acquisition
b561f838667f4bc7753b1f89dfbdd545d0f00ada
[ "MIT" ]
9
2020-11-22T18:15:04.000Z
2022-02-11T06:07:38.000Z
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import logging import numpy as np import torch def get_mask_func(mask_type, which_dataset, rnl_params=None): # Whether the number of lines is random or not random_num_lines = mask_type[-4:] == "_rnl" if "symmetric_basic" in mask_type: logging.info( f"Mask is symmetric uniform choice with random_num_lines={random_num_lines}." ) return SymmetricUniformChoiceMaskFunc( [0.125], [4], which_dataset, random_num_lines=random_num_lines, rnl_params=rnl_params, ) if "basic" in mask_type: # First two parameters are ignored if `random_num_lines` is True logging.info( f"Mask is fixed acceleration mask with random_num_lines={random_num_lines}." ) return BasicMaskFunc( [0.125], [4], which_dataset, random_num_lines=random_num_lines, rnl_params=rnl_params, ) if "low_to_high" in mask_type: logging.info( f"Mask is symmetric low to high with random_num_lines={random_num_lines}." ) return SymmetricLowToHighMaskFunc( [0.125], [4], which_dataset, random_num_lines=random_num_lines, rnl_params=rnl_params, ) if "symmetric_grid" in mask_type: logging.info("Mask is symmetric grid.") return SymmetricUniformGridMaskFunc( [], [], which_dataset, random_num_lines=True, rnl_params=rnl_params ) if "grid" in mask_type: logging.info("Mask is grid (not symmetric).") return UniformGridMaskFunc( [], [], which_dataset, random_num_lines=True, rnl_params=rnl_params ) raise ValueError(f"Invalid mask type: {mask_type}.") class MaskFunc: def __init__( self, center_fractions, accelerations, which_dataset, random_num_lines=False, rnl_params=None, ): if len(center_fractions) != len(accelerations): raise ValueError( "Number of center fractions should match number of accelerations" ) self.center_fractions = center_fractions self.accelerations = accelerations self.random_num_lines = random_num_lines if rnl_params is None: # The lines below give approx. 4x acceleration on average. self.min_lowf_lines = 10 if which_dataset != "KNEE_RAW" else 30 self.max_lowf_lines = 12 if which_dataset != "KNEE_RAW" else 32 self.highf_beta_alpha = 1 self.highf_beta_beta = 5 else: params = [int(x) for x in rnl_params.split(",")] assert len(params) == 4 self.min_lowf_lines = params[0] self.max_lowf_lines = params[1] self.highf_beta_alpha = params[2] self.highf_beta_beta = params[3] self.rng = np.random.RandomState() def __call__(self, shape, seed=None): if len(shape) < 3: raise ValueError("Shape should have 3 or more dimensions") self.rng.seed(seed) num_cols = shape[-2] # Determine number of low and high frequency lines to scan if self.random_num_lines: # These are guaranteed to be an even number (useful for symmetric masks) num_low_freqs = self.rng.choice( range(self.min_lowf_lines, self.max_lowf_lines, 2) ) num_high_freqs = ( int( self.rng.beta(self.highf_beta_alpha, self.highf_beta_beta) * (num_cols - num_low_freqs) // 2 ) * 2 ) else: choice = self.rng.randint(0, len(self.accelerations)) center_fraction = self.center_fractions[choice] acceleration = self.accelerations[choice] num_low_freqs = int(round(num_cols * center_fraction)) num_high_freqs = int(num_cols // acceleration - num_low_freqs) # Create the mask mask = self.create_lf_focused_mask(num_cols, num_high_freqs, num_low_freqs) # Reshape the mask mask_shape = [1 for _ in shape] mask_shape[-1] = num_cols mask = torch.from_numpy(mask.reshape(*mask_shape).astype(np.float32)) return mask def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): p = num_high_freqs / (num_cols - num_low_freqs) mask = self.rng.uniform(size=num_cols) < p pad = (num_cols - num_low_freqs + 1) // 2 mask[pad : pad + num_low_freqs] = True return mask class BasicMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) hf_cols = self.rng.choice( np.arange(num_cols - num_low_freqs), num_high_freqs, replace=False ) hf_cols[hf_cols >= (num_cols - num_low_freqs + 1) // 2] += num_low_freqs mask[hf_cols] = True pad = (num_cols - num_low_freqs + 1) // 2 mask[pad : pad + num_low_freqs] = True mask = np.fft.ifftshift(mask, axes=0) return mask class SymmetricUniformChoiceMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) num_cols //= 2 num_low_freqs //= 2 num_high_freqs //= 2 hf_cols = self.rng.choice( np.arange(num_cols - num_low_freqs), num_high_freqs, replace=False ) mask[hf_cols] = True pad = num_cols - num_low_freqs mask[pad:num_cols] = True mask[: -(num_cols + 1) : -1] = mask[:num_cols] mask = np.fft.ifftshift(mask, axes=0) return mask class UniformGridMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) acceleration = self.rng.choice([4, 8, 16]) hf_cols = np.arange(acceleration, num_cols, acceleration) mask[hf_cols] = True mask[: num_low_freqs // 2] = mask[-(num_low_freqs // 2) :] = True return mask class SymmetricLowToHighMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) num_cols //= 2 num_low_freqs //= 2 num_high_freqs //= 2 num_low_freqs += num_high_freqs pad = num_cols - num_low_freqs mask[pad:num_cols] = True mask[: -(num_cols + 1) : -1] = mask[:num_cols] mask = np.fft.ifftshift(mask, axes=0) return mask class SymmetricUniformGridMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) acceleration = self.rng.choice([4, 8, 16]) num_cols //= 2 num_low_freqs //= 2 hf_cols = np.arange(acceleration, num_cols, acceleration) mask[hf_cols] = True mask[:num_low_freqs] = True mask[: -(num_cols + 1) : -1] = mask[:num_cols] return mask
35.456731
89
0.608949
import logging import numpy as np import torch def get_mask_func(mask_type, which_dataset, rnl_params=None): random_num_lines = mask_type[-4:] == "_rnl" if "symmetric_basic" in mask_type: logging.info( f"Mask is symmetric uniform choice with random_num_lines={random_num_lines}." ) return SymmetricUniformChoiceMaskFunc( [0.125], [4], which_dataset, random_num_lines=random_num_lines, rnl_params=rnl_params, ) if "basic" in mask_type: logging.info( f"Mask is fixed acceleration mask with random_num_lines={random_num_lines}." ) return BasicMaskFunc( [0.125], [4], which_dataset, random_num_lines=random_num_lines, rnl_params=rnl_params, ) if "low_to_high" in mask_type: logging.info( f"Mask is symmetric low to high with random_num_lines={random_num_lines}." ) return SymmetricLowToHighMaskFunc( [0.125], [4], which_dataset, random_num_lines=random_num_lines, rnl_params=rnl_params, ) if "symmetric_grid" in mask_type: logging.info("Mask is symmetric grid.") return SymmetricUniformGridMaskFunc( [], [], which_dataset, random_num_lines=True, rnl_params=rnl_params ) if "grid" in mask_type: logging.info("Mask is grid (not symmetric).") return UniformGridMaskFunc( [], [], which_dataset, random_num_lines=True, rnl_params=rnl_params ) raise ValueError(f"Invalid mask type: {mask_type}.") class MaskFunc: def __init__( self, center_fractions, accelerations, which_dataset, random_num_lines=False, rnl_params=None, ): if len(center_fractions) != len(accelerations): raise ValueError( "Number of center fractions should match number of accelerations" ) self.center_fractions = center_fractions self.accelerations = accelerations self.random_num_lines = random_num_lines if rnl_params is None: self.min_lowf_lines = 10 if which_dataset != "KNEE_RAW" else 30 self.max_lowf_lines = 12 if which_dataset != "KNEE_RAW" else 32 self.highf_beta_alpha = 1 self.highf_beta_beta = 5 else: params = [int(x) for x in rnl_params.split(",")] assert len(params) == 4 self.min_lowf_lines = params[0] self.max_lowf_lines = params[1] self.highf_beta_alpha = params[2] self.highf_beta_beta = params[3] self.rng = np.random.RandomState() def __call__(self, shape, seed=None): if len(shape) < 3: raise ValueError("Shape should have 3 or more dimensions") self.rng.seed(seed) num_cols = shape[-2] if self.random_num_lines: num_low_freqs = self.rng.choice( range(self.min_lowf_lines, self.max_lowf_lines, 2) ) num_high_freqs = ( int( self.rng.beta(self.highf_beta_alpha, self.highf_beta_beta) * (num_cols - num_low_freqs) // 2 ) * 2 ) else: choice = self.rng.randint(0, len(self.accelerations)) center_fraction = self.center_fractions[choice] acceleration = self.accelerations[choice] num_low_freqs = int(round(num_cols * center_fraction)) num_high_freqs = int(num_cols // acceleration - num_low_freqs) mask = self.create_lf_focused_mask(num_cols, num_high_freqs, num_low_freqs) mask_shape = [1 for _ in shape] mask_shape[-1] = num_cols mask = torch.from_numpy(mask.reshape(*mask_shape).astype(np.float32)) return mask def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): p = num_high_freqs / (num_cols - num_low_freqs) mask = self.rng.uniform(size=num_cols) < p pad = (num_cols - num_low_freqs + 1) // 2 mask[pad : pad + num_low_freqs] = True return mask class BasicMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) hf_cols = self.rng.choice( np.arange(num_cols - num_low_freqs), num_high_freqs, replace=False ) hf_cols[hf_cols >= (num_cols - num_low_freqs + 1) // 2] += num_low_freqs mask[hf_cols] = True pad = (num_cols - num_low_freqs + 1) // 2 mask[pad : pad + num_low_freqs] = True mask = np.fft.ifftshift(mask, axes=0) return mask class SymmetricUniformChoiceMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) num_cols //= 2 num_low_freqs //= 2 num_high_freqs //= 2 hf_cols = self.rng.choice( np.arange(num_cols - num_low_freqs), num_high_freqs, replace=False ) mask[hf_cols] = True pad = num_cols - num_low_freqs mask[pad:num_cols] = True mask[: -(num_cols + 1) : -1] = mask[:num_cols] mask = np.fft.ifftshift(mask, axes=0) return mask class UniformGridMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) acceleration = self.rng.choice([4, 8, 16]) hf_cols = np.arange(acceleration, num_cols, acceleration) mask[hf_cols] = True mask[: num_low_freqs // 2] = mask[-(num_low_freqs // 2) :] = True return mask class SymmetricLowToHighMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) num_cols //= 2 num_low_freqs //= 2 num_high_freqs //= 2 num_low_freqs += num_high_freqs pad = num_cols - num_low_freqs mask[pad:num_cols] = True mask[: -(num_cols + 1) : -1] = mask[:num_cols] mask = np.fft.ifftshift(mask, axes=0) return mask class SymmetricUniformGridMaskFunc(MaskFunc): def create_lf_focused_mask(self, num_cols, num_high_freqs, num_low_freqs): mask = np.zeros([num_cols]) acceleration = self.rng.choice([4, 8, 16]) num_cols //= 2 num_low_freqs //= 2 hf_cols = np.arange(acceleration, num_cols, acceleration) mask[hf_cols] = True mask[:num_low_freqs] = True mask[: -(num_cols + 1) : -1] = mask[:num_cols] return mask
true
true
f71e53cc65fda9fdbec30eb8bdaa1bf278ded2d8
602
py
Python
Company_Based_Questions/Extras/Sum_of_bit_differences.py
Satyam-Bhalla/Competitive-Coding
5814f5f60572f1e76495efe751b94bf4d2845198
[ "MIT" ]
1
2021-12-09T10:36:48.000Z
2021-12-09T10:36:48.000Z
Company_Based_Questions/Extras/Sum_of_bit_differences.py
Satyam-Bhalla/Competitive-Coding
5814f5f60572f1e76495efe751b94bf4d2845198
[ "MIT" ]
null
null
null
Company_Based_Questions/Extras/Sum_of_bit_differences.py
Satyam-Bhalla/Competitive-Coding
5814f5f60572f1e76495efe751b94bf4d2845198
[ "MIT" ]
null
null
null
t = int(input()) # Python program to compute sum of pairwise bit differences def sumBitDifferences(arr,n): ans = 0 # Initialize result # traverse over all bits for i in range(0, 32): # count number of elements with i'th bit set count = 0 for j in range(0,n): if ( (arr[j] & (1 << i)) ): count+=1 # Add "count * (n - count) * 2" to the answer ans += (count * (n - count) * 2); return ans for _ in range(t): n = int(input()) l = list(map(int,input().split())) print(sumBitDifferences(l,n))
26.173913
59
0.528239
t = int(input()) def sumBitDifferences(arr,n): ans = 0 for i in range(0, 32): count = 0 for j in range(0,n): if ( (arr[j] & (1 << i)) ): count+=1 # Add "count * (n - count) * 2" to the answer ans += (count * (n - count) * 2); return ans for _ in range(t): n = int(input()) l = list(map(int,input().split())) print(sumBitDifferences(l,n))
true
true
f71e53e205f5ac04b5c06e079190727d551ec4a4
11,777
py
Python
src/engine/SCons/SConsignTests.py
andrewyoung1991/scons
7517c277e23bc04e3809a9bf0793cdfe00097a58
[ "MIT" ]
null
null
null
src/engine/SCons/SConsignTests.py
andrewyoung1991/scons
7517c277e23bc04e3809a9bf0793cdfe00097a58
[ "MIT" ]
null
null
null
src/engine/SCons/SConsignTests.py
andrewyoung1991/scons
7517c277e23bc04e3809a9bf0793cdfe00097a58
[ "MIT" ]
null
null
null
# # __COPYRIGHT__ # # Permission is hereby granted, free of charge, to any person obtaining # a copy of this software and associated documentation files (the # "Software"), to deal in the Software without restriction, including # without limitation the rights to use, copy, modify, merge, publish, # distribute, sublicense, and/or sell copies of the Software, and to # permit persons to whom the Software is furnished to do so, subject to # the following conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY # KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE # WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND # NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE # LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION # OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION # WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. # __revision__ = "__FILE__ __REVISION__ __DATE__ __DEVELOPER__" import os import sys import unittest import TestCmd import TestUnit import SCons.dblite import SCons.SConsign class BuildInfo(object): def merge(self, object): pass class DummySConsignEntry(object): def __init__(self, name): self.name = name self.binfo = BuildInfo() def convert_to_sconsign(self): self.c_to_s = 1 def convert_from_sconsign(self, dir, name): self.c_from_s = 1 class FS(object): def __init__(self, top): self.Top = top self.Top.repositories = [] class DummyNode(object): def __init__(self, path='not_a_valid_path', binfo=None): self.path = path self.tpath = path self.fs = FS(self) self.binfo = binfo def get_stored_info(self): return self.binfo def get_binfo(self): return self.binfo class SConsignTestCase(unittest.TestCase): def setUp(self): self.save_cwd = os.getcwd() self.test = TestCmd.TestCmd(workdir = '') os.chdir(self.test.workpath('')) def tearDown(self): self.test.cleanup() SCons.SConsign.Reset() os.chdir(self.save_cwd) class BaseTestCase(SConsignTestCase): def test_Base(self): aaa = DummySConsignEntry('aaa') bbb = DummySConsignEntry('bbb') bbb.arg1 = 'bbb arg1' ccc = DummySConsignEntry('ccc') ccc.arg2 = 'ccc arg2' f = SCons.SConsign.Base() f.set_entry('aaa', aaa) f.set_entry('bbb', bbb) #f.merge() e = f.get_entry('aaa') assert e == aaa, e assert e.name == 'aaa', e.name e = f.get_entry('bbb') assert e == bbb, e assert e.name == 'bbb', e.name assert e.arg1 == 'bbb arg1', e.arg1 assert not hasattr(e, 'arg2'), e f.set_entry('bbb', ccc) e = f.get_entry('bbb') assert e.name == 'ccc', e.name assert not hasattr(e, 'arg1'), e assert e.arg2 == 'ccc arg2', e.arg1 ddd = DummySConsignEntry('ddd') eee = DummySConsignEntry('eee') fff = DummySConsignEntry('fff') fff.arg = 'fff arg' f = SCons.SConsign.Base() f.set_entry('ddd', ddd) f.set_entry('eee', eee) e = f.get_entry('ddd') assert e == ddd, e assert e.name == 'ddd', e.name e = f.get_entry('eee') assert e == eee, e assert e.name == 'eee', e.name assert not hasattr(e, 'arg'), e f.set_entry('eee', fff) e = f.get_entry('eee') assert e.name == 'fff', e.name assert e.arg == 'fff arg', e.arg def test_store_info(self): aaa = DummySConsignEntry('aaa') bbb = DummySConsignEntry('bbb') bbb.arg1 = 'bbb arg1' ccc = DummySConsignEntry('ccc') ccc.arg2 = 'ccc arg2' f = SCons.SConsign.Base() f.store_info('aaa', DummyNode('aaa', aaa)) f.store_info('bbb', DummyNode('bbb', bbb)) try: e = f.get_entry('aaa') except KeyError: pass else: raise Exception("unexpected entry %s" % e) try: e = f.get_entry('bbb') except KeyError: pass else: raise Exception("unexpected entry %s" % e) f.merge() e = f.get_entry('aaa') assert e == aaa, "aaa = %s, e = %s" % (aaa, e) assert e.name == 'aaa', e.name e = f.get_entry('bbb') assert e == bbb, "bbb = %s, e = %s" % (bbb, e) assert e.name == 'bbb', e.name assert e.arg1 == 'bbb arg1', e.arg1 assert not hasattr(e, 'arg2'), e f.store_info('bbb', DummyNode('bbb', ccc)) e = f.get_entry('bbb') assert e == bbb, e assert e.name == 'bbb', e.name assert e.arg1 == 'bbb arg1', e.arg1 assert not hasattr(e, 'arg2'), e f.merge() e = f.get_entry('bbb') assert e.name == 'ccc', e.name assert not hasattr(e, 'arg1'), e assert e.arg2 == 'ccc arg2', e.arg1 ddd = DummySConsignEntry('ddd') eee = DummySConsignEntry('eee') fff = DummySConsignEntry('fff') fff.arg = 'fff arg' f = SCons.SConsign.Base() f.store_info('ddd', DummyNode('ddd', ddd)) f.store_info('eee', DummyNode('eee', eee)) f.merge() e = f.get_entry('ddd') assert e == ddd, e assert e.name == 'ddd', e.name e = f.get_entry('eee') assert e == eee, e assert e.name == 'eee', e.name assert not hasattr(e, 'arg'), e f.store_info('eee', DummyNode('eee', fff)) e = f.get_entry('eee') assert e == eee, e assert e.name == 'eee', e.name assert not hasattr(e, 'arg'), e f.merge() e = f.get_entry('eee') assert e.name == 'fff', e.name assert e.arg == 'fff arg', e.arg class SConsignDBTestCase(SConsignTestCase): def test_SConsignDB(self): save_DataBase = SCons.SConsign.DataBase SCons.SConsign.DataBase = {} try: d1 = SCons.SConsign.DB(DummyNode('dir1')) d1.set_entry('aaa', DummySConsignEntry('aaa name')) d1.set_entry('bbb', DummySConsignEntry('bbb name')) aaa = d1.get_entry('aaa') assert aaa.name == 'aaa name' bbb = d1.get_entry('bbb') assert bbb.name == 'bbb name' d2 = SCons.SConsign.DB(DummyNode('dir2')) d2.set_entry('ccc', DummySConsignEntry('ccc name')) d2.set_entry('ddd', DummySConsignEntry('ddd name')) ccc = d2.get_entry('ccc') assert ccc.name == 'ccc name' ddd = d2.get_entry('ddd') assert ddd.name == 'ddd name' d31 = SCons.SConsign.DB(DummyNode('dir3/sub1')) d31.set_entry('eee', DummySConsignEntry('eee name')) d31.set_entry('fff', DummySConsignEntry('fff name')) eee = d31.get_entry('eee') assert eee.name == 'eee name' fff = d31.get_entry('fff') assert fff.name == 'fff name' d32 = SCons.SConsign.DB(DummyNode('dir3%ssub2' % os.sep)) d32.set_entry('ggg', DummySConsignEntry('ggg name')) d32.set_entry('hhh', DummySConsignEntry('hhh name')) ggg = d32.get_entry('ggg') assert ggg.name == 'ggg name' hhh = d32.get_entry('hhh') assert hhh.name == 'hhh name' finally: SCons.SConsign.DataBase = save_DataBase class SConsignDirFileTestCase(SConsignTestCase): def test_SConsignDirFile(self): bi_foo = DummySConsignEntry('foo') bi_bar = DummySConsignEntry('bar') f = SCons.SConsign.DirFile(DummyNode()) f.set_entry('foo', bi_foo) f.set_entry('bar', bi_bar) e = f.get_entry('foo') assert e == bi_foo, e assert e.name == 'foo', e.name e = f.get_entry('bar') assert e == bi_bar, e assert e.name == 'bar', e.name assert not hasattr(e, 'arg'), e bbb = DummySConsignEntry('bbb') bbb.arg = 'bbb arg' f.set_entry('bar', bbb) e = f.get_entry('bar') assert e.name == 'bbb', e.name assert e.arg == 'bbb arg', e.arg class SConsignFileTestCase(SConsignTestCase): def test_SConsignFile(self): test = self.test file = test.workpath('sconsign_file') assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name == ".sconsign", SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is SCons.dblite, SCons.SConsign.DB_Module SCons.SConsign.File(file) assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name is file, SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is SCons.dblite, SCons.SConsign.DB_Module SCons.SConsign.File(None) assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name is file, SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is None, SCons.SConsign.DB_Module class Fake_DBM(object): def open(self, name, mode): self.name = name self.mode = mode return self def __getitem__(self, key): pass def __setitem__(self, key, value): pass fake_dbm = Fake_DBM() SCons.SConsign.File(file, fake_dbm) assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name is file, SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is fake_dbm, SCons.SConsign.DB_Module assert not hasattr(fake_dbm, 'name'), fake_dbm assert not hasattr(fake_dbm, 'mode'), fake_dbm SCons.SConsign.ForDirectory(DummyNode(test.workpath('dir'))) assert not SCons.SConsign.DataBase is None, SCons.SConsign.DataBase assert fake_dbm.name == file, fake_dbm.name assert fake_dbm.mode == "c", fake_dbm.mode class writeTestCase(SConsignTestCase): def test_write(self): test = self.test file = test.workpath('sconsign_file') class Fake_DBM(object): def __getitem__(self, key): return None def __setitem__(self, key, value): pass def open(self, name, mode): self.sync_count = 0 return self def sync(self): self.sync_count = self.sync_count + 1 fake_dbm = Fake_DBM() SCons.SConsign.DataBase = {} SCons.SConsign.File(file, fake_dbm) f = SCons.SConsign.DB(DummyNode()) bi_foo = DummySConsignEntry('foo') bi_bar = DummySConsignEntry('bar') f.set_entry('foo', bi_foo) f.set_entry('bar', bi_bar) SCons.SConsign.write() assert bi_foo.c_to_s, bi_foo.c_to_s assert bi_bar.c_to_s, bi_bar.c_to_s assert fake_dbm.sync_count == 1, fake_dbm.sync_count if __name__ == "__main__": suite = unittest.TestSuite() tclasses = [ BaseTestCase, SConsignDBTestCase, SConsignDirFileTestCase, SConsignFileTestCase, writeTestCase, ] for tclass in tclasses: names = unittest.getTestCaseNames(tclass, 'test_') suite.addTests(list(map(tclass, names))) TestUnit.run(suite) # Local Variables: # tab-width:4 # indent-tabs-mode:nil # End: # vim: set expandtab tabstop=4 shiftwidth=4:
29.516291
81
0.585888
__revision__ = "__FILE__ __REVISION__ __DATE__ __DEVELOPER__" import os import sys import unittest import TestCmd import TestUnit import SCons.dblite import SCons.SConsign class BuildInfo(object): def merge(self, object): pass class DummySConsignEntry(object): def __init__(self, name): self.name = name self.binfo = BuildInfo() def convert_to_sconsign(self): self.c_to_s = 1 def convert_from_sconsign(self, dir, name): self.c_from_s = 1 class FS(object): def __init__(self, top): self.Top = top self.Top.repositories = [] class DummyNode(object): def __init__(self, path='not_a_valid_path', binfo=None): self.path = path self.tpath = path self.fs = FS(self) self.binfo = binfo def get_stored_info(self): return self.binfo def get_binfo(self): return self.binfo class SConsignTestCase(unittest.TestCase): def setUp(self): self.save_cwd = os.getcwd() self.test = TestCmd.TestCmd(workdir = '') os.chdir(self.test.workpath('')) def tearDown(self): self.test.cleanup() SCons.SConsign.Reset() os.chdir(self.save_cwd) class BaseTestCase(SConsignTestCase): def test_Base(self): aaa = DummySConsignEntry('aaa') bbb = DummySConsignEntry('bbb') bbb.arg1 = 'bbb arg1' ccc = DummySConsignEntry('ccc') ccc.arg2 = 'ccc arg2' f = SCons.SConsign.Base() f.set_entry('aaa', aaa) f.set_entry('bbb', bbb) e = f.get_entry('aaa') assert e == aaa, e assert e.name == 'aaa', e.name e = f.get_entry('bbb') assert e == bbb, e assert e.name == 'bbb', e.name assert e.arg1 == 'bbb arg1', e.arg1 assert not hasattr(e, 'arg2'), e f.set_entry('bbb', ccc) e = f.get_entry('bbb') assert e.name == 'ccc', e.name assert not hasattr(e, 'arg1'), e assert e.arg2 == 'ccc arg2', e.arg1 ddd = DummySConsignEntry('ddd') eee = DummySConsignEntry('eee') fff = DummySConsignEntry('fff') fff.arg = 'fff arg' f = SCons.SConsign.Base() f.set_entry('ddd', ddd) f.set_entry('eee', eee) e = f.get_entry('ddd') assert e == ddd, e assert e.name == 'ddd', e.name e = f.get_entry('eee') assert e == eee, e assert e.name == 'eee', e.name assert not hasattr(e, 'arg'), e f.set_entry('eee', fff) e = f.get_entry('eee') assert e.name == 'fff', e.name assert e.arg == 'fff arg', e.arg def test_store_info(self): aaa = DummySConsignEntry('aaa') bbb = DummySConsignEntry('bbb') bbb.arg1 = 'bbb arg1' ccc = DummySConsignEntry('ccc') ccc.arg2 = 'ccc arg2' f = SCons.SConsign.Base() f.store_info('aaa', DummyNode('aaa', aaa)) f.store_info('bbb', DummyNode('bbb', bbb)) try: e = f.get_entry('aaa') except KeyError: pass else: raise Exception("unexpected entry %s" % e) try: e = f.get_entry('bbb') except KeyError: pass else: raise Exception("unexpected entry %s" % e) f.merge() e = f.get_entry('aaa') assert e == aaa, "aaa = %s, e = %s" % (aaa, e) assert e.name == 'aaa', e.name e = f.get_entry('bbb') assert e == bbb, "bbb = %s, e = %s" % (bbb, e) assert e.name == 'bbb', e.name assert e.arg1 == 'bbb arg1', e.arg1 assert not hasattr(e, 'arg2'), e f.store_info('bbb', DummyNode('bbb', ccc)) e = f.get_entry('bbb') assert e == bbb, e assert e.name == 'bbb', e.name assert e.arg1 == 'bbb arg1', e.arg1 assert not hasattr(e, 'arg2'), e f.merge() e = f.get_entry('bbb') assert e.name == 'ccc', e.name assert not hasattr(e, 'arg1'), e assert e.arg2 == 'ccc arg2', e.arg1 ddd = DummySConsignEntry('ddd') eee = DummySConsignEntry('eee') fff = DummySConsignEntry('fff') fff.arg = 'fff arg' f = SCons.SConsign.Base() f.store_info('ddd', DummyNode('ddd', ddd)) f.store_info('eee', DummyNode('eee', eee)) f.merge() e = f.get_entry('ddd') assert e == ddd, e assert e.name == 'ddd', e.name e = f.get_entry('eee') assert e == eee, e assert e.name == 'eee', e.name assert not hasattr(e, 'arg'), e f.store_info('eee', DummyNode('eee', fff)) e = f.get_entry('eee') assert e == eee, e assert e.name == 'eee', e.name assert not hasattr(e, 'arg'), e f.merge() e = f.get_entry('eee') assert e.name == 'fff', e.name assert e.arg == 'fff arg', e.arg class SConsignDBTestCase(SConsignTestCase): def test_SConsignDB(self): save_DataBase = SCons.SConsign.DataBase SCons.SConsign.DataBase = {} try: d1 = SCons.SConsign.DB(DummyNode('dir1')) d1.set_entry('aaa', DummySConsignEntry('aaa name')) d1.set_entry('bbb', DummySConsignEntry('bbb name')) aaa = d1.get_entry('aaa') assert aaa.name == 'aaa name' bbb = d1.get_entry('bbb') assert bbb.name == 'bbb name' d2 = SCons.SConsign.DB(DummyNode('dir2')) d2.set_entry('ccc', DummySConsignEntry('ccc name')) d2.set_entry('ddd', DummySConsignEntry('ddd name')) ccc = d2.get_entry('ccc') assert ccc.name == 'ccc name' ddd = d2.get_entry('ddd') assert ddd.name == 'ddd name' d31 = SCons.SConsign.DB(DummyNode('dir3/sub1')) d31.set_entry('eee', DummySConsignEntry('eee name')) d31.set_entry('fff', DummySConsignEntry('fff name')) eee = d31.get_entry('eee') assert eee.name == 'eee name' fff = d31.get_entry('fff') assert fff.name == 'fff name' d32 = SCons.SConsign.DB(DummyNode('dir3%ssub2' % os.sep)) d32.set_entry('ggg', DummySConsignEntry('ggg name')) d32.set_entry('hhh', DummySConsignEntry('hhh name')) ggg = d32.get_entry('ggg') assert ggg.name == 'ggg name' hhh = d32.get_entry('hhh') assert hhh.name == 'hhh name' finally: SCons.SConsign.DataBase = save_DataBase class SConsignDirFileTestCase(SConsignTestCase): def test_SConsignDirFile(self): bi_foo = DummySConsignEntry('foo') bi_bar = DummySConsignEntry('bar') f = SCons.SConsign.DirFile(DummyNode()) f.set_entry('foo', bi_foo) f.set_entry('bar', bi_bar) e = f.get_entry('foo') assert e == bi_foo, e assert e.name == 'foo', e.name e = f.get_entry('bar') assert e == bi_bar, e assert e.name == 'bar', e.name assert not hasattr(e, 'arg'), e bbb = DummySConsignEntry('bbb') bbb.arg = 'bbb arg' f.set_entry('bar', bbb) e = f.get_entry('bar') assert e.name == 'bbb', e.name assert e.arg == 'bbb arg', e.arg class SConsignFileTestCase(SConsignTestCase): def test_SConsignFile(self): test = self.test file = test.workpath('sconsign_file') assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name == ".sconsign", SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is SCons.dblite, SCons.SConsign.DB_Module SCons.SConsign.File(file) assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name is file, SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is SCons.dblite, SCons.SConsign.DB_Module SCons.SConsign.File(None) assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name is file, SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is None, SCons.SConsign.DB_Module class Fake_DBM(object): def open(self, name, mode): self.name = name self.mode = mode return self def __getitem__(self, key): pass def __setitem__(self, key, value): pass fake_dbm = Fake_DBM() SCons.SConsign.File(file, fake_dbm) assert SCons.SConsign.DataBase == {}, SCons.SConsign.DataBase assert SCons.SConsign.DB_Name is file, SCons.SConsign.DB_Name assert SCons.SConsign.DB_Module is fake_dbm, SCons.SConsign.DB_Module assert not hasattr(fake_dbm, 'name'), fake_dbm assert not hasattr(fake_dbm, 'mode'), fake_dbm SCons.SConsign.ForDirectory(DummyNode(test.workpath('dir'))) assert not SCons.SConsign.DataBase is None, SCons.SConsign.DataBase assert fake_dbm.name == file, fake_dbm.name assert fake_dbm.mode == "c", fake_dbm.mode class writeTestCase(SConsignTestCase): def test_write(self): test = self.test file = test.workpath('sconsign_file') class Fake_DBM(object): def __getitem__(self, key): return None def __setitem__(self, key, value): pass def open(self, name, mode): self.sync_count = 0 return self def sync(self): self.sync_count = self.sync_count + 1 fake_dbm = Fake_DBM() SCons.SConsign.DataBase = {} SCons.SConsign.File(file, fake_dbm) f = SCons.SConsign.DB(DummyNode()) bi_foo = DummySConsignEntry('foo') bi_bar = DummySConsignEntry('bar') f.set_entry('foo', bi_foo) f.set_entry('bar', bi_bar) SCons.SConsign.write() assert bi_foo.c_to_s, bi_foo.c_to_s assert bi_bar.c_to_s, bi_bar.c_to_s assert fake_dbm.sync_count == 1, fake_dbm.sync_count if __name__ == "__main__": suite = unittest.TestSuite() tclasses = [ BaseTestCase, SConsignDBTestCase, SConsignDirFileTestCase, SConsignFileTestCase, writeTestCase, ] for tclass in tclasses: names = unittest.getTestCaseNames(tclass, 'test_') suite.addTests(list(map(tclass, names))) TestUnit.run(suite)
true
true
f71e5460155bd9f16fa19e166afd300b1c1a08f8
1,469
py
Python
setup.py
inducer/pyfft
3780b30aebcd2c056f8c6bdd2ad7572e04d6b886
[ "AML" ]
1
2016-08-26T07:12:54.000Z
2016-08-26T07:12:54.000Z
setup.py
inducer/pyfft
3780b30aebcd2c056f8c6bdd2ad7572e04d6b886
[ "AML" ]
null
null
null
setup.py
inducer/pyfft
3780b30aebcd2c056f8c6bdd2ad7572e04d6b886
[ "AML" ]
null
null
null
import sys major, minor, micro, releaselevel, serial = sys.version_info if not (major == 2 and minor >= 5): print("Python >=2.5 is required to use this module.") sys.exit(1) try: from setuptools import setup except ImportError: from distutils.core import setup import os.path import logging setup_dir = os.path.split(os.path.abspath(__file__))[0] DOCUMENTATION = open(os.path.join(setup_dir, 'README.rst')).read() pyfft_path = os.path.join(setup_dir, 'pyfft', '__init__.py') globals_dict = {} execfile(pyfft_path, globals_dict) VERSION = '.'.join([str(x) for x in globals_dict['VERSION']]) dependencies = ['mako', 'numpy'] logging.warning("*" * 80 + "\n\n" + "PyFFT is deprecated and will not be updated any more.\n" + "Its functionality is being moved to Reikna (http://reikna.publicfields.net).\n\n" + "*" * 80) setup( name='pyfft', packages=['pyfft'], provides=['pyfft'], requires=dependencies, install_requires=dependencies, package_data={'pyfft': ['*.mako']}, version=VERSION, author='Bogdan Opanchuk', author_email='mantihor@gmail.com', url='http://github.com/Manticore/pyfft', description='FFT library for PyCuda and PyOpenCL', long_description=DOCUMENTATION, classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'License :: OSI Approved :: MIT License', 'Operating System :: OS Independent', 'Programming Language :: Python :: 2', 'Topic :: Scientific/Engineering :: Mathematics' ] )
27.716981
85
0.704561
import sys major, minor, micro, releaselevel, serial = sys.version_info if not (major == 2 and minor >= 5): print("Python >=2.5 is required to use this module.") sys.exit(1) try: from setuptools import setup except ImportError: from distutils.core import setup import os.path import logging setup_dir = os.path.split(os.path.abspath(__file__))[0] DOCUMENTATION = open(os.path.join(setup_dir, 'README.rst')).read() pyfft_path = os.path.join(setup_dir, 'pyfft', '__init__.py') globals_dict = {} execfile(pyfft_path, globals_dict) VERSION = '.'.join([str(x) for x in globals_dict['VERSION']]) dependencies = ['mako', 'numpy'] logging.warning("*" * 80 + "\n\n" + "PyFFT is deprecated and will not be updated any more.\n" + "Its functionality is being moved to Reikna (http://reikna.publicfields.net).\n\n" + "*" * 80) setup( name='pyfft', packages=['pyfft'], provides=['pyfft'], requires=dependencies, install_requires=dependencies, package_data={'pyfft': ['*.mako']}, version=VERSION, author='Bogdan Opanchuk', author_email='mantihor@gmail.com', url='http://github.com/Manticore/pyfft', description='FFT library for PyCuda and PyOpenCL', long_description=DOCUMENTATION, classifiers=[ 'Development Status :: 4 - Beta', 'Intended Audience :: Developers', 'License :: OSI Approved :: MIT License', 'Operating System :: OS Independent', 'Programming Language :: Python :: 2', 'Topic :: Scientific/Engineering :: Mathematics' ] )
true
true
f71e5477d9830202d03e82ec5b932891a0558a54
22,305
py
Python
test/functional/test_framework/util.py
Guinea1/AnotherScryptCoin
58bae163e23da7468a9854073231a512a4d037ee
[ "MIT" ]
null
null
null
test/functional/test_framework/util.py
Guinea1/AnotherScryptCoin
58bae163e23da7468a9854073231a512a4d037ee
[ "MIT" ]
2
2021-01-14T16:29:02.000Z
2022-03-03T22:55:41.000Z
test/functional/test_framework/util.py
Guinea1/AnotherScryptCoin
58bae163e23da7468a9854073231a512a4d037ee
[ "MIT" ]
1
2022-01-09T08:44:40.000Z
2022-01-09T08:44:40.000Z
#!/usr/bin/env python3 # Copyright (c) 2014-2018 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Helpful routines for regression testing.""" from base64 import b64encode from binascii import hexlify, unhexlify from decimal import Decimal, ROUND_DOWN import hashlib import inspect import json import logging import os import random import re from subprocess import CalledProcessError import time from . import coverage from .authproxy import AuthServiceProxy, JSONRPCException logger = logging.getLogger("TestFramework.utils") # Assert functions ################## def assert_fee_amount(fee, tx_size, fee_per_kB): """Assert the fee was in range""" target_fee = round(tx_size * fee_per_kB / 1000, 8) if fee < target_fee: raise AssertionError("Fee of %s ASC too low! (Should be %s ASC)" % (str(fee), str(target_fee))) # allow the wallet's estimation to be at most 2 bytes off if fee > (tx_size + 2) * fee_per_kB / 1000: raise AssertionError("Fee of %s ASC too high! (Should be %s ASC)" % (str(fee), str(target_fee))) def assert_equal(thing1, thing2, *args): if thing1 != thing2 or any(thing1 != arg for arg in args): raise AssertionError("not(%s)" % " == ".join(str(arg) for arg in (thing1, thing2) + args)) def assert_greater_than(thing1, thing2): if thing1 <= thing2: raise AssertionError("%s <= %s" % (str(thing1), str(thing2))) def assert_greater_than_or_equal(thing1, thing2): if thing1 < thing2: raise AssertionError("%s < %s" % (str(thing1), str(thing2))) def assert_raises(exc, fun, *args, **kwds): assert_raises_message(exc, None, fun, *args, **kwds) def assert_raises_message(exc, message, fun, *args, **kwds): try: fun(*args, **kwds) except JSONRPCException: raise AssertionError("Use assert_raises_rpc_error() to test RPC failures") except exc as e: if message is not None and message not in e.error['message']: raise AssertionError("Expected substring not found:" + e.error['message']) except Exception as e: raise AssertionError("Unexpected exception raised: " + type(e).__name__) else: raise AssertionError("No exception raised") def assert_raises_process_error(returncode, output, fun, *args, **kwds): """Execute a process and asserts the process return code and output. Calls function `fun` with arguments `args` and `kwds`. Catches a CalledProcessError and verifies that the return code and output are as expected. Throws AssertionError if no CalledProcessError was raised or if the return code and output are not as expected. Args: returncode (int): the process return code. output (string): [a substring of] the process output. fun (function): the function to call. This should execute a process. args*: positional arguments for the function. kwds**: named arguments for the function. """ try: fun(*args, **kwds) except CalledProcessError as e: if returncode != e.returncode: raise AssertionError("Unexpected returncode %i" % e.returncode) if output not in e.output: raise AssertionError("Expected substring not found:" + e.output) else: raise AssertionError("No exception raised") def assert_raises_rpc_error(code, message, fun, *args, **kwds): """Run an RPC and verify that a specific JSONRPC exception code and message is raised. Calls function `fun` with arguments `args` and `kwds`. Catches a JSONRPCException and verifies that the error code and message are as expected. Throws AssertionError if no JSONRPCException was raised or if the error code/message are not as expected. Args: code (int), optional: the error code returned by the RPC call (defined in src/rpc/protocol.h). Set to None if checking the error code is not required. message (string), optional: [a substring of] the error string returned by the RPC call. Set to None if checking the error string is not required. fun (function): the function to call. This should be the name of an RPC. args*: positional arguments for the function. kwds**: named arguments for the function. """ assert try_rpc(code, message, fun, *args, **kwds), "No exception raised" def try_rpc(code, message, fun, *args, **kwds): """Tries to run an rpc command. Test against error code and message if the rpc fails. Returns whether a JSONRPCException was raised.""" try: fun(*args, **kwds) except JSONRPCException as e: # JSONRPCException was thrown as expected. Check the code and message values are correct. if (code is not None) and (code != e.error["code"]): raise AssertionError("Unexpected JSONRPC error code %i" % e.error["code"]) if (message is not None) and (message not in e.error['message']): raise AssertionError("Expected substring not found:" + e.error['message']) return True except Exception as e: raise AssertionError("Unexpected exception raised: " + type(e).__name__) else: return False def assert_is_hex_string(string): try: int(string, 16) except Exception as e: raise AssertionError( "Couldn't interpret %r as hexadecimal; raised: %s" % (string, e)) def assert_is_hash_string(string, length=64): if not isinstance(string, str): raise AssertionError("Expected a string, got type %r" % type(string)) elif length and len(string) != length: raise AssertionError( "String of length %d expected; got %d" % (length, len(string))) elif not re.match('[abcdef0-9]+$', string): raise AssertionError( "String %r contains invalid characters for a hash." % string) def assert_array_result(object_array, to_match, expected, should_not_find=False): """ Pass in array of JSON objects, a dictionary with key/value pairs to match against, and another dictionary with expected key/value pairs. If the should_not_find flag is true, to_match should not be found in object_array """ if should_not_find: assert_equal(expected, {}) num_matched = 0 for item in object_array: all_match = True for key, value in to_match.items(): if item[key] != value: all_match = False if not all_match: continue elif should_not_find: num_matched = num_matched + 1 for key, value in expected.items(): if item[key] != value: raise AssertionError("%s : expected %s=%s" % (str(item), str(key), str(value))) num_matched = num_matched + 1 if num_matched == 0 and not should_not_find: raise AssertionError("No objects matched %s" % (str(to_match))) if num_matched > 0 and should_not_find: raise AssertionError("Objects were found %s" % (str(to_match))) # Utility functions ################### def check_json_precision(): """Make sure json library being used does not lose precision converting BTC values""" n = Decimal("20000000.00000003") satoshis = int(json.loads(json.dumps(float(n))) * 1.0e8) if satoshis != 2000000000000003: raise RuntimeError("JSON encode/decode loses precision") def count_bytes(hex_string): return len(bytearray.fromhex(hex_string)) def bytes_to_hex_str(byte_str): return hexlify(byte_str).decode('ascii') def hash256(byte_str): sha256 = hashlib.sha256() sha256.update(byte_str) sha256d = hashlib.sha256() sha256d.update(sha256.digest()) return sha256d.digest()[::-1] def hex_str_to_bytes(hex_str): return unhexlify(hex_str.encode('ascii')) def str_to_b64str(string): return b64encode(string.encode('utf-8')).decode('ascii') def satoshi_round(amount): return Decimal(amount).quantize(Decimal('0.00000001'), rounding=ROUND_DOWN) def wait_until(predicate, *, attempts=float('inf'), timeout=float('inf'), lock=None): if attempts == float('inf') and timeout == float('inf'): timeout = 60 attempt = 0 time_end = time.time() + timeout while attempt < attempts and time.time() < time_end: if lock: with lock: if predicate(): return else: if predicate(): return attempt += 1 time.sleep(0.05) # Print the cause of the timeout predicate_source = "''''\n" + inspect.getsource(predicate) + "'''" logger.error("wait_until() failed. Predicate: {}".format(predicate_source)) if attempt >= attempts: raise AssertionError("Predicate {} not true after {} attempts".format(predicate_source, attempts)) elif time.time() >= time_end: raise AssertionError("Predicate {} not true after {} seconds".format(predicate_source, timeout)) raise RuntimeError('Unreachable') # RPC/P2P connection constants and functions ############################################ # The maximum number of nodes a single test can spawn MAX_NODES = 8 # Don't assign rpc or p2p ports lower than this PORT_MIN = 11000 # The number of ports to "reserve" for p2p and rpc, each PORT_RANGE = 5000 class PortSeed: # Must be initialized with a unique integer for each process n = None def get_rpc_proxy(url, node_number, timeout=None, coveragedir=None): """ Args: url (str): URL of the RPC server to call node_number (int): the node number (or id) that this calls to Kwargs: timeout (int): HTTP timeout in seconds Returns: AuthServiceProxy. convenience object for making RPC calls. """ proxy_kwargs = {} if timeout is not None: proxy_kwargs['timeout'] = timeout proxy = AuthServiceProxy(url, **proxy_kwargs) proxy.url = url # store URL on proxy for info coverage_logfile = coverage.get_filename( coveragedir, node_number) if coveragedir else None return coverage.AuthServiceProxyWrapper(proxy, coverage_logfile) def p2p_port(n): assert(n <= MAX_NODES) return PORT_MIN + n + (MAX_NODES * PortSeed.n) % (PORT_RANGE - 1 - MAX_NODES) def rpc_port(n): return PORT_MIN + PORT_RANGE + n + (MAX_NODES * PortSeed.n) % (PORT_RANGE - 1 - MAX_NODES) def rpc_url(datadir, i, rpchost=None): rpc_u, rpc_p = get_auth_cookie(datadir) host = '127.0.0.1' port = rpc_port(i) if rpchost: parts = rpchost.split(':') if len(parts) == 2: host, port = parts else: host = rpchost return "http://%s:%s@%s:%d" % (rpc_u, rpc_p, host, int(port)) # Node functions ################ def initialize_datadir(dirname, n): datadir = get_datadir_path(dirname, n) if not os.path.isdir(datadir): os.makedirs(datadir) with open(os.path.join(datadir, "anotherscryptcoin.conf"), 'w', encoding='utf8') as f: f.write("regtest=1\n") f.write("[regtest]\n") f.write("port=" + str(p2p_port(n)) + "\n") f.write("rpcport=" + str(rpc_port(n)) + "\n") f.write("server=1\n") f.write("keypool=1\n") f.write("discover=0\n") f.write("listenonion=0\n") f.write("printtoconsole=0\n") f.write("upnp=0\n") os.makedirs(os.path.join(datadir, 'stderr'), exist_ok=True) os.makedirs(os.path.join(datadir, 'stdout'), exist_ok=True) return datadir def get_datadir_path(dirname, n): return os.path.join(dirname, "node" + str(n)) def append_config(datadir, options): with open(os.path.join(datadir, "anotherscryptcoin.conf"), 'a', encoding='utf8') as f: for option in options: f.write(option + "\n") def get_auth_cookie(datadir): user = None password = None if os.path.isfile(os.path.join(datadir, "anotherscryptcoin.conf")): with open(os.path.join(datadir, "anotherscryptcoin.conf"), 'r', encoding='utf8') as f: for line in f: if line.startswith("rpcuser="): assert user is None # Ensure that there is only one rpcuser line user = line.split("=")[1].strip("\n") if line.startswith("rpcpassword="): assert password is None # Ensure that there is only one rpcpassword line password = line.split("=")[1].strip("\n") if os.path.isfile(os.path.join(datadir, "regtest", ".cookie")) and os.access(os.path.join(datadir, "regtest", ".cookie"), os.R_OK): with open(os.path.join(datadir, "regtest", ".cookie"), 'r', encoding="ascii") as f: userpass = f.read() split_userpass = userpass.split(':') user = split_userpass[0] password = split_userpass[1] if user is None or password is None: raise ValueError("No RPC credentials") return user, password # If a cookie file exists in the given datadir, delete it. def delete_cookie_file(datadir): if os.path.isfile(os.path.join(datadir, "regtest", ".cookie")): logger.debug("Deleting leftover cookie file") os.remove(os.path.join(datadir, "regtest", ".cookie")) def get_bip9_status(node, key): info = node.getblockchaininfo() return info['bip9_softforks'][key] def set_node_times(nodes, t): for node in nodes: node.setmocktime(t) def disconnect_nodes(from_connection, node_num): for peer_id in [peer['id'] for peer in from_connection.getpeerinfo() if "testnode%d" % node_num in peer['subver']]: try: from_connection.disconnectnode(nodeid=peer_id) except JSONRPCException as e: # If this node is disconnected between calculating the peer id # and issuing the disconnect, don't worry about it. # This avoids a race condition if we're mass-disconnecting peers. if e.error['code'] != -29: # RPC_CLIENT_NODE_NOT_CONNECTED raise # wait to disconnect wait_until(lambda: [peer['id'] for peer in from_connection.getpeerinfo() if "testnode%d" % node_num in peer['subver']] == [], timeout=5) def connect_nodes(from_connection, node_num): ip_port = "127.0.0.1:" + str(p2p_port(node_num)) from_connection.addnode(ip_port, "onetry") # poll until version handshake complete to avoid race conditions # with transaction relaying wait_until(lambda: all(peer['version'] != 0 for peer in from_connection.getpeerinfo())) def connect_nodes_bi(nodes, a, b): connect_nodes(nodes[a], b) connect_nodes(nodes[b], a) def sync_blocks(rpc_connections, *, wait=1, timeout=60): """ Wait until everybody has the same tip. sync_blocks needs to be called with an rpc_connections set that has least one node already synced to the latest, stable tip, otherwise there's a chance it might return before all nodes are stably synced. """ stop_time = time.time() + timeout while time.time() <= stop_time: best_hash = [x.getbestblockhash() for x in rpc_connections] if best_hash.count(best_hash[0]) == len(rpc_connections): return time.sleep(wait) raise AssertionError("Block sync timed out:{}".format("".join("\n {!r}".format(b) for b in best_hash))) def sync_mempools(rpc_connections, *, wait=1, timeout=60, flush_scheduler=True): """ Wait until everybody has the same transactions in their memory pools """ stop_time = time.time() + timeout while time.time() <= stop_time: pool = [set(r.getrawmempool()) for r in rpc_connections] if pool.count(pool[0]) == len(rpc_connections): if flush_scheduler: for r in rpc_connections: r.syncwithvalidationinterfacequeue() return time.sleep(wait) raise AssertionError("Mempool sync timed out:{}".format("".join("\n {!r}".format(m) for m in pool))) # Transaction/Block functions ############################# def find_output(node, txid, amount, *, blockhash=None): """ Return index to output of txid with value amount Raises exception if there is none. """ txdata = node.getrawtransaction(txid, 1, blockhash) for i in range(len(txdata["vout"])): if txdata["vout"][i]["value"] == amount: return i raise RuntimeError("find_output txid %s : %s not found" % (txid, str(amount))) def gather_inputs(from_node, amount_needed, confirmations_required=1): """ Return a random set of unspent txouts that are enough to pay amount_needed """ assert(confirmations_required >= 0) utxo = from_node.listunspent(confirmations_required) random.shuffle(utxo) inputs = [] total_in = Decimal("0.00000000") while total_in < amount_needed and len(utxo) > 0: t = utxo.pop() total_in += t["amount"] inputs.append({"txid": t["txid"], "vout": t["vout"], "address": t["address"]}) if total_in < amount_needed: raise RuntimeError("Insufficient funds: need %d, have %d" % (amount_needed, total_in)) return (total_in, inputs) def make_change(from_node, amount_in, amount_out, fee): """ Create change output(s), return them """ outputs = {} amount = amount_out + fee change = amount_in - amount if change > amount * 2: # Create an extra change output to break up big inputs change_address = from_node.getnewaddress() # Split change in two, being careful of rounding: outputs[change_address] = Decimal(change / 2).quantize(Decimal('0.00000001'), rounding=ROUND_DOWN) change = amount_in - amount - outputs[change_address] if change > 0: outputs[from_node.getnewaddress()] = change return outputs def random_transaction(nodes, amount, min_fee, fee_increment, fee_variants): """ Create a random transaction. Returns (txid, hex-encoded-transaction-data, fee) """ from_node = random.choice(nodes) to_node = random.choice(nodes) fee = min_fee + fee_increment * random.randint(0, fee_variants) (total_in, inputs) = gather_inputs(from_node, amount + fee) outputs = make_change(from_node, total_in, amount, fee) outputs[to_node.getnewaddress()] = float(amount) rawtx = from_node.createrawtransaction(inputs, outputs) signresult = from_node.signrawtransactionwithwallet(rawtx) txid = from_node.sendrawtransaction(signresult["hex"], True) return (txid, signresult["hex"], fee) # Helper to create at least "count" utxos # Pass in a fee that is sufficient for relay and mining new transactions. def create_confirmed_utxos(fee, node, count): to_generate = int(0.5 * count) + 101 while to_generate > 0: node.generate(min(25, to_generate)) to_generate -= 25 utxos = node.listunspent() iterations = count - len(utxos) addr1 = node.getnewaddress() addr2 = node.getnewaddress() if iterations <= 0: return utxos for i in range(iterations): t = utxos.pop() inputs = [] inputs.append({"txid": t["txid"], "vout": t["vout"]}) outputs = {} send_value = t['amount'] - fee outputs[addr1] = satoshi_round(send_value / 2) outputs[addr2] = satoshi_round(send_value / 2) raw_tx = node.createrawtransaction(inputs, outputs) signed_tx = node.signrawtransactionwithwallet(raw_tx)["hex"] node.sendrawtransaction(signed_tx) while (node.getmempoolinfo()['size'] > 0): node.generate(1) utxos = node.listunspent() assert(len(utxos) >= count) return utxos # Create large OP_RETURN txouts that can be appended to a transaction # to make it large (helper for constructing large transactions). def gen_return_txouts(): # Some pre-processing to create a bunch of OP_RETURN txouts to insert into transactions we create # So we have big transactions (and therefore can't fit very many into each block) # create one script_pubkey script_pubkey = "6a4d0200" # OP_RETURN OP_PUSH2 512 bytes for i in range(512): script_pubkey = script_pubkey + "01" # concatenate 128 txouts of above script_pubkey which we'll insert before the txout for change txouts = "81" for k in range(128): # add txout value txouts = txouts + "0000000000000000" # add length of script_pubkey txouts = txouts + "fd0402" # add script_pubkey txouts = txouts + script_pubkey return txouts # Create a spend of each passed-in utxo, splicing in "txouts" to each raw # transaction to make it large. See gen_return_txouts() above. def create_lots_of_big_transactions(node, txouts, utxos, num, fee): addr = node.getnewaddress() txids = [] for _ in range(num): t = utxos.pop() inputs = [{"txid": t["txid"], "vout": t["vout"]}] outputs = {} change = t['amount'] - fee outputs[addr] = satoshi_round(change) rawtx = node.createrawtransaction(inputs, outputs) newtx = rawtx[0:92] newtx = newtx + txouts newtx = newtx + rawtx[94:] signresult = node.signrawtransactionwithwallet(newtx, None, "NONE") txid = node.sendrawtransaction(signresult["hex"], True) txids.append(txid) return txids def mine_large_block(node, utxos=None): # generate a 66k transaction, # and 14 of them is close to the 1MB block limit num = 14 txouts = gen_return_txouts() utxos = utxos if utxos is not None else [] if len(utxos) < num: utxos.clear() utxos.extend(node.listunspent()) fee = 100 * node.getnetworkinfo()["relayfee"] create_lots_of_big_transactions(node, txouts, utxos, num, fee=fee) node.generate(1) def find_vout_for_address(node, txid, addr): """ Locate the vout index of the given transaction sending to the given address. Raises runtime error exception if not found. """ tx = node.getrawtransaction(txid, True) for i in range(len(tx["vout"])): if any([addr == a for a in tx["vout"][i]["scriptPubKey"]["addresses"]]): return i raise RuntimeError("Vout not found for address: txid=%s, addr=%s" % (txid, addr))
38.926702
140
0.652589
from base64 import b64encode from binascii import hexlify, unhexlify from decimal import Decimal, ROUND_DOWN import hashlib import inspect import json import logging import os import random import re from subprocess import CalledProcessError import time from . import coverage from .authproxy import AuthServiceProxy, JSONRPCException logger = logging.getLogger("TestFramework.utils") nError("Fee of %s ASC too low! (Should be %s ASC)" % (str(fee), str(target_fee))) if fee > (tx_size + 2) * fee_per_kB / 1000: raise AssertionError("Fee of %s ASC too high! (Should be %s ASC)" % (str(fee), str(target_fee))) def assert_equal(thing1, thing2, *args): if thing1 != thing2 or any(thing1 != arg for arg in args): raise AssertionError("not(%s)" % " == ".join(str(arg) for arg in (thing1, thing2) + args)) def assert_greater_than(thing1, thing2): if thing1 <= thing2: raise AssertionError("%s <= %s" % (str(thing1), str(thing2))) def assert_greater_than_or_equal(thing1, thing2): if thing1 < thing2: raise AssertionError("%s < %s" % (str(thing1), str(thing2))) def assert_raises(exc, fun, *args, **kwds): assert_raises_message(exc, None, fun, *args, **kwds) def assert_raises_message(exc, message, fun, *args, **kwds): try: fun(*args, **kwds) except JSONRPCException: raise AssertionError("Use assert_raises_rpc_error() to test RPC failures") except exc as e: if message is not None and message not in e.error['message']: raise AssertionError("Expected substring not found:" + e.error['message']) except Exception as e: raise AssertionError("Unexpected exception raised: " + type(e).__name__) else: raise AssertionError("No exception raised") def assert_raises_process_error(returncode, output, fun, *args, **kwds): try: fun(*args, **kwds) except CalledProcessError as e: if returncode != e.returncode: raise AssertionError("Unexpected returncode %i" % e.returncode) if output not in e.output: raise AssertionError("Expected substring not found:" + e.output) else: raise AssertionError("No exception raised") def assert_raises_rpc_error(code, message, fun, *args, **kwds): assert try_rpc(code, message, fun, *args, **kwds), "No exception raised" def try_rpc(code, message, fun, *args, **kwds): try: fun(*args, **kwds) except JSONRPCException as e: # JSONRPCException was thrown as expected. Check the code and message values are correct. if (code is not None) and (code != e.error["code"]): raise AssertionError("Unexpected JSONRPC error code %i" % e.error["code"]) if (message is not None) and (message not in e.error['message']): raise AssertionError("Expected substring not found:" + e.error['message']) return True except Exception as e: raise AssertionError("Unexpected exception raised: " + type(e).__name__) else: return False def assert_is_hex_string(string): try: int(string, 16) except Exception as e: raise AssertionError( "Couldn't interpret %r as hexadecimal; raised: %s" % (string, e)) def assert_is_hash_string(string, length=64): if not isinstance(string, str): raise AssertionError("Expected a string, got type %r" % type(string)) elif length and len(string) != length: raise AssertionError( "String of length %d expected; got %d" % (length, len(string))) elif not re.match('[abcdef0-9]+$', string): raise AssertionError( "String %r contains invalid characters for a hash." % string) def assert_array_result(object_array, to_match, expected, should_not_find=False): if should_not_find: assert_equal(expected, {}) num_matched = 0 for item in object_array: all_match = True for key, value in to_match.items(): if item[key] != value: all_match = False if not all_match: continue elif should_not_find: num_matched = num_matched + 1 for key, value in expected.items(): if item[key] != value: raise AssertionError("%s : expected %s=%s" % (str(item), str(key), str(value))) num_matched = num_matched + 1 if num_matched == 0 and not should_not_find: raise AssertionError("No objects matched %s" % (str(to_match))) if num_matched > 0 and should_not_find: raise AssertionError("Objects were found %s" % (str(to_match))) raise RuntimeError("JSON encode/decode loses precision") def count_bytes(hex_string): return len(bytearray.fromhex(hex_string)) def bytes_to_hex_str(byte_str): return hexlify(byte_str).decode('ascii') def hash256(byte_str): sha256 = hashlib.sha256() sha256.update(byte_str) sha256d = hashlib.sha256() sha256d.update(sha256.digest()) return sha256d.digest()[::-1] def hex_str_to_bytes(hex_str): return unhexlify(hex_str.encode('ascii')) def str_to_b64str(string): return b64encode(string.encode('utf-8')).decode('ascii') def satoshi_round(amount): return Decimal(amount).quantize(Decimal('0.00000001'), rounding=ROUND_DOWN) def wait_until(predicate, *, attempts=float('inf'), timeout=float('inf'), lock=None): if attempts == float('inf') and timeout == float('inf'): timeout = 60 attempt = 0 time_end = time.time() + timeout while attempt < attempts and time.time() < time_end: if lock: with lock: if predicate(): return else: if predicate(): return attempt += 1 time.sleep(0.05) predicate_source = "''''\n" + inspect.getsource(predicate) + "'''" logger.error("wait_until() failed. Predicate: {}".format(predicate_source)) if attempt >= attempts: raise AssertionError("Predicate {} not true after {} attempts".format(predicate_source, attempts)) elif time.time() >= time_end: raise AssertionError("Predicate {} not true after {} seconds".format(predicate_source, timeout)) raise RuntimeError('Unreachable') # RPC/P2P connection constants and functions ############################################ # The maximum number of nodes a single test can spawn MAX_NODES = 8 # Don't assign rpc or p2p ports lower than this PORT_MIN = 11000 PORT_RANGE = 5000 class PortSeed: n = None def get_rpc_proxy(url, node_number, timeout=None, coveragedir=None): proxy_kwargs = {} if timeout is not None: proxy_kwargs['timeout'] = timeout proxy = AuthServiceProxy(url, **proxy_kwargs) proxy.url = url coverage_logfile = coverage.get_filename( coveragedir, node_number) if coveragedir else None return coverage.AuthServiceProxyWrapper(proxy, coverage_logfile) def p2p_port(n): assert(n <= MAX_NODES) return PORT_MIN + n + (MAX_NODES * PortSeed.n) % (PORT_RANGE - 1 - MAX_NODES) def rpc_port(n): return PORT_MIN + PORT_RANGE + n + (MAX_NODES * PortSeed.n) % (PORT_RANGE - 1 - MAX_NODES) def rpc_url(datadir, i, rpchost=None): rpc_u, rpc_p = get_auth_cookie(datadir) host = '127.0.0.1' port = rpc_port(i) if rpchost: parts = rpchost.split(':') if len(parts) == 2: host, port = parts else: host = rpchost return "http://%s:%s@%s:%d" % (rpc_u, rpc_p, host, int(port)) os.makedirs(datadir) with open(os.path.join(datadir, "anotherscryptcoin.conf"), 'w', encoding='utf8') as f: f.write("regtest=1\n") f.write("[regtest]\n") f.write("port=" + str(p2p_port(n)) + "\n") f.write("rpcport=" + str(rpc_port(n)) + "\n") f.write("server=1\n") f.write("keypool=1\n") f.write("discover=0\n") f.write("listenonion=0\n") f.write("printtoconsole=0\n") f.write("upnp=0\n") os.makedirs(os.path.join(datadir, 'stderr'), exist_ok=True) os.makedirs(os.path.join(datadir, 'stdout'), exist_ok=True) return datadir def get_datadir_path(dirname, n): return os.path.join(dirname, "node" + str(n)) def append_config(datadir, options): with open(os.path.join(datadir, "anotherscryptcoin.conf"), 'a', encoding='utf8') as f: for option in options: f.write(option + "\n") def get_auth_cookie(datadir): user = None password = None if os.path.isfile(os.path.join(datadir, "anotherscryptcoin.conf")): with open(os.path.join(datadir, "anotherscryptcoin.conf"), 'r', encoding='utf8') as f: for line in f: if line.startswith("rpcuser="): assert user is None user = line.split("=")[1].strip("\n") if line.startswith("rpcpassword="): assert password is None password = line.split("=")[1].strip("\n") if os.path.isfile(os.path.join(datadir, "regtest", ".cookie")) and os.access(os.path.join(datadir, "regtest", ".cookie"), os.R_OK): with open(os.path.join(datadir, "regtest", ".cookie"), 'r', encoding="ascii") as f: userpass = f.read() split_userpass = userpass.split(':') user = split_userpass[0] password = split_userpass[1] if user is None or password is None: raise ValueError("No RPC credentials") return user, password def delete_cookie_file(datadir): if os.path.isfile(os.path.join(datadir, "regtest", ".cookie")): logger.debug("Deleting leftover cookie file") os.remove(os.path.join(datadir, "regtest", ".cookie")) def get_bip9_status(node, key): info = node.getblockchaininfo() return info['bip9_softforks'][key] def set_node_times(nodes, t): for node in nodes: node.setmocktime(t) def disconnect_nodes(from_connection, node_num): for peer_id in [peer['id'] for peer in from_connection.getpeerinfo() if "testnode%d" % node_num in peer['subver']]: try: from_connection.disconnectnode(nodeid=peer_id) except JSONRPCException as e: # This avoids a race condition if we're mass-disconnecting peers. if e.error['code'] != -29: raise wait_until(lambda: [peer['id'] for peer in from_connection.getpeerinfo() if "testnode%d" % node_num in peer['subver']] == [], timeout=5) def connect_nodes(from_connection, node_num): ip_port = "127.0.0.1:" + str(p2p_port(node_num)) from_connection.addnode(ip_port, "onetry") wait_until(lambda: all(peer['version'] != 0 for peer in from_connection.getpeerinfo())) def connect_nodes_bi(nodes, a, b): connect_nodes(nodes[a], b) connect_nodes(nodes[b], a) def sync_blocks(rpc_connections, *, wait=1, timeout=60): stop_time = time.time() + timeout while time.time() <= stop_time: best_hash = [x.getbestblockhash() for x in rpc_connections] if best_hash.count(best_hash[0]) == len(rpc_connections): return time.sleep(wait) raise AssertionError("Block sync timed out:{}".format("".join("\n {!r}".format(b) for b in best_hash))) def sync_mempools(rpc_connections, *, wait=1, timeout=60, flush_scheduler=True): stop_time = time.time() + timeout while time.time() <= stop_time: pool = [set(r.getrawmempool()) for r in rpc_connections] if pool.count(pool[0]) == len(rpc_connections): if flush_scheduler: for r in rpc_connections: r.syncwithvalidationinterfacequeue() return time.sleep(wait) raise AssertionError("Mempool sync timed out:{}".format("".join("\n {!r}".format(m) for m in pool))) equired >= 0) utxo = from_node.listunspent(confirmations_required) random.shuffle(utxo) inputs = [] total_in = Decimal("0.00000000") while total_in < amount_needed and len(utxo) > 0: t = utxo.pop() total_in += t["amount"] inputs.append({"txid": t["txid"], "vout": t["vout"], "address": t["address"]}) if total_in < amount_needed: raise RuntimeError("Insufficient funds: need %d, have %d" % (amount_needed, total_in)) return (total_in, inputs) def make_change(from_node, amount_in, amount_out, fee): outputs = {} amount = amount_out + fee change = amount_in - amount if change > amount * 2: change_address = from_node.getnewaddress() outputs[change_address] = Decimal(change / 2).quantize(Decimal('0.00000001'), rounding=ROUND_DOWN) change = amount_in - amount - outputs[change_address] if change > 0: outputs[from_node.getnewaddress()] = change return outputs def random_transaction(nodes, amount, min_fee, fee_increment, fee_variants): from_node = random.choice(nodes) to_node = random.choice(nodes) fee = min_fee + fee_increment * random.randint(0, fee_variants) (total_in, inputs) = gather_inputs(from_node, amount + fee) outputs = make_change(from_node, total_in, amount, fee) outputs[to_node.getnewaddress()] = float(amount) rawtx = from_node.createrawtransaction(inputs, outputs) signresult = from_node.signrawtransactionwithwallet(rawtx) txid = from_node.sendrawtransaction(signresult["hex"], True) return (txid, signresult["hex"], fee) def create_confirmed_utxos(fee, node, count): to_generate = int(0.5 * count) + 101 while to_generate > 0: node.generate(min(25, to_generate)) to_generate -= 25 utxos = node.listunspent() iterations = count - len(utxos) addr1 = node.getnewaddress() addr2 = node.getnewaddress() if iterations <= 0: return utxos for i in range(iterations): t = utxos.pop() inputs = [] inputs.append({"txid": t["txid"], "vout": t["vout"]}) outputs = {} send_value = t['amount'] - fee outputs[addr1] = satoshi_round(send_value / 2) outputs[addr2] = satoshi_round(send_value / 2) raw_tx = node.createrawtransaction(inputs, outputs) signed_tx = node.signrawtransactionwithwallet(raw_tx)["hex"] node.sendrawtransaction(signed_tx) while (node.getmempoolinfo()['size'] > 0): node.generate(1) utxos = node.listunspent() assert(len(utxos) >= count) return utxos def gen_return_txouts(): # create one script_pubkey script_pubkey = "6a4d0200" # OP_RETURN OP_PUSH2 512 bytes for i in range(512): script_pubkey = script_pubkey + "01" # concatenate 128 txouts of above script_pubkey which we'll insert before the txout for change txouts = "81" for k in range(128): txouts = txouts + "0000000000000000" txouts = txouts + "fd0402" txouts = txouts + script_pubkey return txouts def create_lots_of_big_transactions(node, txouts, utxos, num, fee): addr = node.getnewaddress() txids = [] for _ in range(num): t = utxos.pop() inputs = [{"txid": t["txid"], "vout": t["vout"]}] outputs = {} change = t['amount'] - fee outputs[addr] = satoshi_round(change) rawtx = node.createrawtransaction(inputs, outputs) newtx = rawtx[0:92] newtx = newtx + txouts newtx = newtx + rawtx[94:] signresult = node.signrawtransactionwithwallet(newtx, None, "NONE") txid = node.sendrawtransaction(signresult["hex"], True) txids.append(txid) return txids def mine_large_block(node, utxos=None): num = 14 txouts = gen_return_txouts() utxos = utxos if utxos is not None else [] if len(utxos) < num: utxos.clear() utxos.extend(node.listunspent()) fee = 100 * node.getnetworkinfo()["relayfee"] create_lots_of_big_transactions(node, txouts, utxos, num, fee=fee) node.generate(1) def find_vout_for_address(node, txid, addr): tx = node.getrawtransaction(txid, True) for i in range(len(tx["vout"])): if any([addr == a for a in tx["vout"][i]["scriptPubKey"]["addresses"]]): return i raise RuntimeError("Vout not found for address: txid=%s, addr=%s" % (txid, addr))
true
true
f71e55cfd055438d6c39116f56d41f4f94768b6f
75,527
py
Python
models/networks.py
izhorvath/MetGAN
aca85fb3306d2515a65c8d525cd78e1147ba7e1b
[ "BSD-3-Clause" ]
null
null
null
models/networks.py
izhorvath/MetGAN
aca85fb3306d2515a65c8d525cd78e1147ba7e1b
[ "BSD-3-Clause" ]
null
null
null
models/networks.py
izhorvath/MetGAN
aca85fb3306d2515a65c8d525cd78e1147ba7e1b
[ "BSD-3-Clause" ]
null
null
null
import torch import torch.nn as nn from torch.nn import init import functools from torch.optim import lr_scheduler from math import floor, log2 from functools import partial from linear_attention_transformer import ImageLinearAttention ### from random import random import numpy as np import torch.nn.functional as F ### from models.networks_SPADE.base_network import BaseNetwork from models.networks_SPADE.architecture import ResnetBlock as ResnetBlock from models.networks_SPADE.architecture import SPADEResnetBlock as SPADEResnetBlock ############################################################################### # Helper Functions ############################################################################### class Identity(nn.Module): def forward(self, x): return x def get_norm_layer(norm_type='instance'): """Return a normalization layer Parameters: norm_type (str) -- the name of the normalization layer: batch | instance | none For BatchNorm, we use learnable affine parameters and track running statistics (mean/stddev). For InstanceNorm, we do not use learnable affine parameters. We do not track running statistics. """ if norm_type == 'batch': norm_layer = functools.partial(nn.BatchNorm2d, affine=True, track_running_stats=True) elif norm_type == 'instance': norm_layer = functools.partial(nn.InstanceNorm2d, affine=False, track_running_stats=False) elif norm_type == 'none': def norm_layer(x): return Identity() else: raise NotImplementedError('normalization layer [%s] is not found' % norm_type) return norm_layer def get_scheduler(optimizer, opt): """Return a learning rate scheduler Parameters: optimizer -- the optimizer of the network opt (option class) -- stores all the experiment flags; needs to be a subclass of BaseOptions.  opt.lr_policy is the name of learning rate policy: linear | step | plateau | cosine For 'linear', we keep the same learning rate for the first <opt.n_epochs> epochs and linearly decay the rate to zero over the next <opt.n_epochs_decay> epochs. For other schedulers (step, plateau, and cosine), we use the default PyTorch schedulers. See https://pytorch.org/docs/stable/optim.html for more details. """ if opt.lr_policy == 'linear': def lambda_rule(epoch): lr_l = 1.0 - max(0, epoch + opt.epoch_count - opt.n_epochs) / float(opt.n_epochs_decay + 1) return lr_l scheduler = lr_scheduler.LambdaLR(optimizer, lr_lambda=lambda_rule) elif opt.lr_policy == 'step': scheduler = lr_scheduler.StepLR(optimizer, step_size=opt.lr_decay_iters, gamma=0.1) elif opt.lr_policy == 'plateau': scheduler = lr_scheduler.ReduceLROnPlateau(optimizer, mode='min', factor=0.2, threshold=0.01, patience=5) elif opt.lr_policy == 'cosine': scheduler = lr_scheduler.CosineAnnealingLR(optimizer, T_max=opt.n_epochs, eta_min=0) else: return NotImplementedError('learning rate policy [%s] is not implemented', opt.lr_policy) return scheduler def define_SPADE(opt,gpu_ids): if('spade8' in opt.netG): net = SPADE8Generator(input_nc=1, output_nc=1, num_downs = 8, ngf=1, norm_layer='abc', use_dropout=False, opt=opt) elif('spade6' in opt.netG): net = SPADE6Generator(input_nc=1, output_nc=1, num_downs = 8, ngf=1, norm_layer='abc', use_dropout=False, opt=opt) else: net = SPADEGenerator(input_nc=1, output_nc=1, num_downs = 8, ngf=1, norm_layer='abc', use_dropout=False, opt=opt) if len(gpu_ids) > 0: assert(torch.cuda.is_available()) net.to(gpu_ids[0]) #net = torch.nn.DataParallel(net, gpu_ids) net.init_weights() return net def init_weights(net, init_type='normal', init_gain=0.02): """Initialize network weights. Parameters: net (network) -- network to be initialized init_type (str) -- the name of an initialization method: normal | xavier | kaiming | orthogonal init_gain (float) -- scaling factor for normal, xavier and orthogonal. We use 'normal' in the original pix2pix and CycleGAN paper. But xavier and kaiming might work better for some applications. Feel free to try yourself. """ def init_func(m): # define the initialization function classname = m.__class__.__name__ if hasattr(m, 'weight') and (classname.find('Conv') != -1 or classname.find('Linear') != -1): if init_type == 'normal': init.normal_(m.weight.data, 0.0, init_gain) elif init_type == 'xavier': init.xavier_normal_(m.weight.data, gain=init_gain) elif init_type == 'kaiming': init.kaiming_normal_(m.weight.data, a=0, mode='fan_in') elif init_type == 'orthogonal': init.orthogonal_(m.weight.data, gain=init_gain) else: raise NotImplementedError('initialization method [%s] is not implemented' % init_type) if hasattr(m, 'bias') and m.bias is not None: init.constant_(m.bias.data, 0.0) elif classname.find('BatchNorm2d') != -1: # BatchNorm Layer's weight is not a matrix; only normal distribution applies. init.normal_(m.weight.data, 1.0, init_gain) init.constant_(m.bias.data, 0.0) print('initialize network with %s' % init_type) net.apply(init_func) # apply the initialization function <init_func> def init_net(net, init_type='normal', init_gain=0.02, gpu_ids=[]): """Initialize a network: 1. register CPU/GPU device (with multi-GPU support); 2. initialize the network weights Parameters: net (network) -- the network to be initialized init_type (str) -- the name of an initialization method: normal | xavier | kaiming | orthogonal gain (float) -- scaling factor for normal, xavier and orthogonal. gpu_ids (int list) -- which GPUs the network runs on: e.g., 0,1,2 Return an initialized network. """ if len(gpu_ids) > 0: assert(torch.cuda.is_available()) net.to(gpu_ids[0]) #net = torch.nn.DataParallel(net, gpu_ids) # multi-GPUs init_weights(net, init_type, init_gain=init_gain) return net def define_G(input_nc, output_nc, ngf, netG, norm='batch', use_dropout=False, init_type='normal', init_gain=0.02, gpu_ids=[]): """Create a generator Parameters: input_nc (int) -- the number of channels in input images output_nc (int) -- the number of channels in output images ngf (int) -- the number of filters in the last conv layer netG (str) -- the architecture's name: resnet_9blocks | resnet_6blocks | unet_256 | unet_128 norm (str) -- the name of normalization layers used in the network: batch | instance | none use_dropout (bool) -- if use dropout layers. init_type (str) -- the name of our initialization method. init_gain (float) -- scaling factor for normal, xavier and orthogonal. gpu_ids (int list) -- which GPUs the network runs on: e.g., 0,1,2 Returns a generator Our current implementation provides two types of generators: U-Net: [unet_128] (for 128x128 input images) and [unet_256] (for 256x256 input images) The original U-Net paper: https://arxiv.org/abs/1505.04597 Resnet-based generator: [resnet_6blocks] (with 6 Resnet blocks) and [resnet_9blocks] (with 9 Resnet blocks) Resnet-based generator consists of several Resnet blocks between a few downsampling/upsampling operations. We adapt Torch code from Justin Johnson's neural style transfer project (https://github.com/jcjohnson/fast-neural-style). The generator has been initialized by <init_net>. It uses RELU for non-linearity. """ net = None norm_layer = get_norm_layer(norm_type=norm) if netG == 'resnet_9blocks': net = ResnetGenerator(input_nc, output_nc, ngf, norm_layer=norm_layer, use_dropout=use_dropout, n_blocks=9) elif netG == 'resnet_9blocksup': net = ResnetGeneratorUp(input_nc, output_nc, ngf, norm_layer=norm_layer, use_dropout=use_dropout, n_blocks=9) elif netG == 'resnet_6blocks': net = ResnetGenerator(input_nc, output_nc, ngf, norm_layer=norm_layer, use_dropout=use_dropout, n_blocks=6) elif netG == 'unet_128': net = UnetGenerator(input_nc, output_nc, 7, ngf, norm_layer=norm_layer, use_dropout=use_dropout) elif netG == 'unet_256': net = UnetGenerator(input_nc, output_nc, 8, ngf, norm_layer=norm_layer, use_dropout=use_dropout) elif netG == 'unet_768': net = UNet768(input_nc, output_nc, 8, ngf, norm_layer=norm_layer, use_dropout=use_dropout) elif netG == 'unet_768_sigm': net = UNet768Sigm(input_nc, output_nc, 8, ngf, norm_layer=norm_layer, use_dropout=use_dropout) elif netG == 'unet_spade': net = UNet768PIXSPADE(input_nc, output_nc, 8, ngf, norm_layer=norm_layer, use_dropout=use_dropout) elif netG == 'unet_spade8sm': net = UNet768PIXSPADE8SM(input_nc, output_nc, 8, ngf, norm_layer=norm_layer, use_dropout=use_dropout) else: raise NotImplementedError('Generator model name [%s] is not recognized' % netG) return init_net(net, init_type, init_gain, gpu_ids) def define_D(input_nc, ndf, netD, n_layers_D=3, norm='batch', init_type='normal', init_gain=0.02, gpu_ids=[]): """Create a discriminator Parameters: input_nc (int) -- the number of channels in input images ndf (int) -- the number of filters in the first conv layer netD (str) -- the architecture's name: basic | n_layers | pixel n_layers_D (int) -- the number of conv layers in the discriminator; effective when netD=='n_layers' norm (str) -- the type of normalization layers used in the network. init_type (str) -- the name of the initialization method. init_gain (float) -- scaling factor for normal, xavier and orthogonal. gpu_ids (int list) -- which GPUs the network runs on: e.g., 0,1,2 Returns a discriminator Our current implementation provides three types of discriminators: [basic]: 'PatchGAN' classifier described in the original pix2pix paper. It can classify whether 70×70 overlapping patches are real or fake. Such a patch-level discriminator architecture has fewer parameters than a full-image discriminator and can work on arbitrarily-sized images in a fully convolutional fashion. [n_layers]: With this mode, you can specify the number of conv layers in the discriminator with the parameter <n_layers_D> (default=3 as used in [basic] (PatchGAN).) [pixel]: 1x1 PixelGAN discriminator can classify whether a pixel is real or not. It encourages greater color diversity but has no effect on spatial statistics. The discriminator has been initialized by <init_net>. It uses Leakly RELU for non-linearity. """ net = None norm_layer = get_norm_layer(norm_type=norm) if netD == 'basic': # default PatchGAN classifier net = NLayerDiscriminator(input_nc, ndf, n_layers=3, norm_layer=norm_layer) elif netD == 'n_layers': # more options net = NLayerDiscriminator(input_nc, ndf, n_layers_D, norm_layer=norm_layer) elif netD == 'pixel': # classify if each pixel is real or fake net = PixelDiscriminator(input_nc, ndf, norm_layer=norm_layer) elif netD == 'conditional': #conditional patchGAN net = NLayerDiscriminator(input_nc, ndf, n_layers=3, norm_layer=norm_layer) elif netD == 'unet': net = UnetDiscriminator() else: raise NotImplementedError('Discriminator model name [%s] is not recognized' % netD) return init_net(net, init_type, init_gain, gpu_ids) ############################################################################## # Classes ############################################################################## class GANLoss(nn.Module): """Define different GAN objectives. The GANLoss class abstracts away the need to create the target label tensor that has the same size as the input. """ def __init__(self, gan_mode, target_real_label=1.0, target_fake_label=0.0): """ Initialize the GANLoss class. Parameters: gan_mode (str) - - the type of GAN objective. It currently supports vanilla, lsgan, and wgangp. target_real_label (bool) - - label for a real image target_fake_label (bool) - - label of a fake image Note: Do not use sigmoid as the last layer of Discriminator. LSGAN needs no sigmoid. vanilla GANs will handle it with BCEWithLogitsLoss. """ super(GANLoss, self).__init__() self.register_buffer('real_label', torch.tensor(target_real_label)) self.register_buffer('fake_label', torch.tensor(target_fake_label)) self.gan_mode = gan_mode if gan_mode == 'lsgan': self.loss = nn.MSELoss() elif gan_mode == 'vanilla': self.loss = nn.BCEWithLogitsLoss() elif gan_mode in ['wgangp']: self.loss = None else: raise NotImplementedError('gan mode %s not implemented' % gan_mode) def get_target_tensor(self, prediction, target_is_real): """Create label tensors with the same size as the input. Parameters: prediction (tensor) - - tpyically the prediction from a discriminator target_is_real (bool) - - if the ground truth label is for real images or fake images Returns: A label tensor filled with ground truth label, and with the size of the input """ if target_is_real: target_tensor = self.real_label else: target_tensor = self.fake_label return target_tensor.expand_as(prediction) def __call__(self, prediction, target_is_real): """Calculate loss given Discriminator's output and grount truth labels. Parameters: prediction (tensor) - - tpyically the prediction output from a discriminator target_is_real (bool) - - if the ground truth label is for real images or fake images Returns: the calculated loss. """ if self.gan_mode in ['lsgan', 'vanilla']: target_tensor = self.get_target_tensor(prediction, target_is_real) loss = self.loss(prediction, target_tensor) elif self.gan_mode == 'wgangp': if target_is_real: loss = -prediction.mean() else: loss = prediction.mean() return loss class UnetGANLoss(nn.Module): """Define different GAN objectives. The GANLoss class abstracts away the need to create the target label tensor that has the same size as the input. """ def __init__(self, gan_mode, target_real_label=1.0, target_fake_label=0.0): """ Initialize the GANLoss class. Parameters: gan_mode (str) - - the type of GAN objective. It currently supports vanilla, lsgan, and wgangp. target_real_label (bool) - - label for a real image target_fake_label (bool) - - label of a fake image Note: Do not use sigmoid as the last layer of Discriminator. LSGAN needs no sigmoid. vanilla GANs will handle it with BCEWithLogitsLoss. """ super(UnetGANLoss, self).__init__() self.register_buffer('real_label_1', torch.tensor(target_real_label)) self.register_buffer('real_label_2', torch.tensor(np.ones((1,256,256)))) self.register_buffer('fake_label_1', torch.tensor(target_fake_label)) self.register_buffer('fake_label_2', torch.tensor(np.zeros((1,256,256)))) self.loss_1 = nn.BCEWithLogitsLoss() self.loss_2 = nn.BCEWithLogitsLoss() def get_target_tensor(self, prediction_1, prediction_2, target_is_real): """Create label tensors with the same size as the input. Parameters: prediction (tensor) - - tpyically the prediction from a discriminator target_is_real (bool) - - if the ground truth label is for real images or fake images Returns: A label tensor filled with ground truth label, and with the size of the input """ if target_is_real: target_tensor_1 = self.real_label_1 target_tensor_2 = self.real_label_2 else: target_tensor_1 = self.fake_label_1 target_tensor_2 = self.fake_label_2 return target_tensor_1.expand_as(prediction_1), target_tensor_2.expand_as(prediction_2) def __call__(self, prediction_1, prediction_2, target_is_real): """Calculate loss given Discriminator's output and grount truth labels. Parameters: prediction (tensor) - - tpyically the prediction output from a discriminator target_is_real (bool) - - if the ground truth label is for real images or fake images Returns: the calculated loss. """ target_tensor_1, target_tensor_2 = self.get_target_tensor(prediction_1, prediction_2, target_is_real) loss_1 = self.loss_1(prediction_1, target_tensor_1) loss_2 = self.loss_2(prediction_2, target_tensor_2) loss = loss_1.mean()+loss_2.mean() return loss def cal_gradient_penalty(netD, real_data, fake_data, device, type='mixed', constant=1.0, lambda_gp=10.0): """Calculate the gradient penalty loss, used in WGAN-GP paper https://arxiv.org/abs/1704.00028 Arguments: netD (network) -- discriminator network real_data (tensor array) -- real images fake_data (tensor array) -- generated images from the generator device (str) -- GPU / CPU: from torch.device('cuda:{}'.format(self.gpu_ids[0])) if self.gpu_ids else torch.device('cpu') type (str) -- if we mix real and fake data or not [real | fake | mixed]. constant (float) -- the constant used in formula ( | |gradient||_2 - constant)^2 lambda_gp (float) -- weight for this loss Returns the gradient penalty loss """ if lambda_gp > 0.0: if type == 'real': # either use real images, fake images, or a linear interpolation of two. interpolatesv = real_data elif type == 'fake': interpolatesv = fake_data elif type == 'mixed': alpha = torch.rand(real_data.shape[0], 1, device=device) alpha = alpha.expand(real_data.shape[0], real_data.nelement() // real_data.shape[0]).contiguous().view(*real_data.shape) interpolatesv = alpha * real_data + ((1 - alpha) * fake_data) else: raise NotImplementedError('{} not implemented'.format(type)) interpolatesv.requires_grad_(True) disc_interpolates = netD(interpolatesv) gradients = torch.autograd.grad(outputs=disc_interpolates, inputs=interpolatesv, grad_outputs=torch.ones(disc_interpolates.size()).to(device), create_graph=True, retain_graph=True, only_inputs=True) gradients = gradients[0].view(real_data.size(0), -1) # flat the data gradient_penalty = (((gradients + 1e-16).norm(2, dim=1) - constant) ** 2).mean() * lambda_gp # added eps return gradient_penalty, gradients else: return 0.0, None class ResnetGenerator(nn.Module): """Resnet-based generator that consists of Resnet blocks between a few downsampling/upsampling operations. We adapt Torch code and idea from Justin Johnson's neural style transfer project(https://github.com/jcjohnson/fast-neural-style) """ def __init__(self, input_nc, output_nc, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False, n_blocks=6, padding_type='reflect'): """Construct a Resnet-based generator Parameters: input_nc (int) -- the number of channels in input images output_nc (int) -- the number of channels in output images ngf (int) -- the number of filters in the last conv layer norm_layer -- normalization layer use_dropout (bool) -- if use dropout layers n_blocks (int) -- the number of ResNet blocks padding_type (str) -- the name of padding layer in conv layers: reflect | replicate | zero """ assert(n_blocks >= 0) super(ResnetGenerator, self).__init__() if type(norm_layer) == functools.partial: use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d model = [nn.ReflectionPad2d(3), nn.Conv2d(input_nc, ngf, kernel_size=7, padding=0, bias=use_bias), norm_layer(ngf), nn.ReLU(True)] n_downsampling = 2 for i in range(n_downsampling): # add downsampling layers mult = 2 ** i model += [nn.Conv2d(ngf * mult, ngf * mult * 2, kernel_size=3, stride=2, padding=1, bias=use_bias), norm_layer(ngf * mult * 2), nn.ReLU(True)] mult = 2 ** n_downsampling for i in range(n_blocks): # add ResNet blocks model += [ResnetBlock(ngf * mult, padding_type=padding_type, norm_layer=norm_layer, use_dropout=use_dropout, use_bias=use_bias)] for i in range(n_downsampling): # add upsampling layers mult = 2 ** (n_downsampling - i) model += [nn.ConvTranspose2d(ngf * mult, int(ngf * mult / 2), kernel_size=3, stride=2, padding=1, output_padding=1, bias=use_bias), norm_layer(int(ngf * mult / 2)), nn.ReLU(True)] model += [nn.ReflectionPad2d(3)] model += [nn.Conv2d(ngf, output_nc, kernel_size=7, padding=0)] model += [nn.Tanh()] self.model = nn.Sequential(*model) def forward(self, input): """Standard forward""" return self.model(input) class ResnetGeneratorUp(nn.Module): """Resnet-based generator that consists of Resnet blocks between a few downsampling/upsampling operations. We adapt Torch code and idea from Justin Johnson's neural style transfer project(https://github.com/jcjohnson/fast-neural-style) """ def __init__(self, input_nc, output_nc, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False, n_blocks=6, padding_type='reflect'): """Construct a Resnet-based generator Parameters: input_nc (int) -- the number of channels in input images output_nc (int) -- the number of channels in output images ngf (int) -- the number of filters in the last conv layer norm_layer -- normalization layer use_dropout (bool) -- if use dropout layers n_blocks (int) -- the number of ResNet blocks padding_type (str) -- the name of padding layer in conv layers: reflect | replicate | zero """ assert(n_blocks >= 0) super(ResnetGeneratorUp, self).__init__() if type(norm_layer) == functools.partial: use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d model = [nn.ReflectionPad2d(3), nn.Conv2d(input_nc, ngf, kernel_size=7, padding=0, bias=use_bias), norm_layer(ngf), nn.ReLU(True)] n_downsampling = 2 for i in range(n_downsampling): # add downsampling layers mult = 2 ** i model += [nn.Conv2d(ngf * mult, ngf * mult * 2, kernel_size=3, stride=2, padding=1, bias=use_bias), norm_layer(ngf * mult * 2), nn.ReLU(True)] mult = 2 ** n_downsampling for i in range(n_blocks): # add ResNet blocks model += [ResnetBlock(ngf * mult, padding_type=padding_type, norm_layer=norm_layer, use_dropout=use_dropout, use_bias=use_bias)] for i in range(n_downsampling): # add upsampling layers mult = 2 ** (n_downsampling - i) model += [nn.Upsample(scale_factor = 2, mode='nearest'), nn.ReflectionPad2d(1), nn.Conv2d(ngf * mult, int(ngf * mult / 2), kernel_size=3, stride=1, padding=0),] model += [nn.ReflectionPad2d(3)] model += [nn.Conv2d(ngf, output_nc, kernel_size=7, padding=0)] model += [nn.Tanh()] self.model = nn.Sequential(*model) def forward(self, input): """Standard forward""" return self.model(input) class ResnetBlock(nn.Module): """Define a Resnet block""" def __init__(self, dim, padding_type, norm_layer, use_dropout, use_bias): """Initialize the Resnet block A resnet block is a conv block with skip connections We construct a conv block with build_conv_block function, and implement skip connections in <forward> function. Original Resnet paper: https://arxiv.org/pdf/1512.03385.pdf """ super(ResnetBlock, self).__init__() self.conv_block = self.build_conv_block(dim, padding_type, norm_layer, use_dropout, use_bias) def build_conv_block(self, dim, padding_type, norm_layer, use_dropout, use_bias): """Construct a convolutional block. Parameters: dim (int) -- the number of channels in the conv layer. padding_type (str) -- the name of padding layer: reflect | replicate | zero norm_layer -- normalization layer use_dropout (bool) -- if use dropout layers. use_bias (bool) -- if the conv layer uses bias or not Returns a conv block (with a conv layer, a normalization layer, and a non-linearity layer (ReLU)) """ conv_block = [] p = 0 if padding_type == 'reflect': conv_block += [nn.ReflectionPad2d(1)] elif padding_type == 'replicate': conv_block += [nn.ReplicationPad2d(1)] elif padding_type == 'zero': p = 1 else: raise NotImplementedError('padding [%s] is not implemented' % padding_type) conv_block += [nn.Conv2d(dim, dim, kernel_size=3, padding=p, bias=use_bias), norm_layer(dim), nn.ReLU(True)] if use_dropout: conv_block += [nn.Dropout(0.5)] p = 0 if padding_type == 'reflect': conv_block += [nn.ReflectionPad2d(1)] elif padding_type == 'replicate': conv_block += [nn.ReplicationPad2d(1)] elif padding_type == 'zero': p = 1 else: raise NotImplementedError('padding [%s] is not implemented' % padding_type) conv_block += [nn.Conv2d(dim, dim, kernel_size=3, padding=p, bias=use_bias), norm_layer(dim)] return nn.Sequential(*conv_block) def forward(self, x): """Forward function (with skip connections)""" out = x + self.conv_block(x) # add skip connections return out class UnetGenerator(nn.Module): """Create a Unet-based generator""" def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): """Construct a Unet generator Parameters: input_nc (int) -- the number of channels in input images output_nc (int) -- the number of channels in output images num_downs (int) -- the number of downsamplings in UNet. For example, # if |num_downs| == 7, image of size 128x128 will become of size 1x1 # at the bottleneck ngf (int) -- the number of filters in the last conv layer norm_layer -- normalization layer We construct the U-Net from the innermost layer to the outermost layer. It is a recursive process. """ super(UnetGenerator, self).__init__() # construct unet structure unet_block = UnetSkipConnectionBlock(ngf * 8, ngf * 8, input_nc=None, submodule=None, norm_layer=norm_layer, innermost=True) # add the innermost layer for i in range(num_downs - 5): # add intermediate layers with ngf * 8 filters unet_block = UnetSkipConnectionBlock(ngf * 8, ngf * 8, input_nc=None, submodule=unet_block, norm_layer=norm_layer, use_dropout=use_dropout) # gradually reduce the number of filters from ngf * 8 to ngf unet_block = UnetSkipConnectionBlock(ngf * 4, ngf * 8, input_nc=None, submodule=unet_block, norm_layer=norm_layer) unet_block = UnetSkipConnectionBlock(ngf * 2, ngf * 4, input_nc=None, submodule=unet_block, norm_layer=norm_layer) unet_block = UnetSkipConnectionBlock(ngf, ngf * 2, input_nc=None, submodule=unet_block, norm_layer=norm_layer) self.model = UnetSkipConnectionBlock(output_nc, ngf, input_nc=input_nc, submodule=unet_block, outermost=True, norm_layer=norm_layer) # add the outermost layer def forward(self, input): """Standard forward""" return self.model(input) class UnetSkipConnectionBlock(nn.Module): """Defines the Unet submodule with skip connection. X -------------------identity---------------------- |-- downsampling -- |submodule| -- upsampling --| """ def __init__(self, outer_nc, inner_nc, input_nc=None, submodule=None, outermost=False, innermost=False, norm_layer=nn.BatchNorm2d, use_dropout=False): """Construct a Unet submodule with skip connections. Parameters: outer_nc (int) -- the number of filters in the outer conv layer inner_nc (int) -- the number of filters in the inner conv layer input_nc (int) -- the number of channels in input images/features submodule (UnetSkipConnectionBlock) -- previously defined submodules outermost (bool) -- if this module is the outermost module innermost (bool) -- if this module is the innermost module norm_layer -- normalization layer use_dropout (bool) -- if use dropout layers. """ super(UnetSkipConnectionBlock, self).__init__() self.outermost = outermost if type(norm_layer) == functools.partial: use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d if input_nc is None: input_nc = outer_nc downconv = nn.Conv2d(input_nc, inner_nc, kernel_size=4, stride=2, padding=1, bias=use_bias) downrelu = nn.LeakyReLU(0.2, True) downnorm = norm_layer(inner_nc) uprelu = nn.ReLU(True) upnorm = norm_layer(outer_nc) if outermost: upconv = nn.ConvTranspose2d(inner_nc * 2, outer_nc, kernel_size=4, stride=2, padding=1) down = [downconv] up = [uprelu, upconv, nn.Tanh()] model = down + [submodule] + up elif innermost: upconv = nn.ConvTranspose2d(inner_nc, outer_nc, kernel_size=4, stride=2, padding=1, bias=use_bias) down = [downrelu, downconv] up = [uprelu, upconv, upnorm] model = down + up else: upconv = nn.ConvTranspose2d(inner_nc * 2, outer_nc, kernel_size=4, stride=2, padding=1, bias=use_bias) down = [downrelu, downconv, downnorm] up = [uprelu, upconv, upnorm] if use_dropout: model = down + [submodule] + up + [nn.Dropout(0.5)] else: model = down + [submodule] + up self.model = nn.Sequential(*model) def forward(self, x): if self.outermost: return self.model(x) else: # add skip connections return torch.cat([x, self.model(x)], 1) #%%% Unet from DeepMact class ConvBnRelu2d(torch.nn.Module): def __init__(self, in_channels, out_channels, kernel_size=3, padding=1, output_padding=1, dilation=1, stride=1, groups=1, is_bn=True, is_relu=True, is_decoder=False): super(ConvBnRelu2d, self).__init__() if is_decoder: self.transpConv = torch.nn.ConvTranspose2d(in_channels, out_channels, kernel_size=kernel_size, padding=padding, output_padding=output_padding, stride=stride, dilation=dilation, groups=groups, bias=False) self.conv = None else: self.transpConv = None self.conv = torch.nn.Conv2d(in_channels, out_channels, kernel_size=kernel_size, padding=padding, stride=stride, dilation=dilation, groups=groups, bias=False) self.bn = torch.nn.BatchNorm2d(out_channels, eps=1e-4) self.relu = torch.nn.ReLU(inplace=True) if is_bn is False: self.bn = None if is_relu is False: self.relu = None def forward(self, x): if self.conv is None: x = self.transpConv(x) elif self.transpConv is None: x = self.conv(x) if self.bn is not None: x = self.bn(x) if self.relu is not None: x = self.relu(x) return x class StackEncoder(torch.nn.Module): def __init__(self, x_channels, y_channels, kernel_size=3, stride=1): super(StackEncoder, self).__init__() padding = (kernel_size - 1) // 2 self.encode = torch.nn.Sequential( ConvBnRelu2d(x_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ConvBnRelu2d(y_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ) def forward(self, x): y = self.encode(x) y_small = torch.nn.functional.max_pool2d(y, kernel_size=2, stride=2) return y, y_small class StackDecoder(torch.nn.Module): def __init__(self, x_big_channels, x_channels, y_channels, kernel_size=3, stride=1): super(StackDecoder, self).__init__() padding = (kernel_size - 1) // 2 self.decode = torch.nn.Sequential( ConvBnRelu2d(x_big_channels + x_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ConvBnRelu2d(y_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ConvBnRelu2d(y_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ) def forward(self, x_big, x): N, C, H, W = x_big.size() y = torch.nn.functional.upsample(x, size=(H, W), mode='bilinear', align_corners=True) y = torch.cat([y, x_big], 1) y = self.decode(y) return y # 768 class UNet768(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) self.output_nc = output_nc # 1024 self.down1 = StackEncoder(input_nc, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Tanh() def _crop_concat(self, upsampled, bypass): """ Crop y to the (h, w) of x and concat them. Used for the expansive path. Returns: The concatenated tensor """ c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self, x): out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##; #print('down1',down1.shape) #256 down2, out = self.down2(out) # ; #print('down2',down2.shape) #128 down3, out = self.down3(out) # ; #print('down3',down3.shape) #64 down4, out = self.down4(out) # ; #print('down4',down4.shape) #32 down5, out = self.down5(out) # ; #print('down5',down5.shape) #16 down6, out = self.down6(out) # ; #print('down6',down6.shape) #8 pass # ; #print('out ',out.shape) out = self.center(out) #print('0',out.shape) out = self.up6(down6, out) #print('1',out.shape) out = self.up5(down5, out) #print('2',out.shape) out = self.up4(down4, out) #print('3',out.shape) out = self.up3(down3, out) #print('4',out.shape) out = self.up2(down2, out) #print('5',out.shape) out = self.up1(down1, out) # 1024 #print('6',out.shape) out = self.final_out(self.classify(out)) out = torch.reshape(out,(-1, self.output_nc, x.shape[2],x.shape[3]))#, dim=1) return out #%%Unet_spade_768_300 #%%sigm class UNet768Sigm(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768Sigm, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) self.output_nc = output_nc # 1024 self.down1 = StackEncoder(input_nc, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Sigmoid() def _crop_concat(self, upsampled, bypass): """ Crop y to the (h, w) of x and concat them. Used for the expansive path. Returns: The concatenated tensor """ c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self, x): out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##;print('down1',down1.size()) #256 down2, out = self.down2(out) # ;print('down2',down2.size()) #128 down3, out = self.down3(out) # ;print('down3',down3.size()) #64 down4, out = self.down4(out) # ;print('down4',down4.size()) #32 down5, out = self.down5(out) # ;print('down5',down5.size()) #16 down6, out = self.down6(out) # ;print('down6',down6.size()) #8 pass # ;print('out ',out.size()) out = self.center(out) out = self.up6(down6, out) out = self.up5(down5, out) out = self.up4(down4, out) out = self.up3(down3, out) out = self.up2(down2, out) out = self.up1(down1, out) # 1024 out = self.final_out(self.classify(out)) out = torch.reshape(out,(1, self.output_nc, 256,256))#, dim=1) return out class NLayerDiscriminator(nn.Module): """Defines a PatchGAN discriminator""" def __init__(self, input_nc, ndf=64, n_layers=3, norm_layer=nn.BatchNorm2d): """Construct a PatchGAN discriminator Parameters: input_nc (int) -- the number of channels in input images ndf (int) -- the number of filters in the last conv layer n_layers (int) -- the number of conv layers in the discriminator norm_layer -- normalization layer """ super(NLayerDiscriminator, self).__init__() if type(norm_layer) == functools.partial: # no need to use bias as BatchNorm2d has affine parameters use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d kw = 4 padw = 1 sequence = [nn.Conv2d(input_nc, ndf, kernel_size=kw, stride=2, padding=padw), nn.LeakyReLU(0.2, True)] nf_mult = 1 nf_mult_prev = 1 for n in range(1, n_layers): # gradually increase the number of filters nf_mult_prev = nf_mult nf_mult = min(2 ** n, 8) sequence += [ nn.Conv2d(ndf * nf_mult_prev, ndf * nf_mult, kernel_size=kw, stride=2, padding=padw, bias=use_bias), norm_layer(ndf * nf_mult), nn.LeakyReLU(0.2, True) ] nf_mult_prev = nf_mult nf_mult = min(2 ** n_layers, 8) sequence += [ nn.Conv2d(ndf * nf_mult_prev, ndf * nf_mult, kernel_size=kw, stride=1, padding=padw, bias=use_bias), norm_layer(ndf * nf_mult), nn.LeakyReLU(0.2, True) ] sequence += [nn.Conv2d(ndf * nf_mult, 1, kernel_size=kw, stride=1, padding=padw)] # output 1 channel prediction map self.model = nn.Sequential(*sequence) def forward(self, input): """Standard forward.""" return self.model(input) class PixelDiscriminator(nn.Module): """Defines a 1x1 PatchGAN discriminator (pixelGAN)""" def __init__(self, input_nc, ndf=64, norm_layer=nn.BatchNorm2d): """Construct a 1x1 PatchGAN discriminator Parameters: input_nc (int) -- the number of channels in input images ndf (int) -- the number of filters in the last conv layer norm_layer -- normalization layer """ super(PixelDiscriminator, self).__init__() if type(norm_layer) == functools.partial: # no need to use bias as BatchNorm2d has affine parameters use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d self.net = [ nn.Conv2d(input_nc, ndf, kernel_size=1, stride=1, padding=0), nn.LeakyReLU(0.2, True), nn.Conv2d(ndf, ndf * 2, kernel_size=1, stride=1, padding=0, bias=use_bias), norm_layer(ndf * 2), nn.LeakyReLU(0.2, True), nn.Conv2d(ndf * 2, 1, kernel_size=1, stride=1, padding=0, bias=use_bias)] self.net = nn.Sequential(*self.net) def forward(self, input): """Standard forward.""" return self.net(input) #%% Unet as Disdef random_hflip(tensor, prob): def DiffAugment(x, types=[]): for p in types: for f in AUGMENT_FNS[p]: x = f(x) return x.contiguous(memory_format = torch.contiguous_format) def rand_brightness(x): x = x + (torch.rand(x.size(0), 1, 1, 1, dtype=x.dtype, device=x.device) - 0.5) return x def rand_saturation(x): x_mean = x.mean(dim=1, keepdim=True) x = (x - x_mean) * (torch.rand(x.size(0), 1, 1, 1, dtype=x.dtype, device=x.device) * 2) + x_mean return x def rand_contrast(x): x_mean = x.mean(dim=[1, 2, 3], keepdim=True) x = (x - x_mean) * (torch.rand(x.size(0), 1, 1, 1, dtype=x.dtype, device=x.device) + 0.5) + x_mean return x def rand_translation(x, ratio=0.125): shift_x, shift_y = int(x.size(2) * ratio + 0.5), int(x.size(3) * ratio + 0.5) translation_x = torch.randint(-shift_x, shift_x + 1, size=[x.size(0), 1, 1], device=x.device) translation_y = torch.randint(-shift_y, shift_y + 1, size=[x.size(0), 1, 1], device=x.device) grid_batch, grid_x, grid_y = torch.meshgrid( torch.arange(x.size(0), dtype=torch.long, device=x.device), torch.arange(x.size(2), dtype=torch.long, device=x.device), torch.arange(x.size(3), dtype=torch.long, device=x.device), ) grid_x = torch.clamp(grid_x + translation_x + 1, 0, x.size(2) + 1) grid_y = torch.clamp(grid_y + translation_y + 1, 0, x.size(3) + 1) x_pad = F.pad(x, [1, 1, 1, 1, 0, 0, 0, 0]) x = x_pad.permute(0, 2, 3, 1).contiguous()[grid_batch, grid_x, grid_y].permute(0, 3, 1, 2).contiguous(memory_format = torch.contiguous_format) return x def rand_cutout(x, ratio=0.5): cutout_size = int(x.size(2) * ratio + 0.5), int(x.size(3) * ratio + 0.5) offset_x = torch.randint(0, x.size(2) + (1 - cutout_size[0] % 2), size=[x.size(0), 1, 1], device=x.device) offset_y = torch.randint(0, x.size(3) + (1 - cutout_size[1] % 2), size=[x.size(0), 1, 1], device=x.device) grid_batch, grid_x, grid_y = torch.meshgrid( torch.arange(x.size(0), dtype=torch.long, device=x.device), torch.arange(cutout_size[0], dtype=torch.long, device=x.device), torch.arange(cutout_size[1], dtype=torch.long, device=x.device), ) grid_x = torch.clamp(grid_x + offset_x - cutout_size[0] // 2, min=0, max=x.size(2) - 1) grid_y = torch.clamp(grid_y + offset_y - cutout_size[1] // 2, min=0, max=x.size(3) - 1) mask = torch.ones(x.size(0), x.size(2), x.size(3), dtype=x.dtype, device=x.device) mask[grid_batch, grid_x, grid_y] = 0 x = x * mask.unsqueeze(1) return x AUGMENT_FNS = { 'color': [rand_brightness, rand_saturation, rand_contrast], 'translation': [rand_translation], 'cutout': [rand_cutout], } def random_float(lo, hi): return lo + (hi - lo) * random() def random_crop_and_resize(tensor, scale): b, c, h, _ = tensor.shape new_width = int(h * scale) delta = h - new_width h_delta = int(random() * delta) w_delta = int(random() * delta) cropped = tensor[:, :, h_delta:(h_delta + new_width), w_delta:(w_delta + new_width)].clone() return F.interpolate(cropped, size=(h, h), mode='bilinear') def random_hflip(tensor, prob): if prob > random(): return tensor return torch.flip(tensor, dims=(3,)) class AugWrapper(nn.Module): def __init__(self, D, image_size, types): super().__init__() self.D = D self.types = types def forward(self, images, prob = 0., detach = False): if random() < prob: images = random_hflip(images, prob=0.5) images = DiffAugment(images, types=self.types) if detach: images.detach_() return self.D(images), images def leaky_relu(p=0.2): return nn.LeakyReLU(p) class Residual(nn.Module): def __init__(self, fn): super().__init__() self.fn = fn def forward(self, x): return self.fn(x) + x class Flatten(nn.Module): def __init__(self, index): super().__init__() self.index = index def forward(self, x): return x.flatten(self.index) class Rezero(nn.Module): def __init__(self, fn): super().__init__() self.fn = fn self.g = nn.Parameter(torch.zeros(1)) def forward(self, x): return self.fn(x) * self.g def double_conv(chan_in, chan_out): return nn.Sequential( nn.Conv2d(chan_in, chan_out, 3, padding=1), leaky_relu(), nn.Conv2d(chan_out, chan_out, 3, padding=1), leaky_relu() ) class DownBlock(nn.Module): def __init__(self, input_channels, filters, downsample=True): super().__init__() self.conv_res = nn.Conv2d(input_channels, filters, 1, stride = (2 if downsample else 1)) self.net = double_conv(input_channels, filters) self.down = nn.Conv2d(filters, filters, 3, padding = 1, stride = 2) if downsample else None def forward(self, x): res = self.conv_res(x) x = self.net(x) unet_res = x if self.down is not None: x = self.down(x) x = x + res return x, unet_res # one layer of self-attention and feedforward, for images attn_and_ff = lambda chan: nn.Sequential(*[ Residual(Rezero(ImageLinearAttention(chan, norm_queries = True))), Residual(Rezero(nn.Sequential(nn.Conv2d(chan, chan * 2, 1), leaky_relu(), nn.Conv2d(chan * 2, chan, 1)))) ]) class UpBlock(nn.Module): def __init__(self, input_channels, filters): super().__init__() self.conv_res = nn.ConvTranspose2d(input_channels // 2, filters, 1, stride = 2) self.net = double_conv(input_channels, filters) self.up = nn.Upsample(scale_factor = 2, mode='bilinear', align_corners=False) self.input_channels = input_channels self.filters = filters def forward(self, x, res): *_, h, w = x.shape conv_res = self.conv_res(x, output_size = (h * 2, w * 2)) x = self.up(x) x = torch.cat((x, res), dim=1) x = self.net(x) x = x + conv_res return x class UnetDiscriminator(nn.Module): def __init__(self, image_size=256, network_capacity = 16, transparent = False, fmap_max = 256): super().__init__() num_layers = int(log2(image_size) - 3) num_init_filters = 2# if not transparent else 4 blocks = [] filters = [num_init_filters] + [(network_capacity) * (2 ** i) for i in range(num_layers + 1)] set_fmap_max = partial(min, fmap_max) filters = list(map(set_fmap_max, filters)) filters[-1] = filters[-2] chan_in_out = list(zip(filters[:-1], filters[1:])) chan_in_out = list(map(list, chan_in_out)) print('Channels',chan_in_out) down_blocks = [] attn_blocks = [] for ind, (in_chan, out_chan) in enumerate(chan_in_out): num_layer = ind + 1 is_not_last = ind != (len(chan_in_out) - 1) block = DownBlock(in_chan, out_chan, downsample = is_not_last) down_blocks.append(block) attn_fn = attn_and_ff(out_chan) attn_blocks.append(attn_fn) self.down_blocks = nn.ModuleList(down_blocks) self.attn_blocks = nn.ModuleList(attn_blocks) last_chan = filters[-1] self.to_logit = nn.Sequential( leaky_relu(), nn.AvgPool2d(image_size // (2 ** num_layers)), Flatten(1), nn.Linear(last_chan, 1) ) self.conv = double_conv(last_chan, last_chan) dec_chan_in_out = chan_in_out[:-1][::-1] self.up_blocks = nn.ModuleList(list(map(lambda c: UpBlock(c[1] * 2, c[0]), dec_chan_in_out))) self.conv_out = nn.Conv2d(2, 1, 1) def forward(self, x): #print('Input shape:', x.shape) b, *_ = x.shape residuals = [] i=0 for (down_block, attn_block) in zip(self.down_blocks, self.attn_blocks): #print('Step', i, x.shape) i=i+1 x, unet_res = down_block(x) residuals.append(unet_res) if attn_block is not None: x = attn_block(x) x = self.conv(x) + x enc_out = self.to_logit(x) for (up_block, res) in zip(self.up_blocks, residuals[:-1][::-1]): #print('in up blocK', x.shape) x = up_block(x, res) dec_out = self.conv_out(x) return enc_out.squeeze(), dec_out #%% SPADE RESNET class SPADEGenerator(BaseNetwork): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False,opt=None): super(SPADEGenerator, self).__init__() self.opt = opt self.opt.num_upsampling_layers = 'normal' self.opt.norm_G = 'spectralspadesyncbatch3x3' self.opt.ngf = 64 self.opt.semantic_nc = 2 self.opt.use_vae = False self.opt.crop_size = 256 self.opt.normG = 'spectralinstance' self.opt.aspect_ratio = 1.0 nf = self.opt.ngf opt = self.opt self.sw, self.sh = self.compute_latent_vector_size(opt) self.fc = nn.Conv2d(self.opt.semantic_nc, 16 * nf, 3, padding=1) self.head_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_1 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.up_0 = SPADEResnetBlock(16 * nf, 8 * nf, opt) self.up_1 = SPADEResnetBlock(8 * nf, 4 * nf, opt) self.up_2 = SPADEResnetBlock(4 * nf, 2 * nf, opt) self.up_3 = SPADEResnetBlock(2 * nf, 1 * nf, opt) final_nc = nf if opt.num_upsampling_layers == 'most': self.up_4 = SPADEResnetBlock(1 * nf, nf // 2, opt) final_nc = nf // 2 self.conv_img = nn.Conv2d(final_nc, 3, 3, padding=1) self.up = nn.Upsample(scale_factor=2) def compute_latent_vector_size(self, opt): if opt.num_upsampling_layers == 'normal': num_up_layers = 5 elif opt.num_upsampling_layers == 'more': num_up_layers = 6 elif opt.num_upsampling_layers == 'most': num_up_layers = 7 else: raise ValueError('opt.num_upsampling_layers [%s] not recognized' % opt.num_upsampling_layers) sw = self.opt.crop_size // (2**num_up_layers) sh = round(sw / opt.aspect_ratio) return sw, sh def forward(self, input, z=None): seg = input if self.opt.use_vae: # we sample z from unit normal and reshape the tensor if z is None: z = torch.randn(input.size(0), self.opt.z_dim, dtype=torch.float32, device=input.get_device()) x = self.fc(z) x = x.view(-1, 16 * self.opt.ngf, self.sh, self.sw) else: # we downsample segmap and run convolution x = F.interpolate(seg, size=(self.sh, self.sw)) x = self.fc(x) #print('0,', x.shape) x = self.head_0(x, seg) #print('1,', x.shape) x = self.up(x) #print('2', x.shape) x = self.G_middle_0(x, seg) #print('3,', x.shape) if self.opt.num_upsampling_layers == 'more' or \ self.opt.num_upsampling_layers == 'most': x = self.up(x) #print('4,', x.shape) #x = self.G_middle_1(x, seg) output_5 = x #print('5,', x.shape) x = self.up(x) output_6 = x #print('6,', x.shape) x = self.up_0(x, seg) #print('7,', x.shape) x = self.up(x) #print('8,', x.shape) x = self.up_1(x, seg) output_9 = x #print('9,', x.shape) x = self.up(x) #print('10,', x.shape) x = self.up_2(x, seg) #print('11,', x.shape) output_11 = x x = self.up(x) # print('12,', x.shape) x = self.up_3(x, seg) #print('13,', x.shape) if self.opt.num_upsampling_layers == 'most': x = self.up(x) x = self.up_4(x, seg) #print('14,', x.shape) x = self.conv_img(F.leaky_relu(x, 2e-1)) # print('15,', x.shape) output_15 = x #x = F.tanh(x) #print('16,', x.shape) return output_5,output_6,output_9,output_11,output_15 #%% spade8 class SPADE8Generator(BaseNetwork): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False,opt=None): super(SPADE8Generator, self).__init__() self.opt = opt self.opt.num_upsampling_layers = 'normal' self.opt.norm_G = 'spectralspadesyncbatch3x3' self.opt.ngf = 8 self.opt.semantic_nc = 2 self.opt.use_vae = False self.opt.crop_size = 256 self.opt.normG = 'spectralinstance' self.opt.aspect_ratio = 1.0 nf = self.opt.ngf opt = self.opt self.sw, self.sh = self.compute_latent_vector_size(opt) self.fc = nn.Conv2d(self.opt.semantic_nc, 16 * nf, 3, padding=1) self.head_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_1 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.up_0 = SPADEResnetBlock(16 * nf, 8 * nf, opt) self.up_1 = SPADEResnetBlock(8 * nf, 4 * nf, opt) self.up_2 = SPADEResnetBlock(4 * nf, 2 * nf, opt) self.up_3 = SPADEResnetBlock(2 * nf, 1 * nf, opt) final_nc = nf if opt.num_upsampling_layers == 'most': self.up_4 = SPADEResnetBlock(1 * nf, nf // 2, opt) final_nc = nf // 2 self.conv_img = nn.Conv2d(final_nc, 3, 3, padding=1) self.up = nn.Upsample(scale_factor=2) def compute_latent_vector_size(self, opt): if opt.num_upsampling_layers == 'normal': num_up_layers = 5 elif opt.num_upsampling_layers == 'more': num_up_layers = 6 elif opt.num_upsampling_layers == 'most': num_up_layers = 7 else: raise ValueError('opt.num_upsampling_layers [%s] not recognized' % opt.num_upsampling_layers) sw = self.opt.crop_size // (2**num_up_layers) sh = round(sw / opt.aspect_ratio) return sw, sh def forward(self, input, z=None): seg = input if self.opt.use_vae: # we sample z from unit normal and reshape the tensor if z is None: z = torch.randn(input.size(0), self.opt.z_dim, dtype=torch.float32, device=input.get_device()) x = self.fc(z) x = x.view(-1, 16 * self.opt.ngf, self.sh, self.sw) else: # we downsample segmap and run convolution x = F.interpolate(seg, size=(self.sh, self.sw)) x = self.fc(x) #print('0,', x.shape) x = self.head_0(x, seg) #print('1,', x.shape) x = self.up(x) #print('2', x.shape) x = self.G_middle_0(x, seg) #print('3,', x.shape) if self.opt.num_upsampling_layers == 'more' or \ self.opt.num_upsampling_layers == 'most': x = self.up(x) #print('4,', x.shape) x = self.G_middle_1(x, seg) output_5 = x #print('5,', x.shape) x = self.up(x) output_6 = x #print('6,', x.shape) x = self.up_0(x, seg) #print('7,', x.shape) x = self.up(x) #print('8,', x.shape) x = self.up_1(x, seg) output_9 = x #print('9,', x.shape) x = self.up(x) #print('10,', x.shape) x = self.up_2(x, seg) #print('11,', x.shape) output_11 = x '''this can be removed''' x = self.up(x) #print('12,', x.shape) x = self.up_3(x, seg) #print('13,', x.shape) if self.opt.num_upsampling_layers == 'most': x = self.up(x) x = self.up_4(x, seg) #print('14,', x.shape) x = self.conv_img(F.leaky_relu(x, 2e-1)) #print('15,', x.shape) output_15 = x #x = F.tanh(x) #print('16,', x.shape) '''til here''' return output_5,output_6,output_9,output_11,output_15 #%% class SPADE6Generator(BaseNetwork): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False,opt=None): super(SPADE6Generator, self).__init__() self.opt = opt self.opt.num_upsampling_layers = 'normal' self.opt.norm_G = 'spectralspadesyncbatch3x3' self.opt.ngf = 6 self.opt.semantic_nc = 2 self.opt.use_vae = False self.opt.crop_size = 300 self.opt.normG = 'spectralinstance' self.opt.aspect_ratio = 1.0 nf = self.opt.ngf opt = self.opt self.sw, self.sh = self.compute_latent_vector_size(opt) self.fc = nn.Conv2d(self.opt.semantic_nc, 16 * nf, 3, padding=1) self.head_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_1 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.up_0 = SPADEResnetBlock(16 * nf, 8 * nf, opt) self.up_1 = SPADEResnetBlock(8 * nf, 4 * nf, opt) self.up_2 = SPADEResnetBlock(4 * nf, 2 * nf, opt) self.up_3 = SPADEResnetBlock(2 * nf, 1 * nf, opt) final_nc = nf if opt.num_upsampling_layers == 'most': self.up_4 = SPADEResnetBlock(1 * nf, nf // 2, opt) final_nc = nf // 2 self.conv_img = nn.Conv2d(final_nc, 3, 3, padding=1) self.up = nn.Upsample(scale_factor=2) def compute_latent_vector_size(self, opt): if opt.num_upsampling_layers == 'normal': num_up_layers = 5 elif opt.num_upsampling_layers == 'more': num_up_layers = 6 elif opt.num_upsampling_layers == 'most': num_up_layers = 7 else: raise ValueError('opt.num_upsampling_layers [%s] not recognized' % opt.num_upsampling_layers) sw = 10#self.opt.crop_size // (2**num_up_layers) sh = round(sw / opt.aspect_ratio) return sw, sh def forward(self, input, z=None): seg = input if self.opt.use_vae: # we sample z from unit normal and reshape the tensor if z is None: z = torch.randn(input.size(0), self.opt.z_dim, dtype=torch.float32, device=input.get_device()) x = self.fc(z) x = x.view(-1, 16 * self.opt.ngf, self.sh, self.sw) else: # we downsample segmap and run convolution x = F.interpolate(seg, size=(self.sh, self.sw)) x = self.fc(x) print('0,', x.shape) x = self.head_0(x, seg) print('1,', x.shape) x = self.up(x) print('2', x.shape) x = self.G_middle_0(x, seg) print('3,', x.shape) if self.opt.num_upsampling_layers == 'more' or \ self.opt.num_upsampling_layers == 'most': x = self.up(x) print('4,', x.shape) x = self.G_middle_1(x, seg) output_5 = x print('5,', x.shape) x = self.up(x) output_6 = x print('6,', x.shape) x = self.up_0(x, seg) print('7,', x.shape) x = self.up(x) print('8,', x.shape) x = self.up_1(x, seg) output_9 = x print('9,', x.shape) x = self.up(x) print('10,', x.shape) x = self.up_2(x, seg) print('11,', x.shape) output_11 = x x = self.up(x) print('12,', x.shape) x = self.up_3(x, seg) print('13,', x.shape) if self.opt.num_upsampling_layers == 'most': x = self.up(x) x = self.up_4(x, seg) print('14,', x.shape) x = self.conv_img(F.leaky_relu(x, 2e-1)) print('15,', x.shape) output_15 = x #x = F.tanh(x) print('16,', x.shape) return output_5,output_6,output_9,output_11,output_15 #%% For the PIX2SPADE class UNet768PIXSPADE(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768PIXSPADE, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) print('UNET 768 SPADE') self.output_nc = output_nc # 1024 self.down1 = StackEncoder(1, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256+1024, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128+1024, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64+256, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24+128, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24+3, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Tanh() def _crop_concat(self, upsampled, bypass): """ Crop y to the (h, w) of x and concat them. Used for the expansive path. Returns: The concatenated tensor """ c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self,x, input_to_net): #print(input_to_net.shape) output_5,output_6,output_9,output_11,output_15 = input_to_net #print(x.shape) out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##; #print('down1',down1.shape) #256 down2, out = self.down2(out) # ; #print('down2',down2.shape) #128 down3, out = self.down3(out) # ; #print('down3',down3.shape) #64 down4, out = self.down4(out) # ; #print('down4',down4.shape) #32 down5, out = self.down5(out) # ; #print('down5',down5.shape) #16 down6, out = self.down6(out) # ; #print('down6',down6.shape) #8 pass # ; #print('out ',out.shape) out = self.center(out) #print('0',out.shape) out = self.up6(down6, out) #print('1',out.shape) out = self.up5(down5, out) out = torch.cat((out,output_5 ),1 ) #print('2',out.shape) out = self.up4(down4, out) out = torch.cat((out,output_6 ),1 ) #print('3',out.shape) out = self.up3(down3, out) out = torch.cat((out,output_9 ),1 ) #print('4',out.shape) out = self.up2(down2, out) out = torch.cat((out,output_11 ),1 ) #print('5',out.shape) out = self.up1(down1, out) # 1024 out = torch.cat((out,output_15 ),1 ) #print('6',out.shape) out = self.final_out(self.classify(out)) out = torch.reshape(out,(-1, self.output_nc, 256,256))#, dim=1) return out #%%Unet for spade8 class UNet768PIXSPADE8SM(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768PIXSPADE8SM, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) print('UNET 768 SPADE') self.output_nc = output_nc # 1024 self.down1 = StackEncoder(1, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256+128, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128+128, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64+32, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24+16, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Tanh() def _crop_concat(self, upsampled, bypass): """ Crop y to the (h, w) of x and concat them. Used for the expansive path. Returns: The concatenated tensor """ c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self,x, input_to_net): #print(input_to_net.shape) output_5,output_6,output_9,output_11,output_15 = input_to_net #print(x.shape) out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##; #print('down1',down1.shape) #256 down2, out = self.down2(out) # ; #print('down2',down2.shape) #128 down3, out = self.down3(out) # ; #print('down3',down3.shape) #64 down4, out = self.down4(out) # ; #print('down4',down4.shape) #32 down5, out = self.down5(out) # ; #print('down5',down5.shape) #16 down6, out = self.down6(out) # ; #print('down6',down6.shape) #8 pass # ; #print('out ',out.shape) out = self.center(out) #print('0',out.shape) out = self.up6(down6, out) #print('1',out.shape) out = self.up5(down5, out) out = torch.cat((out,output_5 ),1 ) #print('2',out.shape) out = self.up4(down4, out) out = torch.cat((out,output_6 ),1 ) #print('3',out.shape) out = self.up3(down3, out) out = torch.cat((out,output_9 ),1 ) #print('4',out.shape) out = self.up2(down2, out) out = torch.cat((out,output_11 ),1 ) #print('5',out.shape) out = self.up1(down1, out) # 1024 #out = torch.cat((out,output_15 ),1 ) #print('6',out.shape) out = self.final_out(self.classify(out)) out = torch.reshape(out,(-1, self.output_nc, 256,256))#, dim=1) return out
41.959444
215
0.600421
import torch import torch.nn as nn from torch.nn import init import functools from torch.optim import lr_scheduler from math import floor, log2 from functools import partial from linear_attention_transformer import ImageLinearAttention rom random import random import numpy as np import torch.nn.functional as F rom models.networks_SPADE.base_network import BaseNetwork from models.networks_SPADE.architecture import ResnetBlock as ResnetBlock from models.networks_SPADE.architecture import SPADEResnetBlock as SPADEResnetBlock ################################################ class GANLoss(nn.Module): def __init__(self, gan_mode, target_real_label=1.0, target_fake_label=0.0): super(GANLoss, self).__init__() self.register_buffer('real_label', torch.tensor(target_real_label)) self.register_buffer('fake_label', torch.tensor(target_fake_label)) self.gan_mode = gan_mode if gan_mode == 'lsgan': self.loss = nn.MSELoss() elif gan_mode == 'vanilla': self.loss = nn.BCEWithLogitsLoss() elif gan_mode in ['wgangp']: self.loss = None else: raise NotImplementedError('gan mode %s not implemented' % gan_mode) def get_target_tensor(self, prediction, target_is_real): if target_is_real: target_tensor = self.real_label else: target_tensor = self.fake_label return target_tensor.expand_as(prediction) def __call__(self, prediction, target_is_real): if self.gan_mode in ['lsgan', 'vanilla']: target_tensor = self.get_target_tensor(prediction, target_is_real) loss = self.loss(prediction, target_tensor) elif self.gan_mode == 'wgangp': if target_is_real: loss = -prediction.mean() else: loss = prediction.mean() return loss class UnetGANLoss(nn.Module): def __init__(self, gan_mode, target_real_label=1.0, target_fake_label=0.0): super(UnetGANLoss, self).__init__() self.register_buffer('real_label_1', torch.tensor(target_real_label)) self.register_buffer('real_label_2', torch.tensor(np.ones((1,256,256)))) self.register_buffer('fake_label_1', torch.tensor(target_fake_label)) self.register_buffer('fake_label_2', torch.tensor(np.zeros((1,256,256)))) self.loss_1 = nn.BCEWithLogitsLoss() self.loss_2 = nn.BCEWithLogitsLoss() def get_target_tensor(self, prediction_1, prediction_2, target_is_real): if target_is_real: target_tensor_1 = self.real_label_1 target_tensor_2 = self.real_label_2 else: target_tensor_1 = self.fake_label_1 target_tensor_2 = self.fake_label_2 return target_tensor_1.expand_as(prediction_1), target_tensor_2.expand_as(prediction_2) def __call__(self, prediction_1, prediction_2, target_is_real): target_tensor_1, target_tensor_2 = self.get_target_tensor(prediction_1, prediction_2, target_is_real) loss_1 = self.loss_1(prediction_1, target_tensor_1) loss_2 = self.loss_2(prediction_2, target_tensor_2) loss = loss_1.mean()+loss_2.mean() return loss def cal_gradient_penalty(netD, real_data, fake_data, device, type='mixed', constant=1.0, lambda_gp=10.0): if lambda_gp > 0.0: if type == 'real': # either use real images, fake images, or a linear interpolation of two. interpolatesv = real_data elif type == 'fake': interpolatesv = fake_data elif type == 'mixed': alpha = torch.rand(real_data.shape[0], 1, device=device) alpha = alpha.expand(real_data.shape[0], real_data.nelement() // real_data.shape[0]).contiguous().view(*real_data.shape) interpolatesv = alpha * real_data + ((1 - alpha) * fake_data) else: raise NotImplementedError('{} not implemented'.format(type)) interpolatesv.requires_grad_(True) disc_interpolates = netD(interpolatesv) gradients = torch.autograd.grad(outputs=disc_interpolates, inputs=interpolatesv, grad_outputs=torch.ones(disc_interpolates.size()).to(device), create_graph=True, retain_graph=True, only_inputs=True) gradients = gradients[0].view(real_data.size(0), -1) # flat the data gradient_penalty = (((gradients + 1e-16).norm(2, dim=1) - constant) ** 2).mean() * lambda_gp # added eps return gradient_penalty, gradients else: return 0.0, None class ResnetGenerator(nn.Module): def __init__(self, input_nc, output_nc, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False, n_blocks=6, padding_type='reflect'): assert(n_blocks >= 0) super(ResnetGenerator, self).__init__() if type(norm_layer) == functools.partial: use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d model = [nn.ReflectionPad2d(3), nn.Conv2d(input_nc, ngf, kernel_size=7, padding=0, bias=use_bias), norm_layer(ngf), nn.ReLU(True)] n_downsampling = 2 for i in range(n_downsampling): # add downsampling layers mult = 2 ** i model += [nn.Conv2d(ngf * mult, ngf * mult * 2, kernel_size=3, stride=2, padding=1, bias=use_bias), norm_layer(ngf * mult * 2), nn.ReLU(True)] mult = 2 ** n_downsampling for i in range(n_blocks): # add ResNet blocks model += [ResnetBlock(ngf * mult, padding_type=padding_type, norm_layer=norm_layer, use_dropout=use_dropout, use_bias=use_bias)] for i in range(n_downsampling): # add upsampling layers mult = 2 ** (n_downsampling - i) model += [nn.ConvTranspose2d(ngf * mult, int(ngf * mult / 2), kernel_size=3, stride=2, padding=1, output_padding=1, bias=use_bias), norm_layer(int(ngf * mult / 2)), nn.ReLU(True)] model += [nn.ReflectionPad2d(3)] model += [nn.Conv2d(ngf, output_nc, kernel_size=7, padding=0)] model += [nn.Tanh()] self.model = nn.Sequential(*model) def forward(self, input): return self.model(input) class ResnetGeneratorUp(nn.Module): def __init__(self, input_nc, output_nc, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False, n_blocks=6, padding_type='reflect'): assert(n_blocks >= 0) super(ResnetGeneratorUp, self).__init__() if type(norm_layer) == functools.partial: use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d model = [nn.ReflectionPad2d(3), nn.Conv2d(input_nc, ngf, kernel_size=7, padding=0, bias=use_bias), norm_layer(ngf), nn.ReLU(True)] n_downsampling = 2 for i in range(n_downsampling): # add downsampling layers mult = 2 ** i model += [nn.Conv2d(ngf * mult, ngf * mult * 2, kernel_size=3, stride=2, padding=1, bias=use_bias), norm_layer(ngf * mult * 2), nn.ReLU(True)] mult = 2 ** n_downsampling for i in range(n_blocks): # add ResNet blocks model += [ResnetBlock(ngf * mult, padding_type=padding_type, norm_layer=norm_layer, use_dropout=use_dropout, use_bias=use_bias)] for i in range(n_downsampling): # add upsampling layers mult = 2 ** (n_downsampling - i) model += [nn.Upsample(scale_factor = 2, mode='nearest'), nn.ReflectionPad2d(1), nn.Conv2d(ngf * mult, int(ngf * mult / 2), kernel_size=3, stride=1, padding=0),] model += [nn.ReflectionPad2d(3)] model += [nn.Conv2d(ngf, output_nc, kernel_size=7, padding=0)] model += [nn.Tanh()] self.model = nn.Sequential(*model) def forward(self, input): return self.model(input) class ResnetBlock(nn.Module): def __init__(self, dim, padding_type, norm_layer, use_dropout, use_bias): super(ResnetBlock, self).__init__() self.conv_block = self.build_conv_block(dim, padding_type, norm_layer, use_dropout, use_bias) def build_conv_block(self, dim, padding_type, norm_layer, use_dropout, use_bias): conv_block = [] p = 0 if padding_type == 'reflect': conv_block += [nn.ReflectionPad2d(1)] elif padding_type == 'replicate': conv_block += [nn.ReplicationPad2d(1)] elif padding_type == 'zero': p = 1 else: raise NotImplementedError('padding [%s] is not implemented' % padding_type) conv_block += [nn.Conv2d(dim, dim, kernel_size=3, padding=p, bias=use_bias), norm_layer(dim), nn.ReLU(True)] if use_dropout: conv_block += [nn.Dropout(0.5)] p = 0 if padding_type == 'reflect': conv_block += [nn.ReflectionPad2d(1)] elif padding_type == 'replicate': conv_block += [nn.ReplicationPad2d(1)] elif padding_type == 'zero': p = 1 else: raise NotImplementedError('padding [%s] is not implemented' % padding_type) conv_block += [nn.Conv2d(dim, dim, kernel_size=3, padding=p, bias=use_bias), norm_layer(dim)] return nn.Sequential(*conv_block) def forward(self, x): out = x + self.conv_block(x) # add skip connections return out class UnetGenerator(nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UnetGenerator, self).__init__() # construct unet structure unet_block = UnetSkipConnectionBlock(ngf * 8, ngf * 8, input_nc=None, submodule=None, norm_layer=norm_layer, innermost=True) # add the innermost layer for i in range(num_downs - 5): # add intermediate layers with ngf * 8 filters unet_block = UnetSkipConnectionBlock(ngf * 8, ngf * 8, input_nc=None, submodule=unet_block, norm_layer=norm_layer, use_dropout=use_dropout) # gradually reduce the number of filters from ngf * 8 to ngf unet_block = UnetSkipConnectionBlock(ngf * 4, ngf * 8, input_nc=None, submodule=unet_block, norm_layer=norm_layer) unet_block = UnetSkipConnectionBlock(ngf * 2, ngf * 4, input_nc=None, submodule=unet_block, norm_layer=norm_layer) unet_block = UnetSkipConnectionBlock(ngf, ngf * 2, input_nc=None, submodule=unet_block, norm_layer=norm_layer) self.model = UnetSkipConnectionBlock(output_nc, ngf, input_nc=input_nc, submodule=unet_block, outermost=True, norm_layer=norm_layer) # add the outermost layer def forward(self, input): return self.model(input) class UnetSkipConnectionBlock(nn.Module): def __init__(self, outer_nc, inner_nc, input_nc=None, submodule=None, outermost=False, innermost=False, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UnetSkipConnectionBlock, self).__init__() self.outermost = outermost if type(norm_layer) == functools.partial: use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d if input_nc is None: input_nc = outer_nc downconv = nn.Conv2d(input_nc, inner_nc, kernel_size=4, stride=2, padding=1, bias=use_bias) downrelu = nn.LeakyReLU(0.2, True) downnorm = norm_layer(inner_nc) uprelu = nn.ReLU(True) upnorm = norm_layer(outer_nc) if outermost: upconv = nn.ConvTranspose2d(inner_nc * 2, outer_nc, kernel_size=4, stride=2, padding=1) down = [downconv] up = [uprelu, upconv, nn.Tanh()] model = down + [submodule] + up elif innermost: upconv = nn.ConvTranspose2d(inner_nc, outer_nc, kernel_size=4, stride=2, padding=1, bias=use_bias) down = [downrelu, downconv] up = [uprelu, upconv, upnorm] model = down + up else: upconv = nn.ConvTranspose2d(inner_nc * 2, outer_nc, kernel_size=4, stride=2, padding=1, bias=use_bias) down = [downrelu, downconv, downnorm] up = [uprelu, upconv, upnorm] if use_dropout: model = down + [submodule] + up + [nn.Dropout(0.5)] else: model = down + [submodule] + up self.model = nn.Sequential(*model) def forward(self, x): if self.outermost: return self.model(x) else: # add skip connections return torch.cat([x, self.model(x)], 1) #%%% Unet from DeepMact class ConvBnRelu2d(torch.nn.Module): def __init__(self, in_channels, out_channels, kernel_size=3, padding=1, output_padding=1, dilation=1, stride=1, groups=1, is_bn=True, is_relu=True, is_decoder=False): super(ConvBnRelu2d, self).__init__() if is_decoder: self.transpConv = torch.nn.ConvTranspose2d(in_channels, out_channels, kernel_size=kernel_size, padding=padding, output_padding=output_padding, stride=stride, dilation=dilation, groups=groups, bias=False) self.conv = None else: self.transpConv = None self.conv = torch.nn.Conv2d(in_channels, out_channels, kernel_size=kernel_size, padding=padding, stride=stride, dilation=dilation, groups=groups, bias=False) self.bn = torch.nn.BatchNorm2d(out_channels, eps=1e-4) self.relu = torch.nn.ReLU(inplace=True) if is_bn is False: self.bn = None if is_relu is False: self.relu = None def forward(self, x): if self.conv is None: x = self.transpConv(x) elif self.transpConv is None: x = self.conv(x) if self.bn is not None: x = self.bn(x) if self.relu is not None: x = self.relu(x) return x class StackEncoder(torch.nn.Module): def __init__(self, x_channels, y_channels, kernel_size=3, stride=1): super(StackEncoder, self).__init__() padding = (kernel_size - 1) // 2 self.encode = torch.nn.Sequential( ConvBnRelu2d(x_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ConvBnRelu2d(y_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ) def forward(self, x): y = self.encode(x) y_small = torch.nn.functional.max_pool2d(y, kernel_size=2, stride=2) return y, y_small class StackDecoder(torch.nn.Module): def __init__(self, x_big_channels, x_channels, y_channels, kernel_size=3, stride=1): super(StackDecoder, self).__init__() padding = (kernel_size - 1) // 2 self.decode = torch.nn.Sequential( ConvBnRelu2d(x_big_channels + x_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ConvBnRelu2d(y_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ConvBnRelu2d(y_channels, y_channels, kernel_size=kernel_size, padding=padding, dilation=1, stride=stride, groups=1), ) def forward(self, x_big, x): N, C, H, W = x_big.size() y = torch.nn.functional.upsample(x, size=(H, W), mode='bilinear', align_corners=True) y = torch.cat([y, x_big], 1) y = self.decode(y) return y # 768 class UNet768(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) self.output_nc = output_nc # 1024 self.down1 = StackEncoder(input_nc, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Tanh() def _crop_concat(self, upsampled, bypass): c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self, x): out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##; #print('down1',down1.shape) #256 down2, out = self.down2(out) # ; #print('down2',down2.shape) #128 down3, out = self.down3(out) # ; #print('down3',down3.shape) #64 down4, out = self.down4(out) # ; #print('down4',down4.shape) #32 down5, out = self.down5(out) # ; #print('down5',down5.shape) #16 down6, out = self.down6(out) # ; #print('down6',down6.shape) #8 pass # ; #print('out ',out.shape) out = self.center(out) #print('0',out.shape) out = self.up6(down6, out) #print('1',out.shape) out = self.up5(down5, out) #print('2',out.shape) out = self.up4(down4, out) #print('3',out.shape) out = self.up3(down3, out) #print('4',out.shape) out = self.up2(down2, out) #print('5',out.shape) out = self.up1(down1, out) # 1024 #print('6',out.shape) out = self.final_out(self.classify(out)) out = torch.reshape(out,(-1, self.output_nc, x.shape[2],x.shape[3]))#, dim=1) return out #%%Unet_spade_768_300 #%%sigm class UNet768Sigm(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768Sigm, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) self.output_nc = output_nc # 1024 self.down1 = StackEncoder(input_nc, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Sigmoid() def _crop_concat(self, upsampled, bypass): c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self, x): out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##;print('down1',down1.size()) #256 down2, out = self.down2(out) # ;print('down2',down2.size()) #128 down3, out = self.down3(out) # ;print('down3',down3.size()) #64 down4, out = self.down4(out) # ;print('down4',down4.size()) #32 down5, out = self.down5(out) # ;print('down5',down5.size()) #16 down6, out = self.down6(out) # ;print('down6',down6.size()) #8 pass # ;print('out ',out.size()) out = self.center(out) out = self.up6(down6, out) out = self.up5(down5, out) out = self.up4(down4, out) out = self.up3(down3, out) out = self.up2(down2, out) out = self.up1(down1, out) # 1024 out = self.final_out(self.classify(out)) out = torch.reshape(out,(1, self.output_nc, 256,256))#, dim=1) return out class NLayerDiscriminator(nn.Module): def __init__(self, input_nc, ndf=64, n_layers=3, norm_layer=nn.BatchNorm2d): super(NLayerDiscriminator, self).__init__() if type(norm_layer) == functools.partial: # no need to use bias as BatchNorm2d has affine parameters use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d kw = 4 padw = 1 sequence = [nn.Conv2d(input_nc, ndf, kernel_size=kw, stride=2, padding=padw), nn.LeakyReLU(0.2, True)] nf_mult = 1 nf_mult_prev = 1 for n in range(1, n_layers): # gradually increase the number of filters nf_mult_prev = nf_mult nf_mult = min(2 ** n, 8) sequence += [ nn.Conv2d(ndf * nf_mult_prev, ndf * nf_mult, kernel_size=kw, stride=2, padding=padw, bias=use_bias), norm_layer(ndf * nf_mult), nn.LeakyReLU(0.2, True) ] nf_mult_prev = nf_mult nf_mult = min(2 ** n_layers, 8) sequence += [ nn.Conv2d(ndf * nf_mult_prev, ndf * nf_mult, kernel_size=kw, stride=1, padding=padw, bias=use_bias), norm_layer(ndf * nf_mult), nn.LeakyReLU(0.2, True) ] sequence += [nn.Conv2d(ndf * nf_mult, 1, kernel_size=kw, stride=1, padding=padw)] # output 1 channel prediction map self.model = nn.Sequential(*sequence) def forward(self, input): return self.model(input) class PixelDiscriminator(nn.Module): def __init__(self, input_nc, ndf=64, norm_layer=nn.BatchNorm2d): super(PixelDiscriminator, self).__init__() if type(norm_layer) == functools.partial: # no need to use bias as BatchNorm2d has affine parameters use_bias = norm_layer.func == nn.InstanceNorm2d else: use_bias = norm_layer == nn.InstanceNorm2d self.net = [ nn.Conv2d(input_nc, ndf, kernel_size=1, stride=1, padding=0), nn.LeakyReLU(0.2, True), nn.Conv2d(ndf, ndf * 2, kernel_size=1, stride=1, padding=0, bias=use_bias), norm_layer(ndf * 2), nn.LeakyReLU(0.2, True), nn.Conv2d(ndf * 2, 1, kernel_size=1, stride=1, padding=0, bias=use_bias)] self.net = nn.Sequential(*self.net) def forward(self, input): return self.net(input) #%% Unet as Disdef random_hflip(tensor, prob): def DiffAugment(x, types=[]): for p in types: for f in AUGMENT_FNS[p]: x = f(x) return x.contiguous(memory_format = torch.contiguous_format) def rand_brightness(x): x = x + (torch.rand(x.size(0), 1, 1, 1, dtype=x.dtype, device=x.device) - 0.5) return x def rand_saturation(x): x_mean = x.mean(dim=1, keepdim=True) x = (x - x_mean) * (torch.rand(x.size(0), 1, 1, 1, dtype=x.dtype, device=x.device) * 2) + x_mean return x def rand_contrast(x): x_mean = x.mean(dim=[1, 2, 3], keepdim=True) x = (x - x_mean) * (torch.rand(x.size(0), 1, 1, 1, dtype=x.dtype, device=x.device) + 0.5) + x_mean return x def rand_translation(x, ratio=0.125): shift_x, shift_y = int(x.size(2) * ratio + 0.5), int(x.size(3) * ratio + 0.5) translation_x = torch.randint(-shift_x, shift_x + 1, size=[x.size(0), 1, 1], device=x.device) translation_y = torch.randint(-shift_y, shift_y + 1, size=[x.size(0), 1, 1], device=x.device) grid_batch, grid_x, grid_y = torch.meshgrid( torch.arange(x.size(0), dtype=torch.long, device=x.device), torch.arange(x.size(2), dtype=torch.long, device=x.device), torch.arange(x.size(3), dtype=torch.long, device=x.device), ) grid_x = torch.clamp(grid_x + translation_x + 1, 0, x.size(2) + 1) grid_y = torch.clamp(grid_y + translation_y + 1, 0, x.size(3) + 1) x_pad = F.pad(x, [1, 1, 1, 1, 0, 0, 0, 0]) x = x_pad.permute(0, 2, 3, 1).contiguous()[grid_batch, grid_x, grid_y].permute(0, 3, 1, 2).contiguous(memory_format = torch.contiguous_format) return x def rand_cutout(x, ratio=0.5): cutout_size = int(x.size(2) * ratio + 0.5), int(x.size(3) * ratio + 0.5) offset_x = torch.randint(0, x.size(2) + (1 - cutout_size[0] % 2), size=[x.size(0), 1, 1], device=x.device) offset_y = torch.randint(0, x.size(3) + (1 - cutout_size[1] % 2), size=[x.size(0), 1, 1], device=x.device) grid_batch, grid_x, grid_y = torch.meshgrid( torch.arange(x.size(0), dtype=torch.long, device=x.device), torch.arange(cutout_size[0], dtype=torch.long, device=x.device), torch.arange(cutout_size[1], dtype=torch.long, device=x.device), ) grid_x = torch.clamp(grid_x + offset_x - cutout_size[0] // 2, min=0, max=x.size(2) - 1) grid_y = torch.clamp(grid_y + offset_y - cutout_size[1] // 2, min=0, max=x.size(3) - 1) mask = torch.ones(x.size(0), x.size(2), x.size(3), dtype=x.dtype, device=x.device) mask[grid_batch, grid_x, grid_y] = 0 x = x * mask.unsqueeze(1) return x AUGMENT_FNS = { 'color': [rand_brightness, rand_saturation, rand_contrast], 'translation': [rand_translation], 'cutout': [rand_cutout], } def random_float(lo, hi): return lo + (hi - lo) * random() def random_crop_and_resize(tensor, scale): b, c, h, _ = tensor.shape new_width = int(h * scale) delta = h - new_width h_delta = int(random() * delta) w_delta = int(random() * delta) cropped = tensor[:, :, h_delta:(h_delta + new_width), w_delta:(w_delta + new_width)].clone() return F.interpolate(cropped, size=(h, h), mode='bilinear') def random_hflip(tensor, prob): if prob > random(): return tensor return torch.flip(tensor, dims=(3,)) class AugWrapper(nn.Module): def __init__(self, D, image_size, types): super().__init__() self.D = D self.types = types def forward(self, images, prob = 0., detach = False): if random() < prob: images = random_hflip(images, prob=0.5) images = DiffAugment(images, types=self.types) if detach: images.detach_() return self.D(images), images def leaky_relu(p=0.2): return nn.LeakyReLU(p) class Residual(nn.Module): def __init__(self, fn): super().__init__() self.fn = fn def forward(self, x): return self.fn(x) + x class Flatten(nn.Module): def __init__(self, index): super().__init__() self.index = index def forward(self, x): return x.flatten(self.index) class Rezero(nn.Module): def __init__(self, fn): super().__init__() self.fn = fn self.g = nn.Parameter(torch.zeros(1)) def forward(self, x): return self.fn(x) * self.g def double_conv(chan_in, chan_out): return nn.Sequential( nn.Conv2d(chan_in, chan_out, 3, padding=1), leaky_relu(), nn.Conv2d(chan_out, chan_out, 3, padding=1), leaky_relu() ) class DownBlock(nn.Module): def __init__(self, input_channels, filters, downsample=True): super().__init__() self.conv_res = nn.Conv2d(input_channels, filters, 1, stride = (2 if downsample else 1)) self.net = double_conv(input_channels, filters) self.down = nn.Conv2d(filters, filters, 3, padding = 1, stride = 2) if downsample else None def forward(self, x): res = self.conv_res(x) x = self.net(x) unet_res = x if self.down is not None: x = self.down(x) x = x + res return x, unet_res # one layer of self-attention and feedforward, for images attn_and_ff = lambda chan: nn.Sequential(*[ Residual(Rezero(ImageLinearAttention(chan, norm_queries = True))), Residual(Rezero(nn.Sequential(nn.Conv2d(chan, chan * 2, 1), leaky_relu(), nn.Conv2d(chan * 2, chan, 1)))) ]) class UpBlock(nn.Module): def __init__(self, input_channels, filters): super().__init__() self.conv_res = nn.ConvTranspose2d(input_channels // 2, filters, 1, stride = 2) self.net = double_conv(input_channels, filters) self.up = nn.Upsample(scale_factor = 2, mode='bilinear', align_corners=False) self.input_channels = input_channels self.filters = filters def forward(self, x, res): *_, h, w = x.shape conv_res = self.conv_res(x, output_size = (h * 2, w * 2)) x = self.up(x) x = torch.cat((x, res), dim=1) x = self.net(x) x = x + conv_res return x class UnetDiscriminator(nn.Module): def __init__(self, image_size=256, network_capacity = 16, transparent = False, fmap_max = 256): super().__init__() num_layers = int(log2(image_size) - 3) num_init_filters = 2# if not transparent else 4 blocks = [] filters = [num_init_filters] + [(network_capacity) * (2 ** i) for i in range(num_layers + 1)] set_fmap_max = partial(min, fmap_max) filters = list(map(set_fmap_max, filters)) filters[-1] = filters[-2] chan_in_out = list(zip(filters[:-1], filters[1:])) chan_in_out = list(map(list, chan_in_out)) print('Channels',chan_in_out) down_blocks = [] attn_blocks = [] for ind, (in_chan, out_chan) in enumerate(chan_in_out): num_layer = ind + 1 is_not_last = ind != (len(chan_in_out) - 1) block = DownBlock(in_chan, out_chan, downsample = is_not_last) down_blocks.append(block) attn_fn = attn_and_ff(out_chan) attn_blocks.append(attn_fn) self.down_blocks = nn.ModuleList(down_blocks) self.attn_blocks = nn.ModuleList(attn_blocks) last_chan = filters[-1] self.to_logit = nn.Sequential( leaky_relu(), nn.AvgPool2d(image_size // (2 ** num_layers)), Flatten(1), nn.Linear(last_chan, 1) ) self.conv = double_conv(last_chan, last_chan) dec_chan_in_out = chan_in_out[:-1][::-1] self.up_blocks = nn.ModuleList(list(map(lambda c: UpBlock(c[1] * 2, c[0]), dec_chan_in_out))) self.conv_out = nn.Conv2d(2, 1, 1) def forward(self, x): #print('Input shape:', x.shape) b, *_ = x.shape residuals = [] i=0 for (down_block, attn_block) in zip(self.down_blocks, self.attn_blocks): #print('Step', i, x.shape) i=i+1 x, unet_res = down_block(x) residuals.append(unet_res) if attn_block is not None: x = attn_block(x) x = self.conv(x) + x enc_out = self.to_logit(x) for (up_block, res) in zip(self.up_blocks, residuals[:-1][::-1]): #print('in up blocK', x.shape) x = up_block(x, res) dec_out = self.conv_out(x) return enc_out.squeeze(), dec_out #%% SPADE RESNET class SPADEGenerator(BaseNetwork): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False,opt=None): super(SPADEGenerator, self).__init__() self.opt = opt self.opt.num_upsampling_layers = 'normal' self.opt.norm_G = 'spectralspadesyncbatch3x3' self.opt.ngf = 64 self.opt.semantic_nc = 2 self.opt.use_vae = False self.opt.crop_size = 256 self.opt.normG = 'spectralinstance' self.opt.aspect_ratio = 1.0 nf = self.opt.ngf opt = self.opt self.sw, self.sh = self.compute_latent_vector_size(opt) self.fc = nn.Conv2d(self.opt.semantic_nc, 16 * nf, 3, padding=1) self.head_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_1 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.up_0 = SPADEResnetBlock(16 * nf, 8 * nf, opt) self.up_1 = SPADEResnetBlock(8 * nf, 4 * nf, opt) self.up_2 = SPADEResnetBlock(4 * nf, 2 * nf, opt) self.up_3 = SPADEResnetBlock(2 * nf, 1 * nf, opt) final_nc = nf if opt.num_upsampling_layers == 'most': self.up_4 = SPADEResnetBlock(1 * nf, nf // 2, opt) final_nc = nf // 2 self.conv_img = nn.Conv2d(final_nc, 3, 3, padding=1) self.up = nn.Upsample(scale_factor=2) def compute_latent_vector_size(self, opt): if opt.num_upsampling_layers == 'normal': num_up_layers = 5 elif opt.num_upsampling_layers == 'more': num_up_layers = 6 elif opt.num_upsampling_layers == 'most': num_up_layers = 7 else: raise ValueError('opt.num_upsampling_layers [%s] not recognized' % opt.num_upsampling_layers) sw = self.opt.crop_size // (2**num_up_layers) sh = round(sw / opt.aspect_ratio) return sw, sh def forward(self, input, z=None): seg = input if self.opt.use_vae: # we sample z from unit normal and reshape the tensor if z is None: z = torch.randn(input.size(0), self.opt.z_dim, dtype=torch.float32, device=input.get_device()) x = self.fc(z) x = x.view(-1, 16 * self.opt.ngf, self.sh, self.sw) else: # we downsample segmap and run convolution x = F.interpolate(seg, size=(self.sh, self.sw)) x = self.fc(x) #print('0,', x.shape) x = self.head_0(x, seg) #print('1,', x.shape) x = self.up(x) #print('2', x.shape) x = self.G_middle_0(x, seg) #print('3,', x.shape) if self.opt.num_upsampling_layers == 'more' or \ self.opt.num_upsampling_layers == 'most': x = self.up(x) #print('4,', x.shape) #x = self.G_middle_1(x, seg) output_5 = x #print('5,', x.shape) x = self.up(x) output_6 = x #print('6,', x.shape) x = self.up_0(x, seg) #print('7,', x.shape) x = self.up(x) #print('8,', x.shape) x = self.up_1(x, seg) output_9 = x #print('9,', x.shape) x = self.up(x) #print('10,', x.shape) x = self.up_2(x, seg) #print('11,', x.shape) output_11 = x x = self.up(x) # print('12,', x.shape) x = self.up_3(x, seg) #print('13,', x.shape) if self.opt.num_upsampling_layers == 'most': x = self.up(x) x = self.up_4(x, seg) #print('14,', x.shape) x = self.conv_img(F.leaky_relu(x, 2e-1)) # print('15,', x.shape) output_15 = x #x = F.tanh(x) #print('16,', x.shape) return output_5,output_6,output_9,output_11,output_15 #%% spade8 class SPADE8Generator(BaseNetwork): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False,opt=None): super(SPADE8Generator, self).__init__() self.opt = opt self.opt.num_upsampling_layers = 'normal' self.opt.norm_G = 'spectralspadesyncbatch3x3' self.opt.ngf = 8 self.opt.semantic_nc = 2 self.opt.use_vae = False self.opt.crop_size = 256 self.opt.normG = 'spectralinstance' self.opt.aspect_ratio = 1.0 nf = self.opt.ngf opt = self.opt self.sw, self.sh = self.compute_latent_vector_size(opt) self.fc = nn.Conv2d(self.opt.semantic_nc, 16 * nf, 3, padding=1) self.head_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_1 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.up_0 = SPADEResnetBlock(16 * nf, 8 * nf, opt) self.up_1 = SPADEResnetBlock(8 * nf, 4 * nf, opt) self.up_2 = SPADEResnetBlock(4 * nf, 2 * nf, opt) self.up_3 = SPADEResnetBlock(2 * nf, 1 * nf, opt) final_nc = nf if opt.num_upsampling_layers == 'most': self.up_4 = SPADEResnetBlock(1 * nf, nf // 2, opt) final_nc = nf // 2 self.conv_img = nn.Conv2d(final_nc, 3, 3, padding=1) self.up = nn.Upsample(scale_factor=2) def compute_latent_vector_size(self, opt): if opt.num_upsampling_layers == 'normal': num_up_layers = 5 elif opt.num_upsampling_layers == 'more': num_up_layers = 6 elif opt.num_upsampling_layers == 'most': num_up_layers = 7 else: raise ValueError('opt.num_upsampling_layers [%s] not recognized' % opt.num_upsampling_layers) sw = self.opt.crop_size // (2**num_up_layers) sh = round(sw / opt.aspect_ratio) return sw, sh def forward(self, input, z=None): seg = input if self.opt.use_vae: # we sample z from unit normal and reshape the tensor if z is None: z = torch.randn(input.size(0), self.opt.z_dim, dtype=torch.float32, device=input.get_device()) x = self.fc(z) x = x.view(-1, 16 * self.opt.ngf, self.sh, self.sw) else: # we downsample segmap and run convolution x = F.interpolate(seg, size=(self.sh, self.sw)) x = self.fc(x) #print('0,', x.shape) x = self.head_0(x, seg) #print('1,', x.shape) x = self.up(x) #print('2', x.shape) x = self.G_middle_0(x, seg) #print('3,', x.shape) if self.opt.num_upsampling_layers == 'more' or \ self.opt.num_upsampling_layers == 'most': x = self.up(x) #print('4,', x.shape) x = self.G_middle_1(x, seg) output_5 = x #print('5,', x.shape) x = self.up(x) output_6 = x #print('6,', x.shape) x = self.up_0(x, seg) #print('7,', x.shape) x = self.up(x) #print('8,', x.shape) x = self.up_1(x, seg) output_9 = x #print('9,', x.shape) x = self.up(x) #print('10,', x.shape) x = self.up_2(x, seg) #print('11,', x.shape) output_11 = x x = self.up(x) #print('12,', x.shape) x = self.up_3(x, seg) #print('13,', x.shape) if self.opt.num_upsampling_layers == 'most': x = self.up(x) x = self.up_4(x, seg) #print('14,', x.shape) x = self.conv_img(F.leaky_relu(x, 2e-1)) #print('15,', x.shape) output_15 = x #x = F.tanh(x) #print('16,', x.shape) return output_5,output_6,output_9,output_11,output_15 #%% class SPADE6Generator(BaseNetwork): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False,opt=None): super(SPADE6Generator, self).__init__() self.opt = opt self.opt.num_upsampling_layers = 'normal' self.opt.norm_G = 'spectralspadesyncbatch3x3' self.opt.ngf = 6 self.opt.semantic_nc = 2 self.opt.use_vae = False self.opt.crop_size = 300 self.opt.normG = 'spectralinstance' self.opt.aspect_ratio = 1.0 nf = self.opt.ngf opt = self.opt self.sw, self.sh = self.compute_latent_vector_size(opt) self.fc = nn.Conv2d(self.opt.semantic_nc, 16 * nf, 3, padding=1) self.head_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_0 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.G_middle_1 = SPADEResnetBlock(16 * nf, 16 * nf, opt) self.up_0 = SPADEResnetBlock(16 * nf, 8 * nf, opt) self.up_1 = SPADEResnetBlock(8 * nf, 4 * nf, opt) self.up_2 = SPADEResnetBlock(4 * nf, 2 * nf, opt) self.up_3 = SPADEResnetBlock(2 * nf, 1 * nf, opt) final_nc = nf if opt.num_upsampling_layers == 'most': self.up_4 = SPADEResnetBlock(1 * nf, nf // 2, opt) final_nc = nf // 2 self.conv_img = nn.Conv2d(final_nc, 3, 3, padding=1) self.up = nn.Upsample(scale_factor=2) def compute_latent_vector_size(self, opt): if opt.num_upsampling_layers == 'normal': num_up_layers = 5 elif opt.num_upsampling_layers == 'more': num_up_layers = 6 elif opt.num_upsampling_layers == 'most': num_up_layers = 7 else: raise ValueError('opt.num_upsampling_layers [%s] not recognized' % opt.num_upsampling_layers) sw = 10#self.opt.crop_size // (2**num_up_layers) sh = round(sw / opt.aspect_ratio) return sw, sh def forward(self, input, z=None): seg = input if self.opt.use_vae: # we sample z from unit normal and reshape the tensor if z is None: z = torch.randn(input.size(0), self.opt.z_dim, dtype=torch.float32, device=input.get_device()) x = self.fc(z) x = x.view(-1, 16 * self.opt.ngf, self.sh, self.sw) else: # we downsample segmap and run convolution x = F.interpolate(seg, size=(self.sh, self.sw)) x = self.fc(x) print('0,', x.shape) x = self.head_0(x, seg) print('1,', x.shape) x = self.up(x) print('2', x.shape) x = self.G_middle_0(x, seg) print('3,', x.shape) if self.opt.num_upsampling_layers == 'more' or \ self.opt.num_upsampling_layers == 'most': x = self.up(x) print('4,', x.shape) x = self.G_middle_1(x, seg) output_5 = x print('5,', x.shape) x = self.up(x) output_6 = x print('6,', x.shape) x = self.up_0(x, seg) print('7,', x.shape) x = self.up(x) print('8,', x.shape) x = self.up_1(x, seg) output_9 = x print('9,', x.shape) x = self.up(x) print('10,', x.shape) x = self.up_2(x, seg) print('11,', x.shape) output_11 = x x = self.up(x) print('12,', x.shape) x = self.up_3(x, seg) print('13,', x.shape) if self.opt.num_upsampling_layers == 'most': x = self.up(x) x = self.up_4(x, seg) print('14,', x.shape) x = self.conv_img(F.leaky_relu(x, 2e-1)) print('15,', x.shape) output_15 = x #x = F.tanh(x) print('16,', x.shape) return output_5,output_6,output_9,output_11,output_15 #%% For the PIX2SPADE class UNet768PIXSPADE(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768PIXSPADE, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) print('UNET 768 SPADE') self.output_nc = output_nc # 1024 self.down1 = StackEncoder(1, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256+1024, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128+1024, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64+256, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24+128, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24+3, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Tanh() def _crop_concat(self, upsampled, bypass): c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self,x, input_to_net): #print(input_to_net.shape) output_5,output_6,output_9,output_11,output_15 = input_to_net #print(x.shape) out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##; #print('down1',down1.shape) #256 down2, out = self.down2(out) # ; #print('down2',down2.shape) #128 down3, out = self.down3(out) # ; #print('down3',down3.shape) #64 down4, out = self.down4(out) # ; #print('down4',down4.shape) #32 down5, out = self.down5(out) # ; #print('down5',down5.shape) #16 down6, out = self.down6(out) # ; #print('down6',down6.shape) #8 pass # ; #print('out ',out.shape) out = self.center(out) #print('0',out.shape) out = self.up6(down6, out) #print('1',out.shape) out = self.up5(down5, out) out = torch.cat((out,output_5 ),1 ) #print('2',out.shape) out = self.up4(down4, out) out = torch.cat((out,output_6 ),1 ) #print('3',out.shape) out = self.up3(down3, out) out = torch.cat((out,output_9 ),1 ) #print('4',out.shape) out = self.up2(down2, out) out = torch.cat((out,output_11 ),1 ) #print('5',out.shape) out = self.up1(down1, out) # 1024 out = torch.cat((out,output_15 ),1 ) #print('6',out.shape) out = self.final_out(self.classify(out)) out = torch.reshape(out,(-1, self.output_nc, 256,256))#, dim=1) return out #%%Unet for spade8 class UNet768PIXSPADE8SM(torch.nn.Module): def __init__(self, input_nc, output_nc, num_downs, ngf, norm_layer=nn.BatchNorm2d, use_dropout=False): super(UNet768PIXSPADE8SM, self).__init__() # def __init__(self, input_nc, output_nc, num_downs, ngf=64, norm_layer=nn.BatchNorm2d, use_dropout=False): # C, H, W = in_shape # assert(C==3) print('UNET 768 SPADE') self.output_nc = output_nc # 1024 self.down1 = StackEncoder(1, 24, kernel_size=3) # Channels: 1 in, 24 out; Image size: 300 in, 150 out self.down2 = StackEncoder(24, 64, kernel_size=3) # Channels: 24 in, 64 out; Image size: 150 in, 75 out self.down3 = StackEncoder(64, 128, kernel_size=3) # Channels: 64 in, 128 out; Image size: 75 in, 38 out self.down4 = StackEncoder(128, 256, kernel_size=3) # Channels: 128 in, 256 out; Image size: 38 in, 19 out self.down5 = StackEncoder(256, 512, kernel_size=3) # Channels: 256 in, 512 out; Image size: 19 in, 10 out self.down6 = StackEncoder(512, 768, kernel_size=3) # Channels: 512 in, 768 out; Image size: 10 in, 5 out self.center = torch.nn.Sequential( ConvBnRelu2d(768, 768, kernel_size=3, padding=1, stride=1), # Channels: 768 in, 768 out; Image size: 5 in, 5 out ) # x_big_channels, x_channels, y_channels self.up6 = StackDecoder(768, 768, 512, kernel_size=3) # Channels: 768+768 = 1536 in, 512 out; Image size: 5 in, 10 out self.up5 = StackDecoder(512, 512, 256, kernel_size=3) # Channels: 512+512 = 1024 in, 256 out; Image size: 10 in, 19 out self.up4 = StackDecoder(256+128, 256, 128, kernel_size=3) # Channels: 256+256 = 512 in, 128 out; Image size: 19 in, 38 out self.up3 = StackDecoder(128+128, 128, 64, kernel_size=3) # Channels: 128+128 = 256 in, 64 out; Image size: 38 in, 75 out self.up2 = StackDecoder(64+32, 64, 24, kernel_size=3) # Channels: 64+64 = 128 in, 24 out; Image size: 75 in, 150 out self.up1 = StackDecoder(24+16, 24, 24, kernel_size=3) # Channels: 24+24 = 48 in, 24 out; Image size: 150 in, 300 out self.classify = torch.nn.Conv2d(24, output_nc, kernel_size=1, padding=0, stride=1, bias=True) # Channels: 24 in, 1 out; Image size: 300 in, 300 out self.final_out = torch.nn.Tanh() def _crop_concat(self, upsampled, bypass): c = (bypass.size()[2] - upsampled.size()[2]) // 2 bypass = torch.nn.functional.pad(bypass, (-c, -c, -c, -c)) return torch.cat((upsampled, bypass), 1) def forward(self,x, input_to_net): #print(input_to_net.shape) output_5,output_6,output_9,output_11,output_15 = input_to_net #print(x.shape) out = x # ;print('x ',x.size()) # down1, out = self.down1(out) ##; #print('down1',down1.shape) #256 down2, out = self.down2(out) # ; #print('down2',down2.shape) #128 down3, out = self.down3(out) # ; #print('down3',down3.shape) #64 down4, out = self.down4(out) # ; #print('down4',down4.shape) #32 down5, out = self.down5(out) # ; #print('down5',down5.shape) #16 down6, out = self.down6(out) # ; #print('down6',down6.shape) #8 pass # ; #print('out ',out.shape) out = self.center(out) #print('0',out.shape) out = self.up6(down6, out) #print('1',out.shape) out = self.up5(down5, out) out = torch.cat((out,output_5 ),1 ) #print('2',out.shape) out = self.up4(down4, out) out = torch.cat((out,output_6 ),1 ) #print('3',out.shape) out = self.up3(down3, out) out = torch.cat((out,output_9 ),1 ) #print('4',out.shape) out = self.up2(down2, out) out = torch.cat((out,output_11 ),1 ) #print('5',out.shape) out = self.up1(down1, out) # 1024 #out = torch.cat((out,output_15 ),1 ) #print('6',out.shape) out = self.final_out(self.classify(out)) out = torch.reshape(out,(-1, self.output_nc, 256,256))#, dim=1) return out
true
true
f71e55d3cf3aa4932ba68a34b333db3adb118d95
3,235
py
Python
tests/unittests/test_extension.py
kontur/psautohint
69bab0df4eac8c4a88d9ac4dce94c2d6c61aba99
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
tests/unittests/test_extension.py
kontur/psautohint
69bab0df4eac8c4a88d9ac4dce94c2d6c61aba99
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
tests/unittests/test_extension.py
kontur/psautohint
69bab0df4eac8c4a88d9ac4dce94c2d6c61aba99
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
import pytest from psautohint import _psautohint INFO = b"FontName Foo" NAME = b"Foo" GLYPH = b"""% square 0 500 rb 60 500 ry sc 560 500 mt 560 0 dt 60 0 dt 60 500 dt cp ed """ def test_autohint_good_args(): _psautohint.autohint(INFO, GLYPH) def test_autohintmm_good_args(): _psautohint.autohintmm((GLYPH, GLYPH), (NAME, NAME)) @pytest.mark.parametrize("args", [ [], # no arguments [INFO], # 1 argument [INFO.decode('ascii'), GLYPH], # 1st is string not bytes [INFO, GLYPH.decode('ascii')], # 2nd is string not bytes [[INFO], GLYPH.decode('ascii')], # 1st is a list [INFO, [GLYPH.decode('ascii')]], # 2nd is a list ]) def test_autohint_bad_args(args): with pytest.raises(TypeError): _psautohint.autohint(*args) @pytest.mark.parametrize("args", [ [], # no arguments [(GLYPH, GLYPH)], # 1 argument [GLYPH, (NAME, NAME)], # 1st is not a tuple [(GLYPH, GLYPH), NAME], # 2nd is not a tuple [(GLYPH, GLYPH), tuple()], # 2nd is an empty tuple [(GLYPH, GLYPH), (NAME,)], # 2nd is shorter than 1st [(GLYPH,), (NAME,)], # 1st is one glyph ]) def test_autohintmm_bad_args(args): with pytest.raises(TypeError): _psautohint.autohintmm(*args) @pytest.mark.parametrize("args", [ [(GLYPH.decode('ascii'), GLYPH), (NAME, NAME)], # 1st should be bytes [(GLYPH, GLYPH), (NAME.decode('ascii'), NAME)], # 2nd should be bytes ]) def test_autohintmm_unicode(args): with pytest.raises(TypeError): _psautohint.autohintmm(*args) @pytest.mark.parametrize("glyph", [ b"% foo\ned", # ending comment with newline b"% foo\red", # ending comment with linefeed b"\t% foo\nsc\ted", # separating tokens with tab b"% foo\nsc ed", # separating tokens with space b"% foo\nsc\ned", # separating tokens with newline b"% foo\nsc\red", # separating tokens with linefeed b"% foo", # glyph name only b"% foo bar", # extra data after glyph name ]) def test_autohint_good_glyph(glyph): result = _psautohint.autohint(INFO, glyph) assert result == b"% foo\nsc\ned\n" @pytest.mark.parametrize("glyph", [ b"% foo\ncf", # unknown operator b"% foo\n" + 80 * b"f", # too long unknown operator b"% " + 65 * b"A", # too long glyph name b"% foo\n10 ", # number left on stack at end of glyph b"% foo\n0a 0 rm\ned", # bad number terminator b"% foo\nry", # stack underflow b"% foo\n$", # unexpected character ]) def test_autohint_bad_glyph(glyph): with pytest.raises(_psautohint.error): _psautohint.autohint(INFO, glyph) @pytest.mark.parametrize("glyphs", [ (b"cf", b"cf"), ]) def test_autohintmm_bad_glyphs(glyphs): with pytest.raises(_psautohint.error): _psautohint.autohintmm(glyphs, (NAME, NAME)) @pytest.mark.parametrize("info", [ b"HCounterChars [" + b" ".join(b"A" * i for i in range(16)) + b"]", b"VCounterChars [" + b" ".join(b"A" * i for i in range(16)) + b"]", ]) def test_autohint_too_many_counter_glyphs(info): _psautohint.autohint(info, GLYPH)
29.953704
74
0.605255
import pytest from psautohint import _psautohint INFO = b"FontName Foo" NAME = b"Foo" GLYPH = b"""% square 0 500 rb 60 500 ry sc 560 500 mt 560 0 dt 60 0 dt 60 500 dt cp ed """ def test_autohint_good_args(): _psautohint.autohint(INFO, GLYPH) def test_autohintmm_good_args(): _psautohint.autohintmm((GLYPH, GLYPH), (NAME, NAME)) @pytest.mark.parametrize("args", [ [], [INFO], [INFO.decode('ascii'), GLYPH], [INFO, GLYPH.decode('ascii')], [[INFO], GLYPH.decode('ascii')], [INFO, [GLYPH.decode('ascii')]], ]) def test_autohint_bad_args(args): with pytest.raises(TypeError): _psautohint.autohint(*args) @pytest.mark.parametrize("args", [ [], [(GLYPH, GLYPH)], [GLYPH, (NAME, NAME)], [(GLYPH, GLYPH), NAME], [(GLYPH, GLYPH), tuple()], [(GLYPH, GLYPH), (NAME,)], [(GLYPH,), (NAME,)], ]) def test_autohintmm_bad_args(args): with pytest.raises(TypeError): _psautohint.autohintmm(*args) @pytest.mark.parametrize("args", [ [(GLYPH.decode('ascii'), GLYPH), (NAME, NAME)], [(GLYPH, GLYPH), (NAME.decode('ascii'), NAME)], ]) def test_autohintmm_unicode(args): with pytest.raises(TypeError): _psautohint.autohintmm(*args) @pytest.mark.parametrize("glyph", [ b"% foo\ned", b"% foo\red", b"\t% foo\nsc\ted", b"% foo\nsc ed", b"% foo\nsc\ned", b"% foo\nsc\red", b"% foo", b"% foo bar", ]) def test_autohint_good_glyph(glyph): result = _psautohint.autohint(INFO, glyph) assert result == b"% foo\nsc\ned\n" @pytest.mark.parametrize("glyph", [ b"% foo\ncf", b"% foo\n" + 80 * b"f", b"% " + 65 * b"A", b"% foo\n10 ", b"% foo\n0a 0 rm\ned", b"% foo\nry", b"% foo\n$", ]) def test_autohint_bad_glyph(glyph): with pytest.raises(_psautohint.error): _psautohint.autohint(INFO, glyph) @pytest.mark.parametrize("glyphs", [ (b"cf", b"cf"), ]) def test_autohintmm_bad_glyphs(glyphs): with pytest.raises(_psautohint.error): _psautohint.autohintmm(glyphs, (NAME, NAME)) @pytest.mark.parametrize("info", [ b"HCounterChars [" + b" ".join(b"A" * i for i in range(16)) + b"]", b"VCounterChars [" + b" ".join(b"A" * i for i in range(16)) + b"]", ]) def test_autohint_too_many_counter_glyphs(info): _psautohint.autohint(info, GLYPH)
true
true
f71e55d60e509a916cc25b65b45816137179e94a
1,085
py
Python
MNIST_convert.py
actionLUO/mnist_handwriting
fa8958417960978fa6230085950dc75e36697fdc
[ "Apache-2.0" ]
1
2019-01-03T06:50:49.000Z
2019-01-03T06:50:49.000Z
MNIST_convert.py
actionLUO/mnist_handwriting
fa8958417960978fa6230085950dc75e36697fdc
[ "Apache-2.0" ]
null
null
null
MNIST_convert.py
actionLUO/mnist_handwriting
fa8958417960978fa6230085950dc75e36697fdc
[ "Apache-2.0" ]
null
null
null
""" Created by Jacky LUO Using python3.5 Reference: https://pjreddie.com/projects/mnist-in-csv """ def convert_mnist_csv(img_file, label_file, output_file, n): imgf = open(img_file, 'rb') labelf = open(label_file, 'rb') outputf = open(output_file, 'w') imgf.read(16) labelf.read(8) images = [] for i in range(n): image = [ord(labelf.read(1))] for j in range(28 * 28): image.append(ord(imgf.read(1))) images.append(image) for image in images: outputf.write(",".join(str(pixel) for pixel in image) + "\n") imgf.close() labelf.close() outputf.close() if __name__ == '__main__': convert_mnist_csv("mnist/train-images-idx3-ubyte", "mnist/train-labels-idx1-ubyte", "mnist/mnist_train.csv", 60000) convert_mnist_csv("mnist/t10k-images-idx3-ubyte", "mnist/t10k-labels-idx1-ubyte", "mnist/mnist_test.csv", 10000) print('Finished data convert!')
21.7
69
0.560369
def convert_mnist_csv(img_file, label_file, output_file, n): imgf = open(img_file, 'rb') labelf = open(label_file, 'rb') outputf = open(output_file, 'w') imgf.read(16) labelf.read(8) images = [] for i in range(n): image = [ord(labelf.read(1))] for j in range(28 * 28): image.append(ord(imgf.read(1))) images.append(image) for image in images: outputf.write(",".join(str(pixel) for pixel in image) + "\n") imgf.close() labelf.close() outputf.close() if __name__ == '__main__': convert_mnist_csv("mnist/train-images-idx3-ubyte", "mnist/train-labels-idx1-ubyte", "mnist/mnist_train.csv", 60000) convert_mnist_csv("mnist/t10k-images-idx3-ubyte", "mnist/t10k-labels-idx1-ubyte", "mnist/mnist_test.csv", 10000) print('Finished data convert!')
true
true
f71e566e04bc0d00ac8b0de8f6db0abb216cd3ab
71,850
py
Python
sdks/python/apache_beam/runners/dataflow/dataflow_runner.py
stephenoken/beam
4797f310b6671de6fd703502520f4b012b655c82
[ "Apache-2.0" ]
1
2020-05-29T12:37:18.000Z
2020-05-29T12:37:18.000Z
sdks/python/apache_beam/runners/dataflow/dataflow_runner.py
stephenoken/beam
4797f310b6671de6fd703502520f4b012b655c82
[ "Apache-2.0" ]
null
null
null
sdks/python/apache_beam/runners/dataflow/dataflow_runner.py
stephenoken/beam
4797f310b6671de6fd703502520f4b012b655c82
[ "Apache-2.0" ]
null
null
null
# # Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # """A runner implementation that submits a job for remote execution. The runner will create a JSON description of the job graph and then submit it to the Dataflow Service for remote execution by a worker. """ # pytype: skip-file from __future__ import absolute_import from __future__ import division import base64 import json import logging import os import subprocess import sys import threading import time import traceback import urllib from builtins import hex from collections import defaultdict from typing import TYPE_CHECKING from typing import List from future.utils import iteritems import apache_beam as beam from apache_beam import coders from apache_beam import error from apache_beam import pvalue from apache_beam.internal import pickler from apache_beam.internal.gcp import json_value from apache_beam.options.pipeline_options import DebugOptions from apache_beam.options.pipeline_options import GoogleCloudOptions from apache_beam.options.pipeline_options import SetupOptions from apache_beam.options.pipeline_options import StandardOptions from apache_beam.options.pipeline_options import TestOptions from apache_beam.options.pipeline_options import WorkerOptions from apache_beam.portability import common_urns from apache_beam.portability.api import beam_runner_api_pb2 from apache_beam.pvalue import AsSideInput from apache_beam.runners.common import DoFnSignature from apache_beam.runners.dataflow.internal import names from apache_beam.runners.dataflow.internal.clients import dataflow as dataflow_api from apache_beam.runners.dataflow.internal.names import PropertyNames from apache_beam.runners.dataflow.internal.names import TransformNames from apache_beam.runners.runner import PipelineResult from apache_beam.runners.runner import PipelineRunner from apache_beam.runners.runner import PipelineState from apache_beam.runners.runner import PValueCache from apache_beam.transforms import window from apache_beam.transforms.core import RunnerAPIPTransformHolder from apache_beam.transforms.display import DisplayData from apache_beam.transforms.sideinputs import SIDE_INPUT_PREFIX from apache_beam.typehints import typehints from apache_beam.utils import processes from apache_beam.utils import proto_utils from apache_beam.utils.interactive_utils import is_in_notebook from apache_beam.utils.plugin import BeamPlugin if TYPE_CHECKING: from apache_beam.pipeline import PTransformOverride if sys.version_info[0] > 2: unquote_to_bytes = urllib.parse.unquote_to_bytes quote = urllib.parse.quote else: unquote_to_bytes = urllib.unquote # pylint: disable=deprecated-urllib-function quote = urllib.quote # pylint: disable=deprecated-urllib-function __all__ = ['DataflowRunner'] _LOGGER = logging.getLogger(__name__) BQ_SOURCE_UW_ERROR = ( 'The Read(BigQuerySource(...)) transform is not supported with newer stack ' 'features (Fn API, Dataflow Runner V2, etc). Please use the transform ' 'apache_beam.io.gcp.bigquery.ReadFromBigQuery instead.') class DataflowRunner(PipelineRunner): """A runner that creates job graphs and submits them for remote execution. Every execution of the run() method will submit an independent job for remote execution that consists of the nodes reachable from the passed in node argument or entire graph if node is None. The run() method returns after the service created the job and will not wait for the job to finish if blocking is set to False. """ # A list of PTransformOverride objects to be applied before running a pipeline # using DataflowRunner. # Currently this only works for overrides where the input and output types do # not change. # For internal SDK use only. This should not be updated by Beam pipeline # authors. # Imported here to avoid circular dependencies. # TODO: Remove the apache_beam.pipeline dependency in CreatePTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import CombineValuesPTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import CreatePTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import ReadPTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import JrhReadPTransformOverride # Thesse overrides should be applied before the proto representation of the # graph is created. _PTRANSFORM_OVERRIDES = [ CombineValuesPTransformOverride() ] # type: List[PTransformOverride] _JRH_PTRANSFORM_OVERRIDES = [ JrhReadPTransformOverride(), ] # type: List[PTransformOverride] # These overrides should be applied after the proto representation of the # graph is created. _NON_PORTABLE_PTRANSFORM_OVERRIDES = [ CreatePTransformOverride(), ReadPTransformOverride(), ] # type: List[PTransformOverride] def __init__(self, cache=None): # Cache of CloudWorkflowStep protos generated while the runner # "executes" a pipeline. self._cache = cache if cache is not None else PValueCache() self._unique_step_id = 0 def is_fnapi_compatible(self): return False def apply(self, transform, input, options): self._maybe_add_unified_worker_missing_options(options) return super(DataflowRunner, self).apply(transform, input, options) def _get_unique_step_name(self): self._unique_step_id += 1 return 's%s' % self._unique_step_id @staticmethod def poll_for_job_completion(runner, result, duration): """Polls for the specified job to finish running (successfully or not). Updates the result with the new job information before returning. Args: runner: DataflowRunner instance to use for polling job state. result: DataflowPipelineResult instance used for job information. duration (int): The time to wait (in milliseconds) for job to finish. If it is set to :data:`None`, it will wait indefinitely until the job is finished. """ last_message_time = None current_seen_messages = set() last_error_rank = float('-inf') last_error_msg = None last_job_state = None # How long to wait after pipeline failure for the error # message to show up giving the reason for the failure. # It typically takes about 30 seconds. final_countdown_timer_secs = 50.0 sleep_secs = 5.0 # Try to prioritize the user-level traceback, if any. def rank_error(msg): if 'work item was attempted' in msg: return -1 elif 'Traceback' in msg: return 1 return 0 if duration: start_secs = time.time() duration_secs = duration // 1000 job_id = result.job_id() while True: response = runner.dataflow_client.get_job(job_id) # If get() is called very soon after Create() the response may not contain # an initialized 'currentState' field. if response.currentState is not None: if response.currentState != last_job_state: _LOGGER.info('Job %s is in state %s', job_id, response.currentState) last_job_state = response.currentState if str(response.currentState) != 'JOB_STATE_RUNNING': # Stop checking for new messages on timeout, explanatory # message received, success, or a terminal job state caused # by the user that therefore doesn't require explanation. if (final_countdown_timer_secs <= 0.0 or last_error_msg is not None or str(response.currentState) == 'JOB_STATE_DONE' or str(response.currentState) == 'JOB_STATE_CANCELLED' or str(response.currentState) == 'JOB_STATE_UPDATED' or str(response.currentState) == 'JOB_STATE_DRAINED'): break # Check that job is in a post-preparation state before starting the # final countdown. if (str(response.currentState) not in ('JOB_STATE_PENDING', 'JOB_STATE_QUEUED')): # The job has failed; ensure we see any final error messages. sleep_secs = 1.0 # poll faster during the final countdown final_countdown_timer_secs -= sleep_secs time.sleep(sleep_secs) # Get all messages since beginning of the job run or since last message. page_token = None while True: messages, page_token = runner.dataflow_client.list_messages( job_id, page_token=page_token, start_time=last_message_time) for m in messages: message = '%s: %s: %s' % (m.time, m.messageImportance, m.messageText) if not last_message_time or m.time > last_message_time: last_message_time = m.time current_seen_messages = set() if message in current_seen_messages: # Skip the message if it has already been seen at the current # time. This could be the case since the list_messages API is # queried starting at last_message_time. continue else: current_seen_messages.add(message) # Skip empty messages. if m.messageImportance is None: continue _LOGGER.info(message) if str(m.messageImportance) == 'JOB_MESSAGE_ERROR': if rank_error(m.messageText) >= last_error_rank: last_error_rank = rank_error(m.messageText) last_error_msg = m.messageText if not page_token: break if duration: passed_secs = time.time() - start_secs if passed_secs > duration_secs: _LOGGER.warning( 'Timing out on waiting for job %s after %d seconds', job_id, passed_secs) break result._job = response runner.last_error_msg = last_error_msg @staticmethod def _only_element(iterable): # type: (Iterable[T]) -> T element, = iterable return element @staticmethod def group_by_key_input_visitor(): # Imported here to avoid circular dependencies. from apache_beam.pipeline import PipelineVisitor class GroupByKeyInputVisitor(PipelineVisitor): """A visitor that replaces `Any` element type for input `PCollection` of a `GroupByKey` or `_GroupByKeyOnly` with a `KV` type. TODO(BEAM-115): Once Python SDk is compatible with the new Runner API, we could directly replace the coder instead of mutating the element type. """ def enter_composite_transform(self, transform_node): self.visit_transform(transform_node) def visit_transform(self, transform_node): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.transforms.core import GroupByKey, _GroupByKeyOnly if isinstance(transform_node.transform, (GroupByKey, _GroupByKeyOnly)): pcoll = transform_node.inputs[0] pcoll.element_type = typehints.coerce_to_kv_type( pcoll.element_type, transform_node.full_label) key_type, value_type = pcoll.element_type.tuple_types if transform_node.outputs: key = DataflowRunner._only_element(transform_node.outputs.keys()) transform_node.outputs[key].element_type = typehints.KV[ key_type, typehints.Iterable[value_type]] return GroupByKeyInputVisitor() @staticmethod def _set_pdone_visitor(pipeline): # Imported here to avoid circular dependencies. from apache_beam.pipeline import PipelineVisitor class SetPDoneVisitor(PipelineVisitor): def __init__(self, pipeline): self._pipeline = pipeline @staticmethod def _maybe_fix_output(transform_node, pipeline): if not transform_node.outputs: pval = pvalue.PDone(pipeline) pval.producer = transform_node transform_node.outputs = {None: pval} def enter_composite_transform(self, transform_node): SetPDoneVisitor._maybe_fix_output(transform_node, self._pipeline) def visit_transform(self, transform_node): SetPDoneVisitor._maybe_fix_output(transform_node, self._pipeline) return SetPDoneVisitor(pipeline) @staticmethod def side_input_visitor(use_unified_worker=False): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.pipeline import PipelineVisitor from apache_beam.transforms.core import ParDo class SideInputVisitor(PipelineVisitor): """Ensures input `PCollection` used as a side inputs has a `KV` type. TODO(BEAM-115): Once Python SDK is compatible with the new Runner API, we could directly replace the coder instead of mutating the element type. """ def visit_transform(self, transform_node): if isinstance(transform_node.transform, ParDo): new_side_inputs = [] for ix, side_input in enumerate(transform_node.side_inputs): access_pattern = side_input._side_input_data().access_pattern if access_pattern == common_urns.side_inputs.ITERABLE.urn: if use_unified_worker: # TODO(BEAM-9173): Stop patching up the access pattern to # appease Dataflow when using the UW and hardcode the output # type to be Any since the Dataflow JSON and pipeline proto # can differ in coders which leads to encoding/decoding issues # within the runner. side_input.pvalue.element_type = typehints.Any new_side_input = _DataflowIterableSideInput(side_input) else: # Add a map to ('', value) as Dataflow currently only handles # keyed side inputs when using the JRH. pipeline = side_input.pvalue.pipeline new_side_input = _DataflowIterableAsMultimapSideInput( side_input) new_side_input.pvalue = beam.pvalue.PCollection( pipeline, element_type=typehints.KV[bytes, side_input.pvalue.element_type], is_bounded=side_input.pvalue.is_bounded) parent = transform_node.parent or pipeline._root_transform() map_to_void_key = beam.pipeline.AppliedPTransform( pipeline, beam.Map(lambda x: (b'', x)), transform_node.full_label + '/MapToVoidKey%s' % ix, (side_input.pvalue, )) new_side_input.pvalue.producer = map_to_void_key map_to_void_key.add_output(new_side_input.pvalue, None) parent.add_part(map_to_void_key) elif access_pattern == common_urns.side_inputs.MULTIMAP.urn: # Ensure the input coder is a KV coder and patch up the # access pattern to appease Dataflow. side_input.pvalue.element_type = typehints.coerce_to_kv_type( side_input.pvalue.element_type, transform_node.full_label) new_side_input = _DataflowMultimapSideInput(side_input) else: raise ValueError( 'Unsupported access pattern for %r: %r' % (transform_node.full_label, access_pattern)) new_side_inputs.append(new_side_input) transform_node.side_inputs = new_side_inputs transform_node.transform.side_inputs = new_side_inputs return SideInputVisitor() @staticmethod def flatten_input_visitor(): # Imported here to avoid circular dependencies. from apache_beam.pipeline import PipelineVisitor class FlattenInputVisitor(PipelineVisitor): """A visitor that replaces the element type for input ``PCollections``s of a ``Flatten`` transform with that of the output ``PCollection``. """ def visit_transform(self, transform_node): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam import Flatten if isinstance(transform_node.transform, Flatten): output_pcoll = DataflowRunner._only_element( transform_node.outputs.values()) for input_pcoll in transform_node.inputs: input_pcoll.element_type = output_pcoll.element_type return FlattenInputVisitor() def _check_for_unsupported_fnapi_features(self, pipeline_proto): components = pipeline_proto.components for windowing_strategy in components.windowing_strategies.values(): if (windowing_strategy.merge_status == beam_runner_api_pb2.MergeStatus.NEEDS_MERGE and windowing_strategy.window_fn.urn not in ( common_urns.session_windows.urn, )): raise RuntimeError( 'Unsupported merging windowing strategy: %s' % windowing_strategy.window_fn.urn) elif components.coders[ windowing_strategy.window_coder_id].spec.urn not in ( common_urns.coders.GLOBAL_WINDOW.urn, common_urns.coders.INTERVAL_WINDOW.urn): raise RuntimeError( 'Unsupported window coder %s for window fn %s' % ( components.coders[windowing_strategy.window_coder_id].spec.urn, windowing_strategy.window_fn.urn)) def run_pipeline(self, pipeline, options): """Remotely executes entire pipeline or parts reachable from node.""" # Label goog-dataflow-notebook if job is started from notebook. if is_in_notebook(): notebook_version = ( 'goog-dataflow-notebook=' + beam.version.__version__.replace('.', '_')) if options.view_as(GoogleCloudOptions).labels: options.view_as(GoogleCloudOptions).labels.append(notebook_version) else: options.view_as(GoogleCloudOptions).labels = [notebook_version] # Import here to avoid adding the dependency for local running scenarios. try: # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.runners.dataflow.internal import apiclient except ImportError: raise ImportError( 'Google Cloud Dataflow runner not available, ' 'please install apache_beam[gcp]') self._maybe_add_unified_worker_missing_options(options) # Convert all side inputs into a form acceptable to Dataflow. if apiclient._use_fnapi(options): pipeline.visit( self.side_input_visitor(apiclient._use_unified_worker(options))) # Performing configured PTransform overrides. Note that this is currently # done before Runner API serialization, since the new proto needs to contain # any added PTransforms. pipeline.replace_all(DataflowRunner._PTRANSFORM_OVERRIDES) if (apiclient._use_fnapi(options) and not apiclient._use_unified_worker(options)): pipeline.replace_all(DataflowRunner._JRH_PTRANSFORM_OVERRIDES) use_fnapi = apiclient._use_fnapi(options) from apache_beam.transforms import environments default_environment = environments.DockerEnvironment.from_container_image( apiclient.get_container_image_from_options(options)) # Snapshot the pipeline in a portable proto. self.proto_pipeline, self.proto_context = pipeline.to_runner_api( return_context=True, default_environment=default_environment) if use_fnapi: self._check_for_unsupported_fnapi_features(self.proto_pipeline) # Cross language transform require using a pipeline object constructed # from the full pipeline proto to make sure that expanded version of # external transforms are reflected in the Pipeline job graph. from apache_beam import Pipeline pipeline = Pipeline.from_runner_api( self.proto_pipeline, pipeline.runner, options, allow_proto_holders=True) # Pipelines generated from proto do not have output set to PDone set for # leaf elements. pipeline.visit(self._set_pdone_visitor(pipeline)) # We need to generate a new context that maps to the new pipeline object. self.proto_pipeline, self.proto_context = pipeline.to_runner_api( return_context=True, default_environment=default_environment) else: # Performing configured PTransform overrides which should not be reflected # in the proto representation of the graph. pipeline.replace_all(DataflowRunner._NON_PORTABLE_PTRANSFORM_OVERRIDES) # Add setup_options for all the BeamPlugin imports setup_options = options.view_as(SetupOptions) plugins = BeamPlugin.get_all_plugin_paths() if setup_options.beam_plugins is not None: plugins = list(set(plugins + setup_options.beam_plugins)) setup_options.beam_plugins = plugins # Elevate "min_cpu_platform" to pipeline option, but using the existing # experiment. debug_options = options.view_as(DebugOptions) worker_options = options.view_as(WorkerOptions) if worker_options.min_cpu_platform: debug_options.add_experiment( 'min_cpu_platform=' + worker_options.min_cpu_platform) # Elevate "enable_streaming_engine" to pipeline option, but using the # existing experiment. google_cloud_options = options.view_as(GoogleCloudOptions) if google_cloud_options.enable_streaming_engine: debug_options.add_experiment("enable_windmill_service") debug_options.add_experiment("enable_streaming_engine") else: if (debug_options.lookup_experiment("enable_windmill_service") or debug_options.lookup_experiment("enable_streaming_engine")): raise ValueError( """Streaming engine both disabled and enabled: enable_streaming_engine flag is not set, but enable_windmill_service and/or enable_streaming_engine experiments are present. It is recommended you only set the enable_streaming_engine flag.""") dataflow_worker_jar = getattr(worker_options, 'dataflow_worker_jar', None) if dataflow_worker_jar is not None: if not apiclient._use_fnapi(options): _LOGGER.warning( 'Typical end users should not use this worker jar feature. ' 'It can only be used when FnAPI is enabled.') else: debug_options.add_experiment('use_staged_dataflow_worker_jar') # Make Dataflow workers use FastAvro on Python 3 unless use_avro experiment # is set. Note that use_avro is only interpreted by the Dataflow runner # at job submission and is not interpreted by Dataflow service or workers, # which by default use avro library unless use_fastavro experiment is set. if sys.version_info[0] > 2 and ( not debug_options.lookup_experiment('use_avro')): debug_options.add_experiment('use_fastavro') self.job = apiclient.Job(options, self.proto_pipeline) # Dataflow runner requires a KV type for GBK inputs, hence we enforce that # here. pipeline.visit(self.group_by_key_input_visitor()) # Dataflow runner requires output type of the Flatten to be the same as the # inputs, hence we enforce that here. pipeline.visit(self.flatten_input_visitor()) # Trigger a traversal of all reachable nodes. self.visit_transforms(pipeline, options) test_options = options.view_as(TestOptions) # If it is a dry run, return without submitting the job. if test_options.dry_run: result = PipelineResult(PipelineState.DONE) result.wait_until_finish = lambda duration=None: None return result # Get a Dataflow API client and set its options self.dataflow_client = apiclient.DataflowApplicationClient(options) # Create the job description and send a request to the service. The result # can be None if there is no need to send a request to the service (e.g. # template creation). If a request was sent and failed then the call will # raise an exception. result = DataflowPipelineResult( self.dataflow_client.create_job(self.job), self) # TODO(BEAM-4274): Circular import runners-metrics. Requires refactoring. from apache_beam.runners.dataflow.dataflow_metrics import DataflowMetrics self._metrics = DataflowMetrics(self.dataflow_client, result, self.job) result.metric_results = self._metrics return result def _maybe_add_unified_worker_missing_options(self, options): # set default beam_fn_api and use_beam_bq_sink experiment if use unified # worker experiment flag exists, no-op otherwise. debug_options = options.view_as(DebugOptions) from apache_beam.runners.dataflow.internal import apiclient if apiclient._use_unified_worker(options): if not debug_options.lookup_experiment('beam_fn_api'): debug_options.add_experiment('beam_fn_api') if not debug_options.lookup_experiment('use_beam_bq_sink'): debug_options.add_experiment('use_beam_bq_sink') def _get_typehint_based_encoding(self, typehint, window_coder): """Returns an encoding based on a typehint object.""" return self._get_cloud_encoding( self._get_coder(typehint, window_coder=window_coder)) @staticmethod def _get_coder(typehint, window_coder): """Returns a coder based on a typehint object.""" if window_coder: return coders.WindowedValueCoder( coders.registry.get_coder(typehint), window_coder=window_coder) return coders.registry.get_coder(typehint) def _get_cloud_encoding(self, coder, unused=None): """Returns an encoding based on a coder object.""" if not isinstance(coder, coders.Coder): raise TypeError( 'Coder object must inherit from coders.Coder: %s.' % str(coder)) return coder.as_cloud_object(self.proto_context.coders) def _get_side_input_encoding(self, input_encoding): """Returns an encoding for the output of a view transform. Args: input_encoding: encoding of current transform's input. Side inputs need this because the service will check that input and output types match. Returns: An encoding that matches the output and input encoding. This is essential for the View transforms introduced to produce side inputs to a ParDo. """ return { '@type': 'kind:stream', 'component_encodings': [input_encoding], 'is_stream_like': { 'value': True }, } def _get_encoded_output_coder( self, transform_node, window_value=True, output_tag=None): """Returns the cloud encoding of the coder for the output of a transform.""" is_external_transform = isinstance( transform_node.transform, RunnerAPIPTransformHolder) if output_tag in transform_node.outputs: element_type = transform_node.outputs[output_tag].element_type elif len(transform_node.outputs) == 1: output_tag = DataflowRunner._only_element(transform_node.outputs.keys()) # TODO(robertwb): Handle type hints for multi-output transforms. element_type = transform_node.outputs[output_tag].element_type elif is_external_transform: raise ValueError( 'For external transforms, output_tag must be specified ' 'since we cannot fallback to a Python only coder.') else: # TODO(silviuc): Remove this branch (and assert) when typehints are # propagated everywhere. Returning an 'Any' as type hint will trigger # usage of the fallback coder (i.e., cPickler). element_type = typehints.Any if window_value: # All outputs have the same windowing. So getting the coder from an # arbitrary window is fine. output_tag = next(iter(transform_node.outputs.keys())) window_coder = ( transform_node.outputs[output_tag].windowing.windowfn. get_window_coder()) else: window_coder = None return self._get_typehint_based_encoding(element_type, window_coder) def _add_step(self, step_kind, step_label, transform_node, side_tags=()): """Creates a Step object and adds it to the cache.""" # Import here to avoid adding the dependency for local running scenarios. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.runners.dataflow.internal import apiclient step = apiclient.Step(step_kind, self._get_unique_step_name()) self.job.proto.steps.append(step.proto) step.add_property(PropertyNames.USER_NAME, step_label) # Cache the node/step association for the main output of the transform node. # Main output key of external transforms can be ambiguous, so we only tag if # there's only one tag instead of None. output_tag = ( DataflowRunner._only_element(transform_node.outputs.keys()) if len( transform_node.outputs.keys()) == 1 else None) self._cache.cache_output(transform_node, output_tag, step) # If side_tags is not () then this is a multi-output transform node and we # need to cache the (node, tag, step) for each of the tags used to access # the outputs. This is essential because the keys used to search in the # cache always contain the tag. for tag in side_tags: self._cache.cache_output(transform_node, tag, step) # Finally, we add the display data items to the pipeline step. # If the transform contains no display data then an empty list is added. step.add_property( PropertyNames.DISPLAY_DATA, [ item.get_dict() for item in DisplayData.create_from(transform_node.transform).items ]) return step def _add_singleton_step( self, label, full_label, tag, input_step, windowing_strategy, access_pattern): """Creates a CollectionToSingleton step used to handle ParDo side inputs.""" # Import here to avoid adding the dependency for local running scenarios. from apache_beam.runners.dataflow.internal import apiclient step = apiclient.Step(TransformNames.COLLECTION_TO_SINGLETON, label) self.job.proto.steps.append(step.proto) step.add_property(PropertyNames.USER_NAME, full_label) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(tag) }) step.encoding = self._get_side_input_encoding(input_step.encoding) output_info = { PropertyNames.USER_NAME: '%s.%s' % (full_label, PropertyNames.OUTPUT), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT } if common_urns.side_inputs.MULTIMAP.urn == access_pattern: output_info[PropertyNames.USE_INDEXED_FORMAT] = True step.add_property(PropertyNames.OUTPUT_INFO, [output_info]) step.add_property( PropertyNames.WINDOWING_STRATEGY, self.serialize_windowing_strategy(windowing_strategy)) return step def run_Impulse(self, transform_node, options): standard_options = options.view_as(StandardOptions) debug_options = options.view_as(DebugOptions) use_fn_api = ( debug_options.experiments and 'beam_fn_api' in debug_options.experiments) use_streaming_engine = ( debug_options.experiments and 'enable_streaming_engine' in debug_options.experiments and 'enable_windmill_service' in debug_options.experiments) step = self._add_step( TransformNames.READ, transform_node.full_label, transform_node) if (standard_options.streaming and (not use_fn_api or not use_streaming_engine)): step.add_property(PropertyNames.FORMAT, 'pubsub') step.add_property(PropertyNames.PUBSUB_SUBSCRIPTION, '_starting_signal/') else: step.add_property(PropertyNames.FORMAT, 'impulse') encoded_impulse_element = coders.WindowedValueCoder( coders.BytesCoder(), coders.coders.GlobalWindowCoder()).get_impl().encode_nested( window.GlobalWindows.windowed_value(b'')) if use_fn_api: encoded_impulse_as_str = self.byte_array_to_json_string( encoded_impulse_element) else: encoded_impulse_as_str = base64.b64encode( encoded_impulse_element).decode('ascii') step.add_property(PropertyNames.IMPULSE_ELEMENT, encoded_impulse_as_str) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) def run_Flatten(self, transform_node, options): step = self._add_step( TransformNames.FLATTEN, transform_node.full_label, transform_node) inputs = [] for one_input in transform_node.inputs: input_step = self._cache.get_pvalue(one_input) inputs.append({ '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(one_input.tag) }) step.add_property(PropertyNames.INPUTS, inputs) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) def apply_WriteToBigQuery(self, transform, pcoll, options): # Make sure this is the WriteToBigQuery class that we expected, and that # users did not specifically request the new BQ sink by passing experiment # flag. # TODO(BEAM-6928): Remove this function for release 2.14.0. experiments = options.view_as(DebugOptions).experiments or [] from apache_beam.runners.dataflow.internal import apiclient use_fnapi = apiclient._use_fnapi(options) if (not isinstance(transform, beam.io.WriteToBigQuery) or use_fnapi or 'use_beam_bq_sink' in experiments): return self.apply_PTransform(transform, pcoll, options) if transform.schema == beam.io.gcp.bigquery.SCHEMA_AUTODETECT: raise RuntimeError( 'Schema auto-detection is not supported on the native sink') standard_options = options.view_as(StandardOptions) if standard_options.streaming: if (transform.write_disposition == beam.io.BigQueryDisposition.WRITE_TRUNCATE): raise RuntimeError('Can not use write truncation mode in streaming') return self.apply_PTransform(transform, pcoll, options) else: from apache_beam.io.gcp.bigquery_tools import parse_table_schema_from_json schema = None if transform.schema: schema = parse_table_schema_from_json(json.dumps(transform.schema)) return pcoll | 'WriteToBigQuery' >> beam.io.Write( beam.io.BigQuerySink( transform.table_reference.tableId, transform.table_reference.datasetId, transform.table_reference.projectId, schema, transform.create_disposition, transform.write_disposition, kms_key=transform.kms_key)) def apply_GroupByKey(self, transform, pcoll, options): # Infer coder of parent. # # TODO(ccy): make Coder inference and checking less specialized and more # comprehensive. parent = pcoll.producer if parent: coder = parent.transform._infer_output_coder() # pylint: disable=protected-access if not coder: coder = self._get_coder(pcoll.element_type or typehints.Any, None) if not coder.is_kv_coder(): raise ValueError(( 'Coder for the GroupByKey operation "%s" is not a ' 'key-value coder: %s.') % (transform.label, coder)) # TODO(robertwb): Update the coder itself if it changed. coders.registry.verify_deterministic( coder.key_coder(), 'GroupByKey operation "%s"' % transform.label) return pvalue.PCollection.from_(pcoll) def run_GroupByKey(self, transform_node, options): input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) step = self._add_step( TransformNames.GROUP, transform_node.full_label, transform_node) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) windowing = transform_node.transform.get_windowing(transform_node.inputs) step.add_property( PropertyNames.SERIALIZED_FN, self.serialize_windowing_strategy(windowing)) def run_RunnerAPIPTransformHolder(self, transform_node, options): """Adding Dataflow runner job description for transform holder objects. These holder transform objects are generated for some of the transforms that become available after a cross-language transform expansion, usually if the corresponding transform object cannot be generated in Python SDK (for example, a python `ParDo` transform cannot be generated without a serialized Python `DoFn` object). """ urn = transform_node.transform.proto().urn assert urn # TODO(chamikara): support other transforms that requires holder objects in # Python SDk. if common_urns.primitives.PAR_DO.urn == urn: self.run_ParDo(transform_node, options) else: raise NotImplementedError( '%s uses unsupported URN: %s' % (transform_node.full_label, urn)) def run_ParDo(self, transform_node, options): transform = transform_node.transform input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) is_external_transform = isinstance(transform, RunnerAPIPTransformHolder) # Attach side inputs. si_dict = {} all_input_labels = transform_node.input_tags_to_preserve si_labels = {} full_label_counts = defaultdict(int) lookup_label = lambda side_pval: si_labels[side_pval] named_inputs = transform_node.named_inputs() label_renames = {} for ix, side_pval in enumerate(transform_node.side_inputs): assert isinstance(side_pval, AsSideInput) step_name = 'SideInput-' + self._get_unique_step_name() si_label = ((SIDE_INPUT_PREFIX + '%d-%s') % (ix, transform_node.full_label) if side_pval.pvalue not in all_input_labels else all_input_labels[side_pval.pvalue]) old_label = (SIDE_INPUT_PREFIX + '%d') % ix if not is_external_transform: label_renames[old_label] = si_label assert old_label in named_inputs pcollection_label = '%s.%s' % ( side_pval.pvalue.producer.full_label.split('/')[-1], side_pval.pvalue.tag if side_pval.pvalue.tag else 'out') si_full_label = '%s/%s(%s.%s)' % ( transform_node.full_label, side_pval.__class__.__name__, pcollection_label, full_label_counts[pcollection_label]) # Count the number of times the same PCollection is a side input # to the same ParDo. full_label_counts[pcollection_label] += 1 self._add_singleton_step( step_name, si_full_label, side_pval.pvalue.tag, self._cache.get_pvalue(side_pval.pvalue), side_pval.pvalue.windowing, side_pval._side_input_data().access_pattern) si_dict[si_label] = { '@type': 'OutputReference', PropertyNames.STEP_NAME: step_name, PropertyNames.OUTPUT_NAME: PropertyNames.OUT } si_labels[side_pval] = si_label # Now create the step for the ParDo transform being handled. transform_name = transform_node.full_label.rsplit('/', 1)[-1] step = self._add_step( TransformNames.DO, transform_node.full_label + ('/{}'.format(transform_name) if transform_node.side_inputs else ''), transform_node, transform_node.transform.output_tags) # Import here to avoid adding the dependency for local running scenarios. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.runners.dataflow.internal import apiclient transform_proto = self.proto_context.transforms.get_proto(transform_node) transform_id = self.proto_context.transforms.get_id(transform_node) use_fnapi = apiclient._use_fnapi(options) use_unified_worker = apiclient._use_unified_worker(options) # The data transmitted in SERIALIZED_FN is different depending on whether # this is a fnapi pipeline or not. if (use_fnapi and (transform_proto.spec.urn == common_urns.primitives.PAR_DO.urn or use_unified_worker)): # Patch side input ids to be unique across a given pipeline. if (label_renames and transform_proto.spec.urn == common_urns.primitives.PAR_DO.urn): # Patch PTransform proto. for old, new in iteritems(label_renames): transform_proto.inputs[new] = transform_proto.inputs[old] del transform_proto.inputs[old] # Patch ParDo proto. proto_type, _ = beam.PTransform._known_urns[transform_proto.spec.urn] proto = proto_utils.parse_Bytes( transform_proto.spec.payload, proto_type) for old, new in iteritems(label_renames): proto.side_inputs[new].CopyFrom(proto.side_inputs[old]) del proto.side_inputs[old] transform_proto.spec.payload = proto.SerializeToString() # We need to update the pipeline proto. del self.proto_pipeline.components.transforms[transform_id] ( self.proto_pipeline.components.transforms[transform_id].CopyFrom( transform_proto)) serialized_data = transform_id else: serialized_data = pickler.dumps( self._pardo_fn_data(transform_node, lookup_label)) step.add_property(PropertyNames.SERIALIZED_FN, serialized_data) # TODO(BEAM-8882): Enable once dataflow service doesn't reject this. # step.add_property(PropertyNames.PIPELINE_PROTO_TRANSFORM_ID, transform_id) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) # Add side inputs if any. step.add_property(PropertyNames.NON_PARALLEL_INPUTS, si_dict) # Generate description for the outputs. The output names # will be 'None' for main output and '<tag>' for a tagged output. outputs = [] all_output_tags = transform_proto.outputs.keys() # Some external transforms require output tags to not be modified. # So we randomly select one of the output tags as the main output and # leave others as side outputs. Transform execution should not change # dependending on which output tag we choose as the main output here. # Also, some SDKs do not work correctly if output tags are modified. So for # external transforms, we leave tags unmodified. # # Python SDK uses 'None' as the tag of the main output. main_output_tag = (all_output_tags[0] if is_external_transform else 'None') step.encoding = self._get_encoded_output_coder( transform_node, output_tag=main_output_tag) side_output_tags = set(all_output_tags).difference({main_output_tag}) # Add the main output to the description. outputs.append({ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: main_output_tag }) for side_tag in side_output_tags: # The assumption here is that all outputs will have the same typehint # and coder as the main output. This is certainly the case right now # but conceivably it could change in the future. encoding = self._get_encoded_output_coder( transform_node, output_tag=side_tag) outputs.append({ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, side_tag)), PropertyNames.ENCODING: encoding, PropertyNames.OUTPUT_NAME: side_tag }) step.add_property(PropertyNames.OUTPUT_INFO, outputs) # Add the restriction encoding if we are a splittable DoFn # and are using the Fn API on the unified worker. restriction_coder = transform.get_restriction_coder() if restriction_coder: step.add_property( PropertyNames.RESTRICTION_ENCODING, self._get_cloud_encoding(restriction_coder)) if options.view_as(StandardOptions).streaming: is_stateful_dofn = ( transform.is_pardo_with_stateful_dofn if is_external_transform else DoFnSignature(transform.dofn).is_stateful_dofn()) if is_stateful_dofn: step.add_property(PropertyNames.USES_KEYED_STATE, 'true') @staticmethod def _pardo_fn_data(transform_node, get_label): transform = transform_node.transform si_tags_and_types = [ # pylint: disable=protected-access (get_label(side_pval), side_pval.__class__, side_pval._view_options()) for side_pval in transform_node.side_inputs] return ( transform.fn, transform.args, transform.kwargs, si_tags_and_types, transform_node.inputs[0].windowing) def run_CombineValuesReplacement(self, transform_node, options): transform = transform_node.transform.transform input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) step = self._add_step( TransformNames.COMBINE, transform_node.full_label, transform_node) transform_id = self.proto_context.transforms.get_id(transform_node.parent) # The data transmitted in SERIALIZED_FN is different depending on whether # this is a fnapi pipeline or not. from apache_beam.runners.dataflow.internal import apiclient use_fnapi = apiclient._use_fnapi(options) if use_fnapi: # Fnapi pipelines send the transform ID of the CombineValues transform's # parent composite because Dataflow expects the ID of a CombinePerKey # transform. serialized_data = transform_id else: # Combiner functions do not take deferred side-inputs (i.e. PValues) and # therefore the code to handle extra args/kwargs is simpler than for the # DoFn's of the ParDo transform. In the last, empty argument is where # side inputs information would go. serialized_data = pickler.dumps( (transform.fn, transform.args, transform.kwargs, ())) step.add_property(PropertyNames.SERIALIZED_FN, serialized_data) # TODO(BEAM-8882): Enable once dataflow service doesn't reject this. # step.add_property(PropertyNames.PIPELINE_PROTO_TRANSFORM_ID, transform_id) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) # Note that the accumulator must not have a WindowedValue encoding, while # the output of this step does in fact have a WindowedValue encoding. accumulator_encoding = self._get_cloud_encoding( transform.fn.get_accumulator_coder()) output_encoding = self._get_encoded_output_coder(transform_node) step.encoding = output_encoding step.add_property(PropertyNames.ENCODING, accumulator_encoding) # Generate description for main output 'out.' outputs = [] # Add the main output to the description. outputs.append({ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }) step.add_property(PropertyNames.OUTPUT_INFO, outputs) def apply_Read(self, transform, pbegin, options): if hasattr(transform.source, 'format'): # Consider native Read to be a primitive for dataflow. return beam.pvalue.PCollection.from_(pbegin) else: return self.apply_PTransform(transform, pbegin, options) def run_Read(self, transform_node, options): transform = transform_node.transform step = self._add_step( TransformNames.READ, transform_node.full_label, transform_node) # TODO(mairbek): refactor if-else tree to use registerable functions. # Initialize the source specific properties. standard_options = options.view_as(StandardOptions) if not hasattr(transform.source, 'format'): # If a format is not set, we assume the source to be a custom source. source_dict = {} source_dict['spec'] = { '@type': names.SOURCE_TYPE, names.SERIALIZED_SOURCE_KEY: pickler.dumps(transform.source) } try: source_dict['metadata'] = { 'estimated_size_bytes': json_value.get_typed_value_descriptor( transform.source.estimate_size()) } except error.RuntimeValueProviderError: # Size estimation is best effort, and this error is by value provider. _LOGGER.info( 'Could not estimate size of source %r due to ' + \ 'RuntimeValueProviderError', transform.source) except Exception: # pylint: disable=broad-except # Size estimation is best effort. So we log the error and continue. _LOGGER.info( 'Could not estimate size of source %r due to an exception: %s', transform.source, traceback.format_exc()) step.add_property(PropertyNames.SOURCE_STEP_INPUT, source_dict) elif transform.source.format == 'text': step.add_property(PropertyNames.FILE_PATTERN, transform.source.path) elif transform.source.format == 'bigquery': if standard_options.streaming: raise ValueError( 'BigQuery source is not currently available for use ' 'in streaming pipelines.') debug_options = options.view_as(DebugOptions) use_fn_api = ( debug_options.experiments and 'beam_fn_api' in debug_options.experiments) if use_fn_api: raise ValueError(BQ_SOURCE_UW_ERROR) step.add_property(PropertyNames.BIGQUERY_EXPORT_FORMAT, 'FORMAT_AVRO') # TODO(silviuc): Add table validation if transform.source.validate. if transform.source.table_reference is not None: step.add_property( PropertyNames.BIGQUERY_DATASET, transform.source.table_reference.datasetId) step.add_property( PropertyNames.BIGQUERY_TABLE, transform.source.table_reference.tableId) # If project owning the table was not specified then the project owning # the workflow (current project) will be used. if transform.source.table_reference.projectId is not None: step.add_property( PropertyNames.BIGQUERY_PROJECT, transform.source.table_reference.projectId) elif transform.source.query is not None: step.add_property(PropertyNames.BIGQUERY_QUERY, transform.source.query) step.add_property( PropertyNames.BIGQUERY_USE_LEGACY_SQL, transform.source.use_legacy_sql) step.add_property( PropertyNames.BIGQUERY_FLATTEN_RESULTS, transform.source.flatten_results) else: raise ValueError( 'BigQuery source %r must specify either a table or' ' a query' % transform.source) if transform.source.kms_key is not None: step.add_property( PropertyNames.BIGQUERY_KMS_KEY, transform.source.kms_key) elif transform.source.format == 'pubsub': if not standard_options.streaming: raise ValueError( 'Cloud Pub/Sub is currently available for use ' 'only in streaming pipelines.') # Only one of topic or subscription should be set. if transform.source.full_subscription: step.add_property( PropertyNames.PUBSUB_SUBSCRIPTION, transform.source.full_subscription) elif transform.source.full_topic: step.add_property( PropertyNames.PUBSUB_TOPIC, transform.source.full_topic) if transform.source.id_label: step.add_property( PropertyNames.PUBSUB_ID_LABEL, transform.source.id_label) if transform.source.with_attributes: # Setting this property signals Dataflow runner to return full # PubsubMessages instead of just the data part of the payload. step.add_property(PropertyNames.PUBSUB_SERIALIZED_ATTRIBUTES_FN, '') if transform.source.timestamp_attribute is not None: step.add_property( PropertyNames.PUBSUB_TIMESTAMP_ATTRIBUTE, transform.source.timestamp_attribute) else: raise ValueError( 'Source %r has unexpected format %s.' % (transform.source, transform.source.format)) if not hasattr(transform.source, 'format'): step.add_property(PropertyNames.FORMAT, names.SOURCE_FORMAT) else: step.add_property(PropertyNames.FORMAT, transform.source.format) # Wrap coder in WindowedValueCoder: this is necessary as the encoding of a # step should be the type of value outputted by each step. Read steps # automatically wrap output values in a WindowedValue wrapper, if necessary. # This is also necessary for proper encoding for size estimation. # Using a GlobalWindowCoder as a place holder instead of the default # PickleCoder because GlobalWindowCoder is known coder. # TODO(robertwb): Query the collection for the windowfn to extract the # correct coder. coder = coders.WindowedValueCoder( coders.registry.get_coder(transform_node.outputs[None].element_type), coders.coders.GlobalWindowCoder()) step.encoding = self._get_cloud_encoding(coder) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) def run__NativeWrite(self, transform_node, options): transform = transform_node.transform input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) step = self._add_step( TransformNames.WRITE, transform_node.full_label, transform_node) # TODO(mairbek): refactor if-else tree to use registerable functions. # Initialize the sink specific properties. if transform.sink.format == 'text': # Note that it is important to use typed properties (@type/value dicts) # for non-string properties and also for empty strings. For example, # in the code below the num_shards must have type and also # file_name_suffix and shard_name_template (could be empty strings). step.add_property( PropertyNames.FILE_NAME_PREFIX, transform.sink.file_name_prefix, with_type=True) step.add_property( PropertyNames.FILE_NAME_SUFFIX, transform.sink.file_name_suffix, with_type=True) step.add_property( PropertyNames.SHARD_NAME_TEMPLATE, transform.sink.shard_name_template, with_type=True) if transform.sink.num_shards > 0: step.add_property( PropertyNames.NUM_SHARDS, transform.sink.num_shards, with_type=True) # TODO(silviuc): Implement sink validation. step.add_property(PropertyNames.VALIDATE_SINK, False, with_type=True) elif transform.sink.format == 'bigquery': # TODO(silviuc): Add table validation if transform.sink.validate. step.add_property( PropertyNames.BIGQUERY_DATASET, transform.sink.table_reference.datasetId) step.add_property( PropertyNames.BIGQUERY_TABLE, transform.sink.table_reference.tableId) # If project owning the table was not specified then the project owning # the workflow (current project) will be used. if transform.sink.table_reference.projectId is not None: step.add_property( PropertyNames.BIGQUERY_PROJECT, transform.sink.table_reference.projectId) step.add_property( PropertyNames.BIGQUERY_CREATE_DISPOSITION, transform.sink.create_disposition) step.add_property( PropertyNames.BIGQUERY_WRITE_DISPOSITION, transform.sink.write_disposition) if transform.sink.table_schema is not None: step.add_property( PropertyNames.BIGQUERY_SCHEMA, transform.sink.schema_as_json()) if transform.sink.kms_key is not None: step.add_property( PropertyNames.BIGQUERY_KMS_KEY, transform.sink.kms_key) elif transform.sink.format == 'pubsub': standard_options = options.view_as(StandardOptions) if not standard_options.streaming: raise ValueError( 'Cloud Pub/Sub is currently available for use ' 'only in streaming pipelines.') step.add_property(PropertyNames.PUBSUB_TOPIC, transform.sink.full_topic) if transform.sink.id_label: step.add_property( PropertyNames.PUBSUB_ID_LABEL, transform.sink.id_label) if transform.sink.with_attributes: # Setting this property signals Dataflow runner that the PCollection # contains PubsubMessage objects instead of just raw data. step.add_property(PropertyNames.PUBSUB_SERIALIZED_ATTRIBUTES_FN, '') if transform.sink.timestamp_attribute is not None: step.add_property( PropertyNames.PUBSUB_TIMESTAMP_ATTRIBUTE, transform.sink.timestamp_attribute) else: raise ValueError( 'Sink %r has unexpected format %s.' % (transform.sink, transform.sink.format)) step.add_property(PropertyNames.FORMAT, transform.sink.format) # Wrap coder in WindowedValueCoder: this is necessary for proper encoding # for size estimation. Using a GlobalWindowCoder as a place holder instead # of the default PickleCoder because GlobalWindowCoder is known coder. # TODO(robertwb): Query the collection for the windowfn to extract the # correct coder. coder = coders.WindowedValueCoder( transform.sink.coder, coders.coders.GlobalWindowCoder()) step.encoding = self._get_cloud_encoding(coder) step.add_property(PropertyNames.ENCODING, step.encoding) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) def run_TestStream(self, transform_node, options): from apache_beam.testing.test_stream import ElementEvent from apache_beam.testing.test_stream import ProcessingTimeEvent from apache_beam.testing.test_stream import WatermarkEvent standard_options = options.view_as(StandardOptions) if not standard_options.streaming: raise ValueError( 'TestStream is currently available for use ' 'only in streaming pipelines.') transform = transform_node.transform step = self._add_step( TransformNames.READ, transform_node.full_label, transform_node) step.add_property(PropertyNames.FORMAT, 'test_stream') test_stream_payload = beam_runner_api_pb2.TestStreamPayload() # TestStream source doesn't do any decoding of elements, # so we won't set test_stream_payload.coder_id. output_coder = transform._infer_output_coder() # pylint: disable=protected-access for event in transform._events: new_event = test_stream_payload.events.add() if isinstance(event, ElementEvent): for tv in event.timestamped_values: element = new_event.element_event.elements.add() element.encoded_element = output_coder.encode(tv.value) element.timestamp = tv.timestamp.micros elif isinstance(event, ProcessingTimeEvent): new_event.processing_time_event.advance_duration = ( event.advance_by.micros) elif isinstance(event, WatermarkEvent): new_event.watermark_event.new_watermark = event.new_watermark.micros serialized_payload = self.byte_array_to_json_string( test_stream_payload.SerializeToString()) step.add_property(PropertyNames.SERIALIZED_TEST_STREAM, serialized_payload) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) # We must mark this method as not a test or else its name is a matcher for # nosetest tests. run_TestStream.__test__ = False # type: ignore[attr-defined] @classmethod def serialize_windowing_strategy(cls, windowing): from apache_beam.runners import pipeline_context context = pipeline_context.PipelineContext() windowing_proto = windowing.to_runner_api(context) return cls.byte_array_to_json_string( beam_runner_api_pb2.MessageWithComponents( components=context.to_runner_api(), windowing_strategy=windowing_proto).SerializeToString()) @classmethod def deserialize_windowing_strategy(cls, serialized_data): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.runners import pipeline_context from apache_beam.transforms.core import Windowing proto = beam_runner_api_pb2.MessageWithComponents() proto.ParseFromString(cls.json_string_to_byte_array(serialized_data)) return Windowing.from_runner_api( proto.windowing_strategy, pipeline_context.PipelineContext(proto.components)) @staticmethod def byte_array_to_json_string(raw_bytes): """Implements org.apache.beam.sdk.util.StringUtils.byteArrayToJsonString.""" return quote(raw_bytes) @staticmethod def json_string_to_byte_array(encoded_string): """Implements org.apache.beam.sdk.util.StringUtils.jsonStringToByteArray.""" return unquote_to_bytes(encoded_string) def get_default_gcp_region(self): """Get a default value for Google Cloud region according to https://cloud.google.com/compute/docs/gcloud-compute/#default-properties. If no default can be found, returns None. """ environment_region = os.environ.get('CLOUDSDK_COMPUTE_REGION') if environment_region: _LOGGER.info( 'Using default GCP region %s from $CLOUDSDK_COMPUTE_REGION', environment_region) return environment_region try: cmd = ['gcloud', 'config', 'get-value', 'compute/region'] # Use subprocess.DEVNULL in Python 3.3+. if hasattr(subprocess, 'DEVNULL'): DEVNULL = subprocess.DEVNULL else: DEVNULL = open(os.devnull, 'ab') raw_output = processes.check_output(cmd, stderr=DEVNULL) formatted_output = raw_output.decode('utf-8').strip() if formatted_output: _LOGGER.info( 'Using default GCP region %s from `%s`', formatted_output, ' '.join(cmd)) return formatted_output except RuntimeError: pass return None class _DataflowSideInput(beam.pvalue.AsSideInput): """Wraps a side input as a dataflow-compatible side input.""" def _view_options(self): return { 'data': self._data, } def _side_input_data(self): return self._data class _DataflowIterableAsMultimapSideInput(_DataflowSideInput): """Wraps an iterable side input as dataflow-compatible side input.""" def __init__(self, side_input): # pylint: disable=protected-access side_input_data = side_input._side_input_data() assert ( side_input_data.access_pattern == common_urns.side_inputs.ITERABLE.urn) iterable_view_fn = side_input_data.view_fn self._data = beam.pvalue.SideInputData( common_urns.side_inputs.MULTIMAP.urn, side_input_data.window_mapping_fn, lambda multimap: iterable_view_fn(multimap[b''])) class _DataflowIterableSideInput(_DataflowSideInput): """Wraps an iterable side input as dataflow-compatible side input.""" def __init__(self, side_input): # pylint: disable=protected-access self.pvalue = side_input.pvalue side_input_data = side_input._side_input_data() assert ( side_input_data.access_pattern == common_urns.side_inputs.ITERABLE.urn) self._data = beam.pvalue.SideInputData( common_urns.side_inputs.ITERABLE.urn, side_input_data.window_mapping_fn, side_input_data.view_fn) class _DataflowMultimapSideInput(_DataflowSideInput): """Wraps a multimap side input as dataflow-compatible side input.""" def __init__(self, side_input): # pylint: disable=protected-access self.pvalue = side_input.pvalue side_input_data = side_input._side_input_data() assert ( side_input_data.access_pattern == common_urns.side_inputs.MULTIMAP.urn) self._data = beam.pvalue.SideInputData( common_urns.side_inputs.MULTIMAP.urn, side_input_data.window_mapping_fn, side_input_data.view_fn) class DataflowPipelineResult(PipelineResult): """Represents the state of a pipeline run on the Dataflow service.""" def __init__(self, job, runner): """Initialize a new DataflowPipelineResult instance. Args: job: Job message from the Dataflow API. Could be :data:`None` if a job request was not sent to Dataflow service (e.g. template jobs). runner: DataflowRunner instance. """ self._job = job self._runner = runner self.metric_results = None def _update_job(self): # We need the job id to be able to update job information. There is no need # to update the job if we are in a known terminal state. if self.has_job and not self.is_in_terminal_state(): self._job = self._runner.dataflow_client.get_job(self.job_id()) def job_id(self): return self._job.id def metrics(self): return self.metric_results @property def has_job(self): return self._job is not None def _get_job_state(self): values_enum = dataflow_api.Job.CurrentStateValueValuesEnum # Ordered by the enum values. Values that may be introduced in # future versions of Dataflow API are considered UNRECOGNIZED by the SDK. api_jobstate_map = defaultdict( lambda: PipelineState.UNRECOGNIZED, { values_enum.JOB_STATE_UNKNOWN: PipelineState.UNKNOWN, values_enum.JOB_STATE_STOPPED: PipelineState.STOPPED, values_enum.JOB_STATE_RUNNING: PipelineState.RUNNING, values_enum.JOB_STATE_DONE: PipelineState.DONE, values_enum.JOB_STATE_FAILED: PipelineState.FAILED, values_enum.JOB_STATE_CANCELLED: PipelineState.CANCELLED, values_enum.JOB_STATE_UPDATED: PipelineState.UPDATED, values_enum.JOB_STATE_DRAINING: PipelineState.DRAINING, values_enum.JOB_STATE_DRAINED: PipelineState.DRAINED, values_enum.JOB_STATE_PENDING: PipelineState.PENDING, values_enum.JOB_STATE_CANCELLING: PipelineState.CANCELLING, }) return ( api_jobstate_map[self._job.currentState] if self._job.currentState else PipelineState.UNKNOWN) @property def state(self): """Return the current state of the remote job. Returns: A PipelineState object. """ if not self.has_job: return PipelineState.UNKNOWN self._update_job() return self._get_job_state() def is_in_terminal_state(self): if not self.has_job: return True return PipelineState.is_terminal(self._get_job_state()) def wait_until_finish(self, duration=None): if not self.is_in_terminal_state(): if not self.has_job: raise IOError('Failed to get the Dataflow job id.') thread = threading.Thread( target=DataflowRunner.poll_for_job_completion, args=(self._runner, self, duration)) # Mark the thread as a daemon thread so a keyboard interrupt on the main # thread will terminate everything. This is also the reason we will not # use thread.join() to wait for the polling thread. thread.daemon = True thread.start() while thread.is_alive(): time.sleep(5.0) # TODO: Merge the termination code in poll_for_job_completion and # is_in_terminal_state. terminated = self.is_in_terminal_state() assert duration or terminated, ( 'Job did not reach to a terminal state after waiting indefinitely.') if terminated and self.state != PipelineState.DONE: # TODO(BEAM-1290): Consider converting this to an error log based on # theresolution of the issue. raise DataflowRuntimeException( 'Dataflow pipeline failed. State: %s, Error:\n%s' % (self.state, getattr(self._runner, 'last_error_msg', None)), self) return self.state def cancel(self): if not self.has_job: raise IOError('Failed to get the Dataflow job id.') self._update_job() if self.is_in_terminal_state(): _LOGGER.warning( 'Cancel failed because job %s is already terminated in state %s.', self.job_id(), self.state) else: if not self._runner.dataflow_client.modify_job_state( self.job_id(), 'JOB_STATE_CANCELLED'): cancel_failed_message = ( 'Failed to cancel job %s, please go to the Developers Console to ' 'cancel it manually.') % self.job_id() _LOGGER.error(cancel_failed_message) raise DataflowRuntimeException(cancel_failed_message, self) return self.state def __str__(self): return '<%s %s %s>' % (self.__class__.__name__, self.job_id(), self.state) def __repr__(self): return '<%s %s at %s>' % (self.__class__.__name__, self._job, hex(id(self))) class DataflowRuntimeException(Exception): """Indicates an error has occurred in running this pipeline.""" def __init__(self, msg, result): super(DataflowRuntimeException, self).__init__(msg) self.result = result
42.691622
95
0.708281
from __future__ import absolute_import from __future__ import division import base64 import json import logging import os import subprocess import sys import threading import time import traceback import urllib from builtins import hex from collections import defaultdict from typing import TYPE_CHECKING from typing import List from future.utils import iteritems import apache_beam as beam from apache_beam import coders from apache_beam import error from apache_beam import pvalue from apache_beam.internal import pickler from apache_beam.internal.gcp import json_value from apache_beam.options.pipeline_options import DebugOptions from apache_beam.options.pipeline_options import GoogleCloudOptions from apache_beam.options.pipeline_options import SetupOptions from apache_beam.options.pipeline_options import StandardOptions from apache_beam.options.pipeline_options import TestOptions from apache_beam.options.pipeline_options import WorkerOptions from apache_beam.portability import common_urns from apache_beam.portability.api import beam_runner_api_pb2 from apache_beam.pvalue import AsSideInput from apache_beam.runners.common import DoFnSignature from apache_beam.runners.dataflow.internal import names from apache_beam.runners.dataflow.internal.clients import dataflow as dataflow_api from apache_beam.runners.dataflow.internal.names import PropertyNames from apache_beam.runners.dataflow.internal.names import TransformNames from apache_beam.runners.runner import PipelineResult from apache_beam.runners.runner import PipelineRunner from apache_beam.runners.runner import PipelineState from apache_beam.runners.runner import PValueCache from apache_beam.transforms import window from apache_beam.transforms.core import RunnerAPIPTransformHolder from apache_beam.transforms.display import DisplayData from apache_beam.transforms.sideinputs import SIDE_INPUT_PREFIX from apache_beam.typehints import typehints from apache_beam.utils import processes from apache_beam.utils import proto_utils from apache_beam.utils.interactive_utils import is_in_notebook from apache_beam.utils.plugin import BeamPlugin if TYPE_CHECKING: from apache_beam.pipeline import PTransformOverride if sys.version_info[0] > 2: unquote_to_bytes = urllib.parse.unquote_to_bytes quote = urllib.parse.quote else: unquote_to_bytes = urllib.unquote quote = urllib.quote __all__ = ['DataflowRunner'] _LOGGER = logging.getLogger(__name__) BQ_SOURCE_UW_ERROR = ( 'The Read(BigQuerySource(...)) transform is not supported with newer stack ' 'features (Fn API, Dataflow Runner V2, etc). Please use the transform ' 'apache_beam.io.gcp.bigquery.ReadFromBigQuery instead.') class DataflowRunner(PipelineRunner): from apache_beam.runners.dataflow.ptransform_overrides import CombineValuesPTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import CreatePTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import ReadPTransformOverride from apache_beam.runners.dataflow.ptransform_overrides import JrhReadPTransformOverride _PTRANSFORM_OVERRIDES = [ CombineValuesPTransformOverride() ] _JRH_PTRANSFORM_OVERRIDES = [ JrhReadPTransformOverride(), ] _NON_PORTABLE_PTRANSFORM_OVERRIDES = [ CreatePTransformOverride(), ReadPTransformOverride(), ] def __init__(self, cache=None): self._cache = cache if cache is not None else PValueCache() self._unique_step_id = 0 def is_fnapi_compatible(self): return False def apply(self, transform, input, options): self._maybe_add_unified_worker_missing_options(options) return super(DataflowRunner, self).apply(transform, input, options) def _get_unique_step_name(self): self._unique_step_id += 1 return 's%s' % self._unique_step_id @staticmethod def poll_for_job_completion(runner, result, duration): last_message_time = None current_seen_messages = set() last_error_rank = float('-inf') last_error_msg = None last_job_state = None final_countdown_timer_secs = 50.0 sleep_secs = 5.0 def rank_error(msg): if 'work item was attempted' in msg: return -1 elif 'Traceback' in msg: return 1 return 0 if duration: start_secs = time.time() duration_secs = duration // 1000 job_id = result.job_id() while True: response = runner.dataflow_client.get_job(job_id) if response.currentState is not None: if response.currentState != last_job_state: _LOGGER.info('Job %s is in state %s', job_id, response.currentState) last_job_state = response.currentState if str(response.currentState) != 'JOB_STATE_RUNNING': if (final_countdown_timer_secs <= 0.0 or last_error_msg is not None or str(response.currentState) == 'JOB_STATE_DONE' or str(response.currentState) == 'JOB_STATE_CANCELLED' or str(response.currentState) == 'JOB_STATE_UPDATED' or str(response.currentState) == 'JOB_STATE_DRAINED'): break # Check that job is in a post-preparation state before starting the # final countdown. if (str(response.currentState) not in ('JOB_STATE_PENDING', 'JOB_STATE_QUEUED')): # The job has failed; ensure we see any final error messages. sleep_secs = 1.0 # poll faster during the final countdown final_countdown_timer_secs -= sleep_secs time.sleep(sleep_secs) # Get all messages since beginning of the job run or since last message. page_token = None while True: messages, page_token = runner.dataflow_client.list_messages( job_id, page_token=page_token, start_time=last_message_time) for m in messages: message = '%s: %s: %s' % (m.time, m.messageImportance, m.messageText) if not last_message_time or m.time > last_message_time: last_message_time = m.time current_seen_messages = set() if message in current_seen_messages: # Skip the message if it has already been seen at the current # time. This could be the case since the list_messages API is # queried starting at last_message_time. continue else: current_seen_messages.add(message) # Skip empty messages. if m.messageImportance is None: continue _LOGGER.info(message) if str(m.messageImportance) == 'JOB_MESSAGE_ERROR': if rank_error(m.messageText) >= last_error_rank: last_error_rank = rank_error(m.messageText) last_error_msg = m.messageText if not page_token: break if duration: passed_secs = time.time() - start_secs if passed_secs > duration_secs: _LOGGER.warning( 'Timing out on waiting for job %s after %d seconds', job_id, passed_secs) break result._job = response runner.last_error_msg = last_error_msg @staticmethod def _only_element(iterable): # type: (Iterable[T]) -> T element, = iterable return element @staticmethod def group_by_key_input_visitor(): # Imported here to avoid circular dependencies. from apache_beam.pipeline import PipelineVisitor class GroupByKeyInputVisitor(PipelineVisitor): def enter_composite_transform(self, transform_node): self.visit_transform(transform_node) def visit_transform(self, transform_node): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.transforms.core import GroupByKey, _GroupByKeyOnly if isinstance(transform_node.transform, (GroupByKey, _GroupByKeyOnly)): pcoll = transform_node.inputs[0] pcoll.element_type = typehints.coerce_to_kv_type( pcoll.element_type, transform_node.full_label) key_type, value_type = pcoll.element_type.tuple_types if transform_node.outputs: key = DataflowRunner._only_element(transform_node.outputs.keys()) transform_node.outputs[key].element_type = typehints.KV[ key_type, typehints.Iterable[value_type]] return GroupByKeyInputVisitor() @staticmethod def _set_pdone_visitor(pipeline): # Imported here to avoid circular dependencies. from apache_beam.pipeline import PipelineVisitor class SetPDoneVisitor(PipelineVisitor): def __init__(self, pipeline): self._pipeline = pipeline @staticmethod def _maybe_fix_output(transform_node, pipeline): if not transform_node.outputs: pval = pvalue.PDone(pipeline) pval.producer = transform_node transform_node.outputs = {None: pval} def enter_composite_transform(self, transform_node): SetPDoneVisitor._maybe_fix_output(transform_node, self._pipeline) def visit_transform(self, transform_node): SetPDoneVisitor._maybe_fix_output(transform_node, self._pipeline) return SetPDoneVisitor(pipeline) @staticmethod def side_input_visitor(use_unified_worker=False): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.pipeline import PipelineVisitor from apache_beam.transforms.core import ParDo class SideInputVisitor(PipelineVisitor): def visit_transform(self, transform_node): if isinstance(transform_node.transform, ParDo): new_side_inputs = [] for ix, side_input in enumerate(transform_node.side_inputs): access_pattern = side_input._side_input_data().access_pattern if access_pattern == common_urns.side_inputs.ITERABLE.urn: if use_unified_worker: # TODO(BEAM-9173): Stop patching up the access pattern to # appease Dataflow when using the UW and hardcode the output # type to be Any since the Dataflow JSON and pipeline proto # can differ in coders which leads to encoding/decoding issues # within the runner. side_input.pvalue.element_type = typehints.Any new_side_input = _DataflowIterableSideInput(side_input) else: # Add a map to ('', value) as Dataflow currently only handles # keyed side inputs when using the JRH. pipeline = side_input.pvalue.pipeline new_side_input = _DataflowIterableAsMultimapSideInput( side_input) new_side_input.pvalue = beam.pvalue.PCollection( pipeline, element_type=typehints.KV[bytes, side_input.pvalue.element_type], is_bounded=side_input.pvalue.is_bounded) parent = transform_node.parent or pipeline._root_transform() map_to_void_key = beam.pipeline.AppliedPTransform( pipeline, beam.Map(lambda x: (b'', x)), transform_node.full_label + '/MapToVoidKey%s' % ix, (side_input.pvalue, )) new_side_input.pvalue.producer = map_to_void_key map_to_void_key.add_output(new_side_input.pvalue, None) parent.add_part(map_to_void_key) elif access_pattern == common_urns.side_inputs.MULTIMAP.urn: # Ensure the input coder is a KV coder and patch up the # access pattern to appease Dataflow. side_input.pvalue.element_type = typehints.coerce_to_kv_type( side_input.pvalue.element_type, transform_node.full_label) new_side_input = _DataflowMultimapSideInput(side_input) else: raise ValueError( 'Unsupported access pattern for %r: %r' % (transform_node.full_label, access_pattern)) new_side_inputs.append(new_side_input) transform_node.side_inputs = new_side_inputs transform_node.transform.side_inputs = new_side_inputs return SideInputVisitor() @staticmethod def flatten_input_visitor(): # Imported here to avoid circular dependencies. from apache_beam.pipeline import PipelineVisitor class FlattenInputVisitor(PipelineVisitor): def visit_transform(self, transform_node): # Imported here to avoid circular dependencies. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam import Flatten if isinstance(transform_node.transform, Flatten): output_pcoll = DataflowRunner._only_element( transform_node.outputs.values()) for input_pcoll in transform_node.inputs: input_pcoll.element_type = output_pcoll.element_type return FlattenInputVisitor() def _check_for_unsupported_fnapi_features(self, pipeline_proto): components = pipeline_proto.components for windowing_strategy in components.windowing_strategies.values(): if (windowing_strategy.merge_status == beam_runner_api_pb2.MergeStatus.NEEDS_MERGE and windowing_strategy.window_fn.urn not in ( common_urns.session_windows.urn, )): raise RuntimeError( 'Unsupported merging windowing strategy: %s' % windowing_strategy.window_fn.urn) elif components.coders[ windowing_strategy.window_coder_id].spec.urn not in ( common_urns.coders.GLOBAL_WINDOW.urn, common_urns.coders.INTERVAL_WINDOW.urn): raise RuntimeError( 'Unsupported window coder %s for window fn %s' % ( components.coders[windowing_strategy.window_coder_id].spec.urn, windowing_strategy.window_fn.urn)) def run_pipeline(self, pipeline, options): # Label goog-dataflow-notebook if job is started from notebook. if is_in_notebook(): notebook_version = ( 'goog-dataflow-notebook=' + beam.version.__version__.replace('.', '_')) if options.view_as(GoogleCloudOptions).labels: options.view_as(GoogleCloudOptions).labels.append(notebook_version) else: options.view_as(GoogleCloudOptions).labels = [notebook_version] # Import here to avoid adding the dependency for local running scenarios. try: # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.runners.dataflow.internal import apiclient except ImportError: raise ImportError( 'Google Cloud Dataflow runner not available, ' 'please install apache_beam[gcp]') self._maybe_add_unified_worker_missing_options(options) # Convert all side inputs into a form acceptable to Dataflow. if apiclient._use_fnapi(options): pipeline.visit( self.side_input_visitor(apiclient._use_unified_worker(options))) # Performing configured PTransform overrides. Note that this is currently # done before Runner API serialization, since the new proto needs to contain # any added PTransforms. pipeline.replace_all(DataflowRunner._PTRANSFORM_OVERRIDES) if (apiclient._use_fnapi(options) and not apiclient._use_unified_worker(options)): pipeline.replace_all(DataflowRunner._JRH_PTRANSFORM_OVERRIDES) use_fnapi = apiclient._use_fnapi(options) from apache_beam.transforms import environments default_environment = environments.DockerEnvironment.from_container_image( apiclient.get_container_image_from_options(options)) # Snapshot the pipeline in a portable proto. self.proto_pipeline, self.proto_context = pipeline.to_runner_api( return_context=True, default_environment=default_environment) if use_fnapi: self._check_for_unsupported_fnapi_features(self.proto_pipeline) # Cross language transform require using a pipeline object constructed # from the full pipeline proto to make sure that expanded version of # external transforms are reflected in the Pipeline job graph. from apache_beam import Pipeline pipeline = Pipeline.from_runner_api( self.proto_pipeline, pipeline.runner, options, allow_proto_holders=True) # Pipelines generated from proto do not have output set to PDone set for # leaf elements. pipeline.visit(self._set_pdone_visitor(pipeline)) # We need to generate a new context that maps to the new pipeline object. self.proto_pipeline, self.proto_context = pipeline.to_runner_api( return_context=True, default_environment=default_environment) else: # Performing configured PTransform overrides which should not be reflected # in the proto representation of the graph. pipeline.replace_all(DataflowRunner._NON_PORTABLE_PTRANSFORM_OVERRIDES) # Add setup_options for all the BeamPlugin imports setup_options = options.view_as(SetupOptions) plugins = BeamPlugin.get_all_plugin_paths() if setup_options.beam_plugins is not None: plugins = list(set(plugins + setup_options.beam_plugins)) setup_options.beam_plugins = plugins # Elevate "min_cpu_platform" to pipeline option, but using the existing # experiment. debug_options = options.view_as(DebugOptions) worker_options = options.view_as(WorkerOptions) if worker_options.min_cpu_platform: debug_options.add_experiment( 'min_cpu_platform=' + worker_options.min_cpu_platform) # Elevate "enable_streaming_engine" to pipeline option, but using the # existing experiment. google_cloud_options = options.view_as(GoogleCloudOptions) if google_cloud_options.enable_streaming_engine: debug_options.add_experiment("enable_windmill_service") debug_options.add_experiment("enable_streaming_engine") else: if (debug_options.lookup_experiment("enable_windmill_service") or debug_options.lookup_experiment("enable_streaming_engine")): raise ValueError( """Streaming engine both disabled and enabled: enable_streaming_engine flag is not set, but enable_windmill_service and/or enable_streaming_engine experiments are present. It is recommended you only set the enable_streaming_engine flag.""") dataflow_worker_jar = getattr(worker_options, 'dataflow_worker_jar', None) if dataflow_worker_jar is not None: if not apiclient._use_fnapi(options): _LOGGER.warning( 'Typical end users should not use this worker jar feature. ' 'It can only be used when FnAPI is enabled.') else: debug_options.add_experiment('use_staged_dataflow_worker_jar') # Make Dataflow workers use FastAvro on Python 3 unless use_avro experiment # is set. Note that use_avro is only interpreted by the Dataflow runner # at job submission and is not interpreted by Dataflow service or workers, # which by default use avro library unless use_fastavro experiment is set. if sys.version_info[0] > 2 and ( not debug_options.lookup_experiment('use_avro')): debug_options.add_experiment('use_fastavro') self.job = apiclient.Job(options, self.proto_pipeline) # Dataflow runner requires a KV type for GBK inputs, hence we enforce that # here. pipeline.visit(self.group_by_key_input_visitor()) # Dataflow runner requires output type of the Flatten to be the same as the # inputs, hence we enforce that here. pipeline.visit(self.flatten_input_visitor()) # Trigger a traversal of all reachable nodes. self.visit_transforms(pipeline, options) test_options = options.view_as(TestOptions) # If it is a dry run, return without submitting the job. if test_options.dry_run: result = PipelineResult(PipelineState.DONE) result.wait_until_finish = lambda duration=None: None return result # Get a Dataflow API client and set its options self.dataflow_client = apiclient.DataflowApplicationClient(options) # Create the job description and send a request to the service. The result # can be None if there is no need to send a request to the service (e.g. # template creation). If a request was sent and failed then the call will # raise an exception. result = DataflowPipelineResult( self.dataflow_client.create_job(self.job), self) # TODO(BEAM-4274): Circular import runners-metrics. Requires refactoring. from apache_beam.runners.dataflow.dataflow_metrics import DataflowMetrics self._metrics = DataflowMetrics(self.dataflow_client, result, self.job) result.metric_results = self._metrics return result def _maybe_add_unified_worker_missing_options(self, options): # set default beam_fn_api and use_beam_bq_sink experiment if use unified # worker experiment flag exists, no-op otherwise. debug_options = options.view_as(DebugOptions) from apache_beam.runners.dataflow.internal import apiclient if apiclient._use_unified_worker(options): if not debug_options.lookup_experiment('beam_fn_api'): debug_options.add_experiment('beam_fn_api') if not debug_options.lookup_experiment('use_beam_bq_sink'): debug_options.add_experiment('use_beam_bq_sink') def _get_typehint_based_encoding(self, typehint, window_coder): return self._get_cloud_encoding( self._get_coder(typehint, window_coder=window_coder)) @staticmethod def _get_coder(typehint, window_coder): if window_coder: return coders.WindowedValueCoder( coders.registry.get_coder(typehint), window_coder=window_coder) return coders.registry.get_coder(typehint) def _get_cloud_encoding(self, coder, unused=None): if not isinstance(coder, coders.Coder): raise TypeError( 'Coder object must inherit from coders.Coder: %s.' % str(coder)) return coder.as_cloud_object(self.proto_context.coders) def _get_side_input_encoding(self, input_encoding): return { '@type': 'kind:stream', 'component_encodings': [input_encoding], 'is_stream_like': { 'value': True }, } def _get_encoded_output_coder( self, transform_node, window_value=True, output_tag=None): is_external_transform = isinstance( transform_node.transform, RunnerAPIPTransformHolder) if output_tag in transform_node.outputs: element_type = transform_node.outputs[output_tag].element_type elif len(transform_node.outputs) == 1: output_tag = DataflowRunner._only_element(transform_node.outputs.keys()) # TODO(robertwb): Handle type hints for multi-output transforms. element_type = transform_node.outputs[output_tag].element_type elif is_external_transform: raise ValueError( 'For external transforms, output_tag must be specified ' 'since we cannot fallback to a Python only coder.') else: # TODO(silviuc): Remove this branch (and assert) when typehints are # propagated everywhere. Returning an 'Any' as type hint will trigger # usage of the fallback coder (i.e., cPickler). element_type = typehints.Any if window_value: # All outputs have the same windowing. So getting the coder from an # arbitrary window is fine. output_tag = next(iter(transform_node.outputs.keys())) window_coder = ( transform_node.outputs[output_tag].windowing.windowfn. get_window_coder()) else: window_coder = None return self._get_typehint_based_encoding(element_type, window_coder) def _add_step(self, step_kind, step_label, transform_node, side_tags=()): # Import here to avoid adding the dependency for local running scenarios. # pylint: disable=wrong-import-order, wrong-import-position from apache_beam.runners.dataflow.internal import apiclient step = apiclient.Step(step_kind, self._get_unique_step_name()) self.job.proto.steps.append(step.proto) step.add_property(PropertyNames.USER_NAME, step_label) # Cache the node/step association for the main output of the transform node. # Main output key of external transforms can be ambiguous, so we only tag if # there's only one tag instead of None. output_tag = ( DataflowRunner._only_element(transform_node.outputs.keys()) if len( transform_node.outputs.keys()) == 1 else None) self._cache.cache_output(transform_node, output_tag, step) for tag in side_tags: self._cache.cache_output(transform_node, tag, step) step.add_property( PropertyNames.DISPLAY_DATA, [ item.get_dict() for item in DisplayData.create_from(transform_node.transform).items ]) return step def _add_singleton_step( self, label, full_label, tag, input_step, windowing_strategy, access_pattern): from apache_beam.runners.dataflow.internal import apiclient step = apiclient.Step(TransformNames.COLLECTION_TO_SINGLETON, label) self.job.proto.steps.append(step.proto) step.add_property(PropertyNames.USER_NAME, full_label) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(tag) }) step.encoding = self._get_side_input_encoding(input_step.encoding) output_info = { PropertyNames.USER_NAME: '%s.%s' % (full_label, PropertyNames.OUTPUT), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT } if common_urns.side_inputs.MULTIMAP.urn == access_pattern: output_info[PropertyNames.USE_INDEXED_FORMAT] = True step.add_property(PropertyNames.OUTPUT_INFO, [output_info]) step.add_property( PropertyNames.WINDOWING_STRATEGY, self.serialize_windowing_strategy(windowing_strategy)) return step def run_Impulse(self, transform_node, options): standard_options = options.view_as(StandardOptions) debug_options = options.view_as(DebugOptions) use_fn_api = ( debug_options.experiments and 'beam_fn_api' in debug_options.experiments) use_streaming_engine = ( debug_options.experiments and 'enable_streaming_engine' in debug_options.experiments and 'enable_windmill_service' in debug_options.experiments) step = self._add_step( TransformNames.READ, transform_node.full_label, transform_node) if (standard_options.streaming and (not use_fn_api or not use_streaming_engine)): step.add_property(PropertyNames.FORMAT, 'pubsub') step.add_property(PropertyNames.PUBSUB_SUBSCRIPTION, '_starting_signal/') else: step.add_property(PropertyNames.FORMAT, 'impulse') encoded_impulse_element = coders.WindowedValueCoder( coders.BytesCoder(), coders.coders.GlobalWindowCoder()).get_impl().encode_nested( window.GlobalWindows.windowed_value(b'')) if use_fn_api: encoded_impulse_as_str = self.byte_array_to_json_string( encoded_impulse_element) else: encoded_impulse_as_str = base64.b64encode( encoded_impulse_element).decode('ascii') step.add_property(PropertyNames.IMPULSE_ELEMENT, encoded_impulse_as_str) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) def run_Flatten(self, transform_node, options): step = self._add_step( TransformNames.FLATTEN, transform_node.full_label, transform_node) inputs = [] for one_input in transform_node.inputs: input_step = self._cache.get_pvalue(one_input) inputs.append({ '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(one_input.tag) }) step.add_property(PropertyNames.INPUTS, inputs) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) def apply_WriteToBigQuery(self, transform, pcoll, options): experiments = options.view_as(DebugOptions).experiments or [] from apache_beam.runners.dataflow.internal import apiclient use_fnapi = apiclient._use_fnapi(options) if (not isinstance(transform, beam.io.WriteToBigQuery) or use_fnapi or 'use_beam_bq_sink' in experiments): return self.apply_PTransform(transform, pcoll, options) if transform.schema == beam.io.gcp.bigquery.SCHEMA_AUTODETECT: raise RuntimeError( 'Schema auto-detection is not supported on the native sink') standard_options = options.view_as(StandardOptions) if standard_options.streaming: if (transform.write_disposition == beam.io.BigQueryDisposition.WRITE_TRUNCATE): raise RuntimeError('Can not use write truncation mode in streaming') return self.apply_PTransform(transform, pcoll, options) else: from apache_beam.io.gcp.bigquery_tools import parse_table_schema_from_json schema = None if transform.schema: schema = parse_table_schema_from_json(json.dumps(transform.schema)) return pcoll | 'WriteToBigQuery' >> beam.io.Write( beam.io.BigQuerySink( transform.table_reference.tableId, transform.table_reference.datasetId, transform.table_reference.projectId, schema, transform.create_disposition, transform.write_disposition, kms_key=transform.kms_key)) def apply_GroupByKey(self, transform, pcoll, options): parent = pcoll.producer if parent: coder = parent.transform._infer_output_coder() if not coder: coder = self._get_coder(pcoll.element_type or typehints.Any, None) if not coder.is_kv_coder(): raise ValueError(( 'Coder for the GroupByKey operation "%s" is not a ' 'key-value coder: %s.') % (transform.label, coder)) coders.registry.verify_deterministic( coder.key_coder(), 'GroupByKey operation "%s"' % transform.label) return pvalue.PCollection.from_(pcoll) def run_GroupByKey(self, transform_node, options): input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) step = self._add_step( TransformNames.GROUP, transform_node.full_label, transform_node) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) windowing = transform_node.transform.get_windowing(transform_node.inputs) step.add_property( PropertyNames.SERIALIZED_FN, self.serialize_windowing_strategy(windowing)) def run_RunnerAPIPTransformHolder(self, transform_node, options): urn = transform_node.transform.proto().urn assert urn if common_urns.primitives.PAR_DO.urn == urn: self.run_ParDo(transform_node, options) else: raise NotImplementedError( '%s uses unsupported URN: %s' % (transform_node.full_label, urn)) def run_ParDo(self, transform_node, options): transform = transform_node.transform input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) is_external_transform = isinstance(transform, RunnerAPIPTransformHolder) si_dict = {} all_input_labels = transform_node.input_tags_to_preserve si_labels = {} full_label_counts = defaultdict(int) lookup_label = lambda side_pval: si_labels[side_pval] named_inputs = transform_node.named_inputs() label_renames = {} for ix, side_pval in enumerate(transform_node.side_inputs): assert isinstance(side_pval, AsSideInput) step_name = 'SideInput-' + self._get_unique_step_name() si_label = ((SIDE_INPUT_PREFIX + '%d-%s') % (ix, transform_node.full_label) if side_pval.pvalue not in all_input_labels else all_input_labels[side_pval.pvalue]) old_label = (SIDE_INPUT_PREFIX + '%d') % ix if not is_external_transform: label_renames[old_label] = si_label assert old_label in named_inputs pcollection_label = '%s.%s' % ( side_pval.pvalue.producer.full_label.split('/')[-1], side_pval.pvalue.tag if side_pval.pvalue.tag else 'out') si_full_label = '%s/%s(%s.%s)' % ( transform_node.full_label, side_pval.__class__.__name__, pcollection_label, full_label_counts[pcollection_label]) full_label_counts[pcollection_label] += 1 self._add_singleton_step( step_name, si_full_label, side_pval.pvalue.tag, self._cache.get_pvalue(side_pval.pvalue), side_pval.pvalue.windowing, side_pval._side_input_data().access_pattern) si_dict[si_label] = { '@type': 'OutputReference', PropertyNames.STEP_NAME: step_name, PropertyNames.OUTPUT_NAME: PropertyNames.OUT } si_labels[side_pval] = si_label transform_name = transform_node.full_label.rsplit('/', 1)[-1] step = self._add_step( TransformNames.DO, transform_node.full_label + ('/{}'.format(transform_name) if transform_node.side_inputs else ''), transform_node, transform_node.transform.output_tags) from apache_beam.runners.dataflow.internal import apiclient transform_proto = self.proto_context.transforms.get_proto(transform_node) transform_id = self.proto_context.transforms.get_id(transform_node) use_fnapi = apiclient._use_fnapi(options) use_unified_worker = apiclient._use_unified_worker(options) if (use_fnapi and (transform_proto.spec.urn == common_urns.primitives.PAR_DO.urn or use_unified_worker)): if (label_renames and transform_proto.spec.urn == common_urns.primitives.PAR_DO.urn): for old, new in iteritems(label_renames): transform_proto.inputs[new] = transform_proto.inputs[old] del transform_proto.inputs[old] proto_type, _ = beam.PTransform._known_urns[transform_proto.spec.urn] proto = proto_utils.parse_Bytes( transform_proto.spec.payload, proto_type) for old, new in iteritems(label_renames): proto.side_inputs[new].CopyFrom(proto.side_inputs[old]) del proto.side_inputs[old] transform_proto.spec.payload = proto.SerializeToString() del self.proto_pipeline.components.transforms[transform_id] ( self.proto_pipeline.components.transforms[transform_id].CopyFrom( transform_proto)) serialized_data = transform_id else: serialized_data = pickler.dumps( self._pardo_fn_data(transform_node, lookup_label)) step.add_property(PropertyNames.SERIALIZED_FN, serialized_data) # step.add_property(PropertyNames.PIPELINE_PROTO_TRANSFORM_ID, transform_id) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) # Add side inputs if any. step.add_property(PropertyNames.NON_PARALLEL_INPUTS, si_dict) # Generate description for the outputs. The output names # will be 'None' for main output and '<tag>' for a tagged output. outputs = [] all_output_tags = transform_proto.outputs.keys() # Some external transforms require output tags to not be modified. # So we randomly select one of the output tags as the main output and # leave others as side outputs. Transform execution should not change # dependending on which output tag we choose as the main output here. # Also, some SDKs do not work correctly if output tags are modified. So for # external transforms, we leave tags unmodified. # # Python SDK uses 'None' as the tag of the main output. main_output_tag = (all_output_tags[0] if is_external_transform else 'None') step.encoding = self._get_encoded_output_coder( transform_node, output_tag=main_output_tag) side_output_tags = set(all_output_tags).difference({main_output_tag}) # Add the main output to the description. outputs.append({ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: main_output_tag }) for side_tag in side_output_tags: # The assumption here is that all outputs will have the same typehint # and coder as the main output. This is certainly the case right now # but conceivably it could change in the future. encoding = self._get_encoded_output_coder( transform_node, output_tag=side_tag) outputs.append({ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, side_tag)), PropertyNames.ENCODING: encoding, PropertyNames.OUTPUT_NAME: side_tag }) step.add_property(PropertyNames.OUTPUT_INFO, outputs) # Add the restriction encoding if we are a splittable DoFn # and are using the Fn API on the unified worker. restriction_coder = transform.get_restriction_coder() if restriction_coder: step.add_property( PropertyNames.RESTRICTION_ENCODING, self._get_cloud_encoding(restriction_coder)) if options.view_as(StandardOptions).streaming: is_stateful_dofn = ( transform.is_pardo_with_stateful_dofn if is_external_transform else DoFnSignature(transform.dofn).is_stateful_dofn()) if is_stateful_dofn: step.add_property(PropertyNames.USES_KEYED_STATE, 'true') @staticmethod def _pardo_fn_data(transform_node, get_label): transform = transform_node.transform si_tags_and_types = [ # pylint: disable=protected-access (get_label(side_pval), side_pval.__class__, side_pval._view_options()) for side_pval in transform_node.side_inputs] return ( transform.fn, transform.args, transform.kwargs, si_tags_and_types, transform_node.inputs[0].windowing) def run_CombineValuesReplacement(self, transform_node, options): transform = transform_node.transform.transform input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) step = self._add_step( TransformNames.COMBINE, transform_node.full_label, transform_node) transform_id = self.proto_context.transforms.get_id(transform_node.parent) # The data transmitted in SERIALIZED_FN is different depending on whether # this is a fnapi pipeline or not. from apache_beam.runners.dataflow.internal import apiclient use_fnapi = apiclient._use_fnapi(options) if use_fnapi: # Fnapi pipelines send the transform ID of the CombineValues transform's serialized_data = transform_id else: # side inputs information would go. serialized_data = pickler.dumps( (transform.fn, transform.args, transform.kwargs, ())) step.add_property(PropertyNames.SERIALIZED_FN, serialized_data) # TODO(BEAM-8882): Enable once dataflow service doesn't reject this. step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) accumulator_encoding = self._get_cloud_encoding( transform.fn.get_accumulator_coder()) output_encoding = self._get_encoded_output_coder(transform_node) step.encoding = output_encoding step.add_property(PropertyNames.ENCODING, accumulator_encoding) outputs = [] outputs.append({ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }) step.add_property(PropertyNames.OUTPUT_INFO, outputs) def apply_Read(self, transform, pbegin, options): if hasattr(transform.source, 'format'): return beam.pvalue.PCollection.from_(pbegin) else: return self.apply_PTransform(transform, pbegin, options) def run_Read(self, transform_node, options): transform = transform_node.transform step = self._add_step( TransformNames.READ, transform_node.full_label, transform_node) standard_options = options.view_as(StandardOptions) if not hasattr(transform.source, 'format'): source_dict = {} source_dict['spec'] = { '@type': names.SOURCE_TYPE, names.SERIALIZED_SOURCE_KEY: pickler.dumps(transform.source) } try: source_dict['metadata'] = { 'estimated_size_bytes': json_value.get_typed_value_descriptor( transform.source.estimate_size()) } except error.RuntimeValueProviderError: _LOGGER.info( 'Could not estimate size of source %r due to ' + \ 'RuntimeValueProviderError', transform.source) except Exception: _LOGGER.info( 'Could not estimate size of source %r due to an exception: %s', transform.source, traceback.format_exc()) step.add_property(PropertyNames.SOURCE_STEP_INPUT, source_dict) elif transform.source.format == 'text': step.add_property(PropertyNames.FILE_PATTERN, transform.source.path) elif transform.source.format == 'bigquery': if standard_options.streaming: raise ValueError( 'BigQuery source is not currently available for use ' 'in streaming pipelines.') debug_options = options.view_as(DebugOptions) use_fn_api = ( debug_options.experiments and 'beam_fn_api' in debug_options.experiments) if use_fn_api: raise ValueError(BQ_SOURCE_UW_ERROR) step.add_property(PropertyNames.BIGQUERY_EXPORT_FORMAT, 'FORMAT_AVRO') if transform.source.table_reference is not None: step.add_property( PropertyNames.BIGQUERY_DATASET, transform.source.table_reference.datasetId) step.add_property( PropertyNames.BIGQUERY_TABLE, transform.source.table_reference.tableId) if transform.source.table_reference.projectId is not None: step.add_property( PropertyNames.BIGQUERY_PROJECT, transform.source.table_reference.projectId) elif transform.source.query is not None: step.add_property(PropertyNames.BIGQUERY_QUERY, transform.source.query) step.add_property( PropertyNames.BIGQUERY_USE_LEGACY_SQL, transform.source.use_legacy_sql) step.add_property( PropertyNames.BIGQUERY_FLATTEN_RESULTS, transform.source.flatten_results) else: raise ValueError( 'BigQuery source %r must specify either a table or' ' a query' % transform.source) if transform.source.kms_key is not None: step.add_property( PropertyNames.BIGQUERY_KMS_KEY, transform.source.kms_key) elif transform.source.format == 'pubsub': if not standard_options.streaming: raise ValueError( 'Cloud Pub/Sub is currently available for use ' 'only in streaming pipelines.') if transform.source.full_subscription: step.add_property( PropertyNames.PUBSUB_SUBSCRIPTION, transform.source.full_subscription) elif transform.source.full_topic: step.add_property( PropertyNames.PUBSUB_TOPIC, transform.source.full_topic) if transform.source.id_label: step.add_property( PropertyNames.PUBSUB_ID_LABEL, transform.source.id_label) if transform.source.with_attributes: step.add_property(PropertyNames.PUBSUB_SERIALIZED_ATTRIBUTES_FN, '') if transform.source.timestamp_attribute is not None: step.add_property( PropertyNames.PUBSUB_TIMESTAMP_ATTRIBUTE, transform.source.timestamp_attribute) else: raise ValueError( 'Source %r has unexpected format %s.' % (transform.source, transform.source.format)) if not hasattr(transform.source, 'format'): step.add_property(PropertyNames.FORMAT, names.SOURCE_FORMAT) else: step.add_property(PropertyNames.FORMAT, transform.source.format) coder = coders.WindowedValueCoder( coders.registry.get_coder(transform_node.outputs[None].element_type), coders.coders.GlobalWindowCoder()) step.encoding = self._get_cloud_encoding(coder) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) def run__NativeWrite(self, transform_node, options): transform = transform_node.transform input_tag = transform_node.inputs[0].tag input_step = self._cache.get_pvalue(transform_node.inputs[0]) step = self._add_step( TransformNames.WRITE, transform_node.full_label, transform_node) if transform.sink.format == 'text': step.add_property( PropertyNames.FILE_NAME_PREFIX, transform.sink.file_name_prefix, with_type=True) step.add_property( PropertyNames.FILE_NAME_SUFFIX, transform.sink.file_name_suffix, with_type=True) step.add_property( PropertyNames.SHARD_NAME_TEMPLATE, transform.sink.shard_name_template, with_type=True) if transform.sink.num_shards > 0: step.add_property( PropertyNames.NUM_SHARDS, transform.sink.num_shards, with_type=True) step.add_property(PropertyNames.VALIDATE_SINK, False, with_type=True) elif transform.sink.format == 'bigquery': step.add_property( PropertyNames.BIGQUERY_DATASET, transform.sink.table_reference.datasetId) step.add_property( PropertyNames.BIGQUERY_TABLE, transform.sink.table_reference.tableId) if transform.sink.table_reference.projectId is not None: step.add_property( PropertyNames.BIGQUERY_PROJECT, transform.sink.table_reference.projectId) step.add_property( PropertyNames.BIGQUERY_CREATE_DISPOSITION, transform.sink.create_disposition) step.add_property( PropertyNames.BIGQUERY_WRITE_DISPOSITION, transform.sink.write_disposition) if transform.sink.table_schema is not None: step.add_property( PropertyNames.BIGQUERY_SCHEMA, transform.sink.schema_as_json()) if transform.sink.kms_key is not None: step.add_property( PropertyNames.BIGQUERY_KMS_KEY, transform.sink.kms_key) elif transform.sink.format == 'pubsub': standard_options = options.view_as(StandardOptions) if not standard_options.streaming: raise ValueError( 'Cloud Pub/Sub is currently available for use ' 'only in streaming pipelines.') step.add_property(PropertyNames.PUBSUB_TOPIC, transform.sink.full_topic) if transform.sink.id_label: step.add_property( PropertyNames.PUBSUB_ID_LABEL, transform.sink.id_label) if transform.sink.with_attributes: step.add_property(PropertyNames.PUBSUB_SERIALIZED_ATTRIBUTES_FN, '') if transform.sink.timestamp_attribute is not None: step.add_property( PropertyNames.PUBSUB_TIMESTAMP_ATTRIBUTE, transform.sink.timestamp_attribute) else: raise ValueError( 'Sink %r has unexpected format %s.' % (transform.sink, transform.sink.format)) step.add_property(PropertyNames.FORMAT, transform.sink.format) coder = coders.WindowedValueCoder( transform.sink.coder, coders.coders.GlobalWindowCoder()) step.encoding = self._get_cloud_encoding(coder) step.add_property(PropertyNames.ENCODING, step.encoding) step.add_property( PropertyNames.PARALLEL_INPUT, { '@type': 'OutputReference', PropertyNames.STEP_NAME: input_step.proto.name, PropertyNames.OUTPUT_NAME: input_step.get_output(input_tag) }) def run_TestStream(self, transform_node, options): from apache_beam.testing.test_stream import ElementEvent from apache_beam.testing.test_stream import ProcessingTimeEvent from apache_beam.testing.test_stream import WatermarkEvent standard_options = options.view_as(StandardOptions) if not standard_options.streaming: raise ValueError( 'TestStream is currently available for use ' 'only in streaming pipelines.') transform = transform_node.transform step = self._add_step( TransformNames.READ, transform_node.full_label, transform_node) step.add_property(PropertyNames.FORMAT, 'test_stream') test_stream_payload = beam_runner_api_pb2.TestStreamPayload() # so we won't set test_stream_payload.coder_id. output_coder = transform._infer_output_coder() for event in transform._events: new_event = test_stream_payload.events.add() if isinstance(event, ElementEvent): for tv in event.timestamped_values: element = new_event.element_event.elements.add() element.encoded_element = output_coder.encode(tv.value) element.timestamp = tv.timestamp.micros elif isinstance(event, ProcessingTimeEvent): new_event.processing_time_event.advance_duration = ( event.advance_by.micros) elif isinstance(event, WatermarkEvent): new_event.watermark_event.new_watermark = event.new_watermark.micros serialized_payload = self.byte_array_to_json_string( test_stream_payload.SerializeToString()) step.add_property(PropertyNames.SERIALIZED_TEST_STREAM, serialized_payload) step.encoding = self._get_encoded_output_coder(transform_node) step.add_property( PropertyNames.OUTPUT_INFO, [{ PropertyNames.USER_NAME: ( '%s.%s' % (transform_node.full_label, PropertyNames.OUT)), PropertyNames.ENCODING: step.encoding, PropertyNames.OUTPUT_NAME: PropertyNames.OUT }]) run_TestStream.__test__ = False @classmethod def serialize_windowing_strategy(cls, windowing): from apache_beam.runners import pipeline_context context = pipeline_context.PipelineContext() windowing_proto = windowing.to_runner_api(context) return cls.byte_array_to_json_string( beam_runner_api_pb2.MessageWithComponents( components=context.to_runner_api(), windowing_strategy=windowing_proto).SerializeToString()) @classmethod def deserialize_windowing_strategy(cls, serialized_data): from apache_beam.runners import pipeline_context from apache_beam.transforms.core import Windowing proto = beam_runner_api_pb2.MessageWithComponents() proto.ParseFromString(cls.json_string_to_byte_array(serialized_data)) return Windowing.from_runner_api( proto.windowing_strategy, pipeline_context.PipelineContext(proto.components)) @staticmethod def byte_array_to_json_string(raw_bytes): return quote(raw_bytes) @staticmethod def json_string_to_byte_array(encoded_string): return unquote_to_bytes(encoded_string) def get_default_gcp_region(self): environment_region = os.environ.get('CLOUDSDK_COMPUTE_REGION') if environment_region: _LOGGER.info( 'Using default GCP region %s from $CLOUDSDK_COMPUTE_REGION', environment_region) return environment_region try: cmd = ['gcloud', 'config', 'get-value', 'compute/region'] if hasattr(subprocess, 'DEVNULL'): DEVNULL = subprocess.DEVNULL else: DEVNULL = open(os.devnull, 'ab') raw_output = processes.check_output(cmd, stderr=DEVNULL) formatted_output = raw_output.decode('utf-8').strip() if formatted_output: _LOGGER.info( 'Using default GCP region %s from `%s`', formatted_output, ' '.join(cmd)) return formatted_output except RuntimeError: pass return None class _DataflowSideInput(beam.pvalue.AsSideInput): def _view_options(self): return { 'data': self._data, } def _side_input_data(self): return self._data class _DataflowIterableAsMultimapSideInput(_DataflowSideInput): def __init__(self, side_input): side_input_data = side_input._side_input_data() assert ( side_input_data.access_pattern == common_urns.side_inputs.ITERABLE.urn) iterable_view_fn = side_input_data.view_fn self._data = beam.pvalue.SideInputData( common_urns.side_inputs.MULTIMAP.urn, side_input_data.window_mapping_fn, lambda multimap: iterable_view_fn(multimap[b''])) class _DataflowIterableSideInput(_DataflowSideInput): def __init__(self, side_input): self.pvalue = side_input.pvalue side_input_data = side_input._side_input_data() assert ( side_input_data.access_pattern == common_urns.side_inputs.ITERABLE.urn) self._data = beam.pvalue.SideInputData( common_urns.side_inputs.ITERABLE.urn, side_input_data.window_mapping_fn, side_input_data.view_fn) class _DataflowMultimapSideInput(_DataflowSideInput): def __init__(self, side_input): self.pvalue = side_input.pvalue side_input_data = side_input._side_input_data() assert ( side_input_data.access_pattern == common_urns.side_inputs.MULTIMAP.urn) self._data = beam.pvalue.SideInputData( common_urns.side_inputs.MULTIMAP.urn, side_input_data.window_mapping_fn, side_input_data.view_fn) class DataflowPipelineResult(PipelineResult): def __init__(self, job, runner): self._job = job self._runner = runner self.metric_results = None def _update_job(self): if self.has_job and not self.is_in_terminal_state(): self._job = self._runner.dataflow_client.get_job(self.job_id()) def job_id(self): return self._job.id def metrics(self): return self.metric_results @property def has_job(self): return self._job is not None def _get_job_state(self): values_enum = dataflow_api.Job.CurrentStateValueValuesEnum api_jobstate_map = defaultdict( lambda: PipelineState.UNRECOGNIZED, { values_enum.JOB_STATE_UNKNOWN: PipelineState.UNKNOWN, values_enum.JOB_STATE_STOPPED: PipelineState.STOPPED, values_enum.JOB_STATE_RUNNING: PipelineState.RUNNING, values_enum.JOB_STATE_DONE: PipelineState.DONE, values_enum.JOB_STATE_FAILED: PipelineState.FAILED, values_enum.JOB_STATE_CANCELLED: PipelineState.CANCELLED, values_enum.JOB_STATE_UPDATED: PipelineState.UPDATED, values_enum.JOB_STATE_DRAINING: PipelineState.DRAINING, values_enum.JOB_STATE_DRAINED: PipelineState.DRAINED, values_enum.JOB_STATE_PENDING: PipelineState.PENDING, values_enum.JOB_STATE_CANCELLING: PipelineState.CANCELLING, }) return ( api_jobstate_map[self._job.currentState] if self._job.currentState else PipelineState.UNKNOWN) @property def state(self): if not self.has_job: return PipelineState.UNKNOWN self._update_job() return self._get_job_state() def is_in_terminal_state(self): if not self.has_job: return True return PipelineState.is_terminal(self._get_job_state()) def wait_until_finish(self, duration=None): if not self.is_in_terminal_state(): if not self.has_job: raise IOError('Failed to get the Dataflow job id.') thread = threading.Thread( target=DataflowRunner.poll_for_job_completion, args=(self._runner, self, duration)) thread.daemon = True thread.start() while thread.is_alive(): time.sleep(5.0) terminated = self.is_in_terminal_state() assert duration or terminated, ( 'Job did not reach to a terminal state after waiting indefinitely.') if terminated and self.state != PipelineState.DONE: raise DataflowRuntimeException( 'Dataflow pipeline failed. State: %s, Error:\n%s' % (self.state, getattr(self._runner, 'last_error_msg', None)), self) return self.state def cancel(self): if not self.has_job: raise IOError('Failed to get the Dataflow job id.') self._update_job() if self.is_in_terminal_state(): _LOGGER.warning( 'Cancel failed because job %s is already terminated in state %s.', self.job_id(), self.state) else: if not self._runner.dataflow_client.modify_job_state( self.job_id(), 'JOB_STATE_CANCELLED'): cancel_failed_message = ( 'Failed to cancel job %s, please go to the Developers Console to ' 'cancel it manually.') % self.job_id() _LOGGER.error(cancel_failed_message) raise DataflowRuntimeException(cancel_failed_message, self) return self.state def __str__(self): return '<%s %s %s>' % (self.__class__.__name__, self.job_id(), self.state) def __repr__(self): return '<%s %s at %s>' % (self.__class__.__name__, self._job, hex(id(self))) class DataflowRuntimeException(Exception): def __init__(self, msg, result): super(DataflowRuntimeException, self).__init__(msg) self.result = result
true
true
f71e568dd0e667d488a561c5ed72e8b96933814c
507
py
Python
setup.py
thejohnfreeman/picard
09b39d6655e1df071ea9f3f63eaf35ddbd2f0e0f
[ "MIT" ]
3
2018-12-28T03:14:49.000Z
2019-05-24T21:05:13.000Z
setup.py
thejohnfreeman/picard
09b39d6655e1df071ea9f3f63eaf35ddbd2f0e0f
[ "MIT" ]
null
null
null
setup.py
thejohnfreeman/picard
09b39d6655e1df071ea9f3f63eaf35ddbd2f0e0f
[ "MIT" ]
null
null
null
# WARNING: DO NOT USE THIS. # This setup.py exists only to satisfy Read the Docs until they can support # pyproject.toml (PEP 517): # https://github.com/rtfd/readthedocs.org/issues/4912#issuecomment-444198329 # https://github.com/pypa/pip/pull/5743 from setuptools import setup setup( name='picard', version='0.1.3', packages=['picard'], install_requires=[ 'boto3>=1.9,<1.10', 'tabulate>=0.8,<0.9', 'toml>=0.10,<0.11', 'typing_extensions>=3.6,<3.7', ], )
28.166667
76
0.637081
t setup setup( name='picard', version='0.1.3', packages=['picard'], install_requires=[ 'boto3>=1.9,<1.10', 'tabulate>=0.8,<0.9', 'toml>=0.10,<0.11', 'typing_extensions>=3.6,<3.7', ], )
true
true
f71e58148d9d1a173dc56feacc564d5b197c059c
2,488
py
Python
httpstream/numbers.py
technige/httpstream
8be13f52fc4f031dfed281963f4313c3c9b4729a
[ "Apache-2.0" ]
2
2017-09-21T10:41:17.000Z
2019-06-27T13:23:11.000Z
httpstream/numbers.py
technige/httpstream
8be13f52fc4f031dfed281963f4313c3c9b4729a
[ "Apache-2.0" ]
null
null
null
httpstream/numbers.py
technige/httpstream
8be13f52fc4f031dfed281963f4313c3c9b4729a
[ "Apache-2.0" ]
1
2019-02-18T13:57:22.000Z
2019-02-18T13:57:22.000Z
#!/usr/bin/env python # -*- coding: utf-8 -*- # Copyright 2012-2015, Nigel Small # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # HTTP/HTTPS Port Numbers HTTP_PORT = 80 HTTPS_PORT = 443 # HTTP Status Codes <http://www.iana.org/assignments/http-status-codes> # 1xx: Informational # Request received, continuing process CONTINUE = 100 SWITCHING_PROTOCOLS = 101 PROCESSING = 102 # 2xx: Success # The action was successfully received, understood, and accepted OK = 200 CREATED = 201 ACCEPTED = 202 NON_AUTHORITATIVE_INFORMATION = 203 NO_CONTENT = 204 RESET_CONTENT = 205 PARTIAL_CONTENT = 206 MULTI_STATUS = 207 ALREADY_REPORTED = 208 IM_USED = 226 # 3xx: Redirection # Further action must be taken in order to complete the request MULTIPLE_CHOICES = 300 MOVED_PERMANENTLY = 301 FOUND = 302 SEE_OTHER = 303 NOT_MODIFIED = 304 USE_PROXY = 305 TEMPORARY_REDIRECT = 307 PERMANENT_REDIRECT = 308 # 4xx: Client Error # The request contains bad syntax or cannot be fulfilled BAD_REQUEST = 400 UNAUTHORIZED = 401 PAYMENT_REQUIRED = 402 FORBIDDEN = 403 NOT_FOUND = 404 METHOD_NOT_ALLOWED = 405 NOT_ACCEPTABLE = 406 PROXY_AUTHENTICATION_REQUIRED = 407 REQUEST_TIMEOUT = 408 CONFLICT = 409 GONE = 410 LENGTH_REQUIRED = 411 PRECONDITION_FAILED = 412 REQUEST_ENTITY_TOO_LARGE = 413 REQUEST_URI_TOO_LONG = 414 UNSUPPORTED_MEDIA_TYPE = 415 REQUESTED_RANGE_NOT_SATISFIABLE = 416 EXPECTATION_FAILED = 417 IM_A_TEAPOT = 418 UNPROCESSABLE_ENTITY = 422 LOCKED = 423 FAILED_DEPENDENCY = 424 UPGRADE_REQUIRED = 426 PRECONDITION_REQUIRED = 428 TOO_MANY_REQUESTS = 429 REQUEST_HEADER_FIELDS_TOO_LARGE = 431 UNAVAILABLE_FOR_LEGAL_REASONS = 451 # 5xx: Server Error # The server failed to fulfill an apparently valid request INTERNAL_SERVER_ERROR = 500 NOT_IMPLEMENTED = 501 BAD_GATEWAY = 502 SERVICE_UNAVAILABLE = 503 GATEWAY_TIMEOUT = 504 HTTP_VERSION_NOT_SUPPORTED = 505 VARIANT_ALSO_NEGOTIATES = 506 INSUFFICIENT_STORAGE = 507 LOOP_DETECTED = 508 NOT_EXTENDED = 510 NETWORK_AUTHENTICATION_REQUIRED = 511
24.88
74
0.791801
HTTP_PORT = 80 HTTPS_PORT = 443 CONTINUE = 100 SWITCHING_PROTOCOLS = 101 PROCESSING = 102 OK = 200 CREATED = 201 ACCEPTED = 202 NON_AUTHORITATIVE_INFORMATION = 203 NO_CONTENT = 204 RESET_CONTENT = 205 PARTIAL_CONTENT = 206 MULTI_STATUS = 207 ALREADY_REPORTED = 208 IM_USED = 226 MULTIPLE_CHOICES = 300 MOVED_PERMANENTLY = 301 FOUND = 302 SEE_OTHER = 303 NOT_MODIFIED = 304 USE_PROXY = 305 TEMPORARY_REDIRECT = 307 PERMANENT_REDIRECT = 308 BAD_REQUEST = 400 UNAUTHORIZED = 401 PAYMENT_REQUIRED = 402 FORBIDDEN = 403 NOT_FOUND = 404 METHOD_NOT_ALLOWED = 405 NOT_ACCEPTABLE = 406 PROXY_AUTHENTICATION_REQUIRED = 407 REQUEST_TIMEOUT = 408 CONFLICT = 409 GONE = 410 LENGTH_REQUIRED = 411 PRECONDITION_FAILED = 412 REQUEST_ENTITY_TOO_LARGE = 413 REQUEST_URI_TOO_LONG = 414 UNSUPPORTED_MEDIA_TYPE = 415 REQUESTED_RANGE_NOT_SATISFIABLE = 416 EXPECTATION_FAILED = 417 IM_A_TEAPOT = 418 UNPROCESSABLE_ENTITY = 422 LOCKED = 423 FAILED_DEPENDENCY = 424 UPGRADE_REQUIRED = 426 PRECONDITION_REQUIRED = 428 TOO_MANY_REQUESTS = 429 REQUEST_HEADER_FIELDS_TOO_LARGE = 431 UNAVAILABLE_FOR_LEGAL_REASONS = 451 INTERNAL_SERVER_ERROR = 500 NOT_IMPLEMENTED = 501 BAD_GATEWAY = 502 SERVICE_UNAVAILABLE = 503 GATEWAY_TIMEOUT = 504 HTTP_VERSION_NOT_SUPPORTED = 505 VARIANT_ALSO_NEGOTIATES = 506 INSUFFICIENT_STORAGE = 507 LOOP_DETECTED = 508 NOT_EXTENDED = 510 NETWORK_AUTHENTICATION_REQUIRED = 511
true
true
f71e5834283c296de8eb47d6ad42b9957168b32a
2,078
py
Python
carga_contadores.py
robzoros/tienda_online
86fa8533f068559e845f867330ad2ba24a2d3601
[ "MIT" ]
null
null
null
carga_contadores.py
robzoros/tienda_online
86fa8533f068559e845f867330ad2ba24a2d3601
[ "MIT" ]
null
null
null
carga_contadores.py
robzoros/tienda_online
86fa8533f068559e845f867330ad2ba24a2d3601
[ "MIT" ]
null
null
null
#!/usr/bin/env python # -*- coding: utf-8 -*- from cassandra.cluster import Cluster # Conectamos al Cluster cluster = Cluster() session = cluster.connect('tienda_online') #****************************************************** # CONTADORES #****************************************************** # Cargamos la lista de productos en una lista session.execute("TRUNCATE productos_mas_vendidos") session.execute("TRUNCATE productos_vendidos_juntos") result = session.execute('SELECT * FROM contador_productos_vendidos') productos_vendidos = sorted(result, key=lambda p: -1 * p.numero_ventas)[0:8] for producto in productos_vendidos: prod = session.execute('SELECT * FROM productos WHERE codigo_referencia = ' + str(producto.codigo_referencia))[0] for contador in range(10): prepared = session.prepare("INSERT INTO productos_mas_vendidos (semilla, codigo_referencia, nombre_producto, precio_producto, url_imagen, numero_ventas)" + " VALUES (?, ?, ?, " + "{:0.2f}".format(prod.precio_producto) + ", ?, ?)") session.execute(prepared, (contador, prod.codigo_referencia, prod.nombre_producto, prod.url_imagen, producto.numero_ventas)) productos = session.execute('SELECT * FROM productos') for producto in productos: result = session.execute('SELECT * FROM contador_prod_vendidos_juntos WHERE producto = ' + str(producto.codigo_referencia)) productos_rel = sorted(result, key=lambda p: -1 * p.numero_ventas) for prod in productos_rel: prod_rel = session.execute('SELECT * FROM productos WHERE codigo_referencia = ' + str(prod.producto_rel))[0] prepared = session.prepare("INSERT INTO productos_vendidos_juntos (producto, producto_rel, nombre_producto, precio_producto, url_imagen, numero_ventas)" + " VALUES (?, ?, ?, " + "{:0.2f}".format(producto.precio_producto) + ", ?, ?)") session.execute(prepared, (producto.codigo_referencia, prod_rel.codigo_referencia, prod_rel.nombre_producto, prod_rel.url_imagen, prod.numero_ventas))
53.282051
163
0.674687
from cassandra.cluster import Cluster cluster = Cluster() session = cluster.connect('tienda_online') session.execute("TRUNCATE productos_mas_vendidos") session.execute("TRUNCATE productos_vendidos_juntos") result = session.execute('SELECT * FROM contador_productos_vendidos') productos_vendidos = sorted(result, key=lambda p: -1 * p.numero_ventas)[0:8] for producto in productos_vendidos: prod = session.execute('SELECT * FROM productos WHERE codigo_referencia = ' + str(producto.codigo_referencia))[0] for contador in range(10): prepared = session.prepare("INSERT INTO productos_mas_vendidos (semilla, codigo_referencia, nombre_producto, precio_producto, url_imagen, numero_ventas)" + " VALUES (?, ?, ?, " + "{:0.2f}".format(prod.precio_producto) + ", ?, ?)") session.execute(prepared, (contador, prod.codigo_referencia, prod.nombre_producto, prod.url_imagen, producto.numero_ventas)) productos = session.execute('SELECT * FROM productos') for producto in productos: result = session.execute('SELECT * FROM contador_prod_vendidos_juntos WHERE producto = ' + str(producto.codigo_referencia)) productos_rel = sorted(result, key=lambda p: -1 * p.numero_ventas) for prod in productos_rel: prod_rel = session.execute('SELECT * FROM productos WHERE codigo_referencia = ' + str(prod.producto_rel))[0] prepared = session.prepare("INSERT INTO productos_vendidos_juntos (producto, producto_rel, nombre_producto, precio_producto, url_imagen, numero_ventas)" + " VALUES (?, ?, ?, " + "{:0.2f}".format(producto.precio_producto) + ", ?, ?)") session.execute(prepared, (producto.codigo_referencia, prod_rel.codigo_referencia, prod_rel.nombre_producto, prod_rel.url_imagen, prod.numero_ventas))
true
true
f71e58d321e14ad0e343e03cdeed51884bcfe901
5,207
py
Python
official/core/base_trainer_test.py
xxia-kathy/models
157faae1af5d89c53a5699b601dc68fee274ef09
[ "Apache-2.0" ]
1
2021-02-22T13:05:55.000Z
2021-02-22T13:05:55.000Z
official/core/base_trainer_test.py
xxia-kathy/models
157faae1af5d89c53a5699b601dc68fee274ef09
[ "Apache-2.0" ]
null
null
null
official/core/base_trainer_test.py
xxia-kathy/models
157faae1af5d89c53a5699b601dc68fee274ef09
[ "Apache-2.0" ]
3
2021-02-22T13:24:07.000Z
2021-02-26T02:06:24.000Z
# Lint as: python3 # Copyright 2020 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for tensorflow_models.core.trainers.trainer.""" # pylint: disable=g-direct-tensorflow-import import os from absl.testing import parameterized import tensorflow as tf from tensorflow.python.distribute import combinations from tensorflow.python.distribute import strategy_combinations from official.core import base_trainer as trainer_lib from official.core import train_lib from official.modeling.hyperparams import config_definitions as cfg from official.utils.testing import mock_task def all_strategy_combinations(): return combinations.combine( distribution=[ strategy_combinations.default_strategy, strategy_combinations.tpu_strategy, strategy_combinations.one_device_strategy_gpu, ], mode='eager', ) class TrainerTest(tf.test.TestCase, parameterized.TestCase): def setUp(self): super().setUp() self._config = cfg.ExperimentConfig( trainer=cfg.TrainerConfig( optimizer_config=cfg.OptimizationConfig({ 'optimizer': { 'type': 'sgd' }, 'learning_rate': { 'type': 'constant' } }))) def create_test_trainer(self, config, model_dir=None): task = mock_task.MockTask(config.task, logging_dir=model_dir) ckpt_exporter = train_lib.maybe_create_best_ckpt_exporter(config, model_dir) trainer = trainer_lib.Trainer( config, task, model=task.build_model(), optimizer=trainer_lib.create_optimizer(config.trainer, config.runtime), checkpoint_exporter=ckpt_exporter) return trainer @combinations.generate(all_strategy_combinations()) def test_trainer_train(self, distribution): with distribution.scope(): trainer = self.create_test_trainer(self._config) logs = trainer.train(tf.convert_to_tensor(5, dtype=tf.int32)) self.assertIn('training_loss', logs) self.assertIn('learning_rate', logs) @combinations.generate(all_strategy_combinations()) def test_trainer_validate(self, distribution): with distribution.scope(): trainer = self.create_test_trainer(self._config) logs = trainer.evaluate(tf.convert_to_tensor(5, dtype=tf.int32)) self.assertIn('validation_loss', logs) self.assertEqual(logs['acc'], 5. * distribution.num_replicas_in_sync) @combinations.generate( combinations.combine( mixed_precision_dtype=['float32', 'bfloat16', 'float16'], loss_scale=[None, 'dynamic', 128, 256], )) def test_configure_optimizer(self, mixed_precision_dtype, loss_scale): config = cfg.ExperimentConfig( runtime=cfg.RuntimeConfig( mixed_precision_dtype=mixed_precision_dtype, loss_scale=loss_scale), trainer=cfg.TrainerConfig( optimizer_config=cfg.OptimizationConfig({ 'optimizer': { 'type': 'sgd' }, 'learning_rate': { 'type': 'constant' } }))) trainer = self.create_test_trainer(config) if mixed_precision_dtype != 'float16': self.assertIsInstance(trainer.optimizer, tf.keras.optimizers.SGD) elif mixed_precision_dtype == 'float16' and loss_scale is None: self.assertIsInstance(trainer.optimizer, tf.keras.optimizers.SGD) else: self.assertIsInstance( trainer.optimizer, tf.keras.mixed_precision.experimental.LossScaleOptimizer) metrics = trainer.train(tf.convert_to_tensor(5, dtype=tf.int32)) self.assertIn('training_loss', metrics) @combinations.generate(all_strategy_combinations()) def test_export_best_ckpt(self, distribution): config = cfg.ExperimentConfig( trainer=cfg.TrainerConfig( best_checkpoint_export_subdir='best_ckpt', best_checkpoint_eval_metric='acc', optimizer_config=cfg.OptimizationConfig({ 'optimizer': { 'type': 'sgd' }, 'learning_rate': { 'type': 'constant' } }))) model_dir = self.get_temp_dir() trainer = self.create_test_trainer(config, model_dir=model_dir) trainer.train(tf.convert_to_tensor(1, dtype=tf.int32)) trainer.evaluate(tf.convert_to_tensor(1, dtype=tf.int32)) self.assertTrue( tf.io.gfile.exists(os.path.join(model_dir, 'best_ckpt', 'info.json'))) if __name__ == '__main__': tf.test.main()
37.460432
80
0.668907
import os from absl.testing import parameterized import tensorflow as tf from tensorflow.python.distribute import combinations from tensorflow.python.distribute import strategy_combinations from official.core import base_trainer as trainer_lib from official.core import train_lib from official.modeling.hyperparams import config_definitions as cfg from official.utils.testing import mock_task def all_strategy_combinations(): return combinations.combine( distribution=[ strategy_combinations.default_strategy, strategy_combinations.tpu_strategy, strategy_combinations.one_device_strategy_gpu, ], mode='eager', ) class TrainerTest(tf.test.TestCase, parameterized.TestCase): def setUp(self): super().setUp() self._config = cfg.ExperimentConfig( trainer=cfg.TrainerConfig( optimizer_config=cfg.OptimizationConfig({ 'optimizer': { 'type': 'sgd' }, 'learning_rate': { 'type': 'constant' } }))) def create_test_trainer(self, config, model_dir=None): task = mock_task.MockTask(config.task, logging_dir=model_dir) ckpt_exporter = train_lib.maybe_create_best_ckpt_exporter(config, model_dir) trainer = trainer_lib.Trainer( config, task, model=task.build_model(), optimizer=trainer_lib.create_optimizer(config.trainer, config.runtime), checkpoint_exporter=ckpt_exporter) return trainer @combinations.generate(all_strategy_combinations()) def test_trainer_train(self, distribution): with distribution.scope(): trainer = self.create_test_trainer(self._config) logs = trainer.train(tf.convert_to_tensor(5, dtype=tf.int32)) self.assertIn('training_loss', logs) self.assertIn('learning_rate', logs) @combinations.generate(all_strategy_combinations()) def test_trainer_validate(self, distribution): with distribution.scope(): trainer = self.create_test_trainer(self._config) logs = trainer.evaluate(tf.convert_to_tensor(5, dtype=tf.int32)) self.assertIn('validation_loss', logs) self.assertEqual(logs['acc'], 5. * distribution.num_replicas_in_sync) @combinations.generate( combinations.combine( mixed_precision_dtype=['float32', 'bfloat16', 'float16'], loss_scale=[None, 'dynamic', 128, 256], )) def test_configure_optimizer(self, mixed_precision_dtype, loss_scale): config = cfg.ExperimentConfig( runtime=cfg.RuntimeConfig( mixed_precision_dtype=mixed_precision_dtype, loss_scale=loss_scale), trainer=cfg.TrainerConfig( optimizer_config=cfg.OptimizationConfig({ 'optimizer': { 'type': 'sgd' }, 'learning_rate': { 'type': 'constant' } }))) trainer = self.create_test_trainer(config) if mixed_precision_dtype != 'float16': self.assertIsInstance(trainer.optimizer, tf.keras.optimizers.SGD) elif mixed_precision_dtype == 'float16' and loss_scale is None: self.assertIsInstance(trainer.optimizer, tf.keras.optimizers.SGD) else: self.assertIsInstance( trainer.optimizer, tf.keras.mixed_precision.experimental.LossScaleOptimizer) metrics = trainer.train(tf.convert_to_tensor(5, dtype=tf.int32)) self.assertIn('training_loss', metrics) @combinations.generate(all_strategy_combinations()) def test_export_best_ckpt(self, distribution): config = cfg.ExperimentConfig( trainer=cfg.TrainerConfig( best_checkpoint_export_subdir='best_ckpt', best_checkpoint_eval_metric='acc', optimizer_config=cfg.OptimizationConfig({ 'optimizer': { 'type': 'sgd' }, 'learning_rate': { 'type': 'constant' } }))) model_dir = self.get_temp_dir() trainer = self.create_test_trainer(config, model_dir=model_dir) trainer.train(tf.convert_to_tensor(1, dtype=tf.int32)) trainer.evaluate(tf.convert_to_tensor(1, dtype=tf.int32)) self.assertTrue( tf.io.gfile.exists(os.path.join(model_dir, 'best_ckpt', 'info.json'))) if __name__ == '__main__': tf.test.main()
true
true
f71e591c2ff6a50a381fad44e154010bbb850217
7,849
py
Python
tools/mo/openvino/tools/mo/middle/passes/convert_data_type.py
pazamelin/openvino
b7e8ef910d7ed8e52326d14dc6fd53b71d16ed48
[ "Apache-2.0" ]
1
2019-09-22T01:05:07.000Z
2019-09-22T01:05:07.000Z
tools/mo/openvino/tools/mo/middle/passes/convert_data_type.py
pazamelin/openvino
b7e8ef910d7ed8e52326d14dc6fd53b71d16ed48
[ "Apache-2.0" ]
58
2020-11-06T12:13:45.000Z
2022-03-28T13:20:11.000Z
tools/mo/openvino/tools/mo/middle/passes/convert_data_type.py
pazamelin/openvino
b7e8ef910d7ed8e52326d14dc6fd53b71d16ed48
[ "Apache-2.0" ]
2
2021-07-14T07:40:50.000Z
2021-07-27T01:40:03.000Z
# Copyright (C) 2018-2021 Intel Corporation # SPDX-License-Identifier: Apache-2.0 import logging as log import numpy as np from openvino.tools.mo.front.extractor import get_new_placeholder_name from openvino.tools.mo.graph.graph import Node, Graph from openvino.tools.mo.utils.error import Error from openvino.tools.mo.utils.utils import refer_to_faq_msg """ Packed data of custom types are stored in numpy uint8 data type. To distinguish true uint8 and custom data we introduce this class not to store, but to have unique data type in SUPPORTED_DATA_TYPES map """ class packed_U1(np.generic): pass class packed_U4(np.generic): pass class packed_I4(np.generic): pass SUPPORTED_DATA_TYPES = { 'float': (np.float32, 'FP32', 'f32'), 'half': (np.float16, 'FP16', 'f16'), 'FP32': (np.float32, 'FP32', 'f32'), 'FP64': (np.float64, 'FP64', 'f64'), 'FP16': (np.float16, 'FP16', 'f16'), 'I32': (np.int32, 'I32', 'i32'), 'I64': (np.int64, 'I64', 'i64'), 'int8': (np.int8, 'I8', 'i8'), 'int32': (np.int32, 'I32', 'i32'), 'int64': (np.int64, 'I64', 'i64'), 'bool': (np.bool, 'BOOL', 'boolean'), 'uint8': (np.uint8, 'U8', 'u8'), 'uint32': (np.uint32, 'U32', 'u32'), 'uint64': (np.uint64, 'U64', 'u64'), # custom types 'U1': (packed_U1, 'U1', 'u1'), 'int4': (packed_I4, 'I4', 'i4'), 'uint4': (packed_U4, 'U4', 'u4'), 'I4': (packed_I4, 'I4', 'i4'), 'U4': (packed_U4, 'U4', 'u4'), } def data_type_str_to_np(data_type_str: str): return SUPPORTED_DATA_TYPES[data_type_str][0] if data_type_str in SUPPORTED_DATA_TYPES else None def data_type_str_to_precision(data_type_str: str): return SUPPORTED_DATA_TYPES[data_type_str][1] if data_type_str in SUPPORTED_DATA_TYPES else None def data_type_str_to_destination_type(data_type_str: str): return SUPPORTED_DATA_TYPES[data_type_str][2] if data_type_str in SUPPORTED_DATA_TYPES else None def np_data_type_to_precision(np_data_type): for np_t, precision, _ in SUPPORTED_DATA_TYPES.values(): if np_t == np_data_type: return precision raise Error('Data type "{}" is not supported'.format(np_data_type)) def np_data_type_to_destination_type(np_data_type): for np_t, _, destination_type in SUPPORTED_DATA_TYPES.values(): if np_t == np_data_type: return destination_type raise Error('Data type "{}" is not supported'.format(np_data_type)) def destination_type_to_np_data_type(dst_type): for np_t, _, destination_type in SUPPORTED_DATA_TYPES.values(): if destination_type == dst_type: return np_t raise Error('Destination type "{}" is not supported'.format(dst_type)) def precision_to_destination_type(data_type_str): for _, precision, destination_type in SUPPORTED_DATA_TYPES.values(): if precision == data_type_str: return destination_type raise Error('Data type "{}" is not supported'.format(data_type_str)) def convert_blob(blob: np.ndarray, dst_type: type): if blob.dtype == dst_type: return blob, None, None converted_blob = blob.astype(dtype=dst_type, casting="unsafe") if dst_type in (np.int32, np.int64, np.uint8, np.int8) and not np.array_equal(blob, converted_blob): raise Error('The conversion of blob with value "{}" to dst_type "{}" results in rounding'.format( blob, dst_type)) finite_match = (np.isfinite(blob) != np.isfinite(converted_blob)) zero_match = ((blob == 0) != (converted_blob == 0)) finite_match_count = np.count_nonzero(finite_match) zero_match_count = np.count_nonzero(zero_match) return converted_blob, finite_match_count, zero_match_count def convert_node_blobs(graph: Graph, node: Node, data_type: type): out_edges = graph.out_edges(node.node, data=True) # if the data.value is used as binary weights if any('bin' in d for _, __, d in out_edges): blob = node.value if blob.dtype != data_type: new_blob, finite_match_count, zero_match_count = convert_blob(blob, data_type) consumers = [x.name if x.has_valid('name') else '<NO NAME>' for x in node.out_nodes()] log.debug( 'Blob was converted to {} while dumping to the bin file. This blob is an input for {} nodes.'.format( data_type, consumers)) if finite_match_count: log.error( ("{} elements of {} were clipped to infinity while converting a blob for node [{}] to {}. " + refer_to_faq_msg(76)).format(finite_match_count, blob.size, consumers, data_type)) if zero_match_count: log.warning( ("{} elements of {} were clipped to zero while converting a blob for node [{}] to {}. " + refer_to_faq_msg(77)).format(zero_match_count, blob.size, consumers, data_type)) node.value = new_blob # for the constant node need to propagate the converted value to the node output because there is a fake # input data for the 'Const' nodes being generated in the CreateConstNodesReplacement if len(node.out_nodes()) == 1 and node.out_node(0).op == 'Const': const_node = node.out_node(0) const_node.value = new_blob const_node.infer(const_node) const_node.type_infer(const_node) def convert_parameters_data_type(graph: Graph, data_type_str: str): inputs = graph.get_op_nodes(op='Parameter') data_type = data_type_str_to_np(data_type_str) user_defined_data_types = graph.graph['user_shapes'] if 'user_shapes' in graph.graph else None for input in inputs: user_defined_type = None name = input.soft_get('initial_node_name', input.id) # override data type for Parameter specified by the user. This is a workaround for the issue in the # extensions.middle.ChangePlaceholderTypes transformation which has an incorrect condition and always overrides # Parameter data type to np.float32. When the transformation is fixed the code below must be updated if user_defined_data_types is not None and name in user_defined_data_types: for desc in user_defined_data_types[name]: if 'port' in desc and desc['port'] is None: # neither input nor output port specified user_defined_type = desc.get('data_type', None) else: # need to check the particular port the Parameter was created for p_name = get_new_placeholder_name(name, 'out' in desc, desc['out'] if 'out' in desc else desc['in']) if p_name == input.soft_get('name'): user_defined_type = desc.get('data_type', None) if user_defined_type is not None: log.info('Overriding Parameter node {} data type to {}'.format(name, user_defined_type)) input['data_type'] = user_defined_type input.out_port(0).set_data_type(user_defined_type, True) elif not input.has_valid('data_type') or input.data_type == np.float32: input['data_type'] = data_type input.out_port(0).set_data_type(data_type, True) else: log.info('Do not change data type for node {}'.format(input.soft_get('name'))) def convert_blobs(graph: Graph, data_type_str: str): for node in graph.get_data_nodes(): if node.value is not None: try: if node.value.dtype in [np.float32, np.float64, np.float16] and not node.has_and_set('correct_data_type'): convert_node_blobs(graph, node, data_type_str_to_np(data_type_str)) except Exception as e: raise Error('Coudn\'t convert blob {}, details: {}', node.soft_get('name'), e) from e
42.89071
122
0.659829
import logging as log import numpy as np from openvino.tools.mo.front.extractor import get_new_placeholder_name from openvino.tools.mo.graph.graph import Node, Graph from openvino.tools.mo.utils.error import Error from openvino.tools.mo.utils.utils import refer_to_faq_msg class packed_U1(np.generic): pass class packed_U4(np.generic): pass class packed_I4(np.generic): pass SUPPORTED_DATA_TYPES = { 'float': (np.float32, 'FP32', 'f32'), 'half': (np.float16, 'FP16', 'f16'), 'FP32': (np.float32, 'FP32', 'f32'), 'FP64': (np.float64, 'FP64', 'f64'), 'FP16': (np.float16, 'FP16', 'f16'), 'I32': (np.int32, 'I32', 'i32'), 'I64': (np.int64, 'I64', 'i64'), 'int8': (np.int8, 'I8', 'i8'), 'int32': (np.int32, 'I32', 'i32'), 'int64': (np.int64, 'I64', 'i64'), 'bool': (np.bool, 'BOOL', 'boolean'), 'uint8': (np.uint8, 'U8', 'u8'), 'uint32': (np.uint32, 'U32', 'u32'), 'uint64': (np.uint64, 'U64', 'u64'), 'U1': (packed_U1, 'U1', 'u1'), 'int4': (packed_I4, 'I4', 'i4'), 'uint4': (packed_U4, 'U4', 'u4'), 'I4': (packed_I4, 'I4', 'i4'), 'U4': (packed_U4, 'U4', 'u4'), } def data_type_str_to_np(data_type_str: str): return SUPPORTED_DATA_TYPES[data_type_str][0] if data_type_str in SUPPORTED_DATA_TYPES else None def data_type_str_to_precision(data_type_str: str): return SUPPORTED_DATA_TYPES[data_type_str][1] if data_type_str in SUPPORTED_DATA_TYPES else None def data_type_str_to_destination_type(data_type_str: str): return SUPPORTED_DATA_TYPES[data_type_str][2] if data_type_str in SUPPORTED_DATA_TYPES else None def np_data_type_to_precision(np_data_type): for np_t, precision, _ in SUPPORTED_DATA_TYPES.values(): if np_t == np_data_type: return precision raise Error('Data type "{}" is not supported'.format(np_data_type)) def np_data_type_to_destination_type(np_data_type): for np_t, _, destination_type in SUPPORTED_DATA_TYPES.values(): if np_t == np_data_type: return destination_type raise Error('Data type "{}" is not supported'.format(np_data_type)) def destination_type_to_np_data_type(dst_type): for np_t, _, destination_type in SUPPORTED_DATA_TYPES.values(): if destination_type == dst_type: return np_t raise Error('Destination type "{}" is not supported'.format(dst_type)) def precision_to_destination_type(data_type_str): for _, precision, destination_type in SUPPORTED_DATA_TYPES.values(): if precision == data_type_str: return destination_type raise Error('Data type "{}" is not supported'.format(data_type_str)) def convert_blob(blob: np.ndarray, dst_type: type): if blob.dtype == dst_type: return blob, None, None converted_blob = blob.astype(dtype=dst_type, casting="unsafe") if dst_type in (np.int32, np.int64, np.uint8, np.int8) and not np.array_equal(blob, converted_blob): raise Error('The conversion of blob with value "{}" to dst_type "{}" results in rounding'.format( blob, dst_type)) finite_match = (np.isfinite(blob) != np.isfinite(converted_blob)) zero_match = ((blob == 0) != (converted_blob == 0)) finite_match_count = np.count_nonzero(finite_match) zero_match_count = np.count_nonzero(zero_match) return converted_blob, finite_match_count, zero_match_count def convert_node_blobs(graph: Graph, node: Node, data_type: type): out_edges = graph.out_edges(node.node, data=True) if any('bin' in d for _, __, d in out_edges): blob = node.value if blob.dtype != data_type: new_blob, finite_match_count, zero_match_count = convert_blob(blob, data_type) consumers = [x.name if x.has_valid('name') else '<NO NAME>' for x in node.out_nodes()] log.debug( 'Blob was converted to {} while dumping to the bin file. This blob is an input for {} nodes.'.format( data_type, consumers)) if finite_match_count: log.error( ("{} elements of {} were clipped to infinity while converting a blob for node [{}] to {}. " + refer_to_faq_msg(76)).format(finite_match_count, blob.size, consumers, data_type)) if zero_match_count: log.warning( ("{} elements of {} were clipped to zero while converting a blob for node [{}] to {}. " + refer_to_faq_msg(77)).format(zero_match_count, blob.size, consumers, data_type)) node.value = new_blob if len(node.out_nodes()) == 1 and node.out_node(0).op == 'Const': const_node = node.out_node(0) const_node.value = new_blob const_node.infer(const_node) const_node.type_infer(const_node) def convert_parameters_data_type(graph: Graph, data_type_str: str): inputs = graph.get_op_nodes(op='Parameter') data_type = data_type_str_to_np(data_type_str) user_defined_data_types = graph.graph['user_shapes'] if 'user_shapes' in graph.graph else None for input in inputs: user_defined_type = None name = input.soft_get('initial_node_name', input.id) if user_defined_data_types is not None and name in user_defined_data_types: for desc in user_defined_data_types[name]: if 'port' in desc and desc['port'] is None: user_defined_type = desc.get('data_type', None) else: p_name = get_new_placeholder_name(name, 'out' in desc, desc['out'] if 'out' in desc else desc['in']) if p_name == input.soft_get('name'): user_defined_type = desc.get('data_type', None) if user_defined_type is not None: log.info('Overriding Parameter node {} data type to {}'.format(name, user_defined_type)) input['data_type'] = user_defined_type input.out_port(0).set_data_type(user_defined_type, True) elif not input.has_valid('data_type') or input.data_type == np.float32: input['data_type'] = data_type input.out_port(0).set_data_type(data_type, True) else: log.info('Do not change data type for node {}'.format(input.soft_get('name'))) def convert_blobs(graph: Graph, data_type_str: str): for node in graph.get_data_nodes(): if node.value is not None: try: if node.value.dtype in [np.float32, np.float64, np.float16] and not node.has_and_set('correct_data_type'): convert_node_blobs(graph, node, data_type_str_to_np(data_type_str)) except Exception as e: raise Error('Coudn\'t convert blob {}, details: {}', node.soft_get('name'), e) from e
true
true
f71e59893a5ea3504751b1c52828d7f9e9fbe96e
3,718
py
Python
python/lib/packet/path_mgmt/rev_info.py
stschwar/scion
f15933081b4947ed46a032d34e9b9c563f2989c4
[ "Apache-2.0" ]
null
null
null
python/lib/packet/path_mgmt/rev_info.py
stschwar/scion
f15933081b4947ed46a032d34e9b9c563f2989c4
[ "Apache-2.0" ]
null
null
null
python/lib/packet/path_mgmt/rev_info.py
stschwar/scion
f15933081b4947ed46a032d34e9b9c563f2989c4
[ "Apache-2.0" ]
null
null
null
# Copyright 2015 ETH Zurich # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ :mod:`rev_info` --- Revocation info payload ============================================ """ # Stdlib import logging # External import capnp # noqa # SCION import proto.rev_info_capnp as P from lib.defines import HASHTREE_EPOCH_TIME from lib.errors import SCIONBaseError from lib.packet.packet_base import Cerealizable from lib.packet.scion_addr import ISD_AS class RevInfoValidationError(SCIONBaseError): """Validation of RevInfo failed""" class RevocationInfo(Cerealizable): """ Class containing revocation information, i.e., the revocation token. """ NAME = "RevocationInfo" P_CLS = P.RevInfo @classmethod def from_values(cls, isd_as, if_id, epoch, nonce, siblings, prev_root, next_root, hash_type, tree_ttl): """ Returns a RevocationInfo object with the specified values. :param ISD_AS isd_as: The ISD_AS of the issuer of the revocation. :param int if_id: ID of the interface to be revoked :param int epoch: Time epoch for which interface is to be revoked :param bytes nonce: Nonce for the (if_id, epoch) leaf in the hashtree :param list[(bool, bytes)] siblings: Positions and hashes of siblings :param bytes prev_root: Hash of the tree root at time T-1 :param bytes next_root: Hash of the tree root at time T+1 :param int hash_type: The hash function needed to verify the revocation. :param int tree_ttl: The validity period of the revocation tree. """ # Put the isd_as, if_id, epoch and nonce of the leaf into the proof. p = cls.P_CLS.new_message(isdas=int(isd_as), ifID=if_id, epoch=epoch, nonce=nonce, hashType=hash_type, treeTTL=tree_ttl) # Put the list of sibling hashes (along with l/r) into the proof. sibs = p.init('siblings', len(siblings)) for i, sibling in enumerate(siblings): sibs[i].isLeft, sibs[i].hash = sibling # Put the roots of the hash trees at T-1 and T+1. p.prevRoot = prev_root p.nextRoot = next_root return cls(p) def isd_as(self): return ISD_AS(self.p.isdas) def validate(self): if self.p.ifID == 0: raise RevInfoValidationError("Invalid ifID: %d" % self.p.ifID) if self.p.treeTTL == 0 or (self.p.treeTTL % HASHTREE_EPOCH_TIME != 0): raise RevInfoValidationError("Invalid TreeTTL: %d" % self.p.treeTTL) self.isd_as() def cmp_str(self): b = [] b.append(self.p.isdas.to_bytes(8, 'big')) b.append(self.p.ifID.to_bytes(8, 'big')) b.append(self.p.epoch.to_bytes(8, 'big')) b.append(self.p.nonce) return b"".join(b) def __eq__(self, other): if other is None: logging.error("Other RevInfo object is None.") return False return self.cmp_str() == other.cmp_str() def __hash__(self): return hash(self.cmp_str()) def short_desc(self): return "RevInfo: %s IF: %d EPOCH: %d TreeTTL: %d" % ( self.isd_as(), self.p.ifID, self.p.epoch, self.p.treeTTL)
37.18
84
0.649274
import logging import capnp import proto.rev_info_capnp as P from lib.defines import HASHTREE_EPOCH_TIME from lib.errors import SCIONBaseError from lib.packet.packet_base import Cerealizable from lib.packet.scion_addr import ISD_AS class RevInfoValidationError(SCIONBaseError): class RevocationInfo(Cerealizable): NAME = "RevocationInfo" P_CLS = P.RevInfo @classmethod def from_values(cls, isd_as, if_id, epoch, nonce, siblings, prev_root, next_root, hash_type, tree_ttl): p = cls.P_CLS.new_message(isdas=int(isd_as), ifID=if_id, epoch=epoch, nonce=nonce, hashType=hash_type, treeTTL=tree_ttl) sibs = p.init('siblings', len(siblings)) for i, sibling in enumerate(siblings): sibs[i].isLeft, sibs[i].hash = sibling p.prevRoot = prev_root p.nextRoot = next_root return cls(p) def isd_as(self): return ISD_AS(self.p.isdas) def validate(self): if self.p.ifID == 0: raise RevInfoValidationError("Invalid ifID: %d" % self.p.ifID) if self.p.treeTTL == 0 or (self.p.treeTTL % HASHTREE_EPOCH_TIME != 0): raise RevInfoValidationError("Invalid TreeTTL: %d" % self.p.treeTTL) self.isd_as() def cmp_str(self): b = [] b.append(self.p.isdas.to_bytes(8, 'big')) b.append(self.p.ifID.to_bytes(8, 'big')) b.append(self.p.epoch.to_bytes(8, 'big')) b.append(self.p.nonce) return b"".join(b) def __eq__(self, other): if other is None: logging.error("Other RevInfo object is None.") return False return self.cmp_str() == other.cmp_str() def __hash__(self): return hash(self.cmp_str()) def short_desc(self): return "RevInfo: %s IF: %d EPOCH: %d TreeTTL: %d" % ( self.isd_as(), self.p.ifID, self.p.epoch, self.p.treeTTL)
true
true
f71e5c0ef766848ef073a7722f2396d351009ea4
11,159
py
Python
lib/models.py
prkriley/neurips2019_intrus
3e36930246347e6b80a583d2ab378054ea3b9f7a
[ "MIT" ]
18
2019-11-04T06:43:47.000Z
2021-10-04T15:02:52.000Z
lib/models.py
prkriley/neurips2019_intrus
3e36930246347e6b80a583d2ab378054ea3b9f7a
[ "MIT" ]
9
2019-11-25T06:35:20.000Z
2022-02-09T23:32:20.000Z
lib/models.py
prkriley/neurips2019_intrus
3e36930246347e6b80a583d2ab378054ea3b9f7a
[ "MIT" ]
5
2020-01-24T09:12:58.000Z
2021-10-04T20:14:11.000Z
""" Transformer encoder / decoder layer chain """ import numpy as np import tensorflow as tf import lib.layers from . import layers, ops from .data import linelen class Transformer: def __init__( self, name, inp_voc, out_voc, logits_bias=False, share_emb=False, dst_rand_offset=False, rescale_emb=True, inp_emb_bias=False, emb_inp_device='', emb_out_device='', **kwargs ): """ Transformer-based model that predicts logp(insert(i, token) | x, y) :type inp_voc: lib.voc.Voc :type out_voc: lib.voc.Voc :param logits_bias: if True, final logits layer has bias term. :param share_emb: if True, input and output embeddings will use the same matrix. Useful for in case of shared vocabularies or when there is a :param dst_rand_offset: if True, adds a random offset to output embeddings, same for all positions :param kwargs: other hyperparameters - see TransformerChain and TransformerEmbedding """ self.name = name self.inp_voc, self.out_voc = inp_voc, out_voc self.dst_rand_offset = dst_rand_offset self.hp = kwargs emb_size = kwargs.get('emb_size', kwargs.get('hid_size', 512)) max_voc_size = max(len(inp_voc), len(out_voc)) with tf.variable_scope(self.name) as self.scope: # Embeddings self.emb_inp = layers.TransformerEmbedding( 'emb_inp', max_voc_size if share_emb else len(inp_voc), emb_size, bias=inp_emb_bias, rescale=rescale_emb, device=emb_inp_device) self.emb_out = layers.TransformerEmbedding( 'emb_out', max_voc_size if share_emb else len(out_voc), emb_size, matrix=self.emb_inp.emb.mat if share_emb else None, rescale=rescale_emb, device=emb_out_device) # Model body self.encoder = layers.TransformerChain('enc', **kwargs) self.decoder = layers.TransformerChain('dec', attn_inputs=['enc'], **kwargs) # logits: token insertions plus one extra logit to predict position where to insert self.logits = layers.Dense( 'logits', kwargs['hid_size'], len(out_voc) + 1, matrix=tf.transpose(self.emb_out.emb.mat) if kwargs.get('dwwt', False) else None, bias=None if logits_bias else 0 ) def _get_batch_sample(self): """ A minimal example of model input data """ return [("i saw a cat", "i write the code")] def make_encoder_batch_ph(self): return { 'inp': tf.placeholder('int32', [None, None]), 'inp_len': tf.placeholder('int32', [None]) } def make_feed_dict(self, batch, **kwargs): """ Take input data strings, return a dict { key: np.array(value) } """ inp_lines, out_lines = zip(*batch) inp_len = [linelen(line) for line in inp_lines] out_len = [linelen(line) for line in out_lines] return { 'inp': self.inp_voc.to_matrix(inp_lines), 'inp_len': np.array(inp_len, 'int32'), 'out': self.out_voc.to_matrix(out_lines), 'out_len': np.array(out_len, 'int32') } def encode(self, batch, is_train): """ Take placeholders for data batch, return encoder state """ with tf.name_scope(self.name), ops.dropout_scope(is_train): inp = batch['inp'] # [batch_size * ninp] inp_len = batch.get('inp_len', ops.infer_length(inp, self.inp_voc.eos)) # [batch] attn_mask = ops.make_attn_mask(inp, inp_len) # [batch_size, 1, 1, ninp] out, _ = self.encoder(self.emb_inp(inp), self_attn_mask=attn_mask) # ^-- [batch_size, ninp, hid_size] return dict(out=out, attn_mask=attn_mask) def compute_action_logprobs(self, batch, is_train, enc=None, temperature=None): """ Compute log-probabilities for all possible actions (aka agent policy) :param batch: a dict with - token matrix 'out'[batch_size, output_length] - optional length vector out_len[batch_size] :param is_train: whether or not to use training behavior (e.g. dropout) :returns: {'insert':logp(insert(i, c) | x, y), 'finish':logp(terminate| x, y)} """ enc = self.encode(batch, is_train) if enc is None else enc with tf.name_scope(self.name), ops.dropout_scope(is_train): out = batch['out'] # partial translation, shape: [batch_size * nout] out_len = batch.get('out_len', ops.infer_length(out, self.out_voc.eos)) # [batch] # embedding. Note: at this point, a special "zero" vector is added # to the first position hence length is increased by 1 out_padded = tf.concat([tf.zeros_like(out[:, :1]), out], axis=1) # [batch_size, nout+1] dec_emb = self.emb_out(out_padded, offset='random' if self.dst_rand_offset else 0) # ^-- shape: [batch_size, nout + 1] # run decoder attn_mask = ops.make_attn_mask(out_padded, out_len + 1) # [batch_size, 1, 1, nout + 1] dec_out, _ = self.decoder(dec_emb, self_attn_mask=attn_mask, enc_out=enc['out'], enc_attn_mask=enc['attn_mask']) # ^-- [batch_size, nout + 1, hid_size] logits = self.logits(dec_out) # [batch_size, nout + 1, voc_size + 1] if temperature is not None: logits /= temperature # compute log-probabilities for actions # position log-probabilities, logP(insert(pos, *) | ...) # used to predict position of next insert and termination condition (EOS) position_logits = logits[:, :, -1] # [batch_size, nout + 1] position_mask = tf.cast(attn_mask, tf.bool)[:, 0, 0, :] # [batch_size, nout + 1] position_logits = tf.where(position_mask, position_logits, tf.fill(tf.shape(position_logits), -1e9)) position_logp = tf.nn.log_softmax(position_logits, axis=-1) # [batch_size, n_out] # two actions: insert - at any non-EOS position - or finish - defined as inserting at EOS finish_logp = tf.gather_nd(position_logp, tf.stack([tf.range(tf.shape(out_len)[0]), out_len], axis=1)) # ^-- [batch_size] insert_position_logp = tf.where(position_mask[:, 1:], position_logp[:, :-1], tf.fill(tf.shape(position_logp[:, :-1]), -1e9)) # ^-- [batch_size, nout] # insertion log-probabilities: # logP(insert(pos, tok) | ...) = logP(insert(pos, *) | ...) + logP(insert(pos, tok) | insert(pos, *), ...) token_logits = logits[:, :-1, :len(self.out_voc)] # [batch_size, n_out, voc_size] token_logp_given_position = tf.nn.log_softmax(token_logits, axis=-1) # note: we do not need mask on token_logp_given_position cuz mask is already applied to insert_position_logp insert_logp = insert_position_logp[:, :, None] + token_logp_given_position return { # group 1 (exps sum to 1) 'insert': insert_logp, # [batch_size, nout, voc_size] 'finish': finish_logp, # [batch_size] } class ImgToSeqTransformer(Transformer): def __init__( self, name, out_voc, inp_w, inp_h, inp_channels=3, make_encoder=lib.layers.ImageEncoder, logits_bias=False, share_emb=False, dst_rand_offset=False, rescale_emb=True, emb_out_device='', **kwargs ): """ Transformer-based model that predicts logp(insert(i, token) | x, y) :type out_voc: lib.voc.Voc :param logits_bias: if True, final logits layer has bias term. :param dst_rand_offset: if True, adds a random offset to output embeddings, same for all positions :param kwargs: other hyperparameters - see TransformerChain and TransformerEmbedding """ self.name = name self.inp_voc, self.out_voc = out_voc, out_voc # inp voc is a stub, the same as out_voc self.dst_rand_offset = dst_rand_offset self.hp = kwargs self.w = inp_w self.h = inp_h self.inp_channels = inp_channels emb_size = kwargs.get('emb_size', kwargs.get('hid_size', 512)) max_voc_size = len(out_voc) with tf.variable_scope(self.name) as self.scope: # Embeddings self.emb_out = layers.TransformerEmbedding( 'emb_out', max_voc_size if share_emb else len(out_voc), emb_size, matrix=self.emb_inp.emb.mat if share_emb else None, rescale=rescale_emb, device=emb_out_device) # Model body self.encoder = make_encoder('enc', inp_h=inp_w, inp_w=inp_h, inp_channels=inp_channels, **kwargs) enc_out_shape = self.encode(self.make_encoder_batch_ph(), True)['out'].shape assert enc_out_shape.ndims == 3 and enc_out_shape[-1].value is not None, \ "encoder output shape must be a 3d tensor with fixed num units, " \ "got shape {}".format(enc_out_shape) self.decoder = layers.TransformerChain('dec', attn_inputs=['enc'], attn_input_sizes={'enc': enc_out_shape[-1].value}, **kwargs) # logits: token insertions plus one extra logit to predict position where to insert self.logits = layers.Dense( 'logits', kwargs['hid_size'], len(out_voc) + 1, bias=None if logits_bias else 0 ) def _get_batch_sample(self): """ A minimal example of model input data """ return [(np.zeros((self.h, self.w, self.inp_channels)), 'A cat sat')] def make_feed_dict(self, batch, **kwargs): """ Take input data strings, return a dict { key: np.array(value) } """ inp_imgs, out_lines = zip(*batch) out_len = [linelen(line) for line in out_lines] return { 'inp': np.array(inp_imgs, 'float32'), 'out': self.out_voc.to_matrix(out_lines), 'out_len': np.array(out_len, 'int32') } def make_encoder_batch_ph(self): return { 'inp': tf.placeholder('float32', [None, self.h, self.w, self.inp_channels]), } def encode(self, batch, is_train): """ Take placeholders for data batch, return encoder state """ with tf.name_scope(self.name), ops.dropout_scope(is_train): inp = batch['inp'] # [batch_size * ninp] out = self.encoder(inp) assert out.shape[-1] is not None out_shape = tf.shape(out) out = tf.reshape(out, [out_shape[0], -1, out.shape[-1]]) attn_mask = tf.ones((out_shape[0], 1, 1, out_shape[1] * out_shape[2])) # [batch_size, 1, 1, ninp] return dict(out=out, attn_mask=attn_mask)
45.546939
120
0.595663
import numpy as np import tensorflow as tf import lib.layers from . import layers, ops from .data import linelen class Transformer: def __init__( self, name, inp_voc, out_voc, logits_bias=False, share_emb=False, dst_rand_offset=False, rescale_emb=True, inp_emb_bias=False, emb_inp_device='', emb_out_device='', **kwargs ): self.name = name self.inp_voc, self.out_voc = inp_voc, out_voc self.dst_rand_offset = dst_rand_offset self.hp = kwargs emb_size = kwargs.get('emb_size', kwargs.get('hid_size', 512)) max_voc_size = max(len(inp_voc), len(out_voc)) with tf.variable_scope(self.name) as self.scope: self.emb_inp = layers.TransformerEmbedding( 'emb_inp', max_voc_size if share_emb else len(inp_voc), emb_size, bias=inp_emb_bias, rescale=rescale_emb, device=emb_inp_device) self.emb_out = layers.TransformerEmbedding( 'emb_out', max_voc_size if share_emb else len(out_voc), emb_size, matrix=self.emb_inp.emb.mat if share_emb else None, rescale=rescale_emb, device=emb_out_device) self.encoder = layers.TransformerChain('enc', **kwargs) self.decoder = layers.TransformerChain('dec', attn_inputs=['enc'], **kwargs) self.logits = layers.Dense( 'logits', kwargs['hid_size'], len(out_voc) + 1, matrix=tf.transpose(self.emb_out.emb.mat) if kwargs.get('dwwt', False) else None, bias=None if logits_bias else 0 ) def _get_batch_sample(self): return [("i saw a cat", "i write the code")] def make_encoder_batch_ph(self): return { 'inp': tf.placeholder('int32', [None, None]), 'inp_len': tf.placeholder('int32', [None]) } def make_feed_dict(self, batch, **kwargs): inp_lines, out_lines = zip(*batch) inp_len = [linelen(line) for line in inp_lines] out_len = [linelen(line) for line in out_lines] return { 'inp': self.inp_voc.to_matrix(inp_lines), 'inp_len': np.array(inp_len, 'int32'), 'out': self.out_voc.to_matrix(out_lines), 'out_len': np.array(out_len, 'int32') } def encode(self, batch, is_train): with tf.name_scope(self.name), ops.dropout_scope(is_train): inp = batch['inp'] inp_len = batch.get('inp_len', ops.infer_length(inp, self.inp_voc.eos)) attn_mask = ops.make_attn_mask(inp, inp_len) out, _ = self.encoder(self.emb_inp(inp), self_attn_mask=attn_mask) return dict(out=out, attn_mask=attn_mask) def compute_action_logprobs(self, batch, is_train, enc=None, temperature=None): enc = self.encode(batch, is_train) if enc is None else enc with tf.name_scope(self.name), ops.dropout_scope(is_train): out = batch['out'] out_len = batch.get('out_len', ops.infer_length(out, self.out_voc.eos)) out_padded = tf.concat([tf.zeros_like(out[:, :1]), out], axis=1) dec_emb = self.emb_out(out_padded, offset='random' if self.dst_rand_offset else 0) attn_mask = ops.make_attn_mask(out_padded, out_len + 1) dec_out, _ = self.decoder(dec_emb, self_attn_mask=attn_mask, enc_out=enc['out'], enc_attn_mask=enc['attn_mask']) logits = self.logits(dec_out) if temperature is not None: logits /= temperature position_logits = logits[:, :, -1] position_mask = tf.cast(attn_mask, tf.bool)[:, 0, 0, :] position_logits = tf.where(position_mask, position_logits, tf.fill(tf.shape(position_logits), -1e9)) position_logp = tf.nn.log_softmax(position_logits, axis=-1) finish_logp = tf.gather_nd(position_logp, tf.stack([tf.range(tf.shape(out_len)[0]), out_len], axis=1)) insert_position_logp = tf.where(position_mask[:, 1:], position_logp[:, :-1], tf.fill(tf.shape(position_logp[:, :-1]), -1e9)) token_logits = logits[:, :-1, :len(self.out_voc)] token_logp_given_position = tf.nn.log_softmax(token_logits, axis=-1) insert_logp = insert_position_logp[:, :, None] + token_logp_given_position return { 'insert': insert_logp, 'finish': finish_logp, } class ImgToSeqTransformer(Transformer): def __init__( self, name, out_voc, inp_w, inp_h, inp_channels=3, make_encoder=lib.layers.ImageEncoder, logits_bias=False, share_emb=False, dst_rand_offset=False, rescale_emb=True, emb_out_device='', **kwargs ): self.name = name self.inp_voc, self.out_voc = out_voc, out_voc self.dst_rand_offset = dst_rand_offset self.hp = kwargs self.w = inp_w self.h = inp_h self.inp_channels = inp_channels emb_size = kwargs.get('emb_size', kwargs.get('hid_size', 512)) max_voc_size = len(out_voc) with tf.variable_scope(self.name) as self.scope: self.emb_out = layers.TransformerEmbedding( 'emb_out', max_voc_size if share_emb else len(out_voc), emb_size, matrix=self.emb_inp.emb.mat if share_emb else None, rescale=rescale_emb, device=emb_out_device) self.encoder = make_encoder('enc', inp_h=inp_w, inp_w=inp_h, inp_channels=inp_channels, **kwargs) enc_out_shape = self.encode(self.make_encoder_batch_ph(), True)['out'].shape assert enc_out_shape.ndims == 3 and enc_out_shape[-1].value is not None, \ "encoder output shape must be a 3d tensor with fixed num units, " \ "got shape {}".format(enc_out_shape) self.decoder = layers.TransformerChain('dec', attn_inputs=['enc'], attn_input_sizes={'enc': enc_out_shape[-1].value}, **kwargs) self.logits = layers.Dense( 'logits', kwargs['hid_size'], len(out_voc) + 1, bias=None if logits_bias else 0 ) def _get_batch_sample(self): return [(np.zeros((self.h, self.w, self.inp_channels)), 'A cat sat')] def make_feed_dict(self, batch, **kwargs): inp_imgs, out_lines = zip(*batch) out_len = [linelen(line) for line in out_lines] return { 'inp': np.array(inp_imgs, 'float32'), 'out': self.out_voc.to_matrix(out_lines), 'out_len': np.array(out_len, 'int32') } def make_encoder_batch_ph(self): return { 'inp': tf.placeholder('float32', [None, self.h, self.w, self.inp_channels]), } def encode(self, batch, is_train): with tf.name_scope(self.name), ops.dropout_scope(is_train): inp = batch['inp'] out = self.encoder(inp) assert out.shape[-1] is not None out_shape = tf.shape(out) out = tf.reshape(out, [out_shape[0], -1, out.shape[-1]]) attn_mask = tf.ones((out_shape[0], 1, 1, out_shape[1] * out_shape[2])) return dict(out=out, attn_mask=attn_mask)
true
true
f71e5cd99b7d4e33658c397072d56eb1f5d3bd35
11,969
py
Python
desktop/core/ext-py/Django/django/db/backends/mysql/base.py
civascu/hue
82f2de44789ff5a981ed725175bae7944832d1e9
[ "Apache-2.0" ]
2
2021-04-27T03:57:00.000Z
2021-06-18T09:39:58.000Z
django/db/backends/mysql/base.py
joetyson/django
c3699190186561d5c216b2a77ecbfc487d42a734
[ "BSD-3-Clause" ]
null
null
null
django/db/backends/mysql/base.py
joetyson/django
c3699190186561d5c216b2a77ecbfc487d42a734
[ "BSD-3-Clause" ]
2
2021-09-06T18:44:45.000Z
2022-02-24T04:10:10.000Z
""" MySQL database backend for Django. Requires MySQLdb: http://sourceforge.net/projects/mysql-python """ import re try: import MySQLdb as Database except ImportError, e: from django.core.exceptions import ImproperlyConfigured raise ImproperlyConfigured("Error loading MySQLdb module: %s" % e) # We want version (1, 2, 1, 'final', 2) or later. We can't just use # lexicographic ordering in this check because then (1, 2, 1, 'gamma') # inadvertently passes the version test. version = Database.version_info if (version < (1,2,1) or (version[:3] == (1, 2, 1) and (len(version) < 5 or version[3] != 'final' or version[4] < 2))): from django.core.exceptions import ImproperlyConfigured raise ImproperlyConfigured("MySQLdb-1.2.1p2 or newer is required; you have %s" % Database.__version__) from MySQLdb.converters import conversions from MySQLdb.constants import FIELD_TYPE, FLAG, CLIENT from django.db.backends import * from django.db.backends.signals import connection_created from django.db.backends.mysql.client import DatabaseClient from django.db.backends.mysql.creation import DatabaseCreation from django.db.backends.mysql.introspection import DatabaseIntrospection from django.db.backends.mysql.validation import DatabaseValidation from django.utils.safestring import SafeString, SafeUnicode # Raise exceptions for database warnings if DEBUG is on from django.conf import settings if settings.DEBUG: from warnings import filterwarnings filterwarnings("error", category=Database.Warning) DatabaseError = Database.DatabaseError IntegrityError = Database.IntegrityError # MySQLdb-1.2.1 returns TIME columns as timedelta -- they are more like # timedelta in terms of actual behavior as they are signed and include days -- # and Django expects time, so we still need to override that. We also need to # add special handling for SafeUnicode and SafeString as MySQLdb's type # checking is too tight to catch those (see Django ticket #6052). django_conversions = conversions.copy() django_conversions.update({ FIELD_TYPE.TIME: util.typecast_time, FIELD_TYPE.DECIMAL: util.typecast_decimal, FIELD_TYPE.NEWDECIMAL: util.typecast_decimal, }) # This should match the numerical portion of the version numbers (we can treat # versions like 5.0.24 and 5.0.24a as the same). Based on the list of version # at http://dev.mysql.com/doc/refman/4.1/en/news.html and # http://dev.mysql.com/doc/refman/5.0/en/news.html . server_version_re = re.compile(r'(\d{1,2})\.(\d{1,2})\.(\d{1,2})') # MySQLdb-1.2.1 and newer automatically makes use of SHOW WARNINGS on # MySQL-4.1 and newer, so the MysqlDebugWrapper is unnecessary. Since the # point is to raise Warnings as exceptions, this can be done with the Python # warning module, and this is setup when the connection is created, and the # standard util.CursorDebugWrapper can be used. Also, using sql_mode # TRADITIONAL will automatically cause most warnings to be treated as errors. class CursorWrapper(object): """ A thin wrapper around MySQLdb's normal cursor class so that we can catch particular exception instances and reraise them with the right types. Implemented as a wrapper, rather than a subclass, so that we aren't stuck to the particular underlying representation returned by Connection.cursor(). """ codes_for_integrityerror = (1048,) def __init__(self, cursor): self.cursor = cursor def execute(self, query, args=None): try: return self.cursor.execute(query, args) except Database.OperationalError, e: # Map some error codes to IntegrityError, since they seem to be # misclassified and Django would prefer the more logical place. if e[0] in self.codes_for_integrityerror: raise Database.IntegrityError(tuple(e)) raise def executemany(self, query, args): try: return self.cursor.executemany(query, args) except Database.OperationalError, e: # Map some error codes to IntegrityError, since they seem to be # misclassified and Django would prefer the more logical place. if e[0] in self.codes_for_integrityerror: raise Database.IntegrityError(tuple(e)) raise def __getattr__(self, attr): if attr in self.__dict__: return self.__dict__[attr] else: return getattr(self.cursor, attr) def __iter__(self): return iter(self.cursor) class DatabaseFeatures(BaseDatabaseFeatures): empty_fetchmany_value = () update_can_self_select = False allows_group_by_pk = True related_fields_match_type = True class DatabaseOperations(BaseDatabaseOperations): def date_extract_sql(self, lookup_type, field_name): # http://dev.mysql.com/doc/mysql/en/date-and-time-functions.html if lookup_type == 'week_day': # DAYOFWEEK() returns an integer, 1-7, Sunday=1. # Note: WEEKDAY() returns 0-6, Monday=0. return "DAYOFWEEK(%s)" % field_name else: return "EXTRACT(%s FROM %s)" % (lookup_type.upper(), field_name) def date_trunc_sql(self, lookup_type, field_name): fields = ['year', 'month', 'day', 'hour', 'minute', 'second'] format = ('%%Y-', '%%m', '-%%d', ' %%H:', '%%i', ':%%s') # Use double percents to escape. format_def = ('0000-', '01', '-01', ' 00:', '00', ':00') try: i = fields.index(lookup_type) + 1 except ValueError: sql = field_name else: format_str = ''.join([f for f in format[:i]] + [f for f in format_def[i:]]) sql = "CAST(DATE_FORMAT(%s, '%s') AS DATETIME)" % (field_name, format_str) return sql def drop_foreignkey_sql(self): return "DROP FOREIGN KEY" def force_no_ordering(self): """ "ORDER BY NULL" prevents MySQL from implicitly ordering by grouped columns. If no ordering would otherwise be applied, we don't want any implicit sorting going on. """ return ["NULL"] def fulltext_search_sql(self, field_name): return 'MATCH (%s) AGAINST (%%s IN BOOLEAN MODE)' % field_name def no_limit_value(self): # 2**64 - 1, as recommended by the MySQL documentation return 18446744073709551615L def quote_name(self, name): if name.startswith("`") and name.endswith("`"): return name # Quoting once is enough. return "`%s`" % name def random_function_sql(self): return 'RAND()' def sql_flush(self, style, tables, sequences): # NB: The generated SQL below is specific to MySQL # 'TRUNCATE x;', 'TRUNCATE y;', 'TRUNCATE z;'... style SQL statements # to clear all tables of all data if tables: sql = ['SET FOREIGN_KEY_CHECKS = 0;'] for table in tables: sql.append('%s %s;' % (style.SQL_KEYWORD('TRUNCATE'), style.SQL_FIELD(self.quote_name(table)))) sql.append('SET FOREIGN_KEY_CHECKS = 1;') # 'ALTER TABLE table AUTO_INCREMENT = 1;'... style SQL statements # to reset sequence indices sql.extend(["%s %s %s %s %s;" % \ (style.SQL_KEYWORD('ALTER'), style.SQL_KEYWORD('TABLE'), style.SQL_TABLE(self.quote_name(sequence['table'])), style.SQL_KEYWORD('AUTO_INCREMENT'), style.SQL_FIELD('= 1'), ) for sequence in sequences]) return sql else: return [] def value_to_db_datetime(self, value): if value is None: return None # MySQL doesn't support tz-aware datetimes if value.tzinfo is not None: raise ValueError("MySQL backend does not support timezone-aware datetimes.") # MySQL doesn't support microseconds return unicode(value.replace(microsecond=0)) def value_to_db_time(self, value): if value is None: return None # MySQL doesn't support tz-aware datetimes if value.tzinfo is not None: raise ValueError("MySQL backend does not support timezone-aware datetimes.") # MySQL doesn't support microseconds return unicode(value.replace(microsecond=0)) def year_lookup_bounds(self, value): # Again, no microseconds first = '%s-01-01 00:00:00' second = '%s-12-31 23:59:59.99' return [first % value, second % value] class DatabaseWrapper(BaseDatabaseWrapper): operators = { 'exact': '= %s', 'iexact': 'LIKE %s', 'contains': 'LIKE BINARY %s', 'icontains': 'LIKE %s', 'regex': 'REGEXP BINARY %s', 'iregex': 'REGEXP %s', 'gt': '> %s', 'gte': '>= %s', 'lt': '< %s', 'lte': '<= %s', 'startswith': 'LIKE BINARY %s', 'endswith': 'LIKE BINARY %s', 'istartswith': 'LIKE %s', 'iendswith': 'LIKE %s', } def __init__(self, *args, **kwargs): super(DatabaseWrapper, self).__init__(*args, **kwargs) self.server_version = None self.features = DatabaseFeatures() self.ops = DatabaseOperations() self.client = DatabaseClient(self) self.creation = DatabaseCreation(self) self.introspection = DatabaseIntrospection(self) self.validation = DatabaseValidation() def _valid_connection(self): if self.connection is not None: try: self.connection.ping() return True except DatabaseError: self.connection.close() self.connection = None return False def _cursor(self): if not self._valid_connection(): kwargs = { 'conv': django_conversions, 'charset': 'utf8', 'use_unicode': True, } settings_dict = self.settings_dict if settings_dict['DATABASE_USER']: kwargs['user'] = settings_dict['DATABASE_USER'] if settings_dict['DATABASE_NAME']: kwargs['db'] = settings_dict['DATABASE_NAME'] if settings_dict['DATABASE_PASSWORD']: kwargs['passwd'] = settings_dict['DATABASE_PASSWORD'] if settings_dict['DATABASE_HOST'].startswith('/'): kwargs['unix_socket'] = settings_dict['DATABASE_HOST'] elif settings_dict['DATABASE_HOST']: kwargs['host'] = settings_dict['DATABASE_HOST'] if settings_dict['DATABASE_PORT']: kwargs['port'] = int(settings_dict['DATABASE_PORT']) # We need the number of potentially affected rows after an # "UPDATE", not the number of changed rows. kwargs['client_flag'] = CLIENT.FOUND_ROWS kwargs.update(settings_dict['DATABASE_OPTIONS']) self.connection = Database.connect(**kwargs) self.connection.encoders[SafeUnicode] = self.connection.encoders[unicode] self.connection.encoders[SafeString] = self.connection.encoders[str] connection_created.send(sender=self.__class__) cursor = CursorWrapper(self.connection.cursor()) return cursor def _rollback(self): try: BaseDatabaseWrapper._rollback(self) except Database.NotSupportedError: pass def get_server_version(self): if not self.server_version: if not self._valid_connection(): self.cursor() m = server_version_re.match(self.connection.get_server_info()) if not m: raise Exception('Unable to determine MySQL version from version string %r' % self.connection.get_server_info()) self.server_version = tuple([int(x) for x in m.groups()]) return self.server_version
39.50165
127
0.636728
""" MySQL database backend for Django. Requires MySQLdb: http://sourceforge.net/projects/mysql-python """ import re try: import MySQLdb as Database except ImportError, e: from django.core.exceptions import ImproperlyConfigured raise ImproperlyConfigured("Error loading MySQLdb module: %s" % e) # lexicographic ordering in this check because then (1, 2, 1, 'gamma') # inadvertently passes the version test. version = Database.version_info if (version < (1,2,1) or (version[:3] == (1, 2, 1) and (len(version) < 5 or version[3] != 'final' or version[4] < 2))): from django.core.exceptions import ImproperlyConfigured raise ImproperlyConfigured("MySQLdb-1.2.1p2 or newer is required; you have %s" % Database.__version__) from MySQLdb.converters import conversions from MySQLdb.constants import FIELD_TYPE, FLAG, CLIENT from django.db.backends import * from django.db.backends.signals import connection_created from django.db.backends.mysql.client import DatabaseClient from django.db.backends.mysql.creation import DatabaseCreation from django.db.backends.mysql.introspection import DatabaseIntrospection from django.db.backends.mysql.validation import DatabaseValidation from django.utils.safestring import SafeString, SafeUnicode # Raise exceptions for database warnings if DEBUG is on from django.conf import settings if settings.DEBUG: from warnings import filterwarnings filterwarnings("error", category=Database.Warning) DatabaseError = Database.DatabaseError IntegrityError = Database.IntegrityError # MySQLdb-1.2.1 returns TIME columns as timedelta -- they are more like # timedelta in terms of actual behavior as they are signed and include days -- # and Django expects time, so we still need to override that. We also need to # add special handling for SafeUnicode and SafeString as MySQLdb's type _conversions = conversions.copy() django_conversions.update({ FIELD_TYPE.TIME: util.typecast_time, FIELD_TYPE.DECIMAL: util.typecast_decimal, FIELD_TYPE.NEWDECIMAL: util.typecast_decimal, }) server_version_re = re.compile(r'(\d{1,2})\.(\d{1,2})\.(\d{1,2})') class CursorWrapper(object): """ A thin wrapper around MySQLdb's normal cursor class so that we can catch particular exception instances and reraise them with the right types. Implemented as a wrapper, rather than a subclass, so that we aren't stuck to the particular underlying representation returned by Connection.cursor(). """ codes_for_integrityerror = (1048,) def __init__(self, cursor): self.cursor = cursor def execute(self, query, args=None): try: return self.cursor.execute(query, args) except Database.OperationalError, e: if e[0] in self.codes_for_integrityerror: raise Database.IntegrityError(tuple(e)) raise def executemany(self, query, args): try: return self.cursor.executemany(query, args) except Database.OperationalError, e: if e[0] in self.codes_for_integrityerror: raise Database.IntegrityError(tuple(e)) raise def __getattr__(self, attr): if attr in self.__dict__: return self.__dict__[attr] else: return getattr(self.cursor, attr) def __iter__(self): return iter(self.cursor) class DatabaseFeatures(BaseDatabaseFeatures): empty_fetchmany_value = () update_can_self_select = False allows_group_by_pk = True related_fields_match_type = True class DatabaseOperations(BaseDatabaseOperations): def date_extract_sql(self, lookup_type, field_name): if lookup_type == 'week_day': return "DAYOFWEEK(%s)" % field_name else: return "EXTRACT(%s FROM %s)" % (lookup_type.upper(), field_name) def date_trunc_sql(self, lookup_type, field_name): fields = ['year', 'month', 'day', 'hour', 'minute', 'second'] format = ('%%Y-', '%%m', '-%%d', ' %%H:', '%%i', ':%%s') format_def = ('0000-', '01', '-01', ' 00:', '00', ':00') try: i = fields.index(lookup_type) + 1 except ValueError: sql = field_name else: format_str = ''.join([f for f in format[:i]] + [f for f in format_def[i:]]) sql = "CAST(DATE_FORMAT(%s, '%s') AS DATETIME)" % (field_name, format_str) return sql def drop_foreignkey_sql(self): return "DROP FOREIGN KEY" def force_no_ordering(self): """ "ORDER BY NULL" prevents MySQL from implicitly ordering by grouped columns. If no ordering would otherwise be applied, we don't want any implicit sorting going on. """ return ["NULL"] def fulltext_search_sql(self, field_name): return 'MATCH (%s) AGAINST (%%s IN BOOLEAN MODE)' % field_name def no_limit_value(self): # 2**64 - 1, as recommended by the MySQL documentation return 18446744073709551615L def quote_name(self, name): if name.startswith("`") and name.endswith("`"): return name # Quoting once is enough. return "`%s`" % name def random_function_sql(self): return 'RAND()' def sql_flush(self, style, tables, sequences): # NB: The generated SQL below is specific to MySQL # 'TRUNCATE x;', 'TRUNCATE y;', 'TRUNCATE z;'... style SQL statements # to clear all tables of all data if tables: sql = ['SET FOREIGN_KEY_CHECKS = 0;'] for table in tables: sql.append('%s %s;' % (style.SQL_KEYWORD('TRUNCATE'), style.SQL_FIELD(self.quote_name(table)))) sql.append('SET FOREIGN_KEY_CHECKS = 1;') # 'ALTER TABLE table AUTO_INCREMENT = 1;'... style SQL statements # to reset sequence indices sql.extend(["%s %s %s %s %s;" % \ (style.SQL_KEYWORD('ALTER'), style.SQL_KEYWORD('TABLE'), style.SQL_TABLE(self.quote_name(sequence['table'])), style.SQL_KEYWORD('AUTO_INCREMENT'), style.SQL_FIELD('= 1'), ) for sequence in sequences]) return sql else: return [] def value_to_db_datetime(self, value): if value is None: return None # MySQL doesn't support tz-aware datetimes if value.tzinfo is not None: raise ValueError("MySQL backend does not support timezone-aware datetimes.") return unicode(value.replace(microsecond=0)) def value_to_db_time(self, value): if value is None: return None # MySQL doesn't support tz-aware datetimes if value.tzinfo is not None: raise ValueError("MySQL backend does not support timezone-aware datetimes.") return unicode(value.replace(microsecond=0)) def year_lookup_bounds(self, value): # Again, no microseconds first = '%s-01-01 00:00:00' second = '%s-12-31 23:59:59.99' return [first % value, second % value] class DatabaseWrapper(BaseDatabaseWrapper): operators = { 'exact': '= %s', 'iexact': 'LIKE %s', 'contains': 'LIKE BINARY %s', 'icontains': 'LIKE %s', 'regex': 'REGEXP BINARY %s', 'iregex': 'REGEXP %s', 'gt': '> %s', 'gte': '>= %s', 'lt': '< %s', 'lte': '<= %s', 'startswith': 'LIKE BINARY %s', 'endswith': 'LIKE BINARY %s', 'istartswith': 'LIKE %s', 'iendswith': 'LIKE %s', } def __init__(self, *args, **kwargs): super(DatabaseWrapper, self).__init__(*args, **kwargs) self.server_version = None self.features = DatabaseFeatures() self.ops = DatabaseOperations() self.client = DatabaseClient(self) self.creation = DatabaseCreation(self) self.introspection = DatabaseIntrospection(self) self.validation = DatabaseValidation() def _valid_connection(self): if self.connection is not None: try: self.connection.ping() return True except DatabaseError: self.connection.close() self.connection = None return False def _cursor(self): if not self._valid_connection(): kwargs = { 'conv': django_conversions, 'charset': 'utf8', 'use_unicode': True, } settings_dict = self.settings_dict if settings_dict['DATABASE_USER']: kwargs['user'] = settings_dict['DATABASE_USER'] if settings_dict['DATABASE_NAME']: kwargs['db'] = settings_dict['DATABASE_NAME'] if settings_dict['DATABASE_PASSWORD']: kwargs['passwd'] = settings_dict['DATABASE_PASSWORD'] if settings_dict['DATABASE_HOST'].startswith('/'): kwargs['unix_socket'] = settings_dict['DATABASE_HOST'] elif settings_dict['DATABASE_HOST']: kwargs['host'] = settings_dict['DATABASE_HOST'] if settings_dict['DATABASE_PORT']: kwargs['port'] = int(settings_dict['DATABASE_PORT']) # We need the number of potentially affected rows after an # "UPDATE", not the number of changed rows. kwargs['client_flag'] = CLIENT.FOUND_ROWS kwargs.update(settings_dict['DATABASE_OPTIONS']) self.connection = Database.connect(**kwargs) self.connection.encoders[SafeUnicode] = self.connection.encoders[unicode] self.connection.encoders[SafeString] = self.connection.encoders[str] connection_created.send(sender=self.__class__) cursor = CursorWrapper(self.connection.cursor()) return cursor def _rollback(self): try: BaseDatabaseWrapper._rollback(self) except Database.NotSupportedError: pass def get_server_version(self): if not self.server_version: if not self._valid_connection(): self.cursor() m = server_version_re.match(self.connection.get_server_info()) if not m: raise Exception('Unable to determine MySQL version from version string %r' % self.connection.get_server_info()) self.server_version = tuple([int(x) for x in m.groups()]) return self.server_version
false
true
f71e5cfe3706fc69791aed22bc1afc781220530b
14,652
py
Python
test/torch/pointers/test_pointer_tensor.py
Prtfw/PySyft
82eede90acf09f26de389237524897e2b142f9ff
[ "Apache-2.0" ]
1
2020-04-11T06:46:49.000Z
2020-04-11T06:46:49.000Z
test/torch/pointers/test_pointer_tensor.py
haofanwang/PySyft
653d31001dbc0c611d486c6c5543fce0abf9b27d
[ "Apache-2.0" ]
1
2020-04-07T13:36:44.000Z
2020-04-07T13:36:44.000Z
test/torch/pointers/test_pointer_tensor.py
JMBehnken/PySyft
35012f5bf55628bb19761d5f40d03181fbbb1766
[ "Apache-2.0" ]
1
2020-03-11T09:52:47.000Z
2020-03-11T09:52:47.000Z
import torch import torch as th import syft from syft.frameworks.torch.tensors.interpreters.additive_shared import AdditiveSharingTensor from syft.frameworks.torch.tensors.interpreters.precision import FixedPrecisionTensor from syft.generic.pointers.pointer_tensor import PointerTensor import pytest def test_init(workers): alice, me = workers["alice"], workers["me"] pointer = PointerTensor(id=1000, location=alice, owner=me) pointer.__str__() def test_create_pointer(): x = torch.Tensor([1, 2]) x.create_pointer() def test_send_default_garbage_collector_true(workers): """ Remote tensor should be garbage collected by default on deletion of the Pointer tensor pointing to remote tensor """ alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) assert x_ptr.child.garbage_collect_data def test_send_garbage_collect_data_false(workers): """ Remote tensor should be not garbage collected on deletion of the Pointer tensor pointing to remote tensor """ alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) x_ptr.garbage_collection = False assert x_ptr.child.garbage_collect_data == False def test_send_gc_false(workers): """ Remote tensor should be not garbage collected on deletion of the Pointer tensor pointing to remote tensor """ alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) x_ptr.gc = False assert x_ptr.child.garbage_collect_data == False assert x_ptr.gc == False, "property GC is not in sync" assert x_ptr.garbage_collection == False, "property garbage_collection is not in sync" def test_send_gc_true(workers): """ Remote tensor by default is garbage collected on deletion of Pointer Tensor """ alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) assert x_ptr.gc == True def test_send_disable_gc(workers): """Pointer tensor should be not garbage collected.""" alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice).disable_gc assert x_ptr.child.garbage_collect_data == False assert x_ptr.gc == False, "property GC is not in sync" assert x_ptr.garbage_collection == False, "property garbage_collection is not in sync" def test_send_get(workers): """Test several send get usages""" bob = workers["bob"] alice = workers["alice"] # simple send x = torch.Tensor([1, 2]) x_ptr = x.send(bob) x_back = x_ptr.get() assert (x == x_back).all() # send with variable overwriting x = torch.Tensor([1, 2]) x = x.send(bob) x_back = x.get() assert (torch.Tensor([1, 2]) == x_back).all() # double send x = torch.Tensor([1, 2]) x_ptr = x.send(bob) x_ptr_ptr = x_ptr.send(alice) x_ptr_back = x_ptr_ptr.get() x_back_back = x_ptr_back.get() assert (x == x_back_back).all() # double send with variable overwriting x = torch.Tensor([1, 2]) x = x.send(bob) x = x.send(alice) x = x.get() x_back = x.get() assert (torch.Tensor([1, 2]) == x_back).all() # chained double send x = torch.Tensor([1, 2]) x = x.send(bob).send(alice) x_back = x.get().get() assert (torch.Tensor([1, 2]) == x_back).all() def test_inplace_send_get(workers): bob = workers["bob"] tensor = torch.tensor([1.0, -1.0, 3.0, 4.0]) tensor_ptr = tensor.send_(bob) assert tensor_ptr.id == tensor.id assert id(tensor_ptr) == id(tensor) tensor_back = tensor_ptr.get_() assert tensor_back.id == tensor_ptr.id assert tensor_back.id == tensor.id assert id(tensor_back) == id(tensor) assert id(tensor_back) == id(tensor) assert (tensor_back == tensor).all() def test_repeated_send(workers): """Tests that repeated calls to .send(bob) works gracefully. Previously garbage collection deleted the remote object when .send() was called twice. This test ensures the fix still works.""" bob = workers["bob"] # create tensor x = torch.Tensor([1, 2]) # send tensor to bob x_ptr = x.send(bob) # send tensor again x_ptr = x.send(bob) # ensure bob has tensor assert x.id in bob._objects def test_remote_autograd(workers): """Tests the ability to backpropagate gradients on a remote worker.""" bob = workers["bob"] # TEST: simple remote grad calculation # create a tensor x = torch.tensor([1, 2, 3, 4.0], requires_grad=True) # send tensor to bob x = x.send(bob) # do some calculation y = (x + x).sum() # backpropagate on remote machine y.backward() # check that remote gradient is correct x_grad = bob._objects[x.id_at_location].grad x_grad_target = torch.ones(4).float() + 1 assert (x_grad == x_grad_target).all() # TEST: Ensure remote grad calculation gets properly serded # create tensor x = torch.tensor([1, 2, 3, 4.0], requires_grad=True).send(bob) # compute function y = x.sum() # backpropagate y.backward() # get the gradient created from backpropagation manually x_grad = bob._objects[x.id_at_location].grad # get the entire x tensor (should bring the grad too) x = x.get() # make sure that the grads match assert (x.grad == x_grad).all() def test_gradient_send_recv(workers): """Tests that gradients are properly sent and received along with their tensors.""" bob = workers["bob"] # create a tensor x = torch.tensor([1, 2, 3, 4.0], requires_grad=True) # create gradient on tensor x.sum().backward(th.tensor(1.0)) # save gradient orig_grad = x.grad # send and get back t = x.send(bob).get() # check that gradient was properly serde assert (t.grad == orig_grad).all() def test_method_on_attribute(workers): bob = workers["bob"] # create remote object with children x = torch.Tensor([1, 2, 3]) x = syft.LoggingTensor().on(x).send(bob) # call method on data tensor directly x.child.point_to_attr = "child.child" y = x.add(x) assert isinstance(y.get(), torch.Tensor) # call method on loggingtensor directly x.child.point_to_attr = "child" y = x.add(x) y = y.get() assert isinstance(y.child, syft.LoggingTensor) # # call method on zeroth attribute # x.child.point_to_attr = "" # y = x.add(x) # y = y.get() # # assert isinstance(y, torch.Tensor) # assert isinstance(y.child, syft.LoggingTensor) # assert isinstance(y.child.child, torch.Tensor) # call .get() on pinter to attribute (should error) x.child.point_to_attr = "child" try: x.get() except syft.exceptions.CannotRequestObjectAttribute as e: assert True def test_grad_pointer(workers): """Tests the automatic creation of a .grad pointer when calling .send() on a tensor with requires_grad==True""" bob = workers["bob"] x = torch.tensor([1, 2, 3.0], requires_grad=True).send(bob) y = (x + x).sum() y.backward() assert (bob._objects[x.id_at_location].grad == torch.tensor([2, 2, 2.0])).all() def test_move(workers): alice, bob, james, me = workers["alice"], workers["bob"], workers["james"], workers["me"] x = torch.tensor([1, 2, 3, 4, 5]).send(bob) assert x.id_at_location in bob._objects assert x.id_at_location not in alice._objects x.move(alice) assert x.id_at_location in bob._objects assert x.id_at_location in alice._objects x = torch.tensor([1.0, 2, 3, 4, 5], requires_grad=True).send(bob) assert x.id_at_location in bob._objects assert x.id_at_location not in alice._objects x.move(alice) assert x.id_at_location in bob._objects assert x.id_at_location in alice._objects alice.clear_objects() bob.clear_objects() x = torch.tensor([1.0, 2, 3, 4, 5]).send(bob) x.move(alice) assert len(alice._objects) == 1 # Test .move on remote objects james.clear_objects() x = th.tensor([1.0]).send(james) remote_x = james._objects[x.id_at_location] remote_ptr = remote_x.send(bob) assert remote_ptr.id in james._objects.keys() remote_ptr2 = remote_ptr.move(alice) assert remote_ptr2.id in james._objects.keys() # Test .move back to myself alice.clear_objects() bob.clear_objects() x = torch.tensor([1.0, 2, 3, 4, 5]).send(bob) y = x.move(alice) z = y.move(me) assert (z == x).all() def test_combine_pointers(workers): """ Ensure that the sy.combine_pointers works as expected """ bob = workers["bob"] alice = workers["alice"] x = th.tensor([1, 2, 3, 4, 5]).send(bob) y = th.tensor([1, 2, 3, 4, 5]).send(alice) a = x.combine(y) b = a + a c = b.get(sum_results=True) assert (c == th.tensor([4, 8, 12, 16, 20])).all() b = a + a c = b.get(sum_results=False) assert len(c) == 2 assert (c[0] == th.tensor([2, 4, 6, 8, 10])).all def test_remote_to_cpu_device(workers): """Ensure remote .to cpu works""" device = torch.device("cpu") bob = workers["bob"] x = th.tensor([1, 2, 3, 4, 5]).send(bob) x.to(device) def test_get_remote_shape(workers): """Test pointer.shape functionality""" bob = workers["bob"] # tensor directly sent: shape stored at sending x = th.tensor([1, 2, 3, 4, 5]).send(bob) assert x.shape == torch.Size([5]) # result of an operation: need to make a call to the remote worker y = x + x assert y.shape == torch.Size([5]) def test_remote_function_with_multi_ouput(workers): """ Functions like .split return several tensors, registration and response must be made carefully in this case """ bob = workers["bob"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) r_ptr = torch.split(ptr, 2) assert (r_ptr[0].get() == torch.tensor([1, 2.0])).all() tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) max_value, argmax_idx = torch.max(ptr, 0) assert max_value.get().item() == 4.0 assert argmax_idx.get().item() == 3 def test_raising_error_when_item_func_called(workers): pointer = PointerTensor(id=1000, location=workers["alice"], owner=workers["me"]) with pytest.raises(RuntimeError): pointer.item() def test_fix_prec_on_pointer_tensor(workers): """ Ensure .fix_precision() works as expected. Also check that fix_precision() is not inplace. """ bob = workers["bob"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr_fp = ptr.fix_precision() remote_tensor = bob._objects[ptr.id_at_location] remote_fp_tensor = bob._objects[ptr_fp.id_at_location] # check that fix_precision is not inplace assert (remote_tensor == tensor).all() assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_fp_tensor.child, FixedPrecisionTensor) def test_fix_prec_on_pointer_of_pointer(workers): """ Ensure .fix_precision() works along a chain of pointers. """ bob = workers["bob"] alice = workers["alice"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.send(alice) ptr = ptr.fix_precision() alice_tensor = alice._objects[ptr.id_at_location] remote_tensor = bob._objects[alice_tensor.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor.child, FixedPrecisionTensor) def test_float_prec_on_pointer_tensor(workers): """ Ensure .float_precision() works as expected. """ bob = workers["bob"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.fix_precision() ptr = ptr.float_precision() remote_tensor = bob._objects[ptr.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor, torch.Tensor) def test_float_prec_on_pointer_of_pointer(workers): """ Ensure .float_precision() works along a chain of pointers. """ bob = workers["bob"] alice = workers["alice"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.send(alice) ptr = ptr.fix_precision() ptr = ptr.float_precision() alice_tensor = alice._objects[ptr.id_at_location] remote_tensor = bob._objects[alice_tensor.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor, torch.Tensor) def test_share_get(workers): """ Ensure .share() works as expected. """ bob = workers["bob"] tensor = torch.tensor([1, 2, 3]) ptr = tensor.send(bob) ptr = ptr.share() remote_tensor = bob._objects[ptr.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor.child, AdditiveSharingTensor) def test_registration_of_action_on_pointer_of_pointer(workers): """ Ensure actions along a chain of pointers are registered as expected. """ bob = workers["bob"] alice = workers["alice"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.send(alice) ptr_action = ptr + ptr assert len(alice._objects) == 2 assert len(bob._objects) == 2 def test_setting_back_grad_to_origin_after_send(workers): """ Calling .backward() on a tensor sent using `.send(..., requires_grad=True)` should update the origin tensor gradient """ me = workers["me"] alice = workers["alice"] with me.registration_enabled(): x = th.tensor([1.0, 2.0, 3, 4, 5], requires_grad=True) y = x + x me.register_obj(y) # registration on the local worker is sometimes buggy y_ptr = y.send(alice, requires_grad=True) z_ptr = y_ptr * 2 z = z_ptr.sum() z.backward() assert (x.grad == th.tensor([4.0, 4.0, 4.0, 4.0, 4.0])).all() def test_setting_back_grad_to_origin_after_move(workers): """ Calling .backward() on a tensor moved using `.move(..., requires_grad=True)` should update the origin tensor gradient """ me = workers["me"] bob = workers["bob"] alice = workers["alice"] with me.registration_enabled(): x = th.tensor([1.0, 2.0, 3, 4, 5], requires_grad=True) y = x + x me.register_obj(y) # registration on the local worker is sometimes buggy y_ptr = y.send(alice, requires_grad=True) z_ptr = y_ptr * 2 z_ptr2 = z_ptr.move(bob, requires_grad=True) z = z_ptr2.sum() z.backward() assert (x.grad == th.tensor([4.0, 4.0, 4.0, 4.0, 4.0])).all()
26.305206
93
0.648034
import torch import torch as th import syft from syft.frameworks.torch.tensors.interpreters.additive_shared import AdditiveSharingTensor from syft.frameworks.torch.tensors.interpreters.precision import FixedPrecisionTensor from syft.generic.pointers.pointer_tensor import PointerTensor import pytest def test_init(workers): alice, me = workers["alice"], workers["me"] pointer = PointerTensor(id=1000, location=alice, owner=me) pointer.__str__() def test_create_pointer(): x = torch.Tensor([1, 2]) x.create_pointer() def test_send_default_garbage_collector_true(workers): alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) assert x_ptr.child.garbage_collect_data def test_send_garbage_collect_data_false(workers): alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) x_ptr.garbage_collection = False assert x_ptr.child.garbage_collect_data == False def test_send_gc_false(workers): alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) x_ptr.gc = False assert x_ptr.child.garbage_collect_data == False assert x_ptr.gc == False, "property GC is not in sync" assert x_ptr.garbage_collection == False, "property garbage_collection is not in sync" def test_send_gc_true(workers): alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice) assert x_ptr.gc == True def test_send_disable_gc(workers): alice = workers["alice"] x = torch.Tensor([-1, 2]) x_ptr = x.send(alice).disable_gc assert x_ptr.child.garbage_collect_data == False assert x_ptr.gc == False, "property GC is not in sync" assert x_ptr.garbage_collection == False, "property garbage_collection is not in sync" def test_send_get(workers): bob = workers["bob"] alice = workers["alice"] x = torch.Tensor([1, 2]) x_ptr = x.send(bob) x_back = x_ptr.get() assert (x == x_back).all() x = torch.Tensor([1, 2]) x = x.send(bob) x_back = x.get() assert (torch.Tensor([1, 2]) == x_back).all() x = torch.Tensor([1, 2]) x_ptr = x.send(bob) x_ptr_ptr = x_ptr.send(alice) x_ptr_back = x_ptr_ptr.get() x_back_back = x_ptr_back.get() assert (x == x_back_back).all() x = torch.Tensor([1, 2]) x = x.send(bob) x = x.send(alice) x = x.get() x_back = x.get() assert (torch.Tensor([1, 2]) == x_back).all() x = torch.Tensor([1, 2]) x = x.send(bob).send(alice) x_back = x.get().get() assert (torch.Tensor([1, 2]) == x_back).all() def test_inplace_send_get(workers): bob = workers["bob"] tensor = torch.tensor([1.0, -1.0, 3.0, 4.0]) tensor_ptr = tensor.send_(bob) assert tensor_ptr.id == tensor.id assert id(tensor_ptr) == id(tensor) tensor_back = tensor_ptr.get_() assert tensor_back.id == tensor_ptr.id assert tensor_back.id == tensor.id assert id(tensor_back) == id(tensor) assert id(tensor_back) == id(tensor) assert (tensor_back == tensor).all() def test_repeated_send(workers): bob = workers["bob"] x = torch.Tensor([1, 2]) x_ptr = x.send(bob) x_ptr = x.send(bob) assert x.id in bob._objects def test_remote_autograd(workers): bob = workers["bob"] x = torch.tensor([1, 2, 3, 4.0], requires_grad=True) x = x.send(bob) y = (x + x).sum() y.backward() x_grad = bob._objects[x.id_at_location].grad x_grad_target = torch.ones(4).float() + 1 assert (x_grad == x_grad_target).all() x = torch.tensor([1, 2, 3, 4.0], requires_grad=True).send(bob) y = x.sum() y.backward() x_grad = bob._objects[x.id_at_location].grad x = x.get() assert (x.grad == x_grad).all() def test_gradient_send_recv(workers): bob = workers["bob"] x = torch.tensor([1, 2, 3, 4.0], requires_grad=True) x.sum().backward(th.tensor(1.0)) orig_grad = x.grad t = x.send(bob).get() assert (t.grad == orig_grad).all() def test_method_on_attribute(workers): bob = workers["bob"] x = torch.Tensor([1, 2, 3]) x = syft.LoggingTensor().on(x).send(bob) x.child.point_to_attr = "child.child" y = x.add(x) assert isinstance(y.get(), torch.Tensor) x.child.point_to_attr = "child" y = x.add(x) y = y.get() assert isinstance(y.child, syft.LoggingTensor) x.child.point_to_attr = "child" try: x.get() except syft.exceptions.CannotRequestObjectAttribute as e: assert True def test_grad_pointer(workers): bob = workers["bob"] x = torch.tensor([1, 2, 3.0], requires_grad=True).send(bob) y = (x + x).sum() y.backward() assert (bob._objects[x.id_at_location].grad == torch.tensor([2, 2, 2.0])).all() def test_move(workers): alice, bob, james, me = workers["alice"], workers["bob"], workers["james"], workers["me"] x = torch.tensor([1, 2, 3, 4, 5]).send(bob) assert x.id_at_location in bob._objects assert x.id_at_location not in alice._objects x.move(alice) assert x.id_at_location in bob._objects assert x.id_at_location in alice._objects x = torch.tensor([1.0, 2, 3, 4, 5], requires_grad=True).send(bob) assert x.id_at_location in bob._objects assert x.id_at_location not in alice._objects x.move(alice) assert x.id_at_location in bob._objects assert x.id_at_location in alice._objects alice.clear_objects() bob.clear_objects() x = torch.tensor([1.0, 2, 3, 4, 5]).send(bob) x.move(alice) assert len(alice._objects) == 1 james.clear_objects() x = th.tensor([1.0]).send(james) remote_x = james._objects[x.id_at_location] remote_ptr = remote_x.send(bob) assert remote_ptr.id in james._objects.keys() remote_ptr2 = remote_ptr.move(alice) assert remote_ptr2.id in james._objects.keys() alice.clear_objects() bob.clear_objects() x = torch.tensor([1.0, 2, 3, 4, 5]).send(bob) y = x.move(alice) z = y.move(me) assert (z == x).all() def test_combine_pointers(workers): bob = workers["bob"] alice = workers["alice"] x = th.tensor([1, 2, 3, 4, 5]).send(bob) y = th.tensor([1, 2, 3, 4, 5]).send(alice) a = x.combine(y) b = a + a c = b.get(sum_results=True) assert (c == th.tensor([4, 8, 12, 16, 20])).all() b = a + a c = b.get(sum_results=False) assert len(c) == 2 assert (c[0] == th.tensor([2, 4, 6, 8, 10])).all def test_remote_to_cpu_device(workers): device = torch.device("cpu") bob = workers["bob"] x = th.tensor([1, 2, 3, 4, 5]).send(bob) x.to(device) def test_get_remote_shape(workers): bob = workers["bob"] x = th.tensor([1, 2, 3, 4, 5]).send(bob) assert x.shape == torch.Size([5]) y = x + x assert y.shape == torch.Size([5]) def test_remote_function_with_multi_ouput(workers): bob = workers["bob"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) r_ptr = torch.split(ptr, 2) assert (r_ptr[0].get() == torch.tensor([1, 2.0])).all() tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) max_value, argmax_idx = torch.max(ptr, 0) assert max_value.get().item() == 4.0 assert argmax_idx.get().item() == 3 def test_raising_error_when_item_func_called(workers): pointer = PointerTensor(id=1000, location=workers["alice"], owner=workers["me"]) with pytest.raises(RuntimeError): pointer.item() def test_fix_prec_on_pointer_tensor(workers): bob = workers["bob"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr_fp = ptr.fix_precision() remote_tensor = bob._objects[ptr.id_at_location] remote_fp_tensor = bob._objects[ptr_fp.id_at_location] assert (remote_tensor == tensor).all() assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_fp_tensor.child, FixedPrecisionTensor) def test_fix_prec_on_pointer_of_pointer(workers): bob = workers["bob"] alice = workers["alice"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.send(alice) ptr = ptr.fix_precision() alice_tensor = alice._objects[ptr.id_at_location] remote_tensor = bob._objects[alice_tensor.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor.child, FixedPrecisionTensor) def test_float_prec_on_pointer_tensor(workers): bob = workers["bob"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.fix_precision() ptr = ptr.float_precision() remote_tensor = bob._objects[ptr.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor, torch.Tensor) def test_float_prec_on_pointer_of_pointer(workers): bob = workers["bob"] alice = workers["alice"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.send(alice) ptr = ptr.fix_precision() ptr = ptr.float_precision() alice_tensor = alice._objects[ptr.id_at_location] remote_tensor = bob._objects[alice_tensor.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor, torch.Tensor) def test_share_get(workers): bob = workers["bob"] tensor = torch.tensor([1, 2, 3]) ptr = tensor.send(bob) ptr = ptr.share() remote_tensor = bob._objects[ptr.id_at_location] assert isinstance(ptr.child, PointerTensor) assert isinstance(remote_tensor.child, AdditiveSharingTensor) def test_registration_of_action_on_pointer_of_pointer(workers): bob = workers["bob"] alice = workers["alice"] tensor = torch.tensor([1, 2, 3, 4.0]) ptr = tensor.send(bob) ptr = ptr.send(alice) ptr_action = ptr + ptr assert len(alice._objects) == 2 assert len(bob._objects) == 2 def test_setting_back_grad_to_origin_after_send(workers): me = workers["me"] alice = workers["alice"] with me.registration_enabled(): x = th.tensor([1.0, 2.0, 3, 4, 5], requires_grad=True) y = x + x me.register_obj(y) y_ptr = y.send(alice, requires_grad=True) z_ptr = y_ptr * 2 z = z_ptr.sum() z.backward() assert (x.grad == th.tensor([4.0, 4.0, 4.0, 4.0, 4.0])).all() def test_setting_back_grad_to_origin_after_move(workers): me = workers["me"] bob = workers["bob"] alice = workers["alice"] with me.registration_enabled(): x = th.tensor([1.0, 2.0, 3, 4, 5], requires_grad=True) y = x + x me.register_obj(y) y_ptr = y.send(alice, requires_grad=True) z_ptr = y_ptr * 2 z_ptr2 = z_ptr.move(bob, requires_grad=True) z = z_ptr2.sum() z.backward() assert (x.grad == th.tensor([4.0, 4.0, 4.0, 4.0, 4.0])).all()
true
true
f71e5df787aa25c35b48b6c65a4730286ccce326
3,762
py
Python
python/paddle/fluid/tests/unittests/ir/inference/auto_scan_test.py
MissPenguin/Paddle
70a9b6522bdbd8ce36be763d8c2866fc8095f1b9
[ "Apache-2.0" ]
1
2021-09-06T15:52:29.000Z
2021-09-06T15:52:29.000Z
python/paddle/fluid/tests/unittests/ir/inference/auto_scan_test.py
glisca/Paddle
266fcbe0aed3e566c167ea8de5114f62c428c013
[ "Apache-2.0" ]
null
null
null
python/paddle/fluid/tests/unittests/ir/inference/auto_scan_test.py
glisca/Paddle
266fcbe0aed3e566c167ea8de5114f62c428c013
[ "Apache-2.0" ]
null
null
null
# Copyright (c) 2021 PaddlePaddle Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import numpy as np import unittest import abc import os import enum import logging import paddle import paddle.fluid as fluid from paddle.fluid.initializer import NumpyArrayInitializer import paddle.fluid.core as core from paddle import compat as cpt import paddle.inference as paddle_infer from typing import Optional, List, Callable, Dict, Any, Set from program_config import TensorConfig, OpConfig, ProgramConfig, create_fake_model, create_quant_model logging.basicConfig(level=logging.INFO, format="%(message)s") class SkipReasons(enum.Enum): # Paddle not support, but trt support, we need to add the feature. TRT_NOT_IMPLEMENTED = 0 # TRT not support. TRT_NOT_SUPPORT = 1 class AutoScanTest(unittest.TestCase): def __init__(self, methodName='runTest'): np.random.seed(1024) paddle.enable_static() super(AutoScanTest, self).__init__(methodName) self.skip_cases = [] @abc.abstractmethod def sample_program_configs(self) -> List[ProgramConfig]: ''' Generate all config with the combination of different Input tensor shape and different Attr values. ''' raise NotImplementedError @abc.abstractmethod def sample_predictor_configs(self) -> List[paddle_infer.Config]: raise NotImplementedError @abc.abstractmethod def add_skip_case( self, teller: [Callable[[ProgramConfig, paddle_infer.Config], bool]], reason: SkipReasons, note: str): self.skip_cases.append((teller, reason, note)) @abc.abstractmethod def is_program_valid(self, program_config: ProgramConfig) -> bool: raise NotImplementedError def run_test_config(self, model, params, prog_config, pred_config, feed_data) -> Dict[str, np.ndarray]: ''' Test a single case. ''' pred_config.set_model_buffer(model, len(model), params, len(params)) predictor = paddle_infer.create_predictor(pred_config) for name, _ in prog_config.inputs.items(): input_tensor = predictor.get_input_handle(name) input_tensor.copy_from_cpu(feed_data[name]['data']) if feed_data[name]['lod'] is not None: input_tensor.set_lod(feed_data[name]['lod']) predictor.run() result = {} for out_name, o_name in zip(prog_config.outputs, predictor.get_output_names()): result[out_name] = predictor.get_output_handle(o_name).copy_to_cpu() return result def assert_tensors_near(self, threshold: float, tensors: List[Dict[str, np.array]]): assert len(tensors) > 1 first = tensors[0] for group in tensors[1:]: for key, arr in group.items(): self.assertTrue( np.allclose( first[key], arr, atol=threshold), "Output has diff between GPU and TensorRT. ") @abc.abstractmethod def run_test(self, quant=False): raise NotImplementedError
35.490566
103
0.661882
import numpy as np import unittest import abc import os import enum import logging import paddle import paddle.fluid as fluid from paddle.fluid.initializer import NumpyArrayInitializer import paddle.fluid.core as core from paddle import compat as cpt import paddle.inference as paddle_infer from typing import Optional, List, Callable, Dict, Any, Set from program_config import TensorConfig, OpConfig, ProgramConfig, create_fake_model, create_quant_model logging.basicConfig(level=logging.INFO, format="%(message)s") class SkipReasons(enum.Enum): TRT_NOT_IMPLEMENTED = 0 TRT_NOT_SUPPORT = 1 class AutoScanTest(unittest.TestCase): def __init__(self, methodName='runTest'): np.random.seed(1024) paddle.enable_static() super(AutoScanTest, self).__init__(methodName) self.skip_cases = [] @abc.abstractmethod def sample_program_configs(self) -> List[ProgramConfig]: raise NotImplementedError @abc.abstractmethod def sample_predictor_configs(self) -> List[paddle_infer.Config]: raise NotImplementedError @abc.abstractmethod def add_skip_case( self, teller: [Callable[[ProgramConfig, paddle_infer.Config], bool]], reason: SkipReasons, note: str): self.skip_cases.append((teller, reason, note)) @abc.abstractmethod def is_program_valid(self, program_config: ProgramConfig) -> bool: raise NotImplementedError def run_test_config(self, model, params, prog_config, pred_config, feed_data) -> Dict[str, np.ndarray]: pred_config.set_model_buffer(model, len(model), params, len(params)) predictor = paddle_infer.create_predictor(pred_config) for name, _ in prog_config.inputs.items(): input_tensor = predictor.get_input_handle(name) input_tensor.copy_from_cpu(feed_data[name]['data']) if feed_data[name]['lod'] is not None: input_tensor.set_lod(feed_data[name]['lod']) predictor.run() result = {} for out_name, o_name in zip(prog_config.outputs, predictor.get_output_names()): result[out_name] = predictor.get_output_handle(o_name).copy_to_cpu() return result def assert_tensors_near(self, threshold: float, tensors: List[Dict[str, np.array]]): assert len(tensors) > 1 first = tensors[0] for group in tensors[1:]: for key, arr in group.items(): self.assertTrue( np.allclose( first[key], arr, atol=threshold), "Output has diff between GPU and TensorRT. ") @abc.abstractmethod def run_test(self, quant=False): raise NotImplementedError
true
true
f71e5df90847f1507f8858e74f83696283613d19
52,912
py
Python
snakemake/io.py
nikostr/snakemake
99d2517b3456771574c26a40da0cff0e611ad99a
[ "MIT" ]
null
null
null
snakemake/io.py
nikostr/snakemake
99d2517b3456771574c26a40da0cff0e611ad99a
[ "MIT" ]
null
null
null
snakemake/io.py
nikostr/snakemake
99d2517b3456771574c26a40da0cff0e611ad99a
[ "MIT" ]
null
null
null
__author__ = "Johannes Köster" __copyright__ = "Copyright 2021, Johannes Köster" __email__ = "johannes.koester@uni-due.de" __license__ = "MIT" import collections import os import shutil from pathlib import Path import re import stat import time import datetime import json import copy import functools import subprocess as sp from itertools import product, chain from contextlib import contextmanager import string import collections import asyncio from snakemake.exceptions import ( MissingOutputException, WorkflowError, WildcardError, RemoteFileException, ) from snakemake.logging import logger from inspect import isfunction, ismethod from snakemake.common import DYNAMIC_FILL, ON_WINDOWS, async_run class Mtime: __slots__ = ["_local", "_local_target", "_remote"] def __init__(self, local=None, local_target=None, remote=None): self._local = local self._local_target = local_target self._remote = remote def local_or_remote(self, follow_symlinks=False): if self._remote is not None: return self._remote if follow_symlinks and self._local_target is not None: return self._local_target return self._local def remote( self, ): return self._remote def local(self, follow_symlinks=False): if follow_symlinks and self._local_target is not None: return self._local_target return self._local def lutime(f, times): # In some cases, we have a platform where os.supports_follow_symlink includes stat() # but not utime(). This leads to an anomaly. In any case we never want to touch the # target of a link. if os.utime in os.supports_follow_symlinks: # ...utime is well behaved os.utime(f, times, follow_symlinks=False) elif not os.path.islink(f): # ...symlinks not an issue here os.utime(f, times) else: try: # try the system command if times: fmt_time = lambda sec: datetime.fromtimestamp(sec).strftime( "%Y%m%d%H%M.%S" ) atime, mtime = times sp.check_call(["touch", "-h", f, "-a", "-t", fmt_time(atime)]) sp.check_call(["touch", "-h", f, "-m", "-t", fmt_time(mtime)]) else: sp.check_call(["touch", "-h", f]) except sp.CalledProcessError: pass # ...problem system. Do nothing. logger.warning( "Unable to set utime on symlink {}. Your Python build does not support it.".format( f ) ) return None if os.chmod in os.supports_follow_symlinks: def lchmod(f, mode): os.chmod(f, mode, follow_symlinks=False) else: def lchmod(f, mode): os.chmod(f, mode) class ExistsDict(dict): def __init__(self, cache): super().__init__() self.cache = cache self.has_inventory = set() def __getitem__(self, path): # Always return False if not in dict. # The reason is that this is only called if the method contains below has returned True. # Hence, we already know that either path is in dict, or inventory has never # seen it, and hence it does not exist. return self.get(path, False) def __contains__(self, path): # if already in inventory, always return True. parent = path.get_inventory_parent() return parent in self.has_inventory or super().__contains__(path) class IOCache: def __init__(self, max_wait_time): self.mtime = dict() self.exists_local = ExistsDict(self) self.exists_remote = ExistsDict(self) self.size = dict() self.active = True self.remaining_wait_time = max_wait_time self.max_wait_time = max_wait_time def mtime_inventory(self, jobs): async_run(self._mtime_inventory(jobs)) async def _mtime_inventory(self, jobs, n_workers=8): queue = asyncio.Queue() stop_item = object() async def worker(queue): while True: item = await queue.get() if item is stop_item: queue.task_done() return try: self.mtime[item] = await self.collect_mtime(item) except Exception as e: queue.task_done() raise e queue.task_done() tasks = [ asyncio.get_event_loop().create_task(worker(queue)) for _ in range(n_workers) ] for job in jobs: for f in chain(job.input, job.expanded_output): if f.exists: queue.put_nowait(f) if job.benchmark and job.benchmark.exists: queue.put_nowait(job.benchmark) # Send a stop item to each worker. for _ in range(n_workers): queue.put_nowait(stop_item) await asyncio.gather(*tasks) async def collect_mtime(self, path): return path.mtime_uncached def clear(self): self.mtime.clear() self.size.clear() self.exists_local.clear() self.exists_remote.clear() self.remaining_wait_time = self.max_wait_time def deactivate(self): self.clear() self.active = False def IOFile(file, rule=None): assert rule is not None f = _IOFile(file) f.rule = rule return f class _IOFile(str): """ A file that is either input or output of a rule. """ __slots__ = [ "_is_function", "_file", "rule", "_regex", ] def __new__(cls, file): is_annotated = isinstance(file, AnnotatedString) is_callable = ( isfunction(file) or ismethod(file) or (is_annotated and bool(file.callable)) ) if not is_callable and file.endswith("/"): # remove trailing slashes stripped = file.rstrip("/") if is_annotated: stripped = AnnotatedString(stripped) stripped.flags = file.flags file = stripped obj = str.__new__(cls, file) obj._is_function = is_callable obj._file = file obj.rule = None obj._regex = None if obj.is_remote: obj.remote_object._iofile = obj return obj def iocache(func): @functools.wraps(func) def wrapper(self, *args, **kwargs): if self.rule.workflow.iocache.active: cache = getattr(self.rule.workflow.iocache, func.__name__) if self in cache: return cache[self] v = func(self, *args, **kwargs) cache[self] = v return v else: return func(self, *args, **kwargs) return wrapper def _refer_to_remote(func): """ A decorator so that if the file is remote and has a version of the same file-related function, call that version instead. """ @functools.wraps(func) def wrapper(self, *args, **kwargs): if self.is_remote: if hasattr(self.remote_object, func.__name__): return getattr(self.remote_object, func.__name__)(*args, **kwargs) return func(self, *args, **kwargs) return wrapper def inventory(self): async_run(self._inventory()) async def _inventory(self): """Starting from the given file, try to cache as much existence and modification date information of this and other files as possible. """ cache = self.rule.workflow.iocache if cache.active: tasks = [] if self.is_remote and self not in cache.exists_remote: # info not yet in inventory, let's discover as much as we can tasks.append(self.remote_object.inventory(cache)) if not ON_WINDOWS and self not in cache.exists_local: # we don't want to mess with different path representations on windows tasks.append(self._local_inventory(cache)) await asyncio.gather(*tasks) async def _local_inventory(self, cache): # for local files, perform BFS via os.scandir to determine existence of files if cache.remaining_wait_time <= 0: # No more time to create inventory. return start_time = time.time() folders = self.split("/")[:-1] if not folders: return if os.path.isabs(self): # For absolute paths, only use scan the immediate parent ancestors = [os.path.dirname(self)] else: ancestors = ["/".join(folders[:i]) for i in range(1, len(folders) + 1)] for (i, path) in enumerate(ancestors): if path in cache.exists_local.has_inventory: # This path was already scanned before, hence we can stop. break try: with os.scandir(path) as scan: for entry in scan: cache.exists_local[entry.path] = True cache.exists_local[path] = True cache.exists_local.has_inventory.add(path) except FileNotFoundError: # Not found, hence, all subfolders cannot be present as well for path in ancestors[i:]: cache.exists_local[path] = False cache.exists_local.has_inventory.add(path) break except PermissionError: raise WorkflowError( "Insufficient permissions to access {}. " "Please make sure that all accessed files and directories " "are readable and writable for you.".format(self) ) cache.remaining_wait_time -= time.time() - start_time @_refer_to_remote def get_inventory_parent(self): """If eligible for inventory, get the parent of a given path. This code does not work on local Windows paths, but inventory is disabled on Windows. """ parent = os.path.dirname(self) if parent and parent != "..": return parent @contextmanager def open(self, mode="r", buffering=-1, encoding=None, errors=None, newline=None): """Open this file. If necessary, download it from remote first. This can (and should) be used in a `with`-statement. """ if not self.exists: raise WorkflowError( "File {} cannot be opened, since it does not exist.".format(self) ) if not self.exists_local and self.is_remote: self.download_from_remote() f = open(self) try: yield f finally: f.close() def contains_wildcard(self): return contains_wildcard(self.file) @property def is_remote(self): return is_flagged(self._file, "remote_object") @property def is_ancient(self): return is_flagged(self._file, "ancient") @property def is_directory(self): return is_flagged(self._file, "directory") @property def is_temp(self): return is_flagged(self._file, "temp") @property def is_multiext(self): return is_flagged(self._file, "multiext") @property def multiext_prefix(self): return get_flag_value(self._file, "multiext") def update_remote_filepath(self): # if the file string is different in the iofile, update the remote object # (as in the case of wildcard expansion) remote_object = self.remote_object if remote_object._file != self._file: remote_object._iofile = self @property def should_keep_local(self): return self.remote_object.keep_local @property def should_stay_on_remote(self): return self.remote_object.stay_on_remote @property def remote_object(self): return get_flag_value(self._file, "remote_object") @property @_refer_to_remote def file(self): if not self._is_function: return self._file else: raise ValueError( "This IOFile is specified as a function and " "may not be used directly." ) def check(self): hint = ( "It can also lead to inconsistent results of the file-matching " "approach used by Snakemake." ) if self._file.startswith("./"): logger.warning( "Relative file path '{}' starts with './'. This is redundant " "and strongly discouraged. {} You can simply omit the './' " "for relative file paths.".format(self._file, hint) ) if self._file.startswith(" "): logger.warning( "File path '{}' starts with whitespace. " "This is likely unintended. {}".format(self._file, hint) ) if self._file.endswith(" "): logger.warning( "File path '{}' ends with whitespace. " "This is likely unintended. {}".format(self._file, hint) ) if "\n" in self._file: logger.warning( "File path '{}' contains line break. " "This is likely unintended. {}".format(self._file, hint) ) if _double_slash_regex.search(self._file) is not None and not self.is_remote: logger.warning( "File path {} contains double '{}'. " "This is likely unintended. {}".format(self._file, os.path.sep, hint) ) @property def exists(self): if self.is_remote: return self.exists_remote else: return self.exists_local def parents(self, omit=0): """Yield all parent paths, omitting the given number of ancestors.""" for p in list(Path(self.file).parents)[::-1][omit:]: p = IOFile(str(p), rule=self.rule) p.clone_flags(self) yield p @property @iocache def exists_local(self): return os.path.exists(self.file) @property @iocache def exists_remote(self): if not self.is_remote: return False return self.remote_object.exists() @property def protected(self): """Returns True if the file is protected. Always False for symlinks.""" # symlinks are never regarded as protected return ( self.exists_local and not os.access(self.file, os.W_OK) and not os.path.islink(self.file) ) @property @iocache def mtime(self): return self.mtime_uncached @property def mtime_uncached(self): """Obtain mtime. Usually, this will be one stat call only. For symlinks and directories it will be two, for symlinked directories it will be three, for remote files it will additionally query the remote location. """ mtime_remote = self.remote_object.mtime() if self.is_remote else None # We first do a normal stat. try: _stat = os.stat(self.file, follow_symlinks=False) is_symlink = stat.S_ISLNK(_stat.st_mode) is_dir = stat.S_ISDIR(_stat.st_mode) mtime = _stat.st_mtime def get_dir_mtime(): # Try whether we have a timestamp file for it. return os.stat( os.path.join(self.file, ".snakemake_timestamp"), follow_symlinks=True, ).st_mtime if not is_symlink: if is_dir: try: mtime = get_dir_mtime() except FileNotFoundError: # No timestamp, hence go on as if it is a file. pass # In the usual case, not a dir, not a symlink. # We need just a single stat call. return Mtime(local=mtime, remote=mtime_remote) else: # In case of a symlink, we need the stats for the target file/dir. target_stat = os.stat(self.file, follow_symlinks=True) # Further, we need to check again if this is a directory. is_dir = stat.S_ISDIR(target_stat.st_mode) mtime_target = target_stat.st_mtime if is_dir: try: mtime_target = get_dir_mtime() except FileNotFoundError: # No timestamp, hence go on as if it is a file. pass return Mtime( local=mtime, local_target=mtime_target, remote=mtime_remote ) except FileNotFoundError: if self.is_remote: return Mtime(remote=mtime_remote) raise WorkflowError( "Unable to obtain modification time of file {} although it existed before. " "It could be that a concurrent process has deleted it while Snakemake " "was running.".format(self.file) ) except PermissionError: raise WorkflowError( "Unable to obtain modification time of file {} because of missing " "read permissions.".format(self.file) ) @property def flags(self): return getattr(self._file, "flags", {}) @property @iocache @_refer_to_remote def size(self): return self.size_local @property def size_local(self): # follow symlinks but throw error if invalid self.check_broken_symlink() return os.path.getsize(self.file) def check_broken_symlink(self): """ Raise WorkflowError if file is a broken symlink. """ if not self.exists_local and os.lstat(self.file): raise WorkflowError( "File {} seems to be a broken symlink.".format(self.file) ) @_refer_to_remote def is_newer(self, time): """Returns true of the file (which is an input file) is newer than time, or if it is a symlink that points to a file newer than time.""" if self.is_ancient: return False return self.mtime.local_or_remote(follow_symlinks=True) > time def download_from_remote(self): if self.is_remote and self.remote_object.exists(): if not self.should_stay_on_remote: logger.info("Downloading from remote: {}".format(self.file)) self.remote_object.download() logger.info("Finished download.") else: raise RemoteFileException( "The file to be downloaded does not seem to exist remotely." ) def upload_to_remote(self): if self.is_remote: logger.info("Uploading to remote: {}".format(self.file)) self.remote_object.upload() logger.info("Finished upload.") def prepare(self): path_until_wildcard = re.split(DYNAMIC_FILL, self.file)[0] dir = os.path.dirname(path_until_wildcard) if len(dir) > 0: try: os.makedirs(dir, exist_ok=True) except OSError as e: # ignore Errno 17 "File exists" (reason: multiprocessing) if e.errno != 17: raise e if is_flagged(self._file, "pipe"): os.mkfifo(self._file) def protect(self): mode = ( os.lstat(self.file).st_mode & ~stat.S_IWUSR & ~stat.S_IWGRP & ~stat.S_IWOTH ) if os.path.isdir(self.file): for root, dirs, files in os.walk(self.file): for d in dirs: lchmod(os.path.join(self.file, d), mode) for f in files: lchmod(os.path.join(self.file, f), mode) lchmod(self.file, mode) def remove(self, remove_non_empty_dir=False): if self.is_directory: remove(self, remove_non_empty_dir=True) else: remove(self, remove_non_empty_dir=remove_non_empty_dir) def touch(self, times=None): """ times must be 2-tuple: (atime, mtime) """ try: if self.is_directory: file = os.path.join(self.file, ".snakemake_timestamp") # Create the flag file if it doesn't exist if not os.path.exists(file): with open(file, "w"): pass lutime(file, times) else: lutime(self.file, times) except OSError as e: if e.errno == 2: raise MissingOutputException( "Output file {} of rule {} shall be touched but " "does not exist.".format(self.file, self.rule.name), lineno=self.rule.lineno, snakefile=self.rule.snakefile, ) else: raise e def touch_or_create(self): try: self.touch() except MissingOutputException: # first create directory if it does not yet exist dir = self.file if self.is_directory else os.path.dirname(self.file) if dir: os.makedirs(dir, exist_ok=True) # create empty file file = ( os.path.join(self.file, ".snakemake_timestamp") if self.is_directory else self.file ) with open(file, "w") as f: pass def apply_wildcards(self, wildcards, fill_missing=False, fail_dynamic=False): f = self._file if self._is_function: f = self._file(Namedlist(fromdict=wildcards)) # this bit ensures flags are transferred over to files after # wildcards are applied file_with_wildcards_applied = IOFile( apply_wildcards( f, wildcards, fill_missing=fill_missing, fail_dynamic=fail_dynamic, dynamic_fill=DYNAMIC_FILL, ), rule=self.rule, ) file_with_wildcards_applied.clone_flags(self) return file_with_wildcards_applied def get_wildcard_names(self): return get_wildcard_names(self.file) def regex(self): if self._regex is None: # compile a regular expression self._regex = re.compile(regex(self.file)) return self._regex def constant_prefix(self): first_wildcard = _wildcard_regex.search(self.file) if first_wildcard: return self.file[: first_wildcard.start()] return self.file def constant_suffix(self): m = None for m in _wildcard_regex.finditer(self.file): pass last_wildcard = m if last_wildcard: return self.file[last_wildcard.end() :] return self.file def match(self, target): return self.regex().match(target) or None def format_dynamic(self): return self.replace(DYNAMIC_FILL, "{*}") def clone_flags(self, other): if isinstance(self._file, str): self._file = AnnotatedString(self._file) if isinstance(other._file, AnnotatedString): self._file.flags = getattr(other._file, "flags", {}).copy() if "remote_object" in self._file.flags: self._file.flags["remote_object"] = copy.copy( self._file.flags["remote_object"] ) self.update_remote_filepath() def clone_remote_object(self, other): if ( isinstance(other._file, AnnotatedString) and "remote_object" in other._file.flags ): self._file.flags["remote_object"] = copy.copy( other._file.flags["remote_object"] ) self.update_remote_filepath() def set_flags(self, flags): if isinstance(self._file, str): self._file = AnnotatedString(self._file) self._file.flags = flags def __eq__(self, other): f = other._file if isinstance(other, _IOFile) else other return self._file == f def __hash__(self): return self._file.__hash__() _double_slash_regex = ( re.compile(r"([^:]//|^//)") if os.path.sep == "/" else re.compile(r"\\\\") ) _wildcard_regex = re.compile( r""" \{ (?=( # This lookahead assertion emulates an 'atomic group' # which is required for performance \s*(?P<name>\w+) # wildcard name (\s*,\s* (?P<constraint> # an optional constraint ([^{}]+ | \{\d+(,\d+)?\})* # allow curly braces to nest one level ) # ... as in '{w,a{3,5}}' )?\s* ))\1 \} """, re.VERBOSE, ) def wait_for_files( files, latency_wait=3, force_stay_on_remote=False, ignore_pipe=False ): """Wait for given files to be present in filesystem.""" files = list(files) def get_missing(): return [ f for f in files if not ( f.exists_remote if ( isinstance(f, _IOFile) and f.is_remote and (force_stay_on_remote or f.should_stay_on_remote) ) else os.path.exists(f) if not (is_flagged(f, "pipe") and ignore_pipe) else True ) ] missing = get_missing() if missing: logger.info( "Waiting at most {} seconds for missing files.".format(latency_wait) ) for _ in range(latency_wait): if not get_missing(): return time.sleep(1) raise IOError( "Missing files after {} seconds:\n{}".format( latency_wait, "\n".join(get_missing()) ) ) def get_wildcard_names(pattern): return set(match.group("name") for match in _wildcard_regex.finditer(pattern)) def contains_wildcard(path): return _wildcard_regex.search(path) is not None def contains_wildcard_constraints(pattern): return any(match.group("constraint") for match in _wildcard_regex.finditer(pattern)) def remove(file, remove_non_empty_dir=False): if file.is_remote and file.should_stay_on_remote: if file.exists_remote: file.remote_object.remove() elif os.path.isdir(file) and not os.path.islink(file): if remove_non_empty_dir: shutil.rmtree(file) else: try: os.removedirs(file) except OSError as e: # skip non empty directories if e.errno == 39: logger.info( "Skipped removing non-empty directory {}".format(e.filename) ) else: logger.warning(str(e)) # Remember that dangling symlinks fail the os.path.exists() test, but # we definitely still want to zap them. try/except is the safest way. # Also, we don't want to remove the null device if it is an output. elif os.devnull != str(file): try: os.remove(file) except FileNotFoundError: pass def regex(filepattern): f = [] last = 0 wildcards = set() for match in _wildcard_regex.finditer(filepattern): f.append(re.escape(filepattern[last : match.start()])) wildcard = match.group("name") if wildcard in wildcards: if match.group("constraint"): raise ValueError( "Constraint regex must be defined only in the first " "occurence of the wildcard in a string." ) f.append("(?P={})".format(wildcard)) else: wildcards.add(wildcard) f.append( "(?P<{}>{})".format( wildcard, match.group("constraint") if match.group("constraint") else ".+", ) ) last = match.end() f.append(re.escape(filepattern[last:])) f.append("$") # ensure that the match spans the whole file return "".join(f) def apply_wildcards( pattern, wildcards, fill_missing=False, fail_dynamic=False, dynamic_fill=None, keep_dynamic=False, ): def format_match(match): name = match.group("name") try: value = wildcards[name] if fail_dynamic and value == dynamic_fill: raise WildcardError(name) return str(value) # convert anything into a str except KeyError as ex: if keep_dynamic: return "{{{}}}".format(name) elif fill_missing: return dynamic_fill else: raise WildcardError(str(ex)) return _wildcard_regex.sub(format_match, pattern) def not_iterable(value): return ( isinstance(value, str) or isinstance(value, dict) or not isinstance(value, collections.abc.Iterable) ) def is_callable(value): return ( callable(value) or (isinstance(value, _IOFile) and value._is_function) or (isinstance(value, AnnotatedString) and value.callable is not None) ) class AnnotatedString(str): def __init__(self, value): self.flags = dict() self.callable = value if is_callable(value) else None def flag(value, flag_type, flag_value=True): if isinstance(value, AnnotatedString): value.flags[flag_type] = flag_value return value if not_iterable(value): value = AnnotatedString(value) value.flags[flag_type] = flag_value return value return [flag(v, flag_type, flag_value=flag_value) for v in value] def is_flagged(value, flag): if isinstance(value, AnnotatedString): return flag in value.flags and value.flags[flag] if isinstance(value, _IOFile): return flag in value.flags and value.flags[flag] return False def get_flag_value(value, flag_type): if isinstance(value, AnnotatedString) or isinstance(value, _IOFile): if flag_type in value.flags: return value.flags[flag_type] else: return None def ancient(value): """ A flag for an input file that shall be considered ancient; i.e. its timestamp shall have no effect on which jobs to run. """ return flag(value, "ancient") def directory(value): """ A flag to specify that an output is a directory, rather than a file or named pipe. """ if is_flagged(value, "pipe"): raise SyntaxError("Pipe and directory flags are mutually exclusive.") if is_flagged(value, "remote"): raise SyntaxError("Remote and directory flags are mutually exclusive.") if is_flagged(value, "dynamic"): raise SyntaxError("Dynamic and directory flags are mutually exclusive.") return flag(value, "directory") def temp(value): """ A flag for an input or output file that shall be removed after usage. """ if is_flagged(value, "protected"): raise SyntaxError("Protected and temporary flags are mutually exclusive.") if is_flagged(value, "remote"): raise SyntaxError("Remote and temporary flags are mutually exclusive.") return flag(value, "temp") def pipe(value): if is_flagged(value, "protected"): raise SyntaxError("Pipes may not be protected.") if is_flagged(value, "remote"): raise SyntaxError("Pipes may not be remote files.") if ON_WINDOWS: logger.warning("Pipes is not yet supported on Windows.") return flag(value, "pipe", not ON_WINDOWS) def temporary(value): """ An alias for temp. """ return temp(value) def protected(value): """ A flag for a file that shall be write protected after creation. """ if is_flagged(value, "temp"): raise SyntaxError("Protected and temporary flags are mutually exclusive.") if is_flagged(value, "remote"): raise SyntaxError("Remote and protected flags are mutually exclusive.") return flag(value, "protected") def dynamic(value): """ A flag for a file that shall be dynamic, i.e. the multiplicity (and wildcard values) will be expanded after a certain rule has been run""" annotated = flag(value, "dynamic", True) tocheck = [annotated] if not_iterable(annotated) else annotated for file in tocheck: matches = list(_wildcard_regex.finditer(file)) # if len(matches) != 1: # raise SyntaxError("Dynamic files need exactly one wildcard.") for match in matches: if match.group("constraint"): raise SyntaxError( "The wildcards in dynamic files cannot be constrained." ) return annotated def touch(value): return flag(value, "touch") def unpack(value): return flag(value, "unpack") def repeat(value, n_repeat): """Flag benchmark records with the number of repeats.""" return flag(value, "repeat", n_repeat) def checkpoint_target(value): return flag(value, "checkpoint_target") ReportObject = collections.namedtuple( "ReportObject", ["caption", "category", "subcategory", "patterns", "htmlindex"] ) def report( value, caption=None, category=None, subcategory=None, patterns=[], htmlindex=None ): """Flag output file or directory as to be included into reports. In case of directory, files to include can be specified via a glob pattern (default: *). Arguments value -- File or directory. caption -- Path to a .rst file with a textual description of the result. category -- Name of the category in which the result should be displayed in the report. pattern -- Wildcard pattern for selecting files if a directory is given (this is used as input for snakemake.io.glob_wildcards). Pattern shall not include the path to the directory itself. """ return flag( value, "report", ReportObject(caption, category, subcategory, patterns, htmlindex), ) def local(value): """Mark a file as local file. This disables application of a default remote provider. """ if is_flagged(value, "remote"): raise SyntaxError("Remote and local flags are mutually exclusive.") return flag(value, "local") def expand(*args, **wildcards): """ Expand wildcards in given filepatterns. Arguments *args -- first arg: filepatterns as list or one single filepattern, second arg (optional): a function to combine wildcard values (itertools.product per default) **wildcards -- the wildcards as keyword arguments with their values as lists. If allow_missing=True is included wildcards in filepattern without values will stay unformatted. """ filepatterns = args[0] if len(args) == 1: combinator = product elif len(args) == 2: combinator = args[1] if isinstance(filepatterns, str) or isinstance(filepatterns, Path): filepatterns = [filepatterns] def path_to_str(f): if isinstance(f, Path): return str(f) return f filepatterns = list(map(path_to_str, filepatterns)) if any(map(lambda f: getattr(f, "flags", {}), filepatterns)): raise WorkflowError( "Flags in file patterns given to expand() are invalid. " "Flags (e.g. temp(), directory()) have to be applied outside " "of expand (e.g. 'temp(expand(\"plots/{sample}.pdf\", sample=SAMPLES))')." ) # check if remove missing is provided format_dict = dict if "allow_missing" in wildcards and wildcards["allow_missing"] is True: class FormatDict(dict): def __missing__(self, key): return "{" + key + "}" format_dict = FormatDict # check that remove missing is not a wildcard in the filepatterns for filepattern in filepatterns: if "allow_missing" in re.findall(r"{([^}\.[!:]+)", filepattern): format_dict = dict break # remove unused wildcards to avoid duplicate filepatterns wildcards = { filepattern: { k: v for k, v in wildcards.items() if k in re.findall(r"{([^}\.[!:]+)", filepattern) } for filepattern in filepatterns } def flatten(wildcards): for wildcard, values in wildcards.items(): if isinstance(values, str) or not isinstance( values, collections.abc.Iterable ): values = [values] yield [(wildcard, value) for value in values] formatter = string.Formatter() try: return [ formatter.vformat(filepattern, (), comb) for filepattern in filepatterns for comb in map(format_dict, combinator(*flatten(wildcards[filepattern]))) ] except KeyError as e: raise WildcardError("No values given for wildcard {}.".format(e)) def multiext(prefix, *extensions): """Expand a given prefix with multiple extensions (e.g. .txt, .csv, _peaks.bed, ...).""" if any((r"/" in ext or r"\\" in ext) for ext in extensions): raise WorkflowError( r"Extensions for multiext may not contain path delimiters " r"(/,\)." ) return [flag(prefix + ext, "multiext", flag_value=prefix) for ext in extensions] def limit(pattern, **wildcards): """ Limit wildcards to the given values. Arguments: **wildcards -- the wildcards as keyword arguments with their values as lists """ return pattern.format( **{ wildcard: "{{{},{}}}".format(wildcard, "|".join(values)) for wildcard, values in wildcards.items() } ) def glob_wildcards(pattern, files=None, followlinks=False): """ Glob the values of the wildcards by matching the given pattern to the filesystem. Returns a named tuple with a list of values for each wildcard. """ pattern = os.path.normpath(pattern) first_wildcard = re.search("{[^{]", pattern) dirname = ( os.path.dirname(pattern[: first_wildcard.start()]) if first_wildcard else os.path.dirname(pattern) ) if not dirname: dirname = "." names = [match.group("name") for match in _wildcard_regex.finditer(pattern)] Wildcards = collections.namedtuple("Wildcards", names) wildcards = Wildcards(*[list() for name in names]) pattern = re.compile(regex(pattern)) if files is None: files = ( os.path.normpath(os.path.join(dirpath, f)) for dirpath, dirnames, filenames in os.walk( dirname, followlinks=followlinks ) for f in chain(filenames, dirnames) ) for f in files: match = re.match(pattern, f) if match: for name, value in match.groupdict().items(): getattr(wildcards, name).append(value) return wildcards def update_wildcard_constraints( pattern, wildcard_constraints, global_wildcard_constraints ): """Update wildcard constraints Args: pattern (str): pattern on which to update constraints wildcard_constraints (dict): dictionary of wildcard:constraint key-value pairs global_wildcard_constraints (dict): dictionary of wildcard:constraint key-value pairs """ def replace_constraint(match): name = match.group("name") constraint = match.group("constraint") newconstraint = wildcard_constraints.get( name, global_wildcard_constraints.get(name) ) if name in examined_names: return match.group(0) examined_names.add(name) # Don't override if constraint already set if constraint is not None: return match.group(0) # Only update if a new constraint has actually been set elif newconstraint is not None: return "{{{},{}}}".format(name, newconstraint) else: return match.group(0) examined_names = set() updated = _wildcard_regex.sub(replace_constraint, pattern) # inherit flags if isinstance(pattern, AnnotatedString): updated = AnnotatedString(updated) updated.flags = dict(pattern.flags) return updated def split_git_path(path): file_sub = re.sub(r"^git\+file:/+", "/", path) (file_path, version) = file_sub.split("@") file_path = os.path.realpath(file_path) root_path = get_git_root(file_path) if file_path.startswith(root_path): file_path = file_path[len(root_path) :].lstrip("/") return (root_path, file_path, version) def get_git_root(path): """ Args: path: (str) Path a to a directory/file that is located inside the repo Returns: path to root folder for git repo """ import git try: git_repo = git.Repo(path, search_parent_directories=True) return git_repo.git.rev_parse("--show-toplevel") except git.exc.NoSuchPathError: tail, head = os.path.split(path) return get_git_root_parent_directory(tail, path) def get_git_root_parent_directory(path, input_path): """ This function will recursively go through parent directories until a git repository is found or until no parent directories are left, in which case a error will be raised. This is needed when providing a path to a file/folder that is located on a branch/tag no currently checked out. Args: path: (str) Path a to a directory that is located inside the repo input_path: (str) origin path, used when raising WorkflowError Returns: path to root folder for git repo """ import git try: git_repo = git.Repo(path, search_parent_directories=True) return git_repo.git.rev_parse("--show-toplevel") except git.exc.NoSuchPathError: tail, head = os.path.split(path) if tail is None: raise WorkflowError( "Neither provided git path ({}) ".format(input_path) + "or parent directories contain a valid git repo." ) else: return get_git_root_parent_directory(tail, input_path) def git_content(git_file): """ This function will extract a file from a git repository, one located on the filesystem. Expected format is git+file:///path/to/your/repo/path_to_file@@version Args: env_file (str): consist of path to repo, @, version and file information Ex: git+file:////home/smeds/snakemake-wrappers/bio/fastqc/wrapper.py@0.19.3 Returns: file content or None if the expected format isn't meet """ import git if git_file.startswith("git+file:"): (root_path, file_path, version) = split_git_path(git_file) return git.Repo(root_path).git.show("{}:{}".format(version, file_path)) else: raise WorkflowError( "Provided git path ({}) doesn't meet the " "expected format:".format(git_file) + ", expected format is " "git+file://PATH_TO_REPO/PATH_TO_FILE_INSIDE_REPO@VERSION" ) def strip_wildcard_constraints(pattern): """Return a string that does not contain any wildcard constraints.""" def strip_constraint(match): return "{{{}}}".format(match.group("name")) return _wildcard_regex.sub(strip_constraint, pattern) class Namedlist(list): """ A list that additionally provides functions to name items. Further, it is hashable, however the hash does not consider the item names. """ def __init__( self, toclone=None, fromdict=None, plainstr=False, strip_constraints=False, custom_map=None, ): """ Create the object. Arguments toclone -- another Namedlist that shall be cloned fromdict -- a dict that shall be converted to a Namedlist (keys become names) """ list.__init__(self) self._names = dict() # white-list of attribute names that can be overridden in _set_name # default to throwing exception if called to prevent use as functions self._allowed_overrides = ["index", "sort"] for name in self._allowed_overrides: setattr(self, name, functools.partial(self._used_attribute, _name=name)) if toclone: if custom_map is not None: self.extend(map(custom_map, toclone)) elif plainstr: self.extend(map(str, toclone)) elif strip_constraints: self.extend(map(strip_wildcard_constraints, toclone)) else: self.extend(toclone) if isinstance(toclone, Namedlist): self._take_names(toclone._get_names()) if fromdict: for key, item in fromdict.items(): self.append(item) self._add_name(key) @staticmethod def _used_attribute(*args, _name, **kwargs): """ Generic function that throws an `AttributeError`. Used as replacement for functions such as `index()` and `sort()`, which may be overridden by workflows, to signal to a user that these functions should not be used. """ raise AttributeError( "{_name}() cannot be used; attribute name reserved" " for use in some existing workflows".format(_name=_name) ) def _add_name(self, name): """ Add a name to the last item. Arguments name -- a name """ self._set_name(name, len(self) - 1) def _set_name(self, name, index, end=None): """ Set the name of an item. Arguments name -- a name index -- the item index """ if name not in self._allowed_overrides and hasattr(self.__class__, name): raise AttributeError( "invalid name for input, output, wildcard, " "params or log: {name} is reserved for internal use".format(name=name) ) self._names[name] = (index, end) if end is None: setattr(self, name, self[index]) else: setattr(self, name, Namedlist(toclone=self[index:end])) def _get_names(self): """ Get the defined names as (name, index) pairs. """ for name, index in self._names.items(): yield name, index def _take_names(self, names): """ Take over the given names. Arguments names -- the given names as (name, index) pairs """ for name, (i, j) in names: self._set_name(name, i, end=j) def items(self): for name in self._names: yield name, getattr(self, name) def _allitems(self): next = 0 for name, index in sorted( self._names.items(), key=lambda item: ( item[1][0], item[1][0] + 1 if item[1][1] is None else item[1][1], ), ): start, end = index if end is None: end = start + 1 if start > next: for item in self[next:start]: yield None, item yield name, getattr(self, name) next = end for item in self[next:]: yield None, item def _insert_items(self, index, items): self[index : index + 1] = items add = len(items) - 1 for name, (i, j) in self._names.items(): if i > index: self._names[name] = (i + add, None if j is None else j + add) elif i == index: self._set_name(name, i, end=i + len(items)) def keys(self): return self._names.keys() def _plainstrings(self): return self.__class__.__call__(toclone=self, plainstr=True) def _stripped_constraints(self): return self.__class__.__call__(toclone=self, strip_constraints=True) def _clone(self): return self.__class__.__call__(toclone=self) def get(self, key, default_value=None): return self.__dict__.get(key, default_value) def __getitem__(self, key): try: return super().__getitem__(key) except TypeError: pass return getattr(self, key) def __hash__(self): return hash(tuple(self)) def __str__(self): return " ".join(map(str, self)) class InputFiles(Namedlist): @property def size(self): return sum(f.size for f in self) @property def size_mb(self): return self.size / 1024 / 1024 class OutputFiles(Namedlist): pass class Wildcards(Namedlist): pass class Params(Namedlist): pass class Resources(Namedlist): pass class Log(Namedlist): pass def _load_configfile(configpath_or_obj, filetype="Config"): "Tries to load a configfile first as JSON, then as YAML, into a dict." import yaml if isinstance(configpath_or_obj, str) or isinstance(configpath_or_obj, Path): obj = open(configpath_or_obj) else: obj = configpath_or_obj try: with obj as f: try: return json.load(f, object_pairs_hook=collections.OrderedDict) except ValueError: f.seek(0) # try again try: # From https://stackoverflow.com/a/21912744/84349 class OrderedLoader(yaml.Loader): pass def construct_mapping(loader, node): loader.flatten_mapping(node) return collections.OrderedDict(loader.construct_pairs(node)) OrderedLoader.add_constructor( yaml.resolver.BaseResolver.DEFAULT_MAPPING_TAG, construct_mapping ) return yaml.load(f, Loader=OrderedLoader) except yaml.YAMLError: raise WorkflowError( "Config file is not valid JSON or YAML. " "In case of YAML, make sure to not mix " "whitespace and tab indentation.".format(filetype) ) except FileNotFoundError: raise WorkflowError("{} file {} not found.".format(filetype, configpath)) def load_configfile(configpath): "Loads a JSON or YAML configfile as a dict, then checks that it's a dict." config = _load_configfile(configpath) if not isinstance(config, dict): raise WorkflowError( "Config file must be given as JSON or YAML " "with keys at top level." ) return config ##### Wildcard pumping detection ##### class PeriodicityDetector: def __init__(self, min_repeat=20, max_repeat=100): """ Args: max_repeat (int): The maximum length of the periodic substring. min_repeat (int): The minimum length of the periodic substring. """ self.min_repeat = min_repeat self.regex = re.compile( "((?P<value>.+)(?P=value){{{min_repeat},{max_repeat}}})$".format( min_repeat=min_repeat - 1, max_repeat=max_repeat - 1 ) ) def is_periodic(self, value): """Returns the periodic substring or None if not periodic.""" # short-circuit: need at least min_repeat characters if len(value) < self.min_repeat: return None # short-circuit: need at least min_repeat same characters last_letter = value[-1] counter = collections.Counter(value) if counter[last_letter] < self.min_repeat: return None # short-circuit: need at least min_repeat same characters pos = 2 while ( value[-pos] != last_letter ): # as long as last letter is not seen, repeat length is minimally pos if ( len(value) < (pos * self.min_repeat) or counter[value[-pos]] < self.min_repeat ): return None pos += 1 # now do the expensive regex m = self.regex.search(value) # search for a periodic suffix. if m is not None: return m.group("value")
31.951691
124
0.584933
__author__ = "Johannes Köster" __copyright__ = "Copyright 2021, Johannes Köster" __email__ = "johannes.koester@uni-due.de" __license__ = "MIT" import collections import os import shutil from pathlib import Path import re import stat import time import datetime import json import copy import functools import subprocess as sp from itertools import product, chain from contextlib import contextmanager import string import collections import asyncio from snakemake.exceptions import ( MissingOutputException, WorkflowError, WildcardError, RemoteFileException, ) from snakemake.logging import logger from inspect import isfunction, ismethod from snakemake.common import DYNAMIC_FILL, ON_WINDOWS, async_run class Mtime: __slots__ = ["_local", "_local_target", "_remote"] def __init__(self, local=None, local_target=None, remote=None): self._local = local self._local_target = local_target self._remote = remote def local_or_remote(self, follow_symlinks=False): if self._remote is not None: return self._remote if follow_symlinks and self._local_target is not None: return self._local_target return self._local def remote( self, ): return self._remote def local(self, follow_symlinks=False): if follow_symlinks and self._local_target is not None: return self._local_target return self._local def lutime(f, times): if os.utime in os.supports_follow_symlinks: os.utime(f, times, follow_symlinks=False) elif not os.path.islink(f): os.utime(f, times) else: try: if times: fmt_time = lambda sec: datetime.fromtimestamp(sec).strftime( "%Y%m%d%H%M.%S" ) atime, mtime = times sp.check_call(["touch", "-h", f, "-a", "-t", fmt_time(atime)]) sp.check_call(["touch", "-h", f, "-m", "-t", fmt_time(mtime)]) else: sp.check_call(["touch", "-h", f]) except sp.CalledProcessError: pass logger.warning( "Unable to set utime on symlink {}. Your Python build does not support it.".format( f ) ) return None if os.chmod in os.supports_follow_symlinks: def lchmod(f, mode): os.chmod(f, mode, follow_symlinks=False) else: def lchmod(f, mode): os.chmod(f, mode) class ExistsDict(dict): def __init__(self, cache): super().__init__() self.cache = cache self.has_inventory = set() def __getitem__(self, path): return self.get(path, False) def __contains__(self, path): parent = path.get_inventory_parent() return parent in self.has_inventory or super().__contains__(path) class IOCache: def __init__(self, max_wait_time): self.mtime = dict() self.exists_local = ExistsDict(self) self.exists_remote = ExistsDict(self) self.size = dict() self.active = True self.remaining_wait_time = max_wait_time self.max_wait_time = max_wait_time def mtime_inventory(self, jobs): async_run(self._mtime_inventory(jobs)) async def _mtime_inventory(self, jobs, n_workers=8): queue = asyncio.Queue() stop_item = object() async def worker(queue): while True: item = await queue.get() if item is stop_item: queue.task_done() return try: self.mtime[item] = await self.collect_mtime(item) except Exception as e: queue.task_done() raise e queue.task_done() tasks = [ asyncio.get_event_loop().create_task(worker(queue)) for _ in range(n_workers) ] for job in jobs: for f in chain(job.input, job.expanded_output): if f.exists: queue.put_nowait(f) if job.benchmark and job.benchmark.exists: queue.put_nowait(job.benchmark) for _ in range(n_workers): queue.put_nowait(stop_item) await asyncio.gather(*tasks) async def collect_mtime(self, path): return path.mtime_uncached def clear(self): self.mtime.clear() self.size.clear() self.exists_local.clear() self.exists_remote.clear() self.remaining_wait_time = self.max_wait_time def deactivate(self): self.clear() self.active = False def IOFile(file, rule=None): assert rule is not None f = _IOFile(file) f.rule = rule return f class _IOFile(str): __slots__ = [ "_is_function", "_file", "rule", "_regex", ] def __new__(cls, file): is_annotated = isinstance(file, AnnotatedString) is_callable = ( isfunction(file) or ismethod(file) or (is_annotated and bool(file.callable)) ) if not is_callable and file.endswith("/"): stripped = file.rstrip("/") if is_annotated: stripped = AnnotatedString(stripped) stripped.flags = file.flags file = stripped obj = str.__new__(cls, file) obj._is_function = is_callable obj._file = file obj.rule = None obj._regex = None if obj.is_remote: obj.remote_object._iofile = obj return obj def iocache(func): @functools.wraps(func) def wrapper(self, *args, **kwargs): if self.rule.workflow.iocache.active: cache = getattr(self.rule.workflow.iocache, func.__name__) if self in cache: return cache[self] v = func(self, *args, **kwargs) cache[self] = v return v else: return func(self, *args, **kwargs) return wrapper def _refer_to_remote(func): @functools.wraps(func) def wrapper(self, *args, **kwargs): if self.is_remote: if hasattr(self.remote_object, func.__name__): return getattr(self.remote_object, func.__name__)(*args, **kwargs) return func(self, *args, **kwargs) return wrapper def inventory(self): async_run(self._inventory()) async def _inventory(self): cache = self.rule.workflow.iocache if cache.active: tasks = [] if self.is_remote and self not in cache.exists_remote: tasks.append(self.remote_object.inventory(cache)) if not ON_WINDOWS and self not in cache.exists_local: # we don't want to mess with different path representations on windows tasks.append(self._local_inventory(cache)) await asyncio.gather(*tasks) async def _local_inventory(self, cache): if cache.remaining_wait_time <= 0: return start_time = time.time() folders = self.split("/")[:-1] if not folders: return if os.path.isabs(self): ancestors = [os.path.dirname(self)] else: ancestors = ["/".join(folders[:i]) for i in range(1, len(folders) + 1)] for (i, path) in enumerate(ancestors): if path in cache.exists_local.has_inventory: break try: with os.scandir(path) as scan: for entry in scan: cache.exists_local[entry.path] = True cache.exists_local[path] = True cache.exists_local.has_inventory.add(path) except FileNotFoundError: for path in ancestors[i:]: cache.exists_local[path] = False cache.exists_local.has_inventory.add(path) break except PermissionError: raise WorkflowError( "Insufficient permissions to access {}. " "Please make sure that all accessed files and directories " "are readable and writable for you.".format(self) ) cache.remaining_wait_time -= time.time() - start_time @_refer_to_remote def get_inventory_parent(self): parent = os.path.dirname(self) if parent and parent != "..": return parent @contextmanager def open(self, mode="r", buffering=-1, encoding=None, errors=None, newline=None): if not self.exists: raise WorkflowError( "File {} cannot be opened, since it does not exist.".format(self) ) if not self.exists_local and self.is_remote: self.download_from_remote() f = open(self) try: yield f finally: f.close() def contains_wildcard(self): return contains_wildcard(self.file) @property def is_remote(self): return is_flagged(self._file, "remote_object") @property def is_ancient(self): return is_flagged(self._file, "ancient") @property def is_directory(self): return is_flagged(self._file, "directory") @property def is_temp(self): return is_flagged(self._file, "temp") @property def is_multiext(self): return is_flagged(self._file, "multiext") @property def multiext_prefix(self): return get_flag_value(self._file, "multiext") def update_remote_filepath(self): remote_object = self.remote_object if remote_object._file != self._file: remote_object._iofile = self @property def should_keep_local(self): return self.remote_object.keep_local @property def should_stay_on_remote(self): return self.remote_object.stay_on_remote @property def remote_object(self): return get_flag_value(self._file, "remote_object") @property @_refer_to_remote def file(self): if not self._is_function: return self._file else: raise ValueError( "This IOFile is specified as a function and " "may not be used directly." ) def check(self): hint = ( "It can also lead to inconsistent results of the file-matching " "approach used by Snakemake." ) if self._file.startswith("./"): logger.warning( "Relative file path '{}' starts with './'. This is redundant " "and strongly discouraged. {} You can simply omit the './' " "for relative file paths.".format(self._file, hint) ) if self._file.startswith(" "): logger.warning( "File path '{}' starts with whitespace. " "This is likely unintended. {}".format(self._file, hint) ) if self._file.endswith(" "): logger.warning( "File path '{}' ends with whitespace. " "This is likely unintended. {}".format(self._file, hint) ) if "\n" in self._file: logger.warning( "File path '{}' contains line break. " "This is likely unintended. {}".format(self._file, hint) ) if _double_slash_regex.search(self._file) is not None and not self.is_remote: logger.warning( "File path {} contains double '{}'. " "This is likely unintended. {}".format(self._file, os.path.sep, hint) ) @property def exists(self): if self.is_remote: return self.exists_remote else: return self.exists_local def parents(self, omit=0): for p in list(Path(self.file).parents)[::-1][omit:]: p = IOFile(str(p), rule=self.rule) p.clone_flags(self) yield p @property @iocache def exists_local(self): return os.path.exists(self.file) @property @iocache def exists_remote(self): if not self.is_remote: return False return self.remote_object.exists() @property def protected(self): return ( self.exists_local and not os.access(self.file, os.W_OK) and not os.path.islink(self.file) ) @property @iocache def mtime(self): return self.mtime_uncached @property def mtime_uncached(self): mtime_remote = self.remote_object.mtime() if self.is_remote else None try: _stat = os.stat(self.file, follow_symlinks=False) is_symlink = stat.S_ISLNK(_stat.st_mode) is_dir = stat.S_ISDIR(_stat.st_mode) mtime = _stat.st_mtime def get_dir_mtime(): return os.stat( os.path.join(self.file, ".snakemake_timestamp"), follow_symlinks=True, ).st_mtime if not is_symlink: if is_dir: try: mtime = get_dir_mtime() except FileNotFoundError: pass return Mtime(local=mtime, remote=mtime_remote) else: target_stat = os.stat(self.file, follow_symlinks=True) is_dir = stat.S_ISDIR(target_stat.st_mode) mtime_target = target_stat.st_mtime if is_dir: try: mtime_target = get_dir_mtime() except FileNotFoundError: pass return Mtime( local=mtime, local_target=mtime_target, remote=mtime_remote ) except FileNotFoundError: if self.is_remote: return Mtime(remote=mtime_remote) raise WorkflowError( "Unable to obtain modification time of file {} although it existed before. " "It could be that a concurrent process has deleted it while Snakemake " "was running.".format(self.file) ) except PermissionError: raise WorkflowError( "Unable to obtain modification time of file {} because of missing " "read permissions.".format(self.file) ) @property def flags(self): return getattr(self._file, "flags", {}) @property @iocache @_refer_to_remote def size(self): return self.size_local @property def size_local(self): self.check_broken_symlink() return os.path.getsize(self.file) def check_broken_symlink(self): if not self.exists_local and os.lstat(self.file): raise WorkflowError( "File {} seems to be a broken symlink.".format(self.file) ) @_refer_to_remote def is_newer(self, time): if self.is_ancient: return False return self.mtime.local_or_remote(follow_symlinks=True) > time def download_from_remote(self): if self.is_remote and self.remote_object.exists(): if not self.should_stay_on_remote: logger.info("Downloading from remote: {}".format(self.file)) self.remote_object.download() logger.info("Finished download.") else: raise RemoteFileException( "The file to be downloaded does not seem to exist remotely." ) def upload_to_remote(self): if self.is_remote: logger.info("Uploading to remote: {}".format(self.file)) self.remote_object.upload() logger.info("Finished upload.") def prepare(self): path_until_wildcard = re.split(DYNAMIC_FILL, self.file)[0] dir = os.path.dirname(path_until_wildcard) if len(dir) > 0: try: os.makedirs(dir, exist_ok=True) except OSError as e: if e.errno != 17: raise e if is_flagged(self._file, "pipe"): os.mkfifo(self._file) def protect(self): mode = ( os.lstat(self.file).st_mode & ~stat.S_IWUSR & ~stat.S_IWGRP & ~stat.S_IWOTH ) if os.path.isdir(self.file): for root, dirs, files in os.walk(self.file): for d in dirs: lchmod(os.path.join(self.file, d), mode) for f in files: lchmod(os.path.join(self.file, f), mode) lchmod(self.file, mode) def remove(self, remove_non_empty_dir=False): if self.is_directory: remove(self, remove_non_empty_dir=True) else: remove(self, remove_non_empty_dir=remove_non_empty_dir) def touch(self, times=None): try: if self.is_directory: file = os.path.join(self.file, ".snakemake_timestamp") if not os.path.exists(file): with open(file, "w"): pass lutime(file, times) else: lutime(self.file, times) except OSError as e: if e.errno == 2: raise MissingOutputException( "Output file {} of rule {} shall be touched but " "does not exist.".format(self.file, self.rule.name), lineno=self.rule.lineno, snakefile=self.rule.snakefile, ) else: raise e def touch_or_create(self): try: self.touch() except MissingOutputException: # first create directory if it does not yet exist dir = self.file if self.is_directory else os.path.dirname(self.file) if dir: os.makedirs(dir, exist_ok=True) # create empty file file = ( os.path.join(self.file, ".snakemake_timestamp") if self.is_directory else self.file ) with open(file, "w") as f: pass def apply_wildcards(self, wildcards, fill_missing=False, fail_dynamic=False): f = self._file if self._is_function: f = self._file(Namedlist(fromdict=wildcards)) # this bit ensures flags are transferred over to files after # wildcards are applied file_with_wildcards_applied = IOFile( apply_wildcards( f, wildcards, fill_missing=fill_missing, fail_dynamic=fail_dynamic, dynamic_fill=DYNAMIC_FILL, ), rule=self.rule, ) file_with_wildcards_applied.clone_flags(self) return file_with_wildcards_applied def get_wildcard_names(self): return get_wildcard_names(self.file) def regex(self): if self._regex is None: # compile a regular expression self._regex = re.compile(regex(self.file)) return self._regex def constant_prefix(self): first_wildcard = _wildcard_regex.search(self.file) if first_wildcard: return self.file[: first_wildcard.start()] return self.file def constant_suffix(self): m = None for m in _wildcard_regex.finditer(self.file): pass last_wildcard = m if last_wildcard: return self.file[last_wildcard.end() :] return self.file def match(self, target): return self.regex().match(target) or None def format_dynamic(self): return self.replace(DYNAMIC_FILL, "{*}") def clone_flags(self, other): if isinstance(self._file, str): self._file = AnnotatedString(self._file) if isinstance(other._file, AnnotatedString): self._file.flags = getattr(other._file, "flags", {}).copy() if "remote_object" in self._file.flags: self._file.flags["remote_object"] = copy.copy( self._file.flags["remote_object"] ) self.update_remote_filepath() def clone_remote_object(self, other): if ( isinstance(other._file, AnnotatedString) and "remote_object" in other._file.flags ): self._file.flags["remote_object"] = copy.copy( other._file.flags["remote_object"] ) self.update_remote_filepath() def set_flags(self, flags): if isinstance(self._file, str): self._file = AnnotatedString(self._file) self._file.flags = flags def __eq__(self, other): f = other._file if isinstance(other, _IOFile) else other return self._file == f def __hash__(self): return self._file.__hash__() _double_slash_regex = ( re.compile(r"([^:]//|^//)") if os.path.sep == "/" else re.compile(r"\\\\") ) _wildcard_regex = re.compile( r""" \{ (?=( # This lookahead assertion emulates an 'atomic group' # which is required for performance \s*(?P<name>\w+) # wildcard name (\s*,\s* (?P<constraint> # an optional constraint ([^{}]+ | \{\d+(,\d+)?\})* # allow curly braces to nest one level ) # ... as in '{w,a{3,5}}' )?\s* ))\1 \} """, re.VERBOSE, ) def wait_for_files( files, latency_wait=3, force_stay_on_remote=False, ignore_pipe=False ): files = list(files) def get_missing(): return [ f for f in files if not ( f.exists_remote if ( isinstance(f, _IOFile) and f.is_remote and (force_stay_on_remote or f.should_stay_on_remote) ) else os.path.exists(f) if not (is_flagged(f, "pipe") and ignore_pipe) else True ) ] missing = get_missing() if missing: logger.info( "Waiting at most {} seconds for missing files.".format(latency_wait) ) for _ in range(latency_wait): if not get_missing(): return time.sleep(1) raise IOError( "Missing files after {} seconds:\n{}".format( latency_wait, "\n".join(get_missing()) ) ) def get_wildcard_names(pattern): return set(match.group("name") for match in _wildcard_regex.finditer(pattern)) def contains_wildcard(path): return _wildcard_regex.search(path) is not None def contains_wildcard_constraints(pattern): return any(match.group("constraint") for match in _wildcard_regex.finditer(pattern)) def remove(file, remove_non_empty_dir=False): if file.is_remote and file.should_stay_on_remote: if file.exists_remote: file.remote_object.remove() elif os.path.isdir(file) and not os.path.islink(file): if remove_non_empty_dir: shutil.rmtree(file) else: try: os.removedirs(file) except OSError as e: # skip non empty directories if e.errno == 39: logger.info( "Skipped removing non-empty directory {}".format(e.filename) ) else: logger.warning(str(e)) # Remember that dangling symlinks fail the os.path.exists() test, but # we definitely still want to zap them. try/except is the safest way. # Also, we don't want to remove the null device if it is an output. elif os.devnull != str(file): try: os.remove(file) except FileNotFoundError: pass def regex(filepattern): f = [] last = 0 wildcards = set() for match in _wildcard_regex.finditer(filepattern): f.append(re.escape(filepattern[last : match.start()])) wildcard = match.group("name") if wildcard in wildcards: if match.group("constraint"): raise ValueError( "Constraint regex must be defined only in the first " "occurence of the wildcard in a string." ) f.append("(?P={})".format(wildcard)) else: wildcards.add(wildcard) f.append( "(?P<{}>{})".format( wildcard, match.group("constraint") if match.group("constraint") else ".+", ) ) last = match.end() f.append(re.escape(filepattern[last:])) f.append("$") return "".join(f) def apply_wildcards( pattern, wildcards, fill_missing=False, fail_dynamic=False, dynamic_fill=None, keep_dynamic=False, ): def format_match(match): name = match.group("name") try: value = wildcards[name] if fail_dynamic and value == dynamic_fill: raise WildcardError(name) return str(value) except KeyError as ex: if keep_dynamic: return "{{{}}}".format(name) elif fill_missing: return dynamic_fill else: raise WildcardError(str(ex)) return _wildcard_regex.sub(format_match, pattern) def not_iterable(value): return ( isinstance(value, str) or isinstance(value, dict) or not isinstance(value, collections.abc.Iterable) ) def is_callable(value): return ( callable(value) or (isinstance(value, _IOFile) and value._is_function) or (isinstance(value, AnnotatedString) and value.callable is not None) ) class AnnotatedString(str): def __init__(self, value): self.flags = dict() self.callable = value if is_callable(value) else None def flag(value, flag_type, flag_value=True): if isinstance(value, AnnotatedString): value.flags[flag_type] = flag_value return value if not_iterable(value): value = AnnotatedString(value) value.flags[flag_type] = flag_value return value return [flag(v, flag_type, flag_value=flag_value) for v in value] def is_flagged(value, flag): if isinstance(value, AnnotatedString): return flag in value.flags and value.flags[flag] if isinstance(value, _IOFile): return flag in value.flags and value.flags[flag] return False def get_flag_value(value, flag_type): if isinstance(value, AnnotatedString) or isinstance(value, _IOFile): if flag_type in value.flags: return value.flags[flag_type] else: return None def ancient(value): return flag(value, "ancient") def directory(value): if is_flagged(value, "pipe"): raise SyntaxError("Pipe and directory flags are mutually exclusive.") if is_flagged(value, "remote"): raise SyntaxError("Remote and directory flags are mutually exclusive.") if is_flagged(value, "dynamic"): raise SyntaxError("Dynamic and directory flags are mutually exclusive.") return flag(value, "directory") def temp(value): if is_flagged(value, "protected"): raise SyntaxError("Protected and temporary flags are mutually exclusive.") if is_flagged(value, "remote"): raise SyntaxError("Remote and temporary flags are mutually exclusive.") return flag(value, "temp") def pipe(value): if is_flagged(value, "protected"): raise SyntaxError("Pipes may not be protected.") if is_flagged(value, "remote"): raise SyntaxError("Pipes may not be remote files.") if ON_WINDOWS: logger.warning("Pipes is not yet supported on Windows.") return flag(value, "pipe", not ON_WINDOWS) def temporary(value): return temp(value) def protected(value): if is_flagged(value, "temp"): raise SyntaxError("Protected and temporary flags are mutually exclusive.") if is_flagged(value, "remote"): raise SyntaxError("Remote and protected flags are mutually exclusive.") return flag(value, "protected") def dynamic(value): annotated = flag(value, "dynamic", True) tocheck = [annotated] if not_iterable(annotated) else annotated for file in tocheck: matches = list(_wildcard_regex.finditer(file)) for match in matches: if match.group("constraint"): raise SyntaxError( "The wildcards in dynamic files cannot be constrained." ) return annotated def touch(value): return flag(value, "touch") def unpack(value): return flag(value, "unpack") def repeat(value, n_repeat): return flag(value, "repeat", n_repeat) def checkpoint_target(value): return flag(value, "checkpoint_target") ReportObject = collections.namedtuple( "ReportObject", ["caption", "category", "subcategory", "patterns", "htmlindex"] ) def report( value, caption=None, category=None, subcategory=None, patterns=[], htmlindex=None ): return flag( value, "report", ReportObject(caption, category, subcategory, patterns, htmlindex), ) def local(value): if is_flagged(value, "remote"): raise SyntaxError("Remote and local flags are mutually exclusive.") return flag(value, "local") def expand(*args, **wildcards): filepatterns = args[0] if len(args) == 1: combinator = product elif len(args) == 2: combinator = args[1] if isinstance(filepatterns, str) or isinstance(filepatterns, Path): filepatterns = [filepatterns] def path_to_str(f): if isinstance(f, Path): return str(f) return f filepatterns = list(map(path_to_str, filepatterns)) if any(map(lambda f: getattr(f, "flags", {}), filepatterns)): raise WorkflowError( "Flags in file patterns given to expand() are invalid. " "Flags (e.g. temp(), directory()) have to be applied outside " "of expand (e.g. 'temp(expand(\"plots/{sample}.pdf\", sample=SAMPLES))')." ) format_dict = dict if "allow_missing" in wildcards and wildcards["allow_missing"] is True: class FormatDict(dict): def __missing__(self, key): return "{" + key + "}" format_dict = FormatDict for filepattern in filepatterns: if "allow_missing" in re.findall(r"{([^}\.[!:]+)", filepattern): format_dict = dict break wildcards = { filepattern: { k: v for k, v in wildcards.items() if k in re.findall(r"{([^}\.[!:]+)", filepattern) } for filepattern in filepatterns } def flatten(wildcards): for wildcard, values in wildcards.items(): if isinstance(values, str) or not isinstance( values, collections.abc.Iterable ): values = [values] yield [(wildcard, value) for value in values] formatter = string.Formatter() try: return [ formatter.vformat(filepattern, (), comb) for filepattern in filepatterns for comb in map(format_dict, combinator(*flatten(wildcards[filepattern]))) ] except KeyError as e: raise WildcardError("No values given for wildcard {}.".format(e)) def multiext(prefix, *extensions): if any((r"/" in ext or r"\\" in ext) for ext in extensions): raise WorkflowError( r"Extensions for multiext may not contain path delimiters " r"(/,\)." ) return [flag(prefix + ext, "multiext", flag_value=prefix) for ext in extensions] def limit(pattern, **wildcards): return pattern.format( **{ wildcard: "{{{},{}}}".format(wildcard, "|".join(values)) for wildcard, values in wildcards.items() } ) def glob_wildcards(pattern, files=None, followlinks=False): pattern = os.path.normpath(pattern) first_wildcard = re.search("{[^{]", pattern) dirname = ( os.path.dirname(pattern[: first_wildcard.start()]) if first_wildcard else os.path.dirname(pattern) ) if not dirname: dirname = "." names = [match.group("name") for match in _wildcard_regex.finditer(pattern)] Wildcards = collections.namedtuple("Wildcards", names) wildcards = Wildcards(*[list() for name in names]) pattern = re.compile(regex(pattern)) if files is None: files = ( os.path.normpath(os.path.join(dirpath, f)) for dirpath, dirnames, filenames in os.walk( dirname, followlinks=followlinks ) for f in chain(filenames, dirnames) ) for f in files: match = re.match(pattern, f) if match: for name, value in match.groupdict().items(): getattr(wildcards, name).append(value) return wildcards def update_wildcard_constraints( pattern, wildcard_constraints, global_wildcard_constraints ): def replace_constraint(match): name = match.group("name") constraint = match.group("constraint") newconstraint = wildcard_constraints.get( name, global_wildcard_constraints.get(name) ) if name in examined_names: return match.group(0) examined_names.add(name) if constraint is not None: return match.group(0) # Only update if a new constraint has actually been set elif newconstraint is not None: return "{{{},{}}}".format(name, newconstraint) else: return match.group(0) examined_names = set() updated = _wildcard_regex.sub(replace_constraint, pattern) # inherit flags if isinstance(pattern, AnnotatedString): updated = AnnotatedString(updated) updated.flags = dict(pattern.flags) return updated def split_git_path(path): file_sub = re.sub(r"^git\+file:/+", "/", path) (file_path, version) = file_sub.split("@") file_path = os.path.realpath(file_path) root_path = get_git_root(file_path) if file_path.startswith(root_path): file_path = file_path[len(root_path) :].lstrip("/") return (root_path, file_path, version) def get_git_root(path): import git try: git_repo = git.Repo(path, search_parent_directories=True) return git_repo.git.rev_parse("--show-toplevel") except git.exc.NoSuchPathError: tail, head = os.path.split(path) return get_git_root_parent_directory(tail, path) def get_git_root_parent_directory(path, input_path): import git try: git_repo = git.Repo(path, search_parent_directories=True) return git_repo.git.rev_parse("--show-toplevel") except git.exc.NoSuchPathError: tail, head = os.path.split(path) if tail is None: raise WorkflowError( "Neither provided git path ({}) ".format(input_path) + "or parent directories contain a valid git repo." ) else: return get_git_root_parent_directory(tail, input_path) def git_content(git_file): import git if git_file.startswith("git+file:"): (root_path, file_path, version) = split_git_path(git_file) return git.Repo(root_path).git.show("{}:{}".format(version, file_path)) else: raise WorkflowError( "Provided git path ({}) doesn't meet the " "expected format:".format(git_file) + ", expected format is " "git+file://PATH_TO_REPO/PATH_TO_FILE_INSIDE_REPO@VERSION" ) def strip_wildcard_constraints(pattern): def strip_constraint(match): return "{{{}}}".format(match.group("name")) return _wildcard_regex.sub(strip_constraint, pattern) class Namedlist(list): def __init__( self, toclone=None, fromdict=None, plainstr=False, strip_constraints=False, custom_map=None, ): list.__init__(self) self._names = dict() self._allowed_overrides = ["index", "sort"] for name in self._allowed_overrides: setattr(self, name, functools.partial(self._used_attribute, _name=name)) if toclone: if custom_map is not None: self.extend(map(custom_map, toclone)) elif plainstr: self.extend(map(str, toclone)) elif strip_constraints: self.extend(map(strip_wildcard_constraints, toclone)) else: self.extend(toclone) if isinstance(toclone, Namedlist): self._take_names(toclone._get_names()) if fromdict: for key, item in fromdict.items(): self.append(item) self._add_name(key) @staticmethod def _used_attribute(*args, _name, **kwargs): raise AttributeError( "{_name}() cannot be used; attribute name reserved" " for use in some existing workflows".format(_name=_name) ) def _add_name(self, name): self._set_name(name, len(self) - 1) def _set_name(self, name, index, end=None): if name not in self._allowed_overrides and hasattr(self.__class__, name): raise AttributeError( "invalid name for input, output, wildcard, " "params or log: {name} is reserved for internal use".format(name=name) ) self._names[name] = (index, end) if end is None: setattr(self, name, self[index]) else: setattr(self, name, Namedlist(toclone=self[index:end])) def _get_names(self): for name, index in self._names.items(): yield name, index def _take_names(self, names): for name, (i, j) in names: self._set_name(name, i, end=j) def items(self): for name in self._names: yield name, getattr(self, name) def _allitems(self): next = 0 for name, index in sorted( self._names.items(), key=lambda item: ( item[1][0], item[1][0] + 1 if item[1][1] is None else item[1][1], ), ): start, end = index if end is None: end = start + 1 if start > next: for item in self[next:start]: yield None, item yield name, getattr(self, name) next = end for item in self[next:]: yield None, item def _insert_items(self, index, items): self[index : index + 1] = items add = len(items) - 1 for name, (i, j) in self._names.items(): if i > index: self._names[name] = (i + add, None if j is None else j + add) elif i == index: self._set_name(name, i, end=i + len(items)) def keys(self): return self._names.keys() def _plainstrings(self): return self.__class__.__call__(toclone=self, plainstr=True) def _stripped_constraints(self): return self.__class__.__call__(toclone=self, strip_constraints=True) def _clone(self): return self.__class__.__call__(toclone=self) def get(self, key, default_value=None): return self.__dict__.get(key, default_value) def __getitem__(self, key): try: return super().__getitem__(key) except TypeError: pass return getattr(self, key) def __hash__(self): return hash(tuple(self)) def __str__(self): return " ".join(map(str, self)) class InputFiles(Namedlist): @property def size(self): return sum(f.size for f in self) @property def size_mb(self): return self.size / 1024 / 1024 class OutputFiles(Namedlist): pass class Wildcards(Namedlist): pass class Params(Namedlist): pass class Resources(Namedlist): pass class Log(Namedlist): pass def _load_configfile(configpath_or_obj, filetype="Config"): import yaml if isinstance(configpath_or_obj, str) or isinstance(configpath_or_obj, Path): obj = open(configpath_or_obj) else: obj = configpath_or_obj try: with obj as f: try: return json.load(f, object_pairs_hook=collections.OrderedDict) except ValueError: f.seek(0) try: class OrderedLoader(yaml.Loader): pass def construct_mapping(loader, node): loader.flatten_mapping(node) return collections.OrderedDict(loader.construct_pairs(node)) OrderedLoader.add_constructor( yaml.resolver.BaseResolver.DEFAULT_MAPPING_TAG, construct_mapping ) return yaml.load(f, Loader=OrderedLoader) except yaml.YAMLError: raise WorkflowError( "Config file is not valid JSON or YAML. " "In case of YAML, make sure to not mix " "whitespace and tab indentation.".format(filetype) ) except FileNotFoundError: raise WorkflowError("{} file {} not found.".format(filetype, configpath)) def load_configfile(configpath): config = _load_configfile(configpath) if not isinstance(config, dict): raise WorkflowError( "Config file must be given as JSON or YAML " "with keys at top level." ) return config "((?P<value>.+)(?P=value){{{min_repeat},{max_repeat}}})$".format( min_repeat=min_repeat - 1, max_repeat=max_repeat - 1 ) ) def is_periodic(self, value): if len(value) < self.min_repeat: return None last_letter = value[-1] counter = collections.Counter(value) if counter[last_letter] < self.min_repeat: return None pos = 2 while ( value[-pos] != last_letter ): if ( len(value) < (pos * self.min_repeat) or counter[value[-pos]] < self.min_repeat ): return None pos += 1 m = self.regex.search(value) if m is not None: return m.group("value")
true
true
f71e5ea1ec662b1ee9b1d78de3fc6bfa709dc4fd
2,100
py
Python
src/compas_plotters/artists/pointartist.py
funkchaser/compas
b58de8771484aa0c6068d43df78b1679503215de
[ "MIT" ]
235
2017-11-07T07:33:22.000Z
2022-03-25T16:20:00.000Z
src/compas_plotters/artists/pointartist.py
funkchaser/compas
b58de8771484aa0c6068d43df78b1679503215de
[ "MIT" ]
770
2017-09-22T13:42:06.000Z
2022-03-31T21:26:45.000Z
src/compas_plotters/artists/pointartist.py
funkchaser/compas
b58de8771484aa0c6068d43df78b1679503215de
[ "MIT" ]
99
2017-11-06T23:15:28.000Z
2022-03-25T16:05:36.000Z
from typing import Tuple from typing import List from typing import Any from matplotlib.patches import Circle from matplotlib.transforms import ScaledTranslation from compas.geometry import Point from compas.artists import PrimitiveArtist from .artist import PlotterArtist Color = Tuple[float, float, float] class PointArtist(PlotterArtist, PrimitiveArtist): """Artist for COMPAS points.""" def __init__(self, point: Point, size: int = 5, facecolor: Color = (1.0, 1.0, 1.0), edgecolor: Color = (0, 0, 0), zorder: int = 9000, **kwargs: Any): super().__init__(primitive=point, **kwargs) self._mpl_circle = None self._size = None self.size = size self.facecolor = facecolor self.edgecolor = edgecolor self.zorder = zorder @property def point(self): return self.primitive @point.setter def point(self, point): self.primitive = point @property def _T(self): F = self.plotter.figure.dpi_scale_trans S = ScaledTranslation(self.point[0], self.point[1], self.plotter.axes.transData) T = F + S return T @property def size(self) -> float: return self._size / self.plotter.dpi @size.setter def size(self, size: int): self._size = size @property def data(self) -> List[List[float]]: return [self.point[:2]] def draw(self) -> None: circle = Circle( [0, 0], radius=self.size, facecolor=self.facecolor, edgecolor=self.edgecolor, transform=self._T, zorder=self.zorder ) self._mpl_circle = self.plotter.axes.add_artist(circle) self.update_data() def redraw(self) -> None: self._mpl_circle.set_radius(self.size) self._mpl_circle.set_edgecolor(self.edgecolor) self._mpl_circle.set_facecolor(self.facecolor) self._mpl_circle.set_transform(self._T) self.update_data()
26.25
88
0.601905
from typing import Tuple from typing import List from typing import Any from matplotlib.patches import Circle from matplotlib.transforms import ScaledTranslation from compas.geometry import Point from compas.artists import PrimitiveArtist from .artist import PlotterArtist Color = Tuple[float, float, float] class PointArtist(PlotterArtist, PrimitiveArtist): def __init__(self, point: Point, size: int = 5, facecolor: Color = (1.0, 1.0, 1.0), edgecolor: Color = (0, 0, 0), zorder: int = 9000, **kwargs: Any): super().__init__(primitive=point, **kwargs) self._mpl_circle = None self._size = None self.size = size self.facecolor = facecolor self.edgecolor = edgecolor self.zorder = zorder @property def point(self): return self.primitive @point.setter def point(self, point): self.primitive = point @property def _T(self): F = self.plotter.figure.dpi_scale_trans S = ScaledTranslation(self.point[0], self.point[1], self.plotter.axes.transData) T = F + S return T @property def size(self) -> float: return self._size / self.plotter.dpi @size.setter def size(self, size: int): self._size = size @property def data(self) -> List[List[float]]: return [self.point[:2]] def draw(self) -> None: circle = Circle( [0, 0], radius=self.size, facecolor=self.facecolor, edgecolor=self.edgecolor, transform=self._T, zorder=self.zorder ) self._mpl_circle = self.plotter.axes.add_artist(circle) self.update_data() def redraw(self) -> None: self._mpl_circle.set_radius(self.size) self._mpl_circle.set_edgecolor(self.edgecolor) self._mpl_circle.set_facecolor(self.facecolor) self._mpl_circle.set_transform(self._T) self.update_data()
true
true
f71e5fdeb867d750cbfc67468c01f5b8fc81fd15
9,510
py
Python
modules/s3/s3fields.py
apocsantos/eden
8b71af6b4dc72e2c4d656dbe1bb3943426705422
[ "MIT" ]
1
2017-03-15T23:29:41.000Z
2017-03-15T23:29:41.000Z
modules/s3/s3fields.py
apocsantos/eden
8b71af6b4dc72e2c4d656dbe1bb3943426705422
[ "MIT" ]
null
null
null
modules/s3/s3fields.py
apocsantos/eden
8b71af6b4dc72e2c4d656dbe1bb3943426705422
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ S3 Extensions for gluon.dal.Field, reusable fields @requires: U{B{I{gluon}} <http://web2py.com>} @author: Dominic König <dominic[at]aidiq.com> @copyright: 2009-2012 (c) Sahana Software Foundation @license: MIT Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ __all__ = ["QueryS3", "FieldS3", "S3ReusableField", "s3uuid", "s3_meta_uuid", "s3_meta_mci", "s3_uid", "s3_meta_deletion_status", "s3_meta_deletion_fk", "s3_deletion_status", "s3_meta_created_on", "s3_meta_modified_on", "s3_timestamp"] import datetime from gluon import current from gluon.dal import Query, Field, SQLCustomType from gluon.storage import Storage from gluon.html import * from gluon.validators import * # ============================================================================= class QueryS3(Query): """ S3 extensions of the gluon.sql.Query class If Server Side Pagination is on, the proper CAST is needed to match the string-typed id to lookup table id @author: sunneach """ def __init__(self, left, op=None, right=None): if op <> "join_via": Query.__init__(self, left, op, right) else: self.sql = "CAST(TRIM(%s,"|") AS INTEGER)=%s" % (left, right) # ============================================================================= class FieldS3(Field): """ S3 extensions of the gluon.sql.Field clas If Server Side Pagination is on, the proper CAST is needed to match the lookup table id @author: sunneach """ def __init__(self, fieldname, type="string", length=None, default=None, required=False, requires="<default>", ondelete="CASCADE", notnull=False, unique=False, uploadfield=True, widget=None, label=None, comment=None, writable=True, readable=True, update=None, authorize=None, autodelete=False, represent=None, uploadfolder=None, compute=None, sortby=None): self.sortby = sortby Field.__init__(self, fieldname, type, length, default, required, requires, ondelete, notnull, unique, uploadfield, widget, label, comment, writable, readable, update, authorize, autodelete, represent, uploadfolder, compute) def join_via(self, value): if self.type.find("reference") == 0: return Query(self, "=", value) else: return QueryS3(self, "join_via", value) # ============================================================================= class S3ReusableField(object): """ DRY Helper for reusable fields: This creates neither a Table nor a Field, but just an argument store. The field is created with the __call__ method, which is faster than copying an existing field. @author: Dominic König """ def __init__(self, name, type="string", **attr): self.name = name self.__type = type self.attr = Storage(attr) def __call__(self, name=None, **attr): if not name: name = self.name ia = Storage(self.attr) if attr: if not attr.get("empty", True): requires = ia.requires if requires: if not isinstance(requires, (list, tuple)): requires = [requires] if requires: r = requires[0] if isinstance(r, IS_EMPTY_OR): requires = r.other ia.update(requires=requires) if "empty" in attr: del attr["empty"] ia.update(**attr) if "script" in ia: if ia.script: if ia.comment: ia.comment = TAG[""](ia.comment, ia.script) else: ia.comment = ia.script del ia["script"] if ia.sortby is not None: return FieldS3(name, self.__type, **ia) else: return Field(name, self.__type, **ia) # ============================================================================= # Use URNs according to http://tools.ietf.org/html/rfc4122 def s3_uuid(): import uuid return uuid.uuid4() s3uuid = SQLCustomType(type = "string", native = "VARCHAR(128)", encoder = lambda x: "%s" % (s3_uuid().urn if x == "" else unicode(x.encode("utf-8"))), decoder = lambda x: x) try: db = current.db except: # Running from 000_1st_run pass else: if current.db._adapter.represent("X", s3uuid) != "'X'": # Old web2py DAL, must add quotes in encoder s3uuid = SQLCustomType(type = "string", native = "VARCHAR(128)", encoder = (lambda x: "'%s'" % (s3_uuid().urn if x == "" else str(x.encode("utf-8")).replace("'", "''"))), decoder = (lambda x: x)) # ============================================================================= # Record identity meta-fields # Universally unique identifier for a record s3_meta_uuid = S3ReusableField("uuid", type=s3uuid, length=128, notnull=True, unique=True, readable=False, writable=False, default="") # Master-Copy-Index (for Sync) s3_meta_mci = S3ReusableField("mci", "integer", default=0, readable=False, writable=False) def s3_uid(): return (s3_meta_uuid(), s3_meta_mci()) # ============================================================================= # Record "soft"-deletion meta-fields # "Deleted"-flag s3_meta_deletion_status = S3ReusableField("deleted", "boolean", readable=False, writable=False, default=False) # Parked foreign keys of a deleted record # => to be restored upon "un"-delete s3_meta_deletion_fk = S3ReusableField("deleted_fk", #"text", readable=False, writable=False) def s3_deletion_status(): return (s3_meta_deletion_status(), s3_meta_deletion_fk()) # ----------------------------------------------------------------------------- # Record timestamp meta-fields s3_meta_created_on = S3ReusableField("created_on", "datetime", readable=False, writable=False, default=lambda: datetime.datetime.utcnow()) s3_meta_modified_on = S3ReusableField("modified_on", "datetime", readable=False, writable=False, default=lambda: datetime.datetime.utcnow(), update=lambda: datetime.datetime.utcnow()) def s3_timestamp(): return (s3_meta_created_on(), s3_meta_modified_on()) # =============================================================================
33.020833
93
0.465089
""" S3 Extensions for gluon.dal.Field, reusable fields @requires: U{B{I{gluon}} <http://web2py.com>} @author: Dominic König <dominic[at]aidiq.com> @copyright: 2009-2012 (c) Sahana Software Foundation @license: MIT Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ __all__ = ["QueryS3", "FieldS3", "S3ReusableField", "s3uuid", "s3_meta_uuid", "s3_meta_mci", "s3_uid", "s3_meta_deletion_status", "s3_meta_deletion_fk", "s3_deletion_status", "s3_meta_created_on", "s3_meta_modified_on", "s3_timestamp"] import datetime from gluon import current from gluon.dal import Query, Field, SQLCustomType from gluon.storage import Storage from gluon.html import * from gluon.validators import * class QueryS3(Query): """ S3 extensions of the gluon.sql.Query class If Server Side Pagination is on, the proper CAST is needed to match the string-typed id to lookup table id @author: sunneach """ def __init__(self, left, op=None, right=None): if op <> "join_via": Query.__init__(self, left, op, right) else: self.sql = "CAST(TRIM(%s,"|") AS INTEGER)=%s" % (left, right) class FieldS3(Field): """ S3 extensions of the gluon.sql.Field clas If Server Side Pagination is on, the proper CAST is needed to match the lookup table id @author: sunneach """ def __init__(self, fieldname, type="string", length=None, default=None, required=False, requires="<default>", ondelete="CASCADE", notnull=False, unique=False, uploadfield=True, widget=None, label=None, comment=None, writable=True, readable=True, update=None, authorize=None, autodelete=False, represent=None, uploadfolder=None, compute=None, sortby=None): self.sortby = sortby Field.__init__(self, fieldname, type, length, default, required, requires, ondelete, notnull, unique, uploadfield, widget, label, comment, writable, readable, update, authorize, autodelete, represent, uploadfolder, compute) def join_via(self, value): if self.type.find("reference") == 0: return Query(self, "=", value) else: return QueryS3(self, "join_via", value) class S3ReusableField(object): """ DRY Helper for reusable fields: This creates neither a Table nor a Field, but just an argument store. The field is created with the __call__ method, which is faster than copying an existing field. @author: Dominic König """ def __init__(self, name, type="string", **attr): self.name = name self.__type = type self.attr = Storage(attr) def __call__(self, name=None, **attr): if not name: name = self.name ia = Storage(self.attr) if attr: if not attr.get("empty", True): requires = ia.requires if requires: if not isinstance(requires, (list, tuple)): requires = [requires] if requires: r = requires[0] if isinstance(r, IS_EMPTY_OR): requires = r.other ia.update(requires=requires) if "empty" in attr: del attr["empty"] ia.update(**attr) if "script" in ia: if ia.script: if ia.comment: ia.comment = TAG[""](ia.comment, ia.script) else: ia.comment = ia.script del ia["script"] if ia.sortby is not None: return FieldS3(name, self.__type, **ia) else: return Field(name, self.__type, **ia) def s3_uuid(): import uuid return uuid.uuid4() s3uuid = SQLCustomType(type = "string", native = "VARCHAR(128)", encoder = lambda x: "%s" % (s3_uuid().urn if x == "" else unicode(x.encode("utf-8"))), decoder = lambda x: x) try: db = current.db except: pass else: if current.db._adapter.represent("X", s3uuid) != "'X'": s3uuid = SQLCustomType(type = "string", native = "VARCHAR(128)", encoder = (lambda x: "'%s'" % (s3_uuid().urn if x == "" else str(x.encode("utf-8")).replace("'", "''"))), decoder = (lambda x: x)) # ============================================================================= # Record identity meta-fields # Universally unique identifier for a record s3_meta_uuid = S3ReusableField("uuid", type=s3uuid, length=128, notnull=True, unique=True, readable=False, writable=False, default="") # Master-Copy-Index (for Sync) s3_meta_mci = S3ReusableField("mci", "integer", default=0, readable=False, writable=False) def s3_uid(): return (s3_meta_uuid(), s3_meta_mci()) # ============================================================================= # Record "soft"-deletion meta-fields # "Deleted"-flag s3_meta_deletion_status = S3ReusableField("deleted", "boolean", readable=False, writable=False, default=False) # Parked foreign keys of a deleted record # => to be restored upon "un"-delete s3_meta_deletion_fk = S3ReusableField("deleted_fk", #"text", readable=False, writable=False) def s3_deletion_status(): return (s3_meta_deletion_status(), s3_meta_deletion_fk()) # ----------------------------------------------------------------------------- # Record timestamp meta-fields s3_meta_created_on = S3ReusableField("created_on", "datetime", readable=False, writable=False, default=lambda: datetime.datetime.utcnow()) s3_meta_modified_on = S3ReusableField("modified_on", "datetime", readable=False, writable=False, default=lambda: datetime.datetime.utcnow(), update=lambda: datetime.datetime.utcnow()) def s3_timestamp(): return (s3_meta_created_on(), s3_meta_modified_on()) # =============================================================================
false
true
f71e5fe49a6e3ab2639977a6bb855247cd56baa2
5,565
py
Python
train/exp_configs/rl/singleagent/test-stl-nw-profit-mid.py
mepear/flow
4fc6ceaf64ca522b5a5c4104a3098b20cf207dd4
[ "MIT" ]
1
2021-03-05T07:39:51.000Z
2021-03-05T07:39:51.000Z
train/exp_configs/rl/singleagent/test-stl-nw-profit-mid.py
mepear/flow
4fc6ceaf64ca522b5a5c4104a3098b20cf207dd4
[ "MIT" ]
1
2021-09-13T02:16:02.000Z
2021-09-13T02:16:02.000Z
train/exp_configs/rl/singleagent/test-stl-nw-profit-mid.py
mepear/flow
4fc6ceaf64ca522b5a5c4104a3098b20cf207dd4
[ "MIT" ]
1
2021-08-21T13:58:30.000Z
2021-08-21T13:58:30.000Z
"""Grid example.""" from flow.controllers import GridRouter, IDMController, RLController from flow.controllers.routing_controllers import MinicityRouter from flow.core.params import SumoParams, EnvParams, InitialConfig, NetParams from flow.core.params import VehicleParams, PersonParams from flow.core.params import TrafficLightParams from flow.core.params import SumoCarFollowingParams, SumoLaneChangeParams from flow.core.params import InFlows # from flow.envs.ring.accel import AccelEnv, ADDITIONAL_ENV_PARAMS from flow.envs.dispatch_and_reposition import DispatchAndRepositionEnv, ADDITIONAL_ENV_PARAMS from flow.networks import GridnxmNetwork v_enter = 10 inner_length = 50 n_rows = 4 n_columns = 4 grid_array = { "inner_length": inner_length, "row_num": n_rows, "col_num": n_columns, "sub_edge_num": 1 } def get_non_flow_params(enter_speed, add_net_params): """Define the network and initial params in the absence of inflows. Note that when a vehicle leaves a network in this case, it is immediately returns to the start of the row/column it was traversing, and in the same direction as it was before. Parameters ---------- enter_speed : float initial speed of vehicles as they enter the network. add_net_params: dict additional network-specific parameters (unique to the grid) Returns ------- flow.core.params.InitialConfig parameters specifying the initial configuration of vehicles in the network flow.core.params.NetParams network-specific parameters used to generate the network """ additional_init_params = {'enter_speed': enter_speed} initial = InitialConfig( x0=2.5, spacing='uniform', min_gap=10, additional_params=additional_init_params) # gap needs to be large enough net = NetParams(additional_params=add_net_params) return initial, net persons = PersonParams() vehicles = VehicleParams() vehicles.add( veh_id="idm", acceleration_controller=(IDMController, {}), routing_controller=(MinicityRouter, {}), car_following_params=SumoCarFollowingParams( speed_mode='all_checks', min_gap=5, decel=10.0, # avoid collisions at emergency stops max_speed=10, ), lane_change_params=SumoLaneChangeParams( lane_change_mode="no_lc_safe", ), initial_speed=0, num_vehicles=25) vehicles.add( veh_id="taxi", initial_speed=0, acceleration_controller=(RLController, {}), # routing_controller=(MinicityRouter, {}), car_following_params=SumoCarFollowingParams( speed_mode='all_checks', min_gap=5, decel=10.0, # avoid collisions at emergency stops max_speed=10, ), lane_change_params=SumoLaneChangeParams( lane_change_mode="sumo_default", ), num_vehicles=15, is_taxi=False) tl_logic = TrafficLightParams(baseline=False) phases = [{ "duration": "5", "minDur": "5", "maxDur": "5", "state": "GGggrrrrGGggrrrr" }, { "duration": "1", "minDur": "1", "maxDur": "1", "state": "yyyyrrrryyyyrrrr" }, { "duration": "5", "minDur": "5", "maxDur": "5", "state": "rrrrGGggrrrrGGgg" }, { "duration": "1", "minDur": "1", "maxDur": "1", "state": "rrrryyyyrrrryyyy" }] tl_logic.add("center9", phases=phases) tl_logic.add("center10", phases=phases) tl_logic.add("center5", phases=phases) tl_logic.add("center6", phases=phases) additional_net_params = { "grid_array": grid_array, "speed_limit": 35, "horizontal_lanes": 1, "vertical_lanes": 1, "print_warnings": False, # warnings in building net } initial_config, net_params = get_non_flow_params( enter_speed=v_enter, add_net_params=additional_net_params) additional_params = ADDITIONAL_ENV_PARAMS.copy() additional_params["time_price"] = 0.01 additional_params["distance_price"] = 0.01 additional_params["pickup_price"] = 1 additional_params["wait_penalty"] = 0.000 additional_params["tle_penalty"] = 0.01 additional_params["person_prob"] = 0.06 additional_params["max_waiting_time"] = 30 additional_params["free_pickup_time"] = 0.0 additional_params["distribution"] = 'mode-11' additional_params["n_mid_edge"] = 1 flow_params = dict( # name of the experiment exp_tag='grid-intersection', # name of the flow environment the experiment is running on env_name=DispatchAndRepositionEnv, # name of the network class the experiment is running on network=GridnxmNetwork, # simulator that is used by the experiment simulator='traci', # sumo-related parameters (see flow.core.params.SumoParams) sim=SumoParams( sim_step=1, render=False, print_warnings=False, restart_instance=True # taxi_dispatch_alg="greedy" ), # environment related parameters (see flow.core.params.EnvParams) env=EnvParams( horizon=500, additional_params=additional_params, ), # network-related parameters (see flow.core.params.NetParams and the # network's documentation or ADDITIONAL_NET_PARAMS component) net=net_params, # vehicles to be placed in the network at the start of a rollout (see # flow.core.params.VehicleParams) veh=vehicles, per=persons, # parameters specifying the positioning of vehicles upon initialization/ # reset (see flow.core.params.InitialConfig) initial=initial_config, # traffic lights to be introduced to specific nodes (see # flow.core.params.TrafficLightParams) tls=tl_logic, )
29.919355
119
0.709793
from flow.controllers import GridRouter, IDMController, RLController from flow.controllers.routing_controllers import MinicityRouter from flow.core.params import SumoParams, EnvParams, InitialConfig, NetParams from flow.core.params import VehicleParams, PersonParams from flow.core.params import TrafficLightParams from flow.core.params import SumoCarFollowingParams, SumoLaneChangeParams from flow.core.params import InFlows from flow.envs.dispatch_and_reposition import DispatchAndRepositionEnv, ADDITIONAL_ENV_PARAMS from flow.networks import GridnxmNetwork v_enter = 10 inner_length = 50 n_rows = 4 n_columns = 4 grid_array = { "inner_length": inner_length, "row_num": n_rows, "col_num": n_columns, "sub_edge_num": 1 } def get_non_flow_params(enter_speed, add_net_params): additional_init_params = {'enter_speed': enter_speed} initial = InitialConfig( x0=2.5, spacing='uniform', min_gap=10, additional_params=additional_init_params) net = NetParams(additional_params=add_net_params) return initial, net persons = PersonParams() vehicles = VehicleParams() vehicles.add( veh_id="idm", acceleration_controller=(IDMController, {}), routing_controller=(MinicityRouter, {}), car_following_params=SumoCarFollowingParams( speed_mode='all_checks', min_gap=5, decel=10.0, max_speed=10, ), lane_change_params=SumoLaneChangeParams( lane_change_mode="no_lc_safe", ), initial_speed=0, num_vehicles=25) vehicles.add( veh_id="taxi", initial_speed=0, acceleration_controller=(RLController, {}), car_following_params=SumoCarFollowingParams( speed_mode='all_checks', min_gap=5, decel=10.0, max_speed=10, ), lane_change_params=SumoLaneChangeParams( lane_change_mode="sumo_default", ), num_vehicles=15, is_taxi=False) tl_logic = TrafficLightParams(baseline=False) phases = [{ "duration": "5", "minDur": "5", "maxDur": "5", "state": "GGggrrrrGGggrrrr" }, { "duration": "1", "minDur": "1", "maxDur": "1", "state": "yyyyrrrryyyyrrrr" }, { "duration": "5", "minDur": "5", "maxDur": "5", "state": "rrrrGGggrrrrGGgg" }, { "duration": "1", "minDur": "1", "maxDur": "1", "state": "rrrryyyyrrrryyyy" }] tl_logic.add("center9", phases=phases) tl_logic.add("center10", phases=phases) tl_logic.add("center5", phases=phases) tl_logic.add("center6", phases=phases) additional_net_params = { "grid_array": grid_array, "speed_limit": 35, "horizontal_lanes": 1, "vertical_lanes": 1, "print_warnings": False, } initial_config, net_params = get_non_flow_params( enter_speed=v_enter, add_net_params=additional_net_params) additional_params = ADDITIONAL_ENV_PARAMS.copy() additional_params["time_price"] = 0.01 additional_params["distance_price"] = 0.01 additional_params["pickup_price"] = 1 additional_params["wait_penalty"] = 0.000 additional_params["tle_penalty"] = 0.01 additional_params["person_prob"] = 0.06 additional_params["max_waiting_time"] = 30 additional_params["free_pickup_time"] = 0.0 additional_params["distribution"] = 'mode-11' additional_params["n_mid_edge"] = 1 flow_params = dict( exp_tag='grid-intersection', env_name=DispatchAndRepositionEnv, network=GridnxmNetwork, simulator='traci', sim=SumoParams( sim_step=1, render=False, print_warnings=False, restart_instance=True ), env=EnvParams( horizon=500, additional_params=additional_params, ), net=net_params, # vehicles to be placed in the network at the start of a rollout (see # flow.core.params.VehicleParams) veh=vehicles, per=persons, # parameters specifying the positioning of vehicles upon initialization/ # reset (see flow.core.params.InitialConfig) initial=initial_config, # traffic lights to be introduced to specific nodes (see # flow.core.params.TrafficLightParams) tls=tl_logic, )
true
true
f71e607e4f8c3f3efd904c8c5129e23baa35a350
9,240
py
Python
source/setup.py
asaranprasad/nvda
e9609694acbfb06398eb6552067a0dcd532d67af
[ "bzip2-1.0.6" ]
2
2020-08-24T17:41:45.000Z
2020-08-25T16:48:52.000Z
source/setup.py
asaranprasad/nvda
e9609694acbfb06398eb6552067a0dcd532d67af
[ "bzip2-1.0.6" ]
3
2017-09-29T17:14:18.000Z
2019-05-20T16:13:39.000Z
source/setup.py
asaranprasad/nvda
e9609694acbfb06398eb6552067a0dcd532d67af
[ "bzip2-1.0.6" ]
1
2017-09-29T08:53:52.000Z
2017-09-29T08:53:52.000Z
# -*- coding: UTF-8 -*- #setup.py #A part of NonVisual Desktop Access (NVDA) #Copyright (C) 2006-2018 NV Access Limited, Peter Vágner, Joseph Lee #This file is covered by the GNU General Public License. #See the file COPYING for more details. import os import copy import gettext gettext.install("nvda", unicode=True) from distutils.core import setup import py2exe as py2exeModule from glob import glob import fnmatch from versionInfo import * from py2exe import build_exe import wx import imp MAIN_MANIFEST_EXTRA = r""" <file name="brailleDisplayDrivers\handyTech\HtBrailleDriverServer.dll"> <comClass description="HtBrailleDriver Class" clsid="{209445BA-92ED-4AB2-83EC-F24ACEE77EE0}" threadingModel="Apartment" progid="HtBrailleDriverServer.HtBrailleDriver" tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" /> </file> <file name="brailleDisplayDrivers\handyTech\HtBrailleDriverServer.tlb"> <typelib tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" version="1.0" helpdir="" /> </file> <comInterfaceExternalProxyStub name="IHtBrailleDriverSink" iid="{EF551F82-1C7E-421F-963D-D9D03548785A}" proxyStubClsid32="{00020420-0000-0000-C000-000000000046}" baseInterface="{00000000-0000-0000-C000-000000000046}" tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" /> <comInterfaceExternalProxyStub name="IHtBrailleDriver" iid="{43A71F9B-58EE-42D4-B58E-0F9FBA28D995}" proxyStubClsid32="{00020424-0000-0000-C000-000000000046}" baseInterface="{00000000-0000-0000-C000-000000000046}" tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" /> <compatibility xmlns="urn:schemas-microsoft-com:compatibility.v1"> <application> <!-- Windows Vista --> <supportedOS Id="{e2011457-1546-43c5-a5fe-008deee3d3f0}"/> <!-- Windows 7 --> <supportedOS Id="{35138b9a-5d96-4fbd-8e2d-a2440225f93a}"/> <!-- Windows 8 --> <supportedOS Id="{4a2f28e3-53b9-4441-ba9c-d69d4a4a6e38}"/> <!-- Windows 8.1 --> <supportedOS Id="{1f676c76-80e1-4239-95bb-83d0f6d0da78}"/> <!-- Windows 10 --> <supportedOS Id="{8e0f7a12-bfb3-4fe8-b9a5-48fd50a15a9a}"/> </application> </compatibility> """ def getModuleExtention(thisModType): for ext,mode,modType in imp.get_suffixes(): if modType==thisModType: return ext raise ValueError("unknown mod type %s"%thisModType) # py2exe's idea of whether a dll is a system dll appears to be wrong sometimes, so monkey patch it. origIsSystemDLL = build_exe.isSystemDLL def isSystemDLL(pathname): dll = os.path.basename(pathname).lower() if dll in ("msvcp71.dll", "msvcp90.dll", "gdiplus.dll","mfc71.dll", "mfc90.dll"): # These dlls don't exist on many systems, so make sure they're included. return 0 elif dll.startswith("api-ms-win-") or dll in ("powrprof.dll", "mpr.dll", "crypt32.dll"): # These are definitely system dlls available on all systems and must be excluded. # Including them can cause serious problems when a binary build is run on a different version of Windows. return 1 return origIsSystemDLL(pathname) build_exe.isSystemDLL = isSystemDLL class py2exe(build_exe.py2exe): """Overridden py2exe command to: * Add a command line option --enable-uiAccess to enable uiAccess for the main executable * Add extra info to the manifest * Don't copy w9xpopen, as NVDA will never run on Win9x """ user_options = build_exe.py2exe.user_options + [ ("enable-uiAccess", "u", "enable uiAccess for the main executable"), ] def initialize_options(self): build_exe.py2exe.initialize_options(self) self.enable_uiAccess = False def copy_w9xpopen(self, modules, dlls): pass def run(self): dist = self.distribution if self.enable_uiAccess: # Add a target for nvda_uiAccess, using nvda_noUIAccess as a base. target = copy.deepcopy(dist.windows[0]) target["dest_base"] = "nvda_uiAccess" target["uac_info"] = (target["uac_info"][0], True) dist.windows.insert(1, target) # nvda_eoaProxy should have uiAccess. target = dist.windows[3] target["uac_info"] = (target["uac_info"][0], True) build_exe.py2exe.run(self) def build_manifest(self, target, template): mfest, rid = build_exe.py2exe.build_manifest(self, target, template) if getattr(target, "script", "").endswith(".pyw"): # This is one of the main application executables. mfest = mfest[:mfest.rindex("</assembly>")] mfest += MAIN_MANIFEST_EXTRA + "</assembly>" return mfest, rid def getLocaleDataFiles(): wxDir=wx.__path__[0] localeMoFiles=set() for f in glob("locale/*/LC_MESSAGES"): localeMoFiles.add((f, (os.path.join(f,"nvda.mo"),))) wxMoFile=os.path.join(wxDir,f,"wxstd.mo") if os.path.isfile(wxMoFile): localeMoFiles.add((f,(wxMoFile,))) lang=os.path.split(os.path.split(f)[0])[1] if '_' in lang: lang=lang.split('_')[0] f=os.path.join('locale',lang,'lc_messages') wxMoFile=os.path.join(wxDir,f,"wxstd.mo") if os.path.isfile(wxMoFile): localeMoFiles.add((f,(wxMoFile,))) localeDicFiles=[(os.path.dirname(f), (f,)) for f in glob("locale/*/*.dic")] NVDALocaleGestureMaps=[(os.path.dirname(f), (f,)) for f in glob("locale/*/gestures.ini")] return list(localeMoFiles)+localeDicFiles+NVDALocaleGestureMaps def getRecursiveDataFiles(dest,source,excludes=()): rulesList=[] rulesList.append((dest, [f for f in glob("%s/*"%source) if not any(fnmatch.fnmatch(f,exclude) for exclude in excludes) and os.path.isfile(f)])) [rulesList.extend(getRecursiveDataFiles(os.path.join(dest,dirName),os.path.join(source,dirName),excludes=excludes)) for dirName in os.listdir(source) if os.path.isdir(os.path.join(source,dirName)) and not dirName.startswith('.')] return rulesList compiledModExtention = getModuleExtention(imp.PY_COMPILED) sourceModExtention = getModuleExtention(imp.PY_SOURCE) setup( name = name, version=version, description=description, url=url, classifiers=[ 'Development Status :: 3 - Alpha', 'Environment :: Win32 (MS Windows)', 'Topic :: Adaptive Technologies' 'Intended Audience :: Developers', 'Intended Audience :: End Users/Desktop', 'License :: OSI Approved :: GNU General Public License (GPL)', 'Natural Language :: English', 'Programming Language :: Python', 'Operating System :: Microsoft :: Windows', ], cmdclass={"py2exe": py2exe}, windows=[ { "script":"nvda.pyw", "dest_base":"nvda_noUIAccess", "uac_info": ("asInvoker", False), "icon_resources":[(1,"images/nvda.ico")], "version":"%s.%s.%s.%s"%(version_year,version_major,version_minor,version_build), "description":"NVDA application", "product_version":version, "copyright":copyright, "company_name":publisher, }, # The nvda_uiAccess target will be added at runtime if required. { "script": "nvda_slave.pyw", "icon_resources": [(1,"images/nvda.ico")], "version":"%s.%s.%s.%s"%(version_year,version_major,version_minor,version_build), "description": name, "product_version": version, "copyright": copyright, "company_name": publisher, }, { "script": "nvda_eoaProxy.pyw", # uiAccess will be enabled at runtime if appropriate. "uac_info": ("asInvoker", False), "icon_resources": [(1,"images/nvda.ico")], "version":"%s.%s.%s.%s"%(version_year,version_major,version_minor,version_build), "description": "NVDA Ease of Access proxy", "product_version": version, "copyright": copyright, "company_name": publisher, }, ], options = {"py2exe": { "bundle_files": 3, "excludes": ["Tkinter", "serial.loopback_connection", "serial.rfc2217", "serial.serialcli", "serial.serialjava", "serial.serialposix", "serial.socket_connection"], "packages": ["NVDAObjects","virtualBuffers","appModules","comInterfaces","brailleDisplayDrivers","synthDrivers"], "includes": [ "nvdaBuiltin", # #3368: bisect was implicitly included with Python 2.7.3, but isn't with 2.7.5. "bisect", # Also, the previous service executable used win32api, which some add-ons use for various purposes. "win32api", # #8628: include an import module for validate, which older add-ons import directly. # Since configobj 5.1.0, validate is a part of the configobj package # and should be imported as configobj.validate instead "validate", ], }}, data_files=[ (".",glob("*.dll")+glob("*.manifest")+["builtin.dic"]), ("documentation", ['../copying.txt', '../contributors.txt']), ("lib/%s"%version, glob("lib/*.dll")), ("lib64/%s"%version, glob("lib64/*.dll") + glob("lib64/*.exe")), ("waves", glob("waves/*.wav")), ("images", glob("images/*.ico")), ("louis/tables",glob("louis/tables/*")), ("COMRegistrationFixes", glob("COMRegistrationFixes/*.reg")), (".", ['message.html' ]) ] + ( getLocaleDataFiles() + getRecursiveDataFiles("synthDrivers", "synthDrivers", excludes=("*%s" % sourceModExtention, "*%s" % compiledModExtention, "*.exp", "*.lib", "*.pdb")) + getRecursiveDataFiles("brailleDisplayDrivers", "brailleDisplayDrivers", excludes=("*%s"%sourceModExtention,"*%s"%compiledModExtention)) + getRecursiveDataFiles('documentation', '../user_docs', excludes=('*.t2t', '*.t2tconf', '*/developerGuide.*')) ), )
38.987342
231
0.695238
import os import copy import gettext gettext.install("nvda", unicode=True) from distutils.core import setup import py2exe as py2exeModule from glob import glob import fnmatch from versionInfo import * from py2exe import build_exe import wx import imp MAIN_MANIFEST_EXTRA = r""" <file name="brailleDisplayDrivers\handyTech\HtBrailleDriverServer.dll"> <comClass description="HtBrailleDriver Class" clsid="{209445BA-92ED-4AB2-83EC-F24ACEE77EE0}" threadingModel="Apartment" progid="HtBrailleDriverServer.HtBrailleDriver" tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" /> </file> <file name="brailleDisplayDrivers\handyTech\HtBrailleDriverServer.tlb"> <typelib tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" version="1.0" helpdir="" /> </file> <comInterfaceExternalProxyStub name="IHtBrailleDriverSink" iid="{EF551F82-1C7E-421F-963D-D9D03548785A}" proxyStubClsid32="{00020420-0000-0000-C000-000000000046}" baseInterface="{00000000-0000-0000-C000-000000000046}" tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" /> <comInterfaceExternalProxyStub name="IHtBrailleDriver" iid="{43A71F9B-58EE-42D4-B58E-0F9FBA28D995}" proxyStubClsid32="{00020424-0000-0000-C000-000000000046}" baseInterface="{00000000-0000-0000-C000-000000000046}" tlbid="{33257EFB-336F-4680-B94E-F5013BA6B9B3}" /> <compatibility xmlns="urn:schemas-microsoft-com:compatibility.v1"> <application> <!-- Windows Vista --> <supportedOS Id="{e2011457-1546-43c5-a5fe-008deee3d3f0}"/> <!-- Windows 7 --> <supportedOS Id="{35138b9a-5d96-4fbd-8e2d-a2440225f93a}"/> <!-- Windows 8 --> <supportedOS Id="{4a2f28e3-53b9-4441-ba9c-d69d4a4a6e38}"/> <!-- Windows 8.1 --> <supportedOS Id="{1f676c76-80e1-4239-95bb-83d0f6d0da78}"/> <!-- Windows 10 --> <supportedOS Id="{8e0f7a12-bfb3-4fe8-b9a5-48fd50a15a9a}"/> </application> </compatibility> """ def getModuleExtention(thisModType): for ext,mode,modType in imp.get_suffixes(): if modType==thisModType: return ext raise ValueError("unknown mod type %s"%thisModType) origIsSystemDLL = build_exe.isSystemDLL def isSystemDLL(pathname): dll = os.path.basename(pathname).lower() if dll in ("msvcp71.dll", "msvcp90.dll", "gdiplus.dll","mfc71.dll", "mfc90.dll"): # These dlls don't exist on many systems, so make sure they're included. return 0 elif dll.startswith("api-ms-win-") or dll in ("powrprof.dll", "mpr.dll", "crypt32.dll"): # These are definitely system dlls available on all systems and must be excluded. # Including them can cause serious problems when a binary build is run on a different version of Windows. return 1 return origIsSystemDLL(pathname) build_exe.isSystemDLL = isSystemDLL class py2exe(build_exe.py2exe): user_options = build_exe.py2exe.user_options + [ ("enable-uiAccess", "u", "enable uiAccess for the main executable"), ] def initialize_options(self): build_exe.py2exe.initialize_options(self) self.enable_uiAccess = False def copy_w9xpopen(self, modules, dlls): pass def run(self): dist = self.distribution if self.enable_uiAccess: # Add a target for nvda_uiAccess, using nvda_noUIAccess as a base. target = copy.deepcopy(dist.windows[0]) target["dest_base"] = "nvda_uiAccess" target["uac_info"] = (target["uac_info"][0], True) dist.windows.insert(1, target) # nvda_eoaProxy should have uiAccess. target = dist.windows[3] target["uac_info"] = (target["uac_info"][0], True) build_exe.py2exe.run(self) def build_manifest(self, target, template): mfest, rid = build_exe.py2exe.build_manifest(self, target, template) if getattr(target, "script", "").endswith(".pyw"): # This is one of the main application executables. mfest = mfest[:mfest.rindex("</assembly>")] mfest += MAIN_MANIFEST_EXTRA + "</assembly>" return mfest, rid def getLocaleDataFiles(): wxDir=wx.__path__[0] localeMoFiles=set() for f in glob("locale/*/LC_MESSAGES"): localeMoFiles.add((f, (os.path.join(f,"nvda.mo"),))) wxMoFile=os.path.join(wxDir,f,"wxstd.mo") if os.path.isfile(wxMoFile): localeMoFiles.add((f,(wxMoFile,))) lang=os.path.split(os.path.split(f)[0])[1] if '_' in lang: lang=lang.split('_')[0] f=os.path.join('locale',lang,'lc_messages') wxMoFile=os.path.join(wxDir,f,"wxstd.mo") if os.path.isfile(wxMoFile): localeMoFiles.add((f,(wxMoFile,))) localeDicFiles=[(os.path.dirname(f), (f,)) for f in glob("locale/*/*.dic")] NVDALocaleGestureMaps=[(os.path.dirname(f), (f,)) for f in glob("locale/*/gestures.ini")] return list(localeMoFiles)+localeDicFiles+NVDALocaleGestureMaps def getRecursiveDataFiles(dest,source,excludes=()): rulesList=[] rulesList.append((dest, [f for f in glob("%s/*"%source) if not any(fnmatch.fnmatch(f,exclude) for exclude in excludes) and os.path.isfile(f)])) [rulesList.extend(getRecursiveDataFiles(os.path.join(dest,dirName),os.path.join(source,dirName),excludes=excludes)) for dirName in os.listdir(source) if os.path.isdir(os.path.join(source,dirName)) and not dirName.startswith('.')] return rulesList compiledModExtention = getModuleExtention(imp.PY_COMPILED) sourceModExtention = getModuleExtention(imp.PY_SOURCE) setup( name = name, version=version, description=description, url=url, classifiers=[ 'Development Status :: 3 - Alpha', 'Environment :: Win32 (MS Windows)', 'Topic :: Adaptive Technologies' 'Intended Audience :: Developers', 'Intended Audience :: End Users/Desktop', 'License :: OSI Approved :: GNU General Public License (GPL)', 'Natural Language :: English', 'Programming Language :: Python', 'Operating System :: Microsoft :: Windows', ], cmdclass={"py2exe": py2exe}, windows=[ { "script":"nvda.pyw", "dest_base":"nvda_noUIAccess", "uac_info": ("asInvoker", False), "icon_resources":[(1,"images/nvda.ico")], "version":"%s.%s.%s.%s"%(version_year,version_major,version_minor,version_build), "description":"NVDA application", "product_version":version, "copyright":copyright, "company_name":publisher, }, # The nvda_uiAccess target will be added at runtime if required. { "script": "nvda_slave.pyw", "icon_resources": [(1,"images/nvda.ico")], "version":"%s.%s.%s.%s"%(version_year,version_major,version_minor,version_build), "description": name, "product_version": version, "copyright": copyright, "company_name": publisher, }, { "script": "nvda_eoaProxy.pyw", # uiAccess will be enabled at runtime if appropriate. "uac_info": ("asInvoker", False), "icon_resources": [(1,"images/nvda.ico")], "version":"%s.%s.%s.%s"%(version_year,version_major,version_minor,version_build), "description": "NVDA Ease of Access proxy", "product_version": version, "copyright": copyright, "company_name": publisher, }, ], options = {"py2exe": { "bundle_files": 3, "excludes": ["Tkinter", "serial.loopback_connection", "serial.rfc2217", "serial.serialcli", "serial.serialjava", "serial.serialposix", "serial.socket_connection"], "packages": ["NVDAObjects","virtualBuffers","appModules","comInterfaces","brailleDisplayDrivers","synthDrivers"], "includes": [ "nvdaBuiltin", # #3368: bisect was implicitly included with Python 2.7.3, but isn't with 2.7.5. "bisect", "win32api", nifest")+["builtin.dic"]), ("documentation", ['../copying.txt', '../contributors.txt']), ("lib/%s"%version, glob("lib/*.dll")), ("lib64/%s"%version, glob("lib64/*.dll") + glob("lib64/*.exe")), ("waves", glob("waves/*.wav")), ("images", glob("images/*.ico")), ("louis/tables",glob("louis/tables/*")), ("COMRegistrationFixes", glob("COMRegistrationFixes/*.reg")), (".", ['message.html' ]) ] + ( getLocaleDataFiles() + getRecursiveDataFiles("synthDrivers", "synthDrivers", excludes=("*%s" % sourceModExtention, "*%s" % compiledModExtention, "*.exp", "*.lib", "*.pdb")) + getRecursiveDataFiles("brailleDisplayDrivers", "brailleDisplayDrivers", excludes=("*%s"%sourceModExtention,"*%s"%compiledModExtention)) + getRecursiveDataFiles('documentation', '../user_docs', excludes=('*.t2t', '*.t2tconf', '*/developerGuide.*')) ), )
true
true
f71e607e7707662acad32327b1147a6236003db1
14,288
py
Python
api/resources/v2/containers.py
mythwm/yardstick
ea13581f450c9c44f6f73d383e6a192697a95cc1
[ "Apache-2.0" ]
28
2017-02-07T07:46:42.000Z
2021-06-30T08:11:06.000Z
api/resources/v2/containers.py
mythwm/yardstick
ea13581f450c9c44f6f73d383e6a192697a95cc1
[ "Apache-2.0" ]
6
2018-01-18T08:00:54.000Z
2019-04-11T04:51:41.000Z
api/resources/v2/containers.py
mythwm/yardstick
ea13581f450c9c44f6f73d383e6a192697a95cc1
[ "Apache-2.0" ]
46
2016-12-13T10:05:47.000Z
2021-02-18T07:33:06.000Z
############################################################################## # Copyright (c) 2017 Huawei Technologies Co.,Ltd. # # All rights reserved. This program and the accompanying materials # are made available under the terms of the Apache License, Version 2.0 # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## from __future__ import absolute_import import logging import threading import time import uuid import os import glob from six.moves import configparser from oslo_serialization import jsonutils from docker import Client from api import ApiResource from api.utils import influx from api.database.v2.handlers import V2ContainerHandler from api.database.v2.handlers import V2EnvironmentHandler from yardstick.common import constants as consts from yardstick.common import utils from yardstick.common.utils import result_handler from yardstick.common.utils import get_free_port from yardstick.common.httpClient import HttpClient LOG = logging.getLogger(__name__) LOG.setLevel(logging.DEBUG) environment_handler = V2EnvironmentHandler() container_handler = V2ContainerHandler() class V2Containers(ApiResource): def post(self): return self._dispatch_post() def create_influxdb(self, args): try: environment_id = args['environment_id'] except KeyError: return result_handler(consts.API_ERROR, 'environment_id must be provided') try: uuid.UUID(environment_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid environment id') try: environment = environment_handler.get_by_uuid(environment_id) except ValueError: return result_handler(consts.API_ERROR, 'no such environment id') container_info = environment.container_id container_info = jsonutils.loads(container_info) if container_info else {} if container_info.get('influxdb'): return result_handler(consts.API_ERROR, 'influxdb container already exist') name = 'influxdb-{}'.format(environment_id[:8]) port = get_free_port(consts.SERVER_IP) container_id = str(uuid.uuid4()) LOG.info('%s will launch on : %s', name, port) LOG.info('launch influxdb background') args = (name, port, container_id) thread = threading.Thread(target=self._create_influxdb, args=args) thread.start() LOG.info('record container in database') container_init_data = { 'uuid': container_id, 'environment_id': environment_id, 'name': name, 'port': port, 'status': 0 } container_handler.insert(container_init_data) LOG.info('update container in environment') container_info['influxdb'] = container_id environment_info = {'container_id': jsonutils.dumps(container_info)} environment_handler.update_attr(environment_id, environment_info) return result_handler(consts.API_SUCCESS, {'uuid': container_id}) def _check_image_exist(self, client, t): return any(t in a['RepoTags'][0] for a in client.images() if a['RepoTags']) def _create_influxdb(self, name, port, container_id): client = Client(base_url=consts.DOCKER_URL) try: LOG.info('Checking if influxdb image exist') if not self._check_image_exist(client, '%s:%s' % (consts.INFLUXDB_IMAGE, consts.INFLUXDB_TAG)): LOG.info('Influxdb image not exist, start pulling') client.pull(consts.INFLUXDB_IMAGE, tag=consts.INFLUXDB_TAG) LOG.info('Createing influxdb container') container = self._create_influxdb_container(client, name, port) LOG.info('Influxdb container is created') time.sleep(5) container = client.inspect_container(container['Id']) ip = container['NetworkSettings']['Networks']['bridge']['IPAddress'] LOG.debug('container ip is: %s', ip) LOG.info('Changing output to influxdb') self._change_output_to_influxdb(ip) LOG.info('Config influxdb') self._config_influxdb() container_handler.update_attr(container_id, {'status': 1}) LOG.info('Finished') except Exception: container_handler.update_attr(container_id, {'status': 2}) LOG.exception('Creating influxdb failed') def _create_influxdb_container(self, client, name, port): ports = [port] port_bindings = {8086: port} restart_policy = {"MaximumRetryCount": 0, "Name": "always"} host_config = client.create_host_config(port_bindings=port_bindings, restart_policy=restart_policy) LOG.info('Creating container') container = client.create_container(image='%s:%s' % (consts.INFLUXDB_IMAGE, consts.INFLUXDB_TAG), ports=ports, name=name, detach=True, tty=True, host_config=host_config) LOG.info('Starting container') client.start(container) return container def _config_influxdb(self): try: client = influx.get_data_db_client() client.create_user(consts.INFLUXDB_USER, consts.INFLUXDB_PASS, consts.INFLUXDB_DB_NAME) client.create_database(consts.INFLUXDB_DB_NAME) LOG.info('Success to config influxDB') except Exception: LOG.exception('Config influxdb failed') def _change_output_to_influxdb(self, ip): utils.makedirs(consts.CONF_DIR) parser = configparser.ConfigParser() LOG.info('Reading output sample configuration') parser.read(consts.CONF_SAMPLE_FILE) LOG.info('Set dispatcher to influxdb') parser.set('DEFAULT', 'dispatcher', 'influxdb') parser.set('dispatcher_influxdb', 'target', 'http://{}:{}'.format(ip, 8086)) LOG.info('Writing to %s', consts.CONF_FILE) with open(consts.CONF_FILE, 'w') as f: parser.write(f) def create_grafana(self, args): try: environment_id = args['environment_id'] except KeyError: return result_handler(consts.API_ERROR, 'environment_id must be provided') try: uuid.UUID(environment_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid environment id') try: environment = environment_handler.get_by_uuid(environment_id) except ValueError: return result_handler(consts.API_ERROR, 'no such environment id') container_info = environment.container_id container_info = jsonutils.loads(container_info) if container_info else {} if not container_info.get('influxdb'): return result_handler(consts.API_ERROR, 'influxdb not set') if container_info.get('grafana'): return result_handler(consts.API_ERROR, 'grafana container already exists') name = 'grafana-{}'.format(environment_id[:8]) port = get_free_port(consts.SERVER_IP) container_id = str(uuid.uuid4()) args = (name, port, container_id) thread = threading.Thread(target=self._create_grafana, args=args) thread.start() container_init_data = { 'uuid': container_id, 'environment_id': environment_id, 'name': name, 'port': port, 'status': 0 } container_handler.insert(container_init_data) container_info['grafana'] = container_id environment_info = {'container_id': jsonutils.dumps(container_info)} environment_handler.update_attr(environment_id, environment_info) return result_handler(consts.API_SUCCESS, {'uuid': container_id}) def _create_grafana(self, name, port, container_id): client = Client(base_url=consts.DOCKER_URL) try: LOG.info('Checking if grafana image exist') image = '{}:{}'.format(consts.GRAFANA_IMAGE, consts.GRAFANA_TAG) if not self._check_image_exist(client, image): LOG.info('Grafana image not exist, start pulling') client.pull(consts.GRAFANA_IMAGE, consts.GRAFANA_TAG) LOG.info('Createing grafana container') container = self._create_grafana_container(client, name, port) LOG.info('Grafana container is created') time.sleep(5) container = client.inspect_container(container['Id']) ip = container['NetworkSettings']['Networks']['bridge']['IPAddress'] LOG.debug('container ip is: %s', ip) LOG.info('Creating data source for grafana') self._create_data_source(ip) LOG.info('Creating dashboard for grafana') self._create_dashboard(ip) container_handler.update_attr(container_id, {'status': 1}) LOG.info('Finished') except Exception: container_handler.update_attr(container_id, {'status': 2}) LOG.exception('Create grafana failed') def _create_dashboard(self, ip): url = 'http://admin:admin@{}:{}/api/dashboards/db'.format(ip, 3000) path = os.path.join(consts.REPOS_DIR, 'dashboard', 'opnfv_yardstick_tc*.json') for i in sorted(glob.iglob(path)): with open(i) as f: data = jsonutils.load(f) try: HttpClient().post(url, {'dashboard': data}) except Exception: LOG.exception('Create dashboard %s failed', i) raise def _create_data_source(self, ip): url = 'http://admin:admin@{}:{}/api/datasources'.format(ip, 3000) influx_conf = utils.parse_ini_file(consts.CONF_FILE).get('dispatcher_influxdb', {}) data = { "name": "yardstick", "type": "influxdb", "access": "proxy", "url": influx_conf.get('target', ''), "password": influx_conf.get('password', ''), "user": influx_conf.get('username', ''), "database": "yardstick", "basicAuth": True, "basicAuthUser": "admin", "basicAuthPassword": "admin", "isDefault": False, } try: HttpClient().post(url, data) except Exception: LOG.exception('Create datasources failed') raise def _create_grafana_container(self, client, name, port): ports = [3000] port_bindings = {3000: port} restart_policy = {"MaximumRetryCount": 0, "Name": "always"} host_config = client.create_host_config(port_bindings=port_bindings, restart_policy=restart_policy) LOG.info('Creating container') container = client.create_container(image='%s:%s' % (consts.GRAFANA_IMAGE, consts.GRAFANA_TAG), name=name, ports=ports, detach=True, tty=True, host_config=host_config) LOG.info('Starting container') client.start(container) return container class V2Container(ApiResource): def get(self, container_id): try: uuid.UUID(container_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid container id') try: container = container_handler.get_by_uuid(container_id) except ValueError: return result_handler(consts.API_ERROR, 'no such container id') name = container.name client = Client(base_url=consts.DOCKER_URL) info = client.inspect_container(name) data = { 'name': name, 'status': info.get('State', {}).get('Status', 'error'), 'time': info.get('Created'), 'port': container.port } return result_handler(consts.API_SUCCESS, {'container': data}) def delete(self, container_id): try: uuid.UUID(container_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid container id') try: container = container_handler.get_by_uuid(container_id) except ValueError: return result_handler(consts.API_ERROR, 'no such container id') environment_id = container.environment_id client = Client(base_url=consts.DOCKER_URL) LOG.info('delete container: %s', container.name) try: client.remove_container(container.name, force=True) except Exception: LOG.exception('delete container failed') return result_handler(consts.API_ERROR, 'delete container failed') LOG.info('delete container in database') container_handler.delete_by_uuid(container_id) LOG.info('update container in environment') environment = environment_handler.get_by_uuid(environment_id) container_info = jsonutils.loads(environment.container_id) key = next((k for k, v in container_info.items() if v == container_id)) container_info.pop(key) environment_delete_data = { 'container_id': jsonutils.dumps(container_info) } environment_handler.update_attr(environment_id, environment_delete_data) return result_handler(consts.API_SUCCESS, {'container': container_id})
37.798942
91
0.597424
arser.set('dispatcher_influxdb', 'target', 'http://{}:{}'.format(ip, 8086)) LOG.info('Writing to %s', consts.CONF_FILE) with open(consts.CONF_FILE, 'w') as f: parser.write(f) def create_grafana(self, args): try: environment_id = args['environment_id'] except KeyError: return result_handler(consts.API_ERROR, 'environment_id must be provided') try: uuid.UUID(environment_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid environment id') try: environment = environment_handler.get_by_uuid(environment_id) except ValueError: return result_handler(consts.API_ERROR, 'no such environment id') container_info = environment.container_id container_info = jsonutils.loads(container_info) if container_info else {} if not container_info.get('influxdb'): return result_handler(consts.API_ERROR, 'influxdb not set') if container_info.get('grafana'): return result_handler(consts.API_ERROR, 'grafana container already exists') name = 'grafana-{}'.format(environment_id[:8]) port = get_free_port(consts.SERVER_IP) container_id = str(uuid.uuid4()) args = (name, port, container_id) thread = threading.Thread(target=self._create_grafana, args=args) thread.start() container_init_data = { 'uuid': container_id, 'environment_id': environment_id, 'name': name, 'port': port, 'status': 0 } container_handler.insert(container_init_data) container_info['grafana'] = container_id environment_info = {'container_id': jsonutils.dumps(container_info)} environment_handler.update_attr(environment_id, environment_info) return result_handler(consts.API_SUCCESS, {'uuid': container_id}) def _create_grafana(self, name, port, container_id): client = Client(base_url=consts.DOCKER_URL) try: LOG.info('Checking if grafana image exist') image = '{}:{}'.format(consts.GRAFANA_IMAGE, consts.GRAFANA_TAG) if not self._check_image_exist(client, image): LOG.info('Grafana image not exist, start pulling') client.pull(consts.GRAFANA_IMAGE, consts.GRAFANA_TAG) LOG.info('Createing grafana container') container = self._create_grafana_container(client, name, port) LOG.info('Grafana container is created') time.sleep(5) container = client.inspect_container(container['Id']) ip = container['NetworkSettings']['Networks']['bridge']['IPAddress'] LOG.debug('container ip is: %s', ip) LOG.info('Creating data source for grafana') self._create_data_source(ip) LOG.info('Creating dashboard for grafana') self._create_dashboard(ip) container_handler.update_attr(container_id, {'status': 1}) LOG.info('Finished') except Exception: container_handler.update_attr(container_id, {'status': 2}) LOG.exception('Create grafana failed') def _create_dashboard(self, ip): url = 'http://admin:admin@{}:{}/api/dashboards/db'.format(ip, 3000) path = os.path.join(consts.REPOS_DIR, 'dashboard', 'opnfv_yardstick_tc*.json') for i in sorted(glob.iglob(path)): with open(i) as f: data = jsonutils.load(f) try: HttpClient().post(url, {'dashboard': data}) except Exception: LOG.exception('Create dashboard %s failed', i) raise def _create_data_source(self, ip): url = 'http://admin:admin@{}:{}/api/datasources'.format(ip, 3000) influx_conf = utils.parse_ini_file(consts.CONF_FILE).get('dispatcher_influxdb', {}) data = { "name": "yardstick", "type": "influxdb", "access": "proxy", "url": influx_conf.get('target', ''), "password": influx_conf.get('password', ''), "user": influx_conf.get('username', ''), "database": "yardstick", "basicAuth": True, "basicAuthUser": "admin", "basicAuthPassword": "admin", "isDefault": False, } try: HttpClient().post(url, data) except Exception: LOG.exception('Create datasources failed') raise def _create_grafana_container(self, client, name, port): ports = [3000] port_bindings = {3000: port} restart_policy = {"MaximumRetryCount": 0, "Name": "always"} host_config = client.create_host_config(port_bindings=port_bindings, restart_policy=restart_policy) LOG.info('Creating container') container = client.create_container(image='%s:%s' % (consts.GRAFANA_IMAGE, consts.GRAFANA_TAG), name=name, ports=ports, detach=True, tty=True, host_config=host_config) LOG.info('Starting container') client.start(container) return container class V2Container(ApiResource): def get(self, container_id): try: uuid.UUID(container_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid container id') try: container = container_handler.get_by_uuid(container_id) except ValueError: return result_handler(consts.API_ERROR, 'no such container id') name = container.name client = Client(base_url=consts.DOCKER_URL) info = client.inspect_container(name) data = { 'name': name, 'status': info.get('State', {}).get('Status', 'error'), 'time': info.get('Created'), 'port': container.port } return result_handler(consts.API_SUCCESS, {'container': data}) def delete(self, container_id): try: uuid.UUID(container_id) except ValueError: return result_handler(consts.API_ERROR, 'invalid container id') try: container = container_handler.get_by_uuid(container_id) except ValueError: return result_handler(consts.API_ERROR, 'no such container id') environment_id = container.environment_id client = Client(base_url=consts.DOCKER_URL) LOG.info('delete container: %s', container.name) try: client.remove_container(container.name, force=True) except Exception: LOG.exception('delete container failed') return result_handler(consts.API_ERROR, 'delete container failed') LOG.info('delete container in database') container_handler.delete_by_uuid(container_id) LOG.info('update container in environment') environment = environment_handler.get_by_uuid(environment_id) container_info = jsonutils.loads(environment.container_id) key = next((k for k, v in container_info.items() if v == container_id)) container_info.pop(key) environment_delete_data = { 'container_id': jsonutils.dumps(container_info) } environment_handler.update_attr(environment_id, environment_delete_data) return result_handler(consts.API_SUCCESS, {'container': container_id})
true
true
f71e60c12f87497872af1c06e0fc7e53274e7bbd
27,815
py
Python
pymatgen/core/units.py
adozier/pymatgen
f1cc4d8db24ec11063be2fd84b4ea911f006eeb7
[ "MIT" ]
null
null
null
pymatgen/core/units.py
adozier/pymatgen
f1cc4d8db24ec11063be2fd84b4ea911f006eeb7
[ "MIT" ]
null
null
null
pymatgen/core/units.py
adozier/pymatgen
f1cc4d8db24ec11063be2fd84b4ea911f006eeb7
[ "MIT" ]
null
null
null
# coding: utf-8 # Copyright (c) Pymatgen Development Team. # Distributed under the terms of the MIT License. from __future__ import division, unicode_literals """ This module implements a FloatWithUnit, which is a subclass of float. It also defines supported units for some commonly used units for energy, length, temperature, time and charge. FloatWithUnit also support conversion to one another, and additions and subtractions perform automatic conversion if units are detected. An ArrayWithUnit is also implemented, which is a subclass of numpy's ndarray with similar unit features. """ from six.moves import filter, zip __author__ = "Shyue Ping Ong, Matteo Giantomassi" __copyright__ = "Copyright 2011, The Materials Project" __version__ = "1.0" __maintainer__ = "Shyue Ping Ong, Matteo Giantomassi" __status__ = "Production" __date__ = "Aug 30, 2013" import numpy as np import six import collections from numbers import Number import numbers from functools import partial import re import scipy.constants as const """ Some conversion factors """ Ha_to_eV = 1/const.physical_constants["electron volt-hartree relationship"][0] eV_to_Ha = 1 / Ha_to_eV Ry_to_eV = Ha_to_eV / 2 amu_to_kg = const.physical_constants["atomic mass unit-kilogram relationship"][0] mile_to_meters = const.mile bohr_to_angstrom = const.physical_constants["Bohr radius"][0] * 1e10 bohr_to_ang = bohr_to_angstrom """ Definitions of supported units. Values below are essentially scaling and conversion factors. What matters is the relative values, not the absolute. The SI units must have factor 1. """ BASE_UNITS = { "length": { "m": 1, "km": 1000, "mile": mile_to_meters, "ang": 1e-10, "cm": 1e-2, "pm": 1e-12, "bohr": bohr_to_angstrom * 1e-10, }, "mass": { "kg": 1, "g": 1e-3, "amu": amu_to_kg, }, "time": { "s": 1, "min": 60, "h": 3600, }, "current": { "A": 1 }, "temperature": { "K": 1, }, "amount": { "mol": 1, "atom": 1 / const.N_A }, "intensity": { "cd": 1 }, "memory": { "byte": 1, "Kb": 1024, "Mb": 1024**2, "Gb": 1024**3, "Tb": 1024**4, }, } # Accept kb, mb, gb ... as well. BASE_UNITS["memory"].update({k.lower(): v for k, v in BASE_UNITS["memory"].items()}) # This current list are supported derived units defined in terms of powers of # SI base units and constants. DERIVED_UNITS = { "energy": { "eV": {"kg": 1, "m": 2, "s": -2, const.e: 1}, "meV": {"kg": 1, "m": 2, "s": -2, const.e * 1e-3: 1}, "Ha": {"kg": 1, "m": 2, "s": -2, const.e * Ha_to_eV: 1}, "Ry": {"kg": 1, "m": 2, "s": -2, const.e * Ry_to_eV: 1}, "J": {"kg": 1, "m": 2, "s": -2}, "kJ": {"kg": 1, "m": 2, "s": -2, 1000: 1} }, "charge": { "C": {"A": 1, "s": 1}, "e": {"A": 1, "s": 1, const.e: 1}, }, "force": { "N": {"kg": 1, "m": 1, "s": -2}, "KN": {"kg": 1, "m": 1, "s": -2, 1000: 1}, "MN": {"kg": 1, "m": 1, "s": -2, 1e6: 1}, "GN": {"kg": 1, "m": 1, "s": -2, 1e9: 1}, }, "pressure": { "Pa": {"kg": 1, "m": -1, "s": -2}, "KPa": {"kg": 1, "m": -1, "s": -2, 1000: 1}, "MPa": {"kg": 1, "m": -1, "s": -2, 1e6: 1}, "GPa": {"kg": 1, "m": -1, "s": -2, 1e9: 1} }, "power": { "W": {"m": 2, "kg": 1, "s": -3}, "KW": {"m": 2, "kg": 1, "s": -3, 1000: 1}, "MW": {"m": 2, "kg": 1, "s": -3, 1e6: 1}, "GW": {"m": 2, "kg": 1, "s": -3, 1e9: 1} }, "emf": { "V": {"m": 2, "kg": 1, "s": -3, "A": -1} }, "capacitance": { "F": {"m": -2, "kg": -1, "s": 4, "A": 2} }, "resistance": { "ohm": {"m": 2, "kg": 1, "s": -3, "A": -2} }, "conductance": { "S": {"m": -2, "kg": -1, "s": 3, "A": 2} }, "magnetic_flux": { "Wb": {"m": 2, "kg": 1, "s": -2, "A": -1} } } ALL_UNITS = dict(list(BASE_UNITS.items()) + list(DERIVED_UNITS.items())) SUPPORTED_UNIT_NAMES = tuple([i for d in ALL_UNITS.values() for i in d.keys()]) # Mapping unit name --> unit type (unit names must be unique). _UNAME2UTYPE = {} for utype, d in ALL_UNITS.items(): assert not set(d.keys()).intersection(_UNAME2UTYPE.keys()) _UNAME2UTYPE.update({uname: utype for uname in d}) del utype, d def _get_si_unit(unit): unit_type = _UNAME2UTYPE[unit] si_unit = filter(lambda k: BASE_UNITS[unit_type][k] == 1, BASE_UNITS[unit_type].keys()) return list(si_unit)[0], BASE_UNITS[unit_type][unit] class UnitError(BaseException): """ Exception class for unit errors. """ def check_mappings(u): for v in DERIVED_UNITS.values(): for k2, v2 in v.items(): if all([v2.get(ku, 0) == vu for ku, vu in u.items()]) and \ all([u.get(kv2, 0) == vv2 for kv2, vv2 in v2.items()]): return {k2: 1} return u class Unit(collections.Mapping): """ Represents a unit, e.g., "m" for meters, etc. Supports compound units. Only integer powers are supported for units. """ Error = UnitError def __init__(self, unit_def): """ Constructs a unit. Args: unit_def: A definition for the unit. Either a mapping of unit to powers, e.g., {"m": 2, "s": -1} represents "m^2 s^-1", or simply as a string "kg m^2 s^-1". Note that the supported format uses "^" as the power operator and all units must be space-separated. """ if isinstance(unit_def, six.string_types): unit = collections.defaultdict(int) for m in re.finditer("([A-Za-z]+)\s*\^*\s*([\-0-9]*)", unit_def): p = m.group(2) p = 1 if not p else int(p) k = m.group(1) unit[k] += p else: unit = {k: v for k, v in dict(unit_def).items() if v != 0} self._unit = check_mappings(unit) def __mul__(self, other): new_units = collections.defaultdict(int) for k, v in self.items(): new_units[k] += v for k, v in other.items(): new_units[k] += v return Unit(new_units) def __rmul__(self, other): return self.__mul__(other) def __div__(self, other): new_units = collections.defaultdict(int) for k, v in self.items(): new_units[k] += v for k, v in other.items(): new_units[k] -= v return Unit(new_units) def __truediv__(self, other): return self.__div__(other) def __pow__(self, i): return Unit({k: v * i for k, v in self.items()}) def __iter__(self): return self._unit.__iter__() def __getitem__(self, i): return self._unit[i] def __len__(self): return len(self._unit) def __repr__(self): sorted_keys = sorted(self._unit.keys(), key=lambda k: (-self._unit[k], k)) return " ".join(["{}^{}".format(k, self._unit[k]) if self._unit[k] != 1 else k for k in sorted_keys if self._unit[k] != 0]) def __str__(self): return self.__repr__() @property def as_base_units(self): """ Converts all units to base SI units, including derived units. Returns: (base_units_dict, scaling factor). base_units_dict will not contain any constants, which are gathered in the scaling factor. """ b = collections.defaultdict(int) factor = 1 for k, v in self.items(): derived = False for d in DERIVED_UNITS.values(): if k in d: for k2, v2 in d[k].items(): if isinstance(k2, Number): factor *= k2 ** (v2 * v) else: b[k2] += v2 * v derived = True break if not derived: si, f = _get_si_unit(k) b[si] += v factor *= f ** v return {k: v for k, v in b.items() if v != 0}, factor def get_conversion_factor(self, new_unit): """ Returns a conversion factor between this unit and a new unit. Compound units are supported, but must have the same powers in each unit type. Args: new_unit: The new unit. """ uo_base, ofactor = self.as_base_units un_base, nfactor = Unit(new_unit).as_base_units units_new = sorted(un_base.items(), key=lambda d: _UNAME2UTYPE[d[0]]) units_old = sorted(uo_base.items(), key=lambda d: _UNAME2UTYPE[d[0]]) factor = ofactor / nfactor for uo, un in zip(units_old, units_new): if uo[1] != un[1]: raise UnitError("Units %s and %s are not compatible!" % (uo, un)) c = ALL_UNITS[_UNAME2UTYPE[uo[0]]] factor *= (c[uo[0]] / c[un[0]]) ** uo[1] return factor class FloatWithUnit(float): """ Subclasses float to attach a unit type. Typically, you should use the pre-defined unit type subclasses such as Energy, Length, etc. instead of using FloatWithUnit directly. Supports conversion, addition and subtraction of the same unit type. E.g., 1 m + 20 cm will be automatically converted to 1.2 m (units follow the leftmost quantity). Note that FloatWithUnit does not override the eq method for float, i.e., units are not checked when testing for equality. The reason is to allow this class to be used transparently wherever floats are expected. >>> e = Energy(1.1, "Ha") >>> a = Energy(1.1, "Ha") >>> b = Energy(3, "eV") >>> c = a + b >>> print(c) 1.2102479761938871 Ha >>> c.to("eV") 32.932522246000005 eV """ Error = UnitError @classmethod def from_string(cls, s): """ Initialize a FloatWithUnit from a string. Example Memory.from_string("1. Mb") """ # Extract num and unit string. s = s.strip() for i, char in enumerate(s): if char.isalpha() or char.isspace(): break else: raise Exception("Unit is missing in string %s" % s) num, unit = float(s[:i]), s[i:] # Find unit type (set it to None if it cannot be detected) for unit_type, d in BASE_UNITS.items(): if unit in d: break else: unit_type = None return cls(num, unit, unit_type=unit_type) def __new__(cls, val, unit, unit_type=None): new = float.__new__(cls, val) new._unit = Unit(unit) new._unit_type = unit_type return new def __init__(self, val, unit, unit_type=None): """ Initializes a float with unit. Args: val (float): Value unit (Unit): A unit. E.g., "C". unit_type (str): A type of unit. E.g., "charge" """ if unit_type is not None and str(unit) not in ALL_UNITS[unit_type]: raise UnitError( "{} is not a supported unit for {}".format(unit, unit_type)) self._unit = Unit(unit) self._unit_type = unit_type def __repr__(self): return super(FloatWithUnit, self).__repr__() def __str__(self): s = super(FloatWithUnit, self).__str__() return "{} {}".format(s, self._unit) def __add__(self, other): if not hasattr(other, "unit_type"): return super(FloatWithUnit, self).__add__(other) if other.unit_type != self._unit_type: raise UnitError("Adding different types of units is not allowed") val = other if other.unit != self._unit: val = other.to(self._unit) return FloatWithUnit(float(self) + val, unit_type=self._unit_type, unit=self._unit) def __sub__(self, other): if not hasattr(other, "unit_type"): return super(FloatWithUnit, self).__sub__(other) if other.unit_type != self._unit_type: raise UnitError("Subtracting different units is not allowed") val = other if other.unit != self._unit: val = other.to(self._unit) return FloatWithUnit(float(self) - val, unit_type=self._unit_type, unit=self._unit) def __mul__(self, other): if not isinstance(other, FloatWithUnit): return FloatWithUnit(float(self) * other, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(float(self) * other, unit_type=None, unit=self._unit * other._unit) def __rmul__(self, other): if not isinstance(other, FloatWithUnit): return FloatWithUnit(float(self) * other, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(float(self) * other, unit_type=None, unit=self._unit * other._unit) def __pow__(self, i): return FloatWithUnit(float(self) ** i, unit_type=None, unit=self._unit ** i) def __div__(self, other): val = super(FloatWithUnit, self).__div__(other) if not isinstance(other, FloatWithUnit): return FloatWithUnit(val, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(val, unit_type=None, unit=self._unit / other._unit) def __truediv__(self, other): val = super(FloatWithUnit, self).__truediv__(other) if not isinstance(other, FloatWithUnit): return FloatWithUnit(val, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(val, unit_type=None, unit=self._unit / other._unit) def __neg__(self): return FloatWithUnit(super(FloatWithUnit, self).__neg__(), unit_type=self._unit_type, unit=self._unit) def __getnewargs__(self): """Function used by pickle to recreate object.""" #print(self.__dict__) # FIXME # There's a problem with _unit_type if we try to unpickle objects from file. # since self._unit_type might not be defined. I think this is due to # the use of decorators (property and unitized). In particular I have problems with "amu" # likely due to weight in core.composition if hasattr(self, "_unit_type"): args = float(self), self._unit, self._unit_type else: args = float(self), self._unit, None return args def __getstate__(self): state = self.__dict__.copy() state["val"] = float(self) #print("in getstate %s" % state) return state def __setstate__(self, state): #print("in setstate %s" % state) self._unit = state["_unit"] @property def unit_type(self): return self._unit_type @property def unit(self): return self._unit def to(self, new_unit): """ Conversion to a new_unit. Right now, only supports 1 to 1 mapping of units of each type. Args: new_unit: New unit type. Returns: A FloatWithUnit object in the new units. Example usage: >>> e = Energy(1.1, "eV") >>> e = Energy(1.1, "Ha") >>> e.to("eV") 29.932522246 eV """ return FloatWithUnit( self * self.unit.get_conversion_factor(new_unit), unit_type=self._unit_type, unit=new_unit) @property def as_base_units(self): """ Returns this FloatWithUnit in base SI units, including derived units. Returns: A FloatWithUnit object in base SI units """ return self.to(self.unit.as_base_units[0]) @property def supported_units(self): """ Supported units for specific unit type. """ return tuple(ALL_UNITS[self._unit_type].keys()) class ArrayWithUnit(np.ndarray): """ Subclasses `numpy.ndarray` to attach a unit type. Typically, you should use the pre-defined unit type subclasses such as EnergyArray, LengthArray, etc. instead of using ArrayWithFloatWithUnit directly. Supports conversion, addition and subtraction of the same unit type. E.g., 1 m + 20 cm will be automatically converted to 1.2 m (units follow the leftmost quantity). >>> a = EnergyArray([1, 2], "Ha") >>> b = EnergyArray([1, 2], "eV") >>> c = a + b >>> print(c) [ 1.03674933 2.07349865] Ha >>> c.to("eV") array([ 28.21138386, 56.42276772]) eV """ Error = UnitError def __new__(cls, input_array, unit, unit_type=None): # Input array is an already formed ndarray instance # We first cast to be our class type obj = np.asarray(input_array).view(cls) # add the new attributes to the created instance obj._unit = Unit(unit) obj._unit_type = unit_type return obj def __array_finalize__(self, obj): """ See http://docs.scipy.org/doc/numpy/user/basics.subclassing.html for comments. """ if obj is None: return self._unit = getattr(obj, "_unit", None) self._unit_type = getattr(obj, "_unit_type", None) #TODO abstract base class property? @property def unit_type(self): return self._unit_type #TODO abstract base class property? @property def unit(self): return self._unit def __reduce__(self): #print("in reduce") reduce = list(super(ArrayWithUnit, self).__reduce__()) #print("unit",self._unit) #print(reduce[2]) reduce[2] = {"np_state": reduce[2], "_unit": self._unit} return tuple(reduce) def __setstate__(self, state): #print("in setstate %s" % str(state)) super(ArrayWithUnit, self).__setstate__(state["np_state"]) self._unit = state["_unit"] def __repr__(self): return "{} {}".format(np.array(self).__repr__(), self.unit) def __str__(self): return "{} {}".format(np.array(self).__str__(), self.unit) def __add__(self, other): if hasattr(other, "unit_type"): if other.unit_type != self.unit_type: raise UnitError("Adding different types of units is" " not allowed") if other.unit != self.unit: other = other.to(self.unit) return self.__class__(np.array(self) + np.array(other), unit_type=self.unit_type, unit=self.unit) def __sub__(self, other): if hasattr(other, "unit_type"): if other.unit_type != self.unit_type: raise UnitError("Subtracting different units is not allowed") if other.unit != self.unit: other = other.to(self.unit) return self.__class__(np.array(self) - np.array(other), unit_type=self.unit_type, unit=self.unit) def __mul__(self, other): # FIXME # Here we have the most important difference between FloatWithUnit and # ArrayWithFloatWithUnit: # If other does not have units, I return an object with the same units # as self. # if other *has* units, I return an object *without* units since # taking into account all the possible derived quantities would be # too difficult. # Moreover Energy(1.0) * Time(1.0, "s") returns 1.0 Ha that is a # bit misleading. # Same protocol for __div__ if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__mul__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: # Cannot use super since it returns an instance of self.__class__ # while here we want a bare numpy array. return self.__class__( np.array(self).__mul__(np.array(other)), unit=self.unit * other.unit) def __rmul__(self, other): if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__rmul__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: return self.__class__( np.array(self).__rmul__(np.array(other)), unit=self.unit * other.unit) def __div__(self, other): if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__div__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: return self.__class__( np.array(self).__div__(np.array(other)), unit=self.unit/other.unit) def __truediv__(self, other): if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__truediv__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: return self.__class__( np.array(self).__truediv__(np.array(other)), unit=self.unit / other.unit) def __neg__(self): return self.__class__(np.array(self).__neg__(), unit_type=self.unit_type, unit=self.unit) def to(self, new_unit): """ Conversion to a new_unit. Args: new_unit: New unit type. Returns: A ArrayWithFloatWithUnit object in the new units. Example usage: >>> e = EnergyArray([1, 1.1], "Ha") >>> e.to("eV") array([ 27.21138386, 29.93252225]) eV """ return self.__class__( np.array(self) * self.unit.get_conversion_factor(new_unit), unit_type=self.unit_type, unit=new_unit) @property def as_base_units(self): """ Returns this ArrayWithUnit in base SI units, including derived units. Returns: An ArrayWithUnit object in base SI units """ return self.to(self.unit.as_base_units[0]) #TODO abstract base class property? @property def supported_units(self): """ Supported units for specific unit type. """ return ALL_UNITS[self.unit_type] #TODO abstract base class method? def conversions(self): """ Returns a string showing the available conversions. Useful tool in interactive mode. """ return "\n".join(str(self.to(unit)) for unit in self.supported_units) def _my_partial(func, *args, **kwargs): """ Partial returns a partial object and therefore we cannot inherit class methods defined in FloatWithUnit. This function calls partial and patches the new class before returning. """ newobj = partial(func, *args, **kwargs) # monkey patch newobj.from_string = FloatWithUnit.from_string return newobj Energy = partial(FloatWithUnit, unit_type="energy") """ A float with an energy unit. Args: val (float): Value unit (Unit): E.g., eV, kJ, etc. Must be valid unit or UnitError is raised. """ EnergyArray = partial(ArrayWithUnit, unit_type="energy") Length = partial(FloatWithUnit, unit_type="length") """ A float with a length unit. Args: val (float): Value unit (Unit): E.g., m, ang, bohr, etc. Must be valid unit or UnitError is raised. """ LengthArray = partial(ArrayWithUnit, unit_type="length") Mass = partial(FloatWithUnit, unit_type="mass") """ A float with a mass unit. Args: val (float): Value unit (Unit): E.g., amu, kg, etc. Must be valid unit or UnitError is raised. """ MassArray = partial(ArrayWithUnit, unit_type="mass") Temp = partial(FloatWithUnit, unit_type="temperature") """ A float with a temperature unit. Args: val (float): Value unit (Unit): E.g., K. Only K (kelvin) is supported. """ TempArray = partial(ArrayWithUnit, unit_type="temperature") Time = partial(FloatWithUnit, unit_type="time") """ A float with a time unit. Args: val (float): Value unit (Unit): E.g., s, min, h. Must be valid unit or UnitError is raised. """ TimeArray = partial(ArrayWithUnit, unit_type="time") Charge = partial(FloatWithUnit, unit_type="charge") """ A float with a charge unit. Args: val (float): Value unit (Unit): E.g., C, e (electron charge). Must be valid unit or UnitError is raised. """ ChargeArray = partial(ArrayWithUnit, unit_type="charge") Memory = _my_partial(FloatWithUnit, unit_type="memory") """ A float with a memory unit. Args: val (float): Value unit (Unit): E.g., Kb, Mb, Gb, Tb. Must be valid unit or UnitError is raised. """ def obj_with_unit(obj, unit): """ Returns a `FloatWithUnit` instance if obj is scalar, a dictionary of objects with units if obj is a dict, else an instance of `ArrayWithFloatWithUnit`. Args: unit: Specific units (eV, Ha, m, ang, etc.). """ unit_type = _UNAME2UTYPE[unit] if isinstance(obj, numbers.Number): return FloatWithUnit(obj, unit=unit, unit_type=unit_type) elif isinstance(obj, collections.Mapping): return {k: obj_with_unit(v, unit) for k,v in obj.items()} else: return ArrayWithUnit(obj, unit=unit, unit_type=unit_type) def unitized(unit): """ Useful decorator to assign units to the output of a function. You can also use it to standardize the output units of a function that already returns a FloatWithUnit or ArrayWithUnit. For sequences, all values in the sequences are assigned the same unit. It works with Python sequences only. The creation of numpy arrays loses all unit information. For mapping types, the values are assigned units. Args: unit: Specific unit (eV, Ha, m, ang, etc.). Example usage:: @unitized(unit="kg") def get_mass(): return 123.45 """ def wrap(f): def wrapped_f(*args, **kwargs): val = f(*args, **kwargs) unit_type = _UNAME2UTYPE[unit] if isinstance(val, FloatWithUnit) or isinstance(val, ArrayWithUnit): return val.to(unit) elif isinstance(val, collections.Sequence): # TODO: why don't we return a ArrayWithUnit? # This complicated way is to ensure the sequence type is # preserved (list or tuple). return val.__class__([FloatWithUnit(i, unit_type=unit_type, unit=unit) for i in val]) elif isinstance(val, collections.Mapping): for k, v in val.items(): val[k] = FloatWithUnit(v, unit_type=unit_type, unit=unit) elif isinstance(val, numbers.Number): return FloatWithUnit(val, unit_type=unit_type, unit=unit) elif val is None: pass else: raise TypeError("Don't know how to assign units to %s" % str(val)) return val return wrapped_f return wrap if __name__ == "__main__": import doctest doctest.testmod()
31.971264
97
0.565846
from __future__ import division, unicode_literals from six.moves import filter, zip __author__ = "Shyue Ping Ong, Matteo Giantomassi" __copyright__ = "Copyright 2011, The Materials Project" __version__ = "1.0" __maintainer__ = "Shyue Ping Ong, Matteo Giantomassi" __status__ = "Production" __date__ = "Aug 30, 2013" import numpy as np import six import collections from numbers import Number import numbers from functools import partial import re import scipy.constants as const Ha_to_eV = 1/const.physical_constants["electron volt-hartree relationship"][0] eV_to_Ha = 1 / Ha_to_eV Ry_to_eV = Ha_to_eV / 2 amu_to_kg = const.physical_constants["atomic mass unit-kilogram relationship"][0] mile_to_meters = const.mile bohr_to_angstrom = const.physical_constants["Bohr radius"][0] * 1e10 bohr_to_ang = bohr_to_angstrom BASE_UNITS = { "length": { "m": 1, "km": 1000, "mile": mile_to_meters, "ang": 1e-10, "cm": 1e-2, "pm": 1e-12, "bohr": bohr_to_angstrom * 1e-10, }, "mass": { "kg": 1, "g": 1e-3, "amu": amu_to_kg, }, "time": { "s": 1, "min": 60, "h": 3600, }, "current": { "A": 1 }, "temperature": { "K": 1, }, "amount": { "mol": 1, "atom": 1 / const.N_A }, "intensity": { "cd": 1 }, "memory": { "byte": 1, "Kb": 1024, "Mb": 1024**2, "Gb": 1024**3, "Tb": 1024**4, }, } BASE_UNITS["memory"].update({k.lower(): v for k, v in BASE_UNITS["memory"].items()}) DERIVED_UNITS = { "energy": { "eV": {"kg": 1, "m": 2, "s": -2, const.e: 1}, "meV": {"kg": 1, "m": 2, "s": -2, const.e * 1e-3: 1}, "Ha": {"kg": 1, "m": 2, "s": -2, const.e * Ha_to_eV: 1}, "Ry": {"kg": 1, "m": 2, "s": -2, const.e * Ry_to_eV: 1}, "J": {"kg": 1, "m": 2, "s": -2}, "kJ": {"kg": 1, "m": 2, "s": -2, 1000: 1} }, "charge": { "C": {"A": 1, "s": 1}, "e": {"A": 1, "s": 1, const.e: 1}, }, "force": { "N": {"kg": 1, "m": 1, "s": -2}, "KN": {"kg": 1, "m": 1, "s": -2, 1000: 1}, "MN": {"kg": 1, "m": 1, "s": -2, 1e6: 1}, "GN": {"kg": 1, "m": 1, "s": -2, 1e9: 1}, }, "pressure": { "Pa": {"kg": 1, "m": -1, "s": -2}, "KPa": {"kg": 1, "m": -1, "s": -2, 1000: 1}, "MPa": {"kg": 1, "m": -1, "s": -2, 1e6: 1}, "GPa": {"kg": 1, "m": -1, "s": -2, 1e9: 1} }, "power": { "W": {"m": 2, "kg": 1, "s": -3}, "KW": {"m": 2, "kg": 1, "s": -3, 1000: 1}, "MW": {"m": 2, "kg": 1, "s": -3, 1e6: 1}, "GW": {"m": 2, "kg": 1, "s": -3, 1e9: 1} }, "emf": { "V": {"m": 2, "kg": 1, "s": -3, "A": -1} }, "capacitance": { "F": {"m": -2, "kg": -1, "s": 4, "A": 2} }, "resistance": { "ohm": {"m": 2, "kg": 1, "s": -3, "A": -2} }, "conductance": { "S": {"m": -2, "kg": -1, "s": 3, "A": 2} }, "magnetic_flux": { "Wb": {"m": 2, "kg": 1, "s": -2, "A": -1} } } ALL_UNITS = dict(list(BASE_UNITS.items()) + list(DERIVED_UNITS.items())) SUPPORTED_UNIT_NAMES = tuple([i for d in ALL_UNITS.values() for i in d.keys()]) _UNAME2UTYPE = {} for utype, d in ALL_UNITS.items(): assert not set(d.keys()).intersection(_UNAME2UTYPE.keys()) _UNAME2UTYPE.update({uname: utype for uname in d}) del utype, d def _get_si_unit(unit): unit_type = _UNAME2UTYPE[unit] si_unit = filter(lambda k: BASE_UNITS[unit_type][k] == 1, BASE_UNITS[unit_type].keys()) return list(si_unit)[0], BASE_UNITS[unit_type][unit] class UnitError(BaseException): def check_mappings(u): for v in DERIVED_UNITS.values(): for k2, v2 in v.items(): if all([v2.get(ku, 0) == vu for ku, vu in u.items()]) and \ all([u.get(kv2, 0) == vv2 for kv2, vv2 in v2.items()]): return {k2: 1} return u class Unit(collections.Mapping): Error = UnitError def __init__(self, unit_def): if isinstance(unit_def, six.string_types): unit = collections.defaultdict(int) for m in re.finditer("([A-Za-z]+)\s*\^*\s*([\-0-9]*)", unit_def): p = m.group(2) p = 1 if not p else int(p) k = m.group(1) unit[k] += p else: unit = {k: v for k, v in dict(unit_def).items() if v != 0} self._unit = check_mappings(unit) def __mul__(self, other): new_units = collections.defaultdict(int) for k, v in self.items(): new_units[k] += v for k, v in other.items(): new_units[k] += v return Unit(new_units) def __rmul__(self, other): return self.__mul__(other) def __div__(self, other): new_units = collections.defaultdict(int) for k, v in self.items(): new_units[k] += v for k, v in other.items(): new_units[k] -= v return Unit(new_units) def __truediv__(self, other): return self.__div__(other) def __pow__(self, i): return Unit({k: v * i for k, v in self.items()}) def __iter__(self): return self._unit.__iter__() def __getitem__(self, i): return self._unit[i] def __len__(self): return len(self._unit) def __repr__(self): sorted_keys = sorted(self._unit.keys(), key=lambda k: (-self._unit[k], k)) return " ".join(["{}^{}".format(k, self._unit[k]) if self._unit[k] != 1 else k for k in sorted_keys if self._unit[k] != 0]) def __str__(self): return self.__repr__() @property def as_base_units(self): b = collections.defaultdict(int) factor = 1 for k, v in self.items(): derived = False for d in DERIVED_UNITS.values(): if k in d: for k2, v2 in d[k].items(): if isinstance(k2, Number): factor *= k2 ** (v2 * v) else: b[k2] += v2 * v derived = True break if not derived: si, f = _get_si_unit(k) b[si] += v factor *= f ** v return {k: v for k, v in b.items() if v != 0}, factor def get_conversion_factor(self, new_unit): uo_base, ofactor = self.as_base_units un_base, nfactor = Unit(new_unit).as_base_units units_new = sorted(un_base.items(), key=lambda d: _UNAME2UTYPE[d[0]]) units_old = sorted(uo_base.items(), key=lambda d: _UNAME2UTYPE[d[0]]) factor = ofactor / nfactor for uo, un in zip(units_old, units_new): if uo[1] != un[1]: raise UnitError("Units %s and %s are not compatible!" % (uo, un)) c = ALL_UNITS[_UNAME2UTYPE[uo[0]]] factor *= (c[uo[0]] / c[un[0]]) ** uo[1] return factor class FloatWithUnit(float): Error = UnitError @classmethod def from_string(cls, s): s = s.strip() for i, char in enumerate(s): if char.isalpha() or char.isspace(): break else: raise Exception("Unit is missing in string %s" % s) num, unit = float(s[:i]), s[i:] for unit_type, d in BASE_UNITS.items(): if unit in d: break else: unit_type = None return cls(num, unit, unit_type=unit_type) def __new__(cls, val, unit, unit_type=None): new = float.__new__(cls, val) new._unit = Unit(unit) new._unit_type = unit_type return new def __init__(self, val, unit, unit_type=None): if unit_type is not None and str(unit) not in ALL_UNITS[unit_type]: raise UnitError( "{} is not a supported unit for {}".format(unit, unit_type)) self._unit = Unit(unit) self._unit_type = unit_type def __repr__(self): return super(FloatWithUnit, self).__repr__() def __str__(self): s = super(FloatWithUnit, self).__str__() return "{} {}".format(s, self._unit) def __add__(self, other): if not hasattr(other, "unit_type"): return super(FloatWithUnit, self).__add__(other) if other.unit_type != self._unit_type: raise UnitError("Adding different types of units is not allowed") val = other if other.unit != self._unit: val = other.to(self._unit) return FloatWithUnit(float(self) + val, unit_type=self._unit_type, unit=self._unit) def __sub__(self, other): if not hasattr(other, "unit_type"): return super(FloatWithUnit, self).__sub__(other) if other.unit_type != self._unit_type: raise UnitError("Subtracting different units is not allowed") val = other if other.unit != self._unit: val = other.to(self._unit) return FloatWithUnit(float(self) - val, unit_type=self._unit_type, unit=self._unit) def __mul__(self, other): if not isinstance(other, FloatWithUnit): return FloatWithUnit(float(self) * other, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(float(self) * other, unit_type=None, unit=self._unit * other._unit) def __rmul__(self, other): if not isinstance(other, FloatWithUnit): return FloatWithUnit(float(self) * other, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(float(self) * other, unit_type=None, unit=self._unit * other._unit) def __pow__(self, i): return FloatWithUnit(float(self) ** i, unit_type=None, unit=self._unit ** i) def __div__(self, other): val = super(FloatWithUnit, self).__div__(other) if not isinstance(other, FloatWithUnit): return FloatWithUnit(val, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(val, unit_type=None, unit=self._unit / other._unit) def __truediv__(self, other): val = super(FloatWithUnit, self).__truediv__(other) if not isinstance(other, FloatWithUnit): return FloatWithUnit(val, unit_type=self._unit_type, unit=self._unit) return FloatWithUnit(val, unit_type=None, unit=self._unit / other._unit) def __neg__(self): return FloatWithUnit(super(FloatWithUnit, self).__neg__(), unit_type=self._unit_type, unit=self._unit) def __getnewargs__(self): # since self._unit_type might not be defined. I think this is due to # the use of decorators (property and unitized). In particular I have problems with "amu" # likely due to weight in core.composition if hasattr(self, "_unit_type"): args = float(self), self._unit, self._unit_type else: args = float(self), self._unit, None return args def __getstate__(self): state = self.__dict__.copy() state["val"] = float(self) #print("in getstate %s" % state) return state def __setstate__(self, state): #print("in setstate %s" % state) self._unit = state["_unit"] @property def unit_type(self): return self._unit_type @property def unit(self): return self._unit def to(self, new_unit): return FloatWithUnit( self * self.unit.get_conversion_factor(new_unit), unit_type=self._unit_type, unit=new_unit) @property def as_base_units(self): return self.to(self.unit.as_base_units[0]) @property def supported_units(self): return tuple(ALL_UNITS[self._unit_type].keys()) class ArrayWithUnit(np.ndarray): Error = UnitError def __new__(cls, input_array, unit, unit_type=None): # Input array is an already formed ndarray instance # We first cast to be our class type obj = np.asarray(input_array).view(cls) # add the new attributes to the created instance obj._unit = Unit(unit) obj._unit_type = unit_type return obj def __array_finalize__(self, obj): if obj is None: return self._unit = getattr(obj, "_unit", None) self._unit_type = getattr(obj, "_unit_type", None) #TODO abstract base class property? @property def unit_type(self): return self._unit_type #TODO abstract base class property? @property def unit(self): return self._unit def __reduce__(self): #print("in reduce") reduce = list(super(ArrayWithUnit, self).__reduce__()) #print("unit",self._unit) #print(reduce[2]) reduce[2] = {"np_state": reduce[2], "_unit": self._unit} return tuple(reduce) def __setstate__(self, state): #print("in setstate %s" % str(state)) super(ArrayWithUnit, self).__setstate__(state["np_state"]) self._unit = state["_unit"] def __repr__(self): return "{} {}".format(np.array(self).__repr__(), self.unit) def __str__(self): return "{} {}".format(np.array(self).__str__(), self.unit) def __add__(self, other): if hasattr(other, "unit_type"): if other.unit_type != self.unit_type: raise UnitError("Adding different types of units is" " not allowed") if other.unit != self.unit: other = other.to(self.unit) return self.__class__(np.array(self) + np.array(other), unit_type=self.unit_type, unit=self.unit) def __sub__(self, other): if hasattr(other, "unit_type"): if other.unit_type != self.unit_type: raise UnitError("Subtracting different units is not allowed") if other.unit != self.unit: other = other.to(self.unit) return self.__class__(np.array(self) - np.array(other), unit_type=self.unit_type, unit=self.unit) def __mul__(self, other): # FIXME # Here we have the most important difference between FloatWithUnit and # ArrayWithFloatWithUnit: # If other does not have units, I return an object with the same units # as self. # if other *has* units, I return an object *without* units since # taking into account all the possible derived quantities would be # too difficult. # Moreover Energy(1.0) * Time(1.0, "s") returns 1.0 Ha that is a # bit misleading. # Same protocol for __div__ if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__mul__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: # Cannot use super since it returns an instance of self.__class__ # while here we want a bare numpy array. return self.__class__( np.array(self).__mul__(np.array(other)), unit=self.unit * other.unit) def __rmul__(self, other): if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__rmul__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: return self.__class__( np.array(self).__rmul__(np.array(other)), unit=self.unit * other.unit) def __div__(self, other): if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__div__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: return self.__class__( np.array(self).__div__(np.array(other)), unit=self.unit/other.unit) def __truediv__(self, other): if not hasattr(other, "unit_type"): return self.__class__(np.array(self).__truediv__(np.array(other)), unit_type=self._unit_type, unit=self._unit) else: return self.__class__( np.array(self).__truediv__(np.array(other)), unit=self.unit / other.unit) def __neg__(self): return self.__class__(np.array(self).__neg__(), unit_type=self.unit_type, unit=self.unit) def to(self, new_unit): return self.__class__( np.array(self) * self.unit.get_conversion_factor(new_unit), unit_type=self.unit_type, unit=new_unit) @property def as_base_units(self): return self.to(self.unit.as_base_units[0]) #TODO abstract base class property? @property def supported_units(self): return ALL_UNITS[self.unit_type] #TODO abstract base class method? def conversions(self): return "\n".join(str(self.to(unit)) for unit in self.supported_units) def _my_partial(func, *args, **kwargs): newobj = partial(func, *args, **kwargs) # monkey patch newobj.from_string = FloatWithUnit.from_string return newobj Energy = partial(FloatWithUnit, unit_type="energy") EnergyArray = partial(ArrayWithUnit, unit_type="energy") Length = partial(FloatWithUnit, unit_type="length") LengthArray = partial(ArrayWithUnit, unit_type="length") Mass = partial(FloatWithUnit, unit_type="mass") MassArray = partial(ArrayWithUnit, unit_type="mass") Temp = partial(FloatWithUnit, unit_type="temperature") TempArray = partial(ArrayWithUnit, unit_type="temperature") Time = partial(FloatWithUnit, unit_type="time") TimeArray = partial(ArrayWithUnit, unit_type="time") Charge = partial(FloatWithUnit, unit_type="charge") ChargeArray = partial(ArrayWithUnit, unit_type="charge") Memory = _my_partial(FloatWithUnit, unit_type="memory") def obj_with_unit(obj, unit): unit_type = _UNAME2UTYPE[unit] if isinstance(obj, numbers.Number): return FloatWithUnit(obj, unit=unit, unit_type=unit_type) elif isinstance(obj, collections.Mapping): return {k: obj_with_unit(v, unit) for k,v in obj.items()} else: return ArrayWithUnit(obj, unit=unit, unit_type=unit_type) def unitized(unit): def wrap(f): def wrapped_f(*args, **kwargs): val = f(*args, **kwargs) unit_type = _UNAME2UTYPE[unit] if isinstance(val, FloatWithUnit) or isinstance(val, ArrayWithUnit): return val.to(unit) elif isinstance(val, collections.Sequence): # TODO: why don't we return a ArrayWithUnit? return val.__class__([FloatWithUnit(i, unit_type=unit_type, unit=unit) for i in val]) elif isinstance(val, collections.Mapping): for k, v in val.items(): val[k] = FloatWithUnit(v, unit_type=unit_type, unit=unit) elif isinstance(val, numbers.Number): return FloatWithUnit(val, unit_type=unit_type, unit=unit) elif val is None: pass else: raise TypeError("Don't know how to assign units to %s" % str(val)) return val return wrapped_f return wrap if __name__ == "__main__": import doctest doctest.testmod()
true
true
f71e616278962d75c4364a4c48d685060d730488
32,900
py
Python
panel/param.py
marcelflygare/panel
75ece664ebc55d482d74abc9b56028cea5218a40
[ "BSD-3-Clause" ]
null
null
null
panel/param.py
marcelflygare/panel
75ece664ebc55d482d74abc9b56028cea5218a40
[ "BSD-3-Clause" ]
null
null
null
panel/param.py
marcelflygare/panel
75ece664ebc55d482d74abc9b56028cea5218a40
[ "BSD-3-Clause" ]
null
null
null
""" Defines the Param pane which converts Parameterized classes into a set of widgets. """ from __future__ import absolute_import, division, unicode_literals import os import sys import json import types import inspect import itertools from collections import OrderedDict, defaultdict, namedtuple from six import string_types import param from bokeh.io import curdoc as _curdoc from param.parameterized import classlist from .io import state from .layout import Row, Panel, Tabs, Column from .pane.base import PaneBase, ReplacementPane from .util import ( abbreviated_repr, full_groupby, get_method_owner, is_parameterized, param_name, recursive_parameterized ) from .viewable import Layoutable from .widgets import ( Button, Checkbox, ColorPicker, DataFrame, DatePicker, DatetimeInput, DateRangeSlider, FileSelector, FloatSlider, IntSlider, LiteralInput, MultiSelect, RangeSlider, Select, Spinner, StaticText, TextInput, Toggle, Widget ) from .widgets.button import _ButtonBase def SingleFileSelector(pobj): """ Determines whether to use a TextInput or Select widget for FileSelector """ if pobj.path: return Select else: return TextInput def LiteralInputTyped(pobj): if isinstance(pobj, param.Tuple): return type(str('TupleInput'), (LiteralInput,), {'type': tuple}) elif isinstance(pobj, param.Number): return type(str('NumberInput'), (LiteralInput,), {'type': (int, float)}) elif isinstance(pobj, param.Dict): return type(str('DictInput'), (LiteralInput,), {'type': dict}) elif isinstance(pobj, param.List): return type(str('ListInput'), (LiteralInput,), {'type': list}) return LiteralInput class Param(PaneBase): """ Param panes render a Parameterized class to a set of widgets which are linked to the parameter values on the class. """ display_threshold = param.Number(default=0, precedence=-10, doc=""" Parameters with precedence below this value are not displayed.""") default_layout = param.ClassSelector(default=Column, class_=Panel, is_instance=False) default_precedence = param.Number(default=1e-8, precedence=-10, doc=""" Precedence value to use for parameters with no declared precedence. By default, zero predecence is available for forcing some parameters to the top of the list, and other values above the default_precedence values can be used to sort or group parameters arbitrarily.""") expand = param.Boolean(default=False, doc=""" Whether parameterized subobjects are expanded or collapsed on instantiation.""") expand_button = param.Boolean(default=None, doc=""" Whether to add buttons to expand and collapse sub-objects.""") expand_layout = param.Parameter(default=Column, doc=""" Layout to expand sub-objects into.""") height = param.Integer(default=None, bounds=(0, None), doc=""" Height of widgetbox the parameter widgets are displayed in.""") initializer = param.Callable(default=None, doc=""" User-supplied function that will be called on initialization, usually to update the default Parameter values of the underlying parameterized object.""") name = param.String(default='', doc=""" Title of the pane.""") parameters = param.List(default=[], allow_None=True, doc=""" If set this serves as a whitelist of parameters to display on the supplied Parameterized object.""") show_labels = param.Boolean(default=True, doc=""" Whether to show labels for each widget""") show_name = param.Boolean(default=True, doc=""" Whether to show the parameterized object's name""") width = param.Integer(default=300, allow_None=True, bounds=(0, None), doc=""" Width of widgetbox the parameter widgets are displayed in.""") widgets = param.Dict(doc=""" Dictionary of widget overrides, mapping from parameter name to widget class.""") priority = 0.1 _unpack = True _mapping = { param.Action: Button, param.Boolean: Checkbox, param.CalendarDate: DatePicker, param.Color: ColorPicker, param.Date: DatetimeInput, param.DateRange: DateRangeSlider, param.CalendarDateRange: DateRangeSlider, param.DataFrame: DataFrame, param.Dict: LiteralInputTyped, param.FileSelector: SingleFileSelector, param.Filename: TextInput, param.Foldername: TextInput, param.Integer: IntSlider, param.List: LiteralInputTyped, param.MultiFileSelector: FileSelector, param.ListSelector: MultiSelect, param.Number: FloatSlider, param.ObjectSelector: Select, param.Parameter: LiteralInputTyped, param.Range: RangeSlider, param.Selector: Select, param.String: TextInput, } _rerender_params = [] def __init__(self, object=None, **params): if isinstance(object, param.Parameter): if not 'show_name' in params: params['show_name'] = False params['parameters'] = [object.name] object = object.owner if isinstance(object, param.parameterized.Parameters): object = object.cls if object.self is None else object.self if 'parameters' not in params and object is not None: params['parameters'] = [p for p in object.param if p != 'name'] self._explicit_parameters = False else: self._explicit_parameters = object is not None if object and 'name' not in params: params['name'] = param_name(object.name) super(Param, self).__init__(object, **params) self._updating = [] # Construct Layout kwargs = {p: v for p, v in self.param.get_param_values() if p in Layoutable.param and v is not None} self._widget_box = self.default_layout(**kwargs) layout = self.expand_layout if isinstance(layout, Panel): self._expand_layout = layout self.layout = self._widget_box elif isinstance(self._widget_box, layout): self.layout = self._expand_layout = self._widget_box elif isinstance(layout, type) and issubclass(layout, Panel): self.layout = self._expand_layout = layout(self._widget_box, **kwargs) else: raise ValueError('expand_layout expected to be a panel.layout.Panel' 'type or instance, found %s type.' % type(layout).__name__) self.param.watch(self._update_widgets, [ 'object', 'parameters', 'name', 'display_threshold', 'expand_button', 'expand', 'expand_layout', 'widgets', 'show_labels', 'show_name']) self._update_widgets() def __repr__(self, depth=0): cls = type(self).__name__ obj_cls = type(self.object).__name__ params = [] if self.object is None else list(self.object.param) parameters = [k for k in params if k != 'name'] params = [] for p, v in sorted(self.param.get_param_values()): if v is self.param[p].default: continue elif v is None: continue elif isinstance(v, string_types) and v == '': continue elif p == 'object' or (p == 'name' and (v.startswith(obj_cls) or v.startswith(cls))): continue elif p == 'parameters' and v == parameters: continue try: params.append('%s=%s' % (p, abbreviated_repr(v))) except RuntimeError: params.append('%s=%s' % (p, '...')) obj = 'None' if self.object is None else '%s' % type(self.object).__name__ template = '{cls}({obj}, {params})' if params else '{cls}({obj})' return template.format(cls=cls, params=', '.join(params), obj=obj) #---------------------------------------------------------------- # Callback API #---------------------------------------------------------------- def _synced_params(self): ignored_params = ['default_layout'] return [p for p in Layoutable.param if p not in ignored_params] def _update_widgets(self, *events): parameters = [] for event in sorted(events, key=lambda x: x.name): if event.name == 'object': if isinstance(event.new, param.parameterized.Parameters): # Setting object will trigger this method a second time self.object = event.new.cls if event.new.self is None else event.new.self return if self._explicit_parameters: parameters = self.parameters elif event.new is None: parameters = [] else: parameters = [p for p in event.new.param if p != 'name'] self.name = param_name(event.new.name) if event.name == 'parameters': if event.new is None: self._explicit_parameters = False if self.object is not None: parameters = [p for p in self.object.param if p != 'name'] else: self._explicit_parameters = True parameters = [] if event.new == [] else event.new if parameters != [] and parameters != self.parameters: # Setting parameters will trigger this method a second time self.parameters = parameters return for cb in list(self._callbacks): if cb.inst in self._widget_box.objects: cb.inst.param.unwatch(cb) self._callbacks.remove(cb) # Construct widgets if self.object is None: self._widgets = {} else: self._widgets = self._get_widgets() alias = {'_title': 'name'} widgets = [widget for p, widget in self._widgets.items() if (self.object.param[alias.get(p, p)].precedence is None) or (self.object.param[alias.get(p, p)].precedence >= self.display_threshold)] self._widget_box.objects = widgets if not (self.expand_button == False and not self.expand): self._link_subobjects() def _link_subobjects(self): for pname, widget in self._widgets.items(): widgets = [widget] if isinstance(widget, Widget) else widget if not any(is_parameterized(getattr(w, 'value', None)) or any(is_parameterized(o) for o in getattr(w, 'options', [])) for w in widgets): continue if (isinstance(widgets, Row) and isinstance(widgets[1], Toggle)): selector, toggle = (widgets[0], widgets[1]) else: selector, toggle = (widget, None) def toggle_pane(change, parameter=pname): "Adds or removes subpanel from layout" parameterized = getattr(self.object, parameter) existing = [p for p in self._expand_layout.objects if isinstance(p, Param) and p.object in recursive_parameterized(parameterized)] if not change.new: self._expand_layout[:] = [ e for e in self._expand_layout.objects if e not in existing ] elif change.new: kwargs = {k: v for k, v in self.param.get_param_values() if k not in ['name', 'object', 'parameters']} pane = Param(parameterized, name=parameterized.name, **kwargs) if isinstance(self._expand_layout, Tabs): title = self.object.param[pname].label pane = (title, pane) self._expand_layout.append(pane) def update_pane(change, parameter=pname): "Adds or removes subpanel from layout" layout = self._expand_layout existing = [p for p in layout.objects if isinstance(p, Param) and p.object is change.old] if toggle: toggle.disabled = not is_parameterized(change.new) if not existing: return elif is_parameterized(change.new): parameterized = change.new kwargs = {k: v for k, v in self.param.get_param_values() if k not in ['name', 'object', 'parameters']} pane = Param(parameterized, name=parameterized.name, **kwargs) layout[layout.objects.index(existing[0])] = pane else: layout.pop(existing[0]) watchers = [selector.param.watch(update_pane, 'value')] if toggle: watchers.append(toggle.param.watch(toggle_pane, 'value')) self._callbacks += watchers if self.expand: if self.expand_button: toggle.value = True else: toggle_pane(namedtuple('Change', 'new')(True)) def widget(self, p_name): """Get widget for param_name""" p_obj = self.object.param[p_name] kw_widget = {} widget_class_overridden = True if self.widgets is None or p_name not in self.widgets: widget_class_overridden = False widget_class = self.widget_type(p_obj) elif isinstance(self.widgets[p_name], dict): if 'type' in self.widgets[p_name]: widget_class = self.widgets[p_name].pop('type') else: widget_class_overridden = False widget_class = self.widget_type(p_obj) kw_widget = self.widgets[p_name] else: widget_class = self.widgets[p_name] if not self.show_labels and not issubclass(widget_class, _ButtonBase): label = '' else: label = p_obj.label kw = dict(disabled=p_obj.constant, name=label) value = getattr(self.object, p_name) if value is not None: kw['value'] = value # Update kwargs kw.update(kw_widget) if hasattr(p_obj, 'get_range'): options = p_obj.get_range() if not options and value is not None: options = [value] kw['options'] = options if hasattr(p_obj, 'get_soft_bounds'): bounds = p_obj.get_soft_bounds() if bounds[0] is not None: kw['start'] = bounds[0] if bounds[1] is not None: kw['end'] = bounds[1] if ('start' not in kw or 'end' not in kw): # Do not change widget class if _mapping was overridden if not widget_class_overridden: if (isinstance(p_obj, param.Number) and not isinstance(p_obj, (param.Date, param.CalendarDate))): widget_class = Spinner if isinstance(p_obj, param.Integer): kw['step'] = 1 elif not issubclass(widget_class, LiteralInput): widget_class = LiteralInput if hasattr(widget_class, 'step') and getattr(p_obj, 'step', None): kw['step'] = p_obj.step kwargs = {k: v for k, v in kw.items() if k in widget_class.param} if isinstance(widget_class, Widget): widget = widget_class else: widget = widget_class(**kwargs) widget._param_pane = self watchers = self._callbacks def link_widget(change): if p_name in self._updating: return try: self._updating.append(p_name) self.object.param.set_param(**{p_name: change.new}) finally: self._updating.remove(p_name) if isinstance(p_obj, param.Action): def action(change): value(self.object) watcher = widget.param.watch(action, 'clicks') else: watcher = widget.param.watch(link_widget, 'value') watchers.append(watcher) def link(change, watchers=[watcher]): updates = {} if change.what == 'constant': updates['disabled'] = change.new elif change.what == 'precedence': if (change.new < self.display_threshold and widget in self._widget_box.objects): self._widget_box.pop(widget) elif change.new >= self.display_threshold: precedence = lambda k: self.object.param['name' if k == '_title' else k].precedence params = self._ordered_params if self.show_name: params.insert(0, '_title') widgets = [] for k in params: if precedence(k) is None or precedence(k) >= self.display_threshold: widgets.append(self._widgets[k]) self._widget_box.objects = widgets return elif change.what == 'objects': updates['options'] = p_obj.get_range() elif change.what == 'bounds': start, end = p_obj.get_soft_bounds() updates['start'] = start updates['end'] = end elif change.what == 'step': updates['step'] = p_obj.step elif change.what == 'label': updates['name'] = p_obj.label elif p_name in self._updating: return elif isinstance(p_obj, param.Action): prev_watcher = watchers[0] widget.param.unwatch(prev_watcher) def action(event): change.new(self.object) watchers[0] = widget.param.watch(action, 'clicks') idx = self._callbacks.index(prev_watcher) self._callbacks[idx] = watchers[0] return else: updates['value'] = change.new try: self._updating.append(p_name) widget.param.set_param(**updates) finally: self._updating.remove(p_name) # Set up links to parameterized object watchers.append(self.object.param.watch(link, p_name, 'constant')) watchers.append(self.object.param.watch(link, p_name, 'precedence')) watchers.append(self.object.param.watch(link, p_name, 'label')) if hasattr(p_obj, 'get_range'): watchers.append(self.object.param.watch(link, p_name, 'objects')) if hasattr(p_obj, 'get_soft_bounds'): watchers.append(self.object.param.watch(link, p_name, 'bounds')) if 'step' in kw: watchers.append(self.object.param.watch(link, p_name, 'step')) watchers.append(self.object.param.watch(link, p_name)) options = kwargs.get('options', []) if isinstance(options, dict): options = options.values() if ((is_parameterized(value) or any(is_parameterized(o) for o in options)) and (self.expand_button or (self.expand_button is None and not self.expand))): widget.margin = (5, 0, 5, 10) toggle = Toggle(name='\u22EE', button_type='primary', disabled=not is_parameterized(value), max_height=30, max_width=20, height_policy='fit', align='end', margin=(0, 0, 5, 10)) widget.width = self._widget_box.width-60 return Row(widget, toggle, width_policy='max', margin=0) else: return widget @property def _ordered_params(self): params = [(p, pobj) for p, pobj in self.object.param.objects('existing').items() if p in self.parameters or p == 'name'] key_fn = lambda x: x[1].precedence if x[1].precedence is not None else self.default_precedence sorted_precedence = sorted(params, key=key_fn) filtered = [(k, p) for k, p in sorted_precedence] groups = itertools.groupby(filtered, key=key_fn) # Params preserve definition order in Python 3.6+ dict_ordered_py3 = (sys.version_info.major == 3 and sys.version_info.minor >= 6) dict_ordered = dict_ordered_py3 or (sys.version_info.major > 3) ordered_groups = [list(grp) if dict_ordered else sorted(grp) for (_, grp) in groups] ordered_params = [el[0] for group in ordered_groups for el in group if (el[0] != 'name' or el[0] in self.parameters)] return ordered_params #---------------------------------------------------------------- # Model API #---------------------------------------------------------------- def _get_widgets(self): """Return name,widget boxes for all parameters (i.e., a property sheet)""" # Format name specially if self.expand_layout is Tabs: widgets = [] elif self.show_name: widgets = [('_title', StaticText(value='<b>{0}</b>'.format(self.name)))] else: widgets = [] widgets += [(pname, self.widget(pname)) for pname in self._ordered_params] return OrderedDict(widgets) def _get_model(self, doc, root=None, parent=None, comm=None): model = self.layout._get_model(doc, root, parent, comm) self._models[root.ref['id']] = (model, parent) return model def _cleanup(self, root): self.layout._cleanup(root) super(Param, self)._cleanup(root) #---------------------------------------------------------------- # Public API #---------------------------------------------------------------- @classmethod def applies(cls, obj): return (is_parameterized(obj) or isinstance(obj, param.parameterized.Parameters) or (isinstance(obj, param.Parameter) and obj.owner is not None)) @classmethod def widget_type(cls, pobj): ptype = type(pobj) for t in classlist(ptype)[::-1]: if t in cls._mapping: if isinstance(cls._mapping[t], types.FunctionType): return cls._mapping[t](pobj) return cls._mapping[t] def select(self, selector=None): """ Iterates over the Viewable and any potential children in the applying the Selector. Arguments --------- selector: type or callable or None The selector allows selecting a subset of Viewables by declaring a type or callable function to filter by. Returns ------- viewables: list(Viewable) """ return super().select(selector) + self.layout.select(selector) def get_root(self, doc=None, comm=None): """ Returns the root model and applies pre-processing hooks Arguments --------- doc: bokeh.Document Bokeh document the bokeh model will be attached to. comm: pyviz_comms.Comm Optional pyviz_comms when working in notebook Returns ------- Returns the bokeh model corresponding to this panel object """ doc = doc or _curdoc() root = self.layout.get_root(doc, comm) ref = root.ref['id'] self._models[ref] = (root, None) state._views[ref] = (self, root, doc, comm) return root class ParamMethod(ReplacementPane): """ ParamMethod panes wrap methods on parameterized classes and rerenders the plot when any of the method's parameters change. By default ParamMethod will watch all parameters on the class owning the method or can be restricted to certain parameters by annotating the method using the param.depends decorator. The method may return any object which itself can be rendered as a Pane. """ def __init__(self, object=None, **params): super(ParamMethod, self).__init__(object, **params) self._link_object_params() if object is not None: self._validate_object() self._update_inner(self.eval(object)) @param.depends('object', watch=True) def _validate_object(self): dependencies = getattr(self.object, '_dinfo', None) if not dependencies or not dependencies.get('watch'): return fn_type = 'method' if type(self) is ParamMethod else 'function' self.param.warning(f"The {fn_type} supplied for Panel to display " "was declared with `watch=True`, which will " f"cause the {fn_type} to be called twice for " "any change in a dependent Parameter. " "`watch` should be False when Panel is " "responsible for displaying the result " f"of the {fn_type} call, while `watch=True` " f"should be reserved for {fn_type}s that work " "via side-effects, e.g. by modifying internal " "state of a class or global state in an " "application's namespace.") #---------------------------------------------------------------- # Callback API #---------------------------------------------------------------- @classmethod def eval(self, function): args, kwargs = (), {} if hasattr(function, '_dinfo'): arg_deps = function._dinfo['dependencies'] kw_deps = function._dinfo.get('kw', {}) if kw_deps or any(isinstance(d, param.Parameter) for d in arg_deps): args = (getattr(dep.owner, dep.name) for dep in arg_deps) kwargs = {n: getattr(dep.owner, dep.name) for n, dep in kw_deps.items()} return function(*args, **kwargs) def _update_pane(self, *events): callbacks = [] for watcher in self._callbacks: obj = watcher.inst if watcher.inst is None else watcher.cls if obj is self: callbacks.append(watcher) continue obj.param.unwatch(watcher) self._callbacks = callbacks self._link_object_params() if object is not None: self._update_inner(self.eval(self.object)) def _link_object_params(self): parameterized = get_method_owner(self.object) params = parameterized.param.params_depended_on(self.object.__name__) deps = params def update_pane(*events): # Update nested dependencies if parameterized object events if any(is_parameterized(event.new) for event in events): new_deps = parameterized.param.params_depended_on(self.object.__name__) for p in list(deps): if p in new_deps: continue watchers = self._callbacks for w in list(watchers): if (w.inst is p.inst and w.cls is p.cls and p.name in w.parameter_names): obj = p.cls if p.inst is None else p.inst obj.param.unwatch(w) watchers.pop(watchers.index(w)) deps.pop(deps.index(p)) new_deps = [dep for dep in new_deps if dep not in deps] for _, params in full_groupby(new_deps, lambda x: (x.inst or x.cls, x.what)): p = params[0] pobj = p.cls if p.inst is None else p.inst ps = [_p.name for _p in params] watcher = pobj.param.watch(update_pane, ps, p.what) self._callbacks.append(watcher) for p in params: deps.append(p) new_object = self.eval(self.object) self._update_inner(new_object) for _, params in full_groupby(params, lambda x: (x.inst or x.cls, x.what)): p = params[0] pobj = (p.inst or p.cls) ps = [_p.name for _p in params] watcher = pobj.param.watch(update_pane, ps, p.what) self._callbacks.append(watcher) #---------------------------------------------------------------- # Public API #---------------------------------------------------------------- @classmethod def applies(cls, obj): return inspect.ismethod(obj) and isinstance(get_method_owner(obj), param.Parameterized) class ParamFunction(ParamMethod): """ ParamFunction panes wrap functions decorated with the param.depends decorator and rerenders the output when any of the function's dependencies change. This allows building reactive components into a Panel which depend on other parameters, e.g. tying the value of a widget to some other output. """ priority = 0.6 def _replace_pane(self, *args): new_object = self.eval(self.object) self._update_inner(new_object) def _link_object_params(self): deps = self.object._dinfo dep_params = list(deps['dependencies']) + list(deps.get('kw', {}).values()) grouped = defaultdict(list) for dep in dep_params: grouped[id(dep.owner)].append(dep) for group in grouped.values(): watcher = group[0].owner.param.watch(self._replace_pane, [dep.name for dep in group]) self._callbacks.append(watcher) #---------------------------------------------------------------- # Public API #---------------------------------------------------------------- @classmethod def applies(cls, obj): return isinstance(obj, types.FunctionType) and hasattr(obj, '_dinfo') class JSONInit(param.Parameterized): """ Callable that can be passed to Widgets.initializer to set Parameter values using JSON. There are three approaches that may be used: 1. If the json_file argument is specified, this takes precedence. 2. The JSON file path can be specified via an environment variable. 3. The JSON can be read directly from an environment variable. Here is an easy example of setting such an environment variable on the commandline: PARAM_JSON_INIT='{"p1":5}' jupyter notebook This addresses any JSONInit instances that are inspecting the default environment variable called PARAM_JSON_INIT, instructing it to set the 'p1' parameter to 5. """ varname = param.String(default='PARAM_JSON_INIT', doc=""" The name of the environment variable containing the JSON specification.""") target = param.String(default=None, doc=""" Optional key in the JSON specification dictionary containing the desired parameter values.""") json_file = param.String(default=None, doc=""" Optional path to a JSON file containing the parameter settings.""") def __call__(self, parameterized): warnobj = param.main if isinstance(parameterized, type) else parameterized param_class = (parameterized if isinstance(parameterized, type) else parameterized.__class__) target = self.target if self.target is not None else param_class.__name__ env_var = os.environ.get(self.varname, None) if env_var is None and self.json_file is None: return if self.json_file or env_var.endswith('.json'): try: fname = self.json_file if self.json_file else env_var spec = json.load(open(os.path.abspath(fname), 'r')) except Exception: warnobj.warning('Could not load JSON file %r' % spec) else: spec = json.loads(env_var) if not isinstance(spec, dict): warnobj.warning('JSON parameter specification must be a dictionary.') return if target in spec: params = spec[target] else: params = spec for name, value in params.items(): try: parameterized.param.set_param(**{name:value}) except ValueError as e: warnobj.warning(str(e))
41.331658
106
0.565015
from __future__ import absolute_import, division, unicode_literals import os import sys import json import types import inspect import itertools from collections import OrderedDict, defaultdict, namedtuple from six import string_types import param from bokeh.io import curdoc as _curdoc from param.parameterized import classlist from .io import state from .layout import Row, Panel, Tabs, Column from .pane.base import PaneBase, ReplacementPane from .util import ( abbreviated_repr, full_groupby, get_method_owner, is_parameterized, param_name, recursive_parameterized ) from .viewable import Layoutable from .widgets import ( Button, Checkbox, ColorPicker, DataFrame, DatePicker, DatetimeInput, DateRangeSlider, FileSelector, FloatSlider, IntSlider, LiteralInput, MultiSelect, RangeSlider, Select, Spinner, StaticText, TextInput, Toggle, Widget ) from .widgets.button import _ButtonBase def SingleFileSelector(pobj): if pobj.path: return Select else: return TextInput def LiteralInputTyped(pobj): if isinstance(pobj, param.Tuple): return type(str('TupleInput'), (LiteralInput,), {'type': tuple}) elif isinstance(pobj, param.Number): return type(str('NumberInput'), (LiteralInput,), {'type': (int, float)}) elif isinstance(pobj, param.Dict): return type(str('DictInput'), (LiteralInput,), {'type': dict}) elif isinstance(pobj, param.List): return type(str('ListInput'), (LiteralInput,), {'type': list}) return LiteralInput class Param(PaneBase): display_threshold = param.Number(default=0, precedence=-10, doc=""" Parameters with precedence below this value are not displayed.""") default_layout = param.ClassSelector(default=Column, class_=Panel, is_instance=False) default_precedence = param.Number(default=1e-8, precedence=-10, doc=""" Precedence value to use for parameters with no declared precedence. By default, zero predecence is available for forcing some parameters to the top of the list, and other values above the default_precedence values can be used to sort or group parameters arbitrarily.""") expand = param.Boolean(default=False, doc=""" Whether parameterized subobjects are expanded or collapsed on instantiation.""") expand_button = param.Boolean(default=None, doc=""" Whether to add buttons to expand and collapse sub-objects.""") expand_layout = param.Parameter(default=Column, doc=""" Layout to expand sub-objects into.""") height = param.Integer(default=None, bounds=(0, None), doc=""" Height of widgetbox the parameter widgets are displayed in.""") initializer = param.Callable(default=None, doc=""" User-supplied function that will be called on initialization, usually to update the default Parameter values of the underlying parameterized object.""") name = param.String(default='', doc=""" Title of the pane.""") parameters = param.List(default=[], allow_None=True, doc=""" If set this serves as a whitelist of parameters to display on the supplied Parameterized object.""") show_labels = param.Boolean(default=True, doc=""" Whether to show labels for each widget""") show_name = param.Boolean(default=True, doc=""" Whether to show the parameterized object's name""") width = param.Integer(default=300, allow_None=True, bounds=(0, None), doc=""" Width of widgetbox the parameter widgets are displayed in.""") widgets = param.Dict(doc=""" Dictionary of widget overrides, mapping from parameter name to widget class.""") priority = 0.1 _unpack = True _mapping = { param.Action: Button, param.Boolean: Checkbox, param.CalendarDate: DatePicker, param.Color: ColorPicker, param.Date: DatetimeInput, param.DateRange: DateRangeSlider, param.CalendarDateRange: DateRangeSlider, param.DataFrame: DataFrame, param.Dict: LiteralInputTyped, param.FileSelector: SingleFileSelector, param.Filename: TextInput, param.Foldername: TextInput, param.Integer: IntSlider, param.List: LiteralInputTyped, param.MultiFileSelector: FileSelector, param.ListSelector: MultiSelect, param.Number: FloatSlider, param.ObjectSelector: Select, param.Parameter: LiteralInputTyped, param.Range: RangeSlider, param.Selector: Select, param.String: TextInput, } _rerender_params = [] def __init__(self, object=None, **params): if isinstance(object, param.Parameter): if not 'show_name' in params: params['show_name'] = False params['parameters'] = [object.name] object = object.owner if isinstance(object, param.parameterized.Parameters): object = object.cls if object.self is None else object.self if 'parameters' not in params and object is not None: params['parameters'] = [p for p in object.param if p != 'name'] self._explicit_parameters = False else: self._explicit_parameters = object is not None if object and 'name' not in params: params['name'] = param_name(object.name) super(Param, self).__init__(object, **params) self._updating = [] # Construct Layout kwargs = {p: v for p, v in self.param.get_param_values() if p in Layoutable.param and v is not None} self._widget_box = self.default_layout(**kwargs) layout = self.expand_layout if isinstance(layout, Panel): self._expand_layout = layout self.layout = self._widget_box elif isinstance(self._widget_box, layout): self.layout = self._expand_layout = self._widget_box elif isinstance(layout, type) and issubclass(layout, Panel): self.layout = self._expand_layout = layout(self._widget_box, **kwargs) else: raise ValueError('expand_layout expected to be a panel.layout.Panel' 'type or instance, found %s type.' % type(layout).__name__) self.param.watch(self._update_widgets, [ 'object', 'parameters', 'name', 'display_threshold', 'expand_button', 'expand', 'expand_layout', 'widgets', 'show_labels', 'show_name']) self._update_widgets() def __repr__(self, depth=0): cls = type(self).__name__ obj_cls = type(self.object).__name__ params = [] if self.object is None else list(self.object.param) parameters = [k for k in params if k != 'name'] params = [] for p, v in sorted(self.param.get_param_values()): if v is self.param[p].default: continue elif v is None: continue elif isinstance(v, string_types) and v == '': continue elif p == 'object' or (p == 'name' and (v.startswith(obj_cls) or v.startswith(cls))): continue elif p == 'parameters' and v == parameters: continue try: params.append('%s=%s' % (p, abbreviated_repr(v))) except RuntimeError: params.append('%s=%s' % (p, '...')) obj = 'None' if self.object is None else '%s' % type(self.object).__name__ template = '{cls}({obj}, {params})' if params else '{cls}({obj})' return template.format(cls=cls, params=', '.join(params), obj=obj) #---------------------------------------------------------------- # Callback API #---------------------------------------------------------------- def _synced_params(self): ignored_params = ['default_layout'] return [p for p in Layoutable.param if p not in ignored_params] def _update_widgets(self, *events): parameters = [] for event in sorted(events, key=lambda x: x.name): if event.name == 'object': if isinstance(event.new, param.parameterized.Parameters): # Setting object will trigger this method a second time self.object = event.new.cls if event.new.self is None else event.new.self return if self._explicit_parameters: parameters = self.parameters elif event.new is None: parameters = [] else: parameters = [p for p in event.new.param if p != 'name'] self.name = param_name(event.new.name) if event.name == 'parameters': if event.new is None: self._explicit_parameters = False if self.object is not None: parameters = [p for p in self.object.param if p != 'name'] else: self._explicit_parameters = True parameters = [] if event.new == [] else event.new if parameters != [] and parameters != self.parameters: # Setting parameters will trigger this method a second time self.parameters = parameters return for cb in list(self._callbacks): if cb.inst in self._widget_box.objects: cb.inst.param.unwatch(cb) self._callbacks.remove(cb) # Construct widgets if self.object is None: self._widgets = {} else: self._widgets = self._get_widgets() alias = {'_title': 'name'} widgets = [widget for p, widget in self._widgets.items() if (self.object.param[alias.get(p, p)].precedence is None) or (self.object.param[alias.get(p, p)].precedence >= self.display_threshold)] self._widget_box.objects = widgets if not (self.expand_button == False and not self.expand): self._link_subobjects() def _link_subobjects(self): for pname, widget in self._widgets.items(): widgets = [widget] if isinstance(widget, Widget) else widget if not any(is_parameterized(getattr(w, 'value', None)) or any(is_parameterized(o) for o in getattr(w, 'options', [])) for w in widgets): continue if (isinstance(widgets, Row) and isinstance(widgets[1], Toggle)): selector, toggle = (widgets[0], widgets[1]) else: selector, toggle = (widget, None) def toggle_pane(change, parameter=pname): parameterized = getattr(self.object, parameter) existing = [p for p in self._expand_layout.objects if isinstance(p, Param) and p.object in recursive_parameterized(parameterized)] if not change.new: self._expand_layout[:] = [ e for e in self._expand_layout.objects if e not in existing ] elif change.new: kwargs = {k: v for k, v in self.param.get_param_values() if k not in ['name', 'object', 'parameters']} pane = Param(parameterized, name=parameterized.name, **kwargs) if isinstance(self._expand_layout, Tabs): title = self.object.param[pname].label pane = (title, pane) self._expand_layout.append(pane) def update_pane(change, parameter=pname): layout = self._expand_layout existing = [p for p in layout.objects if isinstance(p, Param) and p.object is change.old] if toggle: toggle.disabled = not is_parameterized(change.new) if not existing: return elif is_parameterized(change.new): parameterized = change.new kwargs = {k: v for k, v in self.param.get_param_values() if k not in ['name', 'object', 'parameters']} pane = Param(parameterized, name=parameterized.name, **kwargs) layout[layout.objects.index(existing[0])] = pane else: layout.pop(existing[0]) watchers = [selector.param.watch(update_pane, 'value')] if toggle: watchers.append(toggle.param.watch(toggle_pane, 'value')) self._callbacks += watchers if self.expand: if self.expand_button: toggle.value = True else: toggle_pane(namedtuple('Change', 'new')(True)) def widget(self, p_name): p_obj = self.object.param[p_name] kw_widget = {} widget_class_overridden = True if self.widgets is None or p_name not in self.widgets: widget_class_overridden = False widget_class = self.widget_type(p_obj) elif isinstance(self.widgets[p_name], dict): if 'type' in self.widgets[p_name]: widget_class = self.widgets[p_name].pop('type') else: widget_class_overridden = False widget_class = self.widget_type(p_obj) kw_widget = self.widgets[p_name] else: widget_class = self.widgets[p_name] if not self.show_labels and not issubclass(widget_class, _ButtonBase): label = '' else: label = p_obj.label kw = dict(disabled=p_obj.constant, name=label) value = getattr(self.object, p_name) if value is not None: kw['value'] = value # Update kwargs kw.update(kw_widget) if hasattr(p_obj, 'get_range'): options = p_obj.get_range() if not options and value is not None: options = [value] kw['options'] = options if hasattr(p_obj, 'get_soft_bounds'): bounds = p_obj.get_soft_bounds() if bounds[0] is not None: kw['start'] = bounds[0] if bounds[1] is not None: kw['end'] = bounds[1] if ('start' not in kw or 'end' not in kw): # Do not change widget class if _mapping was overridden if not widget_class_overridden: if (isinstance(p_obj, param.Number) and not isinstance(p_obj, (param.Date, param.CalendarDate))): widget_class = Spinner if isinstance(p_obj, param.Integer): kw['step'] = 1 elif not issubclass(widget_class, LiteralInput): widget_class = LiteralInput if hasattr(widget_class, 'step') and getattr(p_obj, 'step', None): kw['step'] = p_obj.step kwargs = {k: v for k, v in kw.items() if k in widget_class.param} if isinstance(widget_class, Widget): widget = widget_class else: widget = widget_class(**kwargs) widget._param_pane = self watchers = self._callbacks def link_widget(change): if p_name in self._updating: return try: self._updating.append(p_name) self.object.param.set_param(**{p_name: change.new}) finally: self._updating.remove(p_name) if isinstance(p_obj, param.Action): def action(change): value(self.object) watcher = widget.param.watch(action, 'clicks') else: watcher = widget.param.watch(link_widget, 'value') watchers.append(watcher) def link(change, watchers=[watcher]): updates = {} if change.what == 'constant': updates['disabled'] = change.new elif change.what == 'precedence': if (change.new < self.display_threshold and widget in self._widget_box.objects): self._widget_box.pop(widget) elif change.new >= self.display_threshold: precedence = lambda k: self.object.param['name' if k == '_title' else k].precedence params = self._ordered_params if self.show_name: params.insert(0, '_title') widgets = [] for k in params: if precedence(k) is None or precedence(k) >= self.display_threshold: widgets.append(self._widgets[k]) self._widget_box.objects = widgets return elif change.what == 'objects': updates['options'] = p_obj.get_range() elif change.what == 'bounds': start, end = p_obj.get_soft_bounds() updates['start'] = start updates['end'] = end elif change.what == 'step': updates['step'] = p_obj.step elif change.what == 'label': updates['name'] = p_obj.label elif p_name in self._updating: return elif isinstance(p_obj, param.Action): prev_watcher = watchers[0] widget.param.unwatch(prev_watcher) def action(event): change.new(self.object) watchers[0] = widget.param.watch(action, 'clicks') idx = self._callbacks.index(prev_watcher) self._callbacks[idx] = watchers[0] return else: updates['value'] = change.new try: self._updating.append(p_name) widget.param.set_param(**updates) finally: self._updating.remove(p_name) # Set up links to parameterized object watchers.append(self.object.param.watch(link, p_name, 'constant')) watchers.append(self.object.param.watch(link, p_name, 'precedence')) watchers.append(self.object.param.watch(link, p_name, 'label')) if hasattr(p_obj, 'get_range'): watchers.append(self.object.param.watch(link, p_name, 'objects')) if hasattr(p_obj, 'get_soft_bounds'): watchers.append(self.object.param.watch(link, p_name, 'bounds')) if 'step' in kw: watchers.append(self.object.param.watch(link, p_name, 'step')) watchers.append(self.object.param.watch(link, p_name)) options = kwargs.get('options', []) if isinstance(options, dict): options = options.values() if ((is_parameterized(value) or any(is_parameterized(o) for o in options)) and (self.expand_button or (self.expand_button is None and not self.expand))): widget.margin = (5, 0, 5, 10) toggle = Toggle(name='\u22EE', button_type='primary', disabled=not is_parameterized(value), max_height=30, max_width=20, height_policy='fit', align='end', margin=(0, 0, 5, 10)) widget.width = self._widget_box.width-60 return Row(widget, toggle, width_policy='max', margin=0) else: return widget @property def _ordered_params(self): params = [(p, pobj) for p, pobj in self.object.param.objects('existing').items() if p in self.parameters or p == 'name'] key_fn = lambda x: x[1].precedence if x[1].precedence is not None else self.default_precedence sorted_precedence = sorted(params, key=key_fn) filtered = [(k, p) for k, p in sorted_precedence] groups = itertools.groupby(filtered, key=key_fn) # Params preserve definition order in Python 3.6+ dict_ordered_py3 = (sys.version_info.major == 3 and sys.version_info.minor >= 6) dict_ordered = dict_ordered_py3 or (sys.version_info.major > 3) ordered_groups = [list(grp) if dict_ordered else sorted(grp) for (_, grp) in groups] ordered_params = [el[0] for group in ordered_groups for el in group if (el[0] != 'name' or el[0] in self.parameters)] return ordered_params #---------------------------------------------------------------- # Model API #---------------------------------------------------------------- def _get_widgets(self): # Format name specially if self.expand_layout is Tabs: widgets = [] elif self.show_name: widgets = [('_title', StaticText(value='<b>{0}</b>'.format(self.name)))] else: widgets = [] widgets += [(pname, self.widget(pname)) for pname in self._ordered_params] return OrderedDict(widgets) def _get_model(self, doc, root=None, parent=None, comm=None): model = self.layout._get_model(doc, root, parent, comm) self._models[root.ref['id']] = (model, parent) return model def _cleanup(self, root): self.layout._cleanup(root) super(Param, self)._cleanup(root) #---------------------------------------------------------------- # Public API #---------------------------------------------------------------- @classmethod def applies(cls, obj): return (is_parameterized(obj) or isinstance(obj, param.parameterized.Parameters) or (isinstance(obj, param.Parameter) and obj.owner is not None)) @classmethod def widget_type(cls, pobj): ptype = type(pobj) for t in classlist(ptype)[::-1]: if t in cls._mapping: if isinstance(cls._mapping[t], types.FunctionType): return cls._mapping[t](pobj) return cls._mapping[t] def select(self, selector=None): return super().select(selector) + self.layout.select(selector) def get_root(self, doc=None, comm=None): doc = doc or _curdoc() root = self.layout.get_root(doc, comm) ref = root.ref['id'] self._models[ref] = (root, None) state._views[ref] = (self, root, doc, comm) return root class ParamMethod(ReplacementPane): def __init__(self, object=None, **params): super(ParamMethod, self).__init__(object, **params) self._link_object_params() if object is not None: self._validate_object() self._update_inner(self.eval(object)) @param.depends('object', watch=True) def _validate_object(self): dependencies = getattr(self.object, '_dinfo', None) if not dependencies or not dependencies.get('watch'): return fn_type = 'method' if type(self) is ParamMethod else 'function' self.param.warning(f"The {fn_type} supplied for Panel to display " "was declared with `watch=True`, which will " f"cause the {fn_type} to be called twice for " "any change in a dependent Parameter. " "`watch` should be False when Panel is " "responsible for displaying the result " f"of the {fn_type} call, while `watch=True` " f"should be reserved for {fn_type}s that work " "via side-effects, e.g. by modifying internal " "state of a class or global state in an " "application's namespace.") @classmethod def eval(self, function): args, kwargs = (), {} if hasattr(function, '_dinfo'): arg_deps = function._dinfo['dependencies'] kw_deps = function._dinfo.get('kw', {}) if kw_deps or any(isinstance(d, param.Parameter) for d in arg_deps): args = (getattr(dep.owner, dep.name) for dep in arg_deps) kwargs = {n: getattr(dep.owner, dep.name) for n, dep in kw_deps.items()} return function(*args, **kwargs) def _update_pane(self, *events): callbacks = [] for watcher in self._callbacks: obj = watcher.inst if watcher.inst is None else watcher.cls if obj is self: callbacks.append(watcher) continue obj.param.unwatch(watcher) self._callbacks = callbacks self._link_object_params() if object is not None: self._update_inner(self.eval(self.object)) def _link_object_params(self): parameterized = get_method_owner(self.object) params = parameterized.param.params_depended_on(self.object.__name__) deps = params def update_pane(*events): if any(is_parameterized(event.new) for event in events): new_deps = parameterized.param.params_depended_on(self.object.__name__) for p in list(deps): if p in new_deps: continue watchers = self._callbacks for w in list(watchers): if (w.inst is p.inst and w.cls is p.cls and p.name in w.parameter_names): obj = p.cls if p.inst is None else p.inst obj.param.unwatch(w) watchers.pop(watchers.index(w)) deps.pop(deps.index(p)) new_deps = [dep for dep in new_deps if dep not in deps] for _, params in full_groupby(new_deps, lambda x: (x.inst or x.cls, x.what)): p = params[0] pobj = p.cls if p.inst is None else p.inst ps = [_p.name for _p in params] watcher = pobj.param.watch(update_pane, ps, p.what) self._callbacks.append(watcher) for p in params: deps.append(p) new_object = self.eval(self.object) self._update_inner(new_object) for _, params in full_groupby(params, lambda x: (x.inst or x.cls, x.what)): p = params[0] pobj = (p.inst or p.cls) ps = [_p.name for _p in params] watcher = pobj.param.watch(update_pane, ps, p.what) self._callbacks.append(watcher) @classmethod def applies(cls, obj): return inspect.ismethod(obj) and isinstance(get_method_owner(obj), param.Parameterized) class ParamFunction(ParamMethod): priority = 0.6 def _replace_pane(self, *args): new_object = self.eval(self.object) self._update_inner(new_object) def _link_object_params(self): deps = self.object._dinfo dep_params = list(deps['dependencies']) + list(deps.get('kw', {}).values()) grouped = defaultdict(list) for dep in dep_params: grouped[id(dep.owner)].append(dep) for group in grouped.values(): watcher = group[0].owner.param.watch(self._replace_pane, [dep.name for dep in group]) self._callbacks.append(watcher) @classmethod def applies(cls, obj): return isinstance(obj, types.FunctionType) and hasattr(obj, '_dinfo') class JSONInit(param.Parameterized): varname = param.String(default='PARAM_JSON_INIT', doc=""" The name of the environment variable containing the JSON specification.""") target = param.String(default=None, doc=""" Optional key in the JSON specification dictionary containing the desired parameter values.""") json_file = param.String(default=None, doc=""" Optional path to a JSON file containing the parameter settings.""") def __call__(self, parameterized): warnobj = param.main if isinstance(parameterized, type) else parameterized param_class = (parameterized if isinstance(parameterized, type) else parameterized.__class__) target = self.target if self.target is not None else param_class.__name__ env_var = os.environ.get(self.varname, None) if env_var is None and self.json_file is None: return if self.json_file or env_var.endswith('.json'): try: fname = self.json_file if self.json_file else env_var spec = json.load(open(os.path.abspath(fname), 'r')) except Exception: warnobj.warning('Could not load JSON file %r' % spec) else: spec = json.loads(env_var) if not isinstance(spec, dict): warnobj.warning('JSON parameter specification must be a dictionary.') return if target in spec: params = spec[target] else: params = spec for name, value in params.items(): try: parameterized.param.set_param(**{name:value}) except ValueError as e: warnobj.warning(str(e))
true
true
f71e6172fb408174fe4da5ba6b742421a696d4dc
1,235
py
Python
python/dir/move_file.py
tagwan/scripts
f88846f13b1e3d05c093aff9124d927d6873280c
[ "MIT" ]
null
null
null
python/dir/move_file.py
tagwan/scripts
f88846f13b1e3d05c093aff9124d927d6873280c
[ "MIT" ]
null
null
null
python/dir/move_file.py
tagwan/scripts
f88846f13b1e3d05c093aff9124d927d6873280c
[ "MIT" ]
null
null
null
import shutil import sys import time import os import argparse """ 将源目录240天以上的所有文件移动到目标目录 """ usage = 'python move_files_over_x_days.py -src [SRC] -dst [DST] -days [DAYS]' description = 'Move files from src to dst if they are older than a certain number of days. Default is 240 days' args_parser = argparse.ArgumentParser(usage=usage, description=description) args_parser.add_argument('-src', '--src', type=str, nargs='?', default='.', help='(OPTIONAL) Directory where files will be moved from. Defaults to current directory') args_parser.add_argument('-dst', '--dst', type=str, nargs='?', required=True, help='(REQUIRED) Directory where files will be moved to.') args_parser.add_argument('-days', '--days', type=int, nargs='?', default=240, help='(OPTIONAL) Days value specifies the minimum age of files to be moved. Default is 240.') args = args_parser.parse_args() if args.days < 0: args.days = 0 src = args.src # 设置源目录 dst = args.dst # 设置目标目录 days = args.days # 设置天数 now = time.time() # 获得当前时间 if not os.path.exists(dst): os.mkdir(dst) for f in os.listdir(src): # 遍历源目录所有文件 if os.stat(f).st_mtime < now - days * 86400: # 判断是否超过240天 if os.path.isfile(f): # 检查是否是文件 shutil.move(f, dst) # 移动文件
36.323529
171
0.702024
import shutil import sys import time import os import argparse usage = 'python move_files_over_x_days.py -src [SRC] -dst [DST] -days [DAYS]' description = 'Move files from src to dst if they are older than a certain number of days. Default is 240 days' args_parser = argparse.ArgumentParser(usage=usage, description=description) args_parser.add_argument('-src', '--src', type=str, nargs='?', default='.', help='(OPTIONAL) Directory where files will be moved from. Defaults to current directory') args_parser.add_argument('-dst', '--dst', type=str, nargs='?', required=True, help='(REQUIRED) Directory where files will be moved to.') args_parser.add_argument('-days', '--days', type=int, nargs='?', default=240, help='(OPTIONAL) Days value specifies the minimum age of files to be moved. Default is 240.') args = args_parser.parse_args() if args.days < 0: args.days = 0 src = args.src dst = args.dst days = args.days now = time.time() if not os.path.exists(dst): os.mkdir(dst) for f in os.listdir(src): if os.stat(f).st_mtime < now - days * 86400: if os.path.isfile(f): shutil.move(f, dst)
true
true
f71e61cc8a120b27b799496cc36516d8bdc3d5e3
582
py
Python
advanced/image_processing/examples/plot_numpy_array.py
rossbar/scipy-lecture-notes
7f74e6925721c43bd81bf0bee34b4805ac4a3b57
[ "CC-BY-4.0" ]
2,538
2015-01-01T04:58:41.000Z
2022-03-31T21:06:05.000Z
advanced/image_processing/examples/plot_numpy_array.py
rossbar/scipy-lecture-notes
7f74e6925721c43bd81bf0bee34b4805ac4a3b57
[ "CC-BY-4.0" ]
362
2015-01-18T14:16:23.000Z
2021-11-18T16:24:34.000Z
advanced/image_processing/examples/plot_numpy_array.py
rossbar/scipy-lecture-notes
7f74e6925721c43bd81bf0bee34b4805ac4a3b57
[ "CC-BY-4.0" ]
1,127
2015-01-05T14:39:29.000Z
2022-03-25T08:38:39.000Z
""" Image manipulation and numpy arrays ==================================== This example shows how to do image manipulation using common numpy arrays tricks. """ import numpy as np import scipy import scipy.misc import matplotlib.pyplot as plt face = scipy.misc.face(gray=True) face[10:13, 20:23] face[100:120] = 255 lx, ly = face.shape X, Y = np.ogrid[0:lx, 0:ly] mask = (X - lx/2)**2 + (Y - ly/2)**2 > lx*ly/4 face[mask] = 0 face[range(400), range(400)] = 255 plt.figure(figsize=(3, 3)) plt.axes([0, 0, 1, 1]) plt.imshow(face, cmap=plt.cm.gray) plt.axis('off') plt.show()
18.774194
73
0.632302
import numpy as np import scipy import scipy.misc import matplotlib.pyplot as plt face = scipy.misc.face(gray=True) face[10:13, 20:23] face[100:120] = 255 lx, ly = face.shape X, Y = np.ogrid[0:lx, 0:ly] mask = (X - lx/2)**2 + (Y - ly/2)**2 > lx*ly/4 face[mask] = 0 face[range(400), range(400)] = 255 plt.figure(figsize=(3, 3)) plt.axes([0, 0, 1, 1]) plt.imshow(face, cmap=plt.cm.gray) plt.axis('off') plt.show()
true
true
f71e63d7fd418ca42a509c3b118e17c51808dd04
7,066
py
Python
python/mxnet/_ctypes/ndarray.py
litaotju/incubator-mxnet
83b28911cbc4a49521c69d8c4330a7234436b2fa
[ "Apache-2.0" ]
3
2018-07-31T02:44:39.000Z
2019-03-10T01:36:47.000Z
python/mxnet/_ctypes/ndarray.py
litaotju/incubator-mxnet
83b28911cbc4a49521c69d8c4330a7234436b2fa
[ "Apache-2.0" ]
3
2019-01-31T07:48:00.000Z
2019-02-14T02:02:18.000Z
python/mxnet/_ctypes/ndarray.py
litaotju/incubator-mxnet
83b28911cbc4a49521c69d8c4330a7234436b2fa
[ "Apache-2.0" ]
1
2019-12-02T04:16:13.000Z
2019-12-02T04:16:13.000Z
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. # coding: utf-8 # pylint: disable=invalid-name, protected-access, too-many-arguments # pylint: disable=global-statement, unused-import """NDArray configuration API.""" from __future__ import absolute_import as _abs import ctypes from ..base import _LIB from ..base import c_str_array, c_handle_array from ..base import NDArrayHandle, CachedOpHandle from ..base import check_call def _monitor_callback_wrapper(callback): """A wrapper for the user-defined handle.""" def callback_handle(name, opr_name, array, _): """ ctypes function """ callback(name, opr_name, array) return callback_handle class NDArrayBase(object): """Base data structure for ndarray""" __slots__ = ["handle", "writable"] # pylint: disable= no-member def __init__(self, handle, writable=True): """initialize a new NDArray Parameters ---------- handle : NDArrayHandle NDArray handle of C API """ if handle is not None: assert isinstance(handle, NDArrayHandle) self.handle = handle self.writable = writable def __del__(self): check_call(_LIB.MXNDArrayFree(self.handle)) def __reduce__(self): return (_ndarray_cls, (None,), self.__getstate__()) _ndarray_cls = None _np_ndarray_cls = None def _set_ndarray_class(cls): """Set the symbolic class to be cls""" global _ndarray_cls _ndarray_cls = cls def _set_np_ndarray_class(cls): """Set the symbolic class to be cls""" global _np_ndarray_cls _np_ndarray_cls = cls def _imperative_invoke(handle, ndargs, keys, vals, out, is_np_op, output_is_list): """ctypes implementation of imperative invoke wrapper""" if out is not None: original_output = out if isinstance(out, NDArrayBase): out = (out,) num_output = ctypes.c_int(len(out)) output_vars = c_handle_array(out) output_vars = ctypes.cast(output_vars, ctypes.POINTER(NDArrayHandle)) else: original_output = None output_vars = ctypes.POINTER(NDArrayHandle)() num_output = ctypes.c_int(0) # return output stypes to avoid the c_api call for checking # a handle's stype in _ndarray_cls out_stypes = ctypes.POINTER(ctypes.c_int)() check_call(_LIB.MXImperativeInvokeEx( ctypes.c_void_p(handle), ctypes.c_int(len(ndargs)), c_handle_array(ndargs), ctypes.byref(num_output), ctypes.byref(output_vars), ctypes.c_int(len(keys)), c_str_array(keys), c_str_array([str(s) for s in vals]), ctypes.byref(out_stypes))) create_ndarray_fn = _np_ndarray_cls if is_np_op else _ndarray_cls if original_output is not None: return original_output if num_output.value == 1 and not output_is_list: return create_ndarray_fn(ctypes.cast(output_vars[0], NDArrayHandle), stype=out_stypes[0]) else: return [create_ndarray_fn(ctypes.cast(output_vars[i], NDArrayHandle), stype=out_stypes[i]) for i in range(num_output.value)] class CachedOp(object): """Cached operator handle.""" __slots__ = ["handle", "is_np_sym", "_monitor_callback"] def __init__(self, sym, flags=()): self.handle = CachedOpHandle() self._monitor_callback = None from ..symbol.numpy._symbol import _Symbol self.is_np_sym = bool(isinstance(sym, _Symbol)) check_call(_LIB.MXCreateCachedOpEx( sym.handle, len(flags), c_str_array([key for key, _ in flags]), c_str_array([str(val) for _, val in flags]), ctypes.byref(self.handle))) def __del__(self): check_call(_LIB.MXFreeCachedOp(self.handle)) def __call__(self, *args, **kwargs): """ctypes implementation of imperative invoke wrapper""" out = kwargs.pop('out', None) if out is not None: original_output = out if isinstance(out, NDArrayBase): out = (out,) num_output = ctypes.c_int(len(out)) output_vars = c_handle_array(out) output_vars = ctypes.cast(output_vars, ctypes.POINTER(NDArrayHandle)) else: original_output = None output_vars = ctypes.POINTER(NDArrayHandle)() num_output = ctypes.c_int(0) if kwargs: raise TypeError( "CachedOp.__call__ got unexpected keyword argument(s): " + \ ', '.join(kwargs.keys())) # return output stypes to avoid the c_api call for checking # a handle's stype in _ndarray_cls out_stypes = ctypes.POINTER(ctypes.c_int)() check_call(_LIB.MXInvokeCachedOpEx( self.handle, ctypes.c_int(len(args)), c_handle_array(args), ctypes.byref(num_output), ctypes.byref(output_vars), ctypes.byref(out_stypes))) if original_output is not None: return original_output create_ndarray_fn = _np_ndarray_cls if self.is_np_sym else _ndarray_cls if num_output.value == 1: return create_ndarray_fn(ctypes.cast(output_vars[0], NDArrayHandle), stype=out_stypes[0]) else: return [create_ndarray_fn(ctypes.cast(output_vars[i], NDArrayHandle), stype=out_stypes[i]) for i in range(num_output.value)] def _register_op_hook(self, callback, monitor_all=False): """Install callback for monitor. Parameters ---------- callback : function Takes a string for node_name, string for op_name and a NDArrayHandle. monitor_all : bool, default False If true, monitor both input _imperative_invoked output, otherwise monitor output only. """ cb_type = ctypes.CFUNCTYPE(None, ctypes.c_char_p, ctypes.c_char_p, NDArrayHandle, ctypes.c_void_p) if callback: self._monitor_callback = cb_type(_monitor_callback_wrapper(callback)) check_call(_LIB.MXCachedOpRegisterOpHook( self.handle, self._monitor_callback, ctypes.c_int(monitor_all)))
35.507538
106
0.647891
from __future__ import absolute_import as _abs import ctypes from ..base import _LIB from ..base import c_str_array, c_handle_array from ..base import NDArrayHandle, CachedOpHandle from ..base import check_call def _monitor_callback_wrapper(callback): def callback_handle(name, opr_name, array, _): callback(name, opr_name, array) return callback_handle class NDArrayBase(object): __slots__ = ["handle", "writable"] def __init__(self, handle, writable=True): if handle is not None: assert isinstance(handle, NDArrayHandle) self.handle = handle self.writable = writable def __del__(self): check_call(_LIB.MXNDArrayFree(self.handle)) def __reduce__(self): return (_ndarray_cls, (None,), self.__getstate__()) _ndarray_cls = None _np_ndarray_cls = None def _set_ndarray_class(cls): global _ndarray_cls _ndarray_cls = cls def _set_np_ndarray_class(cls): global _np_ndarray_cls _np_ndarray_cls = cls def _imperative_invoke(handle, ndargs, keys, vals, out, is_np_op, output_is_list): if out is not None: original_output = out if isinstance(out, NDArrayBase): out = (out,) num_output = ctypes.c_int(len(out)) output_vars = c_handle_array(out) output_vars = ctypes.cast(output_vars, ctypes.POINTER(NDArrayHandle)) else: original_output = None output_vars = ctypes.POINTER(NDArrayHandle)() num_output = ctypes.c_int(0) out_stypes = ctypes.POINTER(ctypes.c_int)() check_call(_LIB.MXImperativeInvokeEx( ctypes.c_void_p(handle), ctypes.c_int(len(ndargs)), c_handle_array(ndargs), ctypes.byref(num_output), ctypes.byref(output_vars), ctypes.c_int(len(keys)), c_str_array(keys), c_str_array([str(s) for s in vals]), ctypes.byref(out_stypes))) create_ndarray_fn = _np_ndarray_cls if is_np_op else _ndarray_cls if original_output is not None: return original_output if num_output.value == 1 and not output_is_list: return create_ndarray_fn(ctypes.cast(output_vars[0], NDArrayHandle), stype=out_stypes[0]) else: return [create_ndarray_fn(ctypes.cast(output_vars[i], NDArrayHandle), stype=out_stypes[i]) for i in range(num_output.value)] class CachedOp(object): __slots__ = ["handle", "is_np_sym", "_monitor_callback"] def __init__(self, sym, flags=()): self.handle = CachedOpHandle() self._monitor_callback = None from ..symbol.numpy._symbol import _Symbol self.is_np_sym = bool(isinstance(sym, _Symbol)) check_call(_LIB.MXCreateCachedOpEx( sym.handle, len(flags), c_str_array([key for key, _ in flags]), c_str_array([str(val) for _, val in flags]), ctypes.byref(self.handle))) def __del__(self): check_call(_LIB.MXFreeCachedOp(self.handle)) def __call__(self, *args, **kwargs): out = kwargs.pop('out', None) if out is not None: original_output = out if isinstance(out, NDArrayBase): out = (out,) num_output = ctypes.c_int(len(out)) output_vars = c_handle_array(out) output_vars = ctypes.cast(output_vars, ctypes.POINTER(NDArrayHandle)) else: original_output = None output_vars = ctypes.POINTER(NDArrayHandle)() num_output = ctypes.c_int(0) if kwargs: raise TypeError( "CachedOp.__call__ got unexpected keyword argument(s): " + \ ', '.join(kwargs.keys())) # return output stypes to avoid the c_api call for checking # a handle's stype in _ndarray_cls out_stypes = ctypes.POINTER(ctypes.c_int)() check_call(_LIB.MXInvokeCachedOpEx( self.handle, ctypes.c_int(len(args)), c_handle_array(args), ctypes.byref(num_output), ctypes.byref(output_vars), ctypes.byref(out_stypes))) if original_output is not None: return original_output create_ndarray_fn = _np_ndarray_cls if self.is_np_sym else _ndarray_cls if num_output.value == 1: return create_ndarray_fn(ctypes.cast(output_vars[0], NDArrayHandle), stype=out_stypes[0]) else: return [create_ndarray_fn(ctypes.cast(output_vars[i], NDArrayHandle), stype=out_stypes[i]) for i in range(num_output.value)] def _register_op_hook(self, callback, monitor_all=False): cb_type = ctypes.CFUNCTYPE(None, ctypes.c_char_p, ctypes.c_char_p, NDArrayHandle, ctypes.c_void_p) if callback: self._monitor_callback = cb_type(_monitor_callback_wrapper(callback)) check_call(_LIB.MXCachedOpRegisterOpHook( self.handle, self._monitor_callback, ctypes.c_int(monitor_all)))
true
true
f71e655c0d5a42907e4e8c54df2f89045dda2ece
988
py
Python
leadmanager/accounts/serializers.py
Nerrdii/lead-manager
391a698ee4f2f389e57527e460f9f20b5fd73060
[ "MIT" ]
null
null
null
leadmanager/accounts/serializers.py
Nerrdii/lead-manager
391a698ee4f2f389e57527e460f9f20b5fd73060
[ "MIT" ]
3
2021-04-08T19:11:07.000Z
2021-06-11T15:13:02.000Z
leadmanager/accounts/serializers.py
Nerrdii/lead-manager
391a698ee4f2f389e57527e460f9f20b5fd73060
[ "MIT" ]
null
null
null
from rest_framework import serializers from django.contrib.auth.models import User from django.contrib.auth import authenticate class UserSerializer(serializers.ModelSerializer): class Meta: model = User fields = ('id', 'username', 'email') class RegisterSerializer(serializers.ModelSerializer): class Meta: model = User fields = ('id', 'username', 'email', 'password') extra_kwargs = {'password': {'write_only': True}} def create(self, validated_data): user = User.objects.create_user( validated_data['username'], validated_data['email'], validated_data['password']) return user class LoginSerializer(serializers.Serializer): username = serializers.CharField() password = serializers.CharField() def validate(self, data): user = authenticate(**data) if user and user.is_active: return user raise serializers.ValidationError("Incorrect credentials")
28.228571
92
0.678138
from rest_framework import serializers from django.contrib.auth.models import User from django.contrib.auth import authenticate class UserSerializer(serializers.ModelSerializer): class Meta: model = User fields = ('id', 'username', 'email') class RegisterSerializer(serializers.ModelSerializer): class Meta: model = User fields = ('id', 'username', 'email', 'password') extra_kwargs = {'password': {'write_only': True}} def create(self, validated_data): user = User.objects.create_user( validated_data['username'], validated_data['email'], validated_data['password']) return user class LoginSerializer(serializers.Serializer): username = serializers.CharField() password = serializers.CharField() def validate(self, data): user = authenticate(**data) if user and user.is_active: return user raise serializers.ValidationError("Incorrect credentials")
true
true
f71e6662c54d213d3019b65fbc96d3cbbbbdac09
6,350
py
Python
google/cloud/vision_v1p2beta1/services/image_annotator/transports/base.py
dylancaponi/python-vision
f94fb5b03bf8932e75967249292d23fed2ae2213
[ "Apache-2.0" ]
null
null
null
google/cloud/vision_v1p2beta1/services/image_annotator/transports/base.py
dylancaponi/python-vision
f94fb5b03bf8932e75967249292d23fed2ae2213
[ "Apache-2.0" ]
1
2021-02-23T12:41:14.000Z
2021-02-23T12:41:14.000Z
google/cloud/vision_v1p2beta1/services/image_annotator/transports/base.py
dylancaponi/python-vision
f94fb5b03bf8932e75967249292d23fed2ae2213
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- # Copyright 2020 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import abc import typing import pkg_resources from google import auth # type: ignore from google.api_core import exceptions # type: ignore from google.api_core import gapic_v1 # type: ignore from google.api_core import retry as retries # type: ignore from google.api_core import operations_v1 # type: ignore from google.auth import credentials # type: ignore from google.cloud.vision_v1p2beta1.types import image_annotator from google.longrunning import operations_pb2 as operations # type: ignore try: DEFAULT_CLIENT_INFO = gapic_v1.client_info.ClientInfo( gapic_version=pkg_resources.get_distribution("google-cloud-vision",).version, ) except pkg_resources.DistributionNotFound: DEFAULT_CLIENT_INFO = gapic_v1.client_info.ClientInfo() class ImageAnnotatorTransport(abc.ABC): """Abstract transport class for ImageAnnotator.""" AUTH_SCOPES = ( "https://www.googleapis.com/auth/cloud-platform", "https://www.googleapis.com/auth/cloud-vision", ) def __init__( self, *, host: str = "vision.googleapis.com", credentials: credentials.Credentials = None, credentials_file: typing.Optional[str] = None, scopes: typing.Optional[typing.Sequence[str]] = AUTH_SCOPES, quota_project_id: typing.Optional[str] = None, client_info: gapic_v1.client_info.ClientInfo = DEFAULT_CLIENT_INFO, **kwargs, ) -> None: """Instantiate the transport. Args: host (Optional[str]): The hostname to connect to. credentials (Optional[google.auth.credentials.Credentials]): The authorization credentials to attach to requests. These credentials identify the application to the service; if none are specified, the client will attempt to ascertain the credentials from the environment. credentials_file (Optional[str]): A file with credentials that can be loaded with :func:`google.auth.load_credentials_from_file`. This argument is mutually exclusive with credentials. scope (Optional[Sequence[str]]): A list of scopes. quota_project_id (Optional[str]): An optional project to use for billing and quota. client_info (google.api_core.gapic_v1.client_info.ClientInfo): The client info used to send a user-agent string along with API requests. If ``None``, then default info will be used. Generally, you only need to set this if you're developing your own client library. """ # Save the hostname. Default to port 443 (HTTPS) if none is specified. if ":" not in host: host += ":443" self._host = host # If no credentials are provided, then determine the appropriate # defaults. if credentials and credentials_file: raise exceptions.DuplicateCredentialArgs( "'credentials_file' and 'credentials' are mutually exclusive" ) if credentials_file is not None: credentials, _ = auth.load_credentials_from_file( credentials_file, scopes=scopes, quota_project_id=quota_project_id ) elif credentials is None: credentials, _ = auth.default( scopes=scopes, quota_project_id=quota_project_id ) # Save the credentials. self._credentials = credentials # Lifted into its own function so it can be stubbed out during tests. self._prep_wrapped_messages(client_info) def _prep_wrapped_messages(self, client_info): # Precompute the wrapped methods. self._wrapped_methods = { self.batch_annotate_images: gapic_v1.method.wrap_method( self.batch_annotate_images, default_retry=retries.Retry( initial=0.1, maximum=60.0, multiplier=1.3, predicate=retries.if_exception_type( exceptions.ServiceUnavailable, exceptions.DeadlineExceeded, ), ), default_timeout=600.0, client_info=client_info, ), self.async_batch_annotate_files: gapic_v1.method.wrap_method( self.async_batch_annotate_files, default_retry=retries.Retry( initial=0.1, maximum=60.0, multiplier=1.3, predicate=retries.if_exception_type( exceptions.ServiceUnavailable, exceptions.DeadlineExceeded, ), ), default_timeout=600.0, client_info=client_info, ), } @property def operations_client(self) -> operations_v1.OperationsClient: """Return the client designed to process long-running operations.""" raise NotImplementedError() @property def batch_annotate_images( self, ) -> typing.Callable[ [image_annotator.BatchAnnotateImagesRequest], typing.Union[ image_annotator.BatchAnnotateImagesResponse, typing.Awaitable[image_annotator.BatchAnnotateImagesResponse], ], ]: raise NotImplementedError() @property def async_batch_annotate_files( self, ) -> typing.Callable[ [image_annotator.AsyncBatchAnnotateFilesRequest], typing.Union[operations.Operation, typing.Awaitable[operations.Operation]], ]: raise NotImplementedError() __all__ = ("ImageAnnotatorTransport",)
37.797619
85
0.639685
import abc import typing import pkg_resources from google import auth from google.api_core import exceptions from google.api_core import gapic_v1 from google.api_core import retry as retries from google.api_core import operations_v1 from google.auth import credentials from google.cloud.vision_v1p2beta1.types import image_annotator from google.longrunning import operations_pb2 as operations try: DEFAULT_CLIENT_INFO = gapic_v1.client_info.ClientInfo( gapic_version=pkg_resources.get_distribution("google-cloud-vision",).version, ) except pkg_resources.DistributionNotFound: DEFAULT_CLIENT_INFO = gapic_v1.client_info.ClientInfo() class ImageAnnotatorTransport(abc.ABC): AUTH_SCOPES = ( "https://www.googleapis.com/auth/cloud-platform", "https://www.googleapis.com/auth/cloud-vision", ) def __init__( self, *, host: str = "vision.googleapis.com", credentials: credentials.Credentials = None, credentials_file: typing.Optional[str] = None, scopes: typing.Optional[typing.Sequence[str]] = AUTH_SCOPES, quota_project_id: typing.Optional[str] = None, client_info: gapic_v1.client_info.ClientInfo = DEFAULT_CLIENT_INFO, **kwargs, ) -> None: if ":" not in host: host += ":443" self._host = host if credentials and credentials_file: raise exceptions.DuplicateCredentialArgs( "'credentials_file' and 'credentials' are mutually exclusive" ) if credentials_file is not None: credentials, _ = auth.load_credentials_from_file( credentials_file, scopes=scopes, quota_project_id=quota_project_id ) elif credentials is None: credentials, _ = auth.default( scopes=scopes, quota_project_id=quota_project_id ) self._credentials = credentials self._prep_wrapped_messages(client_info) def _prep_wrapped_messages(self, client_info): self._wrapped_methods = { self.batch_annotate_images: gapic_v1.method.wrap_method( self.batch_annotate_images, default_retry=retries.Retry( initial=0.1, maximum=60.0, multiplier=1.3, predicate=retries.if_exception_type( exceptions.ServiceUnavailable, exceptions.DeadlineExceeded, ), ), default_timeout=600.0, client_info=client_info, ), self.async_batch_annotate_files: gapic_v1.method.wrap_method( self.async_batch_annotate_files, default_retry=retries.Retry( initial=0.1, maximum=60.0, multiplier=1.3, predicate=retries.if_exception_type( exceptions.ServiceUnavailable, exceptions.DeadlineExceeded, ), ), default_timeout=600.0, client_info=client_info, ), } @property def operations_client(self) -> operations_v1.OperationsClient: raise NotImplementedError() @property def batch_annotate_images( self, ) -> typing.Callable[ [image_annotator.BatchAnnotateImagesRequest], typing.Union[ image_annotator.BatchAnnotateImagesResponse, typing.Awaitable[image_annotator.BatchAnnotateImagesResponse], ], ]: raise NotImplementedError() @property def async_batch_annotate_files( self, ) -> typing.Callable[ [image_annotator.AsyncBatchAnnotateFilesRequest], typing.Union[operations.Operation, typing.Awaitable[operations.Operation]], ]: raise NotImplementedError() __all__ = ("ImageAnnotatorTransport",)
true
true
f71e6798c5685f6274a337abf79482e269315bdc
85,692
py
Python
uhd_restpy/testplatform/sessions/ixnetwork/topology/pppoxclient_57c51b5ca094121e33c3a9ba5033980f.py
Vibaswan/ixnetwork_restpy
239fedc7050890746cbabd71ea1e91c68d9e5cad
[ "MIT" ]
null
null
null
uhd_restpy/testplatform/sessions/ixnetwork/topology/pppoxclient_57c51b5ca094121e33c3a9ba5033980f.py
Vibaswan/ixnetwork_restpy
239fedc7050890746cbabd71ea1e91c68d9e5cad
[ "MIT" ]
null
null
null
uhd_restpy/testplatform/sessions/ixnetwork/topology/pppoxclient_57c51b5ca094121e33c3a9ba5033980f.py
Vibaswan/ixnetwork_restpy
239fedc7050890746cbabd71ea1e91c68d9e5cad
[ "MIT" ]
null
null
null
# MIT LICENSE # # Copyright 1997 - 2020 by IXIA Keysight # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), # to deal in the Software without restriction, including without limitation # the rights to use, copy, modify, merge, publish, distribute, sublicense, # and/or sell copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN # THE SOFTWARE. from uhd_restpy.base import Base from uhd_restpy.files import Files class Pppoxclient(Base): """PPPoX Client The Pppoxclient class encapsulates a list of pppoxclient resources that are managed by the user. A list of resources can be retrieved from the server using the Pppoxclient.find() method. The list can be managed by using the Pppoxclient.add() and Pppoxclient.remove() methods. """ __slots__ = () _SDM_NAME = 'pppoxclient' _SDM_ATT_MAP = { 'AcMatchMac': 'acMatchMac', 'AcMatchName': 'acMatchName', 'AcOptions': 'acOptions', 'ActualRateDownstream': 'actualRateDownstream', 'ActualRateUpstream': 'actualRateUpstream', 'AgentAccessAggregationCircuitId': 'agentAccessAggregationCircuitId', 'AgentCircuitId': 'agentCircuitId', 'AgentRemoteId': 'agentRemoteId', 'AuthRetries': 'authRetries', 'AuthTimeout': 'authTimeout', 'AuthType': 'authType', 'ChapName': 'chapName', 'ChapSecret': 'chapSecret', 'ClientDnsOptions': 'clientDnsOptions', 'ClientLocalIp': 'clientLocalIp', 'ClientLocalIpv6Iid': 'clientLocalIpv6Iid', 'ClientNcpOptions': 'clientNcpOptions', 'ClientNetmask': 'clientNetmask', 'ClientNetmaskOptions': 'clientNetmaskOptions', 'ClientPrimaryDnsAddress': 'clientPrimaryDnsAddress', 'ClientSecondaryDnsAddress': 'clientSecondaryDnsAddress', 'ClientSignalIWF': 'clientSignalIWF', 'ClientSignalLoopChar': 'clientSignalLoopChar', 'ClientSignalLoopEncapsulation': 'clientSignalLoopEncapsulation', 'ClientSignalLoopId': 'clientSignalLoopId', 'ClientV6NcpOptions': 'clientV6NcpOptions', 'ClientWinsOptions': 'clientWinsOptions', 'ClientWinsPrimaryAddress': 'clientWinsPrimaryAddress', 'ClientWinsSecondaryAddress': 'clientWinsSecondaryAddress', 'ConnectSpeedUpdateEnable': 'connectSpeedUpdateEnable', 'ConnectedVia': 'connectedVia', 'Count': 'count', 'DataLink': 'dataLink', 'DescriptiveName': 'descriptiveName', 'DiscoveredIpv4Addresses': 'discoveredIpv4Addresses', 'DiscoveredIpv6Addresses': 'discoveredIpv6Addresses', 'DiscoveredMacs': 'discoveredMacs', 'DiscoveredRemoteSessionIds': 'discoveredRemoteSessionIds', 'DiscoveredRemoteTunnelIds': 'discoveredRemoteTunnelIds', 'DiscoveredSessionIds': 'discoveredSessionIds', 'DiscoveredTunnelIPs': 'discoveredTunnelIPs', 'DiscoveredTunnelIds': 'discoveredTunnelIds', 'DomainList': 'domainList', 'DslTypeTlv': 'dslTypeTlv', 'EchoReqInterval': 'echoReqInterval', 'EnableDomainGroups': 'enableDomainGroups', 'EnableEchoReq': 'enableEchoReq', 'EnableEchoRsp': 'enableEchoRsp', 'EnableHostUniq': 'enableHostUniq', 'EnableMaxPayload': 'enableMaxPayload', 'EnableRedial': 'enableRedial', 'Encaps1': 'encaps1', 'Encaps2': 'encaps2', 'EndpointDiscNegotiation': 'endpointDiscNegotiation', 'EndpointDiscriminatorClass': 'endpointDiscriminatorClass', 'Errors': 'errors', 'HostUniq': 'hostUniq', 'HostUniqLength': 'hostUniqLength', 'LcpAccm': 'lcpAccm', 'LcpEnableAccm': 'lcpEnableAccm', 'LcpMaxFailure': 'lcpMaxFailure', 'LcpRetries': 'lcpRetries', 'LcpStartDelay': 'lcpStartDelay', 'LcpTermRetries': 'lcpTermRetries', 'LcpTimeout': 'lcpTimeout', 'MaxPayload': 'maxPayload', 'MlpppIPAddress': 'mlpppIPAddress', 'MlpppMACAddress': 'mlpppMACAddress', 'Mrru': 'mrru', 'MrruNegotiation': 'mrruNegotiation', 'MruNegotiation': 'mruNegotiation', 'Mtu': 'mtu', 'Multiplier': 'multiplier', 'Name': 'name', 'NcpRetries': 'ncpRetries', 'NcpTimeout': 'ncpTimeout', 'NcpType': 'ncpType', 'PadiRetries': 'padiRetries', 'PadiTimeout': 'padiTimeout', 'PadrRetries': 'padrRetries', 'PadrTimeout': 'padrTimeout', 'PapPassword': 'papPassword', 'PapUser': 'papUser', 'PonTypeTlv': 'ponTypeTlv', 'RedialMax': 'redialMax', 'RedialTimeout': 'redialTimeout', 'RxConnectSpeed': 'rxConnectSpeed', 'ServiceName': 'serviceName', 'ServiceOptions': 'serviceOptions', 'SessionInfo': 'sessionInfo', 'SessionStatus': 'sessionStatus', 'StackedLayers': 'stackedLayers', 'StateCounts': 'stateCounts', 'Status': 'status', 'TxConnectSpeed': 'txConnectSpeed', 'UnlimitedRedialAttempts': 'unlimitedRedialAttempts', 'UserDefinedDslType': 'userDefinedDslType', 'UserDefinedPonType': 'userDefinedPonType', } def __init__(self, parent): super(Pppoxclient, self).__init__(parent) @property def Bfdv4Interface(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.bfdv4interface_91b557a3f744baf442dbe21ac75e8f2e.Bfdv4Interface): An instance of the Bfdv4Interface class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.bfdv4interface_91b557a3f744baf442dbe21ac75e8f2e import Bfdv4Interface return Bfdv4Interface(self) @property def Bfdv6Interface(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.bfdv6interface_b9a91920db1b70c8c6410d2de0b438d3.Bfdv6Interface): An instance of the Bfdv6Interface class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.bfdv6interface_b9a91920db1b70c8c6410d2de0b438d3 import Bfdv6Interface return Bfdv6Interface(self) @property def BgpIpv4Peer(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.bgpipv4peer_9dd9eddcf2bd784d82d8a016e392f035.BgpIpv4Peer): An instance of the BgpIpv4Peer class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.bgpipv4peer_9dd9eddcf2bd784d82d8a016e392f035 import BgpIpv4Peer return BgpIpv4Peer(self) @property def BgpIpv6Peer(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.bgpipv6peer_d4ac277d9da759fd5a152b8e6eb0ab20.BgpIpv6Peer): An instance of the BgpIpv6Peer class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.bgpipv6peer_d4ac277d9da759fd5a152b8e6eb0ab20 import BgpIpv6Peer return BgpIpv6Peer(self) @property def Connector(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.connector_d0d942810e4010add7642d3914a1f29b.Connector): An instance of the Connector class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.connector_d0d942810e4010add7642d3914a1f29b import Connector return Connector(self) @property def Dhcpv6client(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.dhcpv6client_355391ba11ab3c1555c827e2e4ac3c4c.Dhcpv6client): An instance of the Dhcpv6client class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.dhcpv6client_355391ba11ab3c1555c827e2e4ac3c4c import Dhcpv6client return Dhcpv6client(self) @property def ECpriRe(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.ecprire_51f1030cbafd2e567d3b517032a1b011.ECpriRe): An instance of the ECpriRe class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.ecprire_51f1030cbafd2e567d3b517032a1b011 import ECpriRe return ECpriRe(self) @property def ECpriRec(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.ecprirec_129f1d43f285a4f806ade4e0df814255.ECpriRec): An instance of the ECpriRec class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.ecprirec_129f1d43f285a4f806ade4e0df814255 import ECpriRec return ECpriRec(self) @property def Geneve(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.geneve_14ab6f140956b4fc77d1d0f03c5e7514.Geneve): An instance of the Geneve class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.geneve_14ab6f140956b4fc77d1d0f03c5e7514 import Geneve return Geneve(self) @property def IgmpHost(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.igmphost_8940887674c0387469423e8df3a33854.IgmpHost): An instance of the IgmpHost class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.igmphost_8940887674c0387469423e8df3a33854 import IgmpHost return IgmpHost(self) @property def IgmpQuerier(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.igmpquerier_38c883b0cec7ffb5405af90bf1b8cda5.IgmpQuerier): An instance of the IgmpQuerier class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.igmpquerier_38c883b0cec7ffb5405af90bf1b8cda5 import IgmpQuerier return IgmpQuerier(self) @property def MldHost(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.mldhost_824a1bed927138d4bb32f7d2631197a5.MldHost): An instance of the MldHost class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.mldhost_824a1bed927138d4bb32f7d2631197a5 import MldHost return MldHost(self) @property def MldQuerier(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.mldquerier_e20671d730d138d65036e88d7cad63ac.MldQuerier): An instance of the MldQuerier class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.mldquerier_e20671d730d138d65036e88d7cad63ac import MldQuerier return MldQuerier(self) @property def MplsOam(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.mplsoam_e01bb6affe899a4731aa60619f4aeadc.MplsOam): An instance of the MplsOam class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.mplsoam_e01bb6affe899a4731aa60619f4aeadc import MplsOam return MplsOam(self) @property def NetconfClient(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.netconfclient_1eaa2ab0efacd988796bdc1f5fe4291c.NetconfClient): An instance of the NetconfClient class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.netconfclient_1eaa2ab0efacd988796bdc1f5fe4291c import NetconfClient return NetconfClient(self) @property def NetconfServer(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.netconfserver_ad256f8ca38068f1eaff839ed40b1e30.NetconfServer): An instance of the NetconfServer class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.netconfserver_ad256f8ca38068f1eaff839ed40b1e30 import NetconfServer return NetconfServer(self) @property def Ospfv2(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.ospfv2_27b7a27a991a50e01e629b9de482a2f0.Ospfv2): An instance of the Ospfv2 class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.ospfv2_27b7a27a991a50e01e629b9de482a2f0 import Ospfv2 return Ospfv2(self) @property def Ospfv3(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.ospfv3_c029fd7cd4a9e9897b7b4e4547458751.Ospfv3): An instance of the Ospfv3 class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.ospfv3_c029fd7cd4a9e9897b7b4e4547458751 import Ospfv3 return Ospfv3(self) @property def Pcc(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.pcc_9346785b55d17399fecd6fe36c418219.Pcc): An instance of the Pcc class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.pcc_9346785b55d17399fecd6fe36c418219 import Pcc return Pcc(self) @property def Pce(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.pce_bd5f6a11078a4f0deb5d56bef8e9674f.Pce): An instance of the Pce class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.pce_bd5f6a11078a4f0deb5d56bef8e9674f import Pce return Pce(self) @property def PimV4Interface(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.pimv4interface_92603cbceaf153039f7575ed9bc4aa67.PimV4Interface): An instance of the PimV4Interface class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.pimv4interface_92603cbceaf153039f7575ed9bc4aa67 import PimV4Interface return PimV4Interface(self) @property def PimV6Interface(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.pimv6interface_74a3aa08a315ca50732e853e3e8cdc43.PimV6Interface): An instance of the PimV6Interface class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.pimv6interface_74a3aa08a315ca50732e853e3e8cdc43 import PimV6Interface return PimV6Interface(self) @property def Tag(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.tag_e30f24de79247381d4dfd423b2f6986d.Tag): An instance of the Tag class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.tag_e30f24de79247381d4dfd423b2f6986d import Tag return Tag(self) @property def TlvProfile(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.tlvprofile.tlvprofile_69db000d3ef3b060f5edc387b878736c.TlvProfile): An instance of the TlvProfile class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.tlvprofile.tlvprofile_69db000d3ef3b060f5edc387b878736c import TlvProfile return TlvProfile(self) @property def Vxlan(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.vxlan_ed3df6fe7146492fc5fe0f77f53f9473.Vxlan): An instance of the Vxlan class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.vxlan_ed3df6fe7146492fc5fe0f77f53f9473 import Vxlan return Vxlan(self) @property def Vxlanv6(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.topology.vxlanv6_c18187deccae3db44b9e9de30ad538ec.Vxlanv6): An instance of the Vxlanv6 class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.topology.vxlanv6_c18187deccae3db44b9e9de30ad538ec import Vxlanv6 return Vxlanv6(self) @property def AcMatchMac(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): ? """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AcMatchMac'])) @property def AcMatchName(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): ? """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AcMatchName'])) @property def AcOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Indicates PPPoE AC retrieval mode """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AcOptions'])) @property def ActualRateDownstream(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This parameter specifies the value to be included in the vendor specific PPPoE tag. It is the actual downstream data rate (sub-option 0x81), in kbps. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ActualRateDownstream'])) @property def ActualRateUpstream(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This parameter specifies the value to be included in the vendor specific PPPoE tag. It is the actual upstream data rate (sub-option 0x82), in kbps. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ActualRateUpstream'])) @property def AgentAccessAggregationCircuitId(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The value to be inserted into the Agent Access-Aggregation-Circuit-ID-ASCII-Value field of the PPPoX tag. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AgentAccessAggregationCircuitId'])) @property def AgentCircuitId(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The value to be inserted into the Agent Circuit ID field of the PPPoX tag. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AgentCircuitId'])) @property def AgentRemoteId(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The value to be inserted into the Agent Remote ID field of the PPPoX tag. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AgentRemoteId'])) @property def AuthRetries(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of PPP authentication retries """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AuthRetries'])) @property def AuthTimeout(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Timeout for PPP authentication, in seconds. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AuthTimeout'])) @property def AuthType(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The authentication type to use during link setup. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AuthType'])) @property def ChapName(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): User name when CHAP Authentication is being used """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ChapName'])) @property def ChapSecret(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Secret when CHAP Authentication is being used """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ChapSecret'])) @property def ClientDnsOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The client DNS options. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientDnsOptions'])) @property def ClientLocalIp(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The requested IPv4 address. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientLocalIp'])) @property def ClientLocalIpv6Iid(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The requested IPv6 Interface Identifier (IID). """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientLocalIpv6Iid'])) @property def ClientNcpOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The NCP configuration mode for IPv4 addressing. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientNcpOptions'])) @property def ClientNetmask(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The netmask that the client will use with the assigned IP address. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientNetmask'])) @property def ClientNetmaskOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The client netmask option. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientNetmaskOptions'])) @property def ClientPrimaryDnsAddress(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This is the primary DNS server address that the client requests from the server when the value of the Client DNS Options field is set to 'Request Primary only' or 'Request Primary and Secondary'. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientPrimaryDnsAddress'])) @property def ClientSecondaryDnsAddress(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This is the secondary DNS server address that the client requests from the server when the value of the Client DNS Options field is set to 'Request Primary and Secondary'. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSecondaryDnsAddress'])) @property def ClientSignalIWF(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This parameter enables or disables the insertion of sub-option 0xFE (signaling of interworked sessions) into the DSL tag in PADI and PADR packets. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalIWF'])) @property def ClientSignalLoopChar(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This parameter enables or disables the insertion of sub-options 0x81 and 0x82 into the DSL tag in PADI and PADR packets. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalLoopChar'])) @property def ClientSignalLoopEncapsulation(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This parameter enables or disables the insertion of sub-option 0x90 into the DSL tag in PADI and PADR packets. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalLoopEncapsulation'])) @property def ClientSignalLoopId(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): This parameter enables or disables the insertion of sub-options 0x01 , 0x02, 0x03 (Remote ID,Circuit ID and Access Aggregation Circuit ID) into the DSL tag in PADI and PADR packets. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalLoopId'])) @property def ClientV6NcpOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The NCP configuration mode for IPv6 addressing. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientV6NcpOptions'])) @property def ClientWinsOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Specifies the mode in which WINS host addresses are configured. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientWinsOptions'])) @property def ClientWinsPrimaryAddress(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Specifies the primary WINS address. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientWinsPrimaryAddress'])) @property def ClientWinsSecondaryAddress(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Specifies the secondary WINS address. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientWinsSecondaryAddress'])) @property def ConnectSpeedUpdateEnable(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): If checked, LAC will send Connect Speed Update Enable AVP in ICRQ control message """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ConnectSpeedUpdateEnable'])) @property def ConnectedVia(self): """DEPRECATED Returns ------- - list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*]): List of layers this layer is used to connect with to the wire. """ return self._get_attribute(self._SDM_ATT_MAP['ConnectedVia']) @ConnectedVia.setter def ConnectedVia(self, value): self._set_attribute(self._SDM_ATT_MAP['ConnectedVia'], value) @property def Count(self): """ Returns ------- - number: Number of elements inside associated multiplier-scaled container object, e.g. number of devices inside a Device Group. """ return self._get_attribute(self._SDM_ATT_MAP['Count']) @property def DataLink(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): A one-byte field included with sub-option 0x90. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['DataLink'])) @property def DescriptiveName(self): """ Returns ------- - str: Longer, more descriptive name for element. It's not guaranteed to be unique like -name-, but may offer more context. """ return self._get_attribute(self._SDM_ATT_MAP['DescriptiveName']) @property def DiscoveredIpv4Addresses(self): """ Returns ------- - list(str): The discovered IPv4 addresses. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredIpv4Addresses']) @property def DiscoveredIpv6Addresses(self): """ Returns ------- - list(str): The discovered IPv6 addresses. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredIpv6Addresses']) @property def DiscoveredMacs(self): """ Returns ------- - list(str): The discovered remote MAC address. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredMacs']) @property def DiscoveredRemoteSessionIds(self): """ Returns ------- - list(number): Remote session ID. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredRemoteSessionIds']) @property def DiscoveredRemoteTunnelIds(self): """ Returns ------- - list(number): Remote tunnel ID. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredRemoteTunnelIds']) @property def DiscoveredSessionIds(self): """ Returns ------- - list(number): The negotiated session ID. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredSessionIds']) @property def DiscoveredTunnelIPs(self): """ Returns ------- - list(str): The discovered remote tunnel IP. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredTunnelIPs']) @property def DiscoveredTunnelIds(self): """ Returns ------- - list(number): The negotiated tunnel ID. """ return self._get_attribute(self._SDM_ATT_MAP['DiscoveredTunnelIds']) @property def DomainList(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Configure domain group settings """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['DomainList'])) @property def DslTypeTlv(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): DSL Type to be advertised in PPPoE VSA Tag. For undefined DSL type user has to select User-defined DSL Type. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['DslTypeTlv'])) @property def EchoReqInterval(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Keep alive interval, in seconds """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EchoReqInterval'])) @property def EnableDomainGroups(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enable domain groups """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableDomainGroups'])) @property def EnableEchoReq(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): ? """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableEchoReq'])) @property def EnableEchoRsp(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): ? """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableEchoRsp'])) @property def EnableHostUniq(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enables PPPoE Host-Uniq tag """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableHostUniq'])) @property def EnableMaxPayload(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enables PPPoE Max Payload tag """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableMaxPayload'])) @property def EnableRedial(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): If checked, PPPoE redial is enabled """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableRedial'])) @property def Encaps1(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): A one-byte field included with sub-option 0x90. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Encaps1'])) @property def Encaps2(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): A one-byte field included with sub-option 0x90. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Encaps2'])) @property def EndpointDiscNegotiation(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enable Endpoint Discriminator Negotiation """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EndpointDiscNegotiation'])) @property def EndpointDiscriminatorClass(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Endpoint Discriminator for PPP """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EndpointDiscriminatorClass'])) @property def Errors(self): """ Returns ------- - list(dict(arg1:str[None | /api/v1/sessions/1/ixnetwork//.../*],arg2:list[str])): A list of errors that have occurred """ return self._get_attribute(self._SDM_ATT_MAP['Errors']) @property def HostUniq(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Indicates Host-Uniq Tag """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['HostUniq'])) @property def HostUniqLength(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Host-Uniq Length, in bytes """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['HostUniqLength'])) @property def LcpAccm(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Async-Control-Character-Map """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpAccm'])) @property def LcpEnableAccm(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enable Async-Control-Character-Map """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpEnableAccm'])) @property def LcpMaxFailure(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of Configure-Nak packets sent without sending a Configure-Ack before assuming that configuration is not converging. Any further Configure-Nak packets for peer requested options are converted to Configure-Reject packets """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpMaxFailure'])) @property def LcpRetries(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of LCP retries """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpRetries'])) @property def LcpStartDelay(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Delay time in milliseconds to wait before sending LCP Config Request packet """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpStartDelay'])) @property def LcpTermRetries(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of LCP Termination Retries """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpTermRetries'])) @property def LcpTimeout(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Timeout for LCP phase, in seconds """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpTimeout'])) @property def MaxPayload(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Max Payload """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MaxPayload'])) @property def MlpppIPAddress(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The IP address used in the ML-PPP endpoint discriminator option of the LCP configure request sent by PPP clients """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MlpppIPAddress'])) @property def MlpppMACAddress(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): The MAC addresses are automatically derived from the local MAC address. An address in this class contains an IEEE 802.1 MAC address is canonical (802.3) format """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MlpppMACAddress'])) @property def Mrru(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Max Receive Reconstructed Unit for PPP """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Mrru'])) @property def MrruNegotiation(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enable MRRU Negotiation """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MrruNegotiation'])) @property def MruNegotiation(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Enable MRU Negotiation """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MruNegotiation'])) @property def Mtu(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Max Transmit Unit for PPP """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Mtu'])) @property def Multiplier(self): """ Returns ------- - number: Number of layer instances per parent instance (multiplier) """ return self._get_attribute(self._SDM_ATT_MAP['Multiplier']) @Multiplier.setter def Multiplier(self, value): self._set_attribute(self._SDM_ATT_MAP['Multiplier'], value) @property def Name(self): """ Returns ------- - str: Name of NGPF element, guaranteed to be unique in Scenario """ return self._get_attribute(self._SDM_ATT_MAP['Name']) @Name.setter def Name(self, value): self._set_attribute(self._SDM_ATT_MAP['Name'], value) @property def NcpRetries(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of NCP retries """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['NcpRetries'])) @property def NcpTimeout(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Timeout for NCP phase, in seconds """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['NcpTimeout'])) @property def NcpType(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): IP address type (IPv4 or IPv6) for Network Control Protocol """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['NcpType'])) @property def PadiRetries(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of PADI Retries """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadiRetries'])) @property def PadiTimeout(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Timeout for PADI no response, in seconds """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadiTimeout'])) @property def PadrRetries(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Number of PADR Retries """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadrRetries'])) @property def PadrTimeout(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Timeout for PADR no response, in seconds """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadrTimeout'])) @property def PapPassword(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Password when PAP Authentication is being used """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PapPassword'])) @property def PapUser(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): User name when PAP Authentication is being used """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PapUser'])) @property def PonTypeTlv(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): PON Type to be advertised in PPPoE VSA Tag. For undefined PON type user has to select User-defined PON Type. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PonTypeTlv'])) @property def RedialMax(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Maximum number of PPPoE redials """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['RedialMax'])) @property def RedialTimeout(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): PPPoE redial timeout, in seconds """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['RedialTimeout'])) @property def RxConnectSpeed(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Rx Connection Speed """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['RxConnectSpeed'])) @property def ServiceName(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Access Concentrator Service Name - this option is only available for PPP servers. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ServiceName'])) @property def ServiceOptions(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Indicates PPPoE service retrieval mode """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ServiceOptions'])) @property def SessionInfo(self): """ Returns ------- - list(str[cLS_CFG_REJ_AUTH | cLS_CHAP_PEER_DET_FAIL | cLS_CHAP_PEER_RESP_BAD | cLS_CODE_REJ_IPCP | cLS_CODE_REJ_IPV6CP | cLS_CODE_REJ_LCP | cLS_ERR_PPP_NO_BUF | cLS_ERR_PPP_SEND_PKT | cLS_LINK_DISABLE | cLS_LOC_IPADDR_BROADCAST | cLS_LOC_IPADDR_CLASS_E | cLS_LOC_IPADDR_INVAL_ACKS_0 | cLS_LOC_IPADDR_INVAL_ACKS_DIFF | cLS_LOC_IPADDR_LOOPBACK | cLS_LOC_IPADDR_PEER_MATCH_LOC | cLS_LOC_IPADDR_PEER_NO_GIVE | cLS_LOC_IPADDR_PEER_NO_HELP | cLS_LOC_IPADDR_PEER_NO_TAKE | cLS_LOC_IPADDR_PEER_REJ | cLS_LOOPBACK_DETECT | cLS_NO_NCP | cLS_NONE | cLS_PAP_BAD_PASSWD | cLS_PEER_DISCONNECTED | cLS_PEER_DISCONNECTED_NEGO | cLS_PEER_IPADDR_MATCH_LOC | cLS_PEER_IPADDR_PEER_NO_SET | cLS_PPOE_AC_SYSTEM_ERROR | cLS_PPOE_GENERIC_ERROR | cLS_PPP_DISABLE | cLS_PPPOE_NO_HOST_UNIQ | cLS_PPPOE_PADI_TIMEOUT | cLS_PPPOE_PADO_TIMEOUT | cLS_PPPOE_PADR_TIMEOUT | cLS_PROTO_REJ_IPCP | cLS_PROTO_REJ_IPv6CP | cLS_TIMEOUT_CHAP_CHAL | cLS_TIMEOUT_CHAP_RESP | cLS_TIMEOUT_IPCP_CFG_REQ | cLS_TIMEOUT_IPV6CP_CFG_REQ | cLS_TIMEOUT_IPV6CP_RA | cLS_TIMEOUT_LCP_CFG_REQ | cLS_TIMEOUT_LCP_ECHO_REQ | cLS_TIMEOUT_PAP_AUTH_REQ | cLS_TUN_AUTH_FAILED | cLS_TUN_NO_RESOURCES | cLS_TUN_TIMEOUT_ICRQ | cLS_TUN_TIMEOUT_SCCRQ | cLS_TUN_VENDOR_SPECIFIC_ERR]): Logs additional information about the session state """ return self._get_attribute(self._SDM_ATT_MAP['SessionInfo']) @property def SessionStatus(self): """ Returns ------- - list(str[down | notStarted | up]): Current state of protocol session: Not Started - session negotiation not started, the session is not active yet. Down - actively trying to bring up a protocol session, but negotiation is didn't successfully complete (yet). Up - session came up successfully. """ return self._get_attribute(self._SDM_ATT_MAP['SessionStatus']) @property def StackedLayers(self): """ Returns ------- - list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*]): List of secondary (many to one) child layer protocols """ return self._get_attribute(self._SDM_ATT_MAP['StackedLayers']) @StackedLayers.setter def StackedLayers(self, value): self._set_attribute(self._SDM_ATT_MAP['StackedLayers'], value) @property def StateCounts(self): """ Returns ------- - dict(total:number,notStarted:number,down:number,up:number): A list of values that indicates the total number of sessions, the number of sessions not started, the number of sessions down and the number of sessions that are up """ return self._get_attribute(self._SDM_ATT_MAP['StateCounts']) @property def Status(self): """ Returns ------- - str(configured | error | mixed | notStarted | started | starting | stopping): Running status of associated network element. Once in Started state, protocol sessions will begin to negotiate. """ return self._get_attribute(self._SDM_ATT_MAP['Status']) @property def TxConnectSpeed(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): Tx Connection Speed """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['TxConnectSpeed'])) @property def UnlimitedRedialAttempts(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): If checked, PPPoE unlimited redial attempts is enabled """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['UnlimitedRedialAttempts'])) @property def UserDefinedDslType(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): User Defined DSL-Type Value. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['UserDefinedDslType'])) @property def UserDefinedPonType(self): """ Returns ------- - obj(uhd_restpy.multivalue.Multivalue): User Defined PON-Type Value. """ from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['UserDefinedPonType'])) def update(self, ConnectedVia=None, Multiplier=None, Name=None, StackedLayers=None): """Updates pppoxclient resource on the server. This method has some named parameters with a type: obj (Multivalue). The Multivalue class has documentation that details the possible values for those named parameters. Args ---- - ConnectedVia (list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*])): List of layers this layer is used to connect with to the wire. - Multiplier (number): Number of layer instances per parent instance (multiplier) - Name (str): Name of NGPF element, guaranteed to be unique in Scenario - StackedLayers (list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*])): List of secondary (many to one) child layer protocols Raises ------ - ServerError: The server has encountered an uncategorized error condition """ return self._update(self._map_locals(self._SDM_ATT_MAP, locals())) def add(self, ConnectedVia=None, Multiplier=None, Name=None, StackedLayers=None): """Adds a new pppoxclient resource on the server and adds it to the container. Args ---- - ConnectedVia (list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*])): List of layers this layer is used to connect with to the wire. - Multiplier (number): Number of layer instances per parent instance (multiplier) - Name (str): Name of NGPF element, guaranteed to be unique in Scenario - StackedLayers (list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*])): List of secondary (many to one) child layer protocols Returns ------- - self: This instance with all currently retrieved pppoxclient resources using find and the newly added pppoxclient resources available through an iterator or index Raises ------ - ServerError: The server has encountered an uncategorized error condition """ return self._create(self._map_locals(self._SDM_ATT_MAP, locals())) def remove(self): """Deletes all the contained pppoxclient resources in this instance from the server. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ self._delete() def find(self, ConnectedVia=None, Count=None, DescriptiveName=None, DiscoveredIpv4Addresses=None, DiscoveredIpv6Addresses=None, DiscoveredMacs=None, DiscoveredRemoteSessionIds=None, DiscoveredRemoteTunnelIds=None, DiscoveredSessionIds=None, DiscoveredTunnelIPs=None, DiscoveredTunnelIds=None, Errors=None, Multiplier=None, Name=None, SessionInfo=None, SessionStatus=None, StackedLayers=None, StateCounts=None, Status=None): """Finds and retrieves pppoxclient resources from the server. All named parameters are evaluated on the server using regex. The named parameters can be used to selectively retrieve pppoxclient resources from the server. To retrieve an exact match ensure the parameter value starts with ^ and ends with $ By default the find method takes no parameters and will retrieve all pppoxclient resources from the server. Args ---- - ConnectedVia (list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*])): List of layers this layer is used to connect with to the wire. - Count (number): Number of elements inside associated multiplier-scaled container object, e.g. number of devices inside a Device Group. - DescriptiveName (str): Longer, more descriptive name for element. It's not guaranteed to be unique like -name-, but may offer more context. - DiscoveredIpv4Addresses (list(str)): The discovered IPv4 addresses. - DiscoveredIpv6Addresses (list(str)): The discovered IPv6 addresses. - DiscoveredMacs (list(str)): The discovered remote MAC address. - DiscoveredRemoteSessionIds (list(number)): Remote session ID. - DiscoveredRemoteTunnelIds (list(number)): Remote tunnel ID. - DiscoveredSessionIds (list(number)): The negotiated session ID. - DiscoveredTunnelIPs (list(str)): The discovered remote tunnel IP. - DiscoveredTunnelIds (list(number)): The negotiated tunnel ID. - Errors (list(dict(arg1:str[None | /api/v1/sessions/1/ixnetwork//.../*],arg2:list[str]))): A list of errors that have occurred - Multiplier (number): Number of layer instances per parent instance (multiplier) - Name (str): Name of NGPF element, guaranteed to be unique in Scenario - SessionInfo (list(str[cLS_CFG_REJ_AUTH | cLS_CHAP_PEER_DET_FAIL | cLS_CHAP_PEER_RESP_BAD | cLS_CODE_REJ_IPCP | cLS_CODE_REJ_IPV6CP | cLS_CODE_REJ_LCP | cLS_ERR_PPP_NO_BUF | cLS_ERR_PPP_SEND_PKT | cLS_LINK_DISABLE | cLS_LOC_IPADDR_BROADCAST | cLS_LOC_IPADDR_CLASS_E | cLS_LOC_IPADDR_INVAL_ACKS_0 | cLS_LOC_IPADDR_INVAL_ACKS_DIFF | cLS_LOC_IPADDR_LOOPBACK | cLS_LOC_IPADDR_PEER_MATCH_LOC | cLS_LOC_IPADDR_PEER_NO_GIVE | cLS_LOC_IPADDR_PEER_NO_HELP | cLS_LOC_IPADDR_PEER_NO_TAKE | cLS_LOC_IPADDR_PEER_REJ | cLS_LOOPBACK_DETECT | cLS_NO_NCP | cLS_NONE | cLS_PAP_BAD_PASSWD | cLS_PEER_DISCONNECTED | cLS_PEER_DISCONNECTED_NEGO | cLS_PEER_IPADDR_MATCH_LOC | cLS_PEER_IPADDR_PEER_NO_SET | cLS_PPOE_AC_SYSTEM_ERROR | cLS_PPOE_GENERIC_ERROR | cLS_PPP_DISABLE | cLS_PPPOE_NO_HOST_UNIQ | cLS_PPPOE_PADI_TIMEOUT | cLS_PPPOE_PADO_TIMEOUT | cLS_PPPOE_PADR_TIMEOUT | cLS_PROTO_REJ_IPCP | cLS_PROTO_REJ_IPv6CP | cLS_TIMEOUT_CHAP_CHAL | cLS_TIMEOUT_CHAP_RESP | cLS_TIMEOUT_IPCP_CFG_REQ | cLS_TIMEOUT_IPV6CP_CFG_REQ | cLS_TIMEOUT_IPV6CP_RA | cLS_TIMEOUT_LCP_CFG_REQ | cLS_TIMEOUT_LCP_ECHO_REQ | cLS_TIMEOUT_PAP_AUTH_REQ | cLS_TUN_AUTH_FAILED | cLS_TUN_NO_RESOURCES | cLS_TUN_TIMEOUT_ICRQ | cLS_TUN_TIMEOUT_SCCRQ | cLS_TUN_VENDOR_SPECIFIC_ERR])): Logs additional information about the session state - SessionStatus (list(str[down | notStarted | up])): Current state of protocol session: Not Started - session negotiation not started, the session is not active yet. Down - actively trying to bring up a protocol session, but negotiation is didn't successfully complete (yet). Up - session came up successfully. - StackedLayers (list(str[None | /api/v1/sessions/1/ixnetwork/topology/.../*])): List of secondary (many to one) child layer protocols - StateCounts (dict(total:number,notStarted:number,down:number,up:number)): A list of values that indicates the total number of sessions, the number of sessions not started, the number of sessions down and the number of sessions that are up - Status (str(configured | error | mixed | notStarted | started | starting | stopping)): Running status of associated network element. Once in Started state, protocol sessions will begin to negotiate. Returns ------- - self: This instance with matching pppoxclient resources retrieved from the server available through an iterator or index Raises ------ - ServerError: The server has encountered an uncategorized error condition """ return self._select(self._map_locals(self._SDM_ATT_MAP, locals())) def read(self, href): """Retrieves a single instance of pppoxclient data from the server. Args ---- - href (str): An href to the instance to be retrieved Returns ------- - self: This instance with the pppoxclient resources from the server available through an iterator or index Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ return self._read(href) def get_device_ids(self, PortNames=None, AcMatchMac=None, AcMatchName=None, AcOptions=None, ActualRateDownstream=None, ActualRateUpstream=None, AgentAccessAggregationCircuitId=None, AgentCircuitId=None, AgentRemoteId=None, AuthRetries=None, AuthTimeout=None, AuthType=None, ChapName=None, ChapSecret=None, ClientDnsOptions=None, ClientLocalIp=None, ClientLocalIpv6Iid=None, ClientNcpOptions=None, ClientNetmask=None, ClientNetmaskOptions=None, ClientPrimaryDnsAddress=None, ClientSecondaryDnsAddress=None, ClientSignalIWF=None, ClientSignalLoopChar=None, ClientSignalLoopEncapsulation=None, ClientSignalLoopId=None, ClientV6NcpOptions=None, ClientWinsOptions=None, ClientWinsPrimaryAddress=None, ClientWinsSecondaryAddress=None, ConnectSpeedUpdateEnable=None, DataLink=None, DomainList=None, DslTypeTlv=None, EchoReqInterval=None, EnableDomainGroups=None, EnableEchoReq=None, EnableEchoRsp=None, EnableHostUniq=None, EnableMaxPayload=None, EnableRedial=None, Encaps1=None, Encaps2=None, EndpointDiscNegotiation=None, EndpointDiscriminatorClass=None, HostUniq=None, HostUniqLength=None, LcpAccm=None, LcpEnableAccm=None, LcpMaxFailure=None, LcpRetries=None, LcpStartDelay=None, LcpTermRetries=None, LcpTimeout=None, MaxPayload=None, MlpppIPAddress=None, MlpppMACAddress=None, Mrru=None, MrruNegotiation=None, MruNegotiation=None, Mtu=None, NcpRetries=None, NcpTimeout=None, NcpType=None, PadiRetries=None, PadiTimeout=None, PadrRetries=None, PadrTimeout=None, PapPassword=None, PapUser=None, PonTypeTlv=None, RedialMax=None, RedialTimeout=None, RxConnectSpeed=None, ServiceName=None, ServiceOptions=None, TxConnectSpeed=None, UnlimitedRedialAttempts=None, UserDefinedDslType=None, UserDefinedPonType=None): """Base class infrastructure that gets a list of pppoxclient device ids encapsulated by this object. Use the optional regex parameters in the method to refine the list of device ids encapsulated by this object. Args ---- - PortNames (str): optional regex of port names - AcMatchMac (str): optional regex of acMatchMac - AcMatchName (str): optional regex of acMatchName - AcOptions (str): optional regex of acOptions - ActualRateDownstream (str): optional regex of actualRateDownstream - ActualRateUpstream (str): optional regex of actualRateUpstream - AgentAccessAggregationCircuitId (str): optional regex of agentAccessAggregationCircuitId - AgentCircuitId (str): optional regex of agentCircuitId - AgentRemoteId (str): optional regex of agentRemoteId - AuthRetries (str): optional regex of authRetries - AuthTimeout (str): optional regex of authTimeout - AuthType (str): optional regex of authType - ChapName (str): optional regex of chapName - ChapSecret (str): optional regex of chapSecret - ClientDnsOptions (str): optional regex of clientDnsOptions - ClientLocalIp (str): optional regex of clientLocalIp - ClientLocalIpv6Iid (str): optional regex of clientLocalIpv6Iid - ClientNcpOptions (str): optional regex of clientNcpOptions - ClientNetmask (str): optional regex of clientNetmask - ClientNetmaskOptions (str): optional regex of clientNetmaskOptions - ClientPrimaryDnsAddress (str): optional regex of clientPrimaryDnsAddress - ClientSecondaryDnsAddress (str): optional regex of clientSecondaryDnsAddress - ClientSignalIWF (str): optional regex of clientSignalIWF - ClientSignalLoopChar (str): optional regex of clientSignalLoopChar - ClientSignalLoopEncapsulation (str): optional regex of clientSignalLoopEncapsulation - ClientSignalLoopId (str): optional regex of clientSignalLoopId - ClientV6NcpOptions (str): optional regex of clientV6NcpOptions - ClientWinsOptions (str): optional regex of clientWinsOptions - ClientWinsPrimaryAddress (str): optional regex of clientWinsPrimaryAddress - ClientWinsSecondaryAddress (str): optional regex of clientWinsSecondaryAddress - ConnectSpeedUpdateEnable (str): optional regex of connectSpeedUpdateEnable - DataLink (str): optional regex of dataLink - DomainList (str): optional regex of domainList - DslTypeTlv (str): optional regex of dslTypeTlv - EchoReqInterval (str): optional regex of echoReqInterval - EnableDomainGroups (str): optional regex of enableDomainGroups - EnableEchoReq (str): optional regex of enableEchoReq - EnableEchoRsp (str): optional regex of enableEchoRsp - EnableHostUniq (str): optional regex of enableHostUniq - EnableMaxPayload (str): optional regex of enableMaxPayload - EnableRedial (str): optional regex of enableRedial - Encaps1 (str): optional regex of encaps1 - Encaps2 (str): optional regex of encaps2 - EndpointDiscNegotiation (str): optional regex of endpointDiscNegotiation - EndpointDiscriminatorClass (str): optional regex of endpointDiscriminatorClass - HostUniq (str): optional regex of hostUniq - HostUniqLength (str): optional regex of hostUniqLength - LcpAccm (str): optional regex of lcpAccm - LcpEnableAccm (str): optional regex of lcpEnableAccm - LcpMaxFailure (str): optional regex of lcpMaxFailure - LcpRetries (str): optional regex of lcpRetries - LcpStartDelay (str): optional regex of lcpStartDelay - LcpTermRetries (str): optional regex of lcpTermRetries - LcpTimeout (str): optional regex of lcpTimeout - MaxPayload (str): optional regex of maxPayload - MlpppIPAddress (str): optional regex of mlpppIPAddress - MlpppMACAddress (str): optional regex of mlpppMACAddress - Mrru (str): optional regex of mrru - MrruNegotiation (str): optional regex of mrruNegotiation - MruNegotiation (str): optional regex of mruNegotiation - Mtu (str): optional regex of mtu - NcpRetries (str): optional regex of ncpRetries - NcpTimeout (str): optional regex of ncpTimeout - NcpType (str): optional regex of ncpType - PadiRetries (str): optional regex of padiRetries - PadiTimeout (str): optional regex of padiTimeout - PadrRetries (str): optional regex of padrRetries - PadrTimeout (str): optional regex of padrTimeout - PapPassword (str): optional regex of papPassword - PapUser (str): optional regex of papUser - PonTypeTlv (str): optional regex of ponTypeTlv - RedialMax (str): optional regex of redialMax - RedialTimeout (str): optional regex of redialTimeout - RxConnectSpeed (str): optional regex of rxConnectSpeed - ServiceName (str): optional regex of serviceName - ServiceOptions (str): optional regex of serviceOptions - TxConnectSpeed (str): optional regex of txConnectSpeed - UnlimitedRedialAttempts (str): optional regex of unlimitedRedialAttempts - UserDefinedDslType (str): optional regex of userDefinedDslType - UserDefinedPonType (str): optional regex of userDefinedPonType Returns ------- - list(int): A list of device ids that meets the regex criteria provided in the method parameters Raises ------ - ServerError: The server has encountered an uncategorized error condition """ return self._get_ngpf_device_ids(locals()) def Abort(self, *args, **kwargs): """Executes the abort operation on the server. Abort CPF control plane (equals to demote to kUnconfigured state). The IxNetwork model allows for multiple method Signatures with the same name while python does not. abort(SessionIndices=list) -------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 abort(SessionIndices=string) ---------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('abort', payload=payload, response_object=None) def CloseIpcp(self, *args, **kwargs): """Executes the closeIpcp operation on the server. Close IPCP for selected PPPoX items. The IxNetwork model allows for multiple method Signatures with the same name while python does not. closeIpcp(SessionIndices=list)list ---------------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. closeIpcp(SessionIndices=string)list ------------------------------------ - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('closeIpcp', payload=payload, response_object=None) def CloseIpv6cp(self, *args, **kwargs): """Executes the closeIpv6cp operation on the server. Close IPv6CP for selected PPPoX items. The IxNetwork model allows for multiple method Signatures with the same name while python does not. closeIpv6cp(SessionIndices=list)list ------------------------------------ - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. closeIpv6cp(SessionIndices=string)list -------------------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('closeIpv6cp', payload=payload, response_object=None) def OpenIpcp(self, *args, **kwargs): """Executes the openIpcp operation on the server. Open IPCP for selected PPPoX items. The IxNetwork model allows for multiple method Signatures with the same name while python does not. openIpcp(SessionIndices=list)list --------------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. openIpcp(SessionIndices=string)list ----------------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('openIpcp', payload=payload, response_object=None) def OpenIpv6cp(self, *args, **kwargs): """Executes the openIpv6cp operation on the server. Open IPv6CP for selected PPPoX items. The IxNetwork model allows for multiple method Signatures with the same name while python does not. openIpv6cp(SessionIndices=list)list ----------------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. openIpv6cp(SessionIndices=string)list ------------------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('openIpv6cp', payload=payload, response_object=None) def RestartDown(self, *args, **kwargs): """Executes the restartDown operation on the server. Stop and start interfaces and sessions that are in Down state. The IxNetwork model allows for multiple method Signatures with the same name while python does not. restartDown(SessionIndices=list) -------------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 restartDown(SessionIndices=string) ---------------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('restartDown', payload=payload, response_object=None) def SendPing(self, *args, **kwargs): """Executes the sendPing operation on the server. Send Ping IPv4 for selected PPPoX items. The IxNetwork model allows for multiple method Signatures with the same name while python does not. sendPing(DestIp=string)list --------------------------- - DestIp (str): This parameter requires a destIp of type kString - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. sendPing(DestIp=string, SessionIndices=list)list ------------------------------------------------ - DestIp (str): This parameter requires a destIp of type kString - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. sendPing(SessionIndices=string, DestIp=string)list -------------------------------------------------- - SessionIndices (str): This parameter requires a destIp of type kString - DestIp (str): This parameter requires a string of session numbers 1-4;6;7-12 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('sendPing', payload=payload, response_object=None) def SendPing6(self, *args, **kwargs): """Executes the sendPing6 operation on the server. Send Ping IPv6 for selected PPPoX items. The IxNetwork model allows for multiple method Signatures with the same name while python does not. sendPing6(DestIp=string)list ---------------------------- - DestIp (str): This parameter requires a destIp of type kString - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. sendPing6(DestIp=string, SessionIndices=list)list ------------------------------------------------- - DestIp (str): This parameter requires a destIp of type kString - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. sendPing6(SessionIndices=string, DestIp=string)list --------------------------------------------------- - SessionIndices (str): This parameter requires a destIp of type kString - DestIp (str): This parameter requires a string of session numbers 1-4;6;7-12 - Returns list(dict(port:str[None | /api/v1/sessions/1/ixnetwork/vport],isSuccess:bool,data:str)): The return value is an array of structures where each structure consists of a /vport object reference, the success of the operation and the returned data of the operation for that /vport. This exec is not asynchronous. Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('sendPing6', payload=payload, response_object=None) def Start(self, *args, **kwargs): """Executes the start operation on the server. Start CPF control plane (equals to promote to negotiated state). The IxNetwork model allows for multiple method Signatures with the same name while python does not. start(SessionIndices=list) -------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 start(SessionIndices=string) ---------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('start', payload=payload, response_object=None) def Stop(self, *args, **kwargs): """Executes the stop operation on the server. Stop CPF control plane (equals to demote to PreValidated-DoDDone state). The IxNetwork model allows for multiple method Signatures with the same name while python does not. stop(SessionIndices=list) ------------------------- - SessionIndices (list(number)): This parameter requires an array of session numbers 1 2 3 stop(SessionIndices=string) --------------------------- - SessionIndices (str): This parameter requires a string of session numbers 1-4;6;7-12 Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('stop', payload=payload, response_object=None)
43.832225
1,709
0.667437
from uhd_restpy.base import Base from uhd_restpy.files import Files class Pppoxclient(Base): __slots__ = () _SDM_NAME = 'pppoxclient' _SDM_ATT_MAP = { 'AcMatchMac': 'acMatchMac', 'AcMatchName': 'acMatchName', 'AcOptions': 'acOptions', 'ActualRateDownstream': 'actualRateDownstream', 'ActualRateUpstream': 'actualRateUpstream', 'AgentAccessAggregationCircuitId': 'agentAccessAggregationCircuitId', 'AgentCircuitId': 'agentCircuitId', 'AgentRemoteId': 'agentRemoteId', 'AuthRetries': 'authRetries', 'AuthTimeout': 'authTimeout', 'AuthType': 'authType', 'ChapName': 'chapName', 'ChapSecret': 'chapSecret', 'ClientDnsOptions': 'clientDnsOptions', 'ClientLocalIp': 'clientLocalIp', 'ClientLocalIpv6Iid': 'clientLocalIpv6Iid', 'ClientNcpOptions': 'clientNcpOptions', 'ClientNetmask': 'clientNetmask', 'ClientNetmaskOptions': 'clientNetmaskOptions', 'ClientPrimaryDnsAddress': 'clientPrimaryDnsAddress', 'ClientSecondaryDnsAddress': 'clientSecondaryDnsAddress', 'ClientSignalIWF': 'clientSignalIWF', 'ClientSignalLoopChar': 'clientSignalLoopChar', 'ClientSignalLoopEncapsulation': 'clientSignalLoopEncapsulation', 'ClientSignalLoopId': 'clientSignalLoopId', 'ClientV6NcpOptions': 'clientV6NcpOptions', 'ClientWinsOptions': 'clientWinsOptions', 'ClientWinsPrimaryAddress': 'clientWinsPrimaryAddress', 'ClientWinsSecondaryAddress': 'clientWinsSecondaryAddress', 'ConnectSpeedUpdateEnable': 'connectSpeedUpdateEnable', 'ConnectedVia': 'connectedVia', 'Count': 'count', 'DataLink': 'dataLink', 'DescriptiveName': 'descriptiveName', 'DiscoveredIpv4Addresses': 'discoveredIpv4Addresses', 'DiscoveredIpv6Addresses': 'discoveredIpv6Addresses', 'DiscoveredMacs': 'discoveredMacs', 'DiscoveredRemoteSessionIds': 'discoveredRemoteSessionIds', 'DiscoveredRemoteTunnelIds': 'discoveredRemoteTunnelIds', 'DiscoveredSessionIds': 'discoveredSessionIds', 'DiscoveredTunnelIPs': 'discoveredTunnelIPs', 'DiscoveredTunnelIds': 'discoveredTunnelIds', 'DomainList': 'domainList', 'DslTypeTlv': 'dslTypeTlv', 'EchoReqInterval': 'echoReqInterval', 'EnableDomainGroups': 'enableDomainGroups', 'EnableEchoReq': 'enableEchoReq', 'EnableEchoRsp': 'enableEchoRsp', 'EnableHostUniq': 'enableHostUniq', 'EnableMaxPayload': 'enableMaxPayload', 'EnableRedial': 'enableRedial', 'Encaps1': 'encaps1', 'Encaps2': 'encaps2', 'EndpointDiscNegotiation': 'endpointDiscNegotiation', 'EndpointDiscriminatorClass': 'endpointDiscriminatorClass', 'Errors': 'errors', 'HostUniq': 'hostUniq', 'HostUniqLength': 'hostUniqLength', 'LcpAccm': 'lcpAccm', 'LcpEnableAccm': 'lcpEnableAccm', 'LcpMaxFailure': 'lcpMaxFailure', 'LcpRetries': 'lcpRetries', 'LcpStartDelay': 'lcpStartDelay', 'LcpTermRetries': 'lcpTermRetries', 'LcpTimeout': 'lcpTimeout', 'MaxPayload': 'maxPayload', 'MlpppIPAddress': 'mlpppIPAddress', 'MlpppMACAddress': 'mlpppMACAddress', 'Mrru': 'mrru', 'MrruNegotiation': 'mrruNegotiation', 'MruNegotiation': 'mruNegotiation', 'Mtu': 'mtu', 'Multiplier': 'multiplier', 'Name': 'name', 'NcpRetries': 'ncpRetries', 'NcpTimeout': 'ncpTimeout', 'NcpType': 'ncpType', 'PadiRetries': 'padiRetries', 'PadiTimeout': 'padiTimeout', 'PadrRetries': 'padrRetries', 'PadrTimeout': 'padrTimeout', 'PapPassword': 'papPassword', 'PapUser': 'papUser', 'PonTypeTlv': 'ponTypeTlv', 'RedialMax': 'redialMax', 'RedialTimeout': 'redialTimeout', 'RxConnectSpeed': 'rxConnectSpeed', 'ServiceName': 'serviceName', 'ServiceOptions': 'serviceOptions', 'SessionInfo': 'sessionInfo', 'SessionStatus': 'sessionStatus', 'StackedLayers': 'stackedLayers', 'StateCounts': 'stateCounts', 'Status': 'status', 'TxConnectSpeed': 'txConnectSpeed', 'UnlimitedRedialAttempts': 'unlimitedRedialAttempts', 'UserDefinedDslType': 'userDefinedDslType', 'UserDefinedPonType': 'userDefinedPonType', } def __init__(self, parent): super(Pppoxclient, self).__init__(parent) @property def Bfdv4Interface(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.bfdv4interface_91b557a3f744baf442dbe21ac75e8f2e import Bfdv4Interface return Bfdv4Interface(self) @property def Bfdv6Interface(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.bfdv6interface_b9a91920db1b70c8c6410d2de0b438d3 import Bfdv6Interface return Bfdv6Interface(self) @property def BgpIpv4Peer(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.bgpipv4peer_9dd9eddcf2bd784d82d8a016e392f035 import BgpIpv4Peer return BgpIpv4Peer(self) @property def BgpIpv6Peer(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.bgpipv6peer_d4ac277d9da759fd5a152b8e6eb0ab20 import BgpIpv6Peer return BgpIpv6Peer(self) @property def Connector(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.connector_d0d942810e4010add7642d3914a1f29b import Connector return Connector(self) @property def Dhcpv6client(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.dhcpv6client_355391ba11ab3c1555c827e2e4ac3c4c import Dhcpv6client return Dhcpv6client(self) @property def ECpriRe(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.ecprire_51f1030cbafd2e567d3b517032a1b011 import ECpriRe return ECpriRe(self) @property def ECpriRec(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.ecprirec_129f1d43f285a4f806ade4e0df814255 import ECpriRec return ECpriRec(self) @property def Geneve(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.geneve_14ab6f140956b4fc77d1d0f03c5e7514 import Geneve return Geneve(self) @property def IgmpHost(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.igmphost_8940887674c0387469423e8df3a33854 import IgmpHost return IgmpHost(self) @property def IgmpQuerier(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.igmpquerier_38c883b0cec7ffb5405af90bf1b8cda5 import IgmpQuerier return IgmpQuerier(self) @property def MldHost(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.mldhost_824a1bed927138d4bb32f7d2631197a5 import MldHost return MldHost(self) @property def MldQuerier(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.mldquerier_e20671d730d138d65036e88d7cad63ac import MldQuerier return MldQuerier(self) @property def MplsOam(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.mplsoam_e01bb6affe899a4731aa60619f4aeadc import MplsOam return MplsOam(self) @property def NetconfClient(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.netconfclient_1eaa2ab0efacd988796bdc1f5fe4291c import NetconfClient return NetconfClient(self) @property def NetconfServer(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.netconfserver_ad256f8ca38068f1eaff839ed40b1e30 import NetconfServer return NetconfServer(self) @property def Ospfv2(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.ospfv2_27b7a27a991a50e01e629b9de482a2f0 import Ospfv2 return Ospfv2(self) @property def Ospfv3(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.ospfv3_c029fd7cd4a9e9897b7b4e4547458751 import Ospfv3 return Ospfv3(self) @property def Pcc(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.pcc_9346785b55d17399fecd6fe36c418219 import Pcc return Pcc(self) @property def Pce(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.pce_bd5f6a11078a4f0deb5d56bef8e9674f import Pce return Pce(self) @property def PimV4Interface(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.pimv4interface_92603cbceaf153039f7575ed9bc4aa67 import PimV4Interface return PimV4Interface(self) @property def PimV6Interface(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.pimv6interface_74a3aa08a315ca50732e853e3e8cdc43 import PimV6Interface return PimV6Interface(self) @property def Tag(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.tag_e30f24de79247381d4dfd423b2f6986d import Tag return Tag(self) @property def TlvProfile(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.tlvprofile.tlvprofile_69db000d3ef3b060f5edc387b878736c import TlvProfile return TlvProfile(self) @property def Vxlan(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.vxlan_ed3df6fe7146492fc5fe0f77f53f9473 import Vxlan return Vxlan(self) @property def Vxlanv6(self): from uhd_restpy.testplatform.sessions.ixnetwork.topology.vxlanv6_c18187deccae3db44b9e9de30ad538ec import Vxlanv6 return Vxlanv6(self) @property def AcMatchMac(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AcMatchMac'])) @property def AcMatchName(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AcMatchName'])) @property def AcOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AcOptions'])) @property def ActualRateDownstream(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ActualRateDownstream'])) @property def ActualRateUpstream(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ActualRateUpstream'])) @property def AgentAccessAggregationCircuitId(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AgentAccessAggregationCircuitId'])) @property def AgentCircuitId(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AgentCircuitId'])) @property def AgentRemoteId(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AgentRemoteId'])) @property def AuthRetries(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AuthRetries'])) @property def AuthTimeout(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AuthTimeout'])) @property def AuthType(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['AuthType'])) @property def ChapName(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ChapName'])) @property def ChapSecret(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ChapSecret'])) @property def ClientDnsOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientDnsOptions'])) @property def ClientLocalIp(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientLocalIp'])) @property def ClientLocalIpv6Iid(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientLocalIpv6Iid'])) @property def ClientNcpOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientNcpOptions'])) @property def ClientNetmask(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientNetmask'])) @property def ClientNetmaskOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientNetmaskOptions'])) @property def ClientPrimaryDnsAddress(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientPrimaryDnsAddress'])) @property def ClientSecondaryDnsAddress(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSecondaryDnsAddress'])) @property def ClientSignalIWF(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalIWF'])) @property def ClientSignalLoopChar(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalLoopChar'])) @property def ClientSignalLoopEncapsulation(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalLoopEncapsulation'])) @property def ClientSignalLoopId(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientSignalLoopId'])) @property def ClientV6NcpOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientV6NcpOptions'])) @property def ClientWinsOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientWinsOptions'])) @property def ClientWinsPrimaryAddress(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientWinsPrimaryAddress'])) @property def ClientWinsSecondaryAddress(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ClientWinsSecondaryAddress'])) @property def ConnectSpeedUpdateEnable(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ConnectSpeedUpdateEnable'])) @property def ConnectedVia(self): return self._get_attribute(self._SDM_ATT_MAP['ConnectedVia']) @ConnectedVia.setter def ConnectedVia(self, value): self._set_attribute(self._SDM_ATT_MAP['ConnectedVia'], value) @property def Count(self): return self._get_attribute(self._SDM_ATT_MAP['Count']) @property def DataLink(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['DataLink'])) @property def DescriptiveName(self): return self._get_attribute(self._SDM_ATT_MAP['DescriptiveName']) @property def DiscoveredIpv4Addresses(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredIpv4Addresses']) @property def DiscoveredIpv6Addresses(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredIpv6Addresses']) @property def DiscoveredMacs(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredMacs']) @property def DiscoveredRemoteSessionIds(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredRemoteSessionIds']) @property def DiscoveredRemoteTunnelIds(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredRemoteTunnelIds']) @property def DiscoveredSessionIds(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredSessionIds']) @property def DiscoveredTunnelIPs(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredTunnelIPs']) @property def DiscoveredTunnelIds(self): return self._get_attribute(self._SDM_ATT_MAP['DiscoveredTunnelIds']) @property def DomainList(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['DomainList'])) @property def DslTypeTlv(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['DslTypeTlv'])) @property def EchoReqInterval(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EchoReqInterval'])) @property def EnableDomainGroups(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableDomainGroups'])) @property def EnableEchoReq(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableEchoReq'])) @property def EnableEchoRsp(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableEchoRsp'])) @property def EnableHostUniq(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableHostUniq'])) @property def EnableMaxPayload(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableMaxPayload'])) @property def EnableRedial(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EnableRedial'])) @property def Encaps1(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Encaps1'])) @property def Encaps2(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Encaps2'])) @property def EndpointDiscNegotiation(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EndpointDiscNegotiation'])) @property def EndpointDiscriminatorClass(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['EndpointDiscriminatorClass'])) @property def Errors(self): return self._get_attribute(self._SDM_ATT_MAP['Errors']) @property def HostUniq(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['HostUniq'])) @property def HostUniqLength(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['HostUniqLength'])) @property def LcpAccm(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpAccm'])) @property def LcpEnableAccm(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpEnableAccm'])) @property def LcpMaxFailure(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpMaxFailure'])) @property def LcpRetries(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpRetries'])) @property def LcpStartDelay(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpStartDelay'])) @property def LcpTermRetries(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpTermRetries'])) @property def LcpTimeout(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['LcpTimeout'])) @property def MaxPayload(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MaxPayload'])) @property def MlpppIPAddress(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MlpppIPAddress'])) @property def MlpppMACAddress(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MlpppMACAddress'])) @property def Mrru(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Mrru'])) @property def MrruNegotiation(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MrruNegotiation'])) @property def MruNegotiation(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['MruNegotiation'])) @property def Mtu(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['Mtu'])) @property def Multiplier(self): return self._get_attribute(self._SDM_ATT_MAP['Multiplier']) @Multiplier.setter def Multiplier(self, value): self._set_attribute(self._SDM_ATT_MAP['Multiplier'], value) @property def Name(self): return self._get_attribute(self._SDM_ATT_MAP['Name']) @Name.setter def Name(self, value): self._set_attribute(self._SDM_ATT_MAP['Name'], value) @property def NcpRetries(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['NcpRetries'])) @property def NcpTimeout(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['NcpTimeout'])) @property def NcpType(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['NcpType'])) @property def PadiRetries(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadiRetries'])) @property def PadiTimeout(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadiTimeout'])) @property def PadrRetries(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadrRetries'])) @property def PadrTimeout(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PadrTimeout'])) @property def PapPassword(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PapPassword'])) @property def PapUser(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PapUser'])) @property def PonTypeTlv(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['PonTypeTlv'])) @property def RedialMax(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['RedialMax'])) @property def RedialTimeout(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['RedialTimeout'])) @property def RxConnectSpeed(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['RxConnectSpeed'])) @property def ServiceName(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ServiceName'])) @property def ServiceOptions(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['ServiceOptions'])) @property def SessionInfo(self): return self._get_attribute(self._SDM_ATT_MAP['SessionInfo']) @property def SessionStatus(self): return self._get_attribute(self._SDM_ATT_MAP['SessionStatus']) @property def StackedLayers(self): return self._get_attribute(self._SDM_ATT_MAP['StackedLayers']) @StackedLayers.setter def StackedLayers(self, value): self._set_attribute(self._SDM_ATT_MAP['StackedLayers'], value) @property def StateCounts(self): return self._get_attribute(self._SDM_ATT_MAP['StateCounts']) @property def Status(self): return self._get_attribute(self._SDM_ATT_MAP['Status']) @property def TxConnectSpeed(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['TxConnectSpeed'])) @property def UnlimitedRedialAttempts(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['UnlimitedRedialAttempts'])) @property def UserDefinedDslType(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['UserDefinedDslType'])) @property def UserDefinedPonType(self): from uhd_restpy.multivalue import Multivalue return Multivalue(self, self._get_attribute(self._SDM_ATT_MAP['UserDefinedPonType'])) def update(self, ConnectedVia=None, Multiplier=None, Name=None, StackedLayers=None): return self._update(self._map_locals(self._SDM_ATT_MAP, locals())) def add(self, ConnectedVia=None, Multiplier=None, Name=None, StackedLayers=None): return self._create(self._map_locals(self._SDM_ATT_MAP, locals())) def remove(self): self._delete() def find(self, ConnectedVia=None, Count=None, DescriptiveName=None, DiscoveredIpv4Addresses=None, DiscoveredIpv6Addresses=None, DiscoveredMacs=None, DiscoveredRemoteSessionIds=None, DiscoveredRemoteTunnelIds=None, DiscoveredSessionIds=None, DiscoveredTunnelIPs=None, DiscoveredTunnelIds=None, Errors=None, Multiplier=None, Name=None, SessionInfo=None, SessionStatus=None, StackedLayers=None, StateCounts=None, Status=None): return self._select(self._map_locals(self._SDM_ATT_MAP, locals())) def read(self, href): return self._read(href) def get_device_ids(self, PortNames=None, AcMatchMac=None, AcMatchName=None, AcOptions=None, ActualRateDownstream=None, ActualRateUpstream=None, AgentAccessAggregationCircuitId=None, AgentCircuitId=None, AgentRemoteId=None, AuthRetries=None, AuthTimeout=None, AuthType=None, ChapName=None, ChapSecret=None, ClientDnsOptions=None, ClientLocalIp=None, ClientLocalIpv6Iid=None, ClientNcpOptions=None, ClientNetmask=None, ClientNetmaskOptions=None, ClientPrimaryDnsAddress=None, ClientSecondaryDnsAddress=None, ClientSignalIWF=None, ClientSignalLoopChar=None, ClientSignalLoopEncapsulation=None, ClientSignalLoopId=None, ClientV6NcpOptions=None, ClientWinsOptions=None, ClientWinsPrimaryAddress=None, ClientWinsSecondaryAddress=None, ConnectSpeedUpdateEnable=None, DataLink=None, DomainList=None, DslTypeTlv=None, EchoReqInterval=None, EnableDomainGroups=None, EnableEchoReq=None, EnableEchoRsp=None, EnableHostUniq=None, EnableMaxPayload=None, EnableRedial=None, Encaps1=None, Encaps2=None, EndpointDiscNegotiation=None, EndpointDiscriminatorClass=None, HostUniq=None, HostUniqLength=None, LcpAccm=None, LcpEnableAccm=None, LcpMaxFailure=None, LcpRetries=None, LcpStartDelay=None, LcpTermRetries=None, LcpTimeout=None, MaxPayload=None, MlpppIPAddress=None, MlpppMACAddress=None, Mrru=None, MrruNegotiation=None, MruNegotiation=None, Mtu=None, NcpRetries=None, NcpTimeout=None, NcpType=None, PadiRetries=None, PadiTimeout=None, PadrRetries=None, PadrTimeout=None, PapPassword=None, PapUser=None, PonTypeTlv=None, RedialMax=None, RedialTimeout=None, RxConnectSpeed=None, ServiceName=None, ServiceOptions=None, TxConnectSpeed=None, UnlimitedRedialAttempts=None, UserDefinedDslType=None, UserDefinedPonType=None): return self._get_ngpf_device_ids(locals()) def Abort(self, *args, **kwargs): payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('abort', payload=payload, response_object=None) def CloseIpcp(self, *args, **kwargs): payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('closeIpcp', payload=payload, response_object=None) def CloseIpv6cp(self, *args, **kwargs): payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('closeIpv6cp', payload=payload, response_object=None) def OpenIpcp(self, *args, **kwargs): payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('openIpcp', payload=payload, response_object=None) def OpenIpv6cp(self, *args, **kwargs): payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('openIpv6cp', payload=payload, response_object=None) def RestartDown(self, *args, **kwargs): payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('restartDown', payload=payload, response_object=None) def SendPing(self, *args, **kwargs): payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('sendPing', payload=payload, response_object=None) def SendPing6(self, *args, **kwargs): payload = { "Arg1": self.href } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('sendPing6', payload=payload, response_object=None) def Start(self, *args, **kwargs): payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('start', payload=payload, response_object=None) def Stop(self, *args, **kwargs): payload = { "Arg1": self } for i in range(len(args)): payload['Arg%s' % (i + 2)] = args[i] for item in kwargs.items(): payload[item[0]] = item[1] return self._execute('stop', payload=payload, response_object=None)
true
true
f71e695a37aca1817dcabfee1b7c4e42d4724bff
35,646
py
Python
panel/reactive.py
Jacob-Barhak/panel
04cad38ea703e4e69fb76f063a27f4ffe40688e8
[ "BSD-3-Clause" ]
1
2021-03-09T04:46:05.000Z
2021-03-09T04:46:05.000Z
panel/reactive.py
Jacob-Barhak/panel
04cad38ea703e4e69fb76f063a27f4ffe40688e8
[ "BSD-3-Clause" ]
null
null
null
panel/reactive.py
Jacob-Barhak/panel
04cad38ea703e4e69fb76f063a27f4ffe40688e8
[ "BSD-3-Clause" ]
null
null
null
""" Declares Syncable and Reactive classes which provides baseclasses for Panel components which sync their state with one or more bokeh models rendered on the frontend. """ import difflib import sys import threading from collections import namedtuple from functools import partial import numpy as np import param from bokeh.models import LayoutDOM from tornado import gen from .config import config from .io.callbacks import PeriodicCallback from .io.model import hold from .io.notebook import push, push_on_root from .io.server import unlocked from .io.state import state from .util import edit_readonly, updating from .viewable import Renderable, Viewable LinkWatcher = namedtuple("Watcher","inst cls fn mode onlychanged parameter_names what queued target links transformed bidirectional_watcher") class Syncable(Renderable): """ Syncable is an extension of the Renderable object which can not only render to a bokeh model but also sync the parameters on the object with the properties on the model. In order to bi-directionally link parameters with bokeh model instances the _link_params and _link_props methods define callbacks triggered when either the parameter or bokeh property values change. Since there may not be a 1-to-1 mapping between parameter and the model property the _process_property_change and _process_param_change may be overridden to apply any necessary transformations. """ # Timeout if a notebook comm message is swallowed _timeout = 20000 # Timeout before the first event is processed _debounce = 50 # Any parameters that require manual updates handling for the models # e.g. parameters which affect some sub-model _manual_params = [] # Mapping from parameter name to bokeh model property name _rename = {} # Allows defining a mapping from model property name to a JS code # snippet that transforms the object before serialization _js_transforms = {} # Transforms from input value to bokeh property value _source_transforms = {} _target_transforms = {} __abstract = True def __init__(self, **params): super().__init__(**params) # Useful when updating model properties which trigger potentially # recursive events self._updating = False # A dictionary of current property change events self._events = {} # Any watchers associated with links between two objects self._links = [] self._link_params() # A dictionary of bokeh property changes being processed self._changing = {} # Sets up watchers to process manual updates to models if self._manual_params: self.param.watch(self._update_manual, self._manual_params) #---------------------------------------------------------------- # Model API #---------------------------------------------------------------- def _process_property_change(self, msg): """ Transform bokeh model property changes into parameter updates. Should be overridden to provide appropriate mapping between parameter value and bokeh model change. By default uses the _rename class level attribute to map between parameter and property names. """ inverted = {v: k for k, v in self._rename.items()} return {inverted.get(k, k): v for k, v in msg.items()} def _process_param_change(self, msg): """ Transform parameter changes into bokeh model property updates. Should be overridden to provide appropriate mapping between parameter value and bokeh model change. By default uses the _rename class level attribute to map between parameter and property names. """ properties = {self._rename.get(k, k): v for k, v in msg.items() if self._rename.get(k, False) is not None} if 'width' in properties and self.sizing_mode is None: properties['min_width'] = properties['width'] if 'height' in properties and self.sizing_mode is None: properties['min_height'] = properties['height'] return properties @property def _linkable_params(self): """ Parameters that can be linked in JavaScript via source transforms. """ return [p for p in self._synced_params if self._rename.get(p, False) is not None and self._source_transforms.get(p, False) is not None] + ['loading'] @property def _synced_params(self): """ Parameters which are synced with properties using transforms applied in the _process_param_change method. """ ignored = ['default_layout', 'loading'] return [p for p in self.param if p not in self._manual_params+ignored] def _init_params(self): return {k: v for k, v in self.param.get_param_values() if k in self._synced_params and v is not None} def _link_params(self): params = self._synced_params if params: watcher = self.param.watch(self._param_change, params) self._callbacks.append(watcher) def _link_props(self, model, properties, doc, root, comm=None): ref = root.ref['id'] if config.embed: return for p in properties: if isinstance(p, tuple): _, p = p if comm: model.on_change(p, partial(self._comm_change, doc, ref, comm)) else: model.on_change(p, partial(self._server_change, doc, ref)) def _manual_update(self, events, model, doc, root, parent, comm): """ Method for handling any manual update events, i.e. events triggered by changes in the manual params. """ def _update_manual(self, *events): for ref, (model, parent) in self._models.items(): if ref not in state._views or ref in state._fake_roots: continue viewable, root, doc, comm = state._views[ref] if comm or state._unblocked(doc): with unlocked(): self._manual_update(events, model, doc, root, parent, comm) if comm and 'embedded' not in root.tags: push(doc, comm) else: cb = partial(self._manual_update, events, model, doc, root, parent, comm) if doc.session_context: doc.add_next_tick_callback(cb) else: cb() def _update_model(self, events, msg, root, model, doc, comm): self._changing[root.ref['id']] = [ attr for attr, value in msg.items() if not model.lookup(attr).property.matches(getattr(model, attr), value) ] try: model.update(**msg) finally: del self._changing[root.ref['id']] def _cleanup(self, root): super()._cleanup(root) ref = root.ref['id'] self._models.pop(ref, None) comm, client_comm = self._comms.pop(ref, (None, None)) if comm: try: comm.close() except Exception: pass if client_comm: try: client_comm.close() except Exception: pass def _param_change(self, *events): msgs = [] for event in events: msg = self._process_param_change({event.name: event.new}) if msg: msgs.append(msg) events = {event.name: event for event in events} msg = {k: v for msg in msgs for k, v in msg.items()} if not msg: return for ref, (model, parent) in self._models.items(): if ref not in state._views or ref in state._fake_roots: continue viewable, root, doc, comm = state._views[ref] if comm or not doc.session_context or state._unblocked(doc): with unlocked(): self._update_model(events, msg, root, model, doc, comm) if comm and 'embedded' not in root.tags: push(doc, comm) else: cb = partial(self._update_model, events, msg, root, model, doc, comm) doc.add_next_tick_callback(cb) def _process_events(self, events): with edit_readonly(state): state.busy = True try: with edit_readonly(self): self.param.set_param(**self._process_property_change(events)) finally: with edit_readonly(state): state.busy = False @gen.coroutine def _change_coroutine(self, doc=None): self._change_event(doc) def _change_event(self, doc=None): try: state.curdoc = doc thread = threading.current_thread() thread_id = thread.ident if thread else None state._thread_id = thread_id events = self._events self._events = {} self._process_events(events) finally: state.curdoc = None state._thread_id = None def _comm_change(self, doc, ref, comm, attr, old, new): if attr in self._changing.get(ref, []): self._changing[ref].remove(attr) return with hold(doc, comm=comm): self._process_events({attr: new}) def _server_change(self, doc, ref, attr, old, new): if attr in self._changing.get(ref, []): self._changing[ref].remove(attr) return state._locks.clear() processing = bool(self._events) self._events.update({attr: new}) if not processing: if doc.session_context: doc.add_timeout_callback(partial(self._change_coroutine, doc), self._debounce) else: self._change_event(doc) class Reactive(Syncable, Viewable): """ Reactive is a Viewable object that also supports syncing between the objects parameters and the underlying bokeh model either via the defined pyviz_comms.Comm type or using bokeh server. In addition it defines various methods which make it easy to link the parameters to other objects. """ #---------------------------------------------------------------- # Public API #---------------------------------------------------------------- def add_periodic_callback(self, callback, period=500, count=None, timeout=None, start=True): """ Schedules a periodic callback to be run at an interval set by the period. Returns a PeriodicCallback object with the option to stop and start the callback. Arguments --------- callback: callable Callable function to be executed at periodic interval. period: int Interval in milliseconds at which callback will be executed. count: int Maximum number of times callback will be invoked. timeout: int Timeout in seconds when the callback should be stopped. start: boolean (default=True) Whether to start callback immediately. Returns ------- Return a PeriodicCallback object with start and stop methods. """ self.param.warning( "Calling add_periodic_callback on a Panel component is " "deprecated and will be removed in the next minor release. " "Use the pn.state.add_periodic_callback API instead." ) cb = PeriodicCallback(callback=callback, period=period, count=count, timeout=timeout) if start: cb.start() return cb def link(self, target, callbacks=None, bidirectional=False, **links): """ Links the parameters on this object to attributes on another object in Python. Supports two modes, either specify a mapping between the source and target object parameters as keywords or provide a dictionary of callbacks which maps from the source parameter to a callback which is triggered when the parameter changes. Arguments --------- target: object The target object of the link. callbacks: dict Maps from a parameter in the source object to a callback. bidirectional: boolean Whether to link source and target bi-directionally **links: dict Maps between parameters on this object to the parameters on the supplied object. """ if links and callbacks: raise ValueError('Either supply a set of parameters to ' 'link as keywords or a set of callbacks, ' 'not both.') elif not links and not callbacks: raise ValueError('Declare parameters to link or a set of ' 'callbacks, neither was defined.') elif callbacks and bidirectional: raise ValueError('Bidirectional linking not supported for ' 'explicit callbacks. You must define ' 'separate callbacks for each direction.') _updating = [] def link(*events): for event in events: if event.name in _updating: continue _updating.append(event.name) try: if callbacks: callbacks[event.name](target, event) else: setattr(target, links[event.name], event.new) finally: _updating.pop(_updating.index(event.name)) params = list(callbacks) if callbacks else list(links) cb = self.param.watch(link, params) bidirectional_watcher = None if bidirectional: _reverse_updating = [] reverse_links = {v: k for k, v in links.items()} def reverse_link(*events): for event in events: if event.name in _reverse_updating: continue _reverse_updating.append(event.name) try: setattr(self, reverse_links[event.name], event.new) finally: _reverse_updating.remove(event.name) bidirectional_watcher = target.param.watch(reverse_link, list(reverse_links)) link = LinkWatcher(*tuple(cb)+(target, links, callbacks is not None, bidirectional_watcher)) self._links.append(link) return cb def controls(self, parameters=[], jslink=True): """ Creates a set of widgets which allow manipulating the parameters on this instance. By default all parameters which support linking are exposed, but an explicit list of parameters can be provided. Arguments --------- parameters: list(str) An explicit list of parameters to return controls for. jslink: bool Whether to use jslinks instead of Python based links. This does not allow using all types of parameters. Returns ------- A layout of the controls """ from .param import Param from .layout import Tabs, WidgetBox from .widgets import LiteralInput if parameters: linkable = parameters elif jslink: linkable = self._linkable_params + ['loading'] else: linkable = list(self.param) params = [p for p in linkable if p not in Viewable.param] controls = Param(self.param, parameters=params, default_layout=WidgetBox, name='Controls') layout_params = [p for p in linkable if p in Viewable.param] if 'name' not in layout_params and self._rename.get('name', False) is not None and not parameters: layout_params.insert(0, 'name') style = Param(self.param, parameters=layout_params, default_layout=WidgetBox, name='Layout') if jslink: for p in params: widget = controls._widgets[p] widget.jslink(self, value=p, bidirectional=True) if isinstance(widget, LiteralInput): widget.serializer = 'json' for p in layout_params: widget = style._widgets[p] widget.jslink(self, value=p, bidirectional=p != 'loading') if isinstance(widget, LiteralInput): widget.serializer = 'json' if params and layout_params: return Tabs(controls.layout[0], style.layout[0]) elif params: return controls.layout[0] return style.layout[0] def jscallback(self, args={}, **callbacks): """ Allows defining a JS callback to be triggered when a property changes on the source object. The keyword arguments define the properties that trigger a callback and the JS code that gets executed. Arguments ---------- args: dict A mapping of objects to make available to the JS callback **callbacks: dict A mapping between properties on the source model and the code to execute when that property changes Returns ------- callback: Callback The Callback which can be used to disable the callback. """ from .links import Callback for k, v in list(callbacks.items()): callbacks[k] = self._rename.get(v, v) return Callback(self, code=callbacks, args=args) def jslink(self, target, code=None, args=None, bidirectional=False, **links): """ Links properties on the source object to those on the target object in JS code. Supports two modes, either specify a mapping between the source and target model properties as keywords or provide a dictionary of JS code snippets which maps from the source parameter to a JS code snippet which is executed when the property changes. Arguments ---------- target: HoloViews object or bokeh Model or panel Viewable The target to link the value to. code: dict Custom code which will be executed when the widget value changes. bidirectional: boolean Whether to link source and target bi-directionally **links: dict A mapping between properties on the source model and the target model property to link it to. Returns ------- link: GenericLink The GenericLink which can be used unlink the widget and the target model. """ if links and code: raise ValueError('Either supply a set of properties to ' 'link as keywords or a set of JS code ' 'callbacks, not both.') elif not links and not code: raise ValueError('Declare parameters to link or a set of ' 'callbacks, neither was defined.') if args is None: args = {} mapping = code or links for k in mapping: if k.startswith('event:'): continue elif hasattr(self, 'object') and isinstance(self.object, LayoutDOM): current = self.object for attr in k.split('.'): if not hasattr(current, attr): raise ValueError(f"Could not resolve {k} on " f"{self.object} model. Ensure " "you jslink an attribute that " "exists on the bokeh model.") current = getattr(current, attr) elif (k not in self.param and k not in list(self._rename.values())): matches = difflib.get_close_matches(k, list(self.param)) if matches: matches = ' Similar parameters include: %r' % matches else: matches = '' raise ValueError("Could not jslink %r parameter (or property) " "on %s object because it was not found.%s" % (k, type(self).__name__, matches)) elif (self._source_transforms.get(k, False) is None or self._rename.get(k, False) is None): raise ValueError("Cannot jslink %r parameter on %s object, " "the parameter requires a live Python kernel " "to have an effect." % (k, type(self).__name__)) if isinstance(target, Syncable) and code is None: for k, p in mapping.items(): if k.startswith('event:'): continue elif p not in target.param and p not in list(target._rename.values()): matches = difflib.get_close_matches(p, list(target.param)) if matches: matches = ' Similar parameters include: %r' % matches else: matches = '' raise ValueError("Could not jslink %r parameter (or property) " "on %s object because it was not found.%s" % (p, type(self).__name__, matches)) elif (target._source_transforms.get(p, False) is None or target._rename.get(p, False) is None): raise ValueError("Cannot jslink %r parameter on %s object " "to %r parameter on %s object. It requires " "a live Python kernel to have an effect." % (k, type(self).__name__, p, type(target).__name__)) from .links import Link return Link(self, target, properties=links, code=code, args=args, bidirectional=bidirectional) class SyncableData(Reactive): """ A baseclass for components which sync one or more data parameters with the frontend via a ColumnDataSource. """ selection = param.List(default=[], doc=""" The currently selected rows in the data.""") # Parameters which when changed require an update of the data _data_params = [] _rename = {'selection': None} __abstract = True def __init__(self, **params): super().__init__(**params) self._data = None self._processed = None self.param.watch(self._validate, self._data_params) if self._data_params: self.param.watch(self._update_cds, self._data_params) self.param.watch(self._update_selected, 'selection') self._validate(None) self._update_cds() def _validate(self, event): """ Allows implementing validation for the data parameters. """ def _get_data(self): """ Implemented by subclasses converting data parameter(s) into a ColumnDataSource compatible data dictionary. Returns ------- processed: object Raw data after pre-processing (e.g. after filtering) data: dict Dictionary of columns used to instantiate and update the ColumnDataSource """ def _update_column(self, column, array): """ Implemented by subclasses converting changes in columns to changes in the data parameter. Parameters ---------- column: str The name of the column to update. array: numpy.ndarray The array data to update the column with. """ data = getattr(self, self._data_params[0]) data[column] = array def _update_data(self, data): self.param.set_param(**{self._data_params[0]: data}) def _manual_update(self, events, model, doc, root, parent, comm): for event in events: if event.type == 'triggered' and self._updating: continue elif hasattr(self, '_update_' + event.name): getattr(self, '_update_' + event.name)(model) def _update_cds(self, *events): if self._updating: return self._processed, self._data = self._get_data() for ref, (m, _) in self._models.items(): m.source.data = self._data push_on_root(ref) def _update_selected(self, *events, indices=None): if self._updating: return indices = self.selection if indices is None else indices for ref, (m, _) in self._models.items(): m.source.selected.indices = indices push_on_root(ref) @updating def _stream(self, stream, rollover=None): for ref, (m, _) in self._models.items(): m.source.stream(stream, rollover) push_on_root(ref) @updating def _patch(self, patch): for ref, (m, _) in self._models.items(): m.source.patch(patch) push_on_root(ref) def stream(self, stream_value, rollover=None, reset_index=True): """ Streams (appends) the `stream_value` provided to the existing value in an efficient manner. Arguments --------- stream_value: (Union[pd.DataFrame, pd.Series, Dict]) The new value(s) to append to the existing value. rollover: int A maximum column size, above which data from the start of the column begins to be discarded. If None, then columns will continue to grow unbounded. reset_index (bool, default=True): If True and the stream_value is a DataFrame, then its index is reset. Helps to keep the index unique and named `index`. Raises ------ ValueError: Raised if the stream_value is not a supported type. Examples -------- Stream a Series to a DataFrame >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> stream_value = pd.Series({"x": 4, "y": "d"}) >>> obj.stream(stream_value) >>> obj.value.to_dict("list") {'x': [1, 2, 4], 'y': ['a', 'b', 'd']} Stream a Dataframe to a Dataframe >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> stream_value = pd.DataFrame({"x": [3, 4], "y": ["c", "d"]}) >>> obj.stream(stream_value) >>> obj.value.to_dict("list") {'x': [1, 2, 3, 4], 'y': ['a', 'b', 'c', 'd']} Stream a Dictionary row to a DataFrame >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> tabulator = DataComponent(value) >>> stream_value = {"x": 4, "y": "d"} >>> obj.stream(stream_value) >>> obj.value.to_dict("list") {'x': [1, 2, 4], 'y': ['a', 'b', 'd']} Stream a Dictionary of Columns to a Dataframe >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> stream_value = {"x": [3, 4], "y": ["c", "d"]} >>> obj.stream(stream_value) >>> obj.value.to_dict("list") {'x': [1, 2, 3, 4], 'y': ['a', 'b', 'c', 'd']} """ if 'pandas' in sys.modules: import pandas as pd else: pd = None if pd and isinstance(stream_value, pd.DataFrame): if isinstance(self._processed, dict): self.stream(stream_value.to_dict(), rollover) return if reset_index: value_index_start = self._processed.index.max() + 1 stream_value = stream_value.reset_index(drop=True) stream_value.index += value_index_start combined = pd.concat([self._processed, stream_value]) if rollover is not None: combined = combined.iloc[-rollover:] with param.discard_events(self): self._update_data(combined) try: self._updating = True self.param.trigger(self._data_params[0]) finally: self._updating = False try: self._updating = True self._stream(stream_value, rollover) finally: self._updating = False elif pd and isinstance(stream_value, pd.Series): if isinstance(self._processed, dict): self.stream({k: [v] for k, v in stream_value.to_dict().items()}, rollover) return value_index_start = self._processed.index.max() + 1 self._processed.loc[value_index_start] = stream_value with param.discard_events(self): self._update_data(self._processed) self._updating = True try: self._stream(self._processed.iloc[-1:], rollover) finally: self._updating = False elif isinstance(stream_value, dict): if isinstance(self._processed, dict): if not all(col in stream_value for col in self._data): raise ValueError("Stream update must append to all columns.") for col, array in stream_value.items(): combined = np.concatenate([self._data[col], array]) if rollover is not None: combined = combined[-rollover:] self._update_column(col, combined) self._updating = True try: self._stream(stream_value, rollover) finally: self._updating = False else: try: stream_value = pd.DataFrame(stream_value) except ValueError: stream_value = pd.Series(stream_value) self.stream(stream_value) else: raise ValueError("The stream value provided is not a DataFrame, Series or Dict!") def patch(self, patch_value): """ Efficiently patches (updates) the existing value with the `patch_value`. Arguments --------- patch_value: (Union[pd.DataFrame, pd.Series, Dict]) The value(s) to patch the existing value with. Raises ------ ValueError: Raised if the patch_value is not a supported type. Examples -------- Patch a DataFrame with a Dictionary row. >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> patch_value = {"x": [(0, 3)]} >>> obj.patch(patch_value) >>> obj.value.to_dict("list") {'x': [3, 2], 'y': ['a', 'b']} Patch a Dataframe with a Dictionary of Columns. >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> patch_value = {"x": [(slice(2), (3,4))], "y": [(1,'d')]} >>> obj.patch(patch_value) >>> obj.value.to_dict("list") {'x': [3, 4], 'y': ['a', 'd']} Patch a DataFrame with a Series. Please note the index is used in the update. >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> patch_value = pd.Series({"index": 1, "x": 4, "y": "d"}) >>> obj.patch(patch_value) >>> obj.value.to_dict("list") {'x': [1, 4], 'y': ['a', 'd']} Patch a Dataframe with a Dataframe. Please note the index is used in the update. >>> value = pd.DataFrame({"x": [1, 2], "y": ["a", "b"]}) >>> obj = DataComponent(value) >>> patch_value = pd.DataFrame({"x": [3, 4], "y": ["c", "d"]}) >>> obj.patch(patch_value) >>> obj.value.to_dict("list") {'x': [3, 4], 'y': ['c', 'd']} """ if self._processed is None or isinstance(patch_value, dict): self._patch(patch_value) return if 'pandas' in sys.modules: import pandas as pd else: pd = None data = getattr(self, self._data_params[0]) if pd and isinstance(patch_value, pd.DataFrame): patch_value_dict = {} for column in patch_value.columns: patch_value_dict[column] = [] for index in patch_value.index: patch_value_dict[column].append((index, patch_value.loc[index, column])) self.patch(patch_value_dict) elif pd and isinstance(patch_value, pd.Series): if "index" in patch_value: # Series orient is row patch_value_dict = { k: [(patch_value["index"], v)] for k, v in patch_value.items() } patch_value_dict.pop("index") else: # Series orient is column patch_value_dict = { patch_value.name: [(index, value) for index, value in patch_value.items()] } self.patch(patch_value_dict) elif isinstance(patch_value, dict): for k, v in patch_value.items(): for index, patch in v: if pd and isinstance(self._processed, pd.DataFrame): data.loc[index, k] = patch else: data[k][index] = patch self._updating = True try: self._patch(patch_value) finally: self._updating = False else: raise ValueError( f"Patching with a patch_value of type {type(patch_value).__name__} " "is not supported. Please provide a DataFrame, Series or Dict." ) class ReactiveData(SyncableData): """ An extension of SyncableData which bi-directionally syncs a data parameter between frontend and backend using a ColumnDataSource. """ def _update_selection(self, indices): self.selection = indices def _process_events(self, events): if 'data' in events: data = events.pop('data') if self._updating: data = {} _, old_data = self._get_data() updated = False for k, v in data.items(): if k in self.indexes: continue k = self._renamed_cols.get(k, k) if isinstance(v, dict): v = [v for _, v in sorted(v.items(), key=lambda it: int(it[0]))] try: isequal = (old_data[k] == np.asarray(v)).all() except Exception: isequal = False if not isequal: self._update_column(k, v) updated = True if updated: self._updating = True try: self.param.trigger('value') finally: self._updating = False if 'indices' in events: self._updating = True try: self._update_selection(events.pop('indices')) finally: self._updating = False super(ReactiveData, self)._process_events(events)
38.329032
141
0.558464
import difflib import sys import threading from collections import namedtuple from functools import partial import numpy as np import param from bokeh.models import LayoutDOM from tornado import gen from .config import config from .io.callbacks import PeriodicCallback from .io.model import hold from .io.notebook import push, push_on_root from .io.server import unlocked from .io.state import state from .util import edit_readonly, updating from .viewable import Renderable, Viewable LinkWatcher = namedtuple("Watcher","inst cls fn mode onlychanged parameter_names what queued target links transformed bidirectional_watcher") class Syncable(Renderable): _timeout = 20000 _debounce = 50 _manual_params = [] _rename = {} _js_transforms = {} _source_transforms = {} _target_transforms = {} __abstract = True def __init__(self, **params): super().__init__(**params) self._updating = False self._events = {} self._links = [] self._link_params() self._changing = {} if self._manual_params: self.param.watch(self._update_manual, self._manual_params) def _process_property_change(self, msg): inverted = {v: k for k, v in self._rename.items()} return {inverted.get(k, k): v for k, v in msg.items()} def _process_param_change(self, msg): properties = {self._rename.get(k, k): v for k, v in msg.items() if self._rename.get(k, False) is not None} if 'width' in properties and self.sizing_mode is None: properties['min_width'] = properties['width'] if 'height' in properties and self.sizing_mode is None: properties['min_height'] = properties['height'] return properties @property def _linkable_params(self): return [p for p in self._synced_params if self._rename.get(p, False) is not None and self._source_transforms.get(p, False) is not None] + ['loading'] @property def _synced_params(self): ignored = ['default_layout', 'loading'] return [p for p in self.param if p not in self._manual_params+ignored] def _init_params(self): return {k: v for k, v in self.param.get_param_values() if k in self._synced_params and v is not None} def _link_params(self): params = self._synced_params if params: watcher = self.param.watch(self._param_change, params) self._callbacks.append(watcher) def _link_props(self, model, properties, doc, root, comm=None): ref = root.ref['id'] if config.embed: return for p in properties: if isinstance(p, tuple): _, p = p if comm: model.on_change(p, partial(self._comm_change, doc, ref, comm)) else: model.on_change(p, partial(self._server_change, doc, ref)) def _manual_update(self, events, model, doc, root, parent, comm): def _update_manual(self, *events): for ref, (model, parent) in self._models.items(): if ref not in state._views or ref in state._fake_roots: continue viewable, root, doc, comm = state._views[ref] if comm or state._unblocked(doc): with unlocked(): self._manual_update(events, model, doc, root, parent, comm) if comm and 'embedded' not in root.tags: push(doc, comm) else: cb = partial(self._manual_update, events, model, doc, root, parent, comm) if doc.session_context: doc.add_next_tick_callback(cb) else: cb() def _update_model(self, events, msg, root, model, doc, comm): self._changing[root.ref['id']] = [ attr for attr, value in msg.items() if not model.lookup(attr).property.matches(getattr(model, attr), value) ] try: model.update(**msg) finally: del self._changing[root.ref['id']] def _cleanup(self, root): super()._cleanup(root) ref = root.ref['id'] self._models.pop(ref, None) comm, client_comm = self._comms.pop(ref, (None, None)) if comm: try: comm.close() except Exception: pass if client_comm: try: client_comm.close() except Exception: pass def _param_change(self, *events): msgs = [] for event in events: msg = self._process_param_change({event.name: event.new}) if msg: msgs.append(msg) events = {event.name: event for event in events} msg = {k: v for msg in msgs for k, v in msg.items()} if not msg: return for ref, (model, parent) in self._models.items(): if ref not in state._views or ref in state._fake_roots: continue viewable, root, doc, comm = state._views[ref] if comm or not doc.session_context or state._unblocked(doc): with unlocked(): self._update_model(events, msg, root, model, doc, comm) if comm and 'embedded' not in root.tags: push(doc, comm) else: cb = partial(self._update_model, events, msg, root, model, doc, comm) doc.add_next_tick_callback(cb) def _process_events(self, events): with edit_readonly(state): state.busy = True try: with edit_readonly(self): self.param.set_param(**self._process_property_change(events)) finally: with edit_readonly(state): state.busy = False @gen.coroutine def _change_coroutine(self, doc=None): self._change_event(doc) def _change_event(self, doc=None): try: state.curdoc = doc thread = threading.current_thread() thread_id = thread.ident if thread else None state._thread_id = thread_id events = self._events self._events = {} self._process_events(events) finally: state.curdoc = None state._thread_id = None def _comm_change(self, doc, ref, comm, attr, old, new): if attr in self._changing.get(ref, []): self._changing[ref].remove(attr) return with hold(doc, comm=comm): self._process_events({attr: new}) def _server_change(self, doc, ref, attr, old, new): if attr in self._changing.get(ref, []): self._changing[ref].remove(attr) return state._locks.clear() processing = bool(self._events) self._events.update({attr: new}) if not processing: if doc.session_context: doc.add_timeout_callback(partial(self._change_coroutine, doc), self._debounce) else: self._change_event(doc) class Reactive(Syncable, Viewable): def add_periodic_callback(self, callback, period=500, count=None, timeout=None, start=True): self.param.warning( "Calling add_periodic_callback on a Panel component is " "deprecated and will be removed in the next minor release. " "Use the pn.state.add_periodic_callback API instead." ) cb = PeriodicCallback(callback=callback, period=period, count=count, timeout=timeout) if start: cb.start() return cb def link(self, target, callbacks=None, bidirectional=False, **links): if links and callbacks: raise ValueError('Either supply a set of parameters to ' 'link as keywords or a set of callbacks, ' 'not both.') elif not links and not callbacks: raise ValueError('Declare parameters to link or a set of ' 'callbacks, neither was defined.') elif callbacks and bidirectional: raise ValueError('Bidirectional linking not supported for ' 'explicit callbacks. You must define ' 'separate callbacks for each direction.') _updating = [] def link(*events): for event in events: if event.name in _updating: continue _updating.append(event.name) try: if callbacks: callbacks[event.name](target, event) else: setattr(target, links[event.name], event.new) finally: _updating.pop(_updating.index(event.name)) params = list(callbacks) if callbacks else list(links) cb = self.param.watch(link, params) bidirectional_watcher = None if bidirectional: _reverse_updating = [] reverse_links = {v: k for k, v in links.items()} def reverse_link(*events): for event in events: if event.name in _reverse_updating: continue _reverse_updating.append(event.name) try: setattr(self, reverse_links[event.name], event.new) finally: _reverse_updating.remove(event.name) bidirectional_watcher = target.param.watch(reverse_link, list(reverse_links)) link = LinkWatcher(*tuple(cb)+(target, links, callbacks is not None, bidirectional_watcher)) self._links.append(link) return cb def controls(self, parameters=[], jslink=True): from .param import Param from .layout import Tabs, WidgetBox from .widgets import LiteralInput if parameters: linkable = parameters elif jslink: linkable = self._linkable_params + ['loading'] else: linkable = list(self.param) params = [p for p in linkable if p not in Viewable.param] controls = Param(self.param, parameters=params, default_layout=WidgetBox, name='Controls') layout_params = [p for p in linkable if p in Viewable.param] if 'name' not in layout_params and self._rename.get('name', False) is not None and not parameters: layout_params.insert(0, 'name') style = Param(self.param, parameters=layout_params, default_layout=WidgetBox, name='Layout') if jslink: for p in params: widget = controls._widgets[p] widget.jslink(self, value=p, bidirectional=True) if isinstance(widget, LiteralInput): widget.serializer = 'json' for p in layout_params: widget = style._widgets[p] widget.jslink(self, value=p, bidirectional=p != 'loading') if isinstance(widget, LiteralInput): widget.serializer = 'json' if params and layout_params: return Tabs(controls.layout[0], style.layout[0]) elif params: return controls.layout[0] return style.layout[0] def jscallback(self, args={}, **callbacks): from .links import Callback for k, v in list(callbacks.items()): callbacks[k] = self._rename.get(v, v) return Callback(self, code=callbacks, args=args) def jslink(self, target, code=None, args=None, bidirectional=False, **links): if links and code: raise ValueError('Either supply a set of properties to ' 'link as keywords or a set of JS code ' 'callbacks, not both.') elif not links and not code: raise ValueError('Declare parameters to link or a set of ' 'callbacks, neither was defined.') if args is None: args = {} mapping = code or links for k in mapping: if k.startswith('event:'): continue elif hasattr(self, 'object') and isinstance(self.object, LayoutDOM): current = self.object for attr in k.split('.'): if not hasattr(current, attr): raise ValueError(f"Could not resolve {k} on " f"{self.object} model. Ensure " "you jslink an attribute that " "exists on the bokeh model.") current = getattr(current, attr) elif (k not in self.param and k not in list(self._rename.values())): matches = difflib.get_close_matches(k, list(self.param)) if matches: matches = ' Similar parameters include: %r' % matches else: matches = '' raise ValueError("Could not jslink %r parameter (or property) " "on %s object because it was not found.%s" % (k, type(self).__name__, matches)) elif (self._source_transforms.get(k, False) is None or self._rename.get(k, False) is None): raise ValueError("Cannot jslink %r parameter on %s object, " "the parameter requires a live Python kernel " "to have an effect." % (k, type(self).__name__)) if isinstance(target, Syncable) and code is None: for k, p in mapping.items(): if k.startswith('event:'): continue elif p not in target.param and p not in list(target._rename.values()): matches = difflib.get_close_matches(p, list(target.param)) if matches: matches = ' Similar parameters include: %r' % matches else: matches = '' raise ValueError("Could not jslink %r parameter (or property) " "on %s object because it was not found.%s" % (p, type(self).__name__, matches)) elif (target._source_transforms.get(p, False) is None or target._rename.get(p, False) is None): raise ValueError("Cannot jslink %r parameter on %s object " "to %r parameter on %s object. It requires " "a live Python kernel to have an effect." % (k, type(self).__name__, p, type(target).__name__)) from .links import Link return Link(self, target, properties=links, code=code, args=args, bidirectional=bidirectional) class SyncableData(Reactive): selection = param.List(default=[], doc=""" The currently selected rows in the data.""") _data_params = [] _rename = {'selection': None} __abstract = True def __init__(self, **params): super().__init__(**params) self._data = None self._processed = None self.param.watch(self._validate, self._data_params) if self._data_params: self.param.watch(self._update_cds, self._data_params) self.param.watch(self._update_selected, 'selection') self._validate(None) self._update_cds() def _validate(self, event): def _get_data(self): def _update_column(self, column, array): data = getattr(self, self._data_params[0]) data[column] = array def _update_data(self, data): self.param.set_param(**{self._data_params[0]: data}) def _manual_update(self, events, model, doc, root, parent, comm): for event in events: if event.type == 'triggered' and self._updating: continue elif hasattr(self, '_update_' + event.name): getattr(self, '_update_' + event.name)(model) def _update_cds(self, *events): if self._updating: return self._processed, self._data = self._get_data() for ref, (m, _) in self._models.items(): m.source.data = self._data push_on_root(ref) def _update_selected(self, *events, indices=None): if self._updating: return indices = self.selection if indices is None else indices for ref, (m, _) in self._models.items(): m.source.selected.indices = indices push_on_root(ref) @updating def _stream(self, stream, rollover=None): for ref, (m, _) in self._models.items(): m.source.stream(stream, rollover) push_on_root(ref) @updating def _patch(self, patch): for ref, (m, _) in self._models.items(): m.source.patch(patch) push_on_root(ref) def stream(self, stream_value, rollover=None, reset_index=True): if 'pandas' in sys.modules: import pandas as pd else: pd = None if pd and isinstance(stream_value, pd.DataFrame): if isinstance(self._processed, dict): self.stream(stream_value.to_dict(), rollover) return if reset_index: value_index_start = self._processed.index.max() + 1 stream_value = stream_value.reset_index(drop=True) stream_value.index += value_index_start combined = pd.concat([self._processed, stream_value]) if rollover is not None: combined = combined.iloc[-rollover:] with param.discard_events(self): self._update_data(combined) try: self._updating = True self.param.trigger(self._data_params[0]) finally: self._updating = False try: self._updating = True self._stream(stream_value, rollover) finally: self._updating = False elif pd and isinstance(stream_value, pd.Series): if isinstance(self._processed, dict): self.stream({k: [v] for k, v in stream_value.to_dict().items()}, rollover) return value_index_start = self._processed.index.max() + 1 self._processed.loc[value_index_start] = stream_value with param.discard_events(self): self._update_data(self._processed) self._updating = True try: self._stream(self._processed.iloc[-1:], rollover) finally: self._updating = False elif isinstance(stream_value, dict): if isinstance(self._processed, dict): if not all(col in stream_value for col in self._data): raise ValueError("Stream update must append to all columns.") for col, array in stream_value.items(): combined = np.concatenate([self._data[col], array]) if rollover is not None: combined = combined[-rollover:] self._update_column(col, combined) self._updating = True try: self._stream(stream_value, rollover) finally: self._updating = False else: try: stream_value = pd.DataFrame(stream_value) except ValueError: stream_value = pd.Series(stream_value) self.stream(stream_value) else: raise ValueError("The stream value provided is not a DataFrame, Series or Dict!") def patch(self, patch_value): if self._processed is None or isinstance(patch_value, dict): self._patch(patch_value) return if 'pandas' in sys.modules: import pandas as pd else: pd = None data = getattr(self, self._data_params[0]) if pd and isinstance(patch_value, pd.DataFrame): patch_value_dict = {} for column in patch_value.columns: patch_value_dict[column] = [] for index in patch_value.index: patch_value_dict[column].append((index, patch_value.loc[index, column])) self.patch(patch_value_dict) elif pd and isinstance(patch_value, pd.Series): if "index" in patch_value: patch_value_dict = { k: [(patch_value["index"], v)] for k, v in patch_value.items() } patch_value_dict.pop("index") else: patch_value_dict = { patch_value.name: [(index, value) for index, value in patch_value.items()] } self.patch(patch_value_dict) elif isinstance(patch_value, dict): for k, v in patch_value.items(): for index, patch in v: if pd and isinstance(self._processed, pd.DataFrame): data.loc[index, k] = patch else: data[k][index] = patch self._updating = True try: self._patch(patch_value) finally: self._updating = False else: raise ValueError( f"Patching with a patch_value of type {type(patch_value).__name__} " "is not supported. Please provide a DataFrame, Series or Dict." ) class ReactiveData(SyncableData): def _update_selection(self, indices): self.selection = indices def _process_events(self, events): if 'data' in events: data = events.pop('data') if self._updating: data = {} _, old_data = self._get_data() updated = False for k, v in data.items(): if k in self.indexes: continue k = self._renamed_cols.get(k, k) if isinstance(v, dict): v = [v for _, v in sorted(v.items(), key=lambda it: int(it[0]))] try: isequal = (old_data[k] == np.asarray(v)).all() except Exception: isequal = False if not isequal: self._update_column(k, v) updated = True if updated: self._updating = True try: self.param.trigger('value') finally: self._updating = False if 'indices' in events: self._updating = True try: self._update_selection(events.pop('indices')) finally: self._updating = False super(ReactiveData, self)._process_events(events)
true
true
f71e697a978e3d9c4101aee1b43bf18c1e22305d
8,966
py
Python
docs/examples/batzle_wang_1992.py
trhallam/digirock
05b1199d741a384345a4930605be97369c9ec270
[ "MIT" ]
null
null
null
docs/examples/batzle_wang_1992.py
trhallam/digirock
05b1199d741a384345a4930605be97369c9ec270
[ "MIT" ]
2
2022-02-28T08:51:53.000Z
2022-02-28T13:24:33.000Z
docs/examples/batzle_wang_1992.py
trhallam/digirock
05b1199d741a384345a4930605be97369c9ec270
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- # --- # jupyter: # jupytext: # formats: ipynb,py:percent # text_representation: # extension: .py # format_name: percent # format_version: '1.3' # jupytext_version: 1.13.6 # kernelspec: # display_name: Python 3 (ipykernel) # language: python # name: python3 # --- # %% [markdown] # __Recreate the work by Batzle and Wang 1992 to check `digirock.fluids.bw92` functionality.__ # # Tony Hallam 2022 # %% [markdown] # This notebook contains working code to test the functionality of `bw98.py` in `fluids` module of `digirock`, ensuring that the functions honor the work by B&W 1992. # # _Batzle, M., and Wang, Z. [1992]. Seismic properties of pore fluids. Geophysics, 57(11), 1396–1408._ # [Available from the SEG](https://library.seg.org/doi/10.1190/1.1443207). # %% import numpy as np from digirock.fluids import bw92 # %matplotlib inline import matplotlib.pyplot as plt from matplotlib import rc rc("font", size=14) figsize = (15, 5) # %% # Input parameters has defined by B&W 1992 for plotting purporses temp_ar = np.arange(10, 350, 5) # degC pres_ar = np.arange(1, 100, 0.1) # Mpa sal_ar = np.arange(0, 0.3, 0.01) pres = np.array([0.1, 10, 25, 50]) # Mpa temps = np.array([10, 100, 200, 350]) # degC gsg = [0.6, 1.2] # gas Gravity or0 = [1.0, 0.88, 0.78] # oil density re 15.6degC # %% [markdown] # ## GAS # # Hydrocarbon density as a function of temperature and pressure using `bw92.gas_oga_density`, BW92 Eq 10a. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize) for G in gsg: for p in pres: ax[0].plot(temp_ar, bw92.gas_oga_density(temp_ar, p, G), label=f'G={G}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.gas_oga_density(t, pres_ar, G), label=f'G={G}, T={t}') ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 0.6) ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Density (g/cc)') ax[0].legend() _ = ax[0].set_title('B&W 1992, Figure 2') ax[1].set_xlim(0, 50) ax[1].set_ylim(0, 0.6) ax[1].set_xlabel('Pressure (MPa)') ax[1].set_ylabel('Density (g/cc)') _ = ax[1].legend() # %% [markdown] # Gas adibatic bulk modulus using `bw92.gas_adiabatic_bulkmod`. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) for G in gsg: for p in pres: ax[0].plot(temp_ar, bw92.gas_adiabatic_bulkmod(temp_ar, p, G)*1000, label=f'G={G}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.gas_adiabatic_bulkmod(t, pres_ar, G)*1000, label=f'G={G}, T={t}') ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 650) ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Bulk Modulus (MPa)') ax[0].legend() ax[0].set_title('B&W 1992 - Figure 3') ax[1].set_xlim(0, 50) ax[1].set_xlabel('Pressure (MPa)') _ = ax[1].legend() # %% [markdown] # Gas viscosity using `bw92.gas_adiabatic_viscosity` using equations 12 and 13. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) for G in gsg: for p in pres: ax[0].plot(temp_ar, bw92.gas_adiabatic_viscosity(temp_ar, p, G), label=f'G={G}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.gas_adiabatic_viscosity(t, pres_ar, G), label=f'G={G}, T={t}') ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Viscosity (centipoise)') ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 0.09) ax[0].set_title('B&W 1992 - Figure 4') ax[1].set_xlabel('Pressure (MPa)') ax[1].set_xlim(0, 50) _ = ax[1].legend() # %% [markdown] # ## OIL # # Dead oil density using `bw92.oil_density`, BW92 eq19. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) for p in pres: for r0 in or0: ax[0].plot(temp_ar, bw92.oil_density(r0, p, temp_ar), label=f'r0={r0}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.oil_density(r0, pres_ar, t), label=f'r0={r0}, T={t}') ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Oil Density (g/cc)') ax[0].set_xlim(0, 350) ax[0].set_ylim(0.55, 1.05) ax[0].set_title('B&W 1992 - Figure 5') ax[0].legend() ax[1].set_xlabel('Pressure (MPa)') ax[1].set_xlim(0, 50) _ = ax[1].legend(loc=[1.1, 0]) # %% [markdown] # Oil acoustic velocity using `bw92.oil_velocity`, BW92 eq 20a. # %% fig, ax = plt.subplots(nrows=1, ncols=1, figsize=(7.5,5)) api_ar = np.arange(0,70) # oil api rho0_ar = 141/ (api_ar + 131.5) ax.plot(api_ar, bw92.oil_velocity(rho0_ar, 15.6, 1E-4, 0.6, 50)) ax.set_xlim(0, 70) ax.set_ylim(1100, 1800) ax.set_xlabel('Oil API') ax.set_ylabel('Oil Velocity (m/s)') ax.set_title('B&W 1992 - Figure 6') # %% [markdown] # Oil bulk modulus using `bw92.bulkmod`. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 30) for r0 in or0: for p in pres: oil_rho = bw92.oil_density(r0, p, temp_ar) oil_vp = bw92.oil_velocity(r0, p, temp_ar, 0.6, 50) ax[0].plot(temp_ar, bw92.bulkmod(oil_rho*10, oil_vp),label=f"{r0} {p}MPa") for t in temps: oil_rho = bw92.oil_density(r0, pres_ar, t) oil_vp = bw92.oil_velocity(r0, pres_ar, t, 0.6, 50) ax[1].plot(pres_ar, bw92.bulkmod(oil_rho*10, oil_vp),label=f"{r0} {t}degC") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Oil Bulk Modlus (MPa)') ax[0].set_title('B&W 1992 - Figure 7') ax[0].legend()#cols=2) ax[1].set_xlabel('Pressure (MPa)') ax[1].set_xlim(0, 50) _ = ax[1].legend() # %% [markdown] # ## WATER # # Set up some parameters for plotting water. # %% presv = [50, 100, 110] # pressure MPa for velocity plots presrho = [9.81, 49, 98.1] # pressure MPa for density plots presk = [0.1, 50, 100] # pressure MPa for modulus plots sal = np.array([20000, 150000, 240000])/1000000 # ppm to weigh fraction salk = np.array([0, 150000, 300000])/1000000 # ppm to weigh fraction # %% [markdown] # Pure water sonic velocity using `bw92.wat_velocity_pure` and pure water density using `bw92.wat_density_pure`. The parameters Batzle and Wang use from Wilson for pure water velocity were only calibrated to 100degC and 100MPa. So the behaviour above that is a bit odd, even though the plot in the 1992 paper looks good. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharex=True) presv = [50, 100, 130] # pressure MPa tvp_mesh, pvvt_mesh = np.meshgrid(temp_ar, presv) wvp_mesh = bw92.wat_velocity_pure(tvp_mesh, pvvt_mesh) wdp_mesh = bw92.wat_density_pure(tvp_mesh, pvvt_mesh) for i, p in enumerate(presv): ax[0].plot(temp_ar, wvp_mesh[i, :], label=f"{p}MPa") ax[1].plot(temp_ar, wdp_mesh[i, :], label=f"{p}MPa") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Velocity (m/s)') ax[0].set_title('B&W 1992 - Figure 12') ax[0].legend()#cols=2) ax[0].set_xlim(0, 350) ax[0].set_ylim(500, 2000) ax[1].set_xlabel('Temp (C)') ax[1].set_ylabel('Density (g/cc)') _ = ax[1].legend() # %% [markdown] # Brine sonic velocity using `bw92.wat_velocity_brine` and `bw92.wat_density_brine`. Again, odd behaviour due to the influence of the pure water function on the brine velocity. # %% fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharex=True) presv = [50, 100, 130] # pressure MPa db1, db2, db3 = np.meshgrid(temp_ar, presrho, sal) wdb_mesh = bw92.wat_density_brine(db1, db2, db3) vb1, vb2, vb3 = np.meshgrid(temp_ar, presv, sal) wvb_mesh = bw92.wat_velocity_brine(vb1, vb2, vb3) for i, p in enumerate(presv): ax[0].plot(temp_ar, wvb_mesh[i, :], label=f"{p}MPa") ax[1].plot(temp_ar, wdb_mesh[i, :], label=f"{p}MPa") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Velocity (m/s)') ax[0].set_title('B&W 1992 - Figure 13') ax[0].legend()#cols=2) ax[0].set_xlim(0, 350) ax[0].set_ylim(1000, 2500) ax[1].set_xlabel('Temp (C)') ax[1].set_ylabel('Density (g/cc)') _ = ax[1].legend() # %% [markdown] # Brine bulk modulus using `bw92.wat_bulkmod`. This relies on calculating the velocity and density first. # %% tags=[] fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize) kb1, kb2, kb3 = np.meshgrid(temp_ar, presk, salk) kr = bw92.wat_density_brine(kb1, kb2, kb3) kv = bw92.wat_velocity_brine(kb1, kb2, kb3) wkb_mesh = bw92.wat_bulkmod(kr, kv) for i, p in enumerate(presv): ax[0].plot(temp_ar, wkb_mesh[i, :], label=f"{p}MPa") kb1, kb2, kb3 = np.meshgrid(pres_ar, temps, salk) kr = bw92.wat_density_brine(kb2, kb1, kb3) kv = bw92.wat_velocity_brine(kb2, kb1, kb3) wkb_mesh = bw92.wat_bulkmod(kr, kv) for i, t in enumerate(temps): ax[1].plot(pres_ar, wkb_mesh[i, :], label=f"{t}degC") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Bulk Modulus (GPa)') ax[0].set_ylim(0.5, 5.5) ax[0].set_title('B&W 1992 - Figure 14') ax[0].legend()#cols=2) ax[1].set_xlabel('Pressure (MPa)') ax[1].set_ylabel('Bulk Modulus (GPa)') _ = ax[1].legend() # %% [markdown] # ## Other Methods # # For a full list of the BW92 equations available with `digirock` see the [`digirock.fluids.bw92` api](../api/fluid_methods.html#batzle-and-wang-92).
29.11039
320
0.65135
import numpy as np from digirock.fluids import bw92 import matplotlib.pyplot as plt from matplotlib import rc rc("font", size=14) figsize = (15, 5) temp_ar = np.arange(10, 350, 5) pres_ar = np.arange(1, 100, 0.1) sal_ar = np.arange(0, 0.3, 0.01) pres = np.array([0.1, 10, 25, 50]) temps = np.array([10, 100, 200, 350]) gsg = [0.6, 1.2] or0 = [1.0, 0.88, 0.78] x = plt.subplots(nrows=1, ncols=2, figsize=figsize) for G in gsg: for p in pres: ax[0].plot(temp_ar, bw92.gas_oga_density(temp_ar, p, G), label=f'G={G}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.gas_oga_density(t, pres_ar, G), label=f'G={G}, T={t}') ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 0.6) ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Density (g/cc)') ax[0].legend() _ = ax[0].set_title('B&W 1992, Figure 2') ax[1].set_xlim(0, 50) ax[1].set_ylim(0, 0.6) ax[1].set_xlabel('Pressure (MPa)') ax[1].set_ylabel('Density (g/cc)') _ = ax[1].legend() fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) for G in gsg: for p in pres: ax[0].plot(temp_ar, bw92.gas_adiabatic_bulkmod(temp_ar, p, G)*1000, label=f'G={G}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.gas_adiabatic_bulkmod(t, pres_ar, G)*1000, label=f'G={G}, T={t}') ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 650) ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Bulk Modulus (MPa)') ax[0].legend() ax[0].set_title('B&W 1992 - Figure 3') ax[1].set_xlim(0, 50) ax[1].set_xlabel('Pressure (MPa)') _ = ax[1].legend() fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) for G in gsg: for p in pres: ax[0].plot(temp_ar, bw92.gas_adiabatic_viscosity(temp_ar, p, G), label=f'G={G}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.gas_adiabatic_viscosity(t, pres_ar, G), label=f'G={G}, T={t}') ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Viscosity (centipoise)') ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 0.09) ax[0].set_title('B&W 1992 - Figure 4') ax[1].set_xlabel('Pressure (MPa)') ax[1].set_xlim(0, 50) _ = ax[1].legend() x = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) for p in pres: for r0 in or0: ax[0].plot(temp_ar, bw92.oil_density(r0, p, temp_ar), label=f'r0={r0}, P={p}') for t in temps: ax[1].plot(pres_ar, bw92.oil_density(r0, pres_ar, t), label=f'r0={r0}, T={t}') ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Oil Density (g/cc)') ax[0].set_xlim(0, 350) ax[0].set_ylim(0.55, 1.05) ax[0].set_title('B&W 1992 - Figure 5') ax[0].legend() ax[1].set_xlabel('Pressure (MPa)') ax[1].set_xlim(0, 50) _ = ax[1].legend(loc=[1.1, 0]) fig, ax = plt.subplots(nrows=1, ncols=1, figsize=(7.5,5)) api_ar = np.arange(0,70) rho0_ar = 141/ (api_ar + 131.5) ax.plot(api_ar, bw92.oil_velocity(rho0_ar, 15.6, 1E-4, 0.6, 50)) ax.set_xlim(0, 70) ax.set_ylim(1100, 1800) ax.set_xlabel('Oil API') ax.set_ylabel('Oil Velocity (m/s)') ax.set_title('B&W 1992 - Figure 6') fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharey=True) ax[0].set_xlim(0, 350) ax[0].set_ylim(0, 30) for r0 in or0: for p in pres: oil_rho = bw92.oil_density(r0, p, temp_ar) oil_vp = bw92.oil_velocity(r0, p, temp_ar, 0.6, 50) ax[0].plot(temp_ar, bw92.bulkmod(oil_rho*10, oil_vp),label=f"{r0} {p}MPa") for t in temps: oil_rho = bw92.oil_density(r0, pres_ar, t) oil_vp = bw92.oil_velocity(r0, pres_ar, t, 0.6, 50) ax[1].plot(pres_ar, bw92.bulkmod(oil_rho*10, oil_vp),label=f"{r0} {t}degC") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Oil Bulk Modlus (MPa)') ax[0].set_title('B&W 1992 - Figure 7') ax[0].legend() ax[1].set_xlabel('Pressure (MPa)') ax[1].set_xlim(0, 50) _ = ax[1].legend() 0, 100, 110] presrho = [9.81, 49, 98.1] presk = [0.1, 50, 100] sal = np.array([20000, 150000, 240000])/1000000 salk = np.array([0, 150000, 300000])/1000000 fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharex=True) presv = [50, 100, 130] tvp_mesh, pvvt_mesh = np.meshgrid(temp_ar, presv) wvp_mesh = bw92.wat_velocity_pure(tvp_mesh, pvvt_mesh) wdp_mesh = bw92.wat_density_pure(tvp_mesh, pvvt_mesh) for i, p in enumerate(presv): ax[0].plot(temp_ar, wvp_mesh[i, :], label=f"{p}MPa") ax[1].plot(temp_ar, wdp_mesh[i, :], label=f"{p}MPa") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Velocity (m/s)') ax[0].set_title('B&W 1992 - Figure 12') ax[0].legend() ax[0].set_xlim(0, 350) ax[0].set_ylim(500, 2000) ax[1].set_xlabel('Temp (C)') ax[1].set_ylabel('Density (g/cc)') _ = ax[1].legend() fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize, sharex=True) presv = [50, 100, 130] db1, db2, db3 = np.meshgrid(temp_ar, presrho, sal) wdb_mesh = bw92.wat_density_brine(db1, db2, db3) vb1, vb2, vb3 = np.meshgrid(temp_ar, presv, sal) wvb_mesh = bw92.wat_velocity_brine(vb1, vb2, vb3) for i, p in enumerate(presv): ax[0].plot(temp_ar, wvb_mesh[i, :], label=f"{p}MPa") ax[1].plot(temp_ar, wdb_mesh[i, :], label=f"{p}MPa") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Velocity (m/s)') ax[0].set_title('B&W 1992 - Figure 13') ax[0].legend() ax[0].set_xlim(0, 350) ax[0].set_ylim(1000, 2500) ax[1].set_xlabel('Temp (C)') ax[1].set_ylabel('Density (g/cc)') _ = ax[1].legend() fig, ax = plt.subplots(nrows=1, ncols=2, figsize=figsize) kb1, kb2, kb3 = np.meshgrid(temp_ar, presk, salk) kr = bw92.wat_density_brine(kb1, kb2, kb3) kv = bw92.wat_velocity_brine(kb1, kb2, kb3) wkb_mesh = bw92.wat_bulkmod(kr, kv) for i, p in enumerate(presv): ax[0].plot(temp_ar, wkb_mesh[i, :], label=f"{p}MPa") kb1, kb2, kb3 = np.meshgrid(pres_ar, temps, salk) kr = bw92.wat_density_brine(kb2, kb1, kb3) kv = bw92.wat_velocity_brine(kb2, kb1, kb3) wkb_mesh = bw92.wat_bulkmod(kr, kv) for i, t in enumerate(temps): ax[1].plot(pres_ar, wkb_mesh[i, :], label=f"{t}degC") ax[0].set_xlabel('Temp (C)') ax[0].set_ylabel('Bulk Modulus (GPa)') ax[0].set_ylim(0.5, 5.5) ax[0].set_title('B&W 1992 - Figure 14') ax[0].legend() ax[1].set_xlabel('Pressure (MPa)') ax[1].set_ylabel('Bulk Modulus (GPa)') _ = ax[1].legend()
true
true
f71e69d9aaba3771528b04fae2b24551b321c43d
25,996
py
Python
homeassistant/components/simplisafe/__init__.py
stravinci/AIS-home-assistant
ead4dafd3f801ebeb32860bd34443ed24a4f4167
[ "Apache-2.0" ]
null
null
null
homeassistant/components/simplisafe/__init__.py
stravinci/AIS-home-assistant
ead4dafd3f801ebeb32860bd34443ed24a4f4167
[ "Apache-2.0" ]
null
null
null
homeassistant/components/simplisafe/__init__.py
stravinci/AIS-home-assistant
ead4dafd3f801ebeb32860bd34443ed24a4f4167
[ "Apache-2.0" ]
null
null
null
"""Support for SimpliSafe alarm systems.""" import asyncio from uuid import UUID from simplipy import API from simplipy.entity import EntityTypes from simplipy.errors import EndpointUnavailable, InvalidCredentialsError, SimplipyError from simplipy.websocket import ( EVENT_CAMERA_MOTION_DETECTED, EVENT_CONNECTION_LOST, EVENT_CONNECTION_RESTORED, EVENT_DOORBELL_DETECTED, EVENT_ENTRY_DETECTED, EVENT_LOCK_LOCKED, EVENT_LOCK_UNLOCKED, EVENT_MOTION_DETECTED, ) import voluptuous as vol from homeassistant.config_entries import SOURCE_REAUTH from homeassistant.const import ( ATTR_CODE, CONF_CODE, CONF_TOKEN, CONF_USERNAME, EVENT_HOMEASSISTANT_STOP, ) from homeassistant.core import CoreState, callback from homeassistant.exceptions import ConfigEntryNotReady from homeassistant.helpers import ( aiohttp_client, config_validation as cv, device_registry as dr, ) from homeassistant.helpers.dispatcher import ( async_dispatcher_connect, async_dispatcher_send, ) from homeassistant.helpers.service import ( async_register_admin_service, verify_domain_control, ) from homeassistant.helpers.update_coordinator import ( CoordinatorEntity, DataUpdateCoordinator, UpdateFailed, ) from .const import ( ATTR_ALARM_DURATION, ATTR_ALARM_VOLUME, ATTR_CHIME_VOLUME, ATTR_ENTRY_DELAY_AWAY, ATTR_ENTRY_DELAY_HOME, ATTR_EXIT_DELAY_AWAY, ATTR_EXIT_DELAY_HOME, ATTR_LIGHT, ATTR_VOICE_PROMPT_VOLUME, DATA_CLIENT, DEFAULT_SCAN_INTERVAL, DOMAIN, LOGGER, VOLUMES, ) DATA_LISTENER = "listener" TOPIC_UPDATE_WEBSOCKET = "simplisafe_update_websocket_{0}" EVENT_SIMPLISAFE_EVENT = "SIMPLISAFE_EVENT" EVENT_SIMPLISAFE_NOTIFICATION = "SIMPLISAFE_NOTIFICATION" DEFAULT_SOCKET_MIN_RETRY = 15 SUPPORTED_PLATFORMS = ( "alarm_control_panel", "binary_sensor", "lock", "sensor", ) WEBSOCKET_EVENTS_REQUIRING_SERIAL = [EVENT_LOCK_LOCKED, EVENT_LOCK_UNLOCKED] WEBSOCKET_EVENTS_TO_TRIGGER_HASS_EVENT = [ EVENT_CAMERA_MOTION_DETECTED, EVENT_DOORBELL_DETECTED, EVENT_ENTRY_DETECTED, EVENT_MOTION_DETECTED, ] ATTR_CATEGORY = "category" ATTR_LAST_EVENT_CHANGED_BY = "last_event_changed_by" ATTR_LAST_EVENT_INFO = "last_event_info" ATTR_LAST_EVENT_SENSOR_NAME = "last_event_sensor_name" ATTR_LAST_EVENT_SENSOR_SERIAL = "last_event_sensor_serial" ATTR_LAST_EVENT_SENSOR_TYPE = "last_event_sensor_type" ATTR_LAST_EVENT_TIMESTAMP = "last_event_timestamp" ATTR_LAST_EVENT_TYPE = "last_event_type" ATTR_LAST_EVENT_TYPE = "last_event_type" ATTR_MESSAGE = "message" ATTR_PIN_LABEL = "label" ATTR_PIN_LABEL_OR_VALUE = "label_or_pin" ATTR_PIN_VALUE = "pin" ATTR_SYSTEM_ID = "system_id" ATTR_TIMESTAMP = "timestamp" SERVICE_BASE_SCHEMA = vol.Schema({vol.Required(ATTR_SYSTEM_ID): cv.positive_int}) SERVICE_REMOVE_PIN_SCHEMA = SERVICE_BASE_SCHEMA.extend( {vol.Required(ATTR_PIN_LABEL_OR_VALUE): cv.string} ) SERVICE_SET_PIN_SCHEMA = SERVICE_BASE_SCHEMA.extend( {vol.Required(ATTR_PIN_LABEL): cv.string, vol.Required(ATTR_PIN_VALUE): cv.string} ) SERVICE_SET_SYSTEM_PROPERTIES_SCHEMA = SERVICE_BASE_SCHEMA.extend( { vol.Optional(ATTR_ALARM_DURATION): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(min=30, max=480) ), vol.Optional(ATTR_ALARM_VOLUME): vol.All(vol.Coerce(int), vol.In(VOLUMES)), vol.Optional(ATTR_CHIME_VOLUME): vol.All(vol.Coerce(int), vol.In(VOLUMES)), vol.Optional(ATTR_ENTRY_DELAY_AWAY): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(min=30, max=255) ), vol.Optional(ATTR_ENTRY_DELAY_HOME): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(max=255) ), vol.Optional(ATTR_EXIT_DELAY_AWAY): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(min=45, max=255) ), vol.Optional(ATTR_EXIT_DELAY_HOME): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(max=255) ), vol.Optional(ATTR_LIGHT): cv.boolean, vol.Optional(ATTR_VOICE_PROMPT_VOLUME): vol.All( vol.Coerce(int), vol.In(VOLUMES) ), } ) CONFIG_SCHEMA = cv.deprecated(DOMAIN, invalidation_version="0.119") @callback def _async_save_refresh_token(hass, config_entry, token): """Save a refresh token to the config entry.""" hass.config_entries.async_update_entry( config_entry, data={**config_entry.data, CONF_TOKEN: token} ) async def async_get_client_id(hass): """Get a client ID (based on the HASS unique ID) for the SimpliSafe API. Note that SimpliSafe requires full, "dashed" versions of UUIDs. """ hass_id = await hass.helpers.instance_id.async_get() return str(UUID(hass_id)) async def async_register_base_station(hass, system, config_entry_id): """Register a new bridge.""" device_registry = await dr.async_get_registry(hass) device_registry.async_get_or_create( config_entry_id=config_entry_id, identifiers={(DOMAIN, system.serial)}, manufacturer="SimpliSafe", model=system.version, name=system.address, ) async def async_setup(hass, config): """Set up the SimpliSafe component.""" hass.data[DOMAIN] = {DATA_CLIENT: {}, DATA_LISTENER: {}} return True async def async_setup_entry(hass, config_entry): """Set up SimpliSafe as config entry.""" entry_updates = {} if not config_entry.unique_id: # If the config entry doesn't already have a unique ID, set one: entry_updates["unique_id"] = config_entry.data[CONF_USERNAME] if CONF_CODE in config_entry.data: # If an alarm code was provided as part of configuration.yaml, pop it out of # the config entry's data and move it to options: data = {**config_entry.data} entry_updates["data"] = data entry_updates["options"] = { **config_entry.options, CONF_CODE: data.pop(CONF_CODE), } if entry_updates: hass.config_entries.async_update_entry(config_entry, **entry_updates) _verify_domain_control = verify_domain_control(hass, DOMAIN) client_id = await async_get_client_id(hass) websession = aiohttp_client.async_get_clientsession(hass) try: api = await API.login_via_token( config_entry.data[CONF_TOKEN], client_id=client_id, session=websession ) except InvalidCredentialsError: LOGGER.error("Invalid credentials provided") return False except SimplipyError as err: LOGGER.error("Config entry failed: %s", err) raise ConfigEntryNotReady from err _async_save_refresh_token(hass, config_entry, api.refresh_token) simplisafe = hass.data[DOMAIN][DATA_CLIENT][config_entry.entry_id] = SimpliSafe( hass, api, config_entry ) await simplisafe.async_init() for platform in SUPPORTED_PLATFORMS: hass.async_create_task( hass.config_entries.async_forward_entry_setup(config_entry, platform) ) @callback def verify_system_exists(coro): """Log an error if a service call uses an invalid system ID.""" async def decorator(call): """Decorate.""" system_id = int(call.data[ATTR_SYSTEM_ID]) if system_id not in simplisafe.systems: LOGGER.error("Unknown system ID in service call: %s", system_id) return await coro(call) return decorator @callback def v3_only(coro): """Log an error if the decorated coroutine is called with a v2 system.""" async def decorator(call): """Decorate.""" system = simplisafe.systems[int(call.data[ATTR_SYSTEM_ID])] if system.version != 3: LOGGER.error("Service only available on V3 systems") return await coro(call) return decorator @verify_system_exists @_verify_domain_control async def clear_notifications(call): """Clear all active notifications.""" system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.clear_notifications() except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return @verify_system_exists @_verify_domain_control async def remove_pin(call): """Remove a PIN.""" system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.remove_pin(call.data[ATTR_PIN_LABEL_OR_VALUE]) except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return @verify_system_exists @_verify_domain_control async def set_pin(call): """Set a PIN.""" system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.set_pin(call.data[ATTR_PIN_LABEL], call.data[ATTR_PIN_VALUE]) except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return @verify_system_exists @v3_only @_verify_domain_control async def set_system_properties(call): """Set one or more system parameters.""" system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.set_properties( { prop: value for prop, value in call.data.items() if prop != ATTR_SYSTEM_ID } ) except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return for service, method, schema in [ ("clear_notifications", clear_notifications, None), ("remove_pin", remove_pin, SERVICE_REMOVE_PIN_SCHEMA), ("set_pin", set_pin, SERVICE_SET_PIN_SCHEMA), ( "set_system_properties", set_system_properties, SERVICE_SET_SYSTEM_PROPERTIES_SCHEMA, ), ]: async_register_admin_service(hass, DOMAIN, service, method, schema=schema) config_entry.add_update_listener(async_reload_entry) return True async def async_unload_entry(hass, entry): """Unload a SimpliSafe config entry.""" unload_ok = all( await asyncio.gather( *[ hass.config_entries.async_forward_entry_unload(entry, component) for component in SUPPORTED_PLATFORMS ] ) ) if unload_ok: hass.data[DOMAIN][DATA_CLIENT].pop(entry.entry_id) remove_listener = hass.data[DOMAIN][DATA_LISTENER].pop(entry.entry_id) remove_listener() return unload_ok async def async_reload_entry(hass, config_entry): """Handle an options update.""" await hass.config_entries.async_reload(config_entry.entry_id) class SimpliSafeWebsocket: """Define a SimpliSafe websocket "manager" object.""" def __init__(self, hass, websocket): """Initialize.""" self._hass = hass self._websocket = websocket @staticmethod def _on_connect(): """Define a handler to fire when the websocket is connected.""" LOGGER.info("Connected to websocket") @staticmethod def _on_disconnect(): """Define a handler to fire when the websocket is disconnected.""" LOGGER.info("Disconnected from websocket") def _on_event(self, event): """Define a handler to fire when a new SimpliSafe event arrives.""" LOGGER.debug("New websocket event: %s", event) async_dispatcher_send( self._hass, TOPIC_UPDATE_WEBSOCKET.format(event.system_id), event ) if event.event_type not in WEBSOCKET_EVENTS_TO_TRIGGER_HASS_EVENT: return if event.sensor_type: sensor_type = event.sensor_type.name else: sensor_type = None self._hass.bus.async_fire( EVENT_SIMPLISAFE_EVENT, event_data={ ATTR_LAST_EVENT_CHANGED_BY: event.changed_by, ATTR_LAST_EVENT_TYPE: event.event_type, ATTR_LAST_EVENT_INFO: event.info, ATTR_LAST_EVENT_SENSOR_NAME: event.sensor_name, ATTR_LAST_EVENT_SENSOR_SERIAL: event.sensor_serial, ATTR_LAST_EVENT_SENSOR_TYPE: sensor_type, ATTR_SYSTEM_ID: event.system_id, ATTR_LAST_EVENT_TIMESTAMP: event.timestamp, }, ) async def async_connect(self): """Register handlers and connect to the websocket.""" self._websocket.on_connect(self._on_connect) self._websocket.on_disconnect(self._on_disconnect) self._websocket.on_event(self._on_event) await self._websocket.async_connect() async def async_disconnect(self): """Disconnect from the websocket.""" await self._websocket.async_disconnect() class SimpliSafe: """Define a SimpliSafe data object.""" def __init__(self, hass, api, config_entry): """Initialize.""" self._api = api self._emergency_refresh_token_used = False self._hass = hass self._system_notifications = {} self.config_entry = config_entry self.coordinator = None self.initial_event_to_use = {} self.systems = {} self.websocket = SimpliSafeWebsocket(hass, api.websocket) @callback def _async_process_new_notifications(self, system): """Act on any new system notifications.""" if self._hass.state != CoreState.running: # If HASS isn't fully running yet, it may cause the SIMPLISAFE_NOTIFICATION # event to fire before dependent components (like automation) are fully # ready. If that's the case, skip: return latest_notifications = set(system.notifications) to_add = latest_notifications.difference( self._system_notifications[system.system_id] ) if not to_add: return LOGGER.debug("New system notifications: %s", to_add) self._system_notifications[system.system_id].update(to_add) for notification in to_add: text = notification.text if notification.link: text = f"{text} For more information: {notification.link}" self._hass.bus.async_fire( EVENT_SIMPLISAFE_NOTIFICATION, event_data={ ATTR_CATEGORY: notification.category, ATTR_CODE: notification.code, ATTR_MESSAGE: text, ATTR_TIMESTAMP: notification.timestamp, }, ) async def async_init(self): """Initialize the data class.""" asyncio.create_task(self.websocket.async_connect()) async def async_websocket_disconnect(_): """Define an event handler to disconnect from the websocket.""" await self.websocket.async_disconnect() self._hass.data[DOMAIN][DATA_LISTENER][ self.config_entry.entry_id ] = self._hass.bus.async_listen_once( EVENT_HOMEASSISTANT_STOP, async_websocket_disconnect ) self.systems = await self._api.get_systems() for system in self.systems.values(): self._system_notifications[system.system_id] = set() self._hass.async_create_task( async_register_base_station( self._hass, system, self.config_entry.entry_id ) ) # Future events will come from the websocket, but since subscription to the # websocket doesn't provide the most recent event, we grab it from the REST # API to ensure event-related attributes aren't empty on startup: try: self.initial_event_to_use[ system.system_id ] = await system.get_latest_event() except SimplipyError as err: LOGGER.error("Error while fetching initial event: %s", err) self.initial_event_to_use[system.system_id] = {} self.coordinator = DataUpdateCoordinator( self._hass, LOGGER, name=self.config_entry.data[CONF_USERNAME], update_interval=DEFAULT_SCAN_INTERVAL, update_method=self.async_update, ) async def async_update(self): """Get updated data from SimpliSafe.""" async def async_update_system(system): """Update a system.""" await system.update(cached=system.version != 3) self._async_process_new_notifications(system) tasks = [async_update_system(system) for system in self.systems.values()] results = await asyncio.gather(*tasks, return_exceptions=True) for result in results: if isinstance(result, InvalidCredentialsError): if self._emergency_refresh_token_used: matching_flows = [ flow for flow in self._hass.config_entries.flow.async_progress() if flow["context"].get("source") == SOURCE_REAUTH and flow["context"].get("unique_id") == self.config_entry.unique_id ] if not matching_flows: self._hass.async_create_task( self._hass.config_entries.flow.async_init( DOMAIN, context={ "source": SOURCE_REAUTH, "unique_id": self.config_entry.unique_id, }, data=self.config_entry.data, ) ) LOGGER.error("Update failed with stored refresh token") raise UpdateFailed from result LOGGER.warning("SimpliSafe cloud error; trying stored refresh token") self._emergency_refresh_token_used = True try: await self._api.refresh_access_token( self.config_entry.data[CONF_TOKEN] ) return except SimplipyError as err: LOGGER.error("Error while using stored refresh token: %s", err) raise UpdateFailed from err if isinstance(result, EndpointUnavailable): # In case the user attempt an action not allowed in their current plan, # we merely log that message at INFO level (so the user is aware, # but not spammed with ERROR messages that they cannot change): LOGGER.info(result) raise UpdateFailed from result if isinstance(result, SimplipyError): LOGGER.error("SimpliSafe error while updating: %s", result) raise UpdateFailed from result if isinstance(result, Exception): LOGGER.error("Unknown error while updating: %s", result) raise UpdateFailed from result if self._api.refresh_token != self.config_entry.data[CONF_TOKEN]: _async_save_refresh_token( self._hass, self.config_entry, self._api.refresh_token ) # If we've reached this point using an emergency refresh token, we're in the # clear and we can discard it: if self._emergency_refresh_token_used: self._emergency_refresh_token_used = False class SimpliSafeEntity(CoordinatorEntity): """Define a base SimpliSafe entity.""" def __init__(self, simplisafe, system, name, *, serial=None): """Initialize.""" super().__init__(simplisafe.coordinator) self._name = name self._online = True self._simplisafe = simplisafe self._system = system self.websocket_events_to_listen_for = [ EVENT_CONNECTION_LOST, EVENT_CONNECTION_RESTORED, ] if serial: self._serial = serial else: self._serial = system.serial try: sensor_type = EntityTypes( simplisafe.initial_event_to_use[system.system_id].get("sensorType") ) except ValueError: sensor_type = EntityTypes.unknown self._attrs = { ATTR_LAST_EVENT_INFO: simplisafe.initial_event_to_use[system.system_id].get( "info" ), ATTR_LAST_EVENT_SENSOR_NAME: simplisafe.initial_event_to_use[ system.system_id ].get("sensorName"), ATTR_LAST_EVENT_SENSOR_TYPE: sensor_type.name, ATTR_LAST_EVENT_TIMESTAMP: simplisafe.initial_event_to_use[ system.system_id ].get("eventTimestamp"), ATTR_SYSTEM_ID: system.system_id, } self._device_info = { "identifiers": {(DOMAIN, system.system_id)}, "manufacturer": "SimpliSafe", "model": system.version, "name": name, "via_device": (DOMAIN, system.serial), } @property def available(self): """Return whether the entity is available.""" # We can easily detect if the V3 system is offline, but no simple check exists # for the V2 system. Therefore, assuming the coordinator hasn't failed, we mark # the entity as available if: # 1. We can verify that the system is online (assuming True if we can't) # 2. We can verify that the entity is online return not (self._system.version == 3 and self._system.offline) and self._online @property def device_info(self): """Return device registry information for this entity.""" return self._device_info @property def device_state_attributes(self): """Return the state attributes.""" return self._attrs @property def name(self): """Return the name of the entity.""" return f"{self._system.address} {self._name}" @property def unique_id(self): """Return the unique ID of the entity.""" return self._serial @callback def _async_internal_update_from_websocket_event(self, event): """Perform internal websocket handling prior to handing off.""" if event.event_type == EVENT_CONNECTION_LOST: self._online = False elif event.event_type == EVENT_CONNECTION_RESTORED: self._online = True # It's uncertain whether SimpliSafe events will still propagate down the # websocket when the base station is offline. Just in case, we guard against # further action until connection is restored: if not self._online: return if event.sensor_type: sensor_type = event.sensor_type.name else: sensor_type = None self._attrs.update( { ATTR_LAST_EVENT_INFO: event.info, ATTR_LAST_EVENT_SENSOR_NAME: event.sensor_name, ATTR_LAST_EVENT_SENSOR_TYPE: sensor_type, ATTR_LAST_EVENT_TIMESTAMP: event.timestamp, } ) self.async_update_from_websocket_event(event) @callback def _handle_coordinator_update(self): """Update the entity with new REST API data.""" self.async_update_from_rest_api() self.async_write_ha_state() @callback def _handle_websocket_update(self, event): """Update the entity with new websocket data.""" # Ignore this event if it belongs to a system other than this one: if event.system_id != self._system.system_id: return # Ignore this event if this entity hasn't expressed interest in its type: if event.event_type not in self.websocket_events_to_listen_for: return # Ignore this event if it belongs to a entity with a different serial # number from this one's: if ( event.event_type in WEBSOCKET_EVENTS_REQUIRING_SERIAL and event.sensor_serial != self._serial ): return self._async_internal_update_from_websocket_event(event) self.async_write_ha_state() async def async_added_to_hass(self): """Register callbacks.""" await super().async_added_to_hass() self.async_on_remove( async_dispatcher_connect( self.hass, TOPIC_UPDATE_WEBSOCKET.format(self._system.system_id), self._handle_websocket_update, ) ) self.async_update_from_rest_api() @callback def async_update_from_rest_api(self): """Update the entity with the provided REST API data.""" raise NotImplementedError() @callback def async_update_from_websocket_event(self, event): """Update the entity with the provided websocket event.""" class SimpliSafeBaseSensor(SimpliSafeEntity): """Define a SimpliSafe base (binary) sensor.""" def __init__(self, simplisafe, system, sensor): """Initialize.""" super().__init__(simplisafe, system, sensor.name, serial=sensor.serial) self._device_info["identifiers"] = {(DOMAIN, sensor.serial)} self._device_info["model"] = sensor.type.name self._device_info["name"] = sensor.name self._sensor = sensor self._sensor_type_human_name = " ".join( [w.title() for w in self._sensor.type.name.split("_")] ) @property def name(self): """Return the name of the sensor.""" return f"{self._system.address} {self._name} {self._sensor_type_human_name}"
34.52324
88
0.637021
import asyncio from uuid import UUID from simplipy import API from simplipy.entity import EntityTypes from simplipy.errors import EndpointUnavailable, InvalidCredentialsError, SimplipyError from simplipy.websocket import ( EVENT_CAMERA_MOTION_DETECTED, EVENT_CONNECTION_LOST, EVENT_CONNECTION_RESTORED, EVENT_DOORBELL_DETECTED, EVENT_ENTRY_DETECTED, EVENT_LOCK_LOCKED, EVENT_LOCK_UNLOCKED, EVENT_MOTION_DETECTED, ) import voluptuous as vol from homeassistant.config_entries import SOURCE_REAUTH from homeassistant.const import ( ATTR_CODE, CONF_CODE, CONF_TOKEN, CONF_USERNAME, EVENT_HOMEASSISTANT_STOP, ) from homeassistant.core import CoreState, callback from homeassistant.exceptions import ConfigEntryNotReady from homeassistant.helpers import ( aiohttp_client, config_validation as cv, device_registry as dr, ) from homeassistant.helpers.dispatcher import ( async_dispatcher_connect, async_dispatcher_send, ) from homeassistant.helpers.service import ( async_register_admin_service, verify_domain_control, ) from homeassistant.helpers.update_coordinator import ( CoordinatorEntity, DataUpdateCoordinator, UpdateFailed, ) from .const import ( ATTR_ALARM_DURATION, ATTR_ALARM_VOLUME, ATTR_CHIME_VOLUME, ATTR_ENTRY_DELAY_AWAY, ATTR_ENTRY_DELAY_HOME, ATTR_EXIT_DELAY_AWAY, ATTR_EXIT_DELAY_HOME, ATTR_LIGHT, ATTR_VOICE_PROMPT_VOLUME, DATA_CLIENT, DEFAULT_SCAN_INTERVAL, DOMAIN, LOGGER, VOLUMES, ) DATA_LISTENER = "listener" TOPIC_UPDATE_WEBSOCKET = "simplisafe_update_websocket_{0}" EVENT_SIMPLISAFE_EVENT = "SIMPLISAFE_EVENT" EVENT_SIMPLISAFE_NOTIFICATION = "SIMPLISAFE_NOTIFICATION" DEFAULT_SOCKET_MIN_RETRY = 15 SUPPORTED_PLATFORMS = ( "alarm_control_panel", "binary_sensor", "lock", "sensor", ) WEBSOCKET_EVENTS_REQUIRING_SERIAL = [EVENT_LOCK_LOCKED, EVENT_LOCK_UNLOCKED] WEBSOCKET_EVENTS_TO_TRIGGER_HASS_EVENT = [ EVENT_CAMERA_MOTION_DETECTED, EVENT_DOORBELL_DETECTED, EVENT_ENTRY_DETECTED, EVENT_MOTION_DETECTED, ] ATTR_CATEGORY = "category" ATTR_LAST_EVENT_CHANGED_BY = "last_event_changed_by" ATTR_LAST_EVENT_INFO = "last_event_info" ATTR_LAST_EVENT_SENSOR_NAME = "last_event_sensor_name" ATTR_LAST_EVENT_SENSOR_SERIAL = "last_event_sensor_serial" ATTR_LAST_EVENT_SENSOR_TYPE = "last_event_sensor_type" ATTR_LAST_EVENT_TIMESTAMP = "last_event_timestamp" ATTR_LAST_EVENT_TYPE = "last_event_type" ATTR_LAST_EVENT_TYPE = "last_event_type" ATTR_MESSAGE = "message" ATTR_PIN_LABEL = "label" ATTR_PIN_LABEL_OR_VALUE = "label_or_pin" ATTR_PIN_VALUE = "pin" ATTR_SYSTEM_ID = "system_id" ATTR_TIMESTAMP = "timestamp" SERVICE_BASE_SCHEMA = vol.Schema({vol.Required(ATTR_SYSTEM_ID): cv.positive_int}) SERVICE_REMOVE_PIN_SCHEMA = SERVICE_BASE_SCHEMA.extend( {vol.Required(ATTR_PIN_LABEL_OR_VALUE): cv.string} ) SERVICE_SET_PIN_SCHEMA = SERVICE_BASE_SCHEMA.extend( {vol.Required(ATTR_PIN_LABEL): cv.string, vol.Required(ATTR_PIN_VALUE): cv.string} ) SERVICE_SET_SYSTEM_PROPERTIES_SCHEMA = SERVICE_BASE_SCHEMA.extend( { vol.Optional(ATTR_ALARM_DURATION): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(min=30, max=480) ), vol.Optional(ATTR_ALARM_VOLUME): vol.All(vol.Coerce(int), vol.In(VOLUMES)), vol.Optional(ATTR_CHIME_VOLUME): vol.All(vol.Coerce(int), vol.In(VOLUMES)), vol.Optional(ATTR_ENTRY_DELAY_AWAY): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(min=30, max=255) ), vol.Optional(ATTR_ENTRY_DELAY_HOME): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(max=255) ), vol.Optional(ATTR_EXIT_DELAY_AWAY): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(min=45, max=255) ), vol.Optional(ATTR_EXIT_DELAY_HOME): vol.All( cv.time_period, lambda value: value.seconds, vol.Range(max=255) ), vol.Optional(ATTR_LIGHT): cv.boolean, vol.Optional(ATTR_VOICE_PROMPT_VOLUME): vol.All( vol.Coerce(int), vol.In(VOLUMES) ), } ) CONFIG_SCHEMA = cv.deprecated(DOMAIN, invalidation_version="0.119") @callback def _async_save_refresh_token(hass, config_entry, token): hass.config_entries.async_update_entry( config_entry, data={**config_entry.data, CONF_TOKEN: token} ) async def async_get_client_id(hass): hass_id = await hass.helpers.instance_id.async_get() return str(UUID(hass_id)) async def async_register_base_station(hass, system, config_entry_id): device_registry = await dr.async_get_registry(hass) device_registry.async_get_or_create( config_entry_id=config_entry_id, identifiers={(DOMAIN, system.serial)}, manufacturer="SimpliSafe", model=system.version, name=system.address, ) async def async_setup(hass, config): hass.data[DOMAIN] = {DATA_CLIENT: {}, DATA_LISTENER: {}} return True async def async_setup_entry(hass, config_entry): entry_updates = {} if not config_entry.unique_id: entry_updates["unique_id"] = config_entry.data[CONF_USERNAME] if CONF_CODE in config_entry.data: # If an alarm code was provided as part of configuration.yaml, pop it out of # the config entry's data and move it to options: data = {**config_entry.data} entry_updates["data"] = data entry_updates["options"] = { **config_entry.options, CONF_CODE: data.pop(CONF_CODE), } if entry_updates: hass.config_entries.async_update_entry(config_entry, **entry_updates) _verify_domain_control = verify_domain_control(hass, DOMAIN) client_id = await async_get_client_id(hass) websession = aiohttp_client.async_get_clientsession(hass) try: api = await API.login_via_token( config_entry.data[CONF_TOKEN], client_id=client_id, session=websession ) except InvalidCredentialsError: LOGGER.error("Invalid credentials provided") return False except SimplipyError as err: LOGGER.error("Config entry failed: %s", err) raise ConfigEntryNotReady from err _async_save_refresh_token(hass, config_entry, api.refresh_token) simplisafe = hass.data[DOMAIN][DATA_CLIENT][config_entry.entry_id] = SimpliSafe( hass, api, config_entry ) await simplisafe.async_init() for platform in SUPPORTED_PLATFORMS: hass.async_create_task( hass.config_entries.async_forward_entry_setup(config_entry, platform) ) @callback def verify_system_exists(coro): async def decorator(call): system_id = int(call.data[ATTR_SYSTEM_ID]) if system_id not in simplisafe.systems: LOGGER.error("Unknown system ID in service call: %s", system_id) return await coro(call) return decorator @callback def v3_only(coro): async def decorator(call): system = simplisafe.systems[int(call.data[ATTR_SYSTEM_ID])] if system.version != 3: LOGGER.error("Service only available on V3 systems") return await coro(call) return decorator @verify_system_exists @_verify_domain_control async def clear_notifications(call): system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.clear_notifications() except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return @verify_system_exists @_verify_domain_control async def remove_pin(call): system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.remove_pin(call.data[ATTR_PIN_LABEL_OR_VALUE]) except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return @verify_system_exists @_verify_domain_control async def set_pin(call): system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.set_pin(call.data[ATTR_PIN_LABEL], call.data[ATTR_PIN_VALUE]) except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return @verify_system_exists @v3_only @_verify_domain_control async def set_system_properties(call): system = simplisafe.systems[call.data[ATTR_SYSTEM_ID]] try: await system.set_properties( { prop: value for prop, value in call.data.items() if prop != ATTR_SYSTEM_ID } ) except SimplipyError as err: LOGGER.error("Error during service call: %s", err) return for service, method, schema in [ ("clear_notifications", clear_notifications, None), ("remove_pin", remove_pin, SERVICE_REMOVE_PIN_SCHEMA), ("set_pin", set_pin, SERVICE_SET_PIN_SCHEMA), ( "set_system_properties", set_system_properties, SERVICE_SET_SYSTEM_PROPERTIES_SCHEMA, ), ]: async_register_admin_service(hass, DOMAIN, service, method, schema=schema) config_entry.add_update_listener(async_reload_entry) return True async def async_unload_entry(hass, entry): unload_ok = all( await asyncio.gather( *[ hass.config_entries.async_forward_entry_unload(entry, component) for component in SUPPORTED_PLATFORMS ] ) ) if unload_ok: hass.data[DOMAIN][DATA_CLIENT].pop(entry.entry_id) remove_listener = hass.data[DOMAIN][DATA_LISTENER].pop(entry.entry_id) remove_listener() return unload_ok async def async_reload_entry(hass, config_entry): await hass.config_entries.async_reload(config_entry.entry_id) class SimpliSafeWebsocket: def __init__(self, hass, websocket): self._hass = hass self._websocket = websocket @staticmethod def _on_connect(): LOGGER.info("Connected to websocket") @staticmethod def _on_disconnect(): LOGGER.info("Disconnected from websocket") def _on_event(self, event): LOGGER.debug("New websocket event: %s", event) async_dispatcher_send( self._hass, TOPIC_UPDATE_WEBSOCKET.format(event.system_id), event ) if event.event_type not in WEBSOCKET_EVENTS_TO_TRIGGER_HASS_EVENT: return if event.sensor_type: sensor_type = event.sensor_type.name else: sensor_type = None self._hass.bus.async_fire( EVENT_SIMPLISAFE_EVENT, event_data={ ATTR_LAST_EVENT_CHANGED_BY: event.changed_by, ATTR_LAST_EVENT_TYPE: event.event_type, ATTR_LAST_EVENT_INFO: event.info, ATTR_LAST_EVENT_SENSOR_NAME: event.sensor_name, ATTR_LAST_EVENT_SENSOR_SERIAL: event.sensor_serial, ATTR_LAST_EVENT_SENSOR_TYPE: sensor_type, ATTR_SYSTEM_ID: event.system_id, ATTR_LAST_EVENT_TIMESTAMP: event.timestamp, }, ) async def async_connect(self): self._websocket.on_connect(self._on_connect) self._websocket.on_disconnect(self._on_disconnect) self._websocket.on_event(self._on_event) await self._websocket.async_connect() async def async_disconnect(self): await self._websocket.async_disconnect() class SimpliSafe: def __init__(self, hass, api, config_entry): self._api = api self._emergency_refresh_token_used = False self._hass = hass self._system_notifications = {} self.config_entry = config_entry self.coordinator = None self.initial_event_to_use = {} self.systems = {} self.websocket = SimpliSafeWebsocket(hass, api.websocket) @callback def _async_process_new_notifications(self, system): if self._hass.state != CoreState.running: # event to fire before dependent components (like automation) are fully # ready. If that's the case, skip: return latest_notifications = set(system.notifications) to_add = latest_notifications.difference( self._system_notifications[system.system_id] ) if not to_add: return LOGGER.debug("New system notifications: %s", to_add) self._system_notifications[system.system_id].update(to_add) for notification in to_add: text = notification.text if notification.link: text = f"{text} For more information: {notification.link}" self._hass.bus.async_fire( EVENT_SIMPLISAFE_NOTIFICATION, event_data={ ATTR_CATEGORY: notification.category, ATTR_CODE: notification.code, ATTR_MESSAGE: text, ATTR_TIMESTAMP: notification.timestamp, }, ) async def async_init(self): asyncio.create_task(self.websocket.async_connect()) async def async_websocket_disconnect(_): await self.websocket.async_disconnect() self._hass.data[DOMAIN][DATA_LISTENER][ self.config_entry.entry_id ] = self._hass.bus.async_listen_once( EVENT_HOMEASSISTANT_STOP, async_websocket_disconnect ) self.systems = await self._api.get_systems() for system in self.systems.values(): self._system_notifications[system.system_id] = set() self._hass.async_create_task( async_register_base_station( self._hass, system, self.config_entry.entry_id ) ) # API to ensure event-related attributes aren't empty on startup: try: self.initial_event_to_use[ system.system_id ] = await system.get_latest_event() except SimplipyError as err: LOGGER.error("Error while fetching initial event: %s", err) self.initial_event_to_use[system.system_id] = {} self.coordinator = DataUpdateCoordinator( self._hass, LOGGER, name=self.config_entry.data[CONF_USERNAME], update_interval=DEFAULT_SCAN_INTERVAL, update_method=self.async_update, ) async def async_update(self): async def async_update_system(system): await system.update(cached=system.version != 3) self._async_process_new_notifications(system) tasks = [async_update_system(system) for system in self.systems.values()] results = await asyncio.gather(*tasks, return_exceptions=True) for result in results: if isinstance(result, InvalidCredentialsError): if self._emergency_refresh_token_used: matching_flows = [ flow for flow in self._hass.config_entries.flow.async_progress() if flow["context"].get("source") == SOURCE_REAUTH and flow["context"].get("unique_id") == self.config_entry.unique_id ] if not matching_flows: self._hass.async_create_task( self._hass.config_entries.flow.async_init( DOMAIN, context={ "source": SOURCE_REAUTH, "unique_id": self.config_entry.unique_id, }, data=self.config_entry.data, ) ) LOGGER.error("Update failed with stored refresh token") raise UpdateFailed from result LOGGER.warning("SimpliSafe cloud error; trying stored refresh token") self._emergency_refresh_token_used = True try: await self._api.refresh_access_token( self.config_entry.data[CONF_TOKEN] ) return except SimplipyError as err: LOGGER.error("Error while using stored refresh token: %s", err) raise UpdateFailed from err if isinstance(result, EndpointUnavailable): LOGGER.info(result) raise UpdateFailed from result if isinstance(result, SimplipyError): LOGGER.error("SimpliSafe error while updating: %s", result) raise UpdateFailed from result if isinstance(result, Exception): LOGGER.error("Unknown error while updating: %s", result) raise UpdateFailed from result if self._api.refresh_token != self.config_entry.data[CONF_TOKEN]: _async_save_refresh_token( self._hass, self.config_entry, self._api.refresh_token ) if self._emergency_refresh_token_used: self._emergency_refresh_token_used = False class SimpliSafeEntity(CoordinatorEntity): def __init__(self, simplisafe, system, name, *, serial=None): super().__init__(simplisafe.coordinator) self._name = name self._online = True self._simplisafe = simplisafe self._system = system self.websocket_events_to_listen_for = [ EVENT_CONNECTION_LOST, EVENT_CONNECTION_RESTORED, ] if serial: self._serial = serial else: self._serial = system.serial try: sensor_type = EntityTypes( simplisafe.initial_event_to_use[system.system_id].get("sensorType") ) except ValueError: sensor_type = EntityTypes.unknown self._attrs = { ATTR_LAST_EVENT_INFO: simplisafe.initial_event_to_use[system.system_id].get( "info" ), ATTR_LAST_EVENT_SENSOR_NAME: simplisafe.initial_event_to_use[ system.system_id ].get("sensorName"), ATTR_LAST_EVENT_SENSOR_TYPE: sensor_type.name, ATTR_LAST_EVENT_TIMESTAMP: simplisafe.initial_event_to_use[ system.system_id ].get("eventTimestamp"), ATTR_SYSTEM_ID: system.system_id, } self._device_info = { "identifiers": {(DOMAIN, system.system_id)}, "manufacturer": "SimpliSafe", "model": system.version, "name": name, "via_device": (DOMAIN, system.serial), } @property def available(self): # the entity as available if: # 1. We can verify that the system is online (assuming True if we can't) return not (self._system.version == 3 and self._system.offline) and self._online @property def device_info(self): return self._device_info @property def device_state_attributes(self): return self._attrs @property def name(self): return f"{self._system.address} {self._name}" @property def unique_id(self): return self._serial @callback def _async_internal_update_from_websocket_event(self, event): if event.event_type == EVENT_CONNECTION_LOST: self._online = False elif event.event_type == EVENT_CONNECTION_RESTORED: self._online = True # websocket when the base station is offline. Just in case, we guard against # further action until connection is restored: if not self._online: return if event.sensor_type: sensor_type = event.sensor_type.name else: sensor_type = None self._attrs.update( { ATTR_LAST_EVENT_INFO: event.info, ATTR_LAST_EVENT_SENSOR_NAME: event.sensor_name, ATTR_LAST_EVENT_SENSOR_TYPE: sensor_type, ATTR_LAST_EVENT_TIMESTAMP: event.timestamp, } ) self.async_update_from_websocket_event(event) @callback def _handle_coordinator_update(self): self.async_update_from_rest_api() self.async_write_ha_state() @callback def _handle_websocket_update(self, event): # Ignore this event if it belongs to a system other than this one: if event.system_id != self._system.system_id: return # Ignore this event if this entity hasn't expressed interest in its type: if event.event_type not in self.websocket_events_to_listen_for: return if ( event.event_type in WEBSOCKET_EVENTS_REQUIRING_SERIAL and event.sensor_serial != self._serial ): return self._async_internal_update_from_websocket_event(event) self.async_write_ha_state() async def async_added_to_hass(self): await super().async_added_to_hass() self.async_on_remove( async_dispatcher_connect( self.hass, TOPIC_UPDATE_WEBSOCKET.format(self._system.system_id), self._handle_websocket_update, ) ) self.async_update_from_rest_api() @callback def async_update_from_rest_api(self): raise NotImplementedError() @callback def async_update_from_websocket_event(self, event): class SimpliSafeBaseSensor(SimpliSafeEntity): def __init__(self, simplisafe, system, sensor): super().__init__(simplisafe, system, sensor.name, serial=sensor.serial) self._device_info["identifiers"] = {(DOMAIN, sensor.serial)} self._device_info["model"] = sensor.type.name self._device_info["name"] = sensor.name self._sensor = sensor self._sensor_type_human_name = " ".join( [w.title() for w in self._sensor.type.name.split("_")] ) @property def name(self): return f"{self._system.address} {self._name} {self._sensor_type_human_name}"
true
true
f71e69e86ee5de49d09df8256001723a4356642b
4,280
py
Python
parsing/tracking_logs/generate_course_tracking_logs.py
andyzsf/edx_data_research
07a587edb1dc4797f116bfeb60ffecbf4ce5bd7a
[ "MIT" ]
null
null
null
parsing/tracking_logs/generate_course_tracking_logs.py
andyzsf/edx_data_research
07a587edb1dc4797f116bfeb60ffecbf4ce5bd7a
[ "MIT" ]
null
null
null
parsing/tracking_logs/generate_course_tracking_logs.py
andyzsf/edx_data_research
07a587edb1dc4797f116bfeb60ffecbf4ce5bd7a
[ "MIT" ]
null
null
null
''' This module will extract tracking logs for a given course and date range between when course enrollment start and when the course ended. For each log, the parent_data and meta_data from the course_structure collection will be appended to the log based on the event key in the log ''' import pymongo import sys from datetime import datetime import json def connect_to_db_collection(db_name, collection_name): ''' Return collection of a given database name and collection name ''' connection = pymongo.Connection('localhost', 27017) db = connection[db_name] collection = db[collection_name] return collection def load_config(config_file): ''' Return course ids and ranges of dates from which course specific tracking logs will be extracted ''' with open(config_file) as file_handler: data = json.load(file_handler) if not isinstance(data['course_ids'], list): raise ValueError('Expecting list of course ids') try: start_date = datetime.strptime(data['date_of_course_enrollment'], '%Y-%m-%d') end_date = datetime.strptime(data['date_of_course_completion'], '%Y-%m-%d') except ValueError: raise ValueError('Incorrect data format, should be YYYY-MM-DD') return data['course_ids'], start_date.date(), end_date.date() def append_course_structure_data(course_structure_collection, _id, document): ''' Append parent_data and metadata (if exists) from course structure to tracking log ''' try: data = course_structure_collection.find({"_id" : _id})[0] if 'parent_data' in data: document['parent_data'] = data['parent_data'] if 'metadata' in data: document['metadata'] = data['metadata'] except: pass def extract_tracking_logs(source_collection, destination_collection, course_structure_collection, course_ids, start_date, end_date): ''' Return all trackings logs that contain given ids and that contain dates within the given range ''' documents = source_collection.find({'course_id' : { '$in' : course_ids }}) for document in documents: if start_date <= datetime.strptime(document['time'].split('T')[0], "%Y-%m-%d").date() <= end_date: # Bind parent_data and metadata from course_structure to tracking document bound = False if document['event']: if isinstance(document['event'], dict): if 'id' in document['event']: splitted = document['event']['id'].split('-') if len(splitted) > 3: document['event']['id'] = splitted[-1] if not bound: append_course_structure_data(course_structure_collection, document['event']['id'], document) bound = True if document['page']: splitted = document['page'].split('/') if len(splitted) > 2: document['page'] = splitted[-2] if not bound: append_course_structure_data(course_structure_collection, document['page'], document) # End of binding, now insert document into collection destination_collection.insert(document) def main(): if len(sys.argv) != 6: usage_message = """usage: %s source_db destination_db course_config_file Provide name of course database to insert tracking logs to and config file to load configurations\n """ sys.stderr.write(usage_message % sys.argv[0]) sys.exit(1) source_db = sys.argv[1] destination_db = sys.argv[2] source_collection = connect_to_db_collection(source_db, 'tracking') destination_collection = connect_to_db_collection(destination_db, 'tracking') course_structure_collection = connect_to_db_collection(destination_db, 'course_structure') course_ids, start_date, end_date = load_config(sys.argv[3]) extract_tracking_logs(source_collection, destination_collection, course_structure_collection, course_ids, start_date, end_date) if __name__ == '__main__': main()
40
132
0.642991
import pymongo import sys from datetime import datetime import json def connect_to_db_collection(db_name, collection_name): connection = pymongo.Connection('localhost', 27017) db = connection[db_name] collection = db[collection_name] return collection def load_config(config_file): with open(config_file) as file_handler: data = json.load(file_handler) if not isinstance(data['course_ids'], list): raise ValueError('Expecting list of course ids') try: start_date = datetime.strptime(data['date_of_course_enrollment'], '%Y-%m-%d') end_date = datetime.strptime(data['date_of_course_completion'], '%Y-%m-%d') except ValueError: raise ValueError('Incorrect data format, should be YYYY-MM-DD') return data['course_ids'], start_date.date(), end_date.date() def append_course_structure_data(course_structure_collection, _id, document): try: data = course_structure_collection.find({"_id" : _id})[0] if 'parent_data' in data: document['parent_data'] = data['parent_data'] if 'metadata' in data: document['metadata'] = data['metadata'] except: pass def extract_tracking_logs(source_collection, destination_collection, course_structure_collection, course_ids, start_date, end_date): documents = source_collection.find({'course_id' : { '$in' : course_ids }}) for document in documents: if start_date <= datetime.strptime(document['time'].split('T')[0], "%Y-%m-%d").date() <= end_date: bound = False if document['event']: if isinstance(document['event'], dict): if 'id' in document['event']: splitted = document['event']['id'].split('-') if len(splitted) > 3: document['event']['id'] = splitted[-1] if not bound: append_course_structure_data(course_structure_collection, document['event']['id'], document) bound = True if document['page']: splitted = document['page'].split('/') if len(splitted) > 2: document['page'] = splitted[-2] if not bound: append_course_structure_data(course_structure_collection, document['page'], document) destination_collection.insert(document) def main(): if len(sys.argv) != 6: usage_message = """usage: %s source_db destination_db course_config_file Provide name of course database to insert tracking logs to and config file to load configurations\n """ sys.stderr.write(usage_message % sys.argv[0]) sys.exit(1) source_db = sys.argv[1] destination_db = sys.argv[2] source_collection = connect_to_db_collection(source_db, 'tracking') destination_collection = connect_to_db_collection(destination_db, 'tracking') course_structure_collection = connect_to_db_collection(destination_db, 'course_structure') course_ids, start_date, end_date = load_config(sys.argv[3]) extract_tracking_logs(source_collection, destination_collection, course_structure_collection, course_ids, start_date, end_date) if __name__ == '__main__': main()
true
true
f71e6aa4cc52a591b3bd382a510f0d28274d8670
2,419
py
Python
tests/test_endians.py
bwoodsend/rockhopper
7a4de06de69d68beed6f0f5d2961e8fb07fd62e6
[ "MIT" ]
1
2021-07-07T18:21:38.000Z
2021-07-07T18:21:38.000Z
tests/test_endians.py
bwoodsend/rockhopper
7a4de06de69d68beed6f0f5d2961e8fb07fd62e6
[ "MIT" ]
null
null
null
tests/test_endians.py
bwoodsend/rockhopper
7a4de06de69d68beed6f0f5d2961e8fb07fd62e6
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ """ import sys import ctypes import pytest from rockhopper._ragged_array import slug pytestmark = pytest.mark.order(1) def log_range(start, stop, base): while start < stop: # These sequences give a quick way to test the full range of an # integer type. yield start start *= base def test_log_range(): assert list(log_range(1, 10, 3)) == [1, 3, 9] @pytest.mark.parametrize("int_base", range(4)) def test_endian_swap(int_base): """Test the family of :c:`swap_endian_xx()` functions.""" bytes = (1 << int_base) bits = bytes * 8 swap = getattr(slug.dll, f"swap_endian_{bits}") for i in log_range(1, 1 << bytes, 3): assert swap(i).to_bytes(bytes, "big") == i.to_bytes(bytes, "little") def test_is_big_endian(): """Test :c:`is_big_endian()` matched :attr:`sys.byteorder`.""" assert slug.dll.is_big_endian() == (sys.byteorder == "big") def f_ptr(f): """Get the raw memory address of a :mod:`ctypes` function pointer.""" return ctypes.cast(f, ctypes.c_void_p).value @pytest.mark.parametrize("int_base", range(4)) @pytest.mark.parametrize("byteorder", ["little", "big"]) def test_int_write(int_base, byteorder): """ Test the family of :c:`write_xx()` and :c:`write_swap_xx()` integer writing functions and the selector :c:`choose_int_write()`. """ bytes = 1 << int_base bits = 8 * bytes native = sys.byteorder == byteorder # The real return type of `choose_int_write()` is `IntWrite` which is a # typedef (which cslug doesn't support) to a function pointer (which # cslug also doesn't support). We only need to test which function it # returns so raw a void pointer is sufficient. slug.dll.choose_int_write.restype = ctypes.c_void_p # Get the writer we expect to get. name = f"write_{bits}" if native else f"write_swap_{bits}" write = getattr(slug.dll, name) # Check it matches the output of choose_int_write()`. assert slug.dll.choose_int_write(int_base, byteorder == "big") == f_ptr(write) # Try writing an integer with it. x = 0x1122334455667788 & ((1 << bits) - 1) out = ctypes.create_string_buffer(bytes) write(x, out) assert list(out[:]) == list(x.to_bytes(bytes, byteorder)) read = getattr(slug.dll, name.replace("write", "read")) assert read(out) == x
29.5
76
0.646135
import sys import ctypes import pytest from rockhopper._ragged_array import slug pytestmark = pytest.mark.order(1) def log_range(start, stop, base): while start < stop: yield start start *= base def test_log_range(): assert list(log_range(1, 10, 3)) == [1, 3, 9] @pytest.mark.parametrize("int_base", range(4)) def test_endian_swap(int_base): bytes = (1 << int_base) bits = bytes * 8 swap = getattr(slug.dll, f"swap_endian_{bits}") for i in log_range(1, 1 << bytes, 3): assert swap(i).to_bytes(bytes, "big") == i.to_bytes(bytes, "little") def test_is_big_endian(): assert slug.dll.is_big_endian() == (sys.byteorder == "big") def f_ptr(f): return ctypes.cast(f, ctypes.c_void_p).value @pytest.mark.parametrize("int_base", range(4)) @pytest.mark.parametrize("byteorder", ["little", "big"]) def test_int_write(int_base, byteorder): bytes = 1 << int_base bits = 8 * bytes native = sys.byteorder == byteorder # cslug also doesn't support). We only need to test which function it slug.dll.choose_int_write.restype = ctypes.c_void_p name = f"write_{bits}" if native else f"write_swap_{bits}" write = getattr(slug.dll, name) assert slug.dll.choose_int_write(int_base, byteorder == "big") == f_ptr(write) x = 0x1122334455667788 & ((1 << bits) - 1) out = ctypes.create_string_buffer(bytes) write(x, out) assert list(out[:]) == list(x.to_bytes(bytes, byteorder)) read = getattr(slug.dll, name.replace("write", "read")) assert read(out) == x
true
true
f71e6b23d7feba00b1926a7f43eb59a12d8f6a40
5,720
py
Python
utils/catgirlmoe.py
Papyrus12/nekosu
d83315caf764376361cb9680b4297a0061d02305
[ "MIT" ]
null
null
null
utils/catgirlmoe.py
Papyrus12/nekosu
d83315caf764376361cb9680b4297a0061d02305
[ "MIT" ]
null
null
null
utils/catgirlmoe.py
Papyrus12/nekosu
d83315caf764376361cb9680b4297a0061d02305
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- import re from cmyui.discord import Webhook from cmyui.discord import Embed from objects import glob from objects.score import Score from objects.score import Grade from objects.player import Player from objects.beatmap import Beatmap from objects.match import Match from objects.match import Slot from constants.gamemodes import GameMode CHAT_HOOK = glob.config.webhooks['chat-bridge'] SCORE_HOOK = glob.config.webhooks['score-log'] GRADE_EMOTES = { Grade.XH: "<:grade_xh:833673474836660265>", Grade.SH: "<:grade_sh:833673474277900318>", Grade.X: "<:grade_x:833673474270167060>", Grade.S: "<:grade_s:833673474022572032>", Grade.A: "<:grade_a:833673433941934091>", Grade.B: "<:grade_b:833673434122289172>", Grade.C: "<:grade_c:833673433656721418>", Grade.D: "<:grade_d:833673433408733194>", Grade.F: "", Grade.N: "" } GRADE_COLORS = { Grade.XH: 0xE0F7FA, #Silver SS Grade.SH: 0xE0F7FA, #Silver S Grade.X: 0xFFEB3B, #SS Grade.S: 0xFFEB3B, #S Grade.A: 0x8BC34A, Grade.B: 0x2196F3, Grade.C: 0x9C27B0, Grade.D: 0xF44336, Grade.F: 0x212121, Grade.N: 0x212121 } MOD_EMOTES = { 'NF': "<:nf:833699841955201114>", 'EZ': "<:ez:833699842118647819>", 'TD': "TD", 'HD': "<:hd:833699841741422642>", 'HR': "<:hr:833699841644691456>", 'SD': "<:sd:833699840999424041>", 'DT': "<:dt:833699841741422645>", 'RX': "<:rx:833699841267597343>", 'HT': "<:ht:833699842022178847>", 'NC': "<:nc:833699841489895488>", 'FL': "<:fl:833699841510211588>", 'AU': "<:au:833699842269642762>", 'SO': "<:so:833699841287782441>", 'AP': "<:ap:833699842177368125>", 'PF': "<:pf:833699841510211585>", 'FI': "FI", 'RN': "RN", 'CN': "<:cn:833699841955201115>", 'TP': "<:tp:833699841288699944>", 'V2': "V2", 'MR': "MR", '1K': "1K", '2K': "2K", '3K': "3K", '4K': "4K", '5K': "5K", '6K': "6K", '7K': "7K", '8K': "8K", '9K': "9K", 'CO': "CO", } MODE_EMOTES = { GameMode.vn_std: "std", GameMode.vn_taiko: "taiko", GameMode.vn_catch: "catch", GameMode.vn_mania: "mania", GameMode.rx_std: "std (Rx)", GameMode.rx_taiko: "taiko (Rx)", GameMode.rx_catch: "catch (Rx)", GameMode.ap_std: "std (Ap)", } def sanitize(m: str): return m.replace("@", "[@]") async def sendSubmitScore(s: Score): wh = Webhook(url=SCORE_HOOK) diff=[f'{s.sr:.2f}★'] if s.mods: diff.insert(1, f'({"".join(map(lambda mod: MOD_EMOTES[mod], re.findall("..",repr(s.mods).replace("DTNC","NC"))))})') e = Embed(title=s.bmap.full, url=f'https://osu.ppy.sh/b/{s.bmap.id}',color=GRADE_COLORS[s.grade]) e.set_author(name=f'{s.player.name} achieved #{s.rank} in {MODE_EMOTES[s.mode]}', url=f'https://osu.catgirl.moe/u/{s.player.id}', icon_url=f'https://a.osu.catgirl.moe/{s.player.id}') e.add_field("Difficulty:", ' '.join(diff), True) e.add_field("Accuracy:", f'{s.acc:.2f}% {GRADE_EMOTES[s.grade]} ({s.pp:,.2f}pp)', True) e.add_field("Score:", f'{s.score:,} ({s.max_combo:,}/{s.bmap.max_combo:,}x)', True) e.set_image(url=f'https://assets.ppy.sh/beatmaps/{s.bmap.set_id}/covers/cover.jpg') wh.add_embed(e) await wh.post(glob.http) async def sendLogin(p: Player): wh = Webhook(url=CHAT_HOOK, content=f'📥 **{sanitize(p.name)}** has joined the game.') await wh.post(glob.http) async def sendLogout(p: Player): wh = Webhook(url=CHAT_HOOK, content=f'📤 **{sanitize(p.name)}** has left the game.') await wh.post(glob.http) async def sendRankMap(p: Player, b: Beatmap, s: str): wh = Webhook(url=CHAT_HOOK) e = Embed(title=b.full, url=f'https://osu.ppy.sh/b/{b.id}', color=0xE91E63) e.set_author(name=f'{p.name} {s} a map', url=f'https://osu.catgirl.moe/u/{p.id}', icon_url=f'https://a.osu.catgirl.moe/{p.id}') e.set_image(url=f'https://assets.ppy.sh/beatmaps/{b.set_id}/covers/cover.jpg') wh.add_embed(e) await wh.post(glob.http) async def sendSendMessage(p: Player, m: str): wh = Webhook(url=CHAT_HOOK, username=p.name, avatar_url=f'https://a.osu.catgirl.moe/{p.id}', content=sanitize(m)) await wh.post(glob.http) async def sendMatchCreate(p: Player, m: Match): wh = Webhook(url=CHAT_HOOK, content=f'⭐ **{sanitize(p.name)}** created lobby *"{sanitize(m.name)}"*.') await wh.post(glob.http) async def sendMatchJoin(p: Player, m: Match): wh = Webhook(url=CHAT_HOOK, content=f'➡️ **{sanitize(p.name)}** joined lobby *"{sanitize(m.name)}"*.') await wh.post(glob.http) async def sendMatchPart(p: Player, m: Match): wh = Webhook(url=CHAT_HOOK, content=f'⬅️ **{sanitize(p.name)}** left lobby *"{sanitize(m.name)}"*.') await wh.post(glob.http) async def sendMatchComplete(slots: list[Slot], m: Match): submitted, not_submitted = await m.await_submissions(slots) print(submitted) print(not_submitted) if submitted: player_names = [] player_accuracy = [] player_scores = [] wh = Webhook(url=CHAT_HOOK) bmap = next(iter(submitted)).recent_score.bmap e = Embed(title=bmap.full, url=f'https://osu.ppy.sh/b/{bmap.id}',color=0xF44336) for p, z in sorted(submitted.items(), key=lambda item: item[0].recent_score.score, reverse=True): s = p.recent_score player_names.append(p.name) player_accuracy.append(f'{s.acc:.2f}% {GRADE_EMOTES[s.grade]} ({s.pp:,.2f}pp)') player_scores.append(f'{s.score:,} ({s.max_combo:,}/{s.bmap.max_combo:,}x)') e.set_author(name=f'Lobby "{sanitize(m.name)}" finished a map') e.add_field("Players:", '\n'.join(player_names), True) e.add_field("Accuracy:", '\n'.join(player_accuracy), True) e.add_field("Score:", '\n'.join(player_scores), True) e.set_image(url=f'https://assets.ppy.sh/beatmaps/{bmap.set_id}/covers/cover.jpg') wh.add_embed(e) await wh.post(glob.http)
33.255814
184
0.65542
import re from cmyui.discord import Webhook from cmyui.discord import Embed from objects import glob from objects.score import Score from objects.score import Grade from objects.player import Player from objects.beatmap import Beatmap from objects.match import Match from objects.match import Slot from constants.gamemodes import GameMode CHAT_HOOK = glob.config.webhooks['chat-bridge'] SCORE_HOOK = glob.config.webhooks['score-log'] GRADE_EMOTES = { Grade.XH: "<:grade_xh:833673474836660265>", Grade.SH: "<:grade_sh:833673474277900318>", Grade.X: "<:grade_x:833673474270167060>", Grade.S: "<:grade_s:833673474022572032>", Grade.A: "<:grade_a:833673433941934091>", Grade.B: "<:grade_b:833673434122289172>", Grade.C: "<:grade_c:833673433656721418>", Grade.D: "<:grade_d:833673433408733194>", Grade.F: "", Grade.N: "" } GRADE_COLORS = { Grade.XH: 0xE0F7FA, Grade.SH: 0xE0F7FA, Grade.X: 0xFFEB3B, Grade.S: 0xFFEB3B, Grade.A: 0x8BC34A, Grade.B: 0x2196F3, Grade.C: 0x9C27B0, Grade.D: 0xF44336, Grade.F: 0x212121, Grade.N: 0x212121 } MOD_EMOTES = { 'NF': "<:nf:833699841955201114>", 'EZ': "<:ez:833699842118647819>", 'TD': "TD", 'HD': "<:hd:833699841741422642>", 'HR': "<:hr:833699841644691456>", 'SD': "<:sd:833699840999424041>", 'DT': "<:dt:833699841741422645>", 'RX': "<:rx:833699841267597343>", 'HT': "<:ht:833699842022178847>", 'NC': "<:nc:833699841489895488>", 'FL': "<:fl:833699841510211588>", 'AU': "<:au:833699842269642762>", 'SO': "<:so:833699841287782441>", 'AP': "<:ap:833699842177368125>", 'PF': "<:pf:833699841510211585>", 'FI': "FI", 'RN': "RN", 'CN': "<:cn:833699841955201115>", 'TP': "<:tp:833699841288699944>", 'V2': "V2", 'MR': "MR", '1K': "1K", '2K': "2K", '3K': "3K", '4K': "4K", '5K': "5K", '6K': "6K", '7K': "7K", '8K': "8K", '9K': "9K", 'CO': "CO", } MODE_EMOTES = { GameMode.vn_std: "std", GameMode.vn_taiko: "taiko", GameMode.vn_catch: "catch", GameMode.vn_mania: "mania", GameMode.rx_std: "std (Rx)", GameMode.rx_taiko: "taiko (Rx)", GameMode.rx_catch: "catch (Rx)", GameMode.ap_std: "std (Ap)", } def sanitize(m: str): return m.replace("@", "[@]") async def sendSubmitScore(s: Score): wh = Webhook(url=SCORE_HOOK) diff=[f'{s.sr:.2f}★'] if s.mods: diff.insert(1, f'({"".join(map(lambda mod: MOD_EMOTES[mod], re.findall("..",repr(s.mods).replace("DTNC","NC"))))})') e = Embed(title=s.bmap.full, url=f'https://osu.ppy.sh/b/{s.bmap.id}',color=GRADE_COLORS[s.grade]) e.set_author(name=f'{s.player.name} achieved #{s.rank} in {MODE_EMOTES[s.mode]}', url=f'https://osu.catgirl.moe/u/{s.player.id}', icon_url=f'https://a.osu.catgirl.moe/{s.player.id}') e.add_field("Difficulty:", ' '.join(diff), True) e.add_field("Accuracy:", f'{s.acc:.2f}% {GRADE_EMOTES[s.grade]} ({s.pp:,.2f}pp)', True) e.add_field("Score:", f'{s.score:,} ({s.max_combo:,}/{s.bmap.max_combo:,}x)', True) e.set_image(url=f'https://assets.ppy.sh/beatmaps/{s.bmap.set_id}/covers/cover.jpg') wh.add_embed(e) await wh.post(glob.http) async def sendLogin(p: Player): wh = Webhook(url=CHAT_HOOK, content=f'📥 **{sanitize(p.name)}** has joined the game.') await wh.post(glob.http) async def sendLogout(p: Player): wh = Webhook(url=CHAT_HOOK, content=f'📤 **{sanitize(p.name)}** has left the game.') await wh.post(glob.http) async def sendRankMap(p: Player, b: Beatmap, s: str): wh = Webhook(url=CHAT_HOOK) e = Embed(title=b.full, url=f'https://osu.ppy.sh/b/{b.id}', color=0xE91E63) e.set_author(name=f'{p.name} {s} a map', url=f'https://osu.catgirl.moe/u/{p.id}', icon_url=f'https://a.osu.catgirl.moe/{p.id}') e.set_image(url=f'https://assets.ppy.sh/beatmaps/{b.set_id}/covers/cover.jpg') wh.add_embed(e) await wh.post(glob.http) async def sendSendMessage(p: Player, m: str): wh = Webhook(url=CHAT_HOOK, username=p.name, avatar_url=f'https://a.osu.catgirl.moe/{p.id}', content=sanitize(m)) await wh.post(glob.http) async def sendMatchCreate(p: Player, m: Match): wh = Webhook(url=CHAT_HOOK, content=f'⭐ **{sanitize(p.name)}** created lobby *"{sanitize(m.name)}"*.') await wh.post(glob.http) async def sendMatchJoin(p: Player, m: Match): wh = Webhook(url=CHAT_HOOK, content=f'➡️ **{sanitize(p.name)}** joined lobby *"{sanitize(m.name)}"*.') await wh.post(glob.http) async def sendMatchPart(p: Player, m: Match): wh = Webhook(url=CHAT_HOOK, content=f'⬅️ **{sanitize(p.name)}** left lobby *"{sanitize(m.name)}"*.') await wh.post(glob.http) async def sendMatchComplete(slots: list[Slot], m: Match): submitted, not_submitted = await m.await_submissions(slots) print(submitted) print(not_submitted) if submitted: player_names = [] player_accuracy = [] player_scores = [] wh = Webhook(url=CHAT_HOOK) bmap = next(iter(submitted)).recent_score.bmap e = Embed(title=bmap.full, url=f'https://osu.ppy.sh/b/{bmap.id}',color=0xF44336) for p, z in sorted(submitted.items(), key=lambda item: item[0].recent_score.score, reverse=True): s = p.recent_score player_names.append(p.name) player_accuracy.append(f'{s.acc:.2f}% {GRADE_EMOTES[s.grade]} ({s.pp:,.2f}pp)') player_scores.append(f'{s.score:,} ({s.max_combo:,}/{s.bmap.max_combo:,}x)') e.set_author(name=f'Lobby "{sanitize(m.name)}" finished a map') e.add_field("Players:", '\n'.join(player_names), True) e.add_field("Accuracy:", '\n'.join(player_accuracy), True) e.add_field("Score:", '\n'.join(player_scores), True) e.set_image(url=f'https://assets.ppy.sh/beatmaps/{bmap.set_id}/covers/cover.jpg') wh.add_embed(e) await wh.post(glob.http)
true
true
f71e6b80047cea9a2670020af62cbeb40bc92652
1,412
py
Python
pygears/lib/reduce2.py
bogdanvuk/pygears
a0b21d445e1d5c89ad66751447b8253536b835ee
[ "MIT" ]
120
2018-04-23T08:29:04.000Z
2022-03-30T14:41:52.000Z
pygears/lib/reduce2.py
FZP1607152286/pygears
a0b21d445e1d5c89ad66751447b8253536b835ee
[ "MIT" ]
12
2019-07-09T17:12:58.000Z
2022-03-18T09:05:10.000Z
pygears/lib/reduce2.py
FZP1607152286/pygears
a0b21d445e1d5c89ad66751447b8253536b835ee
[ "MIT" ]
12
2019-05-10T19:42:08.000Z
2022-03-28T18:26:44.000Z
from pygears import gear, Intf from pygears.lib import czip from pygears.typing import Tuple, Uint, Union, Queue from pygears.lib import fmap, demux, decouple, fifo, union_collapse from pygears.lib import priority_mux, replicate TCfg = Tuple[{'reduce_size': Uint['w_reduce_size'], 'init': 't_acc'}] @gear def reduce2(din, cfg: TCfg, *, f, max_size): """Similar to the Python reduce function, applies a rolling computation to sequential pairs of values in a list. The ``din`` input is of type :class:`Queue` which holds the values to be used for computation while the ``cfg`` input is a :class:`Tuple` consisting of a ``reduce_size`` field and the ``init`` field holding the inital value. Args: f: Function to be performed max_size: Maximal length of the input `Queue` which is the depth of the FIFO used for storing intermediate values Returns: The result of the reduce operation """ acctype = cfg.dtype['init'] qtype = Queue[acctype, din.dtype.lvl - 1] temp_res = Intf(dtype=qtype) cfg_rep = cfg | replicate sec_opnd = (cfg_rep, temp_res) \ | priority_mux \ | fmap(f=union_collapse, fcat=czip, lvl=1) result = czip(din, sec_opnd) | decouple | fmap(f=f, fcat=czip, lvl=2) acc, fin_res = result | Union[qtype, qtype] | demux acc | fifo(intfs=[temp_res], depth=max_size) return fin_res
33.619048
79
0.67847
from pygears import gear, Intf from pygears.lib import czip from pygears.typing import Tuple, Uint, Union, Queue from pygears.lib import fmap, demux, decouple, fifo, union_collapse from pygears.lib import priority_mux, replicate TCfg = Tuple[{'reduce_size': Uint['w_reduce_size'], 'init': 't_acc'}] @gear def reduce2(din, cfg: TCfg, *, f, max_size): acctype = cfg.dtype['init'] qtype = Queue[acctype, din.dtype.lvl - 1] temp_res = Intf(dtype=qtype) cfg_rep = cfg | replicate sec_opnd = (cfg_rep, temp_res) \ | priority_mux \ | fmap(f=union_collapse, fcat=czip, lvl=1) result = czip(din, sec_opnd) | decouple | fmap(f=f, fcat=czip, lvl=2) acc, fin_res = result | Union[qtype, qtype] | demux acc | fifo(intfs=[temp_res], depth=max_size) return fin_res
true
true
f71e6cf1c4c87d2f388c85fe5d06ee0e82f8e1e9
13,098
py
Python
examples/char-lstm-classification.py
iamgroot42/opacus
51708309e71c030aa2bf15d6dccc7bcbbe9ed570
[ "Apache-2.0" ]
195
2019-12-11T23:55:47.000Z
2020-08-27T04:17:29.000Z
examples/char-lstm-classification.py
iamgroot42/opacus
51708309e71c030aa2bf15d6dccc7bcbbe9ed570
[ "Apache-2.0" ]
35
2020-01-21T11:04:29.000Z
2020-08-27T05:30:57.000Z
examples/char-lstm-classification.py
iamgroot42/opacus
51708309e71c030aa2bf15d6dccc7bcbbe9ed570
[ "Apache-2.0" ]
39
2020-01-04T20:05:20.000Z
2020-08-25T23:09:38.000Z
#!/usr/bin/env python3 # Copyright (c) Meta Platforms, Inc. and affiliates. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import argparse from collections import Counter from pathlib import Path from statistics import mean import torch import torch.nn as nn from opacus import PrivacyEngine from opacus.layers import DPGRU, DPLSTM, DPRNN from torch.nn.utils.rnn import pad_sequence from torch.utils.data import DataLoader, Dataset from tqdm import tqdm parser = argparse.ArgumentParser( description="PyTorch Name language classification DP Training", formatter_class=argparse.ArgumentDefaultsHelpFormatter, ) parser.add_argument( "--data-root", required=True, type=str, help="Path to training set of names (ie. ~/data/names/)", ) parser.add_argument( "--device", type=str, default="cuda", help="GPU ID for this process", ) parser.add_argument( "-b", "--batch-size", default=800, type=int, metavar="N", help="mini-batch size", ) parser.add_argument( "--mode", default="lstm", choices=["lstm", "gru", "rnn"], help="recursive network type", ) parser.add_argument( "--embedding-size", default=64, type=int, help="Character embedding dimension" ) parser.add_argument( "--hidden-size", default=128, type=int, help="hidden state dimensions" ) parser.add_argument("--n-layers", default=1, type=int, help="How many layers to use") parser.add_argument( "--test-every", default=0, type=int, help="Run evaluation on the test every these many epochs", ) parser.add_argument( "--bidirectional", action="store_true", default=False, help="If turned on, makes the RNN bidirectional", ) parser.add_argument( "--learning-rate", default=2.0, type=float, metavar="LR", help="initial learning rate", ) parser.add_argument("--epochs", type=int, default=10, help="Number of training epochs") parser.add_argument( "--train-split", type=float, default=0.8, help="Fraction of data to utilize for training (rest for evaluation)", ) parser.add_argument( "--sigma", type=float, default=1.0, metavar="S", help="Noise multiplier", ) parser.add_argument( "-c", "--max-per-sample-grad-norm", type=float, default=1.5, metavar="C", help="Clip per-sample gradients to this norm", ) parser.add_argument( "--disable-dp", action="store_true", default=False, help="Disable privacy training and just train with vanilla SGD", ) parser.add_argument( "--secure-rng", action="store_true", default=False, help="Enable Secure RNG to have trustworthy privacy guarantees. Comes at a performance cost", ) parser.add_argument( "--delta", type=float, default=8e-5, metavar="D", help="Target delta", ) parser.add_argument( "--print-every", type=int, default=5, help="Print the evaluation accuracy every these many iterations", ) class CharByteEncoder(nn.Module): """ This encoder takes a UTF-8 string and encodes its bytes into a Tensor. It can also perform the opposite operation to check a result. Examples: >>> encoder = CharByteEncoder() >>> t = encoder('Ślusàrski') # returns tensor([256, 197, 154, 108, 117, 115, 195, 160, 114, 115, 107, 105, 257]) >>> encoder.decode(t) # returns "<s>Ślusàrski</s>" """ def __init__(self): super().__init__() self.start_token = "<s>" self.end_token = "</s>" self.pad_token = "<pad>" self.start_idx = 256 self.end_idx = 257 self.pad_idx = 258 def forward(self, s: str, pad_to=0) -> torch.LongTensor: """ Encodes a string. It will append a start token <s> (id=self.start_idx) and an end token </s> (id=self.end_idx). Args: s: The string to encode. pad_to: If not zero, pad by appending self.pad_idx until string is of length `pad_to`. Defaults to 0. Returns: The encoded LongTensor of indices. """ encoded = s.encode() n_pad = pad_to - len(encoded) if pad_to > len(encoded) else 0 return torch.LongTensor( [self.start_idx] + [c for c in encoded] # noqa + [self.end_idx] + [self.pad_idx for _ in range(n_pad)] ) def decode(self, char_ids_tensor: torch.LongTensor) -> str: """ The inverse of `forward`. Keeps the start, end and pad indices. """ char_ids = char_ids_tensor.cpu().detach().tolist() out = [] buf = [] for c in char_ids: if c < 256: buf.append(c) else: if buf: out.append(bytes(buf).decode()) buf = [] if c == self.start_idx: out.append(self.start_token) elif c == self.end_idx: out.append(self.end_token) elif c == self.pad_idx: out.append(self.pad_token) if buf: # in case some are left out.append(bytes(buf).decode()) return "".join(out) def __len__(self): """ The length of our encoder space. This is fixed to 256 (one byte) + 3 special chars (start, end, pad). Returns: 259 """ return 259 class NamesDataset(Dataset): def __init__(self, root): self.root = Path(root) self.labels = list({langfile.stem for langfile in self.root.iterdir()}) self.labels_dict = {label: i for i, label in enumerate(self.labels)} self.encoder = CharByteEncoder() self.samples = self.construct_samples() def __getitem__(self, i): return self.samples[i] def __len__(self): return len(self.samples) def construct_samples(self): samples = [] for langfile in self.root.iterdir(): label_name = langfile.stem label_id = self.labels_dict[label_name] with open(langfile, "r") as fin: for row in fin: samples.append( (self.encoder(row.strip()), torch.tensor(label_id).long()) ) return samples def label_count(self): cnt = Counter() for _x, y in self.samples: label = self.labels[int(y)] cnt[label] += 1 return cnt VOCAB_SIZE = 256 + 3 # 256 alternatives in one byte, plus 3 special characters. class CharNNClassifier(nn.Module): def __init__( self, rnn_type, embedding_size, hidden_size, output_size, num_layers=1, bidirectional=False, vocab_size=VOCAB_SIZE, ): super().__init__() self.embedding_size = embedding_size self.hidden_size = hidden_size self.output_size = output_size self.vocab_size = vocab_size self.embedding = nn.Embedding(vocab_size, embedding_size) self.rnn = rnn_type( embedding_size, hidden_size, num_layers=num_layers, bidirectional=bidirectional, batch_first=True, ) self.out_layer = nn.Linear(hidden_size, output_size) def forward(self, x, hidden=None): x = self.embedding(x) # -> [B, T, D] x, _ = self.rnn(x, hidden) # -> [B, T, H] x = x[:, -1, :] # -> [B, H] x = self.out_layer(x) # -> [B, C] return x def padded_collate(batch, padding_idx=0): x = pad_sequence( [elem[0] for elem in batch], batch_first=True, padding_value=padding_idx ) y = torch.stack([elem[1] for elem in batch]).long() return x, y def train( model, criterion, optimizer, train_loader, epoch, privacy_engine, target_delta, device="cuda:0", ): model.train() accs = [] losses = [] for x, y in tqdm(train_loader): x = x.to(device) y = y.to(device) logits = model(x) loss = criterion(logits, y) loss.backward() optimizer.step() optimizer.zero_grad() preds = logits.argmax(-1) n_correct = float(preds.eq(y).sum()) batch_accuracy = n_correct / len(y) accs.append(batch_accuracy) losses.append(float(loss)) printstr = ( f"\t Epoch {epoch}. Accuracy: {mean(accs):.6f} | Loss: {mean(losses):.6f}" ) try: epsilon, best_alpha = privacy_engine.accountant.get_privacy_spent( delta=target_delta ) printstr += f" | (ε = {epsilon:.2f}, δ = {target_delta}) for α = {best_alpha}" except AttributeError: pass print(printstr) return def test(model, test_loader, privacy_engine, target_delta, device="cuda:0"): model.eval() accs = [] with torch.no_grad(): for x, y in tqdm(test_loader): x = x.to(device) y = y.to(device) preds = model(x).argmax(-1) n_correct = float(preds.eq(y).sum()) batch_accuracy = n_correct / len(y) accs.append(batch_accuracy) mean_acc = mean(accs) printstr = "\n----------------------------\n" f"Test Accuracy: {mean_acc:.6f}" if privacy_engine: epsilon, best_alpha = privacy_engine.accountant.get_privacy_spent( delta=target_delta ) printstr += f" (ε = {epsilon:.2f}, δ = {target_delta}) for α = {best_alpha}" print(printstr + "\n----------------------------\n") return mean_acc def main(): args = parser.parse_args() device = torch.device(args.device) ds = NamesDataset(args.data_root) train_len = int(args.train_split * len(ds)) test_len = len(ds) - train_len print(f"{train_len} samples for training, {test_len} for testing") if args.secure_rng: try: import torchcsprng as prng except ImportError as e: msg = ( "To use secure RNG, you must install the torchcsprng package! " "Check out the instructions here: https://github.com/pytorch/csprng#installation" ) raise ImportError(msg) from e generator = prng.create_random_device_generator("/dev/urandom") else: generator = None train_ds, test_ds = torch.utils.data.random_split( ds, [train_len, test_len], generator=generator ) if args.mode == "rnn": rnn_type = DPRNN elif args.mode == "gru": rnn_type = DPGRU elif args.mode == "lstm": rnn_type = DPLSTM else: raise ValueError(f"Invalid network type: {args.mode}") model = CharNNClassifier( rnn_type, args.embedding_size, args.hidden_size, len(ds.labels), args.n_layers, args.bidirectional, ) model = model.to(device) train_ds, test_ds = torch.utils.data.random_split( ds, [train_len, test_len], generator=generator ) train_loader = DataLoader( train_ds, batch_size=args.batch_size, num_workers=1, pin_memory=True, collate_fn=padded_collate, ) test_loader = DataLoader( test_ds, batch_size=2 * args.batch_size, shuffle=False, num_workers=1, pin_memory=True, collate_fn=padded_collate, ) criterion = nn.CrossEntropyLoss() optimizer = torch.optim.SGD(model.parameters(), lr=args.learning_rate) if not args.disable_dp: privacy_engine = PrivacyEngine(secure_mode=args.secure_rng) model, optimizer, train_loader = privacy_engine.make_private( module=model, optimizer=optimizer, data_loader=train_loader, noise_multiplier=args.sigma, max_grad_norm=args.max_per_sample_grad_norm, ) else: privacy_engine = None print(f"Train stats ({args.mode}): \n") for epoch in tqdm(range(args.epochs)): train( model, criterion, optimizer, train_loader, epoch, privacy_engine, args.delta, device=device, ) if args.test_every: if epoch % args.test_every == 0: test(model, test_loader, privacy_engine, args.delta, device=device) mean_acc = test(model, test_loader, privacy_engine, args.delta, device=device) torch.save(mean_acc, f"run_results_chr_{args.mode}_classification.pt") if __name__ == "__main__": main()
27.574737
117
0.595358
import argparse from collections import Counter from pathlib import Path from statistics import mean import torch import torch.nn as nn from opacus import PrivacyEngine from opacus.layers import DPGRU, DPLSTM, DPRNN from torch.nn.utils.rnn import pad_sequence from torch.utils.data import DataLoader, Dataset from tqdm import tqdm parser = argparse.ArgumentParser( description="PyTorch Name language classification DP Training", formatter_class=argparse.ArgumentDefaultsHelpFormatter, ) parser.add_argument( "--data-root", required=True, type=str, help="Path to training set of names (ie. ~/data/names/)", ) parser.add_argument( "--device", type=str, default="cuda", help="GPU ID for this process", ) parser.add_argument( "-b", "--batch-size", default=800, type=int, metavar="N", help="mini-batch size", ) parser.add_argument( "--mode", default="lstm", choices=["lstm", "gru", "rnn"], help="recursive network type", ) parser.add_argument( "--embedding-size", default=64, type=int, help="Character embedding dimension" ) parser.add_argument( "--hidden-size", default=128, type=int, help="hidden state dimensions" ) parser.add_argument("--n-layers", default=1, type=int, help="How many layers to use") parser.add_argument( "--test-every", default=0, type=int, help="Run evaluation on the test every these many epochs", ) parser.add_argument( "--bidirectional", action="store_true", default=False, help="If turned on, makes the RNN bidirectional", ) parser.add_argument( "--learning-rate", default=2.0, type=float, metavar="LR", help="initial learning rate", ) parser.add_argument("--epochs", type=int, default=10, help="Number of training epochs") parser.add_argument( "--train-split", type=float, default=0.8, help="Fraction of data to utilize for training (rest for evaluation)", ) parser.add_argument( "--sigma", type=float, default=1.0, metavar="S", help="Noise multiplier", ) parser.add_argument( "-c", "--max-per-sample-grad-norm", type=float, default=1.5, metavar="C", help="Clip per-sample gradients to this norm", ) parser.add_argument( "--disable-dp", action="store_true", default=False, help="Disable privacy training and just train with vanilla SGD", ) parser.add_argument( "--secure-rng", action="store_true", default=False, help="Enable Secure RNG to have trustworthy privacy guarantees. Comes at a performance cost", ) parser.add_argument( "--delta", type=float, default=8e-5, metavar="D", help="Target delta", ) parser.add_argument( "--print-every", type=int, default=5, help="Print the evaluation accuracy every these many iterations", ) class CharByteEncoder(nn.Module): def __init__(self): super().__init__() self.start_token = "<s>" self.end_token = "</s>" self.pad_token = "<pad>" self.start_idx = 256 self.end_idx = 257 self.pad_idx = 258 def forward(self, s: str, pad_to=0) -> torch.LongTensor: encoded = s.encode() n_pad = pad_to - len(encoded) if pad_to > len(encoded) else 0 return torch.LongTensor( [self.start_idx] + [c for c in encoded] + [self.end_idx] + [self.pad_idx for _ in range(n_pad)] ) def decode(self, char_ids_tensor: torch.LongTensor) -> str: char_ids = char_ids_tensor.cpu().detach().tolist() out = [] buf = [] for c in char_ids: if c < 256: buf.append(c) else: if buf: out.append(bytes(buf).decode()) buf = [] if c == self.start_idx: out.append(self.start_token) elif c == self.end_idx: out.append(self.end_token) elif c == self.pad_idx: out.append(self.pad_token) if buf: out.append(bytes(buf).decode()) return "".join(out) def __len__(self): return 259 class NamesDataset(Dataset): def __init__(self, root): self.root = Path(root) self.labels = list({langfile.stem for langfile in self.root.iterdir()}) self.labels_dict = {label: i for i, label in enumerate(self.labels)} self.encoder = CharByteEncoder() self.samples = self.construct_samples() def __getitem__(self, i): return self.samples[i] def __len__(self): return len(self.samples) def construct_samples(self): samples = [] for langfile in self.root.iterdir(): label_name = langfile.stem label_id = self.labels_dict[label_name] with open(langfile, "r") as fin: for row in fin: samples.append( (self.encoder(row.strip()), torch.tensor(label_id).long()) ) return samples def label_count(self): cnt = Counter() for _x, y in self.samples: label = self.labels[int(y)] cnt[label] += 1 return cnt VOCAB_SIZE = 256 + 3 class CharNNClassifier(nn.Module): def __init__( self, rnn_type, embedding_size, hidden_size, output_size, num_layers=1, bidirectional=False, vocab_size=VOCAB_SIZE, ): super().__init__() self.embedding_size = embedding_size self.hidden_size = hidden_size self.output_size = output_size self.vocab_size = vocab_size self.embedding = nn.Embedding(vocab_size, embedding_size) self.rnn = rnn_type( embedding_size, hidden_size, num_layers=num_layers, bidirectional=bidirectional, batch_first=True, ) self.out_layer = nn.Linear(hidden_size, output_size) def forward(self, x, hidden=None): x = self.embedding(x) x, _ = self.rnn(x, hidden) x = x[:, -1, :] x = self.out_layer(x) return x def padded_collate(batch, padding_idx=0): x = pad_sequence( [elem[0] for elem in batch], batch_first=True, padding_value=padding_idx ) y = torch.stack([elem[1] for elem in batch]).long() return x, y def train( model, criterion, optimizer, train_loader, epoch, privacy_engine, target_delta, device="cuda:0", ): model.train() accs = [] losses = [] for x, y in tqdm(train_loader): x = x.to(device) y = y.to(device) logits = model(x) loss = criterion(logits, y) loss.backward() optimizer.step() optimizer.zero_grad() preds = logits.argmax(-1) n_correct = float(preds.eq(y).sum()) batch_accuracy = n_correct / len(y) accs.append(batch_accuracy) losses.append(float(loss)) printstr = ( f"\t Epoch {epoch}. Accuracy: {mean(accs):.6f} | Loss: {mean(losses):.6f}" ) try: epsilon, best_alpha = privacy_engine.accountant.get_privacy_spent( delta=target_delta ) printstr += f" | (ε = {epsilon:.2f}, δ = {target_delta}) for α = {best_alpha}" except AttributeError: pass print(printstr) return def test(model, test_loader, privacy_engine, target_delta, device="cuda:0"): model.eval() accs = [] with torch.no_grad(): for x, y in tqdm(test_loader): x = x.to(device) y = y.to(device) preds = model(x).argmax(-1) n_correct = float(preds.eq(y).sum()) batch_accuracy = n_correct / len(y) accs.append(batch_accuracy) mean_acc = mean(accs) printstr = "\n----------------------------\n" f"Test Accuracy: {mean_acc:.6f}" if privacy_engine: epsilon, best_alpha = privacy_engine.accountant.get_privacy_spent( delta=target_delta ) printstr += f" (ε = {epsilon:.2f}, δ = {target_delta}) for α = {best_alpha}" print(printstr + "\n----------------------------\n") return mean_acc def main(): args = parser.parse_args() device = torch.device(args.device) ds = NamesDataset(args.data_root) train_len = int(args.train_split * len(ds)) test_len = len(ds) - train_len print(f"{train_len} samples for training, {test_len} for testing") if args.secure_rng: try: import torchcsprng as prng except ImportError as e: msg = ( "To use secure RNG, you must install the torchcsprng package! " "Check out the instructions here: https://github.com/pytorch/csprng#installation" ) raise ImportError(msg) from e generator = prng.create_random_device_generator("/dev/urandom") else: generator = None train_ds, test_ds = torch.utils.data.random_split( ds, [train_len, test_len], generator=generator ) if args.mode == "rnn": rnn_type = DPRNN elif args.mode == "gru": rnn_type = DPGRU elif args.mode == "lstm": rnn_type = DPLSTM else: raise ValueError(f"Invalid network type: {args.mode}") model = CharNNClassifier( rnn_type, args.embedding_size, args.hidden_size, len(ds.labels), args.n_layers, args.bidirectional, ) model = model.to(device) train_ds, test_ds = torch.utils.data.random_split( ds, [train_len, test_len], generator=generator ) train_loader = DataLoader( train_ds, batch_size=args.batch_size, num_workers=1, pin_memory=True, collate_fn=padded_collate, ) test_loader = DataLoader( test_ds, batch_size=2 * args.batch_size, shuffle=False, num_workers=1, pin_memory=True, collate_fn=padded_collate, ) criterion = nn.CrossEntropyLoss() optimizer = torch.optim.SGD(model.parameters(), lr=args.learning_rate) if not args.disable_dp: privacy_engine = PrivacyEngine(secure_mode=args.secure_rng) model, optimizer, train_loader = privacy_engine.make_private( module=model, optimizer=optimizer, data_loader=train_loader, noise_multiplier=args.sigma, max_grad_norm=args.max_per_sample_grad_norm, ) else: privacy_engine = None print(f"Train stats ({args.mode}): \n") for epoch in tqdm(range(args.epochs)): train( model, criterion, optimizer, train_loader, epoch, privacy_engine, args.delta, device=device, ) if args.test_every: if epoch % args.test_every == 0: test(model, test_loader, privacy_engine, args.delta, device=device) mean_acc = test(model, test_loader, privacy_engine, args.delta, device=device) torch.save(mean_acc, f"run_results_chr_{args.mode}_classification.pt") if __name__ == "__main__": main()
true
true
f71e6d57516ab998da824cc8373fa30884176384
8,384
py
Python
tensorflow_datasets/object_detection/voc.py
ChAnYaNG97/datasets
0a45e2ea98716d325fc1c5e5494f2575f3bdb908
[ "Apache-2.0" ]
1
2020-10-11T19:15:49.000Z
2020-10-11T19:15:49.000Z
tensorflow_datasets/object_detection/voc.py
ChAnYaNG97/datasets
0a45e2ea98716d325fc1c5e5494f2575f3bdb908
[ "Apache-2.0" ]
null
null
null
tensorflow_datasets/object_detection/voc.py
ChAnYaNG97/datasets
0a45e2ea98716d325fc1c5e5494f2575f3bdb908
[ "Apache-2.0" ]
1
2020-08-03T20:19:12.000Z
2020-08-03T20:19:12.000Z
# coding=utf-8 # Copyright 2020 The TensorFlow Datasets Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """PASCAL VOC datasets.""" import os import xml.etree.ElementTree import tensorflow.compat.v2 as tf import tensorflow_datasets.public_api as tfds _VOC_CITATION = """\ @misc{{pascal-voc-{year}, author = "Everingham, M. and Van~Gool, L. and Williams, C. K. I. and Winn, J. and Zisserman, A.", title = "The {{PASCAL}} {{V}}isual {{O}}bject {{C}}lasses {{C}}hallenge {year} {{(VOC{year})}} {{R}}esults", howpublished = "http://www.pascal-network.org/challenges/VOC/voc{year}/workshop/index.html"}} """ _VOC_DESCRIPTION = """\ This dataset contains the data from the PASCAL Visual Object Classes Challenge {year}, a.k.a. VOC{year}, corresponding to the Classification and Detection competitions. A total of {num_images} images are included in this dataset, where each image contains a set of objects, out of 20 different classes, making a total of {num_objects} annotated objects. In the Classification competition, the goal is to predict the set of labels contained in the image, while in the Detection competition the goal is to predict the bounding box and label of each individual object. WARNING: As per the official dataset, the test set of VOC2012 does not contain annotations. """ _VOC_URL = "http://host.robots.ox.ac.uk/pascal/VOC/voc{year}/" # Original site, it is down very often. # _VOC_DATA_URL = "http://host.robots.ox.ac.uk/pascal/VOC/voc{year}/" # Data mirror: _VOC_DATA_URL = "http://pjreddie.com/media/files/" _VOC_LABELS = ( "aeroplane", "bicycle", "bird", "boat", "bottle", "bus", "car", "cat", "chair", "cow", "diningtable", "dog", "horse", "motorbike", "person", "pottedplant", "sheep", "sofa", "train", "tvmonitor", ) _VOC_POSES = ( "frontal", "rear", "left", "right", "unspecified", ) def _get_example_objects(annon_filepath): """Function to get all the objects from the annotation XML file.""" with tf.io.gfile.GFile(annon_filepath, "r") as f: root = xml.etree.ElementTree.parse(f).getroot() # Disable pytype to avoid attribute-error due to find returning # Optional[Element] # pytype: disable=attribute-error size = root.find("size") width = float(size.find("width").text) height = float(size.find("height").text) for obj in root.findall("object"): # Get object's label name. label = obj.find("name").text.lower() # Get objects' pose name. pose = obj.find("pose").text.lower() is_truncated = (obj.find("truncated").text == "1") is_difficult = (obj.find("difficult").text == "1") bndbox = obj.find("bndbox") xmax = float(bndbox.find("xmax").text) xmin = float(bndbox.find("xmin").text) ymax = float(bndbox.find("ymax").text) ymin = float(bndbox.find("ymin").text) yield { "label": label, "pose": pose, "bbox": tfds.features.BBox( ymin / height, xmin / width, ymax / height, xmax / width), "is_truncated": is_truncated, "is_difficult": is_difficult, } # pytype: enable=attribute-error class VocConfig(tfds.core.BuilderConfig): """BuilderConfig for Voc.""" def __init__( self, year=None, filenames=None, has_test_annotations=True, **kwargs): self.year = year self.filenames = filenames self.has_test_annotations = has_test_annotations super(VocConfig, self).__init__( name=year, # Version history: # 4.0.0: Added BuildConfig and 2012 version support, deprecate Voc2007. # 3.0.0: S3 with new hashing function (different shuffle). # 2.0.0: S3 (new shuffling, sharding and slicing mechanism). version=tfds.core.Version("4.0.0"), **kwargs) class Voc(tfds.core.GeneratorBasedBuilder): """Pascal VOC 2007 or 2012.""" BUILDER_CONFIGS = [ VocConfig( year="2007", description=_VOC_DESCRIPTION.format( year=2007, num_images=9963, num_objects=24640), filenames={ "trainval": "VOCtrainval_06-Nov-2007.tar", "test": "VOCtest_06-Nov-2007.tar", }, has_test_annotations=True, ), VocConfig( year="2012", description=_VOC_DESCRIPTION.format( year=2012, num_images=11540, num_objects=27450), filenames={ "trainval": "VOCtrainval_11-May-2012.tar", "test": "VOC2012test.tar", }, has_test_annotations=False, ), ] def _info(self): return tfds.core.DatasetInfo( builder=self, description=self.builder_config.description, features=tfds.features.FeaturesDict({ "image": tfds.features.Image(), "image/filename": tfds.features.Text(), "objects": tfds.features.Sequence({ "label": tfds.features.ClassLabel(names=_VOC_LABELS), "bbox": tfds.features.BBoxFeature(), "pose": tfds.features.ClassLabel(names=_VOC_POSES), "is_truncated": tf.bool, "is_difficult": tf.bool, }), "labels": tfds.features.Sequence( tfds.features.ClassLabel(names=_VOC_LABELS)), "labels_no_difficult": tfds.features.Sequence( tfds.features.ClassLabel(names=_VOC_LABELS)), }), homepage=_VOC_URL.format(year=self.builder_config.year), citation=_VOC_CITATION.format(year=self.builder_config.year), ) def _split_generators(self, dl_manager): paths = dl_manager.download_and_extract({ k: os.path.join(_VOC_DATA_URL, v) for k, v in self.builder_config.filenames.items() }) return [ tfds.core.SplitGenerator( name=tfds.Split.TEST, gen_kwargs=dict(data_path=paths["test"], set_name="test")), tfds.core.SplitGenerator( name=tfds.Split.TRAIN, gen_kwargs=dict(data_path=paths["trainval"], set_name="train")), tfds.core.SplitGenerator( name=tfds.Split.VALIDATION, gen_kwargs=dict(data_path=paths["trainval"], set_name="val")), ] def _generate_examples(self, data_path, set_name): """Yields examples.""" set_filepath = os.path.join( data_path, os.path.normpath("VOCdevkit/VOC{}/ImageSets/Main/{}.txt".format( self.builder_config.year, set_name))) load_annotations = ( self.builder_config.has_test_annotations or set_name != "test") with tf.io.gfile.GFile(set_filepath, "r") as f: for line in f: image_id = line.strip() example = self._generate_example(data_path, image_id, load_annotations) yield image_id, example def _generate_example(self, data_path, image_id, load_annotations): image_filepath = os.path.join( data_path, os.path.normpath("VOCdevkit/VOC{}/JPEGImages/{}.jpg".format( self.builder_config.year, image_id))) annon_filepath = os.path.join( data_path, os.path.normpath("VOCdevkit/VOC{}/Annotations/{}.xml".format( self.builder_config.year, image_id))) if load_annotations: objects = list(_get_example_objects(annon_filepath)) # Use set() to remove duplicates labels = sorted(set(obj["label"] for obj in objects)) labels_no_difficult = sorted(set( obj["label"] for obj in objects if obj["is_difficult"] == 0 )) else: # The test set of VOC2012 does not contain annotations objects = [] labels = [] labels_no_difficult = [] return { "image": image_filepath, "image/filename": image_id + ".jpg", "objects": objects, "labels": labels, "labels_no_difficult": labels_no_difficult, }
34.933333
109
0.637643
import os import xml.etree.ElementTree import tensorflow.compat.v2 as tf import tensorflow_datasets.public_api as tfds _VOC_CITATION = """\ @misc{{pascal-voc-{year}, author = "Everingham, M. and Van~Gool, L. and Williams, C. K. I. and Winn, J. and Zisserman, A.", title = "The {{PASCAL}} {{V}}isual {{O}}bject {{C}}lasses {{C}}hallenge {year} {{(VOC{year})}} {{R}}esults", howpublished = "http://www.pascal-network.org/challenges/VOC/voc{year}/workshop/index.html"}} """ _VOC_DESCRIPTION = """\ This dataset contains the data from the PASCAL Visual Object Classes Challenge {year}, a.k.a. VOC{year}, corresponding to the Classification and Detection competitions. A total of {num_images} images are included in this dataset, where each image contains a set of objects, out of 20 different classes, making a total of {num_objects} annotated objects. In the Classification competition, the goal is to predict the set of labels contained in the image, while in the Detection competition the goal is to predict the bounding box and label of each individual object. WARNING: As per the official dataset, the test set of VOC2012 does not contain annotations. """ _VOC_URL = "http://host.robots.ox.ac.uk/pascal/VOC/voc{year}/" _VOC_DATA_URL = "http://pjreddie.com/media/files/" _VOC_LABELS = ( "aeroplane", "bicycle", "bird", "boat", "bottle", "bus", "car", "cat", "chair", "cow", "diningtable", "dog", "horse", "motorbike", "person", "pottedplant", "sheep", "sofa", "train", "tvmonitor", ) _VOC_POSES = ( "frontal", "rear", "left", "right", "unspecified", ) def _get_example_objects(annon_filepath): with tf.io.gfile.GFile(annon_filepath, "r") as f: root = xml.etree.ElementTree.parse(f).getroot() size = root.find("size") width = float(size.find("width").text) height = float(size.find("height").text) for obj in root.findall("object"): label = obj.find("name").text.lower() # Get objects' pose name. pose = obj.find("pose").text.lower() is_truncated = (obj.find("truncated").text == "1") is_difficult = (obj.find("difficult").text == "1") bndbox = obj.find("bndbox") xmax = float(bndbox.find("xmax").text) xmin = float(bndbox.find("xmin").text) ymax = float(bndbox.find("ymax").text) ymin = float(bndbox.find("ymin").text) yield { "label": label, "pose": pose, "bbox": tfds.features.BBox( ymin / height, xmin / width, ymax / height, xmax / width), "is_truncated": is_truncated, "is_difficult": is_difficult, } class VocConfig(tfds.core.BuilderConfig): def __init__( self, year=None, filenames=None, has_test_annotations=True, **kwargs): self.year = year self.filenames = filenames self.has_test_annotations = has_test_annotations super(VocConfig, self).__init__( name=year, version=tfds.core.Version("4.0.0"), **kwargs) class Voc(tfds.core.GeneratorBasedBuilder): BUILDER_CONFIGS = [ VocConfig( year="2007", description=_VOC_DESCRIPTION.format( year=2007, num_images=9963, num_objects=24640), filenames={ "trainval": "VOCtrainval_06-Nov-2007.tar", "test": "VOCtest_06-Nov-2007.tar", }, has_test_annotations=True, ), VocConfig( year="2012", description=_VOC_DESCRIPTION.format( year=2012, num_images=11540, num_objects=27450), filenames={ "trainval": "VOCtrainval_11-May-2012.tar", "test": "VOC2012test.tar", }, has_test_annotations=False, ), ] def _info(self): return tfds.core.DatasetInfo( builder=self, description=self.builder_config.description, features=tfds.features.FeaturesDict({ "image": tfds.features.Image(), "image/filename": tfds.features.Text(), "objects": tfds.features.Sequence({ "label": tfds.features.ClassLabel(names=_VOC_LABELS), "bbox": tfds.features.BBoxFeature(), "pose": tfds.features.ClassLabel(names=_VOC_POSES), "is_truncated": tf.bool, "is_difficult": tf.bool, }), "labels": tfds.features.Sequence( tfds.features.ClassLabel(names=_VOC_LABELS)), "labels_no_difficult": tfds.features.Sequence( tfds.features.ClassLabel(names=_VOC_LABELS)), }), homepage=_VOC_URL.format(year=self.builder_config.year), citation=_VOC_CITATION.format(year=self.builder_config.year), ) def _split_generators(self, dl_manager): paths = dl_manager.download_and_extract({ k: os.path.join(_VOC_DATA_URL, v) for k, v in self.builder_config.filenames.items() }) return [ tfds.core.SplitGenerator( name=tfds.Split.TEST, gen_kwargs=dict(data_path=paths["test"], set_name="test")), tfds.core.SplitGenerator( name=tfds.Split.TRAIN, gen_kwargs=dict(data_path=paths["trainval"], set_name="train")), tfds.core.SplitGenerator( name=tfds.Split.VALIDATION, gen_kwargs=dict(data_path=paths["trainval"], set_name="val")), ] def _generate_examples(self, data_path, set_name): set_filepath = os.path.join( data_path, os.path.normpath("VOCdevkit/VOC{}/ImageSets/Main/{}.txt".format( self.builder_config.year, set_name))) load_annotations = ( self.builder_config.has_test_annotations or set_name != "test") with tf.io.gfile.GFile(set_filepath, "r") as f: for line in f: image_id = line.strip() example = self._generate_example(data_path, image_id, load_annotations) yield image_id, example def _generate_example(self, data_path, image_id, load_annotations): image_filepath = os.path.join( data_path, os.path.normpath("VOCdevkit/VOC{}/JPEGImages/{}.jpg".format( self.builder_config.year, image_id))) annon_filepath = os.path.join( data_path, os.path.normpath("VOCdevkit/VOC{}/Annotations/{}.xml".format( self.builder_config.year, image_id))) if load_annotations: objects = list(_get_example_objects(annon_filepath)) labels = sorted(set(obj["label"] for obj in objects)) labels_no_difficult = sorted(set( obj["label"] for obj in objects if obj["is_difficult"] == 0 )) else: objects = [] labels = [] labels_no_difficult = [] return { "image": image_filepath, "image/filename": image_id + ".jpg", "objects": objects, "labels": labels, "labels_no_difficult": labels_no_difficult, }
true
true
f71e6de94e01412e6319d7bc86f671f1d05aba6e
82,678
py
Python
electrum_dash/dash_ps.py
STR1017/electrum-dash
f0e3f16c506239bb2f7cf6920464a24706760876
[ "MIT" ]
1
2021-04-05T15:50:33.000Z
2021-04-05T15:50:33.000Z
electrum_dash/dash_ps.py
STR1017/electrum-dash
f0e3f16c506239bb2f7cf6920464a24706760876
[ "MIT" ]
null
null
null
electrum_dash/dash_ps.py
STR1017/electrum-dash
f0e3f16c506239bb2f7cf6920464a24706760876
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- import asyncio import copy import random import time import threading from collections import deque from uuid import uuid4 from . import util from .dash_msg import PRIVATESEND_ENTRY_MAX_SIZE from .dash_ps_net import PSMixSession, PRIVATESEND_SESSION_MSG_TIMEOUT from .dash_ps_wallet import (PSDataMixin, PSKeystoreMixin, KeyPairsMixin, KPStates, NotFoundInKeypairs, AddPSDataError, SignWithKeypairsFailed) from .dash_ps_util import (PSOptsMixin, PSUtilsMixin, PSGUILogHandler, PSManLogAdapter, PSCoinRounds, PSStates, PS_DENOMS_DICT, COLLATERAL_VAL, MIN_DENOM_VAL, CREATE_COLLATERAL_VAL, CREATE_COLLATERAL_VALS, PSTxWorkflow, PSDenominateWorkflow, calc_tx_fee) from .dash_tx import PSTxTypes, SPEC_TX_NAMES, CTxIn from .logging import Logger from .transaction import Transaction, PartialTxOutput, PartialTransaction from .util import (NoDynamicFeeEstimates, log_exceptions, SilentTaskGroup, NotEnoughFunds, bfh, is_android) from .i18n import _ PS_DENOM_REVERSE_DICT = {int(v): k for k, v in PS_DENOMS_DICT.items()} class TooManyUtxos(Exception): """Thrown when creating new denoms/collateral txs from coins""" class TooLargeUtxoVal(Exception): """Thrown when creating new collateral txs from coins""" class PSManager(Logger, PSKeystoreMixin, PSDataMixin, PSOptsMixin, PSUtilsMixin, KeyPairsMixin): '''Class representing wallet PrivateSend manager''' LOGGING_SHORTCUT = 'A' ADD_PS_DATA_ERR_MSG = _('Error on adding PrivateSend transaction data.') SPEND_TO_PS_ADDRS_MSG = _('For privacy reasons blocked attempt to' ' transfer coins to PrivateSend address.') WATCHING_ONLY_MSG = _('This is a watching-only wallet.' ' Mixing can not be run.') ALL_MIXED_MSG = _('PrivateSend mixing is done') CLEAR_PS_DATA_MSG = _('Are you sure to clear all wallet PrivateSend data?' ' This is not recommended if there is' ' no particular need.') NO_NETWORK_MSG = _('Can not start mixing. Network is not available') NO_DASH_NET_MSG = _('Can not start mixing. DashNet is not available') LLMQ_DATA_NOT_READY = _('LLMQ quorums data is not fully loaded.') MNS_DATA_NOT_READY = _('Masternodes data is not fully loaded.') NOT_ENABLED_MSG = _('PrivateSend mixing is not enabled') INITIALIZING_MSG = _('PrivateSend mixing is initializing.' ' Please try again soon') MIXING_ALREADY_RUNNING_MSG = _('PrivateSend mixing is already running.') MIXING_NOT_RUNNING_MSG = _('PrivateSend mixing is not running.') FIND_UNTRACKED_RUN_MSG = _('PrivateSend mixing can not start. Process of' ' finding untracked PS transactions' ' is currently run') ERRORED_MSG = _('PrivateSend mixing can not start.' ' Please check errors in PS Log tab') UNKNOWN_STATE_MSG = _('PrivateSend mixing can not start.' ' Unknown state: {}') WAIT_MIXING_STOP_MSG = _('Mixing is not stopped. If mixing sessions ends' ' prematurely additional pay collateral may be' ' paid. Do you really want to close wallet?') NO_NETWORK_STOP_MSG = _('Network is not available') OTHER_COINS_ARRIVED_MSG1 = _('Some unknown coins arrived on addresses' ' reserved for PrivateSend use, txid: {}.') OTHER_COINS_ARRIVED_MSG2 = _('WARNING: it is not recommended to spend' ' these coins in regular transactions!') OTHER_COINS_ARRIVED_MSG3 = _('You can use these coins in PrivateSend' ' mixing process by manually selecting UTXO' ' and creating new denoms or new collateral,' ' depending on UTXO value.') OTHER_COINS_ARRIVED_Q = _('Do you want to use other coins now?') if is_android(): NO_DYNAMIC_FEE_MSG = _('{}\n\nYou can switch fee estimation method' ' on send screen') OTHER_COINS_ARRIVED_MSG4 = _('You can view and use these coins from' ' Coins popup from PrivateSend options.') else: NO_DYNAMIC_FEE_MSG = _('{}\n\nYou can switch to static fee estimation' ' on Fees Preferences tab') OTHER_COINS_ARRIVED_MSG4 = _('You can view and use these coins from' ' Coins tab.') def __init__(self, wallet): Logger.__init__(self) PSDataMixin.__init__(self, wallet) PSKeystoreMixin.__init__(self, wallet) KeyPairsMixin.__init__(self, wallet) PSOptsMixin.__init__(self, wallet) PSUtilsMixin.__init__(self, wallet) self.log_handler = PSGUILogHandler(self) self.logger = PSManLogAdapter(self.logger, {'psman_id': id(self)}) self.state_lock = threading.Lock() self.states = s = PSStates self.mixing_running_states = [s.StartMixing, s.Mixing, s.StopMixing] self.no_clean_history_states = [s.Initializing, s.Errored, s.StartMixing, s.Mixing, s.StopMixing, s.FindingUntracked] self.config = wallet.config self._state = PSStates.Unsupported self.wallet_types_supported = ['standard'] self.keystore_types_supported = ['bip32', 'hardware'] keystore = wallet.db.get('keystore') if keystore: self.w_ks_type = keystore.get('type', 'unknown') else: self.w_ks_type = 'unknown' self.w_type = wallet.wallet_type if (self.w_type in self.wallet_types_supported and self.w_ks_type in self.keystore_types_supported): if wallet.db.get_ps_data('ps_enabled', False): self.state = PSStates.Initializing else: self.state = PSStates.Disabled if self.unsupported: supported_w = ', '.join(self.wallet_types_supported) supported_ks = ', '.join(self.keystore_types_supported) this_type = self.w_type this_ks_type = self.w_ks_type self.unsupported_msg = _(f'PrivateSend is currently supported on' f' next wallet types: "{supported_w}"' f' and keystore types: "{supported_ks}".' f'\n\nThis wallet has type "{this_type}"' f' and kestore type "{this_ks_type}".') else: self.unsupported_msg = '' if self.is_hw_ks: self.enable_ps_keystore() self.network = None self.dash_net = None self.loop = None self._loop_thread = None self.main_taskgroup = None self.mix_sessions_lock = asyncio.Lock() self.mix_sessions = {} # dict peer -> PSMixSession self.recent_mixes_mns = deque([], 10) # added from mixing sessions self.denoms_lock = threading.Lock() self.collateral_lock = threading.Lock() self.others_lock = threading.Lock() self.new_denoms_wfl_lock = threading.Lock() self.new_collateral_wfl_lock = threading.Lock() self.pay_collateral_wfl_lock = threading.Lock() self.denominate_wfl_lock = threading.Lock() self._not_enough_funds = False # electrum network disconnect time self.disconnect_time = 0 @property def unsupported(self): return self.state == PSStates.Unsupported @property def enabled(self): return self.state not in [PSStates.Unsupported, PSStates.Disabled] @property def is_hw_ks(self): return self.w_ks_type == 'hardware' def enable_ps(self): if (self.w_type == 'standard' and self.is_hw_ks and 'ps_keystore' not in self.wallet.db.data): self.logger.info('ps_keystore for hw wallets must be created') return if not self.enabled: self.wallet.db.set_ps_data('ps_enabled', True) coro = self._enable_ps() asyncio.run_coroutine_threadsafe(coro, self.loop) async def _enable_ps(self): if self.enabled: return self.state = PSStates.Initializing util.trigger_callback('ps-state-changes', self.wallet, None, None) _load_and_cleanup = self.load_and_cleanup await self.loop.run_in_executor(None, _load_and_cleanup) await self.find_untracked_ps_txs() self.wallet.save_db() def can_find_untracked(self): w = self.wallet network = self.network if network is None: return False server_height = network.get_server_height() if server_height == 0: return False local_height = network.get_local_height() if local_height < server_height: return False with w.lock: unverified_no_islock = [] for txid in w.unverified_tx: if txid not in w.db.islocks: unverified_no_islock.append(txid) if (unverified_no_islock or not w.is_up_to_date() or not w.synchronizer.is_up_to_date()): return False return True @property def state(self): return self._state @property def is_waiting(self): if self.state not in self.mixing_running_states: return False if self.keypairs_state in [KPStates.NeedCache, KPStates.Caching]: return False active_wfls_cnt = 0 active_wfls_cnt += len(self.denominate_wfl_list) if self.new_denoms_wfl: active_wfls_cnt += 1 if self.new_collateral_wfl: active_wfls_cnt += 1 return (active_wfls_cnt == 0) @state.setter def state(self, state): self._state = state def on_network_start(self, network): self.network = network util.register_callback(self.on_wallet_updated, ['wallet_updated']) util.register_callback(self.on_network_status, ['status']) self.dash_net = network.dash_net self.loop = network.asyncio_loop self._loop_thread = network._loop_thread asyncio.ensure_future(self.clean_keypairs_on_timeout()) asyncio.ensure_future(self.cleanup_staled_denominate_wfls()) asyncio.ensure_future(self.trigger_postponed_notifications()) asyncio.ensure_future(self.broadcast_new_denoms_new_collateral_wfls()) def on_stop_threads(self): if self.state == PSStates.Mixing: self.stop_mixing() util.unregister_callback(self.on_wallet_updated) util.unregister_callback(self.on_network_status) def on_network_status(self, event, *args): connected = self.network.is_connected() if connected: self.disconnect_time = 0 else: now = time.time() if self.disconnect_time == 0: self.disconnect_time = now if now - self.disconnect_time > 30: # disconnected for 30 seconds if self.state == PSStates.Mixing: self.stop_mixing(self.NO_NETWORK_STOP_MSG) async def on_wallet_updated(self, event, *args): if not self.enabled: return w = args[0] if w != self.wallet: return if w.is_up_to_date(): self._not_enough_funds = False if self.state in [PSStates.Initializing, PSStates.Ready]: await self.find_untracked_ps_txs() # Methods related to mixing process def start_mixing(self, password, nowait=True): w = self.wallet msg = None if w.is_watching_only(): msg = self.WATCHING_ONLY_MSG, 'err' elif self.all_mixed: msg = self.ALL_MIXED_MSG, 'inf' elif not self.network or not self.network.is_connected(): msg = self.NO_NETWORK_MSG, 'err' elif not self.dash_net.run_dash_net: msg = self.NO_DASH_NET_MSG, 'err' if msg: msg, inf = msg self.logger.info(f'Can not start PrivateSend Mixing: {msg}') util.trigger_callback('ps-state-changes', w, msg, inf) return coro = self.find_untracked_ps_txs() asyncio.run_coroutine_threadsafe(coro, self.loop).result() with self.state_lock: if self.state == PSStates.Ready: self.state = PSStates.StartMixing elif self.state in [PSStates.Unsupported, PSStates.Disabled]: msg = self.NOT_ENABLED_MSG elif self.state == PSStates.Initializing: msg = self.INITIALIZING_MSG elif self.state in self.mixing_running_states: msg = self.MIXING_ALREADY_RUNNING_MSG elif self.state == PSStates.FindingUntracked: msg = self.FIND_UNTRACKED_RUN_MSG elif self.state == PSStates.FindingUntracked: msg = self.ERRORED_MSG else: msg = self.UNKNOWN_STATE_MSG.format(self.state) if msg: util.trigger_callback('ps-state-changes', w, msg, None) self.logger.info(f'Can not start PrivateSend Mixing: {msg}') return else: util.trigger_callback('ps-state-changes', w, None, None) fut = asyncio.run_coroutine_threadsafe(self._start_mixing(password), self.loop) if nowait: return try: fut.result(timeout=2) except (asyncio.TimeoutError, asyncio.CancelledError): pass async def _start_mixing(self, password): if not self.enabled or not self.network: return assert not self.main_taskgroup self._not_enough_funds = False self.main_taskgroup = main_taskgroup = SilentTaskGroup() self.logger.info('Starting PrivateSend Mixing') async def main(): try: async with main_taskgroup as group: if (self.w_type == 'standard' and self.is_hw_ks): await group.spawn(self._prepare_funds_from_hw_wallet()) await group.spawn(self._make_keypairs_cache(password)) await group.spawn(self._check_not_enough_funds()) await group.spawn(self._check_all_mixed()) await group.spawn(self._maintain_pay_collateral_tx()) await group.spawn(self._maintain_collateral_amount()) await group.spawn(self._maintain_denoms()) await group.spawn(self._mix_denoms()) except Exception as e: self.logger.info(f'error starting mixing: {str(e)}') raise e asyncio.run_coroutine_threadsafe(main(), self.loop) with self.state_lock: self.state = PSStates.Mixing self.last_mix_start_time = time.time() self.logger.info('Started PrivateSend Mixing') w = self.wallet util.trigger_callback('ps-state-changes', w, None, None) async def stop_mixing_from_async_thread(self, msg, msg_type=None): await self.loop.run_in_executor(None, self.stop_mixing, msg, msg_type) def stop_mixing(self, msg=None, msg_type=None, nowait=True): w = self.wallet with self.state_lock: if self.state == PSStates.Mixing: self.state = PSStates.StopMixing elif self.state == PSStates.StopMixing: return else: msg = self.MIXING_NOT_RUNNING_MSG util.trigger_callback('ps-state-changes', w, msg, 'inf') self.logger.info(f'Can not stop PrivateSend Mixing: {msg}') return if msg: self.logger.info(f'Stopping PrivateSend Mixing: {msg}') if not msg_type or not msg_type.startswith('inf'): stopped_prefix = _('PrivateSend mixing is stopping!') msg = f'{stopped_prefix}\n\n{msg}' util.trigger_callback('ps-state-changes', w, msg, msg_type) else: self.logger.info('Stopping PrivateSend Mixing') util.trigger_callback('ps-state-changes', w, None, None) self.last_mix_stop_time = time.time() # write early if later time lost fut = asyncio.run_coroutine_threadsafe(self._stop_mixing(), self.loop) if nowait: return try: fut.result(timeout=PRIVATESEND_SESSION_MSG_TIMEOUT+5) except (asyncio.TimeoutError, asyncio.CancelledError): pass @log_exceptions async def _stop_mixing(self): if self.keypairs_state == KPStates.Caching: self.logger.info('Waiting for keypairs caching to finish') while self.keypairs_state == KPStates.Caching: await asyncio.sleep(0.5) if self.main_taskgroup: sess_cnt = len(self.mix_sessions) if sess_cnt > 0: self.logger.info(f'Waiting for {sess_cnt}' f' mixing sessions to finish') while sess_cnt > 0: await asyncio.sleep(0.5) sess_cnt = len(self.mix_sessions) try: await asyncio.wait_for(self.main_taskgroup.cancel_remaining(), timeout=2) except (asyncio.TimeoutError, asyncio.CancelledError) as e: self.logger.debug(f'Exception during main_taskgroup' f' cancellation: {repr(e)}') self.main_taskgroup = None with self.keypairs_state_lock: if self.keypairs_state == KPStates.Ready: self.logger.info('Mark keypairs as unused') self.keypairs_state = KPStates.Unused self.logger.info('Stopped PrivateSend Mixing') self.last_mix_stop_time = time.time() with self.state_lock: self.state = PSStates.Ready w = self.wallet util.trigger_callback('ps-state-changes', w, None, None) async def _check_all_mixed(self): while not self.main_taskgroup.closed(): await asyncio.sleep(10) if self.all_mixed: await self.stop_mixing_from_async_thread(self.ALL_MIXED_MSG, 'inf') async def _check_not_enough_funds(self): while not self.main_taskgroup.closed(): if self._not_enough_funds: await asyncio.sleep(30) self._not_enough_funds = False await asyncio.sleep(5) async def _maintain_pay_collateral_tx(self): kp_wait_state = KPStates.Ready if self.need_password() else None while not self.main_taskgroup.closed(): wfl = self.pay_collateral_wfl if wfl: if not wfl.completed or not wfl.tx_order: await self.cleanup_pay_collateral_wfl() elif self.ps_collateral_cnt > 0: if kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('Pay collateral workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue if not self.get_confirmed_ps_collateral_data(): await asyncio.sleep(5) continue await self.prepare_pay_collateral_wfl() await asyncio.sleep(0.25) async def broadcast_new_denoms_new_collateral_wfls(self): w = self.wallet while True: if self.enabled: wfl = self.new_denoms_wfl if wfl and wfl.completed and wfl.next_to_send(w): await self.broadcast_new_denoms_wfl() await asyncio.sleep(0.25) wfl = self.new_collateral_wfl if wfl and wfl.completed and wfl.next_to_send(w): await self.broadcast_new_collateral_wfl() await asyncio.sleep(0.25) else: await asyncio.sleep(1) async def _maintain_collateral_amount(self): kp_wait_state = KPStates.Ready if self.need_password() else None while not self.main_taskgroup.closed(): wfl = self.new_collateral_wfl if wfl: if not wfl.completed or not wfl.tx_order: await self.cleanup_new_collateral_wfl() elif (not self._not_enough_funds and not self.ps_collateral_cnt and not self.calc_need_denoms_amounts(use_cache=True)): coins = await self.get_next_coins_for_mixing(for_denoms=False) if not coins: await asyncio.sleep(5) continue if not self.check_llmq_ready(): self.logger.info(_('New collateral workflow: {}') .format(self.LLMQ_DATA_NOT_READY)) await asyncio.sleep(5) continue elif kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('New collateral workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue await self.create_new_collateral_wfl() await asyncio.sleep(0.25) async def _maintain_denoms(self): kp_wait_state = KPStates.Ready if self.need_password() else None while not self.main_taskgroup.closed(): wfl = self.new_denoms_wfl if wfl: if not wfl.completed or not wfl.tx_order: await self.cleanup_new_denoms_wfl() elif (not self._not_enough_funds and self.calc_need_denoms_amounts(use_cache=True)): coins = await self.get_next_coins_for_mixing() if not coins: await asyncio.sleep(5) continue if not self.check_llmq_ready(): self.logger.info(_('New denoms workflow: {}') .format(self.LLMQ_DATA_NOT_READY)) await asyncio.sleep(5) continue elif kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('New denoms workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue await self.create_new_denoms_wfl() await asyncio.sleep(0.25) async def _mix_denoms(self): kp_wait_state = KPStates.Ready if self.need_password() else None def _cleanup(): for uuid in self.denominate_wfl_list: wfl = self.get_denominate_wfl(uuid) if wfl and not wfl.completed: self._cleanup_denominate_wfl(wfl) await self.loop.run_in_executor(None, _cleanup) main_taskgroup = self.main_taskgroup while not main_taskgroup.closed(): if (self._denoms_to_mix_cache and self.pay_collateral_wfl and self.active_denominate_wfl_cnt < self.max_sessions): if not self.check_llmq_ready(): self.logger.info(_('Denominate workflow: {}') .format(self.LLMQ_DATA_NOT_READY)) await asyncio.sleep(5) continue elif not self.check_protx_info_completeness(): self.logger.info(_('Denominate workflow: {}') .format(self.MNS_DATA_NOT_READY)) await asyncio.sleep(5) continue elif kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('Denominate workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue if self.state == PSStates.Mixing: await main_taskgroup.spawn(self.start_denominate_wfl()) await asyncio.sleep(0.25) async def start_mix_session(self, denom_value, dsq, wfl_lid): n_denom = PS_DENOMS_DICT[denom_value] sess = PSMixSession(self, denom_value, n_denom, dsq, wfl_lid) peer_str = sess.peer_str async with self.mix_sessions_lock: if peer_str in self.mix_sessions: raise Exception(f'Session with {peer_str} already exists') await sess.run_peer() self.mix_sessions[peer_str] = sess return sess async def stop_mix_session(self, peer_str): async with self.mix_sessions_lock: sess = self.mix_sessions.pop(peer_str) if not sess: self.logger.debug(f'Peer {peer_str} not found in mix_session') return sess.close_peer() return sess # Workflow methods for pay collateral transaction def get_confirmed_ps_collateral_data(self): w = self.wallet for outpoint, ps_collateral in w.db.get_ps_collaterals().items(): addr, value = ps_collateral utxos = w.get_utxos([addr], min_rounds=PSCoinRounds.COLLATERAL, confirmed_only=True, consider_islocks=True) utxos = self.filter_out_hw_ks_coins(utxos) inputs = [] for utxo in utxos: if utxo.prevout.to_str() != outpoint: continue w.add_input_info(utxo) inputs.append(utxo) if inputs: return outpoint, value, inputs else: self.logger.wfl_err(f'ps_collateral outpoint {outpoint}' f' is not confirmed') async def prepare_pay_collateral_wfl(self): try: _prepare = self._prepare_pay_collateral_tx res = await self.loop.run_in_executor(None, _prepare) if res: txid, wfl = res self.logger.wfl_ok(f'Completed pay collateral workflow with' f' tx: {txid}, workflow: {wfl.lid}') self.wallet.save_db() except Exception as e: wfl = self.pay_collateral_wfl if wfl: self.logger.wfl_err(f'Error creating pay collateral tx:' f' {str(e)}, workflow: {wfl.lid}') await self.cleanup_pay_collateral_wfl(force=True) else: self.logger.wfl_err(f'Error during creation of pay collateral' f' worfklow: {str(e)}') type_e = type(e) msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG if msg: await self.stop_mixing_from_async_thread(msg) def _prepare_pay_collateral_tx(self): with self.pay_collateral_wfl_lock: if self.pay_collateral_wfl: return uuid = str(uuid4()) wfl = PSTxWorkflow(uuid=uuid) self.set_pay_collateral_wfl(wfl) self.logger.info(f'Started up pay collateral workflow: {wfl.lid}') res = self.get_confirmed_ps_collateral_data() if not res: raise Exception('No confirmed ps_collateral found') outpoint, value, inputs = res # check input addresses is in keypairs if keypairs cache available if self._keypairs_cache: input_addrs = [utxo.address for utxo in inputs] not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') self.add_ps_spending_collateral(outpoint, wfl.uuid) if value >= COLLATERAL_VAL*2: ovalue = value - COLLATERAL_VAL output_addr = None for addr, data in self.wallet.db.get_ps_reserved().items(): if data == outpoint: output_addr = addr break if not output_addr: reserved = self.reserve_addresses(1, for_change=True, data=outpoint) output_addr = reserved[0] outputs = [PartialTxOutput.from_address_and_value(output_addr, ovalue)] else: # OP_RETURN as ouptut script outputs = [PartialTxOutput(scriptpubkey=bfh('6a'), value=0)] tx = PartialTransaction.from_io(inputs[:], outputs[:], locktime=0) tx.inputs()[0].nsequence = 0xffffffff tx = self.sign_transaction(tx, None) txid = tx.txid() raw_tx = tx.serialize_to_network() tx_type = PSTxTypes.PAY_COLLATERAL wfl.add_tx(txid=txid, raw_tx=raw_tx, tx_type=tx_type) wfl.completed = True with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if not saved: raise Exception('pay_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('pay_collateral_wfl differs from original') self.set_pay_collateral_wfl(wfl) return txid, wfl async def cleanup_pay_collateral_wfl(self, force=False): _cleanup = self._cleanup_pay_collateral_wfl changed = await self.loop.run_in_executor(None, _cleanup, force) if changed: self.wallet.save_db() def _cleanup_pay_collateral_wfl(self, force=False): with self.pay_collateral_wfl_lock: wfl = self.pay_collateral_wfl if not wfl or wfl.completed and wfl.tx_order and not force: return w = self.wallet if wfl.tx_order: for txid in wfl.tx_order[::-1]: # use reversed tx_order if w.db.get_transaction(txid): w.remove_transaction(txid) else: self._cleanup_pay_collateral_wfl_tx_data(txid) else: self._cleanup_pay_collateral_wfl_tx_data() return True def _cleanup_pay_collateral_wfl_tx_data(self, txid=None): with self.pay_collateral_wfl_lock: wfl = self.pay_collateral_wfl if not wfl: return if txid: tx_data = wfl.pop_tx(txid) if tx_data: self.set_pay_collateral_wfl(wfl) self.logger.info(f'Cleaned up pay collateral tx:' f' {txid}, workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_collaterals().items()): if uuid != wfl.uuid: continue with self.collateral_lock: self.pop_ps_spending_collateral(outpoint) with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_pay_collateral_wfl() self.logger.info(f'Cleaned up pay collateral workflow: {wfl.lid}') def _search_pay_collateral_wfl(self, txid, tx): err = self._check_pay_collateral_tx_err(txid, tx, full_check=False) if not err: wfl = self.pay_collateral_wfl if wfl and wfl.tx_order and txid in wfl.tx_order: return wfl def _check_on_pay_collateral_wfl(self, txid, tx): wfl = self._search_pay_collateral_wfl(txid, tx) err = self._check_pay_collateral_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_pay_collateral_wfl(self, txid, tx): wfl = self._search_pay_collateral_wfl(txid, tx) if not wfl: return with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if not saved or saved.uuid != wfl.uuid: return tx_data = wfl.pop_tx(txid) if tx_data: self.set_pay_collateral_wfl(wfl) self.logger.wfl_done(f'Processed tx: {txid} from pay' f' collateral workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_collaterals().items()): if uuid != wfl.uuid: continue with self.collateral_lock: self.pop_ps_spending_collateral(outpoint) with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_pay_collateral_wfl() self.logger.wfl_done(f'Finished processing of pay collateral' f' workflow: {wfl.lid}') def get_pay_collateral_tx(self): wfl = self.pay_collateral_wfl if not wfl or not wfl.tx_order: return txid = wfl.tx_order[0] tx_data = wfl.tx_data.get(txid) if not tx_data: return return tx_data.raw_tx # Workflow methods for new collateral transaction def new_collateral_from_coins_info(self, coins): if not coins or len(coins) > 1: return coins_val = sum([c.value_sats() for c in coins]) if (coins_val >= self.min_new_denoms_from_coins_val or coins_val < self.min_new_collateral_from_coins_val): return fee_per_kb = self.config.fee_per_kb() for collateral_val in CREATE_COLLATERAL_VALS[::-1]: new_collateral_fee = calc_tx_fee(1, 1, fee_per_kb, max_size=True) if coins_val - new_collateral_fee >= collateral_val: tx_type = SPEC_TX_NAMES[PSTxTypes.NEW_COLLATERAL] info = _('Transactions type: {}').format(tx_type) info += '\n' info += _('Count of transactions: {}').format(1) info += '\n' info += _('Total sent amount: {}').format(coins_val) info += '\n' info += _('Total output amount: {}').format(collateral_val) info += '\n' info += _('Total fee: {}').format(coins_val - collateral_val) return info def create_new_collateral_wfl_from_gui(self, coins, password): if self.state in self.mixing_running_states: return None, ('Can not create new collateral as mixing' ' process is currently run.') if len(coins) > 1: return None, ('Can not create new collateral amount,' ' too many coins selected') wfl = self._start_new_collateral_wfl() if not wfl: return None, ('Can not create new collateral as other new' ' collateral creation process is in progress') try: w = self.wallet txid, tx = self._make_new_collateral_tx(wfl, coins, password) if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') if not w.db.get_ps_tx(txid)[0] == PSTxTypes.NEW_COLLATERAL: self._add_ps_data(txid, tx, PSTxTypes.NEW_COLLATERAL) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs from original') wfl.completed = True self.set_new_collateral_wfl(wfl) self.logger.wfl_ok(f'Completed new collateral workflow' f' with tx: {txid},' f' workflow: {wfl.lid}') return wfl, None except Exception as e: err = str(e) self.logger.wfl_err(f'Error creating new collateral tx:' f' {err}, workflow: {wfl.lid}') self._cleanup_new_collateral_wfl(force=True) self.logger.info(f'Cleaned up new collateral workflow:' f' {wfl.lid}') return None, err async def create_new_collateral_wfl(self): coins_data = await self.get_next_coins_for_mixing(for_denoms=False) coins = coins_data['coins'] _start = self._start_new_collateral_wfl wfl = await self.loop.run_in_executor(None, _start) if not wfl: return try: _make_tx = self._make_new_collateral_tx txid, tx = await self.loop.run_in_executor(None, _make_tx, wfl, coins) w = self.wallet # add_transaction need run in network therad if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') def _after_create_tx(): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs' ' from original') wfl.completed = True self.set_new_collateral_wfl(wfl) self.logger.wfl_ok(f'Completed new collateral workflow' f' with tx: {txid},' f' workflow: {wfl.lid}') await self.loop.run_in_executor(None, _after_create_tx) w.save_db() except Exception as e: self.logger.wfl_err(f'Error creating new collateral tx:' f' {str(e)}, workflow: {wfl.lid}') await self.cleanup_new_collateral_wfl(force=True) type_e = type(e) msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == AddPSDataError: msg = self.ADD_PS_DATA_ERR_MSG type_name = SPEC_TX_NAMES[PSTxTypes.NEW_COLLATERAL] msg = f'{msg} {type_name} {txid}:\n{str(e)}' elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG elif type_e == NotEnoughFunds: self._not_enough_funds = True if msg: await self.stop_mixing_from_async_thread(msg) def _start_new_collateral_wfl(self): with self.new_collateral_wfl_lock: if self.new_collateral_wfl: return uuid = str(uuid4()) wfl = PSTxWorkflow(uuid=uuid) self.set_new_collateral_wfl(wfl) self.logger.info(f'Started up new collateral workflow: {wfl.lid}') return self.new_collateral_wfl def _make_new_collateral_tx(self, wfl, coins=None, password=None): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs from original') w = self.wallet fee_per_kb = self.config.fee_per_kb() uuid = wfl.uuid oaddr = self.reserve_addresses(1, data=uuid)[0] if not coins: # try select minimal denom utxo with mimial rounds coins = w.get_utxos(None, mature_only=True, confirmed_only=True, consider_islocks=True, min_rounds=0) coins = [c for c in coins if c.value_sats() == MIN_DENOM_VAL] coins = self.filter_out_hw_ks_coins(coins) if not coins: raise NotEnoughFunds() coins = sorted(coins, key=lambda x: x.ps_rounds) coins = coins[0:1] no_change = False outputs = None coins_val = sum([c.value_sats() for c in coins]) if (len(coins) == 1 # Minimal denom or PS other selected, no change and coins[0].ps_rounds is not None and coins[0].ps_rounds != PSCoinRounds.MIX_ORIGIN): if coins_val >= self.min_new_denoms_from_coins_val: raise TooLargeUtxoVal('To large utxo selected') no_change = True if no_change: for val in CREATE_COLLATERAL_VALS[::-1]: new_collateral_fee = calc_tx_fee(1, 1, fee_per_kb, max_size=True) if coins_val - new_collateral_fee < val: continue outputs = [PartialTxOutput.from_address_and_value(oaddr, val)] break if outputs is None: raise NotEnoughFunds() else: val = CREATE_COLLATERAL_VAL outputs = [PartialTxOutput.from_address_and_value(oaddr, val)] tx = w.make_unsigned_transaction(coins=coins, outputs=outputs) inputs = tx.inputs() # check input addresses is in keypairs if keypairs cache available if self._keypairs_cache: input_addrs = [utxo.address for utxo in inputs] not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') if no_change: tx = PartialTransaction.from_io(inputs[:], outputs[:], locktime=0) for txin in tx.inputs(): txin.nsequence = 0xffffffff else: # use first input address as a change, use selected inputs change_addr = inputs[0].address tx = w.make_unsigned_transaction(coins=inputs, outputs=outputs, change_addr=change_addr) tx = self.sign_transaction(tx, password) estimated_fee = calc_tx_fee(len(tx.inputs()), len(tx.outputs()), fee_per_kb, max_size=True) overfee = tx.get_fee() - estimated_fee assert overfee < self.min_new_collateral_from_coins_val, 'too high fee' txid = tx.txid() raw_tx = tx.serialize_to_network() tx_type = PSTxTypes.NEW_COLLATERAL wfl.add_tx(txid=txid, raw_tx=raw_tx, tx_type=tx_type) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs from original') self.set_new_collateral_wfl(wfl) return txid, tx async def cleanup_new_collateral_wfl(self, force=False): _cleanup = self._cleanup_new_collateral_wfl changed = await self.loop.run_in_executor(None, _cleanup, force) if changed: self.wallet.save_db() def _cleanup_new_collateral_wfl(self, force=False): with self.new_collateral_wfl_lock: wfl = self.new_collateral_wfl if not wfl or wfl.completed and wfl.tx_order and not force: return w = self.wallet if wfl.tx_order: for txid in wfl.tx_order[::-1]: # use reversed tx_order if w.db.get_transaction(txid): w.remove_transaction(txid) else: self._cleanup_new_collateral_wfl_tx_data(txid) else: self._cleanup_new_collateral_wfl_tx_data() return True def _cleanup_new_collateral_wfl_tx_data(self, txid=None): with self.new_collateral_wfl_lock: wfl = self.new_collateral_wfl if not wfl: return if txid: tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_collateral_wfl(wfl) self.logger.info(f'Cleaned up new collateral tx:' f' {txid}, workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_collateral_wfl() self.logger.info(f'Cleaned up new collateral workflow: {wfl.lid}') async def broadcast_new_collateral_wfl(self): def _check_wfl(): with self.new_collateral_wfl_lock: wfl = self.new_collateral_wfl if not wfl: return if not wfl.completed: return return wfl wfl = await self.loop.run_in_executor(None, _check_wfl) if not wfl: return w = self.wallet tx_data = wfl.next_to_send(w) if not tx_data: return txid = tx_data.txid sent, err = await tx_data.send(self) if err: def _on_fail(): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs' ' from original') self.set_new_collateral_wfl(wfl) self.logger.wfl_err(f'Failed broadcast of new collateral tx' f' {txid}: {err}, workflow {wfl.lid}') await self.loop.run_in_executor(None, _on_fail) if sent: def _on_success(): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs' ' from original') self.set_new_collateral_wfl(wfl) self.logger.wfl_done(f'Broadcasted transaction {txid} from new' f' collateral workflow: {wfl.lid}') tx = Transaction(wfl.tx_data[txid].raw_tx) self._process_by_new_collateral_wfl(txid, tx) if not wfl.next_to_send(w): self.logger.wfl_done(f'Broadcast completed for new' f' collateral workflow: {wfl.lid}') await self.loop.run_in_executor(None, _on_success) def _search_new_collateral_wfl(self, txid, tx): err = self._check_new_collateral_tx_err(txid, tx, full_check=False) if not err: wfl = self.new_collateral_wfl if wfl and wfl.tx_order and txid in wfl.tx_order: return wfl def _check_on_new_collateral_wfl(self, txid, tx): wfl = self._search_new_collateral_wfl(txid, tx) err = self._check_new_collateral_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_new_collateral_wfl(self, txid, tx): wfl = self._search_new_collateral_wfl(txid, tx) if not wfl: return with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved or saved.uuid != wfl.uuid: return tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_collateral_wfl(wfl) self.logger.wfl_done(f'Processed tx: {txid} from new' f' collateral workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_collateral_wfl() self.logger.wfl_done(f'Finished processing of new collateral' f' workflow: {wfl.lid}') # Workflow methods for new denoms transaction def new_denoms_from_coins_info(self, coins): if not coins or len(coins) > 1: return coins_val = sum([c.value_sats() for c in coins]) if coins_val < self.min_new_denoms_from_coins_val: return fee_per_kb = self.config.fee_per_kb() denoms_amounts = self._calc_denoms_amounts_from_coins(coins, fee_per_kb) if denoms_amounts: tx_cnt = len(denoms_amounts) outputs_val = sum([sum(amounts) for amounts in denoms_amounts]) tx_type = SPEC_TX_NAMES[PSTxTypes.NEW_DENOMS] info = _('Transactions type: {}').format(tx_type) info += '\n' info += _('Count of transactions: {}').format(tx_cnt) info += '\n' info += _('Total sent amount: {}').format(coins_val) info += '\n' info += _('Total output amount: {}').format(outputs_val) info += '\n' info += _('Total fee: {}').format(coins_val - outputs_val) return info def create_new_denoms_wfl_from_gui(self, coins, password): if self.state in self.mixing_running_states: return None, ('Can not create new denoms as mixing process' ' is currently run.') if len(coins) > 1: return None, ('Can not create new denoms,' ' too many coins selected') wfl, outputs_amounts = self._start_new_denoms_wfl(coins, use_all_coins=True) if not outputs_amounts: return None, ('Can not create new denoms,' ' not enough coins selected') if not wfl: return None, ('Can not create new denoms as other new' ' denoms creation process is in progress') last_tx_idx = len(outputs_amounts) - 1 for i, tx_amounts in enumerate(outputs_amounts): try: w = self.wallet txid, tx = self._make_new_denoms_tx(wfl, tx_amounts, last_tx_idx, i, coins, password, use_all_coins=True) if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') if not w.db.get_ps_tx(txid)[0] == PSTxTypes.NEW_DENOMS: self._add_ps_data(txid, tx, PSTxTypes.NEW_DENOMS) self.logger.info(f'Created new denoms tx: {txid},' f' workflow: {wfl.lid}') if i == last_tx_idx: with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs' ' from original') wfl.completed = True self.set_new_denoms_wfl(wfl) self.logger.wfl_ok(f'Completed new denoms' f' workflow: {wfl.lid}') return wfl, None else: txin0 = copy.deepcopy(tx.inputs()[0]) txin0_addr = w.get_txin_address(txin0) utxos = w.get_utxos([txin0_addr], min_rounds=PSCoinRounds.OTHER) change_outpoint = None for change_idx, o in enumerate(tx.outputs()): if o.address == txin0_addr: change_outpoint = f'{txid}:{change_idx}' break coins = [] for utxo in utxos: if utxo.prevout.to_str() != change_outpoint: continue coins.append(utxo) except Exception as e: err = str(e) self.logger.wfl_err(f'Error creating new denoms tx:' f' {err}, workflow: {wfl.lid}') self._cleanup_new_denoms_wfl(force=True) self.logger.info(f'Cleaned up new denoms workflow:' f' {wfl.lid}') return None, err async def create_new_denoms_wfl(self): coins_data = await self.get_next_coins_for_mixing() coins = coins_data['coins'] if not coins: return _start = self._start_new_denoms_wfl wfl, outputs_amounts = await self.loop.run_in_executor(None, _start, coins) if not wfl: return last_tx_idx = len(outputs_amounts) - 1 for i, tx_amounts in enumerate(outputs_amounts): try: w = self.wallet _make_tx = self._make_new_denoms_tx txid, tx = await self.loop.run_in_executor(None, _make_tx, wfl, tx_amounts, last_tx_idx, i, coins) # add_transaction need run in network therad if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') def _after_create_tx(): with self.new_denoms_wfl_lock: self.logger.info(f'Created new denoms tx: {txid},' f' workflow: {wfl.lid}') if i == last_tx_idx: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs' ' from original') wfl.completed = True self.set_new_denoms_wfl(wfl) self.logger.wfl_ok(f'Completed new denoms' f' workflow: {wfl.lid}') coins_data = self._get_next_coins_for_mixing() coins = coins_data['coins'] txin0 = copy.deepcopy(tx.inputs()[0]) txin0_addr = w.get_txin_address(txin0) if i != last_tx_idx: utxos = w.get_utxos([txin0_addr]) change_outpoint = None for change_idx, o in enumerate(tx.outputs()): if o.address == txin0_addr: change_outpoint = f'{txid}:{change_idx}' break for utxo in utxos: if utxo.prevout.to_str() != change_outpoint: continue coins.append(utxo) if self.group_origin_coins_by_addr: coins = [c for c in coins if c.address == txin0_addr] return coins coins = await self.loop.run_in_executor(None, _after_create_tx) w.save_db() except Exception as e: self.logger.wfl_err(f'Error creating new denoms tx:' f' {str(e)}, workflow: {wfl.lid}') await self.cleanup_new_denoms_wfl(force=True) type_e = type(e) msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == AddPSDataError: msg = self.ADD_PS_DATA_ERR_MSG type_name = SPEC_TX_NAMES[PSTxTypes.NEW_DENOMS] msg = f'{msg} {type_name} {txid}:\n{str(e)}' elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG elif type_e == NotEnoughFunds: self._not_enough_funds = True if msg: await self.stop_mixing_from_async_thread(msg) break def _start_new_denoms_wfl(self, coins, use_all_coins=False): outputs_amounts = \ self.calc_need_denoms_amounts(coins=coins, use_all_coins=use_all_coins) if not outputs_amounts: return None, None with self.new_denoms_wfl_lock, \ self.pay_collateral_wfl_lock, \ self.new_collateral_wfl_lock: if self.new_denoms_wfl: return None, None uuid = str(uuid4()) wfl = PSTxWorkflow(uuid=uuid) self.set_new_denoms_wfl(wfl) self.logger.info(f'Started up new denoms workflow: {wfl.lid}') return wfl, outputs_amounts def _make_new_denoms_tx(self, wfl, tx_amounts, last_tx_idx, i, coins, password=None, use_all_coins=False): w = self.wallet # try to create new denoms tx with change outupt at first addrs_cnt = len(tx_amounts) oaddrs = self.reserve_addresses(addrs_cnt, data=wfl.uuid) outputs = [PartialTxOutput.from_address_and_value(addr, a) for addr, a in zip(oaddrs, tx_amounts)] tx = w.make_unsigned_transaction(coins=coins, outputs=outputs) inputs = tx.inputs() # check input addresses is in keypairs if keypairs cache available if self._keypairs_cache: input_addrs = [utxo.address for utxo in inputs] not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') no_change = False fee_per_kb = self.config.fee_per_kb() if i == last_tx_idx: if use_all_coins: no_change = True if no_change: tx = PartialTransaction.from_io(inputs[:], outputs[:], locktime=0) for txin in tx.inputs(): txin.nsequence = 0xffffffff else: # use first input address as a change, use selected inputs in0 = inputs[0].address tx = w.make_unsigned_transaction(coins=inputs, outputs=outputs, change_addr=in0) tx = self.sign_transaction(tx, password) estimated_fee = calc_tx_fee(len(tx.inputs()), len(tx.outputs()), fee_per_kb, max_size=True) overfee = tx.get_fee() - estimated_fee assert overfee < self.min_new_collateral_from_coins_val, 'too high fee' txid = tx.txid() raw_tx = tx.serialize_to_network() tx_type = PSTxTypes.NEW_DENOMS wfl.add_tx(txid=txid, raw_tx=raw_tx, tx_type=tx_type) with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs from original') self.set_new_denoms_wfl(wfl) return txid, tx async def cleanup_new_denoms_wfl(self, force=False): _cleanup = self._cleanup_new_denoms_wfl changed = await self.loop.run_in_executor(None, _cleanup, force) if changed: self.wallet.save_db() def _cleanup_new_denoms_wfl(self, force=False): with self.new_denoms_wfl_lock: wfl = self.new_denoms_wfl if not wfl or wfl.completed and wfl.tx_order and not force: return w = self.wallet if wfl.tx_order: for txid in wfl.tx_order[::-1]: # use reversed tx_order if w.db.get_transaction(txid): w.remove_transaction(txid) else: self._cleanup_new_denoms_wfl_tx_data(txid) else: self._cleanup_new_denoms_wfl_tx_data() return True def _cleanup_new_denoms_wfl_tx_data(self, txid=None): with self.new_denoms_wfl_lock: wfl = self.new_denoms_wfl if not wfl: return if txid: tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_denoms_wfl(wfl) self.logger.info(f'Cleaned up new denoms tx:' f' {txid}, workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_denoms_wfl() self.logger.info(f'Cleaned up new denoms workflow: {wfl.lid}') async def broadcast_new_denoms_wfl(self): def _check_wfl(): with self.new_denoms_wfl_lock: wfl = self.new_denoms_wfl if not wfl: return if not wfl.completed: return return wfl wfl = await self.loop.run_in_executor(None, _check_wfl) if not wfl: return w = self.wallet tx_data = wfl.next_to_send(w) if not tx_data: return txid = tx_data.txid sent, err = await tx_data.send(self) if err: def _on_fail(): with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs from original') self.set_new_denoms_wfl(wfl) self.logger.wfl_err(f'Failed broadcast of new denoms tx' f' {txid}: {err}, workflow {wfl.lid}') await self.loop.run_in_executor(None, _on_fail) if sent: def _on_success(): with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs from original') self.set_new_denoms_wfl(wfl) self.logger.wfl_done(f'Broadcasted transaction {txid} from new' f' denoms workflow: {wfl.lid}') self.last_denoms_tx_time = time.time() tx = Transaction(wfl.tx_data[txid].raw_tx) self._process_by_new_denoms_wfl(txid, tx) if not wfl.next_to_send(w): self.logger.wfl_done(f'Broadcast completed for new denoms' f' workflow: {wfl.lid}') await self.loop.run_in_executor(None, _on_success) def _search_new_denoms_wfl(self, txid, tx): err = self._check_new_denoms_tx_err(txid, tx, full_check=False) if not err: wfl = self.new_denoms_wfl if wfl and wfl.tx_order and txid in wfl.tx_order: return wfl def _check_on_new_denoms_wfl(self, txid, tx): wfl = self._search_new_denoms_wfl(txid, tx) err = self._check_new_denoms_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_new_denoms_wfl(self, txid, tx): wfl = self._search_new_denoms_wfl(txid, tx) if not wfl: return with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved or saved.uuid != wfl.uuid: return tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_denoms_wfl(wfl) self.logger.wfl_done(f'Processed tx: {txid} from new denoms' f' workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_denoms_wfl() self.logger.wfl_done(f'Finished processing of new denoms' f' workflow: {wfl.lid}') # Workflow methods for denominate transaction async def cleanup_staled_denominate_wfls(self): def _cleanup_staled(): changed = False for uuid in self.denominate_wfl_list: wfl = self.get_denominate_wfl(uuid) if not wfl or not wfl.completed: continue now = time.time() if now - wfl.completed > self.wait_for_mn_txs_time: self.logger.info(f'Cleaning staled denominate' f' workflow: {wfl.lid}') self._cleanup_denominate_wfl(wfl) changed = True return changed while True: if self.enabled: done = await self.loop.run_in_executor(None, _cleanup_staled) if done: self.wallet.save_db() await asyncio.sleep(self.wait_for_mn_txs_time/12) async def start_denominate_wfl(self): wfl = None try: _start = self._start_denominate_wfl dsq = None session = None if random.random() > 0.33: self.logger.debug('try to get masternode from recent dsq') recent_mns = self.recent_mixes_mns while self.state == PSStates.Mixing: dsq = self.dash_net.get_recent_dsq(recent_mns) if dsq is not None: self.logger.debug(f'get dsq from recent dsq queue' f' {dsq.masternodeOutPoint}') dval = PS_DENOM_REVERSE_DICT[dsq.nDenom] wfl = await self.loop.run_in_executor(None, _start, dval) break await asyncio.sleep(0.5) else: self.logger.debug('try to create new queue' ' on random masternode') wfl = await self.loop.run_in_executor(None, _start) if not wfl: return if self.state != PSStates.Mixing: raise Exception('Mixing is finished') else: session = await self.start_mix_session(wfl.denom, dsq, wfl.lid) pay_collateral_tx = self.get_pay_collateral_tx() if not pay_collateral_tx: raise Exception('Absent suitable pay collateral tx') await session.send_dsa(pay_collateral_tx) while True: cmd, res = await session.read_next_msg(wfl) if cmd == 'dssu': continue elif cmd == 'dsq' and session.fReady: break else: raise Exception(f'Unsolisited cmd: {cmd} after dsa sent') pay_collateral_tx = self.get_pay_collateral_tx() if not pay_collateral_tx: raise Exception('Absent suitable pay collateral tx') final_tx = None await session.send_dsi(wfl.inputs, pay_collateral_tx, wfl.outputs) while True: cmd, res = await session.read_next_msg(wfl) if cmd == 'dssu': continue elif cmd == 'dsf': final_tx = PartialTransaction.from_tx(res) break else: raise Exception(f'Unsolisited cmd: {cmd} after dsi sent') signed_inputs = self._sign_inputs(final_tx, wfl.inputs) await session.send_dss(signed_inputs) while True: cmd, res = await session.read_next_msg(wfl) if cmd == 'dssu': continue elif cmd == 'dsc': def _on_dsc(): with self.denominate_wfl_lock: saved = self.get_denominate_wfl(wfl.uuid) if saved: saved.completed = time.time() self.set_denominate_wfl(saved) return saved else: # already processed from _add_ps_data self.logger.debug(f'denominate workflow:' f' {wfl.lid} not found') saved = await self.loop.run_in_executor(None, _on_dsc) if saved: wfl = saved self.wallet.save_db() break else: raise Exception(f'Unsolisited cmd: {cmd} after dss sent') self.logger.wfl_ok(f'Completed denominate workflow: {wfl.lid}') except Exception as e: type_e = type(e) if type_e != asyncio.CancelledError: if wfl: self.logger.wfl_err(f'Error in denominate worfklow:' f' {str(e)}, workflow: {wfl.lid}') else: self.logger.wfl_err(f'Error during creation of denominate' f' worfklow: {str(e)}') msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG if msg: await self.stop_mixing_from_async_thread(msg) finally: if session: await self.stop_mix_session(session.peer_str) if wfl: await self.cleanup_denominate_wfl(wfl) def _select_denoms_to_mix(self, denom_value=None): if not self._denoms_to_mix_cache: self.logger.debug('No suitable denoms to mix,' ' _denoms_to_mix_cache is empty') return None, None if denom_value is not None: denoms = self.denoms_to_mix(denom_value=denom_value) else: denoms = self.denoms_to_mix() outpoints = list(denoms.keys()) w = self.wallet icnt = 0 txids = [] inputs = [] while icnt < random.randint(1, PRIVATESEND_ENTRY_MAX_SIZE): if not outpoints: break outpoint = outpoints.pop(random.randint(0, len(outpoints)-1)) if not w.db.get_ps_denom(outpoint): # already spent continue if w.db.get_ps_spending_denom(outpoint): # reserved to spend continue txid = outpoint.split(':')[0] if txid in txids: # skip outputs from same tx continue height = w.get_tx_height(txid).height islock = w.db.get_islock(txid) if not islock and height <= 0: # skip not islocked/confirmed continue denom = denoms.pop(outpoint) if denom[2] >= self.mix_rounds: continue if not self.is_ps_ks(denom[0]) and self.is_hw_ks: continue # skip denoms on hw keystore if denom_value is None: denom_value = denom[1] elif denom[1] != denom_value: # skip other denom values continue inputs.append(outpoint) txids.append(txid) icnt += 1 if not inputs: self.logger.debug(f'No suitable denoms to mix:' f' denom_value={denom_value}') return None, None else: return inputs, denom_value def _start_denominate_wfl(self, denom_value=None): if self.active_denominate_wfl_cnt >= self.max_sessions: return selected_inputs, denom_value = self._select_denoms_to_mix(denom_value) if not selected_inputs: return with self.denominate_wfl_lock, self.denoms_lock: if self.active_denominate_wfl_cnt >= self.max_sessions: return icnt = 0 inputs = [] input_addrs = [] w = self.wallet for outpoint in selected_inputs: denom = w.db.get_ps_denom(outpoint) if not denom: continue # already spent if w.db.get_ps_spending_denom(outpoint): continue # already used by other wfl if self.is_hw_ks and not self.is_ps_ks(denom[0]): continue # skip denoms from hardware keystore inputs.append(outpoint) input_addrs.append(denom[0]) icnt += 1 if icnt < 1: self.logger.debug(f'No suitable denoms to mix after' f' denoms_lock: denom_value={denom_value}') return uuid = str(uuid4()) wfl = PSDenominateWorkflow(uuid=uuid) wfl.inputs = inputs wfl.denom = denom_value self.set_denominate_wfl(wfl) for outpoint in inputs: self.add_ps_spending_denom(outpoint, wfl.uuid) # check input addresses is in keypairs if keypairs cache available if self._keypairs_cache: not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') output_addrs = [] found_outpoints = [] for addr, data in w.db.get_ps_reserved().items(): if data in inputs: output_addrs.append(addr) found_outpoints.append(data) for outpoint in inputs: if outpoint not in found_outpoints: force_main_ks = False if self.is_hw_ks: denom = w.db.get_ps_denom(outpoint) if denom[2] == self.mix_rounds - 1: force_main_ks = True reserved = self.reserve_addresses(1, data=outpoint, force_main_ks=force_main_ks) output_addrs.append(reserved[0]) with self.denominate_wfl_lock: saved = self.get_denominate_wfl(wfl.uuid) if not saved: raise Exception(f'denominate_wfl {wfl.lid} not found') wfl = saved wfl.outputs = output_addrs self.set_denominate_wfl(saved) self.logger.info(f'Created denominate workflow: {wfl.lid}, with inputs' f' value {wfl.denom}, count {len(wfl.inputs)}') return wfl def _sign_inputs(self, tx, inputs): signed_inputs = [] tx = self._sign_denominate_tx(tx) for i in tx.inputs(): if i.prevout.to_str() not in inputs: continue signed_inputs.append(CTxIn(i.prevout.txid[::-1], i.prevout.out_idx, i.script_sig, i.nsequence)) return signed_inputs def _sign_denominate_tx(self, tx): mine_txins_cnt = 0 for txin in tx.inputs(): self.wallet.add_input_info(txin) if txin.address is None: continue mine_txins_cnt += 1 self.sign_transaction(tx, None, mine_txins_cnt) return tx async def cleanup_denominate_wfl(self, wfl): _cleanup = self._cleanup_denominate_wfl changed = await self.loop.run_in_executor(None, _cleanup, wfl) if changed: self.wallet.save_db() def _cleanup_denominate_wfl(self, wfl): with self.denominate_wfl_lock: saved = self.get_denominate_wfl(wfl.uuid) if not saved: # already processed from _add_ps_data return else: wfl = saved completed = wfl.completed if completed: now = time.time() if now - wfl.completed <= self.wait_for_mn_txs_time: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_denoms().items()): if uuid != wfl.uuid: continue with self.denoms_lock: self.pop_ps_spending_denom(outpoint) with self.denominate_wfl_lock: self.clear_denominate_wfl(wfl.uuid) self.logger.info(f'Cleaned up denominate workflow: {wfl.lid}') return True def _search_denominate_wfl(self, txid, tx): err = self._check_denominate_tx_err(txid, tx, full_check=False) if not err: for uuid in self.denominate_wfl_list: wfl = self.get_denominate_wfl(uuid) if not wfl or not wfl.completed: continue if self._check_denominate_tx_io_on_wfl(txid, tx, wfl): return wfl def _check_on_denominate_wfl(self, txid, tx): wfl = self._search_denominate_wfl(txid, tx) err = self._check_denominate_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_denominate_wfl(self, txid, tx): wfl = self._search_denominate_wfl(txid, tx) if not wfl: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_denoms().items()): if uuid != wfl.uuid: continue with self.denoms_lock: self.pop_ps_spending_denom(outpoint) with self.denominate_wfl_lock: self.clear_denominate_wfl(wfl.uuid) self.logger.wfl_done(f'Finished processing of denominate' f' workflow: {wfl.lid} with tx: {txid}') def get_workflow_tx_info(self, wfl): w = self.wallet tx_cnt = len(wfl.tx_order) tx_type = None if not tx_cnt else wfl.tx_data[wfl.tx_order[0]].tx_type total = 0 total_fee = 0 for txid in wfl.tx_order: tx = Transaction(wfl.tx_data[txid].raw_tx) tx_info = w.get_tx_info(tx) total += tx_info.amount total_fee += tx_info.fee return tx_type, tx_cnt, total, total_fee
43.151357
83
0.550037
import asyncio import copy import random import time import threading from collections import deque from uuid import uuid4 from . import util from .dash_msg import PRIVATESEND_ENTRY_MAX_SIZE from .dash_ps_net import PSMixSession, PRIVATESEND_SESSION_MSG_TIMEOUT from .dash_ps_wallet import (PSDataMixin, PSKeystoreMixin, KeyPairsMixin, KPStates, NotFoundInKeypairs, AddPSDataError, SignWithKeypairsFailed) from .dash_ps_util import (PSOptsMixin, PSUtilsMixin, PSGUILogHandler, PSManLogAdapter, PSCoinRounds, PSStates, PS_DENOMS_DICT, COLLATERAL_VAL, MIN_DENOM_VAL, CREATE_COLLATERAL_VAL, CREATE_COLLATERAL_VALS, PSTxWorkflow, PSDenominateWorkflow, calc_tx_fee) from .dash_tx import PSTxTypes, SPEC_TX_NAMES, CTxIn from .logging import Logger from .transaction import Transaction, PartialTxOutput, PartialTransaction from .util import (NoDynamicFeeEstimates, log_exceptions, SilentTaskGroup, NotEnoughFunds, bfh, is_android) from .i18n import _ PS_DENOM_REVERSE_DICT = {int(v): k for k, v in PS_DENOMS_DICT.items()} class TooManyUtxos(Exception): class TooLargeUtxoVal(Exception): class PSManager(Logger, PSKeystoreMixin, PSDataMixin, PSOptsMixin, PSUtilsMixin, KeyPairsMixin): LOGGING_SHORTCUT = 'A' ADD_PS_DATA_ERR_MSG = _('Error on adding PrivateSend transaction data.') SPEND_TO_PS_ADDRS_MSG = _('For privacy reasons blocked attempt to' ' transfer coins to PrivateSend address.') WATCHING_ONLY_MSG = _('This is a watching-only wallet.' ' Mixing can not be run.') ALL_MIXED_MSG = _('PrivateSend mixing is done') CLEAR_PS_DATA_MSG = _('Are you sure to clear all wallet PrivateSend data?' ' This is not recommended if there is' ' no particular need.') NO_NETWORK_MSG = _('Can not start mixing. Network is not available') NO_DASH_NET_MSG = _('Can not start mixing. DashNet is not available') LLMQ_DATA_NOT_READY = _('LLMQ quorums data is not fully loaded.') MNS_DATA_NOT_READY = _('Masternodes data is not fully loaded.') NOT_ENABLED_MSG = _('PrivateSend mixing is not enabled') INITIALIZING_MSG = _('PrivateSend mixing is initializing.' ' Please try again soon') MIXING_ALREADY_RUNNING_MSG = _('PrivateSend mixing is already running.') MIXING_NOT_RUNNING_MSG = _('PrivateSend mixing is not running.') FIND_UNTRACKED_RUN_MSG = _('PrivateSend mixing can not start. Process of' ' finding untracked PS transactions' ' is currently run') ERRORED_MSG = _('PrivateSend mixing can not start.' ' Please check errors in PS Log tab') UNKNOWN_STATE_MSG = _('PrivateSend mixing can not start.' ' Unknown state: {}') WAIT_MIXING_STOP_MSG = _('Mixing is not stopped. If mixing sessions ends' ' prematurely additional pay collateral may be' ' paid. Do you really want to close wallet?') NO_NETWORK_STOP_MSG = _('Network is not available') OTHER_COINS_ARRIVED_MSG1 = _('Some unknown coins arrived on addresses' ' reserved for PrivateSend use, txid: {}.') OTHER_COINS_ARRIVED_MSG2 = _('WARNING: it is not recommended to spend' ' these coins in regular transactions!') OTHER_COINS_ARRIVED_MSG3 = _('You can use these coins in PrivateSend' ' mixing process by manually selecting UTXO' ' and creating new denoms or new collateral,' ' depending on UTXO value.') OTHER_COINS_ARRIVED_Q = _('Do you want to use other coins now?') if is_android(): NO_DYNAMIC_FEE_MSG = _('{}\n\nYou can switch fee estimation method' ' on send screen') OTHER_COINS_ARRIVED_MSG4 = _('You can view and use these coins from' ' Coins popup from PrivateSend options.') else: NO_DYNAMIC_FEE_MSG = _('{}\n\nYou can switch to static fee estimation' ' on Fees Preferences tab') OTHER_COINS_ARRIVED_MSG4 = _('You can view and use these coins from' ' Coins tab.') def __init__(self, wallet): Logger.__init__(self) PSDataMixin.__init__(self, wallet) PSKeystoreMixin.__init__(self, wallet) KeyPairsMixin.__init__(self, wallet) PSOptsMixin.__init__(self, wallet) PSUtilsMixin.__init__(self, wallet) self.log_handler = PSGUILogHandler(self) self.logger = PSManLogAdapter(self.logger, {'psman_id': id(self)}) self.state_lock = threading.Lock() self.states = s = PSStates self.mixing_running_states = [s.StartMixing, s.Mixing, s.StopMixing] self.no_clean_history_states = [s.Initializing, s.Errored, s.StartMixing, s.Mixing, s.StopMixing, s.FindingUntracked] self.config = wallet.config self._state = PSStates.Unsupported self.wallet_types_supported = ['standard'] self.keystore_types_supported = ['bip32', 'hardware'] keystore = wallet.db.get('keystore') if keystore: self.w_ks_type = keystore.get('type', 'unknown') else: self.w_ks_type = 'unknown' self.w_type = wallet.wallet_type if (self.w_type in self.wallet_types_supported and self.w_ks_type in self.keystore_types_supported): if wallet.db.get_ps_data('ps_enabled', False): self.state = PSStates.Initializing else: self.state = PSStates.Disabled if self.unsupported: supported_w = ', '.join(self.wallet_types_supported) supported_ks = ', '.join(self.keystore_types_supported) this_type = self.w_type this_ks_type = self.w_ks_type self.unsupported_msg = _(f'PrivateSend is currently supported on' f' next wallet types: "{supported_w}"' f' and keystore types: "{supported_ks}".' f'\n\nThis wallet has type "{this_type}"' f' and kestore type "{this_ks_type}".') else: self.unsupported_msg = '' if self.is_hw_ks: self.enable_ps_keystore() self.network = None self.dash_net = None self.loop = None self._loop_thread = None self.main_taskgroup = None self.mix_sessions_lock = asyncio.Lock() self.mix_sessions = {} self.recent_mixes_mns = deque([], 10) self.denoms_lock = threading.Lock() self.collateral_lock = threading.Lock() self.others_lock = threading.Lock() self.new_denoms_wfl_lock = threading.Lock() self.new_collateral_wfl_lock = threading.Lock() self.pay_collateral_wfl_lock = threading.Lock() self.denominate_wfl_lock = threading.Lock() self._not_enough_funds = False self.disconnect_time = 0 @property def unsupported(self): return self.state == PSStates.Unsupported @property def enabled(self): return self.state not in [PSStates.Unsupported, PSStates.Disabled] @property def is_hw_ks(self): return self.w_ks_type == 'hardware' def enable_ps(self): if (self.w_type == 'standard' and self.is_hw_ks and 'ps_keystore' not in self.wallet.db.data): self.logger.info('ps_keystore for hw wallets must be created') return if not self.enabled: self.wallet.db.set_ps_data('ps_enabled', True) coro = self._enable_ps() asyncio.run_coroutine_threadsafe(coro, self.loop) async def _enable_ps(self): if self.enabled: return self.state = PSStates.Initializing util.trigger_callback('ps-state-changes', self.wallet, None, None) _load_and_cleanup = self.load_and_cleanup await self.loop.run_in_executor(None, _load_and_cleanup) await self.find_untracked_ps_txs() self.wallet.save_db() def can_find_untracked(self): w = self.wallet network = self.network if network is None: return False server_height = network.get_server_height() if server_height == 0: return False local_height = network.get_local_height() if local_height < server_height: return False with w.lock: unverified_no_islock = [] for txid in w.unverified_tx: if txid not in w.db.islocks: unverified_no_islock.append(txid) if (unverified_no_islock or not w.is_up_to_date() or not w.synchronizer.is_up_to_date()): return False return True @property def state(self): return self._state @property def is_waiting(self): if self.state not in self.mixing_running_states: return False if self.keypairs_state in [KPStates.NeedCache, KPStates.Caching]: return False active_wfls_cnt = 0 active_wfls_cnt += len(self.denominate_wfl_list) if self.new_denoms_wfl: active_wfls_cnt += 1 if self.new_collateral_wfl: active_wfls_cnt += 1 return (active_wfls_cnt == 0) @state.setter def state(self, state): self._state = state def on_network_start(self, network): self.network = network util.register_callback(self.on_wallet_updated, ['wallet_updated']) util.register_callback(self.on_network_status, ['status']) self.dash_net = network.dash_net self.loop = network.asyncio_loop self._loop_thread = network._loop_thread asyncio.ensure_future(self.clean_keypairs_on_timeout()) asyncio.ensure_future(self.cleanup_staled_denominate_wfls()) asyncio.ensure_future(self.trigger_postponed_notifications()) asyncio.ensure_future(self.broadcast_new_denoms_new_collateral_wfls()) def on_stop_threads(self): if self.state == PSStates.Mixing: self.stop_mixing() util.unregister_callback(self.on_wallet_updated) util.unregister_callback(self.on_network_status) def on_network_status(self, event, *args): connected = self.network.is_connected() if connected: self.disconnect_time = 0 else: now = time.time() if self.disconnect_time == 0: self.disconnect_time = now if now - self.disconnect_time > 30: if self.state == PSStates.Mixing: self.stop_mixing(self.NO_NETWORK_STOP_MSG) async def on_wallet_updated(self, event, *args): if not self.enabled: return w = args[0] if w != self.wallet: return if w.is_up_to_date(): self._not_enough_funds = False if self.state in [PSStates.Initializing, PSStates.Ready]: await self.find_untracked_ps_txs() def start_mixing(self, password, nowait=True): w = self.wallet msg = None if w.is_watching_only(): msg = self.WATCHING_ONLY_MSG, 'err' elif self.all_mixed: msg = self.ALL_MIXED_MSG, 'inf' elif not self.network or not self.network.is_connected(): msg = self.NO_NETWORK_MSG, 'err' elif not self.dash_net.run_dash_net: msg = self.NO_DASH_NET_MSG, 'err' if msg: msg, inf = msg self.logger.info(f'Can not start PrivateSend Mixing: {msg}') util.trigger_callback('ps-state-changes', w, msg, inf) return coro = self.find_untracked_ps_txs() asyncio.run_coroutine_threadsafe(coro, self.loop).result() with self.state_lock: if self.state == PSStates.Ready: self.state = PSStates.StartMixing elif self.state in [PSStates.Unsupported, PSStates.Disabled]: msg = self.NOT_ENABLED_MSG elif self.state == PSStates.Initializing: msg = self.INITIALIZING_MSG elif self.state in self.mixing_running_states: msg = self.MIXING_ALREADY_RUNNING_MSG elif self.state == PSStates.FindingUntracked: msg = self.FIND_UNTRACKED_RUN_MSG elif self.state == PSStates.FindingUntracked: msg = self.ERRORED_MSG else: msg = self.UNKNOWN_STATE_MSG.format(self.state) if msg: util.trigger_callback('ps-state-changes', w, msg, None) self.logger.info(f'Can not start PrivateSend Mixing: {msg}') return else: util.trigger_callback('ps-state-changes', w, None, None) fut = asyncio.run_coroutine_threadsafe(self._start_mixing(password), self.loop) if nowait: return try: fut.result(timeout=2) except (asyncio.TimeoutError, asyncio.CancelledError): pass async def _start_mixing(self, password): if not self.enabled or not self.network: return assert not self.main_taskgroup self._not_enough_funds = False self.main_taskgroup = main_taskgroup = SilentTaskGroup() self.logger.info('Starting PrivateSend Mixing') async def main(): try: async with main_taskgroup as group: if (self.w_type == 'standard' and self.is_hw_ks): await group.spawn(self._prepare_funds_from_hw_wallet()) await group.spawn(self._make_keypairs_cache(password)) await group.spawn(self._check_not_enough_funds()) await group.spawn(self._check_all_mixed()) await group.spawn(self._maintain_pay_collateral_tx()) await group.spawn(self._maintain_collateral_amount()) await group.spawn(self._maintain_denoms()) await group.spawn(self._mix_denoms()) except Exception as e: self.logger.info(f'error starting mixing: {str(e)}') raise e asyncio.run_coroutine_threadsafe(main(), self.loop) with self.state_lock: self.state = PSStates.Mixing self.last_mix_start_time = time.time() self.logger.info('Started PrivateSend Mixing') w = self.wallet util.trigger_callback('ps-state-changes', w, None, None) async def stop_mixing_from_async_thread(self, msg, msg_type=None): await self.loop.run_in_executor(None, self.stop_mixing, msg, msg_type) def stop_mixing(self, msg=None, msg_type=None, nowait=True): w = self.wallet with self.state_lock: if self.state == PSStates.Mixing: self.state = PSStates.StopMixing elif self.state == PSStates.StopMixing: return else: msg = self.MIXING_NOT_RUNNING_MSG util.trigger_callback('ps-state-changes', w, msg, 'inf') self.logger.info(f'Can not stop PrivateSend Mixing: {msg}') return if msg: self.logger.info(f'Stopping PrivateSend Mixing: {msg}') if not msg_type or not msg_type.startswith('inf'): stopped_prefix = _('PrivateSend mixing is stopping!') msg = f'{stopped_prefix}\n\n{msg}' util.trigger_callback('ps-state-changes', w, msg, msg_type) else: self.logger.info('Stopping PrivateSend Mixing') util.trigger_callback('ps-state-changes', w, None, None) self.last_mix_stop_time = time.time() fut = asyncio.run_coroutine_threadsafe(self._stop_mixing(), self.loop) if nowait: return try: fut.result(timeout=PRIVATESEND_SESSION_MSG_TIMEOUT+5) except (asyncio.TimeoutError, asyncio.CancelledError): pass @log_exceptions async def _stop_mixing(self): if self.keypairs_state == KPStates.Caching: self.logger.info('Waiting for keypairs caching to finish') while self.keypairs_state == KPStates.Caching: await asyncio.sleep(0.5) if self.main_taskgroup: sess_cnt = len(self.mix_sessions) if sess_cnt > 0: self.logger.info(f'Waiting for {sess_cnt}' f' mixing sessions to finish') while sess_cnt > 0: await asyncio.sleep(0.5) sess_cnt = len(self.mix_sessions) try: await asyncio.wait_for(self.main_taskgroup.cancel_remaining(), timeout=2) except (asyncio.TimeoutError, asyncio.CancelledError) as e: self.logger.debug(f'Exception during main_taskgroup' f' cancellation: {repr(e)}') self.main_taskgroup = None with self.keypairs_state_lock: if self.keypairs_state == KPStates.Ready: self.logger.info('Mark keypairs as unused') self.keypairs_state = KPStates.Unused self.logger.info('Stopped PrivateSend Mixing') self.last_mix_stop_time = time.time() with self.state_lock: self.state = PSStates.Ready w = self.wallet util.trigger_callback('ps-state-changes', w, None, None) async def _check_all_mixed(self): while not self.main_taskgroup.closed(): await asyncio.sleep(10) if self.all_mixed: await self.stop_mixing_from_async_thread(self.ALL_MIXED_MSG, 'inf') async def _check_not_enough_funds(self): while not self.main_taskgroup.closed(): if self._not_enough_funds: await asyncio.sleep(30) self._not_enough_funds = False await asyncio.sleep(5) async def _maintain_pay_collateral_tx(self): kp_wait_state = KPStates.Ready if self.need_password() else None while not self.main_taskgroup.closed(): wfl = self.pay_collateral_wfl if wfl: if not wfl.completed or not wfl.tx_order: await self.cleanup_pay_collateral_wfl() elif self.ps_collateral_cnt > 0: if kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('Pay collateral workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue if not self.get_confirmed_ps_collateral_data(): await asyncio.sleep(5) continue await self.prepare_pay_collateral_wfl() await asyncio.sleep(0.25) async def broadcast_new_denoms_new_collateral_wfls(self): w = self.wallet while True: if self.enabled: wfl = self.new_denoms_wfl if wfl and wfl.completed and wfl.next_to_send(w): await self.broadcast_new_denoms_wfl() await asyncio.sleep(0.25) wfl = self.new_collateral_wfl if wfl and wfl.completed and wfl.next_to_send(w): await self.broadcast_new_collateral_wfl() await asyncio.sleep(0.25) else: await asyncio.sleep(1) async def _maintain_collateral_amount(self): kp_wait_state = KPStates.Ready if self.need_password() else None while not self.main_taskgroup.closed(): wfl = self.new_collateral_wfl if wfl: if not wfl.completed or not wfl.tx_order: await self.cleanup_new_collateral_wfl() elif (not self._not_enough_funds and not self.ps_collateral_cnt and not self.calc_need_denoms_amounts(use_cache=True)): coins = await self.get_next_coins_for_mixing(for_denoms=False) if not coins: await asyncio.sleep(5) continue if not self.check_llmq_ready(): self.logger.info(_('New collateral workflow: {}') .format(self.LLMQ_DATA_NOT_READY)) await asyncio.sleep(5) continue elif kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('New collateral workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue await self.create_new_collateral_wfl() await asyncio.sleep(0.25) async def _maintain_denoms(self): kp_wait_state = KPStates.Ready if self.need_password() else None while not self.main_taskgroup.closed(): wfl = self.new_denoms_wfl if wfl: if not wfl.completed or not wfl.tx_order: await self.cleanup_new_denoms_wfl() elif (not self._not_enough_funds and self.calc_need_denoms_amounts(use_cache=True)): coins = await self.get_next_coins_for_mixing() if not coins: await asyncio.sleep(5) continue if not self.check_llmq_ready(): self.logger.info(_('New denoms workflow: {}') .format(self.LLMQ_DATA_NOT_READY)) await asyncio.sleep(5) continue elif kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('New denoms workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue await self.create_new_denoms_wfl() await asyncio.sleep(0.25) async def _mix_denoms(self): kp_wait_state = KPStates.Ready if self.need_password() else None def _cleanup(): for uuid in self.denominate_wfl_list: wfl = self.get_denominate_wfl(uuid) if wfl and not wfl.completed: self._cleanup_denominate_wfl(wfl) await self.loop.run_in_executor(None, _cleanup) main_taskgroup = self.main_taskgroup while not main_taskgroup.closed(): if (self._denoms_to_mix_cache and self.pay_collateral_wfl and self.active_denominate_wfl_cnt < self.max_sessions): if not self.check_llmq_ready(): self.logger.info(_('Denominate workflow: {}') .format(self.LLMQ_DATA_NOT_READY)) await asyncio.sleep(5) continue elif not self.check_protx_info_completeness(): self.logger.info(_('Denominate workflow: {}') .format(self.MNS_DATA_NOT_READY)) await asyncio.sleep(5) continue elif kp_wait_state and self.keypairs_state != kp_wait_state: self.logger.info('Denominate workflow waiting' ' for keypairs generation') await asyncio.sleep(5) continue if self.state == PSStates.Mixing: await main_taskgroup.spawn(self.start_denominate_wfl()) await asyncio.sleep(0.25) async def start_mix_session(self, denom_value, dsq, wfl_lid): n_denom = PS_DENOMS_DICT[denom_value] sess = PSMixSession(self, denom_value, n_denom, dsq, wfl_lid) peer_str = sess.peer_str async with self.mix_sessions_lock: if peer_str in self.mix_sessions: raise Exception(f'Session with {peer_str} already exists') await sess.run_peer() self.mix_sessions[peer_str] = sess return sess async def stop_mix_session(self, peer_str): async with self.mix_sessions_lock: sess = self.mix_sessions.pop(peer_str) if not sess: self.logger.debug(f'Peer {peer_str} not found in mix_session') return sess.close_peer() return sess def get_confirmed_ps_collateral_data(self): w = self.wallet for outpoint, ps_collateral in w.db.get_ps_collaterals().items(): addr, value = ps_collateral utxos = w.get_utxos([addr], min_rounds=PSCoinRounds.COLLATERAL, confirmed_only=True, consider_islocks=True) utxos = self.filter_out_hw_ks_coins(utxos) inputs = [] for utxo in utxos: if utxo.prevout.to_str() != outpoint: continue w.add_input_info(utxo) inputs.append(utxo) if inputs: return outpoint, value, inputs else: self.logger.wfl_err(f'ps_collateral outpoint {outpoint}' f' is not confirmed') async def prepare_pay_collateral_wfl(self): try: _prepare = self._prepare_pay_collateral_tx res = await self.loop.run_in_executor(None, _prepare) if res: txid, wfl = res self.logger.wfl_ok(f'Completed pay collateral workflow with' f' tx: {txid}, workflow: {wfl.lid}') self.wallet.save_db() except Exception as e: wfl = self.pay_collateral_wfl if wfl: self.logger.wfl_err(f'Error creating pay collateral tx:' f' {str(e)}, workflow: {wfl.lid}') await self.cleanup_pay_collateral_wfl(force=True) else: self.logger.wfl_err(f'Error during creation of pay collateral' f' worfklow: {str(e)}') type_e = type(e) msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG if msg: await self.stop_mixing_from_async_thread(msg) def _prepare_pay_collateral_tx(self): with self.pay_collateral_wfl_lock: if self.pay_collateral_wfl: return uuid = str(uuid4()) wfl = PSTxWorkflow(uuid=uuid) self.set_pay_collateral_wfl(wfl) self.logger.info(f'Started up pay collateral workflow: {wfl.lid}') res = self.get_confirmed_ps_collateral_data() if not res: raise Exception('No confirmed ps_collateral found') outpoint, value, inputs = res if self._keypairs_cache: input_addrs = [utxo.address for utxo in inputs] not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') self.add_ps_spending_collateral(outpoint, wfl.uuid) if value >= COLLATERAL_VAL*2: ovalue = value - COLLATERAL_VAL output_addr = None for addr, data in self.wallet.db.get_ps_reserved().items(): if data == outpoint: output_addr = addr break if not output_addr: reserved = self.reserve_addresses(1, for_change=True, data=outpoint) output_addr = reserved[0] outputs = [PartialTxOutput.from_address_and_value(output_addr, ovalue)] else: outputs = [PartialTxOutput(scriptpubkey=bfh('6a'), value=0)] tx = PartialTransaction.from_io(inputs[:], outputs[:], locktime=0) tx.inputs()[0].nsequence = 0xffffffff tx = self.sign_transaction(tx, None) txid = tx.txid() raw_tx = tx.serialize_to_network() tx_type = PSTxTypes.PAY_COLLATERAL wfl.add_tx(txid=txid, raw_tx=raw_tx, tx_type=tx_type) wfl.completed = True with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if not saved: raise Exception('pay_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('pay_collateral_wfl differs from original') self.set_pay_collateral_wfl(wfl) return txid, wfl async def cleanup_pay_collateral_wfl(self, force=False): _cleanup = self._cleanup_pay_collateral_wfl changed = await self.loop.run_in_executor(None, _cleanup, force) if changed: self.wallet.save_db() def _cleanup_pay_collateral_wfl(self, force=False): with self.pay_collateral_wfl_lock: wfl = self.pay_collateral_wfl if not wfl or wfl.completed and wfl.tx_order and not force: return w = self.wallet if wfl.tx_order: for txid in wfl.tx_order[::-1]: if w.db.get_transaction(txid): w.remove_transaction(txid) else: self._cleanup_pay_collateral_wfl_tx_data(txid) else: self._cleanup_pay_collateral_wfl_tx_data() return True def _cleanup_pay_collateral_wfl_tx_data(self, txid=None): with self.pay_collateral_wfl_lock: wfl = self.pay_collateral_wfl if not wfl: return if txid: tx_data = wfl.pop_tx(txid) if tx_data: self.set_pay_collateral_wfl(wfl) self.logger.info(f'Cleaned up pay collateral tx:' f' {txid}, workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_collaterals().items()): if uuid != wfl.uuid: continue with self.collateral_lock: self.pop_ps_spending_collateral(outpoint) with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_pay_collateral_wfl() self.logger.info(f'Cleaned up pay collateral workflow: {wfl.lid}') def _search_pay_collateral_wfl(self, txid, tx): err = self._check_pay_collateral_tx_err(txid, tx, full_check=False) if not err: wfl = self.pay_collateral_wfl if wfl and wfl.tx_order and txid in wfl.tx_order: return wfl def _check_on_pay_collateral_wfl(self, txid, tx): wfl = self._search_pay_collateral_wfl(txid, tx) err = self._check_pay_collateral_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_pay_collateral_wfl(self, txid, tx): wfl = self._search_pay_collateral_wfl(txid, tx) if not wfl: return with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if not saved or saved.uuid != wfl.uuid: return tx_data = wfl.pop_tx(txid) if tx_data: self.set_pay_collateral_wfl(wfl) self.logger.wfl_done(f'Processed tx: {txid} from pay' f' collateral workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_collaterals().items()): if uuid != wfl.uuid: continue with self.collateral_lock: self.pop_ps_spending_collateral(outpoint) with self.pay_collateral_wfl_lock: saved = self.pay_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_pay_collateral_wfl() self.logger.wfl_done(f'Finished processing of pay collateral' f' workflow: {wfl.lid}') def get_pay_collateral_tx(self): wfl = self.pay_collateral_wfl if not wfl or not wfl.tx_order: return txid = wfl.tx_order[0] tx_data = wfl.tx_data.get(txid) if not tx_data: return return tx_data.raw_tx def new_collateral_from_coins_info(self, coins): if not coins or len(coins) > 1: return coins_val = sum([c.value_sats() for c in coins]) if (coins_val >= self.min_new_denoms_from_coins_val or coins_val < self.min_new_collateral_from_coins_val): return fee_per_kb = self.config.fee_per_kb() for collateral_val in CREATE_COLLATERAL_VALS[::-1]: new_collateral_fee = calc_tx_fee(1, 1, fee_per_kb, max_size=True) if coins_val - new_collateral_fee >= collateral_val: tx_type = SPEC_TX_NAMES[PSTxTypes.NEW_COLLATERAL] info = _('Transactions type: {}').format(tx_type) info += '\n' info += _('Count of transactions: {}').format(1) info += '\n' info += _('Total sent amount: {}').format(coins_val) info += '\n' info += _('Total output amount: {}').format(collateral_val) info += '\n' info += _('Total fee: {}').format(coins_val - collateral_val) return info def create_new_collateral_wfl_from_gui(self, coins, password): if self.state in self.mixing_running_states: return None, ('Can not create new collateral as mixing' ' process is currently run.') if len(coins) > 1: return None, ('Can not create new collateral amount,' ' too many coins selected') wfl = self._start_new_collateral_wfl() if not wfl: return None, ('Can not create new collateral as other new' ' collateral creation process is in progress') try: w = self.wallet txid, tx = self._make_new_collateral_tx(wfl, coins, password) if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') if not w.db.get_ps_tx(txid)[0] == PSTxTypes.NEW_COLLATERAL: self._add_ps_data(txid, tx, PSTxTypes.NEW_COLLATERAL) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs from original') wfl.completed = True self.set_new_collateral_wfl(wfl) self.logger.wfl_ok(f'Completed new collateral workflow' f' with tx: {txid},' f' workflow: {wfl.lid}') return wfl, None except Exception as e: err = str(e) self.logger.wfl_err(f'Error creating new collateral tx:' f' {err}, workflow: {wfl.lid}') self._cleanup_new_collateral_wfl(force=True) self.logger.info(f'Cleaned up new collateral workflow:' f' {wfl.lid}') return None, err async def create_new_collateral_wfl(self): coins_data = await self.get_next_coins_for_mixing(for_denoms=False) coins = coins_data['coins'] _start = self._start_new_collateral_wfl wfl = await self.loop.run_in_executor(None, _start) if not wfl: return try: _make_tx = self._make_new_collateral_tx txid, tx = await self.loop.run_in_executor(None, _make_tx, wfl, coins) w = self.wallet if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') def _after_create_tx(): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs' ' from original') wfl.completed = True self.set_new_collateral_wfl(wfl) self.logger.wfl_ok(f'Completed new collateral workflow' f' with tx: {txid},' f' workflow: {wfl.lid}') await self.loop.run_in_executor(None, _after_create_tx) w.save_db() except Exception as e: self.logger.wfl_err(f'Error creating new collateral tx:' f' {str(e)}, workflow: {wfl.lid}') await self.cleanup_new_collateral_wfl(force=True) type_e = type(e) msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == AddPSDataError: msg = self.ADD_PS_DATA_ERR_MSG type_name = SPEC_TX_NAMES[PSTxTypes.NEW_COLLATERAL] msg = f'{msg} {type_name} {txid}:\n{str(e)}' elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG elif type_e == NotEnoughFunds: self._not_enough_funds = True if msg: await self.stop_mixing_from_async_thread(msg) def _start_new_collateral_wfl(self): with self.new_collateral_wfl_lock: if self.new_collateral_wfl: return uuid = str(uuid4()) wfl = PSTxWorkflow(uuid=uuid) self.set_new_collateral_wfl(wfl) self.logger.info(f'Started up new collateral workflow: {wfl.lid}') return self.new_collateral_wfl def _make_new_collateral_tx(self, wfl, coins=None, password=None): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs from original') w = self.wallet fee_per_kb = self.config.fee_per_kb() uuid = wfl.uuid oaddr = self.reserve_addresses(1, data=uuid)[0] if not coins: coins = w.get_utxos(None, mature_only=True, confirmed_only=True, consider_islocks=True, min_rounds=0) coins = [c for c in coins if c.value_sats() == MIN_DENOM_VAL] coins = self.filter_out_hw_ks_coins(coins) if not coins: raise NotEnoughFunds() coins = sorted(coins, key=lambda x: x.ps_rounds) coins = coins[0:1] no_change = False outputs = None coins_val = sum([c.value_sats() for c in coins]) if (len(coins) == 1 and coins[0].ps_rounds is not None and coins[0].ps_rounds != PSCoinRounds.MIX_ORIGIN): if coins_val >= self.min_new_denoms_from_coins_val: raise TooLargeUtxoVal('To large utxo selected') no_change = True if no_change: for val in CREATE_COLLATERAL_VALS[::-1]: new_collateral_fee = calc_tx_fee(1, 1, fee_per_kb, max_size=True) if coins_val - new_collateral_fee < val: continue outputs = [PartialTxOutput.from_address_and_value(oaddr, val)] break if outputs is None: raise NotEnoughFunds() else: val = CREATE_COLLATERAL_VAL outputs = [PartialTxOutput.from_address_and_value(oaddr, val)] tx = w.make_unsigned_transaction(coins=coins, outputs=outputs) inputs = tx.inputs() if self._keypairs_cache: input_addrs = [utxo.address for utxo in inputs] not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') if no_change: tx = PartialTransaction.from_io(inputs[:], outputs[:], locktime=0) for txin in tx.inputs(): txin.nsequence = 0xffffffff else: change_addr = inputs[0].address tx = w.make_unsigned_transaction(coins=inputs, outputs=outputs, change_addr=change_addr) tx = self.sign_transaction(tx, password) estimated_fee = calc_tx_fee(len(tx.inputs()), len(tx.outputs()), fee_per_kb, max_size=True) overfee = tx.get_fee() - estimated_fee assert overfee < self.min_new_collateral_from_coins_val, 'too high fee' txid = tx.txid() raw_tx = tx.serialize_to_network() tx_type = PSTxTypes.NEW_COLLATERAL wfl.add_tx(txid=txid, raw_tx=raw_tx, tx_type=tx_type) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs from original') self.set_new_collateral_wfl(wfl) return txid, tx async def cleanup_new_collateral_wfl(self, force=False): _cleanup = self._cleanup_new_collateral_wfl changed = await self.loop.run_in_executor(None, _cleanup, force) if changed: self.wallet.save_db() def _cleanup_new_collateral_wfl(self, force=False): with self.new_collateral_wfl_lock: wfl = self.new_collateral_wfl if not wfl or wfl.completed and wfl.tx_order and not force: return w = self.wallet if wfl.tx_order: for txid in wfl.tx_order[::-1]: if w.db.get_transaction(txid): w.remove_transaction(txid) else: self._cleanup_new_collateral_wfl_tx_data(txid) else: self._cleanup_new_collateral_wfl_tx_data() return True def _cleanup_new_collateral_wfl_tx_data(self, txid=None): with self.new_collateral_wfl_lock: wfl = self.new_collateral_wfl if not wfl: return if txid: tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_collateral_wfl(wfl) self.logger.info(f'Cleaned up new collateral tx:' f' {txid}, workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_collateral_wfl() self.logger.info(f'Cleaned up new collateral workflow: {wfl.lid}') async def broadcast_new_collateral_wfl(self): def _check_wfl(): with self.new_collateral_wfl_lock: wfl = self.new_collateral_wfl if not wfl: return if not wfl.completed: return return wfl wfl = await self.loop.run_in_executor(None, _check_wfl) if not wfl: return w = self.wallet tx_data = wfl.next_to_send(w) if not tx_data: return txid = tx_data.txid sent, err = await tx_data.send(self) if err: def _on_fail(): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs' ' from original') self.set_new_collateral_wfl(wfl) self.logger.wfl_err(f'Failed broadcast of new collateral tx' f' {txid}: {err}, workflow {wfl.lid}') await self.loop.run_in_executor(None, _on_fail) if sent: def _on_success(): with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved: raise Exception('new_collateral_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_collateral_wfl differs' ' from original') self.set_new_collateral_wfl(wfl) self.logger.wfl_done(f'Broadcasted transaction {txid} from new' f' collateral workflow: {wfl.lid}') tx = Transaction(wfl.tx_data[txid].raw_tx) self._process_by_new_collateral_wfl(txid, tx) if not wfl.next_to_send(w): self.logger.wfl_done(f'Broadcast completed for new' f' collateral workflow: {wfl.lid}') await self.loop.run_in_executor(None, _on_success) def _search_new_collateral_wfl(self, txid, tx): err = self._check_new_collateral_tx_err(txid, tx, full_check=False) if not err: wfl = self.new_collateral_wfl if wfl and wfl.tx_order and txid in wfl.tx_order: return wfl def _check_on_new_collateral_wfl(self, txid, tx): wfl = self._search_new_collateral_wfl(txid, tx) err = self._check_new_collateral_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_new_collateral_wfl(self, txid, tx): wfl = self._search_new_collateral_wfl(txid, tx) if not wfl: return with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if not saved or saved.uuid != wfl.uuid: return tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_collateral_wfl(wfl) self.logger.wfl_done(f'Processed tx: {txid} from new' f' collateral workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_collateral_wfl_lock: saved = self.new_collateral_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_collateral_wfl() self.logger.wfl_done(f'Finished processing of new collateral' f' workflow: {wfl.lid}') def new_denoms_from_coins_info(self, coins): if not coins or len(coins) > 1: return coins_val = sum([c.value_sats() for c in coins]) if coins_val < self.min_new_denoms_from_coins_val: return fee_per_kb = self.config.fee_per_kb() denoms_amounts = self._calc_denoms_amounts_from_coins(coins, fee_per_kb) if denoms_amounts: tx_cnt = len(denoms_amounts) outputs_val = sum([sum(amounts) for amounts in denoms_amounts]) tx_type = SPEC_TX_NAMES[PSTxTypes.NEW_DENOMS] info = _('Transactions type: {}').format(tx_type) info += '\n' info += _('Count of transactions: {}').format(tx_cnt) info += '\n' info += _('Total sent amount: {}').format(coins_val) info += '\n' info += _('Total output amount: {}').format(outputs_val) info += '\n' info += _('Total fee: {}').format(coins_val - outputs_val) return info def create_new_denoms_wfl_from_gui(self, coins, password): if self.state in self.mixing_running_states: return None, ('Can not create new denoms as mixing process' ' is currently run.') if len(coins) > 1: return None, ('Can not create new denoms,' ' too many coins selected') wfl, outputs_amounts = self._start_new_denoms_wfl(coins, use_all_coins=True) if not outputs_amounts: return None, ('Can not create new denoms,' ' not enough coins selected') if not wfl: return None, ('Can not create new denoms as other new' ' denoms creation process is in progress') last_tx_idx = len(outputs_amounts) - 1 for i, tx_amounts in enumerate(outputs_amounts): try: w = self.wallet txid, tx = self._make_new_denoms_tx(wfl, tx_amounts, last_tx_idx, i, coins, password, use_all_coins=True) if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') if not w.db.get_ps_tx(txid)[0] == PSTxTypes.NEW_DENOMS: self._add_ps_data(txid, tx, PSTxTypes.NEW_DENOMS) self.logger.info(f'Created new denoms tx: {txid},' f' workflow: {wfl.lid}') if i == last_tx_idx: with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs' ' from original') wfl.completed = True self.set_new_denoms_wfl(wfl) self.logger.wfl_ok(f'Completed new denoms' f' workflow: {wfl.lid}') return wfl, None else: txin0 = copy.deepcopy(tx.inputs()[0]) txin0_addr = w.get_txin_address(txin0) utxos = w.get_utxos([txin0_addr], min_rounds=PSCoinRounds.OTHER) change_outpoint = None for change_idx, o in enumerate(tx.outputs()): if o.address == txin0_addr: change_outpoint = f'{txid}:{change_idx}' break coins = [] for utxo in utxos: if utxo.prevout.to_str() != change_outpoint: continue coins.append(utxo) except Exception as e: err = str(e) self.logger.wfl_err(f'Error creating new denoms tx:' f' {err}, workflow: {wfl.lid}') self._cleanup_new_denoms_wfl(force=True) self.logger.info(f'Cleaned up new denoms workflow:' f' {wfl.lid}') return None, err async def create_new_denoms_wfl(self): coins_data = await self.get_next_coins_for_mixing() coins = coins_data['coins'] if not coins: return _start = self._start_new_denoms_wfl wfl, outputs_amounts = await self.loop.run_in_executor(None, _start, coins) if not wfl: return last_tx_idx = len(outputs_amounts) - 1 for i, tx_amounts in enumerate(outputs_amounts): try: w = self.wallet _make_tx = self._make_new_denoms_tx txid, tx = await self.loop.run_in_executor(None, _make_tx, wfl, tx_amounts, last_tx_idx, i, coins) if not w.add_transaction(tx): raise Exception(f'Transaction with txid: {txid}' f' conflicts with current history') def _after_create_tx(): with self.new_denoms_wfl_lock: self.logger.info(f'Created new denoms tx: {txid},' f' workflow: {wfl.lid}') if i == last_tx_idx: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs' ' from original') wfl.completed = True self.set_new_denoms_wfl(wfl) self.logger.wfl_ok(f'Completed new denoms' f' workflow: {wfl.lid}') coins_data = self._get_next_coins_for_mixing() coins = coins_data['coins'] txin0 = copy.deepcopy(tx.inputs()[0]) txin0_addr = w.get_txin_address(txin0) if i != last_tx_idx: utxos = w.get_utxos([txin0_addr]) change_outpoint = None for change_idx, o in enumerate(tx.outputs()): if o.address == txin0_addr: change_outpoint = f'{txid}:{change_idx}' break for utxo in utxos: if utxo.prevout.to_str() != change_outpoint: continue coins.append(utxo) if self.group_origin_coins_by_addr: coins = [c for c in coins if c.address == txin0_addr] return coins coins = await self.loop.run_in_executor(None, _after_create_tx) w.save_db() except Exception as e: self.logger.wfl_err(f'Error creating new denoms tx:' f' {str(e)}, workflow: {wfl.lid}') await self.cleanup_new_denoms_wfl(force=True) type_e = type(e) msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == AddPSDataError: msg = self.ADD_PS_DATA_ERR_MSG type_name = SPEC_TX_NAMES[PSTxTypes.NEW_DENOMS] msg = f'{msg} {type_name} {txid}:\n{str(e)}' elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG elif type_e == NotEnoughFunds: self._not_enough_funds = True if msg: await self.stop_mixing_from_async_thread(msg) break def _start_new_denoms_wfl(self, coins, use_all_coins=False): outputs_amounts = \ self.calc_need_denoms_amounts(coins=coins, use_all_coins=use_all_coins) if not outputs_amounts: return None, None with self.new_denoms_wfl_lock, \ self.pay_collateral_wfl_lock, \ self.new_collateral_wfl_lock: if self.new_denoms_wfl: return None, None uuid = str(uuid4()) wfl = PSTxWorkflow(uuid=uuid) self.set_new_denoms_wfl(wfl) self.logger.info(f'Started up new denoms workflow: {wfl.lid}') return wfl, outputs_amounts def _make_new_denoms_tx(self, wfl, tx_amounts, last_tx_idx, i, coins, password=None, use_all_coins=False): w = self.wallet addrs_cnt = len(tx_amounts) oaddrs = self.reserve_addresses(addrs_cnt, data=wfl.uuid) outputs = [PartialTxOutput.from_address_and_value(addr, a) for addr, a in zip(oaddrs, tx_amounts)] tx = w.make_unsigned_transaction(coins=coins, outputs=outputs) inputs = tx.inputs() if self._keypairs_cache: input_addrs = [utxo.address for utxo in inputs] not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') no_change = False fee_per_kb = self.config.fee_per_kb() if i == last_tx_idx: if use_all_coins: no_change = True if no_change: tx = PartialTransaction.from_io(inputs[:], outputs[:], locktime=0) for txin in tx.inputs(): txin.nsequence = 0xffffffff else: in0 = inputs[0].address tx = w.make_unsigned_transaction(coins=inputs, outputs=outputs, change_addr=in0) tx = self.sign_transaction(tx, password) estimated_fee = calc_tx_fee(len(tx.inputs()), len(tx.outputs()), fee_per_kb, max_size=True) overfee = tx.get_fee() - estimated_fee assert overfee < self.min_new_collateral_from_coins_val, 'too high fee' txid = tx.txid() raw_tx = tx.serialize_to_network() tx_type = PSTxTypes.NEW_DENOMS wfl.add_tx(txid=txid, raw_tx=raw_tx, tx_type=tx_type) with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs from original') self.set_new_denoms_wfl(wfl) return txid, tx async def cleanup_new_denoms_wfl(self, force=False): _cleanup = self._cleanup_new_denoms_wfl changed = await self.loop.run_in_executor(None, _cleanup, force) if changed: self.wallet.save_db() def _cleanup_new_denoms_wfl(self, force=False): with self.new_denoms_wfl_lock: wfl = self.new_denoms_wfl if not wfl or wfl.completed and wfl.tx_order and not force: return w = self.wallet if wfl.tx_order: for txid in wfl.tx_order[::-1]: if w.db.get_transaction(txid): w.remove_transaction(txid) else: self._cleanup_new_denoms_wfl_tx_data(txid) else: self._cleanup_new_denoms_wfl_tx_data() return True def _cleanup_new_denoms_wfl_tx_data(self, txid=None): with self.new_denoms_wfl_lock: wfl = self.new_denoms_wfl if not wfl: return if txid: tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_denoms_wfl(wfl) self.logger.info(f'Cleaned up new denoms tx:' f' {txid}, workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_denoms_wfl() self.logger.info(f'Cleaned up new denoms workflow: {wfl.lid}') async def broadcast_new_denoms_wfl(self): def _check_wfl(): with self.new_denoms_wfl_lock: wfl = self.new_denoms_wfl if not wfl: return if not wfl.completed: return return wfl wfl = await self.loop.run_in_executor(None, _check_wfl) if not wfl: return w = self.wallet tx_data = wfl.next_to_send(w) if not tx_data: return txid = tx_data.txid sent, err = await tx_data.send(self) if err: def _on_fail(): with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs from original') self.set_new_denoms_wfl(wfl) self.logger.wfl_err(f'Failed broadcast of new denoms tx' f' {txid}: {err}, workflow {wfl.lid}') await self.loop.run_in_executor(None, _on_fail) if sent: def _on_success(): with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved: raise Exception('new_denoms_wfl not found') if saved.uuid != wfl.uuid: raise Exception('new_denoms_wfl differs from original') self.set_new_denoms_wfl(wfl) self.logger.wfl_done(f'Broadcasted transaction {txid} from new' f' denoms workflow: {wfl.lid}') self.last_denoms_tx_time = time.time() tx = Transaction(wfl.tx_data[txid].raw_tx) self._process_by_new_denoms_wfl(txid, tx) if not wfl.next_to_send(w): self.logger.wfl_done(f'Broadcast completed for new denoms' f' workflow: {wfl.lid}') await self.loop.run_in_executor(None, _on_success) def _search_new_denoms_wfl(self, txid, tx): err = self._check_new_denoms_tx_err(txid, tx, full_check=False) if not err: wfl = self.new_denoms_wfl if wfl and wfl.tx_order and txid in wfl.tx_order: return wfl def _check_on_new_denoms_wfl(self, txid, tx): wfl = self._search_new_denoms_wfl(txid, tx) err = self._check_new_denoms_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_new_denoms_wfl(self, txid, tx): wfl = self._search_new_denoms_wfl(txid, tx) if not wfl: return with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if not saved or saved.uuid != wfl.uuid: return tx_data = wfl.pop_tx(txid) if tx_data: self.set_new_denoms_wfl(wfl) self.logger.wfl_done(f'Processed tx: {txid} from new denoms' f' workflow: {wfl.lid}') if wfl.tx_order: return w = self.wallet for addr in w.db.select_ps_reserved(data=wfl.uuid): self.pop_ps_reserved(addr) with self.new_denoms_wfl_lock: saved = self.new_denoms_wfl if saved and saved.uuid == wfl.uuid: self.clear_new_denoms_wfl() self.logger.wfl_done(f'Finished processing of new denoms' f' workflow: {wfl.lid}') async def cleanup_staled_denominate_wfls(self): def _cleanup_staled(): changed = False for uuid in self.denominate_wfl_list: wfl = self.get_denominate_wfl(uuid) if not wfl or not wfl.completed: continue now = time.time() if now - wfl.completed > self.wait_for_mn_txs_time: self.logger.info(f'Cleaning staled denominate' f' workflow: {wfl.lid}') self._cleanup_denominate_wfl(wfl) changed = True return changed while True: if self.enabled: done = await self.loop.run_in_executor(None, _cleanup_staled) if done: self.wallet.save_db() await asyncio.sleep(self.wait_for_mn_txs_time/12) async def start_denominate_wfl(self): wfl = None try: _start = self._start_denominate_wfl dsq = None session = None if random.random() > 0.33: self.logger.debug('try to get masternode from recent dsq') recent_mns = self.recent_mixes_mns while self.state == PSStates.Mixing: dsq = self.dash_net.get_recent_dsq(recent_mns) if dsq is not None: self.logger.debug(f'get dsq from recent dsq queue' f' {dsq.masternodeOutPoint}') dval = PS_DENOM_REVERSE_DICT[dsq.nDenom] wfl = await self.loop.run_in_executor(None, _start, dval) break await asyncio.sleep(0.5) else: self.logger.debug('try to create new queue' ' on random masternode') wfl = await self.loop.run_in_executor(None, _start) if not wfl: return if self.state != PSStates.Mixing: raise Exception('Mixing is finished') else: session = await self.start_mix_session(wfl.denom, dsq, wfl.lid) pay_collateral_tx = self.get_pay_collateral_tx() if not pay_collateral_tx: raise Exception('Absent suitable pay collateral tx') await session.send_dsa(pay_collateral_tx) while True: cmd, res = await session.read_next_msg(wfl) if cmd == 'dssu': continue elif cmd == 'dsq' and session.fReady: break else: raise Exception(f'Unsolisited cmd: {cmd} after dsa sent') pay_collateral_tx = self.get_pay_collateral_tx() if not pay_collateral_tx: raise Exception('Absent suitable pay collateral tx') final_tx = None await session.send_dsi(wfl.inputs, pay_collateral_tx, wfl.outputs) while True: cmd, res = await session.read_next_msg(wfl) if cmd == 'dssu': continue elif cmd == 'dsf': final_tx = PartialTransaction.from_tx(res) break else: raise Exception(f'Unsolisited cmd: {cmd} after dsi sent') signed_inputs = self._sign_inputs(final_tx, wfl.inputs) await session.send_dss(signed_inputs) while True: cmd, res = await session.read_next_msg(wfl) if cmd == 'dssu': continue elif cmd == 'dsc': def _on_dsc(): with self.denominate_wfl_lock: saved = self.get_denominate_wfl(wfl.uuid) if saved: saved.completed = time.time() self.set_denominate_wfl(saved) return saved else: self.logger.debug(f'denominate workflow:' f' {wfl.lid} not found') saved = await self.loop.run_in_executor(None, _on_dsc) if saved: wfl = saved self.wallet.save_db() break else: raise Exception(f'Unsolisited cmd: {cmd} after dss sent') self.logger.wfl_ok(f'Completed denominate workflow: {wfl.lid}') except Exception as e: type_e = type(e) if type_e != asyncio.CancelledError: if wfl: self.logger.wfl_err(f'Error in denominate worfklow:' f' {str(e)}, workflow: {wfl.lid}') else: self.logger.wfl_err(f'Error during creation of denominate' f' worfklow: {str(e)}') msg = None if type_e == NoDynamicFeeEstimates: msg = self.NO_DYNAMIC_FEE_MSG.format(str(e)) elif type_e == NotFoundInKeypairs: msg = self.NOT_FOUND_KEYS_MSG elif type_e == SignWithKeypairsFailed: msg = self.SIGN_WIHT_KP_FAILED_MSG if msg: await self.stop_mixing_from_async_thread(msg) finally: if session: await self.stop_mix_session(session.peer_str) if wfl: await self.cleanup_denominate_wfl(wfl) def _select_denoms_to_mix(self, denom_value=None): if not self._denoms_to_mix_cache: self.logger.debug('No suitable denoms to mix,' ' _denoms_to_mix_cache is empty') return None, None if denom_value is not None: denoms = self.denoms_to_mix(denom_value=denom_value) else: denoms = self.denoms_to_mix() outpoints = list(denoms.keys()) w = self.wallet icnt = 0 txids = [] inputs = [] while icnt < random.randint(1, PRIVATESEND_ENTRY_MAX_SIZE): if not outpoints: break outpoint = outpoints.pop(random.randint(0, len(outpoints)-1)) if not w.db.get_ps_denom(outpoint): continue if w.db.get_ps_spending_denom(outpoint): continue txid = outpoint.split(':')[0] if txid in txids: continue height = w.get_tx_height(txid).height islock = w.db.get_islock(txid) if not islock and height <= 0: continue denom = denoms.pop(outpoint) if denom[2] >= self.mix_rounds: continue if not self.is_ps_ks(denom[0]) and self.is_hw_ks: continue if denom_value is None: denom_value = denom[1] elif denom[1] != denom_value: continue inputs.append(outpoint) txids.append(txid) icnt += 1 if not inputs: self.logger.debug(f'No suitable denoms to mix:' f' denom_value={denom_value}') return None, None else: return inputs, denom_value def _start_denominate_wfl(self, denom_value=None): if self.active_denominate_wfl_cnt >= self.max_sessions: return selected_inputs, denom_value = self._select_denoms_to_mix(denom_value) if not selected_inputs: return with self.denominate_wfl_lock, self.denoms_lock: if self.active_denominate_wfl_cnt >= self.max_sessions: return icnt = 0 inputs = [] input_addrs = [] w = self.wallet for outpoint in selected_inputs: denom = w.db.get_ps_denom(outpoint) if not denom: continue if w.db.get_ps_spending_denom(outpoint): continue if self.is_hw_ks and not self.is_ps_ks(denom[0]): continue inputs.append(outpoint) input_addrs.append(denom[0]) icnt += 1 if icnt < 1: self.logger.debug(f'No suitable denoms to mix after' f' denoms_lock: denom_value={denom_value}') return uuid = str(uuid4()) wfl = PSDenominateWorkflow(uuid=uuid) wfl.inputs = inputs wfl.denom = denom_value self.set_denominate_wfl(wfl) for outpoint in inputs: self.add_ps_spending_denom(outpoint, wfl.uuid) if self._keypairs_cache: not_found_addrs = self._find_addrs_not_in_keypairs(input_addrs) if not_found_addrs: not_found_addrs = ', '.join(list(not_found_addrs)) raise NotFoundInKeypairs(f'Input addresses is not found' f' in the keypairs cache:' f' {not_found_addrs}') output_addrs = [] found_outpoints = [] for addr, data in w.db.get_ps_reserved().items(): if data in inputs: output_addrs.append(addr) found_outpoints.append(data) for outpoint in inputs: if outpoint not in found_outpoints: force_main_ks = False if self.is_hw_ks: denom = w.db.get_ps_denom(outpoint) if denom[2] == self.mix_rounds - 1: force_main_ks = True reserved = self.reserve_addresses(1, data=outpoint, force_main_ks=force_main_ks) output_addrs.append(reserved[0]) with self.denominate_wfl_lock: saved = self.get_denominate_wfl(wfl.uuid) if not saved: raise Exception(f'denominate_wfl {wfl.lid} not found') wfl = saved wfl.outputs = output_addrs self.set_denominate_wfl(saved) self.logger.info(f'Created denominate workflow: {wfl.lid}, with inputs' f' value {wfl.denom}, count {len(wfl.inputs)}') return wfl def _sign_inputs(self, tx, inputs): signed_inputs = [] tx = self._sign_denominate_tx(tx) for i in tx.inputs(): if i.prevout.to_str() not in inputs: continue signed_inputs.append(CTxIn(i.prevout.txid[::-1], i.prevout.out_idx, i.script_sig, i.nsequence)) return signed_inputs def _sign_denominate_tx(self, tx): mine_txins_cnt = 0 for txin in tx.inputs(): self.wallet.add_input_info(txin) if txin.address is None: continue mine_txins_cnt += 1 self.sign_transaction(tx, None, mine_txins_cnt) return tx async def cleanup_denominate_wfl(self, wfl): _cleanup = self._cleanup_denominate_wfl changed = await self.loop.run_in_executor(None, _cleanup, wfl) if changed: self.wallet.save_db() def _cleanup_denominate_wfl(self, wfl): with self.denominate_wfl_lock: saved = self.get_denominate_wfl(wfl.uuid) if not saved: return else: wfl = saved completed = wfl.completed if completed: now = time.time() if now - wfl.completed <= self.wait_for_mn_txs_time: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_denoms().items()): if uuid != wfl.uuid: continue with self.denoms_lock: self.pop_ps_spending_denom(outpoint) with self.denominate_wfl_lock: self.clear_denominate_wfl(wfl.uuid) self.logger.info(f'Cleaned up denominate workflow: {wfl.lid}') return True def _search_denominate_wfl(self, txid, tx): err = self._check_denominate_tx_err(txid, tx, full_check=False) if not err: for uuid in self.denominate_wfl_list: wfl = self.get_denominate_wfl(uuid) if not wfl or not wfl.completed: continue if self._check_denominate_tx_io_on_wfl(txid, tx, wfl): return wfl def _check_on_denominate_wfl(self, txid, tx): wfl = self._search_denominate_wfl(txid, tx) err = self._check_denominate_tx_err(txid, tx) if not err: return True if wfl: raise AddPSDataError(f'{err}') else: return False def _process_by_denominate_wfl(self, txid, tx): wfl = self._search_denominate_wfl(txid, tx) if not wfl: return w = self.wallet for outpoint, uuid in list(w.db.get_ps_spending_denoms().items()): if uuid != wfl.uuid: continue with self.denoms_lock: self.pop_ps_spending_denom(outpoint) with self.denominate_wfl_lock: self.clear_denominate_wfl(wfl.uuid) self.logger.wfl_done(f'Finished processing of denominate' f' workflow: {wfl.lid} with tx: {txid}') def get_workflow_tx_info(self, wfl): w = self.wallet tx_cnt = len(wfl.tx_order) tx_type = None if not tx_cnt else wfl.tx_data[wfl.tx_order[0]].tx_type total = 0 total_fee = 0 for txid in wfl.tx_order: tx = Transaction(wfl.tx_data[txid].raw_tx) tx_info = w.get_tx_info(tx) total += tx_info.amount total_fee += tx_info.fee return tx_type, tx_cnt, total, total_fee
true
true
f71e6e34a925999aadf7dbefd40bb6d81463830a
6,170
py
Python
src/gpgodzilla.py
yirzhou/gpgodzilla
b7d4e4d8db730f99d7ad6caab126ff1f14b2d39c
[ "Apache-2.0" ]
1
2020-12-12T00:36:31.000Z
2020-12-12T00:36:31.000Z
src/gpgodzilla.py
yirzhou/gpgodzilla
b7d4e4d8db730f99d7ad6caab126ff1f14b2d39c
[ "Apache-2.0" ]
null
null
null
src/gpgodzilla.py
yirzhou/gpgodzilla
b7d4e4d8db730f99d7ad6caab126ff1f14b2d39c
[ "Apache-2.0" ]
null
null
null
import logging import subprocess from multiprocessing import Process logging.basicConfig(format='gpgeternal: %(asctime)s - %(message)s', level=logging.DEBUG) def load_public_key(key_path): try: output = subprocess.check_output(['gpg2', '--import', key_path]) (output) except Exception as e: logging.error('GPG Error: importing public key at %s.' % key_path) raise ValueError(str(e)) def load_private_key(key_path): try: subprocess.check_output(['gpg2', '--allow-secret-key-import', '--import', key_path]) except Exception as e: logging.error('GPG Error: importing private key at %s.' % key_path) raise ValueError(str(e)) def __encrypt_with_subprocess(encryptProcess, line): try: encryptProcess.stdin.write(line) encryptProcess.stdin.flush() except Exception as e: logging.error(str(e)) raise ValueError(str(e)) def __get_subprocess_for_encrypt(recipient, output_file): try: output_stream = open(output_file, 'ab+') encryptProcess = subprocess.Popen(['gpg2', '--allow-multiple-messages', f'--recipient={recipient}', '--always-trust', '--encrypt'], stdin=subprocess.PIPE, stdout=output_stream) return encryptProcess, output_stream except Exception as e: logging.error(str(e)) raise ValueError(str(e)) def __get_subprocess_for_decrypt(incoming_file, passphrase=None): try: input_file = open(incoming_file, 'r') decryptProcess = None if not passphrase: decryptProcess = subprocess.Popen(['gpg2', '--allow-multiple-messages', '--always-trust', '--decrypt'], stdin=input_file, stdout=subprocess.PIPE) else: decryptProcess = subprocess.Popen(['gpg2', f'--passphrase={passphrase}', '--pinentry-mode=loopback', '--allow-multiple-messages', '--always-trust', '--decrypt'], \ stdin=input_file, stdout=subprocess.PIPE) return decryptProcess except Exception as e: logging.error(str(e)) raise ValueError(str(e)) def __decrypt_and_manipulate_line(file_to_decrypt, output_file, manipulation_function, passphrase=None): """ The flow is as follows: Create one subprocess for decryption. Open the large file for decryption, decrypt it line by line in bytes, manipulate each line and write it to the output file stream. - recipient: the recipient of the encrypted message. - file_to_encrypt: file path of the file to manipulate and encrypt. - output_file: file path of the file to output. - manipulation_function: custom function to manipulate each line before encryption. - passphrase: passphrase of secret key if any. """ decryptProcess = __get_subprocess_for_decrypt(file_to_decrypt, passphrase) with open(output_file, 'a+') as output_stream: for line in iter(decryptProcess.stdout.readline, b''): line = manipulation_function(line.decode("utf-8")) output_stream.write(line) def __encrypt_and_manipulate_line(recipient, file_to_encrypt, output_file, manipulation_function): """ The flow is as follows: Create one subprocess for encryption. Open the large file for encryption, read it line by line in bytes, manipulate each line, encrypt each manipulated line and write it to the output file stream. - recipient: the recipient of the encrypted message. - file_to_encrypt: file path of the file to manipulate and encrypt. - output_file: file path of the file to output. - manipulation_function: custom function to manipulate each line before encryption. """ encryptProcess, output_stream = __get_subprocess_for_encrypt(recipient, output_file) with open(file_to_encrypt, 'r') as input_file: for line in input_file: manipulated_line = manipulation_function(line) manipulated_line = bytes(manipulated_line, 'utf-8') __encrypt_with_subprocess(encryptProcess, manipulated_line) output_stream.close() def encrypt_large_file(recipient, file_to_encrypt, output_file, manipulation_function): """Encrypts large file after manipulating each line with custom function. - recipient: the recipient of the encrypted message. - file_to_encrypt: file path of the file to manipulate and encrypt. - output_file: file path of the file to output. - manipulation_function: custom function to manipulate each line before encryption. """ logging.info('Start encrypting large file: %s', str(file_to_encrypt)) encryption_task = None try: encryption_task = Process(target=__encrypt_and_manipulate_line, args=(recipient, file_to_encrypt, output_file, manipulation_function,)) encryption_task.start() encryption_task.join() except Exception as e: logging.fatal(str(e)) raise ValueError(str(e)) if encryption_task.exitcode != 0: logging.error('Encryption of large file failed: %s', 'exitcode!=0') raise ValueError('Encryption of large file failed.') logging.info('Encryption status: %s' , 'Success') def decrypt_large_file(file_to_decrypt, output_file, manipulation_function, passphrase=None): """Manipulates each line with custom function after decryption of each line. - file_to_decrypt: file path of the file to manipulate and decrypt. - output_file: file path of the file to output. - manipulation_function: custom function to manipulate each line before encryption. """ logging.info('Start decrypting large file: %s', str(file_to_decrypt)) decryption_task = None try: decryption_task = Process(target=__decrypt_and_manipulate_line, args=(file_to_decrypt, output_file, manipulation_function, passphrase,)) decryption_task.start() decryption_task.join() except Exception as e: logging.fatal(str(e)) raise ValueError(str(e)) if decryption_task.exitcode != 0: logging.error('Decryption of large file failed.') raise ValueError('Decryption of large file failed.') logging.info('Decryption status: %s' , 'Success')
45.703704
184
0.702269
import logging import subprocess from multiprocessing import Process logging.basicConfig(format='gpgeternal: %(asctime)s - %(message)s', level=logging.DEBUG) def load_public_key(key_path): try: output = subprocess.check_output(['gpg2', '--import', key_path]) (output) except Exception as e: logging.error('GPG Error: importing public key at %s.' % key_path) raise ValueError(str(e)) def load_private_key(key_path): try: subprocess.check_output(['gpg2', '--allow-secret-key-import', '--import', key_path]) except Exception as e: logging.error('GPG Error: importing private key at %s.' % key_path) raise ValueError(str(e)) def __encrypt_with_subprocess(encryptProcess, line): try: encryptProcess.stdin.write(line) encryptProcess.stdin.flush() except Exception as e: logging.error(str(e)) raise ValueError(str(e)) def __get_subprocess_for_encrypt(recipient, output_file): try: output_stream = open(output_file, 'ab+') encryptProcess = subprocess.Popen(['gpg2', '--allow-multiple-messages', f'--recipient={recipient}', '--always-trust', '--encrypt'], stdin=subprocess.PIPE, stdout=output_stream) return encryptProcess, output_stream except Exception as e: logging.error(str(e)) raise ValueError(str(e)) def __get_subprocess_for_decrypt(incoming_file, passphrase=None): try: input_file = open(incoming_file, 'r') decryptProcess = None if not passphrase: decryptProcess = subprocess.Popen(['gpg2', '--allow-multiple-messages', '--always-trust', '--decrypt'], stdin=input_file, stdout=subprocess.PIPE) else: decryptProcess = subprocess.Popen(['gpg2', f'--passphrase={passphrase}', '--pinentry-mode=loopback', '--allow-multiple-messages', '--always-trust', '--decrypt'], \ stdin=input_file, stdout=subprocess.PIPE) return decryptProcess except Exception as e: logging.error(str(e)) raise ValueError(str(e)) def __decrypt_and_manipulate_line(file_to_decrypt, output_file, manipulation_function, passphrase=None): decryptProcess = __get_subprocess_for_decrypt(file_to_decrypt, passphrase) with open(output_file, 'a+') as output_stream: for line in iter(decryptProcess.stdout.readline, b''): line = manipulation_function(line.decode("utf-8")) output_stream.write(line) def __encrypt_and_manipulate_line(recipient, file_to_encrypt, output_file, manipulation_function): encryptProcess, output_stream = __get_subprocess_for_encrypt(recipient, output_file) with open(file_to_encrypt, 'r') as input_file: for line in input_file: manipulated_line = manipulation_function(line) manipulated_line = bytes(manipulated_line, 'utf-8') __encrypt_with_subprocess(encryptProcess, manipulated_line) output_stream.close() def encrypt_large_file(recipient, file_to_encrypt, output_file, manipulation_function): logging.info('Start encrypting large file: %s', str(file_to_encrypt)) encryption_task = None try: encryption_task = Process(target=__encrypt_and_manipulate_line, args=(recipient, file_to_encrypt, output_file, manipulation_function,)) encryption_task.start() encryption_task.join() except Exception as e: logging.fatal(str(e)) raise ValueError(str(e)) if encryption_task.exitcode != 0: logging.error('Encryption of large file failed: %s', 'exitcode!=0') raise ValueError('Encryption of large file failed.') logging.info('Encryption status: %s' , 'Success') def decrypt_large_file(file_to_decrypt, output_file, manipulation_function, passphrase=None): logging.info('Start decrypting large file: %s', str(file_to_decrypt)) decryption_task = None try: decryption_task = Process(target=__decrypt_and_manipulate_line, args=(file_to_decrypt, output_file, manipulation_function, passphrase,)) decryption_task.start() decryption_task.join() except Exception as e: logging.fatal(str(e)) raise ValueError(str(e)) if decryption_task.exitcode != 0: logging.error('Decryption of large file failed.') raise ValueError('Decryption of large file failed.') logging.info('Decryption status: %s' , 'Success')
true
true
f71e6eba44d1c7020f68f989ac6bd44651c6a4e7
14,293
py
Python
windows_packages_gpu/torch/nn/grad.py
codeproject/DeepStack
d96368a3db1bc0266cb500ba3701d130834da0e6
[ "Apache-2.0" ]
353
2020-12-10T10:47:17.000Z
2022-03-31T23:08:29.000Z
windows_packages_gpu/torch/nn/grad.py
codeproject/DeepStack
d96368a3db1bc0266cb500ba3701d130834da0e6
[ "Apache-2.0" ]
80
2020-12-10T09:54:22.000Z
2022-03-30T22:08:45.000Z
windows_packages_gpu/torch/nn/grad.py
codeproject/DeepStack
d96368a3db1bc0266cb500ba3701d130834da0e6
[ "Apache-2.0" ]
63
2020-12-10T17:10:34.000Z
2022-03-28T16:27:07.000Z
"""Gradient interface""" import torch from .modules.utils import _single, _pair, _triple import warnings def _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation=None): if dilation is None: # For backward compatibility warnings.warn("_grad_input_padding 'dilation' argument not provided. Default of 1 is used.") dilation = [1] * len(stride) input_size = list(input_size) k = grad_output.dim() - 2 if len(input_size) == k + 2: input_size = input_size[-k:] if len(input_size) != k: raise ValueError("input_size must have {} elements (got {})" .format(k + 2, len(input_size))) def dim_size(d): return ((grad_output.size(d + 2) - 1) * stride[d] - 2 * padding[d] + 1 + dilation[d] * (kernel_size[d] - 1)) min_sizes = [dim_size(d) for d in range(k)] max_sizes = [min_sizes[d] + stride[d] - 1 for d in range(k)] for size, min_size, max_size in zip(input_size, min_sizes, max_sizes): if size < min_size or size > max_size: raise ValueError( ("requested an input grad size of {}, but valid sizes range " "from {} to {} (for a grad_output of {})").format( input_size, min_sizes, max_sizes, grad_output.size()[2:])) return tuple(input_size[d] - min_sizes[d] for d in range(k)) def conv1d_input(input_size, weight, grad_output, stride=1, padding=0, dilation=1, groups=1): r""" Computes the gradient of conv1d with respect to the input of the convolution. This is same as the 1D transposed convolution operator under the hood but requires the shape of the gradient w.r.t. input to be specified explicitly. Args: input_size : Shape of the input gradient tensor weight: weight tensor (out_channels x in_channels/groups x kW) grad_output : output gradient tensor (minibatch x out_channels x oW) stride (int or tuple, optional): Stride of the convolution. Default: 1 padding (int or tuple, optional): Zero-padding added to both sides of the input. Default: 0 dilation (int or tuple, optional): Spacing between kernel elements. Default: 1 groups (int, optional): Number of blocked connections from input channels to output channels. Default: 1 Examples:: >>> input = torch.randn(1,1,3, requires_grad=True) >>> weight = torch.randn(1,1,1, requires_grad=True) >>> output = F.conv1d(input, weight) >>> grad_output = torch.randn(output.shape) >>> grad_input = torch.autograd.grad(output, input, grad_output) >>> F.grad.conv1d_input(input.shape, weight, grad_output) """ stride = _single(stride) padding = _single(padding) dilation = _single(dilation) kernel_size = [weight.shape[2]] if input_size is None: raise ValueError("grad.conv1d_input requires specifying an input_size") grad_input_padding = _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation) return torch.conv_transpose1d( grad_output, weight, None, stride, padding, grad_input_padding, groups, dilation) def conv1d_weight(input, weight_size, grad_output, stride=1, padding=0, dilation=1, groups=1): r""" Computes the gradient of conv1d with respect to the weight of the convolution. Args: input: input tensor of shape (minibatch x in_channels x iW) weight_size : Shape of the weight gradient tensor grad_output : output gradient tensor (minibatch x out_channels x oW) stride (int or tuple, optional): Stride of the convolution. Default: 1 padding (int or tuple, optional): Zero-padding added to both sides of the input. Default: 0 dilation (int or tuple, optional): Spacing between kernel elements. Default: 1 groups (int, optional): Number of blocked connections from input channels to output channels. Default: 1 Examples:: >>> input = torch.randn(1,1,3, requires_grad=True) >>> weight = torch.randn(1,1,1, requires_grad=True) >>> output = F.conv1d(input, weight) >>> grad_output = torch.randn(output.shape) >>> grad_weight = torch.autograd.grad(output, filter, grad_output) >>> F.grad.conv1d_weight(input, weight.shape, grad_output) """ stride = _single(stride) padding = _single(padding) dilation = _single(dilation) in_channels = input.shape[1] out_channels = grad_output.shape[1] min_batch = input.shape[0] grad_output = grad_output.contiguous().repeat(1, in_channels // groups, 1) grad_output = grad_output.contiguous().view( grad_output.shape[0] * grad_output.shape[1], 1, grad_output.shape[2]) input = input.contiguous().view(1, input.shape[0] * input.shape[1], input.shape[2]) grad_weight = torch.conv1d(input, grad_output, None, dilation, padding, stride, in_channels * min_batch) grad_weight = grad_weight.contiguous().view( min_batch, grad_weight.shape[1] // min_batch, grad_weight.shape[2]) return grad_weight.sum(dim=0).view( in_channels // groups, out_channels, grad_weight.shape[2]).transpose( 0, 1).narrow(2, 0, weight_size[2]) def conv2d_input(input_size, weight, grad_output, stride=1, padding=0, dilation=1, groups=1): r""" Computes the gradient of conv2d with respect to the input of the convolution. This is same as the 2D transposed convolution operator under the hood but requires the shape of the gradient w.r.t. input to be specified explicitly. Args: input_size : Shape of the input gradient tensor weight: weight tensor (out_channels x in_channels/groups x kH x kW) grad_output : output gradient tensor (minibatch x out_channels x oH x oW) stride (int or tuple, optional): Stride of the convolution. Default: 1 padding (int or tuple, optional): Zero-padding added to both sides of the input. Default: 0 dilation (int or tuple, optional): Spacing between kernel elements. Default: 1 groups (int, optional): Number of blocked connections from input channels to output channels. Default: 1 Examples:: >>> input = torch.randn(1,1,3,3, requires_grad=True) >>> weight = torch.randn(1,1,1,2, requires_grad=True) >>> output = F.conv2d(input, weight) >>> grad_output = torch.randn(output.shape) >>> grad_input = torch.autograd.grad(output, input, grad_output) >>> F.grad.conv2d_input(input.shape, weight, grad_output) """ stride = _pair(stride) padding = _pair(padding) dilation = _pair(dilation) kernel_size = (weight.shape[2], weight.shape[3]) if input_size is None: raise ValueError("grad.conv2d_input requires specifying an input_size") grad_input_padding = _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation) return torch.conv_transpose2d( grad_output, weight, None, stride, padding, grad_input_padding, groups, dilation) def conv2d_weight(input, weight_size, grad_output, stride=1, padding=0, dilation=1, groups=1): r""" Computes the gradient of conv2d with respect to the weight of the convolution. Args: input: input tensor of shape (minibatch x in_channels x iH x iW) weight_size : Shape of the weight gradient tensor grad_output : output gradient tensor (minibatch x out_channels x oH x oW) stride (int or tuple, optional): Stride of the convolution. Default: 1 padding (int or tuple, optional): Zero-padding added to both sides of the input. Default: 0 dilation (int or tuple, optional): Spacing between kernel elements. Default: 1 groups (int, optional): Number of blocked connections from input channels to output channels. Default: 1 Examples:: >>> input = torch.randn(1,1,3,3, requires_grad=True) >>> weight = torch.randn(1,1,1,2, requires_grad=True) >>> output = F.conv2d(input, weight) >>> grad_output = torch.randn(output.shape) >>> grad_weight = torch.autograd.grad(output, filter, grad_output) >>> F.grad.conv2d_weight(input, weight.shape, grad_output) """ stride = _pair(stride) padding = _pair(padding) dilation = _pair(dilation) in_channels = input.shape[1] out_channels = grad_output.shape[1] min_batch = input.shape[0] grad_output = grad_output.contiguous().repeat(1, in_channels // groups, 1, 1) grad_output = grad_output.contiguous().view( grad_output.shape[0] * grad_output.shape[1], 1, grad_output.shape[2], grad_output.shape[3]) input = input.contiguous().view(1, input.shape[0] * input.shape[1], input.shape[2], input.shape[3]) grad_weight = torch.conv2d(input, grad_output, None, dilation, padding, stride, in_channels * min_batch) grad_weight = grad_weight.contiguous().view( min_batch, grad_weight.shape[1] // min_batch, grad_weight.shape[2], grad_weight.shape[3]) return grad_weight.sum(dim=0).view( in_channels // groups, out_channels, grad_weight.shape[2], grad_weight.shape[3]).transpose(0, 1).narrow( 2, 0, weight_size[2]).narrow(3, 0, weight_size[3]) def conv3d_input(input_size, weight, grad_output, stride=1, padding=0, dilation=1, groups=1): r""" Computes the gradient of conv3d with respect to the input of the convolution. This is same as the 3D transposed convolution operator under the hood but requires the shape of the gradient w.r.t. input to be specified explicitly. Args: input_size : Shape of the input gradient tensor weight: weights tensor (out_channels x in_channels/groups x kT x kH x kW) grad_output : output gradient tensor (minibatch x out_channels x oT x oH x oW) stride (int or tuple, optional): Stride of the convolution. Default: 1 padding (int or tuple, optional): Zero-padding added to both sides of the input. Default: 0 dilation (int or tuple, optional): Spacing between kernel elements. Default: 1 groups (int, optional): Number of blocked connections from input channels to output channels. Default: 1 Examples:: >>> input = torch.randn(2, 8, 10, 10, 20, requires_grad=True) >>> weight = torch.randn(4, 8, 2, 3, 3, requires_grad=True) >>> output = F.conv3d(input, weight) >>> grad_output = torch.randn(output.shape) >>> grad_input = torch.autograd.grad(output, input, grad_output) >>> F.grad.conv3d_input(input.shape, weight, grad_output) """ stride = _triple(stride) padding = _triple(padding) dilation = _triple(dilation) kernel_size = (weight.shape[2], weight.shape[3], weight.shape[4]) if input_size is None: raise ValueError("grad.conv3d_input requires specifying an input_size") grad_input_padding = _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation) return torch.conv_transpose3d( grad_output, weight, None, stride, padding, grad_input_padding, groups, dilation) def conv3d_weight(input, weight_size, grad_output, stride=1, padding=0, dilation=1, groups=1): r""" Computes the gradient of conv3d with respect to the weight of the convolution. Args: input: input tensor of shape (minibatch x in_channels x iT x iH x iW) weight_size : Shape of the weight gradient tensor grad_output : output gradient tensor (minibatch x out_channels x oT x oH x oW) stride (int or tuple, optional): Stride of the convolution. Default: 1 padding (int or tuple, optional): Zero-padding added to both sides of the input. Default: 0 dilation (int or tuple, optional): Spacing between kernel elements. Default: 1 groups (int, optional): Number of blocked connections from input channels to output channels. Default: 1 Examples:: >>> input = torch.randn(2, 8, 10, 10, 20, requires_grad=True) >>> weight = torch.randn(4, 8, 2, 3, 3, requires_grad=True) >>> output = F.conv3d(input, weight) >>> grad_output = torch.randn(output.shape) >>> grad_weight = torch.autograd.grad(output, weight, grad_output) >>> F.grad.conv3d_weight(input, weight.shape, grad_output) """ stride = _triple(stride) padding = _triple(padding) dilation = _triple(dilation) in_channels = input.shape[1] out_channels = grad_output.shape[1] min_batch = input.shape[0] grad_output = grad_output.repeat(1, in_channels // groups, 1, 1, 1) grad_output = grad_output.contiguous().view( grad_output.shape[0] * grad_output.shape[1], 1, grad_output.shape[2], grad_output.shape[3], grad_output.shape[4]) input = input.contiguous().view(1, input.shape[0] * input.shape[1], input.shape[2], input.shape[3], input.shape[4]) grad_weight = torch.conv3d(input, grad_output, None, dilation, padding, stride, in_channels * min_batch) grad_weight = grad_weight.contiguous().view( min_batch, grad_weight.shape[1] // min_batch, grad_weight.shape[2], grad_weight.shape[3], grad_weight.shape[4]) return grad_weight.sum(dim=0).view( in_channels // groups, out_channels, grad_weight.shape[2], grad_weight.shape[3], grad_weight.shape[4]).transpose(0, 1).narrow( 2, 0, weight_size[2]).narrow(3, 0, weight_size[3]).narrow( 4, 0, weight_size[4])
45.519108
113
0.639894
import torch from .modules.utils import _single, _pair, _triple import warnings def _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation=None): if dilation is None: warnings.warn("_grad_input_padding 'dilation' argument not provided. Default of 1 is used.") dilation = [1] * len(stride) input_size = list(input_size) k = grad_output.dim() - 2 if len(input_size) == k + 2: input_size = input_size[-k:] if len(input_size) != k: raise ValueError("input_size must have {} elements (got {})" .format(k + 2, len(input_size))) def dim_size(d): return ((grad_output.size(d + 2) - 1) * stride[d] - 2 * padding[d] + 1 + dilation[d] * (kernel_size[d] - 1)) min_sizes = [dim_size(d) for d in range(k)] max_sizes = [min_sizes[d] + stride[d] - 1 for d in range(k)] for size, min_size, max_size in zip(input_size, min_sizes, max_sizes): if size < min_size or size > max_size: raise ValueError( ("requested an input grad size of {}, but valid sizes range " "from {} to {} (for a grad_output of {})").format( input_size, min_sizes, max_sizes, grad_output.size()[2:])) return tuple(input_size[d] - min_sizes[d] for d in range(k)) def conv1d_input(input_size, weight, grad_output, stride=1, padding=0, dilation=1, groups=1): stride = _single(stride) padding = _single(padding) dilation = _single(dilation) kernel_size = [weight.shape[2]] if input_size is None: raise ValueError("grad.conv1d_input requires specifying an input_size") grad_input_padding = _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation) return torch.conv_transpose1d( grad_output, weight, None, stride, padding, grad_input_padding, groups, dilation) def conv1d_weight(input, weight_size, grad_output, stride=1, padding=0, dilation=1, groups=1): stride = _single(stride) padding = _single(padding) dilation = _single(dilation) in_channels = input.shape[1] out_channels = grad_output.shape[1] min_batch = input.shape[0] grad_output = grad_output.contiguous().repeat(1, in_channels // groups, 1) grad_output = grad_output.contiguous().view( grad_output.shape[0] * grad_output.shape[1], 1, grad_output.shape[2]) input = input.contiguous().view(1, input.shape[0] * input.shape[1], input.shape[2]) grad_weight = torch.conv1d(input, grad_output, None, dilation, padding, stride, in_channels * min_batch) grad_weight = grad_weight.contiguous().view( min_batch, grad_weight.shape[1] // min_batch, grad_weight.shape[2]) return grad_weight.sum(dim=0).view( in_channels // groups, out_channels, grad_weight.shape[2]).transpose( 0, 1).narrow(2, 0, weight_size[2]) def conv2d_input(input_size, weight, grad_output, stride=1, padding=0, dilation=1, groups=1): stride = _pair(stride) padding = _pair(padding) dilation = _pair(dilation) kernel_size = (weight.shape[2], weight.shape[3]) if input_size is None: raise ValueError("grad.conv2d_input requires specifying an input_size") grad_input_padding = _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation) return torch.conv_transpose2d( grad_output, weight, None, stride, padding, grad_input_padding, groups, dilation) def conv2d_weight(input, weight_size, grad_output, stride=1, padding=0, dilation=1, groups=1): stride = _pair(stride) padding = _pair(padding) dilation = _pair(dilation) in_channels = input.shape[1] out_channels = grad_output.shape[1] min_batch = input.shape[0] grad_output = grad_output.contiguous().repeat(1, in_channels // groups, 1, 1) grad_output = grad_output.contiguous().view( grad_output.shape[0] * grad_output.shape[1], 1, grad_output.shape[2], grad_output.shape[3]) input = input.contiguous().view(1, input.shape[0] * input.shape[1], input.shape[2], input.shape[3]) grad_weight = torch.conv2d(input, grad_output, None, dilation, padding, stride, in_channels * min_batch) grad_weight = grad_weight.contiguous().view( min_batch, grad_weight.shape[1] // min_batch, grad_weight.shape[2], grad_weight.shape[3]) return grad_weight.sum(dim=0).view( in_channels // groups, out_channels, grad_weight.shape[2], grad_weight.shape[3]).transpose(0, 1).narrow( 2, 0, weight_size[2]).narrow(3, 0, weight_size[3]) def conv3d_input(input_size, weight, grad_output, stride=1, padding=0, dilation=1, groups=1): stride = _triple(stride) padding = _triple(padding) dilation = _triple(dilation) kernel_size = (weight.shape[2], weight.shape[3], weight.shape[4]) if input_size is None: raise ValueError("grad.conv3d_input requires specifying an input_size") grad_input_padding = _grad_input_padding(grad_output, input_size, stride, padding, kernel_size, dilation) return torch.conv_transpose3d( grad_output, weight, None, stride, padding, grad_input_padding, groups, dilation) def conv3d_weight(input, weight_size, grad_output, stride=1, padding=0, dilation=1, groups=1): stride = _triple(stride) padding = _triple(padding) dilation = _triple(dilation) in_channels = input.shape[1] out_channels = grad_output.shape[1] min_batch = input.shape[0] grad_output = grad_output.repeat(1, in_channels // groups, 1, 1, 1) grad_output = grad_output.contiguous().view( grad_output.shape[0] * grad_output.shape[1], 1, grad_output.shape[2], grad_output.shape[3], grad_output.shape[4]) input = input.contiguous().view(1, input.shape[0] * input.shape[1], input.shape[2], input.shape[3], input.shape[4]) grad_weight = torch.conv3d(input, grad_output, None, dilation, padding, stride, in_channels * min_batch) grad_weight = grad_weight.contiguous().view( min_batch, grad_weight.shape[1] // min_batch, grad_weight.shape[2], grad_weight.shape[3], grad_weight.shape[4]) return grad_weight.sum(dim=0).view( in_channels // groups, out_channels, grad_weight.shape[2], grad_weight.shape[3], grad_weight.shape[4]).transpose(0, 1).narrow( 2, 0, weight_size[2]).narrow(3, 0, weight_size[3]).narrow( 4, 0, weight_size[4])
true
true
f71e6fc0c4a210acb51488a7f006a032db64566a
873
py
Python
Introduction/Game - Card/UVa 10646 - What is the card.py
ServioTRC/Competitive-Programming
ddc4ed61d4a826932a65ca6d3d033ad29c36491d
[ "Unlicense" ]
null
null
null
Introduction/Game - Card/UVa 10646 - What is the card.py
ServioTRC/Competitive-Programming
ddc4ed61d4a826932a65ca6d3d033ad29c36491d
[ "Unlicense" ]
null
null
null
Introduction/Game - Card/UVa 10646 - What is the card.py
ServioTRC/Competitive-Programming
ddc4ed61d4a826932a65ca6d3d033ad29c36491d
[ "Unlicense" ]
null
null
null
def card_value(card): if card[0] == "2": return 2 elif card[0] == "3": return 3 elif card[0] == "4": return 4 elif card[0] == "5": return 5 elif card[0] == "6": return 6 elif card[0] == "7": return 7 elif card[0] == "8": return 8 elif card[0] == "9": return 9 elif card[0] == "K" or card[0] == "Q" or card[0] == "J" or card[0] == "A" or card[0] == "T": return 10 def main(): n = int(input()) for i in range(1, n+1): cards = input().split(" ") cards.reverse() y = 0 for _ in range(3): x = card_value(cards.pop()) y += x if (10-x) > 0: cards = cards[:(-1*(10-x))] cards.reverse() print("Case %d: %s" % (i, cards[y-1])) if __name__ == "__main__": main()
23.594595
96
0.419244
def card_value(card): if card[0] == "2": return 2 elif card[0] == "3": return 3 elif card[0] == "4": return 4 elif card[0] == "5": return 5 elif card[0] == "6": return 6 elif card[0] == "7": return 7 elif card[0] == "8": return 8 elif card[0] == "9": return 9 elif card[0] == "K" or card[0] == "Q" or card[0] == "J" or card[0] == "A" or card[0] == "T": return 10 def main(): n = int(input()) for i in range(1, n+1): cards = input().split(" ") cards.reverse() y = 0 for _ in range(3): x = card_value(cards.pop()) y += x if (10-x) > 0: cards = cards[:(-1*(10-x))] cards.reverse() print("Case %d: %s" % (i, cards[y-1])) if __name__ == "__main__": main()
true
true
f71e7051a5a6fe161b39223bd50385377292a238
733
py
Python
appengine-with-cron/appengine_config.py
DoryZi/gcp-optimized-jobs
e88abd4a7b42235e1135230cf3dbd29f3a73fb4f
[ "Apache-2.0" ]
null
null
null
appengine-with-cron/appengine_config.py
DoryZi/gcp-optimized-jobs
e88abd4a7b42235e1135230cf3dbd29f3a73fb4f
[ "Apache-2.0" ]
null
null
null
appengine-with-cron/appengine_config.py
DoryZi/gcp-optimized-jobs
e88abd4a7b42235e1135230cf3dbd29f3a73fb4f
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/env python # Copyright 2015 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from google.appengine.ext import vendor # Add any libraries installed in the "lib" folder. vendor.add('lib')
31.869565
74
0.755798
from google.appengine.ext import vendor vendor.add('lib')
true
true
f71e70cfe09fcd5ce5b22d8790636643baa10130
9,847
py
Python
ruqqus/client.py
richardARPANET/python-ruqqus
4eadc5ae89217c63abc8566bbcbc87b39784b905
[ "MIT" ]
1
2021-01-02T09:49:28.000Z
2021-01-02T09:49:28.000Z
ruqqus/client.py
richardARPANET/python-ruqqus
4eadc5ae89217c63abc8566bbcbc87b39784b905
[ "MIT" ]
null
null
null
ruqqus/client.py
richardARPANET/python-ruqqus
4eadc5ae89217c63abc8566bbcbc87b39784b905
[ "MIT" ]
1
2021-03-21T02:52:38.000Z
2021-03-21T02:52:38.000Z
#!/usr/bin/env python3 from time import time import requests class RuqqusClient: def __init__( self, client_id, client_secret, code=None, access_token=None, refresh_token=None, ): self.headers = {} self.url = 'https://ruqqus.com' self.client_id = client_id self.client_secret = client_secret self.access_token = access_token self._refresh_token = refresh_token self.code = code self.user_agent = f'python-ruqqus-{self.client_id}' self.token_expire_utc = 0 self.header = {} self.refresh_headers() if not self.client_id or not self.client_secret: exit("You must provide both a 'client_id' and 'client_secret") elif ( self.client_id and self.client_secret and not self.code and not self.access_token ): if refresh_token: self.refresh_token() else: exit( "You must provide either a 'code', 'access_token', " "or a 'refresh_token'." ) elif ( self.client_id and self.client_secret and self.code and not self.access_token ): if self._refresh_token: self.refresh_token() else: self.get_access_token() def admin(self): raise NotImplementedError() def mod(self): raise NotImplementedError() def identity(self): self.refresh_headers() return requests.get( url=f'{self.url}/api/v1/identity', headers=self.headers ).json() def user(self, username=None, type=None): self.refresh_headers() if not username: return {'error': 'You must provide a username.'} if type: type = str(type).lower() # Default to user if not type or type == 'user': return requests.get( url=f'{self.url}/api/v1/user/{username}', headers=self.headers ).json() elif type == 'is_available': return requests.get( url=f'{self.url}/api/v1/is_available/{username}', headers=self.headers, ).json() elif type == 'sub': return requests.post( url=f'{self.url}/api/follow/{username}', headers=self.headers ).json() elif type == 'unsub': return requests.post( url=f'{self.url}/api/unfollow/{username}', headers=self.headers ).json() else: return {'error': 'Invalid Call'} def guild(self, name=None, type=None): self.refresh_headers() if not name: return {'error': 'You must provide a guildName.'} if type: type = str(type).lower() if not type or type == 'guild': return requests.get( url=f'{self.url}/api/v1/guild/{name}', headers=self.headers, ).json() elif type == 'is_available': # Default to is_available return requests.get( url=f'{self.url}/api/v1/board_available/{name}', headers=self.headers, ).json() elif type == 'sub': return requests.post( url=f'{self.url}/api/v1/subscribe/{name}', headers=self.headers, ).json() elif type == 'unsub': return requests.post( url=f'{self.url}/api/v1/unsubscribe/{name}', headers=self.headers, ).json() else: return {'error': 'Invalid Call'} def submit_post(self, *, guild, title, url): self.refresh_headers() return requests.post( url=f'{self.url}/api/v1/submit', headers=self.headers, data={ 'board': guild, 'title': title, 'url': url, }, ).json() def get_guild_posts(self, *, name, page=1, sort='hot'): self.refresh_headers() url = f'{self.url}/api/v1/guild/{name.lstrip("+")}/listing' response = requests.get( url=url, params={'page': page, 'sort': sort}, headers=self.headers, ) response.raise_for_status() return response.json() def get( self, type=None, sort=None, time=None, guild_name=None, username=None, post_id=None, comment_id=None, ): self.refresh_headers() if not type: return {'error': "You must specify which 'type' of get to use"} else: type = str(type).lower() if time: time = str(time).lower() if time not in ['day', 'week', 'month', 'year']: return {'error': 'Invalid time parameter.'} if sort: sort = str(sort).lower() if sort not in ['top', 'hot', 'disputed', 'activity', 'new']: return {'error': 'Invalid sort parameter.'} if type == 'front': if sort: if time: return requests.get( url=( f'{self.url}/api/v1/front/listing' f'?sort={sort}&time={time}' ), headers=self.headers, ).json() return requests.get( url=f'{self.url}/api/v1/front/listing?sort={sort}', headers=self.headers, ).json() return requests.get( url=f'{self.url}/api/v1/front/listing', headers=self.headers ).json() elif type == 'guild': if not guild_name: return {'error': 'You must provide a guildName'} else: guild_name = str(guild_name) if sort: if time: return requests.get( url=( f'{self.url}/api/v1/guild/{guild_name}/listing' f'?sort={sort}&time={time}' ), headers=self.headers, ).json() return requests.get( url=( f'{self.url}/api/v1/guild/{guild_name}/listing' f'?sort={sort}' ), headers=self.headers, ).json() return requests.get( url=f'{self.url}/api/v1/guild/{guild_name}/listing', headers=self.headers, ).json() elif type == 'user': if not username: return {'error': 'You must provide a userName.'} else: username = str(username) return requests.get( url=f'{self.url}/api/v1/user/{username}', headers=self.headers ).json() elif type == 'post': if not post_id: return {'error': 'You must provide a postId.'} else: post_id = str(post_id) return requests.get( url=f'{self.url}/api/v1/post/{post_id}', headers=self.headers ).json() elif type == 'comment': if not comment_id: return {'error': 'You must provide a commentId.'} else: comment_id = str(comment_id) return requests.get( url=f'{self.url}/api/v1/comment/{comment_id}', headers=self.headers, ).json() else: return {'error': 'Invalid Call'} def refresh_headers(self, user_agent=None, access_token=None): if self.access_token: self.headers = {'Authorization': 'Bearer ' + self.access_token} elif access_token: self.headers = {'Authorization': 'Bearer ' + access_token} else: return {'error': 'You must provide an accessToken.'} if user_agent: self.header['user-agent'] = user_agent self.user_agent = user_agent elif self.user_agent: self.header['user-agent'] = self.user_agent else: return {'error': 'You must provide a user-agent.'} # refresh token 30 seconds before expiration if self._refresh_token and self.token_expire_utc >= int(time() - 30): self.refresh_token() def refresh_token(self, refresh_token=None): data = { 'client_id': self.client_id, 'client_secret': self.client_secret, 'grant_type': 'refresh', } if not self._refresh_token: if refresh_token: data['refresh_token'] = refresh_token else: data['refresh_token'] = self._refresh_token r = requests.post( url=f'{self.url}/oauth/grant', headers=self.headers, data=data ).json() self.access_token = r['access_token'] return r def get_access_token(self): self.refresh_headers() data = { 'client_id': self.client_id, 'client_secret': self.client_secret, 'grant_type': 'code', 'code': self.code, } r = requests.post( url=f'{self.url}/oauth/grant', headers=self.headers, data=data ).json() self.access_token = r['access_token'] self._refresh_token = r['refresh_token'] self.token_expire_utc = r['expires_at'] return r
28.459538
79
0.487864
from time import time import requests class RuqqusClient: def __init__( self, client_id, client_secret, code=None, access_token=None, refresh_token=None, ): self.headers = {} self.url = 'https://ruqqus.com' self.client_id = client_id self.client_secret = client_secret self.access_token = access_token self._refresh_token = refresh_token self.code = code self.user_agent = f'python-ruqqus-{self.client_id}' self.token_expire_utc = 0 self.header = {} self.refresh_headers() if not self.client_id or not self.client_secret: exit("You must provide both a 'client_id' and 'client_secret") elif ( self.client_id and self.client_secret and not self.code and not self.access_token ): if refresh_token: self.refresh_token() else: exit( "You must provide either a 'code', 'access_token', " "or a 'refresh_token'." ) elif ( self.client_id and self.client_secret and self.code and not self.access_token ): if self._refresh_token: self.refresh_token() else: self.get_access_token() def admin(self): raise NotImplementedError() def mod(self): raise NotImplementedError() def identity(self): self.refresh_headers() return requests.get( url=f'{self.url}/api/v1/identity', headers=self.headers ).json() def user(self, username=None, type=None): self.refresh_headers() if not username: return {'error': 'You must provide a username.'} if type: type = str(type).lower() # Default to user if not type or type == 'user': return requests.get( url=f'{self.url}/api/v1/user/{username}', headers=self.headers ).json() elif type == 'is_available': return requests.get( url=f'{self.url}/api/v1/is_available/{username}', headers=self.headers, ).json() elif type == 'sub': return requests.post( url=f'{self.url}/api/follow/{username}', headers=self.headers ).json() elif type == 'unsub': return requests.post( url=f'{self.url}/api/unfollow/{username}', headers=self.headers ).json() else: return {'error': 'Invalid Call'} def guild(self, name=None, type=None): self.refresh_headers() if not name: return {'error': 'You must provide a guildName.'} if type: type = str(type).lower() if not type or type == 'guild': return requests.get( url=f'{self.url}/api/v1/guild/{name}', headers=self.headers, ).json() elif type == 'is_available': # Default to is_available return requests.get( url=f'{self.url}/api/v1/board_available/{name}', headers=self.headers, ).json() elif type == 'sub': return requests.post( url=f'{self.url}/api/v1/subscribe/{name}', headers=self.headers, ).json() elif type == 'unsub': return requests.post( url=f'{self.url}/api/v1/unsubscribe/{name}', headers=self.headers, ).json() else: return {'error': 'Invalid Call'} def submit_post(self, *, guild, title, url): self.refresh_headers() return requests.post( url=f'{self.url}/api/v1/submit', headers=self.headers, data={ 'board': guild, 'title': title, 'url': url, }, ).json() def get_guild_posts(self, *, name, page=1, sort='hot'): self.refresh_headers() url = f'{self.url}/api/v1/guild/{name.lstrip("+")}/listing' response = requests.get( url=url, params={'page': page, 'sort': sort}, headers=self.headers, ) response.raise_for_status() return response.json() def get( self, type=None, sort=None, time=None, guild_name=None, username=None, post_id=None, comment_id=None, ): self.refresh_headers() if not type: return {'error': "You must specify which 'type' of get to use"} else: type = str(type).lower() if time: time = str(time).lower() if time not in ['day', 'week', 'month', 'year']: return {'error': 'Invalid time parameter.'} if sort: sort = str(sort).lower() if sort not in ['top', 'hot', 'disputed', 'activity', 'new']: return {'error': 'Invalid sort parameter.'} if type == 'front': if sort: if time: return requests.get( url=( f'{self.url}/api/v1/front/listing' f'?sort={sort}&time={time}' ), headers=self.headers, ).json() return requests.get( url=f'{self.url}/api/v1/front/listing?sort={sort}', headers=self.headers, ).json() return requests.get( url=f'{self.url}/api/v1/front/listing', headers=self.headers ).json() elif type == 'guild': if not guild_name: return {'error': 'You must provide a guildName'} else: guild_name = str(guild_name) if sort: if time: return requests.get( url=( f'{self.url}/api/v1/guild/{guild_name}/listing' f'?sort={sort}&time={time}' ), headers=self.headers, ).json() return requests.get( url=( f'{self.url}/api/v1/guild/{guild_name}/listing' f'?sort={sort}' ), headers=self.headers, ).json() return requests.get( url=f'{self.url}/api/v1/guild/{guild_name}/listing', headers=self.headers, ).json() elif type == 'user': if not username: return {'error': 'You must provide a userName.'} else: username = str(username) return requests.get( url=f'{self.url}/api/v1/user/{username}', headers=self.headers ).json() elif type == 'post': if not post_id: return {'error': 'You must provide a postId.'} else: post_id = str(post_id) return requests.get( url=f'{self.url}/api/v1/post/{post_id}', headers=self.headers ).json() elif type == 'comment': if not comment_id: return {'error': 'You must provide a commentId.'} else: comment_id = str(comment_id) return requests.get( url=f'{self.url}/api/v1/comment/{comment_id}', headers=self.headers, ).json() else: return {'error': 'Invalid Call'} def refresh_headers(self, user_agent=None, access_token=None): if self.access_token: self.headers = {'Authorization': 'Bearer ' + self.access_token} elif access_token: self.headers = {'Authorization': 'Bearer ' + access_token} else: return {'error': 'You must provide an accessToken.'} if user_agent: self.header['user-agent'] = user_agent self.user_agent = user_agent elif self.user_agent: self.header['user-agent'] = self.user_agent else: return {'error': 'You must provide a user-agent.'} # refresh token 30 seconds before expiration if self._refresh_token and self.token_expire_utc >= int(time() - 30): self.refresh_token() def refresh_token(self, refresh_token=None): data = { 'client_id': self.client_id, 'client_secret': self.client_secret, 'grant_type': 'refresh', } if not self._refresh_token: if refresh_token: data['refresh_token'] = refresh_token else: data['refresh_token'] = self._refresh_token r = requests.post( url=f'{self.url}/oauth/grant', headers=self.headers, data=data ).json() self.access_token = r['access_token'] return r def get_access_token(self): self.refresh_headers() data = { 'client_id': self.client_id, 'client_secret': self.client_secret, 'grant_type': 'code', 'code': self.code, } r = requests.post( url=f'{self.url}/oauth/grant', headers=self.headers, data=data ).json() self.access_token = r['access_token'] self._refresh_token = r['refresh_token'] self.token_expire_utc = r['expires_at'] return r
true
true
f71e70f75ef74e8cb49110de6c03e5a4a3b5570e
663
py
Python
test/test_container_image.py
hyperonecom/h1-client-python
4ce355852ba3120ec1b8f509ab5894a5c08da730
[ "MIT" ]
null
null
null
test/test_container_image.py
hyperonecom/h1-client-python
4ce355852ba3120ec1b8f509ab5894a5c08da730
[ "MIT" ]
null
null
null
test/test_container_image.py
hyperonecom/h1-client-python
4ce355852ba3120ec1b8f509ab5894a5c08da730
[ "MIT" ]
null
null
null
""" HyperOne HyperOne API # noqa: E501 The version of the OpenAPI document: 0.1.0 Generated by: https://openapi-generator.tech """ import sys import unittest import h1 from h1.model.container_image import ContainerImage class TestContainerImage(unittest.TestCase): """ContainerImage unit test stubs""" def setUp(self): pass def tearDown(self): pass def testContainerImage(self): """Test ContainerImage""" # FIXME: construct object with mandatory attributes with example values # model = ContainerImage() # noqa: E501 pass if __name__ == '__main__': unittest.main()
18.416667
79
0.660633
import sys import unittest import h1 from h1.model.container_image import ContainerImage class TestContainerImage(unittest.TestCase): def setUp(self): pass def tearDown(self): pass def testContainerImage(self): s if __name__ == '__main__': unittest.main()
true
true
f71e725e0b349de80543e5aa9d59479b592d89d0
180
py
Python
krit/invitations/urls.py
huroncg/krit-teams
ce96a49de44496c2f86e37dd917c51952fbbdeed
[ "BSD-3-Clause" ]
null
null
null
krit/invitations/urls.py
huroncg/krit-teams
ce96a49de44496c2f86e37dd917c51952fbbdeed
[ "BSD-3-Clause" ]
null
null
null
krit/invitations/urls.py
huroncg/krit-teams
ce96a49de44496c2f86e37dd917c51952fbbdeed
[ "BSD-3-Clause" ]
1
2021-02-26T01:38:35.000Z
2021-02-26T01:38:35.000Z
from django.conf.urls import url from .views import InvitationDetailView urlpatterns = [ url(r'^(?P<pk>[0-9]+)/$', InvitationDetailView.as_view(), name='invitations-detail') ]
30
88
0.722222
from django.conf.urls import url from .views import InvitationDetailView urlpatterns = [ url(r'^(?P<pk>[0-9]+)/$', InvitationDetailView.as_view(), name='invitations-detail') ]
true
true
f71e725fcb44ac801a9366c707c6df99559a91f7
10,027
py
Python
homeassistant/components/stream/__init__.py
mikan-megane/core
837220cce40890e296920d33a623adbc11bd15a6
[ "Apache-2.0" ]
2
2020-03-29T05:32:57.000Z
2021-06-13T06:55:05.000Z
homeassistant/components/stream/__init__.py
mikan-megane/core
837220cce40890e296920d33a623adbc11bd15a6
[ "Apache-2.0" ]
79
2020-07-23T07:13:37.000Z
2022-03-22T06:02:37.000Z
homeassistant/components/stream/__init__.py
mikan-megane/core
837220cce40890e296920d33a623adbc11bd15a6
[ "Apache-2.0" ]
1
2020-11-18T21:04:18.000Z
2020-11-18T21:04:18.000Z
"""Provide functionality to stream video source. Components use create_stream with a stream source (e.g. an rtsp url) to create a new Stream object. Stream manages: - Background work to fetch and decode a stream - Desired output formats - Home Assistant URLs for viewing a stream - Access tokens for URLs for viewing a stream A Stream consists of a background worker, and one or more output formats each with their own idle timeout managed by the stream component. When an output format is no longer in use, the stream component will expire it. When there are no active output formats, the background worker is shut down and access tokens are expired. Alternatively, a Stream can be configured with keepalive to always keep workers active. """ from __future__ import annotations import logging import re import secrets import threading import time from types import MappingProxyType from homeassistant.const import EVENT_HOMEASSISTANT_STOP from homeassistant.core import callback from homeassistant.exceptions import HomeAssistantError from .const import ( ATTR_ENDPOINTS, ATTR_STREAMS, DOMAIN, HLS_PROVIDER, MAX_SEGMENTS, OUTPUT_IDLE_TIMEOUT, RECORDER_PROVIDER, STREAM_RESTART_INCREMENT, STREAM_RESTART_RESET_TIME, ) from .core import PROVIDERS, IdleTimer, StreamOutput from .hls import async_setup_hls _LOGGER = logging.getLogger(__name__) STREAM_SOURCE_RE = re.compile("//.*:.*@") def redact_credentials(data): """Redact credentials from string data.""" return STREAM_SOURCE_RE.sub("//****:****@", data) def create_stream(hass, stream_source, options=None): """Create a stream with the specified identfier based on the source url. The stream_source is typically an rtsp url and options are passed into pyav / ffmpeg as options. """ if DOMAIN not in hass.config.components: raise HomeAssistantError("Stream integration is not set up.") if options is None: options = {} # For RTSP streams, prefer TCP if isinstance(stream_source, str) and stream_source[:7] == "rtsp://": options = { "rtsp_flags": "prefer_tcp", "stimeout": "5000000", **options, } stream = Stream(hass, stream_source, options=options) hass.data[DOMAIN][ATTR_STREAMS].append(stream) return stream async def async_setup(hass, config): """Set up stream.""" # Set log level to error for libav logging.getLogger("libav").setLevel(logging.ERROR) logging.getLogger("libav.mp4").setLevel(logging.ERROR) # Keep import here so that we can import stream integration without installing reqs # pylint: disable=import-outside-toplevel from .recorder import async_setup_recorder hass.data[DOMAIN] = {} hass.data[DOMAIN][ATTR_ENDPOINTS] = {} hass.data[DOMAIN][ATTR_STREAMS] = [] # Setup HLS hls_endpoint = async_setup_hls(hass) hass.data[DOMAIN][ATTR_ENDPOINTS][HLS_PROVIDER] = hls_endpoint # Setup Recorder async_setup_recorder(hass) @callback def shutdown(event): """Stop all stream workers.""" for stream in hass.data[DOMAIN][ATTR_STREAMS]: stream.keepalive = False stream.stop() _LOGGER.info("Stopped stream workers") hass.bus.async_listen_once(EVENT_HOMEASSISTANT_STOP, shutdown) return True class Stream: """Represents a single stream.""" def __init__(self, hass, source, options=None): """Initialize a stream.""" self.hass = hass self.source = source self.options = options self.keepalive = False self.access_token = None self._thread = None self._thread_quit = threading.Event() self._outputs: dict[str, StreamOutput] = {} self._fast_restart_once = False if self.options is None: self.options = {} def endpoint_url(self, fmt: str) -> str: """Start the stream and returns a url for the output format.""" if fmt not in self._outputs: raise ValueError(f"Stream is not configured for format '{fmt}'") if not self.access_token: self.access_token = secrets.token_hex() return self.hass.data[DOMAIN][ATTR_ENDPOINTS][fmt].format(self.access_token) def outputs(self): """Return a copy of the stream outputs.""" # A copy is returned so the caller can iterate through the outputs # without concern about self._outputs being modified from another thread. return MappingProxyType(self._outputs.copy()) def add_provider(self, fmt, timeout=OUTPUT_IDLE_TIMEOUT): """Add provider output stream.""" if not self._outputs.get(fmt): @callback def idle_callback(): if ( not self.keepalive or fmt == RECORDER_PROVIDER ) and fmt in self._outputs: self.remove_provider(self._outputs[fmt]) self.check_idle() provider = PROVIDERS[fmt]( self.hass, IdleTimer(self.hass, timeout, idle_callback) ) self._outputs[fmt] = provider return self._outputs[fmt] def remove_provider(self, provider): """Remove provider output stream.""" if provider.name in self._outputs: self._outputs[provider.name].cleanup() del self._outputs[provider.name] if not self._outputs: self.stop() def check_idle(self): """Reset access token if all providers are idle.""" if all(p.idle for p in self._outputs.values()): self.access_token = None def start(self): """Start a stream.""" if self._thread is None or not self._thread.is_alive(): if self._thread is not None: # The thread must have crashed/exited. Join to clean up the # previous thread. self._thread.join(timeout=0) self._thread_quit.clear() self._thread = threading.Thread( name="stream_worker", target=self._run_worker, ) self._thread.start() _LOGGER.info("Started stream: %s", redact_credentials(str(self.source))) def update_source(self, new_source): """Restart the stream with a new stream source.""" _LOGGER.debug("Updating stream source %s", new_source) self.source = new_source self._fast_restart_once = True self._thread_quit.set() def _run_worker(self): """Handle consuming streams and restart keepalive streams.""" # Keep import here so that we can import stream integration without installing reqs # pylint: disable=import-outside-toplevel from .worker import SegmentBuffer, stream_worker segment_buffer = SegmentBuffer(self.outputs) wait_timeout = 0 while not self._thread_quit.wait(timeout=wait_timeout): start_time = time.time() stream_worker(self.source, self.options, segment_buffer, self._thread_quit) segment_buffer.discontinuity() if not self.keepalive or self._thread_quit.is_set(): if self._fast_restart_once: # The stream source is updated, restart without any delay. self._fast_restart_once = False self._thread_quit.clear() continue break # To avoid excessive restarts, wait before restarting # As the required recovery time may be different for different setups, start # with trying a short wait_timeout and increase it on each reconnection attempt. # Reset the wait_timeout after the worker has been up for several minutes if time.time() - start_time > STREAM_RESTART_RESET_TIME: wait_timeout = 0 wait_timeout += STREAM_RESTART_INCREMENT _LOGGER.debug( "Restarting stream worker in %d seconds: %s", wait_timeout, self.source, ) self._worker_finished() def _worker_finished(self): """Schedule cleanup of all outputs.""" @callback def remove_outputs(): for provider in self.outputs().values(): self.remove_provider(provider) self.hass.loop.call_soon_threadsafe(remove_outputs) def stop(self): """Remove outputs and access token.""" self._outputs = {} self.access_token = None if not self.keepalive: self._stop() def _stop(self): """Stop worker thread.""" if self._thread is not None: self._thread_quit.set() self._thread.join() self._thread = None _LOGGER.info("Stopped stream: %s", redact_credentials(str(self.source))) async def async_record(self, video_path, duration=30, lookback=5): """Make a .mp4 recording from a provided stream.""" # Check for file access if not self.hass.config.is_allowed_path(video_path): raise HomeAssistantError(f"Can't write {video_path}, no access to path!") # Add recorder recorder = self.outputs().get(RECORDER_PROVIDER) if recorder: raise HomeAssistantError( f"Stream already recording to {recorder.video_path}!" ) recorder = self.add_provider(RECORDER_PROVIDER, timeout=duration) recorder.video_path = video_path self.start() _LOGGER.debug("Started a stream recording of %s seconds", duration) # Take advantage of lookback hls = self.outputs().get(HLS_PROVIDER) if lookback > 0 and hls: num_segments = min(int(lookback // hls.target_duration), MAX_SEGMENTS) # Wait for latest segment, then add the lookback await hls.recv() recorder.prepend(list(hls.get_segments())[-num_segments:])
35.306338
92
0.64057
from __future__ import annotations import logging import re import secrets import threading import time from types import MappingProxyType from homeassistant.const import EVENT_HOMEASSISTANT_STOP from homeassistant.core import callback from homeassistant.exceptions import HomeAssistantError from .const import ( ATTR_ENDPOINTS, ATTR_STREAMS, DOMAIN, HLS_PROVIDER, MAX_SEGMENTS, OUTPUT_IDLE_TIMEOUT, RECORDER_PROVIDER, STREAM_RESTART_INCREMENT, STREAM_RESTART_RESET_TIME, ) from .core import PROVIDERS, IdleTimer, StreamOutput from .hls import async_setup_hls _LOGGER = logging.getLogger(__name__) STREAM_SOURCE_RE = re.compile("//.*:.*@") def redact_credentials(data): return STREAM_SOURCE_RE.sub("//****:****@", data) def create_stream(hass, stream_source, options=None): if DOMAIN not in hass.config.components: raise HomeAssistantError("Stream integration is not set up.") if options is None: options = {} if isinstance(stream_source, str) and stream_source[:7] == "rtsp://": options = { "rtsp_flags": "prefer_tcp", "stimeout": "5000000", **options, } stream = Stream(hass, stream_source, options=options) hass.data[DOMAIN][ATTR_STREAMS].append(stream) return stream async def async_setup(hass, config): logging.getLogger("libav").setLevel(logging.ERROR) logging.getLogger("libav.mp4").setLevel(logging.ERROR) from .recorder import async_setup_recorder hass.data[DOMAIN] = {} hass.data[DOMAIN][ATTR_ENDPOINTS] = {} hass.data[DOMAIN][ATTR_STREAMS] = [] hls_endpoint = async_setup_hls(hass) hass.data[DOMAIN][ATTR_ENDPOINTS][HLS_PROVIDER] = hls_endpoint async_setup_recorder(hass) @callback def shutdown(event): for stream in hass.data[DOMAIN][ATTR_STREAMS]: stream.keepalive = False stream.stop() _LOGGER.info("Stopped stream workers") hass.bus.async_listen_once(EVENT_HOMEASSISTANT_STOP, shutdown) return True class Stream: def __init__(self, hass, source, options=None): self.hass = hass self.source = source self.options = options self.keepalive = False self.access_token = None self._thread = None self._thread_quit = threading.Event() self._outputs: dict[str, StreamOutput] = {} self._fast_restart_once = False if self.options is None: self.options = {} def endpoint_url(self, fmt: str) -> str: if fmt not in self._outputs: raise ValueError(f"Stream is not configured for format '{fmt}'") if not self.access_token: self.access_token = secrets.token_hex() return self.hass.data[DOMAIN][ATTR_ENDPOINTS][fmt].format(self.access_token) def outputs(self): return MappingProxyType(self._outputs.copy()) def add_provider(self, fmt, timeout=OUTPUT_IDLE_TIMEOUT): if not self._outputs.get(fmt): @callback def idle_callback(): if ( not self.keepalive or fmt == RECORDER_PROVIDER ) and fmt in self._outputs: self.remove_provider(self._outputs[fmt]) self.check_idle() provider = PROVIDERS[fmt]( self.hass, IdleTimer(self.hass, timeout, idle_callback) ) self._outputs[fmt] = provider return self._outputs[fmt] def remove_provider(self, provider): if provider.name in self._outputs: self._outputs[provider.name].cleanup() del self._outputs[provider.name] if not self._outputs: self.stop() def check_idle(self): if all(p.idle for p in self._outputs.values()): self.access_token = None def start(self): if self._thread is None or not self._thread.is_alive(): if self._thread is not None: self._thread.join(timeout=0) self._thread_quit.clear() self._thread = threading.Thread( name="stream_worker", target=self._run_worker, ) self._thread.start() _LOGGER.info("Started stream: %s", redact_credentials(str(self.source))) def update_source(self, new_source): _LOGGER.debug("Updating stream source %s", new_source) self.source = new_source self._fast_restart_once = True self._thread_quit.set() def _run_worker(self): from .worker import SegmentBuffer, stream_worker segment_buffer = SegmentBuffer(self.outputs) wait_timeout = 0 while not self._thread_quit.wait(timeout=wait_timeout): start_time = time.time() stream_worker(self.source, self.options, segment_buffer, self._thread_quit) segment_buffer.discontinuity() if not self.keepalive or self._thread_quit.is_set(): if self._fast_restart_once: self._fast_restart_once = False self._thread_quit.clear() continue break if time.time() - start_time > STREAM_RESTART_RESET_TIME: wait_timeout = 0 wait_timeout += STREAM_RESTART_INCREMENT _LOGGER.debug( "Restarting stream worker in %d seconds: %s", wait_timeout, self.source, ) self._worker_finished() def _worker_finished(self): @callback def remove_outputs(): for provider in self.outputs().values(): self.remove_provider(provider) self.hass.loop.call_soon_threadsafe(remove_outputs) def stop(self): self._outputs = {} self.access_token = None if not self.keepalive: self._stop() def _stop(self): if self._thread is not None: self._thread_quit.set() self._thread.join() self._thread = None _LOGGER.info("Stopped stream: %s", redact_credentials(str(self.source))) async def async_record(self, video_path, duration=30, lookback=5): if not self.hass.config.is_allowed_path(video_path): raise HomeAssistantError(f"Can't write {video_path}, no access to path!") # Add recorder recorder = self.outputs().get(RECORDER_PROVIDER) if recorder: raise HomeAssistantError( f"Stream already recording to {recorder.video_path}!" ) recorder = self.add_provider(RECORDER_PROVIDER, timeout=duration) recorder.video_path = video_path self.start() _LOGGER.debug("Started a stream recording of %s seconds", duration) # Take advantage of lookback hls = self.outputs().get(HLS_PROVIDER) if lookback > 0 and hls: num_segments = min(int(lookback // hls.target_duration), MAX_SEGMENTS) # Wait for latest segment, then add the lookback await hls.recv() recorder.prepend(list(hls.get_segments())[-num_segments:])
true
true
f71e7345c9a8dac9495e2a62af51ecf868c01bbb
253
py
Python
tests/factories/test_acf.py
fedorpashin/statistical-modeling
2630e6811afca29cf8a616bab130ae7f9547a043
[ "MIT" ]
2
2021-05-21T15:29:05.000Z
2021-08-11T14:08:31.000Z
tests/factories/test_acf.py
fedorpashin/statistical-modeling
2630e6811afca29cf8a616bab130ae7f9547a043
[ "MIT" ]
59
2021-08-11T14:08:36.000Z
2021-09-30T11:15:33.000Z
tests/factories/test_acf.py
fedorpashin/statistical-modeling
2630e6811afca29cf8a616bab130ae7f9547a043
[ "MIT" ]
null
null
null
import statistical_modeling as sm from typing import Final import unittest class TestACF(unittest.TestCase): def test(self): s: Final = sm.Sample([1, 2, 3]) f: Final = 3 self.assertEqual(sm.ACF(s, f), sm.SampleACF(s, f))
19.461538
58
0.644269
import statistical_modeling as sm from typing import Final import unittest class TestACF(unittest.TestCase): def test(self): s: Final = sm.Sample([1, 2, 3]) f: Final = 3 self.assertEqual(sm.ACF(s, f), sm.SampleACF(s, f))
true
true
f71e73f8ed45ce097a4bf846642a7b1f9267abc3
17,332
py
Python
tf_pose/slim/nets/mobilenet/mobilenet.py
gpspelle/pose-estimation
b817dcc120092002984d8a41431046f323bc02c8
[ "Apache-2.0" ]
3,442
2017-11-20T08:39:51.000Z
2019-05-06T10:51:19.000Z
tf_pose/slim/nets/mobilenet/mobilenet.py
bvanelli/tf-pose-estimation
1dec506ac8abf00616dc0fe76bf476ccdfd6b93e
[ "Apache-2.0" ]
430
2017-11-29T04:21:48.000Z
2019-05-06T05:37:37.000Z
tf_pose/slim/nets/mobilenet/mobilenet.py
bvanelli/tf-pose-estimation
1dec506ac8abf00616dc0fe76bf476ccdfd6b93e
[ "Apache-2.0" ]
683
2017-11-20T08:50:34.000Z
2019-05-04T04:25:14.000Z
# Copyright 2018 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Mobilenet Base Class.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import collections import contextlib import copy import os import tensorflow as tf slim = tf.contrib.slim @slim.add_arg_scope def apply_activation(x, name=None, activation_fn=None): return activation_fn(x, name=name) if activation_fn else x def _fixed_padding(inputs, kernel_size, rate=1): """Pads the input along the spatial dimensions independently of input size. Pads the input such that if it was used in a convolution with 'VALID' padding, the output would have the same dimensions as if the unpadded input was used in a convolution with 'SAME' padding. Args: inputs: A tensor of size [batch, height_in, width_in, channels]. kernel_size: The kernel to be used in the conv2d or max_pool2d operation. rate: An integer, rate for atrous convolution. Returns: output: A tensor of size [batch, height_out, width_out, channels] with the input, either intact (if kernel_size == 1) or padded (if kernel_size > 1). """ kernel_size_effective = [kernel_size[0] + (kernel_size[0] - 1) * (rate - 1), kernel_size[0] + (kernel_size[0] - 1) * (rate - 1)] pad_total = [kernel_size_effective[0] - 1, kernel_size_effective[1] - 1] pad_beg = [pad_total[0] // 2, pad_total[1] // 2] pad_end = [pad_total[0] - pad_beg[0], pad_total[1] - pad_beg[1]] padded_inputs = tf.pad(inputs, [[0, 0], [pad_beg[0], pad_end[0]], [pad_beg[1], pad_end[1]], [0, 0]]) return padded_inputs def _make_divisible(v, divisor, min_value=None): if min_value is None: min_value = divisor new_v = max(min_value, int(v + divisor / 2) // divisor * divisor) # Make sure that round down does not go down by more than 10%. if new_v < 0.9 * v: new_v += divisor return new_v @contextlib.contextmanager def _set_arg_scope_defaults(defaults): """Sets arg scope defaults for all items present in defaults. Args: defaults: dictionary/list of pairs, containing a mapping from function to a dictionary of default args. Yields: context manager where all defaults are set. """ if hasattr(defaults, 'items'): items = list(defaults.items()) else: items = defaults if not items: yield else: func, default_arg = items[0] with slim.arg_scope(func, **default_arg): with _set_arg_scope_defaults(items[1:]): yield @slim.add_arg_scope def depth_multiplier(output_params, multiplier, divisible_by=8, min_depth=8, **unused_kwargs): if 'num_outputs' not in output_params: return d = output_params['num_outputs'] output_params['num_outputs'] = _make_divisible(d * multiplier, divisible_by, min_depth) _Op = collections.namedtuple('Op', ['op', 'params', 'multiplier_func']) def op(opfunc, **params): multiplier = params.pop('multiplier_transorm', depth_multiplier) return _Op(opfunc, params=params, multiplier_func=multiplier) class NoOpScope(object): """No-op context manager.""" def __enter__(self): return None def __exit__(self, exc_type, exc_value, traceback): return False def safe_arg_scope(funcs, **kwargs): """Returns `slim.arg_scope` with all None arguments removed. Arguments: funcs: Functions to pass to `arg_scope`. **kwargs: Arguments to pass to `arg_scope`. Returns: arg_scope or No-op context manager. Note: can be useful if None value should be interpreted as "do not overwrite this parameter value". """ filtered_args = {name: value for name, value in kwargs.items() if value is not None} if filtered_args: return slim.arg_scope(funcs, **filtered_args) else: return NoOpScope() @slim.add_arg_scope def mobilenet_base( # pylint: disable=invalid-name inputs, conv_defs, multiplier=1.0, final_endpoint=None, output_stride=None, use_explicit_padding=False, scope=None, is_training=False): """Mobilenet base network. Constructs a network from inputs to the given final endpoint. By default the network is constructed in inference mode. To create network in training mode use: with slim.arg_scope(mobilenet.training_scope()): logits, endpoints = mobilenet_base(...) Args: inputs: a tensor of shape [batch_size, height, width, channels]. conv_defs: A list of op(...) layers specifying the net architecture. multiplier: Float multiplier for the depth (number of channels) for all convolution ops. The value must be greater than zero. Typical usage will be to set this value in (0, 1) to reduce the number of parameters or computation cost of the model. final_endpoint: The name of last layer, for early termination for for V1-based networks: last layer is "layer_14", for V2: "layer_20" output_stride: An integer that specifies the requested ratio of input to output spatial resolution. If not None, then we invoke atrous convolution if necessary to prevent the network from reducing the spatial resolution of the activation maps. Allowed values are 1 or any even number, excluding zero. Typical values are 8 (accurate fully convolutional mode), 16 (fast fully convolutional mode), and 32 (classification mode). NOTE- output_stride relies on all consequent operators to support dilated operators via "rate" parameter. This might require wrapping non-conv operators to operate properly. use_explicit_padding: Use 'VALID' padding for convolutions, but prepad inputs so that the output dimensions are the same as if 'SAME' padding were used. scope: optional variable scope. is_training: How to setup batch_norm and other ops. Note: most of the time this does not need be set directly. Use mobilenet.training_scope() to set up training instead. This parameter is here for backward compatibility only. It is safe to set it to the value matching training_scope(is_training=...). It is also safe to explicitly set it to False, even if there is outer training_scope set to to training. (The network will be built in inference mode). If this is set to None, no arg_scope is added for slim.batch_norm's is_training parameter. Returns: tensor_out: output tensor. end_points: a set of activations for external use, for example summaries or losses. Raises: ValueError: depth_multiplier <= 0, or the target output_stride is not allowed. """ if multiplier <= 0: raise ValueError('multiplier is not greater than zero.') # Set conv defs defaults and overrides. conv_defs_defaults = conv_defs.get('defaults', {}) conv_defs_overrides = conv_defs.get('overrides', {}) if use_explicit_padding: conv_defs_overrides = copy.deepcopy(conv_defs_overrides) conv_defs_overrides[ (slim.conv2d, slim.separable_conv2d)] = {'padding': 'VALID'} if output_stride is not None: if output_stride == 0 or (output_stride > 1 and output_stride % 2): raise ValueError('Output stride must be None, 1 or a multiple of 2.') # a) Set the tensorflow scope # b) set padding to default: note we might consider removing this # since it is also set by mobilenet_scope # c) set all defaults # d) set all extra overrides. with _scope_all(scope, default_scope='Mobilenet'), \ safe_arg_scope([slim.batch_norm], is_training=is_training), \ _set_arg_scope_defaults(conv_defs_defaults), \ _set_arg_scope_defaults(conv_defs_overrides): # The current_stride variable keeps track of the output stride of the # activations, i.e., the running product of convolution strides up to the # current network layer. This allows us to invoke atrous convolution # whenever applying the next convolution would result in the activations # having output stride larger than the target output_stride. current_stride = 1 # The atrous convolution rate parameter. rate = 1 net = inputs # Insert default parameters before the base scope which includes # any custom overrides set in mobilenet. end_points = {} scopes = {} for i, opdef in enumerate(conv_defs['spec']): params = dict(opdef.params) opdef.multiplier_func(params, multiplier) stride = params.get('stride', 1) if output_stride is not None and current_stride == output_stride: # If we have reached the target output_stride, then we need to employ # atrous convolution with stride=1 and multiply the atrous rate by the # current unit's stride for use in subsequent layers. layer_stride = 1 layer_rate = rate rate *= stride else: layer_stride = stride layer_rate = 1 current_stride *= stride # Update params. params['stride'] = layer_stride # Only insert rate to params if rate > 1. if layer_rate > 1: params['rate'] = layer_rate # Set padding if use_explicit_padding: if 'kernel_size' in params: net = _fixed_padding(net, params['kernel_size'], layer_rate) else: params['use_explicit_padding'] = True end_point = 'layer_%d' % (i + 1) try: net = opdef.op(net, **params) except Exception: print('Failed to create op %i: %r params: %r' % (i, opdef, params)) raise end_points[end_point] = net scope = os.path.dirname(net.name) scopes[scope] = end_point if final_endpoint is not None and end_point == final_endpoint: break # Add all tensors that end with 'output' to # endpoints for t in net.graph.get_operations(): scope = os.path.dirname(t.name) bn = os.path.basename(t.name) if scope in scopes and t.name.endswith('output'): end_points[scopes[scope] + '/' + bn] = t.outputs[0] return net, end_points @contextlib.contextmanager def _scope_all(scope, default_scope=None): with tf.variable_scope(scope, default_name=default_scope) as s,\ tf.name_scope(s.original_name_scope): yield s @slim.add_arg_scope def mobilenet(inputs, num_classes=1001, prediction_fn=slim.softmax, reuse=None, scope='Mobilenet', base_only=False, **mobilenet_args): """Mobilenet model for classification, supports both V1 and V2. Note: default mode is inference, use mobilenet.training_scope to create training network. Args: inputs: a tensor of shape [batch_size, height, width, channels]. num_classes: number of predicted classes. If 0 or None, the logits layer is omitted and the input features to the logits layer (before dropout) are returned instead. prediction_fn: a function to get predictions out of logits (default softmax). reuse: whether or not the network and its variables should be reused. To be able to reuse 'scope' must be given. scope: Optional variable_scope. base_only: if True will only create the base of the network (no pooling and no logits). **mobilenet_args: passed to mobilenet_base verbatim. - conv_defs: list of conv defs - multiplier: Float multiplier for the depth (number of channels) for all convolution ops. The value must be greater than zero. Typical usage will be to set this value in (0, 1) to reduce the number of parameters or computation cost of the model. - output_stride: will ensure that the last layer has at most total stride. If the architecture calls for more stride than that provided (e.g. output_stride=16, but the architecture has 5 stride=2 operators), it will replace output_stride with fractional convolutions using Atrous Convolutions. Returns: logits: the pre-softmax activations, a tensor of size [batch_size, num_classes] end_points: a dictionary from components of the network to the corresponding activation tensor. Raises: ValueError: Input rank is invalid. """ is_training = mobilenet_args.get('is_training', False) input_shape = inputs.get_shape().as_list() if len(input_shape) != 4: raise ValueError('Expected rank 4 input, was: %d' % len(input_shape)) with tf.variable_scope(scope, 'Mobilenet', reuse=reuse) as scope: inputs = tf.identity(inputs, 'input') net, end_points = mobilenet_base(inputs, scope=scope, **mobilenet_args) if base_only: return net, end_points net = tf.identity(net, name='embedding') with tf.variable_scope('Logits'): net = global_pool(net) end_points['global_pool'] = net if not num_classes: return net, end_points net = slim.dropout(net, scope='Dropout', is_training=is_training) # 1 x 1 x num_classes # Note: legacy scope name. logits = slim.conv2d( net, num_classes, [1, 1], activation_fn=None, normalizer_fn=None, biases_initializer=tf.zeros_initializer(), scope='Conv2d_1c_1x1') logits = tf.squeeze(logits, [1, 2]) logits = tf.identity(logits, name='output') end_points['Logits'] = logits if prediction_fn: end_points['Predictions'] = prediction_fn(logits, 'Predictions') return logits, end_points def global_pool(input_tensor, pool_op=tf.nn.avg_pool): """Applies avg pool to produce 1x1 output. NOTE: This function is funcitonally equivalenet to reduce_mean, but it has baked in average pool which has better support across hardware. Args: input_tensor: input tensor pool_op: pooling op (avg pool is default) Returns: a tensor batch_size x 1 x 1 x depth. """ shape = input_tensor.get_shape().as_list() if shape[1] is None or shape[2] is None: kernel_size = tf.convert_to_tensor( [1, tf.shape(input_tensor)[1], tf.shape(input_tensor)[2], 1]) else: kernel_size = [1, shape[1], shape[2], 1] output = pool_op( input_tensor, ksize=kernel_size, strides=[1, 1, 1, 1], padding='VALID') # Recover output shape, for unknown shape. output.set_shape([None, 1, 1, None]) return output def training_scope(is_training=True, weight_decay=0.00004, stddev=0.09, dropout_keep_prob=0.8, bn_decay=0.997): """Defines Mobilenet training scope. Usage: with tf.contrib.slim.arg_scope(mobilenet.training_scope()): logits, endpoints = mobilenet_v2.mobilenet(input_tensor) # the network created will be trainble with dropout/batch norm # initialized appropriately. Args: is_training: if set to False this will ensure that all customizations are set to non-training mode. This might be helpful for code that is reused across both training/evaluation, but most of the time training_scope with value False is not needed. If this is set to None, the parameters is not added to the batch_norm arg_scope. weight_decay: The weight decay to use for regularizing the model. stddev: Standard deviation for initialization, if negative uses xavier. dropout_keep_prob: dropout keep probability (not set if equals to None). bn_decay: decay for the batch norm moving averages (not set if equals to None). Returns: An argument scope to use via arg_scope. """ # Note: do not introduce parameters that would change the inference # model here (for example whether to use bias), modify conv_def instead. batch_norm_params = { 'decay': bn_decay, 'is_training': is_training } if stddev < 0: weight_intitializer = slim.initializers.xavier_initializer() else: weight_intitializer = tf.truncated_normal_initializer(stddev=stddev) # Set weight_decay for weights in Conv and FC layers. with slim.arg_scope( [slim.conv2d, slim.fully_connected, slim.separable_conv2d], weights_initializer=weight_intitializer, normalizer_fn=slim.batch_norm), \ slim.arg_scope([mobilenet_base, mobilenet], is_training=is_training),\ safe_arg_scope([slim.batch_norm], **batch_norm_params), \ safe_arg_scope([slim.dropout], is_training=is_training, keep_prob=dropout_keep_prob), \ slim.arg_scope([slim.conv2d], \ weights_regularizer=slim.l2_regularizer(weight_decay)), \ slim.arg_scope([slim.separable_conv2d], weights_regularizer=None) as s: return s
37.034188
80
0.687111
from __future__ import absolute_import from __future__ import division from __future__ import print_function import collections import contextlib import copy import os import tensorflow as tf slim = tf.contrib.slim @slim.add_arg_scope def apply_activation(x, name=None, activation_fn=None): return activation_fn(x, name=name) if activation_fn else x def _fixed_padding(inputs, kernel_size, rate=1): kernel_size_effective = [kernel_size[0] + (kernel_size[0] - 1) * (rate - 1), kernel_size[0] + (kernel_size[0] - 1) * (rate - 1)] pad_total = [kernel_size_effective[0] - 1, kernel_size_effective[1] - 1] pad_beg = [pad_total[0] // 2, pad_total[1] // 2] pad_end = [pad_total[0] - pad_beg[0], pad_total[1] - pad_beg[1]] padded_inputs = tf.pad(inputs, [[0, 0], [pad_beg[0], pad_end[0]], [pad_beg[1], pad_end[1]], [0, 0]]) return padded_inputs def _make_divisible(v, divisor, min_value=None): if min_value is None: min_value = divisor new_v = max(min_value, int(v + divisor / 2) // divisor * divisor) if new_v < 0.9 * v: new_v += divisor return new_v @contextlib.contextmanager def _set_arg_scope_defaults(defaults): if hasattr(defaults, 'items'): items = list(defaults.items()) else: items = defaults if not items: yield else: func, default_arg = items[0] with slim.arg_scope(func, **default_arg): with _set_arg_scope_defaults(items[1:]): yield @slim.add_arg_scope def depth_multiplier(output_params, multiplier, divisible_by=8, min_depth=8, **unused_kwargs): if 'num_outputs' not in output_params: return d = output_params['num_outputs'] output_params['num_outputs'] = _make_divisible(d * multiplier, divisible_by, min_depth) _Op = collections.namedtuple('Op', ['op', 'params', 'multiplier_func']) def op(opfunc, **params): multiplier = params.pop('multiplier_transorm', depth_multiplier) return _Op(opfunc, params=params, multiplier_func=multiplier) class NoOpScope(object): def __enter__(self): return None def __exit__(self, exc_type, exc_value, traceback): return False def safe_arg_scope(funcs, **kwargs): filtered_args = {name: value for name, value in kwargs.items() if value is not None} if filtered_args: return slim.arg_scope(funcs, **filtered_args) else: return NoOpScope() @slim.add_arg_scope def mobilenet_base( inputs, conv_defs, multiplier=1.0, final_endpoint=None, output_stride=None, use_explicit_padding=False, scope=None, is_training=False): if multiplier <= 0: raise ValueError('multiplier is not greater than zero.') conv_defs_defaults = conv_defs.get('defaults', {}) conv_defs_overrides = conv_defs.get('overrides', {}) if use_explicit_padding: conv_defs_overrides = copy.deepcopy(conv_defs_overrides) conv_defs_overrides[ (slim.conv2d, slim.separable_conv2d)] = {'padding': 'VALID'} if output_stride is not None: if output_stride == 0 or (output_stride > 1 and output_stride % 2): raise ValueError('Output stride must be None, 1 or a multiple of 2.') with _scope_all(scope, default_scope='Mobilenet'), \ safe_arg_scope([slim.batch_norm], is_training=is_training), \ _set_arg_scope_defaults(conv_defs_defaults), \ _set_arg_scope_defaults(conv_defs_overrides): current_stride = 1 rate = 1 net = inputs end_points = {} scopes = {} for i, opdef in enumerate(conv_defs['spec']): params = dict(opdef.params) opdef.multiplier_func(params, multiplier) stride = params.get('stride', 1) if output_stride is not None and current_stride == output_stride: layer_stride = 1 layer_rate = rate rate *= stride else: layer_stride = stride layer_rate = 1 current_stride *= stride # Update params. params['stride'] = layer_stride # Only insert rate to params if rate > 1. if layer_rate > 1: params['rate'] = layer_rate # Set padding if use_explicit_padding: if 'kernel_size' in params: net = _fixed_padding(net, params['kernel_size'], layer_rate) else: params['use_explicit_padding'] = True end_point = 'layer_%d' % (i + 1) try: net = opdef.op(net, **params) except Exception: print('Failed to create op %i: %r params: %r' % (i, opdef, params)) raise end_points[end_point] = net scope = os.path.dirname(net.name) scopes[scope] = end_point if final_endpoint is not None and end_point == final_endpoint: break # Add all tensors that end with 'output' to # endpoints for t in net.graph.get_operations(): scope = os.path.dirname(t.name) bn = os.path.basename(t.name) if scope in scopes and t.name.endswith('output'): end_points[scopes[scope] + '/' + bn] = t.outputs[0] return net, end_points @contextlib.contextmanager def _scope_all(scope, default_scope=None): with tf.variable_scope(scope, default_name=default_scope) as s,\ tf.name_scope(s.original_name_scope): yield s @slim.add_arg_scope def mobilenet(inputs, num_classes=1001, prediction_fn=slim.softmax, reuse=None, scope='Mobilenet', base_only=False, **mobilenet_args): is_training = mobilenet_args.get('is_training', False) input_shape = inputs.get_shape().as_list() if len(input_shape) != 4: raise ValueError('Expected rank 4 input, was: %d' % len(input_shape)) with tf.variable_scope(scope, 'Mobilenet', reuse=reuse) as scope: inputs = tf.identity(inputs, 'input') net, end_points = mobilenet_base(inputs, scope=scope, **mobilenet_args) if base_only: return net, end_points net = tf.identity(net, name='embedding') with tf.variable_scope('Logits'): net = global_pool(net) end_points['global_pool'] = net if not num_classes: return net, end_points net = slim.dropout(net, scope='Dropout', is_training=is_training) # 1 x 1 x num_classes # Note: legacy scope name. logits = slim.conv2d( net, num_classes, [1, 1], activation_fn=None, normalizer_fn=None, biases_initializer=tf.zeros_initializer(), scope='Conv2d_1c_1x1') logits = tf.squeeze(logits, [1, 2]) logits = tf.identity(logits, name='output') end_points['Logits'] = logits if prediction_fn: end_points['Predictions'] = prediction_fn(logits, 'Predictions') return logits, end_points def global_pool(input_tensor, pool_op=tf.nn.avg_pool): shape = input_tensor.get_shape().as_list() if shape[1] is None or shape[2] is None: kernel_size = tf.convert_to_tensor( [1, tf.shape(input_tensor)[1], tf.shape(input_tensor)[2], 1]) else: kernel_size = [1, shape[1], shape[2], 1] output = pool_op( input_tensor, ksize=kernel_size, strides=[1, 1, 1, 1], padding='VALID') # Recover output shape, for unknown shape. output.set_shape([None, 1, 1, None]) return output def training_scope(is_training=True, weight_decay=0.00004, stddev=0.09, dropout_keep_prob=0.8, bn_decay=0.997): # Note: do not introduce parameters that would change the inference # model here (for example whether to use bias), modify conv_def instead. batch_norm_params = { 'decay': bn_decay, 'is_training': is_training } if stddev < 0: weight_intitializer = slim.initializers.xavier_initializer() else: weight_intitializer = tf.truncated_normal_initializer(stddev=stddev) # Set weight_decay for weights in Conv and FC layers. with slim.arg_scope( [slim.conv2d, slim.fully_connected, slim.separable_conv2d], weights_initializer=weight_intitializer, normalizer_fn=slim.batch_norm), \ slim.arg_scope([mobilenet_base, mobilenet], is_training=is_training),\ safe_arg_scope([slim.batch_norm], **batch_norm_params), \ safe_arg_scope([slim.dropout], is_training=is_training, keep_prob=dropout_keep_prob), \ slim.arg_scope([slim.conv2d], \ weights_regularizer=slim.l2_regularizer(weight_decay)), \ slim.arg_scope([slim.separable_conv2d], weights_regularizer=None) as s: return s
true
true
f71e74274134242cf53d0a9f6b3fddeae6b917de
2,269
py
Python
PythonSource/pythoncore/antlr4/Utils.py
dean2191/JavaLove
fb0be1e829b7400aff50334f49bc4e9db7d6cb1a
[ "MIT" ]
1
2021-04-29T06:40:54.000Z
2021-04-29T06:40:54.000Z
src/antlr4/Utils.py
arminnh/ba3-c-to-p-compiler
2c649e1d3643471bac681c2656c1c7d6249be4d7
[ "MIT" ]
2
2021-06-23T21:23:04.000Z
2021-06-23T21:23:11.000Z
src/antlr4/Utils.py
arminnh/ba3-c-to-p-compiler
2c649e1d3643471bac681c2656c1c7d6249be4d7
[ "MIT" ]
1
2019-12-16T07:21:49.000Z
2019-12-16T07:21:49.000Z
#[The "BSD license"] # Copyright (c) 2012 Terence Parr # Copyright (c) 2012 Sam Harwell # Copyright (c) 2014 Eric Vergnaud # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions # are met: # # 1. Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # 2. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # 3. The name of the author may not be used to endorse or promote products # derived from this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR # IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES # OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. # IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, # INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT # NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF # THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # from io import StringIO def str_list(val): with StringIO() as buf: buf.write('[') first = True for item in val: if not first: buf.write(', ') buf.write(str(item)) first = False buf.write(']') return buf.getvalue() def escapeWhitespace(s:str, escapeSpaces:bool): with StringIO() as buf: for c in s: if c==' ' and escapeSpaces: buf.write('\u00B7') elif c=='\t': buf.write("\\t") elif c=='\n': buf.write("\\n") elif c=='\r': buf.write("\\r") else: buf.write(c) return buf.getvalue()
38.457627
75
0.662406
from io import StringIO def str_list(val): with StringIO() as buf: buf.write('[') first = True for item in val: if not first: buf.write(', ') buf.write(str(item)) first = False buf.write(']') return buf.getvalue() def escapeWhitespace(s:str, escapeSpaces:bool): with StringIO() as buf: for c in s: if c==' ' and escapeSpaces: buf.write('\u00B7') elif c=='\t': buf.write("\\t") elif c=='\n': buf.write("\\n") elif c=='\r': buf.write("\\r") else: buf.write(c) return buf.getvalue()
true
true
f71e742c4e9898a942e1c505a387b4ebc7b12bb1
3,945
py
Python
ml/rl/workflow/dqn_workflow.py
tao2020/Horizon
0f9a1b16ddd6e5a8ac98e61acd227aae7c201b57
[ "BSD-3-Clause" ]
1
2020-09-27T08:48:14.000Z
2020-09-27T08:48:14.000Z
ml/rl/workflow/dqn_workflow.py
tao2020/Horizon
0f9a1b16ddd6e5a8ac98e61acd227aae7c201b57
[ "BSD-3-Clause" ]
null
null
null
ml/rl/workflow/dqn_workflow.py
tao2020/Horizon
0f9a1b16ddd6e5a8ac98e61acd227aae7c201b57
[ "BSD-3-Clause" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) Facebook, Inc. and its affiliates. All rights reserved. import logging import sys from typing import Dict import numpy as np from ml.rl.evaluation.evaluator import Evaluator from ml.rl.preprocessing.preprocessor import Preprocessor from ml.rl.preprocessing.sparse_to_dense import PandasSparseToDenseProcessor from ml.rl.readers.json_dataset_reader import JSONDatasetReader from ml.rl.tensorboardX import summary_writer_context from ml.rl.thrift.core.ttypes import ( DiscreteActionModelParameters, NormalizationParameters, RainbowDQNParameters, RLParameters, TrainingParameters, ) from ml.rl.training.dqn_trainer import DQNTrainer from ml.rl.workflow.base_workflow import BaseWorkflow from ml.rl.workflow.helpers import ( export_trainer_and_predictor, minibatch_size_multiplier, parse_args, update_model_for_warm_start, ) from ml.rl.workflow.preprocess_handler import DqnPreprocessHandler, PreprocessHandler from tensorboardX import SummaryWriter logger = logging.getLogger(__name__) class DqnWorkflow(BaseWorkflow): def __init__( self, model_params: DiscreteActionModelParameters, preprocess_handler: PreprocessHandler, state_normalization: Dict[int, NormalizationParameters], use_gpu: bool, use_all_avail_gpus: bool, ): logger.info("Running DQN workflow with params:") logger.info(model_params) model_params = model_params trainer = DQNTrainer( model_params, state_normalization, use_gpu=use_gpu, use_all_avail_gpus=use_all_avail_gpus, ) trainer = update_model_for_warm_start(trainer) assert type(trainer) == DQNTrainer, "Warm started wrong model type: " + str( type(trainer) ) evaluator = Evaluator( model_params.actions, model_params.rl.gamma, trainer, metrics_to_score=trainer.metrics_to_score, ) super(DqnWorkflow, self).__init__( preprocess_handler, trainer, evaluator, model_params.training.minibatch_size ) def main(params): # Set minibatch size based on # of devices being used to train params["training"]["minibatch_size"] *= minibatch_size_multiplier( params["use_gpu"], params["use_all_avail_gpus"] ) rl_parameters = RLParameters(**params["rl"]) training_parameters = TrainingParameters(**params["training"]) rainbow_parameters = RainbowDQNParameters(**params["rainbow"]) model_params = DiscreteActionModelParameters( actions=params["actions"], rl=rl_parameters, training=training_parameters, rainbow=rainbow_parameters, ) state_normalization = BaseWorkflow.read_norm_file(params["state_norm_data_path"]) writer = SummaryWriter(log_dir=params["model_output_path"]) logger.info("TensorBoard logging location is: {}".format(writer.log_dir)) preprocess_handler = DqnPreprocessHandler( Preprocessor(state_normalization, False), np.array(model_params.actions), PandasSparseToDenseProcessor(), ) workflow = DqnWorkflow( model_params, preprocess_handler, state_normalization, params["use_gpu"], params["use_all_avail_gpus"], ) train_dataset = JSONDatasetReader( params["training_data_path"], batch_size=training_parameters.minibatch_size ) eval_dataset = JSONDatasetReader(params["eval_data_path"], batch_size=16) with summary_writer_context(writer): workflow.train_network(train_dataset, eval_dataset, int(params["epochs"])) return export_trainer_and_predictor( workflow.trainer, params["model_output_path"] ) # noqa if __name__ == "__main__": logging.basicConfig(stream=sys.stdout, level=logging.INFO) params = parse_args(sys.argv) main(params)
31.814516
88
0.714068
import logging import sys from typing import Dict import numpy as np from ml.rl.evaluation.evaluator import Evaluator from ml.rl.preprocessing.preprocessor import Preprocessor from ml.rl.preprocessing.sparse_to_dense import PandasSparseToDenseProcessor from ml.rl.readers.json_dataset_reader import JSONDatasetReader from ml.rl.tensorboardX import summary_writer_context from ml.rl.thrift.core.ttypes import ( DiscreteActionModelParameters, NormalizationParameters, RainbowDQNParameters, RLParameters, TrainingParameters, ) from ml.rl.training.dqn_trainer import DQNTrainer from ml.rl.workflow.base_workflow import BaseWorkflow from ml.rl.workflow.helpers import ( export_trainer_and_predictor, minibatch_size_multiplier, parse_args, update_model_for_warm_start, ) from ml.rl.workflow.preprocess_handler import DqnPreprocessHandler, PreprocessHandler from tensorboardX import SummaryWriter logger = logging.getLogger(__name__) class DqnWorkflow(BaseWorkflow): def __init__( self, model_params: DiscreteActionModelParameters, preprocess_handler: PreprocessHandler, state_normalization: Dict[int, NormalizationParameters], use_gpu: bool, use_all_avail_gpus: bool, ): logger.info("Running DQN workflow with params:") logger.info(model_params) model_params = model_params trainer = DQNTrainer( model_params, state_normalization, use_gpu=use_gpu, use_all_avail_gpus=use_all_avail_gpus, ) trainer = update_model_for_warm_start(trainer) assert type(trainer) == DQNTrainer, "Warm started wrong model type: " + str( type(trainer) ) evaluator = Evaluator( model_params.actions, model_params.rl.gamma, trainer, metrics_to_score=trainer.metrics_to_score, ) super(DqnWorkflow, self).__init__( preprocess_handler, trainer, evaluator, model_params.training.minibatch_size ) def main(params): ch_size"] *= minibatch_size_multiplier( params["use_gpu"], params["use_all_avail_gpus"] ) rl_parameters = RLParameters(**params["rl"]) training_parameters = TrainingParameters(**params["training"]) rainbow_parameters = RainbowDQNParameters(**params["rainbow"]) model_params = DiscreteActionModelParameters( actions=params["actions"], rl=rl_parameters, training=training_parameters, rainbow=rainbow_parameters, ) state_normalization = BaseWorkflow.read_norm_file(params["state_norm_data_path"]) writer = SummaryWriter(log_dir=params["model_output_path"]) logger.info("TensorBoard logging location is: {}".format(writer.log_dir)) preprocess_handler = DqnPreprocessHandler( Preprocessor(state_normalization, False), np.array(model_params.actions), PandasSparseToDenseProcessor(), ) workflow = DqnWorkflow( model_params, preprocess_handler, state_normalization, params["use_gpu"], params["use_all_avail_gpus"], ) train_dataset = JSONDatasetReader( params["training_data_path"], batch_size=training_parameters.minibatch_size ) eval_dataset = JSONDatasetReader(params["eval_data_path"], batch_size=16) with summary_writer_context(writer): workflow.train_network(train_dataset, eval_dataset, int(params["epochs"])) return export_trainer_and_predictor( workflow.trainer, params["model_output_path"] ) if __name__ == "__main__": logging.basicConfig(stream=sys.stdout, level=logging.INFO) params = parse_args(sys.argv) main(params)
true
true
f71e7468d92a80a2d5be03a087cf20fb8d906f17
1,476
py
Python
translate.py
kolk/qa_factoid2natural
ccdd0096217c8e88b148f353f0c89628b85f9c4d
[ "MIT" ]
4
2019-11-28T17:49:19.000Z
2022-02-23T17:07:08.000Z
translate.py
kolk/qa_factoid2natural
ccdd0096217c8e88b148f353f0c89628b85f9c4d
[ "MIT" ]
5
2019-11-28T17:49:09.000Z
2022-02-28T16:37:17.000Z
translate.py
kolk/qa_factoid2natural
ccdd0096217c8e88b148f353f0c89628b85f9c4d
[ "MIT" ]
null
null
null
#!/usr/bin/env python # -*- coding: utf-8 -*- from __future__ import unicode_literals import configargparse from onmt.utils.logging import init_logger from onmt.utils.misc import split_corpus from onmt.translate.translator import build_translator import onmt.opts as opts def main(opt): translator = build_translator(opt, report_score=True) src_shards = split_corpus(opt.src, opt.shard_size) ############## Modified ########################## ans_shards = split_corpus(opt.ans, opt.shard_size) tgt_shards = split_corpus(opt.tgt, opt.shard_size) \ if opt.tgt is not None else [None]*opt.shard_size shard_pairs = zip(src_shards, tgt_shards, ans_shards) for i, (src_shard, tgt_shard, ans_shard) in enumerate(shard_pairs): logger.info("Translating shard %d." % i) translator.translate( src=src_shard, tgt=tgt_shard, ans=ans_shard, src_dir=opt.src_dir, batch_size=opt.batch_size, attn_debug=opt.attn_debug ) if __name__ == "__main__": parser = configargparse.ArgumentParser( description='translate.py', config_file_parser_class=configargparse.YAMLConfigFileParser, formatter_class=configargparse.ArgumentDefaultsHelpFormatter) opts.config_opts(parser) opts.add_md_help_argument(parser) opts.translate_opts(parser) opt = parser.parse_args() logger = init_logger(opt.log_file) main(opt)
32.086957
71
0.682927
from __future__ import unicode_literals import configargparse from onmt.utils.logging import init_logger from onmt.utils.misc import split_corpus from onmt.translate.translator import build_translator import onmt.opts as opts def main(opt): translator = build_translator(opt, report_score=True) src_shards = split_corpus(opt.src, opt.shard_size) .translate_opts(parser) opt = parser.parse_args() logger = init_logger(opt.log_file) main(opt)
true
true
f71e752ba12c161e76ce30e5f042ecabae71c44d
1,251
py
Python
evaluation.py
yphsieh/rPPG_blink
31be5b818d34892eb9f2c1abd3b00f370413e3db
[ "Apache-2.0" ]
null
null
null
evaluation.py
yphsieh/rPPG_blink
31be5b818d34892eb9f2c1abd3b00f370413e3db
[ "Apache-2.0" ]
null
null
null
evaluation.py
yphsieh/rPPG_blink
31be5b818d34892eb9f2c1abd3b00f370413e3db
[ "Apache-2.0" ]
null
null
null
import os import argparse from keras.models import load_model import numpy as np from sklearn.metrics import accuracy_score, f1_score from data_preprocessing import * parser = argparse.ArgumentParser() parser.add_argument('-m', '--model_name', default='save/RDNN.h5', type=str) parser.add_argument('--smooth', type=bool, default=False) parser.add_argument('--scale', type=bool, default=False) args = parser.parse_args() print(args) x_test = np.load('data/data_test_600.npy') y_test = np.load('data/label_test_600.npy').reshape(-1, 1) print('x_test: {}'.format(x_test.shape)) print('y_test: {}'.format(y_test.shape)) lie_ratio = np.sum(y_test)/y_test.shape[0] print('Lie Ratio: {}'.format(lie_ratio)) x_test = TestPreprocess(x_test, args.smooth, args.scale) print('='*20, 'Model Loading...', '='*20) model = load_model(args.model_name) print('='*20, 'Model Loaded', '='*20) # os.system('clear') predict = model.predict(x_test) y_predict = (predict > 0.3).astype(np.int) lie_ratio = np.sum(y_predict)/y_predict.shape[0] print('Lie Ratio Predicted: {}'.format(lie_ratio)) score_f1 = f1_score(y_test, y_predict) score_acc = accuracy_score(y_test, y_predict) print('f1 score: {}'.format(score_f1)) print('accuracy score: {}'.format(score_acc))
28.431818
75
0.730616
import os import argparse from keras.models import load_model import numpy as np from sklearn.metrics import accuracy_score, f1_score from data_preprocessing import * parser = argparse.ArgumentParser() parser.add_argument('-m', '--model_name', default='save/RDNN.h5', type=str) parser.add_argument('--smooth', type=bool, default=False) parser.add_argument('--scale', type=bool, default=False) args = parser.parse_args() print(args) x_test = np.load('data/data_test_600.npy') y_test = np.load('data/label_test_600.npy').reshape(-1, 1) print('x_test: {}'.format(x_test.shape)) print('y_test: {}'.format(y_test.shape)) lie_ratio = np.sum(y_test)/y_test.shape[0] print('Lie Ratio: {}'.format(lie_ratio)) x_test = TestPreprocess(x_test, args.smooth, args.scale) print('='*20, 'Model Loading...', '='*20) model = load_model(args.model_name) print('='*20, 'Model Loaded', '='*20) predict = model.predict(x_test) y_predict = (predict > 0.3).astype(np.int) lie_ratio = np.sum(y_predict)/y_predict.shape[0] print('Lie Ratio Predicted: {}'.format(lie_ratio)) score_f1 = f1_score(y_test, y_predict) score_acc = accuracy_score(y_test, y_predict) print('f1 score: {}'.format(score_f1)) print('accuracy score: {}'.format(score_acc))
true
true
f71e757c93cf4638a9270e5f34353dc31a8e6ed9
3,064
py
Python
tests/test_util/test_calibration.py
decarlof/algotom
f357ae5a71d6bc11471da7b3f80505d52918b610
[ "Apache-2.0" ]
6
2021-05-13T15:20:03.000Z
2022-01-08T11:36:03.000Z
tests/test_util/test_calibration.py
decarlof/algotom
f357ae5a71d6bc11471da7b3f80505d52918b610
[ "Apache-2.0" ]
4
2021-05-17T09:15:14.000Z
2021-07-08T19:38:34.000Z
tests/test_util/test_calibration.py
algotom/algotom
3dce086bcc0c4df97700c60f8ec90e07ee95d040
[ "Apache-2.0" ]
5
2021-05-20T16:28:55.000Z
2021-06-11T23:40:57.000Z
# ============================================================================ # ============================================================================ # Copyright (c) 2021 Nghia T. Vo. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================ # Author: Nghia T. Vo # E-mail: algotomography@gmail.com # Description: Tests for the Algotom package. # Contributors: # ============================================================================ """ Tests for methods in util/calibration.py """ import unittest import numpy as np import scipy.ndimage as ndi import algotom.util.calibration as cali class CalibrationMethods(unittest.TestCase): def setUp(self): self.eps = 10 ** (-6) self.var = 0.05 sigma = 30 (self.hei, self.wid) = (64, 64) (ycen, xcen) = (self.hei // 2, self.wid // 2) y, x = np.ogrid[-ycen:self.hei - ycen, -xcen:self.wid - xcen] num = 2.0 * sigma * sigma self.bck = np.exp(-(x * x / num + y * y / num)) mat = np.zeros((self.hei, self.wid), dtype=np.float32) self.num_dots = 1 mat[ycen - 3:ycen + 3, xcen - 3:xcen + 3] = 1 self.mat_dots = np.float32(ndi.binary_dilation(mat, iterations=2)) def test_normalize_background(self): mat_nor = cali.normalize_background(self.bck, 3) std_val = np.std(mat_nor) self.assertTrue(std_val <= self.var) def test_normalize_background_based_fft(self): mat_nor = cali.normalize_background_based_fft(self.bck, sigma=5, pad=10) std_val = np.std(mat_nor) self.assertTrue(std_val <= self.var) def test_binarize_image(self): bck = 0.5 * np.random.rand(self.hei, self.wid) mat_bin = cali.binarize_image(self.mat_dots + bck, bgr="dark", denoise=False) num_dots = ndi.label(mat_bin)[-1] self.assertTrue(self.num_dots == num_dots) def test_calculate_distance(self): mat1 = np.zeros((self.hei, self.wid), dtype=np.float32) mat2 = np.zeros_like(mat1) bck = 0.5 * np.random.rand(self.hei, self.wid) mat1[5, 10] = 1.0 mat1 = np.float32(ndi.binary_dilation(mat1, iterations=3)) mat2[5, 20] = 1.0 mat2 = np.float32(ndi.binary_dilation(mat2, iterations=3)) dis = cali.calculate_distance(mat1 + bck, mat2 + bck, bgr="dark", denoise=False) self.assertTrue(np.abs(dis - 10.0) <= self.eps)
40.315789
80
0.570496
import unittest import numpy as np import scipy.ndimage as ndi import algotom.util.calibration as cali class CalibrationMethods(unittest.TestCase): def setUp(self): self.eps = 10 ** (-6) self.var = 0.05 sigma = 30 (self.hei, self.wid) = (64, 64) (ycen, xcen) = (self.hei // 2, self.wid // 2) y, x = np.ogrid[-ycen:self.hei - ycen, -xcen:self.wid - xcen] num = 2.0 * sigma * sigma self.bck = np.exp(-(x * x / num + y * y / num)) mat = np.zeros((self.hei, self.wid), dtype=np.float32) self.num_dots = 1 mat[ycen - 3:ycen + 3, xcen - 3:xcen + 3] = 1 self.mat_dots = np.float32(ndi.binary_dilation(mat, iterations=2)) def test_normalize_background(self): mat_nor = cali.normalize_background(self.bck, 3) std_val = np.std(mat_nor) self.assertTrue(std_val <= self.var) def test_normalize_background_based_fft(self): mat_nor = cali.normalize_background_based_fft(self.bck, sigma=5, pad=10) std_val = np.std(mat_nor) self.assertTrue(std_val <= self.var) def test_binarize_image(self): bck = 0.5 * np.random.rand(self.hei, self.wid) mat_bin = cali.binarize_image(self.mat_dots + bck, bgr="dark", denoise=False) num_dots = ndi.label(mat_bin)[-1] self.assertTrue(self.num_dots == num_dots) def test_calculate_distance(self): mat1 = np.zeros((self.hei, self.wid), dtype=np.float32) mat2 = np.zeros_like(mat1) bck = 0.5 * np.random.rand(self.hei, self.wid) mat1[5, 10] = 1.0 mat1 = np.float32(ndi.binary_dilation(mat1, iterations=3)) mat2[5, 20] = 1.0 mat2 = np.float32(ndi.binary_dilation(mat2, iterations=3)) dis = cali.calculate_distance(mat1 + bck, mat2 + bck, bgr="dark", denoise=False) self.assertTrue(np.abs(dis - 10.0) <= self.eps)
true
true
f71e76a107f72063c37f240137d16371ad528ba9
2,353
py
Python
third_party/chromite/cros_bisect/manual_evaluator.py
zipated/src
2b8388091c71e442910a21ada3d97ae8bc1845d3
[ "BSD-3-Clause" ]
2,151
2020-04-18T07:31:17.000Z
2022-03-31T08:39:18.000Z
third_party/chromite/cros_bisect/manual_evaluator.py
cangulcan/src
2b8388091c71e442910a21ada3d97ae8bc1845d3
[ "BSD-3-Clause" ]
395
2020-04-18T08:22:18.000Z
2021-12-08T13:04:49.000Z
third_party/chromite/cros_bisect/manual_evaluator.py
cangulcan/src
2b8388091c71e442910a21ada3d97ae8bc1845d3
[ "BSD-3-Clause" ]
338
2020-04-18T08:03:10.000Z
2022-03-29T12:33:22.000Z
# -*- coding: utf-8 -*- # Copyright 2017 The Chromium OS Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """Asks users if the commit is good or bad.""" from __future__ import print_function import os from chromite.cros_bisect import common from chromite.cros_bisect import evaluator from chromite.lib import cros_build_lib from chromite.lib import osutils class ManualEvaluator(evaluator.Evaluator): """Manual evaluator.""" # Binary evaluator. THRESHOLD = 0.5 def __init__(self, options): super(ManualEvaluator, self).__init__(options) def GetReportPath(self, build_label): """Obtains report file path. Args: build_label: current build label to run the evaluation. Returns: Report file path. """ return os.path.join(self.report_base_dir, 'manual.%s.report' % build_label) def Evaluate(self, unused_remote, build_label, unused_repeat=1): """Prompts user if the build is good or bad. Args: unused_remote: Unused args. build_label: Build label used for part of report filename and log message. unused_repeat: Unused args. Returns: Score([1.0]) if it is a good build. Otherwise, Score([0.0]). """ report_path = self.GetReportPath(build_label) prompt = 'Is %s a good build on the DUT?' % build_label is_good = cros_build_lib.BooleanPrompt(prompt=prompt) score = 1.0 if is_good else 0.0 osutils.WriteFile(report_path, '%d' % score) return common.Score([score]) def CheckLastEvaluate(self, build_label, unused_repeat=1): """Checks if previous evaluate report is available. Args: build_label: Build label used for part of report filename and log message. unused_repeat: Unused. Returns: Score([1.0]) if previous result for the build_label is 'Yes'. Score([0.0]) if previous result for the build_label is 'No'. Score() if previous result does not exist or reuse_eval is unset. """ if self.reuse_eval: report_path = self.GetReportPath(build_label) if os.path.isfile(report_path): content = osutils.ReadFile(report_path) if content == '1': return common.Score([1.0]) elif content == '0': return common.Score([0.0]) return common.Score()
29.78481
80
0.689333
from __future__ import print_function import os from chromite.cros_bisect import common from chromite.cros_bisect import evaluator from chromite.lib import cros_build_lib from chromite.lib import osutils class ManualEvaluator(evaluator.Evaluator): THRESHOLD = 0.5 def __init__(self, options): super(ManualEvaluator, self).__init__(options) def GetReportPath(self, build_label): return os.path.join(self.report_base_dir, 'manual.%s.report' % build_label) def Evaluate(self, unused_remote, build_label, unused_repeat=1): report_path = self.GetReportPath(build_label) prompt = 'Is %s a good build on the DUT?' % build_label is_good = cros_build_lib.BooleanPrompt(prompt=prompt) score = 1.0 if is_good else 0.0 osutils.WriteFile(report_path, '%d' % score) return common.Score([score]) def CheckLastEvaluate(self, build_label, unused_repeat=1): if self.reuse_eval: report_path = self.GetReportPath(build_label) if os.path.isfile(report_path): content = osutils.ReadFile(report_path) if content == '1': return common.Score([1.0]) elif content == '0': return common.Score([0.0]) return common.Score()
true
true