hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
958k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f72062f74e3d658e22fe2cb10addd4d8ad13e2b0
399
py
Python
thefuck/rules/brew_uninstall.py
pybenchmark/thefuck
993a661c6048063e84645015cc832602b6ec32df
[ "MIT" ]
1
2021-12-13T18:41:46.000Z
2021-12-13T18:41:46.000Z
thefuck/rules/brew_uninstall.py
pybenchmark/thefuck
993a661c6048063e84645015cc832602b6ec32df
[ "MIT" ]
4
2020-12-23T15:44:08.000Z
2020-12-23T16:48:59.000Z
thefuck/rules/brew_uninstall.py
pybenchmark/thefuck
993a661c6048063e84645015cc832602b6ec32df
[ "MIT" ]
1
2020-12-23T14:46:54.000Z
2020-12-23T14:46:54.000Z
from thefuck.utils import for_app @for_app('brew', at_least=2) def match(command): return (command.script_parts[1] in ['uninstall', 'rm', 'remove'] and "brew uninstall --force" in command.stdout) def get_new_command(command): command_parts = command.script_parts[:] command_parts[1] = 'uninstall' command_parts.insert(2, '--force') return ' '.join(command_parts)
26.6
68
0.684211
from thefuck.utils import for_app @for_app('brew', at_least=2) def match(command): return (command.script_parts[1] in ['uninstall', 'rm', 'remove'] and "brew uninstall --force" in command.stdout) def get_new_command(command): command_parts = command.script_parts[:] command_parts[1] = 'uninstall' command_parts.insert(2, '--force') return ' '.join(command_parts)
true
true
f720630f134225e35a47baee79036aa6afb6bbf5
2,354
py
Python
aliyun-python-sdk-sddp/aliyunsdksddp/request/v20190103/DescribeDataAssetsRequest.py
yndu13/aliyun-openapi-python-sdk
12ace4fb39fe2fb0e3927a4b1b43ee4872da43f5
[ "Apache-2.0" ]
1,001
2015-07-24T01:32:41.000Z
2022-03-25T01:28:18.000Z
aliyun-python-sdk-sddp/aliyunsdksddp/request/v20190103/DescribeDataAssetsRequest.py
yndu13/aliyun-openapi-python-sdk
12ace4fb39fe2fb0e3927a4b1b43ee4872da43f5
[ "Apache-2.0" ]
363
2015-10-20T03:15:00.000Z
2022-03-08T12:26:19.000Z
aliyun-python-sdk-sddp/aliyunsdksddp/request/v20190103/DescribeDataAssetsRequest.py
yndu13/aliyun-openapi-python-sdk
12ace4fb39fe2fb0e3927a4b1b43ee4872da43f5
[ "Apache-2.0" ]
682
2015-09-22T07:19:02.000Z
2022-03-22T09:51:46.000Z
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # # http://www.apache.org/licenses/LICENSE-2.0 # # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. from aliyunsdkcore.request import RpcRequest from aliyunsdksddp.endpoint import endpoint_data class DescribeDataAssetsRequest(RpcRequest): def __init__(self): RpcRequest.__init__(self, 'Sddp', '2019-01-03', 'DescribeDataAssets') self.set_method('POST') if hasattr(self, "endpoint_map"): setattr(self, "endpoint_map", endpoint_data.getEndpointMap()) if hasattr(self, "endpoint_regional"): setattr(self, "endpoint_regional", endpoint_data.getEndpointRegional()) def get_RiskLevels(self): return self.get_query_params().get('RiskLevels') def set_RiskLevels(self,RiskLevels): self.add_query_param('RiskLevels',RiskLevels) def get_RangeId(self): return self.get_query_params().get('RangeId') def set_RangeId(self,RangeId): self.add_query_param('RangeId',RangeId) def get_PageSize(self): return self.get_query_params().get('PageSize') def set_PageSize(self,PageSize): self.add_query_param('PageSize',PageSize) def get_Lang(self): return self.get_query_params().get('Lang') def set_Lang(self,Lang): self.add_query_param('Lang',Lang) def get_CurrentPage(self): return self.get_query_params().get('CurrentPage') def set_CurrentPage(self,CurrentPage): self.add_query_param('CurrentPage',CurrentPage) def get_Name(self): return self.get_query_params().get('Name') def set_Name(self,Name): self.add_query_param('Name',Name) def get_RuleId(self): return self.get_query_params().get('RuleId') def set_RuleId(self,RuleId): self.add_query_param('RuleId',RuleId)
31.810811
74
0.752336
from aliyunsdkcore.request import RpcRequest from aliyunsdksddp.endpoint import endpoint_data class DescribeDataAssetsRequest(RpcRequest): def __init__(self): RpcRequest.__init__(self, 'Sddp', '2019-01-03', 'DescribeDataAssets') self.set_method('POST') if hasattr(self, "endpoint_map"): setattr(self, "endpoint_map", endpoint_data.getEndpointMap()) if hasattr(self, "endpoint_regional"): setattr(self, "endpoint_regional", endpoint_data.getEndpointRegional()) def get_RiskLevels(self): return self.get_query_params().get('RiskLevels') def set_RiskLevels(self,RiskLevels): self.add_query_param('RiskLevels',RiskLevels) def get_RangeId(self): return self.get_query_params().get('RangeId') def set_RangeId(self,RangeId): self.add_query_param('RangeId',RangeId) def get_PageSize(self): return self.get_query_params().get('PageSize') def set_PageSize(self,PageSize): self.add_query_param('PageSize',PageSize) def get_Lang(self): return self.get_query_params().get('Lang') def set_Lang(self,Lang): self.add_query_param('Lang',Lang) def get_CurrentPage(self): return self.get_query_params().get('CurrentPage') def set_CurrentPage(self,CurrentPage): self.add_query_param('CurrentPage',CurrentPage) def get_Name(self): return self.get_query_params().get('Name') def set_Name(self,Name): self.add_query_param('Name',Name) def get_RuleId(self): return self.get_query_params().get('RuleId') def set_RuleId(self,RuleId): self.add_query_param('RuleId',RuleId)
true
true
f720645e9f330d987e8a854268bf2c20aad7c1fa
13,423
py
Python
JChipSetup.py
mbuckaway/CrossMgr
4c64e429eb3215fda1b685c5e684c56f5d0c02cf
[ "MIT" ]
1
2020-02-05T11:22:03.000Z
2020-02-05T11:22:03.000Z
JChipSetup.py
mbuckaway/CrossMgr
4c64e429eb3215fda1b685c5e684c56f5d0c02cf
[ "MIT" ]
null
null
null
JChipSetup.py
mbuckaway/CrossMgr
4c64e429eb3215fda1b685c5e684c56f5d0c02cf
[ "MIT" ]
null
null
null
import wx import wx.lib.intctrl import wx.lib.rcsizer as rcs import socket import sys import re import six import datetime import Model import Utils import JChip import ChipReader from JChip import EVT_CHIP_READER import RaceResult import Ultra import HelpSearch from ReadSignOnSheet import GetTagNums HOST, PORT = JChip.DEFAULT_HOST, JChip.DEFAULT_PORT def CheckExcelLink(): race = Model.race if not race: return (False, 'No active race.') try: externalFields = race.excelLink.getFields() except (ValueError, AttributeError): return (False, 'Unconfigured.') if 'Tag' not in externalFields: return (False, '"Tag" column not specified.') return (True, 'Excel Link OK') #------------------------------------------------------------------------------------------------ reIP = re.compile( '^[0-9.]+$' ) def GetAllIps(): addrInfo = socket.getaddrinfo( socket.gethostname(), None ) ips = set() for a in addrInfo: try: ip = a[4][0] except: continue if reIP.search(ip): ips.add( ip ) return sorted( ips ) class JChipSetupDialog( wx.Dialog ): def __init__( self, parent, id = wx.ID_ANY ): wx.Dialog.__init__( self, parent, id, _("Chip Reader Setup"), style=wx.DEFAULT_DIALOG_STYLE|wx.TAB_TRAVERSAL ) self.timer = None self.receivedCount = 0 self.refTime = None self.enableJChipCheckBox = wx.CheckBox( self, label = _('Accept RFID Reader Data During Race') ) if Model.race: self.enableJChipCheckBox.SetValue( getattr(Model.race, 'enableJChipIntegration', False) ) else: self.enableJChipCheckBox.Enable( False ) self.testJChip = wx.ToggleButton( self, label = _('Start RFID Test') ) self.testJChip.SetFont( wx.Font( (0,24), wx.FONTFAMILY_SWISS, wx.FONTSTYLE_NORMAL, wx.FONTWEIGHT_NORMAL ) ) self.Bind(wx.EVT_TOGGLEBUTTON, self.testJChipToggle, self.testJChip) self.testList = wx.TextCtrl( self, style=wx.TE_READONLY|wx.TE_MULTILINE, size=(-1,200) ) self.testList.Bind( wx.EVT_RIGHT_DOWN, self.skip ) self.okBtn = wx.Button( self, wx.ID_OK ) self.Bind( wx.EVT_BUTTON, self.onOK, self.okBtn ) self.cancelBtn = wx.Button( self, wx.ID_CANCEL ) self.Bind( wx.EVT_BUTTON, self.onCancel, self.cancelBtn ) self.helpBtn = wx.Button( self, wx.ID_HELP ) self.Bind( wx.EVT_BUTTON, lambda evt: HelpSearch.showHelp('Menu-ChipReader.html#chip-reader-setup'), self.helpBtn ) self.Bind(EVT_CHIP_READER, self.handleChipReaderEvent) bs = wx.BoxSizer( wx.VERTICAL ) todoList = u'\n'.join( '%d) %s' % (i + 1, s) for i, s in enumerate( [ _('Make sure the RFID receiver is plugged into the network.'), _('If you are using Impinj/Alien, make sure the CrossMgrImpinj or CrossMgrAlien bridge programs are running.'), _('You must have the Sign-On Excel sheet ready and linked before your race.'), _('You must configure a "Tag" field in your Sign-On Excel Sheet.'), _('Run this test before each race.'), ]) ) intro = (u'\n'.join( [ _('CrossMgr supports the JChip, RaceResult, Ultra, Impinj and Alien RFID readers.'), _('For more details, consult the documentation for your reader.'), ] ) + u'\n' + _('Checklist:') + u'\n\n{}\n').format( todoList ) border = 4 bs.Add( wx.StaticText(self, label = intro), 0, wx.EXPAND|wx.ALL, border ) bs.Add( self.enableJChipCheckBox, 0, wx.EXPAND|wx.ALL|wx.ALIGN_LEFT, border ) #------------------------------------------------------------------- bs.AddSpacer( border ) bs.Add( wx.StaticText( self, label = _('Reader Configuration:') ), 0, wx.EXPAND|wx.ALL, border ) #------------------------------------------------------------------- rowColSizer = rcs.RowColSizer() bs.Add( rowColSizer, 0, wx.EXPAND|wx.ALL, border ) row = 0 rowColSizer.Add( wx.StaticText( self, label=u'{}:'.format(_('Reader Type')) ), row=row, col=0, border=border, flag=wx.TOP|wx.LEFT|wx.ALIGN_RIGHT|wx.ALIGN_CENTER_VERTICAL ) self.chipReaderType = wx.Choice( self, choices=[_('JChip/Impinj/Alien'), _('RaceResult'), _('Ultra')] ) self.chipReaderType.SetSelection( 0 ) self.chipReaderType.Bind( wx.EVT_CHOICE, self.changechipReaderType ) rowColSizer.Add( self.chipReaderType, row=row, col=1, border=border, flag=wx.EXPAND|wx.TOP|wx.RIGHT|wx.ALIGN_LEFT ) row += 1 sep = u' -' + _('or') + u'- ' ips = sep.join( GetAllIps() ) self.ipaddr = wx.TextCtrl( self, value = ips, style = wx.TE_READONLY, size=(240,-1) ) self.autoDetect = wx.Button( self, label=_('AutoDetect') ) self.autoDetect.Show( False ) self.autoDetect.Bind( wx.EVT_BUTTON, self.doAutoDetect ) iphs = wx.BoxSizer( wx.HORIZONTAL ) iphs.Add( self.ipaddr, 1, flag=wx.EXPAND ) iphs.Add( self.autoDetect, 0, flag=wx.LEFT, border=4 ) rowColSizer.Add( wx.StaticText( self, label=_('Remote IP Address:') ), row=row, col=0, flag=wx.ALIGN_RIGHT|wx.ALIGN_CENTER_VERTICAL ) rowColSizer.Add( iphs, row=row, col=1, border=border, flag=wx.EXPAND|wx.RIGHT|wx.ALIGN_LEFT ) row += 1 self.port = wx.lib.intctrl.IntCtrl( self, -1, min=1, max=65535, value=PORT, limited=True, style = wx.TE_READONLY ) rowColSizer.Add( wx.StaticText(self, label = _('Remote Port:')), row=row, col=0, flag=wx.ALIGN_RIGHT|wx.ALIGN_CENTER_VERTICAL ) rowColSizer.Add( self.port, row=row, col=1, border=border, flag=wx.EXPAND|wx.RIGHT|wx.ALIGN_LEFT ) bs.Add( wx.StaticText( self, label = _('If using JChip, see "7 Setting of Connections" in JChip "Control Panel Soft Manual" for more details.') ), border=border, flag = wx.GROW|wx.ALL ) #------------------------------------------------------------------- bs.Add( self.testJChip, 0, wx.ALIGN_CENTER|wx.ALL, border ) bs.Add( wx.StaticText(self, label = _('Messages:')), 0, wx.EXPAND|wx.ALL, border=border ) bs.Add( self.testList, 1, wx.EXPAND|wx.ALL, border ) buttonBox = wx.BoxSizer( wx.HORIZONTAL ) buttonBox.AddStretchSpacer() buttonBox.Add( self.okBtn, flag = wx.RIGHT, border=border ) self.okBtn.SetDefault() buttonBox.Add( self.cancelBtn ) buttonBox.Add( self.helpBtn ) bs.Add( buttonBox, 0, wx.EXPAND | wx.ALL, border ) self.stopTest() self.SetSizerAndFit(bs) bs.Fit( self ) self.update() self.CentreOnParent(wx.BOTH) wx.CallAfter( self.SetFocus ) def skip(self, evt): return def commit( self ): race = Model.race if not race: return race.chipReaderType = max( 0, self.chipReaderType.GetSelection() ) race.chipReaderIpAddr = self.ipaddr.GetValue() if race.chipReaderType == 1: Utils.writeConfig( 'RaceResultHost', race.chipReaderIpAddr ) elif race.chipReaderType == 2: Utils.writeConfig( 'UltraHost', race.chipReaderIpAddr ) race.chipReaderPort = self.port.GetValue() race.enableJChipIntegration = bool(self.enableJChipCheckBox.GetValue()) ChipReader.chipReaderCur.reset( race.chipReaderType ) def update( self ): race = Model.race if not race: return self.enableJChipCheckBox.SetValue( race.enableJChipIntegration ) self.chipReaderType.SetSelection( max(0, race.chipReaderType) ) self.ipaddr.SetValue( race.chipReaderIpAddr ) self.port.SetValue( race.chipReaderPort ) self.changechipReaderType() def changechipReaderType( self, event=None ): selection = self.chipReaderType.GetSelection() if selection == 0: # JChip/CrossMgrImpinj/CrossMgrAlien self.port.SetValue( JChip.DEFAULT_PORT ) self.port.SetEditable( False ) self.ipaddr.SetValue( Utils.GetDefaultHost() ) self.ipaddr.SetEditable( False ) self.autoDetect.Show( False ) elif selection == 1: # RaceResult self.port.SetValue( RaceResult.DEFAULT_PORT ) self.port.SetEditable( True ) self.ipaddr.SetEditable( True ) rfidReaderHost = Utils.readConfig( 'RfidReaderHost', None ) if rfidReaderHost: try: self.ipaddr.SetValue( rfidReaderHost ) except Exception as e: self.ipaddr.SetValue( Utils.GetDefaultHost() ) self.autoDetect.Show( True ) elif selection == 2: # Ultra self.port.SetValue( Ultra.DEFAULT_PORT ) self.port.SetEditable( True ) self.ipaddr.SetEditable( True ) rfidReaderHost = Utils.readConfig( 'RfidReaderHost', None ) if rfidReaderHost: try: self.ipaddr.SetValue( rfidReaderHost ) except Exception as e: self.ipaddr.SetValue( Utils.GetDefaultHost() ) self.autoDetect.Show( True ) self.Layout() self.Refresh() def doAutoDetect( self, event ): selection = self.chipReaderType.GetSelection() autoDetect = [RaceResult.AutoDetect, Ultra.AutoDetect][selection-1] def getHost(): wait = wx.BusyCursor() try: return None, autoDetect(self.port.GetValue()) except Exception as e: return e, None error, readerHost = getHost() if error: Utils.MessageOK( self, u'{}:\n\n{}'.format(_("AutoDetect Error"), error), _("AutoDetect Error"), wx.ICON_ERROR ) return if not readerHost: Utils.MessageOK( self, u'{}:\n\n{}'.format(_("AutoDetect Failure"), _('Reader not found.')), _("AutoDetect Failure"), wx.ICON_ERROR ) return self.ipaddr.SetValue( readerHost ) def handleChipReaderEvent( self, event ): if not event.tagTimes: return tagNums = {} race = Model.race if race: if not race.enableUSBCamera: return tagNums = GetTagNums() tag, dt = event.tagTimes[-1] num = tagNums.get(tag, None) def testJChipToggle( self, event ): self.commit() if not Model.race: self.stopTest() Utils.MessageOK( self, _('No active race. Cannot perform RFID test. "New" or "Open" a race first.'), _('Cannot Perform RFID Test') ) return if Model.race.isRunning(): self.stopTest() Utils.MessageOK( self, _('Cannot perform RFID test while race is running.'), _('Cannot Perform RFID Test') ) return if self.testJChip.GetValue(): correct, reason = CheckExcelLink() explain = _('CrossMgr will not be able to associate chip Tags with Bib numbers.') + u'\n' + \ _('You may proceed with the test, but you need to fix the Excel sheet.') + u'\n\n' + \ _('See documentation for details.') if not correct: if not Utils.MessageOKCancel( self, (_('Problems with Excel sheet.') + u'\n\n ' + _('Reason:') + u' {}\n\n{}').format(reason, explain), title = _('Excel Link Problem'), iconMask = wx.ICON_WARNING ): self.testJChip.SetValue( False ) return tagNums = GetTagNums( True ) if correct and not tagNums: if not Utils.MessageOKCancel( self, (_('All Tag entries in the Excel sheet are blank.') + u'\n\n{}').format(explain), title = _('Excel Link Problem'), iconMask = wx.ICON_WARNING ): self.testJChip.SetValue( False ) return ChipReader.chipReaderCur.readerEventWindow = self self.testList.Clear() self.testJChip.SetLabel( 'Stop RFID Test' ) self.testJChip.SetBackgroundColour( wx.Colour(255,128,128) ) self.testJChip.SetValue( True ) ChipReader.chipReaderCur.StartListener() self.appendMsg( 'listening for RFID connection...' ) # Start a timer to monitor the receiver. self.receivedCount = 0 self.timer = wx.CallLater( 1000, self.onTimerCallback, 'started' ) else: self.stopTest() def appendMsg( self, s ): self.testList.AppendText( s + '\n' ) def onTimerCallback( self, stat ): data = ChipReader.chipReaderCur.GetData() lastTag = None for d in data: if d[0] == 'data': self.receivedCount += 1 ts = d[2].isoformat(' ') if len(ts) == 8: ts += '.00' else: ts = ts[:-2] try: num = '{}'.format(Model.race.tagNums[d[1]]) except (AttributeError, ValueError, KeyError): num = 'not found' lastTag = d[1] self.appendMsg( '{}: tag={}, time={}, Bib={}'.format(self.receivedCount, d[1], ts, num) ) elif d[0] == 'connected': self.appendMsg( '*******************************************' ) self.appendMsg( '{}: {}'.format(d[0], ', '.join('{}'.format(s) for s in d[1:]) ) ) elif d[0] == 'disconnected': self.appendMsg( d[0] ) self.appendMsg( '' ) self.appendMsg( _('listening for RFID connection...') ) elif d[0] == 'name': self.appendMsg( u'{}: {}'.format(_('receiver name'), d[1]) ) else: self.appendMsg( '{}: {}'.format(d[0], ', '.join('<<{}>>'.format(s) for s in d[1:]) ) ) if data: self.testList.SetInsertionPointEnd() self.timer.Restart( 1000, 'restarted' ) if lastTag and Utils.mainWin and getattr(Utils.mainWin, 'findDialog', None): if Utils.mainWin.findDialog.IsShown(): Utils.mainWin.findDialog.refresh( lastTag ) def stopTest( self ): ChipReader.chipReaderCur.StopListener() if self.timer: self.timer.Stop() self.timer = None self.testList.Clear() self.appendMsg( _('No test running.') ) ChipReader.chipReaderCur.readerEventWindow = None self.testJChip.SetLabel( _('Start RFID Test') ) self.testJChip.SetBackgroundColour( wx.NullColour ) self.testJChip.SetValue( False ) def onOK( self, event ): self.stopTest() self.commit() wx.CallAfter( Utils.refresh ) self.EndModal( wx.ID_OK ) def onCancel( self, event ): self.stopTest() self.EndModal( wx.ID_CANCEL ) if __name__ == '__main__': six.print_( GetAllIps() ) #sys.exit() app = wx.App(False) mainWin = wx.Frame(None,title="CrossMan", size=(600,400)) Model.setRace( Model.Race() ) Model.race._populate() Model.race.finishRaceNow() Model.race.enableUSBCamera = True mainWin.Show() dlg = JChipSetupDialog( mainWin ) dlg.ShowModal() dlg.Destroy()
33.896465
149
0.662147
import wx import wx.lib.intctrl import wx.lib.rcsizer as rcs import socket import sys import re import six import datetime import Model import Utils import JChip import ChipReader from JChip import EVT_CHIP_READER import RaceResult import Ultra import HelpSearch from ReadSignOnSheet import GetTagNums HOST, PORT = JChip.DEFAULT_HOST, JChip.DEFAULT_PORT def CheckExcelLink(): race = Model.race if not race: return (False, 'No active race.') try: externalFields = race.excelLink.getFields() except (ValueError, AttributeError): return (False, 'Unconfigured.') if 'Tag' not in externalFields: return (False, '"Tag" column not specified.') return (True, 'Excel Link OK') reIP = re.compile( '^[0-9.]+$' ) def GetAllIps(): addrInfo = socket.getaddrinfo( socket.gethostname(), None ) ips = set() for a in addrInfo: try: ip = a[4][0] except: continue if reIP.search(ip): ips.add( ip ) return sorted( ips ) class JChipSetupDialog( wx.Dialog ): def __init__( self, parent, id = wx.ID_ANY ): wx.Dialog.__init__( self, parent, id, _("Chip Reader Setup"), style=wx.DEFAULT_DIALOG_STYLE|wx.TAB_TRAVERSAL ) self.timer = None self.receivedCount = 0 self.refTime = None self.enableJChipCheckBox = wx.CheckBox( self, label = _('Accept RFID Reader Data During Race') ) if Model.race: self.enableJChipCheckBox.SetValue( getattr(Model.race, 'enableJChipIntegration', False) ) else: self.enableJChipCheckBox.Enable( False ) self.testJChip = wx.ToggleButton( self, label = _('Start RFID Test') ) self.testJChip.SetFont( wx.Font( (0,24), wx.FONTFAMILY_SWISS, wx.FONTSTYLE_NORMAL, wx.FONTWEIGHT_NORMAL ) ) self.Bind(wx.EVT_TOGGLEBUTTON, self.testJChipToggle, self.testJChip) self.testList = wx.TextCtrl( self, style=wx.TE_READONLY|wx.TE_MULTILINE, size=(-1,200) ) self.testList.Bind( wx.EVT_RIGHT_DOWN, self.skip ) self.okBtn = wx.Button( self, wx.ID_OK ) self.Bind( wx.EVT_BUTTON, self.onOK, self.okBtn ) self.cancelBtn = wx.Button( self, wx.ID_CANCEL ) self.Bind( wx.EVT_BUTTON, self.onCancel, self.cancelBtn ) self.helpBtn = wx.Button( self, wx.ID_HELP ) self.Bind( wx.EVT_BUTTON, lambda evt: HelpSearch.showHelp('Menu-ChipReader.html#chip-reader-setup'), self.helpBtn ) self.Bind(EVT_CHIP_READER, self.handleChipReaderEvent) bs = wx.BoxSizer( wx.VERTICAL ) todoList = u'\n'.join( '%d) %s' % (i + 1, s) for i, s in enumerate( [ _('Make sure the RFID receiver is plugged into the network.'), _('If you are using Impinj/Alien, make sure the CrossMgrImpinj or CrossMgrAlien bridge programs are running.'), _('You must have the Sign-On Excel sheet ready and linked before your race.'), _('You must configure a "Tag" field in your Sign-On Excel Sheet.'), _('Run this test before each race.'), ]) ) intro = (u'\n'.join( [ _('CrossMgr supports the JChip, RaceResult, Ultra, Impinj and Alien RFID readers.'), _('For more details, consult the documentation for your reader.'), ] ) + u'\n' + _('Checklist:') + u'\n\n{}\n').format( todoList ) border = 4 bs.Add( wx.StaticText(self, label = intro), 0, wx.EXPAND|wx.ALL, border ) bs.Add( self.enableJChipCheckBox, 0, wx.EXPAND|wx.ALL|wx.ALIGN_LEFT, border ) bs.AddSpacer( border ) bs.Add( wx.StaticText( self, label = _('Reader Configuration:') ), 0, wx.EXPAND|wx.ALL, border ) rowColSizer = rcs.RowColSizer() bs.Add( rowColSizer, 0, wx.EXPAND|wx.ALL, border ) row = 0 rowColSizer.Add( wx.StaticText( self, label=u'{}:'.format(_('Reader Type')) ), row=row, col=0, border=border, flag=wx.TOP|wx.LEFT|wx.ALIGN_RIGHT|wx.ALIGN_CENTER_VERTICAL ) self.chipReaderType = wx.Choice( self, choices=[_('JChip/Impinj/Alien'), _('RaceResult'), _('Ultra')] ) self.chipReaderType.SetSelection( 0 ) self.chipReaderType.Bind( wx.EVT_CHOICE, self.changechipReaderType ) rowColSizer.Add( self.chipReaderType, row=row, col=1, border=border, flag=wx.EXPAND|wx.TOP|wx.RIGHT|wx.ALIGN_LEFT ) row += 1 sep = u' -' + _('or') + u'- ' ips = sep.join( GetAllIps() ) self.ipaddr = wx.TextCtrl( self, value = ips, style = wx.TE_READONLY, size=(240,-1) ) self.autoDetect = wx.Button( self, label=_('AutoDetect') ) self.autoDetect.Show( False ) self.autoDetect.Bind( wx.EVT_BUTTON, self.doAutoDetect ) iphs = wx.BoxSizer( wx.HORIZONTAL ) iphs.Add( self.ipaddr, 1, flag=wx.EXPAND ) iphs.Add( self.autoDetect, 0, flag=wx.LEFT, border=4 ) rowColSizer.Add( wx.StaticText( self, label=_('Remote IP Address:') ), row=row, col=0, flag=wx.ALIGN_RIGHT|wx.ALIGN_CENTER_VERTICAL ) rowColSizer.Add( iphs, row=row, col=1, border=border, flag=wx.EXPAND|wx.RIGHT|wx.ALIGN_LEFT ) row += 1 self.port = wx.lib.intctrl.IntCtrl( self, -1, min=1, max=65535, value=PORT, limited=True, style = wx.TE_READONLY ) rowColSizer.Add( wx.StaticText(self, label = _('Remote Port:')), row=row, col=0, flag=wx.ALIGN_RIGHT|wx.ALIGN_CENTER_VERTICAL ) rowColSizer.Add( self.port, row=row, col=1, border=border, flag=wx.EXPAND|wx.RIGHT|wx.ALIGN_LEFT ) bs.Add( wx.StaticText( self, label = _('If using JChip, see "7 Setting of Connections" in JChip "Control Panel Soft Manual" for more details.') ), border=border, flag = wx.GROW|wx.ALL ) bs.Add( self.testJChip, 0, wx.ALIGN_CENTER|wx.ALL, border ) bs.Add( wx.StaticText(self, label = _('Messages:')), 0, wx.EXPAND|wx.ALL, border=border ) bs.Add( self.testList, 1, wx.EXPAND|wx.ALL, border ) buttonBox = wx.BoxSizer( wx.HORIZONTAL ) buttonBox.AddStretchSpacer() buttonBox.Add( self.okBtn, flag = wx.RIGHT, border=border ) self.okBtn.SetDefault() buttonBox.Add( self.cancelBtn ) buttonBox.Add( self.helpBtn ) bs.Add( buttonBox, 0, wx.EXPAND | wx.ALL, border ) self.stopTest() self.SetSizerAndFit(bs) bs.Fit( self ) self.update() self.CentreOnParent(wx.BOTH) wx.CallAfter( self.SetFocus ) def skip(self, evt): return def commit( self ): race = Model.race if not race: return race.chipReaderType = max( 0, self.chipReaderType.GetSelection() ) race.chipReaderIpAddr = self.ipaddr.GetValue() if race.chipReaderType == 1: Utils.writeConfig( 'RaceResultHost', race.chipReaderIpAddr ) elif race.chipReaderType == 2: Utils.writeConfig( 'UltraHost', race.chipReaderIpAddr ) race.chipReaderPort = self.port.GetValue() race.enableJChipIntegration = bool(self.enableJChipCheckBox.GetValue()) ChipReader.chipReaderCur.reset( race.chipReaderType ) def update( self ): race = Model.race if not race: return self.enableJChipCheckBox.SetValue( race.enableJChipIntegration ) self.chipReaderType.SetSelection( max(0, race.chipReaderType) ) self.ipaddr.SetValue( race.chipReaderIpAddr ) self.port.SetValue( race.chipReaderPort ) self.changechipReaderType() def changechipReaderType( self, event=None ): selection = self.chipReaderType.GetSelection() if selection == 0: self.port.SetValue( JChip.DEFAULT_PORT ) self.port.SetEditable( False ) self.ipaddr.SetValue( Utils.GetDefaultHost() ) self.ipaddr.SetEditable( False ) self.autoDetect.Show( False ) elif selection == 1: self.port.SetValue( RaceResult.DEFAULT_PORT ) self.port.SetEditable( True ) self.ipaddr.SetEditable( True ) rfidReaderHost = Utils.readConfig( 'RfidReaderHost', None ) if rfidReaderHost: try: self.ipaddr.SetValue( rfidReaderHost ) except Exception as e: self.ipaddr.SetValue( Utils.GetDefaultHost() ) self.autoDetect.Show( True ) elif selection == 2: self.port.SetValue( Ultra.DEFAULT_PORT ) self.port.SetEditable( True ) self.ipaddr.SetEditable( True ) rfidReaderHost = Utils.readConfig( 'RfidReaderHost', None ) if rfidReaderHost: try: self.ipaddr.SetValue( rfidReaderHost ) except Exception as e: self.ipaddr.SetValue( Utils.GetDefaultHost() ) self.autoDetect.Show( True ) self.Layout() self.Refresh() def doAutoDetect( self, event ): selection = self.chipReaderType.GetSelection() autoDetect = [RaceResult.AutoDetect, Ultra.AutoDetect][selection-1] def getHost(): wait = wx.BusyCursor() try: return None, autoDetect(self.port.GetValue()) except Exception as e: return e, None error, readerHost = getHost() if error: Utils.MessageOK( self, u'{}:\n\n{}'.format(_("AutoDetect Error"), error), _("AutoDetect Error"), wx.ICON_ERROR ) return if not readerHost: Utils.MessageOK( self, u'{}:\n\n{}'.format(_("AutoDetect Failure"), _('Reader not found.')), _("AutoDetect Failure"), wx.ICON_ERROR ) return self.ipaddr.SetValue( readerHost ) def handleChipReaderEvent( self, event ): if not event.tagTimes: return tagNums = {} race = Model.race if race: if not race.enableUSBCamera: return tagNums = GetTagNums() tag, dt = event.tagTimes[-1] num = tagNums.get(tag, None) def testJChipToggle( self, event ): self.commit() if not Model.race: self.stopTest() Utils.MessageOK( self, _('No active race. Cannot perform RFID test. "New" or "Open" a race first.'), _('Cannot Perform RFID Test') ) return if Model.race.isRunning(): self.stopTest() Utils.MessageOK( self, _('Cannot perform RFID test while race is running.'), _('Cannot Perform RFID Test') ) return if self.testJChip.GetValue(): correct, reason = CheckExcelLink() explain = _('CrossMgr will not be able to associate chip Tags with Bib numbers.') + u'\n' + \ _('You may proceed with the test, but you need to fix the Excel sheet.') + u'\n\n' + \ _('See documentation for details.') if not correct: if not Utils.MessageOKCancel( self, (_('Problems with Excel sheet.') + u'\n\n ' + _('Reason:') + u' {}\n\n{}').format(reason, explain), title = _('Excel Link Problem'), iconMask = wx.ICON_WARNING ): self.testJChip.SetValue( False ) return tagNums = GetTagNums( True ) if correct and not tagNums: if not Utils.MessageOKCancel( self, (_('All Tag entries in the Excel sheet are blank.') + u'\n\n{}').format(explain), title = _('Excel Link Problem'), iconMask = wx.ICON_WARNING ): self.testJChip.SetValue( False ) return ChipReader.chipReaderCur.readerEventWindow = self self.testList.Clear() self.testJChip.SetLabel( 'Stop RFID Test' ) self.testJChip.SetBackgroundColour( wx.Colour(255,128,128) ) self.testJChip.SetValue( True ) ChipReader.chipReaderCur.StartListener() self.appendMsg( 'listening for RFID connection...' ) self.receivedCount = 0 self.timer = wx.CallLater( 1000, self.onTimerCallback, 'started' ) else: self.stopTest() def appendMsg( self, s ): self.testList.AppendText( s + '\n' ) def onTimerCallback( self, stat ): data = ChipReader.chipReaderCur.GetData() lastTag = None for d in data: if d[0] == 'data': self.receivedCount += 1 ts = d[2].isoformat(' ') if len(ts) == 8: ts += '.00' else: ts = ts[:-2] try: num = '{}'.format(Model.race.tagNums[d[1]]) except (AttributeError, ValueError, KeyError): num = 'not found' lastTag = d[1] self.appendMsg( '{}: tag={}, time={}, Bib={}'.format(self.receivedCount, d[1], ts, num) ) elif d[0] == 'connected': self.appendMsg( '*******************************************' ) self.appendMsg( '{}: {}'.format(d[0], ', '.join('{}'.format(s) for s in d[1:]) ) ) elif d[0] == 'disconnected': self.appendMsg( d[0] ) self.appendMsg( '' ) self.appendMsg( _('listening for RFID connection...') ) elif d[0] == 'name': self.appendMsg( u'{}: {}'.format(_('receiver name'), d[1]) ) else: self.appendMsg( '{}: {}'.format(d[0], ', '.join('<<{}>>'.format(s) for s in d[1:]) ) ) if data: self.testList.SetInsertionPointEnd() self.timer.Restart( 1000, 'restarted' ) if lastTag and Utils.mainWin and getattr(Utils.mainWin, 'findDialog', None): if Utils.mainWin.findDialog.IsShown(): Utils.mainWin.findDialog.refresh( lastTag ) def stopTest( self ): ChipReader.chipReaderCur.StopListener() if self.timer: self.timer.Stop() self.timer = None self.testList.Clear() self.appendMsg( _('No test running.') ) ChipReader.chipReaderCur.readerEventWindow = None self.testJChip.SetLabel( _('Start RFID Test') ) self.testJChip.SetBackgroundColour( wx.NullColour ) self.testJChip.SetValue( False ) def onOK( self, event ): self.stopTest() self.commit() wx.CallAfter( Utils.refresh ) self.EndModal( wx.ID_OK ) def onCancel( self, event ): self.stopTest() self.EndModal( wx.ID_CANCEL ) if __name__ == '__main__': six.print_( GetAllIps() ) app = wx.App(False) mainWin = wx.Frame(None,title="CrossMan", size=(600,400)) Model.setRace( Model.Race() ) Model.race._populate() Model.race.finishRaceNow() Model.race.enableUSBCamera = True mainWin.Show() dlg = JChipSetupDialog( mainWin ) dlg.ShowModal() dlg.Destroy()
true
true
f72064b70b67fb3499b7878938b50a98033a491b
845
py
Python
examples/upload_video.py
nullwriter/ig-actor
a089107657ccdf11ba213160c4cc5d3690cecd76
[ "MIT" ]
null
null
null
examples/upload_video.py
nullwriter/ig-actor
a089107657ccdf11ba213160c4cc5d3690cecd76
[ "MIT" ]
null
null
null
examples/upload_video.py
nullwriter/ig-actor
a089107657ccdf11ba213160c4cc5d3690cecd76
[ "MIT" ]
null
null
null
#!/usr/bin/env python # -*- coding: utf-8 -*- # # Use text editor to edit the script and type in valid Instagram username/password import urllib from bot.lib.InstagramAPI import InstagramAPI video_url = 'https://instagram.fmad3-2.fna.fbcdn.net/t50.2886-16/17157217_1660580944235536_866261046376005632_n.mp4' #a valid instagram video video_local_path = video_url.split("/")[-1] thumbnail_url = "https://instagram.fmad3-2.fna.fbcdn.net/t51.2885-15/e15/17075853_1759410394387536_3927726791665385472_n.jpg" thumbnail_local_path = thumbnail_url.split("/")[-1] urllib.urlretrieve(video_url,video_local_path) urllib.urlretrieve(thumbnail_url,thumbnail_local_path) user,pwd = 'user', 'password' InstagramAPI = InstagramAPI(user,pwd) InstagramAPI.login() # login InstagramAPI.uploadVideo(video_local_path,thumbnail_local_path,caption="Tortuguero")
36.73913
141
0.802367
import urllib from bot.lib.InstagramAPI import InstagramAPI video_url = 'https://instagram.fmad3-2.fna.fbcdn.net/t50.2886-16/17157217_1660580944235536_866261046376005632_n.mp4' video_local_path = video_url.split("/")[-1] thumbnail_url = "https://instagram.fmad3-2.fna.fbcdn.net/t51.2885-15/e15/17075853_1759410394387536_3927726791665385472_n.jpg" thumbnail_local_path = thumbnail_url.split("/")[-1] urllib.urlretrieve(video_url,video_local_path) urllib.urlretrieve(thumbnail_url,thumbnail_local_path) user,pwd = 'user', 'password' InstagramAPI = InstagramAPI(user,pwd) InstagramAPI.login() InstagramAPI.uploadVideo(video_local_path,thumbnail_local_path,caption="Tortuguero")
true
true
f72065bfefeeb5caf657c46e57376538c3455609
4,517
py
Python
lib/3rdparty/common/pyqode/core/modes/autocomplete.py
tommo/gii
03624a57cf74a07e38bfdc7f53c50bd926b7b5a7
[ "MIT" ]
7
2016-02-13T18:47:23.000Z
2020-07-03T13:47:49.000Z
lib/3rdparty/common/pyqode/core/modes/autocomplete.py
tommo/gii
03624a57cf74a07e38bfdc7f53c50bd926b7b5a7
[ "MIT" ]
1
2018-06-13T04:55:27.000Z
2021-11-05T05:52:51.000Z
lib/3rdparty/common/pyqode/core/modes/autocomplete.py
tommo/gii
03624a57cf74a07e38bfdc7f53c50bd926b7b5a7
[ "MIT" ]
4
2016-02-15T13:32:46.000Z
2019-12-12T17:22:31.000Z
# -*- coding: utf-8 -*- """ Contains the AutoCompleteMode """ import logging from pyqode.qt import QtCore, QtGui from pyqode.core.api import TextHelper from pyqode.core.api.mode import Mode class AutoCompleteMode(Mode): """ Automatically complete quotes and parentheses Generic auto complete mode that automatically completes the following symbols: - " -> " - ' -> ' - ( -> ) - [ -> ] - { -> } """ #: Auto complete mapping, maps input key with completion text. MAPPING = {'"': '"', "'": "'", "(": ")", "{": "}", "[": "]"} #: The format to use for each symbol in mapping when there is a selection SELECTED_QUOTES_FORMATS = {key: '%s%s%s' for key in MAPPING.keys()} #: The format to use for each symbol in mapping when there is no selection QUOTES_FORMATS = {key: '%s' for key in MAPPING.keys()} def __init__(self): super(AutoCompleteMode, self).__init__() self.logger = logging.getLogger(__name__) self._ignore_post = False def on_state_changed(self, state): if state: self.editor.post_key_pressed.connect(self._on_post_key_pressed) self.editor.key_pressed.connect(self._on_key_pressed) else: self.editor.post_key_pressed.disconnect(self._on_post_key_pressed) self.editor.key_pressed.disconnect(self._on_key_pressed) def _on_post_key_pressed(self, event): if not event.isAccepted() and not self._ignore_post: txt = event.text() trav = self.editor.textCursor() assert isinstance(trav, QtGui.QTextCursor) trav.movePosition(trav.Left, trav.MoveAnchor, 2) literal = TextHelper(self.editor).is_comment_or_string(trav) if not literal: next_char = TextHelper(self.editor).get_right_character() if txt in self.MAPPING: to_insert = self.MAPPING[txt] if (not next_char or next_char in self.MAPPING.keys() or next_char in self.MAPPING.values() or next_char.isspace()): TextHelper(self.editor).insert_text( self.QUOTES_FORMATS[txt] % to_insert) self._ignore_post = False def _on_key_pressed(self, event): txt = event.text() cursor = self.editor.textCursor() from pyqode.qt import QtGui assert isinstance(cursor, QtGui.QTextCursor) if cursor.hasSelection(): # quoting of selected text if event.text() in self.MAPPING.keys(): first = event.text() last = self.MAPPING[event.text()] cursor.insertText( self.SELECTED_QUOTES_FORMATS[event.text()] % ( first, cursor.selectedText(), last)) self.editor.setTextCursor(cursor) event.accept() else: self._ignore_post = True return next_char = TextHelper(self.editor).get_right_character() self.logger.debug('next char: %s', next_char) ignore = False if event.key() == QtCore.Qt.Key_Backspace: # get the character that will get deleted tc = self.editor.textCursor() pos = tc.position() tc.movePosition(tc.Left) tc.movePosition(tc.Right, tc.KeepAnchor) del_char = tc.selectedText() if del_char in self.MAPPING and \ self.MAPPING[del_char] == next_char: tc.beginEditBlock() tc.movePosition(tc.Right, tc.KeepAnchor) tc.insertText('') tc.setPosition(pos - 2) tc.endEditBlock() self.editor.setTextCursor(tc) ignore = True elif txt and next_char == txt and next_char in self.MAPPING: ignore = True elif event.text() == ')' or event.text() == ']' or event.text() == '}': # if typing the same symbol twice, the symbol should not be written # and the cursor moved just after the char # e.g. if you type ) just before ), the cursor will just move after # the existing ) if next_char == event.text(): ignore = True if ignore: event.accept() TextHelper(self.editor).clear_selection() TextHelper(self.editor).move_right()
41.440367
79
0.570511
import logging from pyqode.qt import QtCore, QtGui from pyqode.core.api import TextHelper from pyqode.core.api.mode import Mode class AutoCompleteMode(Mode): MAPPING = {'"': '"', "'": "'", "(": ")", "{": "}", "[": "]"} SELECTED_QUOTES_FORMATS = {key: '%s%s%s' for key in MAPPING.keys()} QUOTES_FORMATS = {key: '%s' for key in MAPPING.keys()} def __init__(self): super(AutoCompleteMode, self).__init__() self.logger = logging.getLogger(__name__) self._ignore_post = False def on_state_changed(self, state): if state: self.editor.post_key_pressed.connect(self._on_post_key_pressed) self.editor.key_pressed.connect(self._on_key_pressed) else: self.editor.post_key_pressed.disconnect(self._on_post_key_pressed) self.editor.key_pressed.disconnect(self._on_key_pressed) def _on_post_key_pressed(self, event): if not event.isAccepted() and not self._ignore_post: txt = event.text() trav = self.editor.textCursor() assert isinstance(trav, QtGui.QTextCursor) trav.movePosition(trav.Left, trav.MoveAnchor, 2) literal = TextHelper(self.editor).is_comment_or_string(trav) if not literal: next_char = TextHelper(self.editor).get_right_character() if txt in self.MAPPING: to_insert = self.MAPPING[txt] if (not next_char or next_char in self.MAPPING.keys() or next_char in self.MAPPING.values() or next_char.isspace()): TextHelper(self.editor).insert_text( self.QUOTES_FORMATS[txt] % to_insert) self._ignore_post = False def _on_key_pressed(self, event): txt = event.text() cursor = self.editor.textCursor() from pyqode.qt import QtGui assert isinstance(cursor, QtGui.QTextCursor) if cursor.hasSelection(): if event.text() in self.MAPPING.keys(): first = event.text() last = self.MAPPING[event.text()] cursor.insertText( self.SELECTED_QUOTES_FORMATS[event.text()] % ( first, cursor.selectedText(), last)) self.editor.setTextCursor(cursor) event.accept() else: self._ignore_post = True return next_char = TextHelper(self.editor).get_right_character() self.logger.debug('next char: %s', next_char) ignore = False if event.key() == QtCore.Qt.Key_Backspace: tc = self.editor.textCursor() pos = tc.position() tc.movePosition(tc.Left) tc.movePosition(tc.Right, tc.KeepAnchor) del_char = tc.selectedText() if del_char in self.MAPPING and \ self.MAPPING[del_char] == next_char: tc.beginEditBlock() tc.movePosition(tc.Right, tc.KeepAnchor) tc.insertText('') tc.setPosition(pos - 2) tc.endEditBlock() self.editor.setTextCursor(tc) ignore = True elif txt and next_char == txt and next_char in self.MAPPING: ignore = True elif event.text() == ')' or event.text() == ']' or event.text() == '}': if next_char == event.text(): ignore = True if ignore: event.accept() TextHelper(self.editor).clear_selection() TextHelper(self.editor).move_right()
true
true
f720669f2683fff61a73382464913841475adbc5
18,762
py
Python
mslib/mswms/dataaccess.py
iamansoni/MSS
69bc8fc61ab277697ca691119f911382a63860c0
[ "Apache-2.0" ]
null
null
null
mslib/mswms/dataaccess.py
iamansoni/MSS
69bc8fc61ab277697ca691119f911382a63860c0
[ "Apache-2.0" ]
null
null
null
mslib/mswms/dataaccess.py
iamansoni/MSS
69bc8fc61ab277697ca691119f911382a63860c0
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- """ mslib.mswms.dataaccess ~~~~~~~~~~~~~~~~~~~~~~ This module provides functions to access data This file is part of mss. :copyright: Copyright 2008-2014 Deutsches Zentrum fuer Luft- und Raumfahrt e.V. :copyright: Copyright 2011-2014 Marc Rautenhaus (mr) :copyright: Copyright 2016-2020 by the mss team, see AUTHORS. :license: APACHE-2.0, see LICENSE for details. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ from abc import ABCMeta, abstractmethod import itertools import os import logging import netCDF4 import numpy as np import pint from mslib import netCDF4tools from mslib.utils import UR class NWPDataAccess(metaclass=ABCMeta): """Abstract superclass providing a framework to let the user query in which data file a given variable at a given time can be found. The class provides the method get_filename(). It derives filenames from CF variable names, initialisation and valid times.q The method get_datapath() provides the root path where the data can be found. In subclasses, the protected method _determine_filename() must be implemented. """ def __init__(self, rootpath, uses_init_time=True, uses_valid_time=True): """Constructor takes the path of the data directory and determines whether this class employs different init_times or valid_times. """ self._root_path = rootpath self._modelname = "" self._use_init_time = uses_init_time self._use_valid_time = uses_valid_time @abstractmethod def setup(self): """Checks for existing files etc. and sets up the class. Called by server whenever a client requests a current capability document. """ pass def have_data(self, variable, vartype, init_time, valid_time): """Checks whether a file with data for the specified variable, type and times is known. This does not trigger a search for updated data files on disk. """ try: self._determine_filename( variable, vartype, init_time, valid_time, reload=False) except ValueError: return False else: return True def get_filename(self, variable, vartype, init_time, valid_time, fullpath=False): """Get the filename of the file in which a given variable at a given time can be found. In case no file is available, the disk is searched for updated data before failing. Arguments: variable -- string with CF name of variable vartype -- string specifying the type of the variable (model specific). For example, can be ml (model level), pl (pressure level), or sfc (surface) for, e.g., ECMWF data. init_time -- datetime object with initialisation time of forecast run valid_time -- datetime object with valid time of forecast fullpath -- if True, the complete path to the file will be returned. Default is False, only the filename will be returned. """ filename = self._determine_filename(variable, vartype, init_time, valid_time) if fullpath: return os.path.join(self._root_path, filename) else: return filename @abstractmethod def _determine_filename(self, variable, vartype, init_time, valid_time): """Must be overwritten in subclass. Determines the filename (without path) of the variable <variable> at the forecast timestep specified by init_time and valid_time. """ pass def get_datapath(self): """Return the path to the data directory. """ return self._root_path def uses_inittime_dimension(self): """ Return whether this data set supports multiple init times """ return self._use_init_time def uses_validtime_dimension(self): """ Return whether this data set supports multiple valid times """ return self._use_valid_time @abstractmethod def get_all_datafiles(self): """Return a list of all available data files. """ pass @abstractmethod def get_init_times(self): """Return a list of available forecast init times (base times). """ pass @abstractmethod def get_valid_times(self): """Return a list of available forecast times. """ pass @abstractmethod def get_elevations(self, vert_type): """Return a list of available elevations for a vertical level type. """ pass @abstractmethod def get_elevation_units(self, vert_type): """Returns units of supplied vertical type. """ pass _mfDatasetArgsDict = {} def mfDatasetArgs(self): """Returns additional keyword for the MFDatasetCommonDims instance that handles the input data of this dataset. See the MFDatasetCommonDims documentation for further details. Mainly provided as a workaround for numerical inaccuracies introduced to the NetCDF files by netcdf-java 4.3. (mr, 16Oct2012) """ return self._mfDatasetArgsDict class DefaultDataAccess(NWPDataAccess): """ Subclass to NWPDataAccess for accessing properly constructed NetCDF files Constructor needs information on domain ID. """ # Workaround for the numerical issue concering the lon dimension in # NetCDF files produced by netcdf-java 4.3.. def __init__(self, rootpath, domain_id, skip_dim_check=[], **kwargs): """Constructor takes the path of the data directory and determines whether this class employs different init_times or valid_times. """ NWPDataAccess.__init__(self, rootpath, **kwargs) self._domain_id = domain_id self._available_files = None self._filetree = None self._mfDatasetArgsDict = {"skip_dim_check": skip_dim_check} def _determine_filename(self, variable, vartype, init_time, valid_time, reload=True): """Determines the name of the data file that contains the variable <variable> with type <vartype> of the forecast specified by <init_time> and <valid_time>. """ assert self._filetree is not None, "filetree is None. Forgot to call setup()?" try: return self._filetree[vartype][init_time][variable][valid_time] except KeyError: if reload: self.setup() try: return self._filetree[vartype][init_time][variable][valid_time] except KeyError as ex: logging.error("Could not identify filename. %s %s %s %s %s %s", variable, vartype, init_time, valid_time, type(ex), ex) raise ValueError("variable type {} not available for variable {}" .format(vartype, variable)) def _parse_file(self, filename): elevations = {"levels": [], "units": None} with netCDF4.Dataset(os.path.join(self._root_path, filename)) as dataset: time_name, time_var = netCDF4tools.identify_CF_time(dataset) init_time = netCDF4tools.num2date(0, time_var.units) if not self.uses_inittime_dimension(): init_time = None valid_times = netCDF4tools.num2date(time_var[:], time_var.units) if not self.uses_validtime_dimension(): if len(valid_times) > 0: raise IOError("Skipping file '{}: no support for valid time, but multiple " "time steps present".format(filename)) valid_times = [None] lat_name, lat_var, lon_name, lon_var = netCDF4tools.identify_CF_lonlat(dataset) vert_name, vert_var, _, _, vert_type = netCDF4tools.identify_vertical_axis(dataset) if len(time_var.dimensions) != 1 or time_var.dimensions[0] != time_name: raise IOError("Problem with time coordinate variable") if len(lat_var.dimensions) != 1 or lat_var.dimensions[0] != lat_name: raise IOError("Problem with latitude coordinate variable") if len(lon_var.dimensions) != 1 or lon_var.dimensions[0] != lon_name: raise IOError("Problem with longitude coordinate variable") if vert_type != "sfc": elevations = {"levels": vert_var[:], "units": vert_var.units} if vert_type in self._elevations: if len(vert_var[:]) != len(self._elevations[vert_type]["levels"]): raise IOError("Number of vertical levels does not fit to levels of " "previous file '{}'.".format(self._elevations[vert_type]["filename"])) if not np.allclose(vert_var[:], self._elevations[vert_type]["levels"]): raise IOError("vertical levels do not fit to levels of previous " "file '{}'.".format(self._elevations[vert_type]["filename"])) if elevations["units"] != self._elevations[vert_type]["units"]: raise IOError("vertical level units do not match previous file '{}'".format( self._elevations[vert_type]["filename"])) standard_names = [] for ncvarname, ncvar in dataset.variables.items(): if hasattr(ncvar, "standard_name"): if (len(ncvar.dimensions) >= 3 and ( ncvar.dimensions[0] != time_name or ncvar.dimensions[-2] != lat_name or ncvar.dimensions[-1] != lon_name)): logging.error("Skipping variable '%s' in file '%s': Incorrect order of dimensions", ncvarname, filename) continue if not hasattr(ncvar, "units"): logging.error("Skipping variable '%s' in file '%s': No units attribute", ncvarname, filename) continue if ncvar.standard_name != "time": try: UR(ncvar.units) except (ValueError, pint.UndefinedUnitError): logging.error("Skipping variable '%s' in file '%s': unparseable units attribute '%s'", ncvarname, filename, ncvar.units) continue if len(ncvar.shape) == 4 and vert_name in ncvar.dimensions: standard_names.append(ncvar.standard_name) elif len(ncvar.shape) == 3 and vert_type == "sfc": standard_names.append(ncvar.standard_name) return { "vert_type": vert_type, "elevations": elevations, "init_time": init_time, "valid_times": valid_times, "standard_names": standard_names } def _add_to_filetree(self, filename, content): logging.info("File '%s' identified as '%s' type", filename, content["vert_type"]) logging.info("Found init time '%s', %s valid_times and %s standard_names", content["init_time"], len(content["valid_times"]), len(content["standard_names"])) if len(content["valid_times"]) == 0 or len(content["standard_names"]) == 0: logging.error( "Something is wrong with this file... valid_times='%s' standard_names='%s'", content["valid_times"], content["standard_names"]) else: logging.debug("valid_times='%s' standard_names='%s'", content["valid_times"], content["standard_names"]) leaf = self._filetree.setdefault(content["vert_type"], {}).setdefault(content["init_time"], {}) for standard_name in content["standard_names"]: var_leaf = leaf.setdefault(standard_name, {}) for valid_time in content["valid_times"]: if valid_time in var_leaf: logging.warning( "some data was found twice! vartype='%s' init_time='%s' standard_name='%s' " "valid_time='%s' first_file='%s' second_file='%s'", content["vert_type"], content["init_time"], standard_name, valid_time, var_leaf[valid_time], filename) else: var_leaf[valid_time] = filename def setup(self): # Get a list of the available data files. self._available_files = [ _filename for _filename in sorted(os.listdir(self._root_path)) if self._domain_id in _filename] logging.info("Files identified for domain '%s': %s", self._domain_id, self._available_files) self._filetree = {} self._elevations = {"sfc": {"filename": None, "levels": [], "units": None}} # Build the tree structure. for filename in self._available_files: logging.info("Opening candidate '%s'", filename) try: content = self._parse_file(filename) except IOError as ex: logging.error("Skipping file '%s' (%s: %s)", filename, type(ex), ex) continue if content["vert_type"] not in self._elevations: self._elevations[content["vert_type"]] = content["elevations"] self._add_to_filetree(filename, content) def get_init_times(self): """Returns a list of available forecast init times (base times). """ init_times = set(itertools.chain.from_iterable( self._filetree[_x].keys() for _x in self._filetree)) return sorted(init_times) def get_valid_times(self, variable, vartype, init_time): """Returns a list of available valid times for the specified variable at the specified init time. """ try: return sorted(self._filetree[vartype][init_time][variable]) except KeyError as ex: logging.error("Could not find times! %s %s", type(ex), ex) return [] def get_elevations(self, vert_type): """Return a list of available elevations for a vertical level type. """ logging.debug("%s", self._elevations) return self._elevations[vert_type]["levels"] def get_elevation_units(self, vert_type): """Return a list of available elevations for a vertical level type. """ logging.debug("%s", self._elevations) return self._elevations[vert_type]["units"] def get_all_valid_times(self, variable, vartype): """Similar to get_valid_times(), but returns the combined valid times of all available init times. """ all_valid_times = [] if vartype not in self._filetree: return [] for init_time in self._filetree[vartype]: if variable in self._filetree[vartype][init_time]: all_valid_times.extend(list(self._filetree[vartype][init_time][variable])) return sorted(set(all_valid_times)) def get_all_datafiles(self): """Return a list of all available data files. """ return self._available_files class CachedDataAccess(DefaultDataAccess): """ Subclass to NWPDataAccess for accessing properly constructed NetCDF files Constructor needs information on domain ID. Uses file name and modification date to reduce setup time by caching directory content in a dictionary. """ def __init__(self, rootpath, domain_id, **kwargs): """Constructor takes the path of the data directory and determines whether this class employs different init_times or valid_times. """ DefaultDataAccess.__init__(self, rootpath, domain_id, **kwargs) self._file_cache = {} def setup(self): # Get a list of the available data files. self._available_files = [ _filename for _filename in os.listdir(self._root_path) if self._domain_id in _filename] logging.info("Files identified for domain '%s': %s", self._domain_id, self._available_files) for filename in list(self._file_cache): if filename not in self._available_files: del self._file_cache[filename] self._filetree = {} self._elevations = {"sfc": {"filename": None, "levels": []}} # Build the tree structure. for filename in self._available_files: mtime = os.path.getmtime(os.path.join(self._root_path, filename)) if filename in self._file_cache and mtime == self._file_cache[filename][0]: logging.info("Using cached candidate '%s'", filename) content = self._file_cache[filename][1] if content["vert_type"] != "sfc": if content["vert_type"] not in self._elevations: self._elevations[content["vert_type"]] = content["elevations"] elif not np.allclose( self._elevations[content["vert_type"]]["levels"], content["elevations"]["levels"]): logging.error("Skipping file '%s' due to elevation mismatch", filename) continue else: if filename in self._file_cache: del self._file_cache[filename] logging.info("Opening candidate '%s'", filename) try: content = self._parse_file(filename) except IOError as ex: logging.error("Skipping file '%s' (%s: %s)", filename, type(ex), ex) continue self._file_cache[filename] = (mtime, content) self._add_to_filetree(filename, content)
43.531323
114
0.600149
from abc import ABCMeta, abstractmethod import itertools import os import logging import netCDF4 import numpy as np import pint from mslib import netCDF4tools from mslib.utils import UR class NWPDataAccess(metaclass=ABCMeta): def __init__(self, rootpath, uses_init_time=True, uses_valid_time=True): self._root_path = rootpath self._modelname = "" self._use_init_time = uses_init_time self._use_valid_time = uses_valid_time @abstractmethod def setup(self): pass def have_data(self, variable, vartype, init_time, valid_time): try: self._determine_filename( variable, vartype, init_time, valid_time, reload=False) except ValueError: return False else: return True def get_filename(self, variable, vartype, init_time, valid_time, fullpath=False): filename = self._determine_filename(variable, vartype, init_time, valid_time) if fullpath: return os.path.join(self._root_path, filename) else: return filename @abstractmethod def _determine_filename(self, variable, vartype, init_time, valid_time): pass def get_datapath(self): return self._root_path def uses_inittime_dimension(self): return self._use_init_time def uses_validtime_dimension(self): return self._use_valid_time @abstractmethod def get_all_datafiles(self): pass @abstractmethod def get_init_times(self): pass @abstractmethod def get_valid_times(self): pass @abstractmethod def get_elevations(self, vert_type): pass @abstractmethod def get_elevation_units(self, vert_type): pass _mfDatasetArgsDict = {} def mfDatasetArgs(self): return self._mfDatasetArgsDict class DefaultDataAccess(NWPDataAccess): def __init__(self, rootpath, domain_id, skip_dim_check=[], **kwargs): NWPDataAccess.__init__(self, rootpath, **kwargs) self._domain_id = domain_id self._available_files = None self._filetree = None self._mfDatasetArgsDict = {"skip_dim_check": skip_dim_check} def _determine_filename(self, variable, vartype, init_time, valid_time, reload=True): assert self._filetree is not None, "filetree is None. Forgot to call setup()?" try: return self._filetree[vartype][init_time][variable][valid_time] except KeyError: if reload: self.setup() try: return self._filetree[vartype][init_time][variable][valid_time] except KeyError as ex: logging.error("Could not identify filename. %s %s %s %s %s %s", variable, vartype, init_time, valid_time, type(ex), ex) raise ValueError("variable type {} not available for variable {}" .format(vartype, variable)) def _parse_file(self, filename): elevations = {"levels": [], "units": None} with netCDF4.Dataset(os.path.join(self._root_path, filename)) as dataset: time_name, time_var = netCDF4tools.identify_CF_time(dataset) init_time = netCDF4tools.num2date(0, time_var.units) if not self.uses_inittime_dimension(): init_time = None valid_times = netCDF4tools.num2date(time_var[:], time_var.units) if not self.uses_validtime_dimension(): if len(valid_times) > 0: raise IOError("Skipping file '{}: no support for valid time, but multiple " "time steps present".format(filename)) valid_times = [None] lat_name, lat_var, lon_name, lon_var = netCDF4tools.identify_CF_lonlat(dataset) vert_name, vert_var, _, _, vert_type = netCDF4tools.identify_vertical_axis(dataset) if len(time_var.dimensions) != 1 or time_var.dimensions[0] != time_name: raise IOError("Problem with time coordinate variable") if len(lat_var.dimensions) != 1 or lat_var.dimensions[0] != lat_name: raise IOError("Problem with latitude coordinate variable") if len(lon_var.dimensions) != 1 or lon_var.dimensions[0] != lon_name: raise IOError("Problem with longitude coordinate variable") if vert_type != "sfc": elevations = {"levels": vert_var[:], "units": vert_var.units} if vert_type in self._elevations: if len(vert_var[:]) != len(self._elevations[vert_type]["levels"]): raise IOError("Number of vertical levels does not fit to levels of " "previous file '{}'.".format(self._elevations[vert_type]["filename"])) if not np.allclose(vert_var[:], self._elevations[vert_type]["levels"]): raise IOError("vertical levels do not fit to levels of previous " "file '{}'.".format(self._elevations[vert_type]["filename"])) if elevations["units"] != self._elevations[vert_type]["units"]: raise IOError("vertical level units do not match previous file '{}'".format( self._elevations[vert_type]["filename"])) standard_names = [] for ncvarname, ncvar in dataset.variables.items(): if hasattr(ncvar, "standard_name"): if (len(ncvar.dimensions) >= 3 and ( ncvar.dimensions[0] != time_name or ncvar.dimensions[-2] != lat_name or ncvar.dimensions[-1] != lon_name)): logging.error("Skipping variable '%s' in file '%s': Incorrect order of dimensions", ncvarname, filename) continue if not hasattr(ncvar, "units"): logging.error("Skipping variable '%s' in file '%s': No units attribute", ncvarname, filename) continue if ncvar.standard_name != "time": try: UR(ncvar.units) except (ValueError, pint.UndefinedUnitError): logging.error("Skipping variable '%s' in file '%s': unparseable units attribute '%s'", ncvarname, filename, ncvar.units) continue if len(ncvar.shape) == 4 and vert_name in ncvar.dimensions: standard_names.append(ncvar.standard_name) elif len(ncvar.shape) == 3 and vert_type == "sfc": standard_names.append(ncvar.standard_name) return { "vert_type": vert_type, "elevations": elevations, "init_time": init_time, "valid_times": valid_times, "standard_names": standard_names } def _add_to_filetree(self, filename, content): logging.info("File '%s' identified as '%s' type", filename, content["vert_type"]) logging.info("Found init time '%s', %s valid_times and %s standard_names", content["init_time"], len(content["valid_times"]), len(content["standard_names"])) if len(content["valid_times"]) == 0 or len(content["standard_names"]) == 0: logging.error( "Something is wrong with this file... valid_times='%s' standard_names='%s'", content["valid_times"], content["standard_names"]) else: logging.debug("valid_times='%s' standard_names='%s'", content["valid_times"], content["standard_names"]) leaf = self._filetree.setdefault(content["vert_type"], {}).setdefault(content["init_time"], {}) for standard_name in content["standard_names"]: var_leaf = leaf.setdefault(standard_name, {}) for valid_time in content["valid_times"]: if valid_time in var_leaf: logging.warning( "some data was found twice! vartype='%s' init_time='%s' standard_name='%s' " "valid_time='%s' first_file='%s' second_file='%s'", content["vert_type"], content["init_time"], standard_name, valid_time, var_leaf[valid_time], filename) else: var_leaf[valid_time] = filename def setup(self): # Get a list of the available data files. self._available_files = [ _filename for _filename in sorted(os.listdir(self._root_path)) if self._domain_id in _filename] logging.info("Files identified for domain '%s': %s", self._domain_id, self._available_files) self._filetree = {} self._elevations = {"sfc": {"filename": None, "levels": [], "units": None}} # Build the tree structure. for filename in self._available_files: logging.info("Opening candidate '%s'", filename) try: content = self._parse_file(filename) except IOError as ex: logging.error("Skipping file '%s' (%s: %s)", filename, type(ex), ex) continue if content["vert_type"] not in self._elevations: self._elevations[content["vert_type"]] = content["elevations"] self._add_to_filetree(filename, content) def get_init_times(self): init_times = set(itertools.chain.from_iterable( self._filetree[_x].keys() for _x in self._filetree)) return sorted(init_times) def get_valid_times(self, variable, vartype, init_time): try: return sorted(self._filetree[vartype][init_time][variable]) except KeyError as ex: logging.error("Could not find times! %s %s", type(ex), ex) return [] def get_elevations(self, vert_type): logging.debug("%s", self._elevations) return self._elevations[vert_type]["levels"] def get_elevation_units(self, vert_type): logging.debug("%s", self._elevations) return self._elevations[vert_type]["units"] def get_all_valid_times(self, variable, vartype): all_valid_times = [] if vartype not in self._filetree: return [] for init_time in self._filetree[vartype]: if variable in self._filetree[vartype][init_time]: all_valid_times.extend(list(self._filetree[vartype][init_time][variable])) return sorted(set(all_valid_times)) def get_all_datafiles(self): return self._available_files class CachedDataAccess(DefaultDataAccess): def __init__(self, rootpath, domain_id, **kwargs): DefaultDataAccess.__init__(self, rootpath, domain_id, **kwargs) self._file_cache = {} def setup(self): # Get a list of the available data files. self._available_files = [ _filename for _filename in os.listdir(self._root_path) if self._domain_id in _filename] logging.info("Files identified for domain '%s': %s", self._domain_id, self._available_files) for filename in list(self._file_cache): if filename not in self._available_files: del self._file_cache[filename] self._filetree = {} self._elevations = {"sfc": {"filename": None, "levels": []}} # Build the tree structure. for filename in self._available_files: mtime = os.path.getmtime(os.path.join(self._root_path, filename)) if filename in self._file_cache and mtime == self._file_cache[filename][0]: logging.info("Using cached candidate '%s'", filename) content = self._file_cache[filename][1] if content["vert_type"] != "sfc": if content["vert_type"] not in self._elevations: self._elevations[content["vert_type"]] = content["elevations"] elif not np.allclose( self._elevations[content["vert_type"]]["levels"], content["elevations"]["levels"]): logging.error("Skipping file '%s' due to elevation mismatch", filename) continue else: if filename in self._file_cache: del self._file_cache[filename] logging.info("Opening candidate '%s'", filename) try: content = self._parse_file(filename) except IOError as ex: logging.error("Skipping file '%s' (%s: %s)", filename, type(ex), ex) continue self._file_cache[filename] = (mtime, content) self._add_to_filetree(filename, content)
true
true
f7206716b828e3c1c1ab325cae68cae705a72727
9,010
py
Python
scalability/experiments/run_mainnet.py
Deland-Labs/ic
047172b01e0afc0e61448669d4ec98b2425c6853
[ "Apache-2.0" ]
1
2021-12-01T03:48:42.000Z
2021-12-01T03:48:42.000Z
scalability/experiments/run_mainnet.py
Deland-Labs/ic
047172b01e0afc0e61448669d4ec98b2425c6853
[ "Apache-2.0" ]
null
null
null
scalability/experiments/run_mainnet.py
Deland-Labs/ic
047172b01e0afc0e61448669d4ec98b2425c6853
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/env python3 import subprocess import sys import time from typing import List import gflags FLAGS = gflags.FLAGS gflags.DEFINE_bool("use_updates", False, "Issue update calls instead of query calls") class Mainnet: """Wrapper to run against subnetworks in mainnet concurrently.""" def __init__(self): """Initialize.""" if FLAGS.testnet == "mercury" and FLAGS.target_subnet_id is None: raise Exception("--target_subnet_id has to be set when running against mainnet") # Testnets you have booked and the number of subnetworks each (including NNS) self.testnets = { "large01": 5, # "large02": 5, "large03": 5, "large04": 5, "large05": 5, # "medium01": 2, # "medium03": 2, "medium04": 2, # "medium06": 2, # "medium07": 2, # "medium08": 2, # "medium09": 2, } # All subnets with the ID of the counter canister. # Uncomment if you want to run against that subnetwork. # sum(self.testnets.items()) has to be larger than the number of subnets uncommented here. self.load_targets = { # --- pjljw has a lot of traffic, so perhaps avoid # "pjljw-kztyl-46ud4-ofrj6-nzkhm-3n4nt-wi3jt-ypmav-ijqkt-gjf66-uae": "ifkln-viaaa-aaaah-qccva-cai", "ejbmu-grnam-gk6ol-6irwa-htwoj-7ihfl-goimw-hlnvh-abms4-47v2e-zqe": "nffi3-byaaa-aaaae-qaava-cai", # # 404 - [MessageId(...)]: Update returned non-202: 404 "gmq5v-hbozq-uui6y-o55wc-ihop3-562wb-3qspg-nnijg-npqp5-he3cj-3ae": "phin2-eyaaa-aaaak-qaaca-cai", "opn46-zyspe-hhmyp-4zu6u-7sbrh-dok77-m7dch-im62f-vyimr-a3n2c-4ae": "psp4x-fqaaa-aaaak-qaabq-cai", # # normal "w4asl-4nmyj-qnr7c-6cqq4-tkwmt-o26di-iupkq-vx4kt-asbrx-jzuxh-4ae": "wrd4y-xiaaa-aaaac-qaaaq-cai", "lspz2-jx4pu-k3e7p-znm7j-q4yum-ork6e-6w4q6-pijwq-znehu-4jabe-kqe": "m4dvk-faaaa-aaaag-aaaba-cai", "k44fs-gm4pv-afozh-rs7zw-cg32n-u7xov-xqyx3-2pw5q-eucnu-cosd4-uqe": "cst46-ryaaa-aaaak-aaaha-cai", "lhg73-sax6z-2zank-6oer2-575lz-zgbxx-ptudx-5korm-fy7we-kh4hl-pqe": "anvl4-jaaaa-aaaag-qaaca-cai", "brlsh-zidhj-3yy3e-6vqbz-7xnih-xeq2l-as5oc-g32c4-i5pdn-2wwof-oae": "qnlji-3yaaa-aaaai-aa2aq-cai", "mpubz-g52jc-grhjo-5oze5-qcj74-sex34-omprz-ivnsm-qvvhr-rfzpv-vae": "2zwmb-wyaaa-aaaai-qa2vq-cai", "qdvhd-os4o2-zzrdw-xrcv4-gljou-eztdp-bj326-e6jgr-tkhuc-ql6v2-yqe": "ivomh-taaaa-aaaaj-aac2a-cai", "jtdsg-3h6gi-hs7o5-z2soi-43w3z-soyl3-ajnp3-ekni5-sw553-5kw67-nqe": "tiezx-5yaaa-aaaaj-qagya-cai", "io67a-2jmkw-zup3h-snbwi-g6a5n-rm5dn-b6png-lvdpl-nqnto-yih6l-gqe": "ftuvq-daaaa-aaaad-aaaqa-cai", "5kdm2-62fc6-fwnja-hutkz-ycsnm-4z33i-woh43-4cenu-ev7mi-gii6t-4ae": "iqjyz-jqaaa-aaaad-qayoa-cai", "4zbus-z2bmt-ilreg-xakz4-6tyre-hsqj4-slb4g-zjwqo-snjcc-iqphi-3qe": "2oxpg-ayaaa-aaaac-aaacq-cai", "qxesv-zoxpm-vc64m-zxguk-5sj74-35vrb-tbgwg-pcird-5gr26-62oxl-cae": "htg4w-ziaaa-aaaab-aabaa-cai", "shefu-t3kr5-t5q3w-mqmdq-jabyv-vyvtf-cyyey-3kmo4-toyln-emubw-4qe": "2vzmb-ayaaa-aaaae-aaf3q-cai", "csyj4-zmann-ys6ge-3kzi6-onexi-obayx-2fvak-zersm-euci4-6pslt-lae": "cozrd-caaaa-aaaaf-qaeua-cai", "eq6en-6jqla-fbu5s-daskr-h6hx2-376n5-iqabl-qgrng-gfqmv-n3yjr-mqe": "34i5c-taaaa-aaaaf-aaa2q-cai", "snjp4-xlbw4-mnbog-ddwy6-6ckfd-2w5a2-eipqo-7l436-pxqkh-l6fuv-vae": "3muos-6yaaa-aaaaa-qaaua-cai", "pae4o-o6dxf-xki7q-ezclx-znyd6-fnk6w-vkv5z-5lfwh-xym2i-otrrw-fqe": "r7fsz-diaaa-aaaab-qadxa-cai", } # Next subnetwork to use for workload generators self.next_subnet = {key: 0 for key in self.testnets.keys()} total_subnetworks = sum(self.testnets.values()) total_targets = len(self.load_targets) missing = total_targets - total_subnetworks if total_targets > total_subnetworks: print( ( f"Insufficient testnets for load generation (have {total_subnetworks}, " f"but {total_targets} load targets, {missing} more missing" ) ) exit(1) self.start_time = int(time.time()) def get_window_name(self, subnet): """Get window name from subnet.""" return subnet.split("-")[0] def get_query_command(self, canister, subnet, wg_testnet, wg_subnet, subnet_prefix): """Return query command.""" return [ "./max_capacity_system_baseline.py", "--testnet", "mercury", "--canister", canister, "--target_subnet_id", subnet, "--wg_testnet", wg_testnet, "--wg_subnet", str(wg_subnet), "--no_instrument=True", "--top_level_out_dir", "mainnet-{}".format(self.start_time), "--second_level_out_dir", subnet_prefix, "--num_workload_generators", str(4), "--query_initial_rps", str(500), "--max_query_load", str(500), "--skip_generate_report=True", "--target_query_load", str(440), "--query_rps_increment", str(40), "--target_all=True", ] def get_update_command(self, canister, subnet, wg_testnet, wg_subnet, subnet_prefix): """Retrun update command.""" return [ "./max_capacity_system_baseline.py", "--testnet", "mercury", "--canister", canister, "--target_subnet_id", subnet, "--wg_testnet", wg_testnet, "--wg_subnet", str(wg_subnet), "--no_instrument=True", "--max_update_load", str(600), "--top_level_out_dir", "mainnet-{}".format(self.start_time), "--second_level_out_dir", subnet_prefix, "--num_workload_generators", str(4), "--target_update_load", str(600), "--update_rps_increment", str(4), "--update_initial_rps", str(600), "--skip_generate_report=True", "--target_update_load", str(600), "--use_updates=True", "--iter_duration={}".format(300), ] def get_commands(self, do_updates=True): """Get commands to run based on the list of subnets and canister IDs.""" r = [] for subnet, canister in self.load_targets.items(): wg_testnet = None for testnet, num_subnets in self.testnets.items(): if num_subnets > 0: wg_testnet = testnet break self.testnets[wg_testnet] -= 1 wg_subnet = self.next_subnet[wg_testnet] self.next_subnet[wg_testnet] += 1 subnet_prefix = self.get_window_name(subnet) r.append( ( subnet_prefix, self.get_update_command(canister, subnet, wg_testnet, wg_subnet, subnet_prefix) if do_updates else self.get_query_command(canister, subnet, wg_testnet, wg_subnet, subnet_prefix), ) ) return r def run_in_session(self, name: str, command: List[str]): """Run the given command in a tmux session.""" assert len(name) > 0 subprocess.run( [ "tmux", "new-window", "-n", name, " ".join(command) + '; echo "Check failure rate + hit enter to terminate"; read', ], check=True, ) def start(self, do_updates): """Start the benchmark.""" print(f"Starting workload with do_updates={do_updates}") for name, command in self.get_commands(do_updates): self.run_in_session(name, command) def tmux_window_list(self) -> List[str]: """Get the current tmux window list.""" r = [] for line in subprocess.check_output(["tmux", "list-windows"], encoding="utf-8").split("\n"): e = line.split(" ") if len(e) > 1: r.append(e[1]) return r def wait(self): """Wait for all benchmarks to terminate.""" time.sleep(30) for name in self.load_targets.keys(): print(f"Waiting for {name}") while self.get_window_name(name) in self.tmux_window_list(): time.sleep(10) FLAGS(sys.argv) mainnet = Mainnet() mainnet.start(FLAGS.use_updates) # Need to sleep a bit in order to ensure that all windows are coming up mainnet.wait() print("All terminated, done")
38.836207
111
0.568036
import subprocess import sys import time from typing import List import gflags FLAGS = gflags.FLAGS gflags.DEFINE_bool("use_updates", False, "Issue update calls instead of query calls") class Mainnet: def __init__(self): if FLAGS.testnet == "mercury" and FLAGS.target_subnet_id is None: raise Exception("--target_subnet_id has to be set when running against mainnet") self.testnets = { "large01": 5, "large03": 5, "large04": 5, "large05": 5, "medium04": 2, } self.load_targets = { "ejbmu-grnam-gk6ol-6irwa-htwoj-7ihfl-goimw-hlnvh-abms4-47v2e-zqe": "nffi3-byaaa-aaaae-qaava-cai", g-nnijg-npqp5-he3cj-3ae": "phin2-eyaaa-aaaak-qaaca-cai", "opn46-zyspe-hhmyp-4zu6u-7sbrh-dok77-m7dch-im62f-vyimr-a3n2c-4ae": "psp4x-fqaaa-aaaak-qaabq-cai", "w4asl-4nmyj-qnr7c-6cqq4-tkwmt-o26di-iupkq-vx4kt-asbrx-jzuxh-4ae": "wrd4y-xiaaa-aaaac-qaaaq-cai", "lspz2-jx4pu-k3e7p-znm7j-q4yum-ork6e-6w4q6-pijwq-znehu-4jabe-kqe": "m4dvk-faaaa-aaaag-aaaba-cai", "k44fs-gm4pv-afozh-rs7zw-cg32n-u7xov-xqyx3-2pw5q-eucnu-cosd4-uqe": "cst46-ryaaa-aaaak-aaaha-cai", "lhg73-sax6z-2zank-6oer2-575lz-zgbxx-ptudx-5korm-fy7we-kh4hl-pqe": "anvl4-jaaaa-aaaag-qaaca-cai", "brlsh-zidhj-3yy3e-6vqbz-7xnih-xeq2l-as5oc-g32c4-i5pdn-2wwof-oae": "qnlji-3yaaa-aaaai-aa2aq-cai", "mpubz-g52jc-grhjo-5oze5-qcj74-sex34-omprz-ivnsm-qvvhr-rfzpv-vae": "2zwmb-wyaaa-aaaai-qa2vq-cai", "qdvhd-os4o2-zzrdw-xrcv4-gljou-eztdp-bj326-e6jgr-tkhuc-ql6v2-yqe": "ivomh-taaaa-aaaaj-aac2a-cai", "jtdsg-3h6gi-hs7o5-z2soi-43w3z-soyl3-ajnp3-ekni5-sw553-5kw67-nqe": "tiezx-5yaaa-aaaaj-qagya-cai", "io67a-2jmkw-zup3h-snbwi-g6a5n-rm5dn-b6png-lvdpl-nqnto-yih6l-gqe": "ftuvq-daaaa-aaaad-aaaqa-cai", "5kdm2-62fc6-fwnja-hutkz-ycsnm-4z33i-woh43-4cenu-ev7mi-gii6t-4ae": "iqjyz-jqaaa-aaaad-qayoa-cai", "4zbus-z2bmt-ilreg-xakz4-6tyre-hsqj4-slb4g-zjwqo-snjcc-iqphi-3qe": "2oxpg-ayaaa-aaaac-aaacq-cai", "qxesv-zoxpm-vc64m-zxguk-5sj74-35vrb-tbgwg-pcird-5gr26-62oxl-cae": "htg4w-ziaaa-aaaab-aabaa-cai", "shefu-t3kr5-t5q3w-mqmdq-jabyv-vyvtf-cyyey-3kmo4-toyln-emubw-4qe": "2vzmb-ayaaa-aaaae-aaf3q-cai", "csyj4-zmann-ys6ge-3kzi6-onexi-obayx-2fvak-zersm-euci4-6pslt-lae": "cozrd-caaaa-aaaaf-qaeua-cai", "eq6en-6jqla-fbu5s-daskr-h6hx2-376n5-iqabl-qgrng-gfqmv-n3yjr-mqe": "34i5c-taaaa-aaaaf-aaa2q-cai", "snjp4-xlbw4-mnbog-ddwy6-6ckfd-2w5a2-eipqo-7l436-pxqkh-l6fuv-vae": "3muos-6yaaa-aaaaa-qaaua-cai", "pae4o-o6dxf-xki7q-ezclx-znyd6-fnk6w-vkv5z-5lfwh-xym2i-otrrw-fqe": "r7fsz-diaaa-aaaab-qadxa-cai", } self.next_subnet = {key: 0 for key in self.testnets.keys()} total_subnetworks = sum(self.testnets.values()) total_targets = len(self.load_targets) missing = total_targets - total_subnetworks if total_targets > total_subnetworks: print( ( f"Insufficient testnets for load generation (have {total_subnetworks}, " f"but {total_targets} load targets, {missing} more missing" ) ) exit(1) self.start_time = int(time.time()) def get_window_name(self, subnet): return subnet.split("-")[0] def get_query_command(self, canister, subnet, wg_testnet, wg_subnet, subnet_prefix): return [ "./max_capacity_system_baseline.py", "--testnet", "mercury", "--canister", canister, "--target_subnet_id", subnet, "--wg_testnet", wg_testnet, "--wg_subnet", str(wg_subnet), "--no_instrument=True", "--top_level_out_dir", "mainnet-{}".format(self.start_time), "--second_level_out_dir", subnet_prefix, "--num_workload_generators", str(4), "--query_initial_rps", str(500), "--max_query_load", str(500), "--skip_generate_report=True", "--target_query_load", str(440), "--query_rps_increment", str(40), "--target_all=True", ] def get_update_command(self, canister, subnet, wg_testnet, wg_subnet, subnet_prefix): return [ "./max_capacity_system_baseline.py", "--testnet", "mercury", "--canister", canister, "--target_subnet_id", subnet, "--wg_testnet", wg_testnet, "--wg_subnet", str(wg_subnet), "--no_instrument=True", "--max_update_load", str(600), "--top_level_out_dir", "mainnet-{}".format(self.start_time), "--second_level_out_dir", subnet_prefix, "--num_workload_generators", str(4), "--target_update_load", str(600), "--update_rps_increment", str(4), "--update_initial_rps", str(600), "--skip_generate_report=True", "--target_update_load", str(600), "--use_updates=True", "--iter_duration={}".format(300), ] def get_commands(self, do_updates=True): r = [] for subnet, canister in self.load_targets.items(): wg_testnet = None for testnet, num_subnets in self.testnets.items(): if num_subnets > 0: wg_testnet = testnet break self.testnets[wg_testnet] -= 1 wg_subnet = self.next_subnet[wg_testnet] self.next_subnet[wg_testnet] += 1 subnet_prefix = self.get_window_name(subnet) r.append( ( subnet_prefix, self.get_update_command(canister, subnet, wg_testnet, wg_subnet, subnet_prefix) if do_updates else self.get_query_command(canister, subnet, wg_testnet, wg_subnet, subnet_prefix), ) ) return r def run_in_session(self, name: str, command: List[str]): assert len(name) > 0 subprocess.run( [ "tmux", "new-window", "-n", name, " ".join(command) + '; echo "Check failure rate + hit enter to terminate"; read', ], check=True, ) def start(self, do_updates): print(f"Starting workload with do_updates={do_updates}") for name, command in self.get_commands(do_updates): self.run_in_session(name, command) def tmux_window_list(self) -> List[str]: r = [] for line in subprocess.check_output(["tmux", "list-windows"], encoding="utf-8").split("\n"): e = line.split(" ") if len(e) > 1: r.append(e[1]) return r def wait(self): time.sleep(30) for name in self.load_targets.keys(): print(f"Waiting for {name}") while self.get_window_name(name) in self.tmux_window_list(): time.sleep(10) FLAGS(sys.argv) mainnet = Mainnet() mainnet.start(FLAGS.use_updates) mainnet.wait() print("All terminated, done")
true
true
f72067b03fcce0e8fbe2579787be36a9398c361c
627
py
Python
transform_file.py
BXuan694/universalAdversarialPerturbation
ebca90f76b5d45715c98a1ff0b6f11df753b51c6
[ "BSD-2-Clause" ]
38
2019-01-19T09:43:13.000Z
2022-01-05T09:47:02.000Z
transform_file.py
BXuan694/universalAdversarialPerturbation
ebca90f76b5d45715c98a1ff0b6f11df753b51c6
[ "BSD-2-Clause" ]
3
2020-02-24T05:56:35.000Z
2022-01-07T12:08:33.000Z
transform_file.py
BXuan694/universalAdversarialPerturbation
ebca90f76b5d45715c98a1ff0b6f11df753b51c6
[ "BSD-2-Clause" ]
10
2019-02-19T10:05:57.000Z
2021-06-07T08:02:36.000Z
from torchvision import transforms transform1 = transforms.Compose([ transforms.Resize(256), transforms.CenterCrop(224), transforms.ToTensor(), transforms.Normalize(mean = [0.485,0.456,0.406], std = [0.229,0.224,0.225]), ]) cut = transforms.Compose([ transforms.Resize(256), transforms.CenterCrop(224), ]) convert = transforms.Compose([ transforms.ToTensor(), transforms.Normalize(mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]), ]) transform = transforms.Compose([ cut.transforms[0], cut.transforms[1], convert.transforms[0], convert.transforms[1] ])
24.115385
80
0.657097
from torchvision import transforms transform1 = transforms.Compose([ transforms.Resize(256), transforms.CenterCrop(224), transforms.ToTensor(), transforms.Normalize(mean = [0.485,0.456,0.406], std = [0.229,0.224,0.225]), ]) cut = transforms.Compose([ transforms.Resize(256), transforms.CenterCrop(224), ]) convert = transforms.Compose([ transforms.ToTensor(), transforms.Normalize(mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]), ]) transform = transforms.Compose([ cut.transforms[0], cut.transforms[1], convert.transforms[0], convert.transforms[1] ])
true
true
f7206874eea5462451a2197d6ce51ff97b87f248
7,039
py
Python
pypi_tools/main.py
xnuinside/pypi_tools_bot
2ae408e510dcc30c39475af1f9cba8af866c54ee
[ "MIT" ]
2
2021-03-04T07:37:38.000Z
2021-04-01T16:57:10.000Z
pypi_tools/main.py
xnuinside/pypi_tools_bot
2ae408e510dcc30c39475af1f9cba8af866c54ee
[ "MIT" ]
null
null
null
pypi_tools/main.py
xnuinside/pypi_tools_bot
2ae408e510dcc30c39475af1f9cba8af866c54ee
[ "MIT" ]
null
null
null
import os import logging import sentry_sdk from aiogram import Bot, Dispatcher, executor, types from datetime import datetime, timedelta from pypi_tools.logic import remove_track_for_package import pypi_tools.data as d from pypi_tools.helpers import validate_input import pypi_tools.vizualizer as v import pypi_tools.readme as r import asyncio import aioredis logging.basicConfig(level=logging.INFO) redis_host = f"redis://{os.environ.get('REDIS_HOST')}" #sentry_sdk.init(os.environ["SENTRY_PATH"]) bot = Bot(token=os.environ["BOT_API_KEY"], parse_mode="html") dp = Dispatcher(bot) @dp.message_handler(commands=['start']) async def send_welcome(message): text = f"Hello, {message.chat.first_name} {message.chat.last_name}! \n" \ f"Welcome to <b>PyPi Tools Bot.</b>\n\n" \ "This Bot created special to obtain information from Official Python PyPi Server\n" \ + r.help_text + r.current_version await message.answer(text) @dp.message_handler(commands=['help']) async def send_welcome(message): await message.answer(r.help_text) @dp.message_handler(lambda message: message.text and ( '/stats' in message.text.lower() or 'stats:' in message.text.lower())) @validate_input(command='stats', known_sub_commands={'@any_number': lambda num: num}) async def send_package_stats(message): output = message.output sub_command = message.sub_command or 5 if len(output.split()) == 1: days = sub_command package_name = output current_date = datetime.now().date() data_ = await d.cached_package_downloads_stats(package_name, days, current_date) output = d.stats_text(data_, package_name, days) await message.answer(output) @dp.message_handler(lambda message: message.text and ( '/plot' in message.text.lower() or 'plot:' in message.text.lower())) @validate_input(command='plot', known_sub_commands={'@any_number': lambda num: num}) async def send_package_stats_with_graph(message): output = message.output sub_command = message.sub_command or 5 if len(output.split()) == 1: days = sub_command package_name = output current_date = datetime.now().date() data_ = await d.cached_package_downloads_stats(package_name, days, current_date) output = d.stats_text(data_, package_name, days) temp = 'temp/' os.makedirs(temp, exist_ok=True) # for pandas range start_date = current_date - timedelta(days=2) file_name = f'{temp}/{package_name}:{current_date - timedelta(days=1)}:{days}.png' if not os.path.isfile(file_name): file_name = v.generate_graph(start_date, [item for _, item in data_.items()][::-1], file_name) file_ = types.InputFile(file_name) await message.answer(output) await message.answer_photo(file_) @dp.message_handler(commands=['random']) async def command(message): output = await d.get_random_package() await message.answer(output) @dp.message_handler(commands=['search', 'search:detailed']) @validate_input(command='search', known_sub_commands={'detailed': lambda _package_name: d.request_package_info_from_pypi( _package_name, detailed=True)}, additional_error="Or use with sub-command to get detailed information:" "/search:detailed aiohttp") async def search_command(message): output = message.output sub_command = message.sub_command if len(output.split()) == 1: package_name = output if sub_command: output = await sub_command(package_name) else: output = await d.request_package_info_from_pypi(package_name) await message.answer(output) @dp.message_handler(commands=['releases', 'releases:full']) @validate_input(command='releases', known_sub_commands={'full': 'full'}, additional_error="Or use with sub-command to get full list of releases:" "/releases:full aiohttp") async def releases_command(message): output = message.output sub_command = message.sub_command if len(output.split()) == 1: package_name = output releases = await d.get_release_list(package_name=package_name) if sub_command and sub_command == 'full': output = f"Full Releases list for Package {package_name}\n\n" for version, v_date in releases.items(): output += f"<b>{version}</b>: {v_date}\n" else: output = f"Last 7 Releases for Package {package_name}\n\n" for num, items in enumerate(list(releases.items())): if num > 7: break version, v_date = items output += f"<b>{version}</b>: {v_date}\n" await message.answer(output) track_sub_commands = {'stop': lambda key: remove_track_for_package(key), 'nodev': 'nodev'} @dp.message_handler(commands=['track', 'track:stop', 'track:nodev']) @validate_input(command='track', known_sub_commands=track_sub_commands, additional_error="Or use with sub-command to stop track a package releases" "/track:stop aiohttp") async def track_command(message): """ handler to react on /track command and it sub-commands""" pool = await aioredis.create_redis_pool(redis_host) with await pool as redis: output = message.output sub_command = message.sub_command if len(output.split()) == 1: package_name = output chat_id = str(message.chat.id) key = chat_id + ":" + package_name if sub_command and sub_command != 'nodev': output = await sub_command(key) else: nodev = False if sub_command: nodev = True versions = await d.get_release_list(package_name, nodev) if versions is None: output = f'Package {package_name} does not exists' else: current_version = d.get_last_release_version(versions) output = f"Current {package_name} version is {current_version} \n" \ "You will be announced with new version release" version = current_version[0] if nodev: version = version + ':nodev' await redis.set(key, version) await message.answer(output) @dp.message_handler() async def echo_all(message: types.Message): await message.answer(message.text) if __name__ == '__main__': try: executor.start_polling(dp, skip_updates=True) except Exception as e: sentry_sdk.capture_exception(e)
40.687861
107
0.624378
import os import logging import sentry_sdk from aiogram import Bot, Dispatcher, executor, types from datetime import datetime, timedelta from pypi_tools.logic import remove_track_for_package import pypi_tools.data as d from pypi_tools.helpers import validate_input import pypi_tools.vizualizer as v import pypi_tools.readme as r import asyncio import aioredis logging.basicConfig(level=logging.INFO) redis_host = f"redis://{os.environ.get('REDIS_HOST')}" bot = Bot(token=os.environ["BOT_API_KEY"], parse_mode="html") dp = Dispatcher(bot) @dp.message_handler(commands=['start']) async def send_welcome(message): text = f"Hello, {message.chat.first_name} {message.chat.last_name}! \n" \ f"Welcome to <b>PyPi Tools Bot.</b>\n\n" \ "This Bot created special to obtain information from Official Python PyPi Server\n" \ + r.help_text + r.current_version await message.answer(text) @dp.message_handler(commands=['help']) async def send_welcome(message): await message.answer(r.help_text) @dp.message_handler(lambda message: message.text and ( '/stats' in message.text.lower() or 'stats:' in message.text.lower())) @validate_input(command='stats', known_sub_commands={'@any_number': lambda num: num}) async def send_package_stats(message): output = message.output sub_command = message.sub_command or 5 if len(output.split()) == 1: days = sub_command package_name = output current_date = datetime.now().date() data_ = await d.cached_package_downloads_stats(package_name, days, current_date) output = d.stats_text(data_, package_name, days) await message.answer(output) @dp.message_handler(lambda message: message.text and ( '/plot' in message.text.lower() or 'plot:' in message.text.lower())) @validate_input(command='plot', known_sub_commands={'@any_number': lambda num: num}) async def send_package_stats_with_graph(message): output = message.output sub_command = message.sub_command or 5 if len(output.split()) == 1: days = sub_command package_name = output current_date = datetime.now().date() data_ = await d.cached_package_downloads_stats(package_name, days, current_date) output = d.stats_text(data_, package_name, days) temp = 'temp/' os.makedirs(temp, exist_ok=True) start_date = current_date - timedelta(days=2) file_name = f'{temp}/{package_name}:{current_date - timedelta(days=1)}:{days}.png' if not os.path.isfile(file_name): file_name = v.generate_graph(start_date, [item for _, item in data_.items()][::-1], file_name) file_ = types.InputFile(file_name) await message.answer(output) await message.answer_photo(file_) @dp.message_handler(commands=['random']) async def command(message): output = await d.get_random_package() await message.answer(output) @dp.message_handler(commands=['search', 'search:detailed']) @validate_input(command='search', known_sub_commands={'detailed': lambda _package_name: d.request_package_info_from_pypi( _package_name, detailed=True)}, additional_error="Or use with sub-command to get detailed information:" "/search:detailed aiohttp") async def search_command(message): output = message.output sub_command = message.sub_command if len(output.split()) == 1: package_name = output if sub_command: output = await sub_command(package_name) else: output = await d.request_package_info_from_pypi(package_name) await message.answer(output) @dp.message_handler(commands=['releases', 'releases:full']) @validate_input(command='releases', known_sub_commands={'full': 'full'}, additional_error="Or use with sub-command to get full list of releases:" "/releases:full aiohttp") async def releases_command(message): output = message.output sub_command = message.sub_command if len(output.split()) == 1: package_name = output releases = await d.get_release_list(package_name=package_name) if sub_command and sub_command == 'full': output = f"Full Releases list for Package {package_name}\n\n" for version, v_date in releases.items(): output += f"<b>{version}</b>: {v_date}\n" else: output = f"Last 7 Releases for Package {package_name}\n\n" for num, items in enumerate(list(releases.items())): if num > 7: break version, v_date = items output += f"<b>{version}</b>: {v_date}\n" await message.answer(output) track_sub_commands = {'stop': lambda key: remove_track_for_package(key), 'nodev': 'nodev'} @dp.message_handler(commands=['track', 'track:stop', 'track:nodev']) @validate_input(command='track', known_sub_commands=track_sub_commands, additional_error="Or use with sub-command to stop track a package releases" "/track:stop aiohttp") async def track_command(message): pool = await aioredis.create_redis_pool(redis_host) with await pool as redis: output = message.output sub_command = message.sub_command if len(output.split()) == 1: package_name = output chat_id = str(message.chat.id) key = chat_id + ":" + package_name if sub_command and sub_command != 'nodev': output = await sub_command(key) else: nodev = False if sub_command: nodev = True versions = await d.get_release_list(package_name, nodev) if versions is None: output = f'Package {package_name} does not exists' else: current_version = d.get_last_release_version(versions) output = f"Current {package_name} version is {current_version} \n" \ "You will be announced with new version release" version = current_version[0] if nodev: version = version + ':nodev' await redis.set(key, version) await message.answer(output) @dp.message_handler() async def echo_all(message: types.Message): await message.answer(message.text) if __name__ == '__main__': try: executor.start_polling(dp, skip_updates=True) except Exception as e: sentry_sdk.capture_exception(e)
true
true
f720698516b3281db66e46d699cb433d69aa86c5
473
py
Python
4_factory/simple_factory/veggie_pizza.py
hypersport/Head-First-Design-Patterns-Python
0c8b831ae89ebbbef8b203b96508deb7e3063590
[ "MIT" ]
null
null
null
4_factory/simple_factory/veggie_pizza.py
hypersport/Head-First-Design-Patterns-Python
0c8b831ae89ebbbef8b203b96508deb7e3063590
[ "MIT" ]
null
null
null
4_factory/simple_factory/veggie_pizza.py
hypersport/Head-First-Design-Patterns-Python
0c8b831ae89ebbbef8b203b96508deb7e3063590
[ "MIT" ]
null
null
null
from pizza import Pizza class VeggiePizza(Pizza): def __init__(self): self.name = 'Veggie Pizza' self.dough = 'Crust' self.sauce = 'Marinara sauce' self.toppings.append('Shredded mozzarella') self.toppings.append('Grated parmesan') self.toppings.append('Diced onion') self.toppings.append('Sliced mushrooms') self.toppings.append('Sliced red pepper') self.toppings.append('Sliced black olives')
31.533333
51
0.651163
from pizza import Pizza class VeggiePizza(Pizza): def __init__(self): self.name = 'Veggie Pizza' self.dough = 'Crust' self.sauce = 'Marinara sauce' self.toppings.append('Shredded mozzarella') self.toppings.append('Grated parmesan') self.toppings.append('Diced onion') self.toppings.append('Sliced mushrooms') self.toppings.append('Sliced red pepper') self.toppings.append('Sliced black olives')
true
true
f7206acbc129c68b6043e8dd105bdfbbd6738ace
240
py
Python
python/homeflux/utils/timer.py
david2777/homeflux
4f7c4b855bd69b0b132d480cac133582445cacf5
[ "MIT" ]
null
null
null
python/homeflux/utils/timer.py
david2777/homeflux
4f7c4b855bd69b0b132d480cac133582445cacf5
[ "MIT" ]
null
null
null
python/homeflux/utils/timer.py
david2777/homeflux
4f7c4b855bd69b0b132d480cac133582445cacf5
[ "MIT" ]
null
null
null
import time class Timer: """Simple Timer""" def __init__(self): self.start = time.perf_counter() def end(self, precision: int = 3) -> str: return '%.{}f'.format(precision) % (time.perf_counter() - self.start)
21.818182
77
0.6
import time class Timer: def __init__(self): self.start = time.perf_counter() def end(self, precision: int = 3) -> str: return '%.{}f'.format(precision) % (time.perf_counter() - self.start)
true
true
f7206b1325541721ae9f9158f32fc2ad213a5369
16,774
py
Python
pw_tokenizer/py/pw_tokenizer/tokens.py
LuDuda/pigweed
dcd7230895a234156bc7b6e5061e6936627c5fbb
[ "Apache-2.0" ]
null
null
null
pw_tokenizer/py/pw_tokenizer/tokens.py
LuDuda/pigweed
dcd7230895a234156bc7b6e5061e6936627c5fbb
[ "Apache-2.0" ]
null
null
null
pw_tokenizer/py/pw_tokenizer/tokens.py
LuDuda/pigweed
dcd7230895a234156bc7b6e5061e6936627c5fbb
[ "Apache-2.0" ]
null
null
null
# Copyright 2020 The Pigweed Authors # # Licensed under the Apache License, Version 2.0 (the "License"); you may not # use this file except in compliance with the License. You may obtain a copy of # the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations under # the License. """Builds and manages databases of tokenized strings.""" import collections import csv from dataclasses import dataclass from datetime import datetime import io import logging from pathlib import Path import re import struct from typing import (BinaryIO, Callable, Dict, Iterable, Iterator, List, NamedTuple, Optional, Pattern, Tuple, Union, ValuesView) DATE_FORMAT = '%Y-%m-%d' DEFAULT_DOMAIN = '' # The default hash length to use. This value only applies when hashing strings # from a legacy-style ELF with plain strings. New tokenized string entries # include the token alongside the string. # # This MUST match the default value of PW_TOKENIZER_CFG_C_HASH_LENGTH in # pw_tokenizer/public/pw_tokenizer/config.h. DEFAULT_C_HASH_LENGTH = 128 TOKENIZER_HASH_CONSTANT = 65599 _LOG = logging.getLogger('pw_tokenizer') def _value(char: Union[int, str]) -> int: return char if isinstance(char, int) else ord(char) def pw_tokenizer_65599_fixed_length_hash(string: Union[str, bytes], hash_length: int) -> int: """Hashes the provided string. This hash function is only used when adding tokens from legacy-style tokenized strings in an ELF, which do not include the token. """ hash_value = len(string) coefficient = TOKENIZER_HASH_CONSTANT for char in string[:hash_length]: hash_value = (hash_value + coefficient * _value(char)) % 2**32 coefficient = (coefficient * TOKENIZER_HASH_CONSTANT) % 2**32 return hash_value def default_hash(string: Union[str, bytes]) -> int: return pw_tokenizer_65599_fixed_length_hash(string, DEFAULT_C_HASH_LENGTH) class _EntryKey(NamedTuple): """Uniquely refers to an entry.""" token: int string: str @dataclass(eq=True, order=False) class TokenizedStringEntry: """A tokenized string with its metadata.""" token: int string: str domain: str = DEFAULT_DOMAIN date_removed: Optional[datetime] = None def key(self) -> _EntryKey: """The key determines uniqueness for a tokenized string.""" return _EntryKey(self.token, self.string) def update_date_removed(self, new_date_removed: Optional[datetime]) -> None: """Sets self.date_removed if the other date is newer.""" # No removal date (None) is treated as the newest date. if self.date_removed is None: return if new_date_removed is None or new_date_removed > self.date_removed: self.date_removed = new_date_removed def __lt__(self, other) -> bool: """Sorts the entry by token, date removed, then string.""" if self.token != other.token: return self.token < other.token # Sort removal dates in reverse, so the most recently removed (or still # present) entry appears first. if self.date_removed != other.date_removed: return (other.date_removed or datetime.max) < (self.date_removed or datetime.max) return self.string < other.string def __str__(self) -> str: return self.string class Database: """Database of tokenized strings stored as TokenizedStringEntry objects.""" def __init__(self, entries: Iterable[TokenizedStringEntry] = ()): """Creates a token database.""" # The database dict stores each unique (token, string) entry. self._database: Dict[_EntryKey, TokenizedStringEntry] = { entry.key(): entry for entry in entries } # This is a cache for fast token lookup that is built as needed. self._cache: Optional[Dict[int, List[TokenizedStringEntry]]] = None @classmethod def from_strings( cls, strings: Iterable[str], domain: str = DEFAULT_DOMAIN, tokenize: Callable[[str], int] = default_hash) -> 'Database': """Creates a Database from an iterable of strings.""" return cls((TokenizedStringEntry(tokenize(string), string, domain) for string in strings)) @classmethod def merged(cls, *databases: 'Database') -> 'Database': """Creates a TokenDatabase from one or more other databases.""" db = cls() db.merge(*databases) return db @property def token_to_entries(self) -> Dict[int, List[TokenizedStringEntry]]: """Returns a dict that maps tokens to a list of TokenizedStringEntry.""" if self._cache is None: # build cache token -> entry cache self._cache = collections.defaultdict(list) for entry in self._database.values(): self._cache[entry.token].append(entry) return self._cache def entries(self) -> ValuesView[TokenizedStringEntry]: """Returns iterable over all TokenizedStringEntries in the database.""" return self._database.values() def collisions(self) -> Iterator[Tuple[int, List[TokenizedStringEntry]]]: """Returns tuple of (token, entries_list)) for all colliding tokens.""" for token, entries in self.token_to_entries.items(): if len(entries) > 1: yield token, entries def mark_removals( self, all_entries: Iterable[TokenizedStringEntry], removal_date: Optional[datetime] = None ) -> List[TokenizedStringEntry]: """Marks entries missing from all_entries as having been removed. The entries are assumed to represent the complete set of entries for the database. Entries currently in the database not present in the provided entries are marked with a removal date but remain in the database. Entries in all_entries missing from the database are NOT added; call the add function to add these. Args: all_entries: the complete set of strings present in the database removal_date: the datetime for removed entries; today by default Returns: A list of entries marked as removed. """ self._cache = None if removal_date is None: removal_date = datetime.now() all_keys = frozenset(entry.key() for entry in all_entries) removed = [] for entry in self._database.values(): if (entry.key() not in all_keys and (entry.date_removed is None or removal_date < entry.date_removed)): # Add a removal date, or update it to the oldest date. entry.date_removed = removal_date removed.append(entry) return removed def add(self, entries: Iterable[TokenizedStringEntry]) -> None: """Adds new entries and updates date_removed for existing entries.""" self._cache = None for new_entry in entries: # Update an existing entry or create a new one. try: entry = self._database[new_entry.key()] entry.domain = new_entry.domain entry.date_removed = None except KeyError: self._database[new_entry.key()] = TokenizedStringEntry( new_entry.token, new_entry.string, new_entry.domain) def purge( self, date_removed_cutoff: Optional[datetime] = None ) -> List[TokenizedStringEntry]: """Removes and returns entries removed on/before date_removed_cutoff.""" self._cache = None if date_removed_cutoff is None: date_removed_cutoff = datetime.max to_delete = [ entry for _, entry in self._database.items() if entry.date_removed and entry.date_removed <= date_removed_cutoff ] for entry in to_delete: del self._database[entry.key()] return to_delete def merge(self, *databases: 'Database') -> None: """Merges two or more databases together, keeping the newest dates.""" self._cache = None for other_db in databases: for entry in other_db.entries(): key = entry.key() if key in self._database: self._database[key].update_date_removed(entry.date_removed) else: self._database[key] = entry def filter( self, include: Iterable[Union[str, Pattern[str]]] = (), exclude: Iterable[Union[str, Pattern[str]]] = (), replace: Iterable[Tuple[Union[str, Pattern[str]], str]] = () ) -> None: """Filters the database using regular expressions (strings or compiled). Args: include: regexes; only entries matching at least one are kept exclude: regexes; entries matching any of these are removed replace: (regex, str) tuples; replaces matching terms in all entries """ self._cache = None to_delete: List[_EntryKey] = [] if include: include_re = [re.compile(pattern) for pattern in include] to_delete.extend( key for key, val in self._database.items() if not any(rgx.search(val.string) for rgx in include_re)) if exclude: exclude_re = [re.compile(pattern) for pattern in exclude] to_delete.extend(key for key, val in self._database.items() if any( rgx.search(val.string) for rgx in exclude_re)) for key in to_delete: del self._database[key] for search, replacement in replace: search = re.compile(search) for value in self._database.values(): value.string = search.sub(replacement, value.string) def __len__(self) -> int: """Returns the number of entries in the database.""" return len(self.entries()) def __str__(self) -> str: """Outputs the database as CSV.""" csv_output = io.BytesIO() write_csv(self, csv_output) return csv_output.getvalue().decode() def parse_csv(fd) -> Iterable[TokenizedStringEntry]: """Parses TokenizedStringEntries from a CSV token database file.""" for line in csv.reader(fd): try: token_str, date_str, string_literal = line token = int(token_str, 16) date = (datetime.strptime(date_str, DATE_FORMAT) if date_str.strip() else None) yield TokenizedStringEntry(token, string_literal, DEFAULT_DOMAIN, date) except (ValueError, UnicodeDecodeError) as err: _LOG.error('Failed to parse tokenized string entry %s: %s', line, err) def write_csv(database: Database, fd: BinaryIO) -> None: """Writes the database as CSV to the provided binary file.""" for entry in sorted(database.entries()): # Align the CSV output to 10-character columns for improved readability. # Use \n instead of RFC 4180's \r\n. fd.write('{:08x},{:10},"{}"\n'.format( entry.token, entry.date_removed.strftime(DATE_FORMAT) if entry.date_removed else '', entry.string.replace('"', '""')).encode()) # escape " as "" class _BinaryFileFormat(NamedTuple): """Attributes of the binary token database file format.""" magic: bytes = b'TOKENS\0\0' header: struct.Struct = struct.Struct('<8sI4x') entry: struct.Struct = struct.Struct('<IBBH') BINARY_FORMAT = _BinaryFileFormat() class DatabaseFormatError(Exception): """Failed to parse a token database file.""" def file_is_binary_database(fd: BinaryIO) -> bool: """True if the file starts with the binary token database magic string.""" try: fd.seek(0) magic = fd.read(len(BINARY_FORMAT.magic)) fd.seek(0) return BINARY_FORMAT.magic == magic except IOError: return False def _check_that_file_is_csv_database(path: Path) -> None: """Raises an error unless the path appears to be a CSV token database.""" try: with path.open('rb') as fd: data = fd.read(8) # Read 8 bytes, which should be the first token. if not data: return # File is empty, which is valid CSV. if len(data) != 8: raise DatabaseFormatError( f'Attempted to read {path} as a CSV token database, but the ' f'file is too short ({len(data)} B)') # Make sure the first 8 chars are a valid hexadecimal number. _ = int(data.decode(), 16) except (IOError, UnicodeDecodeError, ValueError) as err: raise DatabaseFormatError( f'Encountered error while reading {path} as a CSV token database' ) from err def parse_binary(fd: BinaryIO) -> Iterable[TokenizedStringEntry]: """Parses TokenizedStringEntries from a binary token database file.""" magic, entry_count = BINARY_FORMAT.header.unpack( fd.read(BINARY_FORMAT.header.size)) if magic != BINARY_FORMAT.magic: raise DatabaseFormatError( f'Binary token database magic number mismatch (found {magic!r}, ' f'expected {BINARY_FORMAT.magic!r}) while reading from {fd}') entries = [] for _ in range(entry_count): token, day, month, year = BINARY_FORMAT.entry.unpack( fd.read(BINARY_FORMAT.entry.size)) try: date_removed: Optional[datetime] = datetime(year, month, day) except ValueError: date_removed = None entries.append((token, date_removed)) # Read the entire string table and define a function for looking up strings. string_table = fd.read() def read_string(start): end = string_table.find(b'\0', start) return string_table[start:string_table.find(b'\0', start)].decode( ), end + 1 offset = 0 for token, removed in entries: string, offset = read_string(offset) yield TokenizedStringEntry(token, string, DEFAULT_DOMAIN, removed) def write_binary(database: Database, fd: BinaryIO) -> None: """Writes the database as packed binary to the provided binary file.""" entries = sorted(database.entries()) fd.write(BINARY_FORMAT.header.pack(BINARY_FORMAT.magic, len(entries))) string_table = bytearray() for entry in entries: if entry.date_removed: removed_day = entry.date_removed.day removed_month = entry.date_removed.month removed_year = entry.date_removed.year else: # If there is no removal date, use the special value 0xffffffff for # the day/month/year. That ensures that still-present tokens appear # as the newest tokens when sorted by removal date. removed_day = 0xff removed_month = 0xff removed_year = 0xffff string_table += entry.string.encode() string_table.append(0) fd.write( BINARY_FORMAT.entry.pack(entry.token, removed_day, removed_month, removed_year)) fd.write(string_table) class DatabaseFile(Database): """A token database that is associated with a particular file. This class adds the write_to_file() method that writes to file from which it was created in the correct format (CSV or binary). """ def __init__(self, path: Union[Path, str]): self.path = Path(path) # Read the path as a packed binary file. with self.path.open('rb') as fd: if file_is_binary_database(fd): super().__init__(parse_binary(fd)) self._export = write_binary return # Read the path as a CSV file. _check_that_file_is_csv_database(self.path) with self.path.open('r', newline='') as file: super().__init__(parse_csv(file)) self._export = write_csv def write_to_file(self, path: Optional[Union[Path, str]] = None) -> None: """Exports in the original format to the original or provided path.""" with open(self.path if path is None else path, 'wb') as fd: self._export(self, fd)
35.84188
80
0.63205
import collections import csv from dataclasses import dataclass from datetime import datetime import io import logging from pathlib import Path import re import struct from typing import (BinaryIO, Callable, Dict, Iterable, Iterator, List, NamedTuple, Optional, Pattern, Tuple, Union, ValuesView) DATE_FORMAT = '%Y-%m-%d' DEFAULT_DOMAIN = '' DEFAULT_C_HASH_LENGTH = 128 TOKENIZER_HASH_CONSTANT = 65599 _LOG = logging.getLogger('pw_tokenizer') def _value(char: Union[int, str]) -> int: return char if isinstance(char, int) else ord(char) def pw_tokenizer_65599_fixed_length_hash(string: Union[str, bytes], hash_length: int) -> int: hash_value = len(string) coefficient = TOKENIZER_HASH_CONSTANT for char in string[:hash_length]: hash_value = (hash_value + coefficient * _value(char)) % 2**32 coefficient = (coefficient * TOKENIZER_HASH_CONSTANT) % 2**32 return hash_value def default_hash(string: Union[str, bytes]) -> int: return pw_tokenizer_65599_fixed_length_hash(string, DEFAULT_C_HASH_LENGTH) class _EntryKey(NamedTuple): token: int string: str @dataclass(eq=True, order=False) class TokenizedStringEntry: token: int string: str domain: str = DEFAULT_DOMAIN date_removed: Optional[datetime] = None def key(self) -> _EntryKey: return _EntryKey(self.token, self.string) def update_date_removed(self, new_date_removed: Optional[datetime]) -> None: if self.date_removed is None: return if new_date_removed is None or new_date_removed > self.date_removed: self.date_removed = new_date_removed def __lt__(self, other) -> bool: if self.token != other.token: return self.token < other.token if self.date_removed != other.date_removed: return (other.date_removed or datetime.max) < (self.date_removed or datetime.max) return self.string < other.string def __str__(self) -> str: return self.string class Database: def __init__(self, entries: Iterable[TokenizedStringEntry] = ()): self._database: Dict[_EntryKey, TokenizedStringEntry] = { entry.key(): entry for entry in entries } self._cache: Optional[Dict[int, List[TokenizedStringEntry]]] = None @classmethod def from_strings( cls, strings: Iterable[str], domain: str = DEFAULT_DOMAIN, tokenize: Callable[[str], int] = default_hash) -> 'Database': return cls((TokenizedStringEntry(tokenize(string), string, domain) for string in strings)) @classmethod def merged(cls, *databases: 'Database') -> 'Database': db = cls() db.merge(*databases) return db @property def token_to_entries(self) -> Dict[int, List[TokenizedStringEntry]]: if self._cache is None: self._cache = collections.defaultdict(list) for entry in self._database.values(): self._cache[entry.token].append(entry) return self._cache def entries(self) -> ValuesView[TokenizedStringEntry]: return self._database.values() def collisions(self) -> Iterator[Tuple[int, List[TokenizedStringEntry]]]: for token, entries in self.token_to_entries.items(): if len(entries) > 1: yield token, entries def mark_removals( self, all_entries: Iterable[TokenizedStringEntry], removal_date: Optional[datetime] = None ) -> List[TokenizedStringEntry]: self._cache = None if removal_date is None: removal_date = datetime.now() all_keys = frozenset(entry.key() for entry in all_entries) removed = [] for entry in self._database.values(): if (entry.key() not in all_keys and (entry.date_removed is None or removal_date < entry.date_removed)): entry.date_removed = removal_date removed.append(entry) return removed def add(self, entries: Iterable[TokenizedStringEntry]) -> None: self._cache = None for new_entry in entries: try: entry = self._database[new_entry.key()] entry.domain = new_entry.domain entry.date_removed = None except KeyError: self._database[new_entry.key()] = TokenizedStringEntry( new_entry.token, new_entry.string, new_entry.domain) def purge( self, date_removed_cutoff: Optional[datetime] = None ) -> List[TokenizedStringEntry]: self._cache = None if date_removed_cutoff is None: date_removed_cutoff = datetime.max to_delete = [ entry for _, entry in self._database.items() if entry.date_removed and entry.date_removed <= date_removed_cutoff ] for entry in to_delete: del self._database[entry.key()] return to_delete def merge(self, *databases: 'Database') -> None: self._cache = None for other_db in databases: for entry in other_db.entries(): key = entry.key() if key in self._database: self._database[key].update_date_removed(entry.date_removed) else: self._database[key] = entry def filter( self, include: Iterable[Union[str, Pattern[str]]] = (), exclude: Iterable[Union[str, Pattern[str]]] = (), replace: Iterable[Tuple[Union[str, Pattern[str]], str]] = () ) -> None: self._cache = None to_delete: List[_EntryKey] = [] if include: include_re = [re.compile(pattern) for pattern in include] to_delete.extend( key for key, val in self._database.items() if not any(rgx.search(val.string) for rgx in include_re)) if exclude: exclude_re = [re.compile(pattern) for pattern in exclude] to_delete.extend(key for key, val in self._database.items() if any( rgx.search(val.string) for rgx in exclude_re)) for key in to_delete: del self._database[key] for search, replacement in replace: search = re.compile(search) for value in self._database.values(): value.string = search.sub(replacement, value.string) def __len__(self) -> int: return len(self.entries()) def __str__(self) -> str: csv_output = io.BytesIO() write_csv(self, csv_output) return csv_output.getvalue().decode() def parse_csv(fd) -> Iterable[TokenizedStringEntry]: for line in csv.reader(fd): try: token_str, date_str, string_literal = line token = int(token_str, 16) date = (datetime.strptime(date_str, DATE_FORMAT) if date_str.strip() else None) yield TokenizedStringEntry(token, string_literal, DEFAULT_DOMAIN, date) except (ValueError, UnicodeDecodeError) as err: _LOG.error('Failed to parse tokenized string entry %s: %s', line, err) def write_csv(database: Database, fd: BinaryIO) -> None: for entry in sorted(database.entries()): fd.write('{:08x},{:10},"{}"\n'.format( entry.token, entry.date_removed.strftime(DATE_FORMAT) if entry.date_removed else '', entry.string.replace('"', '""')).encode()) # escape " as "" class _BinaryFileFormat(NamedTuple): magic: bytes = b'TOKENS\0\0' header: struct.Struct = struct.Struct('<8sI4x') entry: struct.Struct = struct.Struct('<IBBH') BINARY_FORMAT = _BinaryFileFormat() class DatabaseFormatError(Exception): def file_is_binary_database(fd: BinaryIO) -> bool: try: fd.seek(0) magic = fd.read(len(BINARY_FORMAT.magic)) fd.seek(0) return BINARY_FORMAT.magic == magic except IOError: return False def _check_that_file_is_csv_database(path: Path) -> None: try: with path.open('rb') as fd: data = fd.read(8) # Read 8 bytes, which should be the first token. if not data: return # File is empty, which is valid CSV. if len(data) != 8: raise DatabaseFormatError( f'Attempted to read {path} as a CSV token database, but the ' f'file is too short ({len(data)} B)') # Make sure the first 8 chars are a valid hexadecimal number. _ = int(data.decode(), 16) except (IOError, UnicodeDecodeError, ValueError) as err: raise DatabaseFormatError( f'Encountered error while reading {path} as a CSV token database' ) from err def parse_binary(fd: BinaryIO) -> Iterable[TokenizedStringEntry]: magic, entry_count = BINARY_FORMAT.header.unpack( fd.read(BINARY_FORMAT.header.size)) if magic != BINARY_FORMAT.magic: raise DatabaseFormatError( f'Binary token database magic number mismatch (found {magic!r}, ' f'expected {BINARY_FORMAT.magic!r}) while reading from {fd}') entries = [] for _ in range(entry_count): token, day, month, year = BINARY_FORMAT.entry.unpack( fd.read(BINARY_FORMAT.entry.size)) try: date_removed: Optional[datetime] = datetime(year, month, day) except ValueError: date_removed = None entries.append((token, date_removed)) # Read the entire string table and define a function for looking up strings. string_table = fd.read() def read_string(start): end = string_table.find(b'\0', start) return string_table[start:string_table.find(b'\0', start)].decode( ), end + 1 offset = 0 for token, removed in entries: string, offset = read_string(offset) yield TokenizedStringEntry(token, string, DEFAULT_DOMAIN, removed) def write_binary(database: Database, fd: BinaryIO) -> None: entries = sorted(database.entries()) fd.write(BINARY_FORMAT.header.pack(BINARY_FORMAT.magic, len(entries))) string_table = bytearray() for entry in entries: if entry.date_removed: removed_day = entry.date_removed.day removed_month = entry.date_removed.month removed_year = entry.date_removed.year else: # If there is no removal date, use the special value 0xffffffff for # the day/month/year. That ensures that still-present tokens appear # as the newest tokens when sorted by removal date. removed_day = 0xff removed_month = 0xff removed_year = 0xffff string_table += entry.string.encode() string_table.append(0) fd.write( BINARY_FORMAT.entry.pack(entry.token, removed_day, removed_month, removed_year)) fd.write(string_table) class DatabaseFile(Database): def __init__(self, path: Union[Path, str]): self.path = Path(path) # Read the path as a packed binary file. with self.path.open('rb') as fd: if file_is_binary_database(fd): super().__init__(parse_binary(fd)) self._export = write_binary return # Read the path as a CSV file. _check_that_file_is_csv_database(self.path) with self.path.open('r', newline='') as file: super().__init__(parse_csv(file)) self._export = write_csv def write_to_file(self, path: Optional[Union[Path, str]] = None) -> None: with open(self.path if path is None else path, 'wb') as fd: self._export(self, fd)
true
true
f7206b36e5a22338c09290307a5bbcd5356c269a
366
py
Python
chatterbot/ext/django_chatterbot/migrations/0016_statement_stemmed_text.py
dieterwarson/ChatterBot
69c674218be274bca1f47c105b09995373e09f47
[ "BSD-3-Clause" ]
null
null
null
chatterbot/ext/django_chatterbot/migrations/0016_statement_stemmed_text.py
dieterwarson/ChatterBot
69c674218be274bca1f47c105b09995373e09f47
[ "BSD-3-Clause" ]
null
null
null
chatterbot/ext/django_chatterbot/migrations/0016_statement_stemmed_text.py
dieterwarson/ChatterBot
69c674218be274bca1f47c105b09995373e09f47
[ "BSD-3-Clause" ]
null
null
null
from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('django_chatterbot', '0015_statement_persona'), ] operations = [ migrations.AddField( model_name='statement', name='stemmed_text', field=models.CharField(blank=True, max_length=400), ), ]
21.529412
63
0.60929
from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('django_chatterbot', '0015_statement_persona'), ] operations = [ migrations.AddField( model_name='statement', name='stemmed_text', field=models.CharField(blank=True, max_length=400), ), ]
true
true
f7206bcb4173f335d34eb68cdae8a22c3c3c3a67
1,928
py
Python
docs_src/sql_databases/sql_app/alt_main.py
Aryabhata-Rootspring/fastapi
f6237ad05a8468ac19c591181adad38d75372c46
[ "MIT" ]
53,007
2018-12-08T10:05:29.000Z
2022-03-31T23:30:02.000Z
docs_src/sql_databases/sql_app/alt_main.py
Aryabhata-Rootspring/fastapi
f6237ad05a8468ac19c591181adad38d75372c46
[ "MIT" ]
4,155
2019-01-05T05:07:49.000Z
2022-03-31T21:25:38.000Z
docs_src/sql_databases/sql_app/alt_main.py
Aryabhata-Rootspring/fastapi
f6237ad05a8468ac19c591181adad38d75372c46
[ "MIT" ]
4,092
2018-12-09T16:21:00.000Z
2022-03-31T07:59:45.000Z
from typing import List from fastapi import Depends, FastAPI, HTTPException, Request, Response from sqlalchemy.orm import Session from . import crud, models, schemas from .database import SessionLocal, engine models.Base.metadata.create_all(bind=engine) app = FastAPI() @app.middleware("http") async def db_session_middleware(request: Request, call_next): response = Response("Internal server error", status_code=500) try: request.state.db = SessionLocal() response = await call_next(request) finally: request.state.db.close() return response # Dependency def get_db(request: Request): return request.state.db @app.post("/users/", response_model=schemas.User) def create_user(user: schemas.UserCreate, db: Session = Depends(get_db)): db_user = crud.get_user_by_email(db, email=user.email) if db_user: raise HTTPException(status_code=400, detail="Email already registered") return crud.create_user(db=db, user=user) @app.get("/users/", response_model=List[schemas.User]) def read_users(skip: int = 0, limit: int = 100, db: Session = Depends(get_db)): users = crud.get_users(db, skip=skip, limit=limit) return users @app.get("/users/{user_id}", response_model=schemas.User) def read_user(user_id: int, db: Session = Depends(get_db)): db_user = crud.get_user(db, user_id=user_id) if db_user is None: raise HTTPException(status_code=404, detail="User not found") return db_user @app.post("/users/{user_id}/items/", response_model=schemas.Item) def create_item_for_user( user_id: int, item: schemas.ItemCreate, db: Session = Depends(get_db) ): return crud.create_user_item(db=db, item=item, user_id=user_id) @app.get("/items/", response_model=List[schemas.Item]) def read_items(skip: int = 0, limit: int = 100, db: Session = Depends(get_db)): items = crud.get_items(db, skip=skip, limit=limit) return items
30.603175
79
0.721992
from typing import List from fastapi import Depends, FastAPI, HTTPException, Request, Response from sqlalchemy.orm import Session from . import crud, models, schemas from .database import SessionLocal, engine models.Base.metadata.create_all(bind=engine) app = FastAPI() @app.middleware("http") async def db_session_middleware(request: Request, call_next): response = Response("Internal server error", status_code=500) try: request.state.db = SessionLocal() response = await call_next(request) finally: request.state.db.close() return response def get_db(request: Request): return request.state.db @app.post("/users/", response_model=schemas.User) def create_user(user: schemas.UserCreate, db: Session = Depends(get_db)): db_user = crud.get_user_by_email(db, email=user.email) if db_user: raise HTTPException(status_code=400, detail="Email already registered") return crud.create_user(db=db, user=user) @app.get("/users/", response_model=List[schemas.User]) def read_users(skip: int = 0, limit: int = 100, db: Session = Depends(get_db)): users = crud.get_users(db, skip=skip, limit=limit) return users @app.get("/users/{user_id}", response_model=schemas.User) def read_user(user_id: int, db: Session = Depends(get_db)): db_user = crud.get_user(db, user_id=user_id) if db_user is None: raise HTTPException(status_code=404, detail="User not found") return db_user @app.post("/users/{user_id}/items/", response_model=schemas.Item) def create_item_for_user( user_id: int, item: schemas.ItemCreate, db: Session = Depends(get_db) ): return crud.create_user_item(db=db, item=item, user_id=user_id) @app.get("/items/", response_model=List[schemas.Item]) def read_items(skip: int = 0, limit: int = 100, db: Session = Depends(get_db)): items = crud.get_items(db, skip=skip, limit=limit) return items
true
true
f7206d083d469a643b9a783b3a819077f502c23e
450
py
Python
Lib/fontTools/ttLib/tables/T_S_I__2.py
anntzer/fonttools
726cd67549956b985bbbe83e26fb0af9da59ddf7
[ "MIT", "BSD-3-Clause" ]
2
2021-04-07T16:47:04.000Z
2022-01-15T04:01:01.000Z
Lib/fontTools/ttLib/tables/T_S_I__2.py
anntzer/fonttools
726cd67549956b985bbbe83e26fb0af9da59ddf7
[ "MIT", "BSD-3-Clause" ]
74
2020-01-30T07:27:54.000Z
2021-08-03T05:47:17.000Z
Lib/fontTools/ttLib/tables/T_S_I__2.py
anntzer/fonttools
726cd67549956b985bbbe83e26fb0af9da59ddf7
[ "MIT", "BSD-3-Clause" ]
1
2020-01-22T20:06:09.000Z
2020-01-22T20:06:09.000Z
""" TSI{0,1,2,3,5} are private tables used by Microsoft Visual TrueType (VTT) tool to store its hinting source data. TSI2 is the index table containing the lengths and offsets for the glyph programs that are contained in the TSI3 table. It uses the same format as the TSI0 table. """ from fontTools.misc.py23 import * from fontTools import ttLib superclass = ttLib.getTableClass("TSI0") class table_T_S_I__2(superclass): dependencies = ["TSI3"]
28.125
77
0.768889
from fontTools.misc.py23 import * from fontTools import ttLib superclass = ttLib.getTableClass("TSI0") class table_T_S_I__2(superclass): dependencies = ["TSI3"]
true
true
f7206d8f4f866ba92ed05ffaf316f027c8f23f04
405
py
Python
psqlflow/printers/graph_printer.py
liuhenry/psqlflow
a4d39794d437a16fbf89582d3f7b8e7425bdfca5
[ "MIT" ]
3
2016-12-11T19:50:44.000Z
2018-05-24T13:52:09.000Z
psqlflow/printers/graph_printer.py
liuhenry/psqlflow
a4d39794d437a16fbf89582d3f7b8e7425bdfca5
[ "MIT" ]
null
null
null
psqlflow/printers/graph_printer.py
liuhenry/psqlflow
a4d39794d437a16fbf89582d3f7b8e7425bdfca5
[ "MIT" ]
null
null
null
import pygraphviz as pgv from .printer import Printer class GraphPrinter(Printer): """ Exports flows to graphviz """ def __init__(self, *args, **kwargs): super(GraphPrinter, self).__init__(*args, **kwargs) def new_obj(self): return pgv.AGraph(strict=False, directed=True, rankdir='LR') @staticmethod def add_edge(graph, a, b): graph.add_edge(a, b)
21.315789
68
0.644444
import pygraphviz as pgv from .printer import Printer class GraphPrinter(Printer): def __init__(self, *args, **kwargs): super(GraphPrinter, self).__init__(*args, **kwargs) def new_obj(self): return pgv.AGraph(strict=False, directed=True, rankdir='LR') @staticmethod def add_edge(graph, a, b): graph.add_edge(a, b)
true
true
f7206e62311f2ae8bf498980b4772f3ea02b5efc
6,337
py
Python
apps/alerts/main.py
Cal-CS-61A-Staff/examtool-web
c31b8596fde75c54fe6436400bb6d2889d7b1283
[ "MIT" ]
1
2020-05-06T22:34:44.000Z
2020-05-06T22:34:44.000Z
apps/alerts/main.py
Cal-CS-61A-Staff/examtool-web
c31b8596fde75c54fe6436400bb6d2889d7b1283
[ "MIT" ]
5
2020-07-13T09:29:01.000Z
2020-10-18T06:33:30.000Z
apps/alerts/main.py
Cal-CS-61A-Staff/examtool-web
c31b8596fde75c54fe6436400bb6d2889d7b1283
[ "MIT" ]
5
2020-05-13T16:10:24.000Z
2020-09-23T18:41:06.000Z
import time from os import getenv from flask import jsonify, abort from google.cloud import firestore from google.oauth2 import id_token from google.auth.transport import requests as g_requests from api import ( process_ok_exam_upload, is_admin, clear_collection, get_announcements, get_email_from_secret, generate_audio, ) # this can be public CLIENT_ID = "713452892775-59gliacuhbfho8qvn4ctngtp3858fgf9.apps.googleusercontent.com" DEV_EMAIL = getenv("DEV_EMAIL", "exam-test@berkeley.edu") def update_cache(): global main_html, main_js with open("static/index.html") as f: main_html = f.read() with open("static/main.js") as f: main_js = f.read() update_cache() def get_email(request): if getenv("ENV") == "dev": return DEV_EMAIL token = request.json["token"] # validate token id_info = id_token.verify_oauth2_token(token, g_requests.Request(), CLIENT_ID) if id_info["iss"] not in ["accounts.google.com", "https://accounts.google.com"]: raise ValueError("Wrong issuer.") return id_info["email"] def index(request): try: if getenv("ENV") == "dev": update_cache() db = firestore.Client() if request.path.endswith("main.js"): return main_js if request.path.endswith("list_exams"): return jsonify( db.collection("exam-alerts") .document("all") .get() .to_dict()["exam-list"] ) if request.path == "/" or request.json is None: return main_html if request.path.endswith("upload_ok_exam"): process_ok_exam_upload(db, request.json["data"], request.json["secret"]) return jsonify({"success": True}) exam = request.json["exam"] course = exam.split("-")[0] if request.path.endswith("fetch_data"): received_audio = request.json.get("receivedAudio") email = get_email(request) student_data = ( db.collection("exam-alerts") .document(exam) .collection("students") .document(email) .get() .to_dict() ) announcements = list( db.collection("exam-alerts") .document(exam) .collection("announcements") .stream() ) return jsonify( { "success": True, "exam_type": "ok-exam", "questions": [], "startTime": student_data["start_time"], "endTime": student_data["end_time"], # "questions": [ # { # "questionName": question["student_question_name"], # "startTime": question["start_time"], # "endTime": question["end_time"], # } # for question in student_data["questions"] # ], "announcements": get_announcements( student_data, announcements, received_audio, lambda x: ( db.collection("exam-alerts") .document(exam) .collection("announcement_audio") .document(x) .get() .to_dict() or {} ).get("audio"), ), } ) # only staff endpoints from here onwards email = ( get_email_from_secret(request.json["secret"]) if "secret" in request.json else get_email(request) ) if not is_admin(email, course): abort(401) if request.path.endswith("fetch_staff_data"): pass elif request.path.endswith("add_announcement"): announcement = request.json["announcement"] announcement["timestamp"] = time.time() ref = ( db.collection("exam-alerts") .document(exam) .collection("announcements") .document() ) ref.set(announcement) spoken_message = announcement.get("spoken_message", announcement["message"]) if spoken_message: audio = generate_audio(spoken_message) db.collection("exam-alerts").document(exam).collection( "announcement_audio" ).document(ref.id).set({"audio": audio}) elif request.path.endswith("clear_announcements"): clear_collection( db, db.collection("exam-alerts").document(exam).collection("announcements"), ) clear_collection( db, db.collection("exam-alerts") .document(exam) .collection("announcement_audio"), ) elif request.path.endswith("delete_announcement"): target = request.json["id"] db.collection("exam-alerts").document(exam).collection( "announcements" ).document(target).delete() else: abort(404) # all staff endpoints return an updated state exam_data = db.collection("exam-alerts").document(exam).get().to_dict() announcements = sorted( ( {"id": announcement.id, **announcement.to_dict()} for announcement in db.collection("exam-alerts") .document(exam) .collection("announcements") .stream() ), key=lambda announcement: announcement["timestamp"], reverse=True, ) return jsonify( {"success": True, "exam": exam_data, "announcements": announcements} ) except Exception as e: if getenv("ENV") == "dev": raise print(e) print(dict(request.json)) return jsonify({"success": False})
31.844221
88
0.504024
import time from os import getenv from flask import jsonify, abort from google.cloud import firestore from google.oauth2 import id_token from google.auth.transport import requests as g_requests from api import ( process_ok_exam_upload, is_admin, clear_collection, get_announcements, get_email_from_secret, generate_audio, ) CLIENT_ID = "713452892775-59gliacuhbfho8qvn4ctngtp3858fgf9.apps.googleusercontent.com" DEV_EMAIL = getenv("DEV_EMAIL", "exam-test@berkeley.edu") def update_cache(): global main_html, main_js with open("static/index.html") as f: main_html = f.read() with open("static/main.js") as f: main_js = f.read() update_cache() def get_email(request): if getenv("ENV") == "dev": return DEV_EMAIL token = request.json["token"] id_info = id_token.verify_oauth2_token(token, g_requests.Request(), CLIENT_ID) if id_info["iss"] not in ["accounts.google.com", "https://accounts.google.com"]: raise ValueError("Wrong issuer.") return id_info["email"] def index(request): try: if getenv("ENV") == "dev": update_cache() db = firestore.Client() if request.path.endswith("main.js"): return main_js if request.path.endswith("list_exams"): return jsonify( db.collection("exam-alerts") .document("all") .get() .to_dict()["exam-list"] ) if request.path == "/" or request.json is None: return main_html if request.path.endswith("upload_ok_exam"): process_ok_exam_upload(db, request.json["data"], request.json["secret"]) return jsonify({"success": True}) exam = request.json["exam"] course = exam.split("-")[0] if request.path.endswith("fetch_data"): received_audio = request.json.get("receivedAudio") email = get_email(request) student_data = ( db.collection("exam-alerts") .document(exam) .collection("students") .document(email) .get() .to_dict() ) announcements = list( db.collection("exam-alerts") .document(exam) .collection("announcements") .stream() ) return jsonify( { "success": True, "exam_type": "ok-exam", "questions": [], "startTime": student_data["start_time"], "endTime": student_data["end_time"], "announcements": get_announcements( student_data, announcements, received_audio, lambda x: ( db.collection("exam-alerts") .document(exam) .collection("announcement_audio") .document(x) .get() .to_dict() or {} ).get("audio"), ), } ) email = ( get_email_from_secret(request.json["secret"]) if "secret" in request.json else get_email(request) ) if not is_admin(email, course): abort(401) if request.path.endswith("fetch_staff_data"): pass elif request.path.endswith("add_announcement"): announcement = request.json["announcement"] announcement["timestamp"] = time.time() ref = ( db.collection("exam-alerts") .document(exam) .collection("announcements") .document() ) ref.set(announcement) spoken_message = announcement.get("spoken_message", announcement["message"]) if spoken_message: audio = generate_audio(spoken_message) db.collection("exam-alerts").document(exam).collection( "announcement_audio" ).document(ref.id).set({"audio": audio}) elif request.path.endswith("clear_announcements"): clear_collection( db, db.collection("exam-alerts").document(exam).collection("announcements"), ) clear_collection( db, db.collection("exam-alerts") .document(exam) .collection("announcement_audio"), ) elif request.path.endswith("delete_announcement"): target = request.json["id"] db.collection("exam-alerts").document(exam).collection( "announcements" ).document(target).delete() else: abort(404) exam_data = db.collection("exam-alerts").document(exam).get().to_dict() announcements = sorted( ( {"id": announcement.id, **announcement.to_dict()} for announcement in db.collection("exam-alerts") .document(exam) .collection("announcements") .stream() ), key=lambda announcement: announcement["timestamp"], reverse=True, ) return jsonify( {"success": True, "exam": exam_data, "announcements": announcements} ) except Exception as e: if getenv("ENV") == "dev": raise print(e) print(dict(request.json)) return jsonify({"success": False})
true
true
f7206ebe8fad56aa6688ff5f36b4dc7a3840b16f
413
py
Python
backend/app/models/user.py
Infam852/IoT-project
673d8a96676e046331550b9c16c0610de5733f73
[ "MIT" ]
null
null
null
backend/app/models/user.py
Infam852/IoT-project
673d8a96676e046331550b9c16c0610de5733f73
[ "MIT" ]
null
null
null
backend/app/models/user.py
Infam852/IoT-project
673d8a96676e046331550b9c16c0610de5733f73
[ "MIT" ]
1
2021-12-18T19:33:01.000Z
2021-12-18T19:33:01.000Z
from sqlalchemy import Column, Integer, ForeignKey, DateTime from sqlalchemy.sql.sqltypes import Boolean, String from app.db.database import Base class UserModel(Base): __tablename__ = "users" id = Column(Integer, primary_key=True, index=True) username = Column(String, nullable=False, index=True) disabled = Column(Boolean, default=False) hashed_password = Column(String, nullable=False)
29.5
60
0.755448
from sqlalchemy import Column, Integer, ForeignKey, DateTime from sqlalchemy.sql.sqltypes import Boolean, String from app.db.database import Base class UserModel(Base): __tablename__ = "users" id = Column(Integer, primary_key=True, index=True) username = Column(String, nullable=False, index=True) disabled = Column(Boolean, default=False) hashed_password = Column(String, nullable=False)
true
true
f7206ec0c3d11ce24235924a1f5bf4631efd543f
1,715
py
Python
tools/generate_taint_models/tests/get_exit_nodes_test.py
rvantonder/pyre-check-1
600ec9656ece5fff21598f4248c55089714bf590
[ "MIT" ]
null
null
null
tools/generate_taint_models/tests/get_exit_nodes_test.py
rvantonder/pyre-check-1
600ec9656ece5fff21598f4248c55089714bf590
[ "MIT" ]
null
null
null
tools/generate_taint_models/tests/get_exit_nodes_test.py
rvantonder/pyre-check-1
600ec9656ece5fff21598f4248c55089714bf590
[ "MIT" ]
null
null
null
# Copyright (c) 2016-present, Facebook, Inc. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. import unittest from typing import Callable from ..get_exit_nodes import ExitNodeGenerator from ..model_generator import Configuration from .test_functions import __name__ as qualifier, all_functions class GetExitNodesTest(unittest.TestCase): def test_compute_models(self): sink = "TaintSink[ReturnedToUser]" self.assertEqual( list(ExitNodeGenerator().compute_models(all_functions)), [ f"def {qualifier}.TestClass.methodA(self, x) -> {sink}: ...", f"def {qualifier}.TestClass.methodB(self, *args) -> {sink}: ...", f"def {qualifier}.testA() -> {sink}: ...", f"def {qualifier}.testB(x) -> {sink}: ...", f"def {qualifier}.testC(x) -> {sink}: ...", f"def {qualifier}.testD(x, *args) -> {sink}: ...", f"def {qualifier}.testE(x, **kwargs) -> {sink}: ...", ], ) Configuration.whitelisted_views = [f"{qualifier}.TestClass.methodA"] self.assertEqual( list(ExitNodeGenerator().compute_models(all_functions)), [ f"def {qualifier}.TestClass.methodB(self, *args) -> {sink}: ...", f"def {qualifier}.testA() -> {sink}: ...", f"def {qualifier}.testB(x) -> {sink}: ...", f"def {qualifier}.testC(x) -> {sink}: ...", f"def {qualifier}.testD(x, *args) -> {sink}: ...", f"def {qualifier}.testE(x, **kwargs) -> {sink}: ...", ], )
41.829268
81
0.549271
import unittest from typing import Callable from ..get_exit_nodes import ExitNodeGenerator from ..model_generator import Configuration from .test_functions import __name__ as qualifier, all_functions class GetExitNodesTest(unittest.TestCase): def test_compute_models(self): sink = "TaintSink[ReturnedToUser]" self.assertEqual( list(ExitNodeGenerator().compute_models(all_functions)), [ f"def {qualifier}.TestClass.methodA(self, x) -> {sink}: ...", f"def {qualifier}.TestClass.methodB(self, *args) -> {sink}: ...", f"def {qualifier}.testA() -> {sink}: ...", f"def {qualifier}.testB(x) -> {sink}: ...", f"def {qualifier}.testC(x) -> {sink}: ...", f"def {qualifier}.testD(x, *args) -> {sink}: ...", f"def {qualifier}.testE(x, **kwargs) -> {sink}: ...", ], ) Configuration.whitelisted_views = [f"{qualifier}.TestClass.methodA"] self.assertEqual( list(ExitNodeGenerator().compute_models(all_functions)), [ f"def {qualifier}.TestClass.methodB(self, *args) -> {sink}: ...", f"def {qualifier}.testA() -> {sink}: ...", f"def {qualifier}.testB(x) -> {sink}: ...", f"def {qualifier}.testC(x) -> {sink}: ...", f"def {qualifier}.testD(x, *args) -> {sink}: ...", f"def {qualifier}.testE(x, **kwargs) -> {sink}: ...", ], )
true
true
f7206f20aeb3af06e52189f7a1589c4376b4e9c4
1,677
py
Python
09.py
Michanix/Algorithms-Intro-Course
c81fa38b05199a42eaeb48567447ee3f6b1e535e
[ "MIT" ]
null
null
null
09.py
Michanix/Algorithms-Intro-Course
c81fa38b05199a42eaeb48567447ee3f6b1e535e
[ "MIT" ]
null
null
null
09.py
Michanix/Algorithms-Intro-Course
c81fa38b05199a42eaeb48567447ee3f6b1e535e
[ "MIT" ]
null
null
null
from random import randrange from time import time def bubble_sort(arr): for i in range(len(arr)): for j in range(len(arr)-1, i, -1): if arr[j] < arr[j-1]: # меняем элементы местами arr[j], arr[j-1] = arr[j-1], arr[j] return arr def opt_bubble_sort(arr): while True: swap = False for i in range(len(arr)-1): if arr[i] > arr[i+1]: arr[i], arr[i+1] = arr[i+1], arr[i] swap = True if not swap: break swap = False for j in range(len(arr)-1, 0): if arr[j] < arr[j+1]: # меняем элементы местами arr[j], arr[j+1] = arr[j+1], arr[j] swap = True return arr # измерить время работы алгоритма в случайом массиве def check_time_in_random_arr(f): arr = [randrange(100) for i in range(1100)] start = time() f(arr) end = time() return end - start # время работы алгоритма в сортированном массиве def check_time(f): arr = [i for i in range(1100)] start = time() f(arr) end = time() return end - start bubble_sort_time = check_time(bubble_sort) opt_bubble_sort_time = check_time(opt_bubble_sort) bubble_sort_time2 = check_time_in_random_arr(bubble_sort) opt_bubble_sort_time2 = check_time_in_random_arr(opt_bubble_sort) print(''' Время работы в уже отсортированном массиве:\n Обычный пузырёк: {}\n Модифицированный {}\n Время работы в случайном массиве: \n Обычный пузырёк: {}\n Модифицированный: {}'''.format(bubble_sort_time, opt_bubble_sort_time, bubble_sort_time2, opt_bubble_sort_time2))
26.203125
117
0.603459
from random import randrange from time import time def bubble_sort(arr): for i in range(len(arr)): for j in range(len(arr)-1, i, -1): if arr[j] < arr[j-1]: arr[j], arr[j-1] = arr[j-1], arr[j] return arr def opt_bubble_sort(arr): while True: swap = False for i in range(len(arr)-1): if arr[i] > arr[i+1]: arr[i], arr[i+1] = arr[i+1], arr[i] swap = True if not swap: break swap = False for j in range(len(arr)-1, 0): if arr[j] < arr[j+1]: arr[j], arr[j+1] = arr[j+1], arr[j] swap = True return arr def check_time_in_random_arr(f): arr = [randrange(100) for i in range(1100)] start = time() f(arr) end = time() return end - start def check_time(f): arr = [i for i in range(1100)] start = time() f(arr) end = time() return end - start bubble_sort_time = check_time(bubble_sort) opt_bubble_sort_time = check_time(opt_bubble_sort) bubble_sort_time2 = check_time_in_random_arr(bubble_sort) opt_bubble_sort_time2 = check_time_in_random_arr(opt_bubble_sort) print(''' Время работы в уже отсортированном массиве:\n Обычный пузырёк: {}\n Модифицированный {}\n Время работы в случайном массиве: \n Обычный пузырёк: {}\n Модифицированный: {}'''.format(bubble_sort_time, opt_bubble_sort_time, bubble_sort_time2, opt_bubble_sort_time2))
true
true
f72071c15f22bdfc2b6d13e6fb45864f32d756e1
5,175
py
Python
nay/scrape_nominate_movie.py
kondounagi/japanese_movies_dataset
349f217cd04e07fd44a401ecb2f2dcaea7bc2e5e
[ "MIT" ]
1
2019-08-05T21:43:09.000Z
2019-08-05T21:43:09.000Z
nay/scrape_nominate_movie.py
kondounagi/japanese_movies_dataset
349f217cd04e07fd44a401ecb2f2dcaea7bc2e5e
[ "MIT" ]
3
2020-03-31T05:53:37.000Z
2021-12-13T20:07:39.000Z
nay/scrape_nominate_movie.py
kondounagi/japanese_movies_dataset
349f217cd04e07fd44a401ecb2f2dcaea7bc2e5e
[ "MIT" ]
null
null
null
import re import sys import json import requests from bs4 import BeautifulSoup def scrape_nominate_movie(year): film_index = "https://eiga.com/movie/" re_time = re.compile(r"/\d*分/") re_production_studio = re.compile(r"配給:[^<]*") re_title = re.compile(r"映画「[^」]*」") re_date = re.compile(r"\d*年\d*月\d*日") year_film_data = [] # title aligns with eiga.com best_prize_title = [ '万引き家族', '三度目の殺人', 'シン・ゴジラ', '海街diary', '永遠の0', '舟を編む', '桐島、部活やめるってよ', '八日目の蟬', '告白', '沈まぬ太陽', 'おくりびと', '東京タワー オカンとボクと、時々、オトン', 'フラガール', 'ALWAYS 三丁目の夕日', '半落ち', '壬生義士伝', 'たそがれ清兵衛', '千と千尋の神隠し', '雨あがる', '鉄道員(ぽっぽや)', '愛を乞うひと', 'もののけ姫', 'Shall we ダンス?', '午後の遺言状', '忠臣蔵外伝 四谷怪談', '学校', 'シコふんじゃった。', '息子', '少年時代', '黒い雨', '敦煌', 'マルサの女', '火宅の人', '花いちもんめ', 'お葬式', '楢山節考', '蒲田行進曲', '駅 STATION', 'ツィゴイネルワイゼン', '復讐するは我にあり', '事件', '幸福の黄色いハンカチ', ] with open("nominate_id/" + str(year) + ".txt", "r") as f: for line in f.readlines(): film_id = line.strip() film_data = {} film_data["director"] = [] film_data["scriptwriter"] = [] film_data["performers"] = [] film_data["screen_time"] = -1 film_data["production_studio"] = "" film_data["title"] = "" film_data["year"] = year if len(year_film_data) == 0 and year != 2020: film_data["prize"] = 1 else: film_data["prize"] = 0 # fetch top-1 movie result information content = requests.get(film_index + film_id).content soup = BeautifulSoup(content, features="lxml") # filter out screen time and production studio html_text = soup.prettify() production_studio = re_production_studio.search(html_text) screen_time = re_time.search(html_text) title = re_title.search(html_text) date = re_date.search(html_text) if production_studio: film_data["production_studio"] = ( production_studio.group(0)[3:].strip()) if screen_time: film_data["screen_time"] = int(screen_time.group(0)[1:-2]) if title: film_data["title"] = title.group(0)[3:-1] if film_data["title"] in best_prize_title: film_data["prize"] = 1 else: print(film_id) if date: date_str = date.group(0) film_data["year"] = date_str[0:date_str.find("年")] film_data["month"] = ( date_str[date_str.find("年") + 1:date_str.find("月")]) film_data["day"] = ( date_str[date_str.find("月") + 1:date_str.find("日")]) # filter out informative data staff_cast = soup.find(id="staff-cast") if staff_cast is not None: for div in staff_cast.find_all(): # When calling div["class"], return type is list[string] if div.name == "dl" and div.has_attr("class") and div["class"][0] == "movie-staff": # movie staff column data_type = "" for p in div.find_all(): if p.name == "dt": if p.get_text().find("監督") != -1: data_type = "director" elif p.get_text().find("脚本") != -1: data_type = "scriptwriter" else: data_type = "" # new meta data type can be added here elif p.name == "dd" and len(data_type) > 0: film_data[data_type].append(p.get_text().strip()) elif div.name == "ul" and div.has_attr("class") and div["class"][0] == "movie-cast": # movie cast column for p in div.find_all(): if p.name == "span": film_data["performers"].append(p.get_text().strip()) # print(film_data) year_film_data.append(film_data) sys.stdout.flush() return year_film_data def main(): start_year = 1978 end_year = 2020 years_dict = {} unique_id = 10 for i in range(start_year, end_year + 1): years_dict[i] = scrape_nominate_movie(i) for j in range(len(years_dict[i])): years_dict[i][j]["id"] = unique_id unique_id += 1 with open("nominate_movie_meta_data.json", "w") as f: f.write(json.dumps(years_dict, ensure_ascii=False)) f.write("\n") if __name__ == "__main__": main()
32.753165
104
0.465507
import re import sys import json import requests from bs4 import BeautifulSoup def scrape_nominate_movie(year): film_index = "https://eiga.com/movie/" re_time = re.compile(r"/\d*分/") re_production_studio = re.compile(r"配給:[^<]*") re_title = re.compile(r"映画「[^」]*」") re_date = re.compile(r"\d*年\d*月\d*日") year_film_data = [] best_prize_title = [ '万引き家族', '三度目の殺人', 'シン・ゴジラ', '海街diary', '永遠の0', '舟を編む', '桐島、部活やめるってよ', '八日目の蟬', '告白', '沈まぬ太陽', 'おくりびと', '東京タワー オカンとボクと、時々、オトン', 'フラガール', 'ALWAYS 三丁目の夕日', '半落ち', '壬生義士伝', 'たそがれ清兵衛', '千と千尋の神隠し', '雨あがる', '鉄道員(ぽっぽや)', '愛を乞うひと', 'もののけ姫', 'Shall we ダンス?', '午後の遺言状', '忠臣蔵外伝 四谷怪談', '学校', 'シコふんじゃった。', '息子', '少年時代', '黒い雨', '敦煌', 'マルサの女', '火宅の人', '花いちもんめ', 'お葬式', '楢山節考', '蒲田行進曲', '駅 STATION', 'ツィゴイネルワイゼン', '復讐するは我にあり', '事件', '幸福の黄色いハンカチ', ] with open("nominate_id/" + str(year) + ".txt", "r") as f: for line in f.readlines(): film_id = line.strip() film_data = {} film_data["director"] = [] film_data["scriptwriter"] = [] film_data["performers"] = [] film_data["screen_time"] = -1 film_data["production_studio"] = "" film_data["title"] = "" film_data["year"] = year if len(year_film_data) == 0 and year != 2020: film_data["prize"] = 1 else: film_data["prize"] = 0 content = requests.get(film_index + film_id).content soup = BeautifulSoup(content, features="lxml") html_text = soup.prettify() production_studio = re_production_studio.search(html_text) screen_time = re_time.search(html_text) title = re_title.search(html_text) date = re_date.search(html_text) if production_studio: film_data["production_studio"] = ( production_studio.group(0)[3:].strip()) if screen_time: film_data["screen_time"] = int(screen_time.group(0)[1:-2]) if title: film_data["title"] = title.group(0)[3:-1] if film_data["title"] in best_prize_title: film_data["prize"] = 1 else: print(film_id) if date: date_str = date.group(0) film_data["year"] = date_str[0:date_str.find("年")] film_data["month"] = ( date_str[date_str.find("年") + 1:date_str.find("月")]) film_data["day"] = ( date_str[date_str.find("月") + 1:date_str.find("日")]) staff_cast = soup.find(id="staff-cast") if staff_cast is not None: for div in staff_cast.find_all(): if div.name == "dl" and div.has_attr("class") and div["class"][0] == "movie-staff": data_type = "" for p in div.find_all(): if p.name == "dt": if p.get_text().find("監督") != -1: data_type = "director" elif p.get_text().find("脚本") != -1: data_type = "scriptwriter" else: data_type = "" elif p.name == "dd" and len(data_type) > 0: film_data[data_type].append(p.get_text().strip()) elif div.name == "ul" and div.has_attr("class") and div["class"][0] == "movie-cast": for p in div.find_all(): if p.name == "span": film_data["performers"].append(p.get_text().strip()) year_film_data.append(film_data) sys.stdout.flush() return year_film_data def main(): start_year = 1978 end_year = 2020 years_dict = {} unique_id = 10 for i in range(start_year, end_year + 1): years_dict[i] = scrape_nominate_movie(i) for j in range(len(years_dict[i])): years_dict[i][j]["id"] = unique_id unique_id += 1 with open("nominate_movie_meta_data.json", "w") as f: f.write(json.dumps(years_dict, ensure_ascii=False)) f.write("\n") if __name__ == "__main__": main()
true
true
f72073fa7cc1e6f079942989602618bed6ed1f0a
9,216
py
Python
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_07_01/aio/operations/_available_private_endpoint_types_operations.py
praveenkuttappan/azure-sdk-for-python
4b79413667b7539750a6c7dde15737013a3d4bd5
[ "MIT" ]
2,728
2015-01-09T10:19:32.000Z
2022-03-31T14:50:33.000Z
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_07_01/aio/operations/_available_private_endpoint_types_operations.py
v-xuto/azure-sdk-for-python
9c6296d22094c5ede410bc83749e8df8694ccacc
[ "MIT" ]
17,773
2015-01-05T15:57:17.000Z
2022-03-31T23:50:25.000Z
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_07_01/aio/operations/_available_private_endpoint_types_operations.py
v-xuto/azure-sdk-for-python
9c6296d22094c5ede410bc83749e8df8694ccacc
[ "MIT" ]
1,916
2015-01-19T05:05:41.000Z
2022-03-31T19:36:44.000Z
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for license information. # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is regenerated. # -------------------------------------------------------------------------- from typing import Any, AsyncIterable, Callable, Dict, Generic, Optional, TypeVar import warnings from azure.core.async_paging import AsyncItemPaged, AsyncList from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import AsyncHttpResponse, HttpRequest from azure.mgmt.core.exceptions import ARMErrorFormat from ... import models as _models T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, AsyncHttpResponse], T, Dict[str, Any]], Any]] class AvailablePrivateEndpointTypesOperations: """AvailablePrivateEndpointTypesOperations async operations. You should not instantiate this class directly. Instead, you should create a Client instance that instantiates it for you and attaches it as an attribute. :ivar models: Alias to model classes used in this operation group. :type models: ~azure.mgmt.network.v2019_07_01.models :param client: Client for service requests. :param config: Configuration of service client. :param serializer: An object model serializer. :param deserializer: An object model deserializer. """ models = _models def __init__(self, client, config, serializer, deserializer) -> None: self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def list( self, location: str, **kwargs: Any ) -> AsyncIterable["_models.AvailablePrivateEndpointTypesResult"]: """Returns all of the resource types that can be linked to a Private Endpoint in this subscription in this region. :param location: The location of the domain name. :type location: str :keyword callable cls: A custom type or function that will be passed the direct response :return: An iterator like instance of either AvailablePrivateEndpointTypesResult or the result of cls(response) :rtype: ~azure.core.async_paging.AsyncItemPaged[~azure.mgmt.network.v2019_07_01.models.AvailablePrivateEndpointTypesResult] :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.AvailablePrivateEndpointTypesResult"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-07-01" accept = "application/json" def prepare_request(next_link=None): # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: # Construct URL url = self.list.metadata['url'] # type: ignore path_format_arguments = { 'location': self._serialize.url("location", location, 'str'), 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} # type: Dict[str, Any] request = self._client.get(url, query_parameters, header_parameters) return request async def extract_data(pipeline_response): deserialized = self._deserialize('AvailablePrivateEndpointTypesResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, AsyncList(list_of_elem) async def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) return pipeline_response return AsyncItemPaged( get_next, extract_data ) list.metadata = {'url': '/subscriptions/{subscriptionId}/providers/Microsoft.Network/locations/{location}/availablePrivateEndpointTypes'} # type: ignore def list_by_resource_group( self, location: str, resource_group_name: str, **kwargs: Any ) -> AsyncIterable["_models.AvailablePrivateEndpointTypesResult"]: """Returns all of the resource types that can be linked to a Private Endpoint in this subscription in this region. :param location: The location of the domain name. :type location: str :param resource_group_name: The name of the resource group. :type resource_group_name: str :keyword callable cls: A custom type or function that will be passed the direct response :return: An iterator like instance of either AvailablePrivateEndpointTypesResult or the result of cls(response) :rtype: ~azure.core.async_paging.AsyncItemPaged[~azure.mgmt.network.v2019_07_01.models.AvailablePrivateEndpointTypesResult] :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.AvailablePrivateEndpointTypesResult"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-07-01" accept = "application/json" def prepare_request(next_link=None): # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: # Construct URL url = self.list_by_resource_group.metadata['url'] # type: ignore path_format_arguments = { 'location': self._serialize.url("location", location, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} # type: Dict[str, Any] request = self._client.get(url, query_parameters, header_parameters) return request async def extract_data(pipeline_response): deserialized = self._deserialize('AvailablePrivateEndpointTypesResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, AsyncList(list_of_elem) async def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) return pipeline_response return AsyncItemPaged( get_next, extract_data ) list_by_resource_group.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/locations/{location}/availablePrivateEndpointTypes'} # type: ignore
48.761905
210
0.659397
from typing import Any, AsyncIterable, Callable, Dict, Generic, Optional, TypeVar import warnings from azure.core.async_paging import AsyncItemPaged, AsyncList from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import AsyncHttpResponse, HttpRequest from azure.mgmt.core.exceptions import ARMErrorFormat from ... import models as _models T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, AsyncHttpResponse], T, Dict[str, Any]], Any]] class AvailablePrivateEndpointTypesOperations: models = _models def __init__(self, client, config, serializer, deserializer) -> None: self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def list( self, location: str, **kwargs: Any ) -> AsyncIterable["_models.AvailablePrivateEndpointTypesResult"]: cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-07-01" accept = "application/json" def prepare_request(next_link=None): header_parameters = {} header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: url = self.list.metadata['url'] path_format_arguments = { 'location': self._serialize.url("location", location, 'str'), 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} request = self._client.get(url, query_parameters, header_parameters) return request async def extract_data(pipeline_response): deserialized = self._deserialize('AvailablePrivateEndpointTypesResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, AsyncList(list_of_elem) async def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) return pipeline_response return AsyncItemPaged( get_next, extract_data ) list.metadata = {'url': '/subscriptions/{subscriptionId}/providers/Microsoft.Network/locations/{location}/availablePrivateEndpointTypes'} def list_by_resource_group( self, location: str, resource_group_name: str, **kwargs: Any ) -> AsyncIterable["_models.AvailablePrivateEndpointTypesResult"]: cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-07-01" accept = "application/json" def prepare_request(next_link=None): header_parameters = {} header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: url = self.list_by_resource_group.metadata['url'] path_format_arguments = { 'location': self._serialize.url("location", location, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} request = self._client.get(url, query_parameters, header_parameters) return request async def extract_data(pipeline_response): deserialized = self._deserialize('AvailablePrivateEndpointTypesResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, AsyncList(list_of_elem) async def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) return pipeline_response return AsyncItemPaged( get_next, extract_data ) list_by_resource_group.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/locations/{location}/availablePrivateEndpointTypes'}
true
true
f72076a759856b30a8e2638c441c193c5f2894fe
3,023
py
Python
rally_openstack/scenarios/gnocchi/archive_policy.py
RSE-Cambridge/rally-openstack
32bbc091bbce1db625a2fc22da28b32718befa13
[ "Apache-2.0" ]
null
null
null
rally_openstack/scenarios/gnocchi/archive_policy.py
RSE-Cambridge/rally-openstack
32bbc091bbce1db625a2fc22da28b32718befa13
[ "Apache-2.0" ]
null
null
null
rally_openstack/scenarios/gnocchi/archive_policy.py
RSE-Cambridge/rally-openstack
32bbc091bbce1db625a2fc22da28b32718befa13
[ "Apache-2.0" ]
1
2018-12-10T12:31:27.000Z
2018-12-10T12:31:27.000Z
# Copyright 2017 Red Hat, Inc. <http://www.redhat.com> # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from rally.task import validation from rally_openstack import consts from rally_openstack import scenario from rally_openstack.scenarios.gnocchi import utils as gnocchiutils """Scenarios for Gnocchi archive policy.""" @validation.add("required_services", services=[consts.Service.GNOCCHI]) @validation.add("required_platform", platform="openstack", users=True) @scenario.configure(name="GnocchiArchivePolicy.list_archive_policy") class ListArchivePolicy(gnocchiutils.GnocchiBase): def run(self): """List archive policies.""" self.gnocchi.list_archive_policy() @validation.add("required_services", services=[consts.Service.GNOCCHI]) @validation.add("required_platform", platform="openstack", admin=True) @scenario.configure( context={"admin_cleanup@openstack": ["gnocchi.archive_policy"]}, name="GnocchiArchivePolicy.create_archive_policy") class CreateArchivePolicy(gnocchiutils.GnocchiBase): def run(self, definition=None, aggregation_methods=None): """Create archive policy. :param definition: List of definitions :param aggregation_methods: List of aggregation methods """ if definition is None: definition = [{"granularity": "0:00:01", "timespan": "1:00:00"}] name = self.generate_random_name() self.admin_gnocchi.create_archive_policy( name, definition=definition, aggregation_methods=aggregation_methods) @validation.add("required_services", services=[consts.Service.GNOCCHI]) @validation.add("required_platform", platform="openstack", admin=True) @scenario.configure( context={"admin_cleanup@openstack": ["gnocchi.archive_policy"]}, name="GnocchiArchivePolicy.create_delete_archive_policy") class CreateDeleteArchivePolicy(gnocchiutils.GnocchiBase): def run(self, definition=None, aggregation_methods=None): """Create archive policy and then delete it. :param definition: List of definitions :param aggregation_methods: List of aggregation methods """ if definition is None: definition = [{"granularity": "0:00:01", "timespan": "1:00:00"}] name = self.generate_random_name() self.admin_gnocchi.create_archive_policy( name, definition=definition, aggregation_methods=aggregation_methods) self.admin_gnocchi.delete_archive_policy(name)
38.75641
78
0.7261
from rally.task import validation from rally_openstack import consts from rally_openstack import scenario from rally_openstack.scenarios.gnocchi import utils as gnocchiutils @validation.add("required_services", services=[consts.Service.GNOCCHI]) @validation.add("required_platform", platform="openstack", users=True) @scenario.configure(name="GnocchiArchivePolicy.list_archive_policy") class ListArchivePolicy(gnocchiutils.GnocchiBase): def run(self): self.gnocchi.list_archive_policy() @validation.add("required_services", services=[consts.Service.GNOCCHI]) @validation.add("required_platform", platform="openstack", admin=True) @scenario.configure( context={"admin_cleanup@openstack": ["gnocchi.archive_policy"]}, name="GnocchiArchivePolicy.create_archive_policy") class CreateArchivePolicy(gnocchiutils.GnocchiBase): def run(self, definition=None, aggregation_methods=None): if definition is None: definition = [{"granularity": "0:00:01", "timespan": "1:00:00"}] name = self.generate_random_name() self.admin_gnocchi.create_archive_policy( name, definition=definition, aggregation_methods=aggregation_methods) @validation.add("required_services", services=[consts.Service.GNOCCHI]) @validation.add("required_platform", platform="openstack", admin=True) @scenario.configure( context={"admin_cleanup@openstack": ["gnocchi.archive_policy"]}, name="GnocchiArchivePolicy.create_delete_archive_policy") class CreateDeleteArchivePolicy(gnocchiutils.GnocchiBase): def run(self, definition=None, aggregation_methods=None): if definition is None: definition = [{"granularity": "0:00:01", "timespan": "1:00:00"}] name = self.generate_random_name() self.admin_gnocchi.create_archive_policy( name, definition=definition, aggregation_methods=aggregation_methods) self.admin_gnocchi.delete_archive_policy(name)
true
true
f720771fafd95ebfe23bca7f24afc2f571e9f07b
51,158
py
Python
tests/test_dataset.py
jenhaoyang/datumaro
add81ddb59502362fa65fa07e5bc4d8c9f61afde
[ "MIT" ]
null
null
null
tests/test_dataset.py
jenhaoyang/datumaro
add81ddb59502362fa65fa07e5bc4d8c9f61afde
[ "MIT" ]
null
null
null
tests/test_dataset.py
jenhaoyang/datumaro
add81ddb59502362fa65fa07e5bc4d8c9f61afde
[ "MIT" ]
1
2021-12-15T22:15:59.000Z
2021-12-15T22:15:59.000Z
from unittest import TestCase import os import os.path as osp import numpy as np from datumaro.components.annotation import ( AnnotationType, Bbox, Caption, Label, LabelCategories, Mask, Points, Polygon, PolyLine, ) from datumaro.components.converter import Converter from datumaro.components.dataset import ( DEFAULT_FORMAT, Dataset, ItemStatus, eager_mode, ) from datumaro.components.dataset_filter import ( DatasetItemEncoder, XPathAnnotationsFilter, XPathDatasetFilter, ) from datumaro.components.environment import Environment from datumaro.components.errors import ( ConflictingCategoriesError, DatasetNotFoundError, MultipleFormatsMatchError, NoMatchingFormatsError, RepeatedItemError, UnknownFormatError, ) from datumaro.components.extractor import ( DEFAULT_SUBSET_NAME, DatasetItem, Extractor, ItemTransform, Transform, ) from datumaro.components.launcher import Launcher from datumaro.components.media import Image from datumaro.util.test_utils import TestDir, compare_datasets from .requirements import Requirements, mark_requirement class DatasetTest(TestCase): @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_create_from_extractors(self): class SrcExtractor1(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(4), ]), ]) class SrcExtractor2(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='val', annotations=[ Label(5), ]), ]) class DstExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(4), Label(5), ]), ]) dataset = Dataset.from_extractors(SrcExtractor1(), SrcExtractor2()) compare_datasets(self, DstExtractor(), dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_create_from_iterable(self): class TestExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4, label=2), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(3), ]), ]) def categories(self): return { AnnotationType.label: LabelCategories.from_iterable( ['a', 'b', 'c', 'd', 'e']) } actual = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4, label=2), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(3), ]), ], categories=['a', 'b', 'c', 'd', 'e']) compare_datasets(self, TestExtractor(), actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_join_datasets_with_empty_categories(self): expected = Dataset.from_iterable([ DatasetItem(1, annotations=[ Label(0), Bbox(1, 2, 3, 4), Caption('hello world'), ]) ], categories=['a']) src1 = Dataset.from_iterable([ DatasetItem(1, annotations=[ Bbox(1, 2, 3, 4, label=None) ]) ], categories=[]) src2 = Dataset.from_iterable([ DatasetItem(1, annotations=[ Label(0) ]) ], categories=['a']) src3 = Dataset.from_iterable([ DatasetItem(1, annotations=[ Caption('hello world') ]) ]) actual = Dataset.from_extractors(src1, src2, src3) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_save_and_load(self): source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) loaded_dataset = Dataset.load(test_dir) compare_datasets(self, source_dataset, loaded_dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_detect(self): env = Environment() env.importers.items = {DEFAULT_FORMAT: env.importers[DEFAULT_FORMAT]} env.extractors.items = {DEFAULT_FORMAT: env.extractors[DEFAULT_FORMAT]} dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: dataset.save(test_dir) detected_format = Dataset.detect(test_dir, env=env) self.assertEqual(DEFAULT_FORMAT, detected_format) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_detect_and_import(self): env = Environment() env.importers.items = {DEFAULT_FORMAT: env.importers[DEFAULT_FORMAT]} env.extractors.items = {DEFAULT_FORMAT: env.extractors[DEFAULT_FORMAT]} source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) imported_dataset = Dataset.import_from(test_dir, env=env) self.assertEqual(imported_dataset.data_path, test_dir) self.assertEqual(imported_dataset.format, DEFAULT_FORMAT) compare_datasets(self, source_dataset, imported_dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_no_dataset_found(self): env = Environment() env.importers.items = { DEFAULT_FORMAT: env.importers[DEFAULT_FORMAT], } env.extractors.items = { DEFAULT_FORMAT: env.extractors[DEFAULT_FORMAT], } with TestDir() as test_dir, self.assertRaises(DatasetNotFoundError): Dataset.import_from(test_dir, DEFAULT_FORMAT, env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_multiple_formats_match(self): env = Environment() env.importers.items = { 'a': env.importers[DEFAULT_FORMAT], 'b': env.importers[DEFAULT_FORMAT], } env.extractors.items = { 'a': env.extractors[DEFAULT_FORMAT], 'b': env.extractors[DEFAULT_FORMAT], } source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) with self.assertRaises(MultipleFormatsMatchError): Dataset.import_from(test_dir, env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_no_matching_formats(self): env = Environment() env.importers.items = {} env.extractors.items = {} source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) with self.assertRaises(NoMatchingFormatsError): Dataset.import_from(test_dir, env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_unknown_format_requested(self): env = Environment() env.importers.items = {} env.extractors.items = {} source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) with self.assertRaises(UnknownFormatError): Dataset.import_from(test_dir, format='custom', env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_export_by_string_format_name(self): env = Environment() env.converters.items = {'qq': env.converters[DEFAULT_FORMAT]} dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c'], env=env) with TestDir() as test_dir: dataset.export(format='qq', save_dir=test_dir) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_remember_export_options(self): dataset = Dataset.from_iterable([ DatasetItem(id=1, image=np.ones((1, 2, 3))), ], categories=['a']) with TestDir() as test_dir: dataset.save(test_dir, save_images=True) dataset.put(dataset.get(1)) # mark the item modified for patching image_path = osp.join(test_dir, 'images', 'default', '1.jpg') os.remove(image_path) dataset.save(test_dir) self.assertEqual({'save_images': True}, dataset.options) self.assertTrue(osp.isfile(image_path)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_length_when_created_from_scratch(self): dataset = Dataset() dataset.put(DatasetItem(1)) dataset.put(DatasetItem(2)) dataset.put(DatasetItem(3)) dataset.remove(1) self.assertEqual(2, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_length_when_created_from_extractor(self): class TestExtractor(Extractor): def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), ] dataset = Dataset.from_extractors(TestExtractor()) self.assertEqual(3, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_length_when_created_from_sequence(self): dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), DatasetItem(3), ]) self.assertEqual(3, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_transform_by_string_name(self): expected = Dataset.from_iterable([ DatasetItem(id=1, attributes={'qq': 1}), ]) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, attributes={'qq': 1}) env = Environment() env.transforms.register('qq', TestTransform) dataset = Dataset.from_iterable([ DatasetItem(id=1) ], env=env) actual = dataset.transform('qq') compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_transform(self): expected = Dataset.from_iterable([ DatasetItem(id=1, attributes={'qq': 1}), ]) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, attributes={'qq': 1}) dataset = Dataset.from_iterable([ DatasetItem(id=1) ]) actual = dataset.transform(TestTransform) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_join_annotations(self): a = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Label(1, id=3), Label(2, attributes={ 'x': 1 }), ]) ], categories=['a', 'b', 'c', 'd']) b = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Label(2, attributes={ 'x': 1 }), Label(3, id=4), ]) ], categories=['a', 'b', 'c', 'd']) expected = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Label(1, id=3), Label(2, attributes={ 'x': 1 }), Label(3, id=4), ]) ], categories=['a', 'b', 'c', 'd']) merged = Dataset.from_extractors(a, b) compare_datasets(self, expected, merged) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_cant_join_different_categories(self): s1 = Dataset.from_iterable([], categories=['a', 'b']) s2 = Dataset.from_iterable([], categories=['b', 'a']) with self.assertRaises(ConflictingCategoriesError): Dataset.from_extractors(s1, s2) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_join_datasets(self): s1 = Dataset.from_iterable([ DatasetItem(0), DatasetItem(1) ]) s2 = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2) ]) expected = Dataset.from_iterable([ DatasetItem(0), DatasetItem(1), DatasetItem(2) ]) actual = Dataset.from_extractors(s1, s2) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_track_modifications_on_addition(self): dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) self.assertFalse(dataset.is_modified) dataset.put(DatasetItem(3, subset='a')) self.assertTrue(dataset.is_modified) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_track_modifications_on_removal(self): dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) self.assertFalse(dataset.is_modified) dataset.remove(1) self.assertTrue(dataset.is_modified) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_create_patch(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) dataset.put(DatasetItem(2)) dataset.put(DatasetItem(3, subset='a')) dataset.remove(1) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.added, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_create_patch_when_cached(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) dataset.init_cache() dataset.put(DatasetItem(2)) dataset.put(DatasetItem(3, subset='a')) dataset.remove(1) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, # Item was not changed from the original one. # TODO: add item comparison and remove this line ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_mixed(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) class Remove1(Transform): def __iter__(self): for item in self._extractor: if item.id != '1': yield item class Add3(Transform): def __iter__(self): for item in self._extractor: if item.id == '2': yield item yield DatasetItem(3, subset='a') dataset.transform(Remove1) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_chained(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class Remove1(Transform): iter_called = 0 def __iter__(self): for item in self._extractor: if item.id != '1': yield item __class__.iter_called += 1 class Add3(Transform): iter_called = 0 def __iter__(self): yield from self._extractor yield DatasetItem(3, subset='a') __class__.iter_called += 1 dataset = Dataset.from_extractors(TestExtractor()) dataset.transform(Remove1) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) self.assertEqual(TestExtractor.iter_called, 2) # 1 for items, 1 for list self.assertEqual(Remove1.iter_called, 1) self.assertEqual(Add3.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_intermixed_with_direct_ops(self): expected = Dataset.from_iterable([ DatasetItem(3, subset='a'), DatasetItem(4), DatasetItem(5), ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class Remove1(Transform): iter_called = 0 def __iter__(self): for item in self._extractor: if item.id != '1': yield item __class__.iter_called += 1 class Add3(Transform): iter_called = 0 def __iter__(self): yield from self._extractor yield DatasetItem(3, subset='a') __class__.iter_called += 1 dataset = Dataset.from_extractors(TestExtractor()) dataset.init_cache() dataset.put(DatasetItem(4)) dataset.transform(Remove1) dataset.put(DatasetItem(5)) dataset.remove(2) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('3', 'a'): ItemStatus.added, ('4', DEFAULT_SUBSET_NAME): ItemStatus.added, ('5', DEFAULT_SUBSET_NAME): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(3, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(None, patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) self.assertEqual(dataset.get(4), patch.data.get(4)) self.assertEqual(dataset.get(5), patch.data.get(5)) self.assertEqual(TestExtractor.iter_called, 1) self.assertEqual(Remove1.iter_called, 1) self.assertEqual(Add3.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_local_transforms_stacked(self): expected = Dataset.from_iterable([ DatasetItem(4), DatasetItem(5), ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class ShiftIds(ItemTransform): def transform_item(self, item): return item.wrap(id=int(item.id) + 1) dataset = Dataset.from_extractors(TestExtractor()) dataset.remove(2) dataset.transform(ShiftIds) dataset.transform(ShiftIds) dataset.transform(ShiftIds) dataset.put(DatasetItem(5)) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('4', DEFAULT_SUBSET_NAME): ItemStatus.added, ('5', DEFAULT_SUBSET_NAME): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(None, patch.data.get(2)) self.assertEqual(None, patch.data.get(3)) self.assertEqual(dataset.get(4), patch.data.get(4)) self.assertEqual(dataset.get(5), patch.data.get(5)) self.assertEqual(TestExtractor.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_chained_and_source_cached(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class Remove1(Transform): iter_called = 0 def __iter__(self): for item in self._extractor: if item.id != '1': yield item __class__.iter_called += 1 class Add3(Transform): iter_called = 0 def __iter__(self): yield from self._extractor yield DatasetItem(3, subset='a') __class__.iter_called += 1 dataset = Dataset.from_extractors(TestExtractor()) dataset.init_cache() dataset.transform(Remove1) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, # TODO: remove this ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) self.assertEqual(TestExtractor.iter_called, 1) # 1 for items and list self.assertEqual(Remove1.iter_called, 1) self.assertEqual(Add3.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_lazy_put_and_remove(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True return iter([ DatasetItem(1), DatasetItem(2), ]) dataset = Dataset.from_extractors(TestExtractor()) self.assertFalse(dataset.is_cache_initialized) dataset.put(DatasetItem(3)) dataset.remove(DatasetItem(1)) self.assertFalse(dataset.is_cache_initialized) self.assertFalse(iter_called) dataset.init_cache() self.assertTrue(dataset.is_cache_initialized) self.assertTrue(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_put(self): dataset = Dataset() dataset.put(DatasetItem(1)) self.assertTrue((1, '') in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_lazy_get_on_updated_item(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True return iter([ DatasetItem(1), DatasetItem(2), ]) dataset = Dataset.from_extractors(TestExtractor()) dataset.put(DatasetItem(2)) self.assertTrue((2, '') in dataset) self.assertFalse(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_switch_eager_and_lazy_with_cm_global(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True return iter([ DatasetItem(1), DatasetItem(2), ]) with eager_mode(): Dataset.from_extractors(TestExtractor()) self.assertTrue(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_switch_eager_and_lazy_with_cm_local(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) with eager_mode(dataset=dataset): dataset.select(lambda item: int(item.id) < 3) dataset.select(lambda item: int(item.id) < 2) self.assertTrue(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_lazy_select(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) dataset.select(lambda item: int(item.id) < 3) dataset.select(lambda item: int(item.id) < 2) self.assertEqual(iter_called, 0) self.assertEqual(1, len(dataset)) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_chain_lazy_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, id=int(item.id) + 1) dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual(4, len(dataset)) self.assertEqual(3, int(min(int(item.id) for item in dataset))) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_len_after_local_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, id=int(item.id) + 1) dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual(4, len(dataset)) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_len_after_nonlocal_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(Transform): def __iter__(self): for item in self._extractor: yield self.wrap_item(item, id=int(item.id) + 1) dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual(4, len(dataset)) self.assertEqual(iter_called, 2) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_subsets_after_local_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, id=int(item.id) + 1, subset='a') dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual({'a'}, set(dataset.subsets())) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_subsets_after_nonlocal_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(Transform): def __iter__(self): for item in self._extractor: yield self.wrap_item(item, id=int(item.id) + 1, subset='a') dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual({'a'}, set(dataset.subsets())) self.assertEqual(iter_called, 2) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_raises_when_repeated_items_in_source(self): dataset = Dataset.from_iterable([DatasetItem(0), DatasetItem(0)]) with self.assertRaises(RepeatedItemError): dataset.init_cache() @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_check_item_existence(self): dataset = Dataset.from_iterable([ DatasetItem(0, subset='a'), DatasetItem(1) ]) self.assertTrue(DatasetItem(0, subset='a') in dataset) self.assertFalse(DatasetItem(0, subset='b') in dataset) self.assertTrue((0, 'a') in dataset) self.assertFalse((0, 'b') in dataset) self.assertTrue(1 in dataset) self.assertFalse(0 in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_put_with_id_override(self): dataset = Dataset.from_iterable([]) dataset.put(DatasetItem(0, subset='a'), id=2, subset='b') self.assertTrue((2, 'b') in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_cache_with_empty_source(self): dataset = Dataset.from_iterable([]) dataset.put(DatasetItem(2)) dataset.init_cache() self.assertTrue(2 in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_cant_do_partial_caching_in_get_when_default(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 return iter([ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ]) dataset = Dataset.from_extractors(TestExtractor()) dataset.get(3) dataset.get(4) self.assertEqual(1, iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_partial_caching_in_get_when_redefined(self): iter_called = 0 get_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 return iter([ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ]) def get(self, id, subset=None): nonlocal get_called get_called += 1 return DatasetItem(id, subset=subset) dataset = Dataset.from_extractors(TestExtractor()) dataset.get(3) dataset.get(4) self.assertEqual(0, iter_called) self.assertEqual(2, get_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_binds_on_save(self): dataset = Dataset.from_iterable([DatasetItem(1)]) self.assertFalse(dataset.is_bound) with TestDir() as test_dir: dataset.save(test_dir) self.assertTrue(dataset.is_bound) self.assertEqual(dataset.data_path, test_dir) self.assertEqual(dataset.format, DEFAULT_FORMAT) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_flushes_changes_on_save(self): dataset = Dataset.from_iterable([]) dataset.put(DatasetItem(1)) self.assertTrue(dataset.is_modified) with TestDir() as test_dir: dataset.save(test_dir) self.assertFalse(dataset.is_modified) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_does_not_load_images_on_saving(self): # Issue https://github.com/openvinotoolkit/datumaro/issues/177 # Missing image metadata (size etc.) can lead to image loading on # dataset save without image saving called = False def test_loader(): nonlocal called called = True dataset = Dataset.from_iterable([ DatasetItem(1, image=test_loader) ]) with TestDir() as test_dir: dataset.save(test_dir) self.assertFalse(called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_transform_labels(self): expected = Dataset.from_iterable([], categories=['c', 'b']) dataset = Dataset.from_iterable([], categories=['a', 'b']) actual = dataset.transform('remap_labels', {'a': 'c'}) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_run_model(self): dataset = Dataset.from_iterable([ DatasetItem(i, image=np.array([i])) for i in range(5) ], categories=['label']) batch_size = 3 expected = Dataset.from_iterable([ DatasetItem(i, image=np.array([i]), annotations=[ Label(0, attributes={ 'idx': i % batch_size, 'data': i }) ]) for i in range(5) ], categories=['label']) calls = 0 class TestLauncher(Launcher): def launch(self, inputs): nonlocal calls calls += 1 for i, inp in enumerate(inputs): yield [ Label(0, attributes={'idx': i, 'data': inp.item()}) ] model = TestLauncher() actual = dataset.run_model(model, batch_size=batch_size) compare_datasets(self, expected, actual, require_images=True) self.assertEqual(2, calls) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_items(self): dataset = Dataset.from_iterable([ DatasetItem(id=0, subset='train'), DatasetItem(id=1, subset='test'), ]) dataset.filter('/item[id > 0]') self.assertEqual(1, len(dataset)) @mark_requirement(Requirements.DATUM_BUG_257) def test_filter_registers_changes(self): dataset = Dataset.from_iterable([ DatasetItem(id=0, subset='train'), DatasetItem(id=1, subset='test'), ]) dataset.filter('/item[id > 0]') self.assertEqual({ ('0', 'train'): ItemStatus.removed, ('1', 'test'): ItemStatus.modified, # TODO: remove this line }, dataset.get_patch().updated_items) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_annotations(self): dataset = Dataset.from_iterable([ DatasetItem(id=0, subset='train', annotations=[Label(0), Label(1)]), DatasetItem(id=1, subset='val', annotations=[Label(2)]), DatasetItem(id=2, subset='test', annotations=[Label(0), Label(2)]), ], categories=['a', 'b', 'c']) dataset.filter('/item/annotation[label = "c"]', filter_annotations=True, remove_empty=True) self.assertEqual(2, len(dataset)) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_items_in_merged_dataset(self): dataset = Dataset.from_extractors( Dataset.from_iterable([ DatasetItem(id=0, subset='train') ]), Dataset.from_iterable([ DatasetItem(id=1, subset='test') ]), ) dataset.filter('/item[id > 0]') self.assertEqual(1, len(dataset)) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_annotations_in_merged_dataset(self): dataset = Dataset.from_extractors( Dataset.from_iterable([ DatasetItem(id=0, subset='train', annotations=[Label(0)]), ], categories=['a', 'b', 'c']), Dataset.from_iterable([ DatasetItem(id=1, subset='val', annotations=[Label(1)]), ], categories=['a', 'b', 'c']), Dataset.from_iterable([ DatasetItem(id=2, subset='test', annotations=[Label(2)]), ], categories=['a', 'b', 'c']), ) dataset.filter('/item/annotation[label = "c"]', filter_annotations=True, remove_empty=True) self.assertEqual(1, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_inplace_save_writes_only_updated_data(self): class CustomConverter(Converter): DEFAULT_IMAGE_EXT = '.jpg' def apply(self): assert osp.isdir(self._save_dir) for item in self._extractor: name = f'{item.subset}_{item.id}' with open(osp.join( self._save_dir, name + '.txt'), 'w') as f: f.write('\n') if self._save_images and \ item.has_image and item.image.has_data: self._save_image(item, name=name) env = Environment() env.converters.items = { 'test': CustomConverter } with TestDir() as path: dataset = Dataset.from_iterable([ DatasetItem(1, subset='train', image=np.ones((2, 4, 3))), DatasetItem(2, subset='train', image=Image(path='2.jpg', size=(3, 2))), DatasetItem(3, subset='valid', image=np.ones((2, 2, 3))), ], categories=[], env=env) dataset.export(path, 'test', save_images=True) dataset.put(DatasetItem(2, subset='train', image=np.ones((3, 2, 3)))) dataset.remove(3, 'valid') dataset.save(save_images=True) self.assertEqual({ 'train_1.txt', 'train_1.jpg', 'train_2.txt', 'train_2.jpg' }, set(os.listdir(path))) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_update_overwrites_matching_items(self): patch = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]) ], categories=['a', 'b']) dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(2, 2, 1, 1, label=0) ]), DatasetItem(id=2, annotations=[ Bbox(1, 1, 1, 1, label=1) ]), ], categories=['a', 'b']) expected = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]), DatasetItem(id=2, annotations=[ Bbox(1, 1, 1, 1, label=1) ]), ], categories=['a', 'b']) dataset.update(patch) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_update_can_reorder_labels(self): patch = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]) ], categories=['b', 'a']) dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(2, 2, 1, 1, label=0) ]) ], categories=['a', 'b']) # Note that label id and categories are changed expected = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=0) ]) ], categories=['a', 'b']) dataset.update(patch) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_update_can_project_labels(self): dataset = Dataset.from_iterable([ # Must be overridden DatasetItem(id=100, annotations=[ Bbox(1, 2, 3, 3, label=0), ]), # Must be kept DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]), ], categories=['a', 'b']) patch = Dataset.from_iterable([ # Must override DatasetItem(id=100, annotations=[ Bbox(1, 2, 3, 4, label=0), # Label must be remapped Bbox(5, 6, 2, 3, label=1), # Label must be remapped Bbox(2, 2, 2, 3, label=2), # Will be dropped due to label ]), # Must be added DatasetItem(id=2, annotations=[ Bbox(1, 2, 3, 2, label=1) # Label must be remapped ]), ], categories=['b', 'a', 'c']) expected = Dataset.from_iterable([ DatasetItem(id=100, annotations=[ Bbox(1, 2, 3, 4, label=1), Bbox(5, 6, 2, 3, label=0), ]), DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]), DatasetItem(id=2, annotations=[ Bbox(1, 2, 3, 2, label=0) ]), ], categories=['a', 'b']) dataset.update(patch) compare_datasets(self, expected, dataset, ignored_attrs='*') class DatasetItemTest(TestCase): @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_ctor_requires_id(self): with self.assertRaises(Exception): # pylint: disable=no-value-for-parameter DatasetItem() # pylint: enable=no-value-for-parameter @staticmethod @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_ctors_with_image(): for args in [ { 'id': 0, 'image': None }, { 'id': 0, 'image': 'path.jpg' }, { 'id': 0, 'image': np.array([1, 2, 3]) }, { 'id': 0, 'image': lambda f: np.array([1, 2, 3]) }, { 'id': 0, 'image': Image(data=np.array([1, 2, 3])) }, ]: DatasetItem(**args) class DatasetFilterTest(TestCase): @staticmethod @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_item_representations(): item = DatasetItem(id=1, subset='subset', image=np.ones((5, 4, 3)), annotations=[ Label(0, attributes={'a1': 1, 'a2': '2'}, id=1, group=2), Caption('hello', id=1), Caption('world', group=5), Label(2, id=3, attributes={ 'x': 1, 'y': '2' }), Bbox(1, 2, 3, 4, label=4, id=4, attributes={ 'a': 1.0 }), Bbox(5, 6, 7, 8, id=5, group=5), Points([1, 2, 2, 0, 1, 1], label=0, id=5), Mask(id=5, image=np.ones((3, 2))), Mask(label=3, id=5, image=np.ones((2, 3))), PolyLine([1, 2, 3, 4, 5, 6, 7, 8], id=11), Polygon([1, 2, 3, 4, 5, 6, 7, 8]), ] ) encoded = DatasetItemEncoder.encode(item) DatasetItemEncoder.to_string(encoded) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_item_filter_can_be_applied(self): class TestExtractor(Extractor): def __iter__(self): for i in range(4): yield DatasetItem(id=i, subset='train') extractor = TestExtractor() filtered = XPathDatasetFilter(extractor, '/item[id > 1]') self.assertEqual(2, len(filtered)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_annotations_filter_can_be_applied(self): class SrcExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=0), DatasetItem(id=1, annotations=[ Label(0), Label(1), ]), DatasetItem(id=2, annotations=[ Label(0), Label(2), ]), ]) class DstExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=0), DatasetItem(id=1, annotations=[ Label(0), ]), DatasetItem(id=2, annotations=[ Label(0), ]), ]) extractor = SrcExtractor() filtered = XPathAnnotationsFilter(extractor, '/item/annotation[label_id = 0]') self.assertListEqual(list(filtered), list(DstExtractor())) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_annotations_filter_can_remove_empty_items(self): source = Dataset.from_iterable([ DatasetItem(id=0), DatasetItem(id=1, annotations=[ Label(0), Label(1), ]), DatasetItem(id=2, annotations=[ Label(0), Label(2), ]), ], categories=['a', 'b', 'c']) expected = Dataset.from_iterable([ DatasetItem(id=2, annotations=[Label(2)]), ], categories=['a', 'b', 'c']) filtered = XPathAnnotationsFilter(source, '/item/annotation[label_id = 2]', remove_empty=True) compare_datasets(self, expected, filtered)
33.371168
81
0.572403
from unittest import TestCase import os import os.path as osp import numpy as np from datumaro.components.annotation import ( AnnotationType, Bbox, Caption, Label, LabelCategories, Mask, Points, Polygon, PolyLine, ) from datumaro.components.converter import Converter from datumaro.components.dataset import ( DEFAULT_FORMAT, Dataset, ItemStatus, eager_mode, ) from datumaro.components.dataset_filter import ( DatasetItemEncoder, XPathAnnotationsFilter, XPathDatasetFilter, ) from datumaro.components.environment import Environment from datumaro.components.errors import ( ConflictingCategoriesError, DatasetNotFoundError, MultipleFormatsMatchError, NoMatchingFormatsError, RepeatedItemError, UnknownFormatError, ) from datumaro.components.extractor import ( DEFAULT_SUBSET_NAME, DatasetItem, Extractor, ItemTransform, Transform, ) from datumaro.components.launcher import Launcher from datumaro.components.media import Image from datumaro.util.test_utils import TestDir, compare_datasets from .requirements import Requirements, mark_requirement class DatasetTest(TestCase): @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_create_from_extractors(self): class SrcExtractor1(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(4), ]), ]) class SrcExtractor2(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='val', annotations=[ Label(5), ]), ]) class DstExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(4), Label(5), ]), ]) dataset = Dataset.from_extractors(SrcExtractor1(), SrcExtractor2()) compare_datasets(self, DstExtractor(), dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_create_from_iterable(self): class TestExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4, label=2), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(3), ]), ]) def categories(self): return { AnnotationType.label: LabelCategories.from_iterable( ['a', 'b', 'c', 'd', 'e']) } actual = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Bbox(1, 2, 3, 4, label=2), Label(4), ]), DatasetItem(id=1, subset='val', annotations=[ Label(3), ]), ], categories=['a', 'b', 'c', 'd', 'e']) compare_datasets(self, TestExtractor(), actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_join_datasets_with_empty_categories(self): expected = Dataset.from_iterable([ DatasetItem(1, annotations=[ Label(0), Bbox(1, 2, 3, 4), Caption('hello world'), ]) ], categories=['a']) src1 = Dataset.from_iterable([ DatasetItem(1, annotations=[ Bbox(1, 2, 3, 4, label=None) ]) ], categories=[]) src2 = Dataset.from_iterable([ DatasetItem(1, annotations=[ Label(0) ]) ], categories=['a']) src3 = Dataset.from_iterable([ DatasetItem(1, annotations=[ Caption('hello world') ]) ]) actual = Dataset.from_extractors(src1, src2, src3) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_save_and_load(self): source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) loaded_dataset = Dataset.load(test_dir) compare_datasets(self, source_dataset, loaded_dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_detect(self): env = Environment() env.importers.items = {DEFAULT_FORMAT: env.importers[DEFAULT_FORMAT]} env.extractors.items = {DEFAULT_FORMAT: env.extractors[DEFAULT_FORMAT]} dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: dataset.save(test_dir) detected_format = Dataset.detect(test_dir, env=env) self.assertEqual(DEFAULT_FORMAT, detected_format) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_detect_and_import(self): env = Environment() env.importers.items = {DEFAULT_FORMAT: env.importers[DEFAULT_FORMAT]} env.extractors.items = {DEFAULT_FORMAT: env.extractors[DEFAULT_FORMAT]} source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) imported_dataset = Dataset.import_from(test_dir, env=env) self.assertEqual(imported_dataset.data_path, test_dir) self.assertEqual(imported_dataset.format, DEFAULT_FORMAT) compare_datasets(self, source_dataset, imported_dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_no_dataset_found(self): env = Environment() env.importers.items = { DEFAULT_FORMAT: env.importers[DEFAULT_FORMAT], } env.extractors.items = { DEFAULT_FORMAT: env.extractors[DEFAULT_FORMAT], } with TestDir() as test_dir, self.assertRaises(DatasetNotFoundError): Dataset.import_from(test_dir, DEFAULT_FORMAT, env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_multiple_formats_match(self): env = Environment() env.importers.items = { 'a': env.importers[DEFAULT_FORMAT], 'b': env.importers[DEFAULT_FORMAT], } env.extractors.items = { 'a': env.extractors[DEFAULT_FORMAT], 'b': env.extractors[DEFAULT_FORMAT], } source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) with self.assertRaises(MultipleFormatsMatchError): Dataset.import_from(test_dir, env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_no_matching_formats(self): env = Environment() env.importers.items = {} env.extractors.items = {} source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) with self.assertRaises(NoMatchingFormatsError): Dataset.import_from(test_dir, env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_report_unknown_format_requested(self): env = Environment() env.importers.items = {} env.extractors.items = {} source_dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c']) with TestDir() as test_dir: source_dataset.save(test_dir) with self.assertRaises(UnknownFormatError): Dataset.import_from(test_dir, format='custom', env=env) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_export_by_string_format_name(self): env = Environment() env.converters.items = {'qq': env.converters[DEFAULT_FORMAT]} dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Label(2) ]), ], categories=['a', 'b', 'c'], env=env) with TestDir() as test_dir: dataset.export(format='qq', save_dir=test_dir) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_remember_export_options(self): dataset = Dataset.from_iterable([ DatasetItem(id=1, image=np.ones((1, 2, 3))), ], categories=['a']) with TestDir() as test_dir: dataset.save(test_dir, save_images=True) dataset.put(dataset.get(1)) image_path = osp.join(test_dir, 'images', 'default', '1.jpg') os.remove(image_path) dataset.save(test_dir) self.assertEqual({'save_images': True}, dataset.options) self.assertTrue(osp.isfile(image_path)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_length_when_created_from_scratch(self): dataset = Dataset() dataset.put(DatasetItem(1)) dataset.put(DatasetItem(2)) dataset.put(DatasetItem(3)) dataset.remove(1) self.assertEqual(2, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_length_when_created_from_extractor(self): class TestExtractor(Extractor): def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), ] dataset = Dataset.from_extractors(TestExtractor()) self.assertEqual(3, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_length_when_created_from_sequence(self): dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), DatasetItem(3), ]) self.assertEqual(3, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_transform_by_string_name(self): expected = Dataset.from_iterable([ DatasetItem(id=1, attributes={'qq': 1}), ]) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, attributes={'qq': 1}) env = Environment() env.transforms.register('qq', TestTransform) dataset = Dataset.from_iterable([ DatasetItem(id=1) ], env=env) actual = dataset.transform('qq') compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_transform(self): expected = Dataset.from_iterable([ DatasetItem(id=1, attributes={'qq': 1}), ]) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, attributes={'qq': 1}) dataset = Dataset.from_iterable([ DatasetItem(id=1) ]) actual = dataset.transform(TestTransform) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_join_annotations(self): a = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Label(1, id=3), Label(2, attributes={ 'x': 1 }), ]) ], categories=['a', 'b', 'c', 'd']) b = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Label(2, attributes={ 'x': 1 }), Label(3, id=4), ]) ], categories=['a', 'b', 'c', 'd']) expected = Dataset.from_iterable([ DatasetItem(id=1, subset='train', annotations=[ Label(1, id=3), Label(2, attributes={ 'x': 1 }), Label(3, id=4), ]) ], categories=['a', 'b', 'c', 'd']) merged = Dataset.from_extractors(a, b) compare_datasets(self, expected, merged) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_cant_join_different_categories(self): s1 = Dataset.from_iterable([], categories=['a', 'b']) s2 = Dataset.from_iterable([], categories=['b', 'a']) with self.assertRaises(ConflictingCategoriesError): Dataset.from_extractors(s1, s2) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_join_datasets(self): s1 = Dataset.from_iterable([ DatasetItem(0), DatasetItem(1) ]) s2 = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2) ]) expected = Dataset.from_iterable([ DatasetItem(0), DatasetItem(1), DatasetItem(2) ]) actual = Dataset.from_extractors(s1, s2) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_track_modifications_on_addition(self): dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) self.assertFalse(dataset.is_modified) dataset.put(DatasetItem(3, subset='a')) self.assertTrue(dataset.is_modified) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_track_modifications_on_removal(self): dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) self.assertFalse(dataset.is_modified) dataset.remove(1) self.assertTrue(dataset.is_modified) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_create_patch(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) dataset.put(DatasetItem(2)) dataset.put(DatasetItem(3, subset='a')) dataset.remove(1) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.added, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_create_patch_when_cached(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) dataset.init_cache() dataset.put(DatasetItem(2)) dataset.put(DatasetItem(3, subset='a')) dataset.remove(1) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_mixed(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) dataset = Dataset.from_iterable([ DatasetItem(1), DatasetItem(2), ]) class Remove1(Transform): def __iter__(self): for item in self._extractor: if item.id != '1': yield item class Add3(Transform): def __iter__(self): for item in self._extractor: if item.id == '2': yield item yield DatasetItem(3, subset='a') dataset.transform(Remove1) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_chained(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class Remove1(Transform): iter_called = 0 def __iter__(self): for item in self._extractor: if item.id != '1': yield item __class__.iter_called += 1 class Add3(Transform): iter_called = 0 def __iter__(self): yield from self._extractor yield DatasetItem(3, subset='a') __class__.iter_called += 1 dataset = Dataset.from_extractors(TestExtractor()) dataset.transform(Remove1) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) self.assertEqual(TestExtractor.iter_called, 2) self.assertEqual(Remove1.iter_called, 1) self.assertEqual(Add3.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_intermixed_with_direct_ops(self): expected = Dataset.from_iterable([ DatasetItem(3, subset='a'), DatasetItem(4), DatasetItem(5), ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class Remove1(Transform): iter_called = 0 def __iter__(self): for item in self._extractor: if item.id != '1': yield item __class__.iter_called += 1 class Add3(Transform): iter_called = 0 def __iter__(self): yield from self._extractor yield DatasetItem(3, subset='a') __class__.iter_called += 1 dataset = Dataset.from_extractors(TestExtractor()) dataset.init_cache() dataset.put(DatasetItem(4)) dataset.transform(Remove1) dataset.put(DatasetItem(5)) dataset.remove(2) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('3', 'a'): ItemStatus.added, ('4', DEFAULT_SUBSET_NAME): ItemStatus.added, ('5', DEFAULT_SUBSET_NAME): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(3, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(None, patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) self.assertEqual(dataset.get(4), patch.data.get(4)) self.assertEqual(dataset.get(5), patch.data.get(5)) self.assertEqual(TestExtractor.iter_called, 1) self.assertEqual(Remove1.iter_called, 1) self.assertEqual(Add3.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_local_transforms_stacked(self): expected = Dataset.from_iterable([ DatasetItem(4), DatasetItem(5), ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class ShiftIds(ItemTransform): def transform_item(self, item): return item.wrap(id=int(item.id) + 1) dataset = Dataset.from_extractors(TestExtractor()) dataset.remove(2) dataset.transform(ShiftIds) dataset.transform(ShiftIds) dataset.transform(ShiftIds) dataset.put(DatasetItem(5)) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('4', DEFAULT_SUBSET_NAME): ItemStatus.added, ('5', DEFAULT_SUBSET_NAME): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(None, patch.data.get(2)) self.assertEqual(None, patch.data.get(3)) self.assertEqual(dataset.get(4), patch.data.get(4)) self.assertEqual(dataset.get(5), patch.data.get(5)) self.assertEqual(TestExtractor.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_BUG_257) def test_can_create_patch_when_transforms_chained_and_source_cached(self): expected = Dataset.from_iterable([ DatasetItem(2), DatasetItem(3, subset='a') ]) class TestExtractor(Extractor): iter_called = 0 def __iter__(self): yield from [ DatasetItem(1), DatasetItem(2), ] __class__.iter_called += 1 class Remove1(Transform): iter_called = 0 def __iter__(self): for item in self._extractor: if item.id != '1': yield item __class__.iter_called += 1 class Add3(Transform): iter_called = 0 def __iter__(self): yield from self._extractor yield DatasetItem(3, subset='a') __class__.iter_called += 1 dataset = Dataset.from_extractors(TestExtractor()) dataset.init_cache() dataset.transform(Remove1) dataset.transform(Add3) patch = dataset.get_patch() self.assertEqual({ ('1', DEFAULT_SUBSET_NAME): ItemStatus.removed, ('2', DEFAULT_SUBSET_NAME): ItemStatus.modified, ('3', 'a'): ItemStatus.added, }, patch.updated_items) self.assertEqual({ 'default': ItemStatus.modified, 'a': ItemStatus.modified, }, patch.updated_subsets) self.assertEqual(2, len(patch.data)) self.assertEqual(None, patch.data.get(1)) self.assertEqual(dataset.get(2), patch.data.get(2)) self.assertEqual(dataset.get(3, 'a'), patch.data.get(3, 'a')) self.assertEqual(TestExtractor.iter_called, 1) self.assertEqual(Remove1.iter_called, 1) self.assertEqual(Add3.iter_called, 1) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_lazy_put_and_remove(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True return iter([ DatasetItem(1), DatasetItem(2), ]) dataset = Dataset.from_extractors(TestExtractor()) self.assertFalse(dataset.is_cache_initialized) dataset.put(DatasetItem(3)) dataset.remove(DatasetItem(1)) self.assertFalse(dataset.is_cache_initialized) self.assertFalse(iter_called) dataset.init_cache() self.assertTrue(dataset.is_cache_initialized) self.assertTrue(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_put(self): dataset = Dataset() dataset.put(DatasetItem(1)) self.assertTrue((1, '') in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_lazy_get_on_updated_item(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True return iter([ DatasetItem(1), DatasetItem(2), ]) dataset = Dataset.from_extractors(TestExtractor()) dataset.put(DatasetItem(2)) self.assertTrue((2, '') in dataset) self.assertFalse(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_switch_eager_and_lazy_with_cm_global(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True return iter([ DatasetItem(1), DatasetItem(2), ]) with eager_mode(): Dataset.from_extractors(TestExtractor()) self.assertTrue(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_switch_eager_and_lazy_with_cm_local(self): iter_called = False class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called = True yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) with eager_mode(dataset=dataset): dataset.select(lambda item: int(item.id) < 3) dataset.select(lambda item: int(item.id) < 2) self.assertTrue(iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_lazy_select(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) dataset.select(lambda item: int(item.id) < 3) dataset.select(lambda item: int(item.id) < 2) self.assertEqual(iter_called, 0) self.assertEqual(1, len(dataset)) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_chain_lazy_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, id=int(item.id) + 1) dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual(4, len(dataset)) self.assertEqual(3, int(min(int(item.id) for item in dataset))) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_len_after_local_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, id=int(item.id) + 1) dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual(4, len(dataset)) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_len_after_nonlocal_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(Transform): def __iter__(self): for item in self._extractor: yield self.wrap_item(item, id=int(item.id) + 1) dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual(4, len(dataset)) self.assertEqual(iter_called, 2) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_subsets_after_local_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(ItemTransform): def transform_item(self, item): return self.wrap_item(item, id=int(item.id) + 1, subset='a') dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual({'a'}, set(dataset.subsets())) self.assertEqual(iter_called, 1) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_get_subsets_after_nonlocal_transforms(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 yield from [ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ] dataset = Dataset.from_extractors(TestExtractor()) class TestTransform(Transform): def __iter__(self): for item in self._extractor: yield self.wrap_item(item, id=int(item.id) + 1, subset='a') dataset.transform(TestTransform) dataset.transform(TestTransform) self.assertEqual(iter_called, 0) self.assertEqual({'a'}, set(dataset.subsets())) self.assertEqual(iter_called, 2) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_raises_when_repeated_items_in_source(self): dataset = Dataset.from_iterable([DatasetItem(0), DatasetItem(0)]) with self.assertRaises(RepeatedItemError): dataset.init_cache() @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_check_item_existence(self): dataset = Dataset.from_iterable([ DatasetItem(0, subset='a'), DatasetItem(1) ]) self.assertTrue(DatasetItem(0, subset='a') in dataset) self.assertFalse(DatasetItem(0, subset='b') in dataset) self.assertTrue((0, 'a') in dataset) self.assertFalse((0, 'b') in dataset) self.assertTrue(1 in dataset) self.assertFalse(0 in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_put_with_id_override(self): dataset = Dataset.from_iterable([]) dataset.put(DatasetItem(0, subset='a'), id=2, subset='b') self.assertTrue((2, 'b') in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_compute_cache_with_empty_source(self): dataset = Dataset.from_iterable([]) dataset.put(DatasetItem(2)) dataset.init_cache() self.assertTrue(2 in dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_cant_do_partial_caching_in_get_when_default(self): iter_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 return iter([ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ]) dataset = Dataset.from_extractors(TestExtractor()) dataset.get(3) dataset.get(4) self.assertEqual(1, iter_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_do_partial_caching_in_get_when_redefined(self): iter_called = 0 get_called = 0 class TestExtractor(Extractor): def __iter__(self): nonlocal iter_called iter_called += 1 return iter([ DatasetItem(1), DatasetItem(2), DatasetItem(3), DatasetItem(4), ]) def get(self, id, subset=None): nonlocal get_called get_called += 1 return DatasetItem(id, subset=subset) dataset = Dataset.from_extractors(TestExtractor()) dataset.get(3) dataset.get(4) self.assertEqual(0, iter_called) self.assertEqual(2, get_called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_binds_on_save(self): dataset = Dataset.from_iterable([DatasetItem(1)]) self.assertFalse(dataset.is_bound) with TestDir() as test_dir: dataset.save(test_dir) self.assertTrue(dataset.is_bound) self.assertEqual(dataset.data_path, test_dir) self.assertEqual(dataset.format, DEFAULT_FORMAT) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_flushes_changes_on_save(self): dataset = Dataset.from_iterable([]) dataset.put(DatasetItem(1)) self.assertTrue(dataset.is_modified) with TestDir() as test_dir: dataset.save(test_dir) self.assertFalse(dataset.is_modified) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_does_not_load_images_on_saving(self): called = False def test_loader(): nonlocal called called = True dataset = Dataset.from_iterable([ DatasetItem(1, image=test_loader) ]) with TestDir() as test_dir: dataset.save(test_dir) self.assertFalse(called) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_transform_labels(self): expected = Dataset.from_iterable([], categories=['c', 'b']) dataset = Dataset.from_iterable([], categories=['a', 'b']) actual = dataset.transform('remap_labels', {'a': 'c'}) compare_datasets(self, expected, actual) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_can_run_model(self): dataset = Dataset.from_iterable([ DatasetItem(i, image=np.array([i])) for i in range(5) ], categories=['label']) batch_size = 3 expected = Dataset.from_iterable([ DatasetItem(i, image=np.array([i]), annotations=[ Label(0, attributes={ 'idx': i % batch_size, 'data': i }) ]) for i in range(5) ], categories=['label']) calls = 0 class TestLauncher(Launcher): def launch(self, inputs): nonlocal calls calls += 1 for i, inp in enumerate(inputs): yield [ Label(0, attributes={'idx': i, 'data': inp.item()}) ] model = TestLauncher() actual = dataset.run_model(model, batch_size=batch_size) compare_datasets(self, expected, actual, require_images=True) self.assertEqual(2, calls) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_items(self): dataset = Dataset.from_iterable([ DatasetItem(id=0, subset='train'), DatasetItem(id=1, subset='test'), ]) dataset.filter('/item[id > 0]') self.assertEqual(1, len(dataset)) @mark_requirement(Requirements.DATUM_BUG_257) def test_filter_registers_changes(self): dataset = Dataset.from_iterable([ DatasetItem(id=0, subset='train'), DatasetItem(id=1, subset='test'), ]) dataset.filter('/item[id > 0]') self.assertEqual({ ('0', 'train'): ItemStatus.removed, ('1', 'test'): ItemStatus.modified, }, dataset.get_patch().updated_items) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_annotations(self): dataset = Dataset.from_iterable([ DatasetItem(id=0, subset='train', annotations=[Label(0), Label(1)]), DatasetItem(id=1, subset='val', annotations=[Label(2)]), DatasetItem(id=2, subset='test', annotations=[Label(0), Label(2)]), ], categories=['a', 'b', 'c']) dataset.filter('/item/annotation[label = "c"]', filter_annotations=True, remove_empty=True) self.assertEqual(2, len(dataset)) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_items_in_merged_dataset(self): dataset = Dataset.from_extractors( Dataset.from_iterable([ DatasetItem(id=0, subset='train') ]), Dataset.from_iterable([ DatasetItem(id=1, subset='test') ]), ) dataset.filter('/item[id > 0]') self.assertEqual(1, len(dataset)) @mark_requirement(Requirements.DATUM_BUG_259) def test_can_filter_annotations_in_merged_dataset(self): dataset = Dataset.from_extractors( Dataset.from_iterable([ DatasetItem(id=0, subset='train', annotations=[Label(0)]), ], categories=['a', 'b', 'c']), Dataset.from_iterable([ DatasetItem(id=1, subset='val', annotations=[Label(1)]), ], categories=['a', 'b', 'c']), Dataset.from_iterable([ DatasetItem(id=2, subset='test', annotations=[Label(2)]), ], categories=['a', 'b', 'c']), ) dataset.filter('/item/annotation[label = "c"]', filter_annotations=True, remove_empty=True) self.assertEqual(1, len(dataset)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_inplace_save_writes_only_updated_data(self): class CustomConverter(Converter): DEFAULT_IMAGE_EXT = '.jpg' def apply(self): assert osp.isdir(self._save_dir) for item in self._extractor: name = f'{item.subset}_{item.id}' with open(osp.join( self._save_dir, name + '.txt'), 'w') as f: f.write('\n') if self._save_images and \ item.has_image and item.image.has_data: self._save_image(item, name=name) env = Environment() env.converters.items = { 'test': CustomConverter } with TestDir() as path: dataset = Dataset.from_iterable([ DatasetItem(1, subset='train', image=np.ones((2, 4, 3))), DatasetItem(2, subset='train', image=Image(path='2.jpg', size=(3, 2))), DatasetItem(3, subset='valid', image=np.ones((2, 2, 3))), ], categories=[], env=env) dataset.export(path, 'test', save_images=True) dataset.put(DatasetItem(2, subset='train', image=np.ones((3, 2, 3)))) dataset.remove(3, 'valid') dataset.save(save_images=True) self.assertEqual({ 'train_1.txt', 'train_1.jpg', 'train_2.txt', 'train_2.jpg' }, set(os.listdir(path))) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_update_overwrites_matching_items(self): patch = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]) ], categories=['a', 'b']) dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(2, 2, 1, 1, label=0) ]), DatasetItem(id=2, annotations=[ Bbox(1, 1, 1, 1, label=1) ]), ], categories=['a', 'b']) expected = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]), DatasetItem(id=2, annotations=[ Bbox(1, 1, 1, 1, label=1) ]), ], categories=['a', 'b']) dataset.update(patch) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_update_can_reorder_labels(self): patch = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]) ], categories=['b', 'a']) dataset = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(2, 2, 1, 1, label=0) ]) ], categories=['a', 'b']) expected = Dataset.from_iterable([ DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=0) ]) ], categories=['a', 'b']) dataset.update(patch) compare_datasets(self, expected, dataset) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_update_can_project_labels(self): dataset = Dataset.from_iterable([ DatasetItem(id=100, annotations=[ Bbox(1, 2, 3, 3, label=0), ]), DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]), ], categories=['a', 'b']) patch = Dataset.from_iterable([ DatasetItem(id=100, annotations=[ Bbox(1, 2, 3, 4, label=0), Bbox(5, 6, 2, 3, label=1), Bbox(2, 2, 2, 3, label=2), ]), DatasetItem(id=2, annotations=[ Bbox(1, 2, 3, 2, label=1) ]), ], categories=['b', 'a', 'c']) expected = Dataset.from_iterable([ DatasetItem(id=100, annotations=[ Bbox(1, 2, 3, 4, label=1), Bbox(5, 6, 2, 3, label=0), ]), DatasetItem(id=1, annotations=[ Bbox(1, 2, 3, 4, label=1) ]), DatasetItem(id=2, annotations=[ Bbox(1, 2, 3, 2, label=0) ]), ], categories=['a', 'b']) dataset.update(patch) compare_datasets(self, expected, dataset, ignored_attrs='*') class DatasetItemTest(TestCase): @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_ctor_requires_id(self): with self.assertRaises(Exception): DatasetItem() @staticmethod @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_ctors_with_image(): for args in [ { 'id': 0, 'image': None }, { 'id': 0, 'image': 'path.jpg' }, { 'id': 0, 'image': np.array([1, 2, 3]) }, { 'id': 0, 'image': lambda f: np.array([1, 2, 3]) }, { 'id': 0, 'image': Image(data=np.array([1, 2, 3])) }, ]: DatasetItem(**args) class DatasetFilterTest(TestCase): @staticmethod @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_item_representations(): item = DatasetItem(id=1, subset='subset', image=np.ones((5, 4, 3)), annotations=[ Label(0, attributes={'a1': 1, 'a2': '2'}, id=1, group=2), Caption('hello', id=1), Caption('world', group=5), Label(2, id=3, attributes={ 'x': 1, 'y': '2' }), Bbox(1, 2, 3, 4, label=4, id=4, attributes={ 'a': 1.0 }), Bbox(5, 6, 7, 8, id=5, group=5), Points([1, 2, 2, 0, 1, 1], label=0, id=5), Mask(id=5, image=np.ones((3, 2))), Mask(label=3, id=5, image=np.ones((2, 3))), PolyLine([1, 2, 3, 4, 5, 6, 7, 8], id=11), Polygon([1, 2, 3, 4, 5, 6, 7, 8]), ] ) encoded = DatasetItemEncoder.encode(item) DatasetItemEncoder.to_string(encoded) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_item_filter_can_be_applied(self): class TestExtractor(Extractor): def __iter__(self): for i in range(4): yield DatasetItem(id=i, subset='train') extractor = TestExtractor() filtered = XPathDatasetFilter(extractor, '/item[id > 1]') self.assertEqual(2, len(filtered)) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_annotations_filter_can_be_applied(self): class SrcExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=0), DatasetItem(id=1, annotations=[ Label(0), Label(1), ]), DatasetItem(id=2, annotations=[ Label(0), Label(2), ]), ]) class DstExtractor(Extractor): def __iter__(self): return iter([ DatasetItem(id=0), DatasetItem(id=1, annotations=[ Label(0), ]), DatasetItem(id=2, annotations=[ Label(0), ]), ]) extractor = SrcExtractor() filtered = XPathAnnotationsFilter(extractor, '/item/annotation[label_id = 0]') self.assertListEqual(list(filtered), list(DstExtractor())) @mark_requirement(Requirements.DATUM_GENERAL_REQ) def test_annotations_filter_can_remove_empty_items(self): source = Dataset.from_iterable([ DatasetItem(id=0), DatasetItem(id=1, annotations=[ Label(0), Label(1), ]), DatasetItem(id=2, annotations=[ Label(0), Label(2), ]), ], categories=['a', 'b', 'c']) expected = Dataset.from_iterable([ DatasetItem(id=2, annotations=[Label(2)]), ], categories=['a', 'b', 'c']) filtered = XPathAnnotationsFilter(source, '/item/annotation[label_id = 2]', remove_empty=True) compare_datasets(self, expected, filtered)
true
true
f720773382e2af71b9b530986df7d022a800c635
4,874
py
Python
protoseg/report.py
chriamue/protoseg
4ddc7d613aadcb9d25b5773eff688214349ab23f
[ "MIT" ]
null
null
null
protoseg/report.py
chriamue/protoseg
4ddc7d613aadcb9d25b5773eff688214349ab23f
[ "MIT" ]
null
null
null
protoseg/report.py
chriamue/protoseg
4ddc7d613aadcb9d25b5773eff688214349ab23f
[ "MIT" ]
1
2020-03-30T07:10:54.000Z
2020-03-30T07:10:54.000Z
import os import numpy as np import cv2 import json import pandas as pd import tensorflow as tf from tensorboard.backend.event_processing import event_accumulator as ea from matplotlib import pyplot as plt from matplotlib import colors as colors from matplotlib.backends.backend_agg import FigureCanvasAgg as FigureCanvas from matplotlib.figure import Figure import seaborn as sns sns.set(style="darkgrid") sns.set_context("paper") from matplotlib.backends.backend_pdf import PdfPages class Report(): def __init__(self, configs, resultspath='results/'): self.configs = configs self.resultspath = resultspath assert(configs) # source: https://github.com/JamesChuanggg/Tensorboard2Seaborn/blob/master/beautify.py def plot(self, acc, tag='loss', smooth_space=100, color_code='#4169E1'): x_list = [] y_list = [] x_list_raw = [] y_list_raw = [] try: x = [int(s.step) for s in acc.Scalars(tag=tag)] y = [s.value for s in acc.Scalars(tag=tag)] # smooth curve x_ = [] y_ = [] for i in range(0, len(x), smooth_space): x_.append(x[i]) y_.append(sum(y[i:i+smooth_space]) / float(smooth_space)) x_.append(x[-1]) y_.append(y[-1]) x_list = x_ y_list = y_ # raw curve x_list_raw = x y_list_raw = y except Exception as e: print(e) fig, ax = plt.subplots() plt.title(tag) plt.plot(x_list_raw, y_list_raw, color=colors.to_rgba(color_code, alpha=0.4)) plt.plot(x_list, y_list, color=color_code, linewidth=1.5) fig.canvas.draw() return fig, np.array(fig.canvas.renderer._renderer) def image(self, acc, tag='loss'): image_list = acc.Images(tag=tag) with tf.Session() as sess: img = tf.image.decode_image(image_list[-1].encoded_image_string) npimg = img.eval(session=sess) return npimg def generate(self): pp = PdfPages(os.path.join(self.resultspath, os.path.basename(self.configs.filename) + '.pdf')) for run in self.configs: resultpath = os.path.join(self.resultspath, run) event_acc = ea.EventAccumulator(resultpath) event_acc.Reload() fig, img = self.plot(event_acc, tag="loss") plt.text(0.05, 0.95, run, transform=fig.transFigure, size=24) pp.savefig(fig) cv2.imwrite(resultpath+'/loss.png', img) config = self.configs.get() for metric in config['metrices']: name = list(metric.keys())[0] fig, img = self.plot(event_acc, tag=name) pp.savefig(fig) cv2.imwrite(resultpath+'/'+name+'.png', img) pp.close() def hyperparamopt(self, config, hyperparamoptimizer, resultpath): filename = os.path.join(resultpath, 'trials.csv') df = pd.DataFrame(data=hyperparamoptimizer.trials.results) df = df.set_index('loss') df.to_csv(filename) pp = PdfPages(os.path.join(resultpath, 'paramopt.pdf')) event_acc = ea.EventAccumulator(resultpath) event_acc.Reload() for result in hyperparamoptimizer.trials.results: trial = result['trial'] l = result['loss'] _, loss = self.plot(event_acc, tag='trial'+str(trial)+'_loss') val_image = self.image( event_acc, tag='trial'+str(trial)+'_val_image') val_mask = self.image( event_acc, tag='trial'+str(trial)+'_val_mask') val_predicted = self.image( event_acc, tag='trial'+str(trial)+'_val_predicted') fig = plt.figure() fig.add_subplot(2, 4, 1) plt.axis('on') plt.imshow(loss) fig.add_subplot(2, 4, 2) plt.axis('off') plt.imshow(val_image) fig.add_subplot(2, 4, 3) plt.axis('off') plt.imshow(val_mask) fig.add_subplot(2, 4, 4) plt.axis('off') plt.imshow(val_predicted) plt.text(0.05, 0.95, 'trial ' + str(trial) + " loss: " + str(l), transform=fig.transFigure, size=24) for i, m in enumerate(config['metrices']): name = list(m.keys())[0] tag = 'trial'+str(trial)+'_'+name _, metric = self.plot(event_acc, tag=tag) fig.add_subplot(2, len(config['metrices']), len( config['metrices']) + i+1) plt.imshow(metric) pp.attach_note(result['params']) pp.savefig(fig) plt.close(fig) pp.close()
35.318841
90
0.560936
import os import numpy as np import cv2 import json import pandas as pd import tensorflow as tf from tensorboard.backend.event_processing import event_accumulator as ea from matplotlib import pyplot as plt from matplotlib import colors as colors from matplotlib.backends.backend_agg import FigureCanvasAgg as FigureCanvas from matplotlib.figure import Figure import seaborn as sns sns.set(style="darkgrid") sns.set_context("paper") from matplotlib.backends.backend_pdf import PdfPages class Report(): def __init__(self, configs, resultspath='results/'): self.configs = configs self.resultspath = resultspath assert(configs) def plot(self, acc, tag='loss', smooth_space=100, color_code='#4169E1'): x_list = [] y_list = [] x_list_raw = [] y_list_raw = [] try: x = [int(s.step) for s in acc.Scalars(tag=tag)] y = [s.value for s in acc.Scalars(tag=tag)] x_ = [] y_ = [] for i in range(0, len(x), smooth_space): x_.append(x[i]) y_.append(sum(y[i:i+smooth_space]) / float(smooth_space)) x_.append(x[-1]) y_.append(y[-1]) x_list = x_ y_list = y_ x_list_raw = x y_list_raw = y except Exception as e: print(e) fig, ax = plt.subplots() plt.title(tag) plt.plot(x_list_raw, y_list_raw, color=colors.to_rgba(color_code, alpha=0.4)) plt.plot(x_list, y_list, color=color_code, linewidth=1.5) fig.canvas.draw() return fig, np.array(fig.canvas.renderer._renderer) def image(self, acc, tag='loss'): image_list = acc.Images(tag=tag) with tf.Session() as sess: img = tf.image.decode_image(image_list[-1].encoded_image_string) npimg = img.eval(session=sess) return npimg def generate(self): pp = PdfPages(os.path.join(self.resultspath, os.path.basename(self.configs.filename) + '.pdf')) for run in self.configs: resultpath = os.path.join(self.resultspath, run) event_acc = ea.EventAccumulator(resultpath) event_acc.Reload() fig, img = self.plot(event_acc, tag="loss") plt.text(0.05, 0.95, run, transform=fig.transFigure, size=24) pp.savefig(fig) cv2.imwrite(resultpath+'/loss.png', img) config = self.configs.get() for metric in config['metrices']: name = list(metric.keys())[0] fig, img = self.plot(event_acc, tag=name) pp.savefig(fig) cv2.imwrite(resultpath+'/'+name+'.png', img) pp.close() def hyperparamopt(self, config, hyperparamoptimizer, resultpath): filename = os.path.join(resultpath, 'trials.csv') df = pd.DataFrame(data=hyperparamoptimizer.trials.results) df = df.set_index('loss') df.to_csv(filename) pp = PdfPages(os.path.join(resultpath, 'paramopt.pdf')) event_acc = ea.EventAccumulator(resultpath) event_acc.Reload() for result in hyperparamoptimizer.trials.results: trial = result['trial'] l = result['loss'] _, loss = self.plot(event_acc, tag='trial'+str(trial)+'_loss') val_image = self.image( event_acc, tag='trial'+str(trial)+'_val_image') val_mask = self.image( event_acc, tag='trial'+str(trial)+'_val_mask') val_predicted = self.image( event_acc, tag='trial'+str(trial)+'_val_predicted') fig = plt.figure() fig.add_subplot(2, 4, 1) plt.axis('on') plt.imshow(loss) fig.add_subplot(2, 4, 2) plt.axis('off') plt.imshow(val_image) fig.add_subplot(2, 4, 3) plt.axis('off') plt.imshow(val_mask) fig.add_subplot(2, 4, 4) plt.axis('off') plt.imshow(val_predicted) plt.text(0.05, 0.95, 'trial ' + str(trial) + " loss: " + str(l), transform=fig.transFigure, size=24) for i, m in enumerate(config['metrices']): name = list(m.keys())[0] tag = 'trial'+str(trial)+'_'+name _, metric = self.plot(event_acc, tag=tag) fig.add_subplot(2, len(config['metrices']), len( config['metrices']) + i+1) plt.imshow(metric) pp.attach_note(result['params']) pp.savefig(fig) plt.close(fig) pp.close()
true
true
f72077cdf636f62c3c764ed25b75858a0cc4d91d
434
py
Python
data/scripts/templates/object/mobile/shared_giant_veermok.py
obi-two/GameServer
7d37024e2291a97d49522610cd8f1dbe5666afc2
[ "MIT" ]
20
2015-02-23T15:11:56.000Z
2022-03-18T20:56:48.000Z
data/scripts/templates/object/mobile/shared_giant_veermok.py
apathyboy/swganh
665128efe9154611dec4cb5efc61d246dd095984
[ "MIT" ]
null
null
null
data/scripts/templates/object/mobile/shared_giant_veermok.py
apathyboy/swganh
665128efe9154611dec4cb5efc61d246dd095984
[ "MIT" ]
20
2015-04-04T16:35:59.000Z
2022-03-24T14:54:37.000Z
#### NOTICE: THIS FILE IS AUTOGENERATED #### MODIFICATIONS MAY BE LOST IF DONE IMPROPERLY #### PLEASE SEE THE ONLINE DOCUMENTATION FOR EXAMPLES from swgpy.object import * def create(kernel): result = Creature() result.template = "object/mobile/shared_giant_veermok.iff" result.attribute_template_id = 9 result.stfName("monster_name","veermok") #### BEGIN MODIFICATIONS #### #### END MODIFICATIONS #### return result
25.529412
59
0.723502
true
true
f72077d78671f48577f3268c91b0668f5686d755
214
py
Python
Linguagens/Python/Exercicios/cursos_em_video/aulas-01_a_21/012.py
rafaelvizu/Estudos
eef5e3e3706ff99959226c51b9907b6af4377bfe
[ "MIT" ]
null
null
null
Linguagens/Python/Exercicios/cursos_em_video/aulas-01_a_21/012.py
rafaelvizu/Estudos
eef5e3e3706ff99959226c51b9907b6af4377bfe
[ "MIT" ]
null
null
null
Linguagens/Python/Exercicios/cursos_em_video/aulas-01_a_21/012.py
rafaelvizu/Estudos
eef5e3e3706ff99959226c51b9907b6af4377bfe
[ "MIT" ]
null
null
null
print('Exercício Python #012 - Calculando Descontos') a6 = float(input('Preço: ')) b6 = int(input('Desconto:')) c6 = a6 * b6 / 100 d6 = a6 - c6 print(' O valor com o desconto de {} % é de {} Reais '.format(b6, d6))
35.666667
70
0.630841
print('Exercício Python #012 - Calculando Descontos') a6 = float(input('Preço: ')) b6 = int(input('Desconto:')) c6 = a6 * b6 / 100 d6 = a6 - c6 print(' O valor com o desconto de {} % é de {} Reais '.format(b6, d6))
true
true
f720787fc556e48c6de48c95c2046dbcd33827a9
26,887
py
Python
dask_kubernetes/classic/kubecluster.py
Matt711/dask-kubernetes
8190529fc140b6ea2c345bde02aa1c647272eb98
[ "BSD-3-Clause" ]
1
2022-01-20T12:38:27.000Z
2022-01-20T12:38:27.000Z
dask_kubernetes/classic/kubecluster.py
Matt711/dask-kubernetes
8190529fc140b6ea2c345bde02aa1c647272eb98
[ "BSD-3-Clause" ]
null
null
null
dask_kubernetes/classic/kubecluster.py
Matt711/dask-kubernetes
8190529fc140b6ea2c345bde02aa1c647272eb98
[ "BSD-3-Clause" ]
null
null
null
import asyncio import copy import getpass import logging import os import time import uuid import warnings import yaml import dask import dask.distributed import distributed.security from distributed.deploy import SpecCluster, ProcessInterface from distributed.utils import Log, Logs import kubernetes_asyncio as kubernetes from kubernetes_asyncio.client.rest import ApiException from ..constants import KUBECLUSTER_WORKER_CONTAINER_NAME from ..common.objects import ( make_pod_from_dict, make_service_from_dict, make_pdb_from_dict, clean_pod_template, clean_service_template, clean_pdb_template, ) from ..common.auth import ClusterAuth from ..common.utils import ( namespace_default, escape, ) from ..common.networking import get_external_address_for_scheduler_service logger = logging.getLogger(__name__) SCHEDULER_PORT = 8786 class Pod(ProcessInterface): """A superclass for Kubernetes Pods See Also -------- Worker Scheduler """ def __init__( self, cluster, core_api, policy_api, pod_template, namespace, loop=None, **kwargs ): self._pod = None self.cluster = cluster self.core_api = core_api self.policy_api = policy_api self.pod_template = copy.deepcopy(pod_template) self.base_labels = self.pod_template.metadata.labels self.namespace = namespace self.name = None self.loop = loop self.kwargs = kwargs super().__init__() @property def cluster_name(self): return self.pod_template.metadata.labels["dask.org/cluster-name"] async def start(self, **kwargs): retry_count = 0 # Retry 10 times while True: try: self._pod = await self.core_api.create_namespaced_pod( self.namespace, self.pod_template ) return await super().start(**kwargs) except ApiException as e: if retry_count < 10: logger.debug("Error when creating pod, retrying... - %s", str(e)) await asyncio.sleep(0.1) retry_count += 1 else: raise e async def close(self, **kwargs): if self._pod: name, namespace = self._pod.metadata.name, self.namespace try: await self.core_api.delete_namespaced_pod(name, namespace) except ApiException as e: if e.reason == "Not Found": logger.debug( "Pod %s in namespace %s has been deleated already.", name, namespace, ) else: raise await super().close(**kwargs) async def logs(self): try: log = await self.core_api.read_namespaced_pod_log( self._pod.metadata.name, self.namespace, container=KUBECLUSTER_WORKER_CONTAINER_NAME, ) except ApiException as e: if "waiting to start" in str(e): log = "" else: raise e return Log(log) async def describe_pod(self): self._pod = await self.core_api.read_namespaced_pod( self._pod.metadata.name, self.namespace ) return self._pod def __repr__(self): return "<Pod %s: status=%s>" % (type(self).__name__, self.status) class Worker(Pod): """A Remote Dask Worker controled by Kubernetes Parameters ---------- scheduler: str The address of the scheduler name (optional): The name passed to the dask-worker CLI at creation time. """ def __init__(self, scheduler: str, name=None, **kwargs): super().__init__(**kwargs) self.scheduler = scheduler self.pod_template.metadata.labels["dask.org/component"] = "worker" self.pod_template.spec.containers[0].env.append( kubernetes.client.V1EnvVar( name="DASK_SCHEDULER_ADDRESS", value=self.scheduler ) ) if name is not None: worker_name_args = ["--name", str(name)] self.pod_template.spec.containers[0].args += worker_name_args class Scheduler(Pod): """A Remote Dask Scheduler controled by Kubernetes Parameters ---------- idle_timeout: str, optional The scheduler task will exit after this amount of time if there are no requests from the client. Default is to never timeout. service_wait_timeout_s: int (optional) Timeout, in seconds, to wait for the remote scheduler service to be ready. Defaults to 30 seconds. Set to 0 to disable the timeout (not recommended). """ def __init__( self, idle_timeout: str, service_wait_timeout_s: int = None, service_name_retries: int = None, **kwargs ): super().__init__(**kwargs) self.cluster._log("Creating scheduler pod on cluster. This may take some time.") self.service = None self._idle_timeout = idle_timeout self._service_wait_timeout_s = service_wait_timeout_s self._service_name_retries = service_name_retries if self._idle_timeout is not None: self.pod_template.spec.containers[0].args += [ "--idle-timeout", self._idle_timeout, ] self.pdb = None async def start(self, **kwargs): await super().start(**kwargs) while (await self.describe_pod()).status.phase == "Pending": await asyncio.sleep(0.1) while self.address is None: logs = await self.logs() for line in logs.splitlines(): if "Scheduler at:" in line: self.address = line.split("Scheduler at:")[1].strip() await asyncio.sleep(0.1) self.service = await self._create_service() self.address = "tcp://{name}.{namespace}:{port}".format( name=self.service.metadata.name, namespace=self.namespace, port=SCHEDULER_PORT, ) self.external_address = await get_external_address_for_scheduler_service( self.core_api, self.service, service_name_resolution_retries=self._service_name_retries, ) self.pdb = await self._create_pdb() async def close(self, **kwargs): if self.service: await self.core_api.delete_namespaced_service( self.cluster_name, self.namespace ) if self.pdb: await self.policy_api.delete_namespaced_pod_disruption_budget( self.cluster_name, self.namespace ) await super().close(**kwargs) async def _create_service(self): service_template_dict = dask.config.get("kubernetes.scheduler-service-template") self.service_template = clean_service_template( make_service_from_dict(service_template_dict) ) self.service_template.metadata.name = self.cluster_name self.service_template.metadata.labels = copy.deepcopy(self.base_labels) self.service_template.spec.selector["dask.org/cluster-name"] = self.cluster_name if self.service_template.spec.type is None: self.service_template.spec.type = dask.config.get( "kubernetes.scheduler-service-type" ) await self.core_api.create_namespaced_service( self.namespace, self.service_template ) service = await self.core_api.read_namespaced_service( self.cluster_name, self.namespace ) if service.spec.type == "LoadBalancer": # Wait for load balancer to be assigned start = time.time() while service.status.load_balancer.ingress is None: if ( self._service_wait_timeout_s > 0 and time.time() > start + self._service_wait_timeout_s ): raise asyncio.TimeoutError( "Timed out waiting for Load Balancer to be provisioned." ) service = await self.core_api.read_namespaced_service( self.cluster_name, self.namespace ) await asyncio.sleep(0.2) return service async def _create_pdb(self): pdb_template_dict = dask.config.get("kubernetes.scheduler-pdb-template") self.pdb_template = clean_pdb_template(make_pdb_from_dict(pdb_template_dict)) self.pdb_template.metadata.name = self.cluster_name self.pdb_template.metadata.labels = copy.deepcopy(self.base_labels) self.pdb_template.spec.selector.match_labels[ "dask.org/cluster-name" ] = self.cluster_name await self.policy_api.create_namespaced_pod_disruption_budget( self.namespace, self.pdb_template ) return await self.policy_api.read_namespaced_pod_disruption_budget( self.cluster_name, self.namespace ) class KubeCluster(SpecCluster): """Launch a Dask cluster on Kubernetes This starts a local Dask scheduler and then dynamically launches Dask workers on a Kubernetes cluster. The Kubernetes cluster is taken to be either the current one on which this code is running, or as a fallback, the default one configured in a kubeconfig file. **Environments** Your worker pod image should have a similar environment to your local environment, including versions of Python, dask, cloudpickle, and any libraries that you may wish to use (like NumPy, Pandas, or Scikit-Learn). See examples below for suggestions on how to manage and check for this. **Network** Since the Dask scheduler is launched locally, for it to work, we need to be able to open network connections between this local node and all the workers nodes on the Kubernetes cluster. If the current process is not already on a Kubernetes node, some network configuration will likely be required to make this work. **Resources** Your Kubernetes resource limits and requests should match the ``--memory-limit`` and ``--nthreads`` parameters given to the ``dask-worker`` command. Parameters ---------- pod_template: (kubernetes.client.V1Pod, dict, str) A Kubernetes specification for a Pod for a dask worker. Can be either a ``V1Pod``, a dict representation of a pod, or a path to a yaml file containing a pod specification. scheduler_pod_template: kubernetes.client.V1Pod (optional) A Kubernetes specification for a Pod for a dask scheduler. Defaults to the pod_template. name: str (optional) Name given to the pods. Defaults to ``dask-$USER-random`` namespace: str (optional) Namespace in which to launch the workers. Defaults to current namespace if available or "default" n_workers: int Number of workers on initial launch. Use ``scale`` to change this number in the future env: Dict[str, str] Dictionary of environment variables to pass to worker pod host: str Listen address for local scheduler. Defaults to 0.0.0.0 port: int Port of local scheduler auth: List[ClusterAuth] (optional) Configuration methods to attempt in order. Defaults to ``[InCluster(), KubeConfig()]``. idle_timeout: str (optional) The scheduler task will exit after this amount of time if there are no requests from the client. Default is to never timeout. scheduler_service_wait_timeout: int (optional) Timeout, in seconds, to wait for the remote scheduler service to be ready. Defaults to 30 seconds. Set to 0 to disable the timeout (not recommended). scheduler_service_name_resolution_retries: int (optional) Number of retries to resolve scheduler service name when running from within the Kubernetes cluster. Defaults to 20. Must be set to 1 or greater. deploy_mode: str (optional) Run the scheduler as "local" or "remote". Defaults to ``"remote"``. **kwargs: dict Additional keyword arguments to pass to LocalCluster Examples -------- >>> from dask_kubernetes import KubeCluster, make_pod_spec >>> pod_spec = make_pod_spec(image='ghcr.io/dask/dask:latest', ... memory_limit='4G', memory_request='4G', ... cpu_limit=1, cpu_request=1, ... env={'EXTRA_PIP_PACKAGES': 'fastparquet git+https://github.com/dask/distributed'}) >>> cluster = KubeCluster(pod_spec) >>> cluster.scale(10) You can also create clusters with worker pod specifications as dictionaries or stored in YAML files >>> cluster = KubeCluster('worker-template.yml') >>> cluster = KubeCluster({...}) Rather than explicitly setting a number of workers you can also ask the cluster to allocate workers dynamically based on current workload >>> cluster.adapt() You can pass this cluster directly to a Dask client >>> from dask.distributed import Client >>> client = Client(cluster) You can verify that your local environment matches your worker environments by calling ``client.get_versions(check=True)``. This will raise an informative error if versions do not match. >>> client.get_versions(check=True) The ``ghcr.io/dask/dask`` docker images support ``EXTRA_PIP_PACKAGES``, ``EXTRA_APT_PACKAGES`` and ``EXTRA_CONDA_PACKAGES`` environment variables to help with small adjustments to the worker environments. We recommend the use of pip over conda in this case due to a much shorter startup time. These environment variables can be modified directly from the KubeCluster constructor methods using the ``env=`` keyword. You may list as many packages as you like in a single string like the following: >>> pip = 'pyarrow gcsfs git+https://github.com/dask/distributed' >>> conda = '-c conda-forge scikit-learn' >>> KubeCluster(..., env={'EXTRA_PIP_PACKAGES': pip, ... 'EXTRA_CONDA_PACKAGES': conda}) You can also start a KubeCluster with no arguments *if* the worker template is specified in the Dask config files, either as a full template in ``kubernetes.worker-template`` or a path to a YAML file in ``kubernetes.worker-template-path``. See https://docs.dask.org/en/latest/configuration.html for more information about setting configuration values.:: $ export DASK_KUBERNETES__WORKER_TEMPLATE_PATH=worker_template.yaml >>> cluster = KubeCluster() # automatically finds 'worker_template.yaml' See Also -------- KubeCluster.adapt """ def __init__( self, pod_template=None, name=None, namespace=None, n_workers=None, host=None, port=None, env=None, auth=ClusterAuth.DEFAULT, idle_timeout=None, deploy_mode=None, interface=None, protocol=None, dashboard_address=None, security=None, scheduler_service_wait_timeout=None, scheduler_service_name_resolution_retries=None, scheduler_pod_template=None, **kwargs ): if isinstance(pod_template, str): with open(pod_template) as f: pod_template = dask.config.expand_environment_variables( yaml.safe_load(f) ) if isinstance(pod_template, dict): pod_template = make_pod_from_dict(pod_template) if isinstance(scheduler_pod_template, str): with open(scheduler_pod_template) as f: scheduler_pod_template = dask.config.expand_environment_variables( yaml.safe_load(f) ) if isinstance(scheduler_pod_template, dict): scheduler_pod_template = make_pod_from_dict(scheduler_pod_template) self.pod_template = pod_template self.scheduler_pod_template = scheduler_pod_template self._generate_name = dask.config.get("kubernetes.name", override_with=name) self.namespace = dask.config.get( "kubernetes.namespace", override_with=namespace ) self._n_workers = dask.config.get( "kubernetes.count.start", override_with=n_workers ) self._idle_timeout = dask.config.get( "kubernetes.idle-timeout", override_with=idle_timeout ) self._deploy_mode = dask.config.get( "kubernetes.deploy-mode", override_with=deploy_mode ) self._protocol = dask.config.get("kubernetes.protocol", override_with=protocol) self._interface = dask.config.get( "kubernetes.interface", override_with=interface ) self._dashboard_address = dask.config.get( "kubernetes.dashboard_address", override_with=dashboard_address ) self._scheduler_service_wait_timeout = dask.config.get( "kubernetes.scheduler-service-wait-timeout", override_with=scheduler_service_wait_timeout, ) self._scheduler_service_name_resolution_retries = dask.config.get( "kubernetes.scheduler-service-name-resolution-retries", override_with=scheduler_service_name_resolution_retries, ) self.security = security if self.security and not isinstance( self.security, distributed.security.Security ): raise RuntimeError( "Security object is not a valid distributed.security.Security object" ) self.host = dask.config.get("kubernetes.host", override_with=host) self.port = dask.config.get("kubernetes.port", override_with=port) self.env = dask.config.get("kubernetes.env", override_with=env) self.auth = auth self.kwargs = kwargs super().__init__(**self.kwargs) def _get_pod_template(self, pod_template, pod_type): if not pod_template and dask.config.get( "kubernetes.{}-template".format(pod_type), None ): d = dask.config.get("kubernetes.{}-template".format(pod_type)) d = dask.config.expand_environment_variables(d) pod_template = make_pod_from_dict(d) if not pod_template and dask.config.get( "kubernetes.{}-template-path".format(pod_type), None ): import yaml fn = dask.config.get("kubernetes.{}-template-path".format(pod_type)) fn = fn.format(**os.environ) with open(fn) as f: d = yaml.safe_load(f) d = dask.config.expand_environment_variables(d) pod_template = make_pod_from_dict(d) return pod_template def _fill_pod_templates(self, pod_template, pod_type): pod_template = copy.deepcopy(pod_template) # Default labels that can't be overwritten pod_template.metadata.labels["dask.org/cluster-name"] = self._generate_name pod_template.metadata.labels["dask.org/component"] = pod_type pod_template.metadata.labels["user"] = escape(getpass.getuser()) pod_template.metadata.labels["app"] = "dask" pod_template.metadata.namespace = self.namespace if self.env: pod_template.spec.containers[0].env.extend( [ kubernetes.client.V1EnvVar(name=k, value=str(v)) for k, v in self.env.items() ] ) pod_template.metadata.generate_name = self._generate_name return pod_template async def _start(self): self.pod_template = self._get_pod_template(self.pod_template, pod_type="worker") self.scheduler_pod_template = self._get_pod_template( self.scheduler_pod_template, pod_type="scheduler" ) if not self.pod_template: msg = ( "Worker pod specification not provided. See KubeCluster " "docstring for ways to specify workers" ) raise ValueError(msg) base_pod_template = self.pod_template self.pod_template = clean_pod_template(self.pod_template, pod_type="worker") if not self.scheduler_pod_template: self.scheduler_pod_template = base_pod_template self.scheduler_pod_template.spec.containers[0].args = ["dask-scheduler"] self.scheduler_pod_template = clean_pod_template( self.scheduler_pod_template, pod_type="scheduler" ) await ClusterAuth.load_first(self.auth) self.core_api = kubernetes.client.CoreV1Api() self.policy_api = kubernetes.client.PolicyV1beta1Api() if self.namespace is None: self.namespace = namespace_default() environ = {k: v for k, v in os.environ.items() if k not in ["user", "uuid"]} self._generate_name = self._generate_name.format( user=getpass.getuser(), uuid=str(uuid.uuid4())[:10], **environ ) self._generate_name = escape(self._generate_name) self.pod_template = self._fill_pod_templates( self.pod_template, pod_type="worker" ) self.scheduler_pod_template = self._fill_pod_templates( self.scheduler_pod_template, pod_type="scheduler" ) common_options = { "cluster": self, "core_api": self.core_api, "policy_api": self.policy_api, "namespace": self.namespace, "loop": self.loop, } if self._deploy_mode == "local": self.scheduler_spec = { "cls": dask.distributed.Scheduler, "options": { "protocol": self._protocol, "interface": self._interface, "host": self.host, "port": self.port, "dashboard_address": self._dashboard_address, "security": self.security, }, } elif self._deploy_mode == "remote": self.scheduler_spec = { "cls": Scheduler, "options": { "idle_timeout": self._idle_timeout, "service_wait_timeout_s": self._scheduler_service_wait_timeout, "service_name_retries": self._scheduler_service_name_resolution_retries, "pod_template": self.scheduler_pod_template, **common_options, }, } else: raise RuntimeError("Unknown deploy mode %s" % self._deploy_mode) self.new_spec = { "cls": Worker, "options": {"pod_template": self.pod_template, **common_options}, } self.worker_spec = {i: self.new_spec for i in range(self._n_workers)} self.name = self.pod_template.metadata.generate_name await super()._start() @classmethod def from_dict(cls, pod_spec, **kwargs): """Create cluster with worker pod spec defined by Python dictionary Deprecated, please use the `KubeCluster` constructor directly. Examples -------- >>> spec = { ... 'metadata': {}, ... 'spec': { ... 'containers': [{ ... 'args': ['dask-worker', '$(DASK_SCHEDULER_ADDRESS)', ... '--nthreads', '1', ... '--death-timeout', '60'], ... 'command': None, ... 'image': 'ghcr.io/dask/dask:latest', ... 'name': 'dask-worker', ... }], ... 'restartPolicy': 'Never', ... } ... } >>> cluster = KubeCluster.from_dict(spec, namespace='my-ns') # doctest: +SKIP See Also -------- KubeCluster.from_yaml """ warnings.warn( "KubeCluster.from_dict is deprecated, use the constructor directly" ) return cls(pod_spec, **kwargs) @classmethod def from_yaml(cls, yaml_path, **kwargs): """Create cluster with worker pod spec defined by a YAML file Deprecated, please use the `KubeCluster` constructor directly. We can start a cluster with pods defined in an accompanying YAML file like the following: .. code-block:: yaml kind: Pod metadata: labels: foo: bar baz: quux spec: containers: - image: ghcr.io/dask/dask:latest name: dask-worker args: [dask-worker, $(DASK_SCHEDULER_ADDRESS), --nthreads, '2', --memory-limit, 8GB] restartPolicy: Never Examples -------- >>> cluster = KubeCluster.from_yaml('pod.yaml', namespace='my-ns') # doctest: +SKIP See Also -------- KubeCluster.from_dict """ warnings.warn( "KubeCluster.from_yaml is deprecated, use the constructor directly" ) return cls(yaml_path, **kwargs) def scale(self, n): # A shim to maintain backward compatibility # https://github.com/dask/distributed/issues/3054 maximum = dask.config.get("kubernetes.count.max") if maximum is not None and maximum < n: logger.info( "Tried to scale beyond maximum number of workers %d > %d", n, maximum ) n = maximum return super().scale(n) async def _logs(self, scheduler=True, workers=True): """Return logs for the scheduler and workers Parameters ---------- scheduler : boolean Whether or not to collect logs for the scheduler workers : boolean or Iterable[str], optional A list of worker addresses to select. Defaults to all workers if `True` or no workers if `False` Returns ------- logs: Dict[str] A dictionary of logs, with one item for the scheduler and one for each worker """ logs = Logs() if scheduler: logs["Scheduler"] = await self.scheduler.logs() if workers: worker_logs = await asyncio.gather( *[w.logs() for w in self.workers.values()] ) for key, log in zip(self.workers, worker_logs): logs[key] = log return logs
36.481682
115
0.609886
import asyncio import copy import getpass import logging import os import time import uuid import warnings import yaml import dask import dask.distributed import distributed.security from distributed.deploy import SpecCluster, ProcessInterface from distributed.utils import Log, Logs import kubernetes_asyncio as kubernetes from kubernetes_asyncio.client.rest import ApiException from ..constants import KUBECLUSTER_WORKER_CONTAINER_NAME from ..common.objects import ( make_pod_from_dict, make_service_from_dict, make_pdb_from_dict, clean_pod_template, clean_service_template, clean_pdb_template, ) from ..common.auth import ClusterAuth from ..common.utils import ( namespace_default, escape, ) from ..common.networking import get_external_address_for_scheduler_service logger = logging.getLogger(__name__) SCHEDULER_PORT = 8786 class Pod(ProcessInterface): def __init__( self, cluster, core_api, policy_api, pod_template, namespace, loop=None, **kwargs ): self._pod = None self.cluster = cluster self.core_api = core_api self.policy_api = policy_api self.pod_template = copy.deepcopy(pod_template) self.base_labels = self.pod_template.metadata.labels self.namespace = namespace self.name = None self.loop = loop self.kwargs = kwargs super().__init__() @property def cluster_name(self): return self.pod_template.metadata.labels["dask.org/cluster-name"] async def start(self, **kwargs): retry_count = 0 while True: try: self._pod = await self.core_api.create_namespaced_pod( self.namespace, self.pod_template ) return await super().start(**kwargs) except ApiException as e: if retry_count < 10: logger.debug("Error when creating pod, retrying... - %s", str(e)) await asyncio.sleep(0.1) retry_count += 1 else: raise e async def close(self, **kwargs): if self._pod: name, namespace = self._pod.metadata.name, self.namespace try: await self.core_api.delete_namespaced_pod(name, namespace) except ApiException as e: if e.reason == "Not Found": logger.debug( "Pod %s in namespace %s has been deleated already.", name, namespace, ) else: raise await super().close(**kwargs) async def logs(self): try: log = await self.core_api.read_namespaced_pod_log( self._pod.metadata.name, self.namespace, container=KUBECLUSTER_WORKER_CONTAINER_NAME, ) except ApiException as e: if "waiting to start" in str(e): log = "" else: raise e return Log(log) async def describe_pod(self): self._pod = await self.core_api.read_namespaced_pod( self._pod.metadata.name, self.namespace ) return self._pod def __repr__(self): return "<Pod %s: status=%s>" % (type(self).__name__, self.status) class Worker(Pod): def __init__(self, scheduler: str, name=None, **kwargs): super().__init__(**kwargs) self.scheduler = scheduler self.pod_template.metadata.labels["dask.org/component"] = "worker" self.pod_template.spec.containers[0].env.append( kubernetes.client.V1EnvVar( name="DASK_SCHEDULER_ADDRESS", value=self.scheduler ) ) if name is not None: worker_name_args = ["--name", str(name)] self.pod_template.spec.containers[0].args += worker_name_args class Scheduler(Pod): def __init__( self, idle_timeout: str, service_wait_timeout_s: int = None, service_name_retries: int = None, **kwargs ): super().__init__(**kwargs) self.cluster._log("Creating scheduler pod on cluster. This may take some time.") self.service = None self._idle_timeout = idle_timeout self._service_wait_timeout_s = service_wait_timeout_s self._service_name_retries = service_name_retries if self._idle_timeout is not None: self.pod_template.spec.containers[0].args += [ "--idle-timeout", self._idle_timeout, ] self.pdb = None async def start(self, **kwargs): await super().start(**kwargs) while (await self.describe_pod()).status.phase == "Pending": await asyncio.sleep(0.1) while self.address is None: logs = await self.logs() for line in logs.splitlines(): if "Scheduler at:" in line: self.address = line.split("Scheduler at:")[1].strip() await asyncio.sleep(0.1) self.service = await self._create_service() self.address = "tcp://{name}.{namespace}:{port}".format( name=self.service.metadata.name, namespace=self.namespace, port=SCHEDULER_PORT, ) self.external_address = await get_external_address_for_scheduler_service( self.core_api, self.service, service_name_resolution_retries=self._service_name_retries, ) self.pdb = await self._create_pdb() async def close(self, **kwargs): if self.service: await self.core_api.delete_namespaced_service( self.cluster_name, self.namespace ) if self.pdb: await self.policy_api.delete_namespaced_pod_disruption_budget( self.cluster_name, self.namespace ) await super().close(**kwargs) async def _create_service(self): service_template_dict = dask.config.get("kubernetes.scheduler-service-template") self.service_template = clean_service_template( make_service_from_dict(service_template_dict) ) self.service_template.metadata.name = self.cluster_name self.service_template.metadata.labels = copy.deepcopy(self.base_labels) self.service_template.spec.selector["dask.org/cluster-name"] = self.cluster_name if self.service_template.spec.type is None: self.service_template.spec.type = dask.config.get( "kubernetes.scheduler-service-type" ) await self.core_api.create_namespaced_service( self.namespace, self.service_template ) service = await self.core_api.read_namespaced_service( self.cluster_name, self.namespace ) if service.spec.type == "LoadBalancer": start = time.time() while service.status.load_balancer.ingress is None: if ( self._service_wait_timeout_s > 0 and time.time() > start + self._service_wait_timeout_s ): raise asyncio.TimeoutError( "Timed out waiting for Load Balancer to be provisioned." ) service = await self.core_api.read_namespaced_service( self.cluster_name, self.namespace ) await asyncio.sleep(0.2) return service async def _create_pdb(self): pdb_template_dict = dask.config.get("kubernetes.scheduler-pdb-template") self.pdb_template = clean_pdb_template(make_pdb_from_dict(pdb_template_dict)) self.pdb_template.metadata.name = self.cluster_name self.pdb_template.metadata.labels = copy.deepcopy(self.base_labels) self.pdb_template.spec.selector.match_labels[ "dask.org/cluster-name" ] = self.cluster_name await self.policy_api.create_namespaced_pod_disruption_budget( self.namespace, self.pdb_template ) return await self.policy_api.read_namespaced_pod_disruption_budget( self.cluster_name, self.namespace ) class KubeCluster(SpecCluster): def __init__( self, pod_template=None, name=None, namespace=None, n_workers=None, host=None, port=None, env=None, auth=ClusterAuth.DEFAULT, idle_timeout=None, deploy_mode=None, interface=None, protocol=None, dashboard_address=None, security=None, scheduler_service_wait_timeout=None, scheduler_service_name_resolution_retries=None, scheduler_pod_template=None, **kwargs ): if isinstance(pod_template, str): with open(pod_template) as f: pod_template = dask.config.expand_environment_variables( yaml.safe_load(f) ) if isinstance(pod_template, dict): pod_template = make_pod_from_dict(pod_template) if isinstance(scheduler_pod_template, str): with open(scheduler_pod_template) as f: scheduler_pod_template = dask.config.expand_environment_variables( yaml.safe_load(f) ) if isinstance(scheduler_pod_template, dict): scheduler_pod_template = make_pod_from_dict(scheduler_pod_template) self.pod_template = pod_template self.scheduler_pod_template = scheduler_pod_template self._generate_name = dask.config.get("kubernetes.name", override_with=name) self.namespace = dask.config.get( "kubernetes.namespace", override_with=namespace ) self._n_workers = dask.config.get( "kubernetes.count.start", override_with=n_workers ) self._idle_timeout = dask.config.get( "kubernetes.idle-timeout", override_with=idle_timeout ) self._deploy_mode = dask.config.get( "kubernetes.deploy-mode", override_with=deploy_mode ) self._protocol = dask.config.get("kubernetes.protocol", override_with=protocol) self._interface = dask.config.get( "kubernetes.interface", override_with=interface ) self._dashboard_address = dask.config.get( "kubernetes.dashboard_address", override_with=dashboard_address ) self._scheduler_service_wait_timeout = dask.config.get( "kubernetes.scheduler-service-wait-timeout", override_with=scheduler_service_wait_timeout, ) self._scheduler_service_name_resolution_retries = dask.config.get( "kubernetes.scheduler-service-name-resolution-retries", override_with=scheduler_service_name_resolution_retries, ) self.security = security if self.security and not isinstance( self.security, distributed.security.Security ): raise RuntimeError( "Security object is not a valid distributed.security.Security object" ) self.host = dask.config.get("kubernetes.host", override_with=host) self.port = dask.config.get("kubernetes.port", override_with=port) self.env = dask.config.get("kubernetes.env", override_with=env) self.auth = auth self.kwargs = kwargs super().__init__(**self.kwargs) def _get_pod_template(self, pod_template, pod_type): if not pod_template and dask.config.get( "kubernetes.{}-template".format(pod_type), None ): d = dask.config.get("kubernetes.{}-template".format(pod_type)) d = dask.config.expand_environment_variables(d) pod_template = make_pod_from_dict(d) if not pod_template and dask.config.get( "kubernetes.{}-template-path".format(pod_type), None ): import yaml fn = dask.config.get("kubernetes.{}-template-path".format(pod_type)) fn = fn.format(**os.environ) with open(fn) as f: d = yaml.safe_load(f) d = dask.config.expand_environment_variables(d) pod_template = make_pod_from_dict(d) return pod_template def _fill_pod_templates(self, pod_template, pod_type): pod_template = copy.deepcopy(pod_template) pod_template.metadata.labels["dask.org/cluster-name"] = self._generate_name pod_template.metadata.labels["dask.org/component"] = pod_type pod_template.metadata.labels["user"] = escape(getpass.getuser()) pod_template.metadata.labels["app"] = "dask" pod_template.metadata.namespace = self.namespace if self.env: pod_template.spec.containers[0].env.extend( [ kubernetes.client.V1EnvVar(name=k, value=str(v)) for k, v in self.env.items() ] ) pod_template.metadata.generate_name = self._generate_name return pod_template async def _start(self): self.pod_template = self._get_pod_template(self.pod_template, pod_type="worker") self.scheduler_pod_template = self._get_pod_template( self.scheduler_pod_template, pod_type="scheduler" ) if not self.pod_template: msg = ( "Worker pod specification not provided. See KubeCluster " "docstring for ways to specify workers" ) raise ValueError(msg) base_pod_template = self.pod_template self.pod_template = clean_pod_template(self.pod_template, pod_type="worker") if not self.scheduler_pod_template: self.scheduler_pod_template = base_pod_template self.scheduler_pod_template.spec.containers[0].args = ["dask-scheduler"] self.scheduler_pod_template = clean_pod_template( self.scheduler_pod_template, pod_type="scheduler" ) await ClusterAuth.load_first(self.auth) self.core_api = kubernetes.client.CoreV1Api() self.policy_api = kubernetes.client.PolicyV1beta1Api() if self.namespace is None: self.namespace = namespace_default() environ = {k: v for k, v in os.environ.items() if k not in ["user", "uuid"]} self._generate_name = self._generate_name.format( user=getpass.getuser(), uuid=str(uuid.uuid4())[:10], **environ ) self._generate_name = escape(self._generate_name) self.pod_template = self._fill_pod_templates( self.pod_template, pod_type="worker" ) self.scheduler_pod_template = self._fill_pod_templates( self.scheduler_pod_template, pod_type="scheduler" ) common_options = { "cluster": self, "core_api": self.core_api, "policy_api": self.policy_api, "namespace": self.namespace, "loop": self.loop, } if self._deploy_mode == "local": self.scheduler_spec = { "cls": dask.distributed.Scheduler, "options": { "protocol": self._protocol, "interface": self._interface, "host": self.host, "port": self.port, "dashboard_address": self._dashboard_address, "security": self.security, }, } elif self._deploy_mode == "remote": self.scheduler_spec = { "cls": Scheduler, "options": { "idle_timeout": self._idle_timeout, "service_wait_timeout_s": self._scheduler_service_wait_timeout, "service_name_retries": self._scheduler_service_name_resolution_retries, "pod_template": self.scheduler_pod_template, **common_options, }, } else: raise RuntimeError("Unknown deploy mode %s" % self._deploy_mode) self.new_spec = { "cls": Worker, "options": {"pod_template": self.pod_template, **common_options}, } self.worker_spec = {i: self.new_spec for i in range(self._n_workers)} self.name = self.pod_template.metadata.generate_name await super()._start() @classmethod def from_dict(cls, pod_spec, **kwargs): warnings.warn( "KubeCluster.from_dict is deprecated, use the constructor directly" ) return cls(pod_spec, **kwargs) @classmethod def from_yaml(cls, yaml_path, **kwargs): warnings.warn( "KubeCluster.from_yaml is deprecated, use the constructor directly" ) return cls(yaml_path, **kwargs) def scale(self, n): # A shim to maintain backward compatibility # https://github.com/dask/distributed/issues/3054 maximum = dask.config.get("kubernetes.count.max") if maximum is not None and maximum < n: logger.info( "Tried to scale beyond maximum number of workers %d > %d", n, maximum ) n = maximum return super().scale(n) async def _logs(self, scheduler=True, workers=True): logs = Logs() if scheduler: logs["Scheduler"] = await self.scheduler.logs() if workers: worker_logs = await asyncio.gather( *[w.logs() for w in self.workers.values()] ) for key, log in zip(self.workers, worker_logs): logs[key] = log return logs
true
true
f720789c8c15c24400e6e5290d6e30a895646242
7,694
py
Python
rfmizer/tests_views.py
JunglistMNSQ/rfm
f42fa1424edbc9c57c9cd27d8183574f72acbf5c
[ "BSD-3-Clause" ]
null
null
null
rfmizer/tests_views.py
JunglistMNSQ/rfm
f42fa1424edbc9c57c9cd27d8183574f72acbf5c
[ "BSD-3-Clause" ]
4
2021-06-04T23:58:19.000Z
2021-09-22T19:38:00.000Z
rfmizer/tests_views.py
JunglistMNSQ/rfm
f42fa1424edbc9c57c9cd27d8183574f72acbf5c
[ "BSD-3-Clause" ]
null
null
null
from django.test import TestCase from django.urls import reverse from unittest import mock from .fixtures import FixturesMixin from .models import Person, Tab, User import hashlib # Create your tests here. class TestRegister(FixturesMixin, TestCase): def test_create_and_login(self): self.client.post('/register/', {'username': 'TestUser1', 'email': 'test@test.com', 'password': 'password', 'password2': 'password'}) session = self.client.session session.save() user = User.objects.get_by_natural_key('TestUser1') self.assertEqual(user.get_username(), 'TestUser1') response = self.client.post('/login/', {'username': 'TestUser1', 'password': 'password'}, follow=True) self.assertEqual(response.redirect_chain, [('/profile/', 302)]) def test_create_with_different_passwords(self): response = self.client.post('/register/', {'username': 'TestUser1', 'email': 'test@test.com', 'password': 'password1', 'password2': 'password2'}) self.assertRaisesMessage(response, 'Пароли не совпадают') class TestLogin(FixturesMixin, TestCase): def test_login(self): response = self.client.post('/login/', {'username': 'TestUser', 'password': 'password'}, follow=True) self.assertEqual(response.redirect_chain, [('/profile/', 302)]) class TestUploadToParse(FixturesMixin, TestCase): def test_get(self): response = self.client.get('/upload/', ) self.assertEqual(response.status_code, 200) self.assertEqual(Tab.objects.filter(owner=self.user)[0], self.tab_exist) def test_create_and_parse_corrupt_file(self): with open(self.file) as f: response = self.client.post( '/upload/', {'name': 'test1', 'file': f}, follow=True ) session = self.client.session session.save() tab = Tab.objects.get(pk=session['tab']) self.assertTrue(response.context['lines']) self.assertEqual(tab.name, 'test1') self.assertTrue(session['tab_is_new']) self.assertEqual(response.status_code, 200) self.assertEqual(response.redirect_chain, [('/parse/', 302)]) response = self.client.post('/parse/', {'col4': 'date', 'col3': 'name', 'col2': 'phone', 'col1': 'good', 'col0': 'pay'}, follow=True ) self.assertEqual(response.redirect_chain, [('/corrupt_data/', 302)]) self.assertEqual(response.status_code, 200) def test_update_and_parse(self): with open(self.file) as f: response = self.client.post( '/upload/', {'choice_exist_tab': self.tab_exist.id, 'file': f}, follow=True ) session = self.client.session session.save() tab = Tab.objects.get(pk=session['tab']) self.assertTrue(response.context['lines']) self.assertEqual(session['tab_is_new'], False) self.assertEqual(tab.name, self.tab_exist.name) self.assertEqual(response.redirect_chain, [('/parse/', 302)]) response = self.client.post('/parse/', self.column_order, follow=True ) tab = Tab.objects.get(pk=session['tab']) self.assertEqual( response.redirect_chain, [('/my_tables/' + tab.slug, 302)] ) class TestMyTables(FixturesMixin, TestCase): def test_get(self): response = self.client.get('/my_tables/') qs = response.context['list_tab'] self.assertSetEqual( set(qs), {self.tab_exist, Tab.objects.get(pk=2), Tab.objects.get(pk=3)} ) self.assertEqual(response.status_code, 200) class TestManageTab(FixturesMixin, TestCase): def setUp(self): super(TestManageTab, self).setUp() self.url = reverse('manage_tab', args=(self.tab_exist.slug, )) def test_get_post(self): response = self.client.get(self.url) session = self.client.session session.save() self.assertEqual(response.status_code, 200) class TestDeleteTab(FixturesMixin, TestCase): def test_post(self): test_tab = Tab(owner=self.user, name='test_tab_del') test_tab.save() url = reverse('delete', args=(test_tab.slug, )) response = self.client.post(url, follow=True) self.assertEqual(response.redirect_chain, [('/my_tables', 302), ('/my_tables/', 301)]) class TestLog(FixturesMixin, TestCase): def test_log(self): response = self.client.get('/log/') self.assertEqual(response.status_code, 200) class TestClientList(FixturesMixin, TestCase): def test_get(self): url = reverse('client_list', kwargs={'slug': self.tab_exist.slug, }) response = self.client.get(url) self.assertEqual(response.status_code, 200) class TestClientCard(FixturesMixin, TestCase): def test_get(self): new_client = Person.get_new_line(self.data) url = reverse('client_card', kwargs={'slug_tab': self.tab_exist.slug, 'slug': new_client.slug}) response = self.client.get(url) session = self.client.session session.save() self.assertEqual(response.status_code, 200) class TestRulesList(FixturesMixin, TestCase): def test_get(self): url = reverse('rules', kwargs={'slug': self.tab_exist.slug}) response = self.client.get(url) self.assertEqual(response.status_code, 200) class TestProfile(FixturesMixin, TestCase): def test_get(self): response = self.client.get('/profile/') self.assertEqual(response.status_code, 200) @mock.patch('rfmizer.sms.RocketSMS.check_balance', return_value=[True, 25, None]) def test_post(self, balance_mock): password = 'test_sms_pass' login = 'test_sms_login' response = self.client.post('/profile/', {'sms_login': login, 'sms_pass': password}, follow=True) hash_pass = hashlib.md5(password.encode('utf-8')).hexdigest() user = User.objects.get(pk=self.user.pk) self.assertEqual(user.profile.sms_login, login) self.assertEqual(user.profile.sms_pass, hash_pass) self.assertEqual(user.profile.balance, 25) self.assertEqual(response.status_code, 200) balance_mock.assert_called_once()
38.089109
71
0.525214
from django.test import TestCase from django.urls import reverse from unittest import mock from .fixtures import FixturesMixin from .models import Person, Tab, User import hashlib class TestRegister(FixturesMixin, TestCase): def test_create_and_login(self): self.client.post('/register/', {'username': 'TestUser1', 'email': 'test@test.com', 'password': 'password', 'password2': 'password'}) session = self.client.session session.save() user = User.objects.get_by_natural_key('TestUser1') self.assertEqual(user.get_username(), 'TestUser1') response = self.client.post('/login/', {'username': 'TestUser1', 'password': 'password'}, follow=True) self.assertEqual(response.redirect_chain, [('/profile/', 302)]) def test_create_with_different_passwords(self): response = self.client.post('/register/', {'username': 'TestUser1', 'email': 'test@test.com', 'password': 'password1', 'password2': 'password2'}) self.assertRaisesMessage(response, 'Пароли не совпадают') class TestLogin(FixturesMixin, TestCase): def test_login(self): response = self.client.post('/login/', {'username': 'TestUser', 'password': 'password'}, follow=True) self.assertEqual(response.redirect_chain, [('/profile/', 302)]) class TestUploadToParse(FixturesMixin, TestCase): def test_get(self): response = self.client.get('/upload/', ) self.assertEqual(response.status_code, 200) self.assertEqual(Tab.objects.filter(owner=self.user)[0], self.tab_exist) def test_create_and_parse_corrupt_file(self): with open(self.file) as f: response = self.client.post( '/upload/', {'name': 'test1', 'file': f}, follow=True ) session = self.client.session session.save() tab = Tab.objects.get(pk=session['tab']) self.assertTrue(response.context['lines']) self.assertEqual(tab.name, 'test1') self.assertTrue(session['tab_is_new']) self.assertEqual(response.status_code, 200) self.assertEqual(response.redirect_chain, [('/parse/', 302)]) response = self.client.post('/parse/', {'col4': 'date', 'col3': 'name', 'col2': 'phone', 'col1': 'good', 'col0': 'pay'}, follow=True ) self.assertEqual(response.redirect_chain, [('/corrupt_data/', 302)]) self.assertEqual(response.status_code, 200) def test_update_and_parse(self): with open(self.file) as f: response = self.client.post( '/upload/', {'choice_exist_tab': self.tab_exist.id, 'file': f}, follow=True ) session = self.client.session session.save() tab = Tab.objects.get(pk=session['tab']) self.assertTrue(response.context['lines']) self.assertEqual(session['tab_is_new'], False) self.assertEqual(tab.name, self.tab_exist.name) self.assertEqual(response.redirect_chain, [('/parse/', 302)]) response = self.client.post('/parse/', self.column_order, follow=True ) tab = Tab.objects.get(pk=session['tab']) self.assertEqual( response.redirect_chain, [('/my_tables/' + tab.slug, 302)] ) class TestMyTables(FixturesMixin, TestCase): def test_get(self): response = self.client.get('/my_tables/') qs = response.context['list_tab'] self.assertSetEqual( set(qs), {self.tab_exist, Tab.objects.get(pk=2), Tab.objects.get(pk=3)} ) self.assertEqual(response.status_code, 200) class TestManageTab(FixturesMixin, TestCase): def setUp(self): super(TestManageTab, self).setUp() self.url = reverse('manage_tab', args=(self.tab_exist.slug, )) def test_get_post(self): response = self.client.get(self.url) session = self.client.session session.save() self.assertEqual(response.status_code, 200) class TestDeleteTab(FixturesMixin, TestCase): def test_post(self): test_tab = Tab(owner=self.user, name='test_tab_del') test_tab.save() url = reverse('delete', args=(test_tab.slug, )) response = self.client.post(url, follow=True) self.assertEqual(response.redirect_chain, [('/my_tables', 302), ('/my_tables/', 301)]) class TestLog(FixturesMixin, TestCase): def test_log(self): response = self.client.get('/log/') self.assertEqual(response.status_code, 200) class TestClientList(FixturesMixin, TestCase): def test_get(self): url = reverse('client_list', kwargs={'slug': self.tab_exist.slug, }) response = self.client.get(url) self.assertEqual(response.status_code, 200) class TestClientCard(FixturesMixin, TestCase): def test_get(self): new_client = Person.get_new_line(self.data) url = reverse('client_card', kwargs={'slug_tab': self.tab_exist.slug, 'slug': new_client.slug}) response = self.client.get(url) session = self.client.session session.save() self.assertEqual(response.status_code, 200) class TestRulesList(FixturesMixin, TestCase): def test_get(self): url = reverse('rules', kwargs={'slug': self.tab_exist.slug}) response = self.client.get(url) self.assertEqual(response.status_code, 200) class TestProfile(FixturesMixin, TestCase): def test_get(self): response = self.client.get('/profile/') self.assertEqual(response.status_code, 200) @mock.patch('rfmizer.sms.RocketSMS.check_balance', return_value=[True, 25, None]) def test_post(self, balance_mock): password = 'test_sms_pass' login = 'test_sms_login' response = self.client.post('/profile/', {'sms_login': login, 'sms_pass': password}, follow=True) hash_pass = hashlib.md5(password.encode('utf-8')).hexdigest() user = User.objects.get(pk=self.user.pk) self.assertEqual(user.profile.sms_login, login) self.assertEqual(user.profile.sms_pass, hash_pass) self.assertEqual(user.profile.balance, 25) self.assertEqual(response.status_code, 200) balance_mock.assert_called_once()
true
true
f72078f20b5cc5766f8c851d62a5d4fcbc04c993
13
py
Python
python/testData/inspections/PyUnresolvedReferencesInspection/ImportToContainingFileInPackage/p1/__init__.py
truthiswill/intellij-community
fff88cfb0dc168eea18ecb745d3e5b93f57b0b95
[ "Apache-2.0" ]
2
2019-04-28T07:48:50.000Z
2020-12-11T14:18:08.000Z
python/testData/inspections/PyUnresolvedReferencesInspection/ImportToContainingFileInPackage/p1/__init__.py
truthiswill/intellij-community
fff88cfb0dc168eea18ecb745d3e5b93f57b0b95
[ "Apache-2.0" ]
173
2018-07-05T13:59:39.000Z
2018-08-09T01:12:03.000Z
python/testData/inspections/PyUnresolvedReferencesInspection/ImportToContainingFileInPackage/p1/__init__.py
truthiswill/intellij-community
fff88cfb0dc168eea18ecb745d3e5b93f57b0b95
[ "Apache-2.0" ]
2
2020-03-15T08:57:37.000Z
2020-04-07T04:48:14.000Z
import p1.m1
6.5
12
0.769231
import p1.m1
true
true
f72079009d9d6b4d0c1dd53f8c56f7204272da9b
1,527
py
Python
firmware/adafruit-circuitpython-bundle-5.x-mpy-20200915/examples/st7735r_minitft_simpletest.py
freeglow/microcontroller-cpy
5adfda49da6eefaece81be2a2f26122d68736355
[ "MIT" ]
null
null
null
firmware/adafruit-circuitpython-bundle-5.x-mpy-20200915/examples/st7735r_minitft_simpletest.py
freeglow/microcontroller-cpy
5adfda49da6eefaece81be2a2f26122d68736355
[ "MIT" ]
null
null
null
firmware/adafruit-circuitpython-bundle-5.x-mpy-20200915/examples/st7735r_minitft_simpletest.py
freeglow/microcontroller-cpy
5adfda49da6eefaece81be2a2f26122d68736355
[ "MIT" ]
null
null
null
""" This test will initialize the display using displayio and draw a solid green background, a smaller purple rectangle, and some yellow text. """ import board import terminalio import displayio from adafruit_display_text import label from adafruit_st7735r import ST7735R # Release any resources currently in use for the displays displayio.release_displays() spi = board.SPI() tft_cs = board.D5 tft_dc = board.D6 display_bus = displayio.FourWire( spi, command=tft_dc, chip_select=tft_cs, reset=board.D9 ) display = ST7735R( display_bus, width=160, height=80, colstart=24, rotation=270, bgr=True ) # Make the display context splash = displayio.Group(max_size=10) display.show(splash) color_bitmap = displayio.Bitmap(160, 80, 1) color_palette = displayio.Palette(1) color_palette[0] = 0x00FF00 # Bright Green bg_sprite = displayio.TileGrid(color_bitmap, pixel_shader=color_palette, x=0, y=0) splash.append(bg_sprite) # Draw a smaller inner rectangle inner_bitmap = displayio.Bitmap(150, 70, 1) inner_palette = displayio.Palette(1) inner_palette[0] = 0xAA0088 # Purple inner_sprite = displayio.TileGrid(inner_bitmap, pixel_shader=inner_palette, x=5, y=5) splash.append(inner_sprite) # Draw a label text_group = displayio.Group(max_size=10, scale=2, x=11, y=40) text = "Hello World!" text_area = label.Label(terminalio.FONT, text=text, color=0xFFFF00) text_group.append(text_area) # Subgroup for text scaling splash.append(text_group) while True: pass
28.277778
86
0.749836
import board import terminalio import displayio from adafruit_display_text import label from adafruit_st7735r import ST7735R displayio.release_displays() spi = board.SPI() tft_cs = board.D5 tft_dc = board.D6 display_bus = displayio.FourWire( spi, command=tft_dc, chip_select=tft_cs, reset=board.D9 ) display = ST7735R( display_bus, width=160, height=80, colstart=24, rotation=270, bgr=True ) splash = displayio.Group(max_size=10) display.show(splash) color_bitmap = displayio.Bitmap(160, 80, 1) color_palette = displayio.Palette(1) color_palette[0] = 0x00FF00 bg_sprite = displayio.TileGrid(color_bitmap, pixel_shader=color_palette, x=0, y=0) splash.append(bg_sprite) inner_bitmap = displayio.Bitmap(150, 70, 1) inner_palette = displayio.Palette(1) inner_palette[0] = 0xAA0088 inner_sprite = displayio.TileGrid(inner_bitmap, pixel_shader=inner_palette, x=5, y=5) splash.append(inner_sprite) text_group = displayio.Group(max_size=10, scale=2, x=11, y=40) text = "Hello World!" text_area = label.Label(terminalio.FONT, text=text, color=0xFFFF00) text_group.append(text_area) splash.append(text_group) while True: pass
true
true
f7207935c2b023e55a08f2a1a9a84c47dc130d71
16,613
py
Python
model/model.py
sahara2001/editsql
d4325ac996d1ed0069def6d349e43e2a1914e761
[ "MIT" ]
null
null
null
model/model.py
sahara2001/editsql
d4325ac996d1ed0069def6d349e43e2a1914e761
[ "MIT" ]
null
null
null
model/model.py
sahara2001/editsql
d4325ac996d1ed0069def6d349e43e2a1914e761
[ "MIT" ]
null
null
null
""" Class for the Sequence to sequence model for ATIS.""" import os import torch import torch.nn.functional as F from . import torch_utils from . import utils_bert from data_util.vocabulary import DEL_TOK, UNK_TOK from .encoder import Encoder, Encoder_Gnn from .embedder import Embedder from .token_predictor import construct_token_predictor import numpy as np from data_util.atis_vocab import ATISVocabulary from .gated_graph_conv import GatedGraphConv def get_token_indices(token, index_to_token): """ Maps from a gold token (string) to a list of indices. Inputs: token (string): String to look up. index_to_token (list of tokens): Ordered list of tokens. Returns: list of int, representing the indices of the token in the probability distribution. """ if token in index_to_token: if len(set(index_to_token)) == len(index_to_token): # no duplicates return [index_to_token.index(token)] else: indices = [] for index, other_token in enumerate(index_to_token): if token == other_token: indices.append(index) assert len(indices) == len(set(indices)) return indices else: return [index_to_token.index(UNK_TOK)] def flatten_utterances(utterances): """ Gets a flat sequence from a sequence of utterances. Inputs: utterances (list of list of str): Utterances to concatenate. Returns: list of str, representing the flattened sequence with separating delimiter tokens. """ sequence = [] for i, utterance in enumerate(utterances): sequence.extend(utterance) if i < len(utterances) - 1: sequence.append(DEL_TOK) return sequence def encode_snippets_with_states(snippets, states): """ Encodes snippets by using previous query states instead. Inputs: snippets (list of Snippet): Input snippets. states (list of dy.Expression): Previous hidden states to use. TODO: should this by dy.Expression or vector values? """ for snippet in snippets: snippet.set_embedding(torch.cat([states[snippet.startpos],states[snippet.endpos]], dim=0)) return snippets def load_word_embeddings(input_vocabulary, output_vocabulary, output_vocabulary_schema, params): # print(output_vocabulary.inorder_tokens) # print() def read_glove_embedding(embedding_filename, embedding_size): glove_embeddings = {} with open(embedding_filename) as f: cnt = 1 for line in f: cnt += 1 if params.debug or not params.train: if cnt == 1000: print('Read 1000 word embeddings') break l_split = line.split() word = " ".join(l_split[0:len(l_split) - embedding_size]) embedding = np.array([float(val) for val in l_split[-embedding_size:]]) glove_embeddings[word] = embedding return glove_embeddings print('Loading Glove Embedding from', params.embedding_filename) glove_embedding_size = 300 glove_embeddings = read_glove_embedding(params.embedding_filename, glove_embedding_size) print('Done') input_embedding_size = glove_embedding_size def create_word_embeddings(vocab): vocabulary_embeddings = np.zeros((len(vocab), glove_embedding_size), dtype=np.float32) vocabulary_tokens = vocab.inorder_tokens glove_oov = 0 para_oov = 0 for token in vocabulary_tokens: token_id = vocab.token_to_id(token) if token in glove_embeddings: vocabulary_embeddings[token_id][:glove_embedding_size] = glove_embeddings[token] else: glove_oov += 1 print('Glove OOV:', glove_oov, 'Para OOV', para_oov, 'Total', len(vocab)) return vocabulary_embeddings input_vocabulary_embeddings = create_word_embeddings(input_vocabulary) output_vocabulary_embeddings = create_word_embeddings(output_vocabulary) output_vocabulary_schema_embeddings = None if output_vocabulary_schema: output_vocabulary_schema_embeddings = create_word_embeddings(output_vocabulary_schema) return input_vocabulary_embeddings, output_vocabulary_embeddings, output_vocabulary_schema_embeddings, input_embedding_size class ATISModel(torch.nn.Module): """ Sequence-to-sequence model for predicting a SQL query given an utterance and an interaction prefix. """ def __init__( self, params, input_vocabulary, output_vocabulary, output_vocabulary_schema, anonymizer): super().__init__() self.params = params if params.use_bert: self.model_bert, self.tokenizer, self.bert_config = utils_bert.get_bert(params) self.gnn=None if 'atis' not in params.data_directory: if params.use_bert: if params.use_gnn: encoder_input_size = self.bert_config.hidden_size encoder_output_size = params.encoder_state_size self.gnn = GatedGraphConv(encoder_output_size, 2, 3) #input_dim, num_timesteps, num_edge_types, input_vocabulary_embeddings, output_vocabulary_embeddings, output_vocabulary_schema_embeddings, input_embedding_size = load_word_embeddings(input_vocabulary, output_vocabulary, output_vocabulary_schema, params) # Create the output embeddings self.output_embedder = Embedder(params.output_embedding_size, name="output-embedding", initializer=output_vocabulary_embeddings, vocabulary=output_vocabulary, anonymizer=anonymizer, freeze=False) self.column_name_token_embedder = None else: input_vocabulary_embeddings, output_vocabulary_embeddings, output_vocabulary_schema_embeddings, input_embedding_size = load_word_embeddings(input_vocabulary, output_vocabulary, output_vocabulary_schema, params) params.input_embedding_size = input_embedding_size self.params.input_embedding_size = input_embedding_size # Create the input embeddings self.input_embedder = Embedder(params.input_embedding_size, name="input-embedding", initializer=input_vocabulary_embeddings, vocabulary=input_vocabulary, anonymizer=anonymizer, freeze=params.freeze) # Create the output embeddings self.output_embedder = Embedder(params.output_embedding_size, name="output-embedding", initializer=output_vocabulary_embeddings, vocabulary=output_vocabulary, anonymizer=anonymizer, freeze=False) self.column_name_token_embedder = Embedder(params.input_embedding_size, name="schema-embedding", initializer=output_vocabulary_schema_embeddings, vocabulary=output_vocabulary_schema, anonymizer=anonymizer, freeze=params.freeze) else: # Create the input embeddings self.input_embedder = Embedder(params.input_embedding_size, name="input-embedding", vocabulary=input_vocabulary, anonymizer=anonymizer, freeze=False) # Create the output embeddings self.output_embedder = Embedder(params.output_embedding_size, name="output-embedding", vocabulary=output_vocabulary, anonymizer=anonymizer, freeze=False) self.column_name_token_embedder = None # Create the encoder encoder_input_size = params.input_embedding_size encoder_output_size = params.encoder_state_size if params.use_bert: encoder_input_size = self.bert_config.hidden_size if params.discourse_level_lstm: encoder_input_size += params.encoder_state_size / 2 self.utterance_encoder = Encoder(params.encoder_num_layers, encoder_input_size, encoder_output_size) # Positional embedder for utterances attention_key_size = params.encoder_state_size self.schema_attention_key_size = attention_key_size if params.state_positional_embeddings: attention_key_size += params.positional_embedding_size self.positional_embedder = Embedder( params.positional_embedding_size, name="positional-embedding", num_tokens=params.maximum_utterances) self.utterance_attention_key_size = attention_key_size # Create the discourse-level LSTM parameters if params.discourse_level_lstm: self.discourse_lstms = torch_utils.create_multilayer_lstm_params(1, params.encoder_state_size, params.encoder_state_size / 2, "LSTM-t") self.initial_discourse_state = torch_utils.add_params(tuple([params.encoder_state_size / 2]), "V-turn-state-0") # Snippet encoder final_snippet_size = 0 if params.use_snippets and not params.previous_decoder_snippet_encoding: snippet_encoding_size = int(params.encoder_state_size / 2) final_snippet_size = params.encoder_state_size if params.snippet_age_embedding: snippet_encoding_size -= int( params.snippet_age_embedding_size / 4) self.snippet_age_embedder = Embedder( params.snippet_age_embedding_size, name="snippet-age-embedding", num_tokens=params.max_snippet_age_embedding) final_snippet_size = params.encoder_state_size + params.snippet_age_embedding_size / 2 self.snippet_encoder = Encoder(params.snippet_num_layers, params.output_embedding_size, snippet_encoding_size) # Previous query Encoder if params.use_previous_query: self.query_encoder = Encoder(params.encoder_num_layers, params.output_embedding_size, params.encoder_state_size) self.final_snippet_size = final_snippet_size self.dropout = 0. def _encode_snippets(self, previous_query, snippets, input_schema): """ Computes a single vector representation for each snippet. Inputs: previous_query (list of str): Previous query in the interaction. snippets (list of Snippet): Snippets extracted from the previous Returns: list of Snippets, where the embedding is set to a vector. """ startpoints = [snippet.startpos for snippet in snippets] endpoints = [snippet.endpos for snippet in snippets] assert len(startpoints) == 0 or min(startpoints) >= 0 if input_schema: assert len(endpoints) == 0 or max(endpoints) <= len(previous_query) else: assert len(endpoints) == 0 or max(endpoints) < len(previous_query) snippet_embedder = lambda query_token: self.get_query_token_embedding(query_token, input_schema) if previous_query and snippets: _, previous_outputs = self.snippet_encoder( previous_query, snippet_embedder, dropout_amount=self.dropout) assert len(previous_outputs) == len(previous_query) for snippet in snippets: if input_schema: embedding = torch.cat([previous_outputs[snippet.startpos],previous_outputs[snippet.endpos-1]], dim=0) else: embedding = torch.cat([previous_outputs[snippet.startpos],previous_outputs[snippet.endpos]], dim=0) if self.params.snippet_age_embedding: embedding = torch.cat([embedding, self.snippet_age_embedder(min(snippet.age, self.params.max_snippet_age_embedding - 1))], dim=0) snippet.set_embedding(embedding) return snippets def _initialize_discourse_states(self): discourse_state = self.initial_discourse_state discourse_lstm_states = [] for lstm in self.discourse_lstms: hidden_size = lstm.weight_hh.size()[1] if lstm.weight_hh.is_cuda: h_0 = torch.cuda.FloatTensor(1,hidden_size).fill_(0) c_0 = torch.cuda.FloatTensor(1,hidden_size).fill_(0) else: h_0 = torch.zeros(1,hidden_size) c_0 = torch.zeros(1,hidden_size) discourse_lstm_states.append((h_0, c_0)) return discourse_state, discourse_lstm_states def _add_positional_embeddings(self, hidden_states, utterances, group=False): grouped_states = [] start_index = 0 for utterance in utterances: grouped_states.append(hidden_states[start_index:start_index + len(utterance)]) start_index += len(utterance) assert len(hidden_states) == sum([len(seq) for seq in grouped_states]) == sum([len(utterance) for utterance in utterances]) new_states = [] flat_sequence = [] num_utterances_to_keep = min(self.params.maximum_utterances, len(utterances)) for i, (states, utterance) in enumerate(zip( grouped_states[-num_utterances_to_keep:], utterances[-num_utterances_to_keep:])): positional_sequence = [] index = num_utterances_to_keep - i - 1 for state in states: positional_sequence.append(torch.cat([state, self.positional_embedder(index)], dim=0)) assert len(positional_sequence) == len(utterance), \ "Expected utterance and state sequence length to be the same, " \ + "but they were " + str(len(utterance)) \ + " and " + str(len(positional_sequence)) if group: new_states.append(positional_sequence) else: new_states.extend(positional_sequence) flat_sequence.extend(utterance) return new_states, flat_sequence def build_optim(self): params_trainer = [] params_bert_trainer = [] for name, param in self.named_parameters(): if param.requires_grad: if 'model_bert' in name: params_bert_trainer.append(param) else: params_trainer.append(param) self.trainer = torch.optim.Adam(params_trainer, lr=self.params.initial_learning_rate) if self.params.fine_tune_bert: self.bert_trainer = torch.optim.Adam(params_bert_trainer, lr=self.params.lr_bert) def set_dropout(self, value): """ Sets the dropout to a specified value. Inputs: value (float): Value to set dropout to. """ self.dropout = value def set_learning_rate(self, value): """ Sets the learning rate for the trainer. Inputs: value (float): The new learning rate. """ for param_group in self.trainer.param_groups: param_group['lr'] = value def save(self, filename): """ Saves the model to the specified filename. Inputs: filename (str): The filename to save to. """ torch.save(self.state_dict(), filename) def load(self, filename): """ Loads saved parameters into the parameter collection. Inputs: filename (str): Name of file containing parameters. """ self.load_state_dict(torch.load(filename)) print("Loaded model from file " + filename)
41.325871
226
0.618612
import os import torch import torch.nn.functional as F from . import torch_utils from . import utils_bert from data_util.vocabulary import DEL_TOK, UNK_TOK from .encoder import Encoder, Encoder_Gnn from .embedder import Embedder from .token_predictor import construct_token_predictor import numpy as np from data_util.atis_vocab import ATISVocabulary from .gated_graph_conv import GatedGraphConv def get_token_indices(token, index_to_token): if token in index_to_token: if len(set(index_to_token)) == len(index_to_token): return [index_to_token.index(token)] else: indices = [] for index, other_token in enumerate(index_to_token): if token == other_token: indices.append(index) assert len(indices) == len(set(indices)) return indices else: return [index_to_token.index(UNK_TOK)] def flatten_utterances(utterances): sequence = [] for i, utterance in enumerate(utterances): sequence.extend(utterance) if i < len(utterances) - 1: sequence.append(DEL_TOK) return sequence def encode_snippets_with_states(snippets, states): for snippet in snippets: snippet.set_embedding(torch.cat([states[snippet.startpos],states[snippet.endpos]], dim=0)) return snippets def load_word_embeddings(input_vocabulary, output_vocabulary, output_vocabulary_schema, params): def read_glove_embedding(embedding_filename, embedding_size): glove_embeddings = {} with open(embedding_filename) as f: cnt = 1 for line in f: cnt += 1 if params.debug or not params.train: if cnt == 1000: print('Read 1000 word embeddings') break l_split = line.split() word = " ".join(l_split[0:len(l_split) - embedding_size]) embedding = np.array([float(val) for val in l_split[-embedding_size:]]) glove_embeddings[word] = embedding return glove_embeddings print('Loading Glove Embedding from', params.embedding_filename) glove_embedding_size = 300 glove_embeddings = read_glove_embedding(params.embedding_filename, glove_embedding_size) print('Done') input_embedding_size = glove_embedding_size def create_word_embeddings(vocab): vocabulary_embeddings = np.zeros((len(vocab), glove_embedding_size), dtype=np.float32) vocabulary_tokens = vocab.inorder_tokens glove_oov = 0 para_oov = 0 for token in vocabulary_tokens: token_id = vocab.token_to_id(token) if token in glove_embeddings: vocabulary_embeddings[token_id][:glove_embedding_size] = glove_embeddings[token] else: glove_oov += 1 print('Glove OOV:', glove_oov, 'Para OOV', para_oov, 'Total', len(vocab)) return vocabulary_embeddings input_vocabulary_embeddings = create_word_embeddings(input_vocabulary) output_vocabulary_embeddings = create_word_embeddings(output_vocabulary) output_vocabulary_schema_embeddings = None if output_vocabulary_schema: output_vocabulary_schema_embeddings = create_word_embeddings(output_vocabulary_schema) return input_vocabulary_embeddings, output_vocabulary_embeddings, output_vocabulary_schema_embeddings, input_embedding_size class ATISModel(torch.nn.Module): def __init__( self, params, input_vocabulary, output_vocabulary, output_vocabulary_schema, anonymizer): super().__init__() self.params = params if params.use_bert: self.model_bert, self.tokenizer, self.bert_config = utils_bert.get_bert(params) self.gnn=None if 'atis' not in params.data_directory: if params.use_bert: if params.use_gnn: encoder_input_size = self.bert_config.hidden_size encoder_output_size = params.encoder_state_size self.gnn = GatedGraphConv(encoder_output_size, 2, 3) input_vocabulary_embeddings, output_vocabulary_embeddings, output_vocabulary_schema_embeddings, input_embedding_size = load_word_embeddings(input_vocabulary, output_vocabulary, output_vocabulary_schema, params) self.output_embedder = Embedder(params.output_embedding_size, name="output-embedding", initializer=output_vocabulary_embeddings, vocabulary=output_vocabulary, anonymizer=anonymizer, freeze=False) self.column_name_token_embedder = None else: input_vocabulary_embeddings, output_vocabulary_embeddings, output_vocabulary_schema_embeddings, input_embedding_size = load_word_embeddings(input_vocabulary, output_vocabulary, output_vocabulary_schema, params) params.input_embedding_size = input_embedding_size self.params.input_embedding_size = input_embedding_size self.input_embedder = Embedder(params.input_embedding_size, name="input-embedding", initializer=input_vocabulary_embeddings, vocabulary=input_vocabulary, anonymizer=anonymizer, freeze=params.freeze) self.output_embedder = Embedder(params.output_embedding_size, name="output-embedding", initializer=output_vocabulary_embeddings, vocabulary=output_vocabulary, anonymizer=anonymizer, freeze=False) self.column_name_token_embedder = Embedder(params.input_embedding_size, name="schema-embedding", initializer=output_vocabulary_schema_embeddings, vocabulary=output_vocabulary_schema, anonymizer=anonymizer, freeze=params.freeze) else: self.input_embedder = Embedder(params.input_embedding_size, name="input-embedding", vocabulary=input_vocabulary, anonymizer=anonymizer, freeze=False) self.output_embedder = Embedder(params.output_embedding_size, name="output-embedding", vocabulary=output_vocabulary, anonymizer=anonymizer, freeze=False) self.column_name_token_embedder = None encoder_input_size = params.input_embedding_size encoder_output_size = params.encoder_state_size if params.use_bert: encoder_input_size = self.bert_config.hidden_size if params.discourse_level_lstm: encoder_input_size += params.encoder_state_size / 2 self.utterance_encoder = Encoder(params.encoder_num_layers, encoder_input_size, encoder_output_size) attention_key_size = params.encoder_state_size self.schema_attention_key_size = attention_key_size if params.state_positional_embeddings: attention_key_size += params.positional_embedding_size self.positional_embedder = Embedder( params.positional_embedding_size, name="positional-embedding", num_tokens=params.maximum_utterances) self.utterance_attention_key_size = attention_key_size if params.discourse_level_lstm: self.discourse_lstms = torch_utils.create_multilayer_lstm_params(1, params.encoder_state_size, params.encoder_state_size / 2, "LSTM-t") self.initial_discourse_state = torch_utils.add_params(tuple([params.encoder_state_size / 2]), "V-turn-state-0") final_snippet_size = 0 if params.use_snippets and not params.previous_decoder_snippet_encoding: snippet_encoding_size = int(params.encoder_state_size / 2) final_snippet_size = params.encoder_state_size if params.snippet_age_embedding: snippet_encoding_size -= int( params.snippet_age_embedding_size / 4) self.snippet_age_embedder = Embedder( params.snippet_age_embedding_size, name="snippet-age-embedding", num_tokens=params.max_snippet_age_embedding) final_snippet_size = params.encoder_state_size + params.snippet_age_embedding_size / 2 self.snippet_encoder = Encoder(params.snippet_num_layers, params.output_embedding_size, snippet_encoding_size) if params.use_previous_query: self.query_encoder = Encoder(params.encoder_num_layers, params.output_embedding_size, params.encoder_state_size) self.final_snippet_size = final_snippet_size self.dropout = 0. def _encode_snippets(self, previous_query, snippets, input_schema): startpoints = [snippet.startpos for snippet in snippets] endpoints = [snippet.endpos for snippet in snippets] assert len(startpoints) == 0 or min(startpoints) >= 0 if input_schema: assert len(endpoints) == 0 or max(endpoints) <= len(previous_query) else: assert len(endpoints) == 0 or max(endpoints) < len(previous_query) snippet_embedder = lambda query_token: self.get_query_token_embedding(query_token, input_schema) if previous_query and snippets: _, previous_outputs = self.snippet_encoder( previous_query, snippet_embedder, dropout_amount=self.dropout) assert len(previous_outputs) == len(previous_query) for snippet in snippets: if input_schema: embedding = torch.cat([previous_outputs[snippet.startpos],previous_outputs[snippet.endpos-1]], dim=0) else: embedding = torch.cat([previous_outputs[snippet.startpos],previous_outputs[snippet.endpos]], dim=0) if self.params.snippet_age_embedding: embedding = torch.cat([embedding, self.snippet_age_embedder(min(snippet.age, self.params.max_snippet_age_embedding - 1))], dim=0) snippet.set_embedding(embedding) return snippets def _initialize_discourse_states(self): discourse_state = self.initial_discourse_state discourse_lstm_states = [] for lstm in self.discourse_lstms: hidden_size = lstm.weight_hh.size()[1] if lstm.weight_hh.is_cuda: h_0 = torch.cuda.FloatTensor(1,hidden_size).fill_(0) c_0 = torch.cuda.FloatTensor(1,hidden_size).fill_(0) else: h_0 = torch.zeros(1,hidden_size) c_0 = torch.zeros(1,hidden_size) discourse_lstm_states.append((h_0, c_0)) return discourse_state, discourse_lstm_states def _add_positional_embeddings(self, hidden_states, utterances, group=False): grouped_states = [] start_index = 0 for utterance in utterances: grouped_states.append(hidden_states[start_index:start_index + len(utterance)]) start_index += len(utterance) assert len(hidden_states) == sum([len(seq) for seq in grouped_states]) == sum([len(utterance) for utterance in utterances]) new_states = [] flat_sequence = [] num_utterances_to_keep = min(self.params.maximum_utterances, len(utterances)) for i, (states, utterance) in enumerate(zip( grouped_states[-num_utterances_to_keep:], utterances[-num_utterances_to_keep:])): positional_sequence = [] index = num_utterances_to_keep - i - 1 for state in states: positional_sequence.append(torch.cat([state, self.positional_embedder(index)], dim=0)) assert len(positional_sequence) == len(utterance), \ "Expected utterance and state sequence length to be the same, " \ + "but they were " + str(len(utterance)) \ + " and " + str(len(positional_sequence)) if group: new_states.append(positional_sequence) else: new_states.extend(positional_sequence) flat_sequence.extend(utterance) return new_states, flat_sequence def build_optim(self): params_trainer = [] params_bert_trainer = [] for name, param in self.named_parameters(): if param.requires_grad: if 'model_bert' in name: params_bert_trainer.append(param) else: params_trainer.append(param) self.trainer = torch.optim.Adam(params_trainer, lr=self.params.initial_learning_rate) if self.params.fine_tune_bert: self.bert_trainer = torch.optim.Adam(params_bert_trainer, lr=self.params.lr_bert) def set_dropout(self, value): self.dropout = value def set_learning_rate(self, value): for param_group in self.trainer.param_groups: param_group['lr'] = value def save(self, filename): torch.save(self.state_dict(), filename) def load(self, filename): self.load_state_dict(torch.load(filename)) print("Loaded model from file " + filename)
true
true
f7207971f79f86b58e5d4a4b9ee3f1c8c602689e
1,890
py
Python
MNISTT.py
ankit9437/MNIST
bf620e7779a5383c2ad87cf89cd11651963bd7c5
[ "MIT" ]
null
null
null
MNISTT.py
ankit9437/MNIST
bf620e7779a5383c2ad87cf89cd11651963bd7c5
[ "MIT" ]
null
null
null
MNISTT.py
ankit9437/MNIST
bf620e7779a5383c2ad87cf89cd11651963bd7c5
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ Created on Sun Dec 15 10:58:44 2019 @author: DELL """ from __future__ import print_function, division import numpy as np import pandas as pd import matplotlib.pyplot as plt def d(u, v): diff = u - v return diff.dot(diff) def get_data(limit=None): print("Reading in and transforming data...") df = pd.read_csv('train.csv') data = df.values np.random.shuffle(data) X = data[:, 1:] / 255.0 # data is from 0..255 Y = data[:, 0] if limit is not None: X, Y = X[:limit], Y[:limit] return X, Y def plot_k_means(X, K, max_iter=5, beta=3.0, show_plots=False): N, D = X.shape # R = np.zeros((N, K)) exponents = np.empty((N, K)) # initialize M to random initial_centers = np.random.choice(N, K, replace=False) M = X[initial_centers] k = 0 for i in range(max_iter): k += 1 # step 1: determine assignments / resposibilities # is this inefficient? for k in range(K): for n in range(N): exponents[n,k] = np.exp(-beta*d(M[k], X[n])) R = exponents / exponents.sum(axis=1, keepdims=True) # step 2: recalculate means for k in range(K): M[k] = R[:,k].dot(X) / R[:,k].sum() return M, R def main(): # mnist data X, Y = get_data(1000) # simple data # X = get_simple_data() # Y = np.array([0]*300 + [1]*300 + [2]*300) print("Number of data points:", len(Y)) M, R = plot_k_means(X, len(set(Y))) # Exercise: Try different values of K and compare the evaluation metrics # they should look like digits for k in range(len(M)): im = M[k].reshape(28, 28) plt.imshow(im, cmap='Blues') plt.show() if __name__ == "__main__": main()
21.976744
77
0.539153
from __future__ import print_function, division import numpy as np import pandas as pd import matplotlib.pyplot as plt def d(u, v): diff = u - v return diff.dot(diff) def get_data(limit=None): print("Reading in and transforming data...") df = pd.read_csv('train.csv') data = df.values np.random.shuffle(data) X = data[:, 1:] / 255.0 Y = data[:, 0] if limit is not None: X, Y = X[:limit], Y[:limit] return X, Y def plot_k_means(X, K, max_iter=5, beta=3.0, show_plots=False): N, D = X.shape exponents = np.empty((N, K)) initial_centers = np.random.choice(N, K, replace=False) M = X[initial_centers] k = 0 for i in range(max_iter): k += 1 for k in range(K): for n in range(N): exponents[n,k] = np.exp(-beta*d(M[k], X[n])) R = exponents / exponents.sum(axis=1, keepdims=True) for k in range(K): M[k] = R[:,k].dot(X) / R[:,k].sum() return M, R def main(): X, Y = get_data(1000) print("Number of data points:", len(Y)) M, R = plot_k_means(X, len(set(Y))) for k in range(len(M)): im = M[k].reshape(28, 28) plt.imshow(im, cmap='Blues') plt.show() if __name__ == "__main__": main()
true
true
f72079f7da23aae91f56118b998102076ab9cb85
5,205
py
Python
email-finder.py
shivangraikar/Twitter-Data-Mining-For-Targeted-Marketing
d12fe807187d438041b4497cbb82ad9ef14d4dbf
[ "MIT" ]
5
2021-02-25T12:10:02.000Z
2021-11-13T04:03:42.000Z
email-finder.py
shivangraikar/Twitter-Data-Mining-For-Targeted-Marketing
d12fe807187d438041b4497cbb82ad9ef14d4dbf
[ "MIT" ]
null
null
null
email-finder.py
shivangraikar/Twitter-Data-Mining-For-Targeted-Marketing
d12fe807187d438041b4497cbb82ad9ef14d4dbf
[ "MIT" ]
3
2021-02-25T12:10:06.000Z
2021-03-21T20:26:15.000Z
import string import time import threading import urllib import re import io import sys from time import sleep import pickle import pandas as pd import psycopg2 def formats(first, middle, last, domain): """ Create a list of 30 possible email formats combining: - First name: [empty] | Full | Initial | - Delimeter: [empty] | . | _ | - - Last name: [empty] | Full | Initial | """ list = [] if len(last)==0: list.append(first + '@' + domain) # first@example.com else: list.append(first[0] + last + '@' + domain) # flast@example.com list.append(first[0] + '.' + last + '@' + domain) # f.last@example.com list.append(first[0] + '_' + last + '@' + domain) # f_last@example.com list.append(first + '@' + domain) # first@example.com list.append(first + last + '@' + domain) # firstlast@example.com list.append(first + '.' + last + '@' + domain) # first.last@example.com list.append(first + '_' + last + '@' + domain) # first_last@example.com list.append(first + '-' + last + '@' + domain) # first-last@example.com list.append(first + last[0] + '@' + domain) # fistl@example.com list.append(first + '.' + last[0] + '@' + domain) # first.l@example.com list.append(first + '_' + last[0] + '@' + domain) # fist_l@example.com list.append(first[0] + middle + last + '@' + domain) # fmiddlelast@example.com list.append(first[0] + '.' + middle + last + '@' + domain) # f.middlelast@example.com list.append(first[0] + middle + '.' + last + '@' + domain) # fmiddle.last@example.com list.append(first[0] + '_' + middle+ last + '@' + domain) # f_middlelast@example.com list.append(first[0] + middle +'_' + last + '@' + domain) # fmiddle_last@example.com list.append(first + middle+ last + '@' + domain) # firstmiddlelast@example.com list.append(first + middle + '.' + last + '@' + domain) # firstmiddle.last@example.com list.append(first + '.' + middle + last + '@' + domain) # first.middlelast@example.com list.append(first + '_' + middle + last + '@' + domain) # first_last@example.com list.append(first + middle + '_' + last + '@' + domain) # first_last@example.com list.append(first + middle+ last[0] + '@' + domain) # firstmiddlel@example.com list.append(first + '.' + middle +last[0] + '@' + domain) # first.middlel@example.com list.append(first + middle + '.' +last[0] + '@' + domain) # firstmiddle.l@example.com list.append(first + '_' + middle +last[0] + '@' + domain) # first_middlel@example.com list.append(first + middle +'_' + last[0] + '@' + domain) # firstmiddle_l@example.com list.append(last + '@' + domain) # last@example.com list.append(last + first+ '@' + domain) # lastfirst@example.com list.append(last + '.' + first + '@' + domain) # last.first@example.com list.append(last + '_' + first + '@' + domain) # last_first@example.com list.append(last[0] + '.' + first + '@' + domain) # l.first@example.com list.append(last[0] + first + '@' + domain) # lfirst@example.com list.append(last + first[0] + '@' + domain) # lastf@example.com list.append(last + '.' + first[0] + '@' + domain) # last.f@example.com list.append(last + '_' + first[0] + '@' + domain) # last_f@example.com return(list) val="select distinct name from keywords" try: conn = psycopg2.connect(database='Hiranandani', user = "postgres", password = "parth123n@#*", host = "127.0.0.1", port = "5432") except: print("Create database first") df=pd.read_sql(val,conn) uname=list() for i in df['name']: uname.append(i.translate(str.maketrans('', '', string.punctuation))) a=['dr','ca','er'] notdrca=list() for i in uname: if any(x in i.lower() for x in a): continue else: notdrca.append(i) len2=list() l1=list() l3=list() ln=list() email_list=list() for i in notdrca: if any(x in i.lower() for x in a): print(i) for i in notdrca: try: i=i.lower() s=i.split() if len(s)==2: email_list.extend(formats(s[0],s[1],'','gmail.com')) len2.append(i) elif len(s)==1: email_list.extend(formats(s[0],'','','gmail.com')) l1.append(i) elif len(s)==3: email_list.extend(formats(s[0],s[1],s[2],'gmail.com')) l3.append(i) elif len(s)>3: ln.append(i) continue except: continue try: h=open('emails.pickle','wb') except Exception as e: print(e) pickle.dump(email_list,h) regex = '^\w+([\.-]?\w+)*@\w+([\.-]?\w+)*(\.\w{2,3})+$' match=re.match(regex,'harsha_nihar@yahoon') if match==None: print(match)
36.65493
136
0.529491
import string import time import threading import urllib import re import io import sys from time import sleep import pickle import pandas as pd import psycopg2 def formats(first, middle, last, domain): list = [] if len(last)==0: list.append(first + '@' + domain) else: list.append(first[0] + last + '@' + domain) list.append(first[0] + '.' + last + '@' + domain) list.append(first[0] + '_' + last + '@' + domain) list.append(first + '@' + domain) list.append(first + last + '@' + domain) list.append(first + '.' + last + '@' + domain) list.append(first + '_' + last + '@' + domain) list.append(first + '-' + last + '@' + domain) list.append(first + last[0] + '@' + domain) list.append(first + '.' + last[0] + '@' + domain) list.append(first + '_' + last[0] + '@' + domain) list.append(first[0] + middle + last + '@' + domain) list.append(first[0] + '.' + middle + last + '@' + domain) list.append(first[0] + middle + '.' + last + '@' + domain) list.append(first[0] + '_' + middle+ last + '@' + domain) list.append(first[0] + middle +'_' + last + '@' + domain) list.append(first + middle+ last + '@' + domain) list.append(first + middle + '.' + last + '@' + domain) list.append(first + '.' + middle + last + '@' + domain) list.append(first + '_' + middle + last + '@' + domain) list.append(first + middle + '_' + last + '@' + domain) list.append(first + middle+ last[0] + '@' + domain) list.append(first + '.' + middle +last[0] + '@' + domain) list.append(first + middle + '.' +last[0] + '@' + domain) list.append(first + '_' + middle +last[0] + '@' + domain) list.append(first + middle +'_' + last[0] + '@' + domain) list.append(last + '@' + domain) list.append(last + first+ '@' + domain) list.append(last + '.' + first + '@' + domain) list.append(last + '_' + first + '@' + domain) list.append(last[0] + '.' + first + '@' + domain) list.append(last[0] + first + '@' + domain) list.append(last + first[0] + '@' + domain) list.append(last + '.' + first[0] + '@' + domain) list.append(last + '_' + first[0] + '@' + domain) return(list) val="select distinct name from keywords" try: conn = psycopg2.connect(database='Hiranandani', user = "postgres", password = "parth123n@#*", host = "127.0.0.1", port = "5432") except: print("Create database first") df=pd.read_sql(val,conn) uname=list() for i in df['name']: uname.append(i.translate(str.maketrans('', '', string.punctuation))) a=['dr','ca','er'] notdrca=list() for i in uname: if any(x in i.lower() for x in a): continue else: notdrca.append(i) len2=list() l1=list() l3=list() ln=list() email_list=list() for i in notdrca: if any(x in i.lower() for x in a): print(i) for i in notdrca: try: i=i.lower() s=i.split() if len(s)==2: email_list.extend(formats(s[0],s[1],'','gmail.com')) len2.append(i) elif len(s)==1: email_list.extend(formats(s[0],'','','gmail.com')) l1.append(i) elif len(s)==3: email_list.extend(formats(s[0],s[1],s[2],'gmail.com')) l3.append(i) elif len(s)>3: ln.append(i) continue except: continue try: h=open('emails.pickle','wb') except Exception as e: print(e) pickle.dump(email_list,h) regex = '^\w+([\.-]?\w+)*@\w+([\.-]?\w+)*(\.\w{2,3})+$' match=re.match(regex,'harsha_nihar@yahoon') if match==None: print(match)
true
true
f7207a2b951aa4caf689bd23c876ef2c79f64116
22,958
py
Python
lib/python3.7/site-packages/django/db/backends/sqlite3/base.py
Boring-Mind/DjangoGirls1
54ac8f01d12785470fd5a4ece759206639997122
[ "Apache-2.0" ]
304
2015-01-06T18:02:49.000Z
2021-12-11T18:08:37.000Z
lib/python3.7/site-packages/django/db/backends/sqlite3/base.py
Boring-Mind/DjangoGirls1
54ac8f01d12785470fd5a4ece759206639997122
[ "Apache-2.0" ]
123
2019-09-10T14:48:01.000Z
2019-11-28T21:24:06.000Z
virtual/lib/python3.6/site-packages/django/db/backends/sqlite3/base.py
Krasivaya/Tracks
c18d1c9222dff39e4678d44495a8a7d9434339ff
[ "MIT" ]
41
2015-04-11T14:58:02.000Z
2021-11-13T20:47:58.000Z
""" SQLite backend for the sqlite3 module in the standard library. """ import datetime import decimal import functools import math import operator import re import statistics import warnings from itertools import chain from sqlite3 import dbapi2 as Database import pytz from django.core.exceptions import ImproperlyConfigured from django.db import utils from django.db.backends import utils as backend_utils from django.db.backends.base.base import BaseDatabaseWrapper from django.utils import timezone from django.utils.dateparse import parse_datetime, parse_time from django.utils.duration import duration_microseconds from .client import DatabaseClient # isort:skip from .creation import DatabaseCreation # isort:skip from .features import DatabaseFeatures # isort:skip from .introspection import DatabaseIntrospection # isort:skip from .operations import DatabaseOperations # isort:skip from .schema import DatabaseSchemaEditor # isort:skip def decoder(conv_func): """ Convert bytestrings from Python's sqlite3 interface to a regular string. """ return lambda s: conv_func(s.decode()) def none_guard(func): """ Decorator that returns None if any of the arguments to the decorated function are None. Many SQL functions return NULL if any of their arguments are NULL. This decorator simplifies the implementation of this for the custom functions registered below. """ @functools.wraps(func) def wrapper(*args, **kwargs): return None if None in args else func(*args, **kwargs) return wrapper def list_aggregate(function): """ Return an aggregate class that accumulates values in a list and applies the provided function to the data. """ return type('ListAggregate', (list,), {'finalize': function, 'step': list.append}) def check_sqlite_version(): if Database.sqlite_version_info < (3, 8, 3): raise ImproperlyConfigured('SQLite 3.8.3 or later is required (found %s).' % Database.sqlite_version) check_sqlite_version() Database.register_converter("bool", b'1'.__eq__) Database.register_converter("time", decoder(parse_time)) Database.register_converter("datetime", decoder(parse_datetime)) Database.register_converter("timestamp", decoder(parse_datetime)) Database.register_converter("TIMESTAMP", decoder(parse_datetime)) Database.register_adapter(decimal.Decimal, str) class DatabaseWrapper(BaseDatabaseWrapper): vendor = 'sqlite' display_name = 'SQLite' # SQLite doesn't actually support most of these types, but it "does the right # thing" given more verbose field definitions, so leave them as is so that # schema inspection is more useful. data_types = { 'AutoField': 'integer', 'BigAutoField': 'integer', 'BinaryField': 'BLOB', 'BooleanField': 'bool', 'CharField': 'varchar(%(max_length)s)', 'DateField': 'date', 'DateTimeField': 'datetime', 'DecimalField': 'decimal', 'DurationField': 'bigint', 'FileField': 'varchar(%(max_length)s)', 'FilePathField': 'varchar(%(max_length)s)', 'FloatField': 'real', 'IntegerField': 'integer', 'BigIntegerField': 'bigint', 'IPAddressField': 'char(15)', 'GenericIPAddressField': 'char(39)', 'NullBooleanField': 'bool', 'OneToOneField': 'integer', 'PositiveIntegerField': 'integer unsigned', 'PositiveSmallIntegerField': 'smallint unsigned', 'SlugField': 'varchar(%(max_length)s)', 'SmallIntegerField': 'smallint', 'TextField': 'text', 'TimeField': 'time', 'UUIDField': 'char(32)', } data_type_check_constraints = { 'PositiveIntegerField': '"%(column)s" >= 0', 'PositiveSmallIntegerField': '"%(column)s" >= 0', } data_types_suffix = { 'AutoField': 'AUTOINCREMENT', 'BigAutoField': 'AUTOINCREMENT', } # SQLite requires LIKE statements to include an ESCAPE clause if the value # being escaped has a percent or underscore in it. # See https://www.sqlite.org/lang_expr.html for an explanation. operators = { 'exact': '= %s', 'iexact': "LIKE %s ESCAPE '\\'", 'contains': "LIKE %s ESCAPE '\\'", 'icontains': "LIKE %s ESCAPE '\\'", 'regex': 'REGEXP %s', 'iregex': "REGEXP '(?i)' || %s", 'gt': '> %s', 'gte': '>= %s', 'lt': '< %s', 'lte': '<= %s', 'startswith': "LIKE %s ESCAPE '\\'", 'endswith': "LIKE %s ESCAPE '\\'", 'istartswith': "LIKE %s ESCAPE '\\'", 'iendswith': "LIKE %s ESCAPE '\\'", } # The patterns below are used to generate SQL pattern lookup clauses when # the right-hand side of the lookup isn't a raw string (it might be an expression # or the result of a bilateral transformation). # In those cases, special characters for LIKE operators (e.g. \, *, _) should be # escaped on database side. # # Note: we use str.format() here for readability as '%' is used as a wildcard for # the LIKE operator. pattern_esc = r"REPLACE(REPLACE(REPLACE({}, '\', '\\'), '%%', '\%%'), '_', '\_')" pattern_ops = { 'contains': r"LIKE '%%' || {} || '%%' ESCAPE '\'", 'icontains': r"LIKE '%%' || UPPER({}) || '%%' ESCAPE '\'", 'startswith': r"LIKE {} || '%%' ESCAPE '\'", 'istartswith': r"LIKE UPPER({}) || '%%' ESCAPE '\'", 'endswith': r"LIKE '%%' || {} ESCAPE '\'", 'iendswith': r"LIKE '%%' || UPPER({}) ESCAPE '\'", } Database = Database SchemaEditorClass = DatabaseSchemaEditor # Classes instantiated in __init__(). client_class = DatabaseClient creation_class = DatabaseCreation features_class = DatabaseFeatures introspection_class = DatabaseIntrospection ops_class = DatabaseOperations def get_connection_params(self): settings_dict = self.settings_dict if not settings_dict['NAME']: raise ImproperlyConfigured( "settings.DATABASES is improperly configured. " "Please supply the NAME value.") kwargs = { 'database': settings_dict['NAME'], 'detect_types': Database.PARSE_DECLTYPES | Database.PARSE_COLNAMES, **settings_dict['OPTIONS'], } # Always allow the underlying SQLite connection to be shareable # between multiple threads. The safe-guarding will be handled at a # higher level by the `BaseDatabaseWrapper.allow_thread_sharing` # property. This is necessary as the shareability is disabled by # default in pysqlite and it cannot be changed once a connection is # opened. if 'check_same_thread' in kwargs and kwargs['check_same_thread']: warnings.warn( 'The `check_same_thread` option was provided and set to ' 'True. It will be overridden with False. Use the ' '`DatabaseWrapper.allow_thread_sharing` property instead ' 'for controlling thread shareability.', RuntimeWarning ) kwargs.update({'check_same_thread': False, 'uri': True}) return kwargs def get_new_connection(self, conn_params): conn = Database.connect(**conn_params) conn.create_function("django_date_extract", 2, _sqlite_datetime_extract) conn.create_function("django_date_trunc", 2, _sqlite_date_trunc) conn.create_function("django_datetime_cast_date", 2, _sqlite_datetime_cast_date) conn.create_function("django_datetime_cast_time", 2, _sqlite_datetime_cast_time) conn.create_function("django_datetime_extract", 3, _sqlite_datetime_extract) conn.create_function("django_datetime_trunc", 3, _sqlite_datetime_trunc) conn.create_function("django_time_extract", 2, _sqlite_time_extract) conn.create_function("django_time_trunc", 2, _sqlite_time_trunc) conn.create_function("django_time_diff", 2, _sqlite_time_diff) conn.create_function("django_timestamp_diff", 2, _sqlite_timestamp_diff) conn.create_function("django_format_dtdelta", 3, _sqlite_format_dtdelta) conn.create_function('regexp', 2, _sqlite_regexp) conn.create_function('ACOS', 1, none_guard(math.acos)) conn.create_function('ASIN', 1, none_guard(math.asin)) conn.create_function('ATAN', 1, none_guard(math.atan)) conn.create_function('ATAN2', 2, none_guard(math.atan2)) conn.create_function('CEILING', 1, none_guard(math.ceil)) conn.create_function('COS', 1, none_guard(math.cos)) conn.create_function('COT', 1, none_guard(lambda x: 1 / math.tan(x))) conn.create_function('DEGREES', 1, none_guard(math.degrees)) conn.create_function('EXP', 1, none_guard(math.exp)) conn.create_function('FLOOR', 1, none_guard(math.floor)) conn.create_function('LN', 1, none_guard(math.log)) conn.create_function('LOG', 2, none_guard(lambda x, y: math.log(y, x))) conn.create_function('LPAD', 3, _sqlite_lpad) conn.create_function('MOD', 2, none_guard(math.fmod)) conn.create_function('PI', 0, lambda: math.pi) conn.create_function('POWER', 2, none_guard(operator.pow)) conn.create_function('RADIANS', 1, none_guard(math.radians)) conn.create_function('REPEAT', 2, none_guard(operator.mul)) conn.create_function('REVERSE', 1, none_guard(lambda x: x[::-1])) conn.create_function('RPAD', 3, _sqlite_rpad) conn.create_function('SIN', 1, none_guard(math.sin)) conn.create_function('SQRT', 1, none_guard(math.sqrt)) conn.create_function('TAN', 1, none_guard(math.tan)) conn.create_aggregate('STDDEV_POP', 1, list_aggregate(statistics.pstdev)) conn.create_aggregate('STDDEV_SAMP', 1, list_aggregate(statistics.stdev)) conn.create_aggregate('VAR_POP', 1, list_aggregate(statistics.pvariance)) conn.create_aggregate('VAR_SAMP', 1, list_aggregate(statistics.variance)) conn.execute('PRAGMA foreign_keys = ON') return conn def init_connection_state(self): pass def create_cursor(self, name=None): return self.connection.cursor(factory=SQLiteCursorWrapper) def close(self): self.validate_thread_sharing() # If database is in memory, closing the connection destroys the # database. To prevent accidental data loss, ignore close requests on # an in-memory db. if not self.is_in_memory_db(): BaseDatabaseWrapper.close(self) def _savepoint_allowed(self): # When 'isolation_level' is not None, sqlite3 commits before each # savepoint; it's a bug. When it is None, savepoints don't make sense # because autocommit is enabled. The only exception is inside 'atomic' # blocks. To work around that bug, on SQLite, 'atomic' starts a # transaction explicitly rather than simply disable autocommit. return self.in_atomic_block def _set_autocommit(self, autocommit): if autocommit: level = None else: # sqlite3's internal default is ''. It's different from None. # See Modules/_sqlite/connection.c. level = '' # 'isolation_level' is a misleading API. # SQLite always runs at the SERIALIZABLE isolation level. with self.wrap_database_errors: self.connection.isolation_level = level def disable_constraint_checking(self): with self.cursor() as cursor: cursor.execute('PRAGMA foreign_keys = OFF') # Foreign key constraints cannot be turned off while in a multi- # statement transaction. Fetch the current state of the pragma # to determine if constraints are effectively disabled. enabled = cursor.execute('PRAGMA foreign_keys').fetchone()[0] return not bool(enabled) def enable_constraint_checking(self): self.cursor().execute('PRAGMA foreign_keys = ON') def check_constraints(self, table_names=None): """ Check each table name in `table_names` for rows with invalid foreign key references. This method is intended to be used in conjunction with `disable_constraint_checking()` and `enable_constraint_checking()`, to determine if rows with invalid references were entered while constraint checks were off. """ if self.features.supports_pragma_foreign_key_check: with self.cursor() as cursor: if table_names is None: violations = self.cursor().execute('PRAGMA foreign_key_check').fetchall() else: violations = chain.from_iterable( cursor.execute('PRAGMA foreign_key_check(%s)' % table_name).fetchall() for table_name in table_names ) # See https://www.sqlite.org/pragma.html#pragma_foreign_key_check for table_name, rowid, referenced_table_name, foreign_key_index in violations: foreign_key = cursor.execute( 'PRAGMA foreign_key_list(%s)' % table_name ).fetchall()[foreign_key_index] column_name, referenced_column_name = foreign_key[3:5] primary_key_column_name = self.introspection.get_primary_key_column(cursor, table_name) primary_key_value, bad_value = cursor.execute( 'SELECT %s, %s FROM %s WHERE rowid = %%s' % ( primary_key_column_name, column_name, table_name ), (rowid,), ).fetchone() raise utils.IntegrityError( "The row in table '%s' with primary key '%s' has an " "invalid foreign key: %s.%s contains a value '%s' that " "does not have a corresponding value in %s.%s." % ( table_name, primary_key_value, table_name, column_name, bad_value, referenced_table_name, referenced_column_name ) ) else: with self.cursor() as cursor: if table_names is None: table_names = self.introspection.table_names(cursor) for table_name in table_names: primary_key_column_name = self.introspection.get_primary_key_column(cursor, table_name) if not primary_key_column_name: continue key_columns = self.introspection.get_key_columns(cursor, table_name) for column_name, referenced_table_name, referenced_column_name in key_columns: cursor.execute( """ SELECT REFERRING.`%s`, REFERRING.`%s` FROM `%s` as REFERRING LEFT JOIN `%s` as REFERRED ON (REFERRING.`%s` = REFERRED.`%s`) WHERE REFERRING.`%s` IS NOT NULL AND REFERRED.`%s` IS NULL """ % ( primary_key_column_name, column_name, table_name, referenced_table_name, column_name, referenced_column_name, column_name, referenced_column_name, ) ) for bad_row in cursor.fetchall(): raise utils.IntegrityError( "The row in table '%s' with primary key '%s' has an " "invalid foreign key: %s.%s contains a value '%s' that " "does not have a corresponding value in %s.%s." % ( table_name, bad_row[0], table_name, column_name, bad_row[1], referenced_table_name, referenced_column_name, ) ) def is_usable(self): return True def _start_transaction_under_autocommit(self): """ Start a transaction explicitly in autocommit mode. Staying in autocommit mode works around a bug of sqlite3 that breaks savepoints when autocommit is disabled. """ self.cursor().execute("BEGIN") def is_in_memory_db(self): return self.creation.is_in_memory_db(self.settings_dict['NAME']) FORMAT_QMARK_REGEX = re.compile(r'(?<!%)%s') class SQLiteCursorWrapper(Database.Cursor): """ Django uses "format" style placeholders, but pysqlite2 uses "qmark" style. This fixes it -- but note that if you want to use a literal "%s" in a query, you'll need to use "%%s". """ def execute(self, query, params=None): if params is None: return Database.Cursor.execute(self, query) query = self.convert_query(query) return Database.Cursor.execute(self, query, params) def executemany(self, query, param_list): query = self.convert_query(query) return Database.Cursor.executemany(self, query, param_list) def convert_query(self, query): return FORMAT_QMARK_REGEX.sub('?', query).replace('%%', '%') def _sqlite_datetime_parse(dt, tzname=None): if dt is None: return None try: dt = backend_utils.typecast_timestamp(dt) except (TypeError, ValueError): return None if tzname is not None: dt = timezone.localtime(dt, pytz.timezone(tzname)) return dt def _sqlite_date_trunc(lookup_type, dt): dt = _sqlite_datetime_parse(dt) if dt is None: return None if lookup_type == 'year': return "%i-01-01" % dt.year elif lookup_type == 'quarter': month_in_quarter = dt.month - (dt.month - 1) % 3 return '%i-%02i-01' % (dt.year, month_in_quarter) elif lookup_type == 'month': return "%i-%02i-01" % (dt.year, dt.month) elif lookup_type == 'week': dt = dt - datetime.timedelta(days=dt.weekday()) return "%i-%02i-%02i" % (dt.year, dt.month, dt.day) elif lookup_type == 'day': return "%i-%02i-%02i" % (dt.year, dt.month, dt.day) def _sqlite_time_trunc(lookup_type, dt): if dt is None: return None try: dt = backend_utils.typecast_time(dt) except (ValueError, TypeError): return None if lookup_type == 'hour': return "%02i:00:00" % dt.hour elif lookup_type == 'minute': return "%02i:%02i:00" % (dt.hour, dt.minute) elif lookup_type == 'second': return "%02i:%02i:%02i" % (dt.hour, dt.minute, dt.second) def _sqlite_datetime_cast_date(dt, tzname): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None return dt.date().isoformat() def _sqlite_datetime_cast_time(dt, tzname): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None return dt.time().isoformat() def _sqlite_datetime_extract(lookup_type, dt, tzname=None): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None if lookup_type == 'week_day': return (dt.isoweekday() % 7) + 1 elif lookup_type == 'week': return dt.isocalendar()[1] elif lookup_type == 'quarter': return math.ceil(dt.month / 3) elif lookup_type == 'iso_year': return dt.isocalendar()[0] else: return getattr(dt, lookup_type) def _sqlite_datetime_trunc(lookup_type, dt, tzname): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None if lookup_type == 'year': return "%i-01-01 00:00:00" % dt.year elif lookup_type == 'quarter': month_in_quarter = dt.month - (dt.month - 1) % 3 return '%i-%02i-01 00:00:00' % (dt.year, month_in_quarter) elif lookup_type == 'month': return "%i-%02i-01 00:00:00" % (dt.year, dt.month) elif lookup_type == 'week': dt = dt - datetime.timedelta(days=dt.weekday()) return "%i-%02i-%02i 00:00:00" % (dt.year, dt.month, dt.day) elif lookup_type == 'day': return "%i-%02i-%02i 00:00:00" % (dt.year, dt.month, dt.day) elif lookup_type == 'hour': return "%i-%02i-%02i %02i:00:00" % (dt.year, dt.month, dt.day, dt.hour) elif lookup_type == 'minute': return "%i-%02i-%02i %02i:%02i:00" % (dt.year, dt.month, dt.day, dt.hour, dt.minute) elif lookup_type == 'second': return "%i-%02i-%02i %02i:%02i:%02i" % (dt.year, dt.month, dt.day, dt.hour, dt.minute, dt.second) def _sqlite_time_extract(lookup_type, dt): if dt is None: return None try: dt = backend_utils.typecast_time(dt) except (ValueError, TypeError): return None return getattr(dt, lookup_type) @none_guard def _sqlite_format_dtdelta(conn, lhs, rhs): """ LHS and RHS can be either: - An integer number of microseconds - A string representing a datetime """ try: real_lhs = datetime.timedelta(0, 0, lhs) if isinstance(lhs, int) else backend_utils.typecast_timestamp(lhs) real_rhs = datetime.timedelta(0, 0, rhs) if isinstance(rhs, int) else backend_utils.typecast_timestamp(rhs) if conn.strip() == '+': out = real_lhs + real_rhs else: out = real_lhs - real_rhs except (ValueError, TypeError): return None # typecast_timestamp returns a date or a datetime without timezone. # It will be formatted as "%Y-%m-%d" or "%Y-%m-%d %H:%M:%S[.%f]" return str(out) @none_guard def _sqlite_time_diff(lhs, rhs): left = backend_utils.typecast_time(lhs) right = backend_utils.typecast_time(rhs) return ( (left.hour * 60 * 60 * 1000000) + (left.minute * 60 * 1000000) + (left.second * 1000000) + (left.microsecond) - (right.hour * 60 * 60 * 1000000) - (right.minute * 60 * 1000000) - (right.second * 1000000) - (right.microsecond) ) @none_guard def _sqlite_timestamp_diff(lhs, rhs): left = backend_utils.typecast_timestamp(lhs) right = backend_utils.typecast_timestamp(rhs) return duration_microseconds(left - right) @none_guard def _sqlite_regexp(re_pattern, re_string): return bool(re.search(re_pattern, str(re_string))) @none_guard def _sqlite_lpad(text, length, fill_text): if len(text) >= length: return text[:length] return (fill_text * length)[:length - len(text)] + text @none_guard def _sqlite_rpad(text, length, fill_text): return (text + fill_text * length)[:length]
40.923351
115
0.619828
import datetime import decimal import functools import math import operator import re import statistics import warnings from itertools import chain from sqlite3 import dbapi2 as Database import pytz from django.core.exceptions import ImproperlyConfigured from django.db import utils from django.db.backends import utils as backend_utils from django.db.backends.base.base import BaseDatabaseWrapper from django.utils import timezone from django.utils.dateparse import parse_datetime, parse_time from django.utils.duration import duration_microseconds from .client import DatabaseClient from .creation import DatabaseCreation from .features import DatabaseFeatures from .introspection import DatabaseIntrospection from .operations import DatabaseOperations from .schema import DatabaseSchemaEditor def decoder(conv_func): return lambda s: conv_func(s.decode()) def none_guard(func): @functools.wraps(func) def wrapper(*args, **kwargs): return None if None in args else func(*args, **kwargs) return wrapper def list_aggregate(function): return type('ListAggregate', (list,), {'finalize': function, 'step': list.append}) def check_sqlite_version(): if Database.sqlite_version_info < (3, 8, 3): raise ImproperlyConfigured('SQLite 3.8.3 or later is required (found %s).' % Database.sqlite_version) check_sqlite_version() Database.register_converter("bool", b'1'.__eq__) Database.register_converter("time", decoder(parse_time)) Database.register_converter("datetime", decoder(parse_datetime)) Database.register_converter("timestamp", decoder(parse_datetime)) Database.register_converter("TIMESTAMP", decoder(parse_datetime)) Database.register_adapter(decimal.Decimal, str) class DatabaseWrapper(BaseDatabaseWrapper): vendor = 'sqlite' display_name = 'SQLite' # thing" given more verbose field definitions, so leave them as is so that # schema inspection is more useful. data_types = { 'AutoField': 'integer', 'BigAutoField': 'integer', 'BinaryField': 'BLOB', 'BooleanField': 'bool', 'CharField': 'varchar(%(max_length)s)', 'DateField': 'date', 'DateTimeField': 'datetime', 'DecimalField': 'decimal', 'DurationField': 'bigint', 'FileField': 'varchar(%(max_length)s)', 'FilePathField': 'varchar(%(max_length)s)', 'FloatField': 'real', 'IntegerField': 'integer', 'BigIntegerField': 'bigint', 'IPAddressField': 'char(15)', 'GenericIPAddressField': 'char(39)', 'NullBooleanField': 'bool', 'OneToOneField': 'integer', 'PositiveIntegerField': 'integer unsigned', 'PositiveSmallIntegerField': 'smallint unsigned', 'SlugField': 'varchar(%(max_length)s)', 'SmallIntegerField': 'smallint', 'TextField': 'text', 'TimeField': 'time', 'UUIDField': 'char(32)', } data_type_check_constraints = { 'PositiveIntegerField': '"%(column)s" >= 0', 'PositiveSmallIntegerField': '"%(column)s" >= 0', } data_types_suffix = { 'AutoField': 'AUTOINCREMENT', 'BigAutoField': 'AUTOINCREMENT', } # SQLite requires LIKE statements to include an ESCAPE clause if the value # being escaped has a percent or underscore in it. # See https://www.sqlite.org/lang_expr.html for an explanation. operators = { 'exact': '= %s', 'iexact': "LIKE %s ESCAPE '\\'", 'contains': "LIKE %s ESCAPE '\\'", 'icontains': "LIKE %s ESCAPE '\\'", 'regex': 'REGEXP %s', 'iregex': "REGEXP '(?i)' || %s", 'gt': '> %s', 'gte': '>= %s', 'lt': '< %s', 'lte': '<= %s', 'startswith': "LIKE %s ESCAPE '\\'", 'endswith': "LIKE %s ESCAPE '\\'", 'istartswith': "LIKE %s ESCAPE '\\'", 'iendswith': "LIKE %s ESCAPE '\\'", } # The patterns below are used to generate SQL pattern lookup clauses when # the right-hand side of the lookup isn't a raw string (it might be an expression pattern_esc = r"REPLACE(REPLACE(REPLACE({}, '\', '\\'), '%%', '\%%'), '_', '\_')" pattern_ops = { 'contains': r"LIKE '%%' || {} || '%%' ESCAPE '\'", 'icontains': r"LIKE '%%' || UPPER({}) || '%%' ESCAPE '\'", 'startswith': r"LIKE {} || '%%' ESCAPE '\'", 'istartswith': r"LIKE UPPER({}) || '%%' ESCAPE '\'", 'endswith': r"LIKE '%%' || {} ESCAPE '\'", 'iendswith': r"LIKE '%%' || UPPER({}) ESCAPE '\'", } Database = Database SchemaEditorClass = DatabaseSchemaEditor client_class = DatabaseClient creation_class = DatabaseCreation features_class = DatabaseFeatures introspection_class = DatabaseIntrospection ops_class = DatabaseOperations def get_connection_params(self): settings_dict = self.settings_dict if not settings_dict['NAME']: raise ImproperlyConfigured( "settings.DATABASES is improperly configured. " "Please supply the NAME value.") kwargs = { 'database': settings_dict['NAME'], 'detect_types': Database.PARSE_DECLTYPES | Database.PARSE_COLNAMES, **settings_dict['OPTIONS'], } if 'check_same_thread' in kwargs and kwargs['check_same_thread']: warnings.warn( 'The `check_same_thread` option was provided and set to ' 'True. It will be overridden with False. Use the ' '`DatabaseWrapper.allow_thread_sharing` property instead ' 'for controlling thread shareability.', RuntimeWarning ) kwargs.update({'check_same_thread': False, 'uri': True}) return kwargs def get_new_connection(self, conn_params): conn = Database.connect(**conn_params) conn.create_function("django_date_extract", 2, _sqlite_datetime_extract) conn.create_function("django_date_trunc", 2, _sqlite_date_trunc) conn.create_function("django_datetime_cast_date", 2, _sqlite_datetime_cast_date) conn.create_function("django_datetime_cast_time", 2, _sqlite_datetime_cast_time) conn.create_function("django_datetime_extract", 3, _sqlite_datetime_extract) conn.create_function("django_datetime_trunc", 3, _sqlite_datetime_trunc) conn.create_function("django_time_extract", 2, _sqlite_time_extract) conn.create_function("django_time_trunc", 2, _sqlite_time_trunc) conn.create_function("django_time_diff", 2, _sqlite_time_diff) conn.create_function("django_timestamp_diff", 2, _sqlite_timestamp_diff) conn.create_function("django_format_dtdelta", 3, _sqlite_format_dtdelta) conn.create_function('regexp', 2, _sqlite_regexp) conn.create_function('ACOS', 1, none_guard(math.acos)) conn.create_function('ASIN', 1, none_guard(math.asin)) conn.create_function('ATAN', 1, none_guard(math.atan)) conn.create_function('ATAN2', 2, none_guard(math.atan2)) conn.create_function('CEILING', 1, none_guard(math.ceil)) conn.create_function('COS', 1, none_guard(math.cos)) conn.create_function('COT', 1, none_guard(lambda x: 1 / math.tan(x))) conn.create_function('DEGREES', 1, none_guard(math.degrees)) conn.create_function('EXP', 1, none_guard(math.exp)) conn.create_function('FLOOR', 1, none_guard(math.floor)) conn.create_function('LN', 1, none_guard(math.log)) conn.create_function('LOG', 2, none_guard(lambda x, y: math.log(y, x))) conn.create_function('LPAD', 3, _sqlite_lpad) conn.create_function('MOD', 2, none_guard(math.fmod)) conn.create_function('PI', 0, lambda: math.pi) conn.create_function('POWER', 2, none_guard(operator.pow)) conn.create_function('RADIANS', 1, none_guard(math.radians)) conn.create_function('REPEAT', 2, none_guard(operator.mul)) conn.create_function('REVERSE', 1, none_guard(lambda x: x[::-1])) conn.create_function('RPAD', 3, _sqlite_rpad) conn.create_function('SIN', 1, none_guard(math.sin)) conn.create_function('SQRT', 1, none_guard(math.sqrt)) conn.create_function('TAN', 1, none_guard(math.tan)) conn.create_aggregate('STDDEV_POP', 1, list_aggregate(statistics.pstdev)) conn.create_aggregate('STDDEV_SAMP', 1, list_aggregate(statistics.stdev)) conn.create_aggregate('VAR_POP', 1, list_aggregate(statistics.pvariance)) conn.create_aggregate('VAR_SAMP', 1, list_aggregate(statistics.variance)) conn.execute('PRAGMA foreign_keys = ON') return conn def init_connection_state(self): pass def create_cursor(self, name=None): return self.connection.cursor(factory=SQLiteCursorWrapper) def close(self): self.validate_thread_sharing() if not self.is_in_memory_db(): BaseDatabaseWrapper.close(self) def _savepoint_allowed(self): return self.in_atomic_block def _set_autocommit(self, autocommit): if autocommit: level = None else: level = '' with self.wrap_database_errors: self.connection.isolation_level = level def disable_constraint_checking(self): with self.cursor() as cursor: cursor.execute('PRAGMA foreign_keys = OFF') enabled = cursor.execute('PRAGMA foreign_keys').fetchone()[0] return not bool(enabled) def enable_constraint_checking(self): self.cursor().execute('PRAGMA foreign_keys = ON') def check_constraints(self, table_names=None): if self.features.supports_pragma_foreign_key_check: with self.cursor() as cursor: if table_names is None: violations = self.cursor().execute('PRAGMA foreign_key_check').fetchall() else: violations = chain.from_iterable( cursor.execute('PRAGMA foreign_key_check(%s)' % table_name).fetchall() for table_name in table_names ) e_name, rowid, referenced_table_name, foreign_key_index in violations: foreign_key = cursor.execute( 'PRAGMA foreign_key_list(%s)' % table_name ).fetchall()[foreign_key_index] column_name, referenced_column_name = foreign_key[3:5] primary_key_column_name = self.introspection.get_primary_key_column(cursor, table_name) primary_key_value, bad_value = cursor.execute( 'SELECT %s, %s FROM %s WHERE rowid = %%s' % ( primary_key_column_name, column_name, table_name ), (rowid,), ).fetchone() raise utils.IntegrityError( "The row in table '%s' with primary key '%s' has an " "invalid foreign key: %s.%s contains a value '%s' that " "does not have a corresponding value in %s.%s." % ( table_name, primary_key_value, table_name, column_name, bad_value, referenced_table_name, referenced_column_name ) ) else: with self.cursor() as cursor: if table_names is None: table_names = self.introspection.table_names(cursor) for table_name in table_names: primary_key_column_name = self.introspection.get_primary_key_column(cursor, table_name) if not primary_key_column_name: continue key_columns = self.introspection.get_key_columns(cursor, table_name) for column_name, referenced_table_name, referenced_column_name in key_columns: cursor.execute( """ SELECT REFERRING.`%s`, REFERRING.`%s` FROM `%s` as REFERRING LEFT JOIN `%s` as REFERRED ON (REFERRING.`%s` = REFERRED.`%s`) WHERE REFERRING.`%s` IS NOT NULL AND REFERRED.`%s` IS NULL """ % ( primary_key_column_name, column_name, table_name, referenced_table_name, column_name, referenced_column_name, column_name, referenced_column_name, ) ) for bad_row in cursor.fetchall(): raise utils.IntegrityError( "The row in table '%s' with primary key '%s' has an " "invalid foreign key: %s.%s contains a value '%s' that " "does not have a corresponding value in %s.%s." % ( table_name, bad_row[0], table_name, column_name, bad_row[1], referenced_table_name, referenced_column_name, ) ) def is_usable(self): return True def _start_transaction_under_autocommit(self): self.cursor().execute("BEGIN") def is_in_memory_db(self): return self.creation.is_in_memory_db(self.settings_dict['NAME']) FORMAT_QMARK_REGEX = re.compile(r'(?<!%)%s') class SQLiteCursorWrapper(Database.Cursor): def execute(self, query, params=None): if params is None: return Database.Cursor.execute(self, query) query = self.convert_query(query) return Database.Cursor.execute(self, query, params) def executemany(self, query, param_list): query = self.convert_query(query) return Database.Cursor.executemany(self, query, param_list) def convert_query(self, query): return FORMAT_QMARK_REGEX.sub('?', query).replace('%%', '%') def _sqlite_datetime_parse(dt, tzname=None): if dt is None: return None try: dt = backend_utils.typecast_timestamp(dt) except (TypeError, ValueError): return None if tzname is not None: dt = timezone.localtime(dt, pytz.timezone(tzname)) return dt def _sqlite_date_trunc(lookup_type, dt): dt = _sqlite_datetime_parse(dt) if dt is None: return None if lookup_type == 'year': return "%i-01-01" % dt.year elif lookup_type == 'quarter': month_in_quarter = dt.month - (dt.month - 1) % 3 return '%i-%02i-01' % (dt.year, month_in_quarter) elif lookup_type == 'month': return "%i-%02i-01" % (dt.year, dt.month) elif lookup_type == 'week': dt = dt - datetime.timedelta(days=dt.weekday()) return "%i-%02i-%02i" % (dt.year, dt.month, dt.day) elif lookup_type == 'day': return "%i-%02i-%02i" % (dt.year, dt.month, dt.day) def _sqlite_time_trunc(lookup_type, dt): if dt is None: return None try: dt = backend_utils.typecast_time(dt) except (ValueError, TypeError): return None if lookup_type == 'hour': return "%02i:00:00" % dt.hour elif lookup_type == 'minute': return "%02i:%02i:00" % (dt.hour, dt.minute) elif lookup_type == 'second': return "%02i:%02i:%02i" % (dt.hour, dt.minute, dt.second) def _sqlite_datetime_cast_date(dt, tzname): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None return dt.date().isoformat() def _sqlite_datetime_cast_time(dt, tzname): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None return dt.time().isoformat() def _sqlite_datetime_extract(lookup_type, dt, tzname=None): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None if lookup_type == 'week_day': return (dt.isoweekday() % 7) + 1 elif lookup_type == 'week': return dt.isocalendar()[1] elif lookup_type == 'quarter': return math.ceil(dt.month / 3) elif lookup_type == 'iso_year': return dt.isocalendar()[0] else: return getattr(dt, lookup_type) def _sqlite_datetime_trunc(lookup_type, dt, tzname): dt = _sqlite_datetime_parse(dt, tzname) if dt is None: return None if lookup_type == 'year': return "%i-01-01 00:00:00" % dt.year elif lookup_type == 'quarter': month_in_quarter = dt.month - (dt.month - 1) % 3 return '%i-%02i-01 00:00:00' % (dt.year, month_in_quarter) elif lookup_type == 'month': return "%i-%02i-01 00:00:00" % (dt.year, dt.month) elif lookup_type == 'week': dt = dt - datetime.timedelta(days=dt.weekday()) return "%i-%02i-%02i 00:00:00" % (dt.year, dt.month, dt.day) elif lookup_type == 'day': return "%i-%02i-%02i 00:00:00" % (dt.year, dt.month, dt.day) elif lookup_type == 'hour': return "%i-%02i-%02i %02i:00:00" % (dt.year, dt.month, dt.day, dt.hour) elif lookup_type == 'minute': return "%i-%02i-%02i %02i:%02i:00" % (dt.year, dt.month, dt.day, dt.hour, dt.minute) elif lookup_type == 'second': return "%i-%02i-%02i %02i:%02i:%02i" % (dt.year, dt.month, dt.day, dt.hour, dt.minute, dt.second) def _sqlite_time_extract(lookup_type, dt): if dt is None: return None try: dt = backend_utils.typecast_time(dt) except (ValueError, TypeError): return None return getattr(dt, lookup_type) @none_guard def _sqlite_format_dtdelta(conn, lhs, rhs): try: real_lhs = datetime.timedelta(0, 0, lhs) if isinstance(lhs, int) else backend_utils.typecast_timestamp(lhs) real_rhs = datetime.timedelta(0, 0, rhs) if isinstance(rhs, int) else backend_utils.typecast_timestamp(rhs) if conn.strip() == '+': out = real_lhs + real_rhs else: out = real_lhs - real_rhs except (ValueError, TypeError): return None return str(out) @none_guard def _sqlite_time_diff(lhs, rhs): left = backend_utils.typecast_time(lhs) right = backend_utils.typecast_time(rhs) return ( (left.hour * 60 * 60 * 1000000) + (left.minute * 60 * 1000000) + (left.second * 1000000) + (left.microsecond) - (right.hour * 60 * 60 * 1000000) - (right.minute * 60 * 1000000) - (right.second * 1000000) - (right.microsecond) ) @none_guard def _sqlite_timestamp_diff(lhs, rhs): left = backend_utils.typecast_timestamp(lhs) right = backend_utils.typecast_timestamp(rhs) return duration_microseconds(left - right) @none_guard def _sqlite_regexp(re_pattern, re_string): return bool(re.search(re_pattern, str(re_string))) @none_guard def _sqlite_lpad(text, length, fill_text): if len(text) >= length: return text[:length] return (fill_text * length)[:length - len(text)] + text @none_guard def _sqlite_rpad(text, length, fill_text): return (text + fill_text * length)[:length]
true
true
f7207bb8de11f352cd6af90099062c5d0ac72db3
2,345
py
Python
tests/ccapi/test__attr__.py
achillesrasquinha/CCPy
7a5b4fc008a9a0c90caee5d2d6a8c67393dcb822
[ "MIT" ]
9
2020-05-12T08:16:35.000Z
2022-01-06T03:22:18.000Z
tests/ccapi/test__attr__.py
achillesrasquinha/CCPy
7a5b4fc008a9a0c90caee5d2d6a8c67393dcb822
[ "MIT" ]
3
2020-10-14T16:29:24.000Z
2021-10-04T07:24:34.000Z
tests/ccapi/test__attr__.py
achillesrasquinha/CCPy
7a5b4fc008a9a0c90caee5d2d6a8c67393dcb822
[ "MIT" ]
1
2019-12-30T23:13:46.000Z
2019-12-30T23:13:46.000Z
# imports - standard imports import os.path as osp import subprocess # imports - test imports import pytest # imports - module imports from ccapi.__attr__ import ( read, pardir, strip, safe_decode, sequence_filter, get_revision ) def call(*args, **kwargs): subprocess.call(args, **kwargs) def test_read(tmpdir): directory = tmpdir.mkdir("tmp") tempfile = directory.join("foobar.txt") tempfile.write("foobar") assert tempfile.read() == read(str(tempfile)) tempfile = directory.join("barfoo.txt") tempfile.write(\ """ foobar \n barfoo """ ) assert tempfile.read() == read(str(tempfile)) def test_pardir(): assert pardir(__file__) == osp.dirname(__file__) assert pardir(__file__, 2) == osp.dirname(osp.dirname(__file__)) def test_strip(): string = "foobar" assert strip(string) == string string = "\n foobar\nfoobar \n " assert strip(string) == "foobar\nfoobar" string = "\n\n\n" assert strip(string) == "" string = "\r\nfoobar\nfoobar\n" assert strip(string) == "foobar\nfoobar" def test_safe_decode(): assert safe_decode(b"foobar") == "foobar" assert safe_decode( "foobar") == "foobar" assert safe_decode(123456789) == 123456789 def test_sequence_filter(): assert sequence_filter([0,1,2,3,4,5], filter_ = lambda x: x % 2 == 0) == [0,2,4] assert sequence_filter([0,1,2,3,4,5], filter_ = lambda x: x % 2 != 0, type_ = tuple) == (1,3,5) def test_get_revision(tmpdir): directory = tmpdir.mkdir("tmp") path = str(directory) with pytest.raises(subprocess.CalledProcessError): get_revision(path) assert get_revision(path, raise_err = False) == None # Initialize the git repository call("git","init",path) call("git","config","user.email","foobar@foobar.com", cwd = path) call("git","config","user.name" ,"Foo Bar", cwd = path) with pytest.raises(subprocess.CalledProcessError): get_revision(path) tempfile = directory.join("foobar.txt") tempfile.write("foobar") call("git","add",".", cwd = path) call("git","commit","-m","'Test Commit'", cwd = path) assert len(get_revision(path)) == 40 assert len(get_revision(path, short = True)) == 7
26.055556
99
0.620469
import os.path as osp import subprocess import pytest from ccapi.__attr__ import ( read, pardir, strip, safe_decode, sequence_filter, get_revision ) def call(*args, **kwargs): subprocess.call(args, **kwargs) def test_read(tmpdir): directory = tmpdir.mkdir("tmp") tempfile = directory.join("foobar.txt") tempfile.write("foobar") assert tempfile.read() == read(str(tempfile)) tempfile = directory.join("barfoo.txt") tempfile.write(\ """ foobar \n barfoo """ ) assert tempfile.read() == read(str(tempfile)) def test_pardir(): assert pardir(__file__) == osp.dirname(__file__) assert pardir(__file__, 2) == osp.dirname(osp.dirname(__file__)) def test_strip(): string = "foobar" assert strip(string) == string string = "\n foobar\nfoobar \n " assert strip(string) == "foobar\nfoobar" string = "\n\n\n" assert strip(string) == "" string = "\r\nfoobar\nfoobar\n" assert strip(string) == "foobar\nfoobar" def test_safe_decode(): assert safe_decode(b"foobar") == "foobar" assert safe_decode( "foobar") == "foobar" assert safe_decode(123456789) == 123456789 def test_sequence_filter(): assert sequence_filter([0,1,2,3,4,5], filter_ = lambda x: x % 2 == 0) == [0,2,4] assert sequence_filter([0,1,2,3,4,5], filter_ = lambda x: x % 2 != 0, type_ = tuple) == (1,3,5) def test_get_revision(tmpdir): directory = tmpdir.mkdir("tmp") path = str(directory) with pytest.raises(subprocess.CalledProcessError): get_revision(path) assert get_revision(path, raise_err = False) == None call("git","init",path) call("git","config","user.email","foobar@foobar.com", cwd = path) call("git","config","user.name" ,"Foo Bar", cwd = path) with pytest.raises(subprocess.CalledProcessError): get_revision(path) tempfile = directory.join("foobar.txt") tempfile.write("foobar") call("git","add",".", cwd = path) call("git","commit","-m","'Test Commit'", cwd = path) assert len(get_revision(path)) == 40 assert len(get_revision(path, short = True)) == 7
true
true
f7207db9c00de82d099854acdd08b0a2728247b5
1,679
py
Python
genderPredictScript.py
ganesh2583/Python-Data_Science
233586491d3863176a008b938b0946c472940a6d
[ "MIT" ]
null
null
null
genderPredictScript.py
ganesh2583/Python-Data_Science
233586491d3863176a008b938b0946c472940a6d
[ "MIT" ]
null
null
null
genderPredictScript.py
ganesh2583/Python-Data_Science
233586491d3863176a008b938b0946c472940a6d
[ "MIT" ]
null
null
null
from sklearn import tree from sklearn import neighbors from sklearn import gaussian_process #[height, weight, shoe size] X = [[181,80,10],[161,70,6],[171,66,7],[176,88,7],[189,100,8],[141,80,5],[156,78,6],[161,50,6],[171,60,7],[151,78,7],[171,40,7]] #Gender Y = ['male','male','male','male','male','female','female','female','female','female','female'] #Define 'DecisionTreeClassifier' Classifier From the imported Tree decisionTreeclassifier = tree.DecisionTreeClassifier() #Fit the data into the Classifier decisionTreeclassifier = decisionTreeclassifier.fit(X,Y) #Perform Prediction decisionTreeclassifierPrediction = decisionTreeclassifier.predict([[161,60,9]]) #Print the Classifier print(decisionTreeclassifier) #Print the Prediction print(decisionTreeclassifierPrediction) #Define 'KNeighborsClassifier' Classifier From the imported Tree kNeighborsClassifier = neighbors.KNeighborsClassifier() #Fit the data into the Classifier kNeighborsClassifier = kNeighborsClassifier.fit(X,Y) #Perform Prediction kNeighborsClassifierPrediction = kNeighborsClassifier.predict([[161,60,9]]) #Print the Classifier print(kNeighborsClassifier) #Print the Prediction print(kNeighborsClassifierPrediction) #Define 'GaussianProcessClassifier' Classifier From the imported Tree gaussianProcessClassifier = gaussian_process.GaussianProcessClassifier() #Fit the data into the Classifier gaussianProcessClassifier = gaussianProcessClassifier.fit(X,Y) #Perform Prediction gaussianProcessClassifierPrediction = gaussianProcessClassifier.predict([[161,60,9]]) #Print the Classifier print(gaussianProcessClassifier) #Print the Prediction print(gaussianProcessClassifierPrediction)
29.45614
128
0.805837
from sklearn import tree from sklearn import neighbors from sklearn import gaussian_process X = [[181,80,10],[161,70,6],[171,66,7],[176,88,7],[189,100,8],[141,80,5],[156,78,6],[161,50,6],[171,60,7],[151,78,7],[171,40,7]] Y = ['male','male','male','male','male','female','female','female','female','female','female'] decisionTreeclassifier = tree.DecisionTreeClassifier() decisionTreeclassifier = decisionTreeclassifier.fit(X,Y) decisionTreeclassifierPrediction = decisionTreeclassifier.predict([[161,60,9]]) print(decisionTreeclassifier) print(decisionTreeclassifierPrediction) kNeighborsClassifier = neighbors.KNeighborsClassifier() kNeighborsClassifier = kNeighborsClassifier.fit(X,Y) kNeighborsClassifierPrediction = kNeighborsClassifier.predict([[161,60,9]]) print(kNeighborsClassifier) print(kNeighborsClassifierPrediction) gaussianProcessClassifier = gaussian_process.GaussianProcessClassifier() gaussianProcessClassifier = gaussianProcessClassifier.fit(X,Y) gaussianProcessClassifierPrediction = gaussianProcessClassifier.predict([[161,60,9]]) print(gaussianProcessClassifier) print(gaussianProcessClassifierPrediction)
true
true
f7207ef7a8d650d8bd9ead304e0f30c6f37038f4
366
py
Python
main.py
zruss11/Nike-InboxCheck
5e3be689797a8d861e4894b1df4bd6ed8f1066e8
[ "MIT" ]
11
2017-09-09T03:47:18.000Z
2019-11-15T14:12:51.000Z
main.py
zruss11/Nike-InboxCheck
5e3be689797a8d861e4894b1df4bd6ed8f1066e8
[ "MIT" ]
null
null
null
main.py
zruss11/Nike-InboxCheck
5e3be689797a8d861e4894b1df4bd6ed8f1066e8
[ "MIT" ]
5
2017-09-09T03:48:07.000Z
2020-07-04T00:59:01.000Z
import requests from classes.login import Login from classes.logger import logger log = logger().log with open('config/accounts.txt') as accounts_file: accounts = accounts_file.read().splitlines() def run(x): req = requests.Session() log("{} Attempting Login".format(x.split(':')[0])) l = Login(req) l.login(x) for x in accounts: run(x)
19.263158
54
0.674863
import requests from classes.login import Login from classes.logger import logger log = logger().log with open('config/accounts.txt') as accounts_file: accounts = accounts_file.read().splitlines() def run(x): req = requests.Session() log("{} Attempting Login".format(x.split(':')[0])) l = Login(req) l.login(x) for x in accounts: run(x)
true
true
f7207f32e150c7bc0ac42fe89ad3f6575a482a24
2,502
py
Python
google/cloud/bigquery/_http.py
msuozzo/python-bigquery
dcb8728c12f5ab0d7809a1b6cf72755dff973772
[ "Apache-2.0" ]
384
2020-02-07T06:39:26.000Z
2022-03-30T18:25:50.000Z
google/cloud/bigquery/_http.py
msuozzo/python-bigquery
dcb8728c12f5ab0d7809a1b6cf72755dff973772
[ "Apache-2.0" ]
770
2020-02-04T10:46:40.000Z
2022-03-31T15:12:19.000Z
google/cloud/bigquery/_http.py
msuozzo/python-bigquery
dcb8728c12f5ab0d7809a1b6cf72755dff973772
[ "Apache-2.0" ]
177
2020-02-06T05:24:31.000Z
2022-03-25T18:51:36.000Z
# Copyright 2015 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Create / interact with Google BigQuery connections.""" import os import pkg_resources from google.cloud import _http # type: ignore # pytype: disable=import-error from google.cloud.bigquery import __version__ # TODO: Increase the minimum version of google-cloud-core to 1.6.0 # and remove this logic. See: # https://github.com/googleapis/python-bigquery/issues/509 if os.getenv("GOOGLE_API_USE_CLIENT_CERTIFICATE") == "true": # pragma: NO COVER release = pkg_resources.get_distribution("google-cloud-core").parsed_version if release < pkg_resources.parse_version("1.6.0"): raise ImportError("google-cloud-core >= 1.6.0 is required to use mTLS feature") class Connection(_http.JSONConnection): """A connection to Google BigQuery via the JSON REST API. Args: client (google.cloud.bigquery.client.Client): The client that owns the current connection. client_info (Optional[google.api_core.client_info.ClientInfo]): Instance used to generate user agent. api_endpoint (str): The api_endpoint to use. If None, the library will decide what endpoint to use. """ DEFAULT_API_ENDPOINT = "https://bigquery.googleapis.com" DEFAULT_API_MTLS_ENDPOINT = "https://bigquery.mtls.googleapis.com" def __init__(self, client, client_info=None, api_endpoint=None): super(Connection, self).__init__(client, client_info) self.API_BASE_URL = api_endpoint or self.DEFAULT_API_ENDPOINT self.API_BASE_MTLS_URL = self.DEFAULT_API_MTLS_ENDPOINT self.ALLOW_AUTO_SWITCH_TO_MTLS_URL = api_endpoint is None self._client_info.gapic_version = __version__ self._client_info.client_library_version = __version__ API_VERSION = "v2" """The version of the API, used in building the API call's URL.""" API_URL_TEMPLATE = "{api_base_url}/bigquery/{api_version}{path}" """A template for the URL of a particular API call."""
41.7
109
0.742606
import os import pkg_resources from google.cloud import _http port __version__ if os.getenv("GOOGLE_API_USE_CLIENT_CERTIFICATE") == "true": release = pkg_resources.get_distribution("google-cloud-core").parsed_version if release < pkg_resources.parse_version("1.6.0"): raise ImportError("google-cloud-core >= 1.6.0 is required to use mTLS feature") class Connection(_http.JSONConnection): DEFAULT_API_ENDPOINT = "https://bigquery.googleapis.com" DEFAULT_API_MTLS_ENDPOINT = "https://bigquery.mtls.googleapis.com" def __init__(self, client, client_info=None, api_endpoint=None): super(Connection, self).__init__(client, client_info) self.API_BASE_URL = api_endpoint or self.DEFAULT_API_ENDPOINT self.API_BASE_MTLS_URL = self.DEFAULT_API_MTLS_ENDPOINT self.ALLOW_AUTO_SWITCH_TO_MTLS_URL = api_endpoint is None self._client_info.gapic_version = __version__ self._client_info.client_library_version = __version__ API_VERSION = "v2" API_URL_TEMPLATE = "{api_base_url}/bigquery/{api_version}{path}"
true
true
f720804843b0cf052334ea5fd31c198aa77f5bcf
51,935
py
Python
tests/test_catalina_10_15_7.py
RhetTbull/osxphotos
0e9b9d625190b94c1dd68276e3b0e5367002d87c
[ "MIT" ]
656
2019-08-14T14:10:44.000Z
2022-03-28T15:25:42.000Z
tests/test_catalina_10_15_7.py
RhetTbull/osxphotos
0e9b9d625190b94c1dd68276e3b0e5367002d87c
[ "MIT" ]
557
2019-10-14T19:00:02.000Z
2022-03-28T00:48:30.000Z
tests/test_catalina_10_15_7.py
RhetTbull/osxphotos
0e9b9d625190b94c1dd68276e3b0e5367002d87c
[ "MIT" ]
58
2019-12-27T01:39:33.000Z
2022-02-26T22:18:49.000Z
""" Basic tests for Photos 5 on MacOS 10.15.7 """ import datetime import os import os.path import pathlib import sqlite3 import tempfile import time from collections import Counter, namedtuple import pytest import osxphotos from osxphotos._constants import _UNKNOWN_PERSON from osxphotos.utils import _get_os_version OS_VERSION = _get_os_version() SKIP_TEST = "OSXPHOTOS_TEST_EXPORT" not in os.environ or OS_VERSION[1] != "15" PHOTOS_DB_LOCAL = os.path.expanduser("~/Pictures/Photos Library.photoslibrary") PHOTOS_DB = "tests/Test-10.15.7.photoslibrary/database/photos.db" PHOTOS_DB_PATH = "/Test-10.15.7.photoslibrary/database/photos.db" PHOTOS_LIBRARY_PATH = "/Test-10.15.7.photoslibrary" PHOTOS_DB_LEN = 25 PHOTOS_NOT_IN_TRASH_LEN = 23 PHOTOS_IN_TRASH_LEN = 2 PHOTOS_DB_IMPORT_SESSIONS = 17 KEYWORDS = [ "Kids", "wedding", "flowers", "England", "London", "London 2018", "St. James's Park", "UK", "United Kingdom", "foo/bar", "Travel", "Maria", "Drink", "Val d'Isère", "Wine", "Wine Bottle", "Food", "Furniture", "Pizza", "Table", "Cloudy", "Cord", "Outdoor", "Sky", "Sunset Sunrise", ] # Photos 5 includes blank person for detected face PERSONS = ["Katie", "Suzy", "Maria", _UNKNOWN_PERSON] ALBUMS = [ "2018-10 - Sponsion, Museum, Frühstück, Römermuseum", "2019-10/11 Paris Clermont", "AlbumInFolder", "EmptyAlbum", "I have a deleted twin", # there's an empty album with same name that has been deleted "Multi Keyword", "Pumpkin Farm", "Raw", "Sorted Manual", "Sorted Newest First", "Sorted Oldest First", "Sorted Title", "Test Album", # there are 2 albums named "Test Album" for testing duplicate album names ] KEYWORDS_DICT = { "Drink": 2, "England": 1, "Kids": 4, "London 2018": 1, "London": 1, "Maria": 1, "St. James's Park": 1, "Travel": 2, "UK": 1, "United Kingdom": 1, "Val d'Isère": 2, "Wine Bottle": 2, "Wine": 2, "flowers": 1, "foo/bar": 1, "wedding": 3, "Food": 2, "Furniture": 2, "Pizza": 2, "Table": 2, "Cloudy": 2, "Cord": 2, "Outdoor": 2, "Sky": 2, "Sunset Sunrise": 2, } PERSONS_DICT = {"Katie": 3, "Suzy": 2, "Maria": 2, _UNKNOWN_PERSON: 1} ALBUM_DICT = { "2018-10 - Sponsion, Museum, Frühstück, Römermuseum": 1, "2019-10/11 Paris Clermont": 1, "AlbumInFolder": 2, "EmptyAlbum": 0, "I have a deleted twin": 1, "Multi Keyword": 2, "Pumpkin Farm": 3, "Raw": 4, "Sorted Manual": 3, "Sorted Newest First": 3, "Sorted Oldest First": 3, "Sorted Title": 3, "Test Album": 2, } # Note: there are 2 albums named "Test Album" for testing duplicate album names UUID_DICT = { "missing": "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C", "favorite": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "not_favorite": "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C", "hidden": "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C", "not_hidden": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "has_adjustments": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "adjustments_info": "7783E8E6-9CAC-40F3-BE22-81FB7051C266", "no_adjustments": "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068", "location": "DC99FBDD-7A52-4100-A5BB-344131646C30", "no_location": "6191423D-8DB8-4D4C-92BE-9BBBA308AAC4", "external_edit": "DC99FBDD-7A52-4100-A5BB-344131646C30", "no_external_edit": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "export": "D79B8D77-BFFC-460B-9312-034F2877D35B", # "Pumkins2.jpg" "export_tif": "8846E3E6-8AC8-4857-8448-E3D025784410", "in_album": "D79B8D77-BFFC-460B-9312-034F2877D35B", # "Pumkins2.jpg" "date_invalid": "8846E3E6-8AC8-4857-8448-E3D025784410", "intrash": "71E3E212-00EB-430D-8A63-5E294B268554", "not_intrash": "DC99FBDD-7A52-4100-A5BB-344131646C30", "intrash_person_keywords": "6FD38366-3BF2-407D-81FE-7153EB6125B6", "import_session": "8846E3E6-8AC8-4857-8448-E3D025784410", "movie": "D1359D09-1373-4F3B-B0E3-1A4DE573E4A3", "description_newlines": "7F74DD34-5920-4DA3-B284-479887A34F66", "no_duplicates": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "multi_query_1": "D79B8D77-BFFC-460B-9312-034F2877D35B", "multi_query_2": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", } UUID_DICT_LOCAL = { "not_visible": "4A836160-51B2-4E32-907D-ECDDB2CEC657", # IMG_9815.JPG "burst": "9A5B4CE6-6A9F-4917-95D4-1C98D14FCE4F", # IMG_9812.JPG "burst_key": "9A5B4CE6-6A9F-4917-95D4-1C98D14FCE4F", # IMG_9812.JPG "burst_not_key": "4A836160-51B2-4E32-907D-ECDDB2CEC657", # IMG_9815.JPG "burst_selected": "75154738-83AA-4DCD-A913-632D5D1C0FEE", # IMG_9814.JPG "burst_not_selected": "89E235DD-B9AC-4E8D-BDA2-986981CA7582", # IMG_9813.JPG "burst_default": "F5E6BD24-B493-44E9-BDA2-7AD9D2CC8C9D", # IMG_9816.JPG "burst_not_default": "75154738-83AA-4DCD-A913-632D5D1C0FEE", # IMG_9814.JPG "live_edited": "54A01B04-16D7-4FDE-8860-19F2A641E433", # IMG_3203.HEIC "live": "8EC216A2-0032-4934-BD3F-04C6259B3304", # IMG_3259.HEIC } UUID_PUMPKIN_FARM = [ "F12384F6-CD17-4151-ACBA-AE0E3688539E", "D79B8D77-BFFC-460B-9312-034F2877D35B", "1EB2B765-0765-43BA-A90C-0D0580E6172C", ] ALBUM_SORT_ORDER = [ "1EB2B765-0765-43BA-A90C-0D0580E6172C", "F12384F6-CD17-4151-ACBA-AE0E3688539E", "D79B8D77-BFFC-460B-9312-034F2877D35B", ] ALBUM_KEY_PHOTO = "D79B8D77-BFFC-460B-9312-034F2877D35B" UTI_DICT = { "8846E3E6-8AC8-4857-8448-E3D025784410": "public.tiff", "7783E8E6-9CAC-40F3-BE22-81FB7051C266": "public.jpeg", "1EB2B765-0765-43BA-A90C-0D0580E6172C": "public.jpeg", } UTI_ORIGINAL_DICT = { "8846E3E6-8AC8-4857-8448-E3D025784410": "public.tiff", "7783E8E6-9CAC-40F3-BE22-81FB7051C266": "public.heic", "1EB2B765-0765-43BA-A90C-0D0580E6172C": "public.jpeg", } RawInfo = namedtuple( "RawInfo", [ "comment", "original_filename", "has_raw", "israw", "raw_original", "uti", "uti_original", "uti_raw", ], ) RAW_DICT = { "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068": RawInfo( "raw image, no jpeg pair", "DSC03584.dng", False, True, False, "com.adobe.raw-image", "com.adobe.raw-image", None, ), "A92D9C26-3A50-4197-9388-CB5F7DB9FA91": RawInfo( "raw+jpeg, jpeg original", "IMG_1994.JPG", True, False, False, "public.jpeg", "public.jpeg", "com.canon.cr2-raw-image", ), "4D521201-92AC-43E5-8F7C-59BC41C37A96": RawInfo( "raw+jpeg, raw original", "IMG_1997.JPG", True, False, True, "public.jpeg", "public.jpeg", "com.canon.cr2-raw-image", ), "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51": RawInfo( "jpeg, no raw", "wedding.jpg", False, False, False, "public.jpeg", "public.jpeg", None, ), } ORIGINAL_FILENAME_DICT = { "uuid": "D79B8D77-BFFC-460B-9312-034F2877D35B", "filename": "D79B8D77-BFFC-460B-9312-034F2877D35B.jpeg", "original_filename": "Pumkins2.jpg", } UUID_IS_REFERENCE = "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C" UUID_NOT_REFERENCE = "F12384F6-CD17-4151-ACBA-AE0E3688539E" UUID_DUPLICATE = "" UUID_DETECTED_TEXT = { "E2078879-A29C-4D6F-BACB-E3BBE6C3EB91": "osxphotos", "A92D9C26-3A50-4197-9388-CB5F7DB9FA91": None, } @pytest.fixture(scope="module") def photosdb(): return osxphotos.PhotosDB(dbfile=PHOTOS_DB) @pytest.fixture(scope="module") def photosdb_local(): return osxphotos.PhotosDB(dbfile=PHOTOS_DB_LOCAL) def test_init1(): # test named argument photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB) assert isinstance(photosdb, osxphotos.PhotosDB) def test_init2(): # test positional argument photosdb = osxphotos.PhotosDB(PHOTOS_DB) assert isinstance(photosdb, osxphotos.PhotosDB) def test_init3(): # test positional and named argument (raises exception) with pytest.raises(Exception): assert osxphotos.PhotosDB(PHOTOS_DB, dbfile=PHOTOS_DB) def test_init4(): # test invalid db (bad_db, bad_db_name) = tempfile.mkstemp(suffix=".db", prefix="osxphotos-") os.close(bad_db) with pytest.raises(Exception): assert osxphotos.PhotosDB(bad_db_name) with pytest.raises(Exception): assert osxphotos.PhotosDB(dbfile=bad_db_name) try: os.remove(bad_db_name) except: pass def test_init5(mocker): # test failed get_last_library_path def bad_library(): return None # get_last_library actually in utils but need to patch it in photosdb because it's imported into photosdb # because of the layout of photosdb/ need to patch it this way...don't really understand why, but it works mocker.patch("osxphotos.photosdb.photosdb.get_last_library_path", new=bad_library) with pytest.raises(Exception): assert osxphotos.PhotosDB() def test_db_len(photosdb): # assert photosdb.db_version in osxphotos._TESTED_DB_VERSIONS assert len(photosdb) == PHOTOS_DB_LEN def test_db_version(photosdb): # assert photosdb.db_version in osxphotos._TESTED_DB_VERSIONS assert photosdb.db_version == "6000" def test_persons(photosdb): assert "Katie" in photosdb.persons assert Counter(PERSONS) == Counter(photosdb.persons) def test_keywords(photosdb): assert "wedding" in photosdb.keywords assert Counter(KEYWORDS) == Counter(photosdb.keywords) def test_album_names(photosdb): assert "Pumpkin Farm" in photosdb.albums assert Counter(ALBUMS) == Counter(photosdb.albums) def test_keywords_dict(photosdb): keywords = photosdb.keywords_as_dict assert keywords["wedding"] == 3 assert keywords == KEYWORDS_DICT def test_persons_as_dict(photosdb): persons = photosdb.persons_as_dict assert persons["Maria"] == 2 assert persons == PERSONS_DICT def test_albums_as_dict(photosdb): albums = photosdb.albums_as_dict assert albums["Pumpkin Farm"] == 3 assert albums == ALBUM_DICT def test_album_sort_order(photosdb): album = [a for a in photosdb.album_info if a.title == "Pumpkin Farm"][0] photos = album.photos uuids = [p.uuid for p in photos] assert uuids == ALBUM_SORT_ORDER def test_album_empty_album(photosdb): album = [a for a in photosdb.album_info if a.title == "EmptyAlbum"][0] photos = album.photos assert photos == [] def test_attributes(photosdb): photos = photosdb.photos(uuid=["D79B8D77-BFFC-460B-9312-034F2877D35B"]) assert len(photos) == 1 p = photos[0] assert p.keywords == ["Kids"] assert p.original_filename == "Pumkins2.jpg" assert p.filename == "D79B8D77-BFFC-460B-9312-034F2877D35B.jpeg" assert p.date == datetime.datetime( 2018, 9, 28, 16, 7, 7, 0, datetime.timezone(datetime.timedelta(seconds=-14400)) ) assert p.date_added == datetime.datetime( 2019, 7, 27, 9, 16, 49, 778432, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=72000)), ) assert p.description == "Girl holding pumpkin" assert p.title == "I found one!" assert sorted(p.albums) == ["Multi Keyword", "Pumpkin Farm", "Test Album"] assert p.persons == ["Katie"] assert p.path.endswith( "tests/Test-10.15.7.photoslibrary/originals/D/D79B8D77-BFFC-460B-9312-034F2877D35B.jpeg" ) assert p.ismissing == False def test_attributes_2(photosdb): """Test attributes including height, width, etc""" photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) assert len(photos) == 1 p = photos[0] assert sorted(p.keywords) == ["Maria", "wedding"] assert p.original_filename == "wedding.jpg" assert p.filename == "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51.jpeg" assert p.date == datetime.datetime( 2019, 4, 15, 14, 40, 24, 86000, datetime.timezone(datetime.timedelta(seconds=-14400)), ) assert p.description == "Bride Wedding day" assert p.title is None assert sorted(p.albums) == [ "AlbumInFolder", "I have a deleted twin", "Multi Keyword", ] assert p.persons == ["Maria"] assert p.path.endswith( "tests/Test-10.15.7.photoslibrary/originals/E/E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51.jpeg" ) assert not p.ismissing assert p.hasadjustments assert p.height == 1325 assert p.width == 1526 assert p.original_height == 1367 assert p.original_width == 2048 assert p.orientation == 1 assert p.original_orientation == 1 assert p.original_filesize == 460483 def test_missing(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["missing"]]) assert len(photos) == 1 p = photos[0] assert p.path is None assert p.ismissing == True def test_favorite(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["favorite"]]) assert len(photos) == 1 p = photos[0] assert p.favorite == True def test_not_favorite(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["not_favorite"]]) assert len(photos) == 1 p = photos[0] assert p.favorite == False def test_hidden(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["hidden"]]) assert len(photos) == 1 p = photos[0] assert p.hidden == True def test_not_hidden(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["not_hidden"]]) assert len(photos) == 1 p = photos[0] assert p.hidden == False def test_visible(photosdb): """test visible""" photos = photosdb.photos(uuid=[UUID_DICT["not_hidden"]]) assert len(photos) == 1 p = photos[0] assert p.visible def test_not_burst(photosdb): """test not burst""" photos = photosdb.photos(uuid=[UUID_DICT["not_hidden"]]) assert len(photos) == 1 p = photos[0] assert not p.burst def test_location_1(photosdb): # test photo with lat/lon info photos = photosdb.photos(uuid=[UUID_DICT["location"]]) assert len(photos) == 1 p = photos[0] lat, lon = p.location assert lat == pytest.approx(51.50357167) assert lon == pytest.approx(-0.1318055) def test_location_2(photosdb): # test photo with no location info photos = photosdb.photos(uuid=[UUID_DICT["no_location"]]) assert len(photos) == 1 p = photos[0] lat, lon = p.location assert lat is None assert lon is None def test_hasadjustments1(photosdb): # test hasadjustments == True photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) assert len(photos) == 1 p = photos[0] assert p.hasadjustments == True def test_hasadjustments2(photosdb): # test hasadjustments == False photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) assert len(photos) == 1 p = photos[0] assert p.hasadjustments == False def test_external_edit1(photosdb): # test image has been edited in external editor photos = photosdb.photos(uuid=[UUID_DICT["external_edit"]]) assert len(photos) == 1 p = photos[0] assert p.external_edit == True def test_external_edit2(photosdb): # test image has not been edited in external editor photos = photosdb.photos(uuid=[UUID_DICT["no_external_edit"]]) assert len(photos) == 1 p = photos[0] assert p.external_edit == False def test_path_edited1(photosdb): # test a valid edited path photos = photosdb.photos(uuid=["E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51"]) assert len(photos) == 1 p = photos[0] path = p.path_edited assert path.endswith( "resources/renders/E/E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51_1_201_a.jpeg" ) assert os.path.exists(path) def test_path_edited2(photosdb): # test an invalid edited path photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) assert len(photos) == 1 p = photos[0] path = p.path_edited assert path is None def test_path_derivatives(photosdb): # test an path_derivatives photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) assert len(photos) == 1 p = photos[0] path = p.path_derivatives derivs = [ "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068_1_100_o.jpeg", "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068_1_105_c.jpeg", ] for i, p in enumerate(path): assert p.endswith(derivs[i]) def test_ismovie(photosdb): # test ismovie == True photos = photosdb.photos(uuid=[UUID_DICT["movie"]]) p = photos[0] assert p.ismovie def test_not_ismovie(photosdb): # test ismovie == False photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) p = photos[0] assert not p.ismovie def test_count(photosdb): photos = photosdb.photos() assert len(photos) == PHOTOS_NOT_IN_TRASH_LEN def test_photos_intrash_1(photosdb): """test PhotosDB.photos(intrash=True)""" photos = photosdb.photos(intrash=True) assert len(photos) == PHOTOS_IN_TRASH_LEN def test_photos_intrash_2(photosdb): """test PhotosDB.photos(intrash=True)""" photos = photosdb.photos(intrash=True) for p in photos: assert p.intrash def test_photos_intrash_3(photosdb): """test PhotosDB.photos(intrash=False)""" photos = photosdb.photos(intrash=False) for p in photos: assert not p.intrash def test_photoinfo_intrash_1(photosdb): """Test PhotoInfo.intrash""" p = photosdb.photos(uuid=[UUID_DICT["intrash"]], intrash=True)[0] assert p.intrash assert p.date_trashed.isoformat() == "2120-06-10T11:24:47.685857-05:00" def test_photoinfo_intrash_2(photosdb): """Test PhotoInfo.intrash and intrash=default""" p = photosdb.photos(uuid=[UUID_DICT["intrash"]]) assert not p def test_photoinfo_intrash_3(photosdb): """Test PhotoInfo.intrash and photo has keyword and person""" p = photosdb.photos(uuid=[UUID_DICT["intrash_person_keywords"]], intrash=True)[0] assert p.intrash assert "Maria" in p.persons assert "wedding" in p.keywords def test_photoinfo_intrash_4(photosdb): """Test PhotoInfo.intrash and photo has keyword and person""" p = photosdb.photos(persons=["Maria"], intrash=True)[0] assert p.intrash assert "Maria" in p.persons assert "wedding" in p.keywords def test_photoinfo_intrash_5(photosdb): """Test PhotoInfo.intrash and photo has keyword and person""" p = photosdb.photos(keywords=["wedding"], intrash=True)[0] assert p.intrash assert "Maria" in p.persons assert "wedding" in p.keywords def test_photoinfo_not_intrash(photosdb): """Test PhotoInfo.intrash""" p = photosdb.photos(uuid=[UUID_DICT["not_intrash"]])[0] assert not p.intrash assert p.date_trashed is None def test_keyword_2(photosdb): photos = photosdb.photos(keywords=["wedding"]) assert len(photos) == 2 # won't show the one in the trash def test_keyword_not_in_album(photosdb): # find all photos with keyword "Kids" not in the album "Pumpkin Farm" photos1 = photosdb.photos(albums=["Pumpkin Farm"]) photos2 = photosdb.photos(keywords=["Kids"]) photos3 = [p for p in photos2 if p not in photos1] assert len(photos3) == 1 assert photos3[0].uuid == "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C" def test_album_folder_name(photosdb): """Test query with album name same as a folder name""" photos = photosdb.photos(albums=["Pumpkin Farm"]) assert sorted(p.uuid for p in photos) == sorted(UUID_PUMPKIN_FARM) def test_multi_person(photosdb): photos = photosdb.photos(persons=["Katie", "Suzy"]) assert len(photos) == 3 def test_get_db_path(photosdb): db_path = photosdb.db_path assert db_path.endswith(PHOTOS_DB_PATH) def test_get_library_path(photosdb): lib_path = photosdb.library_path assert lib_path.endswith(PHOTOS_LIBRARY_PATH) def test_get_db_connection(photosdb): """Test PhotosDB.get_db_connection""" conn, cursor = photosdb.get_db_connection() assert isinstance(conn, sqlite3.Connection) assert isinstance(cursor, sqlite3.Cursor) results = conn.execute( "SELECT ZUUID FROM ZGENERICASSET WHERE ZFAVORITE = 1;" ).fetchall() assert len(results) == 1 assert results[0][0] == "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51" # uuid conn.close() def test_export_1(photosdb): # test basic export # get an unedited image and export it using default filename tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].original_filename expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) def test_export_2(photosdb): # test export with user provided filename tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) timestamp = time.time() filename = f"osxphotos-export-2-test-{timestamp}.jpg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) def test_export_3(photosdb): # test file already exists and test increment=True (default) tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].original_filename filename2 = pathlib.Path(filename) filename2 = f"{filename2.stem} (1){filename2.suffix}" expected_dest_2 = os.path.join(dest, filename2) got_dest = photos[0].export(dest)[0] got_dest_2 = photos[0].export(dest)[0] assert got_dest_2 == expected_dest_2 assert os.path.isfile(got_dest_2) def test_export_4(photosdb): # test user supplied file already exists and test increment=True (default) tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) timestamp = time.time() filename = f"osxphotos-export-2-test-{timestamp}.jpg" filename2 = f"osxphotos-export-2-test-{timestamp} (1).jpg" expected_dest_2 = os.path.join(dest, filename2) got_dest = photos[0].export(dest, filename)[0] got_dest_2 = photos[0].export(dest, filename)[0] assert got_dest_2 == expected_dest_2 assert os.path.isfile(got_dest_2) def test_export_5(photosdb): # test file already exists and test increment=True (default) # and overwrite = True tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].original_filename expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest)[0] got_dest_2 = photos[0].export(dest, overwrite=True)[0] assert got_dest_2 == got_dest assert got_dest_2 == expected_dest assert os.path.isfile(got_dest_2) def test_export_6(photosdb): # test user supplied file already exists and test increment=True (default) # and overwrite = True tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) timestamp = time.time() filename = f"osxphotos-export-test-{timestamp}.jpg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename)[0] got_dest_2 = photos[0].export(dest, filename, overwrite=True)[0] assert got_dest_2 == got_dest assert got_dest_2 == expected_dest assert os.path.isfile(got_dest_2) def test_export_7(photosdb): # test file already exists and test increment=False (not default), overwrite=False (default) # should raise exception tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].filename got_dest = photos[0].export(dest)[0] with pytest.raises(Exception) as e: # try to export again with increment = False assert photos[0].export(dest, increment=False) assert e.type == type(FileExistsError()) def test_export_8(photosdb): # try to export missing file tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["missing"]]) assert photos[0].export(dest) == [] def test_export_9(photosdb): # try to export edited file that's not edited # should raise exception tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) filename = photos[0].filename with pytest.raises(Exception) as e: assert photos[0].export(dest, edited=True) assert e.type == ValueError def test_export_10(photosdb): # try to export edited file that's not edited and name provided # should raise exception tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) timestamp = time.time() filename = f"osxphotos-export-test-{timestamp}.jpg" with pytest.raises(Exception) as e: assert photos[0].export(dest, filename, edited=True) assert e.type == ValueError def test_export_11(photosdb): # export edited file with name provided tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) timestamp = time.time() filename = f"osxphotos-export-test-{timestamp}.jpg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename, edited=True)[0] assert got_dest == expected_dest def test_export_12(photosdb): # export edited file with default name tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) edited_name = pathlib.Path(photos[0].path_edited).name edited_suffix = pathlib.Path(edited_name).suffix filename = ( pathlib.Path(photos[0].original_filename).stem + "_edited" + edited_suffix ) expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, edited=True)[0] assert got_dest == expected_dest def test_export_13(photosdb): # export to invalid destination # should raise exception tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name # create a folder that doesn't exist i = 0 while os.path.isdir(dest): dest = os.path.join(dest, str(i)) i += 1 photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].filename with pytest.raises(Exception) as e: assert photos[0].export(dest) assert e.type == type(FileNotFoundError()) def test_export_14(photosdb, caplog): # test export with user provided filename with different (but valid) extension than source tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export_tif"]]) timestamp = time.time() filename = f"osxphotos-export-2-test-{timestamp}.tif" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) assert "Invalid destination suffix" not in caplog.text def test_export_no_original_filename(photosdb): # test export OK if original filename is null # issue #267 tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) # monkey patch original_filename for testing original_filename = photos[0]._info["originalFilename"] photos[0]._info["originalFilename"] = None filename = f"{photos[0].uuid}.jpeg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) photos[0]._info["originalFilename"] = original_filename def test_eq(): """Test equality of two PhotoInfo objects""" photosdb1 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photosdb2 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photos1 = photosdb1.photos(uuid=[UUID_DICT["export"]]) photos2 = photosdb2.photos(uuid=[UUID_DICT["export"]]) assert photos1[0] == photos2[0] def test_eq_2(): """Test equality of two PhotoInfo objects when one has memoized property""" photosdb1 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photosdb2 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photos1 = photosdb1.photos(uuid=[UUID_DICT["in_album"]]) photos2 = photosdb2.photos(uuid=[UUID_DICT["in_album"]]) # memoize a value albums = photos1[0].albums assert albums assert photos1[0] == photos2[0] def test_not_eq(photosdb): photos1 = photosdb.photos(uuid=[UUID_DICT["export"]]) photos2 = photosdb.photos(uuid=[UUID_DICT["missing"]]) assert photos1[0] != photos2[0] def test_photosdb_repr(): photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photosdb2 = eval(repr(photosdb)) ignore_keys = ["_tmp_db", "_tempdir", "_tempdir_name", "_db_connection"] assert {k: v for k, v in photosdb.__dict__.items() if k not in ignore_keys} == { k: v for k, v in photosdb2.__dict__.items() if k not in ignore_keys } def test_photosinfo_repr(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["favorite"]]) photo = photos[0] photo2 = eval(repr(photo)) assert {k: str(v).encode("utf-8") for k, v in photo.__dict__.items()} == { k: str(v).encode("utf-8") for k, v in photo2.__dict__.items() } def test_from_to_date(photosdb): """test from_date / to_date""" os.environ["TZ"] = "US/Pacific" time.tzset() photos = photosdb.photos(from_date=datetime.datetime(2018, 10, 28)) assert len(photos) == 16 photos = photosdb.photos(to_date=datetime.datetime(2018, 10, 28)) assert len(photos) == 7 photos = photosdb.photos( from_date=datetime.datetime(2018, 9, 28), to_date=datetime.datetime(2018, 9, 29) ) assert len(photos) == 4 def test_from_to_date_tz(photosdb): """Test from_date / to_date with and without timezone""" os.environ["TZ"] = "US/Pacific" time.tzset() photos = photosdb.photos( from_date=datetime.datetime(2018, 9, 28, 13, 7, 0), to_date=datetime.datetime(2018, 9, 28, 13, 9, 0), ) assert len(photos) == 1 assert photos[0].uuid == "D79B8D77-BFFC-460B-9312-034F2877D35B" photos = photosdb.photos( from_date=datetime.datetime( 2018, 9, 28, 16, 7, 0, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=72000)), ), to_date=datetime.datetime( 2018, 9, 28, 16, 9, 0, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=72000)), ), ) assert len(photos) == 1 assert photos[0].uuid == "D79B8D77-BFFC-460B-9312-034F2877D35B" def test_date_invalid(): """Test date is invalid""" # doesn't run correctly with the module-level fixture from datetime import datetime, timedelta, timezone import osxphotos photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photos = photosdb.photos(uuid=[UUID_DICT["date_invalid"]]) assert len(photos) == 1 p = photos[0] delta = timedelta(seconds=p.tzoffset) tz = timezone(delta) assert p.date == datetime(1970, 1, 1).astimezone(tz=tz) def test_date_modified_invalid(photosdb): """Test date modified is invalid""" photos = photosdb.photos(uuid=[UUID_DICT["date_invalid"]]) assert len(photos) == 1 p = photos[0] assert p.date_modified is None def test_import_session_count(photosdb): """Test PhotosDB.import_session""" import_sessions = photosdb.import_info assert len(import_sessions) == PHOTOS_DB_IMPORT_SESSIONS def test_import_session_photo(photosdb): """Test photo.import_session""" photo = photosdb.get_photo(UUID_DICT["import_session"]) import_session = photo.import_info assert import_session.creation_date == datetime.datetime( 2020, 6, 6, 7, 15, 24, 729811, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=61200), "PDT"), ) assert import_session.start_date == datetime.datetime( 2020, 6, 6, 7, 15, 24, 725564, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=61200), "PDT"), ) assert import_session.end_date == datetime.datetime( 2020, 6, 6, 7, 15, 24, 725564, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=61200), "PDT"), ) assert len(import_session.photos) == 1 def test_uti(photosdb): """test uti""" for uuid, uti in UTI_DICT.items(): photo = photosdb.get_photo(uuid) assert photo.uti == uti assert photo.uti_original == UTI_ORIGINAL_DICT[uuid] def test_raw(photosdb): """Test various raw properties""" for uuid, rawinfo in RAW_DICT.items(): photo = photosdb.get_photo(uuid) assert photo.original_filename == rawinfo.original_filename assert photo.has_raw == rawinfo.has_raw assert photo.israw == rawinfo.israw assert photo.uti == rawinfo.uti assert photo.uti_original == rawinfo.uti_original assert photo.uti_raw == rawinfo.uti_raw def test_verbose(capsys): """test verbose output in PhotosDB()""" photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB, verbose=print) captured = capsys.readouterr() assert "Processing database" in captured.out def test_original_filename(photosdb): """test original filename""" uuid = ORIGINAL_FILENAME_DICT["uuid"] photo = photosdb.get_photo(uuid) assert photo.original_filename == ORIGINAL_FILENAME_DICT["original_filename"] assert photo.filename == ORIGINAL_FILENAME_DICT["filename"] # monkey patch original_filename = photo._info["originalFilename"] photo._info["originalFilename"] = None assert photo.original_filename == ORIGINAL_FILENAME_DICT["filename"] photo._info["originalFilename"] = original_filename # The following tests only run on the author's personal library # They test things difficult to test in the test libraries @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_not_visible_burst(photosdb_local): """test not visible and burst (needs image from local library)""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["not_visible"]) assert not photo.visible assert photo.burst @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_visible_burst(photosdb_local): """test not visible and burst (needs image from local library)""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst"]) assert photo.visible assert photo.burst assert len(photo.burst_photos) == 4 @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_burst_key(photosdb_local): """test burst_key""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_key"]) assert photo.burst_key photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_not_key"]) assert not photo.burst_key @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_burst_selected(photosdb_local): """test burst_selected""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_selected"]) assert photo.burst_selected photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_not_selected"]) assert not photo.burst_selected @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_burst_default_pic(photosdb_local): """test burst_default_pick""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_default"]) assert photo.burst_default_pick photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_not_default"]) assert not photo.burst_default_pick @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_path_edited_live_photo(photosdb_local): """test path_edited_live_photo (needs image from local library)""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["live_edited"]) assert photo.path_edited_live_photo is not None @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_path_edited_live_photo_not_edited(photosdb_local): """test path_edited_live_photo for a live photo that's not edited (needs image from local library)""" photo = photosdb_local.get_photo(UUID_DICT_LOCAL["live"]) assert photo.path_edited_live_photo is None def test_is_reference(photosdb): """test isreference""" photo = photosdb.get_photo(UUID_IS_REFERENCE) assert photo.isreference photo = photosdb.get_photo(UUID_NOT_REFERENCE) assert not photo.isreference def test_adjustments(photosdb): """test adjustments/AdjustmentsInfo""" from osxphotos.adjustmentsinfo import AdjustmentsInfo photo = photosdb.get_photo(UUID_DICT["adjustments_info"]) adjustments = photo.adjustments assert isinstance(adjustments, AdjustmentsInfo) assert adjustments.asdict() == { "data": b"mW[\xb7\xa2:\xb3\xfd/\xbe\xda\xa3\x17((\xf4\x18\xdf\x03H\xc2E\xb9%\\\xc4\xb3\xce\x03\x02\x12.\x82\n\x1at\x8f\xfd\xdf\xbf\xb8\xba\xfb\xec\xdec\x1c\xde\x92\xaa\xcc\x9aU\t\xa9\x99\xbff\x8f\xe26T}gv\xa7~\xf6\xe3\xaf\xd9\xf1^\xb5\xb9s?\x1f\x8b\xdb\xec\xc7\x8c\x97\xf5\xf5r\xf6m\x96^.\xd1O\xbf\xf7\xe4\x8a\xff\xce}\xe7\x17\x1c3\x0c\x19)\xce)*\x1e\xd5O#\xffmvi\xd3\xf1\xd4\xdf\xce\xcc\xd3\xc5\xfb\xd9\xdf\xdff\xe7bL\xf3tL\xdf\xf8\xe7t\x18\x8b[\\\xe5#\x99\xfdXr\x0b\x81-\xa8.E[u\xc5?\x11\xd8\xba\xef\x02C\xff\xe9l\x14UI\xc6\xd9\x0f\x81[.\xbe\xcd\xfa[Utc:\xfe\x0c\xc7\xd0\xdf\xb1\xd2\xf1\xff\x163\x06i^\xdf\x87\xf1\xcc\xdc\x86\xd9\x8f\xff\xf9\xeb\xff\xf1(\xba\xf4\xd8\x16\xf9\xec\xc7x\xbb\x17,\x8bb\x1c\xab\xae\x1c\xde\x04\xfb\xd3\x89\rw}\x96\xb6\xbb\x9fq\xb9o\xbf&\r6n\xdfs\xc3\xd7d\xd5]\xee\xe3o\x9f\xefKn\xbd\x14\xc4\xe5\x8a\x93\x16\xc2ZX,\xe4\xdf\xab\xc0t\xe9\x87\xfb\xad\xf8\x03Hm\xd3\xac\xf1\xfa\xaa\xfb\x13]\xbd\xbd\xa1\xbab\xf8\x89>\xbcs\x1c\xc6*\xfbbu\xe1\x16\xef \x1c\xb7\x96\x84%\xbf\\/DA\xe6xy\xc5\xadY\xfdD\xee\xcb&K\xdcR^\xf0\xe2JZ-\xd6\x82\xc8I\xac\x12\xf7\xb1\x8f\xd2\xf6\xfe\x0e\xfe}!\x89+\xee\x8f\x8f\x15\xf3\xf8'\x11\x86\xbe\xe4\xe5\xf5J\xe4Y\xa5EYZ\xf0k\xf1\xdbl\xec\xbb\xb4EiW\x16\xbf\x82\x08\xe2j\xcd\t\xb2\xb4\\\x8bk\xf1\xbd}\x0b\xf1\xcb\xb2\x14\x17\xb2\xc0\xf3\xeb\x95\xb0\xe6DIZ,\x99I\x96\xde&Q\xfe\xf7\xc7\x88}\x95\xd1N/l\xb3at\xd9\xe6\xdc\xe5\x88\xa3\xc6\x8f\x15q\x8f\xf8\xc6\x89U'\x860\xb9\xda\x1b\xf7b\xc1\xf2\x18\xab\xe7;\xe4\x13Ro\x82\xb5%\x83\xaa\xe1\x0e\xc4\x8c-\xd8\xf2\x9e\x19\xe9m\x9c\xf2\xf9\x18\xc7r\x9a\xb5\xfcb\xbfl\xb5\xcf\x0fbQ\xad\r\xbd\xa8\xc9\x13\x0bf^\x84\x94\t\xaa\x073\x06$\xd1#\x07\xc4\xaa\xb5\x07m\x92\xc4\x1b\xdd\xb4\xd2\xd6I\xa6G\t\x97Jy\x0co4\xcc\xc5\x88\x8f\x0eC\xb4\xe0\x0fG\xfe2\xed\x8d\xe8T\xa8gM\xc3\x8d\x13Q1fD\xa2H\x831\xe2s#\xe2\xc8\x1e\xc3\x9c\xe1\xb6\x0c\xb7\t\xe2\xe6fz\xe9\xf0\xf8\xfc\x08\xd7\xa2\xc6\x0f\xdeAEcx>\x84)\x8c\xae\xd1\x83\x1b\x86Mm\xc5\xa7)k[Q\x80Op\xc0\xaa\xca\x80\x92c\xa46\x19\x08\x84\xd0\x00\xf9\x1eG\xc4b\x80\x07\xdc\xb6\xdb\x98\x1b\xb3\x00\xf2\xf6\xbe\x8aJt\x02\xce\xa6\x94[\xb7C\xf8\x14\xa1>\xd2/Q\xf3,??\xb6\\\x98!\xd2p\xa1\xd7\xbb\xa6j\x9d\xd0\x9c1\xa3\x9c\xa3\xbd\xec\xd4P\xe5\x04\xc3\xdf\x80\x97m\xdc\x8c\xc7/\xc0F,\x83\x05\xf4\x92\x92\xd3\xb5\xd8\xe7\x1fZ\xf4\xf9\x11\x19\xf6\xa2\xdc\xc0!\x12\xac\r?\xc5%L\xa5\x90\x12\x13C\xd5\x0c\xa3\t\xed\xdd\xb8\xc7\x11\xaa\xb6x\xab\x9aI\xf3\x8ba\xc3\xf6\x8e\x9f\x18 \x7f\xfa\x02$\xacV~\xe8\xc4\xad\xb5rt;\xcc\x91\xca;\xb2\xb2\xa7\x93\xdb\x81\xa7\x1f\x00b#\xad\xc9\xf6\x08e!\x8c\xca\x18?\xbd\xc2J\xb3\xea\x10^\xaa/\x82\xdc\x9b \xc3\x0b\x7f\xe1\xb5\xb0\xd1\xe2\xc4QK\xf1\x1ey\x02r\xc9\xd6\x02HA\x00\x99\x18t~\x98\xf3\xa2\x94$!\x8a&'\x82\x93\xbf\xe7P\xbe\x87\xe7\xb2\xfd\xfch\x96\x9f\x1f\xf8!\xff\xc30\xe4\x8b\xdf\x88\xe1\xdevsU\x1c\xbdk\xc96\x8b\xce\xe5mB\xaf=l\xb9\xb8s\x8e7^\\\xb2cD\xae\xefc\xd9\xf6\xfb\x18E7k\xa4\x97X\x9b\x9f\xf0]Y\xed\xc1\xa5\xfb\xaa!\xf7\xab\x86<l\xbde\xdf\x1fp\x1e\x9a\xb1\x99\x14jG\xf4s\x9f\x132\xef\x8d.\xa9m\x1c\x1fL\xbd\xd9?T\xb0\xc3\x9f\x1f\xd6\x96\x01\x1c\xf5\xa6\x8coj\xb1E)\xb1W\xcd\xeb\x10\xe4\xb2\xcbq\x9f\x1fy0w|\x9e7\x82p'\x04\xe5\xa4\x10\xedI\x91\x8b@\x0c\xe2\x81\xac'\xbf5_\xc3\x0b\x05H\xb79\xfb\xee\xa1q\x05\xfa\x88\xa56\x15\x10R\x0f(\x92\xab\xbd|\x84\xc8\x0e\x82\x81\xe2;\xd9J\xc6\xc5?f\x13}\xc0'\xf5\xfcR8i1\x87_\xca<\xd5(\xf5\x81\x1a>\xb5)\xb9x5\xef\xfaP\x91\x02\xed\x00\x1c\xa7\xbf6\xe1\x93B\xc8!\x8d2<\x02|\x80\x8c\x1e\xc4\nN\xc8Xou\xfb\xe2W\xc9\xc2|\xf9\xc7\xb4\x94oo\x1c\x9d\nX#\xbd\xa3Q\x0eCl\x16\xce\xb3a\xd9\xc8\x9b0\x18\xed\xddR\xb4\x1f\xaf+\x82j\x883\x04\xcf\xf0\x98\xc5t\xf2}\xfd\xe4xm\xab\xd6a\x1c\xde\x0e\xf8\xd0\x99\xe7KtT\xa31\xea\x14'\xf3\xb9\x9d\x86\xedt\x8b\xc1`\xe2\xbe\xb6kE\xb2_bV@Q4\xba\xa6|Vk\xdf\x16{O#\xd3\x11l\xa8g\xa2tm\xb8M\xb8\xa6\x82\xa9\xf9\x99WD\x8el\xb8y\x9c\xc1v\x02\x9d\xe2\xea>54\xc4\x9d\xed']\xee\xb4\xecfW\r\xb55n(\xf4\x8d\x9d\xec\xe9\xe3\xa4\xae6\xd66\xaa\x16j\x04\xe1\xa8`\xaa|~\x9c\xb4K\xef\x18>\x97\xb3\x04=\xb1\\\x9c4?q6H\xe6\xad\x8b\xe9\xe5\x94_j\x88\x01\xe3Ar\xb8\x90\xf3kG\xd9\xd5\xc3\xdd\xc5D\xda\xdf\x9d\xbal\nEOh\xd9U\xaf\xb3\xc1\x9b\x87\x0b\xe9pp:\xf7s\xfa\xf9!k~co\xc9\xee\xbc=\xd9\xaeD\x17\x08t\t\xceU\x93U\x88\xc3\xa6B\x91\xa5\r\x12\xae\xc7\xad\x0b\x92\x97\xaf\xeb\xca\xc1TV\xb5\x9en\"\xc1\xce\xab\xca\x9ao\xe5vs\xf3\xe5\xd1\x08\xedC\x80^km\x0e\x1c\x80\xfc\x00\x9at\x7fUwW\xb0\xf5#\x1d5\xa5\xb1\xf1s\x0bq\x9d\x86\x04g\xfbl\xc16,/h\xe3K\x9a\x00\xcf\x04^\xdd\x83\xec\xd4\x15\xfb[\xf5CHe\xd8yZ*\xf9W\xb5s\\;C\x13\xa2\x9d^\xdby\x82\xe8IG}\xa8W`\xb0j\xe5\xe6\xe0\x86\xb74\xff\xb4+\xb9-$\xb4\xddm\x86\xa7\xf6R<XJN\xd8\xb7\xe7J\xbf\xdb\xbb\x8bTw\x9bMnm\xedC\xab\x82\x01\xa8\x12\xf6\xc8\xba6p\xc6\x9aj\xf2\xb04\xb3\xde=\xc1k\xfb\xa2/\xa49\xd0\x0e\xfd\t\xa9\xe0\xc5\xae\x86\xbdNh\xb7\x05\x19\x06\x08\xc8 \xc8p\xcd\xeb^jEq3U\xae\xd1\xd3\xa2\x9f\x9a\x0b\xab\x93\xab\x95,\xaf\xa7];XX\xdb5\xf7\xf4jen\x06!\xf1\x83\x8b\xebE@\xc4\x94\xdf\x00\x9f\xdb\x9b\x1b\xfbaa\xe1\x9a\x92\xc8\xb1Z*\xe4H>oa\xd6\x1c\x9e\x88\xd7\x0f\\\xe0=]b\xc0\xc4\x06T:\x00\xd5\xce-l\x9e\x8d\xba'^\xe5(\xb6&\r\xdef\xe0vA\xd38%w\xd4\xd4\xcc\x86\xa8<\x1b\xb8\x19\xdc\xe7+\xb7l\xa5H7\x9f\x1f\x9e)\x84\xdd\x15G\x9e\xb1\x14B\xa2:\x1bm\x11z\x16\x95\xaf`\x1a\x12\xf3iwf\x15\x12\x0b\xfbw\xebE\x9f\xbe\x16iv\xc0\xdd]FL#\x99m\x12?d'\xa9\xf3\x02K\xd8\tM\xfd\xa8\xf2\x87\xed\xf4\xf7\xb6zB\xeb<\x90+\x19\x1f\xe0U\x1e\xdb\xa9-\xad\x8e\xbb\xd4\x15\xb8\x9aUYoqx\xb3\x96\xc3<\xa8y\xc7i\xc2\x97_\x8d\x0b\xad51+\x8c\x03\xf7\x8a\xbd\xa1R\xae\x83\xe1\xd4\xd4\x05\xeb\x10FY\x9dqT\xeen\xef\x8bw\x15\x80[\xe6e\xd3\xb8\x84:%5Y,\xe1\xb6\xef\xec*\xa7\x10daG\xa5\x07\xd8J\xfe\x86\xa8\x9e\x9e\xf5\x8e:\xd9Xk@\x98*B\xc8\xda\\\xecM25Rp~ME\x0ey\xe5\x18\xa1\xf6\xa2\x9f\x95\xb4F\xb06\xac&\xca\xa6'6;.\xa8H\xfe\x04\xad\x8dw\xea\x1e[n\x92\xac\x91\x12\x03\x7f@\x83\xcf\x19\x10%\xaeG\xec\x03\x14\xc2C\xa9\xa6\x8a\xde\xd2r\xc2\x81\x06\xd3&&\x9b\xb8\x85\x87d\x9f\x93C\xa3\t\xa6\xb3\xf7\xe5J[\x8c\xf9\x92\x8a\xaca\xf6N\xe4\x7f~\xa0\x9d\x9c\xe1\xfbt2!l\xfcM)\xed\xd9\x11\x0fu\x94\xabz$\x9c\x86\x89\xdca\x96\x8cu\xa5%\x86I\x8f\x15\xa9\x00\x10}tDQ\x0b\r\x13\x87>\x1f\x00Xz\xa9\xb2\xc84A\xc1\x13\x95\x1b\xd8\xd3KG\x9e;C\xe7\xc8\xb1\x94\x13\x8d\x96\xac\xd7r\x9e\x1e\xf5\xa4\xc4\xee\x1a\x8a\xc2\xbe$\x0f\x15\xf6\xe1\xfeL\x12Y7)k\xe3\x0e\x01K\xc1\xb3\xd1\x96\x80\xa2q'*\xde\xb5'\x13\t\x04\xae\xa04\xdc\xb8MLv\x17\x9f\xff\xfcx\xee\xe6\xc6\xb5t7\ngh\xe1p\x1d\xab\xfb\xd3b=kD\x16\x81\xfb>H'\xa7\xd78\x01\x17\xaa\xab\x02\xd1\x0e\x11\x02s\x80\x05\x8f\xdd\xa6;v\xabF\x90\xca>\xb8\x98~J\x9e\x0bm! \x7f\x82\x0b\xe0\x0c~\xad\x08\xecW\x0c]\xaf2\xac\xad\xe9G)\x95\xae\xe0\x9c\xb0}\x96(\xe8B/\xa4\xbc\x08\xf6\xe10 H@\x04\xfc\x145Gv\xd7\xd8\x9a2?\x82\xbd\x106\xc8\xe2uI\xc9\xee\xbe|\xd2T!H\xe9<c\xb7\xa7\xa3\"G\xd5G;{a\xd70\x85$\x08\x118\x81\xa8\xd97\xea$\x81\xde\x0f:\xe4\xdc\xb5\xaew\xacR\xa0\xa0\x1d\x9c\x04\xc55\x90l\x9c<\xbd (\xa0uW\x16\xa5\xa6\x84N\xed\xcfc\xed98*\xe5,\xa3m\x10xv\x08\xae\x92\x82\xado\xc0A\xf1v\xbe\xbc\xd5\xf7\xc0c\xdd\x12k\xcb\xd2;\x95\\\xa9-\xfb\xff0\xe9\xdf\xbe\x05\xb8\xf2\xa7|]\xfeK\xbcr\x1c\x93\x9e\x94Tc\xf1K\xbe\xf2o\xf9\xfa\x87\xfc}\xbfD\xf8\x9f\xc2\xf8\x1fI\xfcK\"\x7f\x9b\x11\xa6?\xb7\xc5\xf3m\x96\xb8\xd5R`\xb2\x9d\xe9vQ^I\xd2\xfa\xef\xdf\x8a|\xd3w\xe3\x8d=A\xfe\x10\xe9\x98\xa4yO\xdf\n\x9dyU9{bT\xa7\xea\xeb\xa9\x84\xcf\xe9m\x0c\xfa\xae\x98\xfd\xfd\xbf\x7f\xff\x17", "editor": "com.apple.Photos", "format_id": "com.apple.photo", "base_version": 0, "format_version": "1.5", "adjustments": [ { "formatVersion": 1, "enabled": True, "settings": { "offsetLocalLight": 0, "offsetHighlights": 0, "inputLight": 0.3073453608247423, "offsetExposure": 0, "offsetBlackPoint": 0, "offsetBrightness": 0, "statistics": { "p02": 0.00784313725490196, "p50": 0.09803921568627451, "autoValue": 0.2856, "blackPoint": 0.0031976514035982175, "tonalRange": 0.09845670498375754, "p25": 0.03529411764705882, "p98": 0.6, "lightMap": "FVpKd0pbSVkQWA5XR1kNWBNWFFYqMCOpJFgbWBmuF1YhjCT7J9Eik0ZhIWJFl1PIVGlWa1dtWW9acl12X3lD/hJwDlUPVkdYJFcPVRAxFBZIWEhYGVNEWBJXElYYWCGIJalNYxvgF3AgbUrwUd5V1VZsV21Zb1pxXHVfeBmDDSkNVw5WF1YVVDFWR1dHV0hXSFdIWElYGVkTWkrIPasv/U75D1sPZBRtUmZUaFVqVv0ssCjJWfxcll54FyEZSBBWR1YbVBkcET4UHEdXSVhJWElZSllKW0tcTF1MXiVgRfENCg9lOnRSfVRoVGpVkyg/K0UcRhk0UPoOIBJfR+dHVw0NDzMaHB9YSFhJWElZSlpKWktbTF1MXk5gT2FPYg0GDWQ1vDV/VHM2gCFsV4JC1xWgFa8UwhISFBIUVxRXOWoSVRiKSKBIYklZSllKWkpbS1xMXk1fT2FPYhBmDQUNWlJ6NGMUdRB1N9AXwxOnEyQTEhMRDkcXRRcUFVgWSyPeJaciZUpiSlpKW0tbTFxMXU1fT2FPYlFkDWYNBg5uVP4ROhKJERARERISEnQUd158YYURVxNVFxQX0RdXFmgl/k3/Sv9KWkpbS1xMXU1eT2FPYlFkUXMOdB5tPqgv/w+9KYwqoFl0WnNbr153X3lhq0pbSloXWRVrJtwpWD+fSuA6XEpnTF1MX05gT2FPY1FlP3ooZSdUIWIYeBnhGmodhh+oHnYjMSWZIGkXvBELS/JKXEpbGkgWrBeKRahM6kzZTd9O00/dT+NQ11HTUL4TgxAhDywROREWEWsh7xQlIzszRTRGM0MuPRt6EoVMXUxeFFwPEA8ODzQRRhLFEswSuhK8HpQbcxwvFywPQg4fDW0SzA+aDwwQEBUyDxYpPj1OQFA8TDZENNoqkUywFF0RDw8ODhEQERHoEWASYhtjKGMpQiY2IzQbag9rDwwQGw4SDhoNDw0SFSIeNyk9O09CUTtML35MvzqRFBUScRFmFbcWwxQQGfNPllBjUWUrZSZnImpVbBVtVnANcQ0LDSMaKSEsISojMjA8Mz5ceF55Hnkgyi7QM5oPDhxbECwPIRa7HOkU7w4IDQcPeVN9HOdWcFlxEnAOGQwHDR0mMyw3LDcrMikwMD0seGCMYXwvfB6CJKVi2BVFFtASwA/fDpoNHQ0dDwwP5g2fDQYNCR91JpIPdw13DRAOGSs8N0U0QjNALjsuOSh8XuNjgkeAGYwgnizmH1IZphnSTfmo+w/9DQkMKhLmKfMO8w2REnYSdBIRFB0SIAwRJDs8SjtKOEYzQGGAZIA6jGaCV4MdiiJ+K9lCrQ9tHUMZTRz7D+ENERQTFIwXqBLqEKQVGRkgHCQdJR0nDR4NKylEKUgpRCQ8D4FmhFqOZ9NjiBmDGZUw9FnPDa8QqBnNOMcRxRwnGjMdYRwfGRoUGiEsJjArNSk1JDQfLg0KFhwlLCsyDzAPFg8NUolmiGuMLp8jnCCdJKMZlBEsEB8SPh7jHSclLiYvJDIjLyEzKzwzRDNFMUQxRBEzEhMXGhwnKEcSERE9ETcSj1GPaJVWkxiOHoweoxkpFB0ODg0nDyMjNS47Mj0yPjA+ITUhQTpOPVE5Sw1CEQ0XICMvJS4qahVNJlw4dR9mKFckZyR1GZ0TPyOhHFYMEw8ZEBMdJSImHjohPiNAMD8sPCs0LTkkNg0bDBcMFRgmHSksOyzdJMAeaC/PI4UnqSVPH34UhBNCD2UPJw9qExsYIyMnIiUhJSQuJzwyQDVDMT0uOCMvDhcMIhQUDRAnPTJ4L4kjvidvMNouliyFJmshqhtvEzgblxlgJn0pjiEqIigjKSUrJ3s+Tj1NNkUzQit2DlISDg0NFXAMCw8dGEsfkje/KHgimSVgLrcXRR6TErcPcxt3FGwhjh23FKonMidwFEcUnw8vEK8QChBPGcoNBxMSDkEUaA4UElYWPx9wHaEmzxedF1AbVRlpGmAajRFjHJkVcxySIn0TihdyElMSLBXSJOYY7RAWEQsRsQ0HFRYOPhMZF4UZgBaAGlwgxSTDFakWhCWlFZYXdhZkD4INXQ9iD2td3w5yEZoNVQ/RL9cSuxfIFFkQCg8XDR4UGRdBGV4fsxhuFcYtjiDYHIwbihiEE5QRbRVlFHISUQ1TEFgPaA2cD4ASxw9kFowpnhyLHG0hbg9YDwgNCg0PGVohgSO7F54XghvBFoUXmhY9GIwWfxNhE34PMRKhEekOxw5uDykNVhF6F8sr0CWhLpQ1/yL+HqgOCA0HDUsqtiuyJYYUtRJhFXoTaxNoD04SeBOBE5MURRE+ES4PDw0LDhoVFw9QEpIQahy2D24RQxF2ENsQjA4JDQUOPiHJKIQVaw8qEmYSVg8wEnUPUw15EXUssRFhEVEQaRkbEnYMDA+bEX4UkRJ1G8AcuQ9fDB4Taw+cDQcNBRNBGtMczSOHI4YTUREfEVkXkBx8EoQTnRNuDnoNJg4wElsNYRWjE8MSYyPTTeFJuA2gDAUNjQ+WDysNBw0JHlkREynRF6YenRNkEZAPLQ9KGXEPnhGSD3gPfg0gD3o=", "localAutoValue": 0.36000000000000004, "whitePoint": 1.003921568627451, "p10": 0.01568627450980392, "highKey": 0.8063460882459689, }, "offsetContrast": 0, "offsetShadows": 0, }, "identifier": "SmartTone", } ], "metadata": { "masterWidth": 3024, "pipelineVersion": "OSX.4", "masterHeight": 4032, "orientation": 1, }, "orientation": 1, "adjustment_format_version": 1, "version_info": { "buildNumber": "19G73", "appVersion": "161.0.120", "schemaRevision": 1, "platform": "OSX", }, "timestamp": "2020-10-03T22:54:20+00:00", } def test_no_adjustments(photosdb): """test adjustments when photo has no adjusments""" photo = photosdb.get_photo(UUID_DICT["no_adjustments"]) assert photo.adjustments is None def test_exiftool_newlines_in_description(photosdb): """Test that exiftool handles newlines embedded in description, issue #393""" photo = photosdb.get_photo(UUID_DICT["description_newlines"]) exif = photo._exiftool_dict() assert photo.description.find("\n") > 0 assert exif["EXIF:ImageDescription"].find("\n") > 0 @pytest.mark.skip(SKIP_TEST, reason="Not yet implemented") def test_duplicates_1(photosdb): # test photo has duplicates photo = photosdb.get_photo(uuid=UUID_DICT["duplicates"]) assert len(photo.duplicates) == 1 assert photo.duplicates[0].uuid == UUID_DUPLICATE def test_duplicates_2(photosdb): # test photo does not have duplicates photo = photosdb.get_photo(uuid=UUID_DICT["no_duplicates"]) assert not photo.duplicates def test_compound_query(photosdb): """test photos() with multiple query terms""" photos = photosdb.photos(persons=["Katie", "Maria"], albums=["Multi Keyword"]) assert len(photos) == 2 assert UUID_DICT["multi_query_1"] in [p.uuid for p in photos] assert UUID_DICT["multi_query_2"] in [p.uuid for p in photos] def test_multi_keyword(photosdb): """test photos() with multiple keywords""" photos = photosdb.photos(keywords=["Kids", "wedding"]) assert len(photos) == 6 def test_multi_album(photosdb): """test photos() with multiple albums""" photos = photosdb.photos(albums=["Pumpkin Farm", "Test Album"]) assert len(photos) == 3 def test_multi_uuid(photosdb): """test photos() with multiple uuids""" photos = photosdb.photos(uuid=[UUID_DICT["favorite"], UUID_DICT["not_favorite"]]) assert len(photos) == 2 def test_detected_text(photosdb): """test PhotoInfo.detected_text""" for uuid, expected_text in UUID_DETECTED_TEXT.items(): photo = photosdb.get_photo(uuid=uuid) detected_text = " ".join(text for text, conf in photo.detected_text()) if expected_text is not None: assert expected_text in detected_text else: assert not detected_text
35.596299
7,228
0.694772
import datetime import os import os.path import pathlib import sqlite3 import tempfile import time from collections import Counter, namedtuple import pytest import osxphotos from osxphotos._constants import _UNKNOWN_PERSON from osxphotos.utils import _get_os_version OS_VERSION = _get_os_version() SKIP_TEST = "OSXPHOTOS_TEST_EXPORT" not in os.environ or OS_VERSION[1] != "15" PHOTOS_DB_LOCAL = os.path.expanduser("~/Pictures/Photos Library.photoslibrary") PHOTOS_DB = "tests/Test-10.15.7.photoslibrary/database/photos.db" PHOTOS_DB_PATH = "/Test-10.15.7.photoslibrary/database/photos.db" PHOTOS_LIBRARY_PATH = "/Test-10.15.7.photoslibrary" PHOTOS_DB_LEN = 25 PHOTOS_NOT_IN_TRASH_LEN = 23 PHOTOS_IN_TRASH_LEN = 2 PHOTOS_DB_IMPORT_SESSIONS = 17 KEYWORDS = [ "Kids", "wedding", "flowers", "England", "London", "London 2018", "St. James's Park", "UK", "United Kingdom", "foo/bar", "Travel", "Maria", "Drink", "Val d'Isère", "Wine", "Wine Bottle", "Food", "Furniture", "Pizza", "Table", "Cloudy", "Cord", "Outdoor", "Sky", "Sunset Sunrise", ] PERSONS = ["Katie", "Suzy", "Maria", _UNKNOWN_PERSON] ALBUMS = [ "2018-10 - Sponsion, Museum, Frühstück, Römermuseum", "2019-10/11 Paris Clermont", "AlbumInFolder", "EmptyAlbum", "I have a deleted twin", "Multi Keyword", "Pumpkin Farm", "Raw", "Sorted Manual", "Sorted Newest First", "Sorted Oldest First", "Sorted Title", "Test Album", # there are 2 albums named "Test Album" for testing duplicate album names ] KEYWORDS_DICT = { "Drink": 2, "England": 1, "Kids": 4, "London 2018": 1, "London": 1, "Maria": 1, "St. James's Park": 1, "Travel": 2, "UK": 1, "United Kingdom": 1, "Val d'Isère": 2, "Wine Bottle": 2, "Wine": 2, "flowers": 1, "foo/bar": 1, "wedding": 3, "Food": 2, "Furniture": 2, "Pizza": 2, "Table": 2, "Cloudy": 2, "Cord": 2, "Outdoor": 2, "Sky": 2, "Sunset Sunrise": 2, } PERSONS_DICT = {"Katie": 3, "Suzy": 2, "Maria": 2, _UNKNOWN_PERSON: 1} ALBUM_DICT = { "2018-10 - Sponsion, Museum, Frühstück, Römermuseum": 1, "2019-10/11 Paris Clermont": 1, "AlbumInFolder": 2, "EmptyAlbum": 0, "I have a deleted twin": 1, "Multi Keyword": 2, "Pumpkin Farm": 3, "Raw": 4, "Sorted Manual": 3, "Sorted Newest First": 3, "Sorted Oldest First": 3, "Sorted Title": 3, "Test Album": 2, } # Note: there are 2 albums named "Test Album" for testing duplicate album names UUID_DICT = { "missing": "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C", "favorite": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "not_favorite": "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C", "hidden": "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C", "not_hidden": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "has_adjustments": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "adjustments_info": "7783E8E6-9CAC-40F3-BE22-81FB7051C266", "no_adjustments": "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068", "location": "DC99FBDD-7A52-4100-A5BB-344131646C30", "no_location": "6191423D-8DB8-4D4C-92BE-9BBBA308AAC4", "external_edit": "DC99FBDD-7A52-4100-A5BB-344131646C30", "no_external_edit": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "export": "D79B8D77-BFFC-460B-9312-034F2877D35B", # "Pumkins2.jpg" "export_tif": "8846E3E6-8AC8-4857-8448-E3D025784410", "in_album": "D79B8D77-BFFC-460B-9312-034F2877D35B", # "Pumkins2.jpg" "date_invalid": "8846E3E6-8AC8-4857-8448-E3D025784410", "intrash": "71E3E212-00EB-430D-8A63-5E294B268554", "not_intrash": "DC99FBDD-7A52-4100-A5BB-344131646C30", "intrash_person_keywords": "6FD38366-3BF2-407D-81FE-7153EB6125B6", "import_session": "8846E3E6-8AC8-4857-8448-E3D025784410", "movie": "D1359D09-1373-4F3B-B0E3-1A4DE573E4A3", "description_newlines": "7F74DD34-5920-4DA3-B284-479887A34F66", "no_duplicates": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", "multi_query_1": "D79B8D77-BFFC-460B-9312-034F2877D35B", "multi_query_2": "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51", } UUID_DICT_LOCAL = { "not_visible": "4A836160-51B2-4E32-907D-ECDDB2CEC657", # IMG_9815.JPG "burst": "9A5B4CE6-6A9F-4917-95D4-1C98D14FCE4F", # IMG_9812.JPG "burst_key": "9A5B4CE6-6A9F-4917-95D4-1C98D14FCE4F", # IMG_9812.JPG "burst_not_key": "4A836160-51B2-4E32-907D-ECDDB2CEC657", # IMG_9815.JPG "burst_selected": "75154738-83AA-4DCD-A913-632D5D1C0FEE", # IMG_9814.JPG "burst_not_selected": "89E235DD-B9AC-4E8D-BDA2-986981CA7582", # IMG_9813.JPG "burst_default": "F5E6BD24-B493-44E9-BDA2-7AD9D2CC8C9D", # IMG_9816.JPG "burst_not_default": "75154738-83AA-4DCD-A913-632D5D1C0FEE", # IMG_9814.JPG "live_edited": "54A01B04-16D7-4FDE-8860-19F2A641E433", # IMG_3203.HEIC "live": "8EC216A2-0032-4934-BD3F-04C6259B3304", # IMG_3259.HEIC } UUID_PUMPKIN_FARM = [ "F12384F6-CD17-4151-ACBA-AE0E3688539E", "D79B8D77-BFFC-460B-9312-034F2877D35B", "1EB2B765-0765-43BA-A90C-0D0580E6172C", ] ALBUM_SORT_ORDER = [ "1EB2B765-0765-43BA-A90C-0D0580E6172C", "F12384F6-CD17-4151-ACBA-AE0E3688539E", "D79B8D77-BFFC-460B-9312-034F2877D35B", ] ALBUM_KEY_PHOTO = "D79B8D77-BFFC-460B-9312-034F2877D35B" UTI_DICT = { "8846E3E6-8AC8-4857-8448-E3D025784410": "public.tiff", "7783E8E6-9CAC-40F3-BE22-81FB7051C266": "public.jpeg", "1EB2B765-0765-43BA-A90C-0D0580E6172C": "public.jpeg", } UTI_ORIGINAL_DICT = { "8846E3E6-8AC8-4857-8448-E3D025784410": "public.tiff", "7783E8E6-9CAC-40F3-BE22-81FB7051C266": "public.heic", "1EB2B765-0765-43BA-A90C-0D0580E6172C": "public.jpeg", } RawInfo = namedtuple( "RawInfo", [ "comment", "original_filename", "has_raw", "israw", "raw_original", "uti", "uti_original", "uti_raw", ], ) RAW_DICT = { "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068": RawInfo( "raw image, no jpeg pair", "DSC03584.dng", False, True, False, "com.adobe.raw-image", "com.adobe.raw-image", None, ), "A92D9C26-3A50-4197-9388-CB5F7DB9FA91": RawInfo( "raw+jpeg, jpeg original", "IMG_1994.JPG", True, False, False, "public.jpeg", "public.jpeg", "com.canon.cr2-raw-image", ), "4D521201-92AC-43E5-8F7C-59BC41C37A96": RawInfo( "raw+jpeg, raw original", "IMG_1997.JPG", True, False, True, "public.jpeg", "public.jpeg", "com.canon.cr2-raw-image", ), "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51": RawInfo( "jpeg, no raw", "wedding.jpg", False, False, False, "public.jpeg", "public.jpeg", None, ), } ORIGINAL_FILENAME_DICT = { "uuid": "D79B8D77-BFFC-460B-9312-034F2877D35B", "filename": "D79B8D77-BFFC-460B-9312-034F2877D35B.jpeg", "original_filename": "Pumkins2.jpg", } UUID_IS_REFERENCE = "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C" UUID_NOT_REFERENCE = "F12384F6-CD17-4151-ACBA-AE0E3688539E" UUID_DUPLICATE = "" UUID_DETECTED_TEXT = { "E2078879-A29C-4D6F-BACB-E3BBE6C3EB91": "osxphotos", "A92D9C26-3A50-4197-9388-CB5F7DB9FA91": None, } @pytest.fixture(scope="module") def photosdb(): return osxphotos.PhotosDB(dbfile=PHOTOS_DB) @pytest.fixture(scope="module") def photosdb_local(): return osxphotos.PhotosDB(dbfile=PHOTOS_DB_LOCAL) def test_init1(): # test named argument photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB) assert isinstance(photosdb, osxphotos.PhotosDB) def test_init2(): # test positional argument photosdb = osxphotos.PhotosDB(PHOTOS_DB) assert isinstance(photosdb, osxphotos.PhotosDB) def test_init3(): # test positional and named argument (raises exception) with pytest.raises(Exception): assert osxphotos.PhotosDB(PHOTOS_DB, dbfile=PHOTOS_DB) def test_init4(): # test invalid db (bad_db, bad_db_name) = tempfile.mkstemp(suffix=".db", prefix="osxphotos-") os.close(bad_db) with pytest.raises(Exception): assert osxphotos.PhotosDB(bad_db_name) with pytest.raises(Exception): assert osxphotos.PhotosDB(dbfile=bad_db_name) try: os.remove(bad_db_name) except: pass def test_init5(mocker): # test failed get_last_library_path def bad_library(): return None # get_last_library actually in utils but need to patch it in photosdb because it's imported into photosdb mocker.patch("osxphotos.photosdb.photosdb.get_last_library_path", new=bad_library) with pytest.raises(Exception): assert osxphotos.PhotosDB() def test_db_len(photosdb): # assert photosdb.db_version in osxphotos._TESTED_DB_VERSIONS assert len(photosdb) == PHOTOS_DB_LEN def test_db_version(photosdb): # assert photosdb.db_version in osxphotos._TESTED_DB_VERSIONS assert photosdb.db_version == "6000" def test_persons(photosdb): assert "Katie" in photosdb.persons assert Counter(PERSONS) == Counter(photosdb.persons) def test_keywords(photosdb): assert "wedding" in photosdb.keywords assert Counter(KEYWORDS) == Counter(photosdb.keywords) def test_album_names(photosdb): assert "Pumpkin Farm" in photosdb.albums assert Counter(ALBUMS) == Counter(photosdb.albums) def test_keywords_dict(photosdb): keywords = photosdb.keywords_as_dict assert keywords["wedding"] == 3 assert keywords == KEYWORDS_DICT def test_persons_as_dict(photosdb): persons = photosdb.persons_as_dict assert persons["Maria"] == 2 assert persons == PERSONS_DICT def test_albums_as_dict(photosdb): albums = photosdb.albums_as_dict assert albums["Pumpkin Farm"] == 3 assert albums == ALBUM_DICT def test_album_sort_order(photosdb): album = [a for a in photosdb.album_info if a.title == "Pumpkin Farm"][0] photos = album.photos uuids = [p.uuid for p in photos] assert uuids == ALBUM_SORT_ORDER def test_album_empty_album(photosdb): album = [a for a in photosdb.album_info if a.title == "EmptyAlbum"][0] photos = album.photos assert photos == [] def test_attributes(photosdb): photos = photosdb.photos(uuid=["D79B8D77-BFFC-460B-9312-034F2877D35B"]) assert len(photos) == 1 p = photos[0] assert p.keywords == ["Kids"] assert p.original_filename == "Pumkins2.jpg" assert p.filename == "D79B8D77-BFFC-460B-9312-034F2877D35B.jpeg" assert p.date == datetime.datetime( 2018, 9, 28, 16, 7, 7, 0, datetime.timezone(datetime.timedelta(seconds=-14400)) ) assert p.date_added == datetime.datetime( 2019, 7, 27, 9, 16, 49, 778432, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=72000)), ) assert p.description == "Girl holding pumpkin" assert p.title == "I found one!" assert sorted(p.albums) == ["Multi Keyword", "Pumpkin Farm", "Test Album"] assert p.persons == ["Katie"] assert p.path.endswith( "tests/Test-10.15.7.photoslibrary/originals/D/D79B8D77-BFFC-460B-9312-034F2877D35B.jpeg" ) assert p.ismissing == False def test_attributes_2(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) assert len(photos) == 1 p = photos[0] assert sorted(p.keywords) == ["Maria", "wedding"] assert p.original_filename == "wedding.jpg" assert p.filename == "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51.jpeg" assert p.date == datetime.datetime( 2019, 4, 15, 14, 40, 24, 86000, datetime.timezone(datetime.timedelta(seconds=-14400)), ) assert p.description == "Bride Wedding day" assert p.title is None assert sorted(p.albums) == [ "AlbumInFolder", "I have a deleted twin", "Multi Keyword", ] assert p.persons == ["Maria"] assert p.path.endswith( "tests/Test-10.15.7.photoslibrary/originals/E/E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51.jpeg" ) assert not p.ismissing assert p.hasadjustments assert p.height == 1325 assert p.width == 1526 assert p.original_height == 1367 assert p.original_width == 2048 assert p.orientation == 1 assert p.original_orientation == 1 assert p.original_filesize == 460483 def test_missing(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["missing"]]) assert len(photos) == 1 p = photos[0] assert p.path is None assert p.ismissing == True def test_favorite(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["favorite"]]) assert len(photos) == 1 p = photos[0] assert p.favorite == True def test_not_favorite(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["not_favorite"]]) assert len(photos) == 1 p = photos[0] assert p.favorite == False def test_hidden(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["hidden"]]) assert len(photos) == 1 p = photos[0] assert p.hidden == True def test_not_hidden(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["not_hidden"]]) assert len(photos) == 1 p = photos[0] assert p.hidden == False def test_visible(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["not_hidden"]]) assert len(photos) == 1 p = photos[0] assert p.visible def test_not_burst(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["not_hidden"]]) assert len(photos) == 1 p = photos[0] assert not p.burst def test_location_1(photosdb): # test photo with lat/lon info photos = photosdb.photos(uuid=[UUID_DICT["location"]]) assert len(photos) == 1 p = photos[0] lat, lon = p.location assert lat == pytest.approx(51.50357167) assert lon == pytest.approx(-0.1318055) def test_location_2(photosdb): # test photo with no location info photos = photosdb.photos(uuid=[UUID_DICT["no_location"]]) assert len(photos) == 1 p = photos[0] lat, lon = p.location assert lat is None assert lon is None def test_hasadjustments1(photosdb): # test hasadjustments == True photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) assert len(photos) == 1 p = photos[0] assert p.hasadjustments == True def test_hasadjustments2(photosdb): # test hasadjustments == False photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) assert len(photos) == 1 p = photos[0] assert p.hasadjustments == False def test_external_edit1(photosdb): # test image has been edited in external editor photos = photosdb.photos(uuid=[UUID_DICT["external_edit"]]) assert len(photos) == 1 p = photos[0] assert p.external_edit == True def test_external_edit2(photosdb): # test image has not been edited in external editor photos = photosdb.photos(uuid=[UUID_DICT["no_external_edit"]]) assert len(photos) == 1 p = photos[0] assert p.external_edit == False def test_path_edited1(photosdb): # test a valid edited path photos = photosdb.photos(uuid=["E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51"]) assert len(photos) == 1 p = photos[0] path = p.path_edited assert path.endswith( "resources/renders/E/E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51_1_201_a.jpeg" ) assert os.path.exists(path) def test_path_edited2(photosdb): # test an invalid edited path photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) assert len(photos) == 1 p = photos[0] path = p.path_edited assert path is None def test_path_derivatives(photosdb): # test an path_derivatives photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) assert len(photos) == 1 p = photos[0] path = p.path_derivatives derivs = [ "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068_1_100_o.jpeg", "D05A5FE3-15FB-49A1-A15D-AB3DA6F8B068_1_105_c.jpeg", ] for i, p in enumerate(path): assert p.endswith(derivs[i]) def test_ismovie(photosdb): # test ismovie == True photos = photosdb.photos(uuid=[UUID_DICT["movie"]]) p = photos[0] assert p.ismovie def test_not_ismovie(photosdb): # test ismovie == False photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) p = photos[0] assert not p.ismovie def test_count(photosdb): photos = photosdb.photos() assert len(photos) == PHOTOS_NOT_IN_TRASH_LEN def test_photos_intrash_1(photosdb): photos = photosdb.photos(intrash=True) assert len(photos) == PHOTOS_IN_TRASH_LEN def test_photos_intrash_2(photosdb): photos = photosdb.photos(intrash=True) for p in photos: assert p.intrash def test_photos_intrash_3(photosdb): photos = photosdb.photos(intrash=False) for p in photos: assert not p.intrash def test_photoinfo_intrash_1(photosdb): p = photosdb.photos(uuid=[UUID_DICT["intrash"]], intrash=True)[0] assert p.intrash assert p.date_trashed.isoformat() == "2120-06-10T11:24:47.685857-05:00" def test_photoinfo_intrash_2(photosdb): p = photosdb.photos(uuid=[UUID_DICT["intrash"]]) assert not p def test_photoinfo_intrash_3(photosdb): p = photosdb.photos(uuid=[UUID_DICT["intrash_person_keywords"]], intrash=True)[0] assert p.intrash assert "Maria" in p.persons assert "wedding" in p.keywords def test_photoinfo_intrash_4(photosdb): p = photosdb.photos(persons=["Maria"], intrash=True)[0] assert p.intrash assert "Maria" in p.persons assert "wedding" in p.keywords def test_photoinfo_intrash_5(photosdb): p = photosdb.photos(keywords=["wedding"], intrash=True)[0] assert p.intrash assert "Maria" in p.persons assert "wedding" in p.keywords def test_photoinfo_not_intrash(photosdb): p = photosdb.photos(uuid=[UUID_DICT["not_intrash"]])[0] assert not p.intrash assert p.date_trashed is None def test_keyword_2(photosdb): photos = photosdb.photos(keywords=["wedding"]) assert len(photos) == 2 # won't show the one in the trash def test_keyword_not_in_album(photosdb): photos1 = photosdb.photos(albums=["Pumpkin Farm"]) photos2 = photosdb.photos(keywords=["Kids"]) photos3 = [p for p in photos2 if p not in photos1] assert len(photos3) == 1 assert photos3[0].uuid == "A1DD1F98-2ECD-431F-9AC9-5AFEFE2D3A5C" def test_album_folder_name(photosdb): photos = photosdb.photos(albums=["Pumpkin Farm"]) assert sorted(p.uuid for p in photos) == sorted(UUID_PUMPKIN_FARM) def test_multi_person(photosdb): photos = photosdb.photos(persons=["Katie", "Suzy"]) assert len(photos) == 3 def test_get_db_path(photosdb): db_path = photosdb.db_path assert db_path.endswith(PHOTOS_DB_PATH) def test_get_library_path(photosdb): lib_path = photosdb.library_path assert lib_path.endswith(PHOTOS_LIBRARY_PATH) def test_get_db_connection(photosdb): conn, cursor = photosdb.get_db_connection() assert isinstance(conn, sqlite3.Connection) assert isinstance(cursor, sqlite3.Cursor) results = conn.execute( "SELECT ZUUID FROM ZGENERICASSET WHERE ZFAVORITE = 1;" ).fetchall() assert len(results) == 1 assert results[0][0] == "E9BC5C36-7CD1-40A1-A72B-8B8FAC227D51" conn.close() def test_export_1(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].original_filename expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) def test_export_2(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) timestamp = time.time() filename = f"osxphotos-export-2-test-{timestamp}.jpg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) def test_export_3(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].original_filename filename2 = pathlib.Path(filename) filename2 = f"{filename2.stem} (1){filename2.suffix}" expected_dest_2 = os.path.join(dest, filename2) got_dest = photos[0].export(dest)[0] got_dest_2 = photos[0].export(dest)[0] assert got_dest_2 == expected_dest_2 assert os.path.isfile(got_dest_2) def test_export_4(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) timestamp = time.time() filename = f"osxphotos-export-2-test-{timestamp}.jpg" filename2 = f"osxphotos-export-2-test-{timestamp} (1).jpg" expected_dest_2 = os.path.join(dest, filename2) got_dest = photos[0].export(dest, filename)[0] got_dest_2 = photos[0].export(dest, filename)[0] assert got_dest_2 == expected_dest_2 assert os.path.isfile(got_dest_2) def test_export_5(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].original_filename expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest)[0] got_dest_2 = photos[0].export(dest, overwrite=True)[0] assert got_dest_2 == got_dest assert got_dest_2 == expected_dest assert os.path.isfile(got_dest_2) def test_export_6(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) timestamp = time.time() filename = f"osxphotos-export-test-{timestamp}.jpg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename)[0] got_dest_2 = photos[0].export(dest, filename, overwrite=True)[0] assert got_dest_2 == got_dest assert got_dest_2 == expected_dest assert os.path.isfile(got_dest_2) def test_export_7(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].filename got_dest = photos[0].export(dest)[0] with pytest.raises(Exception) as e: assert photos[0].export(dest, increment=False) assert e.type == type(FileExistsError()) def test_export_8(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["missing"]]) assert photos[0].export(dest) == [] def test_export_9(photosdb): # should raise exception tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) filename = photos[0].filename with pytest.raises(Exception) as e: assert photos[0].export(dest, edited=True) assert e.type == ValueError def test_export_10(photosdb): # try to export edited file that's not edited and name provided tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["no_adjustments"]]) timestamp = time.time() filename = f"osxphotos-export-test-{timestamp}.jpg" with pytest.raises(Exception) as e: assert photos[0].export(dest, filename, edited=True) assert e.type == ValueError def test_export_11(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) timestamp = time.time() filename = f"osxphotos-export-test-{timestamp}.jpg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename, edited=True)[0] assert got_dest == expected_dest def test_export_12(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["has_adjustments"]]) edited_name = pathlib.Path(photos[0].path_edited).name edited_suffix = pathlib.Path(edited_name).suffix filename = ( pathlib.Path(photos[0].original_filename).stem + "_edited" + edited_suffix ) expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, edited=True)[0] assert got_dest == expected_dest def test_export_13(photosdb): tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name i = 0 while os.path.isdir(dest): dest = os.path.join(dest, str(i)) i += 1 photos = photosdb.photos(uuid=[UUID_DICT["export"]]) filename = photos[0].filename with pytest.raises(Exception) as e: assert photos[0].export(dest) assert e.type == type(FileNotFoundError()) def test_export_14(photosdb, caplog): # test export with user provided filename with different (but valid) extension than source tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export_tif"]]) timestamp = time.time() filename = f"osxphotos-export-2-test-{timestamp}.tif" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest, filename)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) assert "Invalid destination suffix" not in caplog.text def test_export_no_original_filename(photosdb): # test export OK if original filename is null # issue #267 tempdir = tempfile.TemporaryDirectory(prefix="osxphotos_") dest = tempdir.name photos = photosdb.photos(uuid=[UUID_DICT["export"]]) # monkey patch original_filename for testing original_filename = photos[0]._info["originalFilename"] photos[0]._info["originalFilename"] = None filename = f"{photos[0].uuid}.jpeg" expected_dest = os.path.join(dest, filename) got_dest = photos[0].export(dest)[0] assert got_dest == expected_dest assert os.path.isfile(got_dest) photos[0]._info["originalFilename"] = original_filename def test_eq(): photosdb1 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photosdb2 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photos1 = photosdb1.photos(uuid=[UUID_DICT["export"]]) photos2 = photosdb2.photos(uuid=[UUID_DICT["export"]]) assert photos1[0] == photos2[0] def test_eq_2(): photosdb1 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photosdb2 = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photos1 = photosdb1.photos(uuid=[UUID_DICT["in_album"]]) photos2 = photosdb2.photos(uuid=[UUID_DICT["in_album"]]) # memoize a value albums = photos1[0].albums assert albums assert photos1[0] == photos2[0] def test_not_eq(photosdb): photos1 = photosdb.photos(uuid=[UUID_DICT["export"]]) photos2 = photosdb.photos(uuid=[UUID_DICT["missing"]]) assert photos1[0] != photos2[0] def test_photosdb_repr(): photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photosdb2 = eval(repr(photosdb)) ignore_keys = ["_tmp_db", "_tempdir", "_tempdir_name", "_db_connection"] assert {k: v for k, v in photosdb.__dict__.items() if k not in ignore_keys} == { k: v for k, v in photosdb2.__dict__.items() if k not in ignore_keys } def test_photosinfo_repr(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["favorite"]]) photo = photos[0] photo2 = eval(repr(photo)) assert {k: str(v).encode("utf-8") for k, v in photo.__dict__.items()} == { k: str(v).encode("utf-8") for k, v in photo2.__dict__.items() } def test_from_to_date(photosdb): os.environ["TZ"] = "US/Pacific" time.tzset() photos = photosdb.photos(from_date=datetime.datetime(2018, 10, 28)) assert len(photos) == 16 photos = photosdb.photos(to_date=datetime.datetime(2018, 10, 28)) assert len(photos) == 7 photos = photosdb.photos( from_date=datetime.datetime(2018, 9, 28), to_date=datetime.datetime(2018, 9, 29) ) assert len(photos) == 4 def test_from_to_date_tz(photosdb): os.environ["TZ"] = "US/Pacific" time.tzset() photos = photosdb.photos( from_date=datetime.datetime(2018, 9, 28, 13, 7, 0), to_date=datetime.datetime(2018, 9, 28, 13, 9, 0), ) assert len(photos) == 1 assert photos[0].uuid == "D79B8D77-BFFC-460B-9312-034F2877D35B" photos = photosdb.photos( from_date=datetime.datetime( 2018, 9, 28, 16, 7, 0, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=72000)), ), to_date=datetime.datetime( 2018, 9, 28, 16, 9, 0, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=72000)), ), ) assert len(photos) == 1 assert photos[0].uuid == "D79B8D77-BFFC-460B-9312-034F2877D35B" def test_date_invalid(): # doesn't run correctly with the module-level fixture from datetime import datetime, timedelta, timezone import osxphotos photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB) photos = photosdb.photos(uuid=[UUID_DICT["date_invalid"]]) assert len(photos) == 1 p = photos[0] delta = timedelta(seconds=p.tzoffset) tz = timezone(delta) assert p.date == datetime(1970, 1, 1).astimezone(tz=tz) def test_date_modified_invalid(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["date_invalid"]]) assert len(photos) == 1 p = photos[0] assert p.date_modified is None def test_import_session_count(photosdb): import_sessions = photosdb.import_info assert len(import_sessions) == PHOTOS_DB_IMPORT_SESSIONS def test_import_session_photo(photosdb): photo = photosdb.get_photo(UUID_DICT["import_session"]) import_session = photo.import_info assert import_session.creation_date == datetime.datetime( 2020, 6, 6, 7, 15, 24, 729811, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=61200), "PDT"), ) assert import_session.start_date == datetime.datetime( 2020, 6, 6, 7, 15, 24, 725564, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=61200), "PDT"), ) assert import_session.end_date == datetime.datetime( 2020, 6, 6, 7, 15, 24, 725564, tzinfo=datetime.timezone(datetime.timedelta(days=-1, seconds=61200), "PDT"), ) assert len(import_session.photos) == 1 def test_uti(photosdb): for uuid, uti in UTI_DICT.items(): photo = photosdb.get_photo(uuid) assert photo.uti == uti assert photo.uti_original == UTI_ORIGINAL_DICT[uuid] def test_raw(photosdb): for uuid, rawinfo in RAW_DICT.items(): photo = photosdb.get_photo(uuid) assert photo.original_filename == rawinfo.original_filename assert photo.has_raw == rawinfo.has_raw assert photo.israw == rawinfo.israw assert photo.uti == rawinfo.uti assert photo.uti_original == rawinfo.uti_original assert photo.uti_raw == rawinfo.uti_raw def test_verbose(capsys): photosdb = osxphotos.PhotosDB(dbfile=PHOTOS_DB, verbose=print) captured = capsys.readouterr() assert "Processing database" in captured.out def test_original_filename(photosdb): uuid = ORIGINAL_FILENAME_DICT["uuid"] photo = photosdb.get_photo(uuid) assert photo.original_filename == ORIGINAL_FILENAME_DICT["original_filename"] assert photo.filename == ORIGINAL_FILENAME_DICT["filename"] original_filename = photo._info["originalFilename"] photo._info["originalFilename"] = None assert photo.original_filename == ORIGINAL_FILENAME_DICT["filename"] photo._info["originalFilename"] = original_filename # They test things difficult to test in the test libraries @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_not_visible_burst(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["not_visible"]) assert not photo.visible assert photo.burst @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_visible_burst(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst"]) assert photo.visible assert photo.burst assert len(photo.burst_photos) == 4 @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_burst_key(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_key"]) assert photo.burst_key photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_not_key"]) assert not photo.burst_key @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_burst_selected(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_selected"]) assert photo.burst_selected photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_not_selected"]) assert not photo.burst_selected @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_burst_default_pic(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_default"]) assert photo.burst_default_pick photo = photosdb_local.get_photo(UUID_DICT_LOCAL["burst_not_default"]) assert not photo.burst_default_pick @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_path_edited_live_photo(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["live_edited"]) assert photo.path_edited_live_photo is not None @pytest.mark.skipif(SKIP_TEST, reason="Skip if not running on author's local machine.") def test_path_edited_live_photo_not_edited(photosdb_local): photo = photosdb_local.get_photo(UUID_DICT_LOCAL["live"]) assert photo.path_edited_live_photo is None def test_is_reference(photosdb): photo = photosdb.get_photo(UUID_IS_REFERENCE) assert photo.isreference photo = photosdb.get_photo(UUID_NOT_REFERENCE) assert not photo.isreference def test_adjustments(photosdb): from osxphotos.adjustmentsinfo import AdjustmentsInfo photo = photosdb.get_photo(UUID_DICT["adjustments_info"]) adjustments = photo.adjustments assert isinstance(adjustments, AdjustmentsInfo) assert adjustments.asdict() == { "data": b"mW[\xb7\xa2:\xb3\xfd/\xbe\xda\xa3\x17((\xf4\x18\xdf\x03H\xc2E\xb9%\\\xc4\xb3\xce\x03\x02\x12.\x82\n\x1at\x8f\xfd\xdf\xbf\xb8\xba\xfb\xec\xdec\x1c\xde\x92\xaa\xcc\x9aU\t\xa9\x99\xbff\x8f\xe26T}gv\xa7~\xf6\xe3\xaf\xd9\xf1^\xb5\xb9s?\x1f\x8b\xdb\xec\xc7\x8c\x97\xf5\xf5r\xf6m\x96^.\xd1O\xbf\xf7\xe4\x8a\xff\xce}\xe7\x17\x1c3\x0c\x19)\xce)*\x1e\xd5O#\xffmvi\xd3\xf1\xd4\xdf\xce\xcc\xd3\xc5\xfb\xd9\xdf\xdff\xe7bL\xf3tL\xdf\xf8\xe7t\x18\x8b[\\\xe5#\x99\xfdXr\x0b\x81-\xa8.E[u\xc5?\x11\xd8\xba\xef\x02C\xff\xe9l\x14UI\xc6\xd9\x0f\x81[.\xbe\xcd\xfa[Utc:\xfe\x0c\xc7\xd0\xdf\xb1\xd2\xf1\xff\x163\x06i^\xdf\x87\xf1\xcc\xdc\x86\xd9\x8f\xff\xf9\xeb\xff\xf1(\xba\xf4\xd8\x16\xf9\xec\xc7x\xbb\x17,\x8bb\x1c\xab\xae\x1c\xde\x04\xfb\xd3\x89\rw}\x96\xb6\xbb\x9fq\xb9o\xbf&\r6n\xdfs\xc3\xd7d\xd5]\xee\xe3o\x9f\xefKn\xbd\x14\xc4\xe5\x8a\x93\x16\xc2ZX,\xe4\xdf\xab\xc0t\xe9\x87\xfb\xad\xf8\x03Hm\xd3\xac\xf1\xfa\xaa\xfb\x13]\xbd\xbd\xa1\xbab\xf8\x89>\xbcs\x1c\xc6*\xfbbu\xe1\x16\xef \x1c\xb7\x96\x84%\xbf\\/DA\xe6xy\xc5\xadY\xfdD\xee\xcb&K\xdcR^\xf0\xe2JZ-\xd6\x82\xc8I\xac\x12\xf7\xb1\x8f\xd2\xf6\xfe\x0e\xfe}!\x89+\xee\x8f\x8f\x15\xf3\xf8'\x11\x86\xbe\xe4\xe5\xf5J\xe4Y\xa5EYZ\xf0k\xf1\xdbl\xec\xbb\xb4EiW\x16\xbf\x82\x08\xe2j\xcd\t\xb2\xb4\\\x8bk\xf1\xbd}\x0b\xf1\xcb\xb2\x14\x17\xb2\xc0\xf3\xeb\x95\xb0\xe6DIZ,\x99I\x96\xde&Q\xfe\xf7\xc7\x88}\x95\xd1N/l\xb3at\xd9\xe6\xdc\xe5\x88\xa3\xc6\x8f\x15q\x8f\xf8\xc6\x89U'\x860\xb9\xda\x1b\xf7b\xc1\xf2\x18\xab\xe7;\xe4\x13Ro\x82\xb5%\x83\xaa\xe1\x0e\xc4\x8c-\xd8\xf2\x9e\x19\xe9m\x9c\xf2\xf9\x18\xc7r\x9a\xb5\xfcb\xbfl\xb5\xcf\x0fbQ\xad\r\xbd\xa8\xc9\x13\x0bf^\x84\x94\t\xaa\x073\x06$\xd1#\x07\xc4\xaa\xb5\x07m\x92\xc4\x1b\xdd\xb4\xd2\xd6I\xa6G\t\x97Jy\x0co4\xcc\xc5\x88\x8f\x0eC\xb4\xe0\x0fG\xfe2\xed\x8d\xe8T\xa8gM\xc3\x8d\x13Q1fD\xa2H\x831\xe2s#\xe2\xc8\x1e\xc3\x9c\xe1\xb6\x0c\xb7\t\xe2\xe6fz\xe9\xf0\xf8\xfc\x08\xd7\xa2\xc6\x0f\xdeAEcx>\x84)\x8c\xae\xd1\x83\x1b\x86Mm\xc5\xa7)k[Q\x80Op\xc0\xaa\xca\x80\x92c\xa46\x19\x08\x84\xd0\x00\xf9\x1eG\xc4b\x80\x07\xdc\xb6\xdb\x98\x1b\xb3\x00\xf2\xf6\xbe\x8aJt\x02\xce\xa6\x94[\xb7C\xf8\x14\xa1>\xd2/Q\xf3,??\xb6\\\x98!\xd2p\xa1\xd7\xbb\xa6j\x9d\xd0\x9c1\xa3\x9c\xa3\xbd\xec\xd4P\xe5\x04\xc3\xdf\x80\x97m\xdc\x8c\xc7/\xc0F,\x83\x05\xf4\x92\x92\xd3\xb5\xd8\xe7\x1fZ\xf4\xf9\x11\x19\xf6\xa2\xdc\xc0!\x12\xac\r?\xc5%L\xa5\x90\x12\x13C\xd5\x0c\xa3\t\xed\xdd\xb8\xc7\x11\xaa\xb6x\xab\x9aI\xf3\x8ba\xc3\xf6\x8e\x9f\x18 \x7f\xfa\x02$\xacV~\xe8\xc4\xad\xb5rt;\xcc\x91\xca;\xb2\xb2\xa7\x93\xdb\x81\xa7\x1f\x00b#\xad\xc9\xf6\x08e!\x8c\xca\x18?\xbd\xc2J\xb3\xea\x10^\xaa/\x82\xdc\x9b \xc3\x0b\x7f\xe1\xb5\xb0\xd1\xe2\xc4QK\xf1\x1ey\x02r\xc9\xd6\x02HA\x00\x99\x18t~\x98\xf3\xa2\x94$!\x8a&'\x82\x93\xbf\xe7P\xbe\x87\xe7\xb2\xfd\xfch\x96\x9f\x1f\xf8!\xff\xc30\xe4\x8b\xdf\x88\xe1\xdevsU\x1c\xbdk\xc96\x8b\xce\xe5mB\xaf=l\xb9\xb8s\x8e7^\\\xb2cD\xae\xefc\xd9\xf6\xfb\x18E7k\xa4\x97X\x9b\x9f\xf0]Y\xed\xc1\xa5\xfb\xaa!\xf7\xab\x86<l\xbde\xdf\x1fp\x1e\x9a\xb1\x99\x14jG\xf4s\x9f\x132\xef\x8d.\xa9m\x1c\x1fL\xbd\xd9?T\xb0\xc3\x9f\x1f\xd6\x96\x01\x1c\xf5\xa6\x8coj\xb1E)\xb1W\xcd\xeb\x10\xe4\xb2\xcbq\x9f\x1fy0w|\x9e7\x82p'\x04\xe5\xa4\x10\xedI\x91\x8b@\x0c\xe2\x81\xac'\xbf5_\xc3\x0b\x05H\xb79\xfb\xee\xa1q\x05\xfa\x88\xa56\x15\x10R\x0f(\x92\xab\xbd|\x84\xc8\x0e\x82\x81\xe2;\xd9J\xc6\xc5?f\x13}\xc0'\xf5\xfcR8i1\x87_\xca<\xd5(\xf5\x81\x1a>\xb5)\xb9x5\xef\xfaP\x91\x02\xed\x00\x1c\xa7\xbf6\xe1\x93B\xc8!\x8d2<\x02|\x80\x8c\x1e\xc4\nN\xc8Xou\xfb\xe2W\xc9\xc2|\xf9\xc7\xb4\x94oo\x1c\x9d\nX#\xbd\xa3Q\x0eCl\x16\xce\xb3a\xd9\xc8\x9b0\x18\xed\xddR\xb4\x1f\xaf+\x82j\x883\x04\xcf\xf0\x98\xc5t\xf2}\xfd\xe4xm\xab\xd6a\x1c\xde\x0e\xf8\xd0\x99\xe7KtT\xa31\xea\x14'\xf3\xb9\x9d\x86\xedt\x8b\xc1`\xe2\xbe\xb6kE\xb2_bV@Q4\xba\xa6|Vk\xdf\x16{O#\xd3\x11l\xa8g\xa2tm\xb8M\xb8\xa6\x82\xa9\xf9\x99WD\x8el\xb8y\x9c\xc1v\x02\x9d\xe2\xea>54\xc4\x9d\xed']\xee\xb4\xecfW\r\xb55n(\xf4\x8d\x9d\xec\xe9\xe3\xa4\xae6\xd66\xaa\x16j\x04\xe1\xa8`\xaa|~\x9c\xb4K\xef\x18>\x97\xb3\x04=\xb1\\\x9c4?q6H\xe6\xad\x8b\xe9\xe5\x94_j\x88\x01\xe3Ar\xb8\x90\xf3kG\xd9\xd5\xc3\xdd\xc5D\xda\xdf\x9d\xbal\nEOh\xd9U\xaf\xb3\xc1\x9b\x87\x0b\xe9pp:\xf7s\xfa\xf9!k~co\xc9\xee\xbc=\xd9\xaeD\x17\x08t\t\xceU\x93U\x88\xc3\xa6B\x91\xa5\r\x12\xae\xc7\xad\x0b\x92\x97\xaf\xeb\xca\xc1TV\xb5\x9en\"\xc1\xce\xab\xca\x9ao\xe5vs\xf3\xe5\xd1\x08\xedC\x80^km\x0e\x1c\x80\xfc\x00\x9at\x7fUwW\xb0\xf5 "editor": "com.apple.Photos", "format_id": "com.apple.photo", "base_version": 0, "format_version": "1.5", "adjustments": [ { "formatVersion": 1, "enabled": True, "settings": { "offsetLocalLight": 0, "offsetHighlights": 0, "inputLight": 0.3073453608247423, "offsetExposure": 0, "offsetBlackPoint": 0, "offsetBrightness": 0, "statistics": { "p02": 0.00784313725490196, "p50": 0.09803921568627451, "autoValue": 0.2856, "blackPoint": 0.0031976514035982175, "tonalRange": 0.09845670498375754, "p25": 0.03529411764705882, "p98": 0.6, "lightMap": "FVpKd0pbSVkQWA5XR1kNWBNWFFYqMCOpJFgbWBmuF1YhjCT7J9Eik0ZhIWJFl1PIVGlWa1dtWW9acl12X3lD/hJwDlUPVkdYJFcPVRAxFBZIWEhYGVNEWBJXElYYWCGIJalNYxvgF3AgbUrwUd5V1VZsV21Zb1pxXHVfeBmDDSkNVw5WF1YVVDFWR1dHV0hXSFdIWElYGVkTWkrIPasv/U75D1sPZBRtUmZUaFVqVv0ssCjJWfxcll54FyEZSBBWR1YbVBkcET4UHEdXSVhJWElZSllKW0tcTF1MXiVgRfENCg9lOnRSfVRoVGpVkyg/K0UcRhk0UPoOIBJfR+dHVw0NDzMaHB9YSFhJWElZSlpKWktbTF1MXk5gT2FPYg0GDWQ1vDV/VHM2gCFsV4JC1xWgFa8UwhISFBIUVxRXOWoSVRiKSKBIYklZSllKWkpbS1xMXk1fT2FPYhBmDQUNWlJ6NGMUdRB1N9AXwxOnEyQTEhMRDkcXRRcUFVgWSyPeJaciZUpiSlpKW0tbTFxMXU1fT2FPYlFkDWYNBg5uVP4ROhKJERARERISEnQUd158YYURVxNVFxQX0RdXFmgl/k3/Sv9KWkpbS1xMXU1eT2FPYlFkUXMOdB5tPqgv/w+9KYwqoFl0WnNbr153X3lhq0pbSloXWRVrJtwpWD+fSuA6XEpnTF1MX05gT2FPY1FlP3ooZSdUIWIYeBnhGmodhh+oHnYjMSWZIGkXvBELS/JKXEpbGkgWrBeKRahM6kzZTd9O00/dT+NQ11HTUL4TgxAhDywROREWEWsh7xQlIzszRTRGM0MuPRt6EoVMXUxeFFwPEA8ODzQRRhLFEswSuhK8HpQbcxwvFywPQg4fDW0SzA+aDwwQEBUyDxYpPj1OQFA8TDZENNoqkUywFF0RDw8ODhEQERHoEWASYhtjKGMpQiY2IzQbag9rDwwQGw4SDhoNDw0SFSIeNyk9O09CUTtML35MvzqRFBUScRFmFbcWwxQQGfNPllBjUWUrZSZnImpVbBVtVnANcQ0LDSMaKSEsISojMjA8Mz5ceF55Hnkgyi7QM5oPDhxbECwPIRa7HOkU7w4IDQcPeVN9HOdWcFlxEnAOGQwHDR0mMyw3LDcrMikwMD0seGCMYXwvfB6CJKVi2BVFFtASwA/fDpoNHQ0dDwwP5g2fDQYNCR91JpIPdw13DRAOGSs8N0U0QjNALjsuOSh8XuNjgkeAGYwgnizmH1IZphnSTfmo+w/9DQkMKhLmKfMO8w2REnYSdBIRFB0SIAwRJDs8SjtKOEYzQGGAZIA6jGaCV4MdiiJ+K9lCrQ9tHUMZTRz7D+ENERQTFIwXqBLqEKQVGRkgHCQdJR0nDR4NKylEKUgpRCQ8D4FmhFqOZ9NjiBmDGZUw9FnPDa8QqBnNOMcRxRwnGjMdYRwfGRoUGiEsJjArNSk1JDQfLg0KFhwlLCsyDzAPFg8NUolmiGuMLp8jnCCdJKMZlBEsEB8SPh7jHSclLiYvJDIjLyEzKzwzRDNFMUQxRBEzEhMXGhwnKEcSERE9ETcSj1GPaJVWkxiOHoweoxkpFB0ODg0nDyMjNS47Mj0yPjA+ITUhQTpOPVE5Sw1CEQ0XICMvJS4qahVNJlw4dR9mKFckZyR1GZ0TPyOhHFYMEw8ZEBMdJSImHjohPiNAMD8sPCs0LTkkNg0bDBcMFRgmHSksOyzdJMAeaC/PI4UnqSVPH34UhBNCD2UPJw9qExsYIyMnIiUhJSQuJzwyQDVDMT0uOCMvDhcMIhQUDRAnPTJ4L4kjvidvMNouliyFJmshqhtvEzgblxlgJn0pjiEqIigjKSUrJ3s+Tj1NNkUzQit2DlISDg0NFXAMCw8dGEsfkje/KHgimSVgLrcXRR6TErcPcxt3FGwhjh23FKonMidwFEcUnw8vEK8QChBPGcoNBxMSDkEUaA4UElYWPx9wHaEmzxedF1AbVRlpGmAajRFjHJkVcxySIn0TihdyElMSLBXSJOYY7RAWEQsRsQ0HFRYOPhMZF4UZgBaAGlwgxSTDFakWhCWlFZYXdhZkD4INXQ9iD2td3w5yEZoNVQ/RL9cSuxfIFFkQCg8XDR4UGRdBGV4fsxhuFcYtjiDYHIwbihiEE5QRbRVlFHISUQ1TEFgPaA2cD4ASxw9kFowpnhyLHG0hbg9YDwgNCg0PGVohgSO7F54XghvBFoUXmhY9GIwWfxNhE34PMRKhEekOxw5uDykNVhF6F8sr0CWhLpQ1/yL+HqgOCA0HDUsqtiuyJYYUtRJhFXoTaxNoD04SeBOBE5MURRE+ES4PDw0LDhoVFw9QEpIQahy2D24RQxF2ENsQjA4JDQUOPiHJKIQVaw8qEmYSVg8wEnUPUw15EXUssRFhEVEQaRkbEnYMDA+bEX4UkRJ1G8AcuQ9fDB4Taw+cDQcNBRNBGtMczSOHI4YTUREfEVkXkBx8EoQTnRNuDnoNJg4wElsNYRWjE8MSYyPTTeFJuA2gDAUNjQ+WDysNBw0JHlkREynRF6YenRNkEZAPLQ9KGXEPnhGSD3gPfg0gD3o=", "localAutoValue": 0.36000000000000004, "whitePoint": 1.003921568627451, "p10": 0.01568627450980392, "highKey": 0.8063460882459689, }, "offsetContrast": 0, "offsetShadows": 0, }, "identifier": "SmartTone", } ], "metadata": { "masterWidth": 3024, "pipelineVersion": "OSX.4", "masterHeight": 4032, "orientation": 1, }, "orientation": 1, "adjustment_format_version": 1, "version_info": { "buildNumber": "19G73", "appVersion": "161.0.120", "schemaRevision": 1, "platform": "OSX", }, "timestamp": "2020-10-03T22:54:20+00:00", } def test_no_adjustments(photosdb): photo = photosdb.get_photo(UUID_DICT["no_adjustments"]) assert photo.adjustments is None def test_exiftool_newlines_in_description(photosdb): photo = photosdb.get_photo(UUID_DICT["description_newlines"]) exif = photo._exiftool_dict() assert photo.description.find("\n") > 0 assert exif["EXIF:ImageDescription"].find("\n") > 0 @pytest.mark.skip(SKIP_TEST, reason="Not yet implemented") def test_duplicates_1(photosdb): # test photo has duplicates photo = photosdb.get_photo(uuid=UUID_DICT["duplicates"]) assert len(photo.duplicates) == 1 assert photo.duplicates[0].uuid == UUID_DUPLICATE def test_duplicates_2(photosdb): # test photo does not have duplicates photo = photosdb.get_photo(uuid=UUID_DICT["no_duplicates"]) assert not photo.duplicates def test_compound_query(photosdb): photos = photosdb.photos(persons=["Katie", "Maria"], albums=["Multi Keyword"]) assert len(photos) == 2 assert UUID_DICT["multi_query_1"] in [p.uuid for p in photos] assert UUID_DICT["multi_query_2"] in [p.uuid for p in photos] def test_multi_keyword(photosdb): photos = photosdb.photos(keywords=["Kids", "wedding"]) assert len(photos) == 6 def test_multi_album(photosdb): photos = photosdb.photos(albums=["Pumpkin Farm", "Test Album"]) assert len(photos) == 3 def test_multi_uuid(photosdb): photos = photosdb.photos(uuid=[UUID_DICT["favorite"], UUID_DICT["not_favorite"]]) assert len(photos) == 2 def test_detected_text(photosdb): for uuid, expected_text in UUID_DETECTED_TEXT.items(): photo = photosdb.get_photo(uuid=uuid) detected_text = " ".join(text for text, conf in photo.detected_text()) if expected_text is not None: assert expected_text in detected_text else: assert not detected_text
true
true
f720807430145448da0dda4234ceca5a1f6435e7
255
py
Python
problems/013.py
JoshKarpel/Euler
9c4a89cfe4b0114d84a82e2b2894c7b8af815e93
[ "MIT" ]
1
2017-09-20T22:26:24.000Z
2017-09-20T22:26:24.000Z
problems/013.py
JoshKarpel/euler-python
9c4a89cfe4b0114d84a82e2b2894c7b8af815e93
[ "MIT" ]
null
null
null
problems/013.py
JoshKarpel/euler-python
9c4a89cfe4b0114d84a82e2b2894c7b8af815e93
[ "MIT" ]
null
null
null
import os def solve(): filepath = os.path.join(os.path.dirname(__file__), '013_numbers.txt') with open(filepath) as f: numbers = [int(x) for x in f] return int(str(sum(numbers))[:10]) if __name__ == '__main__': print(solve())
18.214286
73
0.619608
import os def solve(): filepath = os.path.join(os.path.dirname(__file__), '013_numbers.txt') with open(filepath) as f: numbers = [int(x) for x in f] return int(str(sum(numbers))[:10]) if __name__ == '__main__': print(solve())
true
true
f7208121384b71d9a38bf011097a42030c385a61
798
py
Python
app/ngrok.py
nnsnodnb/line-bot-django-handle
27d0e29b674831eac8068124f6445d0698968f40
[ "Apache-2.0" ]
null
null
null
app/ngrok.py
nnsnodnb/line-bot-django-handle
27d0e29b674831eac8068124f6445d0698968f40
[ "Apache-2.0" ]
1
2020-06-05T18:48:36.000Z
2020-06-05T18:48:36.000Z
app/ngrok.py
nnsnodnb/line-bot-django-handle
27d0e29b674831eac8068124f6445d0698968f40
[ "Apache-2.0" ]
null
null
null
from django.conf import settings import requests import socket BASE_HOST = '127.0.0.1' PORT = 4040 class Ngrok(object): def __init__(self, port=PORT, *args, **kwargs): super(Ngrok, self).__init__(*args, **kwargs) self.port = port self._check_launch_ngrok() def _check_launch_ngrok(self): s = socket.socket(socket.AF_INET, socket.SOCK_STREAM) s.connect((BASE_HOST, self.port)) # error handling: socket.error s.close() def get_public_url(self): if not settings.USE_NGROK: return None response = requests.get(f'http://{BASE_HOST}:{self.port}/api/tunnels').json() tunnels = response['tunnels'] tunnel = tunnels[1] public_url = tunnel['public_url'] return public_url
24.9375
85
0.630326
from django.conf import settings import requests import socket BASE_HOST = '127.0.0.1' PORT = 4040 class Ngrok(object): def __init__(self, port=PORT, *args, **kwargs): super(Ngrok, self).__init__(*args, **kwargs) self.port = port self._check_launch_ngrok() def _check_launch_ngrok(self): s = socket.socket(socket.AF_INET, socket.SOCK_STREAM) s.connect((BASE_HOST, self.port)) s.close() def get_public_url(self): if not settings.USE_NGROK: return None response = requests.get(f'http://{BASE_HOST}:{self.port}/api/tunnels').json() tunnels = response['tunnels'] tunnel = tunnels[1] public_url = tunnel['public_url'] return public_url
true
true
f720816e82bbc8f3addb15db8bbee82d4cadc5e1
811
py
Python
scipy/sparse/data.py
lorentzenchr/scipy
393a05ee927883ad6316b7092c851afea8f16816
[ "BSD-3-Clause" ]
9,095
2015-01-02T18:24:23.000Z
2022-03-31T20:35:31.000Z
scipy/sparse/data.py
lorentzenchr/scipy
393a05ee927883ad6316b7092c851afea8f16816
[ "BSD-3-Clause" ]
11,500
2015-01-01T01:15:30.000Z
2022-03-31T23:07:35.000Z
scipy/sparse/data.py
lorentzenchr/scipy
393a05ee927883ad6316b7092c851afea8f16816
[ "BSD-3-Clause" ]
5,838
2015-01-05T11:56:42.000Z
2022-03-31T23:21:19.000Z
# This file is not meant for public use and will be removed in SciPy v2.0.0. # Use the `scipy.sparse` namespace for importing the functions # included below. import warnings from . import _data __all__ = [ # noqa: F822 'isscalarlike', 'matrix', 'name', 'npfunc', 'spmatrix', 'validateaxis', ] def __dir__(): return __all__ def __getattr__(name): if name not in __all__: raise AttributeError( "scipy.sparse.data is deprecated and has no attribute " f"{name}. Try looking in scipy.sparse instead.") warnings.warn(f"Please use `{name}` from the `scipy.sparse` namespace, " "the `scipy.sparse.data` namespace is deprecated.", category=DeprecationWarning, stacklevel=2) return getattr(_data, name)
23.852941
76
0.641184
import warnings from . import _data __all__ = [ 'isscalarlike', 'matrix', 'name', 'npfunc', 'spmatrix', 'validateaxis', ] def __dir__(): return __all__ def __getattr__(name): if name not in __all__: raise AttributeError( "scipy.sparse.data is deprecated and has no attribute " f"{name}. Try looking in scipy.sparse instead.") warnings.warn(f"Please use `{name}` from the `scipy.sparse` namespace, " "the `scipy.sparse.data` namespace is deprecated.", category=DeprecationWarning, stacklevel=2) return getattr(_data, name)
true
true
f72081ae67b5d48042132e9f4744873649364661
5,831
py
Python
idatasets/datasets/util.py
rahul1990gupta/indic-nlp-datasets
4d0935b194263579b9653cf8c3d4ecdd17af687d
[ "MIT" ]
1
2020-08-16T11:44:37.000Z
2020-08-16T11:44:37.000Z
idatasets/datasets/util.py
rahul1990gupta/indic-nlp-datasets
4d0935b194263579b9653cf8c3d4ecdd17af687d
[ "MIT" ]
2
2020-08-16T05:23:43.000Z
2020-10-21T06:59:15.000Z
idatasets/datasets/util.py
rahul1990gupta/indic-nlp-datasets
4d0935b194263579b9653cf8c3d4ecdd17af687d
[ "MIT" ]
2
2021-06-13T05:40:26.000Z
2022-02-05T15:53:23.000Z
import os from urllib.error import URLError, HTTPError from urllib.request import urlretrieve import tqdm import tarfile import zipfile import shutil import ssl ssl._create_default_https_context = ssl._create_unverified_context def download_file( origin: str, cache_subdir: str = "datasets") -> str: fname = origin.split("/")[-1] datadir_base = os.path.expanduser(os.path.join("~", ".keras")) if not os.access(datadir_base, os.W_OK): datadir_base = os.path.join("/tmp", ".keras") datadir = os.path.join(datadir_base, cache_subdir) if not os.path.exists(datadir): os.makedirs(datadir) fpath = os.path.join(datadir, fname) if os.path.exists(fpath): return fpath global progbar progbar = None def dl_progress(count: int, block_size: int, total_size: int) -> None: global progbar if progbar is None: progbar = tqdm.tqdm(total=total_size) else: progbar.update(block_size) error_msg = "URL fetch failure on {}: {} -- {}" if not os.path.exists(fpath): try: try: urlretrieve(origin, fpath, dl_progress) except URLError as e: raise Exception(error_msg.format(origin, e.errno, e.reason)) except HTTPError as e: raise Exception(error_msg.format(origin, e.code, e.msg)) except (Exception, KeyboardInterrupt): if os.path.exists(fpath): os.remove(fpath) raise progbar = None return fpath def get_file( origin: str, untar: bool = False, unzip: bool = False, cache_subdir: str = "datasets") -> str: """Downloads a file from a URL if it not already in the cache.""" # https://raw.githubusercontent.com/fchollet/keras/master/keras/utils/data_utils.py # Copyright Francois Chollet, Google, others (2015) # Under MIT license fname = origin.split("/")[-1].split(".")[0] datadir_base = os.path.expanduser(os.path.join("~", ".keras")) if not os.access(datadir_base, os.W_OK): datadir_base = os.path.join("/tmp", ".keras") datadir = os.path.join(datadir_base, cache_subdir) if not os.path.exists(datadir): os.makedirs(datadir) if untar or unzip: untar_fpath = os.path.join(datadir, fname) if unzip: fpath = untar_fpath + ".zip" else: fpath = untar_fpath + ".tar.gz" else: fpath = os.path.join(datadir, fname) global progbar progbar = None def dl_progress(count, block_size, total_size): global progbar if progbar is None: progbar = tqdm.tqdm(total=total_size) else: progbar.update(block_size) error_msg = "URL fetch failure on {}: {} -- {}" if not os.path.exists(fpath): try: try: urlretrieve(origin, fpath, dl_progress) except URLError as e: raise Exception(error_msg.format(origin, e.errno, e.reason)) except HTTPError as e: raise Exception(error_msg.format(origin, e.code, e.msg)) except (Exception, KeyboardInterrupt): if os.path.exists(fpath): os.remove(fpath) raise progbar = None if untar: if not os.path.exists(untar_fpath): print("Untaring file...") tfile = tarfile.open(fpath, "r:gz") try: tfile.extractall(path=datadir) except (Exception, KeyboardInterrupt): if os.path.exists(untar_fpath): if os.path.isfile(untar_fpath): os.remove(untar_fpath) else: shutil.rmtree(untar_fpath) raise tfile.close() return untar_fpath elif unzip: if not os.path.exists(untar_fpath): print("Unzipping file...") with zipfile.ZipFile(fpath) as file_: try: file_.extractall(path=datadir) except (Exception, KeyboardInterrupt): if os.path.exists(untar_fpath): if os.path.isfile(untar_fpath): os.remove(untar_fpath) else: shutil.rmtree(untar_fpath) raise return untar_fpath return fpath class Bunch(dict): """Container object exposing keys as attributes Bunch objects are sometimes used as an output for functions and methods. They extend dictionaries by enabling values to be accessed by key, `bunch["value_key"]`, or by an attribute, `bunch.value_key`. Examples -------- >>> b = Bunch(a=1, b=2) >>> b['b'] 2 >>> b.b 2 >>> b.a = 3 >>> b['a'] 3 >>> b.c = 6 >>> b['c'] 6 """ def __init__(self, **kwargs): super().__init__(kwargs) def __setattr__(self, key: str, value: str): self[key] = value def __dir__(self): return self.keys() def __getattr__(self, key: str): try: return self[key] except KeyError: raise AttributeError(key) def __setstate__(self, state): # Bunch pickles generated with scikit-learn 0.16.* have an non # empty __dict__. This causes a surprising behaviour when # loading these pickles scikit-learn 0.17: reading bunch.key # uses __dict__ but assigning to bunch.key use __setattr__ and # only changes bunch['key']. More details can be found at: # https://github.com/scikit-learn/scikit-learn/issues/6196. # Overriding __setstate__ to be a noop has the effect of # ignoring the pickled __dict__ pass
31.690217
87
0.575373
import os from urllib.error import URLError, HTTPError from urllib.request import urlretrieve import tqdm import tarfile import zipfile import shutil import ssl ssl._create_default_https_context = ssl._create_unverified_context def download_file( origin: str, cache_subdir: str = "datasets") -> str: fname = origin.split("/")[-1] datadir_base = os.path.expanduser(os.path.join("~", ".keras")) if not os.access(datadir_base, os.W_OK): datadir_base = os.path.join("/tmp", ".keras") datadir = os.path.join(datadir_base, cache_subdir) if not os.path.exists(datadir): os.makedirs(datadir) fpath = os.path.join(datadir, fname) if os.path.exists(fpath): return fpath global progbar progbar = None def dl_progress(count: int, block_size: int, total_size: int) -> None: global progbar if progbar is None: progbar = tqdm.tqdm(total=total_size) else: progbar.update(block_size) error_msg = "URL fetch failure on {}: {} -- {}" if not os.path.exists(fpath): try: try: urlretrieve(origin, fpath, dl_progress) except URLError as e: raise Exception(error_msg.format(origin, e.errno, e.reason)) except HTTPError as e: raise Exception(error_msg.format(origin, e.code, e.msg)) except (Exception, KeyboardInterrupt): if os.path.exists(fpath): os.remove(fpath) raise progbar = None return fpath def get_file( origin: str, untar: bool = False, unzip: bool = False, cache_subdir: str = "datasets") -> str: fname = origin.split("/")[-1].split(".")[0] datadir_base = os.path.expanduser(os.path.join("~", ".keras")) if not os.access(datadir_base, os.W_OK): datadir_base = os.path.join("/tmp", ".keras") datadir = os.path.join(datadir_base, cache_subdir) if not os.path.exists(datadir): os.makedirs(datadir) if untar or unzip: untar_fpath = os.path.join(datadir, fname) if unzip: fpath = untar_fpath + ".zip" else: fpath = untar_fpath + ".tar.gz" else: fpath = os.path.join(datadir, fname) global progbar progbar = None def dl_progress(count, block_size, total_size): global progbar if progbar is None: progbar = tqdm.tqdm(total=total_size) else: progbar.update(block_size) error_msg = "URL fetch failure on {}: {} -- {}" if not os.path.exists(fpath): try: try: urlretrieve(origin, fpath, dl_progress) except URLError as e: raise Exception(error_msg.format(origin, e.errno, e.reason)) except HTTPError as e: raise Exception(error_msg.format(origin, e.code, e.msg)) except (Exception, KeyboardInterrupt): if os.path.exists(fpath): os.remove(fpath) raise progbar = None if untar: if not os.path.exists(untar_fpath): print("Untaring file...") tfile = tarfile.open(fpath, "r:gz") try: tfile.extractall(path=datadir) except (Exception, KeyboardInterrupt): if os.path.exists(untar_fpath): if os.path.isfile(untar_fpath): os.remove(untar_fpath) else: shutil.rmtree(untar_fpath) raise tfile.close() return untar_fpath elif unzip: if not os.path.exists(untar_fpath): print("Unzipping file...") with zipfile.ZipFile(fpath) as file_: try: file_.extractall(path=datadir) except (Exception, KeyboardInterrupt): if os.path.exists(untar_fpath): if os.path.isfile(untar_fpath): os.remove(untar_fpath) else: shutil.rmtree(untar_fpath) raise return untar_fpath return fpath class Bunch(dict): def __init__(self, **kwargs): super().__init__(kwargs) def __setattr__(self, key: str, value: str): self[key] = value def __dir__(self): return self.keys() def __getattr__(self, key: str): try: return self[key] except KeyError: raise AttributeError(key) def __setstate__(self, state): pass
true
true
f72082ade0aa616c87208ff39d48373868d15c94
1,030
py
Python
api/client/test/test_api_list_pipelines_response.py
krishnakumar27/mlx
dce67d58dffa24ca7a6a4d6b5fd8d4eb94e35215
[ "Apache-2.0" ]
98
2021-05-03T23:27:53.000Z
2022-03-13T02:29:12.000Z
api/client/test/test_api_list_pipelines_response.py
krishnakumar27/mlx
dce67d58dffa24ca7a6a4d6b5fd8d4eb94e35215
[ "Apache-2.0" ]
296
2021-05-03T22:44:26.000Z
2022-03-31T11:50:16.000Z
api/client/test/test_api_list_pipelines_response.py
krishnakumar27/mlx
dce67d58dffa24ca7a6a4d6b5fd8d4eb94e35215
[ "Apache-2.0" ]
38
2021-05-03T22:52:59.000Z
2022-03-31T03:58:34.000Z
# Copyright 2021 The MLX Contributors # # SPDX-License-Identifier: Apache-2.0 # coding: utf-8 """ MLX API MLX API Extension for Kubeflow Pipelines # noqa: E501 OpenAPI spec version: 0.1 Generated by: https://github.com/swagger-api/swagger-codegen.git """ from __future__ import absolute_import import unittest import swagger_client from swagger_client.models.api_list_pipelines_response import ApiListPipelinesResponse # noqa: E501 from swagger_client.rest import ApiException class TestApiListPipelinesResponse(unittest.TestCase): """ApiListPipelinesResponse unit test stubs""" def setUp(self): pass def tearDown(self): pass def testApiListPipelinesResponse(self): """Test ApiListPipelinesResponse""" # FIXME: construct object with mandatory attributes with example values # model = swagger_client.models.api_list_pipelines_response.ApiListPipelinesResponse() # noqa: E501 pass if __name__ == '__main__': unittest.main()
23.409091
108
0.729126
from __future__ import absolute_import import unittest import swagger_client from swagger_client.models.api_list_pipelines_response import ApiListPipelinesResponse from swagger_client.rest import ApiException class TestApiListPipelinesResponse(unittest.TestCase): def setUp(self): pass def tearDown(self): pass def testApiListPipelinesResponse(self): s if __name__ == '__main__': unittest.main()
true
true
f72082bda44b211831ca8f51067e919a7b88a005
29,302
py
Python
stable_baselines/trpo_mpi/trpo_mpi.py
Ow-woo/stable-baselines
ece376f62b0eaa3b58e90593b7db5fb9de3d82c5
[ "MIT" ]
3
2020-04-14T15:28:02.000Z
2020-09-23T00:55:48.000Z
stable_baselines/trpo_mpi/trpo_mpi.py
Ow-woo/stable-baselines
ece376f62b0eaa3b58e90593b7db5fb9de3d82c5
[ "MIT" ]
1
2019-10-30T07:31:52.000Z
2019-10-30T07:31:52.000Z
stable_baselines/trpo_mpi/trpo_mpi.py
Ow-woo/stable-baselines
ece376f62b0eaa3b58e90593b7db5fb9de3d82c5
[ "MIT" ]
7
2019-10-01T05:49:22.000Z
2021-12-24T07:11:55.000Z
import time from contextlib import contextmanager from collections import deque import gym from mpi4py import MPI import tensorflow as tf import numpy as np import stable_baselines.common.tf_util as tf_util from stable_baselines.common.tf_util import total_episode_reward_logger from stable_baselines.common import explained_variance, zipsame, dataset, fmt_row, colorize, ActorCriticRLModel, \ SetVerbosity, TensorboardWriter from stable_baselines import logger from stable_baselines.common.mpi_adam import MpiAdam from stable_baselines.common.cg import conjugate_gradient from stable_baselines.common.policies import ActorCriticPolicy from stable_baselines.common.misc_util import flatten_lists from stable_baselines.common.runners import traj_segment_generator from stable_baselines.trpo_mpi.utils import add_vtarg_and_adv class TRPO(ActorCriticRLModel): """ Trust Region Policy Optimization (https://arxiv.org/abs/1502.05477) :param policy: (ActorCriticPolicy or str) The policy model to use (MlpPolicy, CnnPolicy, CnnLstmPolicy, ...) :param env: (Gym environment or str) The environment to learn from (if registered in Gym, can be str) :param gamma: (float) the discount value :param timesteps_per_batch: (int) the number of timesteps to run per batch (horizon) :param max_kl: (float) the Kullback-Leibler loss threshold :param cg_iters: (int) the number of iterations for the conjugate gradient calculation :param lam: (float) GAE factor :param entcoeff: (float) the weight for the entropy loss :param cg_damping: (float) the compute gradient dampening factor :param vf_stepsize: (float) the value function stepsize :param vf_iters: (int) the value function's number iterations for learning :param verbose: (int) the verbosity level: 0 none, 1 training information, 2 tensorflow debug :param tensorboard_log: (str) the log location for tensorboard (if None, no logging) :param _init_setup_model: (bool) Whether or not to build the network at the creation of the instance :param policy_kwargs: (dict) additional arguments to be passed to the policy on creation :param full_tensorboard_log: (bool) enable additional logging when using tensorboard WARNING: this logging can take a lot of space quickly :param seed: (int) Seed for the pseudo-random generators (python, numpy, tensorflow). If None (default), use random seed. Note that if you want completely deterministic results, you must set `n_cpu_tf_sess` to 1. :param n_cpu_tf_sess: (int) The number of threads for TensorFlow operations If None, the number of cpu of the current machine will be used. """ def __init__(self, policy, env, gamma=0.99, timesteps_per_batch=1024, max_kl=0.01, cg_iters=10, lam=0.98, entcoeff=0.0, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters=3, verbose=0, tensorboard_log=None, _init_setup_model=True, policy_kwargs=None, full_tensorboard_log=False, seed=None, n_cpu_tf_sess=1): super(TRPO, self).__init__(policy=policy, env=env, verbose=verbose, requires_vec_env=False, _init_setup_model=_init_setup_model, policy_kwargs=policy_kwargs, seed=seed, n_cpu_tf_sess=n_cpu_tf_sess) self.using_gail = False self.timesteps_per_batch = timesteps_per_batch self.cg_iters = cg_iters self.cg_damping = cg_damping self.gamma = gamma self.lam = lam self.max_kl = max_kl self.vf_iters = vf_iters self.vf_stepsize = vf_stepsize self.entcoeff = entcoeff self.tensorboard_log = tensorboard_log self.full_tensorboard_log = full_tensorboard_log # GAIL Params self.hidden_size_adversary = 100 self.adversary_entcoeff = 1e-3 self.expert_dataset = None self.g_step = 1 self.d_step = 1 self.d_stepsize = 3e-4 self.graph = None self.sess = None self.policy_pi = None self.loss_names = None self.assign_old_eq_new = None self.compute_losses = None self.compute_lossandgrad = None self.compute_fvp = None self.compute_vflossandgrad = None self.d_adam = None self.vfadam = None self.get_flat = None self.set_from_flat = None self.timed = None self.allmean = None self.nworkers = None self.rank = None self.reward_giver = None self.step = None self.proba_step = None self.initial_state = None self.params = None self.summary = None if _init_setup_model: self.setup_model() def _get_pretrain_placeholders(self): policy = self.policy_pi action_ph = policy.pdtype.sample_placeholder([None]) if isinstance(self.action_space, gym.spaces.Discrete): return policy.obs_ph, action_ph, policy.policy return policy.obs_ph, action_ph, policy.deterministic_action def setup_model(self): # prevent import loops from stable_baselines.gail.adversary import TransitionClassifier with SetVerbosity(self.verbose): assert issubclass(self.policy, ActorCriticPolicy), "Error: the input policy for the TRPO model must be " \ "an instance of common.policies.ActorCriticPolicy." self.nworkers = MPI.COMM_WORLD.Get_size() self.rank = MPI.COMM_WORLD.Get_rank() np.set_printoptions(precision=3) self.graph = tf.Graph() with self.graph.as_default(): self.set_random_seed(self.seed) self.sess = tf_util.make_session(num_cpu=self.n_cpu_tf_sess, graph=self.graph) if self.using_gail: self.reward_giver = TransitionClassifier(self.observation_space, self.action_space, self.hidden_size_adversary, entcoeff=self.adversary_entcoeff) # Construct network for new policy self.policy_pi = self.policy(self.sess, self.observation_space, self.action_space, self.n_envs, 1, None, reuse=False, **self.policy_kwargs) # Network for old policy with tf.variable_scope("oldpi", reuse=False): old_policy = self.policy(self.sess, self.observation_space, self.action_space, self.n_envs, 1, None, reuse=False, **self.policy_kwargs) with tf.variable_scope("loss", reuse=False): atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable) ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return observation = self.policy_pi.obs_ph action = self.policy_pi.pdtype.sample_placeholder([None]) kloldnew = old_policy.proba_distribution.kl(self.policy_pi.proba_distribution) ent = self.policy_pi.proba_distribution.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) entbonus = self.entcoeff * meanent vferr = tf.reduce_mean(tf.square(self.policy_pi.value_flat - ret)) # advantage * pnew / pold ratio = tf.exp(self.policy_pi.proba_distribution.logp(action) - old_policy.proba_distribution.logp(action)) surrgain = tf.reduce_mean(ratio * atarg) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] self.loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = tf_util.get_trainable_vars("model") var_list = [v for v in all_var_list if "/vf" not in v.name and "/q/" not in v.name] vf_var_list = [v for v in all_var_list if "/pi" not in v.name and "/logstd" not in v.name] self.get_flat = tf_util.GetFlat(var_list, sess=self.sess) self.set_from_flat = tf_util.SetFromFlat(var_list, sess=self.sess) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: var_size = tf_util.intprod(shape) tangents.append(tf.reshape(flat_tangent[start: start + var_size], shape)) start += var_size gvp = tf.add_n([tf.reduce_sum(grad * tangent) for (grad, tangent) in zipsame(klgrads, tangents)]) # pylint: disable=E1111 # Fisher vector products fvp = tf_util.flatgrad(gvp, var_list) tf.summary.scalar('entropy_loss', meanent) tf.summary.scalar('policy_gradient_loss', optimgain) tf.summary.scalar('value_function_loss', surrgain) tf.summary.scalar('approximate_kullback-leibler', meankl) tf.summary.scalar('loss', optimgain + meankl + entbonus + surrgain + meanent) self.assign_old_eq_new = \ tf_util.function([], [], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(tf_util.get_globals_vars("oldpi"), tf_util.get_globals_vars("model"))]) self.compute_losses = tf_util.function([observation, old_policy.obs_ph, action, atarg], losses) self.compute_fvp = tf_util.function([flat_tangent, observation, old_policy.obs_ph, action, atarg], fvp) self.compute_vflossandgrad = tf_util.function([observation, old_policy.obs_ph, ret], tf_util.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if self.rank == 0 and self.verbose >= 1: print(colorize(msg, color='magenta')) start_time = time.time() yield print(colorize("done in {:.3f} seconds".format((time.time() - start_time)), color='magenta')) else: yield def allmean(arr): assert isinstance(arr, np.ndarray) out = np.empty_like(arr) MPI.COMM_WORLD.Allreduce(arr, out, op=MPI.SUM) out /= self.nworkers return out tf_util.initialize(sess=self.sess) th_init = self.get_flat() MPI.COMM_WORLD.Bcast(th_init, root=0) self.set_from_flat(th_init) with tf.variable_scope("Adam_mpi", reuse=False): self.vfadam = MpiAdam(vf_var_list, sess=self.sess) if self.using_gail: self.d_adam = MpiAdam(self.reward_giver.get_trainable_variables(), sess=self.sess) self.d_adam.sync() self.vfadam.sync() with tf.variable_scope("input_info", reuse=False): tf.summary.scalar('discounted_rewards', tf.reduce_mean(ret)) tf.summary.scalar('learning_rate', tf.reduce_mean(self.vf_stepsize)) tf.summary.scalar('advantage', tf.reduce_mean(atarg)) tf.summary.scalar('kl_clip_range', tf.reduce_mean(self.max_kl)) if self.full_tensorboard_log: tf.summary.histogram('discounted_rewards', ret) tf.summary.histogram('learning_rate', self.vf_stepsize) tf.summary.histogram('advantage', atarg) tf.summary.histogram('kl_clip_range', self.max_kl) if tf_util.is_image(self.observation_space): tf.summary.image('observation', observation) else: tf.summary.histogram('observation', observation) self.timed = timed self.allmean = allmean self.step = self.policy_pi.step self.proba_step = self.policy_pi.proba_step self.initial_state = self.policy_pi.initial_state self.params = tf_util.get_trainable_vars("model") + tf_util.get_trainable_vars("oldpi") if self.using_gail: self.params.extend(self.reward_giver.get_trainable_variables()) self.summary = tf.summary.merge_all() self.compute_lossandgrad = \ tf_util.function([observation, old_policy.obs_ph, action, atarg, ret], [self.summary, tf_util.flatgrad(optimgain, var_list)] + losses) def learn(self, total_timesteps, callback=None, log_interval=100, tb_log_name="TRPO", reset_num_timesteps=True): new_tb_log = self._init_num_timesteps(reset_num_timesteps) callback = self._init_callback(callback) with SetVerbosity(self.verbose), TensorboardWriter(self.graph, self.tensorboard_log, tb_log_name, new_tb_log) \ as writer: self._setup_learn() with self.sess.as_default(): callback.on_training_start(locals(), globals()) seg_gen = traj_segment_generator(self.policy_pi, self.env, self.timesteps_per_batch, reward_giver=self.reward_giver, gail=self.using_gail, callback=callback) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 t_start = time.time() len_buffer = deque(maxlen=40) # rolling buffer for episode lengths reward_buffer = deque(maxlen=40) # rolling buffer for episode rewards true_reward_buffer = None if self.using_gail: true_reward_buffer = deque(maxlen=40) # Initialize dataloader batchsize = self.timesteps_per_batch // self.d_step self.expert_dataset.init_dataloader(batchsize) # Stats not used for now # TODO: replace with normal tb logging #  g_loss_stats = Stats(loss_names) # d_loss_stats = Stats(reward_giver.loss_name) # ep_stats = Stats(["True_rewards", "Rewards", "Episode_length"]) while True: if timesteps_so_far >= total_timesteps: break logger.log("********** Iteration %i ************" % iters_so_far) def fisher_vector_product(vec): return self.allmean(self.compute_fvp(vec, *fvpargs, sess=self.sess)) + self.cg_damping * vec # ------------------ Update G ------------------ logger.log("Optimizing Policy...") # g_step = 1 when not using GAIL mean_losses = None vpredbefore = None tdlamret = None observation = None action = None seg = None for k in range(self.g_step): with self.timed("sampling"): seg = seg_gen.__next__() # Stop training early (triggered by the callback) if not seg.get('continue_training', True): # pytype: disable=attribute-error break add_vtarg_and_adv(seg, self.gamma, self.lam) # ob, ac, atarg, ret, td1ret = map(np.concatenate, (obs, acs, atargs, rets, td1rets)) observation, action = seg["observations"], seg["actions"] atarg, tdlamret = seg["adv"], seg["tdlamret"] vpredbefore = seg["vpred"] # predicted value function before update atarg = (atarg - atarg.mean()) / (atarg.std() + 1e-8) # standardized advantage function estimate # true_rew is the reward without discount if writer is not None: total_episode_reward_logger(self.episode_reward, seg["true_rewards"].reshape( (self.n_envs, -1)), seg["dones"].reshape((self.n_envs, -1)), writer, self.num_timesteps) args = seg["observations"], seg["observations"], seg["actions"], atarg # Subsampling: see p40-42 of John Schulman thesis # http://joschu.net/docs/thesis.pdf fvpargs = [arr[::5] for arr in args] self.assign_old_eq_new(sess=self.sess) with self.timed("computegrad"): steps = self.num_timesteps + (k + 1) * (seg["total_timestep"] / self.g_step) run_options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE) run_metadata = tf.RunMetadata() if self.full_tensorboard_log else None # run loss backprop with summary, and save the metadata (memory, compute time, ...) if writer is not None: summary, grad, *lossbefore = self.compute_lossandgrad(*args, tdlamret, sess=self.sess, options=run_options, run_metadata=run_metadata) if self.full_tensorboard_log: writer.add_run_metadata(run_metadata, 'step%d' % steps) writer.add_summary(summary, steps) else: _, grad, *lossbefore = self.compute_lossandgrad(*args, tdlamret, sess=self.sess, options=run_options, run_metadata=run_metadata) lossbefore = self.allmean(np.array(lossbefore)) grad = self.allmean(grad) if np.allclose(grad, 0): logger.log("Got zero gradient. not updating") else: with self.timed("conjugate_gradient"): stepdir = conjugate_gradient(fisher_vector_product, grad, cg_iters=self.cg_iters, verbose=self.rank == 0 and self.verbose >= 1) assert np.isfinite(stepdir).all() shs = .5 * stepdir.dot(fisher_vector_product(stepdir)) # abs(shs) to avoid taking square root of negative values lagrange_multiplier = np.sqrt(abs(shs) / self.max_kl) # logger.log("lagrange multiplier:", lm, "gnorm:", np.linalg.norm(g)) fullstep = stepdir / lagrange_multiplier expectedimprove = grad.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = self.get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize self.set_from_flat(thnew) mean_losses = surr, kl_loss, *_ = self.allmean( np.array(self.compute_losses(*args, sess=self.sess))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f" % (expectedimprove, improve)) if not np.isfinite(mean_losses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl_loss > self.max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") self.set_from_flat(thbefore) if self.nworkers > 1 and iters_so_far % 20 == 0: # list of tuples paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), self.vfadam.getflat().sum())) assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (loss_name, loss_val) in zip(self.loss_names, mean_losses): logger.record_tabular(loss_name, loss_val) with self.timed("vf"): for _ in range(self.vf_iters): # NOTE: for recurrent policies, use shuffle=False? for (mbob, mbret) in dataset.iterbatches((seg["observations"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=128, shuffle=True): grad = self.allmean(self.compute_vflossandgrad(mbob, mbob, mbret, sess=self.sess)) self.vfadam.update(grad, self.vf_stepsize) # Stop training early (triggered by the callback) if not seg.get('continue_training', True): # pytype: disable=attribute-error break logger.record_tabular("explained_variance_tdlam_before", explained_variance(vpredbefore, tdlamret)) if self.using_gail: # ------------------ Update D ------------------ logger.log("Optimizing Discriminator...") logger.log(fmt_row(13, self.reward_giver.loss_name)) assert len(observation) == self.timesteps_per_batch batch_size = self.timesteps_per_batch // self.d_step # NOTE: uses only the last g step for observation d_losses = [] # list of tuples, each of which gives the loss for a minibatch # NOTE: for recurrent policies, use shuffle=False? for ob_batch, ac_batch in dataset.iterbatches((observation, action), include_final_partial_batch=False, batch_size=batch_size, shuffle=True): ob_expert, ac_expert = self.expert_dataset.get_next_batch() # update running mean/std for reward_giver if self.reward_giver.normalize: self.reward_giver.obs_rms.update(np.concatenate((ob_batch, ob_expert), 0)) # Reshape actions if needed when using discrete actions if isinstance(self.action_space, gym.spaces.Discrete): if len(ac_batch.shape) == 2: ac_batch = ac_batch[:, 0] if len(ac_expert.shape) == 2: ac_expert = ac_expert[:, 0] *newlosses, grad = self.reward_giver.lossandgrad(ob_batch, ac_batch, ob_expert, ac_expert) self.d_adam.update(self.allmean(grad), self.d_stepsize) d_losses.append(newlosses) logger.log(fmt_row(13, np.mean(d_losses, axis=0))) # lr: lengths and rewards lr_local = (seg["ep_lens"], seg["ep_rets"], seg["ep_true_rets"]) # local values list_lr_pairs = MPI.COMM_WORLD.allgather(lr_local) # list of tuples lens, rews, true_rets = map(flatten_lists, zip(*list_lr_pairs)) true_reward_buffer.extend(true_rets) else: # lr: lengths and rewards lr_local = (seg["ep_lens"], seg["ep_rets"]) # local values list_lr_pairs = MPI.COMM_WORLD.allgather(lr_local) # list of tuples lens, rews = map(flatten_lists, zip(*list_lr_pairs)) len_buffer.extend(lens) reward_buffer.extend(rews) if len(len_buffer) > 0: logger.record_tabular("EpLenMean", np.mean(len_buffer)) logger.record_tabular("EpRewMean", np.mean(reward_buffer)) if self.using_gail: logger.record_tabular("EpTrueRewMean", np.mean(true_reward_buffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) current_it_timesteps = MPI.COMM_WORLD.allreduce(seg["total_timestep"]) timesteps_so_far += current_it_timesteps self.num_timesteps += current_it_timesteps iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", self.num_timesteps) logger.record_tabular("TimeElapsed", time.time() - t_start) if self.verbose >= 1 and self.rank == 0: logger.dump_tabular() callback.on_training_end() return self def save(self, save_path, cloudpickle=False): if self.using_gail and self.expert_dataset is not None: # Exit processes to pickle the dataset self.expert_dataset.prepare_pickling() data = { "gamma": self.gamma, "timesteps_per_batch": self.timesteps_per_batch, "max_kl": self.max_kl, "cg_iters": self.cg_iters, "lam": self.lam, "entcoeff": self.entcoeff, "cg_damping": self.cg_damping, "vf_stepsize": self.vf_stepsize, "vf_iters": self.vf_iters, "hidden_size_adversary": self.hidden_size_adversary, "adversary_entcoeff": self.adversary_entcoeff, "expert_dataset": self.expert_dataset, "g_step": self.g_step, "d_step": self.d_step, "d_stepsize": self.d_stepsize, "using_gail": self.using_gail, "verbose": self.verbose, "policy": self.policy, "observation_space": self.observation_space, "action_space": self.action_space, "n_envs": self.n_envs, "n_cpu_tf_sess": self.n_cpu_tf_sess, "seed": self.seed, "_vectorize_action": self._vectorize_action, "policy_kwargs": self.policy_kwargs } params_to_save = self.get_parameters() self._save_to_file(save_path, data=data, params=params_to_save, cloudpickle=cloudpickle)
54.162662
121
0.524742
import time from contextlib import contextmanager from collections import deque import gym from mpi4py import MPI import tensorflow as tf import numpy as np import stable_baselines.common.tf_util as tf_util from stable_baselines.common.tf_util import total_episode_reward_logger from stable_baselines.common import explained_variance, zipsame, dataset, fmt_row, colorize, ActorCriticRLModel, \ SetVerbosity, TensorboardWriter from stable_baselines import logger from stable_baselines.common.mpi_adam import MpiAdam from stable_baselines.common.cg import conjugate_gradient from stable_baselines.common.policies import ActorCriticPolicy from stable_baselines.common.misc_util import flatten_lists from stable_baselines.common.runners import traj_segment_generator from stable_baselines.trpo_mpi.utils import add_vtarg_and_adv class TRPO(ActorCriticRLModel): def __init__(self, policy, env, gamma=0.99, timesteps_per_batch=1024, max_kl=0.01, cg_iters=10, lam=0.98, entcoeff=0.0, cg_damping=1e-2, vf_stepsize=3e-4, vf_iters=3, verbose=0, tensorboard_log=None, _init_setup_model=True, policy_kwargs=None, full_tensorboard_log=False, seed=None, n_cpu_tf_sess=1): super(TRPO, self).__init__(policy=policy, env=env, verbose=verbose, requires_vec_env=False, _init_setup_model=_init_setup_model, policy_kwargs=policy_kwargs, seed=seed, n_cpu_tf_sess=n_cpu_tf_sess) self.using_gail = False self.timesteps_per_batch = timesteps_per_batch self.cg_iters = cg_iters self.cg_damping = cg_damping self.gamma = gamma self.lam = lam self.max_kl = max_kl self.vf_iters = vf_iters self.vf_stepsize = vf_stepsize self.entcoeff = entcoeff self.tensorboard_log = tensorboard_log self.full_tensorboard_log = full_tensorboard_log self.hidden_size_adversary = 100 self.adversary_entcoeff = 1e-3 self.expert_dataset = None self.g_step = 1 self.d_step = 1 self.d_stepsize = 3e-4 self.graph = None self.sess = None self.policy_pi = None self.loss_names = None self.assign_old_eq_new = None self.compute_losses = None self.compute_lossandgrad = None self.compute_fvp = None self.compute_vflossandgrad = None self.d_adam = None self.vfadam = None self.get_flat = None self.set_from_flat = None self.timed = None self.allmean = None self.nworkers = None self.rank = None self.reward_giver = None self.step = None self.proba_step = None self.initial_state = None self.params = None self.summary = None if _init_setup_model: self.setup_model() def _get_pretrain_placeholders(self): policy = self.policy_pi action_ph = policy.pdtype.sample_placeholder([None]) if isinstance(self.action_space, gym.spaces.Discrete): return policy.obs_ph, action_ph, policy.policy return policy.obs_ph, action_ph, policy.deterministic_action def setup_model(self): from stable_baselines.gail.adversary import TransitionClassifier with SetVerbosity(self.verbose): assert issubclass(self.policy, ActorCriticPolicy), "Error: the input policy for the TRPO model must be " \ "an instance of common.policies.ActorCriticPolicy." self.nworkers = MPI.COMM_WORLD.Get_size() self.rank = MPI.COMM_WORLD.Get_rank() np.set_printoptions(precision=3) self.graph = tf.Graph() with self.graph.as_default(): self.set_random_seed(self.seed) self.sess = tf_util.make_session(num_cpu=self.n_cpu_tf_sess, graph=self.graph) if self.using_gail: self.reward_giver = TransitionClassifier(self.observation_space, self.action_space, self.hidden_size_adversary, entcoeff=self.adversary_entcoeff) self.policy_pi = self.policy(self.sess, self.observation_space, self.action_space, self.n_envs, 1, None, reuse=False, **self.policy_kwargs) with tf.variable_scope("oldpi", reuse=False): old_policy = self.policy(self.sess, self.observation_space, self.action_space, self.n_envs, 1, None, reuse=False, **self.policy_kwargs) with tf.variable_scope("loss", reuse=False): atarg = tf.placeholder(dtype=tf.float32, shape=[None]) ret = tf.placeholder(dtype=tf.float32, shape=[None]) observation = self.policy_pi.obs_ph action = self.policy_pi.pdtype.sample_placeholder([None]) kloldnew = old_policy.proba_distribution.kl(self.policy_pi.proba_distribution) ent = self.policy_pi.proba_distribution.entropy() meankl = tf.reduce_mean(kloldnew) meanent = tf.reduce_mean(ent) entbonus = self.entcoeff * meanent vferr = tf.reduce_mean(tf.square(self.policy_pi.value_flat - ret)) ratio = tf.exp(self.policy_pi.proba_distribution.logp(action) - old_policy.proba_distribution.logp(action)) surrgain = tf.reduce_mean(ratio * atarg) optimgain = surrgain + entbonus losses = [optimgain, meankl, entbonus, surrgain, meanent] self.loss_names = ["optimgain", "meankl", "entloss", "surrgain", "entropy"] dist = meankl all_var_list = tf_util.get_trainable_vars("model") var_list = [v for v in all_var_list if "/vf" not in v.name and "/q/" not in v.name] vf_var_list = [v for v in all_var_list if "/pi" not in v.name and "/logstd" not in v.name] self.get_flat = tf_util.GetFlat(var_list, sess=self.sess) self.set_from_flat = tf_util.SetFromFlat(var_list, sess=self.sess) klgrads = tf.gradients(dist, var_list) flat_tangent = tf.placeholder(dtype=tf.float32, shape=[None], name="flat_tan") shapes = [var.get_shape().as_list() for var in var_list] start = 0 tangents = [] for shape in shapes: var_size = tf_util.intprod(shape) tangents.append(tf.reshape(flat_tangent[start: start + var_size], shape)) start += var_size gvp = tf.add_n([tf.reduce_sum(grad * tangent) for (grad, tangent) in zipsame(klgrads, tangents)]) fvp = tf_util.flatgrad(gvp, var_list) tf.summary.scalar('entropy_loss', meanent) tf.summary.scalar('policy_gradient_loss', optimgain) tf.summary.scalar('value_function_loss', surrgain) tf.summary.scalar('approximate_kullback-leibler', meankl) tf.summary.scalar('loss', optimgain + meankl + entbonus + surrgain + meanent) self.assign_old_eq_new = \ tf_util.function([], [], updates=[tf.assign(oldv, newv) for (oldv, newv) in zipsame(tf_util.get_globals_vars("oldpi"), tf_util.get_globals_vars("model"))]) self.compute_losses = tf_util.function([observation, old_policy.obs_ph, action, atarg], losses) self.compute_fvp = tf_util.function([flat_tangent, observation, old_policy.obs_ph, action, atarg], fvp) self.compute_vflossandgrad = tf_util.function([observation, old_policy.obs_ph, ret], tf_util.flatgrad(vferr, vf_var_list)) @contextmanager def timed(msg): if self.rank == 0 and self.verbose >= 1: print(colorize(msg, color='magenta')) start_time = time.time() yield print(colorize("done in {:.3f} seconds".format((time.time() - start_time)), color='magenta')) else: yield def allmean(arr): assert isinstance(arr, np.ndarray) out = np.empty_like(arr) MPI.COMM_WORLD.Allreduce(arr, out, op=MPI.SUM) out /= self.nworkers return out tf_util.initialize(sess=self.sess) th_init = self.get_flat() MPI.COMM_WORLD.Bcast(th_init, root=0) self.set_from_flat(th_init) with tf.variable_scope("Adam_mpi", reuse=False): self.vfadam = MpiAdam(vf_var_list, sess=self.sess) if self.using_gail: self.d_adam = MpiAdam(self.reward_giver.get_trainable_variables(), sess=self.sess) self.d_adam.sync() self.vfadam.sync() with tf.variable_scope("input_info", reuse=False): tf.summary.scalar('discounted_rewards', tf.reduce_mean(ret)) tf.summary.scalar('learning_rate', tf.reduce_mean(self.vf_stepsize)) tf.summary.scalar('advantage', tf.reduce_mean(atarg)) tf.summary.scalar('kl_clip_range', tf.reduce_mean(self.max_kl)) if self.full_tensorboard_log: tf.summary.histogram('discounted_rewards', ret) tf.summary.histogram('learning_rate', self.vf_stepsize) tf.summary.histogram('advantage', atarg) tf.summary.histogram('kl_clip_range', self.max_kl) if tf_util.is_image(self.observation_space): tf.summary.image('observation', observation) else: tf.summary.histogram('observation', observation) self.timed = timed self.allmean = allmean self.step = self.policy_pi.step self.proba_step = self.policy_pi.proba_step self.initial_state = self.policy_pi.initial_state self.params = tf_util.get_trainable_vars("model") + tf_util.get_trainable_vars("oldpi") if self.using_gail: self.params.extend(self.reward_giver.get_trainable_variables()) self.summary = tf.summary.merge_all() self.compute_lossandgrad = \ tf_util.function([observation, old_policy.obs_ph, action, atarg, ret], [self.summary, tf_util.flatgrad(optimgain, var_list)] + losses) def learn(self, total_timesteps, callback=None, log_interval=100, tb_log_name="TRPO", reset_num_timesteps=True): new_tb_log = self._init_num_timesteps(reset_num_timesteps) callback = self._init_callback(callback) with SetVerbosity(self.verbose), TensorboardWriter(self.graph, self.tensorboard_log, tb_log_name, new_tb_log) \ as writer: self._setup_learn() with self.sess.as_default(): callback.on_training_start(locals(), globals()) seg_gen = traj_segment_generator(self.policy_pi, self.env, self.timesteps_per_batch, reward_giver=self.reward_giver, gail=self.using_gail, callback=callback) episodes_so_far = 0 timesteps_so_far = 0 iters_so_far = 0 t_start = time.time() len_buffer = deque(maxlen=40) reward_buffer = deque(maxlen=40) true_reward_buffer = None if self.using_gail: true_reward_buffer = deque(maxlen=40) batchsize = self.timesteps_per_batch // self.d_step self.expert_dataset.init_dataloader(batchsize) while True: if timesteps_so_far >= total_timesteps: break logger.log("********** Iteration %i ************" % iters_so_far) def fisher_vector_product(vec): return self.allmean(self.compute_fvp(vec, *fvpargs, sess=self.sess)) + self.cg_damping * vec logger.log("Optimizing Policy...") mean_losses = None vpredbefore = None tdlamret = None observation = None action = None seg = None for k in range(self.g_step): with self.timed("sampling"): seg = seg_gen.__next__() if not seg.get('continue_training', True): break add_vtarg_and_adv(seg, self.gamma, self.lam) observation, action = seg["observations"], seg["actions"] atarg, tdlamret = seg["adv"], seg["tdlamret"] vpredbefore = seg["vpred"] atarg = (atarg - atarg.mean()) / (atarg.std() + 1e-8) if writer is not None: total_episode_reward_logger(self.episode_reward, seg["true_rewards"].reshape( (self.n_envs, -1)), seg["dones"].reshape((self.n_envs, -1)), writer, self.num_timesteps) args = seg["observations"], seg["observations"], seg["actions"], atarg fvpargs = [arr[::5] for arr in args] self.assign_old_eq_new(sess=self.sess) with self.timed("computegrad"): steps = self.num_timesteps + (k + 1) * (seg["total_timestep"] / self.g_step) run_options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE) run_metadata = tf.RunMetadata() if self.full_tensorboard_log else None if writer is not None: summary, grad, *lossbefore = self.compute_lossandgrad(*args, tdlamret, sess=self.sess, options=run_options, run_metadata=run_metadata) if self.full_tensorboard_log: writer.add_run_metadata(run_metadata, 'step%d' % steps) writer.add_summary(summary, steps) else: _, grad, *lossbefore = self.compute_lossandgrad(*args, tdlamret, sess=self.sess, options=run_options, run_metadata=run_metadata) lossbefore = self.allmean(np.array(lossbefore)) grad = self.allmean(grad) if np.allclose(grad, 0): logger.log("Got zero gradient. not updating") else: with self.timed("conjugate_gradient"): stepdir = conjugate_gradient(fisher_vector_product, grad, cg_iters=self.cg_iters, verbose=self.rank == 0 and self.verbose >= 1) assert np.isfinite(stepdir).all() shs = .5 * stepdir.dot(fisher_vector_product(stepdir)) lagrange_multiplier = np.sqrt(abs(shs) / self.max_kl) fullstep = stepdir / lagrange_multiplier expectedimprove = grad.dot(fullstep) surrbefore = lossbefore[0] stepsize = 1.0 thbefore = self.get_flat() for _ in range(10): thnew = thbefore + fullstep * stepsize self.set_from_flat(thnew) mean_losses = surr, kl_loss, *_ = self.allmean( np.array(self.compute_losses(*args, sess=self.sess))) improve = surr - surrbefore logger.log("Expected: %.3f Actual: %.3f" % (expectedimprove, improve)) if not np.isfinite(mean_losses).all(): logger.log("Got non-finite value of losses -- bad!") elif kl_loss > self.max_kl * 1.5: logger.log("violated KL constraint. shrinking step.") elif improve < 0: logger.log("surrogate didn't improve. shrinking step.") else: logger.log("Stepsize OK!") break stepsize *= .5 else: logger.log("couldn't compute a good step") self.set_from_flat(thbefore) if self.nworkers > 1 and iters_so_far % 20 == 0: paramsums = MPI.COMM_WORLD.allgather((thnew.sum(), self.vfadam.getflat().sum())) assert all(np.allclose(ps, paramsums[0]) for ps in paramsums[1:]) for (loss_name, loss_val) in zip(self.loss_names, mean_losses): logger.record_tabular(loss_name, loss_val) with self.timed("vf"): for _ in range(self.vf_iters): for (mbob, mbret) in dataset.iterbatches((seg["observations"], seg["tdlamret"]), include_final_partial_batch=False, batch_size=128, shuffle=True): grad = self.allmean(self.compute_vflossandgrad(mbob, mbob, mbret, sess=self.sess)) self.vfadam.update(grad, self.vf_stepsize) if not seg.get('continue_training', True): break logger.record_tabular("explained_variance_tdlam_before", explained_variance(vpredbefore, tdlamret)) if self.using_gail: logger.log("Optimizing Discriminator...") logger.log(fmt_row(13, self.reward_giver.loss_name)) assert len(observation) == self.timesteps_per_batch batch_size = self.timesteps_per_batch // self.d_step d_losses = [] for ob_batch, ac_batch in dataset.iterbatches((observation, action), include_final_partial_batch=False, batch_size=batch_size, shuffle=True): ob_expert, ac_expert = self.expert_dataset.get_next_batch() if self.reward_giver.normalize: self.reward_giver.obs_rms.update(np.concatenate((ob_batch, ob_expert), 0)) if isinstance(self.action_space, gym.spaces.Discrete): if len(ac_batch.shape) == 2: ac_batch = ac_batch[:, 0] if len(ac_expert.shape) == 2: ac_expert = ac_expert[:, 0] *newlosses, grad = self.reward_giver.lossandgrad(ob_batch, ac_batch, ob_expert, ac_expert) self.d_adam.update(self.allmean(grad), self.d_stepsize) d_losses.append(newlosses) logger.log(fmt_row(13, np.mean(d_losses, axis=0))) lr_local = (seg["ep_lens"], seg["ep_rets"], seg["ep_true_rets"]) list_lr_pairs = MPI.COMM_WORLD.allgather(lr_local) lens, rews, true_rets = map(flatten_lists, zip(*list_lr_pairs)) true_reward_buffer.extend(true_rets) else: lr_local = (seg["ep_lens"], seg["ep_rets"]) list_lr_pairs = MPI.COMM_WORLD.allgather(lr_local) lens, rews = map(flatten_lists, zip(*list_lr_pairs)) len_buffer.extend(lens) reward_buffer.extend(rews) if len(len_buffer) > 0: logger.record_tabular("EpLenMean", np.mean(len_buffer)) logger.record_tabular("EpRewMean", np.mean(reward_buffer)) if self.using_gail: logger.record_tabular("EpTrueRewMean", np.mean(true_reward_buffer)) logger.record_tabular("EpThisIter", len(lens)) episodes_so_far += len(lens) current_it_timesteps = MPI.COMM_WORLD.allreduce(seg["total_timestep"]) timesteps_so_far += current_it_timesteps self.num_timesteps += current_it_timesteps iters_so_far += 1 logger.record_tabular("EpisodesSoFar", episodes_so_far) logger.record_tabular("TimestepsSoFar", self.num_timesteps) logger.record_tabular("TimeElapsed", time.time() - t_start) if self.verbose >= 1 and self.rank == 0: logger.dump_tabular() callback.on_training_end() return self def save(self, save_path, cloudpickle=False): if self.using_gail and self.expert_dataset is not None: self.expert_dataset.prepare_pickling() data = { "gamma": self.gamma, "timesteps_per_batch": self.timesteps_per_batch, "max_kl": self.max_kl, "cg_iters": self.cg_iters, "lam": self.lam, "entcoeff": self.entcoeff, "cg_damping": self.cg_damping, "vf_stepsize": self.vf_stepsize, "vf_iters": self.vf_iters, "hidden_size_adversary": self.hidden_size_adversary, "adversary_entcoeff": self.adversary_entcoeff, "expert_dataset": self.expert_dataset, "g_step": self.g_step, "d_step": self.d_step, "d_stepsize": self.d_stepsize, "using_gail": self.using_gail, "verbose": self.verbose, "policy": self.policy, "observation_space": self.observation_space, "action_space": self.action_space, "n_envs": self.n_envs, "n_cpu_tf_sess": self.n_cpu_tf_sess, "seed": self.seed, "_vectorize_action": self._vectorize_action, "policy_kwargs": self.policy_kwargs } params_to_save = self.get_parameters() self._save_to_file(save_path, data=data, params=params_to_save, cloudpickle=cloudpickle)
true
true
f720830ef2390c7f939ff23286a68aa2ce3b6879
6,591
py
Python
mslib/msui/qt5/ui_topview_window.py
iamansoni/MSS
69bc8fc61ab277697ca691119f911382a63860c0
[ "Apache-2.0" ]
null
null
null
mslib/msui/qt5/ui_topview_window.py
iamansoni/MSS
69bc8fc61ab277697ca691119f911382a63860c0
[ "Apache-2.0" ]
null
null
null
mslib/msui/qt5/ui_topview_window.py
iamansoni/MSS
69bc8fc61ab277697ca691119f911382a63860c0
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- # Form implementation generated from reading ui file 'mslib/msui/ui/ui_topview_window.ui' # # Created by: PyQt5 UI code generator 5.9.2 # # WARNING! All changes made in this file will be lost! from PyQt5 import QtCore, QtGui, QtWidgets class Ui_TopViewWindow(object): def setupUi(self, TopViewWindow): TopViewWindow.setObjectName("TopViewWindow") TopViewWindow.resize(952, 782) self.centralwidget = QtWidgets.QWidget(TopViewWindow) self.centralwidget.setObjectName("centralwidget") self.verticalLayout = QtWidgets.QVBoxLayout(self.centralwidget) self.verticalLayout.setObjectName("verticalLayout") self.horizontalLayout_2 = QtWidgets.QHBoxLayout() self.horizontalLayout_2.setObjectName("horizontalLayout_2") self.mpl = MplTopViewWidget(self.centralwidget) sizePolicy = QtWidgets.QSizePolicy(QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Expanding) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.mpl.sizePolicy().hasHeightForWidth()) self.mpl.setSizePolicy(sizePolicy) self.mpl.setMinimumSize(QtCore.QSize(100, 100)) self.mpl.setObjectName("mpl") self.horizontalLayout_2.addWidget(self.mpl) self.verticalLayout.addLayout(self.horizontalLayout_2) self.horizontalLayout = QtWidgets.QHBoxLayout() self.horizontalLayout.setObjectName("horizontalLayout") self.btMapRedraw = QtWidgets.QPushButton(self.centralwidget) font = QtGui.QFont() font.setBold(True) font.setWeight(75) self.btMapRedraw.setFont(font) self.btMapRedraw.setFlat(False) self.btMapRedraw.setObjectName("btMapRedraw") self.horizontalLayout.addWidget(self.btMapRedraw) spacerItem = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem) self.btSettings = QtWidgets.QPushButton(self.centralwidget) self.btSettings.setObjectName("btSettings") self.horizontalLayout.addWidget(self.btSettings) spacerItem1 = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem1) self.btRoundtrip = QtWidgets.QPushButton(self.centralwidget) self.btRoundtrip.setObjectName("btRoundtrip") self.horizontalLayout.addWidget(self.btRoundtrip) spacerItem2 = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem2) self.cbTools = QtWidgets.QComboBox(self.centralwidget) sizePolicy = QtWidgets.QSizePolicy(QtWidgets.QSizePolicy.MinimumExpanding, QtWidgets.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.cbTools.sizePolicy().hasHeightForWidth()) self.cbTools.setSizePolicy(sizePolicy) self.cbTools.setObjectName("cbTools") self.cbTools.addItem("") self.cbTools.addItem("") self.horizontalLayout.addWidget(self.cbTools) spacerItem3 = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem3) self.cbChangeMapSection = QtWidgets.QComboBox(self.centralwidget) sizePolicy = QtWidgets.QSizePolicy(QtWidgets.QSizePolicy.MinimumExpanding, QtWidgets.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.cbChangeMapSection.sizePolicy().hasHeightForWidth()) self.cbChangeMapSection.setSizePolicy(sizePolicy) self.cbChangeMapSection.setSizeAdjustPolicy(QtWidgets.QComboBox.AdjustToContents) self.cbChangeMapSection.setObjectName("cbChangeMapSection") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.horizontalLayout.addWidget(self.cbChangeMapSection) spacerItem4 = QtWidgets.QSpacerItem(40, 20, QtWidgets.QSizePolicy.MinimumExpanding, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem4) self.verticalLayout.addLayout(self.horizontalLayout) TopViewWindow.setCentralWidget(self.centralwidget) self.actionCloseWindow = QtWidgets.QAction(TopViewWindow) self.actionCloseWindow.setObjectName("actionCloseWindow") TopViewWindow.addAction(self.actionCloseWindow) self.retranslateUi(TopViewWindow) self.actionCloseWindow.triggered.connect(TopViewWindow.close) QtCore.QMetaObject.connectSlotsByName(TopViewWindow) def retranslateUi(self, TopViewWindow): _translate = QtCore.QCoreApplication.translate TopViewWindow.setWindowTitle(_translate("TopViewWindow", "Top View - Mission Support System")) self.btMapRedraw.setText(_translate("TopViewWindow", "&REDRAW")) self.btMapRedraw.setShortcut(_translate("TopViewWindow", "R")) self.btSettings.setText(_translate("TopViewWindow", "options")) self.btRoundtrip.setText(_translate("TopViewWindow", "make roundtrip")) self.cbTools.setItemText(0, _translate("TopViewWindow", "(select to open tool)")) self.cbTools.setItemText(1, _translate("TopViewWindow", "WMS")) self.cbChangeMapSection.setItemText(0, _translate("TopViewWindow", "to reset map select a region")) self.cbChangeMapSection.setItemText(1, _translate("TopViewWindow", "Spitsbergen, large")) self.cbChangeMapSection.setItemText(2, _translate("TopViewWindow", "Spitsbergen, local")) self.cbChangeMapSection.setItemText(3, _translate("TopViewWindow", "Europe (ste)")) self.cbChangeMapSection.setItemText(4, _translate("TopViewWindow", "Germany (ste)")) self.cbChangeMapSection.setItemText(5, _translate("TopViewWindow", "Europe (cyl)")) self.cbChangeMapSection.setItemText(6, _translate("TopViewWindow", "Germany (cyl)")) self.actionCloseWindow.setText(_translate("TopViewWindow", "CloseWindow")) self.actionCloseWindow.setShortcut(_translate("TopViewWindow", "Ctrl+W")) from mslib.msui.mpl_qtwidget import MplTopViewWidget
58.327434
122
0.739645
from PyQt5 import QtCore, QtGui, QtWidgets class Ui_TopViewWindow(object): def setupUi(self, TopViewWindow): TopViewWindow.setObjectName("TopViewWindow") TopViewWindow.resize(952, 782) self.centralwidget = QtWidgets.QWidget(TopViewWindow) self.centralwidget.setObjectName("centralwidget") self.verticalLayout = QtWidgets.QVBoxLayout(self.centralwidget) self.verticalLayout.setObjectName("verticalLayout") self.horizontalLayout_2 = QtWidgets.QHBoxLayout() self.horizontalLayout_2.setObjectName("horizontalLayout_2") self.mpl = MplTopViewWidget(self.centralwidget) sizePolicy = QtWidgets.QSizePolicy(QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Expanding) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.mpl.sizePolicy().hasHeightForWidth()) self.mpl.setSizePolicy(sizePolicy) self.mpl.setMinimumSize(QtCore.QSize(100, 100)) self.mpl.setObjectName("mpl") self.horizontalLayout_2.addWidget(self.mpl) self.verticalLayout.addLayout(self.horizontalLayout_2) self.horizontalLayout = QtWidgets.QHBoxLayout() self.horizontalLayout.setObjectName("horizontalLayout") self.btMapRedraw = QtWidgets.QPushButton(self.centralwidget) font = QtGui.QFont() font.setBold(True) font.setWeight(75) self.btMapRedraw.setFont(font) self.btMapRedraw.setFlat(False) self.btMapRedraw.setObjectName("btMapRedraw") self.horizontalLayout.addWidget(self.btMapRedraw) spacerItem = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem) self.btSettings = QtWidgets.QPushButton(self.centralwidget) self.btSettings.setObjectName("btSettings") self.horizontalLayout.addWidget(self.btSettings) spacerItem1 = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem1) self.btRoundtrip = QtWidgets.QPushButton(self.centralwidget) self.btRoundtrip.setObjectName("btRoundtrip") self.horizontalLayout.addWidget(self.btRoundtrip) spacerItem2 = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem2) self.cbTools = QtWidgets.QComboBox(self.centralwidget) sizePolicy = QtWidgets.QSizePolicy(QtWidgets.QSizePolicy.MinimumExpanding, QtWidgets.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.cbTools.sizePolicy().hasHeightForWidth()) self.cbTools.setSizePolicy(sizePolicy) self.cbTools.setObjectName("cbTools") self.cbTools.addItem("") self.cbTools.addItem("") self.horizontalLayout.addWidget(self.cbTools) spacerItem3 = QtWidgets.QSpacerItem(20, 20, QtWidgets.QSizePolicy.Preferred, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem3) self.cbChangeMapSection = QtWidgets.QComboBox(self.centralwidget) sizePolicy = QtWidgets.QSizePolicy(QtWidgets.QSizePolicy.MinimumExpanding, QtWidgets.QSizePolicy.Fixed) sizePolicy.setHorizontalStretch(0) sizePolicy.setVerticalStretch(0) sizePolicy.setHeightForWidth(self.cbChangeMapSection.sizePolicy().hasHeightForWidth()) self.cbChangeMapSection.setSizePolicy(sizePolicy) self.cbChangeMapSection.setSizeAdjustPolicy(QtWidgets.QComboBox.AdjustToContents) self.cbChangeMapSection.setObjectName("cbChangeMapSection") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.cbChangeMapSection.addItem("") self.horizontalLayout.addWidget(self.cbChangeMapSection) spacerItem4 = QtWidgets.QSpacerItem(40, 20, QtWidgets.QSizePolicy.MinimumExpanding, QtWidgets.QSizePolicy.Minimum) self.horizontalLayout.addItem(spacerItem4) self.verticalLayout.addLayout(self.horizontalLayout) TopViewWindow.setCentralWidget(self.centralwidget) self.actionCloseWindow = QtWidgets.QAction(TopViewWindow) self.actionCloseWindow.setObjectName("actionCloseWindow") TopViewWindow.addAction(self.actionCloseWindow) self.retranslateUi(TopViewWindow) self.actionCloseWindow.triggered.connect(TopViewWindow.close) QtCore.QMetaObject.connectSlotsByName(TopViewWindow) def retranslateUi(self, TopViewWindow): _translate = QtCore.QCoreApplication.translate TopViewWindow.setWindowTitle(_translate("TopViewWindow", "Top View - Mission Support System")) self.btMapRedraw.setText(_translate("TopViewWindow", "&REDRAW")) self.btMapRedraw.setShortcut(_translate("TopViewWindow", "R")) self.btSettings.setText(_translate("TopViewWindow", "options")) self.btRoundtrip.setText(_translate("TopViewWindow", "make roundtrip")) self.cbTools.setItemText(0, _translate("TopViewWindow", "(select to open tool)")) self.cbTools.setItemText(1, _translate("TopViewWindow", "WMS")) self.cbChangeMapSection.setItemText(0, _translate("TopViewWindow", "to reset map select a region")) self.cbChangeMapSection.setItemText(1, _translate("TopViewWindow", "Spitsbergen, large")) self.cbChangeMapSection.setItemText(2, _translate("TopViewWindow", "Spitsbergen, local")) self.cbChangeMapSection.setItemText(3, _translate("TopViewWindow", "Europe (ste)")) self.cbChangeMapSection.setItemText(4, _translate("TopViewWindow", "Germany (ste)")) self.cbChangeMapSection.setItemText(5, _translate("TopViewWindow", "Europe (cyl)")) self.cbChangeMapSection.setItemText(6, _translate("TopViewWindow", "Germany (cyl)")) self.actionCloseWindow.setText(_translate("TopViewWindow", "CloseWindow")) self.actionCloseWindow.setShortcut(_translate("TopViewWindow", "Ctrl+W")) from mslib.msui.mpl_qtwidget import MplTopViewWidget
true
true
f720841a7564a5f85416ab65a54983fa155787e0
282
py
Python
Seguranca/Ping/pingmultiplo.py
Luis12368/python
23352d75ad13bcfd09ea85ab422fdc6ae1fcc5e7
[ "MIT" ]
1
2022-03-24T21:30:53.000Z
2022-03-24T21:30:53.000Z
Seguranca-com-python/Ping/pingmultiplo.py
Luis12368/Bootcamp-Cognizant-Cloud-Data-Engineer
789216a6fa76e4cb1336a73ed861bcf2e9d03751
[ "MIT" ]
null
null
null
Seguranca-com-python/Ping/pingmultiplo.py
Luis12368/Bootcamp-Cognizant-Cloud-Data-Engineer
789216a6fa76e4cb1336a73ed861bcf2e9d03751
[ "MIT" ]
null
null
null
import os import time with open('hosts.txt') as file: dump = file.read() dump = dump.splitlines() for ip in dump: print("Verificando o IP", ip) print("-" * 60) os.system('ping -n 2 {}'.format(ip)) print("-" * 60) time.sleep(5)
18.8
44
0.524823
import os import time with open('hosts.txt') as file: dump = file.read() dump = dump.splitlines() for ip in dump: print("Verificando o IP", ip) print("-" * 60) os.system('ping -n 2 {}'.format(ip)) print("-" * 60) time.sleep(5)
true
true
f72084785a53b5effc7e214a1463c10da25fda6e
58,018
py
Python
salt/utils/schema.py
johnskopis/salt
86adb6b0fe40230b8be4c74229e897a7a08f81a6
[ "Apache-2.0" ]
2
2018-11-08T02:59:24.000Z
2021-01-04T00:30:50.000Z
salt/utils/schema.py
johnskopis/salt
86adb6b0fe40230b8be4c74229e897a7a08f81a6
[ "Apache-2.0" ]
4
2020-09-04T10:19:34.000Z
2020-11-09T12:55:59.000Z
salt/utils/schema.py
johnskopis/salt
86adb6b0fe40230b8be4c74229e897a7a08f81a6
[ "Apache-2.0" ]
5
2017-06-16T23:48:13.000Z
2021-04-08T17:43:48.000Z
# -*- coding: utf-8 -*- ''' :codeauthor: Pedro Algarvio (pedro@algarvio.me) :codeauthor: Alexandru Bleotu (alexandru.bleotu@morganstanley.com) salt.utils.schema ~~~~~~~~~~~~~~~~~ Object Oriented Configuration - JSON Schema compatible generator This code was inspired by `jsl`__, "A Python DSL for describing JSON schemas". .. __: https://jsl.readthedocs.io/ A configuration document or configuration document section is defined using the py:class:`Schema`, the configuration items are defined by any of the subclasses of py:class:`BaseSchemaItem` as attributes of a subclass of py:class:`Schema` class. A more complex configuration document (containing a defininitions section) is defined using the py:class:`DefinitionsSchema`. This type of schema supports having complex configuration items as attributes (defined extending the py:class:`ComplexSchemaItem`). These items have other configuration items (complex or not) as attributes, allowing to verify more complex JSON data structures As an example: .. code-block:: python class HostConfig(Schema): title = 'Host Configuration' description = 'This is the host configuration' host = StringItem( 'Host', 'The looong host description', default=None, minimum=1 ) port = NumberItem( description='The port number', default=80, required=False, minimum=0, inclusiveMinimum=False, maximum=65535 ) The serialized version of the above configuration definition is: .. code-block:: python >>> print(HostConfig.serialize()) OrderedDict([ ('$schema', 'http://json-schema.org/draft-04/schema#'), ('title', 'Host Configuration'), ('description', 'This is the host configuration'), ('type', 'object'), ('properties', OrderedDict([ ('host', {'minimum': 1, 'type': 'string', 'description': 'The looong host description', 'title': 'Host'}), ('port', {'description': 'The port number', 'default': 80, 'inclusiveMinimum': False, 'maximum': 65535, 'minimum': 0, 'type': 'number'}) ])), ('required', ['host']), ('x-ordering', ['host', 'port']), ('additionalProperties', True)] ) >>> print(salt.utils.json.dumps(HostConfig.serialize(), indent=2)) { "$schema": "http://json-schema.org/draft-04/schema#", "title": "Host Configuration", "description": "This is the host configuration", "type": "object", "properties": { "host": { "minimum": 1, "type": "string", "description": "The looong host description", "title": "Host" }, "port": { "description": "The port number", "default": 80, "inclusiveMinimum": false, "maximum": 65535, "minimum": 0, "type": "number" } }, "required": [ "host" ], "x-ordering": [ "host", "port" ], "additionalProperties": false } The serialized version of the configuration block can be used to validate a configuration dictionary using the `python jsonschema library`__. .. __: https://pypi.python.org/pypi/jsonschema .. code-block:: python >>> import jsonschema >>> jsonschema.validate({'host': 'localhost', 'port': 80}, HostConfig.serialize()) >>> jsonschema.validate({'host': 'localhost', 'port': -1}, HostConfig.serialize()) Traceback (most recent call last): File "<stdin>", line 1, in <module> File "/usr/lib/python2.7/site-packages/jsonschema/validators.py", line 478, in validate cls(schema, *args, **kwargs).validate(instance) File "/usr/lib/python2.7/site-packages/jsonschema/validators.py", line 123, in validate raise error jsonschema.exceptions.ValidationError: -1 is less than the minimum of 0 Failed validating 'minimum' in schema['properties']['port']: {'default': 80, 'description': 'The port number', 'inclusiveMinimum': False, 'maximum': 65535, 'minimum': 0, 'type': 'number'} On instance['port']: -1 >>> A configuration document can even be split into configuration sections. Let's reuse the above ``HostConfig`` class and include it in a configuration block: .. code-block:: python class LoggingConfig(Schema): title = 'Logging Configuration' description = 'This is the logging configuration' log_level = StringItem( 'Logging Level', 'The logging level', default='debug', minimum=1 ) class MyConfig(Schema): title = 'My Config' description = 'This my configuration' hostconfig = HostConfig() logconfig = LoggingConfig() The JSON Schema string version of the above is: .. code-block:: python >>> print salt.utils.json.dumps(MyConfig.serialize(), indent=4) { "$schema": "http://json-schema.org/draft-04/schema#", "title": "My Config", "description": "This my configuration", "type": "object", "properties": { "hostconfig": { "id": "https://non-existing.saltstack.com/schemas/hostconfig.json#", "title": "Host Configuration", "description": "This is the host configuration", "type": "object", "properties": { "host": { "minimum": 1, "type": "string", "description": "The looong host description", "title": "Host" }, "port": { "description": "The port number", "default": 80, "inclusiveMinimum": false, "maximum": 65535, "minimum": 0, "type": "number" } }, "required": [ "host" ], "x-ordering": [ "host", "port" ], "additionalProperties": false }, "logconfig": { "id": "https://non-existing.saltstack.com/schemas/logconfig.json#", "title": "Logging Configuration", "description": "This is the logging configuration", "type": "object", "properties": { "log_level": { "default": "debug", "minimum": 1, "type": "string", "description": "The logging level", "title": "Logging Level" } }, "required": [ "log_level" ], "x-ordering": [ "log_level" ], "additionalProperties": false } }, "additionalProperties": false } >>> import jsonschema >>> jsonschema.validate( {'hostconfig': {'host': 'localhost', 'port': 80}, 'logconfig': {'log_level': 'debug'}}, MyConfig.serialize()) >>> jsonschema.validate( {'hostconfig': {'host': 'localhost', 'port': -1}, 'logconfig': {'log_level': 'debug'}}, MyConfig.serialize()) Traceback (most recent call last): File "<stdin>", line 1, in <module> File "/usr/lib/python2.7/site-packages/jsonschema/validators.py", line 478, in validate cls(schema, *args, **kwargs).validate(instance) File "/usr/lib/python2.7/site-packages/jsonschema/validators.py", line 123, in validate raise error jsonschema.exceptions.ValidationError: -1 is less than the minimum of 0 Failed validating 'minimum' in schema['properties']['hostconfig']['properties']['port']: {'default': 80, 'description': 'The port number', 'inclusiveMinimum': False, 'maximum': 65535, 'minimum': 0, 'type': 'number'} On instance['hostconfig']['port']: -1 >>> If however, you just want to use the configuration blocks for readability and do not desire the nested dictionaries serialization, you can pass ``flatten=True`` when defining a configuration section as a configuration subclass attribute: .. code-block:: python class MyConfig(Schema): title = 'My Config' description = 'This my configuration' hostconfig = HostConfig(flatten=True) logconfig = LoggingConfig(flatten=True) The JSON Schema string version of the above is: .. code-block:: python >>> print(salt.utils.json.dumps(MyConfig, indent=4)) { "$schema": "http://json-schema.org/draft-04/schema#", "title": "My Config", "description": "This my configuration", "type": "object", "properties": { "host": { "minimum": 1, "type": "string", "description": "The looong host description", "title": "Host" }, "port": { "description": "The port number", "default": 80, "inclusiveMinimum": false, "maximum": 65535, "minimum": 0, "type": "number" }, "log_level": { "default": "debug", "minimum": 1, "type": "string", "description": "The logging level", "title": "Logging Level" } }, "x-ordering": [ "host", "port", "log_level" ], "additionalProperties": false } ''' # Import python libs from __future__ import absolute_import, print_function, unicode_literals import sys import inspect import textwrap import functools # Import salt libs import salt.utils.args #import salt.utils.yaml from salt.utils.odict import OrderedDict # Import 3rd-party libs from salt.ext import six BASE_SCHEMA_URL = 'https://non-existing.saltstack.com/schemas' RENDER_COMMENT_YAML_MAX_LINE_LENGTH = 80 class Prepareable(type): ''' Preserve attributes order for python 2.x ''' # This code was taken from # https://github.com/aromanovich/jsl/blob/master/jsl/_compat/prepareable.py # which in turn was taken from https://gist.github.com/DasIch/5562625 with minor fixes if not six.PY3: def __new__(mcs, name, bases, attributes): try: constructor = attributes["__new__"] except KeyError: return type.__new__(mcs, name, bases, attributes) def preparing_constructor(mcs, name, bases, attributes): try: mcs.__prepare__ except AttributeError: return constructor(mcs, name, bases, attributes) namespace = mcs.__prepare__(name, bases) defining_frame = sys._getframe(1) for constant in reversed(defining_frame.f_code.co_consts): if inspect.iscode(constant) and constant.co_name == name: def get_index(attribute_name, _names=constant.co_names): # pylint: disable=cell-var-from-loop try: return _names.index(attribute_name) except ValueError: return 0 break else: return constructor(mcs, name, bases, attributes) by_appearance = sorted( attributes.items(), key=lambda item: get_index(item[0]) ) for key, value in by_appearance: namespace[key] = value return constructor(mcs, name, bases, namespace) attributes["__new__"] = functools.wraps(constructor)(preparing_constructor) return type.__new__(mcs, name, bases, attributes) class NullSentinel(object): ''' A class which instance represents a null value. Allows specifying fields with a default value of null. ''' def __bool__(self): return False __nonzero__ = __bool__ Null = NullSentinel() ''' A special value that can be used to set the default value of a field to null. ''' # make sure nobody creates another Null value def _failing_new(*args, **kwargs): raise TypeError('Can\'t create another NullSentinel instance') NullSentinel.__new__ = staticmethod(_failing_new) del _failing_new class SchemaMeta(six.with_metaclass(Prepareable, type)): @classmethod def __prepare__(mcs, name, bases): return OrderedDict() def __new__(mcs, name, bases, attrs): # Mark the instance as a configuration document/section attrs['__config__'] = True attrs['__flatten__'] = False attrs['__config_name__'] = None # Let's record the configuration items/sections items = {} sections = {} order = [] # items from parent classes for base in reversed(bases): if hasattr(base, '_items'): items.update(base._items) if hasattr(base, '_sections'): sections.update(base._sections) if hasattr(base, '_order'): order.extend(base._order) # Iterate through attrs to discover items/config sections for key, value in six.iteritems(attrs): entry_name = None if not hasattr(value, '__item__') and not hasattr(value, '__config__'): continue if hasattr(value, '__item__'): # the value is an item instance if hasattr(value, 'title') and value.title is None: # It's an item instance without a title, make the title # it's name value.title = key entry_name = value.__item_name__ or key items[entry_name] = value if hasattr(value, '__config__'): entry_name = value.__config_name__ or key sections[entry_name] = value order.append(entry_name) attrs['_order'] = order attrs['_items'] = items attrs['_sections'] = sections return type.__new__(mcs, name, bases, attrs) def __call__(cls, flatten=False, allow_additional_items=False, **kwargs): instance = object.__new__(cls) instance.__config_name__ = kwargs.pop('name', None) if flatten is True: # This configuration block is to be treated as a part of the # configuration for which it was defined as an attribute, not as # it's own sub configuration instance.__flatten__ = True if allow_additional_items is True: # The configuration block only accepts the configuration items # which are defined on the class. On additional items, validation # with jsonschema will fail instance.__allow_additional_items__ = True instance.__init__(**kwargs) return instance class BaseSchemaItemMeta(six.with_metaclass(Prepareable, type)): ''' Config item metaclass to "tag" the class as a configuration item ''' @classmethod def __prepare__(mcs, name, bases): return OrderedDict() def __new__(mcs, name, bases, attrs): # Register the class as an item class attrs['__item__'] = True attrs['__item_name__'] = None # Instantiate an empty list to store the config item attribute names attributes = [] for base in reversed(bases): try: base_attributes = getattr(base, '_attributes', []) if base_attributes: attributes.extend(base_attributes) # Extend the attributes with the base argspec argument names # but skip "self" for argname in salt.utils.args.get_function_argspec(base.__init__).args: if argname == 'self' or argname in attributes: continue if argname == 'name': continue attributes.append(argname) except TypeError: # On the base object type, __init__ is just a wrapper which # triggers a TypeError when we're trying to find out it's # argspec continue attrs['_attributes'] = attributes return type.__new__(mcs, name, bases, attrs) def __call__(cls, *args, **kwargs): # Create the instance class instance = object.__new__(cls) if args: raise RuntimeError( 'Please pass all arguments as named arguments. Un-named ' 'arguments are not supported' ) for key in kwargs.copy(): # Store the kwarg keys as the instance attributes for the # serialization step if key == 'name': # This is the item name to override the class attribute name instance.__item_name__ = kwargs.pop(key) continue if key not in instance._attributes: instance._attributes.append(key) # Init the class instance.__init__(*args, **kwargs) # Validate the instance after initialization for base in reversed(inspect.getmro(cls)): validate_attributes = getattr(base, '__validate_attributes__', None) if validate_attributes: if instance.__validate_attributes__.__func__.__code__ is not validate_attributes.__code__: # The method was overridden, run base.__validate_attributes__ function base.__validate_attributes__(instance) # Finally, run the instance __validate_attributes__ function instance.__validate_attributes__() # Return the initialized class return instance class Schema(six.with_metaclass(SchemaMeta, object)): ''' Configuration definition class ''' # Define some class level attributes to make PyLint happier title = None description = None _items = _sections = _order = None __flatten__ = False __allow_additional_items__ = False @classmethod def serialize(cls, id_=None): # The order matters serialized = OrderedDict() if id_ is not None: # This is meant as a configuration section, sub json schema serialized['id'] = '{0}/{1}.json#'.format(BASE_SCHEMA_URL, id_) else: # Main configuration block, json schema serialized['$schema'] = 'http://json-schema.org/draft-04/schema#' if cls.title is not None: serialized['title'] = cls.title if cls.description is not None: if cls.description == cls.__doc__: serialized['description'] = textwrap.dedent(cls.description).strip() else: serialized['description'] = cls.description required = [] ordering = [] serialized['type'] = 'object' properties = OrderedDict() cls.after_items_update = [] for name in cls._order: # pylint: disable=E1133 skip_order = False item_name = None if name in cls._sections: # pylint: disable=E1135 section = cls._sections[name] serialized_section = section.serialize(None if section.__flatten__ is True else name) if section.__flatten__ is True: # Flatten the configuration section into the parent # configuration properties.update(serialized_section['properties']) if 'x-ordering' in serialized_section: ordering.extend(serialized_section['x-ordering']) if 'required' in serialized_section: required.extend(serialized_section['required']) if hasattr(section, 'after_items_update'): cls.after_items_update.extend(section.after_items_update) skip_order = True else: # Store it as a configuration section properties[name] = serialized_section if name in cls._items: # pylint: disable=E1135 config = cls._items[name] item_name = config.__item_name__ or name # Handle the configuration items defined in the class instance if config.__flatten__ is True: serialized_config = config.serialize() cls.after_items_update.append(serialized_config) skip_order = True else: properties[item_name] = config.serialize() if config.required: # If it's a required item, add it to the required list required.append(item_name) if skip_order is False: # Store the order of the item if item_name is not None: if item_name not in ordering: ordering.append(item_name) else: if name not in ordering: ordering.append(name) if properties: serialized['properties'] = properties # Update the serialized object with any items to include after properties. # Do not overwrite properties already existing in the serialized dict. if cls.after_items_update: after_items_update = {} for entry in cls.after_items_update: for name, data in six.iteritems(entry): if name in after_items_update: if isinstance(after_items_update[name], list): after_items_update[name].extend(data) else: after_items_update[name] = data if after_items_update: after_items_update.update(serialized) serialized = after_items_update if required: # Only include required if not empty serialized['required'] = required if ordering: # Only include ordering if not empty serialized['x-ordering'] = ordering serialized['additionalProperties'] = cls.__allow_additional_items__ return serialized @classmethod def defaults(cls): serialized = cls.serialize() defaults = {} for name, details in serialized['properties'].items(): if 'default' in details: defaults[name] = details['default'] continue if 'properties' in details: for sname, sdetails in details['properties'].items(): if 'default' in sdetails: defaults.setdefault(name, {})[sname] = sdetails['default'] continue return defaults @classmethod def as_requirements_item(cls): serialized_schema = cls.serialize() required = serialized_schema.get('required', []) for name in serialized_schema['properties']: if name not in required: required.append(name) return RequirementsItem(requirements=required) #@classmethod #def render_as_rst(cls): # ''' # Render the configuration block as a restructured text string # ''' # # TODO: Implement RST rendering # raise NotImplementedError #@classmethod #def render_as_yaml(cls): # ''' # Render the configuration block as a parseable YAML string including comments # ''' # # TODO: Implement YAML rendering # raise NotImplementedError class SchemaItem(six.with_metaclass(BaseSchemaItemMeta, object)): ''' Base configuration items class. All configurations must subclass it ''' # Define some class level attributes to make PyLint happier __type__ = None __format__ = None _attributes = None __flatten__ = False __serialize_attr_aliases__ = None required = False def __init__(self, required=None, **extra): ''' :param required: If the configuration item is required. Defaults to ``False``. ''' if required is not None: self.required = required self.extra = extra def __validate_attributes__(self): ''' Run any validation check you need the instance attributes. ATTENTION: Don't call the parent class when overriding this method because it will just duplicate the executions. This class'es metaclass will take care of that. ''' if self.required not in (True, False): raise RuntimeError( '\'required\' can only be True/False' ) def _get_argname_value(self, argname): ''' Return the argname value looking up on all possible attributes ''' # Let's see if there's a private function to get the value argvalue = getattr(self, '__get_{0}__'.format(argname), None) if argvalue is not None and callable(argvalue): argvalue = argvalue() if argvalue is None: # Let's see if the value is defined as a public class variable argvalue = getattr(self, argname, None) if argvalue is None: # Let's see if it's defined as a private class variable argvalue = getattr(self, '__{0}__'.format(argname), None) if argvalue is None: # Let's look for it in the extra dictionary argvalue = self.extra.get(argname, None) return argvalue def serialize(self): ''' Return a serializable form of the config instance ''' raise NotImplementedError class BaseSchemaItem(SchemaItem): ''' Base configuration items class. All configurations must subclass it ''' # Let's define description as a class attribute, this will allow a custom configuration # item to do something like: # class MyCustomConfig(StringItem): # ''' # This is my custom config, blah, blah, blah # ''' # description = __doc__ # description = None # The same for all other base arguments title = None default = None enum = None enumNames = None def __init__(self, title=None, description=None, default=None, enum=None, enumNames=None, **kwargs): ''' :param required: If the configuration item is required. Defaults to ``False``. :param title: A short explanation about the purpose of the data described by this item. :param description: A detailed explanation about the purpose of the data described by this item. :param default: The default value for this configuration item. May be :data:`.Null` (a special value to set the default value to null). :param enum: A list(list, tuple, set) of valid choices. ''' if title is not None: self.title = title if description is not None: self.description = description if default is not None: self.default = default if enum is not None: self.enum = enum if enumNames is not None: self.enumNames = enumNames super(BaseSchemaItem, self).__init__(**kwargs) def __validate_attributes__(self): if self.enum is not None: if not isinstance(self.enum, (list, tuple, set)): raise RuntimeError( 'Only the \'list\', \'tuple\' and \'set\' python types can be used ' 'to define \'enum\'' ) if not isinstance(self.enum, list): self.enum = list(self.enum) if self.enumNames is not None: if not isinstance(self.enumNames, (list, tuple, set)): raise RuntimeError( 'Only the \'list\', \'tuple\' and \'set\' python types can be used ' 'to define \'enumNames\'' ) if len(self.enum) != len(self.enumNames): raise RuntimeError( 'The size of \'enumNames\' must match the size of \'enum\'' ) if not isinstance(self.enumNames, list): self.enumNames = list(self.enumNames) def serialize(self): ''' Return a serializable form of the config instance ''' serialized = {'type': self.__type__} for argname in self._attributes: if argname == 'required': # This is handled elsewhere continue argvalue = self._get_argname_value(argname) if argvalue is not None: if argvalue is Null: argvalue = None # None values are not meant to be included in the # serialization, since this is not None... if self.__serialize_attr_aliases__ and argname in self.__serialize_attr_aliases__: argname = self.__serialize_attr_aliases__[argname] serialized[argname] = argvalue return serialized def __get_description__(self): if self.description is not None: if self.description == self.__doc__: return textwrap.dedent(self.description).strip() return self.description #def render_as_rst(self, name): # ''' # Render the configuration item as a restructured text string # ''' # # TODO: Implement YAML rendering # raise NotImplementedError #def render_as_yaml(self, name): # ''' # Render the configuration item as a parseable YAML string including comments # ''' # # TODO: Include the item rules in the output, minimum, maximum, etc... # output = '# ----- ' # output += self.title # output += ' ' # output += '-' * (RENDER_COMMENT_YAML_MAX_LINE_LENGTH - 7 - len(self.title) - 2) # output += '>\n' # if self.description: # output += '\n'.join(textwrap.wrap(self.description, # width=RENDER_COMMENT_YAML_MAX_LINE_LENGTH, # initial_indent='# ')) # output += '\n' # yamled_default_value = salt.utils.yaml.safe_dump(self.default, default_flow_style=False).split('\n...', 1)[0] # output += '# Default: {0}\n'.format(yamled_default_value) # output += '#{0}: {1}\n'.format(name, yamled_default_value) # output += '# <---- ' # output += self.title # output += ' ' # output += '-' * (RENDER_COMMENT_YAML_MAX_LINE_LENGTH - 7 - len(self.title) - 1) # return output + '\n' class NullItem(BaseSchemaItem): __type__ = 'null' class BooleanItem(BaseSchemaItem): __type__ = 'boolean' class StringItem(BaseSchemaItem): ''' A string configuration field ''' __type__ = 'string' __serialize_attr_aliases__ = { 'min_length': 'minLength', 'max_length': 'maxLength' } format = None pattern = None min_length = None max_length = None def __init__(self, format=None, # pylint: disable=redefined-builtin pattern=None, min_length=None, max_length=None, **kwargs): ''' :param required: If the configuration item is required. Defaults to ``False``. :param title: A short explanation about the purpose of the data described by this item. :param description: A detailed explanation about the purpose of the data described by this item. :param default: The default value for this configuration item. May be :data:`.Null` (a special value to set the default value to null). :param enum: A list(list, tuple, set) of valid choices. :param format: A semantic format of the string (for example, ``"date-time"``, ``"email"``, or ``"uri"``). :param pattern: A regular expression (ECMA 262) that a string value must match. :param min_length: The minimum length :param max_length: The maximum length ''' if format is not None: # pylint: disable=redefined-builtin self.format = format if pattern is not None: self.pattern = pattern if min_length is not None: self.min_length = min_length if max_length is not None: self.max_length = max_length super(StringItem, self).__init__(**kwargs) def __validate_attributes__(self): if self.format is None and self.__format__ is not None: self.format = self.__format__ class EMailItem(StringItem): ''' An internet email address, see `RFC 5322, section 3.4.1`__. .. __: http://tools.ietf.org/html/rfc5322 ''' __format__ = 'email' class IPv4Item(StringItem): ''' An IPv4 address configuration field, according to dotted-quad ABNF syntax as defined in `RFC 2673, section 3.2`__. .. __: http://tools.ietf.org/html/rfc2673 ''' __format__ = 'ipv4' class IPv6Item(StringItem): ''' An IPv6 address configuration field, as defined in `RFC 2373, section 2.2`__. .. __: http://tools.ietf.org/html/rfc2373 ''' __format__ = 'ipv6' class HostnameItem(StringItem): ''' An Internet host name configuration field, see `RFC 1034, section 3.1`__. .. __: http://tools.ietf.org/html/rfc1034 ''' __format__ = 'hostname' class DateTimeItem(StringItem): ''' An ISO 8601 formatted date-time configuration field, as defined by `RFC 3339, section 5.6`__. .. __: http://tools.ietf.org/html/rfc3339 ''' __format__ = 'date-time' class UriItem(StringItem): ''' A universal resource identifier (URI) configuration field, according to `RFC3986`__. .. __: http://tools.ietf.org/html/rfc3986 ''' __format__ = 'uri' class SecretItem(StringItem): ''' A string configuration field containing a secret, for example, passwords, API keys, etc ''' __format__ = 'secret' class NumberItem(BaseSchemaItem): __type__ = 'number' __serialize_attr_aliases__ = { 'multiple_of': 'multipleOf', 'exclusive_minimum': 'exclusiveMinimum', 'exclusive_maximum': 'exclusiveMaximum', } multiple_of = None minimum = None exclusive_minimum = None maximum = None exclusive_maximum = None def __init__(self, multiple_of=None, minimum=None, exclusive_minimum=None, maximum=None, exclusive_maximum=None, **kwargs): ''' :param required: If the configuration item is required. Defaults to ``False``. :param title: A short explanation about the purpose of the data described by this item. :param description: A detailed explanation about the purpose of the data described by this item. :param default: The default value for this configuration item. May be :data:`.Null` (a special value to set the default value to null). :param enum: A list(list, tuple, set) of valid choices. :param multiple_of: A value must be a multiple of this factor. :param minimum: The minimum allowed value :param exclusive_minimum: Whether a value is allowed to be exactly equal to the minimum :param maximum: The maximum allowed value :param exclusive_maximum: Whether a value is allowed to be exactly equal to the maximum ''' if multiple_of is not None: self.multiple_of = multiple_of if minimum is not None: self.minimum = minimum if exclusive_minimum is not None: self.exclusive_minimum = exclusive_minimum if maximum is not None: self.maximum = maximum if exclusive_maximum is not None: self.exclusive_maximum = exclusive_maximum super(NumberItem, self).__init__(**kwargs) class IntegerItem(NumberItem): __type__ = 'integer' class ArrayItem(BaseSchemaItem): __type__ = 'array' __serialize_attr_aliases__ = { 'min_items': 'minItems', 'max_items': 'maxItems', 'unique_items': 'uniqueItems', 'additional_items': 'additionalItems' } items = None min_items = None max_items = None unique_items = None additional_items = None def __init__(self, items=None, min_items=None, max_items=None, unique_items=None, additional_items=None, **kwargs): ''' :param required: If the configuration item is required. Defaults to ``False``. :param title: A short explanation about the purpose of the data described by this item. :param description: A detailed explanation about the purpose of the data described by this item. :param default: The default value for this configuration item. May be :data:`.Null` (a special value to set the default value to null). :param enum: A list(list, tuple, set) of valid choices. :param items: Either of the following: * :class:`BaseSchemaItem` -- all items of the array must match the field schema; * a list or a tuple of :class:`fields <.BaseSchemaItem>` -- all items of the array must be valid according to the field schema at the corresponding index (tuple typing); :param min_items: Minimum length of the array :param max_items: Maximum length of the array :param unique_items: Whether all the values in the array must be distinct. :param additional_items: If the value of ``items`` is a list or a tuple, and the array length is larger than the number of fields in ``items``, then the additional items are described by the :class:`.BaseField` passed using this argument. :type additional_items: bool or :class:`.BaseSchemaItem` ''' if items is not None: self.items = items if min_items is not None: self.min_items = min_items if max_items is not None: self.max_items = max_items if unique_items is not None: self.unique_items = unique_items if additional_items is not None: self.additional_items = additional_items super(ArrayItem, self).__init__(**kwargs) def __validate_attributes__(self): if not self.items and not self.additional_items: raise RuntimeError( 'One of items or additional_items must be passed.' ) if self.items is not None: if isinstance(self.items, (list, tuple)): for item in self.items: if not isinstance(item, (Schema, SchemaItem)): raise RuntimeError( 'All items passed in the item argument tuple/list must be ' 'a subclass of Schema, SchemaItem or BaseSchemaItem, ' 'not {0}'.format(type(item)) ) elif not isinstance(self.items, (Schema, SchemaItem)): raise RuntimeError( 'The items argument passed must be a subclass of ' 'Schema, SchemaItem or BaseSchemaItem, not ' '{0}'.format(type(self.items)) ) def __get_items__(self): if isinstance(self.items, (Schema, SchemaItem)): # This is either a Schema or a Basetem, return it in it's # serialized form return self.items.serialize() if isinstance(self.items, (tuple, list)): items = [] for item in self.items: items.append(item.serialize()) return items class DictItem(BaseSchemaItem): __type__ = 'object' __serialize_attr_aliases__ = { 'min_properties': 'minProperties', 'max_properties': 'maxProperties', 'pattern_properties': 'patternProperties', 'additional_properties': 'additionalProperties' } properties = None pattern_properties = None additional_properties = None min_properties = None max_properties = None def __init__(self, properties=None, pattern_properties=None, additional_properties=None, min_properties=None, max_properties=None, **kwargs): ''' :param required: If the configuration item is required. Defaults to ``False``. :type required: boolean :param title: A short explanation about the purpose of the data described by this item. :type title: str :param description: A detailed explanation about the purpose of the data described by this item. :param default: The default value for this configuration item. May be :data:`.Null` (a special value to set the default value to null). :param enum: A list(list, tuple, set) of valid choices. :param properties: A dictionary containing fields :param pattern_properties: A dictionary whose keys are regular expressions (ECMA 262). Properties match against these regular expressions, and for any that match, the property is described by the corresponding field schema. :type pattern_properties: dict[str -> :class:`.Schema` or :class:`.SchemaItem` or :class:`.BaseSchemaItem`] :param additional_properties: Describes properties that are not described by the ``properties`` or ``pattern_properties``. :type additional_properties: bool or :class:`.Schema` or :class:`.SchemaItem` or :class:`.BaseSchemaItem` :param min_properties: A minimum number of properties. :type min_properties: int :param max_properties: A maximum number of properties :type max_properties: int ''' if properties is not None: self.properties = properties if pattern_properties is not None: self.pattern_properties = pattern_properties if additional_properties is not None: self.additional_properties = additional_properties if min_properties is not None: self.min_properties = min_properties if max_properties is not None: self.max_properties = max_properties super(DictItem, self).__init__(**kwargs) def __validate_attributes__(self): if not self.properties and not self.pattern_properties and not self.additional_properties: raise RuntimeError( 'One of properties, pattern_properties or additional_properties must be passed' ) if self.properties is not None: if not isinstance(self.properties, (Schema, dict)): raise RuntimeError( 'The passed properties must be passed as a dict or ' ' a Schema not \'{0}\''.format(type(self.properties)) ) if not isinstance(self.properties, Schema): for key, prop in self.properties.items(): if not isinstance(prop, (Schema, SchemaItem)): raise RuntimeError( 'The passed property who\'s key is \'{0}\' must be of type ' 'Schema, SchemaItem or BaseSchemaItem, not ' '\'{1}\''.format(key, type(prop)) ) if self.pattern_properties is not None: if not isinstance(self.pattern_properties, dict): raise RuntimeError( 'The passed pattern_properties must be passed as a dict ' 'not \'{0}\''.format(type(self.pattern_properties)) ) for key, prop in self.pattern_properties.items(): if not isinstance(prop, (Schema, SchemaItem)): raise RuntimeError( 'The passed pattern_property who\'s key is \'{0}\' must ' 'be of type Schema, SchemaItem or BaseSchemaItem, ' 'not \'{1}\''.format(key, type(prop)) ) if self.additional_properties is not None: if not isinstance(self.additional_properties, (bool, Schema, SchemaItem)): raise RuntimeError( 'The passed additional_properties must be of type bool, ' 'Schema, SchemaItem or BaseSchemaItem, not \'{0}\''.format( type(self.pattern_properties) ) ) def __get_properties__(self): if self.properties is None: return if isinstance(self.properties, Schema): return self.properties.serialize()['properties'] properties = OrderedDict() for key, prop in self.properties.items(): properties[key] = prop.serialize() return properties def __get_pattern_properties__(self): if self.pattern_properties is None: return pattern_properties = OrderedDict() for key, prop in self.pattern_properties.items(): pattern_properties[key] = prop.serialize() return pattern_properties def __get_additional_properties__(self): if self.additional_properties is None: return if isinstance(self.additional_properties, bool): return self.additional_properties return self.additional_properties.serialize() def __call__(self, flatten=False): self.__flatten__ = flatten return self def serialize(self): result = super(DictItem, self).serialize() required = [] if self.properties is not None: if isinstance(self.properties, Schema): serialized = self.properties.serialize() if 'required' in serialized: required.extend(serialized['required']) else: for key, prop in self.properties.items(): if prop.required: required.append(key) if required: result['required'] = required return result class RequirementsItem(SchemaItem): __type__ = 'object' requirements = None def __init__(self, requirements=None): if requirements is not None: self.requirements = requirements super(RequirementsItem, self).__init__() def __validate_attributes__(self): if self.requirements is None: raise RuntimeError( 'The passed requirements must not be empty' ) if not isinstance(self.requirements, (SchemaItem, list, tuple, set)): raise RuntimeError( 'The passed requirements must be passed as a list, tuple, ' 'set SchemaItem or BaseSchemaItem, not \'{0}\''.format(self.requirements) ) if not isinstance(self.requirements, SchemaItem): if not isinstance(self.requirements, list): self.requirements = list(self.requirements) for idx, item in enumerate(self.requirements): if not isinstance(item, (six.string_types, SchemaItem)): raise RuntimeError( 'The passed requirement at the {0} index must be of type ' 'str or SchemaItem, not \'{1}\''.format(idx, type(item)) ) def serialize(self): if isinstance(self.requirements, SchemaItem): requirements = self.requirements.serialize() else: requirements = [] for requirement in self.requirements: if isinstance(requirement, SchemaItem): requirements.append(requirement.serialize()) continue requirements.append(requirement) return {'required': requirements} class OneOfItem(SchemaItem): __type__ = 'oneOf' items = None def __init__(self, items=None, required=None): if items is not None: self.items = items super(OneOfItem, self).__init__(required=required) def __validate_attributes__(self): if not self.items: raise RuntimeError( 'The passed items must not be empty' ) if not isinstance(self.items, (list, tuple)): raise RuntimeError( 'The passed items must be passed as a list/tuple not ' '\'{0}\''.format(type(self.items)) ) for idx, item in enumerate(self.items): if not isinstance(item, (Schema, SchemaItem)): raise RuntimeError( 'The passed item at the {0} index must be of type ' 'Schema, SchemaItem or BaseSchemaItem, not ' '\'{1}\''.format(idx, type(item)) ) if not isinstance(self.items, list): self.items = list(self.items) def __call__(self, flatten=False): self.__flatten__ = flatten return self def serialize(self): return {self.__type__: [i.serialize() for i in self.items]} class AnyOfItem(OneOfItem): __type__ = 'anyOf' class AllOfItem(OneOfItem): __type__ = 'allOf' class NotItem(SchemaItem): __type__ = 'not' item = None def __init__(self, item=None): if item is not None: self.item = item super(NotItem, self).__init__() def __validate_attributes__(self): if not self.item: raise RuntimeError( 'An item must be passed' ) if not isinstance(self.item, (Schema, SchemaItem)): raise RuntimeError( 'The passed item be of type Schema, SchemaItem or ' 'BaseSchemaItem, not \'{1}\''.format(type(self.item)) ) def serialize(self): return {self.__type__: self.item.serialize()} # ----- Custom Preconfigured Configs --------------------------------------------------------------------------------> class PortItem(IntegerItem): minimum = 0 # yes, 0 is a valid port number maximum = 65535 # <---- Custom Preconfigured Configs --------------------------------------------------------------------------------- class ComplexSchemaItem(BaseSchemaItem): ''' .. versionadded:: 2016.11.0 Complex Schema Item ''' # This attribute is populated by the metaclass, but pylint fails to see it # and assumes it's not an iterable _attributes = [] _definition_name = None def __init__(self, definition_name=None, required=None): super(ComplexSchemaItem, self).__init__(required=required) self.__type__ = 'object' self._definition_name = definition_name if definition_name else \ self.__class__.__name__ # Schema attributes might have been added as class attributes so we # and they must be added to the _attributes attr self._add_missing_schema_attributes() def _add_missing_schema_attributes(self): ''' Adds any missed schema attributes to the _attributes list The attributes can be class attributes and they won't be included in the _attributes list automatically ''' for attr in [attr for attr in dir(self) if not attr.startswith('__')]: attr_val = getattr(self, attr) if isinstance(getattr(self, attr), SchemaItem) and \ attr not in self._attributes: self._attributes.append(attr) @property def definition_name(self): return self._definition_name def serialize(self): ''' The serialization of the complex item is a pointer to the item definition ''' return {'$ref': '#/definitions/{0}'.format(self.definition_name)} def get_definition(self): '''Returns the definition of the complex item''' serialized = super(ComplexSchemaItem, self).serialize() # Adjust entries in the serialization del serialized['definition_name'] serialized['title'] = self.definition_name properties = {} required_attr_names = [] for attr_name in self._attributes: attr = getattr(self, attr_name) if attr and isinstance(attr, BaseSchemaItem): # Remove the attribute entry added by the base serialization del serialized[attr_name] properties[attr_name] = attr.serialize() properties[attr_name]['type'] = attr.__type__ if attr.required: required_attr_names.append(attr_name) if serialized.get('properties') is None: serialized['properties'] = {} serialized['properties'].update(properties) # Assign the required array if required_attr_names: serialized['required'] = required_attr_names return serialized def get_complex_attrs(self): '''Returns a dictionary of the complex attributes''' return [getattr(self, attr_name) for attr_name in self._attributes if isinstance(getattr(self, attr_name), ComplexSchemaItem)] class DefinitionsSchema(Schema): ''' .. versionadded:: 2016.11.0 JSON schema class that supports ComplexSchemaItem objects by adding a definitions section to the JSON schema, containing the item definitions. All references to ComplexSchemaItems are built using schema inline dereferencing. ''' @classmethod def serialize(cls, id_=None): # Get the initial serialization serialized = super(DefinitionsSchema, cls).serialize(id_) complex_items = [] # Augment the serializations with the definitions of all complex items aux_items = cls._items.values() # Convert dict_view object to a list on Python 3 if six.PY3: aux_items = list(aux_items) while aux_items: item = aux_items.pop(0) # Add complex attributes if isinstance(item, ComplexSchemaItem): complex_items.append(item) aux_items.extend(item.get_complex_attrs()) # Handle container items if isinstance(item, OneOfItem): aux_items.extend(item.items) elif isinstance(item, ArrayItem): aux_items.append(item.items) elif isinstance(item, DictItem): if item.properties: aux_items.extend(item.properties.values()) if item.additional_properties and \ isinstance(item.additional_properties, SchemaItem): aux_items.append(item.additional_properties) definitions = OrderedDict() for config in complex_items: if isinstance(config, ComplexSchemaItem): definitions[config.definition_name] = \ config.get_definition() serialized['definitions'] = definitions return serialized
36.466373
122
0.561688
from __future__ import absolute_import, print_function, unicode_literals import sys import inspect import textwrap import functools import salt.utils.args from salt.utils.odict import OrderedDict from salt.ext import six BASE_SCHEMA_URL = 'https://non-existing.saltstack.com/schemas' RENDER_COMMENT_YAML_MAX_LINE_LENGTH = 80 class Prepareable(type): if not six.PY3: def __new__(mcs, name, bases, attributes): try: constructor = attributes["__new__"] except KeyError: return type.__new__(mcs, name, bases, attributes) def preparing_constructor(mcs, name, bases, attributes): try: mcs.__prepare__ except AttributeError: return constructor(mcs, name, bases, attributes) namespace = mcs.__prepare__(name, bases) defining_frame = sys._getframe(1) for constant in reversed(defining_frame.f_code.co_consts): if inspect.iscode(constant) and constant.co_name == name: def get_index(attribute_name, _names=constant.co_names): try: return _names.index(attribute_name) except ValueError: return 0 break else: return constructor(mcs, name, bases, attributes) by_appearance = sorted( attributes.items(), key=lambda item: get_index(item[0]) ) for key, value in by_appearance: namespace[key] = value return constructor(mcs, name, bases, namespace) attributes["__new__"] = functools.wraps(constructor)(preparing_constructor) return type.__new__(mcs, name, bases, attributes) class NullSentinel(object): def __bool__(self): return False __nonzero__ = __bool__ Null = NullSentinel() def _failing_new(*args, **kwargs): raise TypeError('Can\'t create another NullSentinel instance') NullSentinel.__new__ = staticmethod(_failing_new) del _failing_new class SchemaMeta(six.with_metaclass(Prepareable, type)): @classmethod def __prepare__(mcs, name, bases): return OrderedDict() def __new__(mcs, name, bases, attrs): # Mark the instance as a configuration document/section attrs['__config__'] = True attrs['__flatten__'] = False attrs['__config_name__'] = None # Let's record the configuration items/sections items = {} sections = {} order = [] for base in reversed(bases): if hasattr(base, '_items'): items.update(base._items) if hasattr(base, '_sections'): sections.update(base._sections) if hasattr(base, '_order'): order.extend(base._order) for key, value in six.iteritems(attrs): entry_name = None if not hasattr(value, '__item__') and not hasattr(value, '__config__'): continue if hasattr(value, '__item__'): if hasattr(value, 'title') and value.title is None: # it's name value.title = key entry_name = value.__item_name__ or key items[entry_name] = value if hasattr(value, '__config__'): entry_name = value.__config_name__ or key sections[entry_name] = value order.append(entry_name) attrs['_order'] = order attrs['_items'] = items attrs['_sections'] = sections return type.__new__(mcs, name, bases, attrs) def __call__(cls, flatten=False, allow_additional_items=False, **kwargs): instance = object.__new__(cls) instance.__config_name__ = kwargs.pop('name', None) if flatten is True: instance.__flatten__ = True if allow_additional_items is True: # The configuration block only accepts the configuration items # which are defined on the class. On additional items, validation # with jsonschema will fail instance.__allow_additional_items__ = True instance.__init__(**kwargs) return instance class BaseSchemaItemMeta(six.with_metaclass(Prepareable, type)): @classmethod def __prepare__(mcs, name, bases): return OrderedDict() def __new__(mcs, name, bases, attrs): # Register the class as an item class attrs['__item__'] = True attrs['__item_name__'] = None # Instantiate an empty list to store the config item attribute names attributes = [] for base in reversed(bases): try: base_attributes = getattr(base, '_attributes', []) if base_attributes: attributes.extend(base_attributes) # Extend the attributes with the base argspec argument names # but skip "self" for argname in salt.utils.args.get_function_argspec(base.__init__).args: if argname == 'self' or argname in attributes: continue if argname == 'name': continue attributes.append(argname) except TypeError: # On the base object type, __init__ is just a wrapper which # triggers a TypeError when we're trying to find out it's # argspec continue attrs['_attributes'] = attributes return type.__new__(mcs, name, bases, attrs) def __call__(cls, *args, **kwargs): # Create the instance class instance = object.__new__(cls) if args: raise RuntimeError( 'Please pass all arguments as named arguments. Un-named ' 'arguments are not supported' ) for key in kwargs.copy(): # Store the kwarg keys as the instance attributes for the # serialization step if key == 'name': # This is the item name to override the class attribute name instance.__item_name__ = kwargs.pop(key) continue if key not in instance._attributes: instance._attributes.append(key) # Init the class instance.__init__(*args, **kwargs) # Validate the instance after initialization for base in reversed(inspect.getmro(cls)): validate_attributes = getattr(base, '__validate_attributes__', None) if validate_attributes: if instance.__validate_attributes__.__func__.__code__ is not validate_attributes.__code__: # The method was overridden, run base.__validate_attributes__ function base.__validate_attributes__(instance) # Finally, run the instance __validate_attributes__ function instance.__validate_attributes__() # Return the initialized class return instance class Schema(six.with_metaclass(SchemaMeta, object)): # Define some class level attributes to make PyLint happier title = None description = None _items = _sections = _order = None __flatten__ = False __allow_additional_items__ = False @classmethod def serialize(cls, id_=None): # The order matters serialized = OrderedDict() if id_ is not None: # This is meant as a configuration section, sub json schema serialized['id'] = '{0}/{1}.json else: # Main configuration block, json schema serialized['$schema'] = 'http://json-schema.org/draft-04/schema if cls.title is not None: serialized['title'] = cls.title if cls.description is not None: if cls.description == cls.__doc__: serialized['description'] = textwrap.dedent(cls.description).strip() else: serialized['description'] = cls.description required = [] ordering = [] serialized['type'] = 'object' properties = OrderedDict() cls.after_items_update = [] for name in cls._order: # pylint: disable=E1133 skip_order = False item_name = None if name in cls._sections: # pylint: disable=E1135 section = cls._sections[name] serialized_section = section.serialize(None if section.__flatten__ is True else name) if section.__flatten__ is True: # Flatten the configuration section into the parent # configuration properties.update(serialized_section['properties']) if 'x-ordering' in serialized_section: ordering.extend(serialized_section['x-ordering']) if 'required' in serialized_section: required.extend(serialized_section['required']) if hasattr(section, 'after_items_update'): cls.after_items_update.extend(section.after_items_update) skip_order = True else: # Store it as a configuration section properties[name] = serialized_section if name in cls._items: # pylint: disable=E1135 config = cls._items[name] item_name = config.__item_name__ or name # Handle the configuration items defined in the class instance if config.__flatten__ is True: serialized_config = config.serialize() cls.after_items_update.append(serialized_config) skip_order = True else: properties[item_name] = config.serialize() if config.required: # If it's a required item, add it to the required list required.append(item_name) if skip_order is False: if item_name is not None: if item_name not in ordering: ordering.append(item_name) else: if name not in ordering: ordering.append(name) if properties: serialized['properties'] = properties if cls.after_items_update: after_items_update = {} for entry in cls.after_items_update: for name, data in six.iteritems(entry): if name in after_items_update: if isinstance(after_items_update[name], list): after_items_update[name].extend(data) else: after_items_update[name] = data if after_items_update: after_items_update.update(serialized) serialized = after_items_update if required: serialized['required'] = required if ordering: serialized['x-ordering'] = ordering serialized['additionalProperties'] = cls.__allow_additional_items__ return serialized @classmethod def defaults(cls): serialized = cls.serialize() defaults = {} for name, details in serialized['properties'].items(): if 'default' in details: defaults[name] = details['default'] continue if 'properties' in details: for sname, sdetails in details['properties'].items(): if 'default' in sdetails: defaults.setdefault(name, {})[sname] = sdetails['default'] continue return defaults @classmethod def as_requirements_item(cls): serialized_schema = cls.serialize() required = serialized_schema.get('required', []) for name in serialized_schema['properties']: if name not in required: required.append(name) return RequirementsItem(requirements=required) # Render the configuration block as a restructured text string # ''' Render the configuration block as a parseable YAML string including comments # ''' h_metaclass(BaseSchemaItemMeta, object)): __type__ = None __format__ = None _attributes = None __flatten__ = False __serialize_attr_aliases__ = None required = False def __init__(self, required=None, **extra): if required is not None: self.required = required self.extra = extra def __validate_attributes__(self): if self.required not in (True, False): raise RuntimeError( '\'required\' can only be True/False' ) def _get_argname_value(self, argname): argvalue = getattr(self, '__get_{0}__'.format(argname), None) if argvalue is not None and callable(argvalue): argvalue = argvalue() if argvalue is None: argvalue = getattr(self, argname, None) if argvalue is None: # Let's see if it's defined as a private class variable argvalue = getattr(self, '__{0}__'.format(argname), None) if argvalue is None: # Let's look for it in the extra dictionary argvalue = self.extra.get(argname, None) return argvalue def serialize(self): raise NotImplementedError class BaseSchemaItem(SchemaItem): # item to do something like: # class MyCustomConfig(StringItem): # ''' # This is my custom config, blah, blah, blah # ''' # description = __doc__ # description = None # The same for all other base arguments title = None default = None enum = None enumNames = None def __init__(self, title=None, description=None, default=None, enum=None, enumNames=None, **kwargs): if title is not None: self.title = title if description is not None: self.description = description if default is not None: self.default = default if enum is not None: self.enum = enum if enumNames is not None: self.enumNames = enumNames super(BaseSchemaItem, self).__init__(**kwargs) def __validate_attributes__(self): if self.enum is not None: if not isinstance(self.enum, (list, tuple, set)): raise RuntimeError( 'Only the \'list\', \'tuple\' and \'set\' python types can be used ' 'to define \'enum\'' ) if not isinstance(self.enum, list): self.enum = list(self.enum) if self.enumNames is not None: if not isinstance(self.enumNames, (list, tuple, set)): raise RuntimeError( 'Only the \'list\', \'tuple\' and \'set\' python types can be used ' 'to define \'enumNames\'' ) if len(self.enum) != len(self.enumNames): raise RuntimeError( 'The size of \'enumNames\' must match the size of \'enum\'' ) if not isinstance(self.enumNames, list): self.enumNames = list(self.enumNames) def serialize(self): serialized = {'type': self.__type__} for argname in self._attributes: if argname == 'required': # This is handled elsewhere continue argvalue = self._get_argname_value(argname) if argvalue is not None: if argvalue is Null: argvalue = None # None values are not meant to be included in the # serialization, since this is not None... if self.__serialize_attr_aliases__ and argname in self.__serialize_attr_aliases__: argname = self.__serialize_attr_aliases__[argname] serialized[argname] = argvalue return serialized def __get_description__(self): if self.description is not None: if self.description == self.__doc__: return textwrap.dedent(self.description).strip() return self.description #def render_as_rst(self, name): # ''' # Render the configuration item as a restructured text string # ''' # # TODO: Implement YAML rendering # raise NotImplementedError #def render_as_yaml(self, name): # ''' # Render the configuration item as a parseable YAML string including comments # ''' # # TODO: Include the item rules in the output, minimum, maximum, etc... # output = ' # output += self.title # output += ' ' # output += '-' * (RENDER_COMMENT_YAML_MAX_LINE_LENGTH - 7 - len(self.title) - 2) # output += '>\n' # if self.description: # output += '\n'.join(textwrap.wrap(self.description, # width=RENDER_COMMENT_YAML_MAX_LINE_LENGTH, # initial_indent=' # output += '\n' # yamled_default_value = salt.utils.yaml.safe_dump(self.default, default_flow_style=False).split('\n...', 1)[0] # output += ' # output += ' # output += ' # output += self.title # output += ' ' # output += '-' * (RENDER_COMMENT_YAML_MAX_LINE_LENGTH - 7 - len(self.title) - 1) # return output + '\n' class NullItem(BaseSchemaItem): __type__ = 'null' class BooleanItem(BaseSchemaItem): __type__ = 'boolean' class StringItem(BaseSchemaItem): __type__ = 'string' __serialize_attr_aliases__ = { 'min_length': 'minLength', 'max_length': 'maxLength' } format = None pattern = None min_length = None max_length = None def __init__(self, format=None, # pylint: disable=redefined-builtin pattern=None, min_length=None, max_length=None, **kwargs): if format is not None: # pylint: disable=redefined-builtin self.format = format if pattern is not None: self.pattern = pattern if min_length is not None: self.min_length = min_length if max_length is not None: self.max_length = max_length super(StringItem, self).__init__(**kwargs) def __validate_attributes__(self): if self.format is None and self.__format__ is not None: self.format = self.__format__ class EMailItem(StringItem): __format__ = 'email' class IPv4Item(StringItem): __format__ = 'ipv4' class IPv6Item(StringItem): __format__ = 'ipv6' class HostnameItem(StringItem): __format__ = 'hostname' class DateTimeItem(StringItem): __format__ = 'date-time' class UriItem(StringItem): __format__ = 'uri' class SecretItem(StringItem): __format__ = 'secret' class NumberItem(BaseSchemaItem): __type__ = 'number' __serialize_attr_aliases__ = { 'multiple_of': 'multipleOf', 'exclusive_minimum': 'exclusiveMinimum', 'exclusive_maximum': 'exclusiveMaximum', } multiple_of = None minimum = None exclusive_minimum = None maximum = None exclusive_maximum = None def __init__(self, multiple_of=None, minimum=None, exclusive_minimum=None, maximum=None, exclusive_maximum=None, **kwargs): if multiple_of is not None: self.multiple_of = multiple_of if minimum is not None: self.minimum = minimum if exclusive_minimum is not None: self.exclusive_minimum = exclusive_minimum if maximum is not None: self.maximum = maximum if exclusive_maximum is not None: self.exclusive_maximum = exclusive_maximum super(NumberItem, self).__init__(**kwargs) class IntegerItem(NumberItem): __type__ = 'integer' class ArrayItem(BaseSchemaItem): __type__ = 'array' __serialize_attr_aliases__ = { 'min_items': 'minItems', 'max_items': 'maxItems', 'unique_items': 'uniqueItems', 'additional_items': 'additionalItems' } items = None min_items = None max_items = None unique_items = None additional_items = None def __init__(self, items=None, min_items=None, max_items=None, unique_items=None, additional_items=None, **kwargs): if items is not None: self.items = items if min_items is not None: self.min_items = min_items if max_items is not None: self.max_items = max_items if unique_items is not None: self.unique_items = unique_items if additional_items is not None: self.additional_items = additional_items super(ArrayItem, self).__init__(**kwargs) def __validate_attributes__(self): if not self.items and not self.additional_items: raise RuntimeError( 'One of items or additional_items must be passed.' ) if self.items is not None: if isinstance(self.items, (list, tuple)): for item in self.items: if not isinstance(item, (Schema, SchemaItem)): raise RuntimeError( 'All items passed in the item argument tuple/list must be ' 'a subclass of Schema, SchemaItem or BaseSchemaItem, ' 'not {0}'.format(type(item)) ) elif not isinstance(self.items, (Schema, SchemaItem)): raise RuntimeError( 'The items argument passed must be a subclass of ' 'Schema, SchemaItem or BaseSchemaItem, not ' '{0}'.format(type(self.items)) ) def __get_items__(self): if isinstance(self.items, (Schema, SchemaItem)): # This is either a Schema or a Basetem, return it in it's return self.items.serialize() if isinstance(self.items, (tuple, list)): items = [] for item in self.items: items.append(item.serialize()) return items class DictItem(BaseSchemaItem): __type__ = 'object' __serialize_attr_aliases__ = { 'min_properties': 'minProperties', 'max_properties': 'maxProperties', 'pattern_properties': 'patternProperties', 'additional_properties': 'additionalProperties' } properties = None pattern_properties = None additional_properties = None min_properties = None max_properties = None def __init__(self, properties=None, pattern_properties=None, additional_properties=None, min_properties=None, max_properties=None, **kwargs): if properties is not None: self.properties = properties if pattern_properties is not None: self.pattern_properties = pattern_properties if additional_properties is not None: self.additional_properties = additional_properties if min_properties is not None: self.min_properties = min_properties if max_properties is not None: self.max_properties = max_properties super(DictItem, self).__init__(**kwargs) def __validate_attributes__(self): if not self.properties and not self.pattern_properties and not self.additional_properties: raise RuntimeError( 'One of properties, pattern_properties or additional_properties must be passed' ) if self.properties is not None: if not isinstance(self.properties, (Schema, dict)): raise RuntimeError( 'The passed properties must be passed as a dict or ' ' a Schema not \'{0}\''.format(type(self.properties)) ) if not isinstance(self.properties, Schema): for key, prop in self.properties.items(): if not isinstance(prop, (Schema, SchemaItem)): raise RuntimeError( 'The passed property who\'s key is \'{0}\' must be of type ' 'Schema, SchemaItem or BaseSchemaItem, not ' '\'{1}\''.format(key, type(prop)) ) if self.pattern_properties is not None: if not isinstance(self.pattern_properties, dict): raise RuntimeError( 'The passed pattern_properties must be passed as a dict ' 'not \'{0}\''.format(type(self.pattern_properties)) ) for key, prop in self.pattern_properties.items(): if not isinstance(prop, (Schema, SchemaItem)): raise RuntimeError( 'The passed pattern_property who\'s key is \'{0}\' must ' 'be of type Schema, SchemaItem or BaseSchemaItem, ' 'not \'{1}\''.format(key, type(prop)) ) if self.additional_properties is not None: if not isinstance(self.additional_properties, (bool, Schema, SchemaItem)): raise RuntimeError( 'The passed additional_properties must be of type bool, ' 'Schema, SchemaItem or BaseSchemaItem, not \'{0}\''.format( type(self.pattern_properties) ) ) def __get_properties__(self): if self.properties is None: return if isinstance(self.properties, Schema): return self.properties.serialize()['properties'] properties = OrderedDict() for key, prop in self.properties.items(): properties[key] = prop.serialize() return properties def __get_pattern_properties__(self): if self.pattern_properties is None: return pattern_properties = OrderedDict() for key, prop in self.pattern_properties.items(): pattern_properties[key] = prop.serialize() return pattern_properties def __get_additional_properties__(self): if self.additional_properties is None: return if isinstance(self.additional_properties, bool): return self.additional_properties return self.additional_properties.serialize() def __call__(self, flatten=False): self.__flatten__ = flatten return self def serialize(self): result = super(DictItem, self).serialize() required = [] if self.properties is not None: if isinstance(self.properties, Schema): serialized = self.properties.serialize() if 'required' in serialized: required.extend(serialized['required']) else: for key, prop in self.properties.items(): if prop.required: required.append(key) if required: result['required'] = required return result class RequirementsItem(SchemaItem): __type__ = 'object' requirements = None def __init__(self, requirements=None): if requirements is not None: self.requirements = requirements super(RequirementsItem, self).__init__() def __validate_attributes__(self): if self.requirements is None: raise RuntimeError( 'The passed requirements must not be empty' ) if not isinstance(self.requirements, (SchemaItem, list, tuple, set)): raise RuntimeError( 'The passed requirements must be passed as a list, tuple, ' 'set SchemaItem or BaseSchemaItem, not \'{0}\''.format(self.requirements) ) if not isinstance(self.requirements, SchemaItem): if not isinstance(self.requirements, list): self.requirements = list(self.requirements) for idx, item in enumerate(self.requirements): if not isinstance(item, (six.string_types, SchemaItem)): raise RuntimeError( 'The passed requirement at the {0} index must be of type ' 'str or SchemaItem, not \'{1}\''.format(idx, type(item)) ) def serialize(self): if isinstance(self.requirements, SchemaItem): requirements = self.requirements.serialize() else: requirements = [] for requirement in self.requirements: if isinstance(requirement, SchemaItem): requirements.append(requirement.serialize()) continue requirements.append(requirement) return {'required': requirements} class OneOfItem(SchemaItem): __type__ = 'oneOf' items = None def __init__(self, items=None, required=None): if items is not None: self.items = items super(OneOfItem, self).__init__(required=required) def __validate_attributes__(self): if not self.items: raise RuntimeError( 'The passed items must not be empty' ) if not isinstance(self.items, (list, tuple)): raise RuntimeError( 'The passed items must be passed as a list/tuple not ' '\'{0}\''.format(type(self.items)) ) for idx, item in enumerate(self.items): if not isinstance(item, (Schema, SchemaItem)): raise RuntimeError( 'The passed item at the {0} index must be of type ' 'Schema, SchemaItem or BaseSchemaItem, not ' '\'{1}\''.format(idx, type(item)) ) if not isinstance(self.items, list): self.items = list(self.items) def __call__(self, flatten=False): self.__flatten__ = flatten return self def serialize(self): return {self.__type__: [i.serialize() for i in self.items]} class AnyOfItem(OneOfItem): __type__ = 'anyOf' class AllOfItem(OneOfItem): __type__ = 'allOf' class NotItem(SchemaItem): __type__ = 'not' item = None def __init__(self, item=None): if item is not None: self.item = item super(NotItem, self).__init__() def __validate_attributes__(self): if not self.item: raise RuntimeError( 'An item must be passed' ) if not isinstance(self.item, (Schema, SchemaItem)): raise RuntimeError( 'The passed item be of type Schema, SchemaItem or ' 'BaseSchemaItem, not \'{1}\''.format(type(self.item)) ) def serialize(self): return {self.__type__: self.item.serialize()} class PortItem(IntegerItem): minimum = 0 maximum = 65535 class ComplexSchemaItem(BaseSchemaItem): _attributes = [] _definition_name = None def __init__(self, definition_name=None, required=None): super(ComplexSchemaItem, self).__init__(required=required) self.__type__ = 'object' self._definition_name = definition_name if definition_name else \ self.__class__.__name__ # Schema attributes might have been added as class attributes so we # and they must be added to the _attributes attr self._add_missing_schema_attributes() def _add_missing_schema_attributes(self): for attr in [attr for attr in dir(self) if not attr.startswith('__')]: attr_val = getattr(self, attr) if isinstance(getattr(self, attr), SchemaItem) and \ attr not in self._attributes: self._attributes.append(attr) @property def definition_name(self): return self._definition_name def serialize(self): return {'$ref': ' def get_definition(self): serialized = super(ComplexSchemaItem, self).serialize() # Adjust entries in the serialization del serialized['definition_name'] serialized['title'] = self.definition_name properties = {} required_attr_names = [] for attr_name in self._attributes: attr = getattr(self, attr_name) if attr and isinstance(attr, BaseSchemaItem): # Remove the attribute entry added by the base serialization del serialized[attr_name] properties[attr_name] = attr.serialize() properties[attr_name]['type'] = attr.__type__ if attr.required: required_attr_names.append(attr_name) if serialized.get('properties') is None: serialized['properties'] = {} serialized['properties'].update(properties) # Assign the required array if required_attr_names: serialized['required'] = required_attr_names return serialized def get_complex_attrs(self): return [getattr(self, attr_name) for attr_name in self._attributes if isinstance(getattr(self, attr_name), ComplexSchemaItem)] class DefinitionsSchema(Schema): @classmethod def serialize(cls, id_=None): # Get the initial serialization serialized = super(DefinitionsSchema, cls).serialize(id_) complex_items = [] # Augment the serializations with the definitions of all complex items aux_items = cls._items.values() # Convert dict_view object to a list on Python 3 if six.PY3: aux_items = list(aux_items) while aux_items: item = aux_items.pop(0) # Add complex attributes if isinstance(item, ComplexSchemaItem): complex_items.append(item) aux_items.extend(item.get_complex_attrs()) # Handle container items if isinstance(item, OneOfItem): aux_items.extend(item.items) elif isinstance(item, ArrayItem): aux_items.append(item.items) elif isinstance(item, DictItem): if item.properties: aux_items.extend(item.properties.values()) if item.additional_properties and \ isinstance(item.additional_properties, SchemaItem): aux_items.append(item.additional_properties) definitions = OrderedDict() for config in complex_items: if isinstance(config, ComplexSchemaItem): definitions[config.definition_name] = \ config.get_definition() serialized['definitions'] = definitions return serialized
true
true
f720868bb7566cf137aaa7665b5dbd671fef24fb
2,738
py
Python
skfem/element/element_tet/element_tet_p2.py
carlosal1015/scikit-fem
1e73a417e9b43fe0a36e29807792c41fa289b77d
[ "BSD-3-Clause" ]
null
null
null
skfem/element/element_tet/element_tet_p2.py
carlosal1015/scikit-fem
1e73a417e9b43fe0a36e29807792c41fa289b77d
[ "BSD-3-Clause" ]
null
null
null
skfem/element/element_tet/element_tet_p2.py
carlosal1015/scikit-fem
1e73a417e9b43fe0a36e29807792c41fa289b77d
[ "BSD-3-Clause" ]
null
null
null
import numpy as np from ..element_h1 import ElementH1 class ElementTetP2(ElementH1): nodal_dofs = 1 edge_dofs = 1 dim = 3 maxdeg = 2 dofnames = ['u', 'u'] doflocs = np.array([[0., 0., 0.], [1., 0., 0.], [0., 1., 0.], [0., 0., 1.], [.5, 0., 0.], [.5, .5, 0.], [0., .5, 0.], [0., .0, .5], [.5, .0, .5], [.0, .5, .5]]) def lbasis(self, X, i): x, y, z = X if i == 0: # at (0,0,0) phi = (1. - 3.*x + 2.*x**2 - 3.*y + 4.*x*y + 2.*y**2 - 3.*z + 4.*x*z + 4.*y*z + 2.*z**2) dphi = np.array([ -3. + 4.*x + 4.*y + 4.*z, -3. + 4.*x + 4.*y + 4.*z, -3. + 4.*x + 4.*y + 4.*z, ]) elif i == 1: # at (1,0,0) phi = - 1.*x + 2.*x**2 dphi = np.array([ -1 + 4*x, 0*x, 0*x, ]) elif i == 2: # at (0,1,0) phi = - 1.*y + 2.*y**2 dphi = np.array([ 0*x, -1. + 4.*y, 0*x, ]) elif i == 3: # at (0,0,1) phi = - 1.*z + 2.*z**2 dphi = np.array([ 0*x, 0*x, -1. + 4.*z, ]) elif i == 4: # between (0,1) phi = 4.*x - 4.*x**2 - 4.*x*y - 4*x*z dphi = np.array([ 4. - 8.*x - 4.*y - 4.*z, -4.*x, -4.*x, ]) elif i == 5: # between (1,2) phi = 4.*x*y dphi = np.array([ 4.*y, 4.*x, 0*x, ]) elif i == 6: # between (0,2) phi = 0. + 4.*y - 4.*x*y - 4.*y**2 - 4.*y*z dphi = np.array([ -4.*y, 4. - 4.*x - 8.*y - 4.*z, -4.*y, ]) elif i == 7: # between (0,3) phi = 0. + 4.*z - 4.*x*z - 4.*y*z - 4.*z**2 dphi = np.array([ -4.*z, -4.*z, 4. - 4.*x - 4.*y - 8.*z, ]) elif i == 8: phi = 0. + 4.*x*z dphi = np.array([ 4.*z, 0*x, 4*x, ]) elif i == 9: phi = 0. + 4.*y*z dphi = np.array([ 0*x, 4*z, 4*y, ]) else: raise Exception("!") return phi, dphi
27.38
62
0.233382
import numpy as np from ..element_h1 import ElementH1 class ElementTetP2(ElementH1): nodal_dofs = 1 edge_dofs = 1 dim = 3 maxdeg = 2 dofnames = ['u', 'u'] doflocs = np.array([[0., 0., 0.], [1., 0., 0.], [0., 1., 0.], [0., 0., 1.], [.5, 0., 0.], [.5, .5, 0.], [0., .5, 0.], [0., .0, .5], [.5, .0, .5], [.0, .5, .5]]) def lbasis(self, X, i): x, y, z = X if i == 0: phi = (1. - 3.*x + 2.*x**2 - 3.*y + 4.*x*y + 2.*y**2 - 3.*z + 4.*x*z + 4.*y*z + 2.*z**2) dphi = np.array([ -3. + 4.*x + 4.*y + 4.*z, -3. + 4.*x + 4.*y + 4.*z, -3. + 4.*x + 4.*y + 4.*z, ]) elif i == 1: phi = - 1.*x + 2.*x**2 dphi = np.array([ -1 + 4*x, 0*x, 0*x, ]) elif i == 2: phi = - 1.*y + 2.*y**2 dphi = np.array([ 0*x, -1. + 4.*y, 0*x, ]) elif i == 3: phi = - 1.*z + 2.*z**2 dphi = np.array([ 0*x, 0*x, -1. + 4.*z, ]) elif i == 4: phi = 4.*x - 4.*x**2 - 4.*x*y - 4*x*z dphi = np.array([ 4. - 8.*x - 4.*y - 4.*z, -4.*x, -4.*x, ]) elif i == 5: phi = 4.*x*y dphi = np.array([ 4.*y, 4.*x, 0*x, ]) elif i == 6: phi = 0. + 4.*y - 4.*x*y - 4.*y**2 - 4.*y*z dphi = np.array([ -4.*y, 4. - 4.*x - 8.*y - 4.*z, -4.*y, ]) elif i == 7: phi = 0. + 4.*z - 4.*x*z - 4.*y*z - 4.*z**2 dphi = np.array([ -4.*z, -4.*z, 4. - 4.*x - 4.*y - 8.*z, ]) elif i == 8: phi = 0. + 4.*x*z dphi = np.array([ 4.*z, 0*x, 4*x, ]) elif i == 9: phi = 0. + 4.*y*z dphi = np.array([ 0*x, 4*z, 4*y, ]) else: raise Exception("!") return phi, dphi
true
true
f720884f949f265d08ef7c4e59ff5312172239dc
5,043
py
Python
back/Hera/utils.py
pingPoltergeist/Hera
519336cebbcf14ff3da6299e946407788121a0b7
[ "MIT" ]
1
2021-12-09T11:37:20.000Z
2021-12-09T11:37:20.000Z
back/Hera/utils.py
pingPoltergeist/Hera
519336cebbcf14ff3da6299e946407788121a0b7
[ "MIT" ]
1
2021-11-05T09:14:50.000Z
2021-11-05T09:14:50.000Z
back/Hera/utils.py
pingPoltergeist/Hera
519336cebbcf14ff3da6299e946407788121a0b7
[ "MIT" ]
2
2022-01-13T15:12:36.000Z
2022-03-10T01:35:25.000Z
import traceback from pathlib import Path import hashlib import yaml def get_media_dirs(media_dir_stream): result = dict() movie_dir_map = dict() for media_location in media_dir_stream[0].replace('\n', '').replace('\r', '').split(','): movie_dir_map[hashlib.md5(media_location.encode('utf-8')).hexdigest()] = Path(media_location) tv_dir_map = dict() for tv_location in media_dir_stream[1].replace('\n', '').replace('\r', '').split(','): tv_dir_map[hashlib.md5(tv_location.encode('utf-8')).hexdigest()] = Path(tv_location) result['movie_dir_map'] = movie_dir_map result['tv_dir_map'] = tv_dir_map return result class Config: __filepath = None __config = dict() __movie_dirs_map = dict() __tv_dirs_map = dict() def __init__(self, config_filepath=None): blank_config = { 'movie_dir': list(), 'tv_dir': list() } self.__filepath = config_filepath try: with open(self.__filepath) as f: self.__config = yaml.load(f, Loader=yaml.FullLoader) if ( (not self.__config) or (type(self.__config) != dict) or (type(self.__config.get('movie_dir')) != list) or (type(self.__config.get('tv_dir')) != list) ): self.__config = blank_config try: with open(self.__filepath, 'w') as f: data = yaml.dump(self.__config, f) except Exception as ex: print('Config :: update -> ', ex) traceback.print_exc() except Exception as ex: self.__config = blank_config try: with open(self.__filepath, 'w') as f: data = yaml.dump(self.__config, f) except Exception as ex: print('Config :: update -> ', ex) traceback.print_exc() print('Config::init: -> Creating a fresh config.yaml file') finally: if type(self.__config.get('movie_dir')) == list: for media_location in self.__config.get('movie_dir'): self.__movie_dirs_map[hashlib.md5(media_location.encode('utf-8')).hexdigest()] = Path( media_location) if type(self.__config.get('tv_dir')) == list: for tv_location in self.__config.get('tv_dir'): self.__tv_dirs_map[hashlib.md5(tv_location.encode('utf-8')).hexdigest()] = Path(tv_location) def get(self): return self.__config def get_movie_dirs_map(self): return self.__movie_dirs_map def get_tv_dirs_map(self): return self.__tv_dirs_map def add_to_tv_dirs(self, new_tv_dir): if Path(new_tv_dir).exists() and (new_tv_dir not in self.__config['tv_dir']): self.__config['tv_dir'].append(new_tv_dir) self.__tv_dirs_map[hashlib.md5(new_tv_dir.encode('utf-8')).hexdigest()] = Path(new_tv_dir) def add_to_movie_dirs(self, new_movie_dir): if Path(new_movie_dir).exists() and (new_movie_dir not in self.__config['movie_dir']): self.__config['movie_dir'].append(new_movie_dir) self.__movie_dirs_map[hashlib.md5(new_movie_dir.encode('utf-8')).hexdigest()] = Path(new_movie_dir) def remove_from_movie_dirs(self, movie_dir): if self.__config['movie_dir'] and movie_dir in self.__config['movie_dir']: self.__config['movie_dir'].remove(movie_dir) del self.__movie_dirs_map[hashlib.md5(movie_dir.encode('utf-8')).hexdigest()] def remove_from_tv_dirs(self, tv_dir): if self.__config['tv_dir'] and tv_dir in self.__config['tv_dir']: self.__config['tv_dir'].remove(tv_dir) del self.__tv_dirs_map[hashlib.md5(tv_dir.encode('utf-8')).hexdigest()] def refresh(self): try: with open(self.__filepath) as f: self.__config = yaml.load(f, Loader=yaml.FullLoader) if type(self.__config.get('movie_dir')) == list: for media_location in self.__config.get('movie_dir'): self.__movie_dirs_map[hashlib.md5(media_location.encode('utf-8')).hexdigest()] = Path( media_location) if type(self.__config.get('tv_dir')) == list: for tv_location in self.__config.get('tv_dir'): self.__tv_dirs_map[hashlib.md5(tv_location.encode('utf-8')).hexdigest()] = Path(tv_location) except Exception as ex: print('Config :: init -> ', ex) traceback.print_exc() def update(self, updated_config=None): if updated_config: self.__config = updated_config try: with open(self.__filepath, 'w') as f: data = yaml.dump(self.__config, f) except Exception as ex: print('Config :: update -> ', ex) traceback.print_exc()
39.398438
112
0.584969
import traceback from pathlib import Path import hashlib import yaml def get_media_dirs(media_dir_stream): result = dict() movie_dir_map = dict() for media_location in media_dir_stream[0].replace('\n', '').replace('\r', '').split(','): movie_dir_map[hashlib.md5(media_location.encode('utf-8')).hexdigest()] = Path(media_location) tv_dir_map = dict() for tv_location in media_dir_stream[1].replace('\n', '').replace('\r', '').split(','): tv_dir_map[hashlib.md5(tv_location.encode('utf-8')).hexdigest()] = Path(tv_location) result['movie_dir_map'] = movie_dir_map result['tv_dir_map'] = tv_dir_map return result class Config: __filepath = None __config = dict() __movie_dirs_map = dict() __tv_dirs_map = dict() def __init__(self, config_filepath=None): blank_config = { 'movie_dir': list(), 'tv_dir': list() } self.__filepath = config_filepath try: with open(self.__filepath) as f: self.__config = yaml.load(f, Loader=yaml.FullLoader) if ( (not self.__config) or (type(self.__config) != dict) or (type(self.__config.get('movie_dir')) != list) or (type(self.__config.get('tv_dir')) != list) ): self.__config = blank_config try: with open(self.__filepath, 'w') as f: data = yaml.dump(self.__config, f) except Exception as ex: print('Config :: update -> ', ex) traceback.print_exc() except Exception as ex: self.__config = blank_config try: with open(self.__filepath, 'w') as f: data = yaml.dump(self.__config, f) except Exception as ex: print('Config :: update -> ', ex) traceback.print_exc() print('Config::init: -> Creating a fresh config.yaml file') finally: if type(self.__config.get('movie_dir')) == list: for media_location in self.__config.get('movie_dir'): self.__movie_dirs_map[hashlib.md5(media_location.encode('utf-8')).hexdigest()] = Path( media_location) if type(self.__config.get('tv_dir')) == list: for tv_location in self.__config.get('tv_dir'): self.__tv_dirs_map[hashlib.md5(tv_location.encode('utf-8')).hexdigest()] = Path(tv_location) def get(self): return self.__config def get_movie_dirs_map(self): return self.__movie_dirs_map def get_tv_dirs_map(self): return self.__tv_dirs_map def add_to_tv_dirs(self, new_tv_dir): if Path(new_tv_dir).exists() and (new_tv_dir not in self.__config['tv_dir']): self.__config['tv_dir'].append(new_tv_dir) self.__tv_dirs_map[hashlib.md5(new_tv_dir.encode('utf-8')).hexdigest()] = Path(new_tv_dir) def add_to_movie_dirs(self, new_movie_dir): if Path(new_movie_dir).exists() and (new_movie_dir not in self.__config['movie_dir']): self.__config['movie_dir'].append(new_movie_dir) self.__movie_dirs_map[hashlib.md5(new_movie_dir.encode('utf-8')).hexdigest()] = Path(new_movie_dir) def remove_from_movie_dirs(self, movie_dir): if self.__config['movie_dir'] and movie_dir in self.__config['movie_dir']: self.__config['movie_dir'].remove(movie_dir) del self.__movie_dirs_map[hashlib.md5(movie_dir.encode('utf-8')).hexdigest()] def remove_from_tv_dirs(self, tv_dir): if self.__config['tv_dir'] and tv_dir in self.__config['tv_dir']: self.__config['tv_dir'].remove(tv_dir) del self.__tv_dirs_map[hashlib.md5(tv_dir.encode('utf-8')).hexdigest()] def refresh(self): try: with open(self.__filepath) as f: self.__config = yaml.load(f, Loader=yaml.FullLoader) if type(self.__config.get('movie_dir')) == list: for media_location in self.__config.get('movie_dir'): self.__movie_dirs_map[hashlib.md5(media_location.encode('utf-8')).hexdigest()] = Path( media_location) if type(self.__config.get('tv_dir')) == list: for tv_location in self.__config.get('tv_dir'): self.__tv_dirs_map[hashlib.md5(tv_location.encode('utf-8')).hexdigest()] = Path(tv_location) except Exception as ex: print('Config :: init -> ', ex) traceback.print_exc() def update(self, updated_config=None): if updated_config: self.__config = updated_config try: with open(self.__filepath, 'w') as f: data = yaml.dump(self.__config, f) except Exception as ex: print('Config :: update -> ', ex) traceback.print_exc()
true
true
f7208878a3eceaf4d90f7cc71177db7ce94487d3
6,366
py
Python
son.py
nathanmartins/Son-Of-Anton
d45eec2b9263dbd981f468219c9d0fb049bd481d
[ "MIT" ]
null
null
null
son.py
nathanmartins/Son-Of-Anton
d45eec2b9263dbd981f468219c9d0fb049bd481d
[ "MIT" ]
null
null
null
son.py
nathanmartins/Son-Of-Anton
d45eec2b9263dbd981f468219c9d0fb049bd481d
[ "MIT" ]
null
null
null
import logging import math import os import pickle import re import PIL.Image import numpy as np from mtcnn import MTCNN from numpy import expand_dims from sklearn import preprocessing, neighbors from tensorflow_core.python.keras.models import load_model BASE_DIR = os.path.dirname(os.path.abspath(__file__)) DATASET_DIR = os.path.join(BASE_DIR, "dataset") TRAIN_DIR = os.path.join(DATASET_DIR, "train") TEST_DIR = os.path.join(DATASET_DIR, "test") DEBUG = True # DEBUG = False model = load_model('facenet_keras.h5') logging.basicConfig(level=logging.DEBUG if DEBUG else logging.INFO) def extract_faces(img_path: str): faces_arr = list() # Open file and convert to numpy image_array = np.array(PIL.Image.open(img_path).convert("RGB"), "uint8") detector = MTCNN() faces = detector.detect_faces(image_array) if len(faces) == 0: # If there are no people in a training image, skip the image. logging.warning(f"Image {img_path} not suitable for training. Size{len(faces)}") return None, None for face in faces: # logging.debug(f"Image {img_path} is suitable for training!") x1, y1, width, height = face['box'] # bug fix x1, y1 = abs(x1), abs(y1) x2, y2 = x1 + width, y1 + height # extract the face face = image_array[y1:y2, x1:x2] # resize pixels to the model size image = PIL.Image.fromarray(face) image = image.resize((160, 160)) faces_arr.append(np.asarray(image)) return faces_arr, faces def get_embedding(face_pixels): # scale pixel values face_pixels = face_pixels.astype('float32') # standardize pixel values across channels (global) mean, std = face_pixels.mean(), face_pixels.std() face_pixels = (face_pixels - mean) / std # transform face into one sample samples = expand_dims(face_pixels, axis=0) # make prediction to get embedding return model.predict(samples) def prepare(): x_train = list() y_labels = list() # Loop through each person in the training set for label in os.listdir(TRAIN_DIR): path = os.path.join(TRAIN_DIR, label) # This will ignore anything that is not jpg|jpeg|png *USE WITH CAUTION* allowed_files = [os.path.join(path, f) for f in os.listdir(path) if re.match(r'.*\.(jpg|jpeg|png)', f, flags=re.I)] for img_path in allowed_files: logging.debug(f"File: {img_path}, Label: {label}") faces, _ = extract_faces(img_path) if faces is not None: for face in faces: x_train.append(np.asarray(face)) y_labels.append(label) # Converting string labels into numbers. le = preprocessing.LabelEncoder() labels_encoded = le.fit_transform(y_labels) with open("x_train.pickle", 'wb') as f: pickle.dump(x_train, f) with open("y_labels.pickle", 'wb') as f: pickle.dump(y_labels, f) with open("labels_encoded.pickle", 'wb') as f: pickle.dump(labels_encoded, f) def train(): with open("x_train.pickle", 'rb') as f: x_train = pickle.load(f) # x_train = np.array(x_train) # x_train = np.reshape(x_train, (-1, 2)) with open("labels_encoded.pickle", 'rb') as f: y_labels = pickle.load(f) # convert each face in the train set to an embedding encoded_x_train = list() for face_pixels in x_train: embedding = get_embedding(face_pixels)[0] encoded_x_train.append(embedding) encoded_x_train = np.asarray(encoded_x_train) # Determine how many neighbors to use for weighting in the KNN classifier. n_neighbors = int(round(math.sqrt(len(x_train)))) logging.info(f"n_neighbors: {n_neighbors}") # Create and train the KNN classifier. knn_clf = neighbors.KNeighborsClassifier(n_neighbors=n_neighbors, algorithm="ball_tree", weights='distance') knn_clf.fit(encoded_x_train, y_labels) # perdicted = list() # metrics.accuracy(y_labels, perdicted) # Save the trained KNN classifier with open("model.clf", 'wb') as f: pickle.dump(knn_clf, f) def predict(): with open("model.clf", 'rb') as f: knn_clf = pickle.load(f) with open("labels_encoded.pickle", 'rb') as f: y_labels = pickle.load(f) le = preprocessing.LabelEncoder() le.fit_transform(y_labels) # breakpoint() for img in os.listdir(TEST_DIR): # logging.info(f"Testing image: {img}") full_path = os.path.join(TEST_DIR, img) faces, raws = extract_faces(full_path) if faces is None: logging.info(f"WARNING: COULD NOT FIND A FACE IN {full_path}") continue c = 0 for face in faces: faces_encodings = get_embedding(face) # A list of tuples of found face locations in css (top, right, bottom, left) order x_face_locations = tuple(raws[c]["box"]) c += 1 # Use the KNN model to find the best matches for the test face closest_distances = knn_clf.kneighbors(faces_encodings, n_neighbors=1) are_matches = list() for i in range(len(x_face_locations)): try: dis = closest_distances[0][i][0] # logging.debug(f"Closest distance is {dis} - {dis < 7}") if dis < 7: # logging.debug(f"Adding a Dis {dis}") are_matches.append(dis) except IndexError: pass # logging.debug(f"Dis is {are_matches}") pred = knn_clf.predict(faces_encodings) if len(are_matches) > 0: for pred, loc, rec in zip(pred, x_face_locations, are_matches): if rec: if pred == 1: a = "unknown" else: a = "nsm" logging.info(f"Found: {a} - {img}") else: logging.warning(f"WARNING: COULD NOT IDENTIFY A FACE IN {full_path}") else: a = "unknown" logging.info(f"Found: {a} - {img}") if __name__ == '__main__': # prepare() # train() predict()
30.028302
112
0.600377
import logging import math import os import pickle import re import PIL.Image import numpy as np from mtcnn import MTCNN from numpy import expand_dims from sklearn import preprocessing, neighbors from tensorflow_core.python.keras.models import load_model BASE_DIR = os.path.dirname(os.path.abspath(__file__)) DATASET_DIR = os.path.join(BASE_DIR, "dataset") TRAIN_DIR = os.path.join(DATASET_DIR, "train") TEST_DIR = os.path.join(DATASET_DIR, "test") DEBUG = True model = load_model('facenet_keras.h5') logging.basicConfig(level=logging.DEBUG if DEBUG else logging.INFO) def extract_faces(img_path: str): faces_arr = list() image_array = np.array(PIL.Image.open(img_path).convert("RGB"), "uint8") detector = MTCNN() faces = detector.detect_faces(image_array) if len(faces) == 0: logging.warning(f"Image {img_path} not suitable for training. Size{len(faces)}") return None, None for face in faces: x1, y1, width, height = face['box'] x1, y1 = abs(x1), abs(y1) x2, y2 = x1 + width, y1 + height face = image_array[y1:y2, x1:x2] image = PIL.Image.fromarray(face) image = image.resize((160, 160)) faces_arr.append(np.asarray(image)) return faces_arr, faces def get_embedding(face_pixels): face_pixels = face_pixels.astype('float32') mean, std = face_pixels.mean(), face_pixels.std() face_pixels = (face_pixels - mean) / std samples = expand_dims(face_pixels, axis=0) return model.predict(samples) def prepare(): x_train = list() y_labels = list() for label in os.listdir(TRAIN_DIR): path = os.path.join(TRAIN_DIR, label) allowed_files = [os.path.join(path, f) for f in os.listdir(path) if re.match(r'.*\.(jpg|jpeg|png)', f, flags=re.I)] for img_path in allowed_files: logging.debug(f"File: {img_path}, Label: {label}") faces, _ = extract_faces(img_path) if faces is not None: for face in faces: x_train.append(np.asarray(face)) y_labels.append(label) le = preprocessing.LabelEncoder() labels_encoded = le.fit_transform(y_labels) with open("x_train.pickle", 'wb') as f: pickle.dump(x_train, f) with open("y_labels.pickle", 'wb') as f: pickle.dump(y_labels, f) with open("labels_encoded.pickle", 'wb') as f: pickle.dump(labels_encoded, f) def train(): with open("x_train.pickle", 'rb') as f: x_train = pickle.load(f) with open("labels_encoded.pickle", 'rb') as f: y_labels = pickle.load(f) encoded_x_train = list() for face_pixels in x_train: embedding = get_embedding(face_pixels)[0] encoded_x_train.append(embedding) encoded_x_train = np.asarray(encoded_x_train) n_neighbors = int(round(math.sqrt(len(x_train)))) logging.info(f"n_neighbors: {n_neighbors}") knn_clf = neighbors.KNeighborsClassifier(n_neighbors=n_neighbors, algorithm="ball_tree", weights='distance') knn_clf.fit(encoded_x_train, y_labels) with open("model.clf", 'wb') as f: pickle.dump(knn_clf, f) def predict(): with open("model.clf", 'rb') as f: knn_clf = pickle.load(f) with open("labels_encoded.pickle", 'rb') as f: y_labels = pickle.load(f) le = preprocessing.LabelEncoder() le.fit_transform(y_labels) for img in os.listdir(TEST_DIR): full_path = os.path.join(TEST_DIR, img) faces, raws = extract_faces(full_path) if faces is None: logging.info(f"WARNING: COULD NOT FIND A FACE IN {full_path}") continue c = 0 for face in faces: faces_encodings = get_embedding(face) x_face_locations = tuple(raws[c]["box"]) c += 1 closest_distances = knn_clf.kneighbors(faces_encodings, n_neighbors=1) are_matches = list() for i in range(len(x_face_locations)): try: dis = closest_distances[0][i][0] if dis < 7: are_matches.append(dis) except IndexError: pass pred = knn_clf.predict(faces_encodings) if len(are_matches) > 0: for pred, loc, rec in zip(pred, x_face_locations, are_matches): if rec: if pred == 1: a = "unknown" else: a = "nsm" logging.info(f"Found: {a} - {img}") else: logging.warning(f"WARNING: COULD NOT IDENTIFY A FACE IN {full_path}") else: a = "unknown" logging.info(f"Found: {a} - {img}") if __name__ == '__main__': predict()
true
true
f72088a05bdf713d0b6f36ecd12b25eb950976d1
12,785
py
Python
raiden/exceptions.py
luehrsFred/raiden
a1b118ebe14badb1acd0744b2d7f2b39f8ba5313
[ "MIT" ]
null
null
null
raiden/exceptions.py
luehrsFred/raiden
a1b118ebe14badb1acd0744b2d7f2b39f8ba5313
[ "MIT" ]
69
2020-07-21T05:49:21.000Z
2022-03-08T18:09:44.000Z
raiden/exceptions.py
luehrsFred/raiden
a1b118ebe14badb1acd0744b2d7f2b39f8ba5313
[ "MIT" ]
null
null
null
""" What do you want from this file? 1. I need to look up when to raise what. Then read on the docstrings. 2. I have to add a new exception. Make sure you catch it somewhere. Sometimes you'll realize you cannot catch it. Especially, if your new exception indicates bug in the Raiden codebase, you are not supposed to catch the exception. Instead, use one of the existing uncaught exceptions: RaidenUnrecoverableError or BrokenPreconditionError. """ import enum from typing import Any, Dict, List @enum.unique class PFSError(enum.IntEnum): """ Error codes as returned by the PFS. Defined in the pathfinding_service.exceptions module in https://github.com/raiden-network/raiden-services """ # TODO: link to PFS spec as soon as the error codes are added there. # 20xx - General INVALID_REQUEST = 2000 INVALID_SIGNATURE = 2001 REQUEST_OUTDATED = 2002 # 21xx - IOU errors BAD_IOU = 2100 MISSING_IOU = 2101 WRONG_IOU_RECIPIENT = 2102 IOU_EXPIRED_TOO_EARLY = 2103 INSUFFICIENT_SERVICE_PAYMENT = 2104 IOU_ALREADY_CLAIMED = 2105 USE_THIS_IOU = 2106 DEPOSIT_TOO_LOW = 2107 # 22xx - Routing NO_ROUTE_FOUND = 2201 @staticmethod def is_iou_rejected(error_code: int) -> bool: return error_code >= 2100 and error_code < 2200 class RaidenError(Exception): """Raiden base exception. This exception exists for user code to catch all Raiden related exceptions. This should be used with care, because `RaidenUnrecoverableError` is a `RaidenError`, and when one of such exceptions is raised the state of the client node is undetermined. """ class RaidenRecoverableError(RaidenError): """Exception for recoverable errors. This base exception exists for code written in a EAFP style. It should be inherited when exceptions are expected to happen and handling them will not leave the node is a undefined state. Usage examples: - Operations that failed because of race conditions, e.g. openning a channel fails because both participants try at the same time. - Transient connectivety problems. - Timeouts. Note: Some errors are undesirable, but they are still possible and should be expected. Example a secret registration that finishes after the timeout window. """ class RaidenUnrecoverableError(RaidenError): """Base exception for unexpected errors that should crash the client. This exception is used when something unrecoverable happened: - Corrupted database. - Running out of disk space. """ class RaidenValidationError(RaidenRecoverableError): """Exception raised when an input value is invalid. This exception must be raised on the edges of the system, to inform the caller one of the provided values is invalid. Actually, this exception can also be used in the proxies for insane values that are not valid regardless of the chain state. If a value is not acceptable because of the chain state, BrokenPreconditionError must be used instead. Also, if a value indicates a bug in our codebase, RaidenValidationError is not the right error because RaidenValidationError is considered as a recoverable error. We prefer this exception over ValueError because libraries (e.g. web3.py) raise ValueError sometimes, and we want to differentiate our own exceptions from those. """ class PaymentConflict(RaidenRecoverableError): """ Raised when there is another payment with the same identifier but the attributes of the payment don't match. """ class InsufficientFunds(RaidenError): """ Raised when provided account doesn't have token funds to complete the requested deposit. Used when a *user* tries to deposit a given amount of token in a channel, but his account doesn't have enough funds to pay for the deposit. """ class DepositOverLimit(RaidenError): """ Raised when the requested deposit is over the limit Used when a *user* tries to deposit a given amount of token in a channel, but the amount is over the testing limit. """ class DepositMismatch(RaidenRecoverableError): """ Raised when the requested deposit is lower than actual channel deposit Used when a *user* tries to deposit a given amount of tokens in a channel, but the on-chain amount is already higher. """ class InvalidChannelID(RaidenError): """ Raised when the user provided value is not a channel id. """ class WithdrawMismatch(RaidenRecoverableError): """ Raised when the requested withdraw is larger than actual channel balance. """ class InvalidChecksummedAddress(RaidenError): """Raised when the user provided address is not a str or the value is not properly checksummed. Exception used to enforce the checksummed for external APIs. The address provided by a user must be checksummed to avoid errors, the checksummed address must be validated at the edges before calling internal functions. """ class InvalidBinaryAddress(RaidenValidationError): """Raised when the address is not binary or it is not 20 bytes long. Exception used to enforce the sandwich encoding for python APIs. The internal address representation used by Raiden is binary, the binary address must be validated at the edges before calling internal functions. """ class InvalidSecret(RaidenError): """ Raised when the user provided value is not a valid secret. """ class InvalidSecretHash(RaidenError): """ Raised when the user provided value is not a valid secrethash. """ class InvalidAmount(RaidenError): """ Raised when the user provided value is not a positive integer and cannot be used to define a transfer value. """ class InvalidSettleTimeout(RaidenError): """ Raised when the user provided timeout value is less than the minimum settle timeout""" class InvalidRevealTimeout(RaidenError): """ Raised when the channel's settle timeout is less than double the user provided reveal timeout value. condition: settle_timeout < reveal_timeout * 2 """ class InvalidSignature(RaidenError): """Raised on invalid signature recover/verify""" class InvalidPaymentIdentifier(RaidenError): """Raised on invalid payment identifier""" class SamePeerAddress(RaidenError): """ Raised when a user tries to perform an action that requires two different partners """ class UnknownTokenAddress(RaidenError): """ Raised when the token address in unknown. """ class TokenNotRegistered(RaidenError): """ Raised if there is no token network for token used when opening a channel """ class AlreadyRegisteredTokenAddress(RaidenError): """ Raised when the token address in already registered with the given network. """ class InvalidToken(RaidenError): """ Raised if the token does not follow the ERC20 standard. """ class MaxTokenNetworkNumberReached(RaidenError): """ Raised if the maximum amount of token networks has been registered. """ class InvalidTokenAddress(RaidenError): """ Raised if the token address is invalid. """ class InvalidTokenNetworkDepositLimit(RaidenError): """ Raised when an invalid token network deposit limit is passed to the token network registry proxy. """ class InvalidChannelParticipantDepositLimit(RaidenError): """ Raised when an invalid channel participant deposit limit is passed to the token network registry proxy. """ class EthNodeInterfaceError(RaidenError): """ Raised when the underlying ETH node does not support an rpc interface""" class AddressWithoutCode(RaidenError): """Raised on attempt to execute contract on address without a code.""" class DuplicatedChannelError(RaidenRecoverableError): """Raised if someone tries to create a channel that already exists.""" class UnexpectedChannelState(RaidenRecoverableError): """Raised if an operation is attempted on a channel while it is in an unexpected state.""" class ContractCodeMismatch(RaidenError): """Raised if the onchain code of the contract differs.""" class APIServerPortInUseError(RaidenError): """Raised when API server port is already in use""" class InvalidDBData(RaidenUnrecoverableError): """Raised when the data of the WAL are in an unexpected format""" class InvalidBlockNumberInput(RaidenError): """Raised when the user provided a block number that is < 0 or > UINT64_MAX""" class NoStateForBlockIdentifier(RaidenError): """ Raised when we attempt to provide a block identifier older than STATE_PRUNING_AFTER_BLOCKS blocks """ class InvalidNumberInput(RaidenError): """Raised when the user provided an invalid number""" class TransportError(RaidenError): """ Raised when a transport encounters an unexpected error """ class ReplacementTransactionUnderpriced(RaidenError): """Raised when a replacement transaction is rejected by the blockchain""" class EthereumNonceTooLow(RaidenUnrecoverableError): """Raised when a new transaction is sent with a nonce that has been used already.""" class ChannelOutdatedError(RaidenError): """ Raised when an action is invoked on a channel whose identifier has been replaced with a new channel identifier due to a close/re-open of current channel. """ class InsufficientGasReserve(RaidenError): """ Raised when an action cannot be done because the available balance is not sufficient for the lifecycles of all active channels. """ class InsufficientEth(RaidenError): """ Raised when an on-chain action failed because we could not pay for the gas. (The case we try to avoid with `InsufficientGasReserve` exceptions.) """ class BrokenPreconditionError(RaidenError): """ Raised when the chain doesn't satisfy transaction preconditions that proxies check at the specified block. This exception should be used, when the proxy already sees that, on the specified block, due to the blockchain state, an assert or a revert in the smart contract would be hit for the triggering block. This exception should not be used for errors independent of the chain state. For example, when an argument needs to be always non-zero, violation of this condition is not a BrokenPreconditionError, but RaidenValidationError. This exception can also be used when preconditions are not satisfied on another Raiden node. """ class ServiceRequestFailed(RaidenError): """ Raised when a request to one of the raiden services fails. """ class PFSReturnedError(ServiceRequestFailed): """ The PFS responded with a json message containing an error """ def __init__(self, message: str, error_code: int, error_details: Dict[str, Any]) -> None: args: List[Any] = [f"{message} (PFS error code: {error_code})"] if error_details: args.append(error_details) super().__init__(*args) self.message = error_code self.error_code = error_code self.error_details = error_details @classmethod def from_response(cls, response_json: Dict[str, Any]) -> "PFSReturnedError": # TODO: Use marshmallow to deserialize the message fields. Otherwise we # can't guarantee that the variables have the right type, causing bad # error handling. error_params = dict( message=response_json.get("errors", ""), error_code=response_json.get("error_code", 0), error_details=response_json.get("error_details"), ) if PFSError.is_iou_rejected(error_params["error_code"]): return ServiceRequestIOURejected(**error_params) return cls(**error_params) class ServiceRequestIOURejected(PFSReturnedError): """ Raised when a service request fails due to a problem with the iou. """ class UndefinedMediationFee(RaidenError): """The fee schedule is not applicable resulting in undefined fees Either the raiden node is not capable of mediating this payment, or the FeeSchedule is outdated/inconsistent.""" class TokenNetworkDeprecated(RaidenError): """ Raised when the token network proxy safety switch is turned on (i.e deprecated). """ class MintFailed(RaidenError): """ Raised when an attempt to mint a testnet token failed. """ class SerializationError(RaidenError): """ Invalid data are to be (de-)serialized. """ class MatrixSyncMaxTimeoutReached(RaidenRecoverableError): """ Raised if processing the matrix response takes longer than the poll timeout. """ class ConfigurationError(RaidenError): """ Raised when there is something wrong with the provided Raiden Configuration/arguments """
31.882793
97
0.732264
import enum from typing import Any, Dict, List @enum.unique class PFSError(enum.IntEnum): INVALID_REQUEST = 2000 INVALID_SIGNATURE = 2001 REQUEST_OUTDATED = 2002 BAD_IOU = 2100 MISSING_IOU = 2101 WRONG_IOU_RECIPIENT = 2102 IOU_EXPIRED_TOO_EARLY = 2103 INSUFFICIENT_SERVICE_PAYMENT = 2104 IOU_ALREADY_CLAIMED = 2105 USE_THIS_IOU = 2106 DEPOSIT_TOO_LOW = 2107 NO_ROUTE_FOUND = 2201 @staticmethod def is_iou_rejected(error_code: int) -> bool: return error_code >= 2100 and error_code < 2200 class RaidenError(Exception): class RaidenRecoverableError(RaidenError): class RaidenUnrecoverableError(RaidenError): class RaidenValidationError(RaidenRecoverableError): class PaymentConflict(RaidenRecoverableError): class InsufficientFunds(RaidenError): class DepositOverLimit(RaidenError): class DepositMismatch(RaidenRecoverableError): class InvalidChannelID(RaidenError): class WithdrawMismatch(RaidenRecoverableError): class InvalidChecksummedAddress(RaidenError): class InvalidBinaryAddress(RaidenValidationError): class InvalidSecret(RaidenError): class InvalidSecretHash(RaidenError): class InvalidAmount(RaidenError): class InvalidSettleTimeout(RaidenError): class InvalidRevealTimeout(RaidenError): class InvalidSignature(RaidenError): class InvalidPaymentIdentifier(RaidenError): class SamePeerAddress(RaidenError): class UnknownTokenAddress(RaidenError): class TokenNotRegistered(RaidenError): class AlreadyRegisteredTokenAddress(RaidenError): class InvalidToken(RaidenError): class MaxTokenNetworkNumberReached(RaidenError): class InvalidTokenAddress(RaidenError): class InvalidTokenNetworkDepositLimit(RaidenError): class InvalidChannelParticipantDepositLimit(RaidenError): class EthNodeInterfaceError(RaidenError): class AddressWithoutCode(RaidenError): class DuplicatedChannelError(RaidenRecoverableError): class UnexpectedChannelState(RaidenRecoverableError): class ContractCodeMismatch(RaidenError): class APIServerPortInUseError(RaidenError): class InvalidDBData(RaidenUnrecoverableError): class InvalidBlockNumberInput(RaidenError): class NoStateForBlockIdentifier(RaidenError): class InvalidNumberInput(RaidenError): class TransportError(RaidenError): class ReplacementTransactionUnderpriced(RaidenError): class EthereumNonceTooLow(RaidenUnrecoverableError): class ChannelOutdatedError(RaidenError): class InsufficientGasReserve(RaidenError): class InsufficientEth(RaidenError): class BrokenPreconditionError(RaidenError): class ServiceRequestFailed(RaidenError): class PFSReturnedError(ServiceRequestFailed): def __init__(self, message: str, error_code: int, error_details: Dict[str, Any]) -> None: args: List[Any] = [f"{message} (PFS error code: {error_code})"] if error_details: args.append(error_details) super().__init__(*args) self.message = error_code self.error_code = error_code self.error_details = error_details @classmethod def from_response(cls, response_json: Dict[str, Any]) -> "PFSReturnedError": # error handling. error_params = dict( message=response_json.get("errors", ""), error_code=response_json.get("error_code", 0), error_details=response_json.get("error_details"), ) if PFSError.is_iou_rejected(error_params["error_code"]): return ServiceRequestIOURejected(**error_params) return cls(**error_params) class ServiceRequestIOURejected(PFSReturnedError): class UndefinedMediationFee(RaidenError): class TokenNetworkDeprecated(RaidenError): class MintFailed(RaidenError): class SerializationError(RaidenError): class MatrixSyncMaxTimeoutReached(RaidenRecoverableError): class ConfigurationError(RaidenError):
true
true
f7208908dd0f530934afcd736f133ab23168b854
1,172
py
Python
setup.py
njdanielsen/aws-data-wrangler
5cdb316224370e952dfb3a701825e1b1ab331105
[ "Apache-2.0" ]
null
null
null
setup.py
njdanielsen/aws-data-wrangler
5cdb316224370e952dfb3a701825e1b1ab331105
[ "Apache-2.0" ]
null
null
null
setup.py
njdanielsen/aws-data-wrangler
5cdb316224370e952dfb3a701825e1b1ab331105
[ "Apache-2.0" ]
null
null
null
import os from io import open from typing import Dict from setuptools import find_packages, setup here = os.path.abspath(os.path.dirname(__file__)) about: Dict[str, str] = {} path = os.path.join(here, "awswrangler", "__metadata__.py") with open(file=path, mode="r", encoding="utf-8") as f: exec(f.read(), about) with open("README.md", "r") as fh: long_description = fh.read() setup( author="Igor Tavares", url="https://github.com/awslabs/aws-data-wrangler", name=about["__title__"], version=about["__version__"], description=about["__description__"], long_description=long_description, long_description_content_type="text/markdown", license=about["__license__"], packages=find_packages(exclude=["tests"]), include_package_data=True, python_requires=">=3.6, <3.10", install_requires=open("requirements.txt").read().strip().split("\n"), classifiers=[ "Programming Language :: Python :: 3.6", "Programming Language :: Python :: 3.7", "Programming Language :: Python :: 3.8", "Programming Language :: Python :: 3.9", ], extras_require={"sqlserver": ["pyodbc~=4.0.30"]}, )
31.675676
73
0.664676
import os from io import open from typing import Dict from setuptools import find_packages, setup here = os.path.abspath(os.path.dirname(__file__)) about: Dict[str, str] = {} path = os.path.join(here, "awswrangler", "__metadata__.py") with open(file=path, mode="r", encoding="utf-8") as f: exec(f.read(), about) with open("README.md", "r") as fh: long_description = fh.read() setup( author="Igor Tavares", url="https://github.com/awslabs/aws-data-wrangler", name=about["__title__"], version=about["__version__"], description=about["__description__"], long_description=long_description, long_description_content_type="text/markdown", license=about["__license__"], packages=find_packages(exclude=["tests"]), include_package_data=True, python_requires=">=3.6, <3.10", install_requires=open("requirements.txt").read().strip().split("\n"), classifiers=[ "Programming Language :: Python :: 3.6", "Programming Language :: Python :: 3.7", "Programming Language :: Python :: 3.8", "Programming Language :: Python :: 3.9", ], extras_require={"sqlserver": ["pyodbc~=4.0.30"]}, )
true
true
f72089bdffb1bfe66db8bea55840dc0bef158c5f
18,291
py
Python
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_12_01/operations/_web_application_firewall_policies_operations.py
iscai-msft/azure-sdk-for-python
83715b95c41e519d5be7f1180195e2fba136fc0f
[ "MIT" ]
1
2020-05-12T23:29:15.000Z
2020-05-12T23:29:15.000Z
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_12_01/operations/_web_application_firewall_policies_operations.py
iscai-msft/azure-sdk-for-python
83715b95c41e519d5be7f1180195e2fba136fc0f
[ "MIT" ]
226
2019-07-24T07:57:21.000Z
2019-10-15T01:07:24.000Z
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_12_01/operations/_web_application_firewall_policies_operations.py
iscai-msft/azure-sdk-for-python
83715b95c41e519d5be7f1180195e2fba136fc0f
[ "MIT" ]
null
null
null
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- import uuid from msrest.pipeline import ClientRawResponse from msrestazure.azure_exceptions import CloudError from msrest.polling import LROPoller, NoPolling from msrestazure.polling.arm_polling import ARMPolling from .. import models class WebApplicationFirewallPoliciesOperations(object): """WebApplicationFirewallPoliciesOperations operations. You should not instantiate directly this class, but create a Client instance that will create it for you and attach it as attribute. :param client: Client for service requests. :param config: Configuration of service client. :param serializer: An object model serializer. :param deserializer: An object model deserializer. :ivar api_version: Client API version. Constant value: "2019-12-01". """ models = models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self.api_version = "2019-12-01" self.config = config def list( self, resource_group_name, custom_headers=None, raw=False, **operation_config): """Lists all of the protection policies within a resource group. :param resource_group_name: The name of the resource group. :type resource_group_name: str :param dict custom_headers: headers that will be added to the request :param bool raw: returns the direct response alongside the deserialized response :param operation_config: :ref:`Operation configuration overrides<msrest:optionsforoperations>`. :return: An iterator like instance of WebApplicationFirewallPolicy :rtype: ~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicyPaged[~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicy] :raises: :class:`CloudError<msrestazure.azure_exceptions.CloudError>` """ def prepare_request(next_link=None): if not next_link: # Construct URL url = self.list.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') else: url = next_link query_parameters = {} # Construct headers header_parameters = {} header_parameters['Accept'] = 'application/json' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') # Construct and send request request = self._client.get(url, query_parameters, header_parameters) return request def internal_paging(next_link=None): request = prepare_request(next_link) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp return response # Deserialize response header_dict = None if raw: header_dict = {} deserialized = models.WebApplicationFirewallPolicyPaged(internal_paging, self._deserialize.dependencies, header_dict) return deserialized list.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies'} def list_all( self, custom_headers=None, raw=False, **operation_config): """Gets all the WAF policies in a subscription. :param dict custom_headers: headers that will be added to the request :param bool raw: returns the direct response alongside the deserialized response :param operation_config: :ref:`Operation configuration overrides<msrest:optionsforoperations>`. :return: An iterator like instance of WebApplicationFirewallPolicy :rtype: ~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicyPaged[~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicy] :raises: :class:`CloudError<msrestazure.azure_exceptions.CloudError>` """ def prepare_request(next_link=None): if not next_link: # Construct URL url = self.list_all.metadata['url'] path_format_arguments = { 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') else: url = next_link query_parameters = {} # Construct headers header_parameters = {} header_parameters['Accept'] = 'application/json' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') # Construct and send request request = self._client.get(url, query_parameters, header_parameters) return request def internal_paging(next_link=None): request = prepare_request(next_link) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp return response # Deserialize response header_dict = None if raw: header_dict = {} deserialized = models.WebApplicationFirewallPolicyPaged(internal_paging, self._deserialize.dependencies, header_dict) return deserialized list_all.metadata = {'url': '/subscriptions/{subscriptionId}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies'} def get( self, resource_group_name, policy_name, custom_headers=None, raw=False, **operation_config): """Retrieve protection policy with specified name within a resource group. :param resource_group_name: The name of the resource group. :type resource_group_name: str :param policy_name: The name of the policy. :type policy_name: str :param dict custom_headers: headers that will be added to the request :param bool raw: returns the direct response alongside the deserialized response :param operation_config: :ref:`Operation configuration overrides<msrest:optionsforoperations>`. :return: WebApplicationFirewallPolicy or ClientRawResponse if raw=true :rtype: ~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicy or ~msrest.pipeline.ClientRawResponse :raises: :class:`CloudError<msrestazure.azure_exceptions.CloudError>` """ # Construct URL url = self.get.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'policyName': self._serialize.url("policy_name", policy_name, 'str', max_length=128), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') # Construct headers header_parameters = {} header_parameters['Accept'] = 'application/json' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') # Construct and send request request = self._client.get(url, query_parameters, header_parameters) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp deserialized = None if response.status_code == 200: deserialized = self._deserialize('WebApplicationFirewallPolicy', response) if raw: client_raw_response = ClientRawResponse(deserialized, response) return client_raw_response return deserialized get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies/{policyName}'} def create_or_update( self, resource_group_name, policy_name, parameters, custom_headers=None, raw=False, **operation_config): """Creates or update policy with specified rule set name within a resource group. :param resource_group_name: The name of the resource group. :type resource_group_name: str :param policy_name: The name of the policy. :type policy_name: str :param parameters: Policy to be created. :type parameters: ~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicy :param dict custom_headers: headers that will be added to the request :param bool raw: returns the direct response alongside the deserialized response :param operation_config: :ref:`Operation configuration overrides<msrest:optionsforoperations>`. :return: WebApplicationFirewallPolicy or ClientRawResponse if raw=true :rtype: ~azure.mgmt.network.v2019_12_01.models.WebApplicationFirewallPolicy or ~msrest.pipeline.ClientRawResponse :raises: :class:`CloudError<msrestazure.azure_exceptions.CloudError>` """ # Construct URL url = self.create_or_update.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'policyName': self._serialize.url("policy_name", policy_name, 'str', max_length=128), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') # Construct headers header_parameters = {} header_parameters['Accept'] = 'application/json' header_parameters['Content-Type'] = 'application/json; charset=utf-8' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') # Construct body body_content = self._serialize.body(parameters, 'WebApplicationFirewallPolicy') # Construct and send request request = self._client.put(url, query_parameters, header_parameters, body_content) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200, 201]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp deserialized = None if response.status_code == 200: deserialized = self._deserialize('WebApplicationFirewallPolicy', response) if response.status_code == 201: deserialized = self._deserialize('WebApplicationFirewallPolicy', response) if raw: client_raw_response = ClientRawResponse(deserialized, response) return client_raw_response return deserialized create_or_update.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies/{policyName}'} def _delete_initial( self, resource_group_name, policy_name, custom_headers=None, raw=False, **operation_config): # Construct URL url = self.delete.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'policyName': self._serialize.url("policy_name", policy_name, 'str', max_length=128), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') # Construct headers header_parameters = {} if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') # Construct and send request request = self._client.delete(url, query_parameters, header_parameters) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200, 202, 204]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp if raw: client_raw_response = ClientRawResponse(None, response) return client_raw_response def delete( self, resource_group_name, policy_name, custom_headers=None, raw=False, polling=True, **operation_config): """Deletes Policy. :param resource_group_name: The name of the resource group. :type resource_group_name: str :param policy_name: The name of the policy. :type policy_name: str :param dict custom_headers: headers that will be added to the request :param bool raw: The poller return type is ClientRawResponse, the direct response alongside the deserialized response :param polling: True for ARMPolling, False for no polling, or a polling object for personal polling strategy :return: An instance of LROPoller that returns None or ClientRawResponse<None> if raw==True :rtype: ~msrestazure.azure_operation.AzureOperationPoller[None] or ~msrestazure.azure_operation.AzureOperationPoller[~msrest.pipeline.ClientRawResponse[None]] :raises: :class:`CloudError<msrestazure.azure_exceptions.CloudError>` """ raw_result = self._delete_initial( resource_group_name=resource_group_name, policy_name=policy_name, custom_headers=custom_headers, raw=True, **operation_config ) def get_long_running_output(response): if raw: client_raw_response = ClientRawResponse(None, response) return client_raw_response lro_delay = operation_config.get( 'long_running_operation_timeout', self.config.long_running_operation_timeout) if polling is True: polling_method = ARMPolling(lro_delay, **operation_config) elif polling is False: polling_method = NoPolling() else: polling_method = polling return LROPoller(self._client, raw_result, get_long_running_output, polling_method) delete.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies/{policyName}'}
46.780051
199
0.668526
import uuid from msrest.pipeline import ClientRawResponse from msrestazure.azure_exceptions import CloudError from msrest.polling import LROPoller, NoPolling from msrestazure.polling.arm_polling import ARMPolling from .. import models class WebApplicationFirewallPoliciesOperations(object): models = models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self.api_version = "2019-12-01" self.config = config def list( self, resource_group_name, custom_headers=None, raw=False, **operation_config): def prepare_request(next_link=None): if not next_link: url = self.list.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') else: url = next_link query_parameters = {} header_parameters = {} header_parameters['Accept'] = 'application/json' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') request = self._client.get(url, query_parameters, header_parameters) return request def internal_paging(next_link=None): request = prepare_request(next_link) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp return response header_dict = None if raw: header_dict = {} deserialized = models.WebApplicationFirewallPolicyPaged(internal_paging, self._deserialize.dependencies, header_dict) return deserialized list.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies'} def list_all( self, custom_headers=None, raw=False, **operation_config): def prepare_request(next_link=None): if not next_link: url = self.list_all.metadata['url'] path_format_arguments = { 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') else: url = next_link query_parameters = {} header_parameters = {} header_parameters['Accept'] = 'application/json' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') request = self._client.get(url, query_parameters, header_parameters) return request def internal_paging(next_link=None): request = prepare_request(next_link) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp return response header_dict = None if raw: header_dict = {} deserialized = models.WebApplicationFirewallPolicyPaged(internal_paging, self._deserialize.dependencies, header_dict) return deserialized list_all.metadata = {'url': '/subscriptions/{subscriptionId}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies'} def get( self, resource_group_name, policy_name, custom_headers=None, raw=False, **operation_config): url = self.get.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'policyName': self._serialize.url("policy_name", policy_name, 'str', max_length=128), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') header_parameters = {} header_parameters['Accept'] = 'application/json' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') request = self._client.get(url, query_parameters, header_parameters) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp deserialized = None if response.status_code == 200: deserialized = self._deserialize('WebApplicationFirewallPolicy', response) if raw: client_raw_response = ClientRawResponse(deserialized, response) return client_raw_response return deserialized get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies/{policyName}'} def create_or_update( self, resource_group_name, policy_name, parameters, custom_headers=None, raw=False, **operation_config): url = self.create_or_update.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'policyName': self._serialize.url("policy_name", policy_name, 'str', max_length=128), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') header_parameters = {} header_parameters['Accept'] = 'application/json' header_parameters['Content-Type'] = 'application/json; charset=utf-8' if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') body_content = self._serialize.body(parameters, 'WebApplicationFirewallPolicy') request = self._client.put(url, query_parameters, header_parameters, body_content) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200, 201]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp deserialized = None if response.status_code == 200: deserialized = self._deserialize('WebApplicationFirewallPolicy', response) if response.status_code == 201: deserialized = self._deserialize('WebApplicationFirewallPolicy', response) if raw: client_raw_response = ClientRawResponse(deserialized, response) return client_raw_response return deserialized create_or_update.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies/{policyName}'} def _delete_initial( self, resource_group_name, policy_name, custom_headers=None, raw=False, **operation_config): url = self.delete.metadata['url'] path_format_arguments = { 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'policyName': self._serialize.url("policy_name", policy_name, 'str', max_length=128), 'subscriptionId': self._serialize.url("self.config.subscription_id", self.config.subscription_id, 'str') } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("self.api_version", self.api_version, 'str') header_parameters = {} if self.config.generate_client_request_id: header_parameters['x-ms-client-request-id'] = str(uuid.uuid1()) if custom_headers: header_parameters.update(custom_headers) if self.config.accept_language is not None: header_parameters['accept-language'] = self._serialize.header("self.config.accept_language", self.config.accept_language, 'str') request = self._client.delete(url, query_parameters, header_parameters) response = self._client.send(request, stream=False, **operation_config) if response.status_code not in [200, 202, 204]: exp = CloudError(response) exp.request_id = response.headers.get('x-ms-request-id') raise exp if raw: client_raw_response = ClientRawResponse(None, response) return client_raw_response def delete( self, resource_group_name, policy_name, custom_headers=None, raw=False, polling=True, **operation_config): raw_result = self._delete_initial( resource_group_name=resource_group_name, policy_name=policy_name, custom_headers=custom_headers, raw=True, **operation_config ) def get_long_running_output(response): if raw: client_raw_response = ClientRawResponse(None, response) return client_raw_response lro_delay = operation_config.get( 'long_running_operation_timeout', self.config.long_running_operation_timeout) if polling is True: polling_method = ARMPolling(lro_delay, **operation_config) elif polling is False: polling_method = NoPolling() else: polling_method = polling return LROPoller(self._client, raw_result, get_long_running_output, polling_method) delete.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/ApplicationGatewayWebApplicationFirewallPolicies/{policyName}'}
true
true
f7208a0bce6ed5a17f46fdcb513416605ec0135f
3,249
py
Python
cfgov/v1/models/browse_page.py
atuggle/cfgov-refresh
5a9cfd92b460b9be7befb39f5845abf56857aeac
[ "CC0-1.0" ]
null
null
null
cfgov/v1/models/browse_page.py
atuggle/cfgov-refresh
5a9cfd92b460b9be7befb39f5845abf56857aeac
[ "CC0-1.0" ]
1
2016-09-14T21:11:19.000Z
2016-09-14T21:11:19.000Z
cfgov/v1/models/browse_page.py
atuggle/cfgov-refresh
5a9cfd92b460b9be7befb39f5845abf56857aeac
[ "CC0-1.0" ]
null
null
null
from django.db import models from wagtail.wagtailadmin.edit_handlers import ( FieldPanel, ObjectList, StreamFieldPanel, TabbedInterface ) from wagtail.wagtailcore import blocks from wagtail.wagtailcore.fields import StreamField from wagtail.wagtailcore.models import PageManager from data_research.blocks import ( ConferenceRegistrationForm, MortgageDataDownloads ) from jobmanager.models import JobListingTable from v1 import blocks as v1_blocks from v1.atomic_elements import molecules, organisms from v1.models.base import CFGOVPage from v1.util.util import get_secondary_nav_items class BrowsePage(CFGOVPage): header = StreamField([ ('text_introduction', molecules.TextIntroduction()), ('featured_content', molecules.FeaturedContent()), ], blank=True) content = StreamField([ ('bureau_structure', organisms.BureauStructure()), ('info_unit_group', organisms.InfoUnitGroup()), ('well', organisms.Well()), ('full_width_text', organisms.FullWidthText()), ('expandable', organisms.Expandable()), ('expandable_group', organisms.ExpandableGroup()), ('table_block', organisms.AtomicTableBlock( table_options={'renderer': 'html'})), ('job_listing_table', JobListingTable()), ('feedback', v1_blocks.Feedback()), ('conference_registration_form', ConferenceRegistrationForm()), ('raw_html_block', blocks.RawHTMLBlock( label='Raw HTML block')), ('html_block', organisms.HTMLBlock()), ('chart_block', organisms.ChartBlock()), ('mortgage_chart_block', organisms.MortgageChartBlock()), ('mortgage_map_block', organisms.MortgageMapBlock()), ('mortgage_downloads_block', MortgageDataDownloads()), ('snippet_list', organisms.SnippetList()), ('data_snapshot', organisms.DataSnapshot()), ('image_text_25_75_group', organisms.ImageText2575Group()), ('image_text_50_50_group', organisms.ImageText5050Group()), ('half_width_link_blob_group', organisms.HalfWidthLinkBlobGroup()), ('third_width_link_blob_group', organisms.ThirdWidthLinkBlobGroup()), ], blank=True) secondary_nav_exclude_sibling_pages = models.BooleanField(default=False) # General content tab content_panels = CFGOVPage.content_panels + [ StreamFieldPanel('header'), StreamFieldPanel('content'), ] sidefoot_panels = CFGOVPage.sidefoot_panels + [ FieldPanel('secondary_nav_exclude_sibling_pages'), ] # Tab handler interface edit_handler = TabbedInterface([ ObjectList(content_panels, heading='General Content'), ObjectList(sidefoot_panels, heading='Sidebar'), ObjectList(CFGOVPage.settings_panels, heading='Configuration'), ]) template = 'browse-basic/index.html' objects = PageManager() @property def page_js(self): return ( super(BrowsePage, self).page_js + ['secondary-navigation.js'] ) def get_context(self, request, *args, **kwargs): context = super(BrowsePage, self).get_context(request, *args, **kwargs) context.update({'get_secondary_nav_items': get_secondary_nav_items}) return context
37.77907
79
0.6996
from django.db import models from wagtail.wagtailadmin.edit_handlers import ( FieldPanel, ObjectList, StreamFieldPanel, TabbedInterface ) from wagtail.wagtailcore import blocks from wagtail.wagtailcore.fields import StreamField from wagtail.wagtailcore.models import PageManager from data_research.blocks import ( ConferenceRegistrationForm, MortgageDataDownloads ) from jobmanager.models import JobListingTable from v1 import blocks as v1_blocks from v1.atomic_elements import molecules, organisms from v1.models.base import CFGOVPage from v1.util.util import get_secondary_nav_items class BrowsePage(CFGOVPage): header = StreamField([ ('text_introduction', molecules.TextIntroduction()), ('featured_content', molecules.FeaturedContent()), ], blank=True) content = StreamField([ ('bureau_structure', organisms.BureauStructure()), ('info_unit_group', organisms.InfoUnitGroup()), ('well', organisms.Well()), ('full_width_text', organisms.FullWidthText()), ('expandable', organisms.Expandable()), ('expandable_group', organisms.ExpandableGroup()), ('table_block', organisms.AtomicTableBlock( table_options={'renderer': 'html'})), ('job_listing_table', JobListingTable()), ('feedback', v1_blocks.Feedback()), ('conference_registration_form', ConferenceRegistrationForm()), ('raw_html_block', blocks.RawHTMLBlock( label='Raw HTML block')), ('html_block', organisms.HTMLBlock()), ('chart_block', organisms.ChartBlock()), ('mortgage_chart_block', organisms.MortgageChartBlock()), ('mortgage_map_block', organisms.MortgageMapBlock()), ('mortgage_downloads_block', MortgageDataDownloads()), ('snippet_list', organisms.SnippetList()), ('data_snapshot', organisms.DataSnapshot()), ('image_text_25_75_group', organisms.ImageText2575Group()), ('image_text_50_50_group', organisms.ImageText5050Group()), ('half_width_link_blob_group', organisms.HalfWidthLinkBlobGroup()), ('third_width_link_blob_group', organisms.ThirdWidthLinkBlobGroup()), ], blank=True) secondary_nav_exclude_sibling_pages = models.BooleanField(default=False) content_panels = CFGOVPage.content_panels + [ StreamFieldPanel('header'), StreamFieldPanel('content'), ] sidefoot_panels = CFGOVPage.sidefoot_panels + [ FieldPanel('secondary_nav_exclude_sibling_pages'), ] edit_handler = TabbedInterface([ ObjectList(content_panels, heading='General Content'), ObjectList(sidefoot_panels, heading='Sidebar'), ObjectList(CFGOVPage.settings_panels, heading='Configuration'), ]) template = 'browse-basic/index.html' objects = PageManager() @property def page_js(self): return ( super(BrowsePage, self).page_js + ['secondary-navigation.js'] ) def get_context(self, request, *args, **kwargs): context = super(BrowsePage, self).get_context(request, *args, **kwargs) context.update({'get_secondary_nav_items': get_secondary_nav_items}) return context
true
true
f7208bc906110bb2c8cae40a156edcf4c7547c8c
7,727
py
Python
plugins/opencv/src/opencv/__init__.py
IGx89/scrypted
577b00a090393f31aaa81de67f5fd4555995921a
[ "MIT" ]
null
null
null
plugins/opencv/src/opencv/__init__.py
IGx89/scrypted
577b00a090393f31aaa81de67f5fd4555995921a
[ "MIT" ]
null
null
null
plugins/opencv/src/opencv/__init__.py
IGx89/scrypted
577b00a090393f31aaa81de67f5fd4555995921a
[ "MIT" ]
null
null
null
from __future__ import annotations from time import sleep from detect import DetectionSession, DetectPlugin from typing import Any, List import numpy as np import cv2 import imutils from gi.repository import GLib, Gst from scrypted_sdk.types import ObjectDetectionModel, ObjectDetectionResult, ObjectsDetected class OpenCVDetectionSession(DetectionSession): cap: cv2.VideoCapture previous_frame: Any def __init__(self) -> None: super().__init__() self.previous_frame = None self.cap = None defaultThreshold = 25 defaultArea = 2000 defaultInterval = 250 class OpenCVPlugin(DetectPlugin): def __init__(self, nativeId: str | None = None): super().__init__(nativeId=nativeId) self.color2Gray = None self.pixelFormat = "I420" self.pixelFormatChannelCount = 1 if True: self.retainAspectRatio = False self.color2Gray = None self.pixelFormat = "I420" self.pixelFormatChannelCount = 1 else: self.retainAspectRatio = True self.color2Gray = cv2.COLOR_BGRA2GRAY self.pixelFormat = "BGRA" self.pixelFormatChannelCount = 4 async def getDetectionModel(self) -> ObjectDetectionModel: d: ObjectDetectionModel = { 'name': '@scrypted/opencv', 'classes': ['motion'], } settings = [ { 'title': "Motion Area", 'description': "The area size required to trigger motion. Higher values (larger areas) are less sensitive. Setting this to 0 will output all matches into the console.", 'value': defaultArea, 'key': 'area', 'placeholder': defaultArea, 'type': 'number', }, { 'title': "Motion Threshold", 'description': "The threshold required to consider a pixel changed. Higher values (larger changes) are less sensitive.", 'value': defaultThreshold, 'key': 'threshold', 'placeholder': defaultThreshold, 'type': 'number', }, { 'title': "Frame Analysis Interval", 'description': "The number of milliseconds to wait between motion analysis.", 'value': defaultInterval, 'key': 'interval', 'placeholder': defaultInterval, 'type': 'number', }, ] d['settings'] = settings return d def get_pixel_format(self): return self.pixelFormat def parse_settings(self, settings: Any): area = defaultArea threshold = defaultThreshold interval = defaultInterval if settings: area = float(settings.get('area', area)) threshold = int(settings.get('threshold', threshold)) interval = float(settings.get('interval', interval)) return area, threshold, interval def detect(self, detection_session: OpenCVDetectionSession, frame, settings: Any, src_size, convert_to_src_size) -> ObjectsDetected: area, threshold, interval = self.parse_settings(settings) # see get_detection_input_size on undocumented size requirements for GRAY8 if self.color2Gray != None: gray = cv2.cvtColor(frame, self.color2Gray) else: gray = frame curFrame = cv2.GaussianBlur(gray, (21,21), 0) if detection_session.previous_frame is None: detection_session.previous_frame = curFrame return frameDelta = cv2.absdiff(detection_session.previous_frame, curFrame) detection_session.previous_frame = curFrame _, thresh = cv2.threshold(frameDelta, threshold, 255, cv2.THRESH_BINARY) dilated = cv2.dilate(thresh, None, iterations=2) fcontours = cv2.findContours(dilated, cv2.RETR_EXTERNAL, cv2.CHAIN_APPROX_SIMPLE) contours = imutils.grab_contours(fcontours) detections: List[ObjectDetectionResult] = [] detection_result: ObjectsDetected = {} detection_result['detections'] = detections detection_result['inputDimensions'] = src_size for c in contours: x, y, w, h = cv2.boundingRect(c) # if w * h != contour_area: # print("mismatch w/h", contour_area - w * h) x2, y2 = convert_to_src_size((x + w, y + h)) x, y = convert_to_src_size((x, y)) w = x2 - x + 1 h = y2 - y + 1 contour_area = w * h if not area or contour_area > area: detection: ObjectDetectionResult = {} detection['boundingBox'] = (x, y, w, h) detection['className'] = 'motion' detection['score'] = 1 if area else contour_area detections.append(detection) return detection_result def run_detection_jpeg(self, detection_session: DetectionSession, image_bytes: bytes, min_score: float) -> ObjectsDetected: raise Exception('can not run motion detection on jpeg') def get_detection_input_size(self, src_size): # The initial implementation of this plugin used BGRA # because it seemed impossible to pull the Y frame out of I420 without corruption. # This is because while 318x174 is aspect ratio correct, # it seems to cause strange issues with stride and the image is skewed. # By using 300x300, this seems to avoid some undocumented minimum size # reqiurement in gst-videoscale or opencv. Unclear which. # This is the same input size as tensorflow-lite. Allows for better pipelining. if not self.retainAspectRatio: return (300, 300) width, height = src_size if (width > height): if (width > 318): height = height / width * 318 width = 318 else: if (height > 318): width = width / height * 318 height = 318 width = int(np.floor(width / 6) * 6) height = int(np.floor(height / 6) * 6) return width, height def end_session(self, detection_session: OpenCVDetectionSession): if detection_session and detection_session.cap: detection_session.cap.release() detection_session.cap = None return super().end_session(detection_session) def run_detection_gstsample(self, detection_session: OpenCVDetectionSession, gst_sample, settings: Any, src_size, convert_to_src_size)-> ObjectsDetected: buf = gst_sample.get_buffer() caps = gst_sample.get_caps() # can't trust the width value, compute the stride height = caps.get_structure(0).get_value('height') width = caps.get_structure(0).get_value('width') result, info = buf.map(Gst.MapFlags.READ) if not result: return try: mat = np.ndarray( (height, width, self.pixelFormatChannelCount), buffer=info.data, dtype= np.uint8) return self.detect(detection_session, mat, settings, src_size, convert_to_src_size) finally: buf.unmap(info) def create_detection_session(self): return OpenCVDetectionSession() def detection_event_notified(self, settings: Any): area, threshold, interval = self.parse_settings(settings) # it is safe to block here because gstreamer creates a queue thread sleep(interval / 1000) return super().detection_event_notified(settings)
38.442786
184
0.608645
from __future__ import annotations from time import sleep from detect import DetectionSession, DetectPlugin from typing import Any, List import numpy as np import cv2 import imutils from gi.repository import GLib, Gst from scrypted_sdk.types import ObjectDetectionModel, ObjectDetectionResult, ObjectsDetected class OpenCVDetectionSession(DetectionSession): cap: cv2.VideoCapture previous_frame: Any def __init__(self) -> None: super().__init__() self.previous_frame = None self.cap = None defaultThreshold = 25 defaultArea = 2000 defaultInterval = 250 class OpenCVPlugin(DetectPlugin): def __init__(self, nativeId: str | None = None): super().__init__(nativeId=nativeId) self.color2Gray = None self.pixelFormat = "I420" self.pixelFormatChannelCount = 1 if True: self.retainAspectRatio = False self.color2Gray = None self.pixelFormat = "I420" self.pixelFormatChannelCount = 1 else: self.retainAspectRatio = True self.color2Gray = cv2.COLOR_BGRA2GRAY self.pixelFormat = "BGRA" self.pixelFormatChannelCount = 4 async def getDetectionModel(self) -> ObjectDetectionModel: d: ObjectDetectionModel = { 'name': '@scrypted/opencv', 'classes': ['motion'], } settings = [ { 'title': "Motion Area", 'description': "The area size required to trigger motion. Higher values (larger areas) are less sensitive. Setting this to 0 will output all matches into the console.", 'value': defaultArea, 'key': 'area', 'placeholder': defaultArea, 'type': 'number', }, { 'title': "Motion Threshold", 'description': "The threshold required to consider a pixel changed. Higher values (larger changes) are less sensitive.", 'value': defaultThreshold, 'key': 'threshold', 'placeholder': defaultThreshold, 'type': 'number', }, { 'title': "Frame Analysis Interval", 'description': "The number of milliseconds to wait between motion analysis.", 'value': defaultInterval, 'key': 'interval', 'placeholder': defaultInterval, 'type': 'number', }, ] d['settings'] = settings return d def get_pixel_format(self): return self.pixelFormat def parse_settings(self, settings: Any): area = defaultArea threshold = defaultThreshold interval = defaultInterval if settings: area = float(settings.get('area', area)) threshold = int(settings.get('threshold', threshold)) interval = float(settings.get('interval', interval)) return area, threshold, interval def detect(self, detection_session: OpenCVDetectionSession, frame, settings: Any, src_size, convert_to_src_size) -> ObjectsDetected: area, threshold, interval = self.parse_settings(settings) if self.color2Gray != None: gray = cv2.cvtColor(frame, self.color2Gray) else: gray = frame curFrame = cv2.GaussianBlur(gray, (21,21), 0) if detection_session.previous_frame is None: detection_session.previous_frame = curFrame return frameDelta = cv2.absdiff(detection_session.previous_frame, curFrame) detection_session.previous_frame = curFrame _, thresh = cv2.threshold(frameDelta, threshold, 255, cv2.THRESH_BINARY) dilated = cv2.dilate(thresh, None, iterations=2) fcontours = cv2.findContours(dilated, cv2.RETR_EXTERNAL, cv2.CHAIN_APPROX_SIMPLE) contours = imutils.grab_contours(fcontours) detections: List[ObjectDetectionResult] = [] detection_result: ObjectsDetected = {} detection_result['detections'] = detections detection_result['inputDimensions'] = src_size for c in contours: x, y, w, h = cv2.boundingRect(c) x2, y2 = convert_to_src_size((x + w, y + h)) x, y = convert_to_src_size((x, y)) w = x2 - x + 1 h = y2 - y + 1 contour_area = w * h if not area or contour_area > area: detection: ObjectDetectionResult = {} detection['boundingBox'] = (x, y, w, h) detection['className'] = 'motion' detection['score'] = 1 if area else contour_area detections.append(detection) return detection_result def run_detection_jpeg(self, detection_session: DetectionSession, image_bytes: bytes, min_score: float) -> ObjectsDetected: raise Exception('can not run motion detection on jpeg') def get_detection_input_size(self, src_size): if not self.retainAspectRatio: return (300, 300) width, height = src_size if (width > height): if (width > 318): height = height / width * 318 width = 318 else: if (height > 318): width = width / height * 318 height = 318 width = int(np.floor(width / 6) * 6) height = int(np.floor(height / 6) * 6) return width, height def end_session(self, detection_session: OpenCVDetectionSession): if detection_session and detection_session.cap: detection_session.cap.release() detection_session.cap = None return super().end_session(detection_session) def run_detection_gstsample(self, detection_session: OpenCVDetectionSession, gst_sample, settings: Any, src_size, convert_to_src_size)-> ObjectsDetected: buf = gst_sample.get_buffer() caps = gst_sample.get_caps() height = caps.get_structure(0).get_value('height') width = caps.get_structure(0).get_value('width') result, info = buf.map(Gst.MapFlags.READ) if not result: return try: mat = np.ndarray( (height, width, self.pixelFormatChannelCount), buffer=info.data, dtype= np.uint8) return self.detect(detection_session, mat, settings, src_size, convert_to_src_size) finally: buf.unmap(info) def create_detection_session(self): return OpenCVDetectionSession() def detection_event_notified(self, settings: Any): area, threshold, interval = self.parse_settings(settings) # it is safe to block here because gstreamer creates a queue thread sleep(interval / 1000) return super().detection_event_notified(settings)
true
true
f7208be42fc87aa1346f3bb00981d1c67e5429aa
1,457
py
Python
manager.py
Hugh-wong/hydra
5f2c4770e655d41d3c535f6e3c29ec4848d5d60e
[ "MIT" ]
3
2017-02-03T01:44:30.000Z
2019-02-27T12:00:00.000Z
manager.py
Hugh-wong/hydra
5f2c4770e655d41d3c535f6e3c29ec4848d5d60e
[ "MIT" ]
null
null
null
manager.py
Hugh-wong/hydra
5f2c4770e655d41d3c535f6e3c29ec4848d5d60e
[ "MIT" ]
1
2021-07-12T07:41:07.000Z
2021-07-12T07:41:07.000Z
# coding=utf-8 import sys import signal import time from multiprocessing import Process from allocator import Allocator, Event class Manager(object): """A manager manage multi allocators, when told to stop, manager would tell the allocator to stop.""" def __init__(self, cfg_list): self.allocator_list = [] self.event_list = [] for cfg in cfg_list: event = Event() cfg.update({'poison': event}) self.allocator_list.append(Allocator(**cfg)) self.event_list.append(event) def start_all(self): """start all the allocators""" self.process_list = [] for allocator in self.allocator_list: process = Process(target=allocator.start) process.start() self.process_list.append(process) def stop_all(self, signal, frame): """stop all the allocators""" for event in self.event_list: event.set() for process in self.process_list: process.join() sys.exit() @classmethod def trigger(cls, cfg_list): """outer interface""" manager = cls(cfg_list) manager.start_all() signal.signal(signal.SIGINT, manager.stop_all) signal.signal(signal.SIGTERM, manager.stop_all) while True: # dead loop might meets many problem, better using a finite loop. time.sleep(2) manager.stop_all(None, None)
28.019231
105
0.617021
import sys import signal import time from multiprocessing import Process from allocator import Allocator, Event class Manager(object): def __init__(self, cfg_list): self.allocator_list = [] self.event_list = [] for cfg in cfg_list: event = Event() cfg.update({'poison': event}) self.allocator_list.append(Allocator(**cfg)) self.event_list.append(event) def start_all(self): self.process_list = [] for allocator in self.allocator_list: process = Process(target=allocator.start) process.start() self.process_list.append(process) def stop_all(self, signal, frame): for event in self.event_list: event.set() for process in self.process_list: process.join() sys.exit() @classmethod def trigger(cls, cfg_list): manager = cls(cfg_list) manager.start_all() signal.signal(signal.SIGINT, manager.stop_all) signal.signal(signal.SIGTERM, manager.stop_all) while True: time.sleep(2) manager.stop_all(None, None)
true
true
f7208c7f6012bde16b47b8b7a1531f00d2196076
1,084
py
Python
tests/test_creational/test_prototype.py
smartlegionlab/python-patterns
be898272e4358fa2e60ed9f61ce5ed10aa367e77
[ "BSD-3-Clause" ]
2
2021-11-17T21:35:49.000Z
2022-02-09T16:47:20.000Z
tests/test_creational/test_prototype.py
smartlegionlab/python-patterns
be898272e4358fa2e60ed9f61ce5ed10aa367e77
[ "BSD-3-Clause" ]
null
null
null
tests/test_creational/test_prototype.py
smartlegionlab/python-patterns
be898272e4358fa2e60ed9f61ce5ed10aa367e77
[ "BSD-3-Clause" ]
null
null
null
# -*- coding: utf-8 -*- # -------------------------------------------------------- # Licensed under the terms of the BSD 3-Clause License # (see LICENSE for details). # Copyright © 2018-2021, A.A Suvorov # All rights reserved. # -------------------------------------------------------- """Tests prototype.py""" from patterns.creational.prototype import Bird class TestPrototype: def test_register(self, prototype, bird): prototype.register('Bird', bird) assert 'Bird' in prototype._objects def test_unregister(self, prototype, bird): prototype.register('Bird', bird) prototype.unregister('Bird') assert 'Bird' not in prototype._objects def test_clone(self, prototype, bird): prototype.register('Bird', bird) duck = prototype.clone('Bird', {'name': 'Duck'}) assert isinstance(duck, Bird) def test_get_attr(self, prototype, bird): prototype.register('Bird', bird) duck = prototype.clone('Bird', {'name': 'Duck'}) assert getattr(duck, 'name') assert duck.name == 'Duck'
33.875
58
0.580258
from patterns.creational.prototype import Bird class TestPrototype: def test_register(self, prototype, bird): prototype.register('Bird', bird) assert 'Bird' in prototype._objects def test_unregister(self, prototype, bird): prototype.register('Bird', bird) prototype.unregister('Bird') assert 'Bird' not in prototype._objects def test_clone(self, prototype, bird): prototype.register('Bird', bird) duck = prototype.clone('Bird', {'name': 'Duck'}) assert isinstance(duck, Bird) def test_get_attr(self, prototype, bird): prototype.register('Bird', bird) duck = prototype.clone('Bird', {'name': 'Duck'}) assert getattr(duck, 'name') assert duck.name == 'Duck'
true
true
f7208ce7bbb8661f4bd13d02bdc81b7510d9775a
195
py
Python
Demo/log/example_log_error_file.py
quecpython/EC100Y-SDK
712c7eb7b54a3971009d94f6d6b21a6011d56f68
[ "MIT" ]
4
2021-01-28T01:30:59.000Z
2021-06-15T07:13:41.000Z
Demo/log/example_log_error_file.py
QuePython/EC100Y-SDK
712c7eb7b54a3971009d94f6d6b21a6011d56f68
[ "MIT" ]
null
null
null
Demo/log/example_log_error_file.py
QuePython/EC100Y-SDK
712c7eb7b54a3971009d94f6d6b21a6011d56f68
[ "MIT" ]
3
2021-04-07T09:55:59.000Z
2022-01-08T15:15:23.000Z
import log log.basicConfig(level=log.ERROR) # 设置日志输出级别 # 获取logger对象,如果不指定name则返回root对象,多次使用相同的name调用getLogger方法返回同一个logger对象 log = log.getLogger("error") log.error("Test error message!!")
21.666667
69
0.784615
import log log.basicConfig(level=log.ERROR) log = log.getLogger("error") log.error("Test error message!!")
true
true
f7208d45b1bd9c79cf4bba8f873334a67415881d
2,026
py
Python
Python3_Data_Structure/32_Python_Amortized_Analysis/00_Python_PAA.py
jmmedel/Python3-Data-Structure-References
3a607da2b67b5b80810d7084339e0602288c4f6b
[ "MIT" ]
null
null
null
Python3_Data_Structure/32_Python_Amortized_Analysis/00_Python_PAA.py
jmmedel/Python3-Data-Structure-References
3a607da2b67b5b80810d7084339e0602288c4f6b
[ "MIT" ]
null
null
null
Python3_Data_Structure/32_Python_Amortized_Analysis/00_Python_PAA.py
jmmedel/Python3-Data-Structure-References
3a607da2b67b5b80810d7084339e0602288c4f6b
[ "MIT" ]
null
null
null
""" Python - Amortized Analysis Amortized analysis involves estimating the run time for the sequence of operations in a program without taking into consideration the span of the data distribution in the input values. A simple example is finding a value in a sorted list is quicker than in an unsorted list. If the list is already sorted, it does not matter how distributed the data is. But of course the length of the list has an impact as it decides the number of steps the algorithm has to go through to get the final result. So we see that if the initial cost of a single step of obtaining a sorted list is high, then the cost of subsequent steps of finding an element becomes considerably low. So Amortized analysis helps us find a bound on the worst-case running time for a sequence of operations. There are three approaches to amortized analysis. Accounting Method − This involves assigning a cost to each operation performed. If the actual operation finishes quicker than the assigned time then some positive credit is accumulated in the analysis. In the reverse scenario it will be negative credit. To keep track of these accumulated credits, we use a stack or tree data structure. The operations which are carried out early ( like sorting the list) have high amortized cost but the operations that are late in sequence have lower amortized cost as the accumulated credit is utilized. So the amortized cost is an upper bound of actual cost. Potential Method − In this method the saved credit is utilized for future operations as mathematical function of the state of the data structure. The evaluation of the mathematical function and the amortized cost should be equal. So when the actual cost is greater than amortized cost there is a decrease in potential and it is used utilized for future operations which are expensive. Aggregate analysis − In this method we estimate the upper bound on the total cost of n steps. The amortized cost is a simple division of total cost and the number of steps (n).. """
106.631579
595
0.80306
true
true
f7208d73df1d4b1e754b10c36ce77d84bdc0b130
7,009
py
Python
loadgen/generate_load.py
hythloda/ecommerce-demo
83d23475677d546db59879452f3e388581ab88de
[ "Apache-2.0" ]
null
null
null
loadgen/generate_load.py
hythloda/ecommerce-demo
83d23475677d546db59879452f3e388581ab88de
[ "Apache-2.0" ]
null
null
null
loadgen/generate_load.py
hythloda/ecommerce-demo
83d23475677d546db59879452f3e388581ab88de
[ "Apache-2.0" ]
null
null
null
import barnum, random, time, json, requests, math, os from mysql.connector import connect, Error from kafka import KafkaProducer # CONFIG userSeedCount = 10000 itemSeedCount = 1000 purchaseGenCount = 500000 purchaseGenEveryMS = 100 pageviewMultiplier = 75 # Translates to 75x purchases, currently 750/sec or 65M/day itemInventoryMin = 1000 itemInventoryMax = 5000 itemPriceMin = 5 itemPriceMax = 500 mysqlHost = 'mysql' mysqlPort = '3306' mysqlUser = 'root' mysqlPass = 'debezium' kafkaHostPort = os.getenv('KAFKA_ADDR', 'kafka:9092') kafkaTopic = 'pageviews' debeziumHostPort = 'debezium:8083' channels = ['organic search', 'paid search', 'referral', 'social', 'display'] categories = ['widgets', 'gadgets', 'doodads', 'clearance'] # INSERT TEMPLATES item_insert = "INSERT INTO shop.items (name, category, price, inventory) VALUES ( %s, %s, %s, %s )" user_insert = "INSERT INTO shop.users (email, is_vip) VALUES ( %s, %s )" purchase_insert = "INSERT INTO shop.purchases (user_id, item_id, quantity, purchase_price) VALUES ( %s, %s, %s, %s )" #Initialize Debezium (Kafka Connect Component) requests.post(('http://%s/connectors' % debeziumHostPort), json={ "name": "mysql-connector", "config": { "connector.class": "io.debezium.connector.mysql.MySqlConnector", "database.hostname": mysqlHost, "database.port": mysqlPort, "database.user": mysqlUser, "database.password": mysqlPass, "database.server.name": mysqlHost, "database.server.id": '1234', "database.history.kafka.bootstrap.servers": kafkaHostPort, "database.history.kafka.topic": "mysql-history", "time.precision.mode": "connect" } } ) #Initialize Kafka producer = KafkaProducer(bootstrap_servers=[kafkaHostPort], value_serializer=lambda x: json.dumps(x).encode('utf-8')) def generatePageview(viewer_id, target_id, page_type): return { "user_id": viewer_id, "url": f'/{page_type}/{target_id}', "channel": random.choice(channels), "received_at": int(time.time()) } try: with connect( host=mysqlHost, user=mysqlUser, password=mysqlPass, ) as connection: with connection.cursor() as cursor: print("Initializing shop database...") cursor.execute('CREATE DATABASE IF NOT EXISTS shop;') cursor.execute( """CREATE TABLE IF NOT EXISTS shop.users ( id SERIAL PRIMARY KEY, email VARCHAR(255), is_vip BOOLEAN DEFAULT FALSE, created_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, updated_at DATETIME DEFAULT CURRENT_TIMESTAMP ON UPDATE CURRENT_TIMESTAMP );""" ) cursor.execute( """CREATE TABLE IF NOT EXISTS shop.items ( id SERIAL PRIMARY KEY, name VARCHAR(100), category VARCHAR(100), price DECIMAL(7,2), inventory INT, inventory_updated_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, created_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, updated_at DATETIME DEFAULT CURRENT_TIMESTAMP ON UPDATE CURRENT_TIMESTAMP );""" ) cursor.execute( """CREATE TABLE IF NOT EXISTS shop.purchases ( id SERIAL PRIMARY KEY, user_id BIGINT UNSIGNED REFERENCES user(id), item_id BIGINT UNSIGNED REFERENCES item(id), status TINYINT UNSIGNED DEFAULT 1, quantity INT UNSIGNED DEFAULT 1, purchase_price DECIMAL(12,2), created_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, updated_at DATETIME DEFAULT CURRENT_TIMESTAMP ON UPDATE CURRENT_TIMESTAMP );""" ) connection.commit() print("Seeding data...") cursor.executemany( item_insert, [ ( barnum.create_nouns(), random.choice(categories), random.randint(itemPriceMin*100,itemPriceMax*100)/100, random.randint(itemInventoryMin,itemInventoryMax) ) for i in range(itemSeedCount) ] ) cursor.executemany( user_insert, [ ( barnum.create_email(), (random.randint(0,10) > 8) ) for i in range(userSeedCount) ] ) connection.commit() print("Getting item ID and PRICEs...") cursor.execute("SELECT id, price FROM shop.items") item_prices = [(row[0], row[1]) for row in cursor] print("Preparing to loop + seed kafka pageviews and purchases") for i in range(purchaseGenCount): # Get a user and item to purchase purchase_item = random.choice(item_prices) purchase_user = random.randint(0,userSeedCount-1) purchase_quantity = random.randint(1,5) # Write purchaser pageview producer.send(kafkaTopic, key=str(purchase_user).encode('ascii'), value=generatePageview(purchase_user, purchase_item[0], 'products')) # Write random pageviews to products or profiles pageviewOscillator = int(pageviewMultiplier + (math.sin(time.time()/1000)*50)) for i in range(pageviewOscillator): rand_user = random.randint(0,userSeedCount) rand_page_type = random.choice(['products', 'profiles']) target_id_max_range = itemSeedCount if rand_page_type == 'products' else userSeedCount producer.send(kafkaTopic, key=str(rand_user).encode('ascii'), value=generatePageview(rand_user, random.randint(0,target_id_max_range), rand_page_type)) # Write purchase row cursor.execute( purchase_insert, ( purchase_user, purchase_item[0], purchase_quantity, purchase_item[1] * purchase_quantity ) ) connection.commit() #Pause time.sleep(purchaseGenEveryMS/1000) connection.close() except Error as e: print(e)
40.75
171
0.541304
import barnum, random, time, json, requests, math, os from mysql.connector import connect, Error from kafka import KafkaProducer userSeedCount = 10000 itemSeedCount = 1000 purchaseGenCount = 500000 purchaseGenEveryMS = 100 pageviewMultiplier = 75 itemInventoryMin = 1000 itemInventoryMax = 5000 itemPriceMin = 5 itemPriceMax = 500 mysqlHost = 'mysql' mysqlPort = '3306' mysqlUser = 'root' mysqlPass = 'debezium' kafkaHostPort = os.getenv('KAFKA_ADDR', 'kafka:9092') kafkaTopic = 'pageviews' debeziumHostPort = 'debezium:8083' channels = ['organic search', 'paid search', 'referral', 'social', 'display'] categories = ['widgets', 'gadgets', 'doodads', 'clearance'] item_insert = "INSERT INTO shop.items (name, category, price, inventory) VALUES ( %s, %s, %s, %s )" user_insert = "INSERT INTO shop.users (email, is_vip) VALUES ( %s, %s )" purchase_insert = "INSERT INTO shop.purchases (user_id, item_id, quantity, purchase_price) VALUES ( %s, %s, %s, %s )" requests.post(('http://%s/connectors' % debeziumHostPort), json={ "name": "mysql-connector", "config": { "connector.class": "io.debezium.connector.mysql.MySqlConnector", "database.hostname": mysqlHost, "database.port": mysqlPort, "database.user": mysqlUser, "database.password": mysqlPass, "database.server.name": mysqlHost, "database.server.id": '1234', "database.history.kafka.bootstrap.servers": kafkaHostPort, "database.history.kafka.topic": "mysql-history", "time.precision.mode": "connect" } } ) producer = KafkaProducer(bootstrap_servers=[kafkaHostPort], value_serializer=lambda x: json.dumps(x).encode('utf-8')) def generatePageview(viewer_id, target_id, page_type): return { "user_id": viewer_id, "url": f'/{page_type}/{target_id}', "channel": random.choice(channels), "received_at": int(time.time()) } try: with connect( host=mysqlHost, user=mysqlUser, password=mysqlPass, ) as connection: with connection.cursor() as cursor: print("Initializing shop database...") cursor.execute('CREATE DATABASE IF NOT EXISTS shop;') cursor.execute( """CREATE TABLE IF NOT EXISTS shop.users ( id SERIAL PRIMARY KEY, email VARCHAR(255), is_vip BOOLEAN DEFAULT FALSE, created_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, updated_at DATETIME DEFAULT CURRENT_TIMESTAMP ON UPDATE CURRENT_TIMESTAMP );""" ) cursor.execute( """CREATE TABLE IF NOT EXISTS shop.items ( id SERIAL PRIMARY KEY, name VARCHAR(100), category VARCHAR(100), price DECIMAL(7,2), inventory INT, inventory_updated_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, created_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, updated_at DATETIME DEFAULT CURRENT_TIMESTAMP ON UPDATE CURRENT_TIMESTAMP );""" ) cursor.execute( """CREATE TABLE IF NOT EXISTS shop.purchases ( id SERIAL PRIMARY KEY, user_id BIGINT UNSIGNED REFERENCES user(id), item_id BIGINT UNSIGNED REFERENCES item(id), status TINYINT UNSIGNED DEFAULT 1, quantity INT UNSIGNED DEFAULT 1, purchase_price DECIMAL(12,2), created_at TIMESTAMP DEFAULT CURRENT_TIMESTAMP, updated_at DATETIME DEFAULT CURRENT_TIMESTAMP ON UPDATE CURRENT_TIMESTAMP );""" ) connection.commit() print("Seeding data...") cursor.executemany( item_insert, [ ( barnum.create_nouns(), random.choice(categories), random.randint(itemPriceMin*100,itemPriceMax*100)/100, random.randint(itemInventoryMin,itemInventoryMax) ) for i in range(itemSeedCount) ] ) cursor.executemany( user_insert, [ ( barnum.create_email(), (random.randint(0,10) > 8) ) for i in range(userSeedCount) ] ) connection.commit() print("Getting item ID and PRICEs...") cursor.execute("SELECT id, price FROM shop.items") item_prices = [(row[0], row[1]) for row in cursor] print("Preparing to loop + seed kafka pageviews and purchases") for i in range(purchaseGenCount): purchase_item = random.choice(item_prices) purchase_user = random.randint(0,userSeedCount-1) purchase_quantity = random.randint(1,5) producer.send(kafkaTopic, key=str(purchase_user).encode('ascii'), value=generatePageview(purchase_user, purchase_item[0], 'products')) pageviewOscillator = int(pageviewMultiplier + (math.sin(time.time()/1000)*50)) for i in range(pageviewOscillator): rand_user = random.randint(0,userSeedCount) rand_page_type = random.choice(['products', 'profiles']) target_id_max_range = itemSeedCount if rand_page_type == 'products' else userSeedCount producer.send(kafkaTopic, key=str(rand_user).encode('ascii'), value=generatePageview(rand_user, random.randint(0,target_id_max_range), rand_page_type)) cursor.execute( purchase_insert, ( purchase_user, purchase_item[0], purchase_quantity, purchase_item[1] * purchase_quantity ) ) connection.commit() time.sleep(purchaseGenEveryMS/1000) connection.close() except Error as e: print(e)
true
true
f7208e835090cc50acccc601a70a34153f65abaf
549
py
Python
gcn/lp.py
liqimai/GraphConvForSSL
ef94a897292275680b1058685f2de9d4a8a6449c
[ "MIT" ]
74
2019-04-09T11:53:27.000Z
2022-03-24T09:22:30.000Z
gcn/lp.py
liqimai/GraphConvForSSL
ef94a897292275680b1058685f2de9d4a8a6449c
[ "MIT" ]
4
2019-07-11T08:47:29.000Z
2020-06-15T03:19:31.000Z
gcn/lp.py
liqimai/GraphConvForSSL
ef94a897292275680b1058685f2de9d4a8a6449c
[ "MIT" ]
16
2019-04-15T16:20:07.000Z
2022-03-07T08:42:26.000Z
import numpy as np from gcn.graphconv import ap_approximate def Model17(adj, alpha, y_train, y_test): k = int(np.ceil(4 * alpha)) prediction, time = ap_approximate(adj, y_train, alpha, k) predicted_labels = np.argmax(prediction, axis=1) prediction = np.zeros(prediction.shape) prediction[np.arange(prediction.shape[0]), predicted_labels] = 1 test_acc = np.sum(prediction * y_test) / np.sum(y_test) test_acc_of_class = np.sum(prediction * y_test, axis=0) / np.sum(y_test, axis=0) return test_acc, test_acc_of_class
36.6
84
0.717668
import numpy as np from gcn.graphconv import ap_approximate def Model17(adj, alpha, y_train, y_test): k = int(np.ceil(4 * alpha)) prediction, time = ap_approximate(adj, y_train, alpha, k) predicted_labels = np.argmax(prediction, axis=1) prediction = np.zeros(prediction.shape) prediction[np.arange(prediction.shape[0]), predicted_labels] = 1 test_acc = np.sum(prediction * y_test) / np.sum(y_test) test_acc_of_class = np.sum(prediction * y_test, axis=0) / np.sum(y_test, axis=0) return test_acc, test_acc_of_class
true
true
f7208e8a4a26e682a31e9e84d47b5e97601f74d8
173
py
Python
learning_greek/signals.py
lucafavatella/learning-greek
b29a96668992823e2ec89547b6c82fbbbb9af9f3
[ "MIT" ]
10
2015-04-10T06:35:01.000Z
2021-07-19T01:40:22.000Z
learning_greek/signals.py
lucafavatella/learning-greek
b29a96668992823e2ec89547b6c82fbbbb9af9f3
[ "MIT" ]
16
2015-02-08T16:39:01.000Z
2018-06-10T16:14:44.000Z
learning_greek/signals.py
lucafavatella/learning-greek
b29a96668992823e2ec89547b6c82fbbbb9af9f3
[ "MIT" ]
6
2015-02-12T18:56:40.000Z
2020-10-11T18:59:37.000Z
import django.dispatch adoption_level_change = django.dispatch.Signal(providing_args=["level", "request"]) blurb_read = django.dispatch.Signal(providing_args=["request"])
28.833333
83
0.797688
import django.dispatch adoption_level_change = django.dispatch.Signal(providing_args=["level", "request"]) blurb_read = django.dispatch.Signal(providing_args=["request"])
true
true
f7208edc797411262aa09c8538bfe7878909fc92
1,273
py
Python
test/test_sync_reports_rotate.py
Atomicology/isilon_sdk_python
91039da803ae37ed4abf8d2a3f59c333f3ef1866
[ "MIT" ]
null
null
null
test/test_sync_reports_rotate.py
Atomicology/isilon_sdk_python
91039da803ae37ed4abf8d2a3f59c333f3ef1866
[ "MIT" ]
null
null
null
test/test_sync_reports_rotate.py
Atomicology/isilon_sdk_python
91039da803ae37ed4abf8d2a3f59c333f3ef1866
[ "MIT" ]
null
null
null
# coding: utf-8 """ Copyright 2016 SmartBear Software Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. ref: https://github.com/swagger-api/swagger-codegen """ from __future__ import absolute_import import os import sys import unittest import swagger_client from swagger_client.rest import ApiException from swagger_client.models.sync_reports_rotate import SyncReportsRotate class TestSyncReportsRotate(unittest.TestCase): """ SyncReportsRotate unit test stubs """ def setUp(self): pass def tearDown(self): pass def testSyncReportsRotate(self): """ Test SyncReportsRotate """ model = swagger_client.models.sync_reports_rotate.SyncReportsRotate() if __name__ == '__main__': unittest.main()
25.979592
77
0.735271
from __future__ import absolute_import import os import sys import unittest import swagger_client from swagger_client.rest import ApiException from swagger_client.models.sync_reports_rotate import SyncReportsRotate class TestSyncReportsRotate(unittest.TestCase): def setUp(self): pass def tearDown(self): pass def testSyncReportsRotate(self): model = swagger_client.models.sync_reports_rotate.SyncReportsRotate() if __name__ == '__main__': unittest.main()
true
true
f7208fe4ecb7d3a8e41c130280425906b33dd803
47,072
py
Python
BioSTEAM 2.x.x/biorefineries/TAL/system_TAL_glucose.py
yoelcortes/Bioindustrial-Complex
d39edfec88e443ef7a62218ca0215e3b105f4b96
[ "MIT" ]
2
2020-01-03T21:04:41.000Z
2020-01-09T01:15:48.000Z
BioSTEAM 2.x.x/biorefineries/TAL/system_TAL_glucose.py
yoelcortes/Bioindustrial-Complex
d39edfec88e443ef7a62218ca0215e3b105f4b96
[ "MIT" ]
6
2020-01-03T21:31:27.000Z
2020-02-28T13:53:56.000Z
BioSTEAM 2.x.x/biorefineries/TAL/system_TAL_glucose.py
yoelcortes/Bioindustrial-Complex
d39edfec88e443ef7a62218ca0215e3b105f4b96
[ "MIT" ]
2
2020-01-07T14:04:06.000Z
2020-01-08T23:05:25.000Z
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # Bioindustrial-Park: BioSTEAM's Premier Biorefinery Models and Results # Copyright (C) 2022-2023, Sarang Bhagwat <sarangb2@illinois.edu> (this biorefinery) # # This module is under the UIUC open-source license. See # github.com/BioSTEAMDevelopmentGroup/biosteam/blob/master/LICENSE.txt # for license details. """ @author: sarangbhagwat Created on Sun Aug 23 12:11:15 2020 This module is a modified implementation of modules from the following: [1] Bhagwat et al., Sustainable Production of Acrylic Acid via 3-Hydroxypropionic Acid from Lignocellulosic Biomass. ACS Sustainable Chem. Eng. 2021, 9 (49), 16659–16669. https://doi.org/10.1021/acssuschemeng.1c05441 [2] Li et al., Sustainable Lactic Acid Production from Lignocellulosic Biomass. ACS Sustainable Chem. Eng. 2021, 9 (3), 1341–1351. https://doi.org/10.1021/acssuschemeng.0c08055 [3] Cortes-Peña et al., BioSTEAM: A Fast and Flexible Platform for the Design, Simulation, and Techno-Economic Analysis of Biorefineries under Uncertainty. ACS Sustainable Chem. Eng. 2020, 8 (8), 3302–3310. https://doi.org/10.1021/acssuschemeng.9b07040 All units are explicitly defined here for transparency and easy reference. Naming conventions: D = Distillation column AC = Adsorption column F = Flash tank or multiple-effect evaporator H = Heat exchange M = Mixer P = Pump (including conveying belt) R = Reactor S = Splitter (including solid/liquid separator) T = Tank or bin for storage U = Other units Processes: 100: Feedstock preprocessing 200: Pretreatment 300: Conversion 400: Separation 500: Wastewater treatment 600: Storage 700: Co-heat and power 800: Cooling utility generation 900: Miscellaneous facilities 1000: Heat exchanger network """ # %% Setup import biosteam as bst import thermosteam as tmo import flexsolve as flx import numpy as np from math import exp as math_exp # from biosteam import main_flowsheet as F # from copy import deepcopy # from biosteam import System from thermosteam import Stream # from biorefineries.cornstover import CellulosicEthanolTEA from biorefineries.TAL import units, facilities from biorefineries.TAL._process_specification import ProcessSpecification from biorefineries.TAL.process_settings import price, CFs from biorefineries.TAL.utils import find_split, splits_df, baseline_feedflow from biorefineries.TAL.chemicals_data import TAL_chemicals, chemical_groups, \ soluble_organics, combustibles # from biorefineries.TAL.tea import TALTEA from biorefineries.cornstover import CellulosicEthanolTEA as TALTEA from biosteam import SystemFactory from warnings import filterwarnings filterwarnings('ignore') Rxn = tmo.reaction.Reaction ParallelRxn = tmo.reaction.ParallelReaction # from lactic.hx_network import HX_Network # # Do this to be able to show more streams in a diagram # bst.units.Mixer._graphics.edge_in *= 2 bst.speed_up() flowsheet = bst.Flowsheet('TAL') bst.main_flowsheet.set_flowsheet(flowsheet) # Speeds up ShortcutDistillation bst.units.ShortcutColumn.minimum_guess_distillate_recovery = 0 # Baseline cost year is 2016 bst.CE = 541.7 # _labor_2007to2016 = 22.71 / 19.55 # Set default thermo object for the system tmo.settings.set_thermo(TAL_chemicals) # %% Utils R = 8.314 TAL_Hm = 30883.66976 # by Dannenfelser-Yalkowsky method TAL_Tm = TAL_chemicals['TAL'].Tm # 458.15 K TAL_c = 6056.69421768496 # fitted parameter TAL_c_by_R = TAL_c/R TAL_Hm_by_R = TAL_Hm/R def get_TAL_solubility_in_water(T): # mol TAL : mol (TAL+water) return math_exp(-(TAL_Hm_by_R) * (1/T - 1/TAL_Tm))/math_exp(TAL_c_by_R/T) def get_mol_TAL_dissolved(T, mol_water): TAL_x = get_TAL_solubility_in_water(T) return mol_water*TAL_x/(1-TAL_x) def get_TAL_solubility_in_water_gpL(T): return get_mol_TAL_dissolved(T, 1000./18.)*TAL_chemicals['TAL'].MW def get_K(chem_ID, stream, phase_1, phase_2): return (stream[phase_1].imol[chem_ID]/stream[phase_1].F_mol)/max(1e-6, (stream[phase_2].imol[chem_ID]/stream[phase_2].F_mol)) def get_TAL_solublity_in_solvent_very_rough(T, solvent_ID='Hexanol', units='g/L'): temp_stream =\ tmo.Stream('temp_stream_get_TAL_solublity_in_solvent_very_rough') mol_water = mol_solvent = 1000 mol_TAL = get_mol_TAL_dissolved(T, mol_water) temp_stream.imol['Water'] = mol_water temp_stream.imol[solvent_ID] = mol_solvent temp_stream.imol['TAL'] = mol_TAL temp_stream.lle(T=T, P=temp_stream.P) # temp_stream.show(N=100) phase_1 = 'l' if temp_stream.imol['l', solvent_ID] > temp_stream.imol['L', solvent_ID] else 'L' phase_2 = 'L' if phase_1=='l' else 'l' K_TAL_in_extract = get_K('TAL', temp_stream, phase_1, phase_2) # print(K_TAL_in_extract) if units=='g/L': temp_stream_2 = tmo.Stream('temp_stream_2_get_TAL_solublity_in_solvent_very_rough') temp_stream_2.imol['TAL'] = K_TAL_in_extract*mol_TAL temp_stream_2.imol[solvent_ID] = mol_solvent return temp_stream_2.imass['TAL']/temp_stream_2.F_vol elif units=='mol/mol': return K_TAL_in_extract*mol_TAL/(mol_TAL+mol_solvent) # def get_TAL_solubility_in_hexanol(): return 2.*0.0222/(2.*0.0222+0.951) # mol/mol; 2 * Marco's initial experimental solubility of 2.8 wt% at 21 C def get_TAL_solubility_in_ethanol_ww(): return 0.167682 # solubility of 157.425 g-TAL per L-ethanol # %% @SystemFactory(ID = 'TAL_sys') def create_TAL_sys(ins, outs): # %% # ============================================================================= # Feedstock # ============================================================================= # feedstock = Stream('feedstock', # baseline_feedflow.copy(), # units='kg/hr', # price=price['Feedstock']) feedstock = Stream('feedstock') feedstock.imass['Glucose'] = 29000. feedstock.imass['H2O'] = 500. feedstock.price = price['Glucose']*feedstock.imass['Glucose']/feedstock.F_mass feedstock.F_mass = 25802.9 # at the baseline, the amount of TAL produced would exactly satisfy the US demand for sorbic acid with a hypothetical 100% TAL->sorbic acid conversion. U101 = units.FeedstockPreprocessing('U101', ins=feedstock) # Handling costs/utilities included in feedstock cost thus not considered here U101.cost_items['System'].cost = 0 U101.cost_items['System'].kW = 0 # %% # ============================================================================= # Conversion streams # ============================================================================= # Flow and price will be updated in EnzymeHydrolysateMixer enzyme = Stream('enzyme', units='kg/hr', price=price['Enzyme']) # Used to adjust enzymatic hydrolysis solid loading, will be updated in EnzymeHydrolysateMixer enzyme_water = Stream('enzyme_water', units='kg/hr') # Corn steep liquor as nitrogen nutrient for microbes, flow updated in R301 CSL = Stream('CSL', units='kg/hr') # Lime for neutralization of produced acid # fermentation_lime = Stream('fermentation_lime', units='kg/hr') # For diluting concentrated, inhibitor-reduced hydrolysate dilution_water = Stream('dilution_water', units='kg/hr') # ============================================================================= # Conversion units # ============================================================================= # Cool hydrolysate down to fermentation temperature at 50°C H301 = bst.units.HXutility('H301', ins=U101-0, T=50+273.15) M304 = bst.units.Mixer('M304', ins=(H301-0, dilution_water)) M304.water_to_sugar_mol_ratio = 5. @M304.add_specification() def adjust_M304_water(): M304_ins_1 = M304.ins[1] M304_ins_1.imol['Water'] = M304.water_to_sugar_mol_ratio * M304.ins[0].imol['Glucose', 'Xylose'].sum() M304._run() # M304.specification = adjust_M304_water() M304_H = bst.units.HXutility('M304_H', ins=M304-0, T=30+273.15, rigorous=True) # Mix pretreatment hydrolysate/enzyme mixture with fermentation seed S302 = bst.Splitter('S302', ins=M304_H-0, outs = ('to_seedtrain', 'to_cofermentation'), split = 0.07) # split = inoculum ratio # Cofermentation R302 = units.CoFermentation('R302', ins=(S302-1, '', CSL), outs=('fermentation_effluent', 'CO2_fermentation')) def include_seed_CSL_in_cofermentation(): # note: effluent always has 0 CSL R302._run() R302.ins[2].F_mass*=1./(1-S302.split[0]) R302.specification = include_seed_CSL_in_cofermentation # ferm_ratio is the ratio of conversion relative to the fermenter R303 = units.SeedTrain('R303', ins=S302-0, outs=('seed', 'CO2_seedtrain'), ferm_ratio=0.95) T301 = units.SeedHoldTank('T301', ins=R303-0, outs=1-R302) # %% # ============================================================================= # Separation streams # ============================================================================= # This flow will be automatically updated in CellMassFilter # separation_sulfuric_acid = Stream('separation_sulfuric_acid', units='kg/hr') # # # To be mixed with sulfuric acid, will be updated in SulfuricAdditionTank # # separation_acid_water = Stream('separation_acid_water', units='kg/hr') # separation_DPHP = Stream('DPHP', DPHP =feedstock_dry_mass*22.1/1000*0.93, # H2O=feedstock_dry_mass*22.1/1000*0.07, units='kg/hr') # # Ethanol for esterification reaction, will be updated in the EsterificationReactor # separation_ethanol = Stream('separation_ethanol', Ethanol=feedstock_dry_mass*22.1/1000*0.93, # H2O=feedstock_dry_mass*22.1/1000*0.07, units='kg/hr') # For ester hydrolysis # separation_hydrolysis_water = Stream('separation_hydrolysis_water', units='kg/hr') Hexanol_minimal = Stream('Hexanol_minimal', units = 'kg/hr') # Heptane = Stream('Heptane', units = 'kg/hr') # Toluene = Stream('Toluene', units = 'kg/hr') # Hexanol_s = Stream('Hexanol_s', units = 'kg/hr') Heptane_s = Stream('Heptane_s', units = 'kg/hr') Toluene_s = Stream('Toluene_s', units = 'kg/hr') Hydrogen = Stream('Hydrogen', units = 'kg/hr') KOH = Stream('KOH', units = 'kg/hr') HCl = Stream('HCl', units = 'kg/hr') # ============================================================================= # Separation units # ============================================================================= # Fake unit to enable solid-liquid equilibrium for fermentation broth U401 = bst.Unit('U401', ins=R302-0, outs=('fermentation_broth_first_sle')) def U401_spec(): U401_ins_0 = U401.ins[0] tot_TAL = U401_ins_0.imol['TAL'] U401_outs_0 = U401.outs[0] U401_outs_0.copy_like(U401_ins_0) mol_TAL_dissolved = get_mol_TAL_dissolved(U401_outs_0.T, U401_outs_0.imol['Water']) # U401_outs_0.sle('TAL', U401_outs_0.T) #!!! TODO: use computationally cheaper way of changing from Stream to MultiStream U401_outs_0.phases=['s', 'l'] U401_outs_0.imol['l', 'TAL'] = min(mol_TAL_dissolved, tot_TAL) U401_outs_0.imol['s', 'TAL'] = tot_TAL - min(mol_TAL_dissolved, tot_TAL) U401.specification = U401_spec # Change broth temperature to adjust TAL solubility H401 = bst.HXutility('H401', ins=U401-0, outs=('H401_0'), T=273.15+70.) def H401_spec(): H401_ins_0 = H401.ins[0] H401_ins_0_water=H401_ins_0.imol['Water'] tot_TAL = H401_ins_0.imol['TAL'] # H401_spec_obj_fn = lambda T: get_TAL_solubility_in_water_gpL(T) -\ # H401_ins_0.imass['TAL']/H401_ins_0.F_vol H401_spec_obj_fn = lambda T: get_mol_TAL_dissolved(T, H401_ins_0_water) - tot_TAL H401.T = flx.IQ_interpolation(H401_spec_obj_fn, H401.ins[0].T, 99.+273.15) H401._run() H401_outs_0 = H401.outs[0] mol_TAL_dissolved = get_mol_TAL_dissolved(H401_outs_0.T, H401_outs_0.imol['Water']) # H401_outs_0.sle('TAL', H401_outs_0.T) #!!! TODO: use computationally cheaper way of changing from Stream to MultiStream H401_outs_0.phases = ('l', 's') H401_outs_0.imol['l', 'TAL'] = min(mol_TAL_dissolved, tot_TAL) H401_outs_0.imol['s', 'TAL'] = max(0., round(tot_TAL - min(mol_TAL_dissolved, tot_TAL), 5)) # H401_outs_0.imol['s', 'TAL'] = max(0.0001, tot_TAL - min(mol_TAL_dissolved, tot_TAL)) # if H401_outs_0.imol['s', 'TAL'] == 0.0001: # H401_ins_0.imol['s', 'TAL'] += 0.0001 H401.specification = H401_spec U402 = bst.FakeSplitter('U402', ins=H401-0, outs = ('thermally_decarboxylated_broth','vented_CO2')) U402.decarboxylation_rxns = ParallelRxn([ Rxn('TAL + H2O -> PD + CO2', 'TAL', 0.25), ]) def get_TAL_decarboxylation_conversion(T=273.15+80.): return (0.2*(T-273.15) + 8.)/100. # temporaury def U402_spec(): U402_outs_0 = U402.outs[0] U402_outs_0.copy_like(U402.ins[0]) U402_outs_0.phases = ('l', 's') U402.decarboxylation_rxns[0].X = get_TAL_decarboxylation_conversion(T=U402_outs_0.T) U402.decarboxylation_rxns[0](U402_outs_0['l']) U402.outs[1].imol['CO2'] = U402_outs_0.imol['l', 'CO2'] U402.outs[1].phase = 'g' U402_outs_0.imol['l', 'CO2'] = 0. U402.specification = U402_spec # H401_design_og = H401._design # def H401_design_modified(): # H401.ins[0].copy_like(U401.ins[0]) # H401.outs[0].copy_like(U401.ins[0]) # H401_design_og() # # Remove solids from fermentation broth, modified from the pressure filter in Humbird et al. S401_index = [splits_df.index[0]] + splits_df.index[2:].to_list() S401_cell_mass_split = [splits_df['stream_571'][0]] + splits_df['stream_571'][2:].to_list() S401_filtrate_split = [splits_df['stream_535'][0]] + splits_df['stream_535'][2:].to_list() S401 = bst.units.SolidsCentrifuge('S401', ins=U402-0, outs=('S401_solid_fraction', 'S401_liquid_fraction'), # moisture_content=0.50, split=find_split(S401_index, S401_cell_mass_split, S401_filtrate_split, chemical_groups), solids =\ ['Xylan', 'Glucan', 'Lignin', 'FermMicrobe',\ 'Ash', 'Arabinan', 'Galactan', 'Mannan']) # def S401_TAL_split_spec(): # S401._run() # S401_ins_0 = S401.ins[0] # TOT_TAL = S401_ins_0.imol['TAL'] # dissolved_TAL = get_mol_TAL_dissolved(S401_ins_0.T, S401_ins_0.imol['Water']) # S401.outs[0].imol['TAL'] = TOT_TAL - dissolved_TAL # crystallized TAL # S401.outs[1].imol['TAL'] = dissolved_TAL def S401_TAL_split_spec(): S401._run() S401_ins_0 = S401.ins[0] S401.outs[0].imol['TAL'] = S401_ins_0.imol['s', 'TAL'] S401.outs[1].imol['TAL'] = S401_ins_0.imol['l', 'TAL'] S401.specification = S401_TAL_split_spec H402 = bst.HXutility('H402', ins=S401-1, outs=('H402_0'), T=273.15+1.) # def HXcrystalize(stream, T=None, H=None, P=None, V=None): # tot_TAL = stream.imol['TAL'] # mol_TAL_dissolved = get_mol_TAL_dissolved(stream.T, stream.imol['Water']) # stream.phases = ('s', 'l') # stream.T = H402.T # tal_dissolved = min(mol_TAL_dissolved, tot_TAL) # stream.imol['l', 'TAL'] = # stream.imol['s', 'TAL'] = max(0.0001, tot_TAL - min(mol_TAL_dissolved, tot_TAL)) def H402_spec(): H402._run() H402_ins_0 = H402.ins[0] tot_TAL = H402_ins_0.imol['TAL'] H402_outs_0 = H402.outs[0] TAL_solubility = get_mol_TAL_dissolved(H402_outs_0.T, H402_outs_0.imol['Water']) H402_outs_0.phases = ('s', 'l') H402_outs_0.T = H402.T TAL_dissolved = min(TAL_solubility, tot_TAL) H402_outs_0.imol['l', 'TAL'] = TAL_dissolved H402_outs_0.imol['s', 'TAL'] = max(0, tot_TAL - TAL_dissolved) # H402_outs_0.imol['s', 'TAL'] = max(0.0001, tot_TAL - TAL_dissolved) # if H402_outs_0.imol['s', 'TAL'] == 0.0001: # H402_ins_0.imol['s', 'TAL'] += 0.0001 H402.specification = H402_spec S402 = bst.units.SolidsCentrifuge('S402', ins=H402-0, outs=('S402_solid_fraction', 'S402_liquid_fraction'), # moisture_content=0.50, split=find_split(S401_index, S401_cell_mass_split, S401_filtrate_split, chemical_groups), solids =\ ['Xylan', 'Glucan', 'Lignin', 'FermMicrobe',\ 'Ash', 'Arabinan', 'Galactan', 'Mannan']) def S402_TAL_split_spec(): # S402._run() # S402_ins_0 = S402.ins[0] # S402_outs_0 = S402.outs[0] # S402_outs_0.imol['TAL'] = 1. # S402_outs_0.sle('TAL', S402_outs_0.T) #!!! TODO: use computationally cheaper way of changing from Stream to MultiStream # S402_outs_0.imol['s', 'TAL'] = S402_ins_0.imol['s', 'TAL'] # S402_outs_0.imol['l', 'TAL'] = 0. # S402.outs[1].imol['TAL'] = S402_ins_0.imol['l', 'TAL'] S402_ins_0 = S402.ins[0] solid_TAL = float(S402_ins_0.imol['s', 'TAL']) S402_ins_0.imol['s', 'TAL'] = 0. S402._run() S402.outs[0].imol['TAL'] = solid_TAL S402.outs[1].imol['TAL'] = S402_ins_0.imol['l', 'TAL'] S402_ins_0.imol['s', 'TAL'] = solid_TAL S402.specification = S402_TAL_split_spec H403 = bst.HXutility('H403', ins=S402-0, outs=('heated_TAL'), T=273.15+40.) F401 = bst.Flash('F401', ins=H403-0, outs = ('volatiles', 'pure_TAL_product'), V = 0.99, P=101325.) def F401_spec(): F401_ins_0 = F401.ins[0] F401.V = sum(F401_ins_0.imol['H2O', 'AceticAcid', 'Furfural', 'HMF',]) / F401_ins_0.F_mol F401._run() # F401.outs[1].imol['TAL'] = F401.ins[0].imol['TAL'] # F401.outs[0].imol['TAL'] = 0. F401.specification = F401_spec # %% # ============================================================================= # Wastewater treatment streams # ============================================================================= # For aerobic digestion, flow will be updated in AerobicDigestion air_lagoon = Stream('air_lagoon', phase='g', units='kg/hr') # To neutralize nitric acid formed by nitrification in aerobic digestion # flow will be updated in AerobicDigestion # The active chemical is modeled as NaOH, but the price is cheaper than that of NaOH aerobic_caustic = Stream('aerobic_caustic', units='kg/hr', T=20+273.15, P=2*101325, price=price['Caustics']) # ============================================================================= # Wastewater treatment units # ============================================================================= # Mix waste liquids for treatment M501 = bst.units.Mixer('M501', ins=( # F301-1, S402-1, F401-0, # r_S402_s-1, r_S403_s-1, r_S404_s-1, # X401-1, S408-0, )) # This represents the total cost of wastewater treatment system WWT_cost = units.WastewaterSystemCost('WWTcost501', ins=M501-0) R501 = units.AnaerobicDigestion('R501', ins=WWT_cost-0, outs=('biogas', 'anaerobic_treated_water', 'anaerobic_sludge'), reactants=soluble_organics, split=find_split(splits_df.index, splits_df['stream_611'], splits_df['stream_612'], chemical_groups), T=35+273.15) get_flow_tpd = lambda: (feedstock.F_mass-feedstock.imass['H2O'])*24/907.185 # Mix recycled stream and wastewater after R501 M502 = bst.units.Mixer('M502', ins=(R501-1, '')) R502 = units.AerobicDigestion('R502', ins=(M502-0, air_lagoon, aerobic_caustic), outs=('aerobic_vent', 'aerobic_treated_water'), reactants=soluble_organics, ratio=get_flow_tpd()/2205) # Membrane bioreactor to split treated wastewater from R502 S501 = bst.units.Splitter('S501', ins=R502-1, outs=('membrane_treated_water', 'membrane_sludge'), split=find_split(splits_df.index, splits_df['stream_624'], splits_df['stream_625'], chemical_groups)) S501.line = 'Membrane bioreactor' # Recycled sludge stream of memberane bioreactor, the majority of it (96%) # goes to aerobic digestion and the rest to sludge holding tank then to BT S502 = bst.units.Splitter('S502', ins=S501-1, outs=('to_aerobic_digestion', 'to_boiler_turbogenerator'), split=0.96) M503 = bst.units.Mixer('M503', ins=(S502-0, 'centrate'), outs=1-M502) # Mix anaerobic and 4% of membrane bioreactor sludge M504 = bst.units.Mixer('M504', ins=(R501-2, S502-1)) # Sludge centrifuge to separate water (centrate) from sludge S503 = bst.units.Splitter('S503', ins=M504-0, outs=(1-M503, 'sludge'), split=find_split(splits_df.index, splits_df['stream_616'], splits_df['stream_623'], chemical_groups)) S503.line = 'Sludge centrifuge' # Reverse osmosis to treat membrane separated water S504 = bst.units.Splitter('S504', ins=S501-0, outs=('discharged_water', 'waste_brine'), split=find_split(splits_df.index, splits_df['stream_626'], splits_df['stream_627'], chemical_groups)) S504.line = 'Reverse osmosis' # Mix solid wastes to boiler turbogenerator M505 = bst.units.Mixer('M505', ins=(S503-1, # S301-0, S401-0, # F401-0, D401-0, ), outs='wastes_to_boiler_turbogenerator') # %% # ============================================================================= # Facilities streams # ============================================================================= sulfuric_acid_fresh = Stream('sulfuric_acid_fresh', price=price['Sulfuric acid']) # TCP_fresh = Stream('TCP_fresh', price=price['TCP']) ammonia_fresh = Stream('ammonia_fresh', price=price['AmmoniumHydroxide']) CSL_fresh = Stream('CSL_fresh', price=price['CSL']) # lime_fresh = Stream('lime_fresh', price=price['Lime']) HCl_fresh = Stream('HCl_fresh', price=price['HCl']) hexanol_fresh = Stream('hexanol_fresh', price=price['Hexanol']) # heptane_fresh = Stream('heptane_fresh', price=price['Heptane']) # toluene_fresh = Stream('toluene_fresh', price=price['Toluene']) # hexanol_fresh_s = Stream('hexanol_fresh_s', price=price['Hexanol']) heptane_fresh_s = Stream('heptane_fresh_s', price=price['Heptane']) toluene_fresh_s = Stream('toluene_fresh_s', price=price['Toluene']) hydrogen_fresh = Stream('hydrogen_fresh', price=price['Hydrogen']) KOH_fresh = Stream('KOH_fresh', price=price['KOH']) # S401_out1_F_mass = S401.outs[1].F_mass # if not (S401_out1_F_mass == 0): # ethanol_fresh = Stream('ethanol_fresh', Ethanol = 0.24 * S401_out1_F_mass, units='kg/hr', price=price['Ethanol']) - M401.ins[3].imass['Ethanol'] # DPHP_fresh = Stream('DPHP_fresh', DPHP = 0.25 * S401_out1_F_mass, units='kg/hr', price=price['DPHP']) - M401.ins[3].imass['Dipotassium hydrogen phosphate'] # else: # ethanol_fresh = Stream('ethanol_fresh', Ethanol = get_feedstock_dry_mass()*48*22.1/1000*0.93, units='kg/hr', price=price['Ethanol']) # DPHP_fresh = Stream('DPHP_fresh', DPHP = get_feedstock_dry_mass()*50*22.1/1000*0.93, units='kg/hr', price=price['DPHP']) # Water used to keep system water usage balanced system_makeup_water = Stream('system_makeup_water', price=price['Makeup water']) # TAL stream # TAL = Stream('TAL', units='kg/hr', price=price['TAL']) # SA product SA = Stream('SA', units='kg/hr', price=price['SA']) # Acetoin product # Acetoin = Stream('Acetoin', units='kg/hr', price=price['Acetoin']) # # Isobutyraldehyde product # IBA = Stream('IBA', units='kg/hr', price=price['IBA']) # Chemicals used/generated in BT # FGD_lime = Stream('FGD_lime') ash = Stream('ash', price=price['Ash disposal']) # boiler_chems = Stream('boiler_chems', price=price['Boiler chems']) # baghouse_bag = Stream('baghouse_bag', price=price['Baghouse bag']) # Supplementary natural gas for BT if produced steam not enough for regenerating # all steam streams required by the system # natural_gas = Stream('natural_gas', price=price['Natural gas']) # Cooling tower chemicals cooling_tower_chems = Stream('cooling_tower_chems', price=price['Cooling tower chems']) # 145 based on equipment M-910 (clean-in-place system) in Humbird et al. CIP_chems_in = Stream('CIP_chems_in', Water=145*get_flow_tpd()/2205, units='kg/hr') # 1372608 based on stream 950 in Humbird et al. # Air needed for multiple processes (including enzyme production that was not included here), # not rigorously modeled, only scaled based on plant size plant_air_in = Stream('plant_air_in', phase='g', units='kg/hr', N2=0.79*1372608*get_flow_tpd()/2205, O2=0.21*1372608*get_flow_tpd()/2205) # 8021 based on stream 713 in Humbird et al. fire_water_in = Stream('fire_water_in', Water=8021*get_flow_tpd()/2205, units='kg/hr') # ============================================================================= # Facilities units # ============================================================================= # T601 = units.SulfuricAcidStorageTank('T601', ins=sulfuric_acid_fresh, # outs=sulfuric_acid_T201) # T601.line = 'Sulfuric acid storage tank' # S601 = bst.units.ReversedSplitter('S601', ins=T601-0, # outs=(pretreatment_sulfuric_acid, # '')) # T608 = units.TCPStorageTank('T608', ins=TCP_fresh, # outs='TCP_catalyst') # T608-0-3-R401 # T608.line = 'Tricalcium diphosphate storage tank' # # T602 = units.AmmoniaStorageTank('T602', ins=ammonia_fresh, outs=ammonia_M205) # T602.line = 'Ammonia storage tank' T603 = units.CSLstorageTank('T603', ins=CSL_fresh, outs=CSL) T603.line = 'CSL storage tank' # DPHP storage #!!! Yalin suggests to use BioSTEAM's storage tank, and maybe we don't need the ConveryingBelt # (Yalin removed that from lactic acid biorefinery) T604 = units.DPHPStorageTank('T604', ins=hexanol_fresh) T604.line = 'Hexanol storage tank' T604_P = units.TALPump('T604_P', ins=T604-0, outs = Hexanol_minimal) # T604_P = bst.units.ConveyingBelt('T604_P', ins=T604-0, outs = Hexanol) # # 7-day storage time, similar to ethanol's in Humbird et al. # T605 = units.DPHPStorageTank('T605', ins=heptane_fresh) # T605.line = 'Heptane storage tank' # T605_P = units.TALPump('T605_P', ins=T605-0, outs = Heptane) # T606 = units.DPHPStorageTank('T606', ins=toluene_fresh) # T606.line = 'Toluene storage tank' # T606_P = units.TALPump('T606_P', ins=T606-0, outs = Toluene) T607 = units.DPHPStorageTank('T607', ins=hydrogen_fresh, outs = Hydrogen) T607.line = 'Hydrogen storage tank' T608 = units.DPHPStorageTank('T608', ins=HCl_fresh, outs = HCl, vessel_material = 'Stainless steel') T608.line = 'HCl storage tank' T609 = units.DPHPStorageTank('T609', ins=KOH_fresh, outs = KOH, vessel_material = 'Stainless steel') T609.line = 'KOH storage tank' # T604_s = units.DPHPStorageTank('T604_s', ins=hexanol_fresh_s) # T604_s.line = 'Hexanol storage tank s' # T604_s_P = units.TALPump('T604_s_P', ins=T604_s-0, outs = Hexanol_s) # 7-day storage time, similar to ethanol's in Humbird et al. T605_s = units.DPHPStorageTank('T605_s', ins=heptane_fresh_s) T605_s.line = 'Heptane storage tank s' T605_s_P = units.TALPump('T605_s_P', ins=T605_s-0, outs = Heptane_s) T606_s = units.DPHPStorageTank('T606_s', ins=toluene_fresh_s) T606_s.line = 'Toluene storage tank s' T606_s_P = units.TALPump('T606_s_P', ins=T606_s-0, outs = Toluene_s) # T607_P = units.TALPump('T607_P', ins=T607-0, outs = Hydrogen) # Connections to ATPE Mixer # T604_P-0-1-M401 # T605_P-0-2-M401 # 7-day storage time, similar to ethanol's in Humbird et al. T620 = units.TALStorageTank('T620', ins=F401-1, tau=7*24, V_wf=0.9, vessel_type='Floating roof', vessel_material='Stainless steel') T620.line = 'SAStorageTank' T620_P = units.TALPump('T620_P', ins=T620-0, outs=SA) # # 7-day storage time, similar to ethanol's in Humbird et al. # T607 = units.TALStorageTank('T607', ins=D402_H-0, tau=7*24, V_wf=0.9, # vessel_type='Floating roof', # vessel_material='Stainless steel') # T607.line = 'AcetoinStorageTank' # T607_P = units.TALPump('T607_P', ins=T607-0, outs=Acetoin) # # 7-day storage time, similar to ethanol's in Humbird et al. # T608 = units.TALStorageTank('T608', ins=D403_H-0, tau=7*24, V_wf=0.9, # vessel_type='Floating roof', # vessel_material='Stainless steel') # T608.line = 'IBAStorageTank' # T608_P = units.TALPump('T608_P', ins=T608-0, outs=IBA) CIP = facilities.CIP('CIP901', ins=CIP_chems_in, outs='CIP_chems_out') ADP = facilities.ADP('ADP902', ins=plant_air_in, outs='plant_air_out', ratio=get_flow_tpd()/2205) FWT = units.FireWaterTank('FWT903', ins=fire_water_in, outs='fire_water_out') CWP = facilities.CWP('CWP802', ins='return_chilled_water', outs='process_chilled_water') # M505-0 is the liquid/solid mixture, R501-0 is the biogas, blowdown is discharged # BT = facilities.BT('BT', ins=(M505-0, R501-0, # FGD_lime, boiler_chems, # baghouse_bag, natural_gas, # 'BT_makeup_water'), # B_eff=0.8, TG_eff=0.85, # combustibles=combustibles, # side_streams_to_heat=(water_M201, water_M202, steam_M203), # outs=('gas_emission', ash, 'boiler_blowdown_water')) BT = bst.facilities.BoilerTurbogenerator('BT701', ins=(M505-0, R501-0, 'boiler_makeup_water', 'natural_gas', 'lime', 'boilerchems'), outs=('gas_emission', 'boiler_blowdown_water', ash,), turbogenerator_efficiency=0.85) # BT = bst.BDunits.BoilerTurbogenerator('BT', # ins=(M505-0, R501-0, 'boiler_makeup_water', 'natural_gas', FGD_lime, boiler_chems), # boiler_efficiency=0.80, # turbogenerator_efficiency=0.85) # Blowdown is discharged CT = facilities.CT('CT801', ins=('return_cooling_water', cooling_tower_chems, 'CT_makeup_water'), outs=('process_cooling_water', 'cooling_tower_blowdown')) # All water used in the system, here only consider water usage, # if heating needed, then heeating duty required is considered in BT process_water_streams = (enzyme_water, aerobic_caustic, CIP.ins[-1], BT.ins[-1], CT.ins[-1]) PWC = facilities.PWC('PWC904', ins=(system_makeup_water, S504-0), process_water_streams=process_water_streams, recycled_blowdown_streams=None, outs=('process_water', 'discharged_water')) # Heat exchanger network from hxn._heat_exchanger_network import HeatExchangerNetwork # from biosteam import HeatExchangerNetwork HXN = HeatExchangerNetwork('HXN1001', # ignored=[H401, H402], ) def HXN_no_run_cost(): HXN.heat_utilities = tuple() HXN._installed_cost = 0. # To simulate without HXN, uncomment the following 3 lines: # HXN._cost = HXN_no_run_cost # HXN.energy_balance_percent_error = 0. # HXN.new_HXs = HXN.new_HX_utils = [] # HXN = HX_Network('HXN') # %% # ============================================================================= # Complete system # ============================================================================= TAL_sys = create_TAL_sys() f = bst.main_flowsheet u = f.unit s = f.stream feedstock = s.feedstock SA = s.SA get_flow_tpd = lambda: (feedstock.F_mass-feedstock.imass['H2O'])*24/907.185 TEA_feeds = set([i for i in TAL_sys.feeds if i.price]+ \ [i for i in TAL_sys.feeds if i.price]) TEA_products = set([i for i in TAL_sys.products if i.price]+ \ [i for i in TAL_sys.products if i.price]+[SA]) for ui in u: globals().update({ui.ID: ui}) # %% # ============================================================================= # TEA # ============================================================================= # TAL_tea = CellulosicEthanolTEA(system=TAL_sys, IRR=0.10, duration=(2016, 2046), # depreciation='MACRS7', income_tax=0.21, operating_days=0.9*365, # lang_factor=None, construction_schedule=(0.08, 0.60, 0.32), # startup_months=3, startup_FOCfrac=1, startup_salesfrac=0.5, # startup_VOCfrac=0.75, WC_over_FCI=0.05, # finance_interest=0.08, finance_years=10, finance_fraction=0.4, # # biosteam Splitters and Mixers have no cost, # # cost of all wastewater treatment units are included in WWT_cost, # # BT is not included in this TEA # OSBL_units=(u.U101, u.WWT_cost, # u.T601, u.T602, u.T603, u.T606, u.T606_P, # u.CWP, u.CT, u.PWC, u.CIP, u.ADP, u.FWT, u.BT), # warehouse=0.04, site_development=0.09, additional_piping=0.045, # proratable_costs=0.10, field_expenses=0.10, construction=0.20, # contingency=0.10, other_indirect_costs=0.10, # labor_cost=3212962*get_flow_tpd()/2205, # labor_burden=0.90, property_insurance=0.007, maintenance=0.03, # steam_power_depreciation='MACRS20', boiler_turbogenerator=u.BT) # TAL_no_BT_tea = TAL_tea TAL_tea = TALTEA(system=TAL_sys, IRR=0.10, duration=(2016, 2046), depreciation='MACRS7', income_tax=0.21, operating_days=0.9*365, lang_factor=None, construction_schedule=(0.08, 0.60, 0.32), startup_months=3, startup_FOCfrac=1, startup_salesfrac=0.5, startup_VOCfrac=0.75, WC_over_FCI=0.05, finance_interest=0.08, finance_years=10, finance_fraction=0.4, # biosteam Splitters and Mixers have no cost, # cost of all wastewater treatment units are included in WWT_cost, # BT is not included in this TEA OSBL_units=(u.U101, u.WWTcost501, # u.T601, u.T602, u.T603, u.T604, u.T620, # u.T606, u.T606_P, u.CWP802, u.CT801, u.PWC904, u.CIP901, u.ADP902, u.FWT903, u.BT701), warehouse=0.04, site_development=0.09, additional_piping=0.045, proratable_costs=0.10, field_expenses=0.10, construction=0.20, contingency=0.10, other_indirect_costs=0.10, labor_cost=3212962*get_flow_tpd()/2205, labor_burden=0.90, property_insurance=0.007, maintenance=0.03, steam_power_depreciation='MACRS20', boiler_turbogenerator=u.BT701) TAL_no_BT_tea = TAL_tea # # Removed because there is not double counting anyways. # # Removes feeds/products of BT_sys from TAL_sys to avoid double-counting # for i in BT_sys.feeds: # TAL_sys.feeds.remove(i) # for i in BT_sys.products: # TAL_sys.products.remove(i) # Boiler turbogenerator potentially has different depreciation schedule # BT_tea = bst.TEA.like(BT_sys, TAL_no_BT_tea) # BT_tea.labor_cost = 0 # Changed to MACRS 20 to be consistent with Humbird # BT_tea.depreciation = 'MACRS20' # BT_tea.OSBL_units = (BT,) # %% # ============================================================================= # Simulate system and get results # ============================================================================= # def get_TAL_MPSP(): # TAL_sys.simulate() # for i in range(3): # TAL.price = TAL_tea.solve_price(TAL, TAL_no_BT_tea) # return TAL.price def get_SA_MPSP(): for i in range(3): TAL_sys.simulate() for i in range(3): SA.price = TAL_tea.solve_price(SA) return SA.price*SA.F_mass/SA.imass['TAL'] def get_titer(): return R302.outs[0].imass['TAL']/R302.outs[0].F_vol def set_titer(titer): M304.water_multiplier *= get_titer()/titer get_SA_MPSP() return get_titer() # get_SA_MPSP() # R301 = F('R301') # Fermentor # yearly_production = 125000 # ton/yr spec = ProcessSpecification( evaporator = None, pump = None, mixer = u.M304, heat_exchanger = u.M304_H, seed_train_system = [], reactor= u.R302, reaction_name='fermentation_reaction', substrates=('Xylose', 'Glucose'), products=('TAL',), spec_1=0.19, spec_2=28., spec_3=0.19, xylose_utilization_fraction = 0.80, feedstock = feedstock, dehydration_reactor = None, byproduct_streams = [], HXN = u.HXN1001, maximum_inhibitor_concentration = 1., # pre_conversion_units = process_groups_dict['feedstock_group'].units + process_groups_dict['pretreatment_group'].units + [u.H301], # if the line below does not work (depends on BioSTEAM version) pre_conversion_units = TAL_sys.split(u.M304.ins[0])[0], # set baseline fermentation performance here baseline_yield = 0.19, baseline_titer = 28., baseline_productivity = 0.19, # baseline_yield = 0.30, # baseline_titer = 25., # baseline_productivity = 0.19, feedstock_mass = feedstock.F_mass, pretreatment_reactor = None) spec.load_spec_1 = spec.load_yield # spec.load_spec_2 = spec.load_titer spec.load_spec_3 = spec.load_productivity def M304_titer_obj_fn(water_to_sugar_mol_ratio): M304, R302 = u.M304, u.R302 M304.water_to_sugar_mol_ratio = water_to_sugar_mol_ratio M304.specification[0][0]() u.M304_H._run() u.S302._run() u.R303._run() u.T301._run() R302.specification[0][0]() # broth = R302.outs[0] # return broth.imass['TAL']/broth.F_vol - R302.titer_to_load return R302.effluent_titer - R302.titer_to_load def load_titer_with_glucose(titer_to_load): spec.spec_2 = titer_to_load u.R302.titer_to_load = titer_to_load flx.IQ_interpolation(M304_titer_obj_fn, 1e-3, 20000.) # u.AC401.regeneration_velocity = min(14.4, 3.1158 + ((14.4-3.1158)/(30.-3.))*(titer_to_load-3.)) # heuristic to obtain regeneration velocity at which MPSP is minimum fitted to results from simulations at target_recovery=0.99 # u.AC401.regeneration_velocity = 14.4 spec.load_spec_2 = load_titer_with_glucose # path = (F301, R302) # @np.vectorize # def calculate_titer(V): # F301.V = V # for i in path: i._run() # return spec._calculate_titer() # @np.vectorize # def calculate_MPSP(V): # F301.V = V # TAL_sys.simulate() # MPSP = SA.price = TAL_tea.solve_price(SA, TAL_no_BT_tea) # return MPSP # vapor_fractions = np.linspace(0.20, 0.80) # titers = calculate_titer(vapor_fractions) # MPSPs = calculate_MPSP(vapor_fractions) # import matplotlib.pyplot as plt # plt.plot(vapor_fractions, titers) # plt.show() # plt.plot(titers, MPSPs) # plt.show() # %% # ============================================================================= # Life cycle analysis (LCA), waste disposal emission not included # ============================================================================= # 100-year global warming potential (GWP) from material flows LCA_streams = TEA_feeds.copy() LCA_stream = Stream('LCA_stream', units='kg/hr') def get_material_GWP(): LCA_stream.mass = sum(i.mass for i in LCA_streams) chemical_GWP = LCA_stream.mass*CFs['GWP_CF_stream'].mass # feedstock_GWP = feedstock.F_mass*CFs['GWP_CFs']['Corn stover'] return chemical_GWP.sum()/SA.F_mass # GWP from combustion of non-biogenic carbons get_non_bio_GWP = lambda: (natural_gas.get_atomic_flow('C'))* TAL_chemicals.CO2.MW / SA.F_mass # +ethanol_fresh.get_atomic_flow('C')) \ # GWP from electricity get_electricity_use = lambda: sum(i.power_utility.rate for i in TAL_sys.units) get_electricity_GWP = lambda: get_electricity_use()*CFs['GWP_CFs']['Electricity'] \ / SA.F_mass # CO2 fixed in lactic acid product get_fixed_GWP = lambda: \ SA.get_atomic_flow('C')*TAL_chemicals.CO2.MW/SA.F_mass # carbon_content_of_feedstock = 0 get_GWP = lambda: get_material_GWP()+get_non_bio_GWP()+get_electricity_GWP() # Fossil energy consumption (FEC) from materials def get_material_FEC(): LCA_stream.mass = sum(i.mass for i in LCA_streams) chemical_FEC = LCA_stream.mass*CFs['FEC_CF_stream'].mass # feedstock_FEC = feedstock.F_mass*CFs['FEC_CFs']['Corn stover'] return chemical_FEC.sum()/SA.F_mass # FEC from electricity get_electricity_FEC = lambda: \ get_electricity_use()*CFs['FEC_CFs']['Electricity']/SA.F_mass # Total FEC get_FEC = lambda: get_material_FEC()+get_electricity_FEC() # get_SPED = lambda: BT.system_heating_demand*0.001/SA.F_mass SA_LHV = 31.45 # MJ/kg SA # %% Full analysis def simulate_and_print(): get_SA_MPSP() print('\n---------- Simulation Results ----------') print(f'MPSP is ${get_SA_MPSP():.3f}/kg') # print(f'GWP is {get_GWP():.3f} kg CO2-eq/kg SA') # print(f'FEC is {get_FEC():.2f} MJ/kg SA or {get_FEC()/SA_LHV:.2f} MJ/MJ SA') # print(f'SPED is {get_SPED():.2f} MJ/kg SA or {get_SPED()/SA_LHV:.2f} MJ/MJ SA') # print('--------------------\n') # simulate_and_print() # TAL_sys.simulate() get_SA_MPSP() spec.load_specifications(0.203, 35.9, 0.21) simulate_and_print() # %% # ============================================================================= # For Monte Carlo and analyses # ============================================================================= TAL_sub_sys = { # 'feedstock_sys': (U101,), # 'pretreatment_sys': (T201, M201, M202, M203, # R201, R201_H, T202, T203, # F201, F201_H, # M204, T204, T204_P, # M205, M205_P), # 'conversion_sys': (H301, M301, M302, R301, R302, T301), # 'separation_sys': (S401, M401, M401_P, # S402, # # F401, F401_H, X401, # D401, D401_H, D401_P, S403, # M402_P, S403, # D403, D403_H, D403_P, # M501, # T606, T606_P, T607, T607_P) # F402, F402_H, F402_P, # D405, D405_H1, D405_H2, D405_P, # M401, M401_P) # 'wastewater_sys': (M501, WWT_cost, R501, # M502, R502, S501, S502, M503, # M504, S503, S504, M505), # 'HXN': (HXN,), # 'BT': (BT,), # 'CT': (CT,), # 'other_facilities': (T601, S601, # T602, T603, # T604, T604_P, # T605, T605_P, # T606, T606_P, # PWC, CIP, ADP, FWT) } # for unit in sum(TAL_sub_sys.values(), ()): # if not unit in TAL_sys.units: # print(f'{unit.ID} not in TAL_sys.units') # for unit in TAL_sys.units: # if not unit in sum(TAL_sub_sys.values(), ()): # print(f'{unit.ID} not in TAL_sub_sys')
42.560579
252
0.574312
# Copyright (C) 2022-2023, Sarang Bhagwat <sarangb2@illinois.edu> (this biorefinery) # # This module is under the UIUC open-source license. See # github.com/BioSTEAMDevelopmentGroup/biosteam/blob/master/LICENSE.txt # for license details. # %% Setup import biosteam as bst import thermosteam as tmo import flexsolve as flx import numpy as np from math import exp as math_exp # from biosteam import main_flowsheet as F # from copy import deepcopy # from biosteam import System from thermosteam import Stream # from biorefineries.cornstover import CellulosicEthanolTEA from biorefineries.TAL import units, facilities from biorefineries.TAL._process_specification import ProcessSpecification from biorefineries.TAL.process_settings import price, CFs from biorefineries.TAL.utils import find_split, splits_df, baseline_feedflow from biorefineries.TAL.chemicals_data import TAL_chemicals, chemical_groups, \ soluble_organics, combustibles # from biorefineries.TAL.tea import TALTEA from biorefineries.cornstover import CellulosicEthanolTEA as TALTEA from biosteam import SystemFactory from warnings import filterwarnings filterwarnings('ignore') Rxn = tmo.reaction.Reaction ParallelRxn = tmo.reaction.ParallelReaction # from lactic.hx_network import HX_Network # # Do this to be able to show more streams in a diagram # bst.units.Mixer._graphics.edge_in *= 2 bst.speed_up() flowsheet = bst.Flowsheet('TAL') bst.main_flowsheet.set_flowsheet(flowsheet) # Speeds up ShortcutDistillation bst.units.ShortcutColumn.minimum_guess_distillate_recovery = 0 # Baseline cost year is 2016 bst.CE = 541.7 # _labor_2007to2016 = 22.71 / 19.55 # Set default thermo object for the system tmo.settings.set_thermo(TAL_chemicals) # %% Utils R = 8.314 TAL_Hm = 30883.66976 # by Dannenfelser-Yalkowsky method TAL_Tm = TAL_chemicals['TAL'].Tm # 458.15 K TAL_c = 6056.69421768496 # fitted parameter TAL_c_by_R = TAL_c/R TAL_Hm_by_R = TAL_Hm/R def get_TAL_solubility_in_water(T): # mol TAL : mol (TAL+water) return math_exp(-(TAL_Hm_by_R) * (1/T - 1/TAL_Tm))/math_exp(TAL_c_by_R/T) def get_mol_TAL_dissolved(T, mol_water): TAL_x = get_TAL_solubility_in_water(T) return mol_water*TAL_x/(1-TAL_x) def get_TAL_solubility_in_water_gpL(T): return get_mol_TAL_dissolved(T, 1000./18.)*TAL_chemicals['TAL'].MW def get_K(chem_ID, stream, phase_1, phase_2): return (stream[phase_1].imol[chem_ID]/stream[phase_1].F_mol)/max(1e-6, (stream[phase_2].imol[chem_ID]/stream[phase_2].F_mol)) def get_TAL_solublity_in_solvent_very_rough(T, solvent_ID='Hexanol', units='g/L'): temp_stream =\ tmo.Stream('temp_stream_get_TAL_solublity_in_solvent_very_rough') mol_water = mol_solvent = 1000 mol_TAL = get_mol_TAL_dissolved(T, mol_water) temp_stream.imol['Water'] = mol_water temp_stream.imol[solvent_ID] = mol_solvent temp_stream.imol['TAL'] = mol_TAL temp_stream.lle(T=T, P=temp_stream.P) # temp_stream.show(N=100) phase_1 = 'l' if temp_stream.imol['l', solvent_ID] > temp_stream.imol['L', solvent_ID] else 'L' phase_2 = 'L' if phase_1=='l' else 'l' K_TAL_in_extract = get_K('TAL', temp_stream, phase_1, phase_2) # print(K_TAL_in_extract) if units=='g/L': temp_stream_2 = tmo.Stream('temp_stream_2_get_TAL_solublity_in_solvent_very_rough') temp_stream_2.imol['TAL'] = K_TAL_in_extract*mol_TAL temp_stream_2.imol[solvent_ID] = mol_solvent return temp_stream_2.imass['TAL']/temp_stream_2.F_vol elif units=='mol/mol': return K_TAL_in_extract*mol_TAL/(mol_TAL+mol_solvent) # def get_TAL_solubility_in_hexanol(): return 2.*0.0222/(2.*0.0222+0.951) # mol/mol; 2 * Marco's initial experimental solubility of 2.8 wt% at 21 C def get_TAL_solubility_in_ethanol_ww(): return 0.167682 @SystemFactory(ID = 'TAL_sys') def create_TAL_sys(ins, outs): feedstock = Stream('feedstock') feedstock.imass['Glucose'] = 29000. feedstock.imass['H2O'] = 500. feedstock.price = price['Glucose']*feedstock.imass['Glucose']/feedstock.F_mass feedstock.F_mass = 25802.9 U101 = units.FeedstockPreprocessing('U101', ins=feedstock) U101.cost_items['System'].cost = 0 U101.cost_items['System'].kW = 0 enzyme = Stream('enzyme', units='kg/hr', price=price['Enzyme']) enzyme_water = Stream('enzyme_water', units='kg/hr') CSL = Stream('CSL', units='kg/hr') dilution_water = Stream('dilution_water', units='kg/hr') H301 = bst.units.HXutility('H301', ins=U101-0, T=50+273.15) M304 = bst.units.Mixer('M304', ins=(H301-0, dilution_water)) M304.water_to_sugar_mol_ratio = 5. @M304.add_specification() def adjust_M304_water(): M304_ins_1 = M304.ins[1] M304_ins_1.imol['Water'] = M304.water_to_sugar_mol_ratio * M304.ins[0].imol['Glucose', 'Xylose'].sum() M304._run() M304_H = bst.units.HXutility('M304_H', ins=M304-0, T=30+273.15, rigorous=True) S302 = bst.Splitter('S302', ins=M304_H-0, outs = ('to_seedtrain', 'to_cofermentation'), split = 0.07) R302 = units.CoFermentation('R302', ins=(S302-1, '', CSL), outs=('fermentation_effluent', 'CO2_fermentation')) def include_seed_CSL_in_cofermentation(): R302._run() R302.ins[2].F_mass*=1./(1-S302.split[0]) R302.specification = include_seed_CSL_in_cofermentation R303 = units.SeedTrain('R303', ins=S302-0, outs=('seed', 'CO2_seedtrain'), ferm_ratio=0.95) T301 = units.SeedHoldTank('T301', ins=R303-0, outs=1-R302) hr') KOH = Stream('KOH', units = 'kg/hr') HCl = Stream('HCl', units = 'kg/hr') U401 = bst.Unit('U401', ins=R302-0, outs=('fermentation_broth_first_sle')) def U401_spec(): U401_ins_0 = U401.ins[0] tot_TAL = U401_ins_0.imol['TAL'] U401_outs_0 = U401.outs[0] U401_outs_0.copy_like(U401_ins_0) mol_TAL_dissolved = get_mol_TAL_dissolved(U401_outs_0.T, U401_outs_0.imol['Water']) (mol_TAL_dissolved, tot_TAL) U401_outs_0.imol['s', 'TAL'] = tot_TAL - min(mol_TAL_dissolved, tot_TAL) U401.specification = U401_spec H401 = bst.HXutility('H401', ins=U401-0, outs=('H401_0'), T=273.15+70.) def H401_spec(): H401_ins_0 = H401.ins[0] H401_ins_0_water=H401_ins_0.imol['Water'] tot_TAL = H401_ins_0.imol['TAL'] H401_spec_obj_fn = lambda T: get_mol_TAL_dissolved(T, H401_ins_0_water) - tot_TAL H401.T = flx.IQ_interpolation(H401_spec_obj_fn, H401.ins[0].T, 99.+273.15) H401._run() H401_outs_0 = H401.outs[0] mol_TAL_dissolved = get_mol_TAL_dissolved(H401_outs_0.T, H401_outs_0.imol['Water']) in(mol_TAL_dissolved, tot_TAL) H401_outs_0.imol['s', 'TAL'] = max(0., round(tot_TAL - min(mol_TAL_dissolved, tot_TAL), 5)) H401.specification = H401_spec U402 = bst.FakeSplitter('U402', ins=H401-0, outs = ('thermally_decarboxylated_broth','vented_CO2')) U402.decarboxylation_rxns = ParallelRxn([ Rxn('TAL + H2O -> PD + CO2', 'TAL', 0.25), ]) def get_TAL_decarboxylation_conversion(T=273.15+80.): return (0.2*(T-273.15) + 8.)/100. def U402_spec(): U402_outs_0 = U402.outs[0] U402_outs_0.copy_like(U402.ins[0]) U402_outs_0.phases = ('l', 's') U402.decarboxylation_rxns[0].X = get_TAL_decarboxylation_conversion(T=U402_outs_0.T) U402.decarboxylation_rxns[0](U402_outs_0['l']) U402.outs[1].imol['CO2'] = U402_outs_0.imol['l', 'CO2'] U402.outs[1].phase = 'g' U402_outs_0.imol['l', 'CO2'] = 0. U402.specification = U402_spec lit = [splits_df['stream_571'][0]] + splits_df['stream_571'][2:].to_list() S401_filtrate_split = [splits_df['stream_535'][0]] + splits_df['stream_535'][2:].to_list() S401 = bst.units.SolidsCentrifuge('S401', ins=U402-0, outs=('S401_solid_fraction', 'S401_liquid_fraction'), split=find_split(S401_index, S401_cell_mass_split, S401_filtrate_split, chemical_groups), solids =\ ['Xylan', 'Glucan', 'Lignin', 'FermMicrobe',\ 'Ash', 'Arabinan', 'Galactan', 'Mannan']) S401_TAL_split_spec(): S401._run() S401_ins_0 = S401.ins[0] S401.outs[0].imol['TAL'] = S401_ins_0.imol['s', 'TAL'] S401.outs[1].imol['TAL'] = S401_ins_0.imol['l', 'TAL'] S401.specification = S401_TAL_split_spec H402 = bst.HXutility('H402', ins=S401-1, outs=('H402_0'), T=273.15+1.) def H402_spec(): H402._run() H402_ins_0 = H402.ins[0] tot_TAL = H402_ins_0.imol['TAL'] H402_outs_0 = H402.outs[0] TAL_solubility = get_mol_TAL_dissolved(H402_outs_0.T, H402_outs_0.imol['Water']) H402_outs_0.phases = ('s', 'l') H402_outs_0.T = H402.T TAL_dissolved = min(TAL_solubility, tot_TAL) H402_outs_0.imol['l', 'TAL'] = TAL_dissolved H402_outs_0.imol['s', 'TAL'] = max(0, tot_TAL - TAL_dissolved) H402.specification = H402_spec S402 = bst.units.SolidsCentrifuge('S402', ins=H402-0, outs=('S402_solid_fraction', 'S402_liquid_fraction'), split=find_split(S401_index, S401_cell_mass_split, S401_filtrate_split, chemical_groups), solids =\ ['Xylan', 'Glucan', 'Lignin', 'FermMicrobe',\ 'Ash', 'Arabinan', 'Galactan', 'Mannan']) def S402_TAL_split_spec(): float(S402_ins_0.imol['s', 'TAL']) S402_ins_0.imol['s', 'TAL'] = 0. S402._run() S402.outs[0].imol['TAL'] = solid_TAL S402.outs[1].imol['TAL'] = S402_ins_0.imol['l', 'TAL'] S402_ins_0.imol['s', 'TAL'] = solid_TAL S402.specification = S402_TAL_split_spec H403 = bst.HXutility('H403', ins=S402-0, outs=('heated_TAL'), T=273.15+40.) F401 = bst.Flash('F401', ins=H403-0, outs = ('volatiles', 'pure_TAL_product'), V = 0.99, P=101325.) def F401_spec(): F401_ins_0 = F401.ins[0] F401.V = sum(F401_ins_0.imol['H2O', 'AceticAcid', 'Furfural', 'HMF',]) / F401_ins_0.F_mol F401._run() F401.specification = F401_spec air_lagoon = Stream('air_lagoon', phase='g', units='kg/hr') aerobic_caustic = Stream('aerobic_caustic', units='kg/hr', T=20+273.15, P=2*101325, price=price['Caustics']) M501 = bst.units.Mixer('M501', ins=( S402-1, F401-0, )) WWT_cost = units.WastewaterSystemCost('WWTcost501', ins=M501-0) R501 = units.AnaerobicDigestion('R501', ins=WWT_cost-0, outs=('biogas', 'anaerobic_treated_water', 'anaerobic_sludge'), reactants=soluble_organics, split=find_split(splits_df.index, splits_df['stream_611'], splits_df['stream_612'], chemical_groups), T=35+273.15) get_flow_tpd = lambda: (feedstock.F_mass-feedstock.imass['H2O'])*24/907.185 M502 = bst.units.Mixer('M502', ins=(R501-1, '')) R502 = units.AerobicDigestion('R502', ins=(M502-0, air_lagoon, aerobic_caustic), outs=('aerobic_vent', 'aerobic_treated_water'), reactants=soluble_organics, ratio=get_flow_tpd()/2205) S501 = bst.units.Splitter('S501', ins=R502-1, outs=('membrane_treated_water', 'membrane_sludge'), split=find_split(splits_df.index, splits_df['stream_624'], splits_df['stream_625'], chemical_groups)) S501.line = 'Membrane bioreactor' S502 = bst.units.Splitter('S502', ins=S501-1, outs=('to_aerobic_digestion', 'to_boiler_turbogenerator'), split=0.96) M503 = bst.units.Mixer('M503', ins=(S502-0, 'centrate'), outs=1-M502) M504 = bst.units.Mixer('M504', ins=(R501-2, S502-1)) S503 = bst.units.Splitter('S503', ins=M504-0, outs=(1-M503, 'sludge'), split=find_split(splits_df.index, splits_df['stream_616'], splits_df['stream_623'], chemical_groups)) S503.line = 'Sludge centrifuge' S504 = bst.units.Splitter('S504', ins=S501-0, outs=('discharged_water', 'waste_brine'), split=find_split(splits_df.index, splits_df['stream_626'], splits_df['stream_627'], chemical_groups)) S504.line = 'Reverse osmosis' M505 = bst.units.Mixer('M505', ins=(S503-1, S401-0, ), outs='wastes_to_boiler_turbogenerator') sulfuric_acid_fresh = Stream('sulfuric_acid_fresh', price=price['Sulfuric acid']) ammonia_fresh = Stream('ammonia_fresh', price=price['AmmoniumHydroxide']) CSL_fresh = Stream('CSL_fresh', price=price['CSL']) HCl_fresh = Stream('HCl_fresh', price=price['HCl']) hexanol_fresh = Stream('hexanol_fresh', price=price['Hexanol']) heptane_fresh_s = Stream('heptane_fresh_s', price=price['Heptane']) toluene_fresh_s = Stream('toluene_fresh_s', price=price['Toluene']) hydrogen_fresh = Stream('hydrogen_fresh', price=price['Hydrogen']) KOH_fresh = Stream('KOH_fresh', price=price['KOH']) system_makeup_water = Stream('system_makeup_water', price=price['Makeup water']) SA = Stream('SA', units='kg/hr', price=price['SA']) Stream('ash', price=price['Ash disposal']) cooling_tower_chems = Stream('cooling_tower_chems', price=price['Cooling tower chems']) CIP_chems_in = Stream('CIP_chems_in', Water=145*get_flow_tpd()/2205, units='kg/hr') plant_air_in = Stream('plant_air_in', phase='g', units='kg/hr', N2=0.79*1372608*get_flow_tpd()/2205, O2=0.21*1372608*get_flow_tpd()/2205) fire_water_in = Stream('fire_water_in', Water=8021*get_flow_tpd()/2205, units='kg/hr') T603 = units.CSLstorageTank('T603', ins=CSL_fresh, outs=CSL) T603.line = 'CSL storage tank' T604 = units.DPHPStorageTank('T604', ins=hexanol_fresh) T604.line = 'Hexanol storage tank' T604_P = units.TALPump('T604_P', ins=T604-0, outs = Hexanol_minimal) h) # T605.line = 'Heptane storage tank' # T605_P = units.TALPump('T605_P', ins=T605-0, outs = Heptane) # T606 = units.DPHPStorageTank('T606', ins=toluene_fresh) # T606.line = 'Toluene storage tank' # T606_P = units.TALPump('T606_P', ins=T606-0, outs = Toluene) T607 = units.DPHPStorageTank('T607', ins=hydrogen_fresh, outs = Hydrogen) T607.line = 'Hydrogen storage tank' T608 = units.DPHPStorageTank('T608', ins=HCl_fresh, outs = HCl, vessel_material = 'Stainless steel') T608.line = 'HCl storage tank' T609 = units.DPHPStorageTank('T609', ins=KOH_fresh, outs = KOH, vessel_material = 'Stainless steel') T609.line = 'KOH storage tank' # T604_s = units.DPHPStorageTank('T604_s', ins=hexanol_fresh_s) # T604_s.line = 'Hexanol storage tank s' # T604_s_P = units.TALPump('T604_s_P', ins=T604_s-0, outs = Hexanol_s) # 7-day storage time, similar to ethanol's in Humbird et al. T605_s = units.DPHPStorageTank('T605_s', ins=heptane_fresh_s) T605_s.line = 'Heptane storage tank s' T605_s_P = units.TALPump('T605_s_P', ins=T605_s-0, outs = Heptane_s) T606_s = units.DPHPStorageTank('T606_s', ins=toluene_fresh_s) T606_s.line = 'Toluene storage tank s' T606_s_P = units.TALPump('T606_s_P', ins=T606_s-0, outs = Toluene_s) T620 = units.TALStorageTank('T620', ins=F401-1, tau=7*24, V_wf=0.9, vessel_type='Floating roof', vessel_material='Stainless steel') T620.line = 'SAStorageTank' T620_P = units.TALPump('T620_P', ins=T620-0, outs=SA) # # 7-day storage time, similar to ethanol's in Humbird et al. =7*24, V_wf=0.9, # vessel_type='Floating roof', # vessel_material='Stainless steel') # T608.line = 'IBAStorageTank' # T608_P = units.TALPump('T608_P', ins=T608-0, outs=IBA) CIP = facilities.CIP('CIP901', ins=CIP_chems_in, outs='CIP_chems_out') ADP = facilities.ADP('ADP902', ins=plant_air_in, outs='plant_air_out', ratio=get_flow_tpd()/2205) FWT = units.FireWaterTank('FWT903', ins=fire_water_in, outs='fire_water_out') CWP = facilities.CWP('CWP802', ins='return_chilled_water', outs='process_chilled_water') # M505-0 is the liquid/solid mixture, R501-0 is the biogas, blowdown is discharged # BT = facilities.BT('BT', ins=(M505-0, R501-0, # FGD_lime, boiler_chems, # baghouse_bag, natural_gas, # 'BT_makeup_water'), # B_eff=0.8, TG_eff=0.85, # combustibles=combustibles, # side_streams_to_heat=(water_M201, water_M202, steam_M203), # outs=('gas_emission', ash, 'boiler_blowdown_water')) BT = bst.facilities.BoilerTurbogenerator('BT701', ins=(M505-0, R501-0, 'boiler_makeup_water', 'natural_gas', 'lime', 'boilerchems'), outs=('gas_emission', 'boiler_blowdown_water', ash,), turbogenerator_efficiency=0.85) # BT = bst.BDunits.BoilerTurbogenerator('BT', # ins=(M505-0, R501-0, 'boiler_makeup_water', 'natural_gas', FGD_lime, boiler_chems), # boiler_efficiency=0.80, # turbogenerator_efficiency=0.85) # Blowdown is discharged CT = facilities.CT('CT801', ins=('return_cooling_water', cooling_tower_chems, 'CT_makeup_water'), outs=('process_cooling_water', 'cooling_tower_blowdown')) # All water used in the system, here only consider water usage, # if heating needed, then heeating duty required is considered in BT process_water_streams = (enzyme_water, aerobic_caustic, CIP.ins[-1], BT.ins[-1], CT.ins[-1]) PWC = facilities.PWC('PWC904', ins=(system_makeup_water, S504-0), process_water_streams=process_water_streams, recycled_blowdown_streams=None, outs=('process_water', 'discharged_water')) # Heat exchanger network from hxn._heat_exchanger_network import HeatExchangerNetwork # from biosteam import HeatExchangerNetwork HXN = HeatExchangerNetwork('HXN1001', # ignored=[H401, H402], ) def HXN_no_run_cost(): HXN.heat_utilities = tuple() HXN._installed_cost = 0. # To simulate without HXN, uncomment the following 3 lines: # HXN._cost = HXN_no_run_cost # HXN.energy_balance_percent_error = 0. # HXN.new_HXs = HXN.new_HX_utils = [] # HXN = HX_Network('HXN') # %% # ============================================================================= # Complete system # ============================================================================= TAL_sys = create_TAL_sys() f = bst.main_flowsheet u = f.unit s = f.stream feedstock = s.feedstock SA = s.SA get_flow_tpd = lambda: (feedstock.F_mass-feedstock.imass['H2O'])*24/907.185 TEA_feeds = set([i for i in TAL_sys.feeds if i.price]+ \ [i for i in TAL_sys.feeds if i.price]) TEA_products = set([i for i in TAL_sys.products if i.price]+ \ [i for i in TAL_sys.products if i.price]+[SA]) for ui in u: globals().update({ui.ID: ui}) # %% # ============================================================================= # TEA # ============================================================================= # TAL_tea = CellulosicEthanolTEA(system=TAL_sys, IRR=0.10, duration=(2016, 2046), # depreciation='MACRS7', income_tax=0.21, operating_days=0.9*365, # lang_factor=None, construction_schedule=(0.08, 0.60, 0.32), # startup_months=3, startup_FOCfrac=1, startup_salesfrac=0.5, # startup_VOCfrac=0.75, WC_over_FCI=0.05, # finance_interest=0.08, finance_years=10, finance_fraction=0.4, # # biosteam Splitters and Mixers have no cost, # # cost of all wastewater treatment units are included in WWT_cost, # # BT is not included in this TEA # OSBL_units=(u.U101, u.WWT_cost, # u.T601, u.T602, u.T603, u.T606, u.T606_P, # u.CWP, u.CT, u.PWC, u.CIP, u.ADP, u.FWT, u.BT), # warehouse=0.04, site_development=0.09, additional_piping=0.045, # proratable_costs=0.10, field_expenses=0.10, construction=0.20, # contingency=0.10, other_indirect_costs=0.10, # labor_cost=3212962*get_flow_tpd()/2205, # labor_burden=0.90, property_insurance=0.007, maintenance=0.03, # steam_power_depreciation='MACRS20', boiler_turbogenerator=u.BT) # TAL_no_BT_tea = TAL_tea TAL_tea = TALTEA(system=TAL_sys, IRR=0.10, duration=(2016, 2046), depreciation='MACRS7', income_tax=0.21, operating_days=0.9*365, lang_factor=None, construction_schedule=(0.08, 0.60, 0.32), startup_months=3, startup_FOCfrac=1, startup_salesfrac=0.5, startup_VOCfrac=0.75, WC_over_FCI=0.05, finance_interest=0.08, finance_years=10, finance_fraction=0.4, # biosteam Splitters and Mixers have no cost, # cost of all wastewater treatment units are included in WWT_cost, # BT is not included in this TEA OSBL_units=(u.U101, u.WWTcost501, # u.T601, u.T602, u.T603, u.T604, u.T620, # u.T606, u.T606_P, u.CWP802, u.CT801, u.PWC904, u.CIP901, u.ADP902, u.FWT903, u.BT701), warehouse=0.04, site_development=0.09, additional_piping=0.045, proratable_costs=0.10, field_expenses=0.10, construction=0.20, contingency=0.10, other_indirect_costs=0.10, labor_cost=3212962*get_flow_tpd()/2205, labor_burden=0.90, property_insurance=0.007, maintenance=0.03, steam_power_depreciation='MACRS20', boiler_turbogenerator=u.BT701) TAL_no_BT_tea = TAL_tea # # Removed because there is not double counting anyways. # # Removes feeds/products of BT_sys from TAL_sys to avoid double-counting # for i in BT_sys.feeds: # TAL_sys.feeds.remove(i) # for i in BT_sys.products: # TAL_sys.products.remove(i) # Boiler turbogenerator potentially has different depreciation schedule # BT_tea = bst.TEA.like(BT_sys, TAL_no_BT_tea) # BT_tea.labor_cost = 0 # Changed to MACRS 20 to be consistent with Humbird # BT_tea.depreciation = 'MACRS20' # BT_tea.OSBL_units = (BT,) # %% # ============================================================================= # Simulate system and get results # ============================================================================= # def get_TAL_MPSP(): # TAL_sys.simulate() # for i in range(3): # TAL.price = TAL_tea.solve_price(TAL, TAL_no_BT_tea) # return TAL.price def get_SA_MPSP(): for i in range(3): TAL_sys.simulate() for i in range(3): SA.price = TAL_tea.solve_price(SA) return SA.price*SA.F_mass/SA.imass['TAL'] def get_titer(): return R302.outs[0].imass['TAL']/R302.outs[0].F_vol def set_titer(titer): M304.water_multiplier *= get_titer()/titer get_SA_MPSP() return get_titer() # get_SA_MPSP() # R301 = F('R301') # Fermentor # yearly_production = 125000 # ton/yr spec = ProcessSpecification( evaporator = None, pump = None, mixer = u.M304, heat_exchanger = u.M304_H, seed_train_system = [], reactor= u.R302, reaction_name='fermentation_reaction', substrates=('Xylose', 'Glucose'), products=('TAL',), spec_1=0.19, spec_2=28., spec_3=0.19, xylose_utilization_fraction = 0.80, feedstock = feedstock, dehydration_reactor = None, byproduct_streams = [], HXN = u.HXN1001, maximum_inhibitor_concentration = 1., # pre_conversion_units = process_groups_dict['feedstock_group'].units + process_groups_dict['pretreatment_group'].units + [u.H301], # if the line below does not work (depends on BioSTEAM version) pre_conversion_units = TAL_sys.split(u.M304.ins[0])[0], # set baseline fermentation performance here baseline_yield = 0.19, baseline_titer = 28., baseline_productivity = 0.19, # baseline_yield = 0.30, # baseline_titer = 25., # baseline_productivity = 0.19, feedstock_mass = feedstock.F_mass, pretreatment_reactor = None) spec.load_spec_1 = spec.load_yield # spec.load_spec_2 = spec.load_titer spec.load_spec_3 = spec.load_productivity def M304_titer_obj_fn(water_to_sugar_mol_ratio): M304, R302 = u.M304, u.R302 M304.water_to_sugar_mol_ratio = water_to_sugar_mol_ratio M304.specification[0][0]() u.M304_H._run() u.S302._run() u.R303._run() u.T301._run() R302.specification[0][0]() # broth = R302.outs[0] # return broth.imass['TAL']/broth.F_vol - R302.titer_to_load return R302.effluent_titer - R302.titer_to_load def load_titer_with_glucose(titer_to_load): spec.spec_2 = titer_to_load u.R302.titer_to_load = titer_to_load flx.IQ_interpolation(M304_titer_obj_fn, 1e-3, 20000.) # u.AC401.regeneration_velocity = min(14.4, 3.1158 + ((14.4-3.1158)/(30.-3.))*(titer_to_load-3.)) # heuristic to obtain regeneration velocity at which MPSP is minimum fitted to results from simulations at target_recovery=0.99 # u.AC401.regeneration_velocity = 14.4 spec.load_spec_2 = load_titer_with_glucose # path = (F301, R302) # @np.vectorize # def calculate_titer(V): # F301.V = V # for i in path: i._run() # return spec._calculate_titer() # @np.vectorize # def calculate_MPSP(V): # F301.V = V # TAL_sys.simulate() # MPSP = SA.price = TAL_tea.solve_price(SA, TAL_no_BT_tea) # return MPSP # vapor_fractions = np.linspace(0.20, 0.80) # titers = calculate_titer(vapor_fractions) # MPSPs = calculate_MPSP(vapor_fractions) # import matplotlib.pyplot as plt # plt.plot(vapor_fractions, titers) # plt.show() # plt.plot(titers, MPSPs) # plt.show() # %% # ============================================================================= # Life cycle analysis (LCA), waste disposal emission not included # ============================================================================= # 100-year global warming potential (GWP) from material flows LCA_streams = TEA_feeds.copy() LCA_stream = Stream('LCA_stream', units='kg/hr') def get_material_GWP(): LCA_stream.mass = sum(i.mass for i in LCA_streams) chemical_GWP = LCA_stream.mass*CFs['GWP_CF_stream'].mass # feedstock_GWP = feedstock.F_mass*CFs['GWP_CFs']['Corn stover'] return chemical_GWP.sum()/SA.F_mass # GWP from combustion of non-biogenic carbons get_non_bio_GWP = lambda: (natural_gas.get_atomic_flow('C'))* TAL_chemicals.CO2.MW / SA.F_mass # +ethanol_fresh.get_atomic_flow('C')) \ # GWP from electricity get_electricity_use = lambda: sum(i.power_utility.rate for i in TAL_sys.units) get_electricity_GWP = lambda: get_electricity_use()*CFs['GWP_CFs']['Electricity'] \ / SA.F_mass # CO2 fixed in lactic acid product get_fixed_GWP = lambda: \ SA.get_atomic_flow('C')*TAL_chemicals.CO2.MW/SA.F_mass # carbon_content_of_feedstock = 0 get_GWP = lambda: get_material_GWP()+get_non_bio_GWP()+get_electricity_GWP() # Fossil energy consumption (FEC) from materials def get_material_FEC(): LCA_stream.mass = sum(i.mass for i in LCA_streams) chemical_FEC = LCA_stream.mass*CFs['FEC_CF_stream'].mass # feedstock_FEC = feedstock.F_mass*CFs['FEC_CFs']['Corn stover'] return chemical_FEC.sum()/SA.F_mass # FEC from electricity get_electricity_FEC = lambda: \ get_electricity_use()*CFs['FEC_CFs']['Electricity']/SA.F_mass # Total FEC get_FEC = lambda: get_material_FEC()+get_electricity_FEC() # get_SPED = lambda: BT.system_heating_demand*0.001/SA.F_mass SA_LHV = 31.45 # MJ/kg SA # %% Full analysis def simulate_and_print(): get_SA_MPSP() print('\n---------- Simulation Results ----------') print(f'MPSP is ${get_SA_MPSP():.3f}/kg') # print(f'GWP is {get_GWP():.3f} kg CO2-eq/kg SA') # print(f'FEC is {get_FEC():.2f} MJ/kg SA or {get_FEC()/SA_LHV:.2f} MJ/MJ SA') # print(f'SPED is {get_SPED():.2f} MJ/kg SA or {get_SPED()/SA_LHV:.2f} MJ/MJ SA') # print('--------------------\n') # simulate_and_print() # TAL_sys.simulate() get_SA_MPSP() spec.load_specifications(0.203, 35.9, 0.21) simulate_and_print() # %% # ============================================================================= # For Monte Carlo and analyses # ============================================================================= TAL_sub_sys = { # 'feedstock_sys': (U101,), # 'pretreatment_sys': (T201, M201, M202, M203, # R201, R201_H, T202, T203, # F201, F201_H, # M204, T204, T204_P, # M205, M205_P), # 'conversion_sys': (H301, M301, M302, R301, R302, T301), # 'separation_sys': (S401, M401, M401_P, # S402, # # F401, F401_H, X401, # D401, D401_H, D401_P, S403, # M402_P, S403, # D403, D403_H, D403_P, # M501, # T606, T606_P, T607, T607_P) # F402, F402_H, F402_P, # D405, D405_H1, D405_H2, D405_P, # M401, M401_P) # 'wastewater_sys': (M501, WWT_cost, R501, # M502, R502, S501, S502, M503, # M504, S503, S504, M505), # 'HXN': (HXN,), # 'BT': (BT,), # 'CT': (CT,), # 'other_facilities': (T601, S601, # T602, T603, # T604, T604_P, # T605, T605_P, # T606, T606_P, # PWC, CIP, ADP, FWT) } # for unit in sum(TAL_sub_sys.values(), ()): # if not unit in TAL_sys.units: # print(f'{unit.ID} not in TAL_sys.units') # for unit in TAL_sys.units: # if not unit in sum(TAL_sub_sys.values(), ()): # print(f'{unit.ID} not in TAL_sub_sys')
true
true
f72090137ed4a55b46aada64a6912f716757178f
11,993
py
Python
qusp/target.py
dmargala/qusp
3b08e8bea321f7083f00756f558c1d0af0eddd07
[ "MIT" ]
null
null
null
qusp/target.py
dmargala/qusp
3b08e8bea321f7083f00756f558c1d0af0eddd07
[ "MIT" ]
null
null
null
qusp/target.py
dmargala/qusp
3b08e8bea321f7083f00756f558c1d0af0eddd07
[ "MIT" ]
null
null
null
""" Provides support for working with BOSS targets. In qusp, a target is identified by a unique plate-mjd-fiber. They are implemented as dictionaries and must have at least 'plate', 'mjd', and 'fiber' keys specified. The Target model is designed to be flexible, in that other attributes can be added to targets as needed. Examples -------- Construct a target from a string identifier:: target = qusp.target.Target.from_string('plate-mjd-fiber') Construct a target from a dictionary:: target = qusp.target.Target({'target':'plate-mjd-fiber'}) Read a target list along with **ra**, **dec**, and **z** columns:: targets = qusp.target.load_target_list(filename, fields=[('ra', float, 1), ('dec', float, 2), ('z', float, 3)]) Save a target list along with **z** and **sn** fields:: qusp.target.save_target_list(filename, targets, fields=['z', 'sn']) Iterate over combined spectra for a list targets:: for target, spectrum in qusp.target.get_combined_spectra(targets): ... Iterate over plates for a list of targets:: for target, spplate in qusp.target.get_target_plates(targets): spectrum = qusp.read_combined_spectrum(spplate, target) ... ------------- """ import numpy as np from astropy.io import fits import os import qusp class Target(dict): """ Represents a BOSS target. Args: args: Variable length argument list. kwargs: Arbitrary keyword arguments. Raises: AssertionError: if 'target' key is not specified """ def __init__(self, *args, **kwargs): super(Target, self).__init__(*args, **kwargs) # assert 'target' in self, \ # 'Target: must have plate-mjd-fiber identifier key' # plate, mjd, fiber = self['target'].split('-') self['target'] = '{}-{}-{}'.format(self['plate'], self['mjd'], self['fiber']) self['plate'] = int(self['plate']) self['mjd'] = int(self['mjd']) self['fiber'] = int(self['fiber']) def to_string(self): """ Returns the standard plate-mjd-fiber string represntation of the target. Returns: plate-mjd-fiber string represntation of target """ return self['target'] @classmethod def from_string(cls, target_string): """ Returns a Target object constructed from a target string identifier. Args: target_string (str): a target string identifier. Returns: :class:`Target` object """ plate, mjd, fiber = target_string.split('-') return cls({'plate':plate, 'mjd':mjd, 'fiber':fiber}) # return cls({'target':target_string}) @classmethod def from_plate_mjd_fiber(cls, plate, mjd, fiber): """ Returns a Target object constructed from plate, mjd, fiber. Args: plate (int): target's plate id mjd (int): mjd observation fiber (int): target's fiber id Returns: :class:`Target` object """ return cls({'plate':plate, 'mjd':mjd, 'fiber':fiber}) # target_string = '-'.join([str(field) for field in [plate, mjd, fiber]]) # return cls.from_string(target_string) def load_target_list(filename, fields=None, verbose=False): """ Loads a target data from a text file. The first column must be plate-mjd-fiber target identifier. Use the fields argument to specify additional columns to read. Must specify a (name, type, column index) tuple for each field. Args: filename (str): The filename to load. fields (list, optional): A list of columns to read, see example. Defaults to None. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. Returns: list of :class:`Target` objects. """ if fields is None: fields = [] fields = [('plate', 'S4', 0), ('mjd', 'S5', 1), ('fiber', 'S4', 2)] + fields names, formats, cols = zip(*fields) if verbose: print 'Target list: %s' % filename print 'Reading fields: %s' % (', '.join(names)) targets = np.genfromtxt( filename, dtype={'names':names, 'formats':formats}, usecols=cols, skip_header=1) return [Target(dict(zip(targets.dtype.names, t))) for t in targets] def add_args(parser): """ Adds arguments to the provided command-line parser. Args: parser (argparse.ArgumentParser): an argument parser """ parser.add_argument( "--targets", type=str, default=None, help="text file containing target list") parser.add_argument( "--ntargets", type=int, default=0, help="number of targets to use, 0 for all") def load_target_list_from_args(args, fields=None): """ Loads a target list from a text file specified using the default target arguments. Args: args (argparse.Namespace): argparse argument namespace fields (list, optional): A list of columns to read, see example. Defaults to None. Returns: list of :class:`Target` objects. """ target_list = load_target_list(args.targets, fields=fields) # trim target list if requested ntargets = args.ntargets if args.ntargets > 0 else len(target_list) print 'Using %d targets (out of %d in file)' % (ntargets, len(target_list)) return target_list[:ntargets] def save_target_list(filename, targets, fields=None, verbose=False): """ Writes a list of targets to the provided file. By default, only the target plate-mjd-fiber is written to file. Use the fields argument to specify additional target fields to save. Args: filename (str): The filename of the output text file to create. targets (:class:`Target`): A list of :class:`Target` objects to save. fields (list, optional): A list of :class:`Target` keys to annotate output list. Defaults to None. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. """ keys = ['target'] if fields is not None: keys.extend(fields if type(fields) is list else [fields]) if verbose: print 'Saving targets to %s w/ fields: %s' % (filename, ', '.join(keys)) with open(filename, 'w') as outfile: for target in targets: outfile.write(' '.join([str(target[key]) for key in keys])+'\n') def get_target_plates(targets, boss_path=None, sort=True, verbose=False): """ A generator that yields (target,spplate) tuples for the provided list of targets. With sort=True, the targets will be sorted by plate-mjd-fiber to reduce the number of io operations. Args: targets (:class:`Target`): list of :class:`Target` objects to iterate through. boss_path (str, optional): path to boss data directory. Default is to look this up using env var. sort (bool, optional): Whether or not to sort the provided targets by plate-mjd-fiber. Defaults to True. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. Yields: The next tuple ``(target, spplate)``, where ``target`` is a :class:`Target` and \ ``spplate`` is the corresponding FITS file containing its coadded spectrum from the list of *targets*. """ if boss_path is None: paths = qusp.paths.Paths() boss_path = paths.boss_path if sort: targets = sorted( targets, key=lambda t: (t['plate'], t['mjd'], t['fiber'])) currently_opened_filename = None for target in targets: plate_filename = 'spPlate-%s-%s.fits' % (target['plate'], target['mjd']) if plate_filename != currently_opened_filename: # load the spectrum file if currently_opened_filename is not None: spplate.close() full_path_to_spplate = os.path.join( boss_path, str(target['plate']), plate_filename) if verbose: print 'Opening plate file %s...' % full_path_to_spplate spplate = fits.open(full_path_to_spplate) currently_opened_filename = plate_filename yield target, spplate def get_combined_spectra(targets, paths=None, sort=True, verbose=False, tpcorr=None): """ A generator that yields (target, spectrum) tuples for the provided list of targets. With sort=True, the targets will be sorted by plate-mjd-fiber to reduce the number of io operations. Args: targets (:class:`Target`): list of :class:`Target` objects to iterate through. boss_path (str, optional): path to boss data directory. Default is to look this up using env var. sort (bool, optional): Whether or not to sort the provided targets by plate-mjd-fiber. Defaults to True. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. Yields: The next tuple ``(target, spectrum)``, where ``target`` is a :class:`Target` and \ ``spectrum`` is a :class:`qusp.spectrum.Spectrum` that corresponds to the \ target's coadded spectrum. """ for target, spplate in get_target_plates(targets, boss_path=paths.boss_path, sort=sort, verbose=verbose): if tpcorr is not None: try: corrected = get_corrected_spectrum(target, tpcorr, paths) yield target, corrected except KeyError: if verbose: print 'get_combined_spectra: Error reading correction for %s' % target.to_string() continue else: yield target, qusp.spectrum.read_combined_spectrum(spplate, target) def get_combined_spectrum(target, paths=None): """ Returns the coadded spectrum of the specified target. Args: target (:class:`Target`): a target paths (:class:`qusp.paths.Paths`, optional): paths object that knows where the location of the boss data dir. Returns: Coadded spectrum of the specified target. """ if paths is None: paths = qusp.paths.Paths() plate_filename = paths.get_spplate_filename(target) spplate = fits.open(plate_filename) return qusp.spectrum.read_combined_spectrum(spplate, target) def get_lite_spectrum(target, paths=None): if paths is None: paths = qusp.paths.Paths() spec_filename = paths.get_spec_filename(target, lite=True) spec = fits.open(spec_filename) return qusp.spectrum.read_lite_spectrum(spec) def get_lite_spectra(targets): import bossdata.path import bossdata.remote try: finder = bossdata.path.Finder() mirror = bossdata.remote.Manager() except ValueError as e: print(e) yield StopIteration for target in targets: remote_path = finder.get_spec_path(plate=target['plate'], mjd=target['mjd'], fiber=target['fiber'], lite=True) local_path = mirror.get(remote_path) spec = fits.open(local_path) yield target, qusp.spectrum.read_lite_spectrum(spec) def get_corrected_spectrum(target, tpcorr, paths=None): """ Returns the coadded spectrum of the specified target. Args: target (:class:`Target`): a target tpcorr (hdf5 File object): hdf5 file with throughput corrections paths (:class:`qusp.paths.Paths`, optional): paths object that knows where the location of the boss data dir. Returns: Coadded spectrum of the specified target. """ from scipy.interpolate import interp1d combined = get_combined_spectrum(target, paths) wave = tpcorr['wave'].value value = tpcorr['%s/%s/%s' % (target['plate'], target['mjd'], target['fiber'])].value correction = interp1d(wave, value, kind='linear', copy=False) return combined.create_corrected(correction)
35.482249
118
0.636455
""" Provides support for working with BOSS targets. In qusp, a target is identified by a unique plate-mjd-fiber. They are implemented as dictionaries and must have at least 'plate', 'mjd', and 'fiber' keys specified. The Target model is designed to be flexible, in that other attributes can be added to targets as needed. Examples -------- Construct a target from a string identifier:: target = qusp.target.Target.from_string('plate-mjd-fiber') Construct a target from a dictionary:: target = qusp.target.Target({'target':'plate-mjd-fiber'}) Read a target list along with **ra**, **dec**, and **z** columns:: targets = qusp.target.load_target_list(filename, fields=[('ra', float, 1), ('dec', float, 2), ('z', float, 3)]) Save a target list along with **z** and **sn** fields:: qusp.target.save_target_list(filename, targets, fields=['z', 'sn']) Iterate over combined spectra for a list targets:: for target, spectrum in qusp.target.get_combined_spectra(targets): ... Iterate over plates for a list of targets:: for target, spplate in qusp.target.get_target_plates(targets): spectrum = qusp.read_combined_spectrum(spplate, target) ... ------------- """ import numpy as np from astropy.io import fits import os import qusp class Target(dict): """ Represents a BOSS target. Args: args: Variable length argument list. kwargs: Arbitrary keyword arguments. Raises: AssertionError: if 'target' key is not specified """ def __init__(self, *args, **kwargs): super(Target, self).__init__(*args, **kwargs) self['target'] = '{}-{}-{}'.format(self['plate'], self['mjd'], self['fiber']) self['plate'] = int(self['plate']) self['mjd'] = int(self['mjd']) self['fiber'] = int(self['fiber']) def to_string(self): """ Returns the standard plate-mjd-fiber string represntation of the target. Returns: plate-mjd-fiber string represntation of target """ return self['target'] @classmethod def from_string(cls, target_string): """ Returns a Target object constructed from a target string identifier. Args: target_string (str): a target string identifier. Returns: :class:`Target` object """ plate, mjd, fiber = target_string.split('-') return cls({'plate':plate, 'mjd':mjd, 'fiber':fiber}) @classmethod def from_plate_mjd_fiber(cls, plate, mjd, fiber): """ Returns a Target object constructed from plate, mjd, fiber. Args: plate (int): target's plate id mjd (int): mjd observation fiber (int): target's fiber id Returns: :class:`Target` object """ return cls({'plate':plate, 'mjd':mjd, 'fiber':fiber}) def load_target_list(filename, fields=None, verbose=False): """ Loads a target data from a text file. The first column must be plate-mjd-fiber target identifier. Use the fields argument to specify additional columns to read. Must specify a (name, type, column index) tuple for each field. Args: filename (str): The filename to load. fields (list, optional): A list of columns to read, see example. Defaults to None. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. Returns: list of :class:`Target` objects. """ if fields is None: fields = [] fields = [('plate', 'S4', 0), ('mjd', 'S5', 1), ('fiber', 'S4', 2)] + fields names, formats, cols = zip(*fields) if verbose: print 'Target list: %s' % filename print 'Reading fields: %s' % (', '.join(names)) targets = np.genfromtxt( filename, dtype={'names':names, 'formats':formats}, usecols=cols, skip_header=1) return [Target(dict(zip(targets.dtype.names, t))) for t in targets] def add_args(parser): """ Adds arguments to the provided command-line parser. Args: parser (argparse.ArgumentParser): an argument parser """ parser.add_argument( "--targets", type=str, default=None, help="text file containing target list") parser.add_argument( "--ntargets", type=int, default=0, help="number of targets to use, 0 for all") def load_target_list_from_args(args, fields=None): """ Loads a target list from a text file specified using the default target arguments. Args: args (argparse.Namespace): argparse argument namespace fields (list, optional): A list of columns to read, see example. Defaults to None. Returns: list of :class:`Target` objects. """ target_list = load_target_list(args.targets, fields=fields) ntargets = args.ntargets if args.ntargets > 0 else len(target_list) print 'Using %d targets (out of %d in file)' % (ntargets, len(target_list)) return target_list[:ntargets] def save_target_list(filename, targets, fields=None, verbose=False): """ Writes a list of targets to the provided file. By default, only the target plate-mjd-fiber is written to file. Use the fields argument to specify additional target fields to save. Args: filename (str): The filename of the output text file to create. targets (:class:`Target`): A list of :class:`Target` objects to save. fields (list, optional): A list of :class:`Target` keys to annotate output list. Defaults to None. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. """ keys = ['target'] if fields is not None: keys.extend(fields if type(fields) is list else [fields]) if verbose: print 'Saving targets to %s w/ fields: %s' % (filename, ', '.join(keys)) with open(filename, 'w') as outfile: for target in targets: outfile.write(' '.join([str(target[key]) for key in keys])+'\n') def get_target_plates(targets, boss_path=None, sort=True, verbose=False): """ A generator that yields (target,spplate) tuples for the provided list of targets. With sort=True, the targets will be sorted by plate-mjd-fiber to reduce the number of io operations. Args: targets (:class:`Target`): list of :class:`Target` objects to iterate through. boss_path (str, optional): path to boss data directory. Default is to look this up using env var. sort (bool, optional): Whether or not to sort the provided targets by plate-mjd-fiber. Defaults to True. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. Yields: The next tuple ``(target, spplate)``, where ``target`` is a :class:`Target` and \ ``spplate`` is the corresponding FITS file containing its coadded spectrum from the list of *targets*. """ if boss_path is None: paths = qusp.paths.Paths() boss_path = paths.boss_path if sort: targets = sorted( targets, key=lambda t: (t['plate'], t['mjd'], t['fiber'])) currently_opened_filename = None for target in targets: plate_filename = 'spPlate-%s-%s.fits' % (target['plate'], target['mjd']) if plate_filename != currently_opened_filename: if currently_opened_filename is not None: spplate.close() full_path_to_spplate = os.path.join( boss_path, str(target['plate']), plate_filename) if verbose: print 'Opening plate file %s...' % full_path_to_spplate spplate = fits.open(full_path_to_spplate) currently_opened_filename = plate_filename yield target, spplate def get_combined_spectra(targets, paths=None, sort=True, verbose=False, tpcorr=None): """ A generator that yields (target, spectrum) tuples for the provided list of targets. With sort=True, the targets will be sorted by plate-mjd-fiber to reduce the number of io operations. Args: targets (:class:`Target`): list of :class:`Target` objects to iterate through. boss_path (str, optional): path to boss data directory. Default is to look this up using env var. sort (bool, optional): Whether or not to sort the provided targets by plate-mjd-fiber. Defaults to True. verbose (bool, optional): Whether or not to print verbose output. Defaults to False. Yields: The next tuple ``(target, spectrum)``, where ``target`` is a :class:`Target` and \ ``spectrum`` is a :class:`qusp.spectrum.Spectrum` that corresponds to the \ target's coadded spectrum. """ for target, spplate in get_target_plates(targets, boss_path=paths.boss_path, sort=sort, verbose=verbose): if tpcorr is not None: try: corrected = get_corrected_spectrum(target, tpcorr, paths) yield target, corrected except KeyError: if verbose: print 'get_combined_spectra: Error reading correction for %s' % target.to_string() continue else: yield target, qusp.spectrum.read_combined_spectrum(spplate, target) def get_combined_spectrum(target, paths=None): """ Returns the coadded spectrum of the specified target. Args: target (:class:`Target`): a target paths (:class:`qusp.paths.Paths`, optional): paths object that knows where the location of the boss data dir. Returns: Coadded spectrum of the specified target. """ if paths is None: paths = qusp.paths.Paths() plate_filename = paths.get_spplate_filename(target) spplate = fits.open(plate_filename) return qusp.spectrum.read_combined_spectrum(spplate, target) def get_lite_spectrum(target, paths=None): if paths is None: paths = qusp.paths.Paths() spec_filename = paths.get_spec_filename(target, lite=True) spec = fits.open(spec_filename) return qusp.spectrum.read_lite_spectrum(spec) def get_lite_spectra(targets): import bossdata.path import bossdata.remote try: finder = bossdata.path.Finder() mirror = bossdata.remote.Manager() except ValueError as e: print(e) yield StopIteration for target in targets: remote_path = finder.get_spec_path(plate=target['plate'], mjd=target['mjd'], fiber=target['fiber'], lite=True) local_path = mirror.get(remote_path) spec = fits.open(local_path) yield target, qusp.spectrum.read_lite_spectrum(spec) def get_corrected_spectrum(target, tpcorr, paths=None): """ Returns the coadded spectrum of the specified target. Args: target (:class:`Target`): a target tpcorr (hdf5 File object): hdf5 file with throughput corrections paths (:class:`qusp.paths.Paths`, optional): paths object that knows where the location of the boss data dir. Returns: Coadded spectrum of the specified target. """ from scipy.interpolate import interp1d combined = get_combined_spectrum(target, paths) wave = tpcorr['wave'].value value = tpcorr['%s/%s/%s' % (target['plate'], target['mjd'], target['fiber'])].value correction = interp1d(wave, value, kind='linear', copy=False) return combined.create_corrected(correction)
false
true
f720915b2ad6e84b10d393f7c627605ab0f69c7f
2,018
py
Python
tools/Polygraphy/polygraphy/config.py
spradius/TensorRT
eb5de99b523c76c2f3ae997855ad86d3a1e86a31
[ "Apache-2.0" ]
1
2021-08-23T01:15:16.000Z
2021-08-23T01:15:16.000Z
tools/Polygraphy/polygraphy/config.py
spradius/TensorRT
eb5de99b523c76c2f3ae997855ad86d3a1e86a31
[ "Apache-2.0" ]
null
null
null
tools/Polygraphy/polygraphy/config.py
spradius/TensorRT
eb5de99b523c76c2f3ae997855ad86d3a1e86a31
[ "Apache-2.0" ]
null
null
null
# # Copyright (c) 2021, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import os import sys INTERNAL_CORRECTNESS_CHECKS = bool(os.environ.get("POLYGRAPHY_INTERNAL_CORRECTNESS_CHECKS", "0") != "0") """ Whether internal correctness checks are enabled. This can be configured by setting the 'POLYGRAPHY_INTERNAL_CORRECTNESS_CHECKS' environment variable. """ AUTOINSTALL_DEPS = bool(os.environ.get("POLYGRAPHY_AUTOINSTALL_DEPS", "0") != "0") """ Whether Polygraphy will automatically install required Python packages at runtime. This can be configured by setting the 'POLYGRAPHY_AUTOINSTALL_DEPS' environment variable. """ INSTALL_CMD = os.environ.get("POLYGRAPHY_INSTALL_CMD", "{:} -m pip install".format(sys.executable)).split() """ The command to use to automatically install dependencies. Only relevant when AUTOINSTALL_DEPS is enabled. Defaults to ``["python3", "-m", "pip", "install"]``. This can be configured by setting the 'POLYGRAPHY_INSTALL_CMD' environment variable to a string containing the command; for example: ``python3 -m pip install``. """ ARRAY_SWAP_THRESHOLD_MB = int(os.environ.get("POLYGRAPHY_ARRAY_SWAP_THRESHOLD_MB", "-1")) """ The threshold, in megabytes, above which Polygraphy will evict a NumPy array from memory and swap it to disk. A negative value disables swapping and a value of 0 causes all arrays to be saved to disk. Disabled by default. This can be configured by setting the 'POLYGRAPHY_ARRAY_SWAP_THRESHOLD_MB' environment variable. """
43.869565
109
0.77552
import os import sys INTERNAL_CORRECTNESS_CHECKS = bool(os.environ.get("POLYGRAPHY_INTERNAL_CORRECTNESS_CHECKS", "0") != "0") AUTOINSTALL_DEPS = bool(os.environ.get("POLYGRAPHY_AUTOINSTALL_DEPS", "0") != "0") INSTALL_CMD = os.environ.get("POLYGRAPHY_INSTALL_CMD", "{:} -m pip install".format(sys.executable)).split() ARRAY_SWAP_THRESHOLD_MB = int(os.environ.get("POLYGRAPHY_ARRAY_SWAP_THRESHOLD_MB", "-1"))
true
true
f720930247112fff9273c3101072dae9279f6fa7
4,606
py
Python
tasks/trace_agent.py
charyveer75/datadog-agent
fdf4d2028b0dccd485eb280f4fefda84931927bc
[ "Apache-2.0" ]
2
2020-02-11T16:05:23.000Z
2022-03-30T19:50:28.000Z
tasks/trace_agent.py
charyveer75/datadog-agent
fdf4d2028b0dccd485eb280f4fefda84931927bc
[ "Apache-2.0" ]
2
2021-08-11T15:24:27.000Z
2021-08-23T22:13:05.000Z
tasks/trace_agent.py
charyveer75/datadog-agent
fdf4d2028b0dccd485eb280f4fefda84931927bc
[ "Apache-2.0" ]
null
null
null
import os import sys import shutil import invoke from invoke import task from .utils import bin_name, get_build_flags, get_version_numeric_only, load_release_versions from .utils import REPO_PATH from .build_tags import get_build_tags, get_default_build_tags, LINUX_ONLY_TAGS, REDHAT_AND_DEBIAN_ONLY_TAGS, REDHAT_AND_DEBIAN_DIST from .go import deps BIN_PATH = os.path.join(".", "bin", "trace-agent") DEFAULT_BUILD_TAGS = [ "netcgo", "secrets", "docker", "kubeapiserver", "kubelet", ] @task def build(ctx, rebuild=False, race=False, precompile_only=False, build_include=None, build_exclude=None, major_version='7', python_runtimes='3', arch="x64"): """ Build the trace agent. """ # get env prior to windows sources so we only have to set the target architecture once ldflags, gcflags, env = get_build_flags(ctx, arch=arch, major_version=major_version, python_runtimes=python_runtimes) # generate windows resources if sys.platform == 'win32': windres_target = "pe-x86-64" if arch == "x86": env["GOARCH"] = "386" windres_target = "pe-i386" ver = get_version_numeric_only(ctx, env, major_version=major_version) maj_ver, min_ver, patch_ver = ver.split(".") ctx.run("windmc --target {target_arch} -r cmd/trace-agent/windows_resources cmd/trace-agent/windows_resources/trace-agent-msg.mc".format(target_arch=windres_target)) ctx.run("windres --define MAJ_VER={maj_ver} --define MIN_VER={min_ver} --define PATCH_VER={patch_ver} -i cmd/trace-agent/windows_resources/trace-agent.rc --target {target_arch} -O coff -o cmd/trace-agent/rsrc.syso".format( maj_ver=maj_ver, min_ver=min_ver, patch_ver=patch_ver, target_arch=windres_target )) build_include = DEFAULT_BUILD_TAGS if build_include is None else build_include.split(",") build_exclude = [] if build_exclude is None else build_exclude.split(",") if not sys.platform.startswith('linux'): for ex in LINUX_ONLY_TAGS: if ex not in build_exclude: build_exclude.append(ex) build_tags = get_build_tags(build_include, build_exclude) cmd = "go build {race_opt} {build_type} -tags \"{go_build_tags}\" " cmd += "-o {agent_bin} -gcflags=\"{gcflags}\" -ldflags=\"{ldflags}\" {REPO_PATH}/cmd/trace-agent" args = { "race_opt": "-race" if race else "", "build_type": "-a" if rebuild else ("-i" if precompile_only else ""), "go_build_tags": " ".join(build_tags), "agent_bin": os.path.join(BIN_PATH, bin_name("trace-agent", android=False)), "gcflags": gcflags, "ldflags": ldflags, "REPO_PATH": REPO_PATH, } ctx.run("go generate {REPO_PATH}/pkg/trace/info".format(**args), env=env) ctx.run(cmd.format(**args), env=env) @task def integration_tests(ctx, install_deps=False, race=False, remote_docker=False): """ Run integration tests for trace agent """ if install_deps: deps(ctx) test_args = { "go_build_tags": " ".join(get_default_build_tags()), "race_opt": "-race" if race else "", "exec_opts": "", } if remote_docker: test_args["exec_opts"] = "-exec \"inv docker.dockerize-test\"" go_cmd = 'INTEGRATION=yes go test {race_opt} -v'.format(**test_args) prefixes = [ "./pkg/trace/test/testsuite/...", ] for prefix in prefixes: ctx.run("{} {}".format(go_cmd, prefix)) @task def cross_compile(ctx, tag=""): """ Cross-compiles the trace-agent binaries. Use the "--tag=X" argument to specify build tag. """ if not tag: print("Argument --tag=<version> is required.") return print("Building tag %s..." % tag) env = { "TRACE_AGENT_VERSION": tag, "V": tag, } ctx.run("git checkout $V", env=env) ctx.run("mkdir -p ./bin/trace-agent/$V", env=env) ctx.run("go generate ./pkg/trace/info", env=env) ctx.run("go get -u github.com/karalabe/xgo") ctx.run("xgo -dest=bin/trace-agent/$V -go=1.11 -out=trace-agent-$V -targets=windows-6.1/amd64,linux/amd64,darwin-10.11/amd64 ./cmd/trace-agent", env=env) ctx.run("mv ./bin/trace-agent/$V/trace-agent-$V-windows-6.1-amd64.exe ./bin/trace-agent/$V/trace-agent-$V-windows-amd64.exe", env=env) ctx.run("mv ./bin/trace-agent/$V/trace-agent-$V-darwin-10.11-amd64 ./bin/trace-agent/$V/trace-agent-$V-darwin-amd64 ", env=env) ctx.run("git checkout -") print("Done! Binaries are located in ./bin/trace-agent/%s" % tag)
35.430769
230
0.650673
import os import sys import shutil import invoke from invoke import task from .utils import bin_name, get_build_flags, get_version_numeric_only, load_release_versions from .utils import REPO_PATH from .build_tags import get_build_tags, get_default_build_tags, LINUX_ONLY_TAGS, REDHAT_AND_DEBIAN_ONLY_TAGS, REDHAT_AND_DEBIAN_DIST from .go import deps BIN_PATH = os.path.join(".", "bin", "trace-agent") DEFAULT_BUILD_TAGS = [ "netcgo", "secrets", "docker", "kubeapiserver", "kubelet", ] @task def build(ctx, rebuild=False, race=False, precompile_only=False, build_include=None, build_exclude=None, major_version='7', python_runtimes='3', arch="x64"): ldflags, gcflags, env = get_build_flags(ctx, arch=arch, major_version=major_version, python_runtimes=python_runtimes) if sys.platform == 'win32': windres_target = "pe-x86-64" if arch == "x86": env["GOARCH"] = "386" windres_target = "pe-i386" ver = get_version_numeric_only(ctx, env, major_version=major_version) maj_ver, min_ver, patch_ver = ver.split(".") ctx.run("windmc --target {target_arch} -r cmd/trace-agent/windows_resources cmd/trace-agent/windows_resources/trace-agent-msg.mc".format(target_arch=windres_target)) ctx.run("windres --define MAJ_VER={maj_ver} --define MIN_VER={min_ver} --define PATCH_VER={patch_ver} -i cmd/trace-agent/windows_resources/trace-agent.rc --target {target_arch} -O coff -o cmd/trace-agent/rsrc.syso".format( maj_ver=maj_ver, min_ver=min_ver, patch_ver=patch_ver, target_arch=windres_target )) build_include = DEFAULT_BUILD_TAGS if build_include is None else build_include.split(",") build_exclude = [] if build_exclude is None else build_exclude.split(",") if not sys.platform.startswith('linux'): for ex in LINUX_ONLY_TAGS: if ex not in build_exclude: build_exclude.append(ex) build_tags = get_build_tags(build_include, build_exclude) cmd = "go build {race_opt} {build_type} -tags \"{go_build_tags}\" " cmd += "-o {agent_bin} -gcflags=\"{gcflags}\" -ldflags=\"{ldflags}\" {REPO_PATH}/cmd/trace-agent" args = { "race_opt": "-race" if race else "", "build_type": "-a" if rebuild else ("-i" if precompile_only else ""), "go_build_tags": " ".join(build_tags), "agent_bin": os.path.join(BIN_PATH, bin_name("trace-agent", android=False)), "gcflags": gcflags, "ldflags": ldflags, "REPO_PATH": REPO_PATH, } ctx.run("go generate {REPO_PATH}/pkg/trace/info".format(**args), env=env) ctx.run(cmd.format(**args), env=env) @task def integration_tests(ctx, install_deps=False, race=False, remote_docker=False): if install_deps: deps(ctx) test_args = { "go_build_tags": " ".join(get_default_build_tags()), "race_opt": "-race" if race else "", "exec_opts": "", } if remote_docker: test_args["exec_opts"] = "-exec \"inv docker.dockerize-test\"" go_cmd = 'INTEGRATION=yes go test {race_opt} -v'.format(**test_args) prefixes = [ "./pkg/trace/test/testsuite/...", ] for prefix in prefixes: ctx.run("{} {}".format(go_cmd, prefix)) @task def cross_compile(ctx, tag=""): if not tag: print("Argument --tag=<version> is required.") return print("Building tag %s..." % tag) env = { "TRACE_AGENT_VERSION": tag, "V": tag, } ctx.run("git checkout $V", env=env) ctx.run("mkdir -p ./bin/trace-agent/$V", env=env) ctx.run("go generate ./pkg/trace/info", env=env) ctx.run("go get -u github.com/karalabe/xgo") ctx.run("xgo -dest=bin/trace-agent/$V -go=1.11 -out=trace-agent-$V -targets=windows-6.1/amd64,linux/amd64,darwin-10.11/amd64 ./cmd/trace-agent", env=env) ctx.run("mv ./bin/trace-agent/$V/trace-agent-$V-windows-6.1-amd64.exe ./bin/trace-agent/$V/trace-agent-$V-windows-amd64.exe", env=env) ctx.run("mv ./bin/trace-agent/$V/trace-agent-$V-darwin-10.11-amd64 ./bin/trace-agent/$V/trace-agent-$V-darwin-amd64 ", env=env) ctx.run("git checkout -") print("Done! Binaries are located in ./bin/trace-agent/%s" % tag)
true
true
f7209497e72c208305cb4e1cce93a790ea4e4114
328
py
Python
emoji_chengyu/main.py
alingse/emoji-chengyu
2d4436212c1d2899dfc12a1c965ea2ddce9a4aab
[ "MIT" ]
3
2020-04-28T03:25:36.000Z
2022-01-24T04:52:01.000Z
emoji_chengyu/main.py
alingse/emoji-chengyu
2d4436212c1d2899dfc12a1c965ea2ddce9a4aab
[ "MIT" ]
null
null
null
emoji_chengyu/main.py
alingse/emoji-chengyu
2d4436212c1d2899dfc12a1c965ea2ddce9a4aab
[ "MIT" ]
1
2020-04-28T03:25:49.000Z
2020-04-28T03:25:49.000Z
import itertools from emoji_chengyu.puzzle import gen_puzzle def emoji_chengyu(): N = 100 pg = gen_puzzle() puzzles = list(itertools.islice(pg, N)) puzzles.sort(key=lambda p: sum(p.mask), reverse=True) M = 20 for puzzle in puzzles[:M]: print(''.join(puzzle.puzzle), puzzle.chengyu_item.word)
21.866667
63
0.670732
import itertools from emoji_chengyu.puzzle import gen_puzzle def emoji_chengyu(): N = 100 pg = gen_puzzle() puzzles = list(itertools.islice(pg, N)) puzzles.sort(key=lambda p: sum(p.mask), reverse=True) M = 20 for puzzle in puzzles[:M]: print(''.join(puzzle.puzzle), puzzle.chengyu_item.word)
true
true
f72094b30996c32bb9a24f3c3252221bebecd3fa
2,378
py
Python
tests/technical_ratio_test.py
bopo/mooquant
244a87d4cd8b4d918eec4f16905e0921c3b39f50
[ "Apache-2.0" ]
21
2017-09-07T16:08:21.000Z
2020-10-15T13:42:21.000Z
tests/technical_ratio_test.py
bopo/MooQuant
244a87d4cd8b4d918eec4f16905e0921c3b39f50
[ "Apache-2.0" ]
209
2018-10-09T11:57:39.000Z
2021-03-25T21:40:30.000Z
tests/technical_ratio_test.py
bopo/MooQuant
244a87d4cd8b4d918eec4f16905e0921c3b39f50
[ "Apache-2.0" ]
15
2018-11-17T20:14:37.000Z
2022-02-04T23:55:29.000Z
# -*- coding: utf-8 -*- # MooQuant # # Copyright 2011-2015 Gabriel Martin Becedillas Ruiz # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ .. moduleauthor:: Gabriel Martin Becedillas Ruiz <gabriel.becedillas@gmail.com> """ from mooquant import dataseries from mooquant.technical import ratio from . import common class TestCase(common.TestCase): def __buildRatio(self, values, ratioMaxLen=None): seqDS = dataseries.SequenceDataSeries() ret = ratio.Ratio(seqDS, ratioMaxLen) for value in values: seqDS.append(value) return ret def testSimple(self): ratio = self.__buildRatio([1, 2, 1]) self.assertEqual(ratio[0], None) self.assertEqual(ratio[1], 1) self.assertEqual(ratio[2], -0.5) self.assertEqual(ratio[-1], -0.5) with self.assertRaises(IndexError): ratio[3] self.assertEqual(ratio[-2], ratio[1]) self.assertEqual(ratio[-1], ratio[2]) self.assertEqual(len(ratio.getDateTimes()), 3) for i in range(len(ratio)): self.assertEqual(ratio.getDateTimes()[i], None) def testNegativeValues(self): ratio = self.__buildRatio([-1, -2, -1]) self.assertEqual(ratio[0], None) self.assertEqual(ratio[1], -1) self.assertEqual(ratio[2], 0.5) self.assertEqual(ratio[-1], 0.5) with self.assertRaises(IndexError): ratio[3] self.assertEqual(ratio[-2], ratio[1]) self.assertEqual(ratio[-1], ratio[2]) self.assertEqual(len(ratio.getDateTimes()), 3) for i in range(len(ratio)): self.assertEqual(ratio.getDateTimes()[i], None) def testBounded(self): ratio = self.__buildRatio([-1, -2, -1], 2) self.assertEqual(ratio[0], -1) self.assertEqual(ratio[1], 0.5) self.assertEqual(len(ratio), 2)
30.883117
79
0.647603
from mooquant import dataseries from mooquant.technical import ratio from . import common class TestCase(common.TestCase): def __buildRatio(self, values, ratioMaxLen=None): seqDS = dataseries.SequenceDataSeries() ret = ratio.Ratio(seqDS, ratioMaxLen) for value in values: seqDS.append(value) return ret def testSimple(self): ratio = self.__buildRatio([1, 2, 1]) self.assertEqual(ratio[0], None) self.assertEqual(ratio[1], 1) self.assertEqual(ratio[2], -0.5) self.assertEqual(ratio[-1], -0.5) with self.assertRaises(IndexError): ratio[3] self.assertEqual(ratio[-2], ratio[1]) self.assertEqual(ratio[-1], ratio[2]) self.assertEqual(len(ratio.getDateTimes()), 3) for i in range(len(ratio)): self.assertEqual(ratio.getDateTimes()[i], None) def testNegativeValues(self): ratio = self.__buildRatio([-1, -2, -1]) self.assertEqual(ratio[0], None) self.assertEqual(ratio[1], -1) self.assertEqual(ratio[2], 0.5) self.assertEqual(ratio[-1], 0.5) with self.assertRaises(IndexError): ratio[3] self.assertEqual(ratio[-2], ratio[1]) self.assertEqual(ratio[-1], ratio[2]) self.assertEqual(len(ratio.getDateTimes()), 3) for i in range(len(ratio)): self.assertEqual(ratio.getDateTimes()[i], None) def testBounded(self): ratio = self.__buildRatio([-1, -2, -1], 2) self.assertEqual(ratio[0], -1) self.assertEqual(ratio[1], 0.5) self.assertEqual(len(ratio), 2)
true
true
f72094fcc0eabe24153127ed8f8cfab3259c6ceb
1,247
py
Python
IRIS_data_download/IRIS_download_support/obspy/io/segy/util.py
earthinversion/Fnet_IRIS_data_automated_download
09a6e0c992662feac95744935e038d1c68539fa1
[ "MIT" ]
2
2020-03-05T01:03:01.000Z
2020-12-17T05:04:07.000Z
IRIS_data_download/IRIS_download_support/obspy/io/segy/util.py
earthinversion/Fnet_IRIS_data_automated_download
09a6e0c992662feac95744935e038d1c68539fa1
[ "MIT" ]
4
2021-03-31T19:25:55.000Z
2021-12-13T20:32:46.000Z
IRIS_data_download/IRIS_download_support/obspy/io/segy/util.py
earthinversion/Fnet_IRIS_data_automated_download
09a6e0c992662feac95744935e038d1c68539fa1
[ "MIT" ]
2
2020-09-08T19:33:40.000Z
2021-04-05T09:47:50.000Z
# -*- coding: utf-8 -*- from __future__ import (absolute_import, division, print_function, unicode_literals) from future.builtins import * # NOQA from struct import unpack from obspy.core.util.libnames import _load_cdll # Import shared libsegy clibsegy = _load_cdll("segy") def unpack_header_value(endian, packed_value, length, special_format): """ Unpacks a single value. """ # Use special format if necessary. if special_format: fmt = ('%s%s' % (endian, special_format)).encode('ascii', 'strict') return unpack(fmt, packed_value)[0] # Unpack according to different lengths. elif length == 2: format = ('%sh' % endian).encode('ascii', 'strict') return unpack(format, packed_value)[0] # Update: Seems to be correct. Two's complement integers seem to be # the common way to store integer values. elif length == 4: format = ('%si' % endian).encode('ascii', 'strict') return unpack(format, packed_value)[0] # The unassigned field. Since it is unclear how this field is # encoded it will just be stored as a string. elif length == 8: return packed_value # Should not happen else: raise Exception
31.974359
75
0.652767
from __future__ import (absolute_import, division, print_function, unicode_literals) from future.builtins import * from struct import unpack from obspy.core.util.libnames import _load_cdll clibsegy = _load_cdll("segy") def unpack_header_value(endian, packed_value, length, special_format): if special_format: fmt = ('%s%s' % (endian, special_format)).encode('ascii', 'strict') return unpack(fmt, packed_value)[0] elif length == 2: format = ('%sh' % endian).encode('ascii', 'strict') return unpack(format, packed_value)[0] # the common way to store integer values. elif length == 4: format = ('%si' % endian).encode('ascii', 'strict') return unpack(format, packed_value)[0] # The unassigned field. Since it is unclear how this field is # encoded it will just be stored as a string. elif length == 8: return packed_value # Should not happen else: raise Exception
true
true
f72095d4a18d4936ed6471f607ee84100d63dad6
2,845
py
Python
MMLanScan/Data/build_port_services_list.py
cyb3rc/MMLanScan
60cf1cb9476bad8ee522780ce4df5513a139f47d
[ "MIT" ]
null
null
null
MMLanScan/Data/build_port_services_list.py
cyb3rc/MMLanScan
60cf1cb9476bad8ee522780ce4df5513a139f47d
[ "MIT" ]
null
null
null
MMLanScan/Data/build_port_services_list.py
cyb3rc/MMLanScan
60cf1cb9476bad8ee522780ce4df5513a139f47d
[ "MIT" ]
null
null
null
#!/usr/bin/python import urllib2 import xml.etree.ElementTree as ElementTree import re def refine_table(table): result = table result = re.sub(r"<td.*?>", "<td>", result) result = re.sub(r"<tr.*?>", "<tr>", result) result = re.sub(r"<a.*?>(.*?)</a>", "\\1", result) result = re.sub(r"<span.*?>(.*?)</span>", "\\1", result) result = re.sub(r"<b.*?>(.*?)</b>", "\\1", result) result = re.sub(r"<br\s?/>", "", result) result = re.sub(r"<sup.*?/sup>", "", result) result = re.sub(r"<sub.*?/sub>", "", result) result = re.sub(r"<caption.*?/caption>", "", result) result = re.sub(r"</abbr>", "", result) result = re.sub(r"\n", "", result) result = re.sub(r"<div.*?>.*?<li>(.*?)</li>.*?</div>", "\\1", result, re.M | re.S) return result def main(): response = urllib2.urlopen("https://en.wikipedia.org/wiki/List_of_TCP_and_UDP_port_numbers") content = response.read() tables = re.findall(r"<table class=\"wikitable sortable collapsible\">(.*?)</table>", content, re.M | re.S) table_well_known = refine_table(tables[0]) table_registered_known = refine_table(tables[1]) whole_table = "<table>" + table_well_known + table_registered_known + "</table>" tree = ElementTree.fromstring(whole_table) port_info = {} for child in tree: port = child[0].text tcp = child[1].text udp = child[2].text desc = (child[3][0].text if len(child[3]) > 0 else child[3].text).replace(",", "").replace(".", "") # skip invalid entries if not port: continue if ("Reserved" in [tcp, udp]) or ("N/A" in [tcp, udp]): continue # defaulting to TCP if (not tcp and not udp): tcp = "TCP" elif tcp and tcp.lower() in ["yes", "assigned", "?"]: tcp = "TCP" if udp and udp.lower() in ["yes", "assigned", "?"]: tcp = "TCP" # check if given is port range try: port_range = map(int, port.split("-")) except: continue port_range = [int(port)] if port.isdigit() else map(int, port.split("-")) for p in port_range: if p not in port_info: port_info[p] = [set(),[]] if tcp == "TCP": port_info[p][0].add("tcp") if udp == "UDP": port_info[p][0].add("udp") port_info[p][1].append(desc) with open("services.list", "w") as fsvcs: for port, info in sorted(port_info.items()): for proto in sorted(info[0]): svc = (" | ".join(info[1])).replace(u"\u00e9", "e").replace(u"\u2013", "-").replace(u"\u2014", "-") fsvcs.write(("%s,%s,%s" % (proto, port, svc))) fsvcs.write("\n") if __name__ == "__main__": main()
31.611111
115
0.518102
import urllib2 import xml.etree.ElementTree as ElementTree import re def refine_table(table): result = table result = re.sub(r"<td.*?>", "<td>", result) result = re.sub(r"<tr.*?>", "<tr>", result) result = re.sub(r"<a.*?>(.*?)</a>", "\\1", result) result = re.sub(r"<span.*?>(.*?)</span>", "\\1", result) result = re.sub(r"<b.*?>(.*?)</b>", "\\1", result) result = re.sub(r"<br\s?/>", "", result) result = re.sub(r"<sup.*?/sup>", "", result) result = re.sub(r"<sub.*?/sub>", "", result) result = re.sub(r"<caption.*?/caption>", "", result) result = re.sub(r"</abbr>", "", result) result = re.sub(r"\n", "", result) result = re.sub(r"<div.*?>.*?<li>(.*?)</li>.*?</div>", "\\1", result, re.M | re.S) return result def main(): response = urllib2.urlopen("https://en.wikipedia.org/wiki/List_of_TCP_and_UDP_port_numbers") content = response.read() tables = re.findall(r"<table class=\"wikitable sortable collapsible\">(.*?)</table>", content, re.M | re.S) table_well_known = refine_table(tables[0]) table_registered_known = refine_table(tables[1]) whole_table = "<table>" + table_well_known + table_registered_known + "</table>" tree = ElementTree.fromstring(whole_table) port_info = {} for child in tree: port = child[0].text tcp = child[1].text udp = child[2].text desc = (child[3][0].text if len(child[3]) > 0 else child[3].text).replace(",", "").replace(".", "") if not port: continue if ("Reserved" in [tcp, udp]) or ("N/A" in [tcp, udp]): continue if (not tcp and not udp): tcp = "TCP" elif tcp and tcp.lower() in ["yes", "assigned", "?"]: tcp = "TCP" if udp and udp.lower() in ["yes", "assigned", "?"]: tcp = "TCP" try: port_range = map(int, port.split("-")) except: continue port_range = [int(port)] if port.isdigit() else map(int, port.split("-")) for p in port_range: if p not in port_info: port_info[p] = [set(),[]] if tcp == "TCP": port_info[p][0].add("tcp") if udp == "UDP": port_info[p][0].add("udp") port_info[p][1].append(desc) with open("services.list", "w") as fsvcs: for port, info in sorted(port_info.items()): for proto in sorted(info[0]): svc = (" | ".join(info[1])).replace(u"\u00e9", "e").replace(u"\u2013", "-").replace(u"\u2014", "-") fsvcs.write(("%s,%s,%s" % (proto, port, svc))) fsvcs.write("\n") if __name__ == "__main__": main()
true
true
f72095f560d4de6eaf24da310f2f00ce19300c51
4,718
py
Python
API/content/views.py
kasimbozdag/SWE_573
4bce24f98fe6980b1f2c83196b8454b56118186b
[ "MIT" ]
null
null
null
API/content/views.py
kasimbozdag/SWE_573
4bce24f98fe6980b1f2c83196b8454b56118186b
[ "MIT" ]
52
2019-02-19T10:43:11.000Z
2022-02-10T10:36:37.000Z
API/content/views.py
kasimbozdag/SWE_573
4bce24f98fe6980b1f2c83196b8454b56118186b
[ "MIT" ]
null
null
null
import datetime from django.shortcuts import render, get_object_or_404 # Create your views here. from rest_framework.generics import ListAPIView from rest_framework.response import Response from rest_framework.status import HTTP_200_OK from rest_framework.views import APIView from content.models import Content from content.serializers import ContentSerializer, ContentsSerializer, ContentsDetailSerializer from lesson.models import Lesson, Contents class ContentCreateAPIView(APIView): def post(self, request, *args, **kwargs): user = request.user data = request.data lesson = get_object_or_404(Lesson, pk=kwargs.get("pk")) content = {'text': data['text'], "sub_title": data['title']} if "file" in request.FILES: file = request.FILES['file'] content['file'] = file serializer = ContentSerializer(data=content) serializer.is_valid(raise_exception=True) serializer.save() place = Contents.objects.filter(lesson=lesson.id).count() + 1 contents = { "lesson": kwargs.get("pk"), "content": serializer.instance.pk, "owner": user.pk, "place": place, } serializer = ContentsSerializer(data=contents) serializer.is_valid(raise_exception=True) serializer.save() return Response(serializer.data, status=HTTP_200_OK) class ContentsListAPIView(ListAPIView): serializer_class = ContentsDetailSerializer queryset = Contents.objects.all() def get_queryset(self): return Contents.objects.filter(lesson=self.kwargs.get("pk"), is_active=True).order_by("place") class ContentsAPIView(APIView): def put(self, request, *args, **kwargs): user = request.user data = request.data pk = kwargs['pk'] contents = get_object_or_404(Contents, pk=pk) if not contents.is_authorized(request.user): return Response(status=401) content = contents.content content_data = {'text': data['text'], "last_edited_at": datetime.datetime.now(), "sub_title": data['title']} if "file" in request.FILES: file = request.FILES['file'] content_data['file'] = file serializer = ContentSerializer(content, data=content_data) serializer.is_valid(raise_exception=True) serializer.save() contents_data = { "lesson": contents.lesson_id, "content": content.pk, "owner": contents.owner.pk, "last_edited_at": datetime.datetime.now(), } serializer = ContentsSerializer(contents, data=contents_data) serializer.is_valid(raise_exception=True) serializer.save() return Response(serializer.data, status=HTTP_200_OK) def get(self, request, *args, **kwargs): pk = kwargs['pk'] contents = get_object_or_404(Contents, pk=pk) serializer = ContentsDetailSerializer(contents) return Response(serializer.data, status=HTTP_200_OK) class ContentsInactivateAPIView(APIView): def put(self, request, *args, **kwargs): pk = kwargs['pk'] content = get_object_or_404(Contents, pk=pk) if not content.is_authorized(request.user): return Response(status=401) content.is_active = False content.save() return Response(status=HTTP_200_OK) class ContentsActivateAPIView(APIView): def put(self, request, *args, **kwargs): pk = kwargs['pk'] content = get_object_or_404(Contents, pk=pk) if not content.is_authorized(request.user): return Response(status=401) content.is_active = True content.save() return Response(status=HTTP_200_OK) class TeacherContentsListAPIView(ListAPIView): serializer_class = ContentsDetailSerializer queryset = Contents.objects.all() def get_queryset(self): return Contents.objects.filter(lesson=self.kwargs.get("pk")).order_by("place") class ChangePlaceAPIView(APIView): def put(self, request, *args, **kwargs): pk = kwargs['pk'] content = get_object_or_404(Contents, pk=pk) if not content.is_authorized(request.user): return Response(status=401) place=request.data['place'] lte=content.place gte=place change=1 if lte < gte: lte=place gte=content.place change=-1 contents=Contents.objects.filter(place__gte=gte).filter(place__lte=lte) for l in contents: l.place=l.place+change l.save() content.place=place content.save() return Response(status=HTTP_200_OK)
35.473684
116
0.652183
import datetime from django.shortcuts import render, get_object_or_404 from rest_framework.generics import ListAPIView from rest_framework.response import Response from rest_framework.status import HTTP_200_OK from rest_framework.views import APIView from content.models import Content from content.serializers import ContentSerializer, ContentsSerializer, ContentsDetailSerializer from lesson.models import Lesson, Contents class ContentCreateAPIView(APIView): def post(self, request, *args, **kwargs): user = request.user data = request.data lesson = get_object_or_404(Lesson, pk=kwargs.get("pk")) content = {'text': data['text'], "sub_title": data['title']} if "file" in request.FILES: file = request.FILES['file'] content['file'] = file serializer = ContentSerializer(data=content) serializer.is_valid(raise_exception=True) serializer.save() place = Contents.objects.filter(lesson=lesson.id).count() + 1 contents = { "lesson": kwargs.get("pk"), "content": serializer.instance.pk, "owner": user.pk, "place": place, } serializer = ContentsSerializer(data=contents) serializer.is_valid(raise_exception=True) serializer.save() return Response(serializer.data, status=HTTP_200_OK) class ContentsListAPIView(ListAPIView): serializer_class = ContentsDetailSerializer queryset = Contents.objects.all() def get_queryset(self): return Contents.objects.filter(lesson=self.kwargs.get("pk"), is_active=True).order_by("place") class ContentsAPIView(APIView): def put(self, request, *args, **kwargs): user = request.user data = request.data pk = kwargs['pk'] contents = get_object_or_404(Contents, pk=pk) if not contents.is_authorized(request.user): return Response(status=401) content = contents.content content_data = {'text': data['text'], "last_edited_at": datetime.datetime.now(), "sub_title": data['title']} if "file" in request.FILES: file = request.FILES['file'] content_data['file'] = file serializer = ContentSerializer(content, data=content_data) serializer.is_valid(raise_exception=True) serializer.save() contents_data = { "lesson": contents.lesson_id, "content": content.pk, "owner": contents.owner.pk, "last_edited_at": datetime.datetime.now(), } serializer = ContentsSerializer(contents, data=contents_data) serializer.is_valid(raise_exception=True) serializer.save() return Response(serializer.data, status=HTTP_200_OK) def get(self, request, *args, **kwargs): pk = kwargs['pk'] contents = get_object_or_404(Contents, pk=pk) serializer = ContentsDetailSerializer(contents) return Response(serializer.data, status=HTTP_200_OK) class ContentsInactivateAPIView(APIView): def put(self, request, *args, **kwargs): pk = kwargs['pk'] content = get_object_or_404(Contents, pk=pk) if not content.is_authorized(request.user): return Response(status=401) content.is_active = False content.save() return Response(status=HTTP_200_OK) class ContentsActivateAPIView(APIView): def put(self, request, *args, **kwargs): pk = kwargs['pk'] content = get_object_or_404(Contents, pk=pk) if not content.is_authorized(request.user): return Response(status=401) content.is_active = True content.save() return Response(status=HTTP_200_OK) class TeacherContentsListAPIView(ListAPIView): serializer_class = ContentsDetailSerializer queryset = Contents.objects.all() def get_queryset(self): return Contents.objects.filter(lesson=self.kwargs.get("pk")).order_by("place") class ChangePlaceAPIView(APIView): def put(self, request, *args, **kwargs): pk = kwargs['pk'] content = get_object_or_404(Contents, pk=pk) if not content.is_authorized(request.user): return Response(status=401) place=request.data['place'] lte=content.place gte=place change=1 if lte < gte: lte=place gte=content.place change=-1 contents=Contents.objects.filter(place__gte=gte).filter(place__lte=lte) for l in contents: l.place=l.place+change l.save() content.place=place content.save() return Response(status=HTTP_200_OK)
true
true
f72095f7242e0943bddfcfc8d4c0d806cf6d4b17
1,274
py
Python
build/lib/elang/plot/utils/embedding.py
onlyphantom/elangdev
bdb80e10e98f98ef6510c313cda55daf9464d5c4
[ "CC0-1.0" ]
5
2020-02-26T15:05:47.000Z
2022-01-25T01:15:27.000Z
build/lib/elang/plot/utils/embedding.py
onlyphantom/elangdev
bdb80e10e98f98ef6510c313cda55daf9464d5c4
[ "CC0-1.0" ]
null
null
null
build/lib/elang/plot/utils/embedding.py
onlyphantom/elangdev
bdb80e10e98f98ef6510c313cda55daf9464d5c4
[ "CC0-1.0" ]
1
2020-02-13T08:14:11.000Z
2020-02-13T08:14:11.000Z
import sys, os.path import gensim from gensim.models import Word2Vec import numpy as np import matplotlib.pyplot as plt from sklearn.decomposition import PCA def plot2d_demo(model, words=None): assert ( model.vector_size >= 2 ), "This function expects a model of size 2 (2-dimension word vectors) or higher." if words is None: words = [words for words in model.wv.vocab] word_vec = np.array([model.wv[word] for word in words]) if model.vector_size > 2: pca = PCA(2) word_vec = pca.fit_transform(word_vec) with plt.style.context("seaborn-pastel"): plt.figure(figsize=(7, 5), dpi=180) plt.scatter(word_vec[:, 0], word_vec[:, 1], s=5, edgecolors="k", c="c") for word, (x, y) in zip(words, word_vec): plt.text(x - 0.02, y + 0.02, word, fontsize=5) plt.show() if __name__ == "__main__": MODEL_PATH = ( os.path.abspath(os.path.join(os.path.dirname(__file__), "../../")) + "/word2vec/model/demo2d.model" # + "/word2vec/model/demo500d.model" ) model = Word2Vec.load(MODEL_PATH) print("Loaded from Path:", MODEL_PATH, "\n", model) # plot2d_demo(model, words=["bca", "mandiri", "uob", "algoritma", "airbnb"]) plot2d_demo(model)
28.311111
86
0.625589
import sys, os.path import gensim from gensim.models import Word2Vec import numpy as np import matplotlib.pyplot as plt from sklearn.decomposition import PCA def plot2d_demo(model, words=None): assert ( model.vector_size >= 2 ), "This function expects a model of size 2 (2-dimension word vectors) or higher." if words is None: words = [words for words in model.wv.vocab] word_vec = np.array([model.wv[word] for word in words]) if model.vector_size > 2: pca = PCA(2) word_vec = pca.fit_transform(word_vec) with plt.style.context("seaborn-pastel"): plt.figure(figsize=(7, 5), dpi=180) plt.scatter(word_vec[:, 0], word_vec[:, 1], s=5, edgecolors="k", c="c") for word, (x, y) in zip(words, word_vec): plt.text(x - 0.02, y + 0.02, word, fontsize=5) plt.show() if __name__ == "__main__": MODEL_PATH = ( os.path.abspath(os.path.join(os.path.dirname(__file__), "../../")) + "/word2vec/model/demo2d.model" ) model = Word2Vec.load(MODEL_PATH) print("Loaded from Path:", MODEL_PATH, "\n", model) plot2d_demo(model)
true
true
f720966df99b4facf9ee616398c70c34a8e38598
49,071
py
Python
tensorflow/python/data/experimental/kernel_tests/snapshot_test.py
weikhor/tensorflow
ce047fc05c7b5ff54868ba53d724d9c171c4adbb
[ "Apache-2.0" ]
10
2021-05-25T17:43:04.000Z
2022-03-08T10:46:09.000Z
tensorflow/python/data/experimental/kernel_tests/snapshot_test.py
weikhor/tensorflow
ce047fc05c7b5ff54868ba53d724d9c171c4adbb
[ "Apache-2.0" ]
1,056
2019-12-15T01:20:31.000Z
2022-02-10T02:06:28.000Z
tensorflow/python/data/experimental/kernel_tests/snapshot_test.py
weikhor/tensorflow
ce047fc05c7b5ff54868ba53d724d9c171c4adbb
[ "Apache-2.0" ]
6
2016-09-07T04:00:15.000Z
2022-01-12T01:47:38.000Z
# Copyright 2019 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for the `SnapshotDataset` transformation.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import multiprocessing import os import shutil import time from absl.testing import parameterized import numpy as np from tensorflow.python.data.experimental.ops import snapshot from tensorflow.python.data.kernel_tests import checkpoint_test_base from tensorflow.python.data.kernel_tests import test_base from tensorflow.python.data.kernel_tests import tf_record_test_base from tensorflow.python.data.ops import dataset_ops from tensorflow.python.data.ops import readers as core_readers from tensorflow.python.framework import combinations from tensorflow.python.framework import errors from tensorflow.python.framework import ops from tensorflow.python.ops import gen_array_ops from tensorflow.python.ops import string_ops from tensorflow.python.platform import test def is_graphdef_file(filename): return filename.endswith("-graph.pbtxt") def is_temp_file(filename): return "-tmp-" in filename def listdir_and_filter(dirname, filter_fn): return [path for path in sorted(os.listdir(dirname)) if filter_fn(path)] class SnapshotTest(tf_record_test_base.TFRecordTestBase, parameterized.TestCase): def setUp(self): super(SnapshotTest, self).setUp() tmpdir = self.get_temp_dir() tmpdir = os.path.join(tmpdir, "snapshot") os.mkdir(tmpdir) self._snapshot_dir = tmpdir def tearDown(self): super(SnapshotTest, self).tearDown() shutil.rmtree(self._snapshot_dir) def createTFRecords(self, num_files=10, num_records=100): self._num_files = num_files self._num_records = num_records self._filenames = self._createFiles() def removeTFRecords(self): for filename in self._filenames: os.remove(filename) self._filenames = [] self._num_files = None self._num_records = None def assertDatasetProducesSet(self, dataset, expected): actual = [] next_fn = self.getNext(dataset) for _ in range(len(expected)): elem = self.evaluate(next_fn()) actual.append(elem) self.assertCountEqual(actual, expected) with self.assertRaises(errors.OutOfRangeError): self.evaluate(next_fn()) def assertSnapshotDirectoryContains(self, directory, num_fingerprints, num_runs_per_fingerprint, num_snapshot_shards_per_run): # Ignore the graphdef pbtxts we write for debugging purposes and temporary # files that are an artifact of how TF writes files. dirlist = listdir_and_filter( directory, lambda p: not (is_graphdef_file(p) or is_temp_file(p))) self.assertLen(dirlist, num_fingerprints) for i in range(num_fingerprints): fingerprint_dir = os.path.join(directory, dirlist[i]) fingerprint_dir_list = listdir_and_filter( fingerprint_dir, lambda p: not is_temp_file(p)) self.assertLen(fingerprint_dir_list, num_runs_per_fingerprint + 1) self.assertEqual(fingerprint_dir_list[num_runs_per_fingerprint], "snapshot.metadata") for j in range(num_runs_per_fingerprint): run_dir = os.path.join(fingerprint_dir, fingerprint_dir_list[j]) run_dirlist = sorted(os.listdir(run_dir)) self.assertLen(run_dirlist, num_snapshot_shards_per_run) file_counter = 0 for filename in run_dirlist: self.assertEqual(filename, "%08d.shard" % file_counter) file_counter += 1 @combinations.generate(test_base.default_test_combinations()) def testCreateSnapshotDataset(self): dataset = dataset_ops.Dataset.from_tensors([1, 2, 3]) dataset.apply(snapshot.snapshot(self._snapshot_dir)) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetDefault(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetAutoWriteSnappyRead(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, compression="AUTO")) self.assertDatasetProduces(dataset, expected) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.snapshot(self._snapshot_dir, compression="SNAPPY")) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetCustomShardFn(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, shard_func=lambda _: np.int64(0))) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=1) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.snapshot(self._snapshot_dir, shard_func=lambda _: 0)) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetCustomReaderFn(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.snapshot( self._snapshot_dir, reader_func=( lambda ds: ds.interleave( # pylint:disable=g-long-lambda lambda x: x, cycle_length=4, num_parallel_calls=4)))) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.snapshot( self._snapshot_dir, reader_func=( lambda ds: ds.interleave( # pylint:disable=g-long-lambda lambda x: x, cycle_length=4, num_parallel_calls=4)))) self.assertDatasetProducesSet(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testSnapshotDatasetInvalidShardFn(self): dataset = dataset_ops.Dataset.range(1000) with self.assertRaises(TypeError): dataset = dataset.apply( snapshot.snapshot( self._snapshot_dir, shard_func=lambda _: "invalid_fn")) next_fn = self.getNext(dataset) self.evaluate(next_fn()) @combinations.generate(test_base.default_test_combinations()) def testSnapshotDatasetInvalidReaderFn(self): dataset = dataset_ops.Dataset.range(1000) with self.assertRaises(TypeError): dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, reader_func=lambda x: x + 1)) next_fn = self.getNext(dataset) self.evaluate(next_fn()) @combinations.generate(test_base.default_test_combinations()) def testRoundtripEmptySnapshot(self): dataset = dataset_ops.Dataset.range(0) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, []) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=0) dataset2 = dataset_ops.Dataset.range(0) dataset2 = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, []) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetSimple(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetMultipleFingerprints(self): dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset1, list(range(1000))) dataset2 = dataset_ops.Dataset.range(2000) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, list(range(2000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=2, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetSameFingerprintMultipleCompleteRuns(self): dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset1, list(range(1000))) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetSameFingerprintIncompleteRunRestart(self): dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.snapshot(self._snapshot_dir)) next1 = self.getNext(dataset1) for i in range(500): self.assertEqual(i, self.evaluate(next1())) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) next2 = self.getNext(dataset2) for i in range(500): self.assertEqual(i, self.evaluate(next2())) for i in range(500, 1000): self.assertEqual(i, self.evaluate(next1())) self.assertEqual(i, self.evaluate(next2())) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=2, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotCustomShardFunction(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.enumerate() dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, shard_func=lambda i, _: i % 2)) dataset = dataset.map(lambda _, elem: elem) self.assertDatasetProduces(dataset, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=2) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetWithTuples(self): dataset1 = dataset_ops.Dataset.range(0, 1000) dataset2 = dataset_ops.Dataset.range(1000, 2000) dataset3 = dataset_ops.Dataset.range(2000, 3000) dataset4 = dataset_ops.Dataset.range(3000, 4000) dataset = dataset_ops.Dataset.zip((dataset1, dataset2, dataset3, dataset4)) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) expected = list( zip( range(0, 1000), range(1000, 2000), range(2000, 3000), range(3000, 4000))) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotShuffleSameFingerprint(self): def make_dataset(): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.shuffle(1000) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) return dataset dataset1 = make_dataset() self.assertDatasetProducesSet(dataset1, list(range(1000))) dataset2 = make_dataset() self.assertDatasetProducesSet(dataset2, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testReadUsingFlatMap(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, list(range(1000))) flat_map = dataset_ops.Dataset.from_tensors(dataset).flat_map(lambda x: x) self.assertDatasetProduces(flat_map, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testReadOptimizableUsingFlatMap(self): dataset = dataset_ops.Dataset.range(1000) # Will be optimized into ShuffleAndRepeat. dataset = dataset.shuffle(10) dataset = dataset.repeat(2) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProducesSet(dataset, 2 * list(range(1000))) flat_map = dataset_ops.Dataset.from_tensors(dataset).flat_map(lambda x: x) self.assertDatasetProducesSet(flat_map, 2 * list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testRepeatAndPrefetch(self): """This test reproduces github.com/tensorflow/tensorflow/issues/48903.""" dataset = dataset_ops.Dataset.from_tensor_slices(np.random.rand(16, 32)) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) dataset = dataset.shuffle(buffer_size=16) dataset = dataset.batch(16) dataset = dataset.repeat() dataset = dataset.prefetch(1) next_element = self.getNext(dataset) for _ in range(30): self.evaluate(next_element()) class LegacySnapshotTest(tf_record_test_base.TFRecordTestBase, parameterized.TestCase): def setUp(self): super(LegacySnapshotTest, self).setUp() self.removeTFRecords() tmpdir = self.get_temp_dir() tmpdir = os.path.join(tmpdir, "snapshot") os.mkdir(tmpdir) self.snapshot_dir = tmpdir def tearDown(self): super(LegacySnapshotTest, self).tearDown() shutil.rmtree(self.snapshot_dir) def removeTFRecords(self): for filename in self._filenames: os.remove(filename) self._filenames = [] def setUpTFRecord(self, num_files=10, num_records=10): self._num_files = num_files self._num_records = num_records self._filenames = self._createFiles() def makeSnapshotDirectory(self): return self.snapshot_dir def assertSnapshotDirectoryContains(self, directory, num_fingerprints, num_runs_per_fp, num_snapshot_files): # Ignore the graphdef pbtxts we write for debugging purposes and temporary # files that are an artifact of how TF writes files. dirlist = listdir_and_filter( directory, lambda p: not (is_graphdef_file(p) or is_temp_file(p))) self.assertLen(dirlist, num_fingerprints) for i in range(num_fingerprints): fingerprint_dir = os.path.join(directory, dirlist[i]) fingerprint_dir_list = listdir_and_filter( fingerprint_dir, lambda p: not is_temp_file(p)) self.assertLen(fingerprint_dir_list, num_runs_per_fp + 1) self.assertEqual(fingerprint_dir_list[num_runs_per_fp], "snapshot.metadata") for j in range(num_runs_per_fp): run_dir = os.path.join(fingerprint_dir, fingerprint_dir_list[j]) run_dirlist = sorted(os.listdir(run_dir)) self.assertLen(run_dirlist, num_snapshot_files) file_counter = 0 for filename in run_dirlist: self.assertEqual(filename, "%08d.snapshot" % file_counter) file_counter += 1 @combinations.generate(test_base.default_test_combinations()) def testWriteDifferentPipelinesInOneDirectory(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(1000))) dataset = dataset_ops.Dataset.range(1001) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(1001))) self.assertSnapshotDirectoryContains(tmpdir, 2, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotMultipleSimultaneous(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.legacy_snapshot(tmpdir)) next1 = self.getNext(dataset1) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply(snapshot.legacy_snapshot(tmpdir)) next2 = self.getNext(dataset2) for i in range(0, 1000): self.assertEqual(i, self.evaluate(next1())) self.assertEqual(i, self.evaluate(next2())) # we check that only one copy of the metadata has been written, and the # one that lost the race would be in passthrough mode. self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testGetNextCreatesDir(self): tmpdir = self.snapshot_dir # We create two iterators but call getNext on only one. dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.legacy_snapshot(tmpdir)) next1 = self.getNext(dataset1) dataset2 = dataset_ops.Dataset.range(1001) dataset2 = dataset2.apply(snapshot.legacy_snapshot(tmpdir)) _ = self.getNext(dataset2) for _ in range(1000): self.evaluate(next1()) # We check that only one directory is created. self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testWriteSnapshotSimpleSuccessful(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset, list(range(1000))) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testWriteSnapshotRepeatAfterwards(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testWriteSnapshotMixTypes(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) def map_fn(x): return (x, string_ops.as_string(x), string_ops.as_string(2 * x), 2 * x) dataset = dataset.map(map_fn) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) dataset = dataset.repeat(10) expected = [] for i in range(10): expected.append((i, str(i), str(2 * i), 2 * i)) self.assertDatasetProduces(dataset, expected * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testSpecifySnapshotNameWriteAndRead(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, snapshot_name="my_custom_snapshot")) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) self.assertTrue( os.path.exists(os.path.join(tmpdir, "custom-my_custom_snapshot"))) self.assertTrue( os.path.exists( os.path.join(tmpdir, "custom-my_custom_snapshot", "custom"))) @combinations.generate(test_base.default_test_combinations()) def testForcePassthroughMode(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, mode="passthrough")) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 0, 0, 0) @combinations.generate(test_base.default_test_combinations()) def testForceWriteMode(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir, mode="write")) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) # We will end up writing 10 different runs. self.assertSnapshotDirectoryContains(tmpdir, 1, 10, 1) @combinations.generate(test_base.default_test_combinations()) def testForceReadMode(self): tmpdir = self.snapshot_dir # We write a copy of the snapshot first. dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, mode="write", snapshot_name="my_custom_snapshot")) self.assertDatasetProduces(dataset, list(range(10))) # We move the run to a new name. shutil.move( os.path.join(tmpdir, "custom-my_custom_snapshot"), os.path.join(tmpdir, "custom-my_custom_snapshot_2")) # Even though the snapshot.metadata is pointing to the old run that no # longer exists after we moved, we force it to read from the run we specify. dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, mode="read", snapshot_name="my_custom_snapshot_2")) self.assertDatasetProduces(dataset, list(range(10))) # We should still have one snapshot and one run. self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testForceReadNonexistentSnapshot(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) with self.assertRaises(errors.NotFoundError): dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir, mode="read")) get_next = self.getNext(dataset) self.evaluate(get_next()) @combinations.generate(test_base.default_test_combinations()) def testForceReadNonexistentNamedSnapshot(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) with self.assertRaises(errors.NotFoundError): dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, mode="read", snapshot_name="my_nonexistent_snapshot")) get_next = self.getNext(dataset) self.evaluate(get_next()) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testReadSnapshotBackAfterWrite(self, compression): self.setUpTFRecord() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 10) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadShuffledSnapshotAfterWrite(self): self.setUpTFRecord(num_files=10, num_records=50) filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 50) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=100)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=100, shuffle_on_read=True)) next2 = self.getNext(dataset2) res1 = self.evaluate(next2()) res2 = self.evaluate(next2()) res3 = self.evaluate(next2()) res4 = self.evaluate(next2()) res5 = self.evaluate(next2()) # make sure that we don't read the file back in the same order. self.assertNotEqual([res1, res2, res3, res4, res5], expected[0:5]) # make sure all the elements are still there dataset3 = core_readers._TFRecordDataset(filenames) dataset3 = dataset3.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=100, shuffle_on_read=True)) self.assertDatasetProduces(dataset3, expected, assert_items_equal=True) @combinations.generate(test_base.default_test_combinations()) def testReadShuffledSnapshotWithSeedAfterWrite(self): self.setUpTFRecord(num_files=10, num_records=50) filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 50) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=10)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=10, shuffle_on_read=True, shuffle_seed=123456)) next2 = self.getNext(dataset2) dataset3 = core_readers._TFRecordDataset(filenames) dataset3 = dataset3.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=10, shuffle_on_read=True, shuffle_seed=123456)) next3 = self.getNext(dataset3) # make sure that the items are read back in the same order for both datasets for _ in range(500): res2 = self.evaluate(next2()) res3 = self.evaluate(next3()) self.assertEqual(res2, res3) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testReadSnapshotParallelAfterWrite(self, compression): self.setUpTFRecord(5, 500) filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 5) for r in range(0, 500) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=1024 * 1024, num_reader_threads=2, reader_buffer_size=10, compression=compression)) self.assertDatasetProduces(dataset, expected, assert_items_equal=True) # remove the original files and try to read the data back only from # snapshot. self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=1024 * 1024, num_reader_threads=2, reader_buffer_size=10, compression=compression)) self.assertDatasetProduces(dataset2, expected, assert_items_equal=True) # Not testing Snappy here because Snappy reads currently require a lot of # memory. @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.times( combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP ]), combinations.combine(threads=2, size=[1, 2]) + combinations.combine(threads=8, size=[1, 4, 8])))) def testReadSnapshotBackAfterMultiThreadedWrite(self, compression, threads, size): self.setUpTFRecord() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 10) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, compression=compression, num_writer_threads=threads, writer_buffer_size=size)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from # snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset2, expected, assert_items_equal=True) @combinations.generate(test_base.default_test_combinations()) def testSameFingerprintWithDifferentInitializationOrder(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(0, 100) dataset2 = dataset_ops.Dataset.range(100, 200) dataset3 = dataset_ops.Dataset.range(200, 300) dataset = dataset1.concatenate(dataset2).concatenate(dataset3) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(300))) dataset4 = dataset_ops.Dataset.range(200, 300) dataset5 = dataset_ops.Dataset.range(100, 200) dataset6 = dataset_ops.Dataset.range(0, 100) dataset = dataset6.concatenate(dataset5).concatenate(dataset4) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(300))) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testExpiredSnapshotRewrite(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply( snapshot.legacy_snapshot(tmpdir, pending_snapshot_expiry_seconds=1)) next1 = self.getNext(dataset1) # Don't finish reading dataset1, so it is never finalized for _ in range(500): self.evaluate(next1()) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) time.sleep(2) # Creating dataset2 after we run through dataset1 due to eager mode, where # the snapshot state is determined immediately upon dataset creation. We # only want to determine the snapshot state for dataset2 after the first # snapshot has expired. dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply( snapshot.legacy_snapshot(tmpdir, pending_snapshot_expiry_seconds=1)) next2 = self.getNext(dataset2) for _ in range(500): self.evaluate(next2()) self.assertSnapshotDirectoryContains(tmpdir, 1, 2, 1) @combinations.generate(test_base.default_test_combinations()) def testSnapshotArgsCreateNewSnapshot(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=10000)) next1 = self.getNext(dataset1) for _ in range(1000): self.evaluate(next1()) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) # Create second snapshot with a different shard_size_bytes dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset1.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=20000)) next2 = self.getNext(dataset2) for _ in range(1000): self.evaluate(next2()) self.assertSnapshotDirectoryContains(tmpdir, 2, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testSpecifyShardSize(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.from_tensor_slices([1.0]) dataset = dataset.map(lambda x: gen_array_ops.broadcast_to(x, [1024, 1024])) dataset = dataset.repeat(10) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=10 * 1024 * 1024, compression=compression)) next_fn = self.getNext(dataset) for _ in range(10): self.evaluate(next_fn()) num_files = 1 if compression == snapshot.COMPRESSION_NONE: num_files = 3 self.assertSnapshotDirectoryContains(tmpdir, 1, 1, num_files) @combinations.generate(test_base.default_test_combinations()) def testAdditionalOperationsAfterReadBack(self): self.setUpTFRecord() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 10) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset2, expected) expected_after = [ b"cord %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 10) ] dataset3 = core_readers._TFRecordDataset(filenames) dataset3 = dataset3.apply(snapshot.legacy_snapshot(tmpdir)) dataset3 = dataset3.map(lambda x: string_ops.substr_v2(x, 2, 1000)) self.assertDatasetProduces(dataset3, expected_after) class SnapshotCheckpointTest(checkpoint_test_base.CheckpointTestBase, parameterized.TestCase): def _build_snapshot_dataset(self, repeat=False): def ds_fn(): self._snapshot_dir = os.path.join(self.get_temp_dir(), "snapshot") if not os.path.exists(self._snapshot_dir): os.mkdir(self._snapshot_dir) dataset = dataset_ops.Dataset.range(100) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) if repeat: dataset = dataset.repeat(2) return dataset return ds_fn @combinations.generate(test_base.default_test_combinations()) def testCheckpointBeforeEpochEndNoRepeat(self): ds_fn = self._build_snapshot_dataset(repeat=False) outputs = self.gen_outputs(ds_fn, [], 50, verify_exhausted=False) self.assertSequenceEqual(outputs, range(50)) outputs.extend( self.gen_outputs(ds_fn, [], 50, ckpt_saved=True, verify_exhausted=True)) self.assertSequenceEqual(outputs, range(100)) @combinations.generate(test_base.default_test_combinations()) def testCheckpointBeforeOneEpochWithReading(self): ds_fn = self._build_snapshot_dataset(repeat=True) # Generate 50 entries from iterator and save checkpoint. outputs = self.gen_outputs(ds_fn, [], 50, verify_exhausted=False) self.assertSequenceEqual(outputs, list(range(50))) # Restore from checkpoint and produce the rest of the elements from the # iterator. t = self.gen_outputs(ds_fn, [], 150, ckpt_saved=True, verify_exhausted=True) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(50)) + list(range(50, 100)) + list(range(100))) @combinations.generate(test_base.default_test_combinations()) def testCheckpointBeforeOneEpochThenRunAFewSteps(self): ds_fn = self._build_snapshot_dataset(repeat=False) outputs = self.gen_outputs( ds_fn, [10], 20, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, range(20)) outputs = outputs[:10] outputs.extend( self.gen_outputs(ds_fn, [], 90, ckpt_saved=True, verify_exhausted=True)) self.assertSequenceEqual(outputs, range(100)) @combinations.generate(test_base.default_test_combinations()) def testCheckpointAfterOneEpoch(self): ds_fn = self._build_snapshot_dataset(repeat=True) # Generate 110 entries from iterator and save checkpoint. outputs = self.gen_outputs(ds_fn, [], 110, verify_exhausted=False) self.assertSequenceEqual(outputs, list(range(100)) + list(range(10))) # Restore from checkpoint and produce the rest of the elements from the # iterator. t = self.gen_outputs(ds_fn, [], 90, ckpt_saved=True, verify_exhausted=True) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(100)) + list(range(10)) + list(range(10, 100))) @combinations.generate(test_base.default_test_combinations()) def testCheckpointAfterOneEpochRunFewSteps(self): ds_fn = self._build_snapshot_dataset(repeat=True) # Generate 120 entries from iterator and save checkpoint at 110. outputs = self.gen_outputs( ds_fn, [110], 120, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, list(range(100)) + list(range(20))) # Restore from checkpoint and produce the rest of the elements from the # iterator. outputs = outputs[:110] t = self.gen_outputs(ds_fn, [], 90, ckpt_saved=True, verify_exhausted=True) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(100)) + list(range(10)) + list(range(10, 100))) class LegacySnapshotCheckpointTest( checkpoint_test_base.CheckpointTestBase, parameterized.TestCase): def _build_snapshot_dataset(self, num_threads=1, repeat=False, pending_snapshot_expiry_seconds=-1, shard_size_bytes=None): def ds_fn(): self.snapshot_dir = os.path.join(self.get_temp_dir(), "snapshot") if not os.path.exists(self.snapshot_dir): os.mkdir(self.snapshot_dir) dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply( snapshot.legacy_snapshot( self.snapshot_dir, num_writer_threads=num_threads, writer_buffer_size=2 * num_threads, num_reader_threads=num_threads, reader_buffer_size=2 * num_threads, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds, shard_size_bytes=shard_size_bytes)) if repeat: dataset = dataset.repeat(2) return dataset return ds_fn @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testSnapshotBeforeEpochEnd(self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) outputs = self.gen_outputs(ds_fn, [], 100, verify_exhausted=False) self.assertSequenceEqual(outputs, range(100)) outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointBeforeOneEpochThenRunFewStepsSmallShardMultiThread( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds, shard_size_bytes=100) outputs = [] with ops.Graph().as_default() as g: init_op, get_next_op, saver = self._build_graph(ds_fn) with self.session(graph=g) as sess: self._initialize(init_op, sess) start = 0 end = 100 num_iters = end - start for _ in range(num_iters): outputs.append(sess.run(get_next_op)) self._save(sess, saver) start = 100 end = 400 num_iters = end - start for _ in range(num_iters): outputs.append(sess.run(get_next_op)) self.assertSequenceEqual(outputs, range(400)) outputs = outputs[:100] outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) fp_dir_list = os.listdir(self.snapshot_dir) self.assertLen(list(fp_dir_list), 2) for d in fp_dir_list: if not d.endswith("-graph.pbtxt"): fp_dir = os.path.join(self.snapshot_dir, d) run_dir_list = os.listdir(fp_dir) self.assertLen(list(run_dir_list), 2) for e in run_dir_list: if e != "snapshot.metadata": run_dir = os.path.join(fp_dir, e) self.assertLen(list(os.listdir(run_dir)), 258) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointBeforeOneEpochThenRunFewSteps( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) # Generate 200 entries from iterator but save checkpoint after producing # 100. outputs = self.gen_outputs( ds_fn, [100], 200, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, range(200)) outputs = outputs[:100] outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointBeforeOneEpochThenRunFewStepsMultipleThreads( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( num_threads=2, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) # Generate 200 entries from iterator but save checkpoint after producing # 100. outputs = self.gen_outputs( ds_fn, [100], 200, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, range(200)) outputs = outputs[:100] outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointAfterOneEpoch(self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( repeat=True, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) # Generate 1100 entries from iterator and save checkpoint. outputs = self.gen_outputs(ds_fn, [], 1100, verify_exhausted=False) self.assertSequenceEqual(outputs, list(range(1000)) + list(range(100))) # Restore from checkpoint and produce the rest of the elements from the # iterator. t = self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(1000)) + list(range(100)) + list(range(900))) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointAfterOneEpochThenRunFewSteps( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( repeat=True, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) # Generate 200 entries from iterator but save checkpoint after producing # 100. outputs = self.gen_outputs( ds_fn, [1100], 1200, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual( outputs, list(range(1000)) + list(range(100)) + list(range(100))) outputs = outputs[:1100] t = self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False) outputs.extend(t) self.assertSequenceEqual( outputs, (list(range(1000)) + list(range(100)) + list(range(900)))) if __name__ == "__main__": test.main()
37.834233
82
0.708259
from __future__ import absolute_import from __future__ import division from __future__ import print_function import multiprocessing import os import shutil import time from absl.testing import parameterized import numpy as np from tensorflow.python.data.experimental.ops import snapshot from tensorflow.python.data.kernel_tests import checkpoint_test_base from tensorflow.python.data.kernel_tests import test_base from tensorflow.python.data.kernel_tests import tf_record_test_base from tensorflow.python.data.ops import dataset_ops from tensorflow.python.data.ops import readers as core_readers from tensorflow.python.framework import combinations from tensorflow.python.framework import errors from tensorflow.python.framework import ops from tensorflow.python.ops import gen_array_ops from tensorflow.python.ops import string_ops from tensorflow.python.platform import test def is_graphdef_file(filename): return filename.endswith("-graph.pbtxt") def is_temp_file(filename): return "-tmp-" in filename def listdir_and_filter(dirname, filter_fn): return [path for path in sorted(os.listdir(dirname)) if filter_fn(path)] class SnapshotTest(tf_record_test_base.TFRecordTestBase, parameterized.TestCase): def setUp(self): super(SnapshotTest, self).setUp() tmpdir = self.get_temp_dir() tmpdir = os.path.join(tmpdir, "snapshot") os.mkdir(tmpdir) self._snapshot_dir = tmpdir def tearDown(self): super(SnapshotTest, self).tearDown() shutil.rmtree(self._snapshot_dir) def createTFRecords(self, num_files=10, num_records=100): self._num_files = num_files self._num_records = num_records self._filenames = self._createFiles() def removeTFRecords(self): for filename in self._filenames: os.remove(filename) self._filenames = [] self._num_files = None self._num_records = None def assertDatasetProducesSet(self, dataset, expected): actual = [] next_fn = self.getNext(dataset) for _ in range(len(expected)): elem = self.evaluate(next_fn()) actual.append(elem) self.assertCountEqual(actual, expected) with self.assertRaises(errors.OutOfRangeError): self.evaluate(next_fn()) def assertSnapshotDirectoryContains(self, directory, num_fingerprints, num_runs_per_fingerprint, num_snapshot_shards_per_run): dirlist = listdir_and_filter( directory, lambda p: not (is_graphdef_file(p) or is_temp_file(p))) self.assertLen(dirlist, num_fingerprints) for i in range(num_fingerprints): fingerprint_dir = os.path.join(directory, dirlist[i]) fingerprint_dir_list = listdir_and_filter( fingerprint_dir, lambda p: not is_temp_file(p)) self.assertLen(fingerprint_dir_list, num_runs_per_fingerprint + 1) self.assertEqual(fingerprint_dir_list[num_runs_per_fingerprint], "snapshot.metadata") for j in range(num_runs_per_fingerprint): run_dir = os.path.join(fingerprint_dir, fingerprint_dir_list[j]) run_dirlist = sorted(os.listdir(run_dir)) self.assertLen(run_dirlist, num_snapshot_shards_per_run) file_counter = 0 for filename in run_dirlist: self.assertEqual(filename, "%08d.shard" % file_counter) file_counter += 1 @combinations.generate(test_base.default_test_combinations()) def testCreateSnapshotDataset(self): dataset = dataset_ops.Dataset.from_tensors([1, 2, 3]) dataset.apply(snapshot.snapshot(self._snapshot_dir)) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetDefault(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetAutoWriteSnappyRead(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, compression="AUTO")) self.assertDatasetProduces(dataset, expected) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.snapshot(self._snapshot_dir, compression="SNAPPY")) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetCustomShardFn(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, shard_func=lambda _: np.int64(0))) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=1) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.snapshot(self._snapshot_dir, shard_func=lambda _: 0)) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadSnapshotDatasetCustomReaderFn(self): self.createTFRecords() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 100) ] dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.snapshot( self._snapshot_dir, reader_func=( lambda ds: ds.interleave( lambda x: x, cycle_length=4, num_parallel_calls=4)))) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.snapshot( self._snapshot_dir, reader_func=( lambda ds: ds.interleave( lambda x: x, cycle_length=4, num_parallel_calls=4)))) self.assertDatasetProducesSet(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testSnapshotDatasetInvalidShardFn(self): dataset = dataset_ops.Dataset.range(1000) with self.assertRaises(TypeError): dataset = dataset.apply( snapshot.snapshot( self._snapshot_dir, shard_func=lambda _: "invalid_fn")) next_fn = self.getNext(dataset) self.evaluate(next_fn()) @combinations.generate(test_base.default_test_combinations()) def testSnapshotDatasetInvalidReaderFn(self): dataset = dataset_ops.Dataset.range(1000) with self.assertRaises(TypeError): dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, reader_func=lambda x: x + 1)) next_fn = self.getNext(dataset) self.evaluate(next_fn()) @combinations.generate(test_base.default_test_combinations()) def testRoundtripEmptySnapshot(self): dataset = dataset_ops.Dataset.range(0) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, []) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=0) dataset2 = dataset_ops.Dataset.range(0) dataset2 = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, []) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetSimple(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetMultipleFingerprints(self): dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset1, list(range(1000))) dataset2 = dataset_ops.Dataset.range(2000) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, list(range(2000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=2, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetSameFingerprintMultipleCompleteRuns(self): dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset1, list(range(1000))) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset2, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetSameFingerprintIncompleteRunRestart(self): dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.snapshot(self._snapshot_dir)) next1 = self.getNext(dataset1) for i in range(500): self.assertEqual(i, self.evaluate(next1())) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply(snapshot.snapshot(self._snapshot_dir)) next2 = self.getNext(dataset2) for i in range(500): self.assertEqual(i, self.evaluate(next2())) for i in range(500, 1000): self.assertEqual(i, self.evaluate(next1())) self.assertEqual(i, self.evaluate(next2())) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=2, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotCustomShardFunction(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.enumerate() dataset = dataset.apply( snapshot.snapshot(self._snapshot_dir, shard_func=lambda i, _: i % 2)) dataset = dataset.map(lambda _, elem: elem) self.assertDatasetProduces(dataset, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=2) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotDatasetWithTuples(self): dataset1 = dataset_ops.Dataset.range(0, 1000) dataset2 = dataset_ops.Dataset.range(1000, 2000) dataset3 = dataset_ops.Dataset.range(2000, 3000) dataset4 = dataset_ops.Dataset.range(3000, 4000) dataset = dataset_ops.Dataset.zip((dataset1, dataset2, dataset3, dataset4)) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) expected = list( zip( range(0, 1000), range(1000, 2000), range(2000, 3000), range(3000, 4000))) self.assertDatasetProduces(dataset, expected) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotShuffleSameFingerprint(self): def make_dataset(): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.shuffle(1000) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) return dataset dataset1 = make_dataset() self.assertDatasetProducesSet(dataset1, list(range(1000))) dataset2 = make_dataset() self.assertDatasetProducesSet(dataset2, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testReadUsingFlatMap(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProduces(dataset, list(range(1000))) flat_map = dataset_ops.Dataset.from_tensors(dataset).flat_map(lambda x: x) self.assertDatasetProduces(flat_map, list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testReadOptimizableUsingFlatMap(self): dataset = dataset_ops.Dataset.range(1000) dataset = dataset.shuffle(10) dataset = dataset.repeat(2) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) self.assertDatasetProducesSet(dataset, 2 * list(range(1000))) flat_map = dataset_ops.Dataset.from_tensors(dataset).flat_map(lambda x: x) self.assertDatasetProducesSet(flat_map, 2 * list(range(1000))) self.assertSnapshotDirectoryContains( self._snapshot_dir, num_fingerprints=1, num_runs_per_fingerprint=1, num_snapshot_shards_per_run=multiprocessing.cpu_count()) @combinations.generate(test_base.default_test_combinations()) def testRepeatAndPrefetch(self): dataset = dataset_ops.Dataset.from_tensor_slices(np.random.rand(16, 32)) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) dataset = dataset.shuffle(buffer_size=16) dataset = dataset.batch(16) dataset = dataset.repeat() dataset = dataset.prefetch(1) next_element = self.getNext(dataset) for _ in range(30): self.evaluate(next_element()) class LegacySnapshotTest(tf_record_test_base.TFRecordTestBase, parameterized.TestCase): def setUp(self): super(LegacySnapshotTest, self).setUp() self.removeTFRecords() tmpdir = self.get_temp_dir() tmpdir = os.path.join(tmpdir, "snapshot") os.mkdir(tmpdir) self.snapshot_dir = tmpdir def tearDown(self): super(LegacySnapshotTest, self).tearDown() shutil.rmtree(self.snapshot_dir) def removeTFRecords(self): for filename in self._filenames: os.remove(filename) self._filenames = [] def setUpTFRecord(self, num_files=10, num_records=10): self._num_files = num_files self._num_records = num_records self._filenames = self._createFiles() def makeSnapshotDirectory(self): return self.snapshot_dir def assertSnapshotDirectoryContains(self, directory, num_fingerprints, num_runs_per_fp, num_snapshot_files): dirlist = listdir_and_filter( directory, lambda p: not (is_graphdef_file(p) or is_temp_file(p))) self.assertLen(dirlist, num_fingerprints) for i in range(num_fingerprints): fingerprint_dir = os.path.join(directory, dirlist[i]) fingerprint_dir_list = listdir_and_filter( fingerprint_dir, lambda p: not is_temp_file(p)) self.assertLen(fingerprint_dir_list, num_runs_per_fp + 1) self.assertEqual(fingerprint_dir_list[num_runs_per_fp], "snapshot.metadata") for j in range(num_runs_per_fp): run_dir = os.path.join(fingerprint_dir, fingerprint_dir_list[j]) run_dirlist = sorted(os.listdir(run_dir)) self.assertLen(run_dirlist, num_snapshot_files) file_counter = 0 for filename in run_dirlist: self.assertEqual(filename, "%08d.snapshot" % file_counter) file_counter += 1 @combinations.generate(test_base.default_test_combinations()) def testWriteDifferentPipelinesInOneDirectory(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(1000))) dataset = dataset_ops.Dataset.range(1001) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(1001))) self.assertSnapshotDirectoryContains(tmpdir, 2, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testWriteSnapshotMultipleSimultaneous(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.legacy_snapshot(tmpdir)) next1 = self.getNext(dataset1) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply(snapshot.legacy_snapshot(tmpdir)) next2 = self.getNext(dataset2) for i in range(0, 1000): self.assertEqual(i, self.evaluate(next1())) self.assertEqual(i, self.evaluate(next2())) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testGetNextCreatesDir(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply(snapshot.legacy_snapshot(tmpdir)) next1 = self.getNext(dataset1) dataset2 = dataset_ops.Dataset.range(1001) dataset2 = dataset2.apply(snapshot.legacy_snapshot(tmpdir)) _ = self.getNext(dataset2) for _ in range(1000): self.evaluate(next1()) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testWriteSnapshotSimpleSuccessful(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset, list(range(1000))) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testWriteSnapshotRepeatAfterwards(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testWriteSnapshotMixTypes(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) def map_fn(x): return (x, string_ops.as_string(x), string_ops.as_string(2 * x), 2 * x) dataset = dataset.map(map_fn) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) dataset = dataset.repeat(10) expected = [] for i in range(10): expected.append((i, str(i), str(2 * i), 2 * i)) self.assertDatasetProduces(dataset, expected * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testSpecifySnapshotNameWriteAndRead(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, snapshot_name="my_custom_snapshot")) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) self.assertTrue( os.path.exists(os.path.join(tmpdir, "custom-my_custom_snapshot"))) self.assertTrue( os.path.exists( os.path.join(tmpdir, "custom-my_custom_snapshot", "custom"))) @combinations.generate(test_base.default_test_combinations()) def testForcePassthroughMode(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, mode="passthrough")) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 0, 0, 0) @combinations.generate(test_base.default_test_combinations()) def testForceWriteMode(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir, mode="write")) dataset = dataset.repeat(10) self.assertDatasetProduces(dataset, list(range(10)) * 10) self.assertSnapshotDirectoryContains(tmpdir, 1, 10, 1) @combinations.generate(test_base.default_test_combinations()) def testForceReadMode(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, mode="write", snapshot_name="my_custom_snapshot")) self.assertDatasetProduces(dataset, list(range(10))) shutil.move( os.path.join(tmpdir, "custom-my_custom_snapshot"), os.path.join(tmpdir, "custom-my_custom_snapshot_2")) dataset = dataset_ops.Dataset.range(10) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, mode="read", snapshot_name="my_custom_snapshot_2")) self.assertDatasetProduces(dataset, list(range(10))) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testForceReadNonexistentSnapshot(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) with self.assertRaises(errors.NotFoundError): dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir, mode="read")) get_next = self.getNext(dataset) self.evaluate(get_next()) @combinations.generate(test_base.default_test_combinations()) def testForceReadNonexistentNamedSnapshot(self): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.range(10) with self.assertRaises(errors.NotFoundError): dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, mode="read", snapshot_name="my_nonexistent_snapshot")) get_next = self.getNext(dataset) self.evaluate(get_next()) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testReadSnapshotBackAfterWrite(self, compression): self.setUpTFRecord() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 10) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset, expected) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset2, expected) @combinations.generate(test_base.default_test_combinations()) def testReadShuffledSnapshotAfterWrite(self): self.setUpTFRecord(num_files=10, num_records=50) filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 50) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=100)) self.assertDatasetProduces(dataset, expected) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=100, shuffle_on_read=True)) next2 = self.getNext(dataset2) res1 = self.evaluate(next2()) res2 = self.evaluate(next2()) res3 = self.evaluate(next2()) res4 = self.evaluate(next2()) res5 = self.evaluate(next2()) self.assertNotEqual([res1, res2, res3, res4, res5], expected[0:5]) # make sure all the elements are still there dataset3 = core_readers._TFRecordDataset(filenames) dataset3 = dataset3.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=100, shuffle_on_read=True)) self.assertDatasetProduces(dataset3, expected, assert_items_equal=True) @combinations.generate(test_base.default_test_combinations()) def testReadShuffledSnapshotWithSeedAfterWrite(self): self.setUpTFRecord(num_files=10, num_records=50) filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 50) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=10)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=10, shuffle_on_read=True, shuffle_seed=123456)) next2 = self.getNext(dataset2) dataset3 = core_readers._TFRecordDataset(filenames) dataset3 = dataset3.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=10, shuffle_on_read=True, shuffle_seed=123456)) next3 = self.getNext(dataset3) # make sure that the items are read back in the same order for both datasets for _ in range(500): res2 = self.evaluate(next2()) res3 = self.evaluate(next3()) self.assertEqual(res2, res3) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testReadSnapshotParallelAfterWrite(self, compression): self.setUpTFRecord(5, 500) filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 5) for r in range(0, 500) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=1024 * 1024, num_reader_threads=2, reader_buffer_size=10, compression=compression)) self.assertDatasetProduces(dataset, expected, assert_items_equal=True) # remove the original files and try to read the data back only from # snapshot. self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=1024 * 1024, num_reader_threads=2, reader_buffer_size=10, compression=compression)) self.assertDatasetProduces(dataset2, expected, assert_items_equal=True) # Not testing Snappy here because Snappy reads currently require a lot of # memory. @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.times( combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP ]), combinations.combine(threads=2, size=[1, 2]) + combinations.combine(threads=8, size=[1, 4, 8])))) def testReadSnapshotBackAfterMultiThreadedWrite(self, compression, threads, size): self.setUpTFRecord() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) # pylint:disable=g-complex-comprehension for f in range(0, 10) for r in range(0, 10) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, compression=compression, num_writer_threads=threads, writer_buffer_size=size)) self.assertDatasetProduces(dataset, expected) # remove the original files and try to read the data back only from # snapshot self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply( snapshot.legacy_snapshot(tmpdir, compression=compression)) self.assertDatasetProduces(dataset2, expected, assert_items_equal=True) @combinations.generate(test_base.default_test_combinations()) def testSameFingerprintWithDifferentInitializationOrder(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(0, 100) dataset2 = dataset_ops.Dataset.range(100, 200) dataset3 = dataset_ops.Dataset.range(200, 300) dataset = dataset1.concatenate(dataset2).concatenate(dataset3) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(300))) dataset4 = dataset_ops.Dataset.range(200, 300) dataset5 = dataset_ops.Dataset.range(100, 200) dataset6 = dataset_ops.Dataset.range(0, 100) dataset = dataset6.concatenate(dataset5).concatenate(dataset4) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, list(range(300))) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) @combinations.generate(test_base.default_test_combinations()) def testExpiredSnapshotRewrite(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply( snapshot.legacy_snapshot(tmpdir, pending_snapshot_expiry_seconds=1)) next1 = self.getNext(dataset1) # Don't finish reading dataset1, so it is never finalized for _ in range(500): self.evaluate(next1()) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) time.sleep(2) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset2.apply( snapshot.legacy_snapshot(tmpdir, pending_snapshot_expiry_seconds=1)) next2 = self.getNext(dataset2) for _ in range(500): self.evaluate(next2()) self.assertSnapshotDirectoryContains(tmpdir, 1, 2, 1) @combinations.generate(test_base.default_test_combinations()) def testSnapshotArgsCreateNewSnapshot(self): tmpdir = self.snapshot_dir dataset1 = dataset_ops.Dataset.range(1000) dataset1 = dataset1.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=10000)) next1 = self.getNext(dataset1) for _ in range(1000): self.evaluate(next1()) self.assertSnapshotDirectoryContains(tmpdir, 1, 1, 1) dataset2 = dataset_ops.Dataset.range(1000) dataset2 = dataset1.apply( snapshot.legacy_snapshot(tmpdir, shard_size_bytes=20000)) next2 = self.getNext(dataset2) for _ in range(1000): self.evaluate(next2()) self.assertSnapshotDirectoryContains(tmpdir, 2, 1, 1) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(compression=[ snapshot.COMPRESSION_NONE, snapshot.COMPRESSION_GZIP, snapshot.COMPRESSION_SNAPPY ]))) def testSpecifyShardSize(self, compression): tmpdir = self.snapshot_dir dataset = dataset_ops.Dataset.from_tensor_slices([1.0]) dataset = dataset.map(lambda x: gen_array_ops.broadcast_to(x, [1024, 1024])) dataset = dataset.repeat(10) dataset = dataset.apply( snapshot.legacy_snapshot( tmpdir, shard_size_bytes=10 * 1024 * 1024, compression=compression)) next_fn = self.getNext(dataset) for _ in range(10): self.evaluate(next_fn()) num_files = 1 if compression == snapshot.COMPRESSION_NONE: num_files = 3 self.assertSnapshotDirectoryContains(tmpdir, 1, 1, num_files) @combinations.generate(test_base.default_test_combinations()) def testAdditionalOperationsAfterReadBack(self): self.setUpTFRecord() filenames = self._filenames expected = [ b"Record %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 10) ] tmpdir = self.snapshot_dir dataset = core_readers._TFRecordDataset(filenames) dataset = dataset.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset, expected) self.removeTFRecords() dataset2 = core_readers._TFRecordDataset(filenames) dataset2 = dataset2.apply(snapshot.legacy_snapshot(tmpdir)) self.assertDatasetProduces(dataset2, expected) expected_after = [ b"cord %d of file %d" % (r, f) for f in range(0, 10) for r in range(0, 10) ] dataset3 = core_readers._TFRecordDataset(filenames) dataset3 = dataset3.apply(snapshot.legacy_snapshot(tmpdir)) dataset3 = dataset3.map(lambda x: string_ops.substr_v2(x, 2, 1000)) self.assertDatasetProduces(dataset3, expected_after) class SnapshotCheckpointTest(checkpoint_test_base.CheckpointTestBase, parameterized.TestCase): def _build_snapshot_dataset(self, repeat=False): def ds_fn(): self._snapshot_dir = os.path.join(self.get_temp_dir(), "snapshot") if not os.path.exists(self._snapshot_dir): os.mkdir(self._snapshot_dir) dataset = dataset_ops.Dataset.range(100) dataset = dataset.apply(snapshot.snapshot(self._snapshot_dir)) if repeat: dataset = dataset.repeat(2) return dataset return ds_fn @combinations.generate(test_base.default_test_combinations()) def testCheckpointBeforeEpochEndNoRepeat(self): ds_fn = self._build_snapshot_dataset(repeat=False) outputs = self.gen_outputs(ds_fn, [], 50, verify_exhausted=False) self.assertSequenceEqual(outputs, range(50)) outputs.extend( self.gen_outputs(ds_fn, [], 50, ckpt_saved=True, verify_exhausted=True)) self.assertSequenceEqual(outputs, range(100)) @combinations.generate(test_base.default_test_combinations()) def testCheckpointBeforeOneEpochWithReading(self): ds_fn = self._build_snapshot_dataset(repeat=True) outputs = self.gen_outputs(ds_fn, [], 50, verify_exhausted=False) self.assertSequenceEqual(outputs, list(range(50))) t = self.gen_outputs(ds_fn, [], 150, ckpt_saved=True, verify_exhausted=True) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(50)) + list(range(50, 100)) + list(range(100))) @combinations.generate(test_base.default_test_combinations()) def testCheckpointBeforeOneEpochThenRunAFewSteps(self): ds_fn = self._build_snapshot_dataset(repeat=False) outputs = self.gen_outputs( ds_fn, [10], 20, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, range(20)) outputs = outputs[:10] outputs.extend( self.gen_outputs(ds_fn, [], 90, ckpt_saved=True, verify_exhausted=True)) self.assertSequenceEqual(outputs, range(100)) @combinations.generate(test_base.default_test_combinations()) def testCheckpointAfterOneEpoch(self): ds_fn = self._build_snapshot_dataset(repeat=True) outputs = self.gen_outputs(ds_fn, [], 110, verify_exhausted=False) self.assertSequenceEqual(outputs, list(range(100)) + list(range(10))) t = self.gen_outputs(ds_fn, [], 90, ckpt_saved=True, verify_exhausted=True) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(100)) + list(range(10)) + list(range(10, 100))) @combinations.generate(test_base.default_test_combinations()) def testCheckpointAfterOneEpochRunFewSteps(self): ds_fn = self._build_snapshot_dataset(repeat=True) outputs = self.gen_outputs( ds_fn, [110], 120, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, list(range(100)) + list(range(20))) outputs = outputs[:110] t = self.gen_outputs(ds_fn, [], 90, ckpt_saved=True, verify_exhausted=True) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(100)) + list(range(10)) + list(range(10, 100))) class LegacySnapshotCheckpointTest( checkpoint_test_base.CheckpointTestBase, parameterized.TestCase): def _build_snapshot_dataset(self, num_threads=1, repeat=False, pending_snapshot_expiry_seconds=-1, shard_size_bytes=None): def ds_fn(): self.snapshot_dir = os.path.join(self.get_temp_dir(), "snapshot") if not os.path.exists(self.snapshot_dir): os.mkdir(self.snapshot_dir) dataset = dataset_ops.Dataset.range(1000) dataset = dataset.apply( snapshot.legacy_snapshot( self.snapshot_dir, num_writer_threads=num_threads, writer_buffer_size=2 * num_threads, num_reader_threads=num_threads, reader_buffer_size=2 * num_threads, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds, shard_size_bytes=shard_size_bytes)) if repeat: dataset = dataset.repeat(2) return dataset return ds_fn @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testSnapshotBeforeEpochEnd(self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) outputs = self.gen_outputs(ds_fn, [], 100, verify_exhausted=False) self.assertSequenceEqual(outputs, range(100)) outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointBeforeOneEpochThenRunFewStepsSmallShardMultiThread( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds, shard_size_bytes=100) outputs = [] with ops.Graph().as_default() as g: init_op, get_next_op, saver = self._build_graph(ds_fn) with self.session(graph=g) as sess: self._initialize(init_op, sess) start = 0 end = 100 num_iters = end - start for _ in range(num_iters): outputs.append(sess.run(get_next_op)) self._save(sess, saver) start = 100 end = 400 num_iters = end - start for _ in range(num_iters): outputs.append(sess.run(get_next_op)) self.assertSequenceEqual(outputs, range(400)) outputs = outputs[:100] outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) fp_dir_list = os.listdir(self.snapshot_dir) self.assertLen(list(fp_dir_list), 2) for d in fp_dir_list: if not d.endswith("-graph.pbtxt"): fp_dir = os.path.join(self.snapshot_dir, d) run_dir_list = os.listdir(fp_dir) self.assertLen(list(run_dir_list), 2) for e in run_dir_list: if e != "snapshot.metadata": run_dir = os.path.join(fp_dir, e) self.assertLen(list(os.listdir(run_dir)), 258) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointBeforeOneEpochThenRunFewSteps( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) outputs = self.gen_outputs( ds_fn, [100], 200, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, range(200)) outputs = outputs[:100] outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointBeforeOneEpochThenRunFewStepsMultipleThreads( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( num_threads=2, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) outputs = self.gen_outputs( ds_fn, [100], 200, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual(outputs, range(200)) outputs = outputs[:100] outputs.extend( self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False)) self.assertSequenceEqual(outputs, range(1000)) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointAfterOneEpoch(self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( repeat=True, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) outputs = self.gen_outputs(ds_fn, [], 1100, verify_exhausted=False) self.assertSequenceEqual(outputs, list(range(1000)) + list(range(100))) t = self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False) outputs.extend(t) self.assertSequenceEqual( outputs, list(range(1000)) + list(range(100)) + list(range(900))) @combinations.generate( combinations.times( test_base.default_test_combinations(), combinations.combine(pending_snapshot_expiry_seconds=[None, 1]))) def testCheckpointAfterOneEpochThenRunFewSteps( self, pending_snapshot_expiry_seconds): ds_fn = self._build_snapshot_dataset( repeat=True, pending_snapshot_expiry_seconds=pending_snapshot_expiry_seconds) outputs = self.gen_outputs( ds_fn, [1100], 1200, verify_exhausted=False, save_checkpoint_at_end=False) self.assertSequenceEqual( outputs, list(range(1000)) + list(range(100)) + list(range(100))) outputs = outputs[:1100] t = self.gen_outputs( ds_fn, [], 900, ckpt_saved=True, verify_exhausted=False) outputs.extend(t) self.assertSequenceEqual( outputs, (list(range(1000)) + list(range(100)) + list(range(900)))) if __name__ == "__main__": test.main()
true
true
f720977f63fc56cdf8a97938eefdecd9ebe62107
651
py
Python
src/prereq/exercise8.py
kradical/cluster-analysis-udemy
e2101bdb08ae3b9ed0ed8c4c1c488e3a75a1b7c5
[ "MIT" ]
null
null
null
src/prereq/exercise8.py
kradical/cluster-analysis-udemy
e2101bdb08ae3b9ed0ed8c4c1c488e3a75a1b7c5
[ "MIT" ]
null
null
null
src/prereq/exercise8.py
kradical/cluster-analysis-udemy
e2101bdb08ae3b9ed0ed8c4c1c488e3a75a1b7c5
[ "MIT" ]
null
null
null
import numpy as np import matplotlib.pyplot as plt # Plot a spiral dataset def generateArm(rotation, step): theta = np.random.rand(500) * step r = np.exp(theta) - 1 x = r * np.cos(theta) + (np.random.rand(500) - 0.5) / 7 y = r * np.sin(theta) + (np.random.rand(500) - 0.5) / 7 x, y = x * np.cos(rotation) - y * np.sin(rotation), x * np.sin(rotation) + y * np.cos(rotation) return (x, y) def main(): arms = 6 step = 2 * np.pi / arms for i in range(arms): rotation = i * step x, y = generateArm(rotation, step) plt.scatter(x, y) plt.show() if __name__ == '__main__': main()
20.34375
99
0.563748
import numpy as np import matplotlib.pyplot as plt def generateArm(rotation, step): theta = np.random.rand(500) * step r = np.exp(theta) - 1 x = r * np.cos(theta) + (np.random.rand(500) - 0.5) / 7 y = r * np.sin(theta) + (np.random.rand(500) - 0.5) / 7 x, y = x * np.cos(rotation) - y * np.sin(rotation), x * np.sin(rotation) + y * np.cos(rotation) return (x, y) def main(): arms = 6 step = 2 * np.pi / arms for i in range(arms): rotation = i * step x, y = generateArm(rotation, step) plt.scatter(x, y) plt.show() if __name__ == '__main__': main()
true
true
f7209acf0f181cb1058d455de2841e729f3c8cd5
3,798
py
Python
mlops/parallelm/mlops/stats/health/categorical_hist_stat.py
lisapm/mlpiper
74ad5ae343d364682cc2f8aaa007f2e8a1d84929
[ "Apache-2.0" ]
7
2019-04-08T02:31:55.000Z
2021-11-15T14:40:49.000Z
mlops/parallelm/mlops/stats/health/categorical_hist_stat.py
lisapm/mlpiper
74ad5ae343d364682cc2f8aaa007f2e8a1d84929
[ "Apache-2.0" ]
31
2019-02-22T22:23:26.000Z
2021-08-02T17:17:06.000Z
mlops/parallelm/mlops/stats/health/categorical_hist_stat.py
lisapm/mlpiper
74ad5ae343d364682cc2f8aaa007f2e8a1d84929
[ "Apache-2.0" ]
8
2019-03-15T23:46:08.000Z
2020-02-06T09:16:02.000Z
""" The Code contains functions to calculate univariate statistics for categorical features, given a dataset. """ import numpy as np from parallelm.mlops.stats.health.histogram_data_objects import CategoricalHistogramDataObject class CategoricalHistogram(object): """ Class is responsible for providing fit and get_feature_histogram_rep functionality of categorical training dataset. """ def __init__(self): """ Class constructor to init variables. :rtype: object """ # holds array of tuple of bin and edges. order can be followed by features list. self._prob_dist_categorical = [] self._features = [] def fit(self, training_feature_values, training_feature_names, num_bins, pred_bins): """ Function is responsible for fitting training data and fill up _prob_dist_categorical containing tuples of bin and edges. :rtype: self """ if isinstance(training_feature_values, np.ndarray): prob_dist = self._cal_hist_params(training_feature_values, num_bins=num_bins, pred_bins=pred_bins) self._prob_dist_categorical = prob_dist self._features = training_feature_names else: raise Exception("categorical histograms are generated on numpy array only!") return self def get_feature_histogram_rep(self): """ Function is responsible for creating formatted representation of categorical histogram. It will be used in forwarding stat through MLOps. :rtype: list containing CategoricalHistogramDataObject """ feature_histogram_rep = [] for index in range(len(self._features)): edges = self._prob_dist_categorical[index][0] # Since, edges can be of type string, bins array in python tuple can be stored as string. # To make it strong, converting it to float on fly. bins_str = self._prob_dist_categorical[index][1] # Converting to float! bins = [float(i) for i in bins_str] normalized_bins = bins / np.sum(bins) edges_rep = [] for each_edge_index in range(0, len(edges)): edges_rep.append(str(edges[each_edge_index])) categorical_histogram_data_object = CategoricalHistogramDataObject(feature_name=self._features[index], edges=edges_rep, bins=normalized_bins) feature_histogram_rep.append(categorical_histogram_data_object) return feature_histogram_rep @staticmethod def _cal_hist_params(sample, num_bins, pred_bins=None): """ Calculate the probability of each category in each column, assuming multi-nomial distribution. :param sample: A dataset that is a 2D numpy array :param num_bins: Number of bins to create. Although it is not used right now. But to make it scalable, passing now. :param pred_bins: pre-defined bins. Although it is not used right now. But to make it scalable, passing now. :rtype: prob_dist: A list containing the probability distribution of categories in each column of the sample. Order of arrays in the list is same as the order of columns in sample data """ # convert whole nd array to float! sample = sample.astype(str) prob_dist = [] for a in range(0, sample.shape[1]): # Determine the frequency of unique values unique, counts = np.unique(sample[:, a], return_counts=True) prob_dist.append(np.asarray((unique, counts * 1.0))) return prob_dist
42.2
145
0.645076
import numpy as np from parallelm.mlops.stats.health.histogram_data_objects import CategoricalHistogramDataObject class CategoricalHistogram(object): def __init__(self): self._prob_dist_categorical = [] self._features = [] def fit(self, training_feature_values, training_feature_names, num_bins, pred_bins): if isinstance(training_feature_values, np.ndarray): prob_dist = self._cal_hist_params(training_feature_values, num_bins=num_bins, pred_bins=pred_bins) self._prob_dist_categorical = prob_dist self._features = training_feature_names else: raise Exception("categorical histograms are generated on numpy array only!") return self def get_feature_histogram_rep(self): feature_histogram_rep = [] for index in range(len(self._features)): edges = self._prob_dist_categorical[index][0] bins_str = self._prob_dist_categorical[index][1] bins = [float(i) for i in bins_str] normalized_bins = bins / np.sum(bins) edges_rep = [] for each_edge_index in range(0, len(edges)): edges_rep.append(str(edges[each_edge_index])) categorical_histogram_data_object = CategoricalHistogramDataObject(feature_name=self._features[index], edges=edges_rep, bins=normalized_bins) feature_histogram_rep.append(categorical_histogram_data_object) return feature_histogram_rep @staticmethod def _cal_hist_params(sample, num_bins, pred_bins=None): sample = sample.astype(str) prob_dist = [] for a in range(0, sample.shape[1]): unique, counts = np.unique(sample[:, a], return_counts=True) prob_dist.append(np.asarray((unique, counts * 1.0))) return prob_dist
true
true
f7209b17100218a42c80c8e984c08597d630b188
47
py
Python
odoo-13.0/myaddons/SCM/__init__.py
VaibhavBhujade/Blockchain-ERP-interoperability
b5190a037fb6615386f7cbad024d51b0abd4ba03
[ "MIT" ]
181
2016-11-11T04:39:43.000Z
2022-03-14T21:17:19.000Z
odoo-13.0/myaddons/SCM/__init__.py
VaibhavBhujade/Blockchain-ERP-interoperability
b5190a037fb6615386f7cbad024d51b0abd4ba03
[ "MIT" ]
899
2016-11-14T02:42:56.000Z
2022-03-29T20:47:39.000Z
odoo-13.0/myaddons/SCM/__init__.py
VaibhavBhujade/Blockchain-ERP-interoperability
b5190a037fb6615386f7cbad024d51b0abd4ba03
[ "MIT" ]
227
2016-11-10T17:16:59.000Z
2022-03-26T16:46:38.000Z
from . import models from . import controllers
15.666667
25
0.787234
from . import models from . import controllers
true
true
f7209b3cfc5d5bd59dca31198344266661bee81a
94
py
Python
vaccine_card/api/apps.py
Unanimad/lais_046_2020_etapa_2
630efc6b25a580be44b6cd50be6744a01221a2c4
[ "Apache-2.0" ]
null
null
null
vaccine_card/api/apps.py
Unanimad/lais_046_2020_etapa_2
630efc6b25a580be44b6cd50be6744a01221a2c4
[ "Apache-2.0" ]
null
null
null
vaccine_card/api/apps.py
Unanimad/lais_046_2020_etapa_2
630efc6b25a580be44b6cd50be6744a01221a2c4
[ "Apache-2.0" ]
null
null
null
from django.apps import AppConfig class ApiConfig(AppConfig): name = 'vaccine_card.api'
15.666667
33
0.755319
from django.apps import AppConfig class ApiConfig(AppConfig): name = 'vaccine_card.api'
true
true
f7209bc8e13eb725ec7ffbe1187a20a64ae43a57
3,850
py
Python
EWR/ab6_v2/Sort.py
Koopakiller/Edu
575c43dae24a4432e8c8fb2eda96e948cc33ec32
[ "MIT" ]
null
null
null
EWR/ab6_v2/Sort.py
Koopakiller/Edu
575c43dae24a4432e8c8fb2eda96e948cc33ec32
[ "MIT" ]
null
null
null
EWR/ab6_v2/Sort.py
Koopakiller/Edu
575c43dae24a4432e8c8fb2eda96e948cc33ec32
[ "MIT" ]
null
null
null
# coding=utf-8 # Author: Tom Lambert # Content: Implementierung der Sort-Klasse für ab6. class Sort(object): """Implementiert Sortier-Algorithmen mit der Möglichkeit einer statistischen Auswertung""" def __init__(self): self.counter_swap = 0 # entspricht ca 2 Elementabrufen und 2 Elementzuweisungen self.counter_list_item_assignment = 0 self.counter_item_compare = 0 self.counter_get_item_from_list = 0 self.counter_add_item_to_result_list = 0 self.counter_recursive_call = 0 self.counter_split_list = 0 self.counter_copy_list = 0 self.counter_sort_call = 0 def quick_sort(self, lst): """ Sortiert die lst-Liste mit dem Quick-Sort-Algorithmus und gibt die sortierte Liste zurück. Bestimmte Operationen werden in den counter_-Variablen gezählt. """ self.counter_sort_call += 1 if len(lst) > 1: self.counter_get_item_from_list += 1 pivot = lst[0] ltp = [] # less than pivot item gtp = [] # greater than pivot item ep = [] # equals pivot item for item in lst: self.counter_get_item_from_list += 1 self.counter_item_compare += 1 if item < pivot: self.counter_add_item_to_result_list += 1 ltp.append(item) elif item > pivot: self.counter_add_item_to_result_list += 1 gtp.append(item) else: self.counter_add_item_to_result_list += 1 ep.append(item) self.counter_split_list += 1 self.counter_recursive_call += 1 ltp = self.quick_sort(ltp) self.counter_recursive_call += 1 gtp = self.quick_sort(gtp) result = ltp self.counter_add_item_to_result_list += len(ep) result.extend(ep) self.counter_add_item_to_result_list += len(gtp) result.extend(gtp) return result else: return lst def gnome_sort(self, lst): """ Sortiert die lst-Liste mit dem Gnome-Sort-Algorithmus und gibt die sortierte Liste zurück. Bestimmte Operationen werden in den counter_-Variablen gezählt. """ self.counter_sort_call += 1 self.counter_copy_list += 1 lst = list(lst) # copy the list, because lists are mutable and passed by reference pos = 0 while pos < len(lst): self.counter_get_item_from_list += 2 self.counter_item_compare += 1 if pos == 0 or lst[pos] >= lst[pos - 1]: pos += 1 else: self.counter_swap += 1 lst[pos], lst[pos - 1] = lst[pos - 1], lst[pos] pos -= 1 return lst def insertion_sort(self, lst): """ Sortiert die lst-Liste mit dem Insertion-Sort-Algorithmus und gibt die sortierte Liste zurück. Bestimmte Operationen werden in den counter_-Variablen gezählt. """ self.counter_sort_call += 1 self.counter_copy_list += 1 lst = list(lst) # copy the list, because lists are mutable and passed by reference for i in range(1, len(lst)): self.counter_get_item_from_list += 1 val = lst[i] j = i while j > 0 and lst[j - 1] > val: self.counter_item_compare += 1 self.counter_get_item_from_list += 1 self.counter_list_item_assignment += 1 lst[j] = lst[j - 1] j = j - 1 # breaks the while loop lst[j] = val self.counter_list_item_assignment += 1 return lst
38.118812
103
0.562857
class Sort(object): def __init__(self): self.counter_swap = 0 self.counter_list_item_assignment = 0 self.counter_item_compare = 0 self.counter_get_item_from_list = 0 self.counter_add_item_to_result_list = 0 self.counter_recursive_call = 0 self.counter_split_list = 0 self.counter_copy_list = 0 self.counter_sort_call = 0 def quick_sort(self, lst): self.counter_sort_call += 1 if len(lst) > 1: self.counter_get_item_from_list += 1 pivot = lst[0] ltp = [] gtp = [] ep = [] for item in lst: self.counter_get_item_from_list += 1 self.counter_item_compare += 1 if item < pivot: self.counter_add_item_to_result_list += 1 ltp.append(item) elif item > pivot: self.counter_add_item_to_result_list += 1 gtp.append(item) else: self.counter_add_item_to_result_list += 1 ep.append(item) self.counter_split_list += 1 self.counter_recursive_call += 1 ltp = self.quick_sort(ltp) self.counter_recursive_call += 1 gtp = self.quick_sort(gtp) result = ltp self.counter_add_item_to_result_list += len(ep) result.extend(ep) self.counter_add_item_to_result_list += len(gtp) result.extend(gtp) return result else: return lst def gnome_sort(self, lst): self.counter_sort_call += 1 self.counter_copy_list += 1 lst = list(lst) pos = 0 while pos < len(lst): self.counter_get_item_from_list += 2 self.counter_item_compare += 1 if pos == 0 or lst[pos] >= lst[pos - 1]: pos += 1 else: self.counter_swap += 1 lst[pos], lst[pos - 1] = lst[pos - 1], lst[pos] pos -= 1 return lst def insertion_sort(self, lst): self.counter_sort_call += 1 self.counter_copy_list += 1 lst = list(lst) for i in range(1, len(lst)): self.counter_get_item_from_list += 1 val = lst[i] j = i while j > 0 and lst[j - 1] > val: self.counter_item_compare += 1 self.counter_get_item_from_list += 1 self.counter_list_item_assignment += 1 lst[j] = lst[j - 1] j = j - 1 lst[j] = val self.counter_list_item_assignment += 1 return lst
true
true
f7209bcc24d3c78f312379c3537a4b94dc7b13db
436
py
Python
packages/python/plotly/plotly/validators/icicle/marker/colorbar/_tickangle.py
mastermind88/plotly.py
efa70710df1af22958e1be080e105130042f1839
[ "MIT" ]
null
null
null
packages/python/plotly/plotly/validators/icicle/marker/colorbar/_tickangle.py
mastermind88/plotly.py
efa70710df1af22958e1be080e105130042f1839
[ "MIT" ]
null
null
null
packages/python/plotly/plotly/validators/icicle/marker/colorbar/_tickangle.py
mastermind88/plotly.py
efa70710df1af22958e1be080e105130042f1839
[ "MIT" ]
null
null
null
import _plotly_utils.basevalidators class TickangleValidator(_plotly_utils.basevalidators.AngleValidator): def __init__( self, plotly_name="tickangle", parent_name="icicle.marker.colorbar", **kwargs ): super(TickangleValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop("edit_type", "colorbars"), **kwargs, )
31.142857
85
0.665138
import _plotly_utils.basevalidators class TickangleValidator(_plotly_utils.basevalidators.AngleValidator): def __init__( self, plotly_name="tickangle", parent_name="icicle.marker.colorbar", **kwargs ): super(TickangleValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop("edit_type", "colorbars"), **kwargs, )
true
true
f7209c409ce293886a6af24bf96c863400e8931e
4,791
py
Python
luminoth/utils/bbox_transform_tf.py
jsdussanc/luminoth
7637c52cc01d2826a231fef43746aa10951f99f0
[ "BSD-3-Clause" ]
2,584
2017-08-16T20:31:52.000Z
2022-03-16T07:53:54.000Z
luminoth/utils/bbox_transform_tf.py
dun933/Tabulo
dc1c1203a40e1ecf2aaca9647f3008ab72b41438
[ "BSD-3-Clause" ]
197
2017-08-17T14:49:18.000Z
2022-02-10T01:50:50.000Z
luminoth/utils/bbox_transform_tf.py
dun933/Tabulo
dc1c1203a40e1ecf2aaca9647f3008ab72b41438
[ "BSD-3-Clause" ]
462
2017-08-16T22:00:23.000Z
2022-03-08T19:14:00.000Z
import tensorflow as tf def get_width_upright(bboxes): with tf.name_scope('BoundingBoxTransform/get_width_upright'): bboxes = tf.cast(bboxes, tf.float32) x1, y1, x2, y2 = tf.split(bboxes, 4, axis=1) width = x2 - x1 + 1. height = y2 - y1 + 1. # Calculate up right point of bbox (urx = up right x) urx = x1 + .5 * width ury = y1 + .5 * height return width, height, urx, ury def encode(bboxes, gt_boxes, variances=None): with tf.name_scope('BoundingBoxTransform/encode'): (bboxes_width, bboxes_height, bboxes_urx, bboxes_ury) = get_width_upright(bboxes) (gt_boxes_width, gt_boxes_height, gt_boxes_urx, gt_boxes_ury) = get_width_upright(gt_boxes) if variances is None: variances = [1., 1.] targets_dx = (gt_boxes_urx - bboxes_urx)/(bboxes_width * variances[0]) targets_dy = (gt_boxes_ury - bboxes_ury)/(bboxes_height * variances[0]) targets_dw = tf.log(gt_boxes_width / bboxes_width) / variances[1] targets_dh = tf.log(gt_boxes_height / bboxes_height) / variances[1] targets = tf.concat( [targets_dx, targets_dy, targets_dw, targets_dh], axis=1) return targets def decode(roi, deltas, variances=None): with tf.name_scope('BoundingBoxTransform/decode'): (roi_width, roi_height, roi_urx, roi_ury) = get_width_upright(roi) dx, dy, dw, dh = tf.split(deltas, 4, axis=1) if variances is None: variances = [1., 1.] pred_ur_x = dx * roi_width * variances[0] + roi_urx pred_ur_y = dy * roi_height * variances[0] + roi_ury pred_w = tf.exp(dw * variances[1]) * roi_width pred_h = tf.exp(dh * variances[1]) * roi_height bbox_x1 = pred_ur_x - 0.5 * pred_w bbox_y1 = pred_ur_y - 0.5 * pred_h # This -1. extra is different from reference implementation. bbox_x2 = pred_ur_x + 0.5 * pred_w - 1. bbox_y2 = pred_ur_y + 0.5 * pred_h - 1. bboxes = tf.concat( [bbox_x1, bbox_y1, bbox_x2, bbox_y2], axis=1) return bboxes def clip_boxes(bboxes, imshape): """ Clips bounding boxes to image boundaries based on image shape. Args: bboxes: Tensor with shape (num_bboxes, 4) where point order is x1, y1, x2, y2. imshape: Tensor with shape (2, ) where the first value is height and the next is width. Returns Tensor with same shape as bboxes but making sure that none of the bboxes are outside the image. """ with tf.name_scope('BoundingBoxTransform/clip_bboxes'): bboxes = tf.cast(bboxes, dtype=tf.float32) imshape = tf.cast(imshape, dtype=tf.float32) x1, y1, x2, y2 = tf.split(bboxes, 4, axis=1) width = imshape[1] height = imshape[0] x1 = tf.maximum(tf.minimum(x1, width - 1.0), 0.0) x2 = tf.maximum(tf.minimum(x2, width - 1.0), 0.0) y1 = tf.maximum(tf.minimum(y1, height - 1.0), 0.0) y2 = tf.maximum(tf.minimum(y2, height - 1.0), 0.0) bboxes = tf.concat([x1, y1, x2, y2], axis=1) return bboxes def change_order(bboxes): """Change bounding box encoding order. TensorFlow works with the (y_min, x_min, y_max, x_max) order while we work with the (x_min, y_min, x_max, y_min). While both encoding options have its advantages and disadvantages we decided to use the (x_min, y_min, x_max, y_min), forcing use to switch to TensorFlow's every time we want to use a std function that handles bounding boxes. Args: bboxes: A Tensor of shape (total_bboxes, 4) Returns: bboxes: A Tensor of shape (total_bboxes, 4) with the order swaped. """ with tf.name_scope('BoundingBoxTransform/change_order'): first_min, second_min, first_max, second_max = tf.unstack( bboxes, axis=1 ) bboxes = tf.stack( [second_min, first_min, second_max, first_max], axis=1 ) return bboxes if __name__ == '__main__': import numpy as np bboxes = tf.placeholder(tf.float32) bboxes_val = [[10, 10, 20, 22]] gt_boxes = tf.placeholder(tf.float32) gt_boxes_val = [[11, 13, 34, 31]] imshape = tf.placeholder(tf.int32) imshape_val = (100, 100) deltas = encode(bboxes, gt_boxes) decoded_bboxes = decode(bboxes, deltas) final_decoded_bboxes = clip_boxes(decoded_bboxes, imshape) with tf.Session() as sess: final_decoded_bboxes = sess.run(final_decoded_bboxes, feed_dict={ bboxes: bboxes_val, gt_boxes: gt_boxes_val, imshape: imshape_val, }) assert np.all(gt_boxes_val == final_decoded_bboxes)
31.313725
79
0.622626
import tensorflow as tf def get_width_upright(bboxes): with tf.name_scope('BoundingBoxTransform/get_width_upright'): bboxes = tf.cast(bboxes, tf.float32) x1, y1, x2, y2 = tf.split(bboxes, 4, axis=1) width = x2 - x1 + 1. height = y2 - y1 + 1. urx = x1 + .5 * width ury = y1 + .5 * height return width, height, urx, ury def encode(bboxes, gt_boxes, variances=None): with tf.name_scope('BoundingBoxTransform/encode'): (bboxes_width, bboxes_height, bboxes_urx, bboxes_ury) = get_width_upright(bboxes) (gt_boxes_width, gt_boxes_height, gt_boxes_urx, gt_boxes_ury) = get_width_upright(gt_boxes) if variances is None: variances = [1., 1.] targets_dx = (gt_boxes_urx - bboxes_urx)/(bboxes_width * variances[0]) targets_dy = (gt_boxes_ury - bboxes_ury)/(bboxes_height * variances[0]) targets_dw = tf.log(gt_boxes_width / bboxes_width) / variances[1] targets_dh = tf.log(gt_boxes_height / bboxes_height) / variances[1] targets = tf.concat( [targets_dx, targets_dy, targets_dw, targets_dh], axis=1) return targets def decode(roi, deltas, variances=None): with tf.name_scope('BoundingBoxTransform/decode'): (roi_width, roi_height, roi_urx, roi_ury) = get_width_upright(roi) dx, dy, dw, dh = tf.split(deltas, 4, axis=1) if variances is None: variances = [1., 1.] pred_ur_x = dx * roi_width * variances[0] + roi_urx pred_ur_y = dy * roi_height * variances[0] + roi_ury pred_w = tf.exp(dw * variances[1]) * roi_width pred_h = tf.exp(dh * variances[1]) * roi_height bbox_x1 = pred_ur_x - 0.5 * pred_w bbox_y1 = pred_ur_y - 0.5 * pred_h bbox_x2 = pred_ur_x + 0.5 * pred_w - 1. bbox_y2 = pred_ur_y + 0.5 * pred_h - 1. bboxes = tf.concat( [bbox_x1, bbox_y1, bbox_x2, bbox_y2], axis=1) return bboxes def clip_boxes(bboxes, imshape): with tf.name_scope('BoundingBoxTransform/clip_bboxes'): bboxes = tf.cast(bboxes, dtype=tf.float32) imshape = tf.cast(imshape, dtype=tf.float32) x1, y1, x2, y2 = tf.split(bboxes, 4, axis=1) width = imshape[1] height = imshape[0] x1 = tf.maximum(tf.minimum(x1, width - 1.0), 0.0) x2 = tf.maximum(tf.minimum(x2, width - 1.0), 0.0) y1 = tf.maximum(tf.minimum(y1, height - 1.0), 0.0) y2 = tf.maximum(tf.minimum(y2, height - 1.0), 0.0) bboxes = tf.concat([x1, y1, x2, y2], axis=1) return bboxes def change_order(bboxes): with tf.name_scope('BoundingBoxTransform/change_order'): first_min, second_min, first_max, second_max = tf.unstack( bboxes, axis=1 ) bboxes = tf.stack( [second_min, first_min, second_max, first_max], axis=1 ) return bboxes if __name__ == '__main__': import numpy as np bboxes = tf.placeholder(tf.float32) bboxes_val = [[10, 10, 20, 22]] gt_boxes = tf.placeholder(tf.float32) gt_boxes_val = [[11, 13, 34, 31]] imshape = tf.placeholder(tf.int32) imshape_val = (100, 100) deltas = encode(bboxes, gt_boxes) decoded_bboxes = decode(bboxes, deltas) final_decoded_bboxes = clip_boxes(decoded_bboxes, imshape) with tf.Session() as sess: final_decoded_bboxes = sess.run(final_decoded_bboxes, feed_dict={ bboxes: bboxes_val, gt_boxes: gt_boxes_val, imshape: imshape_val, }) assert np.all(gt_boxes_val == final_decoded_bboxes)
true
true
f7209df8e01166c38a64b49337433ccac2442afc
2,808
py
Python
5-MaksimovKA/code/submit.py
remtav/SpaceNet7_Multi-Temporal_Solutions
ee535c61fc22bffa45331519239c6d1b044b1514
[ "Apache-2.0" ]
38
2021-02-18T07:04:54.000Z
2022-03-22T15:31:06.000Z
5-MaksimovKA/code/submit.py
remtav/SpaceNet7_Multi-Temporal_Solutions
ee535c61fc22bffa45331519239c6d1b044b1514
[ "Apache-2.0" ]
2
2021-02-22T18:53:19.000Z
2021-06-22T20:28:06.000Z
5-MaksimovKA/code/submit.py
remtav/SpaceNet7_Multi-Temporal_Solutions
ee535c61fc22bffa45331519239c6d1b044b1514
[ "Apache-2.0" ]
15
2021-02-25T17:25:40.000Z
2022-01-31T16:59:32.000Z
import os import tqdm import glob import fiona import geopandas as gpd from fire import Fire def sn7_convert_geojsons_to_csv(json_dirs, output_csv_path, population='proposal'): ''' Convert jsons to csv Population is either "ground" or "proposal" ''' first_file = True # switch that will be turned off once we process the first file for json_dir in tqdm.tqdm(json_dirs[:]): json_files = sorted(glob.glob(os.path.join(json_dir, '*.geojson'))) for json_file in tqdm.tqdm(json_files): try: df = gpd.read_file(json_file) except (fiona.errors.DriverError): message = '! Invalid dataframe for %s' % json_file print(message) continue # raise Exception(message) if population == 'ground': file_name_col = df.image_fname.apply(lambda x: os.path.splitext(x)[0]) elif population == 'proposal': file_name_col = os.path.splitext(os.path.basename(json_file))[0] else: raise Exception('! Invalid population') if len(df) == 0: message = '! Empty dataframe for %s' % json_file print(message) # raise Exception(message) df = gpd.GeoDataFrame({ 'filename': file_name_col, 'id': 0, 'geometry': "POLYGON EMPTY", }) else: try: df = gpd.GeoDataFrame({ 'filename': file_name_col, 'id': df.Id.astype(int), 'geometry': df.geometry, }) except: print(df) if first_file: net_df = df first_file = False else: net_df = net_df.append(df) net_df.to_csv(output_csv_path, index=False) return net_df def make_submit(out_file='/wdata/solution.csv'): pred_top_dir = '/wdata/' # out_dir_csv = os.path.join(pred_top_dir, 'csvs') # os.makedirs(out_dir_csv, exist_ok=True) # prop_file = os.path.join(out_dir_csv, 'solution.csv') prop_file = out_file aoi_dirs = sorted([os.path.join(pred_top_dir, 'pred_jsons_match', aoi) \ for aoi in os.listdir(os.path.join(pred_top_dir, 'pred_jsons_match')) \ if os.path.isdir(os.path.join(pred_top_dir, 'pred_jsons_match', aoi))]) print("aoi_dirs:", aoi_dirs) # Execute if os.path.exists(prop_file): os.remove(prop_file) net_df = sn7_convert_geojsons_to_csv(aoi_dirs, prop_file, 'proposal') print("prop_file:", prop_file) if __name__ == '__main__': Fire(make_submit)
35.1
94
0.551994
import os import tqdm import glob import fiona import geopandas as gpd from fire import Fire def sn7_convert_geojsons_to_csv(json_dirs, output_csv_path, population='proposal'): first_file = True for json_dir in tqdm.tqdm(json_dirs[:]): json_files = sorted(glob.glob(os.path.join(json_dir, '*.geojson'))) for json_file in tqdm.tqdm(json_files): try: df = gpd.read_file(json_file) except (fiona.errors.DriverError): message = '! Invalid dataframe for %s' % json_file print(message) continue if population == 'ground': file_name_col = df.image_fname.apply(lambda x: os.path.splitext(x)[0]) elif population == 'proposal': file_name_col = os.path.splitext(os.path.basename(json_file))[0] else: raise Exception('! Invalid population') if len(df) == 0: message = '! Empty dataframe for %s' % json_file print(message) df = gpd.GeoDataFrame({ 'filename': file_name_col, 'id': 0, 'geometry': "POLYGON EMPTY", }) else: try: df = gpd.GeoDataFrame({ 'filename': file_name_col, 'id': df.Id.astype(int), 'geometry': df.geometry, }) except: print(df) if first_file: net_df = df first_file = False else: net_df = net_df.append(df) net_df.to_csv(output_csv_path, index=False) return net_df def make_submit(out_file='/wdata/solution.csv'): pred_top_dir = '/wdata/' prop_file = out_file aoi_dirs = sorted([os.path.join(pred_top_dir, 'pred_jsons_match', aoi) \ for aoi in os.listdir(os.path.join(pred_top_dir, 'pred_jsons_match')) \ if os.path.isdir(os.path.join(pred_top_dir, 'pred_jsons_match', aoi))]) print("aoi_dirs:", aoi_dirs) if os.path.exists(prop_file): os.remove(prop_file) net_df = sn7_convert_geojsons_to_csv(aoi_dirs, prop_file, 'proposal') print("prop_file:", prop_file) if __name__ == '__main__': Fire(make_submit)
true
true
f7209e86a2976584564066d1289e7d7d2268a733
2,401
py
Python
tests/commands/test_modifyoncondition.py
lpd-patrick/oaxmlapi
1e73881c290ca3181c2d33a7b5fa74fb5f86e62c
[ "MIT" ]
25
2015-05-20T01:23:39.000Z
2021-03-01T17:13:59.000Z
tests/commands/test_modifyoncondition.py
lpd-patrick/oaxmlapi
1e73881c290ca3181c2d33a7b5fa74fb5f86e62c
[ "MIT" ]
16
2015-03-03T00:59:29.000Z
2021-11-30T16:45:15.000Z
tests/commands/test_modifyoncondition.py
lpd-patrick/oaxmlapi
1e73881c290ca3181c2d33a7b5fa74fb5f86e62c
[ "MIT" ]
12
2016-01-04T20:06:44.000Z
2020-09-27T20:15:27.000Z
# -*- coding: utf-8 from __future__ import absolute_import import unittest from oaxmlapi import commands, datatypes try: import xml.etree.cElementTree as ET except ImportError: import xml.etree.ElementTree as ET class TestModifyOnConditionClass(unittest.TestCase): def test_str(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertEqual( str(commands.ModifyOnCondition('Slip', slip, date)), '<ModifyOnCondition type=Slip>' ) def test_modifyoncondition(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertIsInstance( commands.ModifyOnCondition('Slip', slip, date).modify(), ET.Element ) def test_tostring(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertEqual( commands.ModifyOnCondition('Slip', slip, date).tostring(), ( b'<ModifyOnCondition condition="if-not-updated" type="Slip">' b'<Slip><id>1234</id></Slip><Date><year>2012</year></Date>' b'</ModifyOnCondition>' ) ) def test_prettify(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertEqual( commands.ModifyOnCondition('Slip', slip, date).prettify(), ( b'<?xml version="1.0" encoding="utf-8"?>\n' b'<ModifyOnCondition condition="if-not-updated" type="Slip">\n' b' <Slip>\n' b' <id>1234</id>\n' b' </Slip>\n' b' <Date>\n' b' <year>2012</year>\n' b' </Date>\n' b'</ModifyOnCondition>\n' ) ) suite = unittest.TestLoader().loadTestsFromTestCase(TestModifyOnConditionClass) unittest.TextTestRunner(verbosity=2).run(suite)
27.918605
79
0.493544
from __future__ import absolute_import import unittest from oaxmlapi import commands, datatypes try: import xml.etree.cElementTree as ET except ImportError: import xml.etree.ElementTree as ET class TestModifyOnConditionClass(unittest.TestCase): def test_str(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertEqual( str(commands.ModifyOnCondition('Slip', slip, date)), '<ModifyOnCondition type=Slip>' ) def test_modifyoncondition(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertIsInstance( commands.ModifyOnCondition('Slip', slip, date).modify(), ET.Element ) def test_tostring(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertEqual( commands.ModifyOnCondition('Slip', slip, date).tostring(), ( b'<ModifyOnCondition condition="if-not-updated" type="Slip">' b'<Slip><id>1234</id></Slip><Date><year>2012</year></Date>' b'</ModifyOnCondition>' ) ) def test_prettify(self): slip = datatypes.Datatype( 'Slip', {'id': '1234'} ) date = datatypes.Datatype( 'Date', {'year': '2012'} ) self.assertEqual( commands.ModifyOnCondition('Slip', slip, date).prettify(), ( b'<?xml version="1.0" encoding="utf-8"?>\n' b'<ModifyOnCondition condition="if-not-updated" type="Slip">\n' b' <Slip>\n' b' <id>1234</id>\n' b' </Slip>\n' b' <Date>\n' b' <year>2012</year>\n' b' </Date>\n' b'</ModifyOnCondition>\n' ) ) suite = unittest.TestLoader().loadTestsFromTestCase(TestModifyOnConditionClass) unittest.TextTestRunner(verbosity=2).run(suite)
true
true
f7209ed2b871197ee55089411c3d1ab6b323fbba
3,956
py
Python
docs/user_guides/tools/elastic_ctr/elastic_ctr/dist_train_demo.py
shiyutang/docs
b05612213a08daf9f225abce08fc42f924ef51ad
[ "Apache-2.0" ]
104
2018-09-04T08:16:05.000Z
2021-05-06T20:45:26.000Z
docs/user_guides/tools/elastic_ctr/elastic_ctr/dist_train_demo.py
shiyutang/docs
b05612213a08daf9f225abce08fc42f924ef51ad
[ "Apache-2.0" ]
1,582
2018-06-25T06:14:11.000Z
2021-05-14T16:00:43.000Z
docs/user_guides/tools/elastic_ctr/elastic_ctr/dist_train_demo.py
shiyutang/docs
b05612213a08daf9f225abce08fc42f924ef51ad
[ "Apache-2.0" ]
387
2018-06-20T07:42:32.000Z
2021-05-14T08:35:28.000Z
# Copyright (c) 2018 PaddlePaddle Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import print_function import paddle.fluid.core as core import math import os import sys import numpy import paddle import paddle.fluid as fluid BATCH_SIZE = 64 PASS_NUM = 1 def loss_net(hidden, label): prediction = fluid.layers.fc(input=hidden, size=10, act='softmax') loss = fluid.layers.cross_entropy(input=prediction, label=label) avg_loss = fluid.layers.mean(loss) acc = fluid.layers.accuracy(input=prediction, label=label) return prediction, avg_loss, acc def conv_net(img, label): conv_pool_1 = fluid.nets.simple_img_conv_pool( input=img, filter_size=5, num_filters=20, pool_size=2, pool_stride=2, act="relu") conv_pool_1 = fluid.layers.batch_norm(conv_pool_1) conv_pool_2 = fluid.nets.simple_img_conv_pool( input=conv_pool_1, filter_size=5, num_filters=50, pool_size=2, pool_stride=2, act="relu") return loss_net(conv_pool_2, label) def train(use_cuda, role, endpoints, current_endpoint, trainer_id, trainers): if use_cuda and not fluid.core.is_compiled_with_cuda(): return img = fluid.layers.data(name='img', shape=[1, 28, 28], dtype='float32') label = fluid.layers.data(name='label', shape=[1], dtype='int64') prediction, avg_loss, acc = conv_net(img, label) test_program = fluid.default_main_program().clone(for_test=True) optimizer = fluid.optimizer.Adam(learning_rate=0.001) optimizer.minimize(avg_loss) t = fluid.DistributeTranspiler() t.transpile(trainer_id, pservers=endpoints, trainers=trainers) if role == "pserver": prog = t.get_pserver_program(current_endpoint) startup = t.get_startup_program(current_endpoint, pserver_program=prog) exe = fluid.Executor(fluid.CPUPlace()) exe.run(startup) exe.run(prog) elif role == "trainer": prog = t.get_trainer_program() place = fluid.CUDAPlace(0) if use_cuda else fluid.CPUPlace() exe = fluid.Executor(place) train_reader = paddle.batch( paddle.reader.shuffle(paddle.dataset.mnist.train(), buf_size=500), batch_size=BATCH_SIZE) test_reader = paddle.batch( paddle.dataset.mnist.test(), batch_size=BATCH_SIZE) feeder = fluid.DataFeeder(feed_list=[img, label], place=place) exe.run(fluid.default_startup_program()) for pass_id in range(PASS_NUM): for batch_id, data in enumerate(train_reader()): acc_np, avg_loss_np = exe.run( prog, feed=feeder.feed(data), fetch_list=[acc, avg_loss]) if (batch_id + 1) % 10 == 0: print( 'PassID {0:1}, BatchID {1:04}, Loss {2:2.2}, Acc {3:2.2}'. format(pass_id, batch_id + 1, float(avg_loss_np.mean()), float( acc_np.mean()))) if __name__ == '__main__': if len(sys.argv) != 6: print( "Usage: python %s role endpoints current_endpoint trainer_id trainers" % sys.argv[0]) exit(0) role, endpoints, current_endpoint, trainer_id, trainers = \ sys.argv[1:] train(True, role, endpoints, current_endpoint, int(trainer_id), int(trainers))
35.321429
82
0.65091
from __future__ import print_function import paddle.fluid.core as core import math import os import sys import numpy import paddle import paddle.fluid as fluid BATCH_SIZE = 64 PASS_NUM = 1 def loss_net(hidden, label): prediction = fluid.layers.fc(input=hidden, size=10, act='softmax') loss = fluid.layers.cross_entropy(input=prediction, label=label) avg_loss = fluid.layers.mean(loss) acc = fluid.layers.accuracy(input=prediction, label=label) return prediction, avg_loss, acc def conv_net(img, label): conv_pool_1 = fluid.nets.simple_img_conv_pool( input=img, filter_size=5, num_filters=20, pool_size=2, pool_stride=2, act="relu") conv_pool_1 = fluid.layers.batch_norm(conv_pool_1) conv_pool_2 = fluid.nets.simple_img_conv_pool( input=conv_pool_1, filter_size=5, num_filters=50, pool_size=2, pool_stride=2, act="relu") return loss_net(conv_pool_2, label) def train(use_cuda, role, endpoints, current_endpoint, trainer_id, trainers): if use_cuda and not fluid.core.is_compiled_with_cuda(): return img = fluid.layers.data(name='img', shape=[1, 28, 28], dtype='float32') label = fluid.layers.data(name='label', shape=[1], dtype='int64') prediction, avg_loss, acc = conv_net(img, label) test_program = fluid.default_main_program().clone(for_test=True) optimizer = fluid.optimizer.Adam(learning_rate=0.001) optimizer.minimize(avg_loss) t = fluid.DistributeTranspiler() t.transpile(trainer_id, pservers=endpoints, trainers=trainers) if role == "pserver": prog = t.get_pserver_program(current_endpoint) startup = t.get_startup_program(current_endpoint, pserver_program=prog) exe = fluid.Executor(fluid.CPUPlace()) exe.run(startup) exe.run(prog) elif role == "trainer": prog = t.get_trainer_program() place = fluid.CUDAPlace(0) if use_cuda else fluid.CPUPlace() exe = fluid.Executor(place) train_reader = paddle.batch( paddle.reader.shuffle(paddle.dataset.mnist.train(), buf_size=500), batch_size=BATCH_SIZE) test_reader = paddle.batch( paddle.dataset.mnist.test(), batch_size=BATCH_SIZE) feeder = fluid.DataFeeder(feed_list=[img, label], place=place) exe.run(fluid.default_startup_program()) for pass_id in range(PASS_NUM): for batch_id, data in enumerate(train_reader()): acc_np, avg_loss_np = exe.run( prog, feed=feeder.feed(data), fetch_list=[acc, avg_loss]) if (batch_id + 1) % 10 == 0: print( 'PassID {0:1}, BatchID {1:04}, Loss {2:2.2}, Acc {3:2.2}'. format(pass_id, batch_id + 1, float(avg_loss_np.mean()), float( acc_np.mean()))) if __name__ == '__main__': if len(sys.argv) != 6: print( "Usage: python %s role endpoints current_endpoint trainer_id trainers" % sys.argv[0]) exit(0) role, endpoints, current_endpoint, trainer_id, trainers = \ sys.argv[1:] train(True, role, endpoints, current_endpoint, int(trainer_id), int(trainers))
true
true
f7209f8d535077c8af62477c05e769c4ef76e2d5
9,895
py
Python
mazda3_joystick.py
moralrecordings/elm327_joystick
edebae95f24913f7c6caed98751fb54477743169
[ "BSD-3-Clause" ]
7
2017-12-18T13:11:18.000Z
2022-01-08T21:13:26.000Z
mazda3_joystick.py
moralrecordings/elm327_joystick
edebae95f24913f7c6caed98751fb54477743169
[ "BSD-3-Clause" ]
null
null
null
mazda3_joystick.py
moralrecordings/elm327_joystick
edebae95f24913f7c6caed98751fb54477743169
[ "BSD-3-Clause" ]
3
2018-10-27T21:37:01.000Z
2022-01-08T21:13:24.000Z
#!/usr/bin/env python3 import uinput from elm327 import ELM327, PROTOCOLS from mrcrowbar import models as mrc import math import time from optparse import OptionParser class OptParser( OptionParser ): def format_epilog( self, formatter ): return '\n{}\n'.format( '\n'.join( [formatter._format_text( x ) for x in self.epilog.split( '\n' )] ) ) class Steering( mrc.Block ): RANGE = 0x00D2 axis_raw = mrc.UInt16_BE( 0x00 ) @property def axis( self ): return min( max( (255*(self.axis_raw - 0x8000)//self.RANGE), -255 ), 255 ) class Accelerator( mrc.Block ): RANGE = 0xC8 axis_raw = mrc.UInt8( 0x06 ) @property def axis( self ): return min( max( (255*(self.axis_raw)//self.RANGE), 0 ), 255 ) class Brake( mrc.Block ): button = mrc.Bits( 0x02, 0b01000000 ) class Cruise( mrc.Block ): button = mrc.Bits( 0x00, 0b10000000 ) class Controls( mrc.Block ): driver_door = mrc.Bits( 0x00, 0b10000000 ) high_beams = mrc.Bits( 0x03, 0b01000000 ) class Mazda3: LATCH_TIME = 0.1 PRESS_THRESHOLD = 32 STEER_THRESHOLD = 64 SHOVE_THRESHOLD = 128 def __init__( self, name, mapping ): print( 'Creating uinput device "{}"...'.format( name ) ) self.device = uinput.Device( mapping, name ) self.steering = 0 self.accelerator = 0 self.brake = 0 self.high_beams = 0 self.cruise_t = self.driver_door_t = time.time() + self.LATCH_TIME self.cruise = 0 self.driver_door = 0 self.cruise_prev = 0 self.driver_door_prev = 0 def update( self, msg_id, msg_b ): t = time.time() self.cruise_prev = self.cruise self.driver_door_prev = self.driver_door if msg_id == 0x4da: self.steering = Steering( msg_b ).axis elif msg_id == 0x201: self.accelerator = Accelerator( msg_b ).axis elif msg_id == 0x205: self.brake = Brake( msg_b ).button elif msg_id == 0x4ec: self.cruise = Cruise( msg_b ).button elif msg_id == 0x433: obj = Controls( msg_b ) self.high_beams = obj.high_beams self.driver_door = obj.driver_door else: return if self.cruise != self.cruise_prev: self.cruise_t = t if self.driver_door != self.driver_door_prev: self.driver_door_t = t self.set_controls() return def set_controls( self ): pass class Mazda3Joystick( Mazda3 ): NAME = 'Mazda 3 Joystick' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (0, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3 ] def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) def set_controls( self ): t = time.time() self.device.emit( uinput.ABS_WHEEL, self.steering ) self.device.emit( uinput.ABS_GAS, self.accelerator ) self.device.emit( uinput.BTN_0, self.brake ) self.device.emit( uinput.BTN_1, self.high_beams ) self.device.emit( uinput.BTN_2, 1 if t < (self.cruise_t + self.LATCH_TIME) else 0 ) self.device.emit( uinput.BTN_3, 1 if t < (self.driver_door_t + self.LATCH_TIME) else 0 ) return class Mazda3Doom( Mazda3Joystick ): NAME = 'Mazda 3 Doom' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (-255, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3 ] class Mazda3DOS( Mazda3Joystick ): NAME = 'Mazda 3 DOS' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (-255, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3 ] def set_controls( self ): t = time.time() self.device.emit( uinput.ABS_WHEEL, self.steering ) self.device.emit( uinput.ABS_GAS, self.accelerator*2-255 ) self.device.emit( uinput.BTN_0, self.brake ) self.device.emit( uinput.BTN_1, self.high_beams ) self.device.emit( uinput.BTN_2, 1 if t < (self.cruise_t + self.LATCH_TIME) else 0 ) self.device.emit( uinput.BTN_3, 1 if t < (self.driver_door_t + self.LATCH_TIME) else 0 ) return class Mazda3Descent( Mazda3 ): NAME = 'Mazda 3 Descent' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (-255, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3, uinput.KEY_UP, uinput.KEY_DOWN ] DOUBLE_TAP = 0.5 def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) self.high_beams_prev = 0 self.high_beams_t = time.time() self.high_beams_key = uinput.KEY_DOWN def update( self, msg_id, msg_b ): t = time.time() self.high_beams_prev = self.high_beams super().update( msg_id, msg_b ) if self.high_beams != self.high_beams_prev: if self.high_beams: self.high_beams_key = uinput.KEY_UP if (t - self.high_beams_t < self.DOUBLE_TAP) else uinput.KEY_DOWN self.device.emit( self.high_beams_key, 1 ) self.high_beams_t = t else: self.device.emit( self.high_beams_key, 0 ) def set_controls( self ): t = time.time() self.device.emit( uinput.ABS_WHEEL, self.steering ) self.device.emit( uinput.ABS_GAS, self.accelerator ) self.device.emit( uinput.BTN_0, self.brake ) self.device.emit( uinput.BTN_2, 1 if t < (self.cruise_t + self.LATCH_TIME) else 0 ) self.device.emit( uinput.BTN_3, 1 if t < (self.driver_door_t + self.LATCH_TIME) else 0 ) return class Mazda3Grim( Mazda3 ): NAME = 'Mazda 3 Grim Fandango' DEVICE = [ uinput.KEY_LEFT, uinput.KEY_UP, uinput.KEY_RIGHT, uinput.KEY_U, uinput.KEY_LEFTSHIFT, uinput.KEY_E, uinput.KEY_P, uinput.KEY_I ] def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) def set_controls( self ): t = time.time() self.device.emit( uinput.KEY_LEFT, 1 if self.steering < -self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_RIGHT, 1 if self.steering > self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_UP, 1 if self.accelerator > self.PRESS_THRESHOLD else 0 ) self.device.emit( uinput.KEY_LEFTSHIFT, 1 if self.accelerator > self.SHOVE_THRESHOLD else 0 ) self.device.emit( uinput.KEY_U, self.brake ) self.device.emit( uinput.KEY_E, self.high_beams ) self.device.emit( uinput.KEY_P, 1 if t < self.cruise_t + self.LATCH_TIME else 0 ) self.device.emit( uinput.KEY_I, 1 if t < self.driver_door_t + self.LATCH_TIME else 0 ) return class Mazda3Sonic( Mazda3 ): NAME = 'Mazda 3 Sonic' DEVICE = [ uinput.KEY_LEFT, uinput.KEY_UP, uinput.KEY_RIGHT, uinput.KEY_DOWN, uinput.KEY_Z, uinput.KEY_ENTER ] def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) def set_controls( self ): t = time.time() self.device.emit( uinput.KEY_LEFT, 1 if self.steering < -self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_RIGHT, 1 if self.steering > self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_Z, 1 if self.accelerator > self.PRESS_THRESHOLD else 0 ) self.device.emit( uinput.KEY_DOWN, self.brake ) self.device.emit( uinput.KEY_UP, self.high_beams ) self.device.emit( uinput.KEY_ENTER, 1 if t < self.cruise_t + self.LATCH_TIME else 0 ) return CONTROLLERS = { 'joystick': Mazda3Joystick, 'grim': Mazda3Grim, 'descent': Mazda3Descent, 'doom': Mazda3Doom, 'dos': Mazda3DOS, 'sonic': Mazda3Sonic, } if __name__ == '__main__': usage = 'Usage: %prog [options]' parser = OptParser( epilog='Protocols supported by the ELM327:\n{}'.format( PROTOCOLS ) ) parser.add_option( '-g', '--game', dest='game', help='Game configuration to use (choices: {})'.format( ' '.join( CONTROLLERS.keys() ) ) ) parser.add_option( '-d', '--device', dest='device', help='Path to ELM327 serial device' ) parser.add_option( '-b', '--baudrate', dest='baud_rate', help='Baud rate' ) parser.add_option( '-p', '--protocol', dest='protocol', help='ELM327 message protocol to use' ) (options, argv) = parser.parse_args() args = {} controller_type = 'joystick' if options.game and options.game in CONTROLLERS: controller_type = options.game elif len( argv ) >= 1 and argv[0] in CONTROLLERS: controller_type = argv[0] controller = CONTROLLERS[controller_type]() if options.device: args['device'] = options.device elif len( argv ) >= 2: args['device'] = argv[1] if options.baud_rate: args['baud_rate'] = options.baud_rate elif len( argv ) >= 3: args['baud_rate'] = argv[2] if options.protocol: args['protocol'] = options.protocol elif len( argv ) >= 4: args['protocol'] = argv[3] elm = ELM327( **args ) elm.reset() elm.set_can_whitelist( [0x4da, 0x201, 0x205, 0x4ec, 0x433] ) elm.start_can() try: while True: msg_id, msg_b = elm.recv_can() if msg_id >= 0: controller.update( msg_id, msg_b ) else: print('-- Miss: {}'.format( msg_b )) except EOFError: print('-- Hit the end') except KeyboardInterrupt: pass elm.get_prompt()
30.167683
141
0.597979
import uinput from elm327 import ELM327, PROTOCOLS from mrcrowbar import models as mrc import math import time from optparse import OptionParser class OptParser( OptionParser ): def format_epilog( self, formatter ): return '\n{}\n'.format( '\n'.join( [formatter._format_text( x ) for x in self.epilog.split( '\n' )] ) ) class Steering( mrc.Block ): RANGE = 0x00D2 axis_raw = mrc.UInt16_BE( 0x00 ) @property def axis( self ): return min( max( (255*(self.axis_raw - 0x8000)//self.RANGE), -255 ), 255 ) class Accelerator( mrc.Block ): RANGE = 0xC8 axis_raw = mrc.UInt8( 0x06 ) @property def axis( self ): return min( max( (255*(self.axis_raw)//self.RANGE), 0 ), 255 ) class Brake( mrc.Block ): button = mrc.Bits( 0x02, 0b01000000 ) class Cruise( mrc.Block ): button = mrc.Bits( 0x00, 0b10000000 ) class Controls( mrc.Block ): driver_door = mrc.Bits( 0x00, 0b10000000 ) high_beams = mrc.Bits( 0x03, 0b01000000 ) class Mazda3: LATCH_TIME = 0.1 PRESS_THRESHOLD = 32 STEER_THRESHOLD = 64 SHOVE_THRESHOLD = 128 def __init__( self, name, mapping ): print( 'Creating uinput device "{}"...'.format( name ) ) self.device = uinput.Device( mapping, name ) self.steering = 0 self.accelerator = 0 self.brake = 0 self.high_beams = 0 self.cruise_t = self.driver_door_t = time.time() + self.LATCH_TIME self.cruise = 0 self.driver_door = 0 self.cruise_prev = 0 self.driver_door_prev = 0 def update( self, msg_id, msg_b ): t = time.time() self.cruise_prev = self.cruise self.driver_door_prev = self.driver_door if msg_id == 0x4da: self.steering = Steering( msg_b ).axis elif msg_id == 0x201: self.accelerator = Accelerator( msg_b ).axis elif msg_id == 0x205: self.brake = Brake( msg_b ).button elif msg_id == 0x4ec: self.cruise = Cruise( msg_b ).button elif msg_id == 0x433: obj = Controls( msg_b ) self.high_beams = obj.high_beams self.driver_door = obj.driver_door else: return if self.cruise != self.cruise_prev: self.cruise_t = t if self.driver_door != self.driver_door_prev: self.driver_door_t = t self.set_controls() return def set_controls( self ): pass class Mazda3Joystick( Mazda3 ): NAME = 'Mazda 3 Joystick' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (0, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3 ] def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) def set_controls( self ): t = time.time() self.device.emit( uinput.ABS_WHEEL, self.steering ) self.device.emit( uinput.ABS_GAS, self.accelerator ) self.device.emit( uinput.BTN_0, self.brake ) self.device.emit( uinput.BTN_1, self.high_beams ) self.device.emit( uinput.BTN_2, 1 if t < (self.cruise_t + self.LATCH_TIME) else 0 ) self.device.emit( uinput.BTN_3, 1 if t < (self.driver_door_t + self.LATCH_TIME) else 0 ) return class Mazda3Doom( Mazda3Joystick ): NAME = 'Mazda 3 Doom' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (-255, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3 ] class Mazda3DOS( Mazda3Joystick ): NAME = 'Mazda 3 DOS' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (-255, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3 ] def set_controls( self ): t = time.time() self.device.emit( uinput.ABS_WHEEL, self.steering ) self.device.emit( uinput.ABS_GAS, self.accelerator*2-255 ) self.device.emit( uinput.BTN_0, self.brake ) self.device.emit( uinput.BTN_1, self.high_beams ) self.device.emit( uinput.BTN_2, 1 if t < (self.cruise_t + self.LATCH_TIME) else 0 ) self.device.emit( uinput.BTN_3, 1 if t < (self.driver_door_t + self.LATCH_TIME) else 0 ) return class Mazda3Descent( Mazda3 ): NAME = 'Mazda 3 Descent' DEVICE = [ uinput.ABS_WHEEL + (-255, 255, 0, 0), uinput.ABS_GAS + (-255, 255, 0, 0), uinput.BTN_0, uinput.BTN_1, uinput.BTN_2, uinput.BTN_3, uinput.KEY_UP, uinput.KEY_DOWN ] DOUBLE_TAP = 0.5 def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) self.high_beams_prev = 0 self.high_beams_t = time.time() self.high_beams_key = uinput.KEY_DOWN def update( self, msg_id, msg_b ): t = time.time() self.high_beams_prev = self.high_beams super().update( msg_id, msg_b ) if self.high_beams != self.high_beams_prev: if self.high_beams: self.high_beams_key = uinput.KEY_UP if (t - self.high_beams_t < self.DOUBLE_TAP) else uinput.KEY_DOWN self.device.emit( self.high_beams_key, 1 ) self.high_beams_t = t else: self.device.emit( self.high_beams_key, 0 ) def set_controls( self ): t = time.time() self.device.emit( uinput.ABS_WHEEL, self.steering ) self.device.emit( uinput.ABS_GAS, self.accelerator ) self.device.emit( uinput.BTN_0, self.brake ) self.device.emit( uinput.BTN_2, 1 if t < (self.cruise_t + self.LATCH_TIME) else 0 ) self.device.emit( uinput.BTN_3, 1 if t < (self.driver_door_t + self.LATCH_TIME) else 0 ) return class Mazda3Grim( Mazda3 ): NAME = 'Mazda 3 Grim Fandango' DEVICE = [ uinput.KEY_LEFT, uinput.KEY_UP, uinput.KEY_RIGHT, uinput.KEY_U, uinput.KEY_LEFTSHIFT, uinput.KEY_E, uinput.KEY_P, uinput.KEY_I ] def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) def set_controls( self ): t = time.time() self.device.emit( uinput.KEY_LEFT, 1 if self.steering < -self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_RIGHT, 1 if self.steering > self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_UP, 1 if self.accelerator > self.PRESS_THRESHOLD else 0 ) self.device.emit( uinput.KEY_LEFTSHIFT, 1 if self.accelerator > self.SHOVE_THRESHOLD else 0 ) self.device.emit( uinput.KEY_U, self.brake ) self.device.emit( uinput.KEY_E, self.high_beams ) self.device.emit( uinput.KEY_P, 1 if t < self.cruise_t + self.LATCH_TIME else 0 ) self.device.emit( uinput.KEY_I, 1 if t < self.driver_door_t + self.LATCH_TIME else 0 ) return class Mazda3Sonic( Mazda3 ): NAME = 'Mazda 3 Sonic' DEVICE = [ uinput.KEY_LEFT, uinput.KEY_UP, uinput.KEY_RIGHT, uinput.KEY_DOWN, uinput.KEY_Z, uinput.KEY_ENTER ] def __init__( self ): super().__init__( name=self.NAME, mapping=self.DEVICE ) def set_controls( self ): t = time.time() self.device.emit( uinput.KEY_LEFT, 1 if self.steering < -self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_RIGHT, 1 if self.steering > self.STEER_THRESHOLD else 0 ) self.device.emit( uinput.KEY_Z, 1 if self.accelerator > self.PRESS_THRESHOLD else 0 ) self.device.emit( uinput.KEY_DOWN, self.brake ) self.device.emit( uinput.KEY_UP, self.high_beams ) self.device.emit( uinput.KEY_ENTER, 1 if t < self.cruise_t + self.LATCH_TIME else 0 ) return CONTROLLERS = { 'joystick': Mazda3Joystick, 'grim': Mazda3Grim, 'descent': Mazda3Descent, 'doom': Mazda3Doom, 'dos': Mazda3DOS, 'sonic': Mazda3Sonic, } if __name__ == '__main__': usage = 'Usage: %prog [options]' parser = OptParser( epilog='Protocols supported by the ELM327:\n{}'.format( PROTOCOLS ) ) parser.add_option( '-g', '--game', dest='game', help='Game configuration to use (choices: {})'.format( ' '.join( CONTROLLERS.keys() ) ) ) parser.add_option( '-d', '--device', dest='device', help='Path to ELM327 serial device' ) parser.add_option( '-b', '--baudrate', dest='baud_rate', help='Baud rate' ) parser.add_option( '-p', '--protocol', dest='protocol', help='ELM327 message protocol to use' ) (options, argv) = parser.parse_args() args = {} controller_type = 'joystick' if options.game and options.game in CONTROLLERS: controller_type = options.game elif len( argv ) >= 1 and argv[0] in CONTROLLERS: controller_type = argv[0] controller = CONTROLLERS[controller_type]() if options.device: args['device'] = options.device elif len( argv ) >= 2: args['device'] = argv[1] if options.baud_rate: args['baud_rate'] = options.baud_rate elif len( argv ) >= 3: args['baud_rate'] = argv[2] if options.protocol: args['protocol'] = options.protocol elif len( argv ) >= 4: args['protocol'] = argv[3] elm = ELM327( **args ) elm.reset() elm.set_can_whitelist( [0x4da, 0x201, 0x205, 0x4ec, 0x433] ) elm.start_can() try: while True: msg_id, msg_b = elm.recv_can() if msg_id >= 0: controller.update( msg_id, msg_b ) else: print('-- Miss: {}'.format( msg_b )) except EOFError: print('-- Hit the end') except KeyboardInterrupt: pass elm.get_prompt()
true
true
f720a09f334fcd690a947282fa271733c27fe7d4
218
py
Python
WriteaFunction.py
jibinmathew691993/PythonHackerrank
14ab5b620435a006d5ccff17536bc01acd7c22dc
[ "MIT" ]
null
null
null
WriteaFunction.py
jibinmathew691993/PythonHackerrank
14ab5b620435a006d5ccff17536bc01acd7c22dc
[ "MIT" ]
null
null
null
WriteaFunction.py
jibinmathew691993/PythonHackerrank
14ab5b620435a006d5ccff17536bc01acd7c22dc
[ "MIT" ]
null
null
null
def is_leap(year): leap = False if year>=1900: if year%4 == 0: leap = True if year%100 == 0 and year%400 != 0: leap = False return leap year = int(input())
18.166667
47
0.463303
def is_leap(year): leap = False if year>=1900: if year%4 == 0: leap = True if year%100 == 0 and year%400 != 0: leap = False return leap year = int(input())
true
true
f720a191c0da487593b1eee10de1b8b4af27c2df
2,276
py
Python
pyecharts/charts/basic_charts/scatter.py
myqf555/pyecharts
050309ee3d2016142df3e2265a091e27aa58a027
[ "MIT" ]
1
2020-02-13T14:48:20.000Z
2020-02-13T14:48:20.000Z
pyecharts/charts/basic_charts/scatter.py
eclipse2007/pyecharts
651731a1a5220420a9a03808d2f5eb38ffe18e09
[ "MIT" ]
null
null
null
pyecharts/charts/basic_charts/scatter.py
eclipse2007/pyecharts
651731a1a5220420a9a03808d2f5eb38ffe18e09
[ "MIT" ]
1
2020-09-12T05:55:48.000Z
2020-09-12T05:55:48.000Z
import itertools from ... import options as opts from ... import types from ...charts.chart import RectChart from ...globals import ChartType class Scatter(RectChart): """ <<< Scatter >>> The scatter diagram on the rectangular coordinate system can be used to show the relationship between x and y of the data. If the data item has multiple dimensions, it can be represented by color, and the visualmap component can be used. """ def add_yaxis( self, series_name: str, y_axis: types.Sequence, *, is_selected: bool = True, xaxis_index: types.Optional[types.Numeric] = None, yaxis_index: types.Optional[types.Numeric] = None, color: types.Optional[str] = None, symbol: types.Optional[str] = None, symbol_size: types.Union[types.Numeric, types.Sequence] = 10, symbol_rotate: types.Optional[types.Numeric] = None, label_opts: types.Label = opts.LabelOpts(position="right"), markpoint_opts: types.MarkPoint = None, markline_opts: types.MarkLine = None, tooltip_opts: types.Tooltip = None, itemstyle_opts: types.ItemStyle = None, ): self._append_color(color) self._append_legend(series_name, is_selected) if len(y_axis) > 0 and isinstance(y_axis[0], types.Sequence): data = [ list(itertools.chain(list([x]), y)) for x, y in zip(self._xaxis_data, y_axis) ] else: data = [list(z) for z in zip(self._xaxis_data, y_axis)] self.options.get("series").append( { "type": ChartType.SCATTER, "name": series_name, "xAxisIndex": xaxis_index, "yAxisIndex": yaxis_index, "symbol": symbol, "symbolSize": symbol_size, "symbolRotate": symbol_rotate, "data": data, "label": label_opts, "markPoint": markpoint_opts, "markLine": markline_opts, "tooltip": tooltip_opts, "itemStyle": itemstyle_opts, } ) return self
35.5625
76
0.560193
import itertools from ... import options as opts from ... import types from ...charts.chart import RectChart from ...globals import ChartType class Scatter(RectChart): def add_yaxis( self, series_name: str, y_axis: types.Sequence, *, is_selected: bool = True, xaxis_index: types.Optional[types.Numeric] = None, yaxis_index: types.Optional[types.Numeric] = None, color: types.Optional[str] = None, symbol: types.Optional[str] = None, symbol_size: types.Union[types.Numeric, types.Sequence] = 10, symbol_rotate: types.Optional[types.Numeric] = None, label_opts: types.Label = opts.LabelOpts(position="right"), markpoint_opts: types.MarkPoint = None, markline_opts: types.MarkLine = None, tooltip_opts: types.Tooltip = None, itemstyle_opts: types.ItemStyle = None, ): self._append_color(color) self._append_legend(series_name, is_selected) if len(y_axis) > 0 and isinstance(y_axis[0], types.Sequence): data = [ list(itertools.chain(list([x]), y)) for x, y in zip(self._xaxis_data, y_axis) ] else: data = [list(z) for z in zip(self._xaxis_data, y_axis)] self.options.get("series").append( { "type": ChartType.SCATTER, "name": series_name, "xAxisIndex": xaxis_index, "yAxisIndex": yaxis_index, "symbol": symbol, "symbolSize": symbol_size, "symbolRotate": symbol_rotate, "data": data, "label": label_opts, "markPoint": markpoint_opts, "markLine": markline_opts, "tooltip": tooltip_opts, "itemStyle": itemstyle_opts, } ) return self
true
true
f720a2030d77959bb04a88ba16fda69fd042f960
8,410
py
Python
LichessBotMain.py
nfeddersen/lichess-bot
6457b5f66104b59b91316ba3a944b55710ca64e5
[ "MIT" ]
null
null
null
LichessBotMain.py
nfeddersen/lichess-bot
6457b5f66104b59b91316ba3a944b55710ca64e5
[ "MIT" ]
null
null
null
LichessBotMain.py
nfeddersen/lichess-bot
6457b5f66104b59b91316ba3a944b55710ca64e5
[ "MIT" ]
1
2021-07-12T14:11:04.000Z
2021-07-12T14:11:04.000Z
import requests import json from stockfish import Stockfish stockfish = Stockfish('stockfish_20090216_x64_bmi2.exe', parameters={"Threads": 8, "Minimum Thinking Time": 300}) stockfish.set_depth(15) stockfish.set_skill_level(25) api_key = 'REPLACE_WITH_API_KEY' headers = {'Authorization': f'Bearer {api_key}'} game_state_url = 'https://lichess.org/api/stream/event' game_id = 'placeholder' is_checkmate = False bot_challenges = False while True: state_session = requests.Session() request = state_session.get(game_state_url, headers=headers, stream=True) for line in request.iter_lines(): if len(line) == 0: print('Request response is empty.') if len(line) != 0: challenge_state_json = json.loads(line) if challenge_state_json['type'] == 'challenge': print('BOT_NAME has been challenged.') challenge_id = challenge_state_json['challenge']['id'] challenger = challenge_state_json['challenge']['challenger']['id'] print('Challenge ID is: ' + challenge_id + '. Challenger is: ' + challenger) if challenge_state_json['challenge']['variant']['key'] != 'standard': requests.post('https://lichess.org/api/challenge/' + challenge_id + '/decline', params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) print('Challenge has been declined for improper variant.') continue else: requests.post('https://lichess.org/api/challenge/' + challenge_id + '/accept', params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) current_move = 'placeholder' best_move = 'placeholder' position = ['placeholder', 'placeholder'] black_position = ['placeholder', 'placeholder'] white = True second_session = requests.Session() request = second_session.get(game_state_url, headers=headers, stream=True) for line in request.iter_lines(): game_start_json = json.loads(line) print(game_start_json) game_id = game_start_json['game']['id'] print('Game ID is: ' + game_id) break game_stream_url = 'https://lichess.org/api/bot/game/stream/' + game_id bot_move_url = 'https://lichess.org/api/bot/game/' + game_id + '/move/' s = requests.Session() r = s.get(game_stream_url, headers=headers, stream=True) i = 0 move_count = 0 for line in r.iter_lines(): if line: i = i + 1 move_count = move_count + .5 move_count = float(move_count) if move_count.is_integer(): move_count = int(move_count) move_count = str(move_count) print('It is move ' + move_count + '.') move_count = float(move_count) start_json = json.loads(line) if i == 1: if start_json["white"]["id"] == 'REPLACE_WITH_BOT_USERNAME': white = True print('It is white to move. I am white.') else: white = False print('It is white to move. I am black.') if start_json['speed'] == 'bullet' and i == 1: stockfish.set_depth(15) stockfish.set_skill_level(20) elif start_json['speed'] == 'blitz' and i == 1: stockfish.set_depth(15) stockfish.set_skill_level(25) elif start_json['speed'] == 'rapid' and i == 1: stockfish.set_depth(19) stockfish.set_skill_level(30) elif start_json['speed'] == 'classical' and i == 1: stockfish.set_depth(20) stockfish.set_skill_level(30) elif start_json['speed'] == 'correspondence' and i == 1: stockfish.set_depth(20) stockfish.set_skill_level(30) if white and i == 1: position.clear() stockfish.set_position() best_move = stockfish.get_best_move() requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) best_move = str(best_move) position.append(best_move) stockfish.set_position(position) if not white and i == 1: print('I am waiting to move.') if not white and i == 2: black_position.clear() current_move = start_json["moves"] current_move = str(current_move) current_move = current_move.split() current_move = current_move[-1] black_position.append(current_move) stockfish.set_position(black_position) best_move = stockfish.get_best_move() black_position.append(best_move) requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) if start_json['type'] == 'gameState': # If bot is white and first move has already been played if not i % 2 == 0 and white and i > 1: current_move = start_json["moves"] current_move = str(current_move) current_move = current_move.split() current_move = current_move[-1] position.append(current_move) stockfish.set_position(position) best_move = stockfish.get_best_move() position.append(best_move) requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) # If bot is black and first move has been played if not white and i % 2 == 0 and i > 2: current_move = start_json["moves"] current_move = str(current_move) current_move = current_move.split() current_move = current_move[-1] black_position.append(current_move) stockfish.set_position(black_position) best_move = stockfish.get_best_move() black_position.append(best_move) requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) else: print('I am waiting to move.') continue
46.464088
114
0.437574
import requests import json from stockfish import Stockfish stockfish = Stockfish('stockfish_20090216_x64_bmi2.exe', parameters={"Threads": 8, "Minimum Thinking Time": 300}) stockfish.set_depth(15) stockfish.set_skill_level(25) api_key = 'REPLACE_WITH_API_KEY' headers = {'Authorization': f'Bearer {api_key}'} game_state_url = 'https://lichess.org/api/stream/event' game_id = 'placeholder' is_checkmate = False bot_challenges = False while True: state_session = requests.Session() request = state_session.get(game_state_url, headers=headers, stream=True) for line in request.iter_lines(): if len(line) == 0: print('Request response is empty.') if len(line) != 0: challenge_state_json = json.loads(line) if challenge_state_json['type'] == 'challenge': print('BOT_NAME has been challenged.') challenge_id = challenge_state_json['challenge']['id'] challenger = challenge_state_json['challenge']['challenger']['id'] print('Challenge ID is: ' + challenge_id + '. Challenger is: ' + challenger) if challenge_state_json['challenge']['variant']['key'] != 'standard': requests.post('https://lichess.org/api/challenge/' + challenge_id + '/decline', params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) print('Challenge has been declined for improper variant.') continue else: requests.post('https://lichess.org/api/challenge/' + challenge_id + '/accept', params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) current_move = 'placeholder' best_move = 'placeholder' position = ['placeholder', 'placeholder'] black_position = ['placeholder', 'placeholder'] white = True second_session = requests.Session() request = second_session.get(game_state_url, headers=headers, stream=True) for line in request.iter_lines(): game_start_json = json.loads(line) print(game_start_json) game_id = game_start_json['game']['id'] print('Game ID is: ' + game_id) break game_stream_url = 'https://lichess.org/api/bot/game/stream/' + game_id bot_move_url = 'https://lichess.org/api/bot/game/' + game_id + '/move/' s = requests.Session() r = s.get(game_stream_url, headers=headers, stream=True) i = 0 move_count = 0 for line in r.iter_lines(): if line: i = i + 1 move_count = move_count + .5 move_count = float(move_count) if move_count.is_integer(): move_count = int(move_count) move_count = str(move_count) print('It is move ' + move_count + '.') move_count = float(move_count) start_json = json.loads(line) if i == 1: if start_json["white"]["id"] == 'REPLACE_WITH_BOT_USERNAME': white = True print('It is white to move. I am white.') else: white = False print('It is white to move. I am black.') if start_json['speed'] == 'bullet' and i == 1: stockfish.set_depth(15) stockfish.set_skill_level(20) elif start_json['speed'] == 'blitz' and i == 1: stockfish.set_depth(15) stockfish.set_skill_level(25) elif start_json['speed'] == 'rapid' and i == 1: stockfish.set_depth(19) stockfish.set_skill_level(30) elif start_json['speed'] == 'classical' and i == 1: stockfish.set_depth(20) stockfish.set_skill_level(30) elif start_json['speed'] == 'correspondence' and i == 1: stockfish.set_depth(20) stockfish.set_skill_level(30) if white and i == 1: position.clear() stockfish.set_position() best_move = stockfish.get_best_move() requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) best_move = str(best_move) position.append(best_move) stockfish.set_position(position) if not white and i == 1: print('I am waiting to move.') if not white and i == 2: black_position.clear() current_move = start_json["moves"] current_move = str(current_move) current_move = current_move.split() current_move = current_move[-1] black_position.append(current_move) stockfish.set_position(black_position) best_move = stockfish.get_best_move() black_position.append(best_move) requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) if start_json['type'] == 'gameState': if not i % 2 == 0 and white and i > 1: current_move = start_json["moves"] current_move = str(current_move) current_move = current_move.split() current_move = current_move[-1] position.append(current_move) stockfish.set_position(position) best_move = stockfish.get_best_move() position.append(best_move) requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) if not white and i % 2 == 0 and i > 2: current_move = start_json["moves"] current_move = str(current_move) current_move = current_move.split() current_move = current_move[-1] black_position.append(current_move) stockfish.set_position(black_position) best_move = stockfish.get_best_move() black_position.append(best_move) requests.post(bot_move_url + best_move, params={ }, headers={ 'Authorization': f'Bearer {api_key}' }) else: print('I am waiting to move.') continue
true
true
f720a21b297857bd9d0f8b0c056695ecb84a54fe
1,510
py
Python
pyArango/index.py
jarvisav/pyArango
dc054e2258c9fccbc54443afc244b74ad0abb8b0
[ "Apache-2.0" ]
null
null
null
pyArango/index.py
jarvisav/pyArango
dc054e2258c9fccbc54443afc244b74ad0abb8b0
[ "Apache-2.0" ]
null
null
null
pyArango/index.py
jarvisav/pyArango
dc054e2258c9fccbc54443afc244b74ad0abb8b0
[ "Apache-2.0" ]
null
null
null
import json from .theExceptions import (CreationError, DeletionError, UpdateError) class Index(object) : """An index on a collection's fields. Indexes are meant to de created by ensureXXX functions of Collections. Indexes have a .infos dictionary that stores all the infos about the index""" def __init__(self, collection, infos = None, creationData = None) : self.collection = collection self.connection = self.collection.database.connection self.indexesURL = "%s/index" % self.collection.database.URL self.infos = None if infos : self.infos = infos elif creationData : self._create(creationData) if self.infos : self.URL = "%s/%s" % (self.indexesURL, self.infos["id"]) def _create(self, postData) : """Creates an index of any type according to postData""" if self.infos is None : r = self.connection.session.post(self.indexesURL, params = {"collection" : self.collection.name}, data = json.dumps(postData, default=str)) data = r.json() if (r.status_code >= 400) or data['error'] : raise CreationError(data['errorMessage'], data) self.infos = data def delete(self) : """Delete the index""" r = self.connection.session.delete(self.URL) data = r.json() if (r.status_code != 200 and r.status_code != 202) or data['error'] : raise DeletionError(data['errorMessage'], data)
40.810811
151
0.625828
import json from .theExceptions import (CreationError, DeletionError, UpdateError) class Index(object) : def __init__(self, collection, infos = None, creationData = None) : self.collection = collection self.connection = self.collection.database.connection self.indexesURL = "%s/index" % self.collection.database.URL self.infos = None if infos : self.infos = infos elif creationData : self._create(creationData) if self.infos : self.URL = "%s/%s" % (self.indexesURL, self.infos["id"]) def _create(self, postData) : if self.infos is None : r = self.connection.session.post(self.indexesURL, params = {"collection" : self.collection.name}, data = json.dumps(postData, default=str)) data = r.json() if (r.status_code >= 400) or data['error'] : raise CreationError(data['errorMessage'], data) self.infos = data def delete(self) : r = self.connection.session.delete(self.URL) data = r.json() if (r.status_code != 200 and r.status_code != 202) or data['error'] : raise DeletionError(data['errorMessage'], data)
true
true
f720a26b353f6b3ddd1548566f5b0a972c16828a
584
py
Python
soleka.py
jshenaop/eko
bb8e96ee9e460ed10505c8046a444a24fdcfcd06
[ "Apache-2.0" ]
null
null
null
soleka.py
jshenaop/eko
bb8e96ee9e460ed10505c8046a444a24fdcfcd06
[ "Apache-2.0" ]
null
null
null
soleka.py
jshenaop/eko
bb8e96ee9e460ed10505c8046a444a24fdcfcd06
[ "Apache-2.0" ]
null
null
null
# coding=utf8 from flask import Flask, render_template from flask_restful.utils import cors from flask_cors import CORS, cross_origin import config import models from resources_v1.predictions import predictions_api_v1 from templates.templates import home app = Flask(__name__) CORS(app) app.register_blueprint(predictions_api_v1, url_prefix='/api/v1') @app.route('/') def index(): return render_template("main.html") if __name__ == '__main__': models.initilize() #app.run(host=config.HOST) app.run(debug=config.DEBUG, host=config.HOST)
22.461538
65
0.738014
from flask import Flask, render_template from flask_restful.utils import cors from flask_cors import CORS, cross_origin import config import models from resources_v1.predictions import predictions_api_v1 from templates.templates import home app = Flask(__name__) CORS(app) app.register_blueprint(predictions_api_v1, url_prefix='/api/v1') @app.route('/') def index(): return render_template("main.html") if __name__ == '__main__': models.initilize() app.run(debug=config.DEBUG, host=config.HOST)
true
true
f720a3476873e92b2ed94d5e14b117589ae55b83
23,418
py
Python
index.py
201723050210/17wanxiaoCheckin-Actions
666a2c8473f876a607011021a8be1ee876ce6c34
[ "MIT" ]
null
null
null
index.py
201723050210/17wanxiaoCheckin-Actions
666a2c8473f876a607011021a8be1ee876ce6c34
[ "MIT" ]
null
null
null
index.py
201723050210/17wanxiaoCheckin-Actions
666a2c8473f876a607011021a8be1ee876ce6c34
[ "MIT" ]
null
null
null
import time import os import datetime import json import logging import requests from utils.server_chan import server_push from utils.qq_email import qq_email_push from utils.qmsg import qmsg_push from login import CampusLogin def initLogging(): logging.getLogger().setLevel(logging.INFO) logging.basicConfig(format="[%(levelname)s]; %(message)s") def get_token(username, password, device_id): """ 获取用户令牌,模拟登录获取:https://github.com/zhongbr/wanmei_campus :param device_id: 设备ID :param username: 账号 :param password: 密码 :return: """ for _ in range(3): try: campus_login = CampusLogin(phone_num=username, device_id=device_id) except Exception as e: logging.warning(e) continue login_dict = campus_login.pwd_login(password) if login_dict["status"]: logging.info(f"{username[:4]},{login_dict['msg']}") return login_dict["token"] elif login_dict['errmsg'] == "该手机号未注册完美校园": logging.warning(f"{username[:4]},{login_dict['errmsg']}") return None elif login_dict['errmsg'].startswith("密码错误"): logging.warning(f"{username[:4]},{login_dict['errmsg']}") logging.warning("代码是死的,密码错误了就是错误了,赶紧去查看一下是不是输错了!") return None else: logging.info(f"{username[:4]},{login_dict['errmsg']}") logging.warning('正在尝试重新登录......') time.sleep(5) return None def get_school_name(token): post_data = {"token": token, "method": "WX_BASE_INFO", "param": "%7B%7D"} headers = {"Content-Type": "application/x-www-form-urlencoded"} try: res = requests.post( "https://server.59wanmei.com/YKT_Interface/xyk", data=post_data, headers=headers, ) return res.json()["data"]["customerName"] except: return "泪目,没获取到学校名字" def get_user_info(token): """ 用来获取custom_id,即类似与打卡模板id :param token: 用户令牌 :return: return """ data = {"appClassify": "DK", "token": token} for _ in range(3): try: res = requests.post( "https://reportedh5.17wanxiao.com/api/clock/school/getUserInfo", data=data ) user_info = res.json()["userInfo"] logging.info('获取个人信息成功') return user_info except: logging.warning('获取个人信息失败,正在重试......') time.sleep(1) return None def get_post_json(post_json): """ 获取打卡数据 :param jsons: 用来获取打卡数据的json字段 :return: """ for _ in range(3): try: res = requests.post( url="https://reportedh5.17wanxiao.com/sass/api/epmpics", json=post_json, timeout=10, ).json() except: logging.warning("获取完美校园打卡post参数失败,正在重试...") time.sleep(1) continue if res["code"] != "10000": logging.warning(res) data = json.loads(res["data"]) # print(data) post_dict = { "areaStr": data['areaStr'], "deptStr": data['deptStr'], "deptid": data['deptStr']['deptid'] if data['deptStr'] else None, "customerid": data['customerid'], "userid": data['userid'], "username": data['username'], "stuNo": data['stuNo'], "phonenum": data["phonenum"], "templateid": data["templateid"], "updatainfo": [ {"propertyname": i["propertyname"], "value": i["value"]} for i in data["cusTemplateRelations"] ], "updatainfo_detail": [ { "propertyname": i["propertyname"], "checkValues": i["checkValues"], "description": i["decription"], "value": i["value"], } for i in data["cusTemplateRelations"] ], "checkbox": [ {"description": i["decription"], "value": i["value"], "propertyname": i["propertyname"]} for i in data["cusTemplateRelations"] ], } # print(json.dumps(post_dict, sort_keys=True, indent=4, ensure_ascii=False)) logging.info("获取完美校园打卡post参数成功") return post_dict return None def healthy_check_in(token, username, post_dict): """ 第一类健康打卡 :param username: 手机号 :param token: 用户令牌 :param post_dict: 打卡数据 :return: """ check_json = { "businessType": "epmpics", "method": "submitUpInfo", "jsonData": { "deptStr": post_dict["deptStr"], "areaStr": post_dict["areaStr"], "reportdate": round(time.time() * 1000), "customerid": post_dict["customerid"], "deptid": post_dict["deptid"], "source": "app", "templateid": post_dict["templateid"], "stuNo": post_dict["stuNo"], "username": post_dict["username"], "phonenum": username, "userid": post_dict["userid"], "updatainfo": post_dict["updatainfo"], "gpsType": 1, "token": token, }, } for _ in range(3): try: res = requests.post( "https://reportedh5.17wanxiao.com/sass/api/epmpics", json=check_json ).json() if res['code'] == '10000': logging.info(res) return { "status": 1, "res": res, "post_dict": post_dict, "check_json": check_json, "type": "healthy", } elif "频繁" in res['data']: logging.info(res) return { "status": 1, "res": res, "post_dict": post_dict, "check_json": check_json, "type": "healthy", } else: logging.warning(res) return {"status": 0, "errmsg": f"{post_dict['username']}: {res}"} except: errmsg = f"```打卡请求出错```" logging.warning("健康打卡请求出错") return {"status": 0, "errmsg": errmsg} return {"status": 0, "errmsg": "健康打卡请求出错"} def get_recall_data(token): """ 获取第二类健康打卡的打卡数据 :param token: 用户令牌 :return: 返回dict数据 """ for _ in range(3): try: res = requests.post( url="https://reportedh5.17wanxiao.com/api/reported/recall", data={"token": token}, timeout=10, ).json() except: logging.warning("获取完美校园打卡post参数失败,正在重试...") time.sleep(1) continue if res["code"] == 0: logging.info("获取完美校园打卡post参数成功") return res["data"] else: logging.warning(res) return None def receive_check_in(token, custom_id, post_dict): """ 第二类健康打卡 :param token: 用户令牌 :param custom_id: 健康打卡id :param post_dict: 健康打卡数据 :return: """ check_json = { "userId": post_dict["userId"], "name": post_dict["name"], "stuNo": post_dict["stuNo"], "whereabouts": post_dict["whereabouts"], "familyWhereabouts": "", "beenToWuhan": post_dict["beenToWuhan"], "contactWithPatients": post_dict["contactWithPatients"], "symptom": post_dict["symptom"], "fever": post_dict["fever"], "cough": post_dict["cough"], "soreThroat": post_dict["soreThroat"], "debilitation": post_dict["debilitation"], "diarrhea": post_dict["diarrhea"], "cold": post_dict["cold"], "staySchool": post_dict["staySchool"], "contacts": post_dict["contacts"], "emergencyPhone": post_dict["emergencyPhone"], "address": post_dict["address"], "familyForAddress": "", "collegeId": post_dict["collegeId"], "majorId": post_dict["majorId"], "classId": post_dict["classId"], "classDescribe": post_dict["classDescribe"], "temperature": post_dict["temperature"], "confirmed": post_dict["confirmed"], "isolated": post_dict["isolated"], "passingWuhan": post_dict["passingWuhan"], "passingHubei": post_dict["passingHubei"], "patientSide": post_dict["patientSide"], "patientContact": post_dict["patientContact"], "mentalHealth": post_dict["mentalHealth"], "wayToSchool": post_dict["wayToSchool"], "backToSchool": post_dict["backToSchool"], "haveBroadband": post_dict["haveBroadband"], "emergencyContactName": post_dict["emergencyContactName"], "helpInfo": "", "passingCity": "", "longitude": "", # 请在此处填写需要打卡位置的longitude "latitude": "", # 请在此处填写需要打卡位置的latitude "token": token, } headers = { "referer": f"https://reportedh5.17wanxiao.com/nCovReport/index.html?token={token}&customerId={custom_id}", "content-type": "application/x-www-form-urlencoded;charset=UTF-8", } try: res = requests.post( "https://reportedh5.17wanxiao.com/api/reported/receive", headers=headers, data=check_json, ).json() # 以json格式打印json字符串 # print(res) if res["code"] == 0: logging.info(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type="healthy", ) else: logging.warning(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type="healthy", ) except: errmsg = f"```打卡请求出错```" logging.warning("打卡请求出错,网络不稳定") return dict(status=0, errmsg=errmsg) def get_ap(): """ 获取当前时间,用于校内打卡 :return: 返回布尔列表:[am, pm, ev] """ now_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) am = 0 <= now_time.hour < 12 pm = 12 <= now_time.hour < 17 ev = 17 <= now_time.hour <= 23 return [am, pm, ev] def get_id_list(token, custom_id): """ 通过校内模板id获取校内打卡具体的每个时间段id :param token: 用户令牌 :param custom_id: 校内打卡模板id :return: 返回校内打卡id列表 """ post_data = { "customerAppTypeId": custom_id, "longitude": "", "latitude": "", "token": token, } try: res = requests.post( "https://reportedh5.17wanxiao.com/api/clock/school/rules", data=post_data ) # print(res.text) return res.json()["customerAppTypeDto"]["ruleList"] except: return None def get_id_list_v1(token): """ 通过校内模板id获取校内打卡具体的每个时间段id(初版,暂留) :param token: 用户令牌 :return: 返回校内打卡id列表 """ post_data = {"appClassify": "DK", "token": token} try: res = requests.post( "https://reportedh5.17wanxiao.com/api/clock/school/childApps", data=post_data, ) if res.json()["appList"]: id_list = sorted( res.json()["appList"][-1]["customerAppTypeRuleList"], key=lambda x: x["id"], ) res_dict = [ {"id": j["id"], "templateid": f"clockSign{i + 1}"} for i, j in enumerate(id_list) ] return res_dict return None except: return None def campus_check_in(username, token, post_dict, id): """ 校内打卡 :param username: 电话号 :param token: 用户令牌 :param post_dict: 校内打卡数据 :param id: 校内打卡id :return: """ check_json = { "businessType": "epmpics", "method": "submitUpInfoSchool", "jsonData": { "deptStr": post_dict["deptStr"], "areaStr": post_dict["areaStr"], "reportdate": round(time.time() * 1000), "customerid": post_dict["customerid"], "deptid": post_dict["deptid"], "source": "app", "templateid": post_dict["templateid"], "stuNo": post_dict["stuNo"], "username": post_dict["username"], "phonenum": username, "userid": post_dict["userid"], "updatainfo": post_dict["updatainfo"], "customerAppTypeRuleId": id, "clockState": 0, "token": token, }, "token": token, } # print(check_json) try: res = requests.post( "https://reportedh5.17wanxiao.com/sass/api/epmpics", json=check_json ).json() # 以json格式打印json字符串 if res["code"] != "10000": logging.warning(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type=post_dict["templateid"], ) else: logging.info(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type=post_dict["templateid"], ) except BaseException: errmsg = f"```校内打卡请求出错```" logging.warning("校内打卡请求出错") return dict(status=0, errmsg=errmsg) def check_in(username, password, device_id): check_dict_list = [] # 登录获取token用于打卡 token = get_token(username, password, device_id) if not token: errmsg = f"{username[:4]},获取token失败,打卡失败" logging.warning(errmsg) check_dict_list.append({"status": 0, "errmsg": errmsg}) return check_dict_list # print(token) # 获取现在是上午,还是下午,还是晚上 # ape_list = get_ap() # 获取学校使用打卡模板Id user_info = get_user_info(token) if not user_info: errmsg = f"{username[:4]},获取user_info失败,打卡失败" logging.warning(errmsg) check_dict_list.append({"status": 0, "errmsg": errmsg}) return check_dict_list # 获取第一类健康打卡的参数 json1 = { "businessType": "epmpics", "jsonData": {"templateid": "pneumonia", "token": token}, "method": "userComeApp", } post_dict = get_post_json(json1) if post_dict: # 第一类健康打卡 # print(post_dict) # 修改温度等参数 # for j in post_dict['updatainfo']: # 这里获取打卡json字段的打卡信息,微信推送的json字段 # if j['propertyname'] == 'temperature': # 找到propertyname为temperature的字段 # j['value'] = '36.2' # 由于原先为null,这里直接设置36.2(根据自己学校打卡选项来) # if j['propertyname'] == 'xinqing': # j['value'] = '健康' # if j['propertyname'] == 'outdoor': # j['value'] = '否' # if j['propertyname'] == 'symptom': # j['value'] = '无症状' # if j['propertyname'] == 'ownbodyzk': # j['value'] = '身体健康,无异常' # 修改地址,依照自己完美校园,查一下地址即可 # post_dict['areaStr'] = '{"streetNumber":"89号","street":"建设东路","district":"","city":"新乡市","province":"河南省",' \ # '"town":"","pois":"河南师范大学(东区)","lng":113.91572178314209,' \ # '"lat":35.327695868943984,"address":"牧野区建设东路89号河南师范大学(东区)","text":"河南省-新乡市",' \ # '"code":""} ' healthy_check_dict = healthy_check_in(token, username, post_dict) check_dict_list.append(healthy_check_dict) else: # 获取第二类健康打卡参数 post_dict = get_recall_data(token) # 第二类健康打卡 healthy_check_dict = receive_check_in(token, user_info["customerId"], post_dict) check_dict_list.append(healthy_check_dict) # # 获取校内打卡ID # id_list = get_id_list(token, user_info.get('customerAppTypeId')) # # print(id_list) # if not id_list: # return check_dict_list # # # 校内打卡 # for index, i in enumerate(id_list): # if ape_list[index]: # # print(i) # logging.info(f"-------------------------------{i['templateid']}-------------------------------") # json2 = {"businessType": "epmpics", # "jsonData": {"templateid": i['templateid'], "customerAppTypeRuleId": i['id'], # "stuNo": post_dict['stuNo'], # "token": token}, "method": "userComeAppSchool", # "token": token} # campus_dict = get_post_json(json2) # campus_dict['areaStr'] = post_dict['areaStr'] # for j in campus_dict['updatainfo']: # if j['propertyname'] == 'temperature': # j['value'] = '36.4' # if j['propertyname'] == 'symptom': # j['value'] = '无症状' # campus_check_dict = campus_check_in(username, token, campus_dict, i['id']) # check_dict_list.append(campus_check_dict) # logging.info("--------------------------------------------------------------") return check_dict_list def wanxiao_server_push(sckey, check_info_list): utc8_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) push_list = [f""" ------ #### 现在时间: ``` {utc8_time.strftime("%Y-%m-%d %H:%M:%S %p")} ```"""] for check_info in check_info_list: if check_info["status"]: if check_info["post_dict"].get("checkbox"): post_msg = "\n".join( [ f"| {i['description']} | {j['value']} |" for i in check_info["post_dict"].get("checkbox") for j in check_info["post_dict"].get("updatainfo") if i["propertyname"] == j["propertyname"] ] ) else: post_msg = "暂无详情" name = check_info["post_dict"].get("username") if not name: name = check_info["post_dict"]["name"] push_list.append( f"""#### {name}{check_info['type']}打卡信息: ``` {json.dumps(check_info['check_json'], sort_keys=True, indent=4, ensure_ascii=False)} ``` ------ | Text | Message | | :----------------------------------- | :--- | {post_msg} ------ ``` {check_info['res']} ```""" ) else: push_list.append( f"""------ #### {check_info['errmsg']} ------ """ ) push_list.append( f""" > > [17wanxiaoCheckin-Actions](https://github.com/ReaJason/17wanxiaoCheckin-Actions) > >微信消息测试! """ ) return server_push(sckey, "健康打卡", "\n".join(push_list)) def wanxiao_qq_mail_push(send_email, send_pwd, receive_email, check_info_list): bj_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) bj_time.strftime("%Y-%m-%d %H:%M:%S %p") mail_msg_list = [f""" <h2><center> >>>> <a href="https://github.com/ReaJason/17wanxiaoCheckin-Actions">17wanxiaoCheckin-Actions</a> <<<<</center></h2> <h2><center>微信消息提醒!</center></h2> <h3><center>打卡时间:{bj_time}</center></h3> """ ] for check in check_info_list: if check["status"]: name = check['post_dict'].get('username') if not name: name = check['post_dict']['name'] mail_msg_list.append(f"""<hr> <details> <summary style="font-family: 'Microsoft YaHei UI',serif; color: deepskyblue;">{name}:{check["type"]} 打卡结果:{check['res']}</summary> <pre><code> {json.dumps(check['check_json'], sort_keys=True, indent=4, ensure_ascii=False)} </code></pre> </details> <details> <summary style="font-family: 'Microsoft YaHei UI',serif; color: black;" >>>>填写数据抓包详情(便于代码的编写)<<<</summary> <pre><code> {json.dumps(check['post_dict']['updatainfo_detail'], sort_keys=True, indent=4, ensure_ascii=False)} </code></pre> </details> <details> <summary style="font-family: 'Microsoft YaHei UI',serif; color: lightskyblue;" >>>>打卡信息数据表格<<<</summary> <table id="customers"> <tr> <th>Text</th> <th>Value</th> </tr> """ ) for index, box in enumerate(check["post_dict"]["checkbox"]): if index % 2: mail_msg_list.append( f"""<tr> <td>{box['description']}</td> <td>{box['value']}</td> </tr>""" ) else: mail_msg_list.append(f"""<tr class="alt"> <td>{box['description']}</td> <td>{box['value']}</td> </tr>""" ) mail_msg_list.append( f""" </table></details>""" ) else: mail_msg_list.append( f"""<hr> <b style="color: red">{check['errmsg']}</b>""" ) css = """<style type="text/css"> #customers { font-family:"Trebuchet MS", Arial, Helvetica, sans-serif; width:100%; border-collapse:collapse; } #customers td, #customers th { font-size:1em; border:1px solid #98bf21; padding:3px 7px 2px 7px; } #customers th { font-size:1.1em; text-align:left; padding-top:5px; padding-bottom:4px; background-color:#A7C942; color:#ffffff; } #customers tr.alt td { color:#000000; background-color:#EAF2D3; } </style>""" mail_msg_list.append(css) return qq_email_push(send_email, send_pwd, receive_email, title="完美校园健康打卡", text="".join(mail_msg_list)) def wanxiao_qmsg_push(key, qq_num, check_info_list, send_type): utc8_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) push_list = [f'@face=74@ {utc8_time.strftime("%Y-%m-%d %H:%M:%S")} @face=74@ '] for check_info in check_info_list: if check_info["status"]: name = check_info["post_dict"].get("username") if not name: name = check_info["post_dict"]["name"] push_list.append(f"""\ @face=54@ {name}{check_info['type']} @face=54@ @face=211@ {check_info['res']} @face=211@""") else: push_list.append(check_info['errmsg']) return qmsg_push(key, qq_num, "\n".join(push_list), send_type) def main_handler(*args, **kwargs): initLogging() raw_info = [] username_list = os.environ['USERNAME'].split(',') password_list = os.environ['PASSWORD'].split(',') device_id_list = os.environ['DEVICEID'].split(',') sckey = os.environ.get('SCKEY') key = os.environ.get('KEY') qq_num = os.environ.get('QQ_NUM') send_email = os.environ.get('SEND_EMAIL') send_pwd = os.environ.get('SEND_PWD') receive_email = os.environ.get('RECEIVE_EMAIL') for username, password, device_id in zip( [i.strip() for i in username_list if i != ''], [i.strip() for i in password_list if i != ''], [i.strip() for i in device_id_list if i != '']): check_dict = check_in(username, password, device_id) raw_info.extend(check_dict) if sckey: logging.info(wanxiao_server_push(sckey, raw_info)) if send_email and send_pwd and receive_email: logging.info(wanxiao_qq_mail_push(send_email, send_pwd, receive_email, raw_info)) if key: logging.info(wanxiao_qmsg_push(key, qq_num, raw_info, send_type="send")) if __name__ == "__main__": main_handler()
32.211829
130
0.530575
import time import os import datetime import json import logging import requests from utils.server_chan import server_push from utils.qq_email import qq_email_push from utils.qmsg import qmsg_push from login import CampusLogin def initLogging(): logging.getLogger().setLevel(logging.INFO) logging.basicConfig(format="[%(levelname)s]; %(message)s") def get_token(username, password, device_id): for _ in range(3): try: campus_login = CampusLogin(phone_num=username, device_id=device_id) except Exception as e: logging.warning(e) continue login_dict = campus_login.pwd_login(password) if login_dict["status"]: logging.info(f"{username[:4]},{login_dict['msg']}") return login_dict["token"] elif login_dict['errmsg'] == "该手机号未注册完美校园": logging.warning(f"{username[:4]},{login_dict['errmsg']}") return None elif login_dict['errmsg'].startswith("密码错误"): logging.warning(f"{username[:4]},{login_dict['errmsg']}") logging.warning("代码是死的,密码错误了就是错误了,赶紧去查看一下是不是输错了!") return None else: logging.info(f"{username[:4]},{login_dict['errmsg']}") logging.warning('正在尝试重新登录......') time.sleep(5) return None def get_school_name(token): post_data = {"token": token, "method": "WX_BASE_INFO", "param": "%7B%7D"} headers = {"Content-Type": "application/x-www-form-urlencoded"} try: res = requests.post( "https://server.59wanmei.com/YKT_Interface/xyk", data=post_data, headers=headers, ) return res.json()["data"]["customerName"] except: return "泪目,没获取到学校名字" def get_user_info(token): data = {"appClassify": "DK", "token": token} for _ in range(3): try: res = requests.post( "https://reportedh5.17wanxiao.com/api/clock/school/getUserInfo", data=data ) user_info = res.json()["userInfo"] logging.info('获取个人信息成功') return user_info except: logging.warning('获取个人信息失败,正在重试......') time.sleep(1) return None def get_post_json(post_json): for _ in range(3): try: res = requests.post( url="https://reportedh5.17wanxiao.com/sass/api/epmpics", json=post_json, timeout=10, ).json() except: logging.warning("获取完美校园打卡post参数失败,正在重试...") time.sleep(1) continue if res["code"] != "10000": logging.warning(res) data = json.loads(res["data"]) post_dict = { "areaStr": data['areaStr'], "deptStr": data['deptStr'], "deptid": data['deptStr']['deptid'] if data['deptStr'] else None, "customerid": data['customerid'], "userid": data['userid'], "username": data['username'], "stuNo": data['stuNo'], "phonenum": data["phonenum"], "templateid": data["templateid"], "updatainfo": [ {"propertyname": i["propertyname"], "value": i["value"]} for i in data["cusTemplateRelations"] ], "updatainfo_detail": [ { "propertyname": i["propertyname"], "checkValues": i["checkValues"], "description": i["decription"], "value": i["value"], } for i in data["cusTemplateRelations"] ], "checkbox": [ {"description": i["decription"], "value": i["value"], "propertyname": i["propertyname"]} for i in data["cusTemplateRelations"] ], } logging.info("获取完美校园打卡post参数成功") return post_dict return None def healthy_check_in(token, username, post_dict): check_json = { "businessType": "epmpics", "method": "submitUpInfo", "jsonData": { "deptStr": post_dict["deptStr"], "areaStr": post_dict["areaStr"], "reportdate": round(time.time() * 1000), "customerid": post_dict["customerid"], "deptid": post_dict["deptid"], "source": "app", "templateid": post_dict["templateid"], "stuNo": post_dict["stuNo"], "username": post_dict["username"], "phonenum": username, "userid": post_dict["userid"], "updatainfo": post_dict["updatainfo"], "gpsType": 1, "token": token, }, } for _ in range(3): try: res = requests.post( "https://reportedh5.17wanxiao.com/sass/api/epmpics", json=check_json ).json() if res['code'] == '10000': logging.info(res) return { "status": 1, "res": res, "post_dict": post_dict, "check_json": check_json, "type": "healthy", } elif "频繁" in res['data']: logging.info(res) return { "status": 1, "res": res, "post_dict": post_dict, "check_json": check_json, "type": "healthy", } else: logging.warning(res) return {"status": 0, "errmsg": f"{post_dict['username']}: {res}"} except: errmsg = f"```打卡请求出错```" logging.warning("健康打卡请求出错") return {"status": 0, "errmsg": errmsg} return {"status": 0, "errmsg": "健康打卡请求出错"} def get_recall_data(token): for _ in range(3): try: res = requests.post( url="https://reportedh5.17wanxiao.com/api/reported/recall", data={"token": token}, timeout=10, ).json() except: logging.warning("获取完美校园打卡post参数失败,正在重试...") time.sleep(1) continue if res["code"] == 0: logging.info("获取完美校园打卡post参数成功") return res["data"] else: logging.warning(res) return None def receive_check_in(token, custom_id, post_dict): check_json = { "userId": post_dict["userId"], "name": post_dict["name"], "stuNo": post_dict["stuNo"], "whereabouts": post_dict["whereabouts"], "familyWhereabouts": "", "beenToWuhan": post_dict["beenToWuhan"], "contactWithPatients": post_dict["contactWithPatients"], "symptom": post_dict["symptom"], "fever": post_dict["fever"], "cough": post_dict["cough"], "soreThroat": post_dict["soreThroat"], "debilitation": post_dict["debilitation"], "diarrhea": post_dict["diarrhea"], "cold": post_dict["cold"], "staySchool": post_dict["staySchool"], "contacts": post_dict["contacts"], "emergencyPhone": post_dict["emergencyPhone"], "address": post_dict["address"], "familyForAddress": "", "collegeId": post_dict["collegeId"], "majorId": post_dict["majorId"], "classId": post_dict["classId"], "classDescribe": post_dict["classDescribe"], "temperature": post_dict["temperature"], "confirmed": post_dict["confirmed"], "isolated": post_dict["isolated"], "passingWuhan": post_dict["passingWuhan"], "passingHubei": post_dict["passingHubei"], "patientSide": post_dict["patientSide"], "patientContact": post_dict["patientContact"], "mentalHealth": post_dict["mentalHealth"], "wayToSchool": post_dict["wayToSchool"], "backToSchool": post_dict["backToSchool"], "haveBroadband": post_dict["haveBroadband"], "emergencyContactName": post_dict["emergencyContactName"], "helpInfo": "", "passingCity": "", "longitude": "", "latitude": "", "token": token, } headers = { "referer": f"https://reportedh5.17wanxiao.com/nCovReport/index.html?token={token}&customerId={custom_id}", "content-type": "application/x-www-form-urlencoded;charset=UTF-8", } try: res = requests.post( "https://reportedh5.17wanxiao.com/api/reported/receive", headers=headers, data=check_json, ).json() if res["code"] == 0: logging.info(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type="healthy", ) else: logging.warning(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type="healthy", ) except: errmsg = f"```打卡请求出错```" logging.warning("打卡请求出错,网络不稳定") return dict(status=0, errmsg=errmsg) def get_ap(): now_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) am = 0 <= now_time.hour < 12 pm = 12 <= now_time.hour < 17 ev = 17 <= now_time.hour <= 23 return [am, pm, ev] def get_id_list(token, custom_id): post_data = { "customerAppTypeId": custom_id, "longitude": "", "latitude": "", "token": token, } try: res = requests.post( "https://reportedh5.17wanxiao.com/api/clock/school/rules", data=post_data ) return res.json()["customerAppTypeDto"]["ruleList"] except: return None def get_id_list_v1(token): post_data = {"appClassify": "DK", "token": token} try: res = requests.post( "https://reportedh5.17wanxiao.com/api/clock/school/childApps", data=post_data, ) if res.json()["appList"]: id_list = sorted( res.json()["appList"][-1]["customerAppTypeRuleList"], key=lambda x: x["id"], ) res_dict = [ {"id": j["id"], "templateid": f"clockSign{i + 1}"} for i, j in enumerate(id_list) ] return res_dict return None except: return None def campus_check_in(username, token, post_dict, id): check_json = { "businessType": "epmpics", "method": "submitUpInfoSchool", "jsonData": { "deptStr": post_dict["deptStr"], "areaStr": post_dict["areaStr"], "reportdate": round(time.time() * 1000), "customerid": post_dict["customerid"], "deptid": post_dict["deptid"], "source": "app", "templateid": post_dict["templateid"], "stuNo": post_dict["stuNo"], "username": post_dict["username"], "phonenum": username, "userid": post_dict["userid"], "updatainfo": post_dict["updatainfo"], "customerAppTypeRuleId": id, "clockState": 0, "token": token, }, "token": token, } try: res = requests.post( "https://reportedh5.17wanxiao.com/sass/api/epmpics", json=check_json ).json() if res["code"] != "10000": logging.warning(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type=post_dict["templateid"], ) else: logging.info(res) return dict( status=1, res=res, post_dict=post_dict, check_json=check_json, type=post_dict["templateid"], ) except BaseException: errmsg = f"```校内打卡请求出错```" logging.warning("校内打卡请求出错") return dict(status=0, errmsg=errmsg) def check_in(username, password, device_id): check_dict_list = [] token = get_token(username, password, device_id) if not token: errmsg = f"{username[:4]},获取token失败,打卡失败" logging.warning(errmsg) check_dict_list.append({"status": 0, "errmsg": errmsg}) return check_dict_list user_info = get_user_info(token) if not user_info: errmsg = f"{username[:4]},获取user_info失败,打卡失败" logging.warning(errmsg) check_dict_list.append({"status": 0, "errmsg": errmsg}) return check_dict_list json1 = { "businessType": "epmpics", "jsonData": {"templateid": "pneumonia", "token": token}, "method": "userComeApp", } post_dict = get_post_json(json1) if post_dict: healthy_check_dict = healthy_check_in(token, username, post_dict) check_dict_list.append(healthy_check_dict) else: post_dict = get_recall_data(token) healthy_check_dict = receive_check_in(token, user_info["customerId"], post_dict) check_dict_list.append(healthy_check_dict) return check_dict_list def wanxiao_server_push(sckey, check_info_list): utc8_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) push_list = [f""" ------ #### 现在时间: ``` {utc8_time.strftime("%Y-%m-%d %H:%M:%S %p")} ```"""] for check_info in check_info_list: if check_info["status"]: if check_info["post_dict"].get("checkbox"): post_msg = "\n".join( [ f"| {i['description']} | {j['value']} |" for i in check_info["post_dict"].get("checkbox") for j in check_info["post_dict"].get("updatainfo") if i["propertyname"] == j["propertyname"] ] ) else: post_msg = "暂无详情" name = check_info["post_dict"].get("username") if not name: name = check_info["post_dict"]["name"] push_list.append( f"""#### {name}{check_info['type']}打卡信息: ``` {json.dumps(check_info['check_json'], sort_keys=True, indent=4, ensure_ascii=False)} ``` ------ | Text | Message | | :----------------------------------- | :--- | {post_msg} ------ ``` {check_info['res']} ```""" ) else: push_list.append( f"""------ #### {check_info['errmsg']} ------ """ ) push_list.append( f""" > > [17wanxiaoCheckin-Actions](https://github.com/ReaJason/17wanxiaoCheckin-Actions) > >微信消息测试! """ ) return server_push(sckey, "健康打卡", "\n".join(push_list)) def wanxiao_qq_mail_push(send_email, send_pwd, receive_email, check_info_list): bj_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) bj_time.strftime("%Y-%m-%d %H:%M:%S %p") mail_msg_list = [f""" <h2><center> >>>> <a href="https://github.com/ReaJason/17wanxiaoCheckin-Actions">17wanxiaoCheckin-Actions</a> <<<<</center></h2> <h2><center>微信消息提醒!</center></h2> <h3><center>打卡时间:{bj_time}</center></h3> """ ] for check in check_info_list: if check["status"]: name = check['post_dict'].get('username') if not name: name = check['post_dict']['name'] mail_msg_list.append(f"""<hr> <details> <summary style="font-family: 'Microsoft YaHei UI',serif; color: deepskyblue;">{name}:{check["type"]} 打卡结果:{check['res']}</summary> <pre><code> {json.dumps(check['check_json'], sort_keys=True, indent=4, ensure_ascii=False)} </code></pre> </details> <details> <summary style="font-family: 'Microsoft YaHei UI',serif; color: black;" >>>>填写数据抓包详情(便于代码的编写)<<<</summary> <pre><code> {json.dumps(check['post_dict']['updatainfo_detail'], sort_keys=True, indent=4, ensure_ascii=False)} </code></pre> </details> <details> <summary style="font-family: 'Microsoft YaHei UI',serif; color: lightskyblue;" >>>>打卡信息数据表格<<<</summary> <table id="customers"> <tr> <th>Text</th> <th>Value</th> </tr> """ ) for index, box in enumerate(check["post_dict"]["checkbox"]): if index % 2: mail_msg_list.append( f"""<tr> <td>{box['description']}</td> <td>{box['value']}</td> </tr>""" ) else: mail_msg_list.append(f"""<tr class="alt"> <td>{box['description']}</td> <td>{box['value']}</td> </tr>""" ) mail_msg_list.append( f""" </table></details>""" ) else: mail_msg_list.append( f"""<hr> <b style="color: red">{check['errmsg']}</b>""" ) css = """<style type="text/css"> #customers { font-family:"Trebuchet MS", Arial, Helvetica, sans-serif; width:100%; border-collapse:collapse; } #customers td, #customers th { font-size:1em; border:1px solid #98bf21; padding:3px 7px 2px 7px; } #customers th { font-size:1.1em; text-align:left; padding-top:5px; padding-bottom:4px; background-color:#A7C942; color:#ffffff; } #customers tr.alt td { color:#000000; background-color:#EAF2D3; } </style>""" mail_msg_list.append(css) return qq_email_push(send_email, send_pwd, receive_email, title="完美校园健康打卡", text="".join(mail_msg_list)) def wanxiao_qmsg_push(key, qq_num, check_info_list, send_type): utc8_time = datetime.datetime.utcnow() + datetime.timedelta(hours=8) push_list = [f'@face=74@ {utc8_time.strftime("%Y-%m-%d %H:%M:%S")} @face=74@ '] for check_info in check_info_list: if check_info["status"]: name = check_info["post_dict"].get("username") if not name: name = check_info["post_dict"]["name"] push_list.append(f"""\ @face=54@ {name}{check_info['type']} @face=54@ @face=211@ {check_info['res']} @face=211@""") else: push_list.append(check_info['errmsg']) return qmsg_push(key, qq_num, "\n".join(push_list), send_type) def main_handler(*args, **kwargs): initLogging() raw_info = [] username_list = os.environ['USERNAME'].split(',') password_list = os.environ['PASSWORD'].split(',') device_id_list = os.environ['DEVICEID'].split(',') sckey = os.environ.get('SCKEY') key = os.environ.get('KEY') qq_num = os.environ.get('QQ_NUM') send_email = os.environ.get('SEND_EMAIL') send_pwd = os.environ.get('SEND_PWD') receive_email = os.environ.get('RECEIVE_EMAIL') for username, password, device_id in zip( [i.strip() for i in username_list if i != ''], [i.strip() for i in password_list if i != ''], [i.strip() for i in device_id_list if i != '']): check_dict = check_in(username, password, device_id) raw_info.extend(check_dict) if sckey: logging.info(wanxiao_server_push(sckey, raw_info)) if send_email and send_pwd and receive_email: logging.info(wanxiao_qq_mail_push(send_email, send_pwd, receive_email, raw_info)) if key: logging.info(wanxiao_qmsg_push(key, qq_num, raw_info, send_type="send")) if __name__ == "__main__": main_handler()
true
true
f720a3b2937b6b9bd9e76101573c229ffea21101
913
py
Python
tabu/package_info.py
wbernoudy/dwave-tabu
793e76405ba60d2da87bc15634adeda821d82564
[ "Apache-2.0" ]
null
null
null
tabu/package_info.py
wbernoudy/dwave-tabu
793e76405ba60d2da87bc15634adeda821d82564
[ "Apache-2.0" ]
null
null
null
tabu/package_info.py
wbernoudy/dwave-tabu
793e76405ba60d2da87bc15634adeda821d82564
[ "Apache-2.0" ]
null
null
null
# Copyright 2018 D-Wave Systems Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. __packagename__ = 'dwave-tabu' __title__ = 'D-Wave Tabu' __version__ = '0.1.3' __author__ = 'D-Wave Systems Inc.' __authoremail__ = 'tools@dwavesys.com' __description__ = 'Optimized Tabu solver for QUBOs' __url__ = 'https://github.com/dwavesystems/dwave-tabu' __license__ = 'Apache 2.0' __copyright__ = '2018, D-Wave Systems Inc.'
38.041667
74
0.756846
__packagename__ = 'dwave-tabu' __title__ = 'D-Wave Tabu' __version__ = '0.1.3' __author__ = 'D-Wave Systems Inc.' __authoremail__ = 'tools@dwavesys.com' __description__ = 'Optimized Tabu solver for QUBOs' __url__ = 'https://github.com/dwavesystems/dwave-tabu' __license__ = 'Apache 2.0' __copyright__ = '2018, D-Wave Systems Inc.'
true
true
f720a3be847c19fa4b9c7affc33b5d31a4209713
276
py
Python
EyeTracker/display.py
PoweredByME/SSVEP_FYP
6839be6a4aeddfa1b29c587b23d64c95a90810f8
[ "MIT" ]
null
null
null
EyeTracker/display.py
PoweredByME/SSVEP_FYP
6839be6a4aeddfa1b29c587b23d64c95a90810f8
[ "MIT" ]
null
null
null
EyeTracker/display.py
PoweredByME/SSVEP_FYP
6839be6a4aeddfa1b29c587b23d64c95a90810f8
[ "MIT" ]
null
null
null
import cv2; class Display(object): def __init__(self): pass; def showFrame(self, frame, windowName = "frame"): cv2.namedWindow(windowName, cv2.WINDOW_NORMAL); cv2.imshow(windowName, frame); def end(self): cv2.destroyAllWindows();
23
55
0.637681
import cv2; class Display(object): def __init__(self): pass; def showFrame(self, frame, windowName = "frame"): cv2.namedWindow(windowName, cv2.WINDOW_NORMAL); cv2.imshow(windowName, frame); def end(self): cv2.destroyAllWindows();
true
true
f720a3c8713f607158450310ae4112fcb026294a
6,344
py
Python
simple_history/manager.py
felixschloesser/django-simple-history
28abacb8a776fbaffcf0a42432a6a88be3561a86
[ "BSD-3-Clause" ]
2
2021-03-26T09:20:05.000Z
2021-05-26T13:46:48.000Z
simple_history/manager.py
felixschloesser/django-simple-history
28abacb8a776fbaffcf0a42432a6a88be3561a86
[ "BSD-3-Clause" ]
42
2021-03-30T11:12:23.000Z
2022-03-28T09:20:13.000Z
simple_history/manager.py
hramezani/django-simple-history
32645206749a1cc68539d9ad6499f1a938b2c9f4
[ "BSD-3-Clause" ]
1
2021-10-05T10:25:35.000Z
2021-10-05T10:25:35.000Z
from django.db import connection, models from django.db.models import OuterRef, Subquery from django.utils import timezone from simple_history.utils import get_change_reason_from_object class HistoryDescriptor: def __init__(self, model): self.model = model def __get__(self, instance, owner): if instance is None: return HistoryManager(self.model) return HistoryManager(self.model, instance) class HistoryManager(models.Manager): def __init__(self, model, instance=None): super(HistoryManager, self).__init__() self.model = model self.instance = instance def get_super_queryset(self): return super(HistoryManager, self).get_queryset() def get_queryset(self): qs = self.get_super_queryset() if self.instance is None: return qs if isinstance(self.instance._meta.pk, models.ForeignKey): key_name = self.instance._meta.pk.name + "_id" else: key_name = self.instance._meta.pk.name return self.get_super_queryset().filter(**{key_name: self.instance.pk}) def most_recent(self): """ Returns the most recent copy of the instance available in the history. """ if not self.instance: raise TypeError( "Can't use most_recent() without a {} instance.".format( self.model._meta.object_name ) ) tmp = [] excluded_fields = getattr(self.model, "_history_excluded_fields", []) for field in self.instance._meta.fields: if field.name in excluded_fields: continue if isinstance(field, models.ForeignKey): tmp.append(field.name + "_id") else: tmp.append(field.name) fields = tuple(tmp) try: values = self.get_queryset().values(*fields)[0] except IndexError: raise self.instance.DoesNotExist( "%s has no historical record." % self.instance._meta.object_name ) return self.instance.__class__(**values) def as_of(self, date): """Get a snapshot as of a specific date. Returns an instance, or an iterable of the instances, of the original model with all the attributes set according to what was present on the object on the date provided. """ if not self.instance: return self._as_of_set(date) queryset = self.get_queryset().filter(history_date__lte=date) try: history_obj = queryset[0] except IndexError: raise self.instance.DoesNotExist( "%s had not yet been created." % self.instance._meta.object_name ) if history_obj.history_type == "-": raise self.instance.DoesNotExist( "%s had already been deleted." % self.instance._meta.object_name ) return history_obj.instance def _as_of_set(self, date): model = type(self.model().instance) # a bit of a hack to get the model pk_attr = model._meta.pk.name queryset = self.get_queryset().filter(history_date__lte=date) # If using MySQL, need to get a list of IDs in memory and then use them for the # second query. # Does mean two loops through the DB to get the full set, but still a speed # improvement. backend = connection.vendor if backend == "mysql": history_ids = {} for item in queryset.order_by("-history_date", "-pk"): if getattr(item, pk_attr) not in history_ids: history_ids[getattr(item, pk_attr)] = item.pk latest_historics = queryset.filter(history_id__in=history_ids.values()) elif backend == "postgresql": latest_pk_attr_historic_ids = ( queryset.order_by(pk_attr, "-history_date", "-pk") .distinct(pk_attr) .values_list("pk", flat=True) ) latest_historics = queryset.filter( history_id__in=latest_pk_attr_historic_ids ) else: latest_pk_attr_historic_ids = ( queryset.filter(**{pk_attr: OuterRef(pk_attr)}) .order_by("-history_date", "-pk") .values("pk")[:1] ) latest_historics = queryset.filter( history_id__in=Subquery(latest_pk_attr_historic_ids) ) adjusted = latest_historics.exclude(history_type="-").order_by(pk_attr) for historic_item in adjusted: yield historic_item.instance def bulk_history_create( self, objs, batch_size=None, update=False, default_user=None, default_change_reason="", default_date=None, ): """ Bulk create the history for the objects specified by objs. If called by bulk_update_with_history, use the update boolean and save the history_type accordingly. """ history_type = "+" if update: history_type = "~" historical_instances = [] for instance in objs: history_user = getattr( instance, "_history_user", default_user or self.model.get_default_history_user(instance), ) row = self.model( history_date=getattr( instance, "_history_date", default_date or timezone.now() ), history_user=history_user, history_change_reason=get_change_reason_from_object(instance) or default_change_reason, history_type=history_type, **{ field.attname: getattr(instance, field.attname) for field in instance._meta.fields if field.name not in self.model._history_excluded_fields }, ) if hasattr(self.model, "history_relation"): row.history_relation_id = instance.pk historical_instances.append(row) return self.model.objects.bulk_create( historical_instances, batch_size=batch_size )
36.67052
87
0.585908
from django.db import connection, models from django.db.models import OuterRef, Subquery from django.utils import timezone from simple_history.utils import get_change_reason_from_object class HistoryDescriptor: def __init__(self, model): self.model = model def __get__(self, instance, owner): if instance is None: return HistoryManager(self.model) return HistoryManager(self.model, instance) class HistoryManager(models.Manager): def __init__(self, model, instance=None): super(HistoryManager, self).__init__() self.model = model self.instance = instance def get_super_queryset(self): return super(HistoryManager, self).get_queryset() def get_queryset(self): qs = self.get_super_queryset() if self.instance is None: return qs if isinstance(self.instance._meta.pk, models.ForeignKey): key_name = self.instance._meta.pk.name + "_id" else: key_name = self.instance._meta.pk.name return self.get_super_queryset().filter(**{key_name: self.instance.pk}) def most_recent(self): if not self.instance: raise TypeError( "Can't use most_recent() without a {} instance.".format( self.model._meta.object_name ) ) tmp = [] excluded_fields = getattr(self.model, "_history_excluded_fields", []) for field in self.instance._meta.fields: if field.name in excluded_fields: continue if isinstance(field, models.ForeignKey): tmp.append(field.name + "_id") else: tmp.append(field.name) fields = tuple(tmp) try: values = self.get_queryset().values(*fields)[0] except IndexError: raise self.instance.DoesNotExist( "%s has no historical record." % self.instance._meta.object_name ) return self.instance.__class__(**values) def as_of(self, date): if not self.instance: return self._as_of_set(date) queryset = self.get_queryset().filter(history_date__lte=date) try: history_obj = queryset[0] except IndexError: raise self.instance.DoesNotExist( "%s had not yet been created." % self.instance._meta.object_name ) if history_obj.history_type == "-": raise self.instance.DoesNotExist( "%s had already been deleted." % self.instance._meta.object_name ) return history_obj.instance def _as_of_set(self, date): model = type(self.model().instance) # a bit of a hack to get the model pk_attr = model._meta.pk.name queryset = self.get_queryset().filter(history_date__lte=date) # If using MySQL, need to get a list of IDs in memory and then use them for the # second query. # Does mean two loops through the DB to get the full set, but still a speed # improvement. backend = connection.vendor if backend == "mysql": history_ids = {} for item in queryset.order_by("-history_date", "-pk"): if getattr(item, pk_attr) not in history_ids: history_ids[getattr(item, pk_attr)] = item.pk latest_historics = queryset.filter(history_id__in=history_ids.values()) elif backend == "postgresql": latest_pk_attr_historic_ids = ( queryset.order_by(pk_attr, "-history_date", "-pk") .distinct(pk_attr) .values_list("pk", flat=True) ) latest_historics = queryset.filter( history_id__in=latest_pk_attr_historic_ids ) else: latest_pk_attr_historic_ids = ( queryset.filter(**{pk_attr: OuterRef(pk_attr)}) .order_by("-history_date", "-pk") .values("pk")[:1] ) latest_historics = queryset.filter( history_id__in=Subquery(latest_pk_attr_historic_ids) ) adjusted = latest_historics.exclude(history_type="-").order_by(pk_attr) for historic_item in adjusted: yield historic_item.instance def bulk_history_create( self, objs, batch_size=None, update=False, default_user=None, default_change_reason="", default_date=None, ): history_type = "+" if update: history_type = "~" historical_instances = [] for instance in objs: history_user = getattr( instance, "_history_user", default_user or self.model.get_default_history_user(instance), ) row = self.model( history_date=getattr( instance, "_history_date", default_date or timezone.now() ), history_user=history_user, history_change_reason=get_change_reason_from_object(instance) or default_change_reason, history_type=history_type, **{ field.attname: getattr(instance, field.attname) for field in instance._meta.fields if field.name not in self.model._history_excluded_fields }, ) if hasattr(self.model, "history_relation"): row.history_relation_id = instance.pk historical_instances.append(row) return self.model.objects.bulk_create( historical_instances, batch_size=batch_size )
true
true
f720a3de70f0386fe46cbec6ae3539699c8d83d8
5,653
py
Python
sdk/python/pulumi_azure_native/botservice/v20171201/get_bot_connection.py
sebtelko/pulumi-azure-native
711ec021b5c73da05611c56c8a35adb0ce3244e4
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_native/botservice/v20171201/get_bot_connection.py
sebtelko/pulumi-azure-native
711ec021b5c73da05611c56c8a35adb0ce3244e4
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_native/botservice/v20171201/get_bot_connection.py
sebtelko/pulumi-azure-native
711ec021b5c73da05611c56c8a35adb0ce3244e4
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # *** WARNING: this file was generated by the Pulumi SDK Generator. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from ... import _utilities from . import outputs __all__ = [ 'GetBotConnectionResult', 'AwaitableGetBotConnectionResult', 'get_bot_connection', ] @pulumi.output_type class GetBotConnectionResult: """ Bot channel resource definition """ def __init__(__self__, etag=None, id=None, kind=None, location=None, name=None, properties=None, sku=None, tags=None, type=None): if etag and not isinstance(etag, str): raise TypeError("Expected argument 'etag' to be a str") pulumi.set(__self__, "etag", etag) if id and not isinstance(id, str): raise TypeError("Expected argument 'id' to be a str") pulumi.set(__self__, "id", id) if kind and not isinstance(kind, str): raise TypeError("Expected argument 'kind' to be a str") pulumi.set(__self__, "kind", kind) if location and not isinstance(location, str): raise TypeError("Expected argument 'location' to be a str") pulumi.set(__self__, "location", location) if name and not isinstance(name, str): raise TypeError("Expected argument 'name' to be a str") pulumi.set(__self__, "name", name) if properties and not isinstance(properties, dict): raise TypeError("Expected argument 'properties' to be a dict") pulumi.set(__self__, "properties", properties) if sku and not isinstance(sku, dict): raise TypeError("Expected argument 'sku' to be a dict") pulumi.set(__self__, "sku", sku) if tags and not isinstance(tags, dict): raise TypeError("Expected argument 'tags' to be a dict") pulumi.set(__self__, "tags", tags) if type and not isinstance(type, str): raise TypeError("Expected argument 'type' to be a str") pulumi.set(__self__, "type", type) @property @pulumi.getter def etag(self) -> Optional[str]: """ Entity Tag """ return pulumi.get(self, "etag") @property @pulumi.getter def id(self) -> str: """ Specifies the resource ID. """ return pulumi.get(self, "id") @property @pulumi.getter def kind(self) -> Optional[str]: """ Required. Gets or sets the Kind of the resource. """ return pulumi.get(self, "kind") @property @pulumi.getter def location(self) -> Optional[str]: """ Specifies the location of the resource. """ return pulumi.get(self, "location") @property @pulumi.getter def name(self) -> str: """ Specifies the name of the resource. """ return pulumi.get(self, "name") @property @pulumi.getter def properties(self) -> 'outputs.ConnectionSettingPropertiesResponse': """ The set of properties specific to bot channel resource """ return pulumi.get(self, "properties") @property @pulumi.getter def sku(self) -> Optional['outputs.SkuResponse']: """ Gets or sets the SKU of the resource. """ return pulumi.get(self, "sku") @property @pulumi.getter def tags(self) -> Optional[Mapping[str, str]]: """ Contains resource tags defined as key/value pairs. """ return pulumi.get(self, "tags") @property @pulumi.getter def type(self) -> str: """ Specifies the type of the resource. """ return pulumi.get(self, "type") class AwaitableGetBotConnectionResult(GetBotConnectionResult): # pylint: disable=using-constant-test def __await__(self): if False: yield self return GetBotConnectionResult( etag=self.etag, id=self.id, kind=self.kind, location=self.location, name=self.name, properties=self.properties, sku=self.sku, tags=self.tags, type=self.type) def get_bot_connection(connection_name: Optional[str] = None, resource_group_name: Optional[str] = None, resource_name: Optional[str] = None, opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableGetBotConnectionResult: """ Bot channel resource definition :param str connection_name: The name of the Bot Service Connection Setting resource :param str resource_group_name: The name of the Bot resource group in the user subscription. :param str resource_name: The name of the Bot resource. """ __args__ = dict() __args__['connectionName'] = connection_name __args__['resourceGroupName'] = resource_group_name __args__['resourceName'] = resource_name if opts is None: opts = pulumi.InvokeOptions() if opts.version is None: opts.version = _utilities.get_version() __ret__ = pulumi.runtime.invoke('azure-native:botservice/v20171201:getBotConnection', __args__, opts=opts, typ=GetBotConnectionResult).value return AwaitableGetBotConnectionResult( etag=__ret__.etag, id=__ret__.id, kind=__ret__.kind, location=__ret__.location, name=__ret__.name, properties=__ret__.properties, sku=__ret__.sku, tags=__ret__.tags, type=__ret__.type)
32.488506
144
0.618433
import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from ... import _utilities from . import outputs __all__ = [ 'GetBotConnectionResult', 'AwaitableGetBotConnectionResult', 'get_bot_connection', ] @pulumi.output_type class GetBotConnectionResult: def __init__(__self__, etag=None, id=None, kind=None, location=None, name=None, properties=None, sku=None, tags=None, type=None): if etag and not isinstance(etag, str): raise TypeError("Expected argument 'etag' to be a str") pulumi.set(__self__, "etag", etag) if id and not isinstance(id, str): raise TypeError("Expected argument 'id' to be a str") pulumi.set(__self__, "id", id) if kind and not isinstance(kind, str): raise TypeError("Expected argument 'kind' to be a str") pulumi.set(__self__, "kind", kind) if location and not isinstance(location, str): raise TypeError("Expected argument 'location' to be a str") pulumi.set(__self__, "location", location) if name and not isinstance(name, str): raise TypeError("Expected argument 'name' to be a str") pulumi.set(__self__, "name", name) if properties and not isinstance(properties, dict): raise TypeError("Expected argument 'properties' to be a dict") pulumi.set(__self__, "properties", properties) if sku and not isinstance(sku, dict): raise TypeError("Expected argument 'sku' to be a dict") pulumi.set(__self__, "sku", sku) if tags and not isinstance(tags, dict): raise TypeError("Expected argument 'tags' to be a dict") pulumi.set(__self__, "tags", tags) if type and not isinstance(type, str): raise TypeError("Expected argument 'type' to be a str") pulumi.set(__self__, "type", type) @property @pulumi.getter def etag(self) -> Optional[str]: return pulumi.get(self, "etag") @property @pulumi.getter def id(self) -> str: return pulumi.get(self, "id") @property @pulumi.getter def kind(self) -> Optional[str]: return pulumi.get(self, "kind") @property @pulumi.getter def location(self) -> Optional[str]: return pulumi.get(self, "location") @property @pulumi.getter def name(self) -> str: return pulumi.get(self, "name") @property @pulumi.getter def properties(self) -> 'outputs.ConnectionSettingPropertiesResponse': return pulumi.get(self, "properties") @property @pulumi.getter def sku(self) -> Optional['outputs.SkuResponse']: return pulumi.get(self, "sku") @property @pulumi.getter def tags(self) -> Optional[Mapping[str, str]]: return pulumi.get(self, "tags") @property @pulumi.getter def type(self) -> str: return pulumi.get(self, "type") class AwaitableGetBotConnectionResult(GetBotConnectionResult): # pylint: disable=using-constant-test def __await__(self): if False: yield self return GetBotConnectionResult( etag=self.etag, id=self.id, kind=self.kind, location=self.location, name=self.name, properties=self.properties, sku=self.sku, tags=self.tags, type=self.type) def get_bot_connection(connection_name: Optional[str] = None, resource_group_name: Optional[str] = None, resource_name: Optional[str] = None, opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableGetBotConnectionResult: __args__ = dict() __args__['connectionName'] = connection_name __args__['resourceGroupName'] = resource_group_name __args__['resourceName'] = resource_name if opts is None: opts = pulumi.InvokeOptions() if opts.version is None: opts.version = _utilities.get_version() __ret__ = pulumi.runtime.invoke('azure-native:botservice/v20171201:getBotConnection', __args__, opts=opts, typ=GetBotConnectionResult).value return AwaitableGetBotConnectionResult( etag=__ret__.etag, id=__ret__.id, kind=__ret__.kind, location=__ret__.location, name=__ret__.name, properties=__ret__.properties, sku=__ret__.sku, tags=__ret__.tags, type=__ret__.type)
true
true
f720a41fe1294d6a6a4f0a5fcf613dac72c9f8da
9,425
py
Python
pulsar-functions/instance/src/main/python/function_stats.py
bruth/pulsar
fe2c8ee4d37e2a45dfb528592915746827416e18
[ "Apache-2.0" ]
null
null
null
pulsar-functions/instance/src/main/python/function_stats.py
bruth/pulsar
fe2c8ee4d37e2a45dfb528592915746827416e18
[ "Apache-2.0" ]
null
null
null
pulsar-functions/instance/src/main/python/function_stats.py
bruth/pulsar
fe2c8ee4d37e2a45dfb528592915746827416e18
[ "Apache-2.0" ]
1
2019-03-15T09:34:50.000Z
2019-03-15T09:34:50.000Z
# # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. # import traceback import time import util from prometheus_client import Counter, Summary, Gauge # We keep track of the following metrics class Stats(object): metrics_label_names = ['tenant', 'namespace', 'function', 'instance_id', 'cluster'] PULSAR_FUNCTION_METRICS_PREFIX = "pulsar_function_" USER_METRIC_PREFIX = "user_metric_"; TOTAL_PROCESSED = 'processed_total' TOTAL_SUCCESSFULLY_PROCESSED = 'processed_successfully_total' TOTAL_SYSTEM_EXCEPTIONS = 'system_exceptions_total' TOTAL_USER_EXCEPTIONS = 'user_exceptions_total' PROCESS_LATENCY_MS = 'process_latency_ms' LAST_INVOCATION = 'last_invocation' TOTAL_RECEIVED = 'received_total' TOTAL_PROCESSED_1min = 'processed_total_1min' TOTAL_SUCCESSFULLY_PROCESSED_1min = 'processed_successfully_total_1min' TOTAL_SYSTEM_EXCEPTIONS_1min = 'system_exceptions_total_1min' TOTAL_USER_EXCEPTIONS_1min = 'user_exceptions_total_1min' PROCESS_LATENCY_MS_1min = 'process_latency_ms_1min' TOTAL_RECEIVED_1min = 'received_total_1min' # Declare Prometheus stat_total_processed = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_PROCESSED, 'Total number of messages processed.', metrics_label_names) stat_total_processed_successfully = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_SUCCESSFULLY_PROCESSED, 'Total number of messages processed successfully.', metrics_label_names) stat_total_sys_exceptions = Counter(PULSAR_FUNCTION_METRICS_PREFIX+ TOTAL_SYSTEM_EXCEPTIONS, 'Total number of system exceptions.', metrics_label_names) stat_total_user_exceptions = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_USER_EXCEPTIONS, 'Total number of user exceptions.', metrics_label_names) stat_process_latency_ms = Summary(PULSAR_FUNCTION_METRICS_PREFIX + PROCESS_LATENCY_MS, 'Process latency in milliseconds.', metrics_label_names) stat_last_invocation = Gauge(PULSAR_FUNCTION_METRICS_PREFIX + LAST_INVOCATION, 'The timestamp of the last invocation of the function.', metrics_label_names) stat_total_received = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_RECEIVED, 'Total number of messages received from source.', metrics_label_names) # 1min windowed metrics stat_total_processed_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_PROCESSED_1min, 'Total number of messages processed in the last 1 minute.', metrics_label_names) stat_total_processed_successfully_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_SUCCESSFULLY_PROCESSED_1min, 'Total number of messages processed successfully in the last 1 minute.', metrics_label_names) stat_total_sys_exceptions_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_SYSTEM_EXCEPTIONS_1min, 'Total number of system exceptions in the last 1 minute.', metrics_label_names) stat_total_user_exceptions_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_USER_EXCEPTIONS_1min, 'Total number of user exceptions in the last 1 minute.', metrics_label_names) stat_process_latency_ms_1min = Summary(PULSAR_FUNCTION_METRICS_PREFIX + PROCESS_LATENCY_MS_1min, 'Process latency in milliseconds in the last 1 minute.', metrics_label_names) stat_total_received_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_RECEIVED_1min, 'Total number of messages received from source in the last 1 minute.', metrics_label_names) latest_user_exception = [] latest_sys_exception = [] def __init__(self, metrics_labels): self.metrics_labels = metrics_labels; self.process_start_time = None # start time for windowed metrics util.FixedTimer(60, self.reset).start() def get_total_received(self): return self.stat_total_received.labels(*self.metrics_labels)._value.get(); def get_total_processed(self): return self.stat_total_processed.labels(*self.metrics_labels)._value.get(); def get_total_processed_successfully(self): return self.stat_total_processed_successfully.labels(*self.metrics_labels)._value.get(); def get_total_sys_exceptions(self): return self.stat_total_sys_exceptions.labels(*self.metrics_labels)._value.get(); def get_total_user_exceptions(self): return self.stat_total_user_exceptions.labels(*self.metrics_labels)._value.get(); def get_avg_process_latency(self): process_latency_ms_count = self.stat_process_latency_ms.labels(*self.metrics_labels)._count.get() process_latency_ms_sum = self.stat_process_latency_ms.labels(*self.metrics_labels)._sum.get() return 0.0 \ if process_latency_ms_count <= 0.0 \ else process_latency_ms_sum / process_latency_ms_count def get_total_received_1min(self): return self.stat_total_received_1min.labels(*self.metrics_labels)._value.get(); def get_total_processed_1min(self): return self.stat_total_processed_1min.labels(*self.metrics_labels)._value.get(); def get_total_processed_successfully_1min(self): return self.stat_total_processed_successfully_1min.labels(*self.metrics_labels)._value.get(); def get_total_sys_exceptions_1min(self): return self.stat_total_sys_exceptions_1min.labels(*self.metrics_labels)._value.get(); def get_total_user_exceptions_1min(self): return self.stat_total_user_exceptions_1min.labels(*self.metrics_labels)._value.get(); def get_avg_process_latency_1min(self): process_latency_ms_count = self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._count.get() process_latency_ms_sum = self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._sum.get() return 0.0 \ if process_latency_ms_count <= 0.0 \ else process_latency_ms_sum / process_latency_ms_count def get_last_invocation(self): return self.stat_last_invocation.labels(*self.metrics_labels)._value.get() def incr_total_processed(self): self.stat_total_processed.labels(*self.metrics_labels).inc() self.stat_total_processed_1min.labels(*self.metrics_labels).inc() def incr_total_processed_successfully(self): self.stat_total_processed_successfully.labels(*self.metrics_labels).inc() self.stat_total_processed_successfully_1min.labels(*self.metrics_labels).inc() def incr_total_sys_exceptions(self): self.stat_total_sys_exceptions.labels(*self.metrics_labels).inc() self.stat_total_sys_exceptions_1min.labels(*self.metrics_labels).inc() self.add_sys_exception() def incr_total_user_exceptions(self): self.stat_total_user_exceptions.labels(*self.metrics_labels).inc() self.stat_total_user_exceptions_1min.labels(*self.metrics_labels).inc() self.add_user_exception() def incr_total_received(self): self.stat_total_received.labels(*self.metrics_labels).inc() self.stat_total_received_1min.labels(*self.metrics_labels).inc() def process_time_start(self): self.process_start_time = time.time(); def process_time_end(self): if self.process_start_time: duration = (time.time() - self.process_start_time) * 1000.0 self.stat_process_latency_ms.labels(*self.metrics_labels).observe(duration) self.stat_process_latency_ms_1min.labels(*self.metrics_labels).observe(duration) def set_last_invocation(self, time): self.stat_last_invocation.labels(*self.metrics_labels).set(time * 1000.0) def add_user_exception(self): self.latest_sys_exception.append((traceback.format_exc(), int(time.time() * 1000))) if len(self.latest_sys_exception) > 10: self.latest_sys_exception.pop(0) def add_sys_exception(self): self.latest_sys_exception.append((traceback.format_exc(), int(time.time() * 1000))) if len(self.latest_sys_exception) > 10: self.latest_sys_exception.pop(0) def reset(self): self.latest_user_exception = [] self.latest_sys_exception = [] self.stat_total_processed_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_total_processed_successfully_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_total_user_exceptions_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_total_sys_exceptions_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._sum.set(0.0) self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._count.set(0.0) self.stat_total_received_1min.labels(*self.metrics_labels)._value.set(0.0)
49.088542
158
0.766154
import traceback import time import util from prometheus_client import Counter, Summary, Gauge class Stats(object): metrics_label_names = ['tenant', 'namespace', 'function', 'instance_id', 'cluster'] PULSAR_FUNCTION_METRICS_PREFIX = "pulsar_function_" USER_METRIC_PREFIX = "user_metric_"; TOTAL_PROCESSED = 'processed_total' TOTAL_SUCCESSFULLY_PROCESSED = 'processed_successfully_total' TOTAL_SYSTEM_EXCEPTIONS = 'system_exceptions_total' TOTAL_USER_EXCEPTIONS = 'user_exceptions_total' PROCESS_LATENCY_MS = 'process_latency_ms' LAST_INVOCATION = 'last_invocation' TOTAL_RECEIVED = 'received_total' TOTAL_PROCESSED_1min = 'processed_total_1min' TOTAL_SUCCESSFULLY_PROCESSED_1min = 'processed_successfully_total_1min' TOTAL_SYSTEM_EXCEPTIONS_1min = 'system_exceptions_total_1min' TOTAL_USER_EXCEPTIONS_1min = 'user_exceptions_total_1min' PROCESS_LATENCY_MS_1min = 'process_latency_ms_1min' TOTAL_RECEIVED_1min = 'received_total_1min' stat_total_processed = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_PROCESSED, 'Total number of messages processed.', metrics_label_names) stat_total_processed_successfully = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_SUCCESSFULLY_PROCESSED, 'Total number of messages processed successfully.', metrics_label_names) stat_total_sys_exceptions = Counter(PULSAR_FUNCTION_METRICS_PREFIX+ TOTAL_SYSTEM_EXCEPTIONS, 'Total number of system exceptions.', metrics_label_names) stat_total_user_exceptions = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_USER_EXCEPTIONS, 'Total number of user exceptions.', metrics_label_names) stat_process_latency_ms = Summary(PULSAR_FUNCTION_METRICS_PREFIX + PROCESS_LATENCY_MS, 'Process latency in milliseconds.', metrics_label_names) stat_last_invocation = Gauge(PULSAR_FUNCTION_METRICS_PREFIX + LAST_INVOCATION, 'The timestamp of the last invocation of the function.', metrics_label_names) stat_total_received = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_RECEIVED, 'Total number of messages received from source.', metrics_label_names) stat_total_processed_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_PROCESSED_1min, 'Total number of messages processed in the last 1 minute.', metrics_label_names) stat_total_processed_successfully_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_SUCCESSFULLY_PROCESSED_1min, 'Total number of messages processed successfully in the last 1 minute.', metrics_label_names) stat_total_sys_exceptions_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_SYSTEM_EXCEPTIONS_1min, 'Total number of system exceptions in the last 1 minute.', metrics_label_names) stat_total_user_exceptions_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_USER_EXCEPTIONS_1min, 'Total number of user exceptions in the last 1 minute.', metrics_label_names) stat_process_latency_ms_1min = Summary(PULSAR_FUNCTION_METRICS_PREFIX + PROCESS_LATENCY_MS_1min, 'Process latency in milliseconds in the last 1 minute.', metrics_label_names) stat_total_received_1min = Counter(PULSAR_FUNCTION_METRICS_PREFIX + TOTAL_RECEIVED_1min, 'Total number of messages received from source in the last 1 minute.', metrics_label_names) latest_user_exception = [] latest_sys_exception = [] def __init__(self, metrics_labels): self.metrics_labels = metrics_labels; self.process_start_time = None util.FixedTimer(60, self.reset).start() def get_total_received(self): return self.stat_total_received.labels(*self.metrics_labels)._value.get(); def get_total_processed(self): return self.stat_total_processed.labels(*self.metrics_labels)._value.get(); def get_total_processed_successfully(self): return self.stat_total_processed_successfully.labels(*self.metrics_labels)._value.get(); def get_total_sys_exceptions(self): return self.stat_total_sys_exceptions.labels(*self.metrics_labels)._value.get(); def get_total_user_exceptions(self): return self.stat_total_user_exceptions.labels(*self.metrics_labels)._value.get(); def get_avg_process_latency(self): process_latency_ms_count = self.stat_process_latency_ms.labels(*self.metrics_labels)._count.get() process_latency_ms_sum = self.stat_process_latency_ms.labels(*self.metrics_labels)._sum.get() return 0.0 \ if process_latency_ms_count <= 0.0 \ else process_latency_ms_sum / process_latency_ms_count def get_total_received_1min(self): return self.stat_total_received_1min.labels(*self.metrics_labels)._value.get(); def get_total_processed_1min(self): return self.stat_total_processed_1min.labels(*self.metrics_labels)._value.get(); def get_total_processed_successfully_1min(self): return self.stat_total_processed_successfully_1min.labels(*self.metrics_labels)._value.get(); def get_total_sys_exceptions_1min(self): return self.stat_total_sys_exceptions_1min.labels(*self.metrics_labels)._value.get(); def get_total_user_exceptions_1min(self): return self.stat_total_user_exceptions_1min.labels(*self.metrics_labels)._value.get(); def get_avg_process_latency_1min(self): process_latency_ms_count = self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._count.get() process_latency_ms_sum = self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._sum.get() return 0.0 \ if process_latency_ms_count <= 0.0 \ else process_latency_ms_sum / process_latency_ms_count def get_last_invocation(self): return self.stat_last_invocation.labels(*self.metrics_labels)._value.get() def incr_total_processed(self): self.stat_total_processed.labels(*self.metrics_labels).inc() self.stat_total_processed_1min.labels(*self.metrics_labels).inc() def incr_total_processed_successfully(self): self.stat_total_processed_successfully.labels(*self.metrics_labels).inc() self.stat_total_processed_successfully_1min.labels(*self.metrics_labels).inc() def incr_total_sys_exceptions(self): self.stat_total_sys_exceptions.labels(*self.metrics_labels).inc() self.stat_total_sys_exceptions_1min.labels(*self.metrics_labels).inc() self.add_sys_exception() def incr_total_user_exceptions(self): self.stat_total_user_exceptions.labels(*self.metrics_labels).inc() self.stat_total_user_exceptions_1min.labels(*self.metrics_labels).inc() self.add_user_exception() def incr_total_received(self): self.stat_total_received.labels(*self.metrics_labels).inc() self.stat_total_received_1min.labels(*self.metrics_labels).inc() def process_time_start(self): self.process_start_time = time.time(); def process_time_end(self): if self.process_start_time: duration = (time.time() - self.process_start_time) * 1000.0 self.stat_process_latency_ms.labels(*self.metrics_labels).observe(duration) self.stat_process_latency_ms_1min.labels(*self.metrics_labels).observe(duration) def set_last_invocation(self, time): self.stat_last_invocation.labels(*self.metrics_labels).set(time * 1000.0) def add_user_exception(self): self.latest_sys_exception.append((traceback.format_exc(), int(time.time() * 1000))) if len(self.latest_sys_exception) > 10: self.latest_sys_exception.pop(0) def add_sys_exception(self): self.latest_sys_exception.append((traceback.format_exc(), int(time.time() * 1000))) if len(self.latest_sys_exception) > 10: self.latest_sys_exception.pop(0) def reset(self): self.latest_user_exception = [] self.latest_sys_exception = [] self.stat_total_processed_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_total_processed_successfully_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_total_user_exceptions_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_total_sys_exceptions_1min.labels(*self.metrics_labels)._value.set(0.0) self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._sum.set(0.0) self.stat_process_latency_ms_1min.labels(*self.metrics_labels)._count.set(0.0) self.stat_total_received_1min.labels(*self.metrics_labels)._value.set(0.0)
true
true
f720a49b1ccb9afbd2e211fb293d03f55301e147
2,226
py
Python
Numpy/code.py
JayeshSukhija/ga-learner-dsmp-repo
4c05d980462dde423b6be41cca1218d6d98e8e48
[ "MIT" ]
null
null
null
Numpy/code.py
JayeshSukhija/ga-learner-dsmp-repo
4c05d980462dde423b6be41cca1218d6d98e8e48
[ "MIT" ]
null
null
null
Numpy/code.py
JayeshSukhija/ga-learner-dsmp-repo
4c05d980462dde423b6be41cca1218d6d98e8e48
[ "MIT" ]
null
null
null
# -------------- # Importing header files import numpy as np #New record new_record=[[50, 9, 4, 1, 0, 0, 40, 0]] #Code starts here #Loading data file and saving it into a new numpy array data = np.genfromtxt(path, delimiter=",", skip_header=1) print(data.shape) #Concatenating the new record to the existing numpy array census=np.concatenate((data, new_record),axis = 0) print(census.shape) #Code ends here # -------------- #Code starts here import numpy as np age=census[:,0] print (age) print ('='*50) max_age=np.max(age) print (max_age) print ('='*50) min_age=np.min(age) print (min_age) print ('='*50) age_mean=np.mean(age) print (age_mean) print ('='*50) age_std=np.std(age) print (age_std) print('='*50) # -------------- #Code starts here #Creating new subsets based on 'Age' race_0=census[census[:,2]==0] race_1=census[census[:,2]==1] race_2=census[census[:,2]==2] race_3=census[census[:,2]==3] race_4=census[census[:,2]==4] #Finding the length of the above created subsets len_0=len(race_0) len_1=len(race_1) len_2=len(race_2) len_3=len(race_3) len_4=len(race_4) #Printing the length of the above created subsets print('Race_0: ', len_0) print('Race_1: ', len_1) print('Race_2: ', len_2) print('Race_3: ', len_3) print('Race_4: ', len_4) #Storing the different race lengths with appropriate indexes race_list=[len_0, len_1,len_2, len_3, len_4] #Storing the race with minimum length into a variable minority_race=race_list.index(min(race_list)) print ('minority_race:',minority_race) #Code ends here # -------------- #Code starts here import numpy as np senior_citizens=census[census[:,0 ]>60] working_hours_sum=senior_citizens.sum(axis=0)[6] senior_citizens_len=len(senior_citizens) avg_working_hours=(working_hours_sum/senior_citizens_len) print (avg_working_hours) # -------------- #Code starts here import numpy as np high=census[census[:,1 ]>10] low=census[census[:,1]<=10] avg_pay_high=high.mean(axis=0)[7] avg_pay_low=low.mean(axis=0)[7] if (avg_pay_high>avg_pay_low): print ("Better Education leads to better pay") else: print ("Better Education does not leads to better pay")
20.611111
61
0.676101
import numpy as np new_record=[[50, 9, 4, 1, 0, 0, 40, 0]] data = np.genfromtxt(path, delimiter=",", skip_header=1) print(data.shape) census=np.concatenate((data, new_record),axis = 0) print(census.shape) import numpy as np age=census[:,0] print (age) print ('='*50) max_age=np.max(age) print (max_age) print ('='*50) min_age=np.min(age) print (min_age) print ('='*50) age_mean=np.mean(age) print (age_mean) print ('='*50) age_std=np.std(age) print (age_std) print('='*50) race_0=census[census[:,2]==0] race_1=census[census[:,2]==1] race_2=census[census[:,2]==2] race_3=census[census[:,2]==3] race_4=census[census[:,2]==4] len_0=len(race_0) len_1=len(race_1) len_2=len(race_2) len_3=len(race_3) len_4=len(race_4) print('Race_0: ', len_0) print('Race_1: ', len_1) print('Race_2: ', len_2) print('Race_3: ', len_3) print('Race_4: ', len_4) race_list=[len_0, len_1,len_2, len_3, len_4] minority_race=race_list.index(min(race_list)) print ('minority_race:',minority_race) import numpy as np senior_citizens=census[census[:,0 ]>60] working_hours_sum=senior_citizens.sum(axis=0)[6] senior_citizens_len=len(senior_citizens) avg_working_hours=(working_hours_sum/senior_citizens_len) print (avg_working_hours) import numpy as np high=census[census[:,1 ]>10] low=census[census[:,1]<=10] avg_pay_high=high.mean(axis=0)[7] avg_pay_low=low.mean(axis=0)[7] if (avg_pay_high>avg_pay_low): print ("Better Education leads to better pay") else: print ("Better Education does not leads to better pay")
true
true
f720a7182cc9382555831934ef834b1a0aab840c
473
py
Python
enaml/qt/__init__.py
dandycheung/enaml
1a7d9c95717a359bb2a8435c597eda36c9235fab
[ "BSD-3-Clause-Clear" ]
null
null
null
enaml/qt/__init__.py
dandycheung/enaml
1a7d9c95717a359bb2a8435c597eda36c9235fab
[ "BSD-3-Clause-Clear" ]
null
null
null
enaml/qt/__init__.py
dandycheung/enaml
1a7d9c95717a359bb2a8435c597eda36c9235fab
[ "BSD-3-Clause-Clear" ]
null
null
null
# ------------------------------------------------------------------------------ # Copyright (c) 2013-2022, Nucleic Development Team. # # Distributed under the terms of the Modified BSD License. # # The full license is in the file LICENSE, distributed with this software. # ------------------------------------------------------------------------------ from qtpy import ( API as QT_API, PYQT5_API, PYSIDE2_API, PYQT6_API, PYSIDE6_API, QT_VERSION, )
29.5625
80
0.46723
from qtpy import ( API as QT_API, PYQT5_API, PYSIDE2_API, PYQT6_API, PYSIDE6_API, QT_VERSION, )
true
true