hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
958k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f724461d9b5f371de5e8cc03ae8c7e10e9f3cfa1
2,813
py
Python
task_manager/tasks/migrations/0001_initial.py
rabilrbl/task_manager
10c96df8f41caf2db6a0ec2aa7cb961135412843
[ "BSD-3-Clause" ]
null
null
null
task_manager/tasks/migrations/0001_initial.py
rabilrbl/task_manager
10c96df8f41caf2db6a0ec2aa7cb961135412843
[ "BSD-3-Clause" ]
null
null
null
task_manager/tasks/migrations/0001_initial.py
rabilrbl/task_manager
10c96df8f41caf2db6a0ec2aa7cb961135412843
[ "BSD-3-Clause" ]
null
null
null
# Generated by Django 3.2.12 on 2022-02-16 17:52 import datetime from django.conf import settings from django.db import migrations, models import django.db.models.deletion import uuid class Migration(migrations.Migration): initial = True dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='Task', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('external_id', models.UUIDField(db_index=True, default=uuid.uuid4, editable=False, unique=True)), ('title', models.CharField(max_length=100)), ('priority', models.IntegerField(default=0)), ('description', models.TextField(blank=True, max_length=500)), ('completed', models.BooleanField(default=False)), ('date_created', models.DateTimeField(auto_now_add=True)), ('deleted', models.BooleanField(default=False)), ('status', models.CharField(choices=[('pending', 'Pending'), ('in_progress', 'In Progress'), ('completed', 'Completed'), ('cancelled', 'Cancelled')], default='pending', max_length=100)), ('user', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL)), ], ), migrations.CreateModel( name='Report', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('consent', models.BooleanField(default=False, help_text='Uncheck to stop receiving reports')), ('time', models.TimeField(default=datetime.time(0, 0), help_text='All times are in UTC format.')), ('user', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL)), ], ), migrations.CreateModel( name='History', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('old_status', models.CharField(choices=[('pending', 'Pending'), ('in_progress', 'In Progress'), ('completed', 'Completed'), ('cancelled', 'Cancelled')], default='n/a', max_length=100)), ('new_status', models.CharField(choices=[('pending', 'Pending'), ('in_progress', 'In Progress'), ('completed', 'Completed'), ('cancelled', 'Cancelled')], default='n/a', max_length=100)), ('change_date', models.DateTimeField(auto_now=True)), ('task', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='tasks.task')), ], ), ]
52.092593
202
0.614646
import datetime from django.conf import settings from django.db import migrations, models import django.db.models.deletion import uuid class Migration(migrations.Migration): initial = True dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='Task', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('external_id', models.UUIDField(db_index=True, default=uuid.uuid4, editable=False, unique=True)), ('title', models.CharField(max_length=100)), ('priority', models.IntegerField(default=0)), ('description', models.TextField(blank=True, max_length=500)), ('completed', models.BooleanField(default=False)), ('date_created', models.DateTimeField(auto_now_add=True)), ('deleted', models.BooleanField(default=False)), ('status', models.CharField(choices=[('pending', 'Pending'), ('in_progress', 'In Progress'), ('completed', 'Completed'), ('cancelled', 'Cancelled')], default='pending', max_length=100)), ('user', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL)), ], ), migrations.CreateModel( name='Report', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('consent', models.BooleanField(default=False, help_text='Uncheck to stop receiving reports')), ('time', models.TimeField(default=datetime.time(0, 0), help_text='All times are in UTC format.')), ('user', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL)), ], ), migrations.CreateModel( name='History', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('old_status', models.CharField(choices=[('pending', 'Pending'), ('in_progress', 'In Progress'), ('completed', 'Completed'), ('cancelled', 'Cancelled')], default='n/a', max_length=100)), ('new_status', models.CharField(choices=[('pending', 'Pending'), ('in_progress', 'In Progress'), ('completed', 'Completed'), ('cancelled', 'Cancelled')], default='n/a', max_length=100)), ('change_date', models.DateTimeField(auto_now=True)), ('task', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='tasks.task')), ], ), ]
true
true
f724467171d010ee0e4c6085d11642893a2e975d
430
py
Python
packages/python/plotly/plotly/validators/barpolar/marker/colorbar/title/_text.py
mastermind88/plotly.py
efa70710df1af22958e1be080e105130042f1839
[ "MIT" ]
null
null
null
packages/python/plotly/plotly/validators/barpolar/marker/colorbar/title/_text.py
mastermind88/plotly.py
efa70710df1af22958e1be080e105130042f1839
[ "MIT" ]
null
null
null
packages/python/plotly/plotly/validators/barpolar/marker/colorbar/title/_text.py
mastermind88/plotly.py
efa70710df1af22958e1be080e105130042f1839
[ "MIT" ]
null
null
null
import _plotly_utils.basevalidators class TextValidator(_plotly_utils.basevalidators.StringValidator): def __init__( self, plotly_name="text", parent_name="barpolar.marker.colorbar.title", **kwargs ): super(TextValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop("edit_type", "colorbars"), **kwargs, )
30.714286
88
0.65814
import _plotly_utils.basevalidators class TextValidator(_plotly_utils.basevalidators.StringValidator): def __init__( self, plotly_name="text", parent_name="barpolar.marker.colorbar.title", **kwargs ): super(TextValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop("edit_type", "colorbars"), **kwargs, )
true
true
f7244861300db686a544ca4278551c0acac34d9c
2,864
py
Python
code/week 6/rat_in_a_maze.py
c235gsy/Sustech_Data-Structure-and-Algorithm-Analysis
fcbd450216e9e62cd3365ad2a8ccab00b9eb679f
[ "MIT" ]
1
2020-01-04T13:35:29.000Z
2020-01-04T13:35:29.000Z
code/week 6/rat_in_a_maze.py
c235gsy/Sustech_Data-Structure-and-Algorithm-Analysis
fcbd450216e9e62cd3365ad2a8ccab00b9eb679f
[ "MIT" ]
null
null
null
code/week 6/rat_in_a_maze.py
c235gsy/Sustech_Data-Structure-and-Algorithm-Analysis
fcbd450216e9e62cd3365ad2a8ccab00b9eb679f
[ "MIT" ]
null
null
null
class Queue: # A container with a first-in-first-out (FIFO) queuing policy. def __init__(self): self.list = [] def push(self,item): # Enqueue the 'item' into the queue self.list.insert(0, item) def pop(self): # Dequeue the earliest enqueued item still in the queue. This operation removes the item from the queue. return self.list.pop() def is_empty(self): # Returns true if the queue is empty return len(self.list) == 0 global maze maze = [[0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0], [0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0], [0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0], [0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1], [0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0]] def get_choices(stage): # Move order is: right, down, left, up choices = [] x = stage[0] y = stage[1] if y != 14 and maze[x][y+1] == 0: choices.append([(x, y+1), "right"]) if x != 13 and maze[x+1][y] == 0: choices.append([(x+1, y), "down"]) if y != 0 and maze[x][y-1] == 0: choices.append([(x, y-1), "left"]) if x != 0 and maze[x-1][y] == 0: choices.append([(x-1, y), "up"]) return choices def get_start_stage(): return 0, 0 def get_goal_stage(): return 13, 14 def is_goal_stage(stage): return stage == (13, 14) def breadth_first_search(): states_to_expand = Queue () states_to_expand.push (get_start_stage()) visited_states = [] path_to_goal = [] path_to_current_state = Queue () current_state = states_to_expand.pop () flag = 1 while flag == 1: if is_goal_stage(current_state): break elif current_state not in visited_states: visited_states.append(current_state) choices_of_move = get_choices(current_state) for p in range(0, len(choices_of_move)): choice = choices_of_move[p] new_position = choice[0] direction = choice[1] states_to_expand.push(new_position) path_to_current_state.push(path_to_goal + [direction]) current_state = states_to_expand.pop() path_to_goal = path_to_current_state.pop() return path_to_goal result = breadth_first_search() for step in result: print(step)
29.525773
112
0.511522
class Queue: def __init__(self): self.list = [] def push(self,item): self.list.insert(0, item) def pop(self): return self.list.pop() def is_empty(self): return len(self.list) == 0 global maze maze = [[0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0], [0, 1, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0], [0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1, 1, 1, 0, 0], [0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 1, 0, 1, 1], [0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0], [0, 1, 1, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0], [0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0], [0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0]] def get_choices(stage): choices = [] x = stage[0] y = stage[1] if y != 14 and maze[x][y+1] == 0: choices.append([(x, y+1), "right"]) if x != 13 and maze[x+1][y] == 0: choices.append([(x+1, y), "down"]) if y != 0 and maze[x][y-1] == 0: choices.append([(x, y-1), "left"]) if x != 0 and maze[x-1][y] == 0: choices.append([(x-1, y), "up"]) return choices def get_start_stage(): return 0, 0 def get_goal_stage(): return 13, 14 def is_goal_stage(stage): return stage == (13, 14) def breadth_first_search(): states_to_expand = Queue () states_to_expand.push (get_start_stage()) visited_states = [] path_to_goal = [] path_to_current_state = Queue () current_state = states_to_expand.pop () flag = 1 while flag == 1: if is_goal_stage(current_state): break elif current_state not in visited_states: visited_states.append(current_state) choices_of_move = get_choices(current_state) for p in range(0, len(choices_of_move)): choice = choices_of_move[p] new_position = choice[0] direction = choice[1] states_to_expand.push(new_position) path_to_current_state.push(path_to_goal + [direction]) current_state = states_to_expand.pop() path_to_goal = path_to_current_state.pop() return path_to_goal result = breadth_first_search() for step in result: print(step)
true
true
f72448dcbaaf3b3cb88177c88c779358a33a7210
545
py
Python
lib/models/__init__.py
ablattmann/pose_estimation_hrnet
67d5a3446979c2abe54578ee4bba3787862d4077
[ "MIT" ]
null
null
null
lib/models/__init__.py
ablattmann/pose_estimation_hrnet
67d5a3446979c2abe54578ee4bba3787862d4077
[ "MIT" ]
null
null
null
lib/models/__init__.py
ablattmann/pose_estimation_hrnet
67d5a3446979c2abe54578ee4bba3787862d4077
[ "MIT" ]
null
null
null
# ------------------------------------------------------------------------------ # Copyright (c) Microsoft # Licensed under the MIT License. # Written by Bin Xiao (Bin.Xiao@microsoft.com) # ------------------------------------------------------------------------------ from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import absolute_import from __future__ import division from __future__ import print_function # import models.pose_resnet # import models.pose_hrnet
32.058824
80
0.585321
from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import absolute_import from __future__ import division from __future__ import print_function
true
true
f72449514abd4834918b9dc32df86e5d6d182d1c
2,299
py
Python
magnum/tests/functional/tempest_tests/config.py
mail2nsrajesh/magnum
2e7e5a77967028c961337177ce577eb936c3845c
[ "Apache-2.0" ]
null
null
null
magnum/tests/functional/tempest_tests/config.py
mail2nsrajesh/magnum
2e7e5a77967028c961337177ce577eb936c3845c
[ "Apache-2.0" ]
null
null
null
magnum/tests/functional/tempest_tests/config.py
mail2nsrajesh/magnum
2e7e5a77967028c961337177ce577eb936c3845c
[ "Apache-2.0" ]
null
null
null
# Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from __future__ import print_function from oslo_config import cfg from tempest import config # noqa service_available_group = cfg.OptGroup(name="service_available", title="Available OpenStack Services") ServiceAvailableGroup = [ cfg.BoolOpt("magnum", default=True, help="Whether or not magnum is expected to be available"), ] magnum_group = cfg.OptGroup(name="magnum", title="Magnum Options") MagnumGroup = [ cfg.StrOpt("image_id", default="fedora-atomic-latest", help="Image id to be used for ClusterTemplate."), cfg.StrOpt("nic_id", default="public", help="NIC id."), cfg.StrOpt("keypair_id", default="default", help="Keypair id to use to log into nova instances."), cfg.StrOpt("flavor_id", default="s1.magnum", help="Flavor id to use for ClusterTemplate."), cfg.StrOpt("magnum_url", help="Bypass URL for Magnum to skip service catalog lookup"), cfg.StrOpt("master_flavor_id", default="m1.magnum", help="Master flavor id to use for ClusterTemplate."), cfg.StrOpt("csr_location", default="/opt/stack/new/magnum/default.csr", deprecated_for_removal=True, help="CSR location for certificates. This option is no " "longer used for anything."), cfg.StrOpt("dns_nameserver", default="8.8.8.8", help="DNS nameserver to use for ClusterTemplate."), cfg.BoolOpt("copy_logs", default=True, help="Specify whether to copy nova server logs on failure."), ]
33.808824
77
0.628099
from __future__ import print_function from oslo_config import cfg from tempest import config service_available_group = cfg.OptGroup(name="service_available", title="Available OpenStack Services") ServiceAvailableGroup = [ cfg.BoolOpt("magnum", default=True, help="Whether or not magnum is expected to be available"), ] magnum_group = cfg.OptGroup(name="magnum", title="Magnum Options") MagnumGroup = [ cfg.StrOpt("image_id", default="fedora-atomic-latest", help="Image id to be used for ClusterTemplate."), cfg.StrOpt("nic_id", default="public", help="NIC id."), cfg.StrOpt("keypair_id", default="default", help="Keypair id to use to log into nova instances."), cfg.StrOpt("flavor_id", default="s1.magnum", help="Flavor id to use for ClusterTemplate."), cfg.StrOpt("magnum_url", help="Bypass URL for Magnum to skip service catalog lookup"), cfg.StrOpt("master_flavor_id", default="m1.magnum", help="Master flavor id to use for ClusterTemplate."), cfg.StrOpt("csr_location", default="/opt/stack/new/magnum/default.csr", deprecated_for_removal=True, help="CSR location for certificates. This option is no " "longer used for anything."), cfg.StrOpt("dns_nameserver", default="8.8.8.8", help="DNS nameserver to use for ClusterTemplate."), cfg.BoolOpt("copy_logs", default=True, help="Specify whether to copy nova server logs on failure."), ]
true
true
f7244962c5bfd8e1aa5c08eb18369e6d57850268
1,912
py
Python
EnvironmentAM2315MuxSensor.py
MBI-Div-B/pytango-EnvironmentAM2315Mux
ebbea69d2c954b6d1e59e49a31eb36ec60929bad
[ "MIT" ]
null
null
null
EnvironmentAM2315MuxSensor.py
MBI-Div-B/pytango-EnvironmentAM2315Mux
ebbea69d2c954b6d1e59e49a31eb36ec60929bad
[ "MIT" ]
null
null
null
EnvironmentAM2315MuxSensor.py
MBI-Div-B/pytango-EnvironmentAM2315Mux
ebbea69d2c954b6d1e59e49a31eb36ec60929bad
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # Copyright (C) 2020 MBI-Division-B # MIT License, refer to LICENSE file # Author: Luca Barbera / Email: barbera@mbi-berlin.de from tango import AttrWriteType, DevState, DebugIt, ErrorIt, InfoIt, DeviceProxy from tango.server import Device, attribute, command, device_property class EnvironmentAM2315MuxSensor(Device): CtrlDevice = device_property( dtype="str", default_value="domain/family/memeber", ) Channel = device_property( dtype="int", default_value=0, ) temperature = attribute(label='Temperature', access=AttrWriteType.READ, dtype=float, format='3.1f', unit='C') humidity = attribute(label='Humidity', access=AttrWriteType.READ, dtype=float, format='3.1f', unit='%') def init_device(self): Device.init_device(self) self.set_state(DevState.INIT) try: self.ctrl = DeviceProxy(self.CtrlDevice) self.info_stream("Connection established.") self.set_state(DevState.ON) except Exception: self.error_stream('Connection could not be established.') self.set_state(DevState.OFF) self._temp = 0 self._humid = 0 def always_executed_hook(self): try: # _read_data measures both humidity and temperature self._temp, self._humid = self.ctrl.read_data(self.Channel) except Exception: self.error_stream('Data could not be read') def read_temperature(self): return self._temp def read_humidity(self): return self._humid if __name__ == "__main__": EnvironmentAM2315MuxSensor.run_server()
28.537313
80
0.582636
from tango import AttrWriteType, DevState, DebugIt, ErrorIt, InfoIt, DeviceProxy from tango.server import Device, attribute, command, device_property class EnvironmentAM2315MuxSensor(Device): CtrlDevice = device_property( dtype="str", default_value="domain/family/memeber", ) Channel = device_property( dtype="int", default_value=0, ) temperature = attribute(label='Temperature', access=AttrWriteType.READ, dtype=float, format='3.1f', unit='C') humidity = attribute(label='Humidity', access=AttrWriteType.READ, dtype=float, format='3.1f', unit='%') def init_device(self): Device.init_device(self) self.set_state(DevState.INIT) try: self.ctrl = DeviceProxy(self.CtrlDevice) self.info_stream("Connection established.") self.set_state(DevState.ON) except Exception: self.error_stream('Connection could not be established.') self.set_state(DevState.OFF) self._temp = 0 self._humid = 0 def always_executed_hook(self): try: self._temp, self._humid = self.ctrl.read_data(self.Channel) except Exception: self.error_stream('Data could not be read') def read_temperature(self): return self._temp def read_humidity(self): return self._humid if __name__ == "__main__": EnvironmentAM2315MuxSensor.run_server()
true
true
f7244a801802bebba70ac938a121a24fcb049c4f
1,578
py
Python
nssrc/com/citrix/netscaler/nitro/resource/config/router/routerdynamicrouting_args.py
guardicore/nitro-python
5346a5086134aead80968f15a41ff527adaa0ec1
[ "Apache-2.0" ]
null
null
null
nssrc/com/citrix/netscaler/nitro/resource/config/router/routerdynamicrouting_args.py
guardicore/nitro-python
5346a5086134aead80968f15a41ff527adaa0ec1
[ "Apache-2.0" ]
null
null
null
nssrc/com/citrix/netscaler/nitro/resource/config/router/routerdynamicrouting_args.py
guardicore/nitro-python
5346a5086134aead80968f15a41ff527adaa0ec1
[ "Apache-2.0" ]
null
null
null
# # Copyright (c) 2021 Citrix Systems, Inc. # # Licensed under the Apache License, Version 2.0 (the "License") # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # class routerdynamicrouting_args : r""" Provides additional arguments required for fetching the routerdynamicrouting resource. """ def __init__(self) : self._commandstring = None self._nodeid = None @property def commandstring(self) : r"""command to be executed. """ try : return self._commandstring except Exception as e: raise e @commandstring.setter def commandstring(self, commandstring) : r"""command to be executed. """ try : self._commandstring = commandstring except Exception as e: raise e @property def nodeid(self) : r"""Unique number that identifies the cluster node.<br/>Minimum value = 0<br/>Maximum value = 31. """ try : return self._nodeid except Exception as e: raise e @nodeid.setter def nodeid(self, nodeid) : r"""Unique number that identifies the cluster node.<br/>Minimum value = 0<br/>Maximum value = 31 """ try : self._nodeid = nodeid except Exception as e: raise e
25.868852
101
0.709125
class routerdynamicrouting_args : def __init__(self) : self._commandstring = None self._nodeid = None @property def commandstring(self) : try : return self._commandstring except Exception as e: raise e @commandstring.setter def commandstring(self, commandstring) : try : self._commandstring = commandstring except Exception as e: raise e @property def nodeid(self) : try : return self._nodeid except Exception as e: raise e @nodeid.setter def nodeid(self, nodeid) : try : self._nodeid = nodeid except Exception as e: raise e
true
true
f7244c2c22cf9787986fc05f8c297d20c042b807
14,326
py
Python
aries_cloudagent/wallet/tests/test_routes.py
jcourt562/aries-cloudagent-python
de291184c59006391a76317826983dd1eb0ada5d
[ "Apache-2.0" ]
1
2020-11-30T05:47:54.000Z
2020-11-30T05:47:54.000Z
aries_cloudagent/wallet/tests/test_routes.py
jcourt562/aries-cloudagent-python
de291184c59006391a76317826983dd1eb0ada5d
[ "Apache-2.0" ]
1
2020-02-25T19:01:16.000Z
2020-02-25T19:01:16.000Z
aries_cloudagent/wallet/tests/test_routes.py
jcourt562/aries-cloudagent-python
de291184c59006391a76317826983dd1eb0ada5d
[ "Apache-2.0" ]
2
2020-02-18T20:34:01.000Z
2021-03-12T16:18:30.000Z
from asynctest import TestCase as AsyncTestCase from asynctest import mock as async_mock import pytest from aiohttp.web import HTTPForbidden from ...config.injection_context import InjectionContext from ...ledger.base import BaseLedger from ...wallet.base import BaseWallet, DIDInfo from .. import routes as test_module class TestWalletRoutes(AsyncTestCase): def setUp(self): self.context = InjectionContext(enforce_typing=False) self.wallet = async_mock.create_autospec(BaseWallet) self.context.injector.bind_instance(BaseWallet, self.wallet) self.app = { "outbound_message_router": async_mock.CoroutineMock(), "request_context": self.context, } self.test_did = "did" self.test_verkey = "verkey" async def test_missing_wallet(self): request = async_mock.MagicMock() request.app = self.app self.context.injector.clear_binding(BaseWallet) with self.assertRaises(HTTPForbidden): await test_module.wallet_create_did(request) with self.assertRaises(HTTPForbidden): await test_module.wallet_did_list(request) with self.assertRaises(HTTPForbidden): await test_module.wallet_get_public_did(request) with self.assertRaises(HTTPForbidden): await test_module.wallet_set_public_did(request) def test_format_did_info(self): did_info = DIDInfo(self.test_did, self.test_verkey, {}) result = test_module.format_did_info(did_info) assert ( result["did"] == self.test_did and result["verkey"] == self.test_verkey and result["public"] == "false" ) did_info = DIDInfo(self.test_did, self.test_verkey, {"public": True}) result = test_module.format_did_info(did_info) assert result["public"] == "true" async def test_create_did(self): request = async_mock.MagicMock() request.app = self.app with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.create_local_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_create_did(request) format_did_info.assert_called_once_with( self.wallet.create_local_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_did_list(self): request = async_mock.MagicMock() request.app = self.app request.query = {} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_local_dids.return_value = [ DIDInfo(self.test_did, self.test_verkey, {}) ] format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_local_dids.return_value[0] ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_public(self): request = async_mock.MagicMock() request.app = self.app request.query = {"public": "true"} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_public_did.return_value ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_did(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_local_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_local_did.return_value ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_did_x(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.get_local_did.side_effect = test_module.WalletError() result = await test_module.wallet_did_list(request) json_response.assert_called_once_with({"results": []}) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_verkey(self): request = async_mock.MagicMock() request.app = self.app request.query = {"verkey": self.test_verkey} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_local_did_for_verkey.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_local_did_for_verkey.return_value ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_verkey_x(self): request = async_mock.MagicMock() request.app = self.app request.query = {"verkey": self.test_verkey} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.get_local_did_for_verkey.side_effect = test_module.WalletError() result = await test_module.wallet_did_list(request) json_response.assert_called_once_with({"results": []}) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_get_public_did(self): request = async_mock.MagicMock() request.app = self.app with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_get_public_did(request) format_did_info.assert_called_once_with( self.wallet.get_public_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_set_public_did(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_set_public_did(request) self.wallet.set_public_did.assert_awaited_once_with(request.query["did"]) format_did_info.assert_called_once_with( self.wallet.set_public_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_set_public_did_no_did(self): request = async_mock.MagicMock() request.app = self.app request.query = {} with self.assertRaises(test_module.web.HTTPBadRequest): await test_module.wallet_set_public_did(request) async def test_set_public_did_not_found(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} self.wallet.get_local_did.side_effect = test_module.WalletError() with self.assertRaises(test_module.web.HTTPBadRequest): await test_module.wallet_set_public_did(request) async def test_set_public_did_update_endpoint(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} Ledger = async_mock.MagicMock() self.ledger = Ledger() self.ledger.update_endpoint_for_did = async_mock.CoroutineMock() self.ledger.__aenter__ = async_mock.CoroutineMock(return_value=self.ledger) self.context.injector.bind_instance(BaseLedger, self.ledger) with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_set_public_did(request) self.wallet.set_public_did.assert_awaited_once_with(request.query["did"]) format_did_info.assert_called_once_with( self.wallet.set_public_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_get_catpol(self): request = async_mock.MagicMock() request.app = self.app with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.WALLET_TYPE = "indy" self.wallet.get_credential_definition_tag_policy = async_mock.CoroutineMock( return_value=["a", "b", "c"] ) result = await test_module.wallet_get_tagging_policy(request) json_response.assert_called_once_with({"taggables": ["a", "b", "c"]}) assert result is json_response.return_value async def test_get_catpol_not_indy_x(self): request = async_mock.MagicMock() request.app = self.app self.wallet.WALLET_TYPE = "rich-corinthian-leather" with self.assertRaises(test_module.web.HTTPForbidden): await test_module.wallet_get_tagging_policy(request) async def test_set_catpol(self): request = async_mock.MagicMock() request.app = self.app request.json = async_mock.CoroutineMock( return_value={"taggables": ["a", "b", "c"]} ) with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.WALLET_TYPE = "indy" self.wallet.set_credential_definition_tag_policy = async_mock.CoroutineMock( return_value=["a", "b", "c"] ) result = await test_module.wallet_set_tagging_policy(request) json_response.assert_called_once_with({}) assert result is json_response.return_value async def test_set_catpol_not_indy_x(self): request = async_mock.MagicMock() request.app = self.app request.json = async_mock.CoroutineMock( return_value={"taggables": ["a", "b", "c"]} ) self.wallet.WALLET_TYPE = "rich-corinthian-leather" with self.assertRaises(test_module.web.HTTPForbidden): await test_module.wallet_set_tagging_policy(request) async def test_register(self): mock_app = async_mock.MagicMock() mock_app.add_routes = async_mock.MagicMock() await test_module.register(mock_app) mock_app.add_routes.assert_called_once()
42.259587
88
0.644144
from asynctest import TestCase as AsyncTestCase from asynctest import mock as async_mock import pytest from aiohttp.web import HTTPForbidden from ...config.injection_context import InjectionContext from ...ledger.base import BaseLedger from ...wallet.base import BaseWallet, DIDInfo from .. import routes as test_module class TestWalletRoutes(AsyncTestCase): def setUp(self): self.context = InjectionContext(enforce_typing=False) self.wallet = async_mock.create_autospec(BaseWallet) self.context.injector.bind_instance(BaseWallet, self.wallet) self.app = { "outbound_message_router": async_mock.CoroutineMock(), "request_context": self.context, } self.test_did = "did" self.test_verkey = "verkey" async def test_missing_wallet(self): request = async_mock.MagicMock() request.app = self.app self.context.injector.clear_binding(BaseWallet) with self.assertRaises(HTTPForbidden): await test_module.wallet_create_did(request) with self.assertRaises(HTTPForbidden): await test_module.wallet_did_list(request) with self.assertRaises(HTTPForbidden): await test_module.wallet_get_public_did(request) with self.assertRaises(HTTPForbidden): await test_module.wallet_set_public_did(request) def test_format_did_info(self): did_info = DIDInfo(self.test_did, self.test_verkey, {}) result = test_module.format_did_info(did_info) assert ( result["did"] == self.test_did and result["verkey"] == self.test_verkey and result["public"] == "false" ) did_info = DIDInfo(self.test_did, self.test_verkey, {"public": True}) result = test_module.format_did_info(did_info) assert result["public"] == "true" async def test_create_did(self): request = async_mock.MagicMock() request.app = self.app with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.create_local_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_create_did(request) format_did_info.assert_called_once_with( self.wallet.create_local_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_did_list(self): request = async_mock.MagicMock() request.app = self.app request.query = {} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_local_dids.return_value = [ DIDInfo(self.test_did, self.test_verkey, {}) ] format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_local_dids.return_value[0] ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_public(self): request = async_mock.MagicMock() request.app = self.app request.query = {"public": "true"} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_public_did.return_value ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_did(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_local_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_local_did.return_value ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_did_x(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.get_local_did.side_effect = test_module.WalletError() result = await test_module.wallet_did_list(request) json_response.assert_called_once_with({"results": []}) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_verkey(self): request = async_mock.MagicMock() request.app = self.app request.query = {"verkey": self.test_verkey} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_local_did_for_verkey.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) format_did_info.return_value = {"did": self.test_did} result = await test_module.wallet_did_list(request) format_did_info.assert_called_once_with( self.wallet.get_local_did_for_verkey.return_value ) json_response.assert_called_once_with( {"results": [format_did_info.return_value]} ) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_did_list_filter_verkey_x(self): request = async_mock.MagicMock() request.app = self.app request.query = {"verkey": self.test_verkey} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.get_local_did_for_verkey.side_effect = test_module.WalletError() result = await test_module.wallet_did_list(request) json_response.assert_called_once_with({"results": []}) assert json_response.return_value is json_response() assert result is json_response.return_value async def test_get_public_did(self): request = async_mock.MagicMock() request.app = self.app with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_get_public_did(request) format_did_info.assert_called_once_with( self.wallet.get_public_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_set_public_did(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_set_public_did(request) self.wallet.set_public_did.assert_awaited_once_with(request.query["did"]) format_did_info.assert_called_once_with( self.wallet.set_public_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_set_public_did_no_did(self): request = async_mock.MagicMock() request.app = self.app request.query = {} with self.assertRaises(test_module.web.HTTPBadRequest): await test_module.wallet_set_public_did(request) async def test_set_public_did_not_found(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} self.wallet.get_local_did.side_effect = test_module.WalletError() with self.assertRaises(test_module.web.HTTPBadRequest): await test_module.wallet_set_public_did(request) async def test_set_public_did_update_endpoint(self): request = async_mock.MagicMock() request.app = self.app request.query = {"did": self.test_did} Ledger = async_mock.MagicMock() self.ledger = Ledger() self.ledger.update_endpoint_for_did = async_mock.CoroutineMock() self.ledger.__aenter__ = async_mock.CoroutineMock(return_value=self.ledger) self.context.injector.bind_instance(BaseLedger, self.ledger) with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response, async_mock.patch.object( test_module, "format_did_info", async_mock.Mock() ) as format_did_info: self.wallet.get_public_did.return_value = DIDInfo( self.test_did, self.test_verkey, {} ) result = await test_module.wallet_set_public_did(request) self.wallet.set_public_did.assert_awaited_once_with(request.query["did"]) format_did_info.assert_called_once_with( self.wallet.set_public_did.return_value ) json_response.assert_called_once_with( {"result": format_did_info.return_value} ) assert result is json_response.return_value async def test_get_catpol(self): request = async_mock.MagicMock() request.app = self.app with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.WALLET_TYPE = "indy" self.wallet.get_credential_definition_tag_policy = async_mock.CoroutineMock( return_value=["a", "b", "c"] ) result = await test_module.wallet_get_tagging_policy(request) json_response.assert_called_once_with({"taggables": ["a", "b", "c"]}) assert result is json_response.return_value async def test_get_catpol_not_indy_x(self): request = async_mock.MagicMock() request.app = self.app self.wallet.WALLET_TYPE = "rich-corinthian-leather" with self.assertRaises(test_module.web.HTTPForbidden): await test_module.wallet_get_tagging_policy(request) async def test_set_catpol(self): request = async_mock.MagicMock() request.app = self.app request.json = async_mock.CoroutineMock( return_value={"taggables": ["a", "b", "c"]} ) with async_mock.patch.object( test_module.web, "json_response", async_mock.Mock() ) as json_response: self.wallet.WALLET_TYPE = "indy" self.wallet.set_credential_definition_tag_policy = async_mock.CoroutineMock( return_value=["a", "b", "c"] ) result = await test_module.wallet_set_tagging_policy(request) json_response.assert_called_once_with({}) assert result is json_response.return_value async def test_set_catpol_not_indy_x(self): request = async_mock.MagicMock() request.app = self.app request.json = async_mock.CoroutineMock( return_value={"taggables": ["a", "b", "c"]} ) self.wallet.WALLET_TYPE = "rich-corinthian-leather" with self.assertRaises(test_module.web.HTTPForbidden): await test_module.wallet_set_tagging_policy(request) async def test_register(self): mock_app = async_mock.MagicMock() mock_app.add_routes = async_mock.MagicMock() await test_module.register(mock_app) mock_app.add_routes.assert_called_once()
true
true
f7244d3b8570046485a9f0792f05527b6f08760b
62
py
Python
app/db/repos/base/protocols/statements/__init__.py
maxzhenzhera/my_vocab_backend
2e9f968374e0bc2fcc0ae40830ca40f3cf5754d1
[ "MIT" ]
null
null
null
app/db/repos/base/protocols/statements/__init__.py
maxzhenzhera/my_vocab_backend
2e9f968374e0bc2fcc0ae40830ca40f3cf5754d1
[ "MIT" ]
null
null
null
app/db/repos/base/protocols/statements/__init__.py
maxzhenzhera/my_vocab_backend
2e9f968374e0bc2fcc0ae40830ca40f3cf5754d1
[ "MIT" ]
null
null
null
from .returnable import Returnable __all__ = ['Returnable']
12.4
34
0.758065
from .returnable import Returnable __all__ = ['Returnable']
true
true
f7244e8ebbd013097871e683eb9e56711f004cd7
461
py
Python
EDUREKA/Course.3/Case.Study.1.Programs/distanceCalculation.py
linkeshkanna/ProblemSolving
8286ce66fbe82a78e1a19396da2d888d755d4cf4
[ "Apache-2.0" ]
null
null
null
EDUREKA/Course.3/Case.Study.1.Programs/distanceCalculation.py
linkeshkanna/ProblemSolving
8286ce66fbe82a78e1a19396da2d888d755d4cf4
[ "Apache-2.0" ]
null
null
null
EDUREKA/Course.3/Case.Study.1.Programs/distanceCalculation.py
linkeshkanna/ProblemSolving
8286ce66fbe82a78e1a19396da2d888d755d4cf4
[ "Apache-2.0" ]
null
null
null
import math from math import radians lat1 = 13.0827 lat2 = 9.4533 long1 = 80.2707 long2 = 77.8024 R = 6371 teta1 = radians(lat1) teta2 = radians(lat2) teta = radians(lat2 - lat1) landa = radians(long2 - long1) a = math.sin(teta/2) * math.sin(teta/2) + math.cos(teta1) * math.cos(teta2) * math.sin(landa/2) * math.sin(landa/2) c = 2 * math.atan2(math.sqrt(a), math.sqrt(1 - a)) d = R * c print("Distance between two Latitude, Longtitude is : " + str(d))
19.208333
115
0.661605
import math from math import radians lat1 = 13.0827 lat2 = 9.4533 long1 = 80.2707 long2 = 77.8024 R = 6371 teta1 = radians(lat1) teta2 = radians(lat2) teta = radians(lat2 - lat1) landa = radians(long2 - long1) a = math.sin(teta/2) * math.sin(teta/2) + math.cos(teta1) * math.cos(teta2) * math.sin(landa/2) * math.sin(landa/2) c = 2 * math.atan2(math.sqrt(a), math.sqrt(1 - a)) d = R * c print("Distance between two Latitude, Longtitude is : " + str(d))
true
true
f7244e9d2237fe01ddaeb6e8e95ca04552be563e
3,688
py
Python
airiam/terraform/entity_terraformers/IAMPolicyDocumentTransformer.py
metahertz/AirIAM
212f84e1b1a51c7a614384f91b220e7f2a57a079
[ "Apache-2.0" ]
501
2020-03-04T16:00:54.000Z
2022-03-30T17:31:10.000Z
airiam/terraform/entity_terraformers/IAMPolicyDocumentTransformer.py
rckasa/AirIAM
5a99dc25354c1bc6525dbaf25a3afcd472f71b2f
[ "Apache-2.0" ]
34
2020-03-23T08:12:18.000Z
2022-02-13T08:50:39.000Z
airiam/terraform/entity_terraformers/IAMPolicyDocumentTransformer.py
rckasa/AirIAM
5a99dc25354c1bc6525dbaf25a3afcd472f71b2f
[ "Apache-2.0" ]
51
2020-04-16T06:43:29.000Z
2022-03-20T14:20:24.000Z
import json from airiam.terraform.entity_terraformers.BaseEntityTransformer import BaseEntityTransformer class IAMPolicyDocumentTransformer(BaseEntityTransformer): def __init__(self, entity_json: dict, policy_name, principal_name=None): policy_document_name = f"{policy_name}_document" if principal_name: policy_document_name = f"{principal_name}_{policy_document_name}" super().__init__('data.aws_iam_policy_document', policy_document_name, entity_json) def _generate_hcl2_code(self, entity_json) -> str: statements = IAMPolicyDocumentTransformer.force_list(entity_json['Statement']) if 'Principal' in statements[0]: statements = self.transform_assume_policy_statements(statements) else: statements = self.transform_execution_policy(statements) code = f"""data "aws_iam_policy_document" "{self._safe_name}" {{ version = "{entity_json.get('Version', '2012-10-17')}" {statements}}}""" return code @staticmethod def transform_execution_policy(statements): statement_block = "" for statement in statements: sid_string = "" if statement.get('Sid', '') != '': sid_string = f"sid = \"{statement['Sid']}\"\n " actions = IAMPolicyDocumentTransformer.force_list(statement.get('Action')) if 'Action' in statement: action_str = f"actions = {json.dumps(actions)}" else: actions = IAMPolicyDocumentTransformer.force_list(statement.get('NotAction')) action_str = f"not_actions = {json.dumps(actions)}" condition_block = IAMPolicyDocumentTransformer.transform_conditions(statement) resources_list_str = json.dumps(IAMPolicyDocumentTransformer.force_list(statement.get('Resource'))).replace('${', '$\\u0024{') statement_block += f""" statement {{ {sid_string}effect = "{statement['Effect']}" {action_str} resources = {resources_list_str} {condition_block} }} """ return statement_block @staticmethod def transform_assume_policy_statements(statements): statement_block = "" for statement in statements: sid_string = "" if statement.get('Sid', '') != '': sid_string = f"sid = \"{statement['Sid']}\"\n " condition_block = IAMPolicyDocumentTransformer.transform_conditions(statement) statement_block += f""" statement {{ {sid_string}effect = "{statement['Effect']}" actions = {json.dumps(IAMPolicyDocumentTransformer.force_list(statement['Action']))} principals {{ type = "{list(statement['Principal'].keys())[0]}" identifiers = {json.dumps(IAMPolicyDocumentTransformer.force_list(statement['Principal'][list(statement['Principal'].keys())[0]]))} }} {condition_block}}} """ return statement_block @staticmethod def transform_conditions(statement): condition_block = "" if 'Condition' in statement: for test, items in statement['Condition'].items(): for variable, values in items.items(): values_str = json.dumps(IAMPolicyDocumentTransformer.force_list(values)).replace('${', '$\\u0024{') condition_block += f""" condition {{ test = "{test}" variable = "{variable}" values = {values_str} }} """ return condition_block @staticmethod def force_list(x): if isinstance(x, list): return x return [x] def entities_to_import(self) -> list: return []
38.821053
138
0.632863
import json from airiam.terraform.entity_terraformers.BaseEntityTransformer import BaseEntityTransformer class IAMPolicyDocumentTransformer(BaseEntityTransformer): def __init__(self, entity_json: dict, policy_name, principal_name=None): policy_document_name = f"{policy_name}_document" if principal_name: policy_document_name = f"{principal_name}_{policy_document_name}" super().__init__('data.aws_iam_policy_document', policy_document_name, entity_json) def _generate_hcl2_code(self, entity_json) -> str: statements = IAMPolicyDocumentTransformer.force_list(entity_json['Statement']) if 'Principal' in statements[0]: statements = self.transform_assume_policy_statements(statements) else: statements = self.transform_execution_policy(statements) code = f"""data "aws_iam_policy_document" "{self._safe_name}" {{ version = "{entity_json.get('Version', '2012-10-17')}" {statements}}}""" return code @staticmethod def transform_execution_policy(statements): statement_block = "" for statement in statements: sid_string = "" if statement.get('Sid', '') != '': sid_string = f"sid = \"{statement['Sid']}\"\n " actions = IAMPolicyDocumentTransformer.force_list(statement.get('Action')) if 'Action' in statement: action_str = f"actions = {json.dumps(actions)}" else: actions = IAMPolicyDocumentTransformer.force_list(statement.get('NotAction')) action_str = f"not_actions = {json.dumps(actions)}" condition_block = IAMPolicyDocumentTransformer.transform_conditions(statement) resources_list_str = json.dumps(IAMPolicyDocumentTransformer.force_list(statement.get('Resource'))).replace('${', '$\\u0024{') statement_block += f""" statement {{ {sid_string}effect = "{statement['Effect']}" {action_str} resources = {resources_list_str} {condition_block} }} """ return statement_block @staticmethod def transform_assume_policy_statements(statements): statement_block = "" for statement in statements: sid_string = "" if statement.get('Sid', '') != '': sid_string = f"sid = \"{statement['Sid']}\"\n " condition_block = IAMPolicyDocumentTransformer.transform_conditions(statement) statement_block += f""" statement {{ {sid_string}effect = "{statement['Effect']}" actions = {json.dumps(IAMPolicyDocumentTransformer.force_list(statement['Action']))} principals {{ type = "{list(statement['Principal'].keys())[0]}" identifiers = {json.dumps(IAMPolicyDocumentTransformer.force_list(statement['Principal'][list(statement['Principal'].keys())[0]]))} }} {condition_block}}} """ return statement_block @staticmethod def transform_conditions(statement): condition_block = "" if 'Condition' in statement: for test, items in statement['Condition'].items(): for variable, values in items.items(): values_str = json.dumps(IAMPolicyDocumentTransformer.force_list(values)).replace('${', '$\\u0024{') condition_block += f""" condition {{ test = "{test}" variable = "{variable}" values = {values_str} }} """ return condition_block @staticmethod def force_list(x): if isinstance(x, list): return x return [x] def entities_to_import(self) -> list: return []
true
true
f7244effc59fcc20c066ca606a185366478f6693
620
py
Python
smpc_demo_platform/benchmarking/views.py
Safe-DEED/mpc-mock-up
7c12b94d50bcde8480da8a7abf93c32b2708e2aa
[ "MIT" ]
null
null
null
smpc_demo_platform/benchmarking/views.py
Safe-DEED/mpc-mock-up
7c12b94d50bcde8480da8a7abf93c32b2708e2aa
[ "MIT" ]
null
null
null
smpc_demo_platform/benchmarking/views.py
Safe-DEED/mpc-mock-up
7c12b94d50bcde8480da8a7abf93c32b2708e2aa
[ "MIT" ]
null
null
null
from django.views.generic.base import TemplateView from django.contrib.auth.decorators import login_required from django.utils.decorators import method_decorator # decorators = [login_required, ] # @method_decorator(decorators, name='dispatch') class BenchmarkViewAppCGOne(TemplateView): template_name = "benchmarking/app-x3-Z63/benchmarking-home.html" def get_context_data(self, **kwargs): context = super().get_context_data(**kwargs) return context # @method_decorator(decorators, name='dispatch') class BenchmarkEndView(TemplateView): template_name = "benchmarking/end-of-demo.html"
31
68
0.774194
from django.views.generic.base import TemplateView from django.contrib.auth.decorators import login_required from django.utils.decorators import method_decorator class BenchmarkViewAppCGOne(TemplateView): template_name = "benchmarking/app-x3-Z63/benchmarking-home.html" def get_context_data(self, **kwargs): context = super().get_context_data(**kwargs) return context class BenchmarkEndView(TemplateView): template_name = "benchmarking/end-of-demo.html"
true
true
f72450ed27bed040eb378e87323d130b0d5efc33
143
py
Python
utests/test_parsers.py
Zephor5/zspider
49178415137d67d7c88f2904bcb204df32082204
[ "MIT" ]
12
2015-12-23T10:13:31.000Z
2021-04-25T17:12:39.000Z
utests/test_parsers.py
Zephor5/zspider
49178415137d67d7c88f2904bcb204df32082204
[ "MIT" ]
1
2022-03-02T14:53:18.000Z
2022-03-02T14:53:18.000Z
utests/test_parsers.py
Zephor5/zspider
49178415137d67d7c88f2904bcb204df32082204
[ "MIT" ]
1
2017-09-18T08:51:51.000Z
2017-09-18T08:51:51.000Z
# coding=utf-8 import unittest __author__ = "zephor" # noinspection PyUnresolvedReferences class TestNewspaper(unittest.TestCase): pass
14.3
39
0.783217
import unittest __author__ = "zephor" class TestNewspaper(unittest.TestCase): pass
true
true
f7245165fdf913d8a10e8d0815498a4fecb991a0
2,721
py
Python
lumbermill/modifier/Permutate.py
dstore-dbap/LumberMill
b7cbadc209a83386871735b8ad88b61da917a6ab
[ "Apache-2.0" ]
15
2015-12-14T19:07:28.000Z
2022-02-28T13:32:11.000Z
lumbermill/modifier/Permutate.py
dstore-dbap/LumberMill
b7cbadc209a83386871735b8ad88b61da917a6ab
[ "Apache-2.0" ]
null
null
null
lumbermill/modifier/Permutate.py
dstore-dbap/LumberMill
b7cbadc209a83386871735b8ad88b61da917a6ab
[ "Apache-2.0" ]
4
2017-02-08T10:49:55.000Z
2019-03-19T18:47:46.000Z
# -*- coding: utf-8 -*- import itertools import sys from lumbermill.BaseThreadedModule import BaseThreadedModule from lumbermill.utils.Decorators import ModuleDocstringParser @ModuleDocstringParser class Permutate(BaseThreadedModule): """ Creates successive len('target_fields') length permutations of elements in 'source_field'. To add some context data to each emitted event 'context_data_field' can specify a field containing a dictionary with the values of 'source_field' as keys. Configuration template: - Permutate: source_field: # <type: string; is: required> target_fields: # <type: list; is: required> context_data_field: # <default: ""; type:string; is: optional> context_target_mapping: # <default: {}; type: dict; is: optional if context_data_field == "" else required> receivers: - NextModule """ module_type = "modifier" """Set module type""" def handleEvent(self, event): """ Process the event. @param event: dictionary @return data: dictionary """ try: context_data = event[self.getConfigurationValue('context_data_field')] except KeyError: context_data = False try: permutation_data = event[self.getConfigurationValue('source_field')] except KeyError: yield event return if type(permutation_data) is not list: yield event return target_field_names = self.getConfigurationValue('target_fields') context_target_mapping = self.getConfigurationValue('context_target_mapping') for permutation in itertools.permutations(permutation_data, r=len(target_field_names)): event_copy = event.copy() if context_data: try: # Rewrite the context data keys to new keys in context_target_mapping ctx_data = {} for idx, dct in enumerate([context_data[key] for key in permutation if key in context_data]): for mapping_key, newkeys in context_target_mapping.items(): if mapping_key in dct: ctx_data[newkeys[idx]] = dct[mapping_key] event_copy.update(ctx_data) except: etype, evalue, etb = sys.exc_info() self.logger.warning("Could not add context data. Exception: %s, Error: %s." % (etype, evalue)) perm = dict(zip(target_field_names, permutation)) event_copy.update(perm) yield event_copy
38.871429
123
0.606027
import itertools import sys from lumbermill.BaseThreadedModule import BaseThreadedModule from lumbermill.utils.Decorators import ModuleDocstringParser @ModuleDocstringParser class Permutate(BaseThreadedModule): module_type = "modifier" def handleEvent(self, event): try: context_data = event[self.getConfigurationValue('context_data_field')] except KeyError: context_data = False try: permutation_data = event[self.getConfigurationValue('source_field')] except KeyError: yield event return if type(permutation_data) is not list: yield event return target_field_names = self.getConfigurationValue('target_fields') context_target_mapping = self.getConfigurationValue('context_target_mapping') for permutation in itertools.permutations(permutation_data, r=len(target_field_names)): event_copy = event.copy() if context_data: try: ctx_data = {} for idx, dct in enumerate([context_data[key] for key in permutation if key in context_data]): for mapping_key, newkeys in context_target_mapping.items(): if mapping_key in dct: ctx_data[newkeys[idx]] = dct[mapping_key] event_copy.update(ctx_data) except: etype, evalue, etb = sys.exc_info() self.logger.warning("Could not add context data. Exception: %s, Error: %s." % (etype, evalue)) perm = dict(zip(target_field_names, permutation)) event_copy.update(perm) yield event_copy
true
true
f72451c6dd941af7a8fa151c731d1b07245f0b6c
8,252
py
Python
tests/test_utils.py
austinjp/textacy
dddfdbf0e0ab3bf756bc4eda042eab1001aac709
[ "Apache-2.0" ]
1,929
2016-02-14T08:30:38.000Z
2022-03-31T03:00:35.000Z
tests/test_utils.py
austinjp/textacy
dddfdbf0e0ab3bf756bc4eda042eab1001aac709
[ "Apache-2.0" ]
304
2016-02-18T15:52:22.000Z
2022-03-31T18:06:54.000Z
tests/test_utils.py
austinjp/textacy
dddfdbf0e0ab3bf756bc4eda042eab1001aac709
[ "Apache-2.0" ]
285
2016-03-20T04:25:08.000Z
2022-03-24T11:31:17.000Z
import datetime import pathlib import pytest from textacy import utils @pytest.mark.parametrize( "val,val_type,col_type,expected", [ (None, int, list, None), (1, int, list, [1]), ([1, 2], int, tuple, (1, 2)), ((1, 1.0), (int, float), set, {1, 1.0}), ], ) def test_to_collection(val, val_type, col_type, expected): assert utils.to_collection(val, val_type, col_type) == expected class TestToUnicode: @pytest.mark.parametrize("s", [b"bytes", "unicode", "úñîçødé"]) def test_valid(self, s): assert isinstance(utils.to_unicode(s), str) @pytest.mark.parametrize("s", [1, 2.0, ["foo", "bar"], {"foo": "bar"}]) def test_invalid(self, s): with pytest.raises(TypeError): _ = utils.to_unicode(s) class TestToBytes: @pytest.mark.parametrize("s", [b"bytes", "unicode", "úñîçødé"]) def test_valid(self, s): assert isinstance(utils.to_bytes(s), bytes) @pytest.mark.parametrize("s", [1, 2.0, ["foo", "bar"], {"foo": "bar"}]) def test_invalid(self, s): with pytest.raises(TypeError): _ = utils.to_bytes(s) class TestToPath: @pytest.mark.parametrize("path", [pathlib.Path("."), pathlib.Path.home()]) def test_path_input(self, path): assert isinstance(utils.to_path(path), pathlib.Path) @pytest.mark.parametrize("path", ["unicode", "úñîçødé"]) def test_str_input(self, path): assert isinstance(utils.to_path(path), pathlib.Path) @pytest.mark.parametrize("path", [1, 2.0, ["foo", "bar"], {"foo": "bar"}]) def test_invalid_input(self, path): with pytest.raises(TypeError): _ = utils.to_path(path) class TestValidateAndClipRange: @pytest.mark.parametrize( "range_vals,full_range,val_type", [ [("2001-01", "2002-01"), ("2000-01", "2003-01"), None], [["2001-01", "2004-01"], ("2000-01", "2003-01"), None], [("2001-01", "2002-01"), ["2000-01", "2003-01"], (str, bytes)], [[-5, 5], [-10, 10], None], [(-5, 5), (0, 10), None], [(-5, 5), (-10, 10), int], [(-5, 5), (-10, 10), (int, float)], [(0, None), (-5, 5), None], [(None, 0), (-5, 5), None], ], ) def test_valid_inputs(self, range_vals, full_range, val_type): output = utils.validate_and_clip_range(range_vals, full_range, val_type) assert isinstance(output, tuple) assert len(output) == 2 if range_vals[0] is None: assert output[0] == full_range[0] else: assert output[0] == max(range_vals[0], full_range[0]) if range_vals[1] is None: assert output[1] == full_range[1] else: assert output[1] == min(range_vals[1], full_range[1]) @pytest.mark.parametrize( "range_vals,full_range,val_type,error", [ ["2001-01", ("2000-01", "2003-01"), None, pytest.raises(TypeError)], [("2001-01", "2002-01"), "2000-01", None, pytest.raises(TypeError)], [ {"2001-01", "2002-01"}, ("2000-01", "2003-01"), None, pytest.raises(TypeError), ], [ ("2001-01", "2002-01"), ("2000-01", "2003-01"), datetime.date, pytest.raises(TypeError), ], [0, [-10, 10], None, pytest.raises(TypeError)], [(-5, 5), 0, None, pytest.raises(TypeError)], [[-5, 5], [-10, 10], (str, bytes), pytest.raises(TypeError)], [ ("2001-01", "2002-01", "2003-01"), ("2000-01", "2003-01"), None, pytest.raises(ValueError), ], [ ("2001-01", "2002-01"), ["2000-01", "2002-01", "2004-01"], None, pytest.raises(ValueError), ], [[0, 5, 10], (-10, 10), None, pytest.raises(ValueError)], [(-5, 5), [-10, 0, 10], None, pytest.raises(ValueError)], [(-5, 5), [-10, 0, 10], (str, bytes), pytest.raises(ValueError)], ], ) def test_invalid_inputs(self, range_vals, full_range, val_type, error): with error: _ = utils.validate_and_clip_range(range_vals, full_range, val_type) class TestValidateSetMembers: @pytest.mark.parametrize( "vals,val_type,valid_vals", [ [{"a", "b"}, (str, bytes), {"a", "b", "c"}], ["a", (str, bytes), {"a", "b", "c"}], [("a", "b"), (str, bytes), {"a", "b", "c"}], [["a", "b"], (str, bytes), None], [{1, 2}, int, {1, 2, 3}], [{1, 2}, (int, float), {1, 2, 3}], [1, int, {1: "a", 2: "b", 3: "c"}], [{3.14, 42.0}, float, None], [3.14, (int, float), None], ] ) def test_valid_inputs(self, vals, val_type, valid_vals): output = utils.validate_set_members(vals, val_type, valid_vals) assert isinstance(output, set) assert all(isinstance(val, val_type) for val in output) @pytest.mark.parametrize( "vals,val_type,valid_vals,error", [ [{"a", "b"}, int, None, pytest.raises(TypeError)], ["a", int, None, pytest.raises(TypeError)], [("a", "b"), (int, float), None, pytest.raises(TypeError)], [{"a", "b"}, (str, bytes), {"x", "y", "z"}, pytest.raises(ValueError)], [{"a", "x"}, (str, bytes), {"x", "y", "z"}, pytest.raises(ValueError)], ["a", (str, bytes), {"x", "y", "z"}, pytest.raises(ValueError)], ["a", (str, bytes), {"x": 24, "y": 25, "z": 26}, pytest.raises(ValueError)], ] ) def test_invalid_inputs(self, vals, val_type, valid_vals, error): with error: _ = utils.validate_set_members(vals, val_type, valid_vals) # TODO: uncomment this when we're only supporting PY3.8+ # def _func_pos_only_args(parg1, parg2, /): # return (parg1, parg2) # TODO: uncomment this when we're only supporting PY3.8+ # def _func_mix_args(parg, /, arg, *, kwarg): # return (parg, arg, kwarg) def _func_mix_args(arg, *, kwarg): return (arg, kwarg) def _func_kw_only_args(*, kwarg1, kwarg2): return (kwarg1, kwarg2) @pytest.mark.parametrize( "func,kwargs,expected", [ # (_func_pos_only_args, {"kwarg": "kwargval"}, {}), (_func_mix_args, {"arg": "argval"}, {"arg": "argval"}), ( _func_mix_args, {"arg": "argval", "kwarg": "kwarval"}, {"arg": "argval", "kwarg": "kwarval"}, ), ( _func_mix_args, {"arg": "argval", "kwarg": "kwargval", "foo": "bar"}, {"arg": "argval", "kwarg": "kwargval"}, ), ( _func_kw_only_args, {"kwarg1": "kwarg1val", "kwarg2": "kwarg2val"}, {"kwarg1": "kwarg1val", "kwarg2": "kwarg2val"}, ), ( _func_kw_only_args, {"kwarg1": "kwarg1val", "kwarg3": "kwarg3val"}, {"kwarg1": "kwarg1val"}, ), (_func_kw_only_args, {}, {}), ], ) def test_get_kwargs_for_func(func, kwargs, expected): assert utils.get_kwargs_for_func(func, kwargs) == expected @pytest.mark.parametrize( "text, n, pad, exp", [ ( "testing 123", 1, False, ('t', 'e', 's', 't', 'i', 'n', 'g', ' ', '1', '2', '3'), ), ( "testing 123", 1, True, ('t', 'e', 's', 't', 'i', 'n', 'g', ' ', '1', '2', '3'), ), ( "testing 123", 2, False, ('te', 'es', 'st', 'ti', 'in', 'ng', 'g ', ' 1', '12', '23'), ), ( "testing 123", 2, True, ('_t', 'te', 'es', 'st', 'ti', 'in', 'ng', 'g ', ' 1', '12', '23', '3_'), ), ] ) def test_text_to_char_ngrams(text, n, pad, exp): obs = utils.text_to_char_ngrams(text, n, pad=pad) assert all(isinstance(cng, str) and len(cng) == n for cng in obs) assert obs == exp
32.234375
88
0.491032
import datetime import pathlib import pytest from textacy import utils @pytest.mark.parametrize( "val,val_type,col_type,expected", [ (None, int, list, None), (1, int, list, [1]), ([1, 2], int, tuple, (1, 2)), ((1, 1.0), (int, float), set, {1, 1.0}), ], ) def test_to_collection(val, val_type, col_type, expected): assert utils.to_collection(val, val_type, col_type) == expected class TestToUnicode: @pytest.mark.parametrize("s", [b"bytes", "unicode", "úñîçødé"]) def test_valid(self, s): assert isinstance(utils.to_unicode(s), str) @pytest.mark.parametrize("s", [1, 2.0, ["foo", "bar"], {"foo": "bar"}]) def test_invalid(self, s): with pytest.raises(TypeError): _ = utils.to_unicode(s) class TestToBytes: @pytest.mark.parametrize("s", [b"bytes", "unicode", "úñîçødé"]) def test_valid(self, s): assert isinstance(utils.to_bytes(s), bytes) @pytest.mark.parametrize("s", [1, 2.0, ["foo", "bar"], {"foo": "bar"}]) def test_invalid(self, s): with pytest.raises(TypeError): _ = utils.to_bytes(s) class TestToPath: @pytest.mark.parametrize("path", [pathlib.Path("."), pathlib.Path.home()]) def test_path_input(self, path): assert isinstance(utils.to_path(path), pathlib.Path) @pytest.mark.parametrize("path", ["unicode", "úñîçødé"]) def test_str_input(self, path): assert isinstance(utils.to_path(path), pathlib.Path) @pytest.mark.parametrize("path", [1, 2.0, ["foo", "bar"], {"foo": "bar"}]) def test_invalid_input(self, path): with pytest.raises(TypeError): _ = utils.to_path(path) class TestValidateAndClipRange: @pytest.mark.parametrize( "range_vals,full_range,val_type", [ [("2001-01", "2002-01"), ("2000-01", "2003-01"), None], [["2001-01", "2004-01"], ("2000-01", "2003-01"), None], [("2001-01", "2002-01"), ["2000-01", "2003-01"], (str, bytes)], [[-5, 5], [-10, 10], None], [(-5, 5), (0, 10), None], [(-5, 5), (-10, 10), int], [(-5, 5), (-10, 10), (int, float)], [(0, None), (-5, 5), None], [(None, 0), (-5, 5), None], ], ) def test_valid_inputs(self, range_vals, full_range, val_type): output = utils.validate_and_clip_range(range_vals, full_range, val_type) assert isinstance(output, tuple) assert len(output) == 2 if range_vals[0] is None: assert output[0] == full_range[0] else: assert output[0] == max(range_vals[0], full_range[0]) if range_vals[1] is None: assert output[1] == full_range[1] else: assert output[1] == min(range_vals[1], full_range[1]) @pytest.mark.parametrize( "range_vals,full_range,val_type,error", [ ["2001-01", ("2000-01", "2003-01"), None, pytest.raises(TypeError)], [("2001-01", "2002-01"), "2000-01", None, pytest.raises(TypeError)], [ {"2001-01", "2002-01"}, ("2000-01", "2003-01"), None, pytest.raises(TypeError), ], [ ("2001-01", "2002-01"), ("2000-01", "2003-01"), datetime.date, pytest.raises(TypeError), ], [0, [-10, 10], None, pytest.raises(TypeError)], [(-5, 5), 0, None, pytest.raises(TypeError)], [[-5, 5], [-10, 10], (str, bytes), pytest.raises(TypeError)], [ ("2001-01", "2002-01", "2003-01"), ("2000-01", "2003-01"), None, pytest.raises(ValueError), ], [ ("2001-01", "2002-01"), ["2000-01", "2002-01", "2004-01"], None, pytest.raises(ValueError), ], [[0, 5, 10], (-10, 10), None, pytest.raises(ValueError)], [(-5, 5), [-10, 0, 10], None, pytest.raises(ValueError)], [(-5, 5), [-10, 0, 10], (str, bytes), pytest.raises(ValueError)], ], ) def test_invalid_inputs(self, range_vals, full_range, val_type, error): with error: _ = utils.validate_and_clip_range(range_vals, full_range, val_type) class TestValidateSetMembers: @pytest.mark.parametrize( "vals,val_type,valid_vals", [ [{"a", "b"}, (str, bytes), {"a", "b", "c"}], ["a", (str, bytes), {"a", "b", "c"}], [("a", "b"), (str, bytes), {"a", "b", "c"}], [["a", "b"], (str, bytes), None], [{1, 2}, int, {1, 2, 3}], [{1, 2}, (int, float), {1, 2, 3}], [1, int, {1: "a", 2: "b", 3: "c"}], [{3.14, 42.0}, float, None], [3.14, (int, float), None], ] ) def test_valid_inputs(self, vals, val_type, valid_vals): output = utils.validate_set_members(vals, val_type, valid_vals) assert isinstance(output, set) assert all(isinstance(val, val_type) for val in output) @pytest.mark.parametrize( "vals,val_type,valid_vals,error", [ [{"a", "b"}, int, None, pytest.raises(TypeError)], ["a", int, None, pytest.raises(TypeError)], [("a", "b"), (int, float), None, pytest.raises(TypeError)], [{"a", "b"}, (str, bytes), {"x", "y", "z"}, pytest.raises(ValueError)], [{"a", "x"}, (str, bytes), {"x", "y", "z"}, pytest.raises(ValueError)], ["a", (str, bytes), {"x", "y", "z"}, pytest.raises(ValueError)], ["a", (str, bytes), {"x": 24, "y": 25, "z": 26}, pytest.raises(ValueError)], ] ) def test_invalid_inputs(self, vals, val_type, valid_vals, error): with error: _ = utils.validate_set_members(vals, val_type, valid_vals) # def _func_pos_only_args(parg1, parg2, /): # return (parg1, parg2) # TODO: uncomment this when we're only supporting PY3.8+ def _func_mix_args(arg, *, kwarg): return (arg, kwarg) def _func_kw_only_args(*, kwarg1, kwarg2): return (kwarg1, kwarg2) @pytest.mark.parametrize( "func,kwargs,expected", [ (_func_mix_args, {"arg": "argval"}, {"arg": "argval"}), ( _func_mix_args, {"arg": "argval", "kwarg": "kwarval"}, {"arg": "argval", "kwarg": "kwarval"}, ), ( _func_mix_args, {"arg": "argval", "kwarg": "kwargval", "foo": "bar"}, {"arg": "argval", "kwarg": "kwargval"}, ), ( _func_kw_only_args, {"kwarg1": "kwarg1val", "kwarg2": "kwarg2val"}, {"kwarg1": "kwarg1val", "kwarg2": "kwarg2val"}, ), ( _func_kw_only_args, {"kwarg1": "kwarg1val", "kwarg3": "kwarg3val"}, {"kwarg1": "kwarg1val"}, ), (_func_kw_only_args, {}, {}), ], ) def test_get_kwargs_for_func(func, kwargs, expected): assert utils.get_kwargs_for_func(func, kwargs) == expected @pytest.mark.parametrize( "text, n, pad, exp", [ ( "testing 123", 1, False, ('t', 'e', 's', 't', 'i', 'n', 'g', ' ', '1', '2', '3'), ), ( "testing 123", 1, True, ('t', 'e', 's', 't', 'i', 'n', 'g', ' ', '1', '2', '3'), ), ( "testing 123", 2, False, ('te', 'es', 'st', 'ti', 'in', 'ng', 'g ', ' 1', '12', '23'), ), ( "testing 123", 2, True, ('_t', 'te', 'es', 'st', 'ti', 'in', 'ng', 'g ', ' 1', '12', '23', '3_'), ), ] ) def test_text_to_char_ngrams(text, n, pad, exp): obs = utils.text_to_char_ngrams(text, n, pad=pad) assert all(isinstance(cng, str) and len(cng) == n for cng in obs) assert obs == exp
true
true
f72453a57dbfc168b184e62aede21ddeafb3650f
2,970
py
Python
cerebro/storage/local.py
Abhishek2304/Cerebro-System-Ray
1e2f2ae291cd449573f87bb83fb2bda12e606b3a
[ "Apache-2.0" ]
16
2020-05-09T03:55:38.000Z
2022-02-27T01:06:09.000Z
cerebro/storage/local.py
Abhishek2304/Cerebro-System-Ray
1e2f2ae291cd449573f87bb83fb2bda12e606b3a
[ "Apache-2.0" ]
16
2020-04-20T20:47:10.000Z
2021-12-02T05:11:09.000Z
cerebro/storage/local.py
Abhishek2304/Cerebro-System-Ray
1e2f2ae291cd449573f87bb83fb2bda12e606b3a
[ "Apache-2.0" ]
6
2020-06-08T01:27:03.000Z
2021-12-02T12:06:44.000Z
# Copyright 2020 Supun Nakandala, Yuhao Zhang, and Arun Kumar. All Rights Reserved. # Copyright 2019 Uber Technologies, Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== from __future__ import absolute_import from __future__ import print_function import contextlib import errno import os import pyarrow as pa from .base import FilesystemStore class LocalStore(FilesystemStore): """Uses the local filesystem as a store of intermediate data and training artifacts (also works with NFS mounted remote storage). :param prefix_path: Prefix path of the local directory (e.g., /user/test/cerebro). :param train_path: (Optional) Path of the directory to store training data. If not specified will default to <prefix_path>/train_data :param val_path: (Optional) Path of the directory to store validation data. If not specified will default to <prefix_path>/val_data :param runs_path: (Optional) Path of the directory to store model checkpoints and log. If not specified will default to <prefix_path>/runs """ FS_PREFIX = 'file://' def __init__(self, prefix_path, train_path=None, val_path=None, runs_path=None): self._fs = pa.LocalFileSystem() super(LocalStore, self).__init__(prefix_path, train_path=train_path, val_path=val_path, runs_path=runs_path) def path_prefix(self): return self.FS_PREFIX def get_filesystem(self): return self._fs def get_local_output_dir_fn(self, run_id): run_path = self.get_localized_path(self.get_run_path(run_id)) @contextlib.contextmanager def local_run_path(): if not os.path.exists(run_path): try: os.makedirs(run_path, mode=0o755) except OSError as e: # Race condition from workers on the same host: ignore if e.errno != errno.EEXIST: raise yield run_path return local_run_path def sync_fn(self, run_id): run_path = self.get_localized_path(self.get_run_path(run_id)) def fn(local_run_path): # No-op for LocalStore since the `local_run_path` will be the same as the run path assert run_path == local_run_path return fn @classmethod def filesystem_prefix(cls): return cls.FS_PREFIX
36.666667
120
0.676768
from __future__ import absolute_import from __future__ import print_function import contextlib import errno import os import pyarrow as pa from .base import FilesystemStore class LocalStore(FilesystemStore): FS_PREFIX = 'file://' def __init__(self, prefix_path, train_path=None, val_path=None, runs_path=None): self._fs = pa.LocalFileSystem() super(LocalStore, self).__init__(prefix_path, train_path=train_path, val_path=val_path, runs_path=runs_path) def path_prefix(self): return self.FS_PREFIX def get_filesystem(self): return self._fs def get_local_output_dir_fn(self, run_id): run_path = self.get_localized_path(self.get_run_path(run_id)) @contextlib.contextmanager def local_run_path(): if not os.path.exists(run_path): try: os.makedirs(run_path, mode=0o755) except OSError as e: if e.errno != errno.EEXIST: raise yield run_path return local_run_path def sync_fn(self, run_id): run_path = self.get_localized_path(self.get_run_path(run_id)) def fn(local_run_path): assert run_path == local_run_path return fn @classmethod def filesystem_prefix(cls): return cls.FS_PREFIX
true
true
f7245409b3ef11681b481c7e78e544f12653dcc6
714
py
Python
pyhfo/ui/adjust_spines.py
andersonbrisil/pyhfo
0fdbe834442550117dc9d9c8f611989bb600db62
[ "MIT" ]
null
null
null
pyhfo/ui/adjust_spines.py
andersonbrisil/pyhfo
0fdbe834442550117dc9d9c8f611989bb600db62
[ "MIT" ]
null
null
null
pyhfo/ui/adjust_spines.py
andersonbrisil/pyhfo
0fdbe834442550117dc9d9c8f611989bb600db62
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ Function adjust spines Created on Fri Apr 17 10:18:30 2015 @author: anderson """ def adjust_spines(ax, spines): for loc, spine in ax.spines.items(): if loc in spines: spine.set_position(('outward', 2)) # outward by 10 points spine.set_smart_bounds(False) else: spine.set_color('none') # don't draw spine # turn off ticks where there is no spine if 'left' in spines: ax.yaxis.set_ticks_position('left') else: # no yaxis ticks ax.yaxis.set_ticks([]) if 'bottom' in spines: ax.xaxis.set_ticks_position('bottom') else: # no xaxis ticks ax.xaxis.set_ticks([])
25.5
70
0.591036
def adjust_spines(ax, spines): for loc, spine in ax.spines.items(): if loc in spines: spine.set_position(('outward', 2)) spine.set_smart_bounds(False) else: spine.set_color('none') # turn off ticks where there is no spine if 'left' in spines: ax.yaxis.set_ticks_position('left') else: # no yaxis ticks ax.yaxis.set_ticks([]) if 'bottom' in spines: ax.xaxis.set_ticks_position('bottom') else: # no xaxis ticks ax.xaxis.set_ticks([])
true
true
f7245440fe7dba32ffeb3a85b4b83af243aba25b
290
py
Python
ceuclid.py
jprzywoski/faster-python
44252bf0a746dd862d752efbe2012a8a404ec7bf
[ "MIT" ]
null
null
null
ceuclid.py
jprzywoski/faster-python
44252bf0a746dd862d752efbe2012a8a404ec7bf
[ "MIT" ]
null
null
null
ceuclid.py
jprzywoski/faster-python
44252bf0a746dd862d752efbe2012a8a404ec7bf
[ "MIT" ]
null
null
null
import ctypes from numpy.ctypeslib import ndpointer lib = ctypes.cdll.LoadLibrary('./libdist.so') fn = lib.dist fn.restype = ctypes.c_double fn.argtypes = [ ndpointer(ctypes.c_double), ndpointer(ctypes.c_double), ctypes.c_size_t ] def dist(x, y): return fn(x, y, len(x))
18.125
45
0.7
import ctypes from numpy.ctypeslib import ndpointer lib = ctypes.cdll.LoadLibrary('./libdist.so') fn = lib.dist fn.restype = ctypes.c_double fn.argtypes = [ ndpointer(ctypes.c_double), ndpointer(ctypes.c_double), ctypes.c_size_t ] def dist(x, y): return fn(x, y, len(x))
true
true
f724555c65e6b8b852f9d596dad3446f0fbf8099
448
py
Python
chap_7/decay_plot.py
jieyanzhu/codes-effective-computation-in-physics
0c99f2da9d462229e6b174a010d7c7b08af4482b
[ "MIT" ]
null
null
null
chap_7/decay_plot.py
jieyanzhu/codes-effective-computation-in-physics
0c99f2da9d462229e6b174a010d7c7b08af4482b
[ "MIT" ]
1
2021-12-23T10:09:01.000Z
2021-12-23T12:06:25.000Z
chap_7/decay_plot.py
jieyanzhu/codes-effective-computation-in-physics
0c99f2da9d462229e6b174a010d7c7b08af4482b
[ "MIT" ]
null
null
null
import numpy as np # as in the previous example, load decays.csv into a NumPy array decaydata = np.loadtxt('decays.csv', delimiter=',', skiprows=1) # provide handles for the x and y columns time = decaydata[:,0] decays = decaydata[:,1] # import the matplotlib plotting functionality import pylab as plt plt.plot(time, decays) plt.xlabel('Time (s)') plt.ylabel('Decays') plt.title('Decays') plt.grid(True) plt.savefig("decays_matplotlib.png")
22.4
64
0.734375
import numpy as np decaydata = np.loadtxt('decays.csv', delimiter=',', skiprows=1) time = decaydata[:,0] decays = decaydata[:,1] import pylab as plt plt.plot(time, decays) plt.xlabel('Time (s)') plt.ylabel('Decays') plt.title('Decays') plt.grid(True) plt.savefig("decays_matplotlib.png")
true
true
f72455bce16e4d2b4c4851dc371a6ac3b783489a
1,136
py
Python
oautom/execution/lambda_execution.py
FabienArcellier/oautom
ed818a34ca726355b1227d3485052793e159b177
[ "MIT" ]
null
null
null
oautom/execution/lambda_execution.py
FabienArcellier/oautom
ed818a34ca726355b1227d3485052793e159b177
[ "MIT" ]
null
null
null
oautom/execution/lambda_execution.py
FabienArcellier/oautom
ed818a34ca726355b1227d3485052793e159b177
[ "MIT" ]
null
null
null
# pylint: disable=useless-super-delegation import json from concurrent.futures import ThreadPoolExecutor, Future import boto3 from oautom import get_logger from oautom.execution.execution import Execution class LambdaExecution(Execution): def __init__(self, name: str, flow: 'Flow', lambda_function: str, payload: dict = {}): super().__init__(name, flow) self._future = None # type: Future self._lambda_arn = lambda_function self._payload = payload def run(self): super().run() # self._logger.info(f"lambda: {self._lambda_arn}") with ThreadPoolExecutor(max_workers=1) as executor: self._future = executor.submit(_run_lambda, self._lambda_arn, self._payload) def check(self) -> bool: return self._future.done() def _run_lambda(lambda_function: str, payload: dict): logger = get_logger() logger.info(f"lambda: {lambda_function}") client = boto3.client('lambda') client.invoke( FunctionName=lambda_function, InvocationType='RequestResponse', LogType='None', Payload=json.dumps(payload), )
29.128205
90
0.681338
import json from concurrent.futures import ThreadPoolExecutor, Future import boto3 from oautom import get_logger from oautom.execution.execution import Execution class LambdaExecution(Execution): def __init__(self, name: str, flow: 'Flow', lambda_function: str, payload: dict = {}): super().__init__(name, flow) self._future = None self._lambda_arn = lambda_function self._payload = payload def run(self): super().run() with ThreadPoolExecutor(max_workers=1) as executor: self._future = executor.submit(_run_lambda, self._lambda_arn, self._payload) def check(self) -> bool: return self._future.done() def _run_lambda(lambda_function: str, payload: dict): logger = get_logger() logger.info(f"lambda: {lambda_function}") client = boto3.client('lambda') client.invoke( FunctionName=lambda_function, InvocationType='RequestResponse', LogType='None', Payload=json.dumps(payload), )
true
true
f72455eb2dee4eaf4803e76cccf48e4cb510f279
1,423
py
Python
cam_lecture/scripts/edge_filter_compressed.py
yasutomo57jp/ros_lecture
811afaded5a5780fa1291bd41196d80446da1e53
[ "MIT" ]
110
2018-11-13T15:04:35.000Z
2022-03-27T20:48:03.000Z
cam_lecture/scripts/edge_filter_compressed.py
yasutomo57jp/ros_lecture
811afaded5a5780fa1291bd41196d80446da1e53
[ "MIT" ]
4
2020-07-16T13:32:22.000Z
2022-01-11T01:08:12.000Z
cam_lecture/scripts/edge_filter_compressed.py
yasutomo57jp/ros_lecture
811afaded5a5780fa1291bd41196d80446da1e53
[ "MIT" ]
57
2019-07-02T23:43:17.000Z
2022-03-27T20:47:28.000Z
#!/usr/bin/env python import rospy import sys import cv2 from sensor_msgs.msg import Image, CompressedImage, CameraInfo from cv_bridge import CvBridge, CvBridgeError import numpy as np class cvBridgeDemo: def __init__(self): self.node_name = "cv_bridge_demo_compressed" rospy.init_node(self.node_name) rospy.on_shutdown(self.cleanup) self.bridge = CvBridge() self.image_sub = rospy.Subscriber("input_image", CompressedImage, self.image_callback, queue_size=1) self.image_pub = rospy.Publisher('output_image', Image, queue_size=1) def image_callback(self, ros_image_compressed): try: np_arr = np.fromstring(ros_image_compressed.data, np.uint8) input_image = cv2.imdecode(np_arr, cv2.IMREAD_COLOR) except CvBridgeError, e: print e output_image = self.process_image(input_image) self.image_pub.publish(self.bridge.cv2_to_imgmsg(output_image, "mono8")) cv2.imshow(self.node_name, output_image) cv2.waitKey(1) def process_image(self, frame): grey = cv2.cvtColor(frame, cv2.COLOR_BGR2GRAY) grey = cv2.blur(grey, (7, 7)) edges = cv2.Canny(grey, 15.0, 30.0) return edges def cleanup(self): cv2.destroyAllWindows() if __name__ == '__main__': cvBridgeDemo() rospy.spin()
33.880952
108
0.650738
import rospy import sys import cv2 from sensor_msgs.msg import Image, CompressedImage, CameraInfo from cv_bridge import CvBridge, CvBridgeError import numpy as np class cvBridgeDemo: def __init__(self): self.node_name = "cv_bridge_demo_compressed" rospy.init_node(self.node_name) rospy.on_shutdown(self.cleanup) self.bridge = CvBridge() self.image_sub = rospy.Subscriber("input_image", CompressedImage, self.image_callback, queue_size=1) self.image_pub = rospy.Publisher('output_image', Image, queue_size=1) def image_callback(self, ros_image_compressed): try: np_arr = np.fromstring(ros_image_compressed.data, np.uint8) input_image = cv2.imdecode(np_arr, cv2.IMREAD_COLOR) except CvBridgeError, e: print e output_image = self.process_image(input_image) self.image_pub.publish(self.bridge.cv2_to_imgmsg(output_image, "mono8")) cv2.imshow(self.node_name, output_image) cv2.waitKey(1) def process_image(self, frame): grey = cv2.cvtColor(frame, cv2.COLOR_BGR2GRAY) grey = cv2.blur(grey, (7, 7)) edges = cv2.Canny(grey, 15.0, 30.0) return edges def cleanup(self): cv2.destroyAllWindows() if __name__ == '__main__': cvBridgeDemo() rospy.spin()
false
true
f724577d79ac37b03a6ecb734534f38b37edce0a
14,449
py
Python
skimage/measure/tests/test_regionprops.py
jjhelmus/scikit-image
b9b5fde0821fe8bcece2528b30d012c65c64ad6f
[ "BSD-3-Clause" ]
2
2017-03-30T11:22:11.000Z
2019-03-03T05:18:01.000Z
skimage/measure/tests/test_regionprops.py
jjhelmus/scikit-image
b9b5fde0821fe8bcece2528b30d012c65c64ad6f
[ "BSD-3-Clause" ]
null
null
null
skimage/measure/tests/test_regionprops.py
jjhelmus/scikit-image
b9b5fde0821fe8bcece2528b30d012c65c64ad6f
[ "BSD-3-Clause" ]
1
2019-12-17T14:53:28.000Z
2019-12-17T14:53:28.000Z
from numpy.testing import assert_array_equal, assert_almost_equal, \ assert_array_almost_equal, assert_raises, assert_equal import numpy as np import math from skimage.measure._regionprops import (regionprops, PROPS, perimeter, _parse_docs) SAMPLE = np.array( [[0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1], [0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1]] ) INTENSITY_SAMPLE = SAMPLE.copy() INTENSITY_SAMPLE[1, 9:11] = 2 SAMPLE_3D = np.zeros((6, 6, 6), dtype=np.uint8) SAMPLE_3D[1:3, 1:3, 1:3] = 1 SAMPLE_3D[3, 2, 2] = 1 INTENSITY_SAMPLE_3D = SAMPLE_3D.copy() def test_all_props(): region = regionprops(SAMPLE, INTENSITY_SAMPLE)[0] for prop in PROPS: assert_almost_equal(region[prop], getattr(region, PROPS[prop])) def test_all_props_3d(): region = regionprops(SAMPLE_3D, INTENSITY_SAMPLE_3D)[0] for prop in PROPS: try: assert_almost_equal(region[prop], getattr(region, PROPS[prop])) except NotImplementedError: pass def test_dtype(): regionprops(np.zeros((10, 10), dtype=np.int)) regionprops(np.zeros((10, 10), dtype=np.uint)) assert_raises((TypeError), regionprops, np.zeros((10, 10), dtype=np.float)) assert_raises((TypeError), regionprops, np.zeros((10, 10), dtype=np.double)) def test_ndim(): regionprops(np.zeros((10, 10), dtype=np.int)) regionprops(np.zeros((10, 10, 1), dtype=np.int)) regionprops(np.zeros((10, 10, 1, 1), dtype=np.int)) regionprops(np.zeros((10, 10, 10), dtype=np.int)) assert_raises(TypeError, regionprops, np.zeros((10, 10, 10, 2), dtype=np.int)) def test_area(): area = regionprops(SAMPLE)[0].area assert area == np.sum(SAMPLE) area = regionprops(SAMPLE_3D)[0].area assert area == np.sum(SAMPLE_3D) def test_bbox(): bbox = regionprops(SAMPLE)[0].bbox assert_array_almost_equal(bbox, (0, 0, SAMPLE.shape[0], SAMPLE.shape[1])) SAMPLE_mod = SAMPLE.copy() SAMPLE_mod[:, -1] = 0 bbox = regionprops(SAMPLE_mod)[0].bbox assert_array_almost_equal(bbox, (0, 0, SAMPLE.shape[0], SAMPLE.shape[1]-1)) bbox = regionprops(SAMPLE_3D)[0].bbox assert_array_almost_equal(bbox, (1, 1, 1, 4, 3, 3)) def test_moments_central(): mu = regionprops(SAMPLE)[0].moments_central # determined with OpenCV assert_almost_equal(mu[0,2], 436.00000000000045) # different from OpenCV results, bug in OpenCV assert_almost_equal(mu[0,3], -737.333333333333) assert_almost_equal(mu[1,1], -87.33333333333303) assert_almost_equal(mu[1,2], -127.5555555555593) assert_almost_equal(mu[2,0], 1259.7777777777774) assert_almost_equal(mu[2,1], 2000.296296296291) assert_almost_equal(mu[3,0], -760.0246913580195) def test_centroid(): centroid = regionprops(SAMPLE)[0].centroid # determined with MATLAB assert_array_almost_equal(centroid, (5.66666666666666, 9.444444444444444)) def test_convex_area(): area = regionprops(SAMPLE)[0].convex_area # determined with MATLAB assert area == 124 def test_convex_image(): img = regionprops(SAMPLE)[0].convex_image # determined with MATLAB ref = np.array( [[0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1]] ) assert_array_equal(img, ref) def test_coordinates(): sample = np.zeros((10, 10), dtype=np.int8) coords = np.array([[3, 2], [3, 3], [3, 4]]) sample[coords[:, 0], coords[:, 1]] = 1 prop_coords = regionprops(sample)[0].coords assert_array_equal(prop_coords, coords) sample = np.zeros((6, 6, 6), dtype=np.int8) coords = np.array([[1, 1, 1], [1, 2, 1], [1, 3, 1]]) sample[coords[:, 0], coords[:, 1], coords[:, 2]] = 1 prop_coords = regionprops(sample)[0].coords assert_array_equal(prop_coords, coords) def test_eccentricity(): eps = regionprops(SAMPLE)[0].eccentricity assert_almost_equal(eps, 0.814629313427) img = np.zeros((5, 5), dtype=np.int) img[2, 2] = 1 eps = regionprops(img)[0].eccentricity assert_almost_equal(eps, 0) def test_equiv_diameter(): diameter = regionprops(SAMPLE)[0].equivalent_diameter # determined with MATLAB assert_almost_equal(diameter, 9.57461472963) def test_euler_number(): en = regionprops(SAMPLE)[0].euler_number assert en == 1 SAMPLE_mod = SAMPLE.copy() SAMPLE_mod[7, -3] = 0 en = regionprops(SAMPLE_mod)[0].euler_number assert en == 0 def test_extent(): extent = regionprops(SAMPLE)[0].extent assert_almost_equal(extent, 0.4) def test_moments_hu(): hu = regionprops(SAMPLE)[0].moments_hu ref = np.array([ 3.27117627e-01, 2.63869194e-02, 2.35390060e-02, 1.23151193e-03, 1.38882330e-06, -2.72586158e-05, 6.48350653e-06 ]) # bug in OpenCV caused in Central Moments calculation? assert_array_almost_equal(hu, ref) def test_image(): img = regionprops(SAMPLE)[0].image assert_array_equal(img, SAMPLE) img = regionprops(SAMPLE_3D)[0].image assert_array_equal(img, SAMPLE_3D[1:4, 1:3, 1:3]) def test_label(): label = regionprops(SAMPLE)[0].label assert_array_equal(label, 1) label = regionprops(SAMPLE_3D)[0].label assert_array_equal(label, 1) def test_filled_area(): area = regionprops(SAMPLE)[0].filled_area assert area == np.sum(SAMPLE) SAMPLE_mod = SAMPLE.copy() SAMPLE_mod[7, -3] = 0 area = regionprops(SAMPLE_mod)[0].filled_area assert area == np.sum(SAMPLE) def test_filled_image(): img = regionprops(SAMPLE)[0].filled_image assert_array_equal(img, SAMPLE) def test_major_axis_length(): length = regionprops(SAMPLE)[0].major_axis_length # MATLAB has different interpretation of ellipse than found in literature, # here implemented as found in literature assert_almost_equal(length, 16.7924234999) def test_max_intensity(): intensity = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].max_intensity assert_almost_equal(intensity, 2) def test_mean_intensity(): intensity = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].mean_intensity assert_almost_equal(intensity, 1.02777777777777) def test_min_intensity(): intensity = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].min_intensity assert_almost_equal(intensity, 1) def test_minor_axis_length(): length = regionprops(SAMPLE)[0].minor_axis_length # MATLAB has different interpretation of ellipse than found in literature, # here implemented as found in literature assert_almost_equal(length, 9.739302807263) def test_moments(): m = regionprops(SAMPLE)[0].moments # determined with OpenCV assert_almost_equal(m[0,0], 72.0) assert_almost_equal(m[0,1], 408.0) assert_almost_equal(m[0,2], 2748.0) assert_almost_equal(m[0,3], 19776.0) assert_almost_equal(m[1,0], 680.0) assert_almost_equal(m[1,1], 3766.0) assert_almost_equal(m[1,2], 24836.0) assert_almost_equal(m[2,0], 7682.0) assert_almost_equal(m[2,1], 43882.0) assert_almost_equal(m[3,0], 95588.0) def test_moments_normalized(): nu = regionprops(SAMPLE)[0].moments_normalized # determined with OpenCV assert_almost_equal(nu[0,2], 0.08410493827160502) assert_almost_equal(nu[1,1], -0.016846707818929982) assert_almost_equal(nu[1,2], -0.002899800614433943) assert_almost_equal(nu[2,0], 0.24301268861454037) assert_almost_equal(nu[2,1], 0.045473992910668816) assert_almost_equal(nu[3,0], -0.017278118992041805) def test_orientation(): orientation = regionprops(SAMPLE)[0].orientation # determined with MATLAB assert_almost_equal(orientation, 0.10446844651921) # test correct quadrant determination orientation2 = regionprops(SAMPLE.T)[0].orientation assert_almost_equal(orientation2, math.pi / 2 - orientation) # test diagonal regions diag = np.eye(10, dtype=int) orientation_diag = regionprops(diag)[0].orientation assert_almost_equal(orientation_diag, -math.pi / 4) orientation_diag = regionprops(np.flipud(diag))[0].orientation assert_almost_equal(orientation_diag, math.pi / 4) orientation_diag = regionprops(np.fliplr(diag))[0].orientation assert_almost_equal(orientation_diag, math.pi / 4) orientation_diag = regionprops(np.fliplr(np.flipud(diag)))[0].orientation assert_almost_equal(orientation_diag, -math.pi / 4) def test_perimeter(): per = regionprops(SAMPLE)[0].perimeter assert_almost_equal(per, 55.2487373415) per = perimeter(SAMPLE.astype('double'), neighbourhood=8) assert_almost_equal(per, 46.8284271247) def test_solidity(): solidity = regionprops(SAMPLE)[0].solidity # determined with MATLAB assert_almost_equal(solidity, 0.580645161290323) def test_weighted_moments_central(): wmu = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments_central ref = np.array( [[ 7.4000000000e+01, -2.1316282073e-13, 4.7837837838e+02, -7.5943608473e+02], [ 3.7303493627e-14, -8.7837837838e+01, -1.4801314828e+02, -1.2714707125e+03], [ 1.2602837838e+03, 2.1571526662e+03, 6.6989799420e+03, 1.5304076361e+04], [ -7.6561796932e+02, -4.2385971907e+03, -9.9501164076e+03, -3.3156729271e+04]] ) np.set_printoptions(precision=10) assert_array_almost_equal(wmu, ref) def test_weighted_centroid(): centroid = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_centroid assert_array_almost_equal(centroid, (5.540540540540, 9.445945945945)) def test_weighted_moments_hu(): whu = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments_hu ref = np.array([ 3.1750587329e-01, 2.1417517159e-02, 2.3609322038e-02, 1.2565683360e-03, 8.3014209421e-07, -3.5073773473e-05, 6.7936409056e-06 ]) assert_array_almost_equal(whu, ref) def test_weighted_moments(): wm = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments ref = np.array( [[ 7.4000000000e+01, 4.1000000000e+02, 2.7500000000e+03, 1.9778000000e+04], [ 6.9900000000e+02, 3.7850000000e+03, 2.4855000000e+04, 1.7500100000e+05], [ 7.8630000000e+03, 4.4063000000e+04, 2.9347700000e+05, 2.0810510000e+06], [ 9.7317000000e+04, 5.7256700000e+05, 3.9007170000e+06, 2.8078871000e+07]] ) assert_array_almost_equal(wm, ref) def test_weighted_moments_normalized(): wnu = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments_normalized ref = np.array( [[ np.nan, np.nan, 0.0873590903, -0.0161217406], [ np.nan, -0.0160405109, -0.0031421072, -0.0031376984], [ 0.230146783, 0.0457932622, 0.0165315478, 0.0043903193], [-0.0162529732, -0.0104598869, -0.0028544152, -0.0011057191]] ) assert_array_almost_equal(wnu, ref) def test_label_sequence(): a = np.empty((2, 2), dtype=np.int) a[:, :] = 2 ps = regionprops(a) assert len(ps) == 1 assert ps[0].label == 2 def test_pure_background(): a = np.zeros((2, 2), dtype=np.int) ps = regionprops(a) assert len(ps) == 0 def test_invalid(): ps = regionprops(SAMPLE) def get_intensity_image(): ps[0].intensity_image assert_raises(AttributeError, get_intensity_image) def test_invalid_size(): wrong_intensity_sample = np.array([[1], [1]]) assert_raises(ValueError, regionprops, SAMPLE, wrong_intensity_sample) def test_equals(): arr = np.zeros((100, 100), dtype=np.int) arr[0:25, 0:25] = 1 arr[50:99, 50:99] = 2 regions = regionprops(arr) r1 = regions[0] regions = regionprops(arr) r2 = regions[0] r3 = regions[1] assert_equal(r1 == r2, True, "Same regionprops are not equal") assert_equal(r1 != r3, True, "Different regionprops are equal") def test_iterate_all_props(): region = regionprops(SAMPLE)[0] p0 = dict((p, region[p]) for p in region) region = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE)[0] p1 = dict((p, region[p]) for p in region) assert len(p0) < len(p1) def test_cache(): region = regionprops(SAMPLE)[0] f0 = region.filled_image region._label_image[:10] = 1 f1 = region.filled_image # Changed underlying image, but cache keeps result the same assert_array_equal(f0, f1) # Now invalidate cache region._cache_active = False f1 = region.filled_image assert np.any(f0 != f1) def test_docstrings_and_props(): region = regionprops(SAMPLE)[0] docs = _parse_docs() props = [m for m in dir(region) if not m.startswith('_')] nr_docs_parsed = len(docs) nr_props = len(props) assert_equal(nr_docs_parsed, nr_props) ds = docs['weighted_moments_normalized'] assert 'iteration' not in ds assert len(ds.split('\n')) > 3 if __name__ == "__main__": from numpy.testing import run_module_suite run_module_suite()
31.479303
82
0.637207
from numpy.testing import assert_array_equal, assert_almost_equal, \ assert_array_almost_equal, assert_raises, assert_equal import numpy as np import math from skimage.measure._regionprops import (regionprops, PROPS, perimeter, _parse_docs) SAMPLE = np.array( [[0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [1, 0, 1, 0, 0, 1, 1, 0, 1, 1, 0, 0, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1], [0, 1, 1, 0, 0, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1]] ) INTENSITY_SAMPLE = SAMPLE.copy() INTENSITY_SAMPLE[1, 9:11] = 2 SAMPLE_3D = np.zeros((6, 6, 6), dtype=np.uint8) SAMPLE_3D[1:3, 1:3, 1:3] = 1 SAMPLE_3D[3, 2, 2] = 1 INTENSITY_SAMPLE_3D = SAMPLE_3D.copy() def test_all_props(): region = regionprops(SAMPLE, INTENSITY_SAMPLE)[0] for prop in PROPS: assert_almost_equal(region[prop], getattr(region, PROPS[prop])) def test_all_props_3d(): region = regionprops(SAMPLE_3D, INTENSITY_SAMPLE_3D)[0] for prop in PROPS: try: assert_almost_equal(region[prop], getattr(region, PROPS[prop])) except NotImplementedError: pass def test_dtype(): regionprops(np.zeros((10, 10), dtype=np.int)) regionprops(np.zeros((10, 10), dtype=np.uint)) assert_raises((TypeError), regionprops, np.zeros((10, 10), dtype=np.float)) assert_raises((TypeError), regionprops, np.zeros((10, 10), dtype=np.double)) def test_ndim(): regionprops(np.zeros((10, 10), dtype=np.int)) regionprops(np.zeros((10, 10, 1), dtype=np.int)) regionprops(np.zeros((10, 10, 1, 1), dtype=np.int)) regionprops(np.zeros((10, 10, 10), dtype=np.int)) assert_raises(TypeError, regionprops, np.zeros((10, 10, 10, 2), dtype=np.int)) def test_area(): area = regionprops(SAMPLE)[0].area assert area == np.sum(SAMPLE) area = regionprops(SAMPLE_3D)[0].area assert area == np.sum(SAMPLE_3D) def test_bbox(): bbox = regionprops(SAMPLE)[0].bbox assert_array_almost_equal(bbox, (0, 0, SAMPLE.shape[0], SAMPLE.shape[1])) SAMPLE_mod = SAMPLE.copy() SAMPLE_mod[:, -1] = 0 bbox = regionprops(SAMPLE_mod)[0].bbox assert_array_almost_equal(bbox, (0, 0, SAMPLE.shape[0], SAMPLE.shape[1]-1)) bbox = regionprops(SAMPLE_3D)[0].bbox assert_array_almost_equal(bbox, (1, 1, 1, 4, 3, 3)) def test_moments_central(): mu = regionprops(SAMPLE)[0].moments_central assert_almost_equal(mu[0,2], 436.00000000000045) assert_almost_equal(mu[0,3], -737.333333333333) assert_almost_equal(mu[1,1], -87.33333333333303) assert_almost_equal(mu[1,2], -127.5555555555593) assert_almost_equal(mu[2,0], 1259.7777777777774) assert_almost_equal(mu[2,1], 2000.296296296291) assert_almost_equal(mu[3,0], -760.0246913580195) def test_centroid(): centroid = regionprops(SAMPLE)[0].centroid assert_array_almost_equal(centroid, (5.66666666666666, 9.444444444444444)) def test_convex_area(): area = regionprops(SAMPLE)[0].convex_area assert area == 124 def test_convex_image(): img = regionprops(SAMPLE)[0].convex_image ref = np.array( [[0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0], [0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0], [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1], [0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1]] ) assert_array_equal(img, ref) def test_coordinates(): sample = np.zeros((10, 10), dtype=np.int8) coords = np.array([[3, 2], [3, 3], [3, 4]]) sample[coords[:, 0], coords[:, 1]] = 1 prop_coords = regionprops(sample)[0].coords assert_array_equal(prop_coords, coords) sample = np.zeros((6, 6, 6), dtype=np.int8) coords = np.array([[1, 1, 1], [1, 2, 1], [1, 3, 1]]) sample[coords[:, 0], coords[:, 1], coords[:, 2]] = 1 prop_coords = regionprops(sample)[0].coords assert_array_equal(prop_coords, coords) def test_eccentricity(): eps = regionprops(SAMPLE)[0].eccentricity assert_almost_equal(eps, 0.814629313427) img = np.zeros((5, 5), dtype=np.int) img[2, 2] = 1 eps = regionprops(img)[0].eccentricity assert_almost_equal(eps, 0) def test_equiv_diameter(): diameter = regionprops(SAMPLE)[0].equivalent_diameter assert_almost_equal(diameter, 9.57461472963) def test_euler_number(): en = regionprops(SAMPLE)[0].euler_number assert en == 1 SAMPLE_mod = SAMPLE.copy() SAMPLE_mod[7, -3] = 0 en = regionprops(SAMPLE_mod)[0].euler_number assert en == 0 def test_extent(): extent = regionprops(SAMPLE)[0].extent assert_almost_equal(extent, 0.4) def test_moments_hu(): hu = regionprops(SAMPLE)[0].moments_hu ref = np.array([ 3.27117627e-01, 2.63869194e-02, 2.35390060e-02, 1.23151193e-03, 1.38882330e-06, -2.72586158e-05, 6.48350653e-06 ]) assert_array_almost_equal(hu, ref) def test_image(): img = regionprops(SAMPLE)[0].image assert_array_equal(img, SAMPLE) img = regionprops(SAMPLE_3D)[0].image assert_array_equal(img, SAMPLE_3D[1:4, 1:3, 1:3]) def test_label(): label = regionprops(SAMPLE)[0].label assert_array_equal(label, 1) label = regionprops(SAMPLE_3D)[0].label assert_array_equal(label, 1) def test_filled_area(): area = regionprops(SAMPLE)[0].filled_area assert area == np.sum(SAMPLE) SAMPLE_mod = SAMPLE.copy() SAMPLE_mod[7, -3] = 0 area = regionprops(SAMPLE_mod)[0].filled_area assert area == np.sum(SAMPLE) def test_filled_image(): img = regionprops(SAMPLE)[0].filled_image assert_array_equal(img, SAMPLE) def test_major_axis_length(): length = regionprops(SAMPLE)[0].major_axis_length assert_almost_equal(length, 16.7924234999) def test_max_intensity(): intensity = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].max_intensity assert_almost_equal(intensity, 2) def test_mean_intensity(): intensity = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].mean_intensity assert_almost_equal(intensity, 1.02777777777777) def test_min_intensity(): intensity = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].min_intensity assert_almost_equal(intensity, 1) def test_minor_axis_length(): length = regionprops(SAMPLE)[0].minor_axis_length assert_almost_equal(length, 9.739302807263) def test_moments(): m = regionprops(SAMPLE)[0].moments assert_almost_equal(m[0,0], 72.0) assert_almost_equal(m[0,1], 408.0) assert_almost_equal(m[0,2], 2748.0) assert_almost_equal(m[0,3], 19776.0) assert_almost_equal(m[1,0], 680.0) assert_almost_equal(m[1,1], 3766.0) assert_almost_equal(m[1,2], 24836.0) assert_almost_equal(m[2,0], 7682.0) assert_almost_equal(m[2,1], 43882.0) assert_almost_equal(m[3,0], 95588.0) def test_moments_normalized(): nu = regionprops(SAMPLE)[0].moments_normalized assert_almost_equal(nu[0,2], 0.08410493827160502) assert_almost_equal(nu[1,1], -0.016846707818929982) assert_almost_equal(nu[1,2], -0.002899800614433943) assert_almost_equal(nu[2,0], 0.24301268861454037) assert_almost_equal(nu[2,1], 0.045473992910668816) assert_almost_equal(nu[3,0], -0.017278118992041805) def test_orientation(): orientation = regionprops(SAMPLE)[0].orientation assert_almost_equal(orientation, 0.10446844651921) orientation2 = regionprops(SAMPLE.T)[0].orientation assert_almost_equal(orientation2, math.pi / 2 - orientation) diag = np.eye(10, dtype=int) orientation_diag = regionprops(diag)[0].orientation assert_almost_equal(orientation_diag, -math.pi / 4) orientation_diag = regionprops(np.flipud(diag))[0].orientation assert_almost_equal(orientation_diag, math.pi / 4) orientation_diag = regionprops(np.fliplr(diag))[0].orientation assert_almost_equal(orientation_diag, math.pi / 4) orientation_diag = regionprops(np.fliplr(np.flipud(diag)))[0].orientation assert_almost_equal(orientation_diag, -math.pi / 4) def test_perimeter(): per = regionprops(SAMPLE)[0].perimeter assert_almost_equal(per, 55.2487373415) per = perimeter(SAMPLE.astype('double'), neighbourhood=8) assert_almost_equal(per, 46.8284271247) def test_solidity(): solidity = regionprops(SAMPLE)[0].solidity assert_almost_equal(solidity, 0.580645161290323) def test_weighted_moments_central(): wmu = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments_central ref = np.array( [[ 7.4000000000e+01, -2.1316282073e-13, 4.7837837838e+02, -7.5943608473e+02], [ 3.7303493627e-14, -8.7837837838e+01, -1.4801314828e+02, -1.2714707125e+03], [ 1.2602837838e+03, 2.1571526662e+03, 6.6989799420e+03, 1.5304076361e+04], [ -7.6561796932e+02, -4.2385971907e+03, -9.9501164076e+03, -3.3156729271e+04]] ) np.set_printoptions(precision=10) assert_array_almost_equal(wmu, ref) def test_weighted_centroid(): centroid = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_centroid assert_array_almost_equal(centroid, (5.540540540540, 9.445945945945)) def test_weighted_moments_hu(): whu = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments_hu ref = np.array([ 3.1750587329e-01, 2.1417517159e-02, 2.3609322038e-02, 1.2565683360e-03, 8.3014209421e-07, -3.5073773473e-05, 6.7936409056e-06 ]) assert_array_almost_equal(whu, ref) def test_weighted_moments(): wm = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments ref = np.array( [[ 7.4000000000e+01, 4.1000000000e+02, 2.7500000000e+03, 1.9778000000e+04], [ 6.9900000000e+02, 3.7850000000e+03, 2.4855000000e+04, 1.7500100000e+05], [ 7.8630000000e+03, 4.4063000000e+04, 2.9347700000e+05, 2.0810510000e+06], [ 9.7317000000e+04, 5.7256700000e+05, 3.9007170000e+06, 2.8078871000e+07]] ) assert_array_almost_equal(wm, ref) def test_weighted_moments_normalized(): wnu = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE )[0].weighted_moments_normalized ref = np.array( [[ np.nan, np.nan, 0.0873590903, -0.0161217406], [ np.nan, -0.0160405109, -0.0031421072, -0.0031376984], [ 0.230146783, 0.0457932622, 0.0165315478, 0.0043903193], [-0.0162529732, -0.0104598869, -0.0028544152, -0.0011057191]] ) assert_array_almost_equal(wnu, ref) def test_label_sequence(): a = np.empty((2, 2), dtype=np.int) a[:, :] = 2 ps = regionprops(a) assert len(ps) == 1 assert ps[0].label == 2 def test_pure_background(): a = np.zeros((2, 2), dtype=np.int) ps = regionprops(a) assert len(ps) == 0 def test_invalid(): ps = regionprops(SAMPLE) def get_intensity_image(): ps[0].intensity_image assert_raises(AttributeError, get_intensity_image) def test_invalid_size(): wrong_intensity_sample = np.array([[1], [1]]) assert_raises(ValueError, regionprops, SAMPLE, wrong_intensity_sample) def test_equals(): arr = np.zeros((100, 100), dtype=np.int) arr[0:25, 0:25] = 1 arr[50:99, 50:99] = 2 regions = regionprops(arr) r1 = regions[0] regions = regionprops(arr) r2 = regions[0] r3 = regions[1] assert_equal(r1 == r2, True, "Same regionprops are not equal") assert_equal(r1 != r3, True, "Different regionprops are equal") def test_iterate_all_props(): region = regionprops(SAMPLE)[0] p0 = dict((p, region[p]) for p in region) region = regionprops(SAMPLE, intensity_image=INTENSITY_SAMPLE)[0] p1 = dict((p, region[p]) for p in region) assert len(p0) < len(p1) def test_cache(): region = regionprops(SAMPLE)[0] f0 = region.filled_image region._label_image[:10] = 1 f1 = region.filled_image assert_array_equal(f0, f1) region._cache_active = False f1 = region.filled_image assert np.any(f0 != f1) def test_docstrings_and_props(): region = regionprops(SAMPLE)[0] docs = _parse_docs() props = [m for m in dir(region) if not m.startswith('_')] nr_docs_parsed = len(docs) nr_props = len(props) assert_equal(nr_docs_parsed, nr_props) ds = docs['weighted_moments_normalized'] assert 'iteration' not in ds assert len(ds.split('\n')) > 3 if __name__ == "__main__": from numpy.testing import run_module_suite run_module_suite()
true
true
f724579a93aae45369d068c1ff4226dc640ec527
1,153
py
Python
Easy21/plot_cuts.py
vuk119/RL
2f5309bfff719b2965060492a19d008ed8382856
[ "MIT" ]
null
null
null
Easy21/plot_cuts.py
vuk119/RL
2f5309bfff719b2965060492a19d008ed8382856
[ "MIT" ]
null
null
null
Easy21/plot_cuts.py
vuk119/RL
2f5309bfff719b2965060492a19d008ed8382856
[ "MIT" ]
null
null
null
""" Some useful plot functions """ import matplotlib.pyplot as plt import numpy as np def matrix_surf(m, xlimits=None, ylimits=None, **kwargs): if xlimits is None: xlimits = [0, m.shape[0]] if ylimits is None: ylimits = [0, m.shape[1]] Y, X = np.meshgrid(np.arange(ylimits[0], ylimits[1]), np.arange(xlimits[0], xlimits[1])) fig = plt.figure() ax = fig.add_subplot(111,projection='3d',**kwargs) ax.plot_surface(X,Y,m) plt.show() def matrix_scatter(m): X=[] Y=[] Z=[] for i in range(m.shape[0]): for j in range(m.shape[1]): X.append(i) Y.append(j) Z.append(m[i,j]) fig = plt.figure() ax = fig.add_subplot(111, projection='3d') ax.scatter(X, Y, Z) plt.show() # mat = np.zeros((6,5)) # mat[0,0] = 5 # mat[0,1] = 4 # mat[1,0] = 4 # mat[1,1] = 3 # mat[1,2] = 3 # mat[2,1] = 3 # mat[0,2] = 3 # mat[2,0] = 3 # mat[0,3] = 3 # mat[3,0] = 3 # matrix_surf(mat, xlabel = 'X AXIS', ylabel = 'Y AXIS', zlabel='Z', xticks =range(10)) # # # # Y, X = np.meshgrid(np.arange(mat.shape[1]), np.arange(mat.shape[0])) # # print(X) # print(Y)
18.901639
92
0.548135
import matplotlib.pyplot as plt import numpy as np def matrix_surf(m, xlimits=None, ylimits=None, **kwargs): if xlimits is None: xlimits = [0, m.shape[0]] if ylimits is None: ylimits = [0, m.shape[1]] Y, X = np.meshgrid(np.arange(ylimits[0], ylimits[1]), np.arange(xlimits[0], xlimits[1])) fig = plt.figure() ax = fig.add_subplot(111,projection='3d',**kwargs) ax.plot_surface(X,Y,m) plt.show() def matrix_scatter(m): X=[] Y=[] Z=[] for i in range(m.shape[0]): for j in range(m.shape[1]): X.append(i) Y.append(j) Z.append(m[i,j]) fig = plt.figure() ax = fig.add_subplot(111, projection='3d') ax.scatter(X, Y, Z) plt.show()
true
true
f724596b02b40510e329925892cf1f8457e42c59
2,489
py
Python
progs/Eval/docReader.py
feddy/Argumentation-Mining
ed2915552d373bdfebf92d4c1d0a356d37bd1f7d
[ "Apache-2.0" ]
57
2017-04-24T21:53:24.000Z
2022-03-29T11:12:13.000Z
progs/Eval/docReader.py
feddy/Argumentation-Mining
ed2915552d373bdfebf92d4c1d0a356d37bd1f7d
[ "Apache-2.0" ]
4
2017-08-22T07:13:31.000Z
2020-09-02T05:47:52.000Z
progs/Eval/docReader.py
feddy/Argumentation-Mining
ed2915552d373bdfebf92d4c1d0a356d37bd1f7d
[ "Apache-2.0" ]
22
2017-10-01T06:58:19.000Z
2021-11-04T00:59:46.000Z
#! /usr/bin/python import sys def readDocs(fn): docs=[] doc=[] for line in open(fn): line = line.strip() if line=="": if doc!=[]: docs.append(doc) doc=[] else: doc.append(line) if doc!=[]: docs.append(doc) return docs def readDocsFine(fn,field=5): docs=[] doc=[[]] lastLabel = None for line in open(fn): line = line.strip() if line=="": if doc!=[[]]: docs.append(doc) doc=[[]] lastLabel = None else: x = line.split("\t") label = x[field] # print label if label.startswith("B-"): # and lastLabel!="O" and lastLabel: if doc[-1]!=[]: doc.append([]) elif label.startswith("O") and lastLabel!="O" and lastLabel: if doc[-1]!=[]: doc.append([]) doc[-1].append(line) lastLabel = label[0] if doc!=[[]]: docs.append(doc) return docs def readDocsFine2(fn,field): docs=[] doc=[[]] argTypes = [] atype = [] lastLabel = None for line in open(fn): line = line.strip() if line=="": if doc!=[[]]: docs.append(doc) argTypes.append(atype) doc=[[]] atype = [] lastLabel = None else: x = line.split("\t") #print x label = x[field] if label.startswith("B-"): # and lastLabel!="O" and lastLabel: atype.append(label.split(":")[0]) if doc[-1]!=[]: doc.append([]) elif label.startswith("O") and lastLabel!="O" and lastLabel: atype.append(None) if doc[-1]!=[]: doc.append([]) elif label.startswith("O") and lastLabel!="O": atype.append(None) doc[-1].append(line) lastLabel = label[0] if doc!=[[]]: docs.append(doc) argTypes.append(atype) return docs,argTypes if __name__ == "__main__": import random docs = readDocs(sys.argv[1]) random.shuffle(docs) n = int(sys.argv[2]) for doc in docs[:n]: for line in doc: x = line.split("\t") x[0] = x[0].split("_")[-1] print("\t".join(x)) print for doc in docs[n:]: for line in doc: x = line.split("\t") x[0] = x[0].split("_")[-1] sys.stderr.write("\t".join(x)+"\n") sys.stderr.write("\n") sys.exit(1) docs=readDocsFine(sys.argv[1]) n=int(sys.argv[2]) print len(docs[n]) print docs[n] for comp in docs[n]: for line in comp: print line
22.026549
72
0.505424
import sys def readDocs(fn): docs=[] doc=[] for line in open(fn): line = line.strip() if line=="": if doc!=[]: docs.append(doc) doc=[] else: doc.append(line) if doc!=[]: docs.append(doc) return docs def readDocsFine(fn,field=5): docs=[] doc=[[]] lastLabel = None for line in open(fn): line = line.strip() if line=="": if doc!=[[]]: docs.append(doc) doc=[[]] lastLabel = None else: x = line.split("\t") label = x[field] if label.startswith("B-"): if doc[-1]!=[]: doc.append([]) elif label.startswith("O") and lastLabel!="O" and lastLabel: if doc[-1]!=[]: doc.append([]) doc[-1].append(line) lastLabel = label[0] if doc!=[[]]: docs.append(doc) return docs def readDocsFine2(fn,field): docs=[] doc=[[]] argTypes = [] atype = [] lastLabel = None for line in open(fn): line = line.strip() if line=="": if doc!=[[]]: docs.append(doc) argTypes.append(atype) doc=[[]] atype = [] lastLabel = None else: x = line.split("\t") label = x[field] if label.startswith("B-"): atype.append(label.split(":")[0]) if doc[-1]!=[]: doc.append([]) elif label.startswith("O") and lastLabel!="O" and lastLabel: atype.append(None) if doc[-1]!=[]: doc.append([]) elif label.startswith("O") and lastLabel!="O": atype.append(None) doc[-1].append(line) lastLabel = label[0] if doc!=[[]]: docs.append(doc) argTypes.append(atype) return docs,argTypes if __name__ == "__main__": import random docs = readDocs(sys.argv[1]) random.shuffle(docs) n = int(sys.argv[2]) for doc in docs[:n]: for line in doc: x = line.split("\t") x[0] = x[0].split("_")[-1] print("\t".join(x)) print for doc in docs[n:]: for line in doc: x = line.split("\t") x[0] = x[0].split("_")[-1] sys.stderr.write("\t".join(x)+"\n") sys.stderr.write("\n") sys.exit(1) docs=readDocsFine(sys.argv[1]) n=int(sys.argv[2]) print len(docs[n]) print docs[n] for comp in docs[n]: for line in comp: print line
false
true
f7245a27daac0be722083cf7badfe71aa73117d0
110
py
Python
torsionfit/tests/test_import.py
ChayaSt/torsionfit
0b810b6da4a930b13c3ab8f8b700c6834824173b
[ "MIT" ]
14
2015-10-09T15:46:09.000Z
2020-11-25T15:30:28.000Z
torsionfit/tests/test_import.py
ChayaSt/torsionfit
0b810b6da4a930b13c3ab8f8b700c6834824173b
[ "MIT" ]
25
2015-08-28T02:09:08.000Z
2019-08-06T19:29:41.000Z
torsionfit/tests/test_import.py
ChayaSt/torsionfit
0b810b6da4a930b13c3ab8f8b700c6834824173b
[ "MIT" ]
3
2015-05-14T19:34:03.000Z
2015-07-27T21:46:36.000Z
#!/usr/bin/python def test_import(): """ Testing import of torsionfit. """ import torsionfit
13.75
33
0.609091
def test_import(): import torsionfit
true
true
f7245a5a8dda4747976414d44dfdefe86c9c2717
1,861
py
Python
pyvoqc/cirq/voqc_optimization.py
akshajgaur/pyvoqc
6352d64542be5fed72e7cae941d4a2a7db012a4f
[ "MIT" ]
1
2021-11-17T10:50:50.000Z
2021-11-17T10:50:50.000Z
pyvoqc/cirq/voqc_optimization.py
akshajgaur/pyvoqc
6352d64542be5fed72e7cae941d4a2a7db012a4f
[ "MIT" ]
5
2021-03-14T20:13:25.000Z
2021-04-10T01:15:05.000Z
pyvoqc/cirq/voqc_optimization.py
akshajgaur/pyvoqc
6352d64542be5fed72e7cae941d4a2a7db012a4f
[ "MIT" ]
2
2021-03-13T16:16:34.000Z
2022-01-27T19:28:15.000Z
from cirq import circuits, ops, protocols import cirq from cirq.contrib.qasm_import import circuit_from_qasm, qasm import re import os from cirq import decompose from cirq.circuits import Circuit from pyvoqc.formatting.format_from_qasm import format_from_qasm from pyvoqc.formatting.rzq_to_rz import rzq_to_rz from pyvoqc.voqc import VOQC from pyvoqc.exceptions import InvalidVOQCFunction,InvalidVOQCGate from pyvoqc.cirq.decompose_cirq_gates import * class CqVOQC: def __init__(self, func = None): self.functions = ["optimize", "not_propagation", "cancel_single_qubit_gates", "cancel_two_qubit_gates", "hadamard_reduction", "merge_rotations"] self.func = func if func else ["optimize"] for i in range(len(self.func)): if ((self.func[i] in self.functions) == False): raise InvalidVOQCFunction(str(self.func[i]), self.functions) def optimize_circuit(self, circuit: circuits.Circuit): #Write qasm file from circuit circuit = Circuit(decompose(circuit, intercepting_decomposer=decompose_library,keep=need_to_keep)) qasm_str = cirq.qasm(circuit) f = open("temp.qasm", "w") f.write(qasm_str) f.close() #Call VOQC optimizations from input list and go from rzq to rz t = self.function_call("temp.qasm") rzq_to_rz("temp2.qasm") #Get Cirq Circuit from qasm file with open("temp2.qasm", "r") as f: c = f.read() circ = circuit_from_qasm(c) #Remove temporary files os.remove("temp.qasm") os.remove("temp2.qasm") return circ def function_call(self,fname_in): a = VOQC(fname_in, False) for i in range(len(self.func)): call = getattr(a,self.func[i]) call() return a.write("temp2.qasm")
36.490196
152
0.661472
from cirq import circuits, ops, protocols import cirq from cirq.contrib.qasm_import import circuit_from_qasm, qasm import re import os from cirq import decompose from cirq.circuits import Circuit from pyvoqc.formatting.format_from_qasm import format_from_qasm from pyvoqc.formatting.rzq_to_rz import rzq_to_rz from pyvoqc.voqc import VOQC from pyvoqc.exceptions import InvalidVOQCFunction,InvalidVOQCGate from pyvoqc.cirq.decompose_cirq_gates import * class CqVOQC: def __init__(self, func = None): self.functions = ["optimize", "not_propagation", "cancel_single_qubit_gates", "cancel_two_qubit_gates", "hadamard_reduction", "merge_rotations"] self.func = func if func else ["optimize"] for i in range(len(self.func)): if ((self.func[i] in self.functions) == False): raise InvalidVOQCFunction(str(self.func[i]), self.functions) def optimize_circuit(self, circuit: circuits.Circuit): circuit = Circuit(decompose(circuit, intercepting_decomposer=decompose_library,keep=need_to_keep)) qasm_str = cirq.qasm(circuit) f = open("temp.qasm", "w") f.write(qasm_str) f.close() t = self.function_call("temp.qasm") rzq_to_rz("temp2.qasm") with open("temp2.qasm", "r") as f: c = f.read() circ = circuit_from_qasm(c) os.remove("temp.qasm") os.remove("temp2.qasm") return circ def function_call(self,fname_in): a = VOQC(fname_in, False) for i in range(len(self.func)): call = getattr(a,self.func[i]) call() return a.write("temp2.qasm")
true
true
f7245abaa8a5cb38551388a2aee2cf80e1403e41
12,195
py
Python
Scripts/plot_ProfileVar_Monthly_FDR.py
zmlabe/StratoVari
c5549f54482a2b05e89bded3e3b0b3c9faa686f3
[ "MIT" ]
4
2019-11-23T19:44:21.000Z
2020-02-20T16:54:45.000Z
Scripts/plot_ProfileVar_Monthly_FDR.py
zmlabe/StratoVari
c5549f54482a2b05e89bded3e3b0b3c9faa686f3
[ "MIT" ]
null
null
null
Scripts/plot_ProfileVar_Monthly_FDR.py
zmlabe/StratoVari
c5549f54482a2b05e89bded3e3b0b3c9faa686f3
[ "MIT" ]
2
2019-06-21T19:27:55.000Z
2021-02-12T19:13:22.000Z
""" Plot vertical plots of PAMIP data for each month from November to April using the ensemble mean (300) Notes ----- Author : Zachary Labe Date : 26 June 2019 """ ### Import modules import numpy as np import matplotlib.pyplot as plt import datetime import read_MonthlyData as MO import statsmodels.stats.multitest as fdr import cmocean import itertools ### Define directories directorydata = '/seley/zlabe/simu/' directoryfigure = '/home/zlabe/Desktop/STRATOVARI/' #directoryfigure = '/home/zlabe/Documents/Research/SITperturb/Figures/' ### Define time now = datetime.datetime.now() currentmn = str(now.month) currentdy = str(now.day) currentyr = str(now.year) currenttime = currentmn + '_' + currentdy + '_' + currentyr titletime = currentmn + '/' + currentdy + '/' + currentyr print('\n' '----Plotting Monthly Vertical Profiles- %s----' % titletime) ### Alott time series (300 ensemble members) year1 = 1701 year2 = 2000 years = np.arange(year1,year2+1,1) ############################################################################### ############################################################################### ############################################################################### ### Call arguments varnames = ['U','GEOP','TEMP','V','EGR'] def calc_indttestfdr(varx,vary): """ Function calculates statistical difference for 2 independent sample t-test Parameters ---------- varx : 3d array vary : 3d array Returns ------- stat = calculated t-statistic pvalue = two-tailed p-value Usage ----- stat,pvalue = calc_ttest(varx,vary) """ print('\n>>> Using calc_ttest function!') ### Import modules import scipy.stats as sts ### 2-independent sample t-test stat,pvalue = sts.ttest_ind(varx,vary,nan_policy='omit') print('*Completed: Finished calc_ttest function!') return stat,pvalue ###################### def readDataPeriods(varnames,sliceq): ### Call function for 4d variable data lat,lon,lev,varfuture = MO.readExperiAll(varnames,'Future','profile') lat,lon,lev,varpast = MO.readExperiAll(varnames,'Past','profile') ### Select ensemble mean period if sliceq == 'Mean': varfuture = varfuture[:,:,:,:,:] varpast = varpast[:,:,:,:,:] elif sliceq == 'A': varfuture = varfuture[:100,:,:,:,:] varpast = varpast[:100,:,:,:,:] elif sliceq == 'B': varfuture = varfuture[100:200,:,:,:,:] varpast = varpast[100:200,:,:,:,:] elif sliceq == 'C': varfuture = varfuture[200:,:,:,:,:] varpast = varpast[200:,:,:,:,:] ### Create 2d array of latitude and longitude lon2,lat2 = np.meshgrid(lon,lat) ### Remove missing data varfuture[np.where(varfuture <= -1e10)] = np.nan varpast[np.where(varpast <= -1e10)] = np.nan ### Rearrange months (N,D,J,F,M,A) varfuturem = np.append(varfuture[:,-2:,:,:,:],varfuture[:,:4,:,:,:], axis=1) varpastm = np.append(varpast[:,-2:,:,:,:],varpast[:,:4,:,:,:],axis=1) ### Calculate zonal means varfuturemz = np.nanmean(varfuturem,axis=4) varpastmz = np.nanmean(varpastm,axis=4) ### Calculate anomalies anompi = varfuturemz - varpastmz ### Calculate ensemble mean anompim = np.nanmean(anompi,axis=0) zdiffruns = anompim ### Calculate climatologies zclimo = np.nanmean(varpastmz,axis=0) ### Calculate significance for each month stat_past = np.empty((varpastm.shape[1],len(lev),len(lat))) pvalue_past = np.empty((varpastm.shape[1],len(lev),len(lat))) for i in range(varpastm.shape[1]): stat_past[i],pvalue_past[i] = calc_indttestfdr(varfuturemz[:,i,:,:], varpastmz[:,i,:,:]) ### Ravel into month x all p values prunsr = np.reshape(pvalue_past, (pvalue_past.shape[0],pvalue_past.shape[1] \ * pvalue_past.shape[2])) ### Calculate false discovery rate prunsq = np.empty((prunsr.shape)) prunsq.fill(np.nan) prunsqq = np.empty((prunsr.shape[1])) prunsqq.fill(np.nan) for i in range(prunsr.shape[0]): ### Check for nans before correction!! mask = np.isfinite(prunsr[i,:]) prunsrr = prunsr[i,:] score,prunsqq[mask] = fdr.fdrcorrection(prunsrr[mask],alpha=0.05, method='indep') prunsq[i,:] = prunsqq ### Reshape into month x lat x lon pruns = np.reshape(prunsq,(pvalue_past.shape)) ### Mask variables by their adjusted p-values pruns[np.where(pruns >= 0.05)] = np.nan pruns[np.where(pruns < 0.05)] = 1. pruns[np.where(np.isnan(pruns))] = 0. return zdiffruns,zclimo,pruns,lat,lon,lev ########################################################################### ########################################################################### ########################################################################### ### Read in data for v in range(len(varnames)): diffm,climom,pvalm,lat,lon,lev = readDataPeriods(varnames[v],'Mean') diffa,climoa,pvala,lat,lon,lev = readDataPeriods(varnames[v],'A') diffb,climob,pvalb,lat,lon,lev = readDataPeriods(varnames[v],'B') diffc,climoc,pvalc,lat,lon,lev = readDataPeriods(varnames[v],'C') varn = list(itertools.chain(*[diffm,diffa,diffb,diffc])) zclimo = list(itertools.chain(*[climom,climoa,climob,climoc])) pvarn = list(itertools.chain(*[pvalm,pvala,pvalb,pvalc])) ### Plot Variables plt.rc('text',usetex=True) plt.rc('font',**{'family':'sans-serif','sans-serif':['Avant Garde']}) ### Set limits for contours and colorbars if varnames[v] == 'U': limit = np.arange(-2,2.1,0.1) barlim = np.arange(-2,3,1) elif varnames[v] == 'TEMP': limit = np.arange(-4,4.1,0.2) barlim = np.arange(-4,5,1) elif varnames[v] == 'GEOP': limit = np.arange(-60,61,2) barlim = np.arange(-60,61,30) elif varnames[v] == 'V': limit = np.arange(-0.2,0.21,0.02) barlim = np.arange(-0.2,0.3,0.1) elif varnames[v] == 'EGR': limit = np.arange(-0.08,0.081,0.005) barlim = np.arange(-0.08,0.09,0.04) zscale = np.array([1000,700,500,300,200, 100,50,30,10]) latq,levq = np.meshgrid(lat,lev) fig = plt.figure() for i in range(len(varn)): ax1 = plt.subplot(4,6,i+1) ax1.spines['top'].set_color('dimgrey') ax1.spines['right'].set_color('dimgrey') ax1.spines['bottom'].set_color('dimgrey') ax1.spines['left'].set_color('dimgrey') ax1.spines['left'].set_linewidth(2) ax1.spines['bottom'].set_linewidth(2) ax1.spines['right'].set_linewidth(2) ax1.spines['top'].set_linewidth(2) ax1.tick_params(axis='y',direction='out',which='major',pad=3, width=2,color='dimgrey') ax1.tick_params(axis='x',direction='out',which='major',pad=3, width=2,color='dimgrey') cs = plt.contourf(lat,lev,varn[i]*pvarn[i],limit,extend='both') if varnames[v] == 'U': cs2 = plt.contour(lat,lev,zclimo[i],np.arange(-20,101,5), linewidths=0.5,colors='dimgrey') plt.gca().invert_yaxis() plt.yscale('log',nonposy='clip') plt.xticks(np.arange(0,96,30),map(str,np.arange(0,91,30)),fontsize=5) plt.yticks(zscale,map(str,zscale),ha='right',fontsize=5) plt.minorticks_off() plt.xlim([0,90]) plt.ylim([1000,10]) if any([i==0,i==6,i==12,i==18]): ax1.tick_params(labelleft='on') else: ax1.tick_params(labelleft='off') if i < 18: ax1.tick_params(labelbottom='off') if any([i==0,i==6,i==12]): ax1.tick_params(axis='y',direction='out',which='major',pad=3, width=2,color='dimgrey') ax1.tick_params(axis='x',direction='out',which='major',pad=3, width=0,color='dimgrey') else: if i < 24 and i != 18: ax1.tick_params(axis='y',direction='out',which='major',pad=3, width=0,color='dimgrey') if i < 18: ax1.tick_params(axis='y',direction='out',which='major', pad=3,width=0,color='dimgrey') ax1.tick_params(axis='x',direction='out',which='major', pad=3,width=0,color='dimgrey') if varnames[v] == 'U': cmap = cmocean.cm.balance cs.set_cmap(cmap) elif varnames[v] == 'TEMP': cmap = cmocean.cm.balance cs.set_cmap(cmap) elif varnames[v] == 'GEOP': cmap = cmocean.cm.balance cs.set_cmap(cmap) elif varnames[v] == 'V': cmap = cmocean.cm.balance cs.set_cmap(cmap) elif varnames[v] == 'EGR': cmap = cmocean.cm.diff cs.set_cmap(cmap) labelmonths = [r'NOV',r'DEC',r'JAN',r'FEB',r'MAR',r'APR'] if i < 6: ax1.annotate(r'\textbf{%s}' % labelmonths[i], xy=(0, 0),xytext=(0.5,1.13),xycoords='axes fraction', fontsize=13,color='dimgrey',rotation=0, ha='center',va='center') if i==0: plt.annotate(r'\textbf{Mean}', xy=(0, 0),xytext=(-0.6,0.5),xycoords='axes fraction', fontsize=15,color='k',rotation=90, ha='center',va='center') elif i==6: plt.annotate(r'\textbf{A}', xy=(0, 0),xytext=(-0.6,0.5),xycoords='axes fraction', fontsize=15,color='k',rotation=90, ha='center',va='center') elif i==12: plt.annotate(r'\textbf{B}', xy=(0, 0),xytext=(-0.6,0.5),xycoords='axes fraction', fontsize=15,color='k',rotation=90, ha='center',va='center') elif i==18: plt.annotate(r'\textbf{C}', xy=(0, 0),xytext=(-0.6,0.5),xycoords='axes fraction', fontsize=15,color='k',rotation=90, ha='center',va='center') cbar_ax = fig.add_axes([0.312,0.07,0.4,0.02]) cbar = fig.colorbar(cs,cax=cbar_ax,orientation='horizontal', extend='both',extendfrac=0.07,drawedges=False) if varnames[v] == 'U': cbar.set_label(r'\textbf{m/s}',fontsize=9,color='dimgray', labelpad=0) elif varnames[v] == 'TEMP': cbar.set_label(r'\textbf{$^\circ$C}',fontsize=9,color='dimgray', labelpad=0) elif varnames[v] == 'GEOP': cbar.set_label(r'\textbf{m}',fontsize=9,color='dimgray', labelpad=0) elif varnames[v] == 'V': cbar.set_label(r'\textbf{m/s}',fontsize=9,color='dimgray', labelpad=0) elif varnames[v] == 'EGR': cbar.set_label(r'\textbf{1/day}',fontsize=9,color='dimgray', labelpad=0) cbar.set_ticks(barlim) cbar.set_ticklabels(list(map(str,barlim))) cbar.ax.tick_params(axis='x', size=.01) cbar.outline.set_edgecolor('dimgrey') cbar.outline.set_linewidth(0.5) cbar.ax.tick_params(labelsize=6) plt.annotate(r'\textbf{Latitude ($^{\circ}$N)', xy=(0, 0),xytext=(0.515,0.12),xycoords='figure fraction', fontsize=6,color='k',rotation=0, ha='center',va='center') plt.subplots_adjust(hspace=0.1,bottom=0.17,top=0.93,wspace=0.1) plt.savefig(directoryfigure + '%s_MonthlyProfiles_100yr_FDR.png' % varnames[v], dpi=300) print('Completed: Script done!')
36.8429
83
0.526117
tlib.pyplot as plt import datetime import read_MonthlyData as MO import statsmodels.stats.multitest as fdr import cmocean import itertools ectoryfigure = '/home/zlabe/Desktop/STRATOVARI/' w.month) currentdy = str(now.day) currentyr = str(now.year) currenttime = currentmn + '_' + currentdy + '_' + currentyr titletime = currentmn + '/' + currentdy + '/' + currentyr print('\n' '----Plotting Monthly Vertical Profiles- %s----' % titletime)
true
true
f7245c8c7d5a9be02f2a22ebc20f3d4370dc8234
1,216
py
Python
package.py
rittikaadhikari/stock-recommendation
1f14276a955301b1c6fa1c00bd88b00cf5668d8c
[ "MIT" ]
null
null
null
package.py
rittikaadhikari/stock-recommendation
1f14276a955301b1c6fa1c00bd88b00cf5668d8c
[ "MIT" ]
null
null
null
package.py
rittikaadhikari/stock-recommendation
1f14276a955301b1c6fa1c00bd88b00cf5668d8c
[ "MIT" ]
null
null
null
# Inspired by npm's package.json file name = 'hisa' version = '0.1.0' release = '0.1.0' description = 'A stock market predictor and model builder' long_description = ['README.md'] keywords = ['neural', 'network', 'machine', 'deep', 'learning', 'tensorflow', 'stock', 'market', 'prediction'] authors = [ { 'name': 'Rittika Adhikari', 'email': 'rittika.adhikari@gmail.com' }, { 'name': 'Sahil Modi', 'email': 'sm34524@gmail.com'}, { 'name': 'Utkarsh Awasthi', 'email': 'navamawasthi@gmail.com'} ] maintainers = [ { 'name': 'Rittika Adhikari', 'email': 'rittika.adhikari@gmail.com' }, { 'name': 'Sahil Modi', 'email': 'sm34524@gmail.com'}, { 'name': 'Utkarsh Awasthi', 'email': 'navamawasthi@gmail.com'} ] license = 'MIT' modules = [ 'hisa', 'hisa.config', 'hisa._util', 'hisa.capsule', 'hisa.learn', 'hisa.learn.models', 'hisa.learn.sentiment', ] github_username = 'rittikaadhikari' github_repository = 'hisa' github_url = '{baseurl}/{username}/{repository}'.format( baseurl = 'https://github.com', username = github_username, repository = github_repository)
34.742857
74
0.591283
name = 'hisa' version = '0.1.0' release = '0.1.0' description = 'A stock market predictor and model builder' long_description = ['README.md'] keywords = ['neural', 'network', 'machine', 'deep', 'learning', 'tensorflow', 'stock', 'market', 'prediction'] authors = [ { 'name': 'Rittika Adhikari', 'email': 'rittika.adhikari@gmail.com' }, { 'name': 'Sahil Modi', 'email': 'sm34524@gmail.com'}, { 'name': 'Utkarsh Awasthi', 'email': 'navamawasthi@gmail.com'} ] maintainers = [ { 'name': 'Rittika Adhikari', 'email': 'rittika.adhikari@gmail.com' }, { 'name': 'Sahil Modi', 'email': 'sm34524@gmail.com'}, { 'name': 'Utkarsh Awasthi', 'email': 'navamawasthi@gmail.com'} ] license = 'MIT' modules = [ 'hisa', 'hisa.config', 'hisa._util', 'hisa.capsule', 'hisa.learn', 'hisa.learn.models', 'hisa.learn.sentiment', ] github_username = 'rittikaadhikari' github_repository = 'hisa' github_url = '{baseurl}/{username}/{repository}'.format( baseurl = 'https://github.com', username = github_username, repository = github_repository)
true
true
f7245d00c96a3042401b96defdbc1bd8590b3469
425
py
Python
raspberrypi/blinkgpio24.py
jbrucepayne/pitoys
49a60dd62f57e1bf5f463fa11dbf3a070ef152f1
[ "MIT" ]
null
null
null
raspberrypi/blinkgpio24.py
jbrucepayne/pitoys
49a60dd62f57e1bf5f463fa11dbf3a070ef152f1
[ "MIT" ]
null
null
null
raspberrypi/blinkgpio24.py
jbrucepayne/pitoys
49a60dd62f57e1bf5f463fa11dbf3a070ef152f1
[ "MIT" ]
null
null
null
#!/usr/bin/python import RPi.GPIO as GPIO import datetime import time GPIO.setwarnings(False) GPIO.setmode(GPIO.BCM) GPIO.setup(24, GPIO.OUT) print "Starting to blink GPIO 24" + datetime.datetime.now().isoformat() while True: print "GPIO On : " + datetime.datetime.now().isoformat() GPIO.output(24, True) time.sleep(2) print "GPIO Off: " + datetime.datetime.now().isoformat() GPIO.output(24, False) time.sleep(2)
26.5625
71
0.72
import RPi.GPIO as GPIO import datetime import time GPIO.setwarnings(False) GPIO.setmode(GPIO.BCM) GPIO.setup(24, GPIO.OUT) print "Starting to blink GPIO 24" + datetime.datetime.now().isoformat() while True: print "GPIO On : " + datetime.datetime.now().isoformat() GPIO.output(24, True) time.sleep(2) print "GPIO Off: " + datetime.datetime.now().isoformat() GPIO.output(24, False) time.sleep(2)
false
true
f7245ff14c37b2aedccbcae8d5af768476c65b57
587
py
Python
setup.py
dimitri-yatsenko/adamacs
c83ce744d207fb5fa3e7069a15cff4a52b9dcf52
[ "MIT" ]
null
null
null
setup.py
dimitri-yatsenko/adamacs
c83ce744d207fb5fa3e7069a15cff4a52b9dcf52
[ "MIT" ]
null
null
null
setup.py
dimitri-yatsenko/adamacs
c83ce744d207fb5fa3e7069a15cff4a52b9dcf52
[ "MIT" ]
null
null
null
from setuptools import setup with open('README.md') as f: readme = f.read() with open('LICENSE') as f: license = f.read() setup( name='adamacs', version='0.0.1', description='Architectures for Data Management and Computational Support.', long_description=readme, author='Daniel Müller-Komorowska', author_email='danielmuellermsc@gmail.com', url='https://github.com/SFB1089/adamacs.git', license=license, packages=['adamacs'], install_requires=[ 'numpy', 'pandas', 'matplotlib', 'scipy' ])
22.576923
79
0.623509
from setuptools import setup with open('README.md') as f: readme = f.read() with open('LICENSE') as f: license = f.read() setup( name='adamacs', version='0.0.1', description='Architectures for Data Management and Computational Support.', long_description=readme, author='Daniel Müller-Komorowska', author_email='danielmuellermsc@gmail.com', url='https://github.com/SFB1089/adamacs.git', license=license, packages=['adamacs'], install_requires=[ 'numpy', 'pandas', 'matplotlib', 'scipy' ])
true
true
f7246097ee00e1071047af06705d6ed6469d67cb
7,066
py
Python
tensorflow/contrib/keras/python/keras/models_test.py
DEVESHTARASIA/tensorflow
d3edb8c60ed4fd831d62833ed22f5c23486c561c
[ "Apache-2.0" ]
384
2017-02-21T18:38:04.000Z
2022-02-22T07:30:25.000Z
tensorflow/contrib/keras/python/keras/models_test.py
DEVESHTARASIA/tensorflow
d3edb8c60ed4fd831d62833ed22f5c23486c561c
[ "Apache-2.0" ]
15
2017-03-01T20:18:43.000Z
2020-05-07T10:33:51.000Z
tensorflow/contrib/keras/python/keras/models_test.py
DEVESHTARASIA/tensorflow
d3edb8c60ed4fd831d62833ed22f5c23486c561c
[ "Apache-2.0" ]
81
2017-02-21T19:31:19.000Z
2022-02-22T07:30:24.000Z
# Copyright 2016 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for training routines.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import os import tempfile import numpy as np from tensorflow.contrib.keras.python import keras from tensorflow.python.platform import test try: import h5py # pylint:disable=g-import-not-at-top except ImportError: h5py = None class TestModelSaving(test.TestCase): def test_sequential_model_saving(self): if h5py is None: return # Skip test if models cannot be saved. with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.RepeatVector(3)) model.add(keras.layers.TimeDistributed(keras.layers.Dense(3))) model.compile(loss=keras.losses.MSE, optimizer=keras.optimizers.RMSprop(lr=0.0001), metrics=[keras.metrics.categorical_accuracy], sample_weight_mode='temporal') x = np.random.random((1, 3)) y = np.random.random((1, 3, 3)) model.train_on_batch(x, y) out = model.predict(x) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) new_model = keras.models.load_model(fname) os.remove(fname) out2 = new_model.predict(x) self.assertAllClose(out, out2, atol=1e-05) # test that new updates are the same with both models x = np.random.random((1, 3)) y = np.random.random((1, 3, 3)) model.train_on_batch(x, y) new_model.train_on_batch(x, y) out = model.predict(x) out2 = new_model.predict(x) self.assertAllClose(out, out2, atol=1e-05) def test_sequential_model_saving_2(self): if h5py is None: return # Skip test if models cannot be saved. with self.test_session(): # test with custom optimizer, loss class CustomOp(keras.optimizers.RMSprop): pass def custom_loss(y_true, y_pred): return keras.losses.mse(y_true, y_pred) model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.Dense(3)) model.compile(loss=custom_loss, optimizer=CustomOp(), metrics=['acc']) x = np.random.random((1, 3)) y = np.random.random((1, 3)) model.train_on_batch(x, y) out = model.predict(x) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model( fname, custom_objects={'CustomOp': CustomOp, 'custom_loss': custom_loss}) os.remove(fname) out2 = model.predict(x) self.assertAllClose(out, out2, atol=1e-05) def test_functional_model_saving(self): if h5py is None: return # Skip test if models cannot be saved. with self.test_session(): inputs = keras.layers.Input(shape=(3,)) x = keras.layers.Dense(2)(inputs) output = keras.layers.Dense(3)(x) model = keras.models.Model(inputs, output) model.compile(loss=keras.losses.MSE, optimizer=keras.optimizers.RMSprop(lr=0.0001), metrics=[keras.metrics.categorical_accuracy]) x = np.random.random((1, 3)) y = np.random.random((1, 3)) model.train_on_batch(x, y) out = model.predict(x) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) out2 = model.predict(x) self.assertAllClose(out, out2, atol=1e-05) def test_saving_without_compilation(self): if h5py is None: return # Skip test if models cannot be saved. with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.Dense(3)) model.compile(loss='mse', optimizer='sgd', metrics=['acc']) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) def test_saving_right_after_compilation(self): if h5py is None: return # Skip test if models cannot be saved. with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.Dense(3)) model.compile(loss='mse', optimizer='sgd', metrics=['acc']) model.model._make_train_function() _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) def test_saving_lambda_numpy_array_arguments(self): if h5py is None: return # Skip test if models cannot be saved. mean = np.random.random((4, 2, 3)) std = np.abs(np.random.random((4, 2, 3))) + 1e-5 inputs = keras.layers.Input(shape=(4, 2, 3)) output = keras.layers.Lambda(lambda image, mu, std: (image - mu) / std, arguments={'mu': mean, 'std': std})(inputs) model = keras.models.Model(inputs, output) model.compile(loss='mse', optimizer='sgd', metrics=['acc']) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) self.assertAllClose(mean, model.layers[1].arguments['mu']) self.assertAllClose(std, model.layers[1].arguments['std']) class TestSequential(test.TestCase): """Most Sequential model API tests are covered in `training_test.py`. """ def test_sequential_pop(self): num_hidden = 5 input_dim = 3 batch_size = 5 num_classes = 2 with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(num_hidden, input_dim=input_dim)) model.add(keras.layers.Dense(num_classes)) model.compile(loss='mse', optimizer='sgd') x = np.random.random((batch_size, input_dim)) y = np.random.random((batch_size, num_classes)) model.fit(x, y, epochs=1) model.pop() self.assertEqual(len(model.layers), 1) self.assertEqual(model.output_shape, (None, num_hidden)) model.compile(loss='mse', optimizer='sgd') y = np.random.random((batch_size, num_hidden)) model.fit(x, y, epochs=1) if __name__ == '__main__': test.main()
32.865116
80
0.649731
from __future__ import absolute_import from __future__ import division from __future__ import print_function import os import tempfile import numpy as np from tensorflow.contrib.keras.python import keras from tensorflow.python.platform import test try: import h5py except ImportError: h5py = None class TestModelSaving(test.TestCase): def test_sequential_model_saving(self): if h5py is None: return with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.RepeatVector(3)) model.add(keras.layers.TimeDistributed(keras.layers.Dense(3))) model.compile(loss=keras.losses.MSE, optimizer=keras.optimizers.RMSprop(lr=0.0001), metrics=[keras.metrics.categorical_accuracy], sample_weight_mode='temporal') x = np.random.random((1, 3)) y = np.random.random((1, 3, 3)) model.train_on_batch(x, y) out = model.predict(x) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) new_model = keras.models.load_model(fname) os.remove(fname) out2 = new_model.predict(x) self.assertAllClose(out, out2, atol=1e-05) x = np.random.random((1, 3)) y = np.random.random((1, 3, 3)) model.train_on_batch(x, y) new_model.train_on_batch(x, y) out = model.predict(x) out2 = new_model.predict(x) self.assertAllClose(out, out2, atol=1e-05) def test_sequential_model_saving_2(self): if h5py is None: return with self.test_session(): class CustomOp(keras.optimizers.RMSprop): pass def custom_loss(y_true, y_pred): return keras.losses.mse(y_true, y_pred) model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.Dense(3)) model.compile(loss=custom_loss, optimizer=CustomOp(), metrics=['acc']) x = np.random.random((1, 3)) y = np.random.random((1, 3)) model.train_on_batch(x, y) out = model.predict(x) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model( fname, custom_objects={'CustomOp': CustomOp, 'custom_loss': custom_loss}) os.remove(fname) out2 = model.predict(x) self.assertAllClose(out, out2, atol=1e-05) def test_functional_model_saving(self): if h5py is None: return with self.test_session(): inputs = keras.layers.Input(shape=(3,)) x = keras.layers.Dense(2)(inputs) output = keras.layers.Dense(3)(x) model = keras.models.Model(inputs, output) model.compile(loss=keras.losses.MSE, optimizer=keras.optimizers.RMSprop(lr=0.0001), metrics=[keras.metrics.categorical_accuracy]) x = np.random.random((1, 3)) y = np.random.random((1, 3)) model.train_on_batch(x, y) out = model.predict(x) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) out2 = model.predict(x) self.assertAllClose(out, out2, atol=1e-05) def test_saving_without_compilation(self): if h5py is None: return with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.Dense(3)) model.compile(loss='mse', optimizer='sgd', metrics=['acc']) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) def test_saving_right_after_compilation(self): if h5py is None: return with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(2, input_shape=(3,))) model.add(keras.layers.Dense(3)) model.compile(loss='mse', optimizer='sgd', metrics=['acc']) model.model._make_train_function() _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) def test_saving_lambda_numpy_array_arguments(self): if h5py is None: return mean = np.random.random((4, 2, 3)) std = np.abs(np.random.random((4, 2, 3))) + 1e-5 inputs = keras.layers.Input(shape=(4, 2, 3)) output = keras.layers.Lambda(lambda image, mu, std: (image - mu) / std, arguments={'mu': mean, 'std': std})(inputs) model = keras.models.Model(inputs, output) model.compile(loss='mse', optimizer='sgd', metrics=['acc']) _, fname = tempfile.mkstemp('.h5') keras.models.save_model(model, fname) model = keras.models.load_model(fname) os.remove(fname) self.assertAllClose(mean, model.layers[1].arguments['mu']) self.assertAllClose(std, model.layers[1].arguments['std']) class TestSequential(test.TestCase): def test_sequential_pop(self): num_hidden = 5 input_dim = 3 batch_size = 5 num_classes = 2 with self.test_session(): model = keras.models.Sequential() model.add(keras.layers.Dense(num_hidden, input_dim=input_dim)) model.add(keras.layers.Dense(num_classes)) model.compile(loss='mse', optimizer='sgd') x = np.random.random((batch_size, input_dim)) y = np.random.random((batch_size, num_classes)) model.fit(x, y, epochs=1) model.pop() self.assertEqual(len(model.layers), 1) self.assertEqual(model.output_shape, (None, num_hidden)) model.compile(loss='mse', optimizer='sgd') y = np.random.random((batch_size, num_hidden)) model.fit(x, y, epochs=1) if __name__ == '__main__': test.main()
true
true
f72460e93b5cc9a2ba178d43a0407e7595709d8c
399
py
Python
run.py
palazzem/gello
19fe9e4aa8de485dd829a87047ec64f89b5fa7ee
[ "Apache-2.0" ]
44
2018-03-28T14:22:23.000Z
2022-03-15T07:25:06.000Z
run.py
palazzem/gello
19fe9e4aa8de485dd829a87047ec64f89b5fa7ee
[ "Apache-2.0" ]
44
2018-03-28T14:19:03.000Z
2022-02-16T10:24:57.000Z
run.py
palazzem/gello
19fe9e4aa8de485dd829a87047ec64f89b5fa7ee
[ "Apache-2.0" ]
12
2018-03-28T14:15:43.000Z
2021-07-19T17:33:20.000Z
# -*- coding: utf-8 -*- # # Unless explicitly stated otherwise all files in this repository are licensed # under the Apache 2 License. # # This product includes software developed at Datadog # (https://www.datadoghq.com/). # # Copyright 2018 Datadog, Inc. # """run.py Run the application locally by runnnig: `python run.py` """ from app import app if __name__ == '__main__': app.run()
16.625
78
0.689223
from app import app if __name__ == '__main__': app.run()
true
true
f7246108e996bd99236ce11f115ac45903250e54
399
py
Python
code/poc/emergency.py
a10pepo/parrot_ar_drone
af3c15379772a7e86082957776ed8c39193170ec
[ "MIT" ]
null
null
null
code/poc/emergency.py
a10pepo/parrot_ar_drone
af3c15379772a7e86082957776ed8c39193170ec
[ "MIT" ]
3
2021-06-08T20:51:39.000Z
2022-03-12T00:13:08.000Z
code/poc/emergency.py
a10pepo/parrot_ar_drone
af3c15379772a7e86082957776ed8c39193170ec
[ "MIT" ]
1
2020-02-03T16:24:38.000Z
2020-02-03T16:24:38.000Z
# -*- coding: utf-8 -*- """ Created on Wed Dec 18 18:19:15 2019 @author: pepo """ import libardrone import pygame from time import sleep import time import cv2 drone = libardrone.ARDrone() def operation(sleep): t1 = time.time() t2=t1 while t2-t1<sleep: drone.turn_left() t2=time.time() def main(): drone.land() if __name__ == '__main__': main()
12.090909
35
0.606516
import libardrone import pygame from time import sleep import time import cv2 drone = libardrone.ARDrone() def operation(sleep): t1 = time.time() t2=t1 while t2-t1<sleep: drone.turn_left() t2=time.time() def main(): drone.land() if __name__ == '__main__': main()
true
true
f724637d889f2486a08417116366b6d3968dc1b4
503
py
Python
ports/gprs_a9/examples/example_31_ssl.py
sebi5361/micropython
6c054cd124bc6229bee127128264dc0829dea53c
[ "MIT" ]
79
2019-02-07T09:04:50.000Z
2022-02-20T06:54:44.000Z
ports/gprs_a9/examples/example_31_ssl.py
sebi5361/micropython
6c054cd124bc6229bee127128264dc0829dea53c
[ "MIT" ]
100
2019-05-16T09:25:23.000Z
2021-09-20T07:46:54.000Z
ports/gprs_a9/examples/example_31_ssl.py
sebi5361/micropython
6c054cd124bc6229bee127128264dc0829dea53c
[ "MIT" ]
25
2019-03-20T08:16:57.000Z
2022-03-11T17:59:36.000Z
# Micropython a9g example # Source: https://github.com/pulkin/micropython # Author: pulkin # Demonstrates how to wrap sockets into ssl tunnel import cellular import socket import ssl cellular.gprs("internet", "", "") print("IP", socket.get_local_ip()) host = "httpstat.us" port = 443 s = socket.socket() s.connect((host, port)) s = ssl.wrap_socket(s) message = "GET /200 HTTP/1.1\r\nHost: {}\r\nConnection: close\r\n\r\n" s.write(message.format(host)) print(s.read(256)) s.close() cellular.gprs(False)
23.952381
70
0.719682
import cellular import socket import ssl cellular.gprs("internet", "", "") print("IP", socket.get_local_ip()) host = "httpstat.us" port = 443 s = socket.socket() s.connect((host, port)) s = ssl.wrap_socket(s) message = "GET /200 HTTP/1.1\r\nHost: {}\r\nConnection: close\r\n\r\n" s.write(message.format(host)) print(s.read(256)) s.close() cellular.gprs(False)
true
true
f7246452a8b54521f9de02de28a010c82e5a7bdd
675
py
Python
script/dbus_mock.py
lingxiao-Zhu/electron
2d85b1f8f527d55f884904dbfdde50ee66a49830
[ "MIT" ]
88,283
2016-04-04T19:29:13.000Z
2022-03-31T23:33:33.000Z
script/dbus_mock.py
lingxiao-Zhu/electron
2d85b1f8f527d55f884904dbfdde50ee66a49830
[ "MIT" ]
27,327
2016-04-04T19:38:58.000Z
2022-03-31T22:34:10.000Z
script/dbus_mock.py
lingxiao-Zhu/electron
2d85b1f8f527d55f884904dbfdde50ee66a49830
[ "MIT" ]
15,972
2016-04-04T19:32:06.000Z
2022-03-31T08:54:00.000Z
#!/usr/bin/env python import os import subprocess import sys from dbusmock import DBusTestCase from lib.config import is_verbose_mode def stop(): DBusTestCase.stop_dbus(DBusTestCase.system_bus_pid) DBusTestCase.stop_dbus(DBusTestCase.session_bus_pid) def start(): log = sys.stdout if is_verbose_mode() else open(os.devnull, 'w') DBusTestCase.start_system_bus() DBusTestCase.spawn_server_template('logind', None, log) DBusTestCase.start_session_bus() DBusTestCase.spawn_server_template('notification_daemon', None, log) if __name__ == '__main__': start() try: subprocess.check_call(sys.argv[1:]) finally: stop()
22.5
72
0.734815
import os import subprocess import sys from dbusmock import DBusTestCase from lib.config import is_verbose_mode def stop(): DBusTestCase.stop_dbus(DBusTestCase.system_bus_pid) DBusTestCase.stop_dbus(DBusTestCase.session_bus_pid) def start(): log = sys.stdout if is_verbose_mode() else open(os.devnull, 'w') DBusTestCase.start_system_bus() DBusTestCase.spawn_server_template('logind', None, log) DBusTestCase.start_session_bus() DBusTestCase.spawn_server_template('notification_daemon', None, log) if __name__ == '__main__': start() try: subprocess.check_call(sys.argv[1:]) finally: stop()
true
true
f7246744af0401037d527244f3f9bd85914a3e69
3,357
py
Python
train_scripts/lognet.py
franciscovargas/TeviotDataScienceGame
77bdffb87b2a25490ca175b3a2f96459067e4ccb
[ "MIT" ]
null
null
null
train_scripts/lognet.py
franciscovargas/TeviotDataScienceGame
77bdffb87b2a25490ca175b3a2f96459067e4ccb
[ "MIT" ]
null
null
null
train_scripts/lognet.py
franciscovargas/TeviotDataScienceGame
77bdffb87b2a25490ca175b3a2f96459067e4ccb
[ "MIT" ]
null
null
null
from keras.layers.convolutional import Convolution2D from keras.layers.convolutional import MaxPooling2D from keras.models import Sequential from keras.layers import Dense, Dropout, Activation, Flatten from keras.optimizers import SGD, Adam import numpy as np import theano as th from keras.utils.np_utils import to_categorical from keras.regularizers import l2 import cPickle as pkl from dutils import subtools from keras.preprocessing.image import ImageDataGenerator LoG = np.array([[0, 1,0], [1,-4,1], [0, 1,0]]) Lox = np.array([[-1, 0,1], [-2, 0,2], [-1, 0,1]]) Loy = np.array([[1, 2,1], [0, 0,0], [-1, -2,-1]]) sha = np.array([[0, -1,0], [-1,5,-1], [0, -1,0]]) avg = (1/25.0)*np.ones((5,5)) weight = np.array([LoG for c in range(3)]) # weight = np.array([LoG, Lox, Loy]) # weights.swapaxes(0,-1) weights = np.array([weight for c in range(10)]) weight1 = np.array([avg for c in range(10)]) # weights.swapaxes(0,-1) weights1 = np.array([weight1 for c in range(10)]) """ CNN Layer signature Convolution1D(nb_filter, filter_length, init='uniform', activation='linear', weights=None, border_mode='valid', subsample_length=1, W_regularizer=None, b_regularizer=None, activity_regularizer=None, W_constraint=None, b_constraint=None, bias=True, input_dim=None, input_length=None) """ model = Sequential() model.add(Convolution2D(nb_filter=10,border_mode='valid',nb_row=3,nb_col=3 , input_shape=(3,64,64), weights=[weights, np.array([0]*10) ]) ) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2, 2))) model.add(Convolution2D(nb_filter=32,border_mode='valid', nb_row=5, nb_col=5,init="glorot_normal")) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2, 2))) # model.add(Convolution2D(nb_filter=10,border_mode='valid', # nb_row=5, nb_col=5,W_regularizer=l2(0.01))) # model.add(Activation('relu')) # model.add(MaxPooling2D(pool_size=(2, 2))) model.add(Flatten()) # MLP model.add(Dense(200, W_regularizer=l2(0.01), init="glorot_normal" )) model.add(Activation('relu')) model.add(Dropout(0.5)) #Classification Layer model.add(Dense(4)) model.add(Activation('softmax')) # compile model sgd = SGD(lr=0.25) adam = Adam(lr=0.1) model.compile(optimizer='rmsprop', loss='categorical_crossentropy', metrics=['accuracy']) print "loading train" trainX = pkl.load(open("../data/pkl/trainX.pkl")) print "done loading train" trainX=trainX.transpose(0,3,1,2) trainY = pkl.load(open("../data/pkl/trainY.pkl")) datagen = ImageDataGenerator( horizontal_flip=True, rotation_range=5, zoom_range=0.2,vertical_flip=True) datagen.fit(trainX) print "GENERATED" generator = datagen.flow(trainX, to_categorical(trainY-1,4) , batch_size=32) model.fit_generator(generator, samples_per_epoch=len(trainX), nb_epoch=155) testX = pkl.load(open("../data/pkl/testX.pkl")) testX=testX.transpose(0,3,1,2) results = np.argmax(model.predict(testX),axis=-1) +1 subtools.create_submision(results,sub=233)
24.683824
97
0.634793
from keras.layers.convolutional import Convolution2D from keras.layers.convolutional import MaxPooling2D from keras.models import Sequential from keras.layers import Dense, Dropout, Activation, Flatten from keras.optimizers import SGD, Adam import numpy as np import theano as th from keras.utils.np_utils import to_categorical from keras.regularizers import l2 import cPickle as pkl from dutils import subtools from keras.preprocessing.image import ImageDataGenerator LoG = np.array([[0, 1,0], [1,-4,1], [0, 1,0]]) Lox = np.array([[-1, 0,1], [-2, 0,2], [-1, 0,1]]) Loy = np.array([[1, 2,1], [0, 0,0], [-1, -2,-1]]) sha = np.array([[0, -1,0], [-1,5,-1], [0, -1,0]]) avg = (1/25.0)*np.ones((5,5)) weight = np.array([LoG for c in range(3)]) weights = np.array([weight for c in range(10)]) weight1 = np.array([avg for c in range(10)]) weights1 = np.array([weight1 for c in range(10)]) """ CNN Layer signature Convolution1D(nb_filter, filter_length, init='uniform', activation='linear', weights=None, border_mode='valid', subsample_length=1, W_regularizer=None, b_regularizer=None, activity_regularizer=None, W_constraint=None, b_constraint=None, bias=True, input_dim=None, input_length=None) """ model = Sequential() model.add(Convolution2D(nb_filter=10,border_mode='valid',nb_row=3,nb_col=3 , input_shape=(3,64,64), weights=[weights, np.array([0]*10) ]) ) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2, 2))) model.add(Convolution2D(nb_filter=32,border_mode='valid', nb_row=5, nb_col=5,init="glorot_normal")) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2, 2))) model.add(Flatten()) model.add(Dense(200, W_regularizer=l2(0.01), init="glorot_normal" )) model.add(Activation('relu')) model.add(Dropout(0.5)) model.add(Dense(4)) model.add(Activation('softmax')) sgd = SGD(lr=0.25) adam = Adam(lr=0.1) model.compile(optimizer='rmsprop', loss='categorical_crossentropy', metrics=['accuracy']) print "loading train" trainX = pkl.load(open("../data/pkl/trainX.pkl")) print "done loading train" trainX=trainX.transpose(0,3,1,2) trainY = pkl.load(open("../data/pkl/trainY.pkl")) datagen = ImageDataGenerator( horizontal_flip=True, rotation_range=5, zoom_range=0.2,vertical_flip=True) datagen.fit(trainX) print "GENERATED" generator = datagen.flow(trainX, to_categorical(trainY-1,4) , batch_size=32) model.fit_generator(generator, samples_per_epoch=len(trainX), nb_epoch=155) testX = pkl.load(open("../data/pkl/testX.pkl")) testX=testX.transpose(0,3,1,2) results = np.argmax(model.predict(testX),axis=-1) +1 subtools.create_submision(results,sub=233)
false
true
f724678f5e7ade231a5e84c6bdf82ae0868ec843
40,659
py
Python
applications/admin/languages/he.py
misl6/web2py
4191d4c48c37c66cc7eb293b610a6b6e86870571
[ "BSD-3-Clause" ]
1
2019-09-05T03:54:51.000Z
2019-09-05T03:54:51.000Z
applications/admin/languages/he.py
misl6/web2py
4191d4c48c37c66cc7eb293b610a6b6e86870571
[ "BSD-3-Clause" ]
null
null
null
applications/admin/languages/he.py
misl6/web2py
4191d4c48c37c66cc7eb293b610a6b6e86870571
[ "BSD-3-Clause" ]
1
2019-09-05T03:54:52.000Z
2019-09-05T03:54:52.000Z
# -*- coding: utf-8 -*- { '!langcode!': 'he-il', '!langname!': 'עברית', '"update" is an optional expression like "field1=\'newvalue\'". You cannot update or delete the results of a JOIN': '"עדכן" הוא ביטוי אופציונאלי, כגון "field1=newvalue". אינך יוכל להשתמש בjoin, בעת שימוש ב"עדכן" או "מחק".', '"User Exception" debug mode. ': '"User Exception" debug mode. ', '%s': '%s', '%s %%{row} deleted': '%s רשומות נמחקו', '%s %%{row} updated': '%s רשומות עודכנו', '%s selected': '%s selected', '%s students registered': '%s students registered', '%Y-%m-%d': '%Y-%m-%d', '%Y-%m-%d %H:%M:%S': '%Y-%m-%d %H:%M:%S', '(requires internet access)': '(requires internet access)', '(requires internet access, experimental)': '(requires internet access, experimental)', '(something like "it-it")': '(למשל "it-it")', '(version %s)': '(version %s)', '?': '?', '@markmin\x01(**%.0d MB**)': '(**%.0d MB**)', '@markmin\x01(file **gluon/contrib/plural_rules/%s.py** is not found)': '(file **gluon/contrib/plural_rules/%s.py** is not found)', '@markmin\x01**%(items)s** %%{item(items)}, **%(bytes)s** %%{byte(bytes)}': '**%(items)s** %%{item(items)}, **%(bytes)s** %%{byte(bytes)}', '@markmin\x01**%(items)s** items, **%(bytes)s** %%{byte(bytes)}': '**%(items)s** items, **%(bytes)s** %%{byte(bytes)}', '@markmin\x01**not available** (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)': '**not available** (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)', '@markmin\x01``**not available**``:red (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)': '``**not available**``:red (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)', '@markmin\x01An error occured, please [[reload %s]] the page': 'An error occured, please [[reload %s]] the page', '@markmin\x01Cache contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.': 'Cache contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.', '@markmin\x01DISK contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.': 'DISK contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.', '@markmin\x01Hit Ratio: **%(ratio)s%%** (**%(hits)s** %%{hit(hits)} and **%(misses)s** %%{miss(misses)})': 'Hit Ratio: **%(ratio)s%%** (**%(hits)s** %%{hit(hits)} and **%(misses)s** %%{miss(misses)})', "@markmin\x01Mercurial Version Control System Interface[[NEWLINE]]for application '%s'": "Mercurial Version Control System Interface[[NEWLINE]]for application '%s'", '@markmin\x01Number of entries: **%s**': 'Number of entries: **%s**', '@markmin\x01Please [[refresh %s]] this page to see if a breakpoint was hit and debug interaction is required.': 'Please [[refresh %s]] this page to see if a breakpoint was hit and debug interaction is required.', '@markmin\x01RAM contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.': 'RAM contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.', '@markmin\x01Searching: **%s** %%{file}': 'Searching: **%s** files', '@markmin\x01You need to set up and reach a [[breakpoint %s]] to use the debugger!': 'You need to set up and reach a [[breakpoint %s]] to use the debugger!', 'A new password was emailed to you': 'A new password was emailed to you', 'A new version of web2py is available: %s': 'גירסא חדשה של web2py זמינה: %s', 'Abort': 'Abort', 'About': 'אודות', 'About application': 'אודות אפליקציה', 'Accept Terms': 'Accept Terms', 'Add breakpoint': 'Add breakpoint', 'additional code for your application': 'קוד נוסף עבור האפליקציה שלך', 'Additional code for your application': 'Additional code for your application', 'Admin design page': 'Admin design page', 'admin disabled because no admin password': 'ממשק המנהל מנוטרל כי לא הוגדרה סיסמת מנהל', 'admin disabled because not supported on google app engine': 'ממשק המנהל נוטרל, כי אין תמיכה בGoogle app engine', 'admin disabled because too many invalid login attempts': 'admin disabled because too many invalid login attempts', 'admin disabled because unable to access password file': 'ממשק מנהל נוטרל, כי לא ניתן לגשת לקובץ הסיסמאות', 'Admin is disabled because insecure channel': 'ממשק האדמין נוטרל בשל גישה לא מאובטחת', 'Admin language': 'Admin language', 'Admin versioning page': 'Admin versioning page', 'administrative interface': 'administrative interface', 'Administrator Password:': 'סיסמת מנהל', 'and rename it (required):': 'ושנה את שמו (חובה):', 'and rename it:': 'ושנה את שמו:', 'App does not exist or you are not authorized': 'App does not exist or you are not authorized', 'appadmin': 'מנהל מסד הנתונים', 'appadmin is disabled because insecure channel': 'מנהל מסד הנתונים נוטרל בשל ערוץ לא מאובטח', 'Application': 'Application', 'application "%s" uninstalled': 'אפליקציה "%s" הוסרה', 'Application cannot be generated in demo mode': 'Application cannot be generated in demo mode', 'application compiled': 'אפליקציה קומפלה', 'Application exists already': 'Application exists already', 'application is compiled and cannot be designed': 'לא ניתן לערוך אפליקציה מקומפלת', 'Application name:': 'Application name:', 'Application updated via git pull': 'Application updated via git pull', 'Apply changes': 'Apply changes', 'are not used': 'are not used', 'are not used yet': 'are not used yet', 'Are you sure you want to delete file "%s"?': 'האם אתה בטוח שברצונך למחוק את הקובץ "%s"?', 'Are you sure you want to delete plugin "%s"?': 'האם אתה בטוח שברצונך למחוק את התוסף "%s"?', 'Are you sure you want to delete this object?': 'Are you sure you want to delete this object?', 'Are you sure you want to uninstall application "%s"?': 'האם אתה בטוח שברצונך להסיר את האפליקציה "%s"?', 'Are you sure you want to upgrade web2py now?': 'האם אתה בטוח שאתה רוצה לשדרג את web2py עכשיו?', 'Are you sure?': 'Are you sure?', 'arguments': 'פרמטרים', 'at char %s': 'at char %s', 'at line %s': 'at line %s', 'ATTENTION:': 'ATTENTION:', 'ATTENTION: Login requires a secure (HTTPS) connection or running on localhost.': 'לתשומת ליבך: ניתן להתחבר רק בערוץ מאובטח (HTTPS) או מlocalhost', 'ATTENTION: TESTING IS NOT THREAD SAFE SO DO NOT PERFORM MULTIPLE TESTS CONCURRENTLY.': 'לתשומת ליבך: אין לערוך מספר בדיקות במקביל, שכן הן עשויות להפריע זו לזו', 'ATTENTION: you cannot edit the running application!': 'לתשומת ליבך: לא ניתן לערוך אפליקציה בזמן הרצתה', 'Authentication code': 'Authentication code', 'Autocomplete Python Code': 'Autocomplete Python Code', 'Available databases and tables': 'מסדי נתונים וטבלאות זמינים', 'Available Databases and Tables': 'Available Databases and Tables', 'back': 'אחורה', 'Back to the plugins list': 'Back to the plugins list', 'Back to wizard': 'Back to wizard', 'Basics': 'Basics', 'Begin': 'Begin', 'breakpoint': 'breakpoint', 'Breakpoints': 'Breakpoints', 'breakpoints': 'breakpoints', 'Bulk Register': 'Bulk Register', 'Bulk Student Registration': 'Bulk Student Registration', 'Cache': 'Cache', 'cache': 'מטמון', 'Cache Cleared': 'Cache Cleared', 'Cache Keys': 'Cache Keys', 'cache, errors and sessions cleaned': 'מטמון, שגיאות וסשן נוקו', 'can be a git repo': 'can be a git repo', 'Cancel': 'Cancel', 'Cannot be empty': 'אינו יכול להישאר ריק', 'Cannot compile: there are errors in your app:': 'לא ניתן לקמפל: ישנן שגיאות באפליקציה שלך:', 'cannot create file': 'לא מצליח ליצור קובץ', 'cannot upload file "%(filename)s"': 'לא הצלחתי להעלות את הקובץ "%(filename)s"', 'Change Admin Password': 'Change Admin Password', 'Change admin password': 'סיסמת מנהל שונתה', 'change editor settings': 'change editor settings', 'Change password': 'Change password', 'Changelog': 'Changelog', 'check all': 'סמן הכל', 'Check for upgrades': 'check for upgrades', 'Check to delete': 'סמן כדי למחוק', 'Checking for upgrades...': 'מחפש עדכונים', 'Clean': 'נקה', 'Clear': 'Clear', 'Clear CACHE?': 'Clear CACHE?', 'Clear DISK': 'Clear DISK', 'Clear RAM': 'Clear RAM', 'Click on the link %(link)s to reset your password': 'Click on the link %(link)s to reset your password', 'Click row to expand traceback': 'Click row to expand traceback', 'Click row to view a ticket': 'Click row to view a ticket', 'click to check for upgrades': 'לחץ כדי לחפש עדכונים', 'Client IP': 'Client IP', 'code': 'קוד', 'Code listing': 'Code listing', 'collapse/expand all': 'collapse/expand all', 'Command': 'Command', 'Comment:': 'Comment:', 'Commit': 'Commit', 'Commit form': 'Commit form', 'Committed files': 'Committed files', 'Compile': 'קמפל', 'Compile (all or nothing)': 'Compile (all or nothing)', 'Compile (skip failed views)': 'Compile (skip failed views)', 'compiled application removed': 'אפליקציה מקומפלת הוסרה', 'Condition': 'Condition', 'continue': 'continue', 'Controllers': 'בקרים', 'controllers': 'בקרים', 'Count': 'Count', 'Create': 'צור', 'create file with filename:': 'צור קובץ בשם:', 'create new application:': 'צור אפליקציה חדשה:', 'Create new simple application': 'צור אפליקציה חדשה', 'Create/Upload': 'Create/Upload', 'created by': 'נוצר ע"י', 'Created by:': 'Created by:', 'Created On': 'Created On', 'Created on:': 'Created on:', 'crontab': 'משימות מתוזמנות', 'Current request': 'בקשה נוכחית', 'Current response': 'מענה נוכחי', 'Current session': 'סשן זה', 'currently running': 'currently running', 'currently saved or': 'נשמר כעת או', 'data uploaded': 'המידע הועלה', 'Database': 'Database', 'database': 'מסד נתונים', 'Database %s select': 'Database %s select', 'database %s select': 'מסד הנתונים %s נבחר', 'Database administration': 'Database administration', 'database administration': 'ניהול מסד נתונים', 'Database Administration (appadmin)': 'Database Administration (appadmin)', 'Date and Time': 'תאריך ושעה', 'db': 'מסד נתונים', 'Debug': 'Debug', 'defines tables': 'הגדר טבלאות', 'Delete': 'מחק', 'delete': 'מחק', 'delete all checked': 'סמן הכל למחיקה', 'delete plugin': 'מחק תוסף', 'Delete this file (you will be asked to confirm deletion)': 'Delete this file (you will be asked to confirm deletion)', 'Delete:': 'מחק:', 'deleted after first hit': 'deleted after first hit', 'Demo': 'Demo', 'Deploy': 'deploy', 'Deploy on Google App Engine': 'העלה ל Google App Engine', 'Deploy to OpenShift': 'Deploy to OpenShift', 'Deploy to pythonanywhere': 'Deploy to pythonanywhere', 'Deploy to PythonAnywhere': 'Deploy to PythonAnywhere', 'Deployment form': 'Deployment form', 'Deployment Interface': 'Deployment Interface', 'Description': 'Description', 'Description:': 'Description:', 'design': 'עיצוב', 'Detailed traceback description': 'Detailed traceback description', 'details': 'details', 'direction: ltr': 'direction: rtl', 'directory not found': 'directory not found', 'Disable': 'Disable', 'Disabled': 'Disabled', 'disabled in demo mode': 'disabled in demo mode', 'disabled in GAE mode': 'disabled in GAE mode', 'disabled in multi user mode': 'disabled in multi user mode', 'DISK': 'DISK', 'Disk Cache Keys': 'Disk Cache Keys', 'Disk Cleared': 'Disk Cleared', 'Display line numbers': 'Display line numbers', 'DO NOT use the "Pack compiled" feature.': 'DO NOT use the "Pack compiled" feature.', 'docs': 'docs', 'Docs': 'Docs', 'done!': 'הסתיים!', 'Downgrade': 'Downgrade', 'Download .w2p': 'Download .w2p', 'Download as .exe': 'Download as .exe', 'download layouts': 'download layouts', 'Download layouts from repository': 'Download layouts from repository', 'download plugins': 'download plugins', 'Download plugins from repository': 'Download plugins from repository', 'E-mail': 'E-mail', 'EDIT': 'ערוך!', 'Edit': 'ערוך', 'edit all': 'edit all', 'Edit application': 'ערוך אפליקציה', 'edit controller': 'ערוך בקר', 'edit controller:': 'edit controller:', 'Edit current record': 'ערוך רשומה נוכחית', 'edit views:': 'ערוך קיבצי תצוגה:', 'Editing %s': 'Editing %s', 'Editing file "%s"': 'עורך את הקובץ "%s"', 'Editing Language file': 'עורך את קובץ השפה', 'Editing Plural Forms File': 'Editing Plural Forms File', 'Editor': 'Editor', 'Email Address': 'Email Address', 'Email sent': 'Email sent', 'Email verification': 'Email verification', 'Email verified': 'Email verified', 'Enable': 'Enable', 'Enable Close-Tag': 'Enable Close-Tag', 'Enable Code Folding': 'Enable Code Folding', 'Enterprise Web Framework': 'סביבת הפיתוח לרשת', 'Error': 'Error', 'Error logs for "%(app)s"': 'דו"ח שגיאות עבור אפליקציה "%(app)s"', 'Error snapshot': 'Error snapshot', 'Error ticket': 'Error ticket', 'Errors': 'שגיאות', 'Exception %(extype)s: %(exvalue)s': 'Exception %(extype)s: %(exvalue)s', 'Exception %s': 'Exception %s', 'Exception instance attributes': 'נתוני החריגה', 'Exit Fullscreen': 'Exit Fullscreen', 'Expand Abbreviation (html files only)': 'Expand Abbreviation (html files only)', 'export as csv file': 'יצא לקובץ csv', 'Exports:': 'Exports:', 'exposes': 'חושף את', 'exposes:': 'exposes:', 'extends': 'הרחבה של', 'failed to compile file because:': 'failed to compile file because:', 'failed to reload module because:': 'נכשל בטעינה חוזרת של מודול בגלל:', 'File': 'File', 'file "%(filename)s" created': 'הקובץ "%(filename)s" נוצר', 'file "%(filename)s" deleted': 'הקובץ "%(filename)s" נמחק', 'file "%(filename)s" uploaded': 'הקובץ "%(filename)s" הועלה', 'file "%s" of %s restored': 'הקובץ "%s" of %s שוחזר', 'file changed on disk': 'קובץ שונה על גבי הדיסק', 'file does not exist': 'קובץ לא נמצא', 'file not found': 'file not found', 'file saved on %(time)s': 'הקובץ נשמר בשעה %(time)s', 'file saved on %s': 'הקובץ נשמר ב%s', 'filename': 'filename', 'Filename': 'Filename', 'Files added': 'Files added', 'filter': 'filter', 'Find Next': 'Find Next', 'Find Previous': 'Find Previous', 'First name': 'First name', 'Form has errors': 'Form has errors', 'Frames': 'Frames', 'Function disabled': 'Function disabled', 'Functions with no doctests will result in [passed] tests.': 'פונקציות שלא הוגדר להן doctest ירשמו כבדיקות ש[עברו בהצלחה].', 'GAE Email': 'GAE Email', 'GAE Output': 'GAE Output', 'GAE Password': 'GAE Password', 'Generate': 'Generate', 'Git Pull': 'Git Pull', 'Git Push': 'Git Push', 'Globals##debug': 'Globals##debug', 'go!': 'go!', 'Google App Engine Deployment Interface': 'Google App Engine Deployment Interface', 'Google Application Id': 'Google Application Id', 'Goto': 'Goto', 'graph model': 'graph model', 'Graph Model': 'Graph Model', 'Group %(group_id)s created': 'Group %(group_id)s created', 'Group %(group_id)s deleted': 'Group %(group_id)s deleted', 'Group ID': 'Group ID', 'Group uniquely assigned to user %(id)s': 'Group uniquely assigned to user %(id)s', 'Help': 'עזרה', 'here': 'here', 'Hide/Show Translated strings': 'Hide/Show Translated strings', 'Highlight current line': 'Highlight current line', 'Hits': 'Hits', 'Home': 'Home', 'honored only if the expression evaluates to true': 'honored only if the expression evaluates to true', 'htmledit': 'עורך ויזואלי', 'If start the downgrade, be patient, it may take a while to rollback': 'If start the downgrade, be patient, it may take a while to rollback', 'If start the upgrade, be patient, it may take a while to download': 'If start the upgrade, be patient, it may take a while to download', 'If the report above contains a ticket number it indicates a failure in executing the controller, before any attempt to execute the doctests. This is usually due to an indentation error or an error outside function code.\n\t\tA green title indicates that all tests (if defined) passed. In this case test results are not shown.': 'If the report above contains a ticket number it indicates a failure in executing the controller, before any attempt to execute the doctests. This is usually due to an indentation error or an error outside function code.\n\t\tA green title indicates that all tests (if defined) passed. In this case test results are not shown.', 'If the report above contains a ticket number it indicates a failure in executing the controller, before any attempt to execute the doctests. This is usually due to an indentation error or an error outside function code.\nA green title indicates that all tests (if defined) passed. In this case test results are not shown.': 'אם בדו"ח לעיל מופיע מספר דו"ח שגיאה, זה מצביע על שגיאה בבקר, עוד לפני שניתן היה להריץ את הdoctest. לרוב מדובר בשגיאת הזחה, או שגיאה שאינה בקוד של הפונקציה.\r\nכותרת ירוקה מצביע על כך שכל הבדיקות (אם הוגדרו) עברו בהצלחה, במידה ותוצאות הבדיקה אינן מופיעות.', 'if your application uses a database other than sqlite you will then have to configure its DAL in pythonanywhere.': 'if your application uses a database other than sqlite you will then have to configure its DAL in pythonanywhere.', 'import': 'import', 'Import/Export': 'יבא\\יצא', 'In development, use the default Rocket webserver that is currently supported by this debugger.': 'In development, use the default Rocket webserver that is currently supported by this debugger.', 'includes': 'מכיל', 'Incorrect code. {0} more attempt(s) remaining.': 'Incorrect code. {0} more attempt(s) remaining.', 'Indent with tabs': 'Indent with tabs', 'insert new': 'הכנס נוסף', 'insert new %s': 'הכנס %s נוסף', 'inspect attributes': 'inspect attributes', 'Install': 'התקן', 'Installation of %(plugin)s for %(app)s': 'Installation of %(plugin)s for %(app)s', 'Installed applications': 'אפליקציות מותקנות', 'Insufficient privileges': 'Insufficient privileges', 'Interaction at %s line %s': 'Interaction at %s line %s', 'Interactive console': 'Interactive console', 'internal error': 'שגיאה מובנית', 'internal error: %s': 'internal error: %s', 'Internal State': 'מצב מובנה', 'Invalid action': 'הוראה לא קיימת', 'Invalid application name': 'Invalid application name', 'invalid circular reference': 'invalid circular reference', 'Invalid email': 'Invalid email', 'Invalid git repository specified.': 'Invalid git repository specified.', 'Invalid key': 'Invalid key', 'Invalid login': 'Invalid login', 'invalid password': 'סיסמא שגויה', 'Invalid password': 'Invalid password', 'invalid password.': 'invalid password.', 'Invalid Query': 'שאילתה לא תקינה', 'invalid request': 'בקשה לא תקינה', 'Invalid request': 'Invalid request', 'Invalid reset password': 'Invalid reset password', 'invalid table names (auth_* tables already defined)': 'invalid table names (auth_* tables already defined)', 'invalid ticket': 'דו"ח שגיאה לא קיים', 'Invalid user': 'Invalid user', 'Invalid username': 'Invalid username', 'Invitation to join %(site)s': 'Invitation to join %(site)s', 'Key': 'Key', 'Key verified': 'Key verified', 'Keyboard shortcuts': 'Keyboard shortcuts', 'kill process': 'kill process', 'language file "%(filename)s" created/updated': 'קובץ השפה "%(filename)s" נוצר\\עודכן', 'Language files (static strings) updated': 'קובץ השפה (מחרוזות סטאטיות) עודכן', 'languages': 'שפות', 'Languages': 'שפות', 'Last name': 'Last name', 'Last Revision': 'Last Revision', 'Last saved on:': 'לאחרונה נשמר בתאריך:', 'License for': 'רשיון עבור', 'License:': 'License:', 'Line Nr': 'Line Nr', 'Line number': 'Line number', 'lists by exception': 'lists by exception', 'lists by ticket': 'lists by ticket', 'Loading...': 'Loading...', 'loading...': 'טוען...', 'Local Apps': 'Local Apps', 'locals': 'locals', 'Locals##debug': 'Locals##debug', 'Log In': 'Log In', 'Logged in': 'Logged in', 'Logged out': 'Logged out', 'Login': 'התחבר', 'login': 'התחבר', 'Login disabled by administrator': 'Login disabled by administrator', 'Login successful': 'Login successful', 'Login to the Administrative Interface': 'התחבר לממשק המנהל', 'Login/Register': 'Login/Register', 'Logout': 'התנתק', 'lost password': 'lost password', 'Main Menu': 'Main Menu', 'Manage': 'Manage', 'Manage %(action)s': 'Manage %(action)s', 'Manage Access Control': 'Manage Access Control', 'Manage Admin Users/Students': 'Manage Admin Users/Students', 'Manage Cache': 'Manage Cache', 'Manage Students': 'Manage Students', 'Memberships': 'Memberships', 'merge': 'מזג', 'Models': 'מבני נתונים', 'models': 'מבני נתונים', 'Modified On': 'Modified On', 'Modules': 'מודולים', 'modules': 'מודולים', 'Multi User Mode': 'Multi User Mode', 'Name': 'Name', 'new application "%s" created': 'האפליקציה "%s" נוצרה', 'new application "%s" imported': 'new application "%s" imported', 'New Application Wizard': 'New Application Wizard', 'New application wizard': 'New application wizard', 'New password': 'New password', 'new plugin installed': 'פלאגין חדש הותקן', 'New plugin installed: %s': 'New plugin installed: %s', 'New Record': 'רשומה חדשה', 'new record inserted': 'הרשומה נוספה', 'New simple application': 'New simple application', 'next': 'next', 'next %s rows': 'next %s rows', 'next 100 rows': '100 הרשומות הבאות', 'NO': 'לא', 'no changes': 'no changes', 'No databases in this application': 'אין מסדי נתונים לאפליקציה זו', 'No Interaction yet': 'No Interaction yet', 'no match': 'לא נמצאה התאמה', 'no package selected': 'no package selected', 'no permission to uninstall "%s"': 'no permission to uninstall "%s"', 'Node:': 'Node:', 'Not Authorized': 'Not Authorized', 'Not supported': 'Not supported', 'Note: If you receive an error with github status code of 128, ensure the system and account you are deploying from has a cooresponding ssh key configured in the openshift account.': 'Note: If you receive an error with github status code of 128, ensure the system and account you are deploying from has a cooresponding ssh key configured in the openshift account.', 'Object or table name': 'Object or table name', 'Old password': 'Old password', "On production, you'll have to configure your webserver to use one process and multiple threads to use this debugger.": "On production, you'll have to configure your webserver to use one process and multiple threads to use this debugger.", 'Open new app in new window': 'Open new app in new window', 'OpenShift Deployment Interface': 'OpenShift Deployment Interface', 'OpenShift Output': 'OpenShift Output', 'or alternatively': 'or alternatively', 'Or Get from URL:': 'Or Get from URL:', 'or import from csv file': 'או יבא מקובץ csv', 'or provide app url:': 'או ספק כתובת url של אפליקציה', 'Origin': 'Origin', 'Original/Translation': 'מקור\\תרגום', 'Overview': 'Overview', 'Overwrite installed app': 'התקן על גבי אפלקציה מותקנת', 'Pack all': 'ארוז הכל', 'Pack compiled': 'ארוז מקומפל', 'Pack custom': 'Pack custom', 'pack plugin': 'ארוז תוסף', 'PAM authenticated user, cannot change password here': 'שינוי סיסמא באמצעות PAM אינו יכול להתבצע כאן', 'Password': 'Password', 'password changed': 'סיסמא שונתה', 'Password changed': 'Password changed', "Password fields don't match": "Password fields don't match", 'Password reset': 'Password reset', 'Password retrieve': 'Password retrieve', 'Past revisions': 'Past revisions', 'Path to appcfg.py': 'Path to appcfg.py', 'Path to local openshift repo root.': 'Path to local openshift repo root.', 'Peeking at file': 'מעיין בקובץ', 'Permission': 'Permission', 'Permissions': 'Permissions', 'Please': 'Please', 'please input your password again': 'please input your password again', 'Please wait, giving pythonanywhere a moment...': 'Please wait, giving pythonanywhere a moment...', 'plugin "%(plugin)s" deleted': 'תוסף "%(plugin)s" נמחק', 'Plugin "%s" in application': 'פלאגין "%s" של אפליקציה', 'plugin not specified': 'plugin not specified', 'Plugin page': 'Plugin page', 'plugins': 'plugins', 'Plugins': 'תוספים', 'Plural Form #%s': 'Plural Form #%s', 'Plural-Forms:': 'Plural-Forms:', 'Powered by': 'מופעל ע"י', 'Preferences saved correctly': 'Preferences saved correctly', 'Preferences saved on session only': 'Preferences saved on session only', 'previous %s rows': 'previous %s rows', 'previous 100 rows': '100 הרשומות הקודמות', 'Private files': 'Private files', 'private files': 'private files', 'Profile updated': 'Profile updated', 'Project Progress': 'Project Progress', 'Pull': 'Pull', 'Pull failed, certain files could not be checked out. Check logs for details.': 'Pull failed, certain files could not be checked out. Check logs for details.', 'Pull is not possible because you have unmerged files. Fix them up in the work tree, and then try again.': 'Pull is not possible because you have unmerged files. Fix them up in the work tree, and then try again.', 'Push': 'Push', 'Push failed, there are unmerged entries in the cache. Resolve merge issues manually and try again.': 'Push failed, there are unmerged entries in the cache. Resolve merge issues manually and try again.', 'pygraphviz library not found': 'pygraphviz library not found', 'PythonAnywhere Apps': 'PythonAnywhere Apps', 'PythonAnywhere Password': 'PythonAnywhere Password', 'Query:': 'שאילתה:', 'RAM': 'RAM', 'RAM Cache Keys': 'RAM Cache Keys', 'Ram Cleared': 'Ram Cleared', 'Rapid Search': 'Rapid Search', 'Record': 'Record', 'record': 'רשומה', 'Record %(id)s created': 'Record %(id)s created', 'Record %(id)s deleted': 'Record %(id)s deleted', 'Record %(id)s read': 'Record %(id)s read', 'Record %(id)s updated': 'Record %(id)s updated', 'Record Created': 'Record Created', 'Record Deleted': 'Record Deleted', 'record does not exist': 'הרשומה אינה קיימת', 'record id': 'מזהה רשומה', 'Record id': 'Record id', 'Record ID': 'Record ID', 'Record Updated': 'Record Updated', 'refresh': 'refresh', 'register': 'register', 'Registration identifier': 'Registration identifier', 'Registration is pending approval': 'Registration is pending approval', 'Registration key': 'Registration key', 'Registration needs verification': 'Registration needs verification', 'Registration successful': 'Registration successful', 'Reload routes': 'Reload routes', 'Remember me (for 30 days)': 'Remember me (for 30 days)', 'Remove compiled': 'הסר מקומפל', 'Removed Breakpoint on %s at line %s': 'Removed Breakpoint on %s at line %s', 'Replace': 'Replace', 'Replace All': 'Replace All', 'Repository (%s)': 'Repository (%s)', 'request': 'request', 'Request reset password': 'Request reset password', 'requires distutils, but not installed': 'requires distutils, but not installed', 'requires python-git, but not installed': 'requires python-git, but not installed', 'Reset Password key': 'Reset Password key', 'Resolve Conflict file': 'הסר קובץ היוצר קונפליקט', 'response': 'response', 'restart': 'restart', 'restore': 'שחזר', 'return': 'return', 'Revert': 'Revert', 'revert': 'חזור לגירסא קודמת', 'reverted to revision %s': 'reverted to revision %s', 'Revision %s': 'Revision %s', 'Revision:': 'Revision:', 'Role': 'Role', 'Roles': 'Roles', 'Rows in Table': 'Rows in Table', 'Rows in table': 'רשומות בטבלה', 'Rows selected': 'רשומות נבחרו', 'rules are not defined': 'rules are not defined', 'Run tests': 'Run tests', 'Run tests in this file': 'Run tests in this file', "Run tests in this file (to run all files, you may also use the button labelled 'test')": "Run tests in this file (to run all files, you may also use the button labelled 'test')", 'Running on %s': 'Running on %s', 'Save': 'Save', 'Save file:': 'Save file:', 'Save file: %s': 'Save file: %s', 'Save model as...': 'Save model as...', 'Save via Ajax': 'Save via Ajax', 'Saved file hash:': 'גיבוב הקובץ השמור:', 'Screenshot %s': 'Screenshot %s', 'Search': 'Search', 'Select Files to Package': 'Select Files to Package', 'selected': 'נבחרו', 'session': 'session', 'session expired': 'תם הסשן', 'Session saved correctly': 'Session saved correctly', 'Session saved on session only': 'Session saved on session only', 'Set Breakpoint on %s at line %s: %s': 'Set Breakpoint on %s at line %s: %s', 'shell': 'שורת פקודה', 'Showing %s to %s of %s %s found': 'Showing %s to %s of %s %s found', 'Sign Up': 'Sign Up', 'Singular Form': 'Singular Form', 'Site': 'אתר', 'Size of cache:': 'Size of cache:', 'skip to generate': 'skip to generate', 'some files could not be removed': 'לא ניתן היה להסיר חלק מהקבצים', 'Something went wrong please wait a few minutes before retrying': 'Something went wrong please wait a few minutes before retrying', 'Sorry, could not find mercurial installed': 'Sorry, could not find mercurial installed', 'source : db': 'source : db', 'source : filesystem': 'source : filesystem', 'Start a new app': 'Start a new app', 'Start searching': 'Start searching', 'Start wizard': 'start wizard', 'state': 'מצב', 'Static': 'Static', 'static': 'קבצים סטאטיים', 'Static files': 'קבצים סטאטיים', 'Statistics': 'Statistics', 'Step': 'Step', 'step': 'step', 'stop': 'stop', 'submit': 'שלח', 'Submit': 'Submit', 'successful': 'successful', 'Sure you want to delete this object?': 'האם אתה בטוח שברצונך למחוק אובייקט זה?', 'switch to : db': 'switch to : db', 'switch to : filesystem': 'switch to : filesystem', 'Tab width (# characters)': 'Tab width (# characters)', 'table': 'טבלה', 'Table': 'Table', 'Temporary': 'Temporary', 'test': 'בדיקות', 'Testing application': 'בודק את האפליקציה', 'The "query" is a condition like "db.table1.field1==\'value\'". Something like "db.table1.field1==db.table2.field2" results in a SQL JOIN.': '"שאליתה" היא תנאי כגון "db1.table1.filed1=\'value\'" ביטוי כמו db.table1.field1=db.table2.field1 יחולל join', 'The app exists, was created by wizard, continue to overwrite!': 'The app exists, was created by wizard, continue to overwrite!', 'The app exists, was NOT created by wizard, continue to overwrite!': 'The app exists, was NOT created by wizard, continue to overwrite!', 'the application logic, each URL path is mapped in one exposed function in the controller': 'הלוגיקה של האפליקציה, כל url ממופה לפונקציה חשופה בבקר', 'The application logic, each URL path is mapped in one exposed function in the controller': 'The application logic, each URL path is mapped in one exposed function in the controller', 'the data representation, define database tables and sets': 'ייצוג המידע, בו מוגדרים טבלאות ומבנים', 'The data representation, define database tables and sets': 'The data representation, define database tables and sets', 'The presentations layer, views are also known as templates': 'The presentations layer, views are also known as templates', 'the presentations layer, views are also known as templates': 'שכבת התצוגה, המכונה גם template', 'Theme': 'Theme', 'There are no controllers': 'אין בקרים', 'There are no models': 'אין מבני נתונים', 'There are no modules': 'אין מודולים', 'There are no plugins': 'There are no plugins', 'There are no private files': 'There are no private files', 'There are no static files': 'אין קבצים סטאטיים', 'There are no translators': 'There are no translators', 'There are no translators, only default language is supported': 'אין תרגומים. רק שפת ברירת המחדל נתמכת', 'There are no views': 'אין קבצי תצוגה', 'These files are not served, they are only available from within your app': 'These files are not served, they are only available from within your app', 'These files are served without processing, your images go here': 'These files are served without processing, your images go here', 'these files are served without processing, your images go here': 'אלו הם קבצים הנשלחים מהשרת ללא עיבוד. הכנס את התמונות כאן', 'This code was emailed to you and is required for login.': 'This code was emailed to you and is required for login.', "This debugger may not work properly if you don't have a threaded webserver or you're using multiple daemon processes.": "This debugger may not work properly if you don't have a threaded webserver or you're using multiple daemon processes.", 'This email already has an account': 'This email already has an account', 'This is an experimental feature and it needs more testing. If you decide to downgrade you do it at your own risk': 'This is an experimental feature and it needs more testing. If you decide to downgrade you do it at your own risk', 'This is an experimental feature and it needs more testing. If you decide to upgrade you do it at your own risk': 'This is an experimental feature and it needs more testing. If you decide to upgrade you do it at your own risk', 'This is the %(filename)s template': 'זוהי תבנית הקובץ %(filename)s ', "This page can commit your changes to an openshift app repo and push them to your cloud instance. This assumes that you've already created the application instance using the web2py skeleton and have that repo somewhere on a filesystem that this web2py instance can access. This functionality requires GitPython installed and on the python path of the runtime that web2py is operating in.": "This page can commit your changes to an openshift app repo and push them to your cloud instance. This assumes that you've already created the application instance using the web2py skeleton and have that repo somewhere on a filesystem that this web2py instance can access. This functionality requires GitPython installed and on the python path of the runtime that web2py is operating in.", 'This page can upload your application to the Google App Engine computing cloud. Mind that you must first create indexes locally and this is done by installing the Google appserver and running the app locally with it once, or there will be errors when selecting records. Attention: deployment may take long time, depending on the network speed. Attention: it will overwrite your app.yaml. DO NOT SUBMIT TWICE.': 'This page can upload your application to the Google App Engine computing cloud. Mind that you must first create indexes locally and this is done by installing the Google appserver and running the app locally with it once, or there will be errors when selecting records. Attention: deployment may take long time, depending on the network speed. Attention: it will overwrite your app.yaml. DO NOT SUBMIT TWICE.', 'this page to see if a breakpoint was hit and debug interaction is required.': 'this page to see if a breakpoint was hit and debug interaction is required.', 'This will pull changes from the remote repo for application "%s"?': 'This will pull changes from the remote repo for application "%s"?', 'This will push changes to the remote repo for application "%s".': 'This will push changes to the remote repo for application "%s".', 'Ticket': 'דו"ח שגיאה', 'Ticket ID': 'Ticket ID', 'Ticket Missing': 'Ticket Missing', 'Time in Cache (h:m:s)': 'Time in Cache (h:m:s)', 'Timestamp': 'Timestamp', 'TM': 'סימן רשום', 'to previous version.': 'אין גירסא קודמת', 'To create a plugin, name a file/folder plugin_[name]': 'כדי ליצור תוסף, קרא לקובץ או סיפריה בשם לפי התבנית plugin_[name]', 'To emulate a breakpoint programatically, write:': 'To emulate a breakpoint programatically, write:', 'to use the debugger!': 'to use the debugger!', 'toggle breakpoint': 'toggle breakpoint', 'Toggle comment': 'Toggle comment', 'Toggle Fullscreen': 'Toggle Fullscreen', 'Traceback': 'Traceback', 'translation strings for the application': 'מחרוזות תרגום עבור האפליקציה', 'Translation strings for the application': 'Translation strings for the application', 'try': 'נסה', 'try something like': 'נסה משהו כמו', 'Try the mobile interface': 'Try the mobile interface', 'try view': 'try view', 'Two-step Login Authentication Code': 'Two-step Login Authentication Code', 'Type PDB debugger command in here and hit Return (Enter) to execute it.': 'Type PDB debugger command in here and hit Return (Enter) to execute it.', 'Type some Python code in here and hit Return (Enter) to execute it.': 'Type some Python code in here and hit Return (Enter) to execute it.', 'Unable to check for upgrades': 'לא ניתן היה לבדוק אם יש שדרוגים', 'unable to create application "%s"': 'נכשל ביצירת האפליקציה "%s"', 'unable to delete file "%(filename)s"': 'נכשל במחיקת הקובץ "%(filename)s"', 'unable to delete file plugin "%(plugin)s"': 'נכשל במחיקת התוסף "%(plugin)s"', 'Unable to determine the line number!': 'Unable to determine the line number!', 'Unable to download app because:': 'לא ניתן היה להוריד את האפליקציה כי:', 'Unable to download because': 'לא הצלחתי להוריד כי', 'unable to download layout': 'unable to download layout', 'unable to download plugin: %s': 'unable to download plugin: %s', 'Unable to download the list of plugins': 'Unable to download the list of plugins', 'unable to install plugin "%s"': 'unable to install plugin "%s"', 'unable to parse csv file': 'לא הצלחתי לנתח את הקלט של קובץ csv', 'Unable to send email': 'Unable to send email', 'unable to uninstall "%s"': 'לא ניתן להסיר את "%s"', 'unable to upgrade because "%s"': 'לא ניתן היה לשדרג כי "%s"', 'uncheck all': 'הסר סימון מהכל', 'Uninstall': 'הסר התקנה', 'Unsupported webserver working mode: %s': 'Unsupported webserver working mode: %s', 'update': 'עדכן', 'update all languages': 'עדכן את כלל קיבצי השפה', 'Update:': 'עדכן:', 'Upgrade': 'Upgrade', 'upgrade now': 'upgrade now', 'upgrade now to %s': 'upgrade now to %s', 'upgrade web2py now': 'שדרג את web2py עכשיו', 'upload': 'upload', 'Upload': 'Upload', 'Upload & install packed application': 'העלה והתקן אפליקציה ארוזה', 'Upload a package:': 'Upload a package:', 'Upload and install packed application': 'Upload and install packed application', 'upload application:': 'העלה אפליקציה:', 'upload file:': 'העלה קובץ:', 'upload plugin file:': 'העלה קובץ תוסף:', 'Use (...)&(...) for AND, (...)|(...) for OR, and ~(...) for NOT to build more complex queries.': 'השתמש ב (...)&(...) עבור תנאי AND, (...)|(...) עבור תנאי OR ו~(...) עבור תנאי NOT ליצירת שאילתות מורכבות', 'Use an url:': 'Use an url:', 'User': 'User', 'User %(id)s is impersonating %(other_id)s': 'User %(id)s is impersonating %(other_id)s', 'User %(id)s Logged-in': 'User %(id)s Logged-in', 'User %(id)s Logged-out': 'User %(id)s Logged-out', 'User %(id)s Password changed': 'User %(id)s Password changed', 'User %(id)s Password reset': 'User %(id)s Password reset', 'User %(id)s Password retrieved': 'User %(id)s Password retrieved', 'User %(id)s Profile updated': 'User %(id)s Profile updated', 'User %(id)s Registered': 'User %(id)s Registered', 'User %(id)s Username retrieved': 'User %(id)s Username retrieved', 'User %(id)s Verification email sent': 'User %(id)s Verification email sent', 'User %(id)s verified registration key': 'User %(id)s verified registration key', 'User ID': 'User ID', 'Username': 'Username', 'Username already taken': 'Username already taken', 'Username retrieve': 'Username retrieve', 'Users': 'Users', 'Using the shell may lock the database to other users of this app.': 'Using the shell may lock the database to other users of this app.', 'variables': 'משתנים', 'Verify Password': 'Verify Password', 'Version': 'גירסא', 'Versioning': 'Versioning', 'versioning': 'מנגנון גירסאות', 'view': 'הצג', 'Views': 'מראה', 'views': 'מראה', 'Warning!': 'Warning!', 'WARNING:': 'WARNING:', 'WARNING: The following views could not be compiled:': 'WARNING: The following views could not be compiled:', 'Web Framework': 'Web Framework', 'web2py Admin Password': 'web2py Admin Password', 'web2py apps to deploy': 'web2py apps to deploy', 'web2py Debugger': 'web2py Debugger', 'web2py downgrade': 'web2py downgrade', 'web2py is up to date': 'web2py מותקנת בגירסתה האחרונה', 'web2py online debugger': 'web2py online debugger', 'web2py Recent Tweets': 'ציוצים אחרונים של web2py', 'web2py upgrade': 'web2py upgrade', 'web2py upgraded; please restart it': 'web2py שודרגה; נא אתחל אותה', 'Welcome %(username)s! Click on the link %(link)s to verify your email': 'Welcome %(username)s! Click on the link %(link)s to verify your email', 'Working...': 'Working...', 'WSGI reference name': 'WSGI reference name', 'YES': 'כן', 'Yes': 'Yes', 'You can also set and remove breakpoint in the edit window, using the Toggle Breakpoint button': 'You can also set and remove breakpoint in the edit window, using the Toggle Breakpoint button', 'You can inspect variables using the console below': 'You can inspect variables using the console below', 'You have been invited to join %(site)s, click %(link)s to complete the process': 'You have been invited to join %(site)s, click %(link)s to complete the process', 'You have one more login attempt before you are locked out': 'You have one more login attempt before you are locked out', 'You need to set up and reach a': 'You need to set up and reach a', 'You only need these if you have already registered': 'You only need these if you have already registered', 'Your application will be blocked until you click an action button (next, step, continue, etc.)': 'Your application will be blocked until you click an action button (next, step, continue, etc.)', 'Your password is: %(password)s': 'Your password is: %(password)s', 'Your temporary login code is {0}': 'Your temporary login code is {0}', 'Your username is: %(username)s': 'Your username is: %(username)s', 'Your username was emailed to you': 'Your username was emailed to you', }
56.004132
823
0.710618
{ '!langcode!': 'he-il', '!langname!': 'עברית', '"update" is an optional expression like "field1=\'newvalue\'". You cannot update or delete the results of a JOIN': '"עדכן" הוא ביטוי אופציונאלי, כגון "field1=newvalue". אינך יוכל להשתמש בjoin, בעת שימוש ב"עדכן" או "מחק".', '"User Exception" debug mode. ': '"User Exception" debug mode. ', '%s': '%s', '%s %%{row} deleted': '%s רשומות נמחקו', '%s %%{row} updated': '%s רשומות עודכנו', '%s selected': '%s selected', '%s students registered': '%s students registered', '%Y-%m-%d': '%Y-%m-%d', '%Y-%m-%d %H:%M:%S': '%Y-%m-%d %H:%M:%S', '(requires internet access)': '(requires internet access)', '(requires internet access, experimental)': '(requires internet access, experimental)', '(something like "it-it")': '(למשל "it-it")', '(version %s)': '(version %s)', '?': '?', '@markmin\x01(**%.0d MB**)': '(**%.0d MB**)', '@markmin\x01(file **gluon/contrib/plural_rules/%s.py** is not found)': '(file **gluon/contrib/plural_rules/%s.py** is not found)', '@markmin\x01**%(items)s** %%{item(items)}, **%(bytes)s** %%{byte(bytes)}': '**%(items)s** %%{item(items)}, **%(bytes)s** %%{byte(bytes)}', '@markmin\x01**%(items)s** items, **%(bytes)s** %%{byte(bytes)}': '**%(items)s** items, **%(bytes)s** %%{byte(bytes)}', '@markmin\x01**not available** (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)': '**not available** (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)', '@markmin\x01``**not available**``:red (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)': '``**not available**``:red (requires the Python [[Pympler https://pypi.python.org/pypi/Pympler popup]] library)', '@markmin\x01An error occured, please [[reload %s]] the page': 'An error occured, please [[reload %s]] the page', '@markmin\x01Cache contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.': 'Cache contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.', '@markmin\x01DISK contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.': 'DISK contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.', '@markmin\x01Hit Ratio: **%(ratio)s%%** (**%(hits)s** %%{hit(hits)} and **%(misses)s** %%{miss(misses)})': 'Hit Ratio: **%(ratio)s%%** (**%(hits)s** %%{hit(hits)} and **%(misses)s** %%{miss(misses)})', "@markmin\x01Mercurial Version Control System Interface[[NEWLINE]]for application '%s'": "Mercurial Version Control System Interface[[NEWLINE]]for application '%s'", '@markmin\x01Number of entries: **%s**': 'Number of entries: **%s**', '@markmin\x01Please [[refresh %s]] this page to see if a breakpoint was hit and debug interaction is required.': 'Please [[refresh %s]] this page to see if a breakpoint was hit and debug interaction is required.', '@markmin\x01RAM contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.': 'RAM contains items up to **%(hours)02d** %%{hour(hours)} **%(min)02d** %%{minute(min)} **%(sec)02d** %%{second(sec)} old.', '@markmin\x01Searching: **%s** %%{file}': 'Searching: **%s** files', '@markmin\x01You need to set up and reach a [[breakpoint %s]] to use the debugger!': 'You need to set up and reach a [[breakpoint %s]] to use the debugger!', 'A new password was emailed to you': 'A new password was emailed to you', 'A new version of web2py is available: %s': 'גירסא חדשה של web2py זמינה: %s', 'Abort': 'Abort', 'About': 'אודות', 'About application': 'אודות אפליקציה', 'Accept Terms': 'Accept Terms', 'Add breakpoint': 'Add breakpoint', 'additional code for your application': 'קוד נוסף עבור האפליקציה שלך', 'Additional code for your application': 'Additional code for your application', 'Admin design page': 'Admin design page', 'admin disabled because no admin password': 'ממשק המנהל מנוטרל כי לא הוגדרה סיסמת מנהל', 'admin disabled because not supported on google app engine': 'ממשק המנהל נוטרל, כי אין תמיכה בGoogle app engine', 'admin disabled because too many invalid login attempts': 'admin disabled because too many invalid login attempts', 'admin disabled because unable to access password file': 'ממשק מנהל נוטרל, כי לא ניתן לגשת לקובץ הסיסמאות', 'Admin is disabled because insecure channel': 'ממשק האדמין נוטרל בשל גישה לא מאובטחת', 'Admin language': 'Admin language', 'Admin versioning page': 'Admin versioning page', 'administrative interface': 'administrative interface', 'Administrator Password:': 'סיסמת מנהל', 'and rename it (required):': 'ושנה את שמו (חובה):', 'and rename it:': 'ושנה את שמו:', 'App does not exist or you are not authorized': 'App does not exist or you are not authorized', 'appadmin': 'מנהל מסד הנתונים', 'appadmin is disabled because insecure channel': 'מנהל מסד הנתונים נוטרל בשל ערוץ לא מאובטח', 'Application': 'Application', 'application "%s" uninstalled': 'אפליקציה "%s" הוסרה', 'Application cannot be generated in demo mode': 'Application cannot be generated in demo mode', 'application compiled': 'אפליקציה קומפלה', 'Application exists already': 'Application exists already', 'application is compiled and cannot be designed': 'לא ניתן לערוך אפליקציה מקומפלת', 'Application name:': 'Application name:', 'Application updated via git pull': 'Application updated via git pull', 'Apply changes': 'Apply changes', 'are not used': 'are not used', 'are not used yet': 'are not used yet', 'Are you sure you want to delete file "%s"?': 'האם אתה בטוח שברצונך למחוק את הקובץ "%s"?', 'Are you sure you want to delete plugin "%s"?': 'האם אתה בטוח שברצונך למחוק את התוסף "%s"?', 'Are you sure you want to delete this object?': 'Are you sure you want to delete this object?', 'Are you sure you want to uninstall application "%s"?': 'האם אתה בטוח שברצונך להסיר את האפליקציה "%s"?', 'Are you sure you want to upgrade web2py now?': 'האם אתה בטוח שאתה רוצה לשדרג את web2py עכשיו?', 'Are you sure?': 'Are you sure?', 'arguments': 'פרמטרים', 'at char %s': 'at char %s', 'at line %s': 'at line %s', 'ATTENTION:': 'ATTENTION:', 'ATTENTION: Login requires a secure (HTTPS) connection or running on localhost.': 'לתשומת ליבך: ניתן להתחבר רק בערוץ מאובטח (HTTPS) או מlocalhost', 'ATTENTION: TESTING IS NOT THREAD SAFE SO DO NOT PERFORM MULTIPLE TESTS CONCURRENTLY.': 'לתשומת ליבך: אין לערוך מספר בדיקות במקביל, שכן הן עשויות להפריע זו לזו', 'ATTENTION: you cannot edit the running application!': 'לתשומת ליבך: לא ניתן לערוך אפליקציה בזמן הרצתה', 'Authentication code': 'Authentication code', 'Autocomplete Python Code': 'Autocomplete Python Code', 'Available databases and tables': 'מסדי נתונים וטבלאות זמינים', 'Available Databases and Tables': 'Available Databases and Tables', 'back': 'אחורה', 'Back to the plugins list': 'Back to the plugins list', 'Back to wizard': 'Back to wizard', 'Basics': 'Basics', 'Begin': 'Begin', 'breakpoint': 'breakpoint', 'Breakpoints': 'Breakpoints', 'breakpoints': 'breakpoints', 'Bulk Register': 'Bulk Register', 'Bulk Student Registration': 'Bulk Student Registration', 'Cache': 'Cache', 'cache': 'מטמון', 'Cache Cleared': 'Cache Cleared', 'Cache Keys': 'Cache Keys', 'cache, errors and sessions cleaned': 'מטמון, שגיאות וסשן נוקו', 'can be a git repo': 'can be a git repo', 'Cancel': 'Cancel', 'Cannot be empty': 'אינו יכול להישאר ריק', 'Cannot compile: there are errors in your app:': 'לא ניתן לקמפל: ישנן שגיאות באפליקציה שלך:', 'cannot create file': 'לא מצליח ליצור קובץ', 'cannot upload file "%(filename)s"': 'לא הצלחתי להעלות את הקובץ "%(filename)s"', 'Change Admin Password': 'Change Admin Password', 'Change admin password': 'סיסמת מנהל שונתה', 'change editor settings': 'change editor settings', 'Change password': 'Change password', 'Changelog': 'Changelog', 'check all': 'סמן הכל', 'Check for upgrades': 'check for upgrades', 'Check to delete': 'סמן כדי למחוק', 'Checking for upgrades...': 'מחפש עדכונים', 'Clean': 'נקה', 'Clear': 'Clear', 'Clear CACHE?': 'Clear CACHE?', 'Clear DISK': 'Clear DISK', 'Clear RAM': 'Clear RAM', 'Click on the link %(link)s to reset your password': 'Click on the link %(link)s to reset your password', 'Click row to expand traceback': 'Click row to expand traceback', 'Click row to view a ticket': 'Click row to view a ticket', 'click to check for upgrades': 'לחץ כדי לחפש עדכונים', 'Client IP': 'Client IP', 'code': 'קוד', 'Code listing': 'Code listing', 'collapse/expand all': 'collapse/expand all', 'Command': 'Command', 'Comment:': 'Comment:', 'Commit': 'Commit', 'Commit form': 'Commit form', 'Committed files': 'Committed files', 'Compile': 'קמפל', 'Compile (all or nothing)': 'Compile (all or nothing)', 'Compile (skip failed views)': 'Compile (skip failed views)', 'compiled application removed': 'אפליקציה מקומפלת הוסרה', 'Condition': 'Condition', 'continue': 'continue', 'Controllers': 'בקרים', 'controllers': 'בקרים', 'Count': 'Count', 'Create': 'צור', 'create file with filename:': 'צור קובץ בשם:', 'create new application:': 'צור אפליקציה חדשה:', 'Create new simple application': 'צור אפליקציה חדשה', 'Create/Upload': 'Create/Upload', 'created by': 'נוצר ע"י', 'Created by:': 'Created by:', 'Created On': 'Created On', 'Created on:': 'Created on:', 'crontab': 'משימות מתוזמנות', 'Current request': 'בקשה נוכחית', 'Current response': 'מענה נוכחי', 'Current session': 'סשן זה', 'currently running': 'currently running', 'currently saved or': 'נשמר כעת או', 'data uploaded': 'המידע הועלה', 'Database': 'Database', 'database': 'מסד נתונים', 'Database %s select': 'Database %s select', 'database %s select': 'מסד הנתונים %s נבחר', 'Database administration': 'Database administration', 'database administration': 'ניהול מסד נתונים', 'Database Administration (appadmin)': 'Database Administration (appadmin)', 'Date and Time': 'תאריך ושעה', 'db': 'מסד נתונים', 'Debug': 'Debug', 'defines tables': 'הגדר טבלאות', 'Delete': 'מחק', 'delete': 'מחק', 'delete all checked': 'סמן הכל למחיקה', 'delete plugin': 'מחק תוסף', 'Delete this file (you will be asked to confirm deletion)': 'Delete this file (you will be asked to confirm deletion)', 'Delete:': 'מחק:', 'deleted after first hit': 'deleted after first hit', 'Demo': 'Demo', 'Deploy': 'deploy', 'Deploy on Google App Engine': 'העלה ל Google App Engine', 'Deploy to OpenShift': 'Deploy to OpenShift', 'Deploy to pythonanywhere': 'Deploy to pythonanywhere', 'Deploy to PythonAnywhere': 'Deploy to PythonAnywhere', 'Deployment form': 'Deployment form', 'Deployment Interface': 'Deployment Interface', 'Description': 'Description', 'Description:': 'Description:', 'design': 'עיצוב', 'Detailed traceback description': 'Detailed traceback description', 'details': 'details', 'direction: ltr': 'direction: rtl', 'directory not found': 'directory not found', 'Disable': 'Disable', 'Disabled': 'Disabled', 'disabled in demo mode': 'disabled in demo mode', 'disabled in GAE mode': 'disabled in GAE mode', 'disabled in multi user mode': 'disabled in multi user mode', 'DISK': 'DISK', 'Disk Cache Keys': 'Disk Cache Keys', 'Disk Cleared': 'Disk Cleared', 'Display line numbers': 'Display line numbers', 'DO NOT use the "Pack compiled" feature.': 'DO NOT use the "Pack compiled" feature.', 'docs': 'docs', 'Docs': 'Docs', 'done!': 'הסתיים!', 'Downgrade': 'Downgrade', 'Download .w2p': 'Download .w2p', 'Download as .exe': 'Download as .exe', 'download layouts': 'download layouts', 'Download layouts from repository': 'Download layouts from repository', 'download plugins': 'download plugins', 'Download plugins from repository': 'Download plugins from repository', 'E-mail': 'E-mail', 'EDIT': 'ערוך!', 'Edit': 'ערוך', 'edit all': 'edit all', 'Edit application': 'ערוך אפליקציה', 'edit controller': 'ערוך בקר', 'edit controller:': 'edit controller:', 'Edit current record': 'ערוך רשומה נוכחית', 'edit views:': 'ערוך קיבצי תצוגה:', 'Editing %s': 'Editing %s', 'Editing file "%s"': 'עורך את הקובץ "%s"', 'Editing Language file': 'עורך את קובץ השפה', 'Editing Plural Forms File': 'Editing Plural Forms File', 'Editor': 'Editor', 'Email Address': 'Email Address', 'Email sent': 'Email sent', 'Email verification': 'Email verification', 'Email verified': 'Email verified', 'Enable': 'Enable', 'Enable Close-Tag': 'Enable Close-Tag', 'Enable Code Folding': 'Enable Code Folding', 'Enterprise Web Framework': 'סביבת הפיתוח לרשת', 'Error': 'Error', 'Error logs for "%(app)s"': 'דו"ח שגיאות עבור אפליקציה "%(app)s"', 'Error snapshot': 'Error snapshot', 'Error ticket': 'Error ticket', 'Errors': 'שגיאות', 'Exception %(extype)s: %(exvalue)s': 'Exception %(extype)s: %(exvalue)s', 'Exception %s': 'Exception %s', 'Exception instance attributes': 'נתוני החריגה', 'Exit Fullscreen': 'Exit Fullscreen', 'Expand Abbreviation (html files only)': 'Expand Abbreviation (html files only)', 'export as csv file': 'יצא לקובץ csv', 'Exports:': 'Exports:', 'exposes': 'חושף את', 'exposes:': 'exposes:', 'extends': 'הרחבה של', 'failed to compile file because:': 'failed to compile file because:', 'failed to reload module because:': 'נכשל בטעינה חוזרת של מודול בגלל:', 'File': 'File', 'file "%(filename)s" created': 'הקובץ "%(filename)s" נוצר', 'file "%(filename)s" deleted': 'הקובץ "%(filename)s" נמחק', 'file "%(filename)s" uploaded': 'הקובץ "%(filename)s" הועלה', 'file "%s" of %s restored': 'הקובץ "%s" of %s שוחזר', 'file changed on disk': 'קובץ שונה על גבי הדיסק', 'file does not exist': 'קובץ לא נמצא', 'file not found': 'file not found', 'file saved on %(time)s': 'הקובץ נשמר בשעה %(time)s', 'file saved on %s': 'הקובץ נשמר ב%s', 'filename': 'filename', 'Filename': 'Filename', 'Files added': 'Files added', 'filter': 'filter', 'Find Next': 'Find Next', 'Find Previous': 'Find Previous', 'First name': 'First name', 'Form has errors': 'Form has errors', 'Frames': 'Frames', 'Function disabled': 'Function disabled', 'Functions with no doctests will result in [passed] tests.': 'פונקציות שלא הוגדר להן doctest ירשמו כבדיקות ש[עברו בהצלחה].', 'GAE Email': 'GAE Email', 'GAE Output': 'GAE Output', 'GAE Password': 'GAE Password', 'Generate': 'Generate', 'Git Pull': 'Git Pull', 'Git Push': 'Git Push', 'Globals##debug': 'Globals##debug', 'go!': 'go!', 'Google App Engine Deployment Interface': 'Google App Engine Deployment Interface', 'Google Application Id': 'Google Application Id', 'Goto': 'Goto', 'graph model': 'graph model', 'Graph Model': 'Graph Model', 'Group %(group_id)s created': 'Group %(group_id)s created', 'Group %(group_id)s deleted': 'Group %(group_id)s deleted', 'Group ID': 'Group ID', 'Group uniquely assigned to user %(id)s': 'Group uniquely assigned to user %(id)s', 'Help': 'עזרה', 'here': 'here', 'Hide/Show Translated strings': 'Hide/Show Translated strings', 'Highlight current line': 'Highlight current line', 'Hits': 'Hits', 'Home': 'Home', 'honored only if the expression evaluates to true': 'honored only if the expression evaluates to true', 'htmledit': 'עורך ויזואלי', 'If start the downgrade, be patient, it may take a while to rollback': 'If start the downgrade, be patient, it may take a while to rollback', 'If start the upgrade, be patient, it may take a while to download': 'If start the upgrade, be patient, it may take a while to download', 'If the report above contains a ticket number it indicates a failure in executing the controller, before any attempt to execute the doctests. This is usually due to an indentation error or an error outside function code.\n\t\tA green title indicates that all tests (if defined) passed. In this case test results are not shown.': 'If the report above contains a ticket number it indicates a failure in executing the controller, before any attempt to execute the doctests. This is usually due to an indentation error or an error outside function code.\n\t\tA green title indicates that all tests (if defined) passed. In this case test results are not shown.', 'If the report above contains a ticket number it indicates a failure in executing the controller, before any attempt to execute the doctests. This is usually due to an indentation error or an error outside function code.\nA green title indicates that all tests (if defined) passed. In this case test results are not shown.': 'אם בדו"ח לעיל מופיע מספר דו"ח שגיאה, זה מצביע על שגיאה בבקר, עוד לפני שניתן היה להריץ את הdoctest. לרוב מדובר בשגיאת הזחה, או שגיאה שאינה בקוד של הפונקציה.\r\nכותרת ירוקה מצביע על כך שכל הבדיקות (אם הוגדרו) עברו בהצלחה, במידה ותוצאות הבדיקה אינן מופיעות.', 'if your application uses a database other than sqlite you will then have to configure its DAL in pythonanywhere.': 'if your application uses a database other than sqlite you will then have to configure its DAL in pythonanywhere.', 'import': 'import', 'Import/Export': 'יבא\\יצא', 'In development, use the default Rocket webserver that is currently supported by this debugger.': 'In development, use the default Rocket webserver that is currently supported by this debugger.', 'includes': 'מכיל', 'Incorrect code. {0} more attempt(s) remaining.': 'Incorrect code. {0} more attempt(s) remaining.', 'Indent with tabs': 'Indent with tabs', 'insert new': 'הכנס נוסף', 'insert new %s': 'הכנס %s נוסף', 'inspect attributes': 'inspect attributes', 'Install': 'התקן', 'Installation of %(plugin)s for %(app)s': 'Installation of %(plugin)s for %(app)s', 'Installed applications': 'אפליקציות מותקנות', 'Insufficient privileges': 'Insufficient privileges', 'Interaction at %s line %s': 'Interaction at %s line %s', 'Interactive console': 'Interactive console', 'internal error': 'שגיאה מובנית', 'internal error: %s': 'internal error: %s', 'Internal State': 'מצב מובנה', 'Invalid action': 'הוראה לא קיימת', 'Invalid application name': 'Invalid application name', 'invalid circular reference': 'invalid circular reference', 'Invalid email': 'Invalid email', 'Invalid git repository specified.': 'Invalid git repository specified.', 'Invalid key': 'Invalid key', 'Invalid login': 'Invalid login', 'invalid password': 'סיסמא שגויה', 'Invalid password': 'Invalid password', 'invalid password.': 'invalid password.', 'Invalid Query': 'שאילתה לא תקינה', 'invalid request': 'בקשה לא תקינה', 'Invalid request': 'Invalid request', 'Invalid reset password': 'Invalid reset password', 'invalid table names (auth_* tables already defined)': 'invalid table names (auth_* tables already defined)', 'invalid ticket': 'דו"ח שגיאה לא קיים', 'Invalid user': 'Invalid user', 'Invalid username': 'Invalid username', 'Invitation to join %(site)s': 'Invitation to join %(site)s', 'Key': 'Key', 'Key verified': 'Key verified', 'Keyboard shortcuts': 'Keyboard shortcuts', 'kill process': 'kill process', 'language file "%(filename)s" created/updated': 'קובץ השפה "%(filename)s" נוצר\\עודכן', 'Language files (static strings) updated': 'קובץ השפה (מחרוזות סטאטיות) עודכן', 'languages': 'שפות', 'Languages': 'שפות', 'Last name': 'Last name', 'Last Revision': 'Last Revision', 'Last saved on:': 'לאחרונה נשמר בתאריך:', 'License for': 'רשיון עבור', 'License:': 'License:', 'Line Nr': 'Line Nr', 'Line number': 'Line number', 'lists by exception': 'lists by exception', 'lists by ticket': 'lists by ticket', 'Loading...': 'Loading...', 'loading...': 'טוען...', 'Local Apps': 'Local Apps', 'locals': 'locals', 'Locals##debug': 'Locals##debug', 'Log In': 'Log In', 'Logged in': 'Logged in', 'Logged out': 'Logged out', 'Login': 'התחבר', 'login': 'התחבר', 'Login disabled by administrator': 'Login disabled by administrator', 'Login successful': 'Login successful', 'Login to the Administrative Interface': 'התחבר לממשק המנהל', 'Login/Register': 'Login/Register', 'Logout': 'התנתק', 'lost password': 'lost password', 'Main Menu': 'Main Menu', 'Manage': 'Manage', 'Manage %(action)s': 'Manage %(action)s', 'Manage Access Control': 'Manage Access Control', 'Manage Admin Users/Students': 'Manage Admin Users/Students', 'Manage Cache': 'Manage Cache', 'Manage Students': 'Manage Students', 'Memberships': 'Memberships', 'merge': 'מזג', 'Models': 'מבני נתונים', 'models': 'מבני נתונים', 'Modified On': 'Modified On', 'Modules': 'מודולים', 'modules': 'מודולים', 'Multi User Mode': 'Multi User Mode', 'Name': 'Name', 'new application "%s" created': 'האפליקציה "%s" נוצרה', 'new application "%s" imported': 'new application "%s" imported', 'New Application Wizard': 'New Application Wizard', 'New application wizard': 'New application wizard', 'New password': 'New password', 'new plugin installed': 'פלאגין חדש הותקן', 'New plugin installed: %s': 'New plugin installed: %s', 'New Record': 'רשומה חדשה', 'new record inserted': 'הרשומה נוספה', 'New simple application': 'New simple application', 'next': 'next', 'next %s rows': 'next %s rows', 'next 100 rows': '100 הרשומות הבאות', 'NO': 'לא', 'no changes': 'no changes', 'No databases in this application': 'אין מסדי נתונים לאפליקציה זו', 'No Interaction yet': 'No Interaction yet', 'no match': 'לא נמצאה התאמה', 'no package selected': 'no package selected', 'no permission to uninstall "%s"': 'no permission to uninstall "%s"', 'Node:': 'Node:', 'Not Authorized': 'Not Authorized', 'Not supported': 'Not supported', 'Note: If you receive an error with github status code of 128, ensure the system and account you are deploying from has a cooresponding ssh key configured in the openshift account.': 'Note: If you receive an error with github status code of 128, ensure the system and account you are deploying from has a cooresponding ssh key configured in the openshift account.', 'Object or table name': 'Object or table name', 'Old password': 'Old password', "On production, you'll have to configure your webserver to use one process and multiple threads to use this debugger.": "On production, you'll have to configure your webserver to use one process and multiple threads to use this debugger.", 'Open new app in new window': 'Open new app in new window', 'OpenShift Deployment Interface': 'OpenShift Deployment Interface', 'OpenShift Output': 'OpenShift Output', 'or alternatively': 'or alternatively', 'Or Get from URL:': 'Or Get from URL:', 'or import from csv file': 'או יבא מקובץ csv', 'or provide app url:': 'או ספק כתובת url של אפליקציה', 'Origin': 'Origin', 'Original/Translation': 'מקור\\תרגום', 'Overview': 'Overview', 'Overwrite installed app': 'התקן על גבי אפלקציה מותקנת', 'Pack all': 'ארוז הכל', 'Pack compiled': 'ארוז מקומפל', 'Pack custom': 'Pack custom', 'pack plugin': 'ארוז תוסף', 'PAM authenticated user, cannot change password here': 'שינוי סיסמא באמצעות PAM אינו יכול להתבצע כאן', 'Password': 'Password', 'password changed': 'סיסמא שונתה', 'Password changed': 'Password changed', "Password fields don't match": "Password fields don't match", 'Password reset': 'Password reset', 'Password retrieve': 'Password retrieve', 'Past revisions': 'Past revisions', 'Path to appcfg.py': 'Path to appcfg.py', 'Path to local openshift repo root.': 'Path to local openshift repo root.', 'Peeking at file': 'מעיין בקובץ', 'Permission': 'Permission', 'Permissions': 'Permissions', 'Please': 'Please', 'please input your password again': 'please input your password again', 'Please wait, giving pythonanywhere a moment...': 'Please wait, giving pythonanywhere a moment...', 'plugin "%(plugin)s" deleted': 'תוסף "%(plugin)s" נמחק', 'Plugin "%s" in application': 'פלאגין "%s" של אפליקציה', 'plugin not specified': 'plugin not specified', 'Plugin page': 'Plugin page', 'plugins': 'plugins', 'Plugins': 'תוספים', 'Plural Form #%s': 'Plural Form #%s', 'Plural-Forms:': 'Plural-Forms:', 'Powered by': 'מופעל ע"י', 'Preferences saved correctly': 'Preferences saved correctly', 'Preferences saved on session only': 'Preferences saved on session only', 'previous %s rows': 'previous %s rows', 'previous 100 rows': '100 הרשומות הקודמות', 'Private files': 'Private files', 'private files': 'private files', 'Profile updated': 'Profile updated', 'Project Progress': 'Project Progress', 'Pull': 'Pull', 'Pull failed, certain files could not be checked out. Check logs for details.': 'Pull failed, certain files could not be checked out. Check logs for details.', 'Pull is not possible because you have unmerged files. Fix them up in the work tree, and then try again.': 'Pull is not possible because you have unmerged files. Fix them up in the work tree, and then try again.', 'Push': 'Push', 'Push failed, there are unmerged entries in the cache. Resolve merge issues manually and try again.': 'Push failed, there are unmerged entries in the cache. Resolve merge issues manually and try again.', 'pygraphviz library not found': 'pygraphviz library not found', 'PythonAnywhere Apps': 'PythonAnywhere Apps', 'PythonAnywhere Password': 'PythonAnywhere Password', 'Query:': 'שאילתה:', 'RAM': 'RAM', 'RAM Cache Keys': 'RAM Cache Keys', 'Ram Cleared': 'Ram Cleared', 'Rapid Search': 'Rapid Search', 'Record': 'Record', 'record': 'רשומה', 'Record %(id)s created': 'Record %(id)s created', 'Record %(id)s deleted': 'Record %(id)s deleted', 'Record %(id)s read': 'Record %(id)s read', 'Record %(id)s updated': 'Record %(id)s updated', 'Record Created': 'Record Created', 'Record Deleted': 'Record Deleted', 'record does not exist': 'הרשומה אינה קיימת', 'record id': 'מזהה רשומה', 'Record id': 'Record id', 'Record ID': 'Record ID', 'Record Updated': 'Record Updated', 'refresh': 'refresh', 'register': 'register', 'Registration identifier': 'Registration identifier', 'Registration is pending approval': 'Registration is pending approval', 'Registration key': 'Registration key', 'Registration needs verification': 'Registration needs verification', 'Registration successful': 'Registration successful', 'Reload routes': 'Reload routes', 'Remember me (for 30 days)': 'Remember me (for 30 days)', 'Remove compiled': 'הסר מקומפל', 'Removed Breakpoint on %s at line %s': 'Removed Breakpoint on %s at line %s', 'Replace': 'Replace', 'Replace All': 'Replace All', 'Repository (%s)': 'Repository (%s)', 'request': 'request', 'Request reset password': 'Request reset password', 'requires distutils, but not installed': 'requires distutils, but not installed', 'requires python-git, but not installed': 'requires python-git, but not installed', 'Reset Password key': 'Reset Password key', 'Resolve Conflict file': 'הסר קובץ היוצר קונפליקט', 'response': 'response', 'restart': 'restart', 'restore': 'שחזר', 'return': 'return', 'Revert': 'Revert', 'revert': 'חזור לגירסא קודמת', 'reverted to revision %s': 'reverted to revision %s', 'Revision %s': 'Revision %s', 'Revision:': 'Revision:', 'Role': 'Role', 'Roles': 'Roles', 'Rows in Table': 'Rows in Table', 'Rows in table': 'רשומות בטבלה', 'Rows selected': 'רשומות נבחרו', 'rules are not defined': 'rules are not defined', 'Run tests': 'Run tests', 'Run tests in this file': 'Run tests in this file', "Run tests in this file (to run all files, you may also use the button labelled 'test')": "Run tests in this file (to run all files, you may also use the button labelled 'test')", 'Running on %s': 'Running on %s', 'Save': 'Save', 'Save file:': 'Save file:', 'Save file: %s': 'Save file: %s', 'Save model as...': 'Save model as...', 'Save via Ajax': 'Save via Ajax', 'Saved file hash:': 'גיבוב הקובץ השמור:', 'Screenshot %s': 'Screenshot %s', 'Search': 'Search', 'Select Files to Package': 'Select Files to Package', 'selected': 'נבחרו', 'session': 'session', 'session expired': 'תם הסשן', 'Session saved correctly': 'Session saved correctly', 'Session saved on session only': 'Session saved on session only', 'Set Breakpoint on %s at line %s: %s': 'Set Breakpoint on %s at line %s: %s', 'shell': 'שורת פקודה', 'Showing %s to %s of %s %s found': 'Showing %s to %s of %s %s found', 'Sign Up': 'Sign Up', 'Singular Form': 'Singular Form', 'Site': 'אתר', 'Size of cache:': 'Size of cache:', 'skip to generate': 'skip to generate', 'some files could not be removed': 'לא ניתן היה להסיר חלק מהקבצים', 'Something went wrong please wait a few minutes before retrying': 'Something went wrong please wait a few minutes before retrying', 'Sorry, could not find mercurial installed': 'Sorry, could not find mercurial installed', 'source : db': 'source : db', 'source : filesystem': 'source : filesystem', 'Start a new app': 'Start a new app', 'Start searching': 'Start searching', 'Start wizard': 'start wizard', 'state': 'מצב', 'Static': 'Static', 'static': 'קבצים סטאטיים', 'Static files': 'קבצים סטאטיים', 'Statistics': 'Statistics', 'Step': 'Step', 'step': 'step', 'stop': 'stop', 'submit': 'שלח', 'Submit': 'Submit', 'successful': 'successful', 'Sure you want to delete this object?': 'האם אתה בטוח שברצונך למחוק אובייקט זה?', 'switch to : db': 'switch to : db', 'switch to : filesystem': 'switch to : filesystem', 'Tab width (# characters)': 'Tab width (# characters)', 'table': 'טבלה', 'Table': 'Table', 'Temporary': 'Temporary', 'test': 'בדיקות', 'Testing application': 'בודק את האפליקציה', 'The "query" is a condition like "db.table1.field1==\'value\'". Something like "db.table1.field1==db.table2.field2" results in a SQL JOIN.': '"שאליתה" היא תנאי כגון "db1.table1.filed1=\'value\'" ביטוי כמו db.table1.field1=db.table2.field1 יחולל join', 'The app exists, was created by wizard, continue to overwrite!': 'The app exists, was created by wizard, continue to overwrite!', 'The app exists, was NOT created by wizard, continue to overwrite!': 'The app exists, was NOT created by wizard, continue to overwrite!', 'the application logic, each URL path is mapped in one exposed function in the controller': 'הלוגיקה של האפליקציה, כל url ממופה לפונקציה חשופה בבקר', 'The application logic, each URL path is mapped in one exposed function in the controller': 'The application logic, each URL path is mapped in one exposed function in the controller', 'the data representation, define database tables and sets': 'ייצוג המידע, בו מוגדרים טבלאות ומבנים', 'The data representation, define database tables and sets': 'The data representation, define database tables and sets', 'The presentations layer, views are also known as templates': 'The presentations layer, views are also known as templates', 'the presentations layer, views are also known as templates': 'שכבת התצוגה, המכונה גם template', 'Theme': 'Theme', 'There are no controllers': 'אין בקרים', 'There are no models': 'אין מבני נתונים', 'There are no modules': 'אין מודולים', 'There are no plugins': 'There are no plugins', 'There are no private files': 'There are no private files', 'There are no static files': 'אין קבצים סטאטיים', 'There are no translators': 'There are no translators', 'There are no translators, only default language is supported': 'אין תרגומים. רק שפת ברירת המחדל נתמכת', 'There are no views': 'אין קבצי תצוגה', 'These files are not served, they are only available from within your app': 'These files are not served, they are only available from within your app', 'These files are served without processing, your images go here': 'These files are served without processing, your images go here', 'these files are served without processing, your images go here': 'אלו הם קבצים הנשלחים מהשרת ללא עיבוד. הכנס את התמונות כאן', 'This code was emailed to you and is required for login.': 'This code was emailed to you and is required for login.', "This debugger may not work properly if you don't have a threaded webserver or you're using multiple daemon processes.": "This debugger may not work properly if you don't have a threaded webserver or you're using multiple daemon processes.", 'This email already has an account': 'This email already has an account', 'This is an experimental feature and it needs more testing. If you decide to downgrade you do it at your own risk': 'This is an experimental feature and it needs more testing. If you decide to downgrade you do it at your own risk', 'This is an experimental feature and it needs more testing. If you decide to upgrade you do it at your own risk': 'This is an experimental feature and it needs more testing. If you decide to upgrade you do it at your own risk', 'This is the %(filename)s template': 'זוהי תבנית הקובץ %(filename)s ', "This page can commit your changes to an openshift app repo and push them to your cloud instance. This assumes that you've already created the application instance using the web2py skeleton and have that repo somewhere on a filesystem that this web2py instance can access. This functionality requires GitPython installed and on the python path of the runtime that web2py is operating in.": "This page can commit your changes to an openshift app repo and push them to your cloud instance. This assumes that you've already created the application instance using the web2py skeleton and have that repo somewhere on a filesystem that this web2py instance can access. This functionality requires GitPython installed and on the python path of the runtime that web2py is operating in.", 'This page can upload your application to the Google App Engine computing cloud. Mind that you must first create indexes locally and this is done by installing the Google appserver and running the app locally with it once, or there will be errors when selecting records. Attention: deployment may take long time, depending on the network speed. Attention: it will overwrite your app.yaml. DO NOT SUBMIT TWICE.': 'This page can upload your application to the Google App Engine computing cloud. Mind that you must first create indexes locally and this is done by installing the Google appserver and running the app locally with it once, or there will be errors when selecting records. Attention: deployment may take long time, depending on the network speed. Attention: it will overwrite your app.yaml. DO NOT SUBMIT TWICE.', 'this page to see if a breakpoint was hit and debug interaction is required.': 'this page to see if a breakpoint was hit and debug interaction is required.', 'This will pull changes from the remote repo for application "%s"?': 'This will pull changes from the remote repo for application "%s"?', 'This will push changes to the remote repo for application "%s".': 'This will push changes to the remote repo for application "%s".', 'Ticket': 'דו"ח שגיאה', 'Ticket ID': 'Ticket ID', 'Ticket Missing': 'Ticket Missing', 'Time in Cache (h:m:s)': 'Time in Cache (h:m:s)', 'Timestamp': 'Timestamp', 'TM': 'סימן רשום', 'to previous version.': 'אין גירסא קודמת', 'To create a plugin, name a file/folder plugin_[name]': 'כדי ליצור תוסף, קרא לקובץ או סיפריה בשם לפי התבנית plugin_[name]', 'To emulate a breakpoint programatically, write:': 'To emulate a breakpoint programatically, write:', 'to use the debugger!': 'to use the debugger!', 'toggle breakpoint': 'toggle breakpoint', 'Toggle comment': 'Toggle comment', 'Toggle Fullscreen': 'Toggle Fullscreen', 'Traceback': 'Traceback', 'translation strings for the application': 'מחרוזות תרגום עבור האפליקציה', 'Translation strings for the application': 'Translation strings for the application', 'try': 'נסה', 'try something like': 'נסה משהו כמו', 'Try the mobile interface': 'Try the mobile interface', 'try view': 'try view', 'Two-step Login Authentication Code': 'Two-step Login Authentication Code', 'Type PDB debugger command in here and hit Return (Enter) to execute it.': 'Type PDB debugger command in here and hit Return (Enter) to execute it.', 'Type some Python code in here and hit Return (Enter) to execute it.': 'Type some Python code in here and hit Return (Enter) to execute it.', 'Unable to check for upgrades': 'לא ניתן היה לבדוק אם יש שדרוגים', 'unable to create application "%s"': 'נכשל ביצירת האפליקציה "%s"', 'unable to delete file "%(filename)s"': 'נכשל במחיקת הקובץ "%(filename)s"', 'unable to delete file plugin "%(plugin)s"': 'נכשל במחיקת התוסף "%(plugin)s"', 'Unable to determine the line number!': 'Unable to determine the line number!', 'Unable to download app because:': 'לא ניתן היה להוריד את האפליקציה כי:', 'Unable to download because': 'לא הצלחתי להוריד כי', 'unable to download layout': 'unable to download layout', 'unable to download plugin: %s': 'unable to download plugin: %s', 'Unable to download the list of plugins': 'Unable to download the list of plugins', 'unable to install plugin "%s"': 'unable to install plugin "%s"', 'unable to parse csv file': 'לא הצלחתי לנתח את הקלט של קובץ csv', 'Unable to send email': 'Unable to send email', 'unable to uninstall "%s"': 'לא ניתן להסיר את "%s"', 'unable to upgrade because "%s"': 'לא ניתן היה לשדרג כי "%s"', 'uncheck all': 'הסר סימון מהכל', 'Uninstall': 'הסר התקנה', 'Unsupported webserver working mode: %s': 'Unsupported webserver working mode: %s', 'update': 'עדכן', 'update all languages': 'עדכן את כלל קיבצי השפה', 'Update:': 'עדכן:', 'Upgrade': 'Upgrade', 'upgrade now': 'upgrade now', 'upgrade now to %s': 'upgrade now to %s', 'upgrade web2py now': 'שדרג את web2py עכשיו', 'upload': 'upload', 'Upload': 'Upload', 'Upload & install packed application': 'העלה והתקן אפליקציה ארוזה', 'Upload a package:': 'Upload a package:', 'Upload and install packed application': 'Upload and install packed application', 'upload application:': 'העלה אפליקציה:', 'upload file:': 'העלה קובץ:', 'upload plugin file:': 'העלה קובץ תוסף:', 'Use (...)&(...) for AND, (...)|(...) for OR, and ~(...) for NOT to build more complex queries.': 'השתמש ב (...)&(...) עבור תנאי AND, (...)|(...) עבור תנאי OR ו~(...) עבור תנאי NOT ליצירת שאילתות מורכבות', 'Use an url:': 'Use an url:', 'User': 'User', 'User %(id)s is impersonating %(other_id)s': 'User %(id)s is impersonating %(other_id)s', 'User %(id)s Logged-in': 'User %(id)s Logged-in', 'User %(id)s Logged-out': 'User %(id)s Logged-out', 'User %(id)s Password changed': 'User %(id)s Password changed', 'User %(id)s Password reset': 'User %(id)s Password reset', 'User %(id)s Password retrieved': 'User %(id)s Password retrieved', 'User %(id)s Profile updated': 'User %(id)s Profile updated', 'User %(id)s Registered': 'User %(id)s Registered', 'User %(id)s Username retrieved': 'User %(id)s Username retrieved', 'User %(id)s Verification email sent': 'User %(id)s Verification email sent', 'User %(id)s verified registration key': 'User %(id)s verified registration key', 'User ID': 'User ID', 'Username': 'Username', 'Username already taken': 'Username already taken', 'Username retrieve': 'Username retrieve', 'Users': 'Users', 'Using the shell may lock the database to other users of this app.': 'Using the shell may lock the database to other users of this app.', 'variables': 'משתנים', 'Verify Password': 'Verify Password', 'Version': 'גירסא', 'Versioning': 'Versioning', 'versioning': 'מנגנון גירסאות', 'view': 'הצג', 'Views': 'מראה', 'views': 'מראה', 'Warning!': 'Warning!', 'WARNING:': 'WARNING:', 'WARNING: The following views could not be compiled:': 'WARNING: The following views could not be compiled:', 'Web Framework': 'Web Framework', 'web2py Admin Password': 'web2py Admin Password', 'web2py apps to deploy': 'web2py apps to deploy', 'web2py Debugger': 'web2py Debugger', 'web2py downgrade': 'web2py downgrade', 'web2py is up to date': 'web2py מותקנת בגירסתה האחרונה', 'web2py online debugger': 'web2py online debugger', 'web2py Recent Tweets': 'ציוצים אחרונים של web2py', 'web2py upgrade': 'web2py upgrade', 'web2py upgraded; please restart it': 'web2py שודרגה; נא אתחל אותה', 'Welcome %(username)s! Click on the link %(link)s to verify your email': 'Welcome %(username)s! Click on the link %(link)s to verify your email', 'Working...': 'Working...', 'WSGI reference name': 'WSGI reference name', 'YES': 'כן', 'Yes': 'Yes', 'You can also set and remove breakpoint in the edit window, using the Toggle Breakpoint button': 'You can also set and remove breakpoint in the edit window, using the Toggle Breakpoint button', 'You can inspect variables using the console below': 'You can inspect variables using the console below', 'You have been invited to join %(site)s, click %(link)s to complete the process': 'You have been invited to join %(site)s, click %(link)s to complete the process', 'You have one more login attempt before you are locked out': 'You have one more login attempt before you are locked out', 'You need to set up and reach a': 'You need to set up and reach a', 'You only need these if you have already registered': 'You only need these if you have already registered', 'Your application will be blocked until you click an action button (next, step, continue, etc.)': 'Your application will be blocked until you click an action button (next, step, continue, etc.)', 'Your password is: %(password)s': 'Your password is: %(password)s', 'Your temporary login code is {0}': 'Your temporary login code is {0}', 'Your username is: %(username)s': 'Your username is: %(username)s', 'Your username was emailed to you': 'Your username was emailed to you', }
true
true
f72467ab96456a59cb16d087533c917c2a6562da
3,363
py
Python
google/ads/google_ads/v1/proto/services/asset_service_pb2_grpc.py
jiulongw/google-ads-python
6f5256eb1eeb5a9a95c8cdb9b97988d3a676282e
[ "Apache-2.0" ]
1
2019-11-30T23:42:39.000Z
2019-11-30T23:42:39.000Z
google/ads/google_ads/v1/proto/services/asset_service_pb2_grpc.py
jiulongw/google-ads-python
6f5256eb1eeb5a9a95c8cdb9b97988d3a676282e
[ "Apache-2.0" ]
null
null
null
google/ads/google_ads/v1/proto/services/asset_service_pb2_grpc.py
jiulongw/google-ads-python
6f5256eb1eeb5a9a95c8cdb9b97988d3a676282e
[ "Apache-2.0" ]
1
2020-09-30T17:04:06.000Z
2020-09-30T17:04:06.000Z
# Generated by the gRPC Python protocol compiler plugin. DO NOT EDIT! import grpc from google.ads.google_ads.v1.proto.resources import asset_pb2 as google_dot_ads_dot_googleads__v1_dot_proto_dot_resources_dot_asset__pb2 from google.ads.google_ads.v1.proto.services import asset_service_pb2 as google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2 class AssetServiceStub(object): """Proto file describing the Asset service. Service to manage assets. Asset types can be created with AssetService are YoutubeVideoAsset, MediaBundleAsset and ImageAsset. TextAsset should be created with Ad inline. """ def __init__(self, channel): """Constructor. Args: channel: A grpc.Channel. """ self.GetAsset = channel.unary_unary( '/google.ads.googleads.v1.services.AssetService/GetAsset', request_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.GetAssetRequest.SerializeToString, response_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_resources_dot_asset__pb2.Asset.FromString, ) self.MutateAssets = channel.unary_unary( '/google.ads.googleads.v1.services.AssetService/MutateAssets', request_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsRequest.SerializeToString, response_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsResponse.FromString, ) class AssetServiceServicer(object): """Proto file describing the Asset service. Service to manage assets. Asset types can be created with AssetService are YoutubeVideoAsset, MediaBundleAsset and ImageAsset. TextAsset should be created with Ad inline. """ def GetAsset(self, request, context): """Returns the requested asset in full detail. """ context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def MutateAssets(self, request, context): """Creates assets. Operation statuses are returned. """ context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def add_AssetServiceServicer_to_server(servicer, server): rpc_method_handlers = { 'GetAsset': grpc.unary_unary_rpc_method_handler( servicer.GetAsset, request_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.GetAssetRequest.FromString, response_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_resources_dot_asset__pb2.Asset.SerializeToString, ), 'MutateAssets': grpc.unary_unary_rpc_method_handler( servicer.MutateAssets, request_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsRequest.FromString, response_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsResponse.SerializeToString, ), } generic_handler = grpc.method_handlers_generic_handler( 'google.ads.googleads.v1.services.AssetService', rpc_method_handlers) server.add_generic_rpc_handlers((generic_handler,))
46.068493
152
0.803152
import grpc from google.ads.google_ads.v1.proto.resources import asset_pb2 as google_dot_ads_dot_googleads__v1_dot_proto_dot_resources_dot_asset__pb2 from google.ads.google_ads.v1.proto.services import asset_service_pb2 as google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2 class AssetServiceStub(object): def __init__(self, channel): self.GetAsset = channel.unary_unary( '/google.ads.googleads.v1.services.AssetService/GetAsset', request_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.GetAssetRequest.SerializeToString, response_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_resources_dot_asset__pb2.Asset.FromString, ) self.MutateAssets = channel.unary_unary( '/google.ads.googleads.v1.services.AssetService/MutateAssets', request_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsRequest.SerializeToString, response_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsResponse.FromString, ) class AssetServiceServicer(object): def GetAsset(self, request, context): context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def MutateAssets(self, request, context): context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def add_AssetServiceServicer_to_server(servicer, server): rpc_method_handlers = { 'GetAsset': grpc.unary_unary_rpc_method_handler( servicer.GetAsset, request_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.GetAssetRequest.FromString, response_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_resources_dot_asset__pb2.Asset.SerializeToString, ), 'MutateAssets': grpc.unary_unary_rpc_method_handler( servicer.MutateAssets, request_deserializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsRequest.FromString, response_serializer=google_dot_ads_dot_googleads__v1_dot_proto_dot_services_dot_asset__service__pb2.MutateAssetsResponse.SerializeToString, ), } generic_handler = grpc.method_handlers_generic_handler( 'google.ads.googleads.v1.services.AssetService', rpc_method_handlers) server.add_generic_rpc_handlers((generic_handler,))
true
true
f72468636003b664ce87050e414e28fea873cd2a
6,582
py
Python
uhd_restpy/testplatform/sessions/ixnetwork/impairment/link/link.py
OpenIxia/ixnetwork_restpy
f628db450573a104f327cf3c737ca25586e067ae
[ "MIT" ]
20
2019-05-07T01:59:14.000Z
2022-02-11T05:24:47.000Z
uhd_restpy/testplatform/sessions/ixnetwork/impairment/link/link.py
OpenIxia/ixnetwork_restpy
f628db450573a104f327cf3c737ca25586e067ae
[ "MIT" ]
60
2019-04-03T18:59:35.000Z
2022-02-22T12:05:05.000Z
uhd_restpy/testplatform/sessions/ixnetwork/impairment/link/link.py
OpenIxia/ixnetwork_restpy
f628db450573a104f327cf3c737ca25586e067ae
[ "MIT" ]
13
2019-05-20T10:48:31.000Z
2021-10-06T07:45:44.000Z
# MIT LICENSE # # Copyright 1997 - 2020 by IXIA Keysight # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), # to deal in the Software without restriction, including without limitation # the rights to use, copy, modify, merge, publish, distribute, sublicense, # and/or sell copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN # THE SOFTWARE. from uhd_restpy.base import Base from uhd_restpy.files import Files from typing import List, Any, Union class Link(Base): """List of impairment links. Each link consists of a pair of ports. The Link class encapsulates a list of link resources that are managed by the system. A list of resources can be retrieved from the server using the Link.find() method. """ __slots__ = () _SDM_NAME = 'link' _SDM_ATT_MAP = { 'ForwardingInterruption': 'forwardingInterruption', 'Name': 'name', 'RxPortName': 'rxPortName', 'TxPortName': 'txPortName', } _SDM_ENUM_MAP = { } def __init__(self, parent, list_op=False): super(Link, self).__init__(parent, list_op) @property def LosLof(self): """ Returns ------- - obj(uhd_restpy.testplatform.sessions.ixnetwork.impairment.link.loslof.loslof.LosLof): An instance of the LosLof class Raises ------ - ServerError: The server has encountered an uncategorized error condition """ from uhd_restpy.testplatform.sessions.ixnetwork.impairment.link.loslof.loslof import LosLof if self._properties.get('LosLof', None) is not None: return self._properties.get('LosLof') else: return LosLof(self)._select() @property def ForwardingInterruption(self): # type: () -> bool """ Returns ------- - bool: Emulate a link fault. Drop all packets received. """ return self._get_attribute(self._SDM_ATT_MAP['ForwardingInterruption']) @ForwardingInterruption.setter def ForwardingInterruption(self, value): # type: (bool) -> None self._set_attribute(self._SDM_ATT_MAP['ForwardingInterruption'], value) @property def Name(self): # type: () -> str """ Returns ------- - str: The name of the link: receiving port -> transmitting port. """ return self._get_attribute(self._SDM_ATT_MAP['Name']) @property def RxPortName(self): # type: () -> str """ Returns ------- - str: The name of the receiving port. """ return self._get_attribute(self._SDM_ATT_MAP['RxPortName']) @property def TxPortName(self): # type: () -> str """ Returns ------- - str: The name of the transmitting port. """ return self._get_attribute(self._SDM_ATT_MAP['TxPortName']) def update(self, ForwardingInterruption=None): # type: (bool) -> Link """Updates link resource on the server. Args ---- - ForwardingInterruption (bool): Emulate a link fault. Drop all packets received. Raises ------ - ServerError: The server has encountered an uncategorized error condition """ return self._update(self._map_locals(self._SDM_ATT_MAP, locals())) def add(self, ForwardingInterruption=None): # type: (bool) -> Link """Adds a new link resource on the json, only valid with config assistant Args ---- - ForwardingInterruption (bool): Emulate a link fault. Drop all packets received. Returns ------- - self: This instance with all currently retrieved link resources using find and the newly added link resources available through an iterator or index Raises ------ - Exception: if this function is not being used with config assistance """ return self._add_xpath(self._map_locals(self._SDM_ATT_MAP, locals())) def find(self, ForwardingInterruption=None, Name=None, RxPortName=None, TxPortName=None): # type: (bool, str, str, str) -> Link """Finds and retrieves link resources from the server. All named parameters are evaluated on the server using regex. The named parameters can be used to selectively retrieve link resources from the server. To retrieve an exact match ensure the parameter value starts with ^ and ends with $ By default the find method takes no parameters and will retrieve all link resources from the server. Args ---- - ForwardingInterruption (bool): Emulate a link fault. Drop all packets received. - Name (str): The name of the link: receiving port -> transmitting port. - RxPortName (str): The name of the receiving port. - TxPortName (str): The name of the transmitting port. Returns ------- - self: This instance with matching link resources retrieved from the server available through an iterator or index Raises ------ - ServerError: The server has encountered an uncategorized error condition """ return self._select(self._map_locals(self._SDM_ATT_MAP, locals())) def read(self, href): """Retrieves a single instance of link data from the server. Args ---- - href (str): An href to the instance to be retrieved Returns ------- - self: This instance with the link resources from the server available through an iterator or index Raises ------ - NotFoundError: The requested resource does not exist on the server - ServerError: The server has encountered an uncategorized error condition """ return self._read(href)
36.164835
158
0.647068
from uhd_restpy.base import Base from uhd_restpy.files import Files from typing import List, Any, Union class Link(Base): __slots__ = () _SDM_NAME = 'link' _SDM_ATT_MAP = { 'ForwardingInterruption': 'forwardingInterruption', 'Name': 'name', 'RxPortName': 'rxPortName', 'TxPortName': 'txPortName', } _SDM_ENUM_MAP = { } def __init__(self, parent, list_op=False): super(Link, self).__init__(parent, list_op) @property def LosLof(self): from uhd_restpy.testplatform.sessions.ixnetwork.impairment.link.loslof.loslof import LosLof if self._properties.get('LosLof', None) is not None: return self._properties.get('LosLof') else: return LosLof(self)._select() @property def ForwardingInterruption(self): return self._get_attribute(self._SDM_ATT_MAP['ForwardingInterruption']) @ForwardingInterruption.setter def ForwardingInterruption(self, value): self._set_attribute(self._SDM_ATT_MAP['ForwardingInterruption'], value) @property def Name(self): return self._get_attribute(self._SDM_ATT_MAP['Name']) @property def RxPortName(self): return self._get_attribute(self._SDM_ATT_MAP['RxPortName']) @property def TxPortName(self): return self._get_attribute(self._SDM_ATT_MAP['TxPortName']) def update(self, ForwardingInterruption=None): return self._update(self._map_locals(self._SDM_ATT_MAP, locals())) def add(self, ForwardingInterruption=None): return self._add_xpath(self._map_locals(self._SDM_ATT_MAP, locals())) def find(self, ForwardingInterruption=None, Name=None, RxPortName=None, TxPortName=None): return self._select(self._map_locals(self._SDM_ATT_MAP, locals())) def read(self, href): return self._read(href)
true
true
f724688f8543cbeb74c6f94451f45052c8b2c1af
11,189
py
Python
plugins/modules/oracle_profile.py
blaf-cgi/ansible-oracle-modules
37905c6ad91808a96f0085c9c1069e166f2e17b4
[ "MIT" ]
8
2020-08-11T04:21:24.000Z
2021-12-03T16:21:56.000Z
plugins/modules/oracle_profile.py
blaf-cgi/ansible-oracle-modules
37905c6ad91808a96f0085c9c1069e166f2e17b4
[ "MIT" ]
4
2021-03-13T09:09:28.000Z
2022-01-07T12:38:02.000Z
plugins/modules/oracle_profile.py
blaf-cgi/ansible-oracle-modules
37905c6ad91808a96f0085c9c1069e166f2e17b4
[ "MIT" ]
3
2021-03-16T13:48:57.000Z
2022-03-02T10:43:47.000Z
#!/usr/bin/python # -*- coding: utf-8 -*- from __future__ import absolute_import, division, print_function __metaclass__ = type DOCUMENTATION = ''' --- module: oracle_profile short_description: Manage profiles in an Oracle database description: - Manage profiles in an Oracle database version_added: "0.8.0" options: name: description: - The name of the profile required: true default: None aliases: ['profile'] state: description: - The intended state of the profile. default: present choices: ['present','absent'] attribute_name: description: - The attribute name (e.g PASSWORD_REUSE_TIME) default: None aliases: ['an'] attribute_value: description: - The attribute value (e.g 10) default: None aliases: ['av'] username: description: - The DB username required: false default: sys aliases: ['un'] password: description: - The password for the DB user required: false default: None aliases: ['pw'] service_name: description: - The profile_name to connect to the database. required: false aliases: ['sn'] hostname: description: - The host of the database if using dbms_profile required: false default: localhost aliases: ['host'] port: description: - The listener port to connect to the database if using dbms_profile required: false default: 1521 oracle_home: description: - The GI ORACLE_HOME required: false default: None aliases: ['oh'] notes: - cx_Oracle needs to be installed requirements: [ "cx_Oracle" ] author: Mikael Sandström, oravirt@gmail.com, @oravirt ''' EXAMPLES = ''' # Create a profile - hosts: dbserver vars: oracle_home: /u01/app/oracle/12.2.0.1/db1 hostname: "{{ inventory_hostname }}" service_name: orclpdb user: system password: Oracle_123 oracle_env: ORACLE_HOME: "{{ oracle_home }}" LD_LIBRARY_PATH: "{{ oracle_home }}/lib" profiles: - name: profile1 attribute_name: - password_reuse_max - password_reuse_time - sessions_per_user attribute_value: - 6 - 20 - 5 state: present tasks: - name: Manage profiles oracle_profile: name={{ item.name }} attribute_name={{ item.attribute_name}} attribute_value={{ item.attribute_value}} state={{ item.state }} hostname={{ hostname }} service_name={{ service_name }} user={{ user }} password={{ password }} environment: "{{oracle_env}}" with_items: "{{ profiles }}" ''' try: import cx_Oracle except ImportError: cx_oracle_exists = False else: cx_oracle_exists = True # Check if the profile exists def check_profile_exists(cursor, module, msg, name): sql = 'select count(*) from dba_profiles where lower (profile) = \'%s\'' % (name.lower()) result = execute_sql_get(module, msg, cursor, sql) if result[0][0] > 0: return True else: return False def create_profile(cursor, module, msg, oracle_home, name, attribute_name, attribute_value): add_attr = False if not any(x == 'None' for x in attribute_name): add_attr = True if not any(x is None for x in attribute_name): add_attr = True if add_attr: attributes = ' '.join(['' + str(n) + ' ' + str(v) + '' for n, v in zip(attribute_name, attribute_value)]) sql = 'create profile %s limit ' % name if add_attr: sql += ' %s' % (attributes.lower()) if execute_sql(module, msg, cursor, sql): return True else: return False def remove_profile(cursor, module, msg, oracle_home, name): dropsql = 'drop profile %s' % name if execute_sql(module, msg, cursor, dropsql): return True else: return False def ensure_profile_state(cursor, module, msg, name, state, attribute_name, attribute_value): # pass total_sql = [] profile_sql = 'alter profile %s ' % (name.upper()) # Deal with attribute differences if attribute_name and attribute_value: # Make sure attributes are lower case attribute_name = [x.lower() for x in attribute_name] attribute_value = [str(y).lower() for y in attribute_value] wanted_attributes = zip(attribute_name, attribute_value) # Check the current attributes attribute_names_ = ','.join(['\'' + n[0] + '\'' for n in wanted_attributes]) if len(attribute_names_) != 0: current_attributes = get_current_attributes(cursor, module, msg, name, attribute_names_) # Convert to dict and compare current with wanted if dict(current_attributes) != dict(wanted_attributes): for i in wanted_attributes: total_sql.append("alter profile %s limit %s %s " % (name, i[0], i[1])) # module.exit_json(msg=total_sql, changed=True) if len(total_sql) > 0: if ensure_profile_state_sql(module, msg, cursor, total_sql): msg = 'profile %s has been put in the intended state' % name module.exit_json(msg=msg, changed=True) else: return False else: msg = 'Nothing to do' module.exit_json(msg=msg, changed=False) def ensure_profile_state_sql(module, msg, cursor, total_sql): for sql in total_sql: execute_sql(module, msg, cursor, sql) return True def get_current_attributes(cursor, module, msg, name, attribute_names_): sql = 'select lower(resource_name),lower(limit) ' sql += 'from dba_profiles ' sql += 'where lower(profile) = \'%s\' ' % (name.lower()) sql += 'and lower(resource_name) in (%s) ' % (attribute_names_.lower()) result = execute_sql_get(module, msg, cursor, sql) return result def execute_sql_get(module, msg, cursor, sql): try: cursor.execute(sql) result = (cursor.fetchall()) except cx_Oracle.DatabaseError as exc: error, = exc.args msg = 'Something went wrong while executing sql_get - %s sql: %s' % (error.message, sql) module.fail_json(msg=msg, changed=False) return False return result def execute_sql(module, msg, cursor, sql): try: cursor.execute(sql) except cx_Oracle.DatabaseError as exc: error, = exc.args msg = 'Something went wrong while executing sql - %s sql: %s' % (error.message, sql) module.fail_json(msg=msg, changed=False) return False return True def main(): msg = [''] cursor = None module = AnsibleModule( argument_spec=dict( name=dict(required=True, aliases=['profile']), attribute_name=dict(required=True, type='list', aliases=['an']), attribute_value=dict(required=True, type='list', aliases=['av']), state=dict(default="present", choices=["present", "absent"]), user=dict(required=False, aliases=['un', 'username']), password=dict(required=False, no_log=True, aliases=['pw']), mode=dict(default='normal', choices=["normal", "sysdba"]), hostname=dict(required=False, default='localhost', aliases=['host']), port=dict(required=False, default=1521), service_name=dict(required=False, aliases=['sn']), oracle_home=dict(required=False, aliases=['oh']), ), ) name = module.params["name"] attribute_name = module.params["attribute_name"] attribute_value = module.params["attribute_value"] state = module.params["state"] user = module.params["user"] password = module.params["password"] mode = module.params["mode"] hostname = module.params["hostname"] port = module.params["port"] service_name = module.params["service_name"] oracle_home = module.params["oracle_home"] if not cx_oracle_exists: msg = "The cx_Oracle module is required. 'pip install cx_Oracle' should do the trick. If cx_Oracle is installed, make sure ORACLE_HOME & LD_LIBRARY_PATH is set" module.fail_json(msg=msg) wallet_connect = '/@%s' % service_name try: if ( not user and not password): # If neither user or password is supplied, the use of an oracle wallet is assumed connect = wallet_connect if mode == 'sysdba': conn = cx_Oracle.connect(wallet_connect, mode=cx_Oracle.SYSDBA) else: conn = cx_Oracle.connect(wallet_connect) elif user and password: dsn = cx_Oracle.makedsn(host=hostname, port=port, service_name=service_name) connect = dsn if mode == 'sysdba': conn = cx_Oracle.connect(user, password, dsn, mode=cx_Oracle.SYSDBA) else: conn = cx_Oracle.connect(user, password, dsn) elif not user or not password: module.fail_json(msg='Missing username or password for cx_Oracle') except cx_Oracle.DatabaseError as exc: error, = exc.args msg = 'Could not connect to DB: %s, connect descriptor: %s, username: %s, pass: %s' % ( error.message, connect, user, password) module.fail_json(msg=msg, changed=False) cursor = conn.cursor() if oracle_home is not None: os.environ['ORACLE_HOME'] = oracle_home elif 'ORACLE_HOME' in os.environ: oracle_home = os.environ['ORACLE_HOME'] else: msg = 'ORACLE_HOME variable not set. Please set it and re-run the command' module.fail_json(msg=msg, changed=False) if state == 'present': if not check_profile_exists(cursor, module, msg, name): if create_profile(cursor, module, msg, oracle_home, name, attribute_name, attribute_value): msg = 'Successfully created profile %s ' % name module.exit_json(msg=msg, changed=True) else: module.fail_json(msg=msg, changed=False) else: ensure_profile_state(cursor, module, msg, name, state, attribute_name, attribute_value) elif state == 'absent': if check_profile_exists(cursor, module, msg, name): if remove_profile(cursor, module, msg, oracle_home, name): msg = 'Profile %s successfully removed' % name module.exit_json(msg=msg, changed=True) else: module.exit_json(msg=msg, changed=False) else: msg = 'Profile %s doesn\'t exist' % name module.exit_json(msg=msg, changed=False) module.exit_json(msg="Unhandled exit", changed=False) from ansible.module_utils.basic import AnsibleModule, os if __name__ == '__main__': main()
32.620991
168
0.602377
from __future__ import absolute_import, division, print_function __metaclass__ = type DOCUMENTATION = ''' --- module: oracle_profile short_description: Manage profiles in an Oracle database description: - Manage profiles in an Oracle database version_added: "0.8.0" options: name: description: - The name of the profile required: true default: None aliases: ['profile'] state: description: - The intended state of the profile. default: present choices: ['present','absent'] attribute_name: description: - The attribute name (e.g PASSWORD_REUSE_TIME) default: None aliases: ['an'] attribute_value: description: - The attribute value (e.g 10) default: None aliases: ['av'] username: description: - The DB username required: false default: sys aliases: ['un'] password: description: - The password for the DB user required: false default: None aliases: ['pw'] service_name: description: - The profile_name to connect to the database. required: false aliases: ['sn'] hostname: description: - The host of the database if using dbms_profile required: false default: localhost aliases: ['host'] port: description: - The listener port to connect to the database if using dbms_profile required: false default: 1521 oracle_home: description: - The GI ORACLE_HOME required: false default: None aliases: ['oh'] notes: - cx_Oracle needs to be installed requirements: [ "cx_Oracle" ] author: Mikael Sandström, oravirt@gmail.com, @oravirt ''' EXAMPLES = ''' # Create a profile - hosts: dbserver vars: oracle_home: /u01/app/oracle/12.2.0.1/db1 hostname: "{{ inventory_hostname }}" service_name: orclpdb user: system password: Oracle_123 oracle_env: ORACLE_HOME: "{{ oracle_home }}" LD_LIBRARY_PATH: "{{ oracle_home }}/lib" profiles: - name: profile1 attribute_name: - password_reuse_max - password_reuse_time - sessions_per_user attribute_value: - 6 - 20 - 5 state: present tasks: - name: Manage profiles oracle_profile: name={{ item.name }} attribute_name={{ item.attribute_name}} attribute_value={{ item.attribute_value}} state={{ item.state }} hostname={{ hostname }} service_name={{ service_name }} user={{ user }} password={{ password }} environment: "{{oracle_env}}" with_items: "{{ profiles }}" ''' try: import cx_Oracle except ImportError: cx_oracle_exists = False else: cx_oracle_exists = True def check_profile_exists(cursor, module, msg, name): sql = 'select count(*) from dba_profiles where lower (profile) = \'%s\'' % (name.lower()) result = execute_sql_get(module, msg, cursor, sql) if result[0][0] > 0: return True else: return False def create_profile(cursor, module, msg, oracle_home, name, attribute_name, attribute_value): add_attr = False if not any(x == 'None' for x in attribute_name): add_attr = True if not any(x is None for x in attribute_name): add_attr = True if add_attr: attributes = ' '.join(['' + str(n) + ' ' + str(v) + '' for n, v in zip(attribute_name, attribute_value)]) sql = 'create profile %s limit ' % name if add_attr: sql += ' %s' % (attributes.lower()) if execute_sql(module, msg, cursor, sql): return True else: return False def remove_profile(cursor, module, msg, oracle_home, name): dropsql = 'drop profile %s' % name if execute_sql(module, msg, cursor, dropsql): return True else: return False def ensure_profile_state(cursor, module, msg, name, state, attribute_name, attribute_value): total_sql = [] profile_sql = 'alter profile %s ' % (name.upper()) if attribute_name and attribute_value: attribute_name = [x.lower() for x in attribute_name] attribute_value = [str(y).lower() for y in attribute_value] wanted_attributes = zip(attribute_name, attribute_value) attribute_names_ = ','.join(['\'' + n[0] + '\'' for n in wanted_attributes]) if len(attribute_names_) != 0: current_attributes = get_current_attributes(cursor, module, msg, name, attribute_names_) if dict(current_attributes) != dict(wanted_attributes): for i in wanted_attributes: total_sql.append("alter profile %s limit %s %s " % (name, i[0], i[1])) if len(total_sql) > 0: if ensure_profile_state_sql(module, msg, cursor, total_sql): msg = 'profile %s has been put in the intended state' % name module.exit_json(msg=msg, changed=True) else: return False else: msg = 'Nothing to do' module.exit_json(msg=msg, changed=False) def ensure_profile_state_sql(module, msg, cursor, total_sql): for sql in total_sql: execute_sql(module, msg, cursor, sql) return True def get_current_attributes(cursor, module, msg, name, attribute_names_): sql = 'select lower(resource_name),lower(limit) ' sql += 'from dba_profiles ' sql += 'where lower(profile) = \'%s\' ' % (name.lower()) sql += 'and lower(resource_name) in (%s) ' % (attribute_names_.lower()) result = execute_sql_get(module, msg, cursor, sql) return result def execute_sql_get(module, msg, cursor, sql): try: cursor.execute(sql) result = (cursor.fetchall()) except cx_Oracle.DatabaseError as exc: error, = exc.args msg = 'Something went wrong while executing sql_get - %s sql: %s' % (error.message, sql) module.fail_json(msg=msg, changed=False) return False return result def execute_sql(module, msg, cursor, sql): try: cursor.execute(sql) except cx_Oracle.DatabaseError as exc: error, = exc.args msg = 'Something went wrong while executing sql - %s sql: %s' % (error.message, sql) module.fail_json(msg=msg, changed=False) return False return True def main(): msg = [''] cursor = None module = AnsibleModule( argument_spec=dict( name=dict(required=True, aliases=['profile']), attribute_name=dict(required=True, type='list', aliases=['an']), attribute_value=dict(required=True, type='list', aliases=['av']), state=dict(default="present", choices=["present", "absent"]), user=dict(required=False, aliases=['un', 'username']), password=dict(required=False, no_log=True, aliases=['pw']), mode=dict(default='normal', choices=["normal", "sysdba"]), hostname=dict(required=False, default='localhost', aliases=['host']), port=dict(required=False, default=1521), service_name=dict(required=False, aliases=['sn']), oracle_home=dict(required=False, aliases=['oh']), ), ) name = module.params["name"] attribute_name = module.params["attribute_name"] attribute_value = module.params["attribute_value"] state = module.params["state"] user = module.params["user"] password = module.params["password"] mode = module.params["mode"] hostname = module.params["hostname"] port = module.params["port"] service_name = module.params["service_name"] oracle_home = module.params["oracle_home"] if not cx_oracle_exists: msg = "The cx_Oracle module is required. 'pip install cx_Oracle' should do the trick. If cx_Oracle is installed, make sure ORACLE_HOME & LD_LIBRARY_PATH is set" module.fail_json(msg=msg) wallet_connect = '/@%s' % service_name try: if ( not user and not password): connect = wallet_connect if mode == 'sysdba': conn = cx_Oracle.connect(wallet_connect, mode=cx_Oracle.SYSDBA) else: conn = cx_Oracle.connect(wallet_connect) elif user and password: dsn = cx_Oracle.makedsn(host=hostname, port=port, service_name=service_name) connect = dsn if mode == 'sysdba': conn = cx_Oracle.connect(user, password, dsn, mode=cx_Oracle.SYSDBA) else: conn = cx_Oracle.connect(user, password, dsn) elif not user or not password: module.fail_json(msg='Missing username or password for cx_Oracle') except cx_Oracle.DatabaseError as exc: error, = exc.args msg = 'Could not connect to DB: %s, connect descriptor: %s, username: %s, pass: %s' % ( error.message, connect, user, password) module.fail_json(msg=msg, changed=False) cursor = conn.cursor() if oracle_home is not None: os.environ['ORACLE_HOME'] = oracle_home elif 'ORACLE_HOME' in os.environ: oracle_home = os.environ['ORACLE_HOME'] else: msg = 'ORACLE_HOME variable not set. Please set it and re-run the command' module.fail_json(msg=msg, changed=False) if state == 'present': if not check_profile_exists(cursor, module, msg, name): if create_profile(cursor, module, msg, oracle_home, name, attribute_name, attribute_value): msg = 'Successfully created profile %s ' % name module.exit_json(msg=msg, changed=True) else: module.fail_json(msg=msg, changed=False) else: ensure_profile_state(cursor, module, msg, name, state, attribute_name, attribute_value) elif state == 'absent': if check_profile_exists(cursor, module, msg, name): if remove_profile(cursor, module, msg, oracle_home, name): msg = 'Profile %s successfully removed' % name module.exit_json(msg=msg, changed=True) else: module.exit_json(msg=msg, changed=False) else: msg = 'Profile %s doesn\'t exist' % name module.exit_json(msg=msg, changed=False) module.exit_json(msg="Unhandled exit", changed=False) from ansible.module_utils.basic import AnsibleModule, os if __name__ == '__main__': main()
true
true
f72468caade31cb02d08f32af7db7f38ca7ca5c2
1,858
py
Python
azure_iot_hub/azure/templates/led_matrix_esp32_iot_hub/__init__.py
codycodes/gix-mkrfridays-iot
8e41040114e58b55a07ecdef7c0f4a669a0b27dc
[ "MIT" ]
2
2020-05-17T05:04:22.000Z
2020-05-19T17:14:59.000Z
azure_iot_hub/azure/templates/led_matrix_esp32_iot_hub/__init__.py
codycodes/gix-mkrfridays-iot
8e41040114e58b55a07ecdef7c0f4a669a0b27dc
[ "MIT" ]
18
2020-05-13T22:51:50.000Z
2020-10-07T04:44:16.000Z
azure_iot_hub/azure/templates/led_matrix_esp32_iot_hub/__init__.py
codycodes/gix-mkrfridays-iot
8e41040114e58b55a07ecdef7c0f4a669a0b27dc
[ "MIT" ]
2
2020-04-24T21:25:42.000Z
2020-05-16T19:00:50.000Z
import logging import azure.functions as func from azure.iot.hub import IoTHubRegistryManager # Note that Azure Key Vault doesn't support underscores # and some other special chars; # we substitute with a hyphen for underscore CONNECTION_STRING = "{c2d connection string}" DEVICE_ID = "{device to invoke}" MESSAGE_COUNT = 1 def iothub_messaging_sample_run(msg): try: # IoTHubRegistryManager registry_manager = IoTHubRegistryManager(CONNECTION_STRING) for i in range(0, MESSAGE_COUNT): logging.info('Sending message: {0}'.format(i)) data = msg props = {} registry_manager.send_c2d_message( DEVICE_ID, data, properties=props) except Exception as ex: logging.info(f"Unexpected error {ex}") return def main(req: func.HttpRequest) -> func.HttpResponse: logging.info('Python HTTP trigger function processed a request.') msg = req.params.get('msg') if not msg: try: req_body = req.get_json() except ValueError: pass else: msg = req_body.get('msg') logging.info('***NOW EXECUTING C2D***') if msg: # TODO: this whitespace is to push some unicode chars off # the screen; can be removed later when Arduino code is # fixed iothub_messaging_sample_run(msg) return func.HttpResponse( f"Your text {msg} has been deployed to the" " device successfully!") else: return func.HttpResponse( "This HTTP triggered function executed successfully." " Pass a msg in the query string or in the request body" " for a personalized response.", status_code=200 )
32.034483
70
0.599569
import logging import azure.functions as func from azure.iot.hub import IoTHubRegistryManager # and some other special chars; # we substitute with a hyphen for underscore CONNECTION_STRING = "{c2d connection string}" DEVICE_ID = "{device to invoke}" MESSAGE_COUNT = 1 def iothub_messaging_sample_run(msg): try: # IoTHubRegistryManager registry_manager = IoTHubRegistryManager(CONNECTION_STRING) for i in range(0, MESSAGE_COUNT): logging.info('Sending message: {0}'.format(i)) data = msg props = {} registry_manager.send_c2d_message( DEVICE_ID, data, properties=props) except Exception as ex: logging.info(f"Unexpected error {ex}") return def main(req: func.HttpRequest) -> func.HttpResponse: logging.info('Python HTTP trigger function processed a request.') msg = req.params.get('msg') if not msg: try: req_body = req.get_json() except ValueError: pass else: msg = req_body.get('msg') logging.info('***NOW EXECUTING C2D***') if msg: # TODO: this whitespace is to push some unicode chars off # the screen; can be removed later when Arduino code is # fixed iothub_messaging_sample_run(msg) return func.HttpResponse( f"Your text {msg} has been deployed to the" " device successfully!") else: return func.HttpResponse( "This HTTP triggered function executed successfully." " Pass a msg in the query string or in the request body" " for a personalized response.", status_code=200 )
true
true
f72469575b1cfc70bf9f89f7c27364ebc94398cb
4,622
py
Python
images/orbit-controller/src/orbit_controller/webhooks/imagereplication_pod_webhook.py
srinivasreddych/aws-orbit-workbench
2d154addff58d26f5459a73c06148aaf5e9fad46
[ "Apache-2.0" ]
94
2021-03-19T19:55:11.000Z
2022-03-31T19:50:01.000Z
images/orbit-controller/src/orbit_controller/webhooks/imagereplication_pod_webhook.py
srinivasreddych/aws-orbit-workbench
2d154addff58d26f5459a73c06148aaf5e9fad46
[ "Apache-2.0" ]
410
2021-03-19T18:04:48.000Z
2022-03-22T13:56:53.000Z
images/orbit-controller/src/orbit_controller/webhooks/imagereplication_pod_webhook.py
srinivasreddych/aws-orbit-workbench
2d154addff58d26f5459a73c06148aaf5e9fad46
[ "Apache-2.0" ]
24
2021-03-19T23:16:23.000Z
2022-03-04T01:05:18.000Z
# Copyright Amazon.com, Inc. or its affiliates. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"). # You may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import logging import os from copy import deepcopy from typing import Any, Dict, List, Optional import kopf from orbit_controller import ORBIT_API_GROUP, ORBIT_API_VERSION, dynamic_client from orbit_controller.utils import imagereplication_utils CONFIG: Dict[str, Any] @kopf.on.startup() def configure(settings: kopf.OperatorSettings, logger: kopf.Logger, **_: Any) -> None: settings.admission.server = kopf.WebhookServer( cafile="/certs/ca.crt", certfile="/certs/tls.crt", pkeyfile="/certs/tls.key", port=443, ) settings.persistence.progress_storage = kopf.MultiProgressStorage( [ kopf.AnnotationsProgressStorage(prefix="orbit.aws"), kopf.StatusProgressStorage(field="status.orbit-aws"), ] ) settings.persistence.finalizer = "imagereplication-pod-webhook.orbit.aws/kopf-finalizer" settings.posting.level = logging.getLevelName(os.environ.get("EVENT_LOG_LEVEL", "INFO")) global CONFIG CONFIG = imagereplication_utils.get_config() logger.info("CONFIG: %s", CONFIG) def _check_replication_status(value: str, **_: Any) -> bool: return value not in ["Failed", "MaxAttemptsExceeded"] @kopf.index( # type: ignore ORBIT_API_GROUP, ORBIT_API_VERSION, "imagereplications", field="status.replication.replicationStatus", value=_check_replication_status, ) def imagereplications_idx(namespace: str, name: str, spec: kopf.Spec, status: kopf.Status, **_: Any) -> Dict[str, Any]: replication_status = status.get("replication", {}).get("replicationStatus", None) return { spec["destination"]: { "namespace": namespace, "name": name, "source": spec["source"], "replicationStatus": replication_status, } } @kopf.on.mutate("pods", id="update-pod-images") # type: ignore def update_pod_images( spec: kopf.Spec, patch: kopf.Patch, dryrun: bool, logger: kopf.Logger, imagereplications_idx: kopf.Index[str, str], **_: Any, ) -> kopf.Patch: if dryrun: logger.debug("DryRun - Skip Pod Mutation") return patch annotations = {} init_containers: List[Dict[str, Any]] = [] containers: List[Dict[str, Any]] = [] replications = {} def process_containers( src_containers: Optional[List[Dict[str, Any]]], dest_containers: List[Dict[str, Any]] ) -> None: for container in src_containers if src_containers else []: image = container.get("image", "") desired_image = imagereplication_utils.get_desired_image(image=image, config=CONFIG) if image != desired_image: container_copy = deepcopy(container) container_copy["image"] = desired_image dest_containers.append(container_copy) replications[image] = desired_image annotations[f"original-container-image~1{container['name']}"] = image process_containers(spec.get("initContainers", []), init_containers) process_containers(spec.get("containers", []), containers) if replications: client = dynamic_client() for source, destination in replications.items(): if not imagereplications_idx.get(destination, []): imagereplication_utils.create_imagereplication( namespace="orbit-system", source=source, destination=destination, client=client, logger=logger, ) else: logger.debug("Skipping ImageReplication Creation") if annotations: patch["metadata"] = {"annotations": annotations} patch["spec"] = {} if init_containers: patch["spec"]["initContainers"] = init_containers if containers: patch["spec"]["containers"] = containers logger.debug("Patch: %s", str(patch)) return patch
35.553846
119
0.650151
import logging import os from copy import deepcopy from typing import Any, Dict, List, Optional import kopf from orbit_controller import ORBIT_API_GROUP, ORBIT_API_VERSION, dynamic_client from orbit_controller.utils import imagereplication_utils CONFIG: Dict[str, Any] @kopf.on.startup() def configure(settings: kopf.OperatorSettings, logger: kopf.Logger, **_: Any) -> None: settings.admission.server = kopf.WebhookServer( cafile="/certs/ca.crt", certfile="/certs/tls.crt", pkeyfile="/certs/tls.key", port=443, ) settings.persistence.progress_storage = kopf.MultiProgressStorage( [ kopf.AnnotationsProgressStorage(prefix="orbit.aws"), kopf.StatusProgressStorage(field="status.orbit-aws"), ] ) settings.persistence.finalizer = "imagereplication-pod-webhook.orbit.aws/kopf-finalizer" settings.posting.level = logging.getLevelName(os.environ.get("EVENT_LOG_LEVEL", "INFO")) global CONFIG CONFIG = imagereplication_utils.get_config() logger.info("CONFIG: %s", CONFIG) def _check_replication_status(value: str, **_: Any) -> bool: return value not in ["Failed", "MaxAttemptsExceeded"] @kopf.index( ORBIT_API_GROUP, ORBIT_API_VERSION, "imagereplications", field="status.replication.replicationStatus", value=_check_replication_status, ) def imagereplications_idx(namespace: str, name: str, spec: kopf.Spec, status: kopf.Status, **_: Any) -> Dict[str, Any]: replication_status = status.get("replication", {}).get("replicationStatus", None) return { spec["destination"]: { "namespace": namespace, "name": name, "source": spec["source"], "replicationStatus": replication_status, } } @kopf.on.mutate("pods", id="update-pod-images") def update_pod_images( spec: kopf.Spec, patch: kopf.Patch, dryrun: bool, logger: kopf.Logger, imagereplications_idx: kopf.Index[str, str], **_: Any, ) -> kopf.Patch: if dryrun: logger.debug("DryRun - Skip Pod Mutation") return patch annotations = {} init_containers: List[Dict[str, Any]] = [] containers: List[Dict[str, Any]] = [] replications = {} def process_containers( src_containers: Optional[List[Dict[str, Any]]], dest_containers: List[Dict[str, Any]] ) -> None: for container in src_containers if src_containers else []: image = container.get("image", "") desired_image = imagereplication_utils.get_desired_image(image=image, config=CONFIG) if image != desired_image: container_copy = deepcopy(container) container_copy["image"] = desired_image dest_containers.append(container_copy) replications[image] = desired_image annotations[f"original-container-image~1{container['name']}"] = image process_containers(spec.get("initContainers", []), init_containers) process_containers(spec.get("containers", []), containers) if replications: client = dynamic_client() for source, destination in replications.items(): if not imagereplications_idx.get(destination, []): imagereplication_utils.create_imagereplication( namespace="orbit-system", source=source, destination=destination, client=client, logger=logger, ) else: logger.debug("Skipping ImageReplication Creation") if annotations: patch["metadata"] = {"annotations": annotations} patch["spec"] = {} if init_containers: patch["spec"]["initContainers"] = init_containers if containers: patch["spec"]["containers"] = containers logger.debug("Patch: %s", str(patch)) return patch
true
true
f724699755ba91bea524160dc912b306d1e17208
40
py
Python
boa3_test/example/tuple_test/BoolTuple.py
jplippi/neo3-boa
052be4adebb665113715bb80067d954f7ad85ad5
[ "Apache-2.0" ]
25
2020-07-22T19:37:43.000Z
2022-03-08T03:23:55.000Z
boa3_test/example/tuple_test/BoolTuple.py
jplippi/neo3-boa
052be4adebb665113715bb80067d954f7ad85ad5
[ "Apache-2.0" ]
419
2020-04-23T17:48:14.000Z
2022-03-31T13:17:45.000Z
boa3_test/example/tuple_test/BoolTuple.py
jplippi/neo3-boa
052be4adebb665113715bb80067d954f7ad85ad5
[ "Apache-2.0" ]
15
2020-05-21T21:54:24.000Z
2021-11-18T06:17:24.000Z
def Main(): a = (True, True, False)
13.333333
27
0.525
def Main(): a = (True, True, False)
true
true
f72469d5195720193ad83e59ae342ad8847b12fa
11,453
py
Python
planner_svg_gen.py
jc0a20/myplannergen
b1a19733fb393bae6159f12cfb1d239bb81d0c25
[ "MIT" ]
null
null
null
planner_svg_gen.py
jc0a20/myplannergen
b1a19733fb393bae6159f12cfb1d239bb81d0c25
[ "MIT" ]
2
2020-05-01T13:54:12.000Z
2020-05-01T13:55:24.000Z
planner_svg_gen.py
jc0a20/myplannergen
b1a19733fb393bae6159f12cfb1d239bb81d0c25
[ "MIT" ]
null
null
null
import configparser import os import re import subprocess import sys import PyPDF2 config = configparser.ConfigParser() config.read('config.ini', encoding='utf-8') INKSCAPE_PATH = config['DEFAULT']['InkscapePath'] def replace_text(target_doc, target_str, replace_str, id_str): pattern = '''id="''' + id_str + '''".+?>''' + target_str + '''<.+?</text>''' result = re.search(pattern, target_doc, re.S) id_trim_str = target_doc[result.span()[0]: result.span()[1]] pattern2 = ">" + target_str + "<" result2 = re.search(pattern2, id_trim_str, re.S) index_s, index_e = result.span()[0] + result2.span()[0] + 1, result.span()[0] + result2.span()[1] - 1 target_doc_new = target_doc[:index_s] + replace_str + target_doc[index_e:] return target_doc_new def replace_color(target_doc, replace_rgb, id_str): pattern = '''<rect.*?/>''' result = re.findall(pattern, target_doc, re.S) result_trim = "" for i in result: if id_str in i: result_trim = i result2 = re.search(result_trim, target_doc, re.S) tmp_trim_txt = target_doc[result2.span()[0]:result2.span()[1]] pattern2 = '''fill:#''' result3 = re.search(pattern2, tmp_trim_txt, re.S) index_s, index_e = result2.span()[0] + result3.span()[1], result2.span()[0] + result3.span()[1] + 6 target_doc_new = target_doc[:index_s] + replace_rgb + target_doc[index_e:] return target_doc_new def replace_blank(target_doc, replace_alpha, id_str): pattern = '''<rect.*?/>''' result = re.findall(pattern, target_doc, re.S) result_trim = "" for i in result: if id_str in i: result_trim = i result2 = re.search(result_trim, target_doc, re.S) tmp_trim_txt = target_doc[result2.span()[0]:result2.span()[1]] pattern2 = '''fill-opacity:''' result3 = re.search(pattern2, tmp_trim_txt, re.S) index_s, index_e = result2.span()[0] + result3.span()[1], result2.span()[0] + result3.span()[1] + 3 # print(target_doc[index_s:index_e]) target_doc_new = target_doc[:index_s] + str(replace_alpha) + target_doc[index_e:] # print(target_doc_new[index_s:index_s+10]) return target_doc_new day_ref_set = set([i for i in range(1,31+1,1)]) ''' 年、月、日、曜日、何の日、上書き色、何週目 2019,01,01,MON,New Year's Day,#ffb6c1,1 2019,01,02,TUE,2nd,#add8e6,1 2019,01,03,WED,3rd,,2 ''' WEEK_NUM_COLOR = ["#000000", "#8b4513", "#cd5c5c", "#ff8c00", "#ffd700", "#006400", "#4169e1", "#9400d3", "#808080"] # read_list_a_month=[[2020,1,1,"MON","New Year's Day","#ffb6c1",1], # [2020,1,2,"TUE","2nd","#add8e6",1], # [2020,1,3,"WED","3rd","",2]] with open('contents.csv', encoding='utf-8') as f: read_tmp = f.read() read_list = [i.split(',') for i in read_tmp.split('\n') if len(i)>0] read_list = read_list[1:] with open("template.svg", encoding='utf-8') as f: target_doc = f.read() with open("template_cutline.svg", encoding='utf-8') as f: target_doc_cutline = f.read() export_dir_str = "./export_svg/" # MONTH_HEADER,01 # YEAR_HEADER,2020 # DAY_01L-31L,33 # DOW_01L-31L,Sun # DAY_WNUM_01L-31L,01 # DAY_OF_NAME_01-31,DAY_OF_NAME # day_rect_01L # DAY_01R-31L,33 # DOW_01R-31L,Sun # day_rect_01R #["p1o", "p2o", "p3o", "p4o", "p5o", "p6o", "p7o", "p1u", "p2u", "p3u", "p4u", "p5u", "p6u", "p7u"] write_svg_filename_list = [] for iii in zip([1, 2, 3, 4, 5, 6, 7, -1, 0, 12, 11, 10, 9, 8], [0, 12, 11, 10, 9, 8, 7, -1, 1, 2, 3, 4, 5, 6], ["002", "004", "006", "008", "010", "012", "014", "001", "003", "005", "007", "009", "011", "013"]): # 断ち切り線ページ # if iii[0] == -1 and iii[1] == -1: target_doc_new = target_doc_cutline write_svg_filename = export_dir_str + iii[2] + ".svg" write_svg_filename_list.append(write_svg_filename) with open(write_svg_filename, mode='w', encoding='utf-8') as f: f.write(target_doc_new) continue else: target_doc_new = target_doc # 左ページ # left_month = iii[0] if left_month == 0: id_str, replace_alpha = "RECT_BLANK_L", 1 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) else: id_str, replace_alpha = "RECT_BLANK_L", 0 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) left_month = str(left_month) read_list_a_month = [rline for rline in read_list if rline[1] == left_month] READ_YEAR = read_list_a_month[0][0] READ_MONTH = read_list_a_month[0][1] # 年月 year_str = str(READ_YEAR).rjust(4, '0') id_str, target_str, replace_str = "YEAR_HEADER", "2020", year_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) # target_doc month_str = str(READ_MONTH).rjust(2, '0') id_str, target_str, replace_str = "MONTH_HEADER", "01", month_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) # 日の色(交互) 初期化 for i in range(1, 31, 1): day_str = str(i).rjust(2, '0') if i % 2 == 0: # 偶数 id_str, replace_rgb = "day_rect_" + day_str + "L", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) else: # 奇数 id_str, replace_rgb = "day_rect_" + day_str + "L", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month: day_str = str(di).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "L", "33", day_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = dowi id_str, target_str, replace_str = "DOW_" + day_str + "L", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_name_str = dnamei id_str, target_str, replace_str = "DAY_OF_NAME_" + day_str, "DAY_OF_NAME", day_of_name_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) week_num_str = wnumi id_str, target_str, replace_str = "DAY_WNUM_" + day_str + "L", "01", week_num_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) if len(dcolori) == 6: id_str, replace_rgb = "day_rect_" + day_str + "L", dcolori target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # その月に存在しない日の処理 day_list = [int(di) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month] day_list_diff = sorted(list(day_ref_set - set(day_list))) # その月に存在しない日のリスト for ddiff in day_list_diff: day_str = str(ddiff).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "L", "33", "" target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = '' id_str, target_str, replace_str = "DOW_" + day_str + "L", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_name_str = '' id_str, target_str, replace_str = "DAY_OF_NAME_" + day_str, "DAY_OF_NAME", day_of_name_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) week_num_str = "" id_str, target_str, replace_str = "DAY_WNUM_" + day_str + "L", "01", week_num_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) id_str, replace_rgb = "day_rect_" + day_str + "L", "CCCCCC" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # 右ページ # right_month = iii[1] if right_month == 0: id_str, replace_alpha = "RECT_BLANK_R", 1 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) else: id_str, replace_alpha = "RECT_BLANK_R", 0 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) right_month = str(right_month) read_list_a_month = [rline for rline in read_list if rline[1] == right_month] READ_YEAR = read_list_a_month[0][0] READ_MONTH = read_list_a_month[0][1] # 日の色(交互) 初期化 for i in range(1, 31, 1): day_str = str(i).rjust(2, '0') if i % 2 == 0: # 偶数 id_str, replace_rgb = "day_rect_" + day_str + "R", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # target_doc_new else: # 奇数 id_str, replace_rgb = "day_rect_" + day_str + "R", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month: day_str = str(di).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "R", "33", day_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = dowi id_str, target_str, replace_str = "DOW_" + day_str + "R", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) if len(dcolori) == 6: id_str, replace_rgb = "day_rect_" + day_str + "R", dcolori target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # その月に存在しない日の処理 day_list = [int(di) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month] day_list_diff = sorted(list(day_ref_set - set(day_list))) # その月に存在しない日のリスト for ddiff in day_list_diff: day_str = str(ddiff).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "R", "33", "" target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = '' id_str, target_str, replace_str = "DOW_" + day_str + "R", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) id_str, replace_rgb = "day_rect_" + day_str + "R", "CCCCCC" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) write_svg_filename = export_dir_str + iii[2] + ".svg" write_svg_filename_list.append(write_svg_filename) with open(write_svg_filename, mode='w', encoding='utf-8') as f: f.write(target_doc_new) write_pdf_filename_list = [] for fnamei in sorted(write_svg_filename_list): basename_without_ext = os.path.splitext(os.path.basename(fnamei))[0] export_pdf_filename = ".\\export_pdf\\{0}.pdf".format(basename_without_ext) write_pdf_filename_list.append(export_pdf_filename) print(fnamei,'->',export_pdf_filename) cmd = '''"{0}" -f {1} -A {2}'''.format(INKSCAPE_PATH,fnamei,export_pdf_filename) e = subprocess.call(cmd, shell=True) merger = PyPDF2.PdfFileMerger() for a_pdf_filename in write_pdf_filename_list: merger.append(a_pdf_filename) merger.write('./output.pdf') merger.close() sys.exit(0)
38.56229
115
0.628045
import configparser import os import re import subprocess import sys import PyPDF2 config = configparser.ConfigParser() config.read('config.ini', encoding='utf-8') INKSCAPE_PATH = config['DEFAULT']['InkscapePath'] def replace_text(target_doc, target_str, replace_str, id_str): pattern = '''id="''' + id_str + '''".+?>''' + target_str + '''<.+?</text>''' result = re.search(pattern, target_doc, re.S) id_trim_str = target_doc[result.span()[0]: result.span()[1]] pattern2 = ">" + target_str + "<" result2 = re.search(pattern2, id_trim_str, re.S) index_s, index_e = result.span()[0] + result2.span()[0] + 1, result.span()[0] + result2.span()[1] - 1 target_doc_new = target_doc[:index_s] + replace_str + target_doc[index_e:] return target_doc_new def replace_color(target_doc, replace_rgb, id_str): pattern = '''<rect.*?/>''' result = re.findall(pattern, target_doc, re.S) result_trim = "" for i in result: if id_str in i: result_trim = i result2 = re.search(result_trim, target_doc, re.S) tmp_trim_txt = target_doc[result2.span()[0]:result2.span()[1]] pattern2 = '''fill:#''' result3 = re.search(pattern2, tmp_trim_txt, re.S) index_s, index_e = result2.span()[0] + result3.span()[1], result2.span()[0] + result3.span()[1] + 6 target_doc_new = target_doc[:index_s] + replace_rgb + target_doc[index_e:] return target_doc_new def replace_blank(target_doc, replace_alpha, id_str): pattern = '''<rect.*?/>''' result = re.findall(pattern, target_doc, re.S) result_trim = "" for i in result: if id_str in i: result_trim = i result2 = re.search(result_trim, target_doc, re.S) tmp_trim_txt = target_doc[result2.span()[0]:result2.span()[1]] pattern2 = '''fill-opacity:''' result3 = re.search(pattern2, tmp_trim_txt, re.S) index_s, index_e = result2.span()[0] + result3.span()[1], result2.span()[0] + result3.span()[1] + 3 target_doc_new = target_doc[:index_s] + str(replace_alpha) + target_doc[index_e:] return target_doc_new day_ref_set = set([i for i in range(1,31+1,1)]) WEEK_NUM_COLOR = ["#000000", "#8b4513", "#cd5c5c", "#ff8c00", "#ffd700", "#006400", "#4169e1", "#9400d3", "#808080"] # [2020,1,2,"TUE","2nd","#add8e6",1], # [2020,1,3,"WED","3rd","",2]] with open('contents.csv', encoding='utf-8') as f: read_tmp = f.read() read_list = [i.split(',') for i in read_tmp.split('\n') if len(i)>0] read_list = read_list[1:] with open("template.svg", encoding='utf-8') as f: target_doc = f.read() with open("template_cutline.svg", encoding='utf-8') as f: target_doc_cutline = f.read() export_dir_str = "./export_svg/" # MONTH_HEADER,01 # YEAR_HEADER,2020 # DAY_01L-31L,33 # DOW_01L-31L,Sun # DAY_WNUM_01L-31L,01 # DAY_OF_NAME_01-31,DAY_OF_NAME # day_rect_01L # DAY_01R-31L,33 # DOW_01R-31L,Sun # day_rect_01R #["p1o", "p2o", "p3o", "p4o", "p5o", "p6o", "p7o", "p1u", "p2u", "p3u", "p4u", "p5u", "p6u", "p7u"] write_svg_filename_list = [] for iii in zip([1, 2, 3, 4, 5, 6, 7, -1, 0, 12, 11, 10, 9, 8], [0, 12, 11, 10, 9, 8, 7, -1, 1, 2, 3, 4, 5, 6], ["002", "004", "006", "008", "010", "012", "014", "001", "003", "005", "007", "009", "011", "013"]): # 断ち切り線ページ # if iii[0] == -1 and iii[1] == -1: target_doc_new = target_doc_cutline write_svg_filename = export_dir_str + iii[2] + ".svg" write_svg_filename_list.append(write_svg_filename) with open(write_svg_filename, mode='w', encoding='utf-8') as f: f.write(target_doc_new) continue else: target_doc_new = target_doc # 左ページ # left_month = iii[0] if left_month == 0: id_str, replace_alpha = "RECT_BLANK_L", 1 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) else: id_str, replace_alpha = "RECT_BLANK_L", 0 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) left_month = str(left_month) read_list_a_month = [rline for rline in read_list if rline[1] == left_month] READ_YEAR = read_list_a_month[0][0] READ_MONTH = read_list_a_month[0][1] # 年月 year_str = str(READ_YEAR).rjust(4, '0') id_str, target_str, replace_str = "YEAR_HEADER", "2020", year_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) # target_doc month_str = str(READ_MONTH).rjust(2, '0') id_str, target_str, replace_str = "MONTH_HEADER", "01", month_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) # 日の色(交互) 初期化 for i in range(1, 31, 1): day_str = str(i).rjust(2, '0') if i % 2 == 0: # 偶数 id_str, replace_rgb = "day_rect_" + day_str + "L", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) else: # 奇数 id_str, replace_rgb = "day_rect_" + day_str + "L", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month: day_str = str(di).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "L", "33", day_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = dowi id_str, target_str, replace_str = "DOW_" + day_str + "L", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_name_str = dnamei id_str, target_str, replace_str = "DAY_OF_NAME_" + day_str, "DAY_OF_NAME", day_of_name_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) week_num_str = wnumi id_str, target_str, replace_str = "DAY_WNUM_" + day_str + "L", "01", week_num_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) if len(dcolori) == 6: id_str, replace_rgb = "day_rect_" + day_str + "L", dcolori target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # その月に存在しない日の処理 day_list = [int(di) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month] day_list_diff = sorted(list(day_ref_set - set(day_list))) # その月に存在しない日のリスト for ddiff in day_list_diff: day_str = str(ddiff).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "L", "33", "" target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = '' id_str, target_str, replace_str = "DOW_" + day_str + "L", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_name_str = '' id_str, target_str, replace_str = "DAY_OF_NAME_" + day_str, "DAY_OF_NAME", day_of_name_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) week_num_str = "" id_str, target_str, replace_str = "DAY_WNUM_" + day_str + "L", "01", week_num_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) id_str, replace_rgb = "day_rect_" + day_str + "L", "CCCCCC" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # 右ページ # right_month = iii[1] if right_month == 0: id_str, replace_alpha = "RECT_BLANK_R", 1 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) else: id_str, replace_alpha = "RECT_BLANK_R", 0 target_doc_new = replace_blank(target_doc_new, replace_alpha, id_str) right_month = str(right_month) read_list_a_month = [rline for rline in read_list if rline[1] == right_month] READ_YEAR = read_list_a_month[0][0] READ_MONTH = read_list_a_month[0][1] # 日の色(交互) 初期化 for i in range(1, 31, 1): day_str = str(i).rjust(2, '0') if i % 2 == 0: # 偶数 id_str, replace_rgb = "day_rect_" + day_str + "R", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # target_doc_new else: # 奇数 id_str, replace_rgb = "day_rect_" + day_str + "R", "FFFFFF" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month: day_str = str(di).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "R", "33", day_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = dowi id_str, target_str, replace_str = "DOW_" + day_str + "R", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) if len(dcolori) == 6: id_str, replace_rgb = "day_rect_" + day_str + "R", dcolori target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) # その月に存在しない日の処理 day_list = [int(di) for yi, mi, di, dowi, dnamei, dcolori, wnumi, tmp1, tmp2, tmp3 in read_list_a_month] day_list_diff = sorted(list(day_ref_set - set(day_list))) # その月に存在しない日のリスト for ddiff in day_list_diff: day_str = str(ddiff).rjust(2, '0') id_str, target_str, replace_str = "DAY_" + day_str + "R", "33", "" target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) day_of_week_str = '' id_str, target_str, replace_str = "DOW_" + day_str + "R", "Sun", day_of_week_str target_doc_new = replace_text(target_doc_new, target_str, replace_str, id_str) id_str, replace_rgb = "day_rect_" + day_str + "R", "CCCCCC" target_doc_new = replace_color(target_doc_new, replace_rgb, id_str) write_svg_filename = export_dir_str + iii[2] + ".svg" write_svg_filename_list.append(write_svg_filename) with open(write_svg_filename, mode='w', encoding='utf-8') as f: f.write(target_doc_new) write_pdf_filename_list = [] for fnamei in sorted(write_svg_filename_list): basename_without_ext = os.path.splitext(os.path.basename(fnamei))[0] export_pdf_filename = ".\\export_pdf\\{0}.pdf".format(basename_without_ext) write_pdf_filename_list.append(export_pdf_filename) print(fnamei,'->',export_pdf_filename) cmd = '''"{0}" -f {1} -A {2}'''.format(INKSCAPE_PATH,fnamei,export_pdf_filename) e = subprocess.call(cmd, shell=True) merger = PyPDF2.PdfFileMerger() for a_pdf_filename in write_pdf_filename_list: merger.append(a_pdf_filename) merger.write('./output.pdf') merger.close() sys.exit(0)
true
true
f7246ae56a8cd487abd73fdf982a117465640f8f
6,658
py
Python
pciids/pciids.py
ilkermanap/python-pciids
9a2fcb00d3e0100b9de331047133a42e98242deb
[ "MIT" ]
5
2018-02-12T13:45:45.000Z
2020-06-04T09:24:52.000Z
pciids/pciids.py
ilkermanap/python-pciids
9a2fcb00d3e0100b9de331047133a42e98242deb
[ "MIT" ]
2
2016-03-17T09:22:01.000Z
2020-01-12T23:04:35.000Z
pciids/pciids.py
ilkermanap/python-pciids
9a2fcb00d3e0100b9de331047133a42e98242deb
[ "MIT" ]
4
2018-09-04T12:57:58.000Z
2021-07-02T01:01:26.000Z
import os import bz2 import requests import glob global HOME HOME = "https://pci-ids.ucw.cz" class Vendor: """ Class for vendors. This is the top level class for the devices belong to a specific vendor. self.devices is the device dictionary subdevices are in each device. """ def __init__(self, vendorStr): """ Class initializes with the raw line from pci.ids Parsing takes place inside __init__ """ self.ID = vendorStr.split()[0] self.name = vendorStr.replace("%s " % self.ID,"") self.devices = {} def addDevice(self, deviceStr): """ Adds a device to self.devices takes the raw line from pci.ids """ s = deviceStr.strip() devID = s.split()[0] if devID in self.devices: pass else: self.devices[devID] = Device(deviceStr) def report(self): print( self.ID, self.name) for id, dev in self.devices.items(): dev.report() class Device: def __init__(self, deviceStr): """ Class for each device. Each vendor has its own devices dictionary. """ s = deviceStr.strip() self.ID = s.split()[0] self.name = s.replace("%s " % self.ID,"") self.subdevices = {} def report(self): print("\t%s\t%s" % (self.ID, self.name)) for subID, subdev in self.subdevices.items(): subdev.report() def addSubDevice(self, subDeviceStr): """ Adds a subvendor, subdevice to device. Uses raw line from pci.ids """ s = subDeviceStr.strip() spl = s.split() subVendorID = spl[0] subDeviceID = spl[1] subDeviceName = s.split(" ")[-1] devID = "%s:%s" % (subVendorID,subDeviceID) self.subdevices[devID] = SubDevice(subVendorID,subDeviceID,subDeviceName) class SubDevice: """ Class for subdevices. """ def __init__(self, vendor, device, name): """ Class initializes with vendorid, deviceid and name """ self.vendorID = vendor self.deviceID = device self.name = name def report(self): print( "\t\t%s\t%s\t%s" % (self.vendorID, self.deviceID,self.name)) class PCIIds: """ Top class for all pci.ids entries. All queries will be asked to this class. PCIIds.vendors["0e11"].devices["0046"].subdevices["0e11:4091"].name = "Smart Array 6i" """ def __init__(self, url=HOME): """ Prepares the directories. Checks local data file. Tries to load from local, if not found, downloads from web """ self.url = url self.version = "" self.date = "" self.compressed = "pci.ids.bz2" if (os.path.isdir("data") is False): os.mkdir("data") self.vendors = {} self.contents = None self.loadLocal() self.parse() def reportVendors(self): """Reports the vendors """ for vid, v in self.vendors.items(): print( v.ID, v.name) def report(self, vendor = None): """ Reports everything for all vendors or a specific vendor PCIIds.report() reports everything PCIIDs.report("0e11") reports only "Compaq Computer Corporation" """ if vendor != None: self.vendors[vendor].report() else: for vID, v in self.vendors.items(): v.report() def findDate(self, content): for l in content: if l.find("Date:") > -1: return l.split()[-2].replace("-", "") return None def parse(self): if len(self.contents) < 1: print( "data/%s-pci.ids not found" % self.date) else: vendorID = "" deviceID = "" for l in self.contents: if l[0] == "#": continue elif len(l.strip()) == 0: continue else: if l.find("\t\t") == 0: self.vendors[vendorID].devices[deviceID].addSubDevice(l) elif l.find("\t") == 0: deviceID = l.strip().split()[0] self.vendors[vendorID].addDevice(l) else: vendorID = l.split()[0] self.vendors[vendorID] = Vendor(l) def getLatest(self): ver, date, url = self.latestVersion() outfile = "data/%s-%s" % (date, self.compressed[:-4]) # remove bz2 out = open(outfile, "wb") resp = requests.get(url) out.write(bz2.decompress(resp.content)) out.close() self.version = ver self.date = date self.readLocal() def readLocal(self): """ Reads the local file """ self.contents = open("data/%s-pci.ids" % self.date).readlines() self.date = self.findDate(self.contents) def loadLocal(self): """ Loads database from local. If there is no file, it creates a new one from web """ idsfile = glob.glob("data/*.ids") if len(idsfile) == 0: self.getLatest() else: self.date = idsfile[0].split("/")[1].split("-")[0] self.readLocal() def latestVersion(self): """ Checks the latest version from web """ resp = requests.get(self.url) webPage = resp.content.decode().splitlines() for line in webPage: if line.find(self.compressed) > -1: print(line) for tag in line.split("<"): if tag.find(self.compressed) > -1: path = tag.split('"')[1] ver = path.split("/")[1] url = "%s%s" % (self.url, path) urlUncompressed = url.replace(".bz2","") resp2 = requests.get(urlUncompressed) con = resp2.content.decode().splitlines() for i in range(10): l = con[i] if l.find("Date:") > -1: date = l.split()[-2].replace("-","") break return (ver, date, "%s%s" % (HOME, path)) break return "" if __name__ == "__main__": id = PCIIds() #id.reportVendors()
30.541284
92
0.49249
import os import bz2 import requests import glob global HOME HOME = "https://pci-ids.ucw.cz" class Vendor: def __init__(self, vendorStr): self.ID = vendorStr.split()[0] self.name = vendorStr.replace("%s " % self.ID,"") self.devices = {} def addDevice(self, deviceStr): s = deviceStr.strip() devID = s.split()[0] if devID in self.devices: pass else: self.devices[devID] = Device(deviceStr) def report(self): print( self.ID, self.name) for id, dev in self.devices.items(): dev.report() class Device: def __init__(self, deviceStr): s = deviceStr.strip() self.ID = s.split()[0] self.name = s.replace("%s " % self.ID,"") self.subdevices = {} def report(self): print("\t%s\t%s" % (self.ID, self.name)) for subID, subdev in self.subdevices.items(): subdev.report() def addSubDevice(self, subDeviceStr): s = subDeviceStr.strip() spl = s.split() subVendorID = spl[0] subDeviceID = spl[1] subDeviceName = s.split(" ")[-1] devID = "%s:%s" % (subVendorID,subDeviceID) self.subdevices[devID] = SubDevice(subVendorID,subDeviceID,subDeviceName) class SubDevice: def __init__(self, vendor, device, name): self.vendorID = vendor self.deviceID = device self.name = name def report(self): print( "\t\t%s\t%s\t%s" % (self.vendorID, self.deviceID,self.name)) class PCIIds: def __init__(self, url=HOME): self.url = url self.version = "" self.date = "" self.compressed = "pci.ids.bz2" if (os.path.isdir("data") is False): os.mkdir("data") self.vendors = {} self.contents = None self.loadLocal() self.parse() def reportVendors(self): for vid, v in self.vendors.items(): print( v.ID, v.name) def report(self, vendor = None): if vendor != None: self.vendors[vendor].report() else: for vID, v in self.vendors.items(): v.report() def findDate(self, content): for l in content: if l.find("Date:") > -1: return l.split()[-2].replace("-", "") return None def parse(self): if len(self.contents) < 1: print( "data/%s-pci.ids not found" % self.date) else: vendorID = "" deviceID = "" for l in self.contents: if l[0] == "#": continue elif len(l.strip()) == 0: continue else: if l.find("\t\t") == 0: self.vendors[vendorID].devices[deviceID].addSubDevice(l) elif l.find("\t") == 0: deviceID = l.strip().split()[0] self.vendors[vendorID].addDevice(l) else: vendorID = l.split()[0] self.vendors[vendorID] = Vendor(l) def getLatest(self): ver, date, url = self.latestVersion() outfile = "data/%s-%s" % (date, self.compressed[:-4]) out = open(outfile, "wb") resp = requests.get(url) out.write(bz2.decompress(resp.content)) out.close() self.version = ver self.date = date self.readLocal() def readLocal(self): self.contents = open("data/%s-pci.ids" % self.date).readlines() self.date = self.findDate(self.contents) def loadLocal(self): idsfile = glob.glob("data/*.ids") if len(idsfile) == 0: self.getLatest() else: self.date = idsfile[0].split("/")[1].split("-")[0] self.readLocal() def latestVersion(self): resp = requests.get(self.url) webPage = resp.content.decode().splitlines() for line in webPage: if line.find(self.compressed) > -1: print(line) for tag in line.split("<"): if tag.find(self.compressed) > -1: path = tag.split('"')[1] ver = path.split("/")[1] url = "%s%s" % (self.url, path) urlUncompressed = url.replace(".bz2","") resp2 = requests.get(urlUncompressed) con = resp2.content.decode().splitlines() for i in range(10): l = con[i] if l.find("Date:") > -1: date = l.split()[-2].replace("-","") break return (ver, date, "%s%s" % (HOME, path)) break return "" if __name__ == "__main__": id = PCIIds() #id.reportVendors()
true
true
f7246b1f729e630e5873f854feff0a703ae952c5
3,564
py
Python
test/functional/feature_notifications.py
cisnes/PINECOIN
a0252cace17ecc1208a07368c0b893d3878459d8
[ "MIT" ]
null
null
null
test/functional/feature_notifications.py
cisnes/PINECOIN
a0252cace17ecc1208a07368c0b893d3878459d8
[ "MIT" ]
null
null
null
test/functional/feature_notifications.py
cisnes/PINECOIN
a0252cace17ecc1208a07368c0b893d3878459d8
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) 2014-2019 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Test the -alertnotify, -blocknotify and -walletnotify options.""" import os from test_framework.address import ADDRESS_BCRT1_UNSPENDABLE from test_framework.test_framework import PineCoinTestFramework from test_framework.util import assert_equal, wait_until, connect_nodes_bi class NotificationsTest(PineCoinTestFramework): def set_test_params(self): self.num_nodes = 2 self.setup_clean_chain = True def setup_network(self): self.alertnotify_dir = os.path.join(self.options.tmpdir, "alertnotify") self.blocknotify_dir = os.path.join(self.options.tmpdir, "blocknotify") self.walletnotify_dir = os.path.join(self.options.tmpdir, "walletnotify") os.mkdir(self.alertnotify_dir) os.mkdir(self.blocknotify_dir) os.mkdir(self.walletnotify_dir) # -alertnotify and -blocknotify on node0, walletnotify on node1 self.extra_args = [[ "-alertnotify=echo > {}".format(os.path.join(self.alertnotify_dir, '%s')), "-blocknotify=echo > {}".format(os.path.join(self.blocknotify_dir, '%s'))], ["-blockversion=211", "-rescan", "-walletnotify=echo > {}".format(os.path.join(self.walletnotify_dir, '%s'))]] super().setup_network() def run_test(self): self.log.info("test -blocknotify") block_count = 10 blocks = self.nodes[1].generatetoaddress(block_count, self.nodes[1].getnewaddress() if self.is_wallet_compiled() else ADDRESS_BCRT1_UNSPENDABLE) # wait at most 10 seconds for expected number of files before reading the content wait_until(lambda: len(os.listdir(self.blocknotify_dir)) == block_count, timeout=10) # directory content should equal the generated blocks hashes assert_equal(sorted(blocks), sorted(os.listdir(self.blocknotify_dir))) if self.is_wallet_compiled(): self.log.info("test -walletnotify") # wait at most 10 seconds for expected number of files before reading the content wait_until(lambda: len(os.listdir(self.walletnotify_dir)) == block_count, timeout=10) # directory content should equal the generated transaction hashes txids_rpc = list(map(lambda t: t['txid'], self.nodes[1].listtransactions("*", block_count))) assert_equal(sorted(txids_rpc), sorted(os.listdir(self.walletnotify_dir))) self.stop_node(1) for tx_file in os.listdir(self.walletnotify_dir): os.remove(os.path.join(self.walletnotify_dir, tx_file)) self.log.info("test -walletnotify after rescan") # restart node to rescan to force wallet notifications self.start_node(1) connect_nodes_bi(self.nodes, 0, 1) wait_until(lambda: len(os.listdir(self.walletnotify_dir)) == block_count, timeout=10) # directory content should equal the generated transaction hashes txids_rpc = list(map(lambda t: t['txid'], self.nodes[1].listtransactions("*", block_count))) assert_equal(sorted(txids_rpc), sorted(os.listdir(self.walletnotify_dir))) # TODO: add test for `-alertnotify` large fork notifications if __name__ == '__main__': NotificationsTest().main()
48.821918
152
0.670034
import os from test_framework.address import ADDRESS_BCRT1_UNSPENDABLE from test_framework.test_framework import PineCoinTestFramework from test_framework.util import assert_equal, wait_until, connect_nodes_bi class NotificationsTest(PineCoinTestFramework): def set_test_params(self): self.num_nodes = 2 self.setup_clean_chain = True def setup_network(self): self.alertnotify_dir = os.path.join(self.options.tmpdir, "alertnotify") self.blocknotify_dir = os.path.join(self.options.tmpdir, "blocknotify") self.walletnotify_dir = os.path.join(self.options.tmpdir, "walletnotify") os.mkdir(self.alertnotify_dir) os.mkdir(self.blocknotify_dir) os.mkdir(self.walletnotify_dir) self.extra_args = [[ "-alertnotify=echo > {}".format(os.path.join(self.alertnotify_dir, '%s')), "-blocknotify=echo > {}".format(os.path.join(self.blocknotify_dir, '%s'))], ["-blockversion=211", "-rescan", "-walletnotify=echo > {}".format(os.path.join(self.walletnotify_dir, '%s'))]] super().setup_network() def run_test(self): self.log.info("test -blocknotify") block_count = 10 blocks = self.nodes[1].generatetoaddress(block_count, self.nodes[1].getnewaddress() if self.is_wallet_compiled() else ADDRESS_BCRT1_UNSPENDABLE) wait_until(lambda: len(os.listdir(self.blocknotify_dir)) == block_count, timeout=10) assert_equal(sorted(blocks), sorted(os.listdir(self.blocknotify_dir))) if self.is_wallet_compiled(): self.log.info("test -walletnotify") wait_until(lambda: len(os.listdir(self.walletnotify_dir)) == block_count, timeout=10) txids_rpc = list(map(lambda t: t['txid'], self.nodes[1].listtransactions("*", block_count))) assert_equal(sorted(txids_rpc), sorted(os.listdir(self.walletnotify_dir))) self.stop_node(1) for tx_file in os.listdir(self.walletnotify_dir): os.remove(os.path.join(self.walletnotify_dir, tx_file)) self.log.info("test -walletnotify after rescan") self.start_node(1) connect_nodes_bi(self.nodes, 0, 1) wait_until(lambda: len(os.listdir(self.walletnotify_dir)) == block_count, timeout=10) txids_rpc = list(map(lambda t: t['txid'], self.nodes[1].listtransactions("*", block_count))) assert_equal(sorted(txids_rpc), sorted(os.listdir(self.walletnotify_dir))) if __name__ == '__main__': NotificationsTest().main()
true
true
f7246b36becdc63ea725194e371727a55e6be4c1
3,932
py
Python
test/functional/test_framework/blocktools.py
tmiholdings/tmi
f1b6027f025dafc40616cde076df2f4b8cdae8a2
[ "MIT" ]
null
null
null
test/functional/test_framework/blocktools.py
tmiholdings/tmi
f1b6027f025dafc40616cde076df2f4b8cdae8a2
[ "MIT" ]
null
null
null
test/functional/test_framework/blocktools.py
tmiholdings/tmi
f1b6027f025dafc40616cde076df2f4b8cdae8a2
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) 2015-2016 The TMIcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Utilities for manipulating blocks and transactions.""" from .mininode import * from .script import CScript, OP_TRUE, OP_CHECKSIG, OP_RETURN # Create a block (with regtest difficulty) def create_block(hashprev, coinbase, nTime=None): block = CBlock() if nTime is None: import time block.nTime = int(time.time()+600) else: block.nTime = nTime block.hashPrevBlock = hashprev block.nBits = 0x207fffff # Will break after a difficulty adjustment... block.vtx.append(coinbase) block.hashMerkleRoot = block.calc_merkle_root() block.calc_sha256() return block # From BIP141 WITNESS_COMMITMENT_HEADER = b"\xaa\x21\xa9\xed" def get_witness_script(witness_root, witness_nonce): witness_commitment = uint256_from_str(hash256(ser_uint256(witness_root)+ser_uint256(witness_nonce))) output_data = WITNESS_COMMITMENT_HEADER + ser_uint256(witness_commitment) return CScript([OP_RETURN, output_data]) # According to BIP141, blocks with witness rules active must commit to the # hash of all in-block transactions including witness. def add_witness_commitment(block, nonce=0): # First calculate the merkle root of the block's # transactions, with witnesses. witness_nonce = nonce witness_root = block.calc_witness_merkle_root() # witness_nonce should go to coinbase witness. block.vtx[0].wit.vtxinwit = [CTxInWitness()] block.vtx[0].wit.vtxinwit[0].scriptWitness.stack = [ser_uint256(witness_nonce)] # witness commitment is the last OP_RETURN output in coinbase block.vtx[0].vout.append(CTxOut(0, get_witness_script(witness_root, witness_nonce))) block.vtx[0].rehash() block.hashMerkleRoot = block.calc_merkle_root() block.rehash() def serialize_script_num(value): r = bytearray(0) if value == 0: return r neg = value < 0 absvalue = -value if neg else value while (absvalue): r.append(int(absvalue & 0xff)) absvalue >>= 8 if r[-1] & 0x80: r.append(0x80 if neg else 0) elif neg: r[-1] |= 0x80 return r # Create a coinbase transaction, assuming no miner fees. # If pubkey is passed in, the coinbase output will be a P2PK output; # otherwise an anyone-can-spend output. def create_coinbase(height, pubkey = None): coinbase = CTransaction() coinbase.vin.append(CTxIn(COutPoint(0, 0xffffffff), ser_string(serialize_script_num(height)), 0xffffffff)) coinbaseoutput = CTxOut() coinbaseoutput.nValue = 50 * COIN halvings = int(height/150) # regtest coinbaseoutput.nValue >>= halvings if (pubkey != None): coinbaseoutput.scriptPubKey = CScript([pubkey, OP_CHECKSIG]) else: coinbaseoutput.scriptPubKey = CScript([OP_TRUE]) coinbase.vout = [ coinbaseoutput ] coinbase.calc_sha256() return coinbase # Create a transaction. # If the scriptPubKey is not specified, make it anyone-can-spend. def create_transaction(prevtx, n, sig, value, scriptPubKey=CScript()): tx = CTransaction() assert(n < len(prevtx.vout)) tx.vin.append(CTxIn(COutPoint(prevtx.sha256, n), sig, 0xffffffff)) tx.vout.append(CTxOut(value, scriptPubKey)) tx.calc_sha256() return tx def get_legacy_sigopcount_block(block, fAccurate=True): count = 0 for tx in block.vtx: count += get_legacy_sigopcount_tx(tx, fAccurate) return count def get_legacy_sigopcount_tx(tx, fAccurate=True): count = 0 for i in tx.vout: count += i.scriptPubKey.GetSigOpCount(fAccurate) for j in tx.vin: # scriptSig might be of type bytes, so convert to CScript for the moment count += CScript(j.scriptSig).GetSigOpCount(fAccurate) return count
35.423423
104
0.709054
from .mininode import * from .script import CScript, OP_TRUE, OP_CHECKSIG, OP_RETURN def create_block(hashprev, coinbase, nTime=None): block = CBlock() if nTime is None: import time block.nTime = int(time.time()+600) else: block.nTime = nTime block.hashPrevBlock = hashprev block.nBits = 0x207fffff block.vtx.append(coinbase) block.hashMerkleRoot = block.calc_merkle_root() block.calc_sha256() return block WITNESS_COMMITMENT_HEADER = b"\xaa\x21\xa9\xed" def get_witness_script(witness_root, witness_nonce): witness_commitment = uint256_from_str(hash256(ser_uint256(witness_root)+ser_uint256(witness_nonce))) output_data = WITNESS_COMMITMENT_HEADER + ser_uint256(witness_commitment) return CScript([OP_RETURN, output_data]) def add_witness_commitment(block, nonce=0): # transactions, with witnesses. witness_nonce = nonce witness_root = block.calc_witness_merkle_root() # witness_nonce should go to coinbase witness. block.vtx[0].wit.vtxinwit = [CTxInWitness()] block.vtx[0].wit.vtxinwit[0].scriptWitness.stack = [ser_uint256(witness_nonce)] # witness commitment is the last OP_RETURN output in coinbase block.vtx[0].vout.append(CTxOut(0, get_witness_script(witness_root, witness_nonce))) block.vtx[0].rehash() block.hashMerkleRoot = block.calc_merkle_root() block.rehash() def serialize_script_num(value): r = bytearray(0) if value == 0: return r neg = value < 0 absvalue = -value if neg else value while (absvalue): r.append(int(absvalue & 0xff)) absvalue >>= 8 if r[-1] & 0x80: r.append(0x80 if neg else 0) elif neg: r[-1] |= 0x80 return r # Create a coinbase transaction, assuming no miner fees. # If pubkey is passed in, the coinbase output will be a P2PK output; # otherwise an anyone-can-spend output. def create_coinbase(height, pubkey = None): coinbase = CTransaction() coinbase.vin.append(CTxIn(COutPoint(0, 0xffffffff), ser_string(serialize_script_num(height)), 0xffffffff)) coinbaseoutput = CTxOut() coinbaseoutput.nValue = 50 * COIN halvings = int(height/150) # regtest coinbaseoutput.nValue >>= halvings if (pubkey != None): coinbaseoutput.scriptPubKey = CScript([pubkey, OP_CHECKSIG]) else: coinbaseoutput.scriptPubKey = CScript([OP_TRUE]) coinbase.vout = [ coinbaseoutput ] coinbase.calc_sha256() return coinbase # Create a transaction. # If the scriptPubKey is not specified, make it anyone-can-spend. def create_transaction(prevtx, n, sig, value, scriptPubKey=CScript()): tx = CTransaction() assert(n < len(prevtx.vout)) tx.vin.append(CTxIn(COutPoint(prevtx.sha256, n), sig, 0xffffffff)) tx.vout.append(CTxOut(value, scriptPubKey)) tx.calc_sha256() return tx def get_legacy_sigopcount_block(block, fAccurate=True): count = 0 for tx in block.vtx: count += get_legacy_sigopcount_tx(tx, fAccurate) return count def get_legacy_sigopcount_tx(tx, fAccurate=True): count = 0 for i in tx.vout: count += i.scriptPubKey.GetSigOpCount(fAccurate) for j in tx.vin: # scriptSig might be of type bytes, so convert to CScript for the moment count += CScript(j.scriptSig).GetSigOpCount(fAccurate) return count
true
true
f7246bf98a05892332d4bb0c595fed3c4643f2dc
2,401
py
Python
src/pudl/__init__.py
erictleung/pudl
32bfbf3a959114f766b630f5b873a93b7a930c71
[ "MIT" ]
null
null
null
src/pudl/__init__.py
erictleung/pudl
32bfbf3a959114f766b630f5b873a93b7a930c71
[ "MIT" ]
null
null
null
src/pudl/__init__.py
erictleung/pudl
32bfbf3a959114f766b630f5b873a93b7a930c71
[ "MIT" ]
null
null
null
"""The Public Utility Data Liberation (PUDL) Project.""" # Create a parent logger for all PUDL loggers to inherit from import logging import pkg_resources import pudl.analysis.mcoe import pudl.cli import pudl.constants import pudl.convert.datapkg_to_sqlite import pudl.convert.epacems_to_parquet import pudl.convert.ferc1_to_sqlite import pudl.convert.flatten_datapkgs import pudl.etl import pudl.extract.eia860 import pudl.extract.eia923 import pudl.extract.epacems import pudl.extract.epaipm import pudl.extract.ferc1 import pudl.glue.ferc1_eia import pudl.helpers import pudl.load.csv import pudl.load.metadata # Output modules by data source: import pudl.output.eia860 import pudl.output.eia923 import pudl.output.ferc1 import pudl.output.glue import pudl.output.pudltabl # Transformation functions, organized by data source: import pudl.transform.eia import pudl.transform.eia860 import pudl.transform.eia923 import pudl.transform.epacems import pudl.transform.epaipm import pudl.transform.ferc1 # Deployed data & workspace management import pudl.validate import pudl.workspace.datastore import pudl.workspace.setup # noqa: F401 WTF is this showing up as unused? __author__ = "Catalyst Cooperative" __contact__ = "pudl@catalyst.coop" __maintainer__ = "Catalyst Cooperative" __license__ = "MIT License" __maintainer_email__ = "zane.selvans@catalyst.coop" __version__ = pkg_resources.get_distribution("catalystcoop.pudl").version __docformat__ = "restructuredtext en" __description__ = "Tools for liberating public US electric utility data." __long_description__ = """ This Public Utility Data Liberation (PUDL) project is a collection of tools that allow programmatic access to and manipulation of many public data sets related to electric utilities in the United States. These data sets are often collected by state and federal agencies, but are publicized in ways that are not well standardized, or intended for interoperability. PUDL seeks to allow more transparent and useful access to this important public data, with the goal of enabling climate advocates, academic researchers, and data journalists to better understand the electricity system and its impacts on climate. """ __pythonrequiredversion__ = "3.7" __projecturl__ = "https://catalyst.coop/pudl/" __downloadurl__ = "https://github.com/catalyst-cooperative/pudl/" logging.getLogger(__name__).addHandler(logging.NullHandler())
35.835821
76
0.82299
import logging import pkg_resources import pudl.analysis.mcoe import pudl.cli import pudl.constants import pudl.convert.datapkg_to_sqlite import pudl.convert.epacems_to_parquet import pudl.convert.ferc1_to_sqlite import pudl.convert.flatten_datapkgs import pudl.etl import pudl.extract.eia860 import pudl.extract.eia923 import pudl.extract.epacems import pudl.extract.epaipm import pudl.extract.ferc1 import pudl.glue.ferc1_eia import pudl.helpers import pudl.load.csv import pudl.load.metadata import pudl.output.eia860 import pudl.output.eia923 import pudl.output.ferc1 import pudl.output.glue import pudl.output.pudltabl import pudl.transform.eia import pudl.transform.eia860 import pudl.transform.eia923 import pudl.transform.epacems import pudl.transform.epaipm import pudl.transform.ferc1 import pudl.validate import pudl.workspace.datastore import pudl.workspace.setup __author__ = "Catalyst Cooperative" __contact__ = "pudl@catalyst.coop" __maintainer__ = "Catalyst Cooperative" __license__ = "MIT License" __maintainer_email__ = "zane.selvans@catalyst.coop" __version__ = pkg_resources.get_distribution("catalystcoop.pudl").version __docformat__ = "restructuredtext en" __description__ = "Tools for liberating public US electric utility data." __long_description__ = """ This Public Utility Data Liberation (PUDL) project is a collection of tools that allow programmatic access to and manipulation of many public data sets related to electric utilities in the United States. These data sets are often collected by state and federal agencies, but are publicized in ways that are not well standardized, or intended for interoperability. PUDL seeks to allow more transparent and useful access to this important public data, with the goal of enabling climate advocates, academic researchers, and data journalists to better understand the electricity system and its impacts on climate. """ __pythonrequiredversion__ = "3.7" __projecturl__ = "https://catalyst.coop/pudl/" __downloadurl__ = "https://github.com/catalyst-cooperative/pudl/" logging.getLogger(__name__).addHandler(logging.NullHandler())
true
true
f7246c03ec5401f98478d3072cffa65821a40e6d
5,510
py
Python
test/functional/p2p_disconnect_ban.py
Simple-Software-Solutions/RBX-Core
8cf0dfda708233e080e8729cec0b5014218386e3
[ "MIT" ]
null
null
null
test/functional/p2p_disconnect_ban.py
Simple-Software-Solutions/RBX-Core
8cf0dfda708233e080e8729cec0b5014218386e3
[ "MIT" ]
null
null
null
test/functional/p2p_disconnect_ban.py
Simple-Software-Solutions/RBX-Core
8cf0dfda708233e080e8729cec0b5014218386e3
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) 2014-2017 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Test node disconnect and ban behavior""" import time from test_framework.test_framework import RbxTestFramework from test_framework.util import ( assert_equal, connect_nodes, assert_raises_rpc_error, wait_until, ) class DisconnectBanTest(RbxTestFramework): def set_test_params(self): self.num_nodes = 2 def run_test(self): self.log.info("Connect nodes both way") connect_nodes(self.nodes[0], 1) connect_nodes(self.nodes[1], 0) self.log.info("Test setban and listbanned RPCs") self.log.info("setban: successfully ban single IP address") assert_equal(len(self.nodes[1].getpeerinfo()), 2) # node1 should have 2 connections to node0 at this point self.nodes[1].setban("127.0.0.1", "add") wait_until(lambda: len(self.nodes[1].getpeerinfo()) == 0, timeout=10) assert_equal(len(self.nodes[1].getpeerinfo()), 0) # all nodes must be disconnected at this point assert_equal(len(self.nodes[1].listbanned()), 1) self.log.info("clearbanned: successfully clear ban list") self.nodes[1].clearbanned() assert_equal(len(self.nodes[1].listbanned()), 0) self.nodes[1].setban("127.0.0.0/24", "add") self.log.info("setban: fail to ban an already banned subnet") assert_equal(len(self.nodes[1].listbanned()), 1) assert_raises_rpc_error(-23, "IP/Subnet already banned", self.nodes[1].setban, "127.0.0.1", "add") self.log.info("setban: fail to ban an invalid subnet") assert_raises_rpc_error(-23, "Error: Invalid IP/Subnet", self.nodes[1].setban, "127.0.0.1/42", "add") assert_equal(len(self.nodes[1].listbanned()), 1) # still only one banned ip because 127.0.0.1 is within the range of 127.0.0.0/24 self.log.info("setban remove: fail to unban a non-banned subnet") assert_raises_rpc_error(-1, "Error: Unban failed", self.nodes[1].setban, "127.0.0.1", "remove") assert_equal(len(self.nodes[1].listbanned()), 1) self.log.info("setban remove: successfully unban subnet") self.nodes[1].setban("127.0.0.0/24", "remove") assert_equal(len(self.nodes[1].listbanned()), 0) self.nodes[1].clearbanned() assert_equal(len(self.nodes[1].listbanned()), 0) self.log.info("setban: test persistence across node restart") self.nodes[1].setban("127.0.0.0/32", "add") self.nodes[1].setban("127.0.0.0/24", "add") # Set the mocktime so we can control when bans expire old_time = int(time.time()) self.nodes[1].setmocktime(old_time) self.nodes[1].setban("192.168.0.1", "add", 1) # ban for 1 seconds self.nodes[1].setban("2001:4d48:ac57:400:cacf:e9ff:fe1d:9c63/19", "add", 1000) # ban for 1000 seconds listBeforeShutdown = self.nodes[1].listbanned() assert_equal("192.168.0.1/32", listBeforeShutdown[2]['address']) # Move time forward by 3 seconds so the third ban has expired self.nodes[1].setmocktime(old_time + 3) assert_equal(len(self.nodes[1].listbanned()), 4) self.stop_node(1) self.start_node(1) listAfterShutdown = self.nodes[1].listbanned() assert_equal("127.0.0.0/24", listAfterShutdown[0]['address']) assert_equal("127.0.0.0/32", listAfterShutdown[1]['address']) assert_equal("/19" in listAfterShutdown[2]['address'], True) # Clear ban lists self.nodes[1].clearbanned() self.log.info("Connect nodes both way") connect_nodes(self.nodes[0], 1) connect_nodes(self.nodes[1], 0) self.log.info("Test disconnectnode RPCs") #self.log.info("disconnectnode: fail to disconnect when calling with address and nodeid") #address1 = self.nodes[0].getpeerinfo()[0]['addr'] #node1 = self.nodes[0].getpeerinfo()[0]['addr'] #assert_raises_rpc_error(-32602, "Only one of address and nodeid should be provided.", self.nodes[0].disconnectnode, address=address1, nodeid=node1) self.log.info("disconnectnode: fail to disconnect when calling with junk address") assert_raises_rpc_error(-29, "Node not found in connected nodes", self.nodes[0].disconnectnode, "221B Baker Street") self.log.info("disconnectnode: successfully disconnect node by address") address1 = self.nodes[0].getpeerinfo()[0]['addr'] self.nodes[0].disconnectnode(address1) wait_until(lambda: len(self.nodes[0].getpeerinfo()) == 1, timeout=10) assert not [node for node in self.nodes[0].getpeerinfo() if node['addr'] == address1] self.log.info("disconnectnode: successfully reconnect node") connect_nodes(self.nodes[0], 1) # reconnect the node assert_equal(len(self.nodes[0].getpeerinfo()), 2) assert [node for node in self.nodes[0].getpeerinfo() if node['addr'] == address1] #self.log.info("disconnectnode: successfully disconnect node by node id") #id1 = self.nodes[0].getpeerinfo()[0]['id'] #self.nodes[0].disconnectnode(nodeid=id1) #wait_until(lambda: len(self.nodes[0].getpeerinfo()) == 1, timeout=10) #assert not [node for node in self.nodes[0].getpeerinfo() if node['id'] == id1] if __name__ == '__main__': DisconnectBanTest().main()
48.333333
156
0.659891
import time from test_framework.test_framework import RbxTestFramework from test_framework.util import ( assert_equal, connect_nodes, assert_raises_rpc_error, wait_until, ) class DisconnectBanTest(RbxTestFramework): def set_test_params(self): self.num_nodes = 2 def run_test(self): self.log.info("Connect nodes both way") connect_nodes(self.nodes[0], 1) connect_nodes(self.nodes[1], 0) self.log.info("Test setban and listbanned RPCs") self.log.info("setban: successfully ban single IP address") assert_equal(len(self.nodes[1].getpeerinfo()), 2) self.nodes[1].setban("127.0.0.1", "add") wait_until(lambda: len(self.nodes[1].getpeerinfo()) == 0, timeout=10) assert_equal(len(self.nodes[1].getpeerinfo()), 0) assert_equal(len(self.nodes[1].listbanned()), 1) self.log.info("clearbanned: successfully clear ban list") self.nodes[1].clearbanned() assert_equal(len(self.nodes[1].listbanned()), 0) self.nodes[1].setban("127.0.0.0/24", "add") self.log.info("setban: fail to ban an already banned subnet") assert_equal(len(self.nodes[1].listbanned()), 1) assert_raises_rpc_error(-23, "IP/Subnet already banned", self.nodes[1].setban, "127.0.0.1", "add") self.log.info("setban: fail to ban an invalid subnet") assert_raises_rpc_error(-23, "Error: Invalid IP/Subnet", self.nodes[1].setban, "127.0.0.1/42", "add") assert_equal(len(self.nodes[1].listbanned()), 1) self.log.info("setban remove: fail to unban a non-banned subnet") assert_raises_rpc_error(-1, "Error: Unban failed", self.nodes[1].setban, "127.0.0.1", "remove") assert_equal(len(self.nodes[1].listbanned()), 1) self.log.info("setban remove: successfully unban subnet") self.nodes[1].setban("127.0.0.0/24", "remove") assert_equal(len(self.nodes[1].listbanned()), 0) self.nodes[1].clearbanned() assert_equal(len(self.nodes[1].listbanned()), 0) self.log.info("setban: test persistence across node restart") self.nodes[1].setban("127.0.0.0/32", "add") self.nodes[1].setban("127.0.0.0/24", "add") old_time = int(time.time()) self.nodes[1].setmocktime(old_time) self.nodes[1].setban("192.168.0.1", "add", 1) self.nodes[1].setban("2001:4d48:ac57:400:cacf:e9ff:fe1d:9c63/19", "add", 1000) listBeforeShutdown = self.nodes[1].listbanned() assert_equal("192.168.0.1/32", listBeforeShutdown[2]['address']) self.nodes[1].setmocktime(old_time + 3) assert_equal(len(self.nodes[1].listbanned()), 4) self.stop_node(1) self.start_node(1) listAfterShutdown = self.nodes[1].listbanned() assert_equal("127.0.0.0/24", listAfterShutdown[0]['address']) assert_equal("127.0.0.0/32", listAfterShutdown[1]['address']) assert_equal("/19" in listAfterShutdown[2]['address'], True) self.nodes[1].clearbanned() self.log.info("Connect nodes both way") connect_nodes(self.nodes[0], 1) connect_nodes(self.nodes[1], 0) self.log.info("Test disconnectnode RPCs") self.log.info("disconnectnode: fail to disconnect when calling with junk address") assert_raises_rpc_error(-29, "Node not found in connected nodes", self.nodes[0].disconnectnode, "221B Baker Street") self.log.info("disconnectnode: successfully disconnect node by address") address1 = self.nodes[0].getpeerinfo()[0]['addr'] self.nodes[0].disconnectnode(address1) wait_until(lambda: len(self.nodes[0].getpeerinfo()) == 1, timeout=10) assert not [node for node in self.nodes[0].getpeerinfo() if node['addr'] == address1] self.log.info("disconnectnode: successfully reconnect node") connect_nodes(self.nodes[0], 1) assert_equal(len(self.nodes[0].getpeerinfo()), 2) assert [node for node in self.nodes[0].getpeerinfo() if node['addr'] == address1] if __name__ == '__main__': DisconnectBanTest().main()
true
true
f7246cc917719e28deb7b06b6817fd9d7b3f055b
1,758
py
Python
core/src/zeit/edit/browser/resources.py
rickdg/vivi
16134ac954bf8425646d4ad47bdd1f372e089355
[ "BSD-3-Clause" ]
5
2019-05-16T09:51:29.000Z
2021-05-31T09:30:03.000Z
core/src/zeit/edit/browser/resources.py
rickdg/vivi
16134ac954bf8425646d4ad47bdd1f372e089355
[ "BSD-3-Clause" ]
107
2019-05-24T12:19:02.000Z
2022-03-23T15:05:56.000Z
core/src/zeit/edit/browser/resources.py
rickdg/vivi
16134ac954bf8425646d4ad47bdd1f372e089355
[ "BSD-3-Clause" ]
3
2020-08-14T11:01:17.000Z
2022-01-08T17:32:19.000Z
from zeit.cms.browser.resources import SplitDirResource, Library import zeit.cms.browser.resources import zeit.find.browser.resources lib_css = Library('zeit.edit', 'resources') lib_js = Library('zeit.edit.js', 'js') SplitDirResource('editor.css') SplitDirResource('fold.js', depends=[zeit.cms.browser.resources.base]) SplitDirResource('json.js', depends=[zeit.cms.browser.resources.base]) SplitDirResource('edit.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.tab_js, zeit.find.browser.resources.find_js, json_js, # noqa editor_css, # noqa ]) SplitDirResource('context.js', depends=[ zeit.cms.browser.resources.base, edit_js]) # noqa SplitDirResource('drop.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.dnd_js, context_js]) # noqa SplitDirResource('sortable.js', depends=[ zeit.cms.browser.resources.base, context_js, # noqa drop_js]) # noqa SplitDirResource('inlineform.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.view_js, zeit.cms.browser.resources.form_js, edit_js, # noqa editor_css, # noqa ]) SplitDirResource('lightbox.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.lightbox_js, zeit.cms.browser.resources.tab_js, context_js, # noqa edit_js, # noqa editor_css, # noqa ]) SplitDirResource('library.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.view_js, zeit.cms.browser.resources.tab_js, drop_js, # noqa editor_css, # noqa ]) SplitDirResource('undo.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.view_js, editor_css, # noqa ])
27.046154
70
0.713879
from zeit.cms.browser.resources import SplitDirResource, Library import zeit.cms.browser.resources import zeit.find.browser.resources lib_css = Library('zeit.edit', 'resources') lib_js = Library('zeit.edit.js', 'js') SplitDirResource('editor.css') SplitDirResource('fold.js', depends=[zeit.cms.browser.resources.base]) SplitDirResource('json.js', depends=[zeit.cms.browser.resources.base]) SplitDirResource('edit.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.tab_js, zeit.find.browser.resources.find_js, json_js, editor_css, ]) SplitDirResource('context.js', depends=[ zeit.cms.browser.resources.base, edit_js]) SplitDirResource('drop.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.dnd_js, context_js]) SplitDirResource('sortable.js', depends=[ zeit.cms.browser.resources.base, context_js, drop_js]) SplitDirResource('inlineform.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.view_js, zeit.cms.browser.resources.form_js, edit_js, editor_css, ]) SplitDirResource('lightbox.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.lightbox_js, zeit.cms.browser.resources.tab_js, context_js, edit_js, editor_css, ]) SplitDirResource('library.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.view_js, zeit.cms.browser.resources.tab_js, drop_js, editor_css, ]) SplitDirResource('undo.js', depends=[ zeit.cms.browser.resources.base, zeit.cms.browser.resources.view_js, editor_css, ])
true
true
f7246cd07aed951d4878742924bcbfb2fe5565c2
329
py
Python
factioncli/commands/credentials.py
joncave/CLI
e12113594574bd4ca112895c6df59d1ae1c2094f
[ "BSD-3-Clause" ]
null
null
null
factioncli/commands/credentials.py
joncave/CLI
e12113594574bd4ca112895c6df59d1ae1c2094f
[ "BSD-3-Clause" ]
null
null
null
factioncli/commands/credentials.py
joncave/CLI
e12113594574bd4ca112895c6df59d1ae1c2094f
[ "BSD-3-Clause" ]
null
null
null
from cliff.lister import Lister from factioncli.processing.config import get_passwords class Credentials(Lister): "Returns a list of the default credentials for this instance of Faction" def take_action(self, parsed_args): passwords = get_passwords() return ("Type", "Username", "Password"), passwords
29.909091
76
0.738602
from cliff.lister import Lister from factioncli.processing.config import get_passwords class Credentials(Lister): def take_action(self, parsed_args): passwords = get_passwords() return ("Type", "Username", "Password"), passwords
true
true
f7246fb1d3475e6a8f8ea2b2fd45ec7d3e10c62f
16,568
py
Python
venv/Lib/site-packages/scipy/sparse/linalg/tests/test_interface.py
EkremBayar/bayar
aad1a32044da671d0b4f11908416044753360b39
[ "MIT" ]
353
2020-12-10T10:47:17.000Z
2022-03-31T23:08:29.000Z
venv/Lib/site-packages/scipy/sparse/linalg/tests/test_interface.py
EkremBayar/bayar
aad1a32044da671d0b4f11908416044753360b39
[ "MIT" ]
80
2020-12-10T09:54:22.000Z
2022-03-30T22:08:45.000Z
venv/Lib/site-packages/scipy/sparse/linalg/tests/test_interface.py
EkremBayar/bayar
aad1a32044da671d0b4f11908416044753360b39
[ "MIT" ]
63
2020-12-10T17:10:34.000Z
2022-03-28T16:27:07.000Z
"""Test functions for the sparse.linalg.interface module """ from functools import partial from itertools import product import operator import pytest from pytest import raises as assert_raises, warns from numpy.testing import assert_, assert_equal import numpy as np import scipy.sparse as sparse from scipy.sparse.linalg import interface from scipy.sparse.sputils import matrix class TestLinearOperator(object): def setup_method(self): self.A = np.array([[1,2,3], [4,5,6]]) self.B = np.array([[1,2], [3,4], [5,6]]) self.C = np.array([[1,2], [3,4]]) def test_matvec(self): def get_matvecs(A): return [{ 'shape': A.shape, 'matvec': lambda x: np.dot(A, x).reshape(A.shape[0]), 'rmatvec': lambda x: np.dot(A.T.conj(), x).reshape(A.shape[1]) }, { 'shape': A.shape, 'matvec': lambda x: np.dot(A, x), 'rmatvec': lambda x: np.dot(A.T.conj(), x), 'rmatmat': lambda x: np.dot(A.T.conj(), x), 'matmat': lambda x: np.dot(A, x) }] for matvecs in get_matvecs(self.A): A = interface.LinearOperator(**matvecs) assert_(A.args == ()) assert_equal(A.matvec(np.array([1,2,3])), [14,32]) assert_equal(A.matvec(np.array([[1],[2],[3]])), [[14],[32]]) assert_equal(A * np.array([1,2,3]), [14,32]) assert_equal(A * np.array([[1],[2],[3]]), [[14],[32]]) assert_equal(A.dot(np.array([1,2,3])), [14,32]) assert_equal(A.dot(np.array([[1],[2],[3]])), [[14],[32]]) assert_equal(A.matvec(matrix([[1],[2],[3]])), [[14],[32]]) assert_equal(A * matrix([[1],[2],[3]]), [[14],[32]]) assert_equal(A.dot(matrix([[1],[2],[3]])), [[14],[32]]) assert_equal((2*A)*[1,1,1], [12,30]) assert_equal((2 * A).rmatvec([1, 1]), [10, 14, 18]) assert_equal((2*A).H.matvec([1,1]), [10, 14, 18]) assert_equal((2*A)*[[1],[1],[1]], [[12],[30]]) assert_equal((2 * A).matmat([[1], [1], [1]]), [[12], [30]]) assert_equal((A*2)*[1,1,1], [12,30]) assert_equal((A*2)*[[1],[1],[1]], [[12],[30]]) assert_equal((2j*A)*[1,1,1], [12j,30j]) assert_equal((A+A)*[1,1,1], [12, 30]) assert_equal((A + A).rmatvec([1, 1]), [10, 14, 18]) assert_equal((A+A).H.matvec([1,1]), [10, 14, 18]) assert_equal((A+A)*[[1],[1],[1]], [[12], [30]]) assert_equal((A+A).matmat([[1],[1],[1]]), [[12], [30]]) assert_equal((-A)*[1,1,1], [-6,-15]) assert_equal((-A)*[[1],[1],[1]], [[-6],[-15]]) assert_equal((A-A)*[1,1,1], [0,0]) assert_equal((A - A) * [[1], [1], [1]], [[0], [0]]) X = np.array([[1, 2], [3, 4]]) # A_asarray = np.array([[1, 2, 3], [4, 5, 6]]) assert_equal((2 * A).rmatmat(X), np.dot((2 * self.A).T, X)) assert_equal((A * 2).rmatmat(X), np.dot((self.A * 2).T, X)) assert_equal((2j * A).rmatmat(X), np.dot((2j * self.A).T.conj(), X)) assert_equal((A * 2j).rmatmat(X), np.dot((self.A * 2j).T.conj(), X)) assert_equal((A + A).rmatmat(X), np.dot((self.A + self.A).T, X)) assert_equal((A + 2j * A).rmatmat(X), np.dot((self.A + 2j * self.A).T.conj(), X)) assert_equal((-A).rmatmat(X), np.dot((-self.A).T, X)) assert_equal((A - A).rmatmat(X), np.dot((self.A - self.A).T, X)) assert_equal((2j * A).rmatmat(2j * X), np.dot((2j * self.A).T.conj(), 2j * X)) z = A+A assert_(len(z.args) == 2 and z.args[0] is A and z.args[1] is A) z = 2*A assert_(len(z.args) == 2 and z.args[0] is A and z.args[1] == 2) assert_(isinstance(A.matvec([1, 2, 3]), np.ndarray)) assert_(isinstance(A.matvec(np.array([[1],[2],[3]])), np.ndarray)) assert_(isinstance(A * np.array([1,2,3]), np.ndarray)) assert_(isinstance(A * np.array([[1],[2],[3]]), np.ndarray)) assert_(isinstance(A.dot(np.array([1,2,3])), np.ndarray)) assert_(isinstance(A.dot(np.array([[1],[2],[3]])), np.ndarray)) assert_(isinstance(A.matvec(matrix([[1],[2],[3]])), np.ndarray)) assert_(isinstance(A * matrix([[1],[2],[3]]), np.ndarray)) assert_(isinstance(A.dot(matrix([[1],[2],[3]])), np.ndarray)) assert_(isinstance(2*A, interface._ScaledLinearOperator)) assert_(isinstance(2j*A, interface._ScaledLinearOperator)) assert_(isinstance(A+A, interface._SumLinearOperator)) assert_(isinstance(-A, interface._ScaledLinearOperator)) assert_(isinstance(A-A, interface._SumLinearOperator)) assert_((2j*A).dtype == np.complex_) assert_raises(ValueError, A.matvec, np.array([1,2])) assert_raises(ValueError, A.matvec, np.array([1,2,3,4])) assert_raises(ValueError, A.matvec, np.array([[1],[2]])) assert_raises(ValueError, A.matvec, np.array([[1],[2],[3],[4]])) assert_raises(ValueError, lambda: A*A) assert_raises(ValueError, lambda: A**2) for matvecsA, matvecsB in product(get_matvecs(self.A), get_matvecs(self.B)): A = interface.LinearOperator(**matvecsA) B = interface.LinearOperator(**matvecsB) # AtimesB = np.array([[22, 28], [49, 64]]) AtimesB = self.A.dot(self.B) X = np.array([[1, 2], [3, 4]]) assert_equal((A * B).rmatmat(X), np.dot((AtimesB).T, X)) assert_equal((2j * A * B).rmatmat(X), np.dot((2j * AtimesB).T.conj(), X)) assert_equal((A*B)*[1,1], [50,113]) assert_equal((A*B)*[[1],[1]], [[50],[113]]) assert_equal((A*B).matmat([[1],[1]]), [[50],[113]]) assert_equal((A * B).rmatvec([1, 1]), [71, 92]) assert_equal((A * B).H.matvec([1, 1]), [71, 92]) assert_(isinstance(A*B, interface._ProductLinearOperator)) assert_raises(ValueError, lambda: A+B) assert_raises(ValueError, lambda: A**2) z = A*B assert_(len(z.args) == 2 and z.args[0] is A and z.args[1] is B) for matvecsC in get_matvecs(self.C): C = interface.LinearOperator(**matvecsC) X = np.array([[1, 2], [3, 4]]) assert_equal(C.rmatmat(X), np.dot((self.C).T, X)) assert_equal((C**2).rmatmat(X), np.dot((np.dot(self.C, self.C)).T, X)) assert_equal((C**2)*[1,1], [17,37]) assert_equal((C**2).rmatvec([1, 1]), [22, 32]) assert_equal((C**2).H.matvec([1, 1]), [22, 32]) assert_equal((C**2).matmat([[1],[1]]), [[17],[37]]) assert_(isinstance(C**2, interface._PowerLinearOperator)) def test_matmul(self): D = {'shape': self.A.shape, 'matvec': lambda x: np.dot(self.A, x).reshape(self.A.shape[0]), 'rmatvec': lambda x: np.dot(self.A.T.conj(), x).reshape(self.A.shape[1]), 'rmatmat': lambda x: np.dot(self.A.T.conj(), x), 'matmat': lambda x: np.dot(self.A, x)} A = interface.LinearOperator(**D) B = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) b = B[0] assert_equal(operator.matmul(A, b), A * b) assert_equal(operator.matmul(A, B), A * B) assert_raises(ValueError, operator.matmul, A, 2) assert_raises(ValueError, operator.matmul, 2, A) class TestAsLinearOperator(object): def setup_method(self): self.cases = [] def make_cases(original, dtype): cases = [] cases.append((matrix(original, dtype=dtype), original)) cases.append((np.array(original, dtype=dtype), original)) cases.append((sparse.csr_matrix(original, dtype=dtype), original)) # Test default implementations of _adjoint and _rmatvec, which # refer to each other. def mv(x, dtype): y = original.dot(x) if len(x.shape) == 2: y = y.reshape(-1, 1) return y def rmv(x, dtype): return original.T.conj().dot(x) class BaseMatlike(interface.LinearOperator): args = () def __init__(self, dtype): self.dtype = np.dtype(dtype) self.shape = original.shape def _matvec(self, x): return mv(x, self.dtype) class HasRmatvec(BaseMatlike): args = () def _rmatvec(self,x): return rmv(x, self.dtype) class HasAdjoint(BaseMatlike): args = () def _adjoint(self): shape = self.shape[1], self.shape[0] matvec = partial(rmv, dtype=self.dtype) rmatvec = partial(mv, dtype=self.dtype) return interface.LinearOperator(matvec=matvec, rmatvec=rmatvec, dtype=self.dtype, shape=shape) class HasRmatmat(HasRmatvec): def _matmat(self, x): return original.dot(x) def _rmatmat(self, x): return original.T.conj().dot(x) cases.append((HasRmatvec(dtype), original)) cases.append((HasAdjoint(dtype), original)) cases.append((HasRmatmat(dtype), original)) return cases original = np.array([[1,2,3], [4,5,6]]) self.cases += make_cases(original, np.int32) self.cases += make_cases(original, np.float32) self.cases += make_cases(original, np.float64) self.cases += [(interface.aslinearoperator(M).T, A.T) for M, A in make_cases(original.T, np.float64)] self.cases += [(interface.aslinearoperator(M).H, A.T.conj()) for M, A in make_cases(original.T, np.float64)] original = np.array([[1, 2j, 3j], [4j, 5j, 6]]) self.cases += make_cases(original, np.complex_) self.cases += [(interface.aslinearoperator(M).T, A.T) for M, A in make_cases(original.T, np.complex_)] self.cases += [(interface.aslinearoperator(M).H, A.T.conj()) for M, A in make_cases(original.T, np.complex_)] def test_basic(self): for M, A_array in self.cases: A = interface.aslinearoperator(M) M,N = A.shape xs = [np.array([1, 2, 3]), np.array([[1], [2], [3]])] ys = [np.array([1, 2]), np.array([[1], [2]])] if A.dtype == np.complex_: xs += [np.array([1, 2j, 3j]), np.array([[1], [2j], [3j]])] ys += [np.array([1, 2j]), np.array([[1], [2j]])] x2 = np.array([[1, 4], [2, 5], [3, 6]]) for x in xs: assert_equal(A.matvec(x), A_array.dot(x)) assert_equal(A * x, A_array.dot(x)) assert_equal(A.matmat(x2), A_array.dot(x2)) assert_equal(A * x2, A_array.dot(x2)) for y in ys: assert_equal(A.rmatvec(y), A_array.T.conj().dot(y)) assert_equal(A.T.matvec(y), A_array.T.dot(y)) assert_equal(A.H.matvec(y), A_array.T.conj().dot(y)) for y in ys: if y.ndim < 2: continue assert_equal(A.rmatmat(y), A_array.T.conj().dot(y)) assert_equal(A.T.matmat(y), A_array.T.dot(y)) assert_equal(A.H.matmat(y), A_array.T.conj().dot(y)) if hasattr(M,'dtype'): assert_equal(A.dtype, M.dtype) assert_(hasattr(A, 'args')) def test_dot(self): for M, A_array in self.cases: A = interface.aslinearoperator(M) M,N = A.shape x0 = np.array([1, 2, 3]) x1 = np.array([[1], [2], [3]]) x2 = np.array([[1, 4], [2, 5], [3, 6]]) assert_equal(A.dot(x0), A_array.dot(x0)) assert_equal(A.dot(x1), A_array.dot(x1)) assert_equal(A.dot(x2), A_array.dot(x2)) def test_repr(): A = interface.LinearOperator(shape=(1, 1), matvec=lambda x: 1) repr_A = repr(A) assert_('unspecified dtype' not in repr_A, repr_A) def test_identity(): ident = interface.IdentityOperator((3, 3)) assert_equal(ident * [1, 2, 3], [1, 2, 3]) assert_equal(ident.dot(np.arange(9).reshape(3, 3)).ravel(), np.arange(9)) assert_raises(ValueError, ident.matvec, [1, 2, 3, 4]) def test_attributes(): A = interface.aslinearoperator(np.arange(16).reshape(4, 4)) def always_four_ones(x): x = np.asarray(x) assert_(x.shape == (3,) or x.shape == (3, 1)) return np.ones(4) B = interface.LinearOperator(shape=(4, 3), matvec=always_four_ones) for op in [A, B, A * B, A.H, A + A, B + B, A**4]: assert_(hasattr(op, "dtype")) assert_(hasattr(op, "shape")) assert_(hasattr(op, "_matvec")) def matvec(x): """ Needed for test_pickle as local functions are not pickleable """ return np.zeros(3) def test_pickle(): import pickle for protocol in range(pickle.HIGHEST_PROTOCOL + 1): A = interface.LinearOperator((3, 3), matvec) s = pickle.dumps(A, protocol=protocol) B = pickle.loads(s) for k in A.__dict__: assert_equal(getattr(A, k), getattr(B, k)) def test_inheritance(): class Empty(interface.LinearOperator): pass with warns(RuntimeWarning, match="should implement at least"): assert_raises(TypeError, Empty) class Identity(interface.LinearOperator): def __init__(self, n): super(Identity, self).__init__(dtype=None, shape=(n, n)) def _matvec(self, x): return x id3 = Identity(3) assert_equal(id3.matvec([1, 2, 3]), [1, 2, 3]) assert_raises(NotImplementedError, id3.rmatvec, [4, 5, 6]) class MatmatOnly(interface.LinearOperator): def __init__(self, A): super(MatmatOnly, self).__init__(A.dtype, A.shape) self.A = A def _matmat(self, x): return self.A.dot(x) mm = MatmatOnly(np.random.randn(5, 3)) assert_equal(mm.matvec(np.random.randn(3)).shape, (5,)) def test_dtypes_of_operator_sum(): # gh-6078 mat_complex = np.random.rand(2,2) + 1j * np.random.rand(2,2) mat_real = np.random.rand(2,2) complex_operator = interface.aslinearoperator(mat_complex) real_operator = interface.aslinearoperator(mat_real) sum_complex = complex_operator + complex_operator sum_real = real_operator + real_operator assert_equal(sum_real.dtype, np.float64) assert_equal(sum_complex.dtype, np.complex128) def test_no_double_init(): call_count = [0] def matvec(v): call_count[0] += 1 return v # It should call matvec exactly once (in order to determine the # operator dtype) interface.LinearOperator((2, 2), matvec=matvec) assert_equal(call_count[0], 1) def test_adjoint_conjugate(): X = np.array([[1j]]) A = interface.aslinearoperator(X) B = 1j * A Y = 1j * X v = np.array([1]) assert_equal(B.dot(v), Y.dot(v)) assert_equal(B.H.dot(v), Y.T.conj().dot(v)) def test_ndim(): X = np.array([[1]]) A = interface.aslinearoperator(X) assert_equal(A.ndim, 2) def test_transpose_noconjugate(): X = np.array([[1j]]) A = interface.aslinearoperator(X) B = 1j * A Y = 1j * X v = np.array([1]) assert_equal(B.dot(v), Y.dot(v)) assert_equal(B.T.dot(v), Y.T.dot(v))
36.736142
78
0.506639
from functools import partial from itertools import product import operator import pytest from pytest import raises as assert_raises, warns from numpy.testing import assert_, assert_equal import numpy as np import scipy.sparse as sparse from scipy.sparse.linalg import interface from scipy.sparse.sputils import matrix class TestLinearOperator(object): def setup_method(self): self.A = np.array([[1,2,3], [4,5,6]]) self.B = np.array([[1,2], [3,4], [5,6]]) self.C = np.array([[1,2], [3,4]]) def test_matvec(self): def get_matvecs(A): return [{ 'shape': A.shape, 'matvec': lambda x: np.dot(A, x).reshape(A.shape[0]), 'rmatvec': lambda x: np.dot(A.T.conj(), x).reshape(A.shape[1]) }, { 'shape': A.shape, 'matvec': lambda x: np.dot(A, x), 'rmatvec': lambda x: np.dot(A.T.conj(), x), 'rmatmat': lambda x: np.dot(A.T.conj(), x), 'matmat': lambda x: np.dot(A, x) }] for matvecs in get_matvecs(self.A): A = interface.LinearOperator(**matvecs) assert_(A.args == ()) assert_equal(A.matvec(np.array([1,2,3])), [14,32]) assert_equal(A.matvec(np.array([[1],[2],[3]])), [[14],[32]]) assert_equal(A * np.array([1,2,3]), [14,32]) assert_equal(A * np.array([[1],[2],[3]]), [[14],[32]]) assert_equal(A.dot(np.array([1,2,3])), [14,32]) assert_equal(A.dot(np.array([[1],[2],[3]])), [[14],[32]]) assert_equal(A.matvec(matrix([[1],[2],[3]])), [[14],[32]]) assert_equal(A * matrix([[1],[2],[3]]), [[14],[32]]) assert_equal(A.dot(matrix([[1],[2],[3]])), [[14],[32]]) assert_equal((2*A)*[1,1,1], [12,30]) assert_equal((2 * A).rmatvec([1, 1]), [10, 14, 18]) assert_equal((2*A).H.matvec([1,1]), [10, 14, 18]) assert_equal((2*A)*[[1],[1],[1]], [[12],[30]]) assert_equal((2 * A).matmat([[1], [1], [1]]), [[12], [30]]) assert_equal((A*2)*[1,1,1], [12,30]) assert_equal((A*2)*[[1],[1],[1]], [[12],[30]]) assert_equal((2j*A)*[1,1,1], [12j,30j]) assert_equal((A+A)*[1,1,1], [12, 30]) assert_equal((A + A).rmatvec([1, 1]), [10, 14, 18]) assert_equal((A+A).H.matvec([1,1]), [10, 14, 18]) assert_equal((A+A)*[[1],[1],[1]], [[12], [30]]) assert_equal((A+A).matmat([[1],[1],[1]]), [[12], [30]]) assert_equal((-A)*[1,1,1], [-6,-15]) assert_equal((-A)*[[1],[1],[1]], [[-6],[-15]]) assert_equal((A-A)*[1,1,1], [0,0]) assert_equal((A - A) * [[1], [1], [1]], [[0], [0]]) X = np.array([[1, 2], [3, 4]]) assert_equal((2 * A).rmatmat(X), np.dot((2 * self.A).T, X)) assert_equal((A * 2).rmatmat(X), np.dot((self.A * 2).T, X)) assert_equal((2j * A).rmatmat(X), np.dot((2j * self.A).T.conj(), X)) assert_equal((A * 2j).rmatmat(X), np.dot((self.A * 2j).T.conj(), X)) assert_equal((A + A).rmatmat(X), np.dot((self.A + self.A).T, X)) assert_equal((A + 2j * A).rmatmat(X), np.dot((self.A + 2j * self.A).T.conj(), X)) assert_equal((-A).rmatmat(X), np.dot((-self.A).T, X)) assert_equal((A - A).rmatmat(X), np.dot((self.A - self.A).T, X)) assert_equal((2j * A).rmatmat(2j * X), np.dot((2j * self.A).T.conj(), 2j * X)) z = A+A assert_(len(z.args) == 2 and z.args[0] is A and z.args[1] is A) z = 2*A assert_(len(z.args) == 2 and z.args[0] is A and z.args[1] == 2) assert_(isinstance(A.matvec([1, 2, 3]), np.ndarray)) assert_(isinstance(A.matvec(np.array([[1],[2],[3]])), np.ndarray)) assert_(isinstance(A * np.array([1,2,3]), np.ndarray)) assert_(isinstance(A * np.array([[1],[2],[3]]), np.ndarray)) assert_(isinstance(A.dot(np.array([1,2,3])), np.ndarray)) assert_(isinstance(A.dot(np.array([[1],[2],[3]])), np.ndarray)) assert_(isinstance(A.matvec(matrix([[1],[2],[3]])), np.ndarray)) assert_(isinstance(A * matrix([[1],[2],[3]]), np.ndarray)) assert_(isinstance(A.dot(matrix([[1],[2],[3]])), np.ndarray)) assert_(isinstance(2*A, interface._ScaledLinearOperator)) assert_(isinstance(2j*A, interface._ScaledLinearOperator)) assert_(isinstance(A+A, interface._SumLinearOperator)) assert_(isinstance(-A, interface._ScaledLinearOperator)) assert_(isinstance(A-A, interface._SumLinearOperator)) assert_((2j*A).dtype == np.complex_) assert_raises(ValueError, A.matvec, np.array([1,2])) assert_raises(ValueError, A.matvec, np.array([1,2,3,4])) assert_raises(ValueError, A.matvec, np.array([[1],[2]])) assert_raises(ValueError, A.matvec, np.array([[1],[2],[3],[4]])) assert_raises(ValueError, lambda: A*A) assert_raises(ValueError, lambda: A**2) for matvecsA, matvecsB in product(get_matvecs(self.A), get_matvecs(self.B)): A = interface.LinearOperator(**matvecsA) B = interface.LinearOperator(**matvecsB) AtimesB = self.A.dot(self.B) X = np.array([[1, 2], [3, 4]]) assert_equal((A * B).rmatmat(X), np.dot((AtimesB).T, X)) assert_equal((2j * A * B).rmatmat(X), np.dot((2j * AtimesB).T.conj(), X)) assert_equal((A*B)*[1,1], [50,113]) assert_equal((A*B)*[[1],[1]], [[50],[113]]) assert_equal((A*B).matmat([[1],[1]]), [[50],[113]]) assert_equal((A * B).rmatvec([1, 1]), [71, 92]) assert_equal((A * B).H.matvec([1, 1]), [71, 92]) assert_(isinstance(A*B, interface._ProductLinearOperator)) assert_raises(ValueError, lambda: A+B) assert_raises(ValueError, lambda: A**2) z = A*B assert_(len(z.args) == 2 and z.args[0] is A and z.args[1] is B) for matvecsC in get_matvecs(self.C): C = interface.LinearOperator(**matvecsC) X = np.array([[1, 2], [3, 4]]) assert_equal(C.rmatmat(X), np.dot((self.C).T, X)) assert_equal((C**2).rmatmat(X), np.dot((np.dot(self.C, self.C)).T, X)) assert_equal((C**2)*[1,1], [17,37]) assert_equal((C**2).rmatvec([1, 1]), [22, 32]) assert_equal((C**2).H.matvec([1, 1]), [22, 32]) assert_equal((C**2).matmat([[1],[1]]), [[17],[37]]) assert_(isinstance(C**2, interface._PowerLinearOperator)) def test_matmul(self): D = {'shape': self.A.shape, 'matvec': lambda x: np.dot(self.A, x).reshape(self.A.shape[0]), 'rmatvec': lambda x: np.dot(self.A.T.conj(), x).reshape(self.A.shape[1]), 'rmatmat': lambda x: np.dot(self.A.T.conj(), x), 'matmat': lambda x: np.dot(self.A, x)} A = interface.LinearOperator(**D) B = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) b = B[0] assert_equal(operator.matmul(A, b), A * b) assert_equal(operator.matmul(A, B), A * B) assert_raises(ValueError, operator.matmul, A, 2) assert_raises(ValueError, operator.matmul, 2, A) class TestAsLinearOperator(object): def setup_method(self): self.cases = [] def make_cases(original, dtype): cases = [] cases.append((matrix(original, dtype=dtype), original)) cases.append((np.array(original, dtype=dtype), original)) cases.append((sparse.csr_matrix(original, dtype=dtype), original)) def mv(x, dtype): y = original.dot(x) if len(x.shape) == 2: y = y.reshape(-1, 1) return y def rmv(x, dtype): return original.T.conj().dot(x) class BaseMatlike(interface.LinearOperator): args = () def __init__(self, dtype): self.dtype = np.dtype(dtype) self.shape = original.shape def _matvec(self, x): return mv(x, self.dtype) class HasRmatvec(BaseMatlike): args = () def _rmatvec(self,x): return rmv(x, self.dtype) class HasAdjoint(BaseMatlike): args = () def _adjoint(self): shape = self.shape[1], self.shape[0] matvec = partial(rmv, dtype=self.dtype) rmatvec = partial(mv, dtype=self.dtype) return interface.LinearOperator(matvec=matvec, rmatvec=rmatvec, dtype=self.dtype, shape=shape) class HasRmatmat(HasRmatvec): def _matmat(self, x): return original.dot(x) def _rmatmat(self, x): return original.T.conj().dot(x) cases.append((HasRmatvec(dtype), original)) cases.append((HasAdjoint(dtype), original)) cases.append((HasRmatmat(dtype), original)) return cases original = np.array([[1,2,3], [4,5,6]]) self.cases += make_cases(original, np.int32) self.cases += make_cases(original, np.float32) self.cases += make_cases(original, np.float64) self.cases += [(interface.aslinearoperator(M).T, A.T) for M, A in make_cases(original.T, np.float64)] self.cases += [(interface.aslinearoperator(M).H, A.T.conj()) for M, A in make_cases(original.T, np.float64)] original = np.array([[1, 2j, 3j], [4j, 5j, 6]]) self.cases += make_cases(original, np.complex_) self.cases += [(interface.aslinearoperator(M).T, A.T) for M, A in make_cases(original.T, np.complex_)] self.cases += [(interface.aslinearoperator(M).H, A.T.conj()) for M, A in make_cases(original.T, np.complex_)] def test_basic(self): for M, A_array in self.cases: A = interface.aslinearoperator(M) M,N = A.shape xs = [np.array([1, 2, 3]), np.array([[1], [2], [3]])] ys = [np.array([1, 2]), np.array([[1], [2]])] if A.dtype == np.complex_: xs += [np.array([1, 2j, 3j]), np.array([[1], [2j], [3j]])] ys += [np.array([1, 2j]), np.array([[1], [2j]])] x2 = np.array([[1, 4], [2, 5], [3, 6]]) for x in xs: assert_equal(A.matvec(x), A_array.dot(x)) assert_equal(A * x, A_array.dot(x)) assert_equal(A.matmat(x2), A_array.dot(x2)) assert_equal(A * x2, A_array.dot(x2)) for y in ys: assert_equal(A.rmatvec(y), A_array.T.conj().dot(y)) assert_equal(A.T.matvec(y), A_array.T.dot(y)) assert_equal(A.H.matvec(y), A_array.T.conj().dot(y)) for y in ys: if y.ndim < 2: continue assert_equal(A.rmatmat(y), A_array.T.conj().dot(y)) assert_equal(A.T.matmat(y), A_array.T.dot(y)) assert_equal(A.H.matmat(y), A_array.T.conj().dot(y)) if hasattr(M,'dtype'): assert_equal(A.dtype, M.dtype) assert_(hasattr(A, 'args')) def test_dot(self): for M, A_array in self.cases: A = interface.aslinearoperator(M) M,N = A.shape x0 = np.array([1, 2, 3]) x1 = np.array([[1], [2], [3]]) x2 = np.array([[1, 4], [2, 5], [3, 6]]) assert_equal(A.dot(x0), A_array.dot(x0)) assert_equal(A.dot(x1), A_array.dot(x1)) assert_equal(A.dot(x2), A_array.dot(x2)) def test_repr(): A = interface.LinearOperator(shape=(1, 1), matvec=lambda x: 1) repr_A = repr(A) assert_('unspecified dtype' not in repr_A, repr_A) def test_identity(): ident = interface.IdentityOperator((3, 3)) assert_equal(ident * [1, 2, 3], [1, 2, 3]) assert_equal(ident.dot(np.arange(9).reshape(3, 3)).ravel(), np.arange(9)) assert_raises(ValueError, ident.matvec, [1, 2, 3, 4]) def test_attributes(): A = interface.aslinearoperator(np.arange(16).reshape(4, 4)) def always_four_ones(x): x = np.asarray(x) assert_(x.shape == (3,) or x.shape == (3, 1)) return np.ones(4) B = interface.LinearOperator(shape=(4, 3), matvec=always_four_ones) for op in [A, B, A * B, A.H, A + A, B + B, A**4]: assert_(hasattr(op, "dtype")) assert_(hasattr(op, "shape")) assert_(hasattr(op, "_matvec")) def matvec(x): return np.zeros(3) def test_pickle(): import pickle for protocol in range(pickle.HIGHEST_PROTOCOL + 1): A = interface.LinearOperator((3, 3), matvec) s = pickle.dumps(A, protocol=protocol) B = pickle.loads(s) for k in A.__dict__: assert_equal(getattr(A, k), getattr(B, k)) def test_inheritance(): class Empty(interface.LinearOperator): pass with warns(RuntimeWarning, match="should implement at least"): assert_raises(TypeError, Empty) class Identity(interface.LinearOperator): def __init__(self, n): super(Identity, self).__init__(dtype=None, shape=(n, n)) def _matvec(self, x): return x id3 = Identity(3) assert_equal(id3.matvec([1, 2, 3]), [1, 2, 3]) assert_raises(NotImplementedError, id3.rmatvec, [4, 5, 6]) class MatmatOnly(interface.LinearOperator): def __init__(self, A): super(MatmatOnly, self).__init__(A.dtype, A.shape) self.A = A def _matmat(self, x): return self.A.dot(x) mm = MatmatOnly(np.random.randn(5, 3)) assert_equal(mm.matvec(np.random.randn(3)).shape, (5,)) def test_dtypes_of_operator_sum(): mat_complex = np.random.rand(2,2) + 1j * np.random.rand(2,2) mat_real = np.random.rand(2,2) complex_operator = interface.aslinearoperator(mat_complex) real_operator = interface.aslinearoperator(mat_real) sum_complex = complex_operator + complex_operator sum_real = real_operator + real_operator assert_equal(sum_real.dtype, np.float64) assert_equal(sum_complex.dtype, np.complex128) def test_no_double_init(): call_count = [0] def matvec(v): call_count[0] += 1 return v interface.LinearOperator((2, 2), matvec=matvec) assert_equal(call_count[0], 1) def test_adjoint_conjugate(): X = np.array([[1j]]) A = interface.aslinearoperator(X) B = 1j * A Y = 1j * X v = np.array([1]) assert_equal(B.dot(v), Y.dot(v)) assert_equal(B.H.dot(v), Y.T.conj().dot(v)) def test_ndim(): X = np.array([[1]]) A = interface.aslinearoperator(X) assert_equal(A.ndim, 2) def test_transpose_noconjugate(): X = np.array([[1j]]) A = interface.aslinearoperator(X) B = 1j * A Y = 1j * X v = np.array([1]) assert_equal(B.dot(v), Y.dot(v)) assert_equal(B.T.dot(v), Y.T.dot(v))
true
true
f7246fd41a52c4c852543dc3cdc9672346ec9dbe
6,333
py
Python
doc/source/conf.py
gaohao95/cffi
8d1a4ec54db0f3f0e18e4a68c2bdc7f32d0fdd8b
[ "MIT" ]
1
2017-01-05T00:59:03.000Z
2017-01-05T00:59:03.000Z
doc/source/conf.py
gaohao95/cffi
8d1a4ec54db0f3f0e18e4a68c2bdc7f32d0fdd8b
[ "MIT" ]
null
null
null
doc/source/conf.py
gaohao95/cffi
8d1a4ec54db0f3f0e18e4a68c2bdc7f32d0fdd8b
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- # # CFFI documentation build configuration file, created by # sphinx-quickstart on Thu Jun 14 16:37:47 2012. # # This file is execfile()d with the current directory set to its containing dir. # # Note that not all possible configuration values are present in this # autogenerated file. # # All configuration values have a default; values that are commented out # serve to show the default. import sys, os # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. #sys.path.append(os.path.abspath('.')) # -- General configuration ----------------------------------------------------- # Add any Sphinx extension module names here, as strings. They can be extensions # coming with Sphinx (named 'sphinx.ext.*') or your custom ones. extensions = ['sphinx.ext.autodoc'] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix of source filenames. source_suffix = '.rst' # The encoding of source files. #source_encoding = 'utf-8' # The master toctree document. master_doc = 'index' # General information about the project. project = u'CFFI' copyright = u'2012-2015, Armin Rigo, Maciej Fijalkowski' # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = '1.9' # The full version, including alpha/beta/rc tags. release = '1.9.2' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. #language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: #today = '' # Else, today_fmt is used as the format for a strftime call. #today_fmt = '%B %d, %Y' # List of documents that shouldn't be included in the build. #unused_docs = [] # List of directories, relative to source directory, that shouldn't be searched # for source files. exclude_trees = [] # The reST default role (used for this markup: `text`) to use for all documents. #default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. #add_function_parentheses = True # If true, the current module name will be prepended to all description # unit titles (such as .. function::). #add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. #show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # A list of ignored prefixes for module index sorting. #modindex_common_prefix = [] # -- Options for HTML output --------------------------------------------------- # The theme to use for HTML and HTML Help pages. Major themes that come with # Sphinx are currently 'default' and 'sphinxdoc'. #html_theme = 'default' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. #html_theme_options = {} # Add any paths that contain custom themes here, relative to this directory. #html_theme_path = [] # The name for this set of Sphinx documents. If None, it defaults to # "<project> v<release> documentation". #html_title = None # A shorter title for the navigation bar. Default is the same as html_title. #html_short_title = None # The name of an image file (relative to this directory) to place at the top # of the sidebar. #html_logo = None # The name of an image file (within the static path) to use as favicon of the # docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. #html_favicon = None # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". #html_static_path = ['_static'] # If not '', a 'Last updated on:' timestamp is inserted at every page bottom, # using the given strftime format. #html_last_updated_fmt = '%b %d, %Y' # If true, SmartyPants will be used to convert quotes and dashes to # typographically correct entities. #html_use_smartypants = True # Custom sidebar templates, maps document names to template names. #html_sidebars = {} # Additional templates that should be rendered to pages, maps page names to # template names. #html_additional_pages = {} # If false, no module index is generated. #html_use_modindex = True # If false, no index is generated. #html_use_index = True # If true, the index is split into individual pages for each letter. #html_split_index = False # If true, links to the reST sources are added to the pages. #html_show_sourcelink = True # If true, an OpenSearch description file will be output, and all pages will # contain a <link> tag referring to it. The value of this option must be the # base URL from which the finished HTML is served. #html_use_opensearch = '' # If nonempty, this is the file name suffix for HTML files (e.g. ".xhtml"). #html_file_suffix = '' # Output file base name for HTML help builder. htmlhelp_basename = 'CFFIdoc' # -- Options for LaTeX output -------------------------------------------------- # The paper size ('letter' or 'a4'). #latex_paper_size = 'letter' # The font size ('10pt', '11pt' or '12pt'). #latex_font_size = '10pt' # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass [howto/manual]). latex_documents = [ ('index', 'CFFI.tex', u'CFFI Documentation', u'Armin Rigo, Maciej Fijalkowski', 'manual'), ] # The name of an image file (relative to this directory) to place at the top of # the title page. #latex_logo = None # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. #latex_use_parts = False # Additional stuff for the LaTeX preamble. #latex_preamble = '' # Documents to append as an appendix to all manuals. #latex_appendices = [] # If false, no module index is generated. #latex_use_modindex = True
32.476923
80
0.722722
import sys, os extensions = ['sphinx.ext.autodoc'] templates_path = ['_templates'] source_suffix = '.rst' master_doc = 'index' project = u'CFFI' copyright = u'2012-2015, Armin Rigo, Maciej Fijalkowski' # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = '1.9' # The full version, including alpha/beta/rc tags. release = '1.9.2' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. #language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: #today = '' # Else, today_fmt is used as the format for a strftime call. #today_fmt = '%B %d, %Y' # List of documents that shouldn't be included in the build. # for source files. exclude_trees = [] # The reST default role (used for this markup: `text`) to use for all documents. #default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. #add_function_parentheses = True # If true, the current module name will be prepended to all description # unit titles (such as .. function::). #add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. #show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # A list of ignored prefixes for module index sorting. #modindex_common_prefix = [] # -- Options for HTML output --------------------------------------------------- # The theme to use for HTML and HTML Help pages. Major themes that come with # Sphinx are currently 'default' and 'sphinxdoc'. #html_theme = 'default' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. #html_theme_options = {} # Add any paths that contain custom themes here, relative to this directory. #html_theme_path = [] # The name for this set of Sphinx documents. If None, it defaults to # "<project> v<release> documentation". #html_title = None # A shorter title for the navigation bar. Default is the same as html_title. #html_short_title = None # The name of an image file (relative to this directory) to place at the top # of the sidebar. #html_logo = None # The name of an image file (within the static path) to use as favicon of the # docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. #html_favicon = None # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". #html_static_path = ['_static'] # If not '', a 'Last updated on:' timestamp is inserted at every page bottom, # using the given strftime format. #html_last_updated_fmt = '%b %d, %Y' # If true, SmartyPants will be used to convert quotes and dashes to # typographically correct entities. #html_use_smartypants = True # Custom sidebar templates, maps document names to template names. #html_sidebars = {} # Additional templates that should be rendered to pages, maps page names to # template names. #html_additional_pages = {} # If false, no module index is generated. #html_use_modindex = True # If false, no index is generated. #html_use_index = True # If true, the index is split into individual pages for each letter. #html_split_index = False # If true, links to the reST sources are added to the pages. #html_show_sourcelink = True # If true, an OpenSearch description file will be output, and all pages will # contain a <link> tag referring to it. The value of this option must be the # base URL from which the finished HTML is served. #html_use_opensearch = '' # If nonempty, this is the file name suffix for HTML files (e.g. ".xhtml"). #html_file_suffix = '' # Output file base name for HTML help builder. htmlhelp_basename = 'CFFIdoc' # -- Options for LaTeX output -------------------------------------------------- # The paper size ('letter' or 'a4'). #latex_paper_size = 'letter' # The font size ('10pt', '11pt' or '12pt'). #latex_font_size = '10pt' # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass [howto/manual]). latex_documents = [ ('index', 'CFFI.tex', u'CFFI Documentation', u'Armin Rigo, Maciej Fijalkowski', 'manual'), ] # The name of an image file (relative to this directory) to place at the top of # the title page. #latex_logo = None # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. #latex_use_parts = False # Additional stuff for the LaTeX preamble. #latex_preamble = '' # Documents to append as an appendix to all manuals. #latex_appendices = [] # If false, no module index is generated. #latex_use_modindex = True
true
true
f72470edb12a542373c15f2c30a033702b46467a
1,325
py
Python
tests/test_erd.py
Datateer/erd-python
528b876bf5adf6114cd1e0aac6a2be14006fd2eb
[ "MIT" ]
1
2021-09-13T06:05:48.000Z
2021-09-13T06:05:48.000Z
tests/test_erd.py
Datateer/erd-python
528b876bf5adf6114cd1e0aac6a2be14006fd2eb
[ "MIT" ]
2
2021-01-22T11:20:34.000Z
2022-01-18T07:20:09.000Z
tests/test_erd.py
Datateer/erd-python
528b876bf5adf6114cd1e0aac6a2be14006fd2eb
[ "MIT" ]
null
null
null
#!/usr/bin/env python """Tests for `erd` package.""" import unittest from click.testing import CliRunner from erd import erd from erd import cli class TestErd(unittest.TestCase): """Tests for `erd` package.""" def setUp(self): """Set up test fixtures, if any.""" def tearDown(self): """Tear down test fixtures, if any.""" def test_000_something(self): """Test something.""" def test_command_line_interface(self): """Test the CLI.""" runner = CliRunner() result = runner.invoke(cli.main) assert result.exit_code == 0 assert 'erd.cli.main' in result.output help_result = runner.invoke(cli.main, ['--help']) assert help_result.exit_code == 0 assert '--help Show this message and exit.' in help_result.output @unittest.skip('not implemented yet') def test_input_filename_required(self): raise NotImplementedError() @unittest.skip('not implemented yet') def test_outputfilename_required(self): raise NotImplementedError() @unittest.skip('not implemented yet') def test_errors_if_input_file_not_found(self): raise NotImplementedError() @unittest.skip('not implemented yet') def test_produces_output_file(self): raise NotImplementedError()
25.980392
74
0.658113
import unittest from click.testing import CliRunner from erd import erd from erd import cli class TestErd(unittest.TestCase): def setUp(self): def tearDown(self): def test_000_something(self): def test_command_line_interface(self): runner = CliRunner() result = runner.invoke(cli.main) assert result.exit_code == 0 assert 'erd.cli.main' in result.output help_result = runner.invoke(cli.main, ['--help']) assert help_result.exit_code == 0 assert '--help Show this message and exit.' in help_result.output @unittest.skip('not implemented yet') def test_input_filename_required(self): raise NotImplementedError() @unittest.skip('not implemented yet') def test_outputfilename_required(self): raise NotImplementedError() @unittest.skip('not implemented yet') def test_errors_if_input_file_not_found(self): raise NotImplementedError() @unittest.skip('not implemented yet') def test_produces_output_file(self): raise NotImplementedError()
true
true
f7247100061d6774afb40c4bea380d62cdfa96b7
11,258
py
Python
modnet/matbench/benchmark.py
sparks-baird/modnet
2b4a88aa8a3323756b6daee52450569cddd0068b
[ "MIT" ]
32
2020-05-22T11:47:37.000Z
2022-03-28T12:55:40.000Z
modnet/matbench/benchmark.py
sparks-baird/modnet
2b4a88aa8a3323756b6daee52450569cddd0068b
[ "MIT" ]
43
2020-06-12T21:09:15.000Z
2022-03-28T21:05:43.000Z
modnet/matbench/benchmark.py
sparks-baird/modnet
2b4a88aa8a3323756b6daee52450569cddd0068b
[ "MIT" ]
22
2020-06-19T12:03:02.000Z
2022-01-17T16:13:38.000Z
import os from collections import defaultdict from traceback import print_exc from typing import List, Dict, Any, Optional, Tuple, Type import numpy as np from modnet.preprocessing import MODData from modnet.models import MODNetModel from modnet.utils import LOG from modnet.hyper_opt import FitGenetic MATBENCH_SEED = 18012019 def matbench_kfold_splits(data: MODData, n_splits=5, classification=False): """Return the pre-defined k-fold splits to use when reporting matbench results. Arguments: data: The featurized MODData. """ if classification: from sklearn.model_selection import StratifiedKFold as KFold else: from sklearn.model_selection import KFold kf = KFold(n_splits=n_splits, shuffle=True, random_state=MATBENCH_SEED) kf_splits = kf.split(data.df_featurized, y=data.df_targets) return kf_splits def matbench_benchmark( data: MODData, target: List[str], target_weights: Dict[str, float], fit_settings: Optional[Dict[str, Any]] = None, ga_settings: Optional[Dict[str, float]] = None, classification: bool = False, model_type: Type[MODNetModel] = MODNetModel, save_folds: bool = False, save_models: bool = False, hp_optimization: bool = True, hp_strategy: str = "fit_preset", inner_feat_selection: bool = True, use_precomputed_cross_nmi: bool = True, presets: Optional[List[dict]] = None, fast: bool = False, n_jobs: Optional[int] = None, nested: bool = False, **model_init_kwargs, ) -> dict: """Train and cross-validate a model against Matbench data splits, optionally performing hyperparameter optimisation. Arguments: data: The entire dataset as a `MODData`. target: The list of target names to train on. target_weights: The target weights to use for the `MODNetModel`. fit_settings: Any settings to pass to `model.fit(...)` directly (typically when not performing hyperparameter optimisation). classification: Whether all tasks are classification rather than regression. model_type: The type of the model to create and benchmark. save_folds: Whether to save dataframes with pre-processed fold data (e.g. feature selection). save_models: Whether to pickle all trained models according to their fold index and performance. hp_optimization: Whether to perform hyperparameter optimisation. hp_strategy: Which optimization strategy to choose. Use either \"fit_preset\" or \"ga\". inner_feat_selection: Whether to perform split-level feature selection or try to use pre-computed values. use_precomputed_cross_nmi: Whether to use the precmputed cross NMI from the Materials Project dataset, or recompute per fold. presets: Override the built-in hyperparameter grid with these presets. fast: Whether to perform debug training, i.e. reduced presets and epochs, for the fit_preset strategy. n_jobs: Try to parallelize the inner fit_preset over this number of processes. Maxes out at number_of_presets*nested_folds nested: Whether to perform nested CV for hyperparameter optimisation. **model_init_kwargs: Additional arguments to pass to the model on creation. Returns: A dictionary containing all the results from the training, broken down by model and by fold. """ if hp_optimization: if hp_strategy not in ["fit_preset", "ga"]: raise RuntimeError( f'{hp_strategy} not supported. Choose from "fit_genetic" or "ga".' ) if fit_settings is None: fit_settings = {} if not fit_settings.get("n_feat"): nf = len(data.df_featurized.columns) fit_settings["n_feat"] = nf if not fit_settings.get("num_neurons"): # Pass dummy network fit_settings["num_neurons"] = [[4], [4], [4], [4]] if ga_settings is None: ga_settings = { "size_pop": 20, "num_generations": 10, "early_stopping": 4, "refit": False, } fold_data = [] results = defaultdict(list) for ind, (train, test) in enumerate( matbench_kfold_splits(data, classification=classification) ): train_data, test_data = data.split((train, test)) if inner_feat_selection: path = "folds/train_moddata_f{}".format(ind + 1) if os.path.isfile(path): train_data = MODData.load(path) else: train_data.feature_selection( n=-1, use_precomputed_cross_nmi=use_precomputed_cross_nmi, n_jobs=n_jobs, ) os.makedirs("folds", exist_ok=True) train_data.save(path) fold_data.append((train_data, test_data)) args = (target, target_weights, fit_settings, ga_settings) model_kwargs = { "model_type": model_type, "hp_optimization": hp_optimization, "fast": fast, "classification": classification, "save_folds": save_folds, "presets": presets, "hp_strategy": hp_strategy, "save_models": save_models, "nested": nested, "n_jobs": n_jobs, } model_kwargs.update(model_init_kwargs) fold_results = [] for fold in enumerate(fold_data): fold_results.append(train_fold(fold, *args, **model_kwargs)) for fold in fold_results: for key in fold: results[key].append(fold[key]) return results def train_fold( fold: Tuple[int, Tuple[MODData, MODData]], target: List[str], target_weights: Dict[str, float], fit_settings: Dict[str, Any], ga_settings: Dict[str, float], model_type: Type[MODNetModel] = MODNetModel, presets=None, hp_optimization=True, hp_strategy="fit_preset", classification=False, save_folds=False, fast=False, save_models=False, nested=False, n_jobs=None, **model_kwargs, ) -> dict: """Train one fold of a CV. Unless stated, all arguments have the same meaning as in `matbench_benchmark(...)`. Arguments: fold: A tuple containing the fold index, and another tuple of the training MODData and test MODData. Returns: A dictionary summarising the fold results. """ fold_ind, (train_data, test_data) = fold results = {} multi_target = bool(len(target) - 1) # If not performing hp_optimization, load model init settings from fit_settings model_settings = {} if not hp_optimization: model_settings = { "num_neurons": fit_settings["num_neurons"], "num_classes": fit_settings.get("num_classes"), "act": fit_settings.get("act"), "out_act": fit_settings.get("out_act", "linear"), "n_feat": fit_settings["n_feat"], } model_settings.update(model_kwargs) if classification: model_settings["num_classes"] = {t: 2 for t in target_weights} model = model_type(target, target_weights, **model_settings) if hp_optimization: if hp_strategy == "fit_preset": ( models, val_losses, best_learning_curve, learning_curves, best_presets, ) = model.fit_preset( train_data, presets=presets, fast=fast, classification=classification, nested=nested, n_jobs=n_jobs, ) results["nested_losses"] = val_losses results["nested_learning_curves"] = learning_curves results["best_learning_curves"] = best_learning_curve results["best_presets"] = best_presets elif hp_strategy == "ga": ga = FitGenetic(train_data) model = ga.run( size_pop=ga_settings["size_pop"], num_generations=ga_settings["num_generations"], nested=nested, n_jobs=n_jobs, early_stopping=ga_settings["early_stopping"], refit=ga_settings["refit"], fast=fast, ) if save_models: for ind, nested_model in enumerate(models): score = val_losses[ind] nested_model.save(f"results/nested_model_{fold_ind}_{ind}_{score:3.3f}") model.save(f"results/best_model_{fold_ind}_{score:3.3f}") else: if fit_settings["increase_bs"]: model.fit( train_data, lr=fit_settings["lr"], epochs=fit_settings["epochs"], batch_size=fit_settings["batch_size"], loss=fit_settings["loss"], ) model.fit( train_data, lr=fit_settings["lr"] / 7, epochs=fit_settings["epochs"] // 2, batch_size=fit_settings["batch_size"] * 2, loss=fit_settings["loss"], ) else: model.fit(train_data, **fit_settings) try: predict_kwargs = {} if classification: predict_kwargs["return_prob"] = True if model.can_return_uncertainty: predict_kwargs["return_unc"] = True pred_results = model.predict(test_data, **predict_kwargs) if isinstance(pred_results, tuple): predictions, stds = pred_results else: predictions = pred_results stds = None targets = test_data.df_targets if classification: from sklearn.metrics import roc_auc_score from sklearn.preprocessing import OneHotEncoder y_true = OneHotEncoder().fit_transform(targets.values).toarray() score = roc_auc_score(y_true, predictions.values) pred_bool = model.predict(test_data, return_prob=False) LOG.info(f"ROC-AUC: {score}") errors = targets - pred_bool elif multi_target: errors = targets - predictions score = np.mean(np.abs(errors.values), axis=0) else: errors = targets - predictions score = np.mean(np.abs(errors.values)) except Exception: print_exc() print("Something went wrong benchmarking this model.") predictions = None errors = None score = None if save_folds: opt_feat = train_data.optimal_features[: fit_settings["n_feat"]] df_train = train_data.df_featurized df_train = df_train[opt_feat] df_train.to_csv("folds/train_f{}.csv".format(ind + 1)) df_test = test_data.df_featurized df_test = df_test[opt_feat] errors.columns = [x + "_error" for x in errors.columns] df_test = df_test.join(errors) df_test.to_csv("folds/test_f{}.csv".format(ind + 1)) results["predictions"] = predictions if stds is not None: results["stds"] = stds results["targets"] = targets results["errors"] = errors results["scores"] = score results["model"] = model return results
34.012085
110
0.618671
import os from collections import defaultdict from traceback import print_exc from typing import List, Dict, Any, Optional, Tuple, Type import numpy as np from modnet.preprocessing import MODData from modnet.models import MODNetModel from modnet.utils import LOG from modnet.hyper_opt import FitGenetic MATBENCH_SEED = 18012019 def matbench_kfold_splits(data: MODData, n_splits=5, classification=False): if classification: from sklearn.model_selection import StratifiedKFold as KFold else: from sklearn.model_selection import KFold kf = KFold(n_splits=n_splits, shuffle=True, random_state=MATBENCH_SEED) kf_splits = kf.split(data.df_featurized, y=data.df_targets) return kf_splits def matbench_benchmark( data: MODData, target: List[str], target_weights: Dict[str, float], fit_settings: Optional[Dict[str, Any]] = None, ga_settings: Optional[Dict[str, float]] = None, classification: bool = False, model_type: Type[MODNetModel] = MODNetModel, save_folds: bool = False, save_models: bool = False, hp_optimization: bool = True, hp_strategy: str = "fit_preset", inner_feat_selection: bool = True, use_precomputed_cross_nmi: bool = True, presets: Optional[List[dict]] = None, fast: bool = False, n_jobs: Optional[int] = None, nested: bool = False, **model_init_kwargs, ) -> dict: if hp_optimization: if hp_strategy not in ["fit_preset", "ga"]: raise RuntimeError( f'{hp_strategy} not supported. Choose from "fit_genetic" or "ga".' ) if fit_settings is None: fit_settings = {} if not fit_settings.get("n_feat"): nf = len(data.df_featurized.columns) fit_settings["n_feat"] = nf if not fit_settings.get("num_neurons"): fit_settings["num_neurons"] = [[4], [4], [4], [4]] if ga_settings is None: ga_settings = { "size_pop": 20, "num_generations": 10, "early_stopping": 4, "refit": False, } fold_data = [] results = defaultdict(list) for ind, (train, test) in enumerate( matbench_kfold_splits(data, classification=classification) ): train_data, test_data = data.split((train, test)) if inner_feat_selection: path = "folds/train_moddata_f{}".format(ind + 1) if os.path.isfile(path): train_data = MODData.load(path) else: train_data.feature_selection( n=-1, use_precomputed_cross_nmi=use_precomputed_cross_nmi, n_jobs=n_jobs, ) os.makedirs("folds", exist_ok=True) train_data.save(path) fold_data.append((train_data, test_data)) args = (target, target_weights, fit_settings, ga_settings) model_kwargs = { "model_type": model_type, "hp_optimization": hp_optimization, "fast": fast, "classification": classification, "save_folds": save_folds, "presets": presets, "hp_strategy": hp_strategy, "save_models": save_models, "nested": nested, "n_jobs": n_jobs, } model_kwargs.update(model_init_kwargs) fold_results = [] for fold in enumerate(fold_data): fold_results.append(train_fold(fold, *args, **model_kwargs)) for fold in fold_results: for key in fold: results[key].append(fold[key]) return results def train_fold( fold: Tuple[int, Tuple[MODData, MODData]], target: List[str], target_weights: Dict[str, float], fit_settings: Dict[str, Any], ga_settings: Dict[str, float], model_type: Type[MODNetModel] = MODNetModel, presets=None, hp_optimization=True, hp_strategy="fit_preset", classification=False, save_folds=False, fast=False, save_models=False, nested=False, n_jobs=None, **model_kwargs, ) -> dict: fold_ind, (train_data, test_data) = fold results = {} multi_target = bool(len(target) - 1) model_settings = {} if not hp_optimization: model_settings = { "num_neurons": fit_settings["num_neurons"], "num_classes": fit_settings.get("num_classes"), "act": fit_settings.get("act"), "out_act": fit_settings.get("out_act", "linear"), "n_feat": fit_settings["n_feat"], } model_settings.update(model_kwargs) if classification: model_settings["num_classes"] = {t: 2 for t in target_weights} model = model_type(target, target_weights, **model_settings) if hp_optimization: if hp_strategy == "fit_preset": ( models, val_losses, best_learning_curve, learning_curves, best_presets, ) = model.fit_preset( train_data, presets=presets, fast=fast, classification=classification, nested=nested, n_jobs=n_jobs, ) results["nested_losses"] = val_losses results["nested_learning_curves"] = learning_curves results["best_learning_curves"] = best_learning_curve results["best_presets"] = best_presets elif hp_strategy == "ga": ga = FitGenetic(train_data) model = ga.run( size_pop=ga_settings["size_pop"], num_generations=ga_settings["num_generations"], nested=nested, n_jobs=n_jobs, early_stopping=ga_settings["early_stopping"], refit=ga_settings["refit"], fast=fast, ) if save_models: for ind, nested_model in enumerate(models): score = val_losses[ind] nested_model.save(f"results/nested_model_{fold_ind}_{ind}_{score:3.3f}") model.save(f"results/best_model_{fold_ind}_{score:3.3f}") else: if fit_settings["increase_bs"]: model.fit( train_data, lr=fit_settings["lr"], epochs=fit_settings["epochs"], batch_size=fit_settings["batch_size"], loss=fit_settings["loss"], ) model.fit( train_data, lr=fit_settings["lr"] / 7, epochs=fit_settings["epochs"] // 2, batch_size=fit_settings["batch_size"] * 2, loss=fit_settings["loss"], ) else: model.fit(train_data, **fit_settings) try: predict_kwargs = {} if classification: predict_kwargs["return_prob"] = True if model.can_return_uncertainty: predict_kwargs["return_unc"] = True pred_results = model.predict(test_data, **predict_kwargs) if isinstance(pred_results, tuple): predictions, stds = pred_results else: predictions = pred_results stds = None targets = test_data.df_targets if classification: from sklearn.metrics import roc_auc_score from sklearn.preprocessing import OneHotEncoder y_true = OneHotEncoder().fit_transform(targets.values).toarray() score = roc_auc_score(y_true, predictions.values) pred_bool = model.predict(test_data, return_prob=False) LOG.info(f"ROC-AUC: {score}") errors = targets - pred_bool elif multi_target: errors = targets - predictions score = np.mean(np.abs(errors.values), axis=0) else: errors = targets - predictions score = np.mean(np.abs(errors.values)) except Exception: print_exc() print("Something went wrong benchmarking this model.") predictions = None errors = None score = None if save_folds: opt_feat = train_data.optimal_features[: fit_settings["n_feat"]] df_train = train_data.df_featurized df_train = df_train[opt_feat] df_train.to_csv("folds/train_f{}.csv".format(ind + 1)) df_test = test_data.df_featurized df_test = df_test[opt_feat] errors.columns = [x + "_error" for x in errors.columns] df_test = df_test.join(errors) df_test.to_csv("folds/test_f{}.csv".format(ind + 1)) results["predictions"] = predictions if stds is not None: results["stds"] = stds results["targets"] = targets results["errors"] = errors results["scores"] = score results["model"] = model return results
true
true
f7247128248055fc8b3fc7e0f99d36f794357c24
5,958
py
Python
utils/evaluation.py
lippman1125/pytorch_FAN
ffc9c968478d55cb0c75c062bb8774923f961110
[ "BSD-3-Clause" ]
58
2019-03-14T20:13:10.000Z
2022-03-17T07:59:34.000Z
utils/evaluation.py
lippman1125/pytorch_FAN
ffc9c968478d55cb0c75c062bb8774923f961110
[ "BSD-3-Clause" ]
7
2019-03-29T05:13:39.000Z
2021-02-08T23:00:32.000Z
utils/evaluation.py
lippman1125/pytorch_FAN
ffc9c968478d55cb0c75c062bb8774923f961110
[ "BSD-3-Clause" ]
8
2019-05-29T09:05:32.000Z
2022-03-12T17:00:02.000Z
from __future__ import absolute_import, print_function import math import numpy as np import matplotlib.pyplot as plt from random import randint from .misc import * from .transforms import transform, transform_preds __all__ = ['accuracy', 'AverageMeter'] def get_preds(scores): ''' get predictions from score maps in torch Tensor return type: torch.LongTensor ''' assert scores.dim() == 4, 'Score maps should be 4-dim' # batch, chn, height, width ===> batch, chn, height*width # chn = 68 # height*width = score_map maxval, idx = torch.max(scores.view(scores.size(0), scores.size(1), -1), 2) maxval = maxval.view(scores.size(0), scores.size(1), 1) idx = idx.view(scores.size(0), scores.size(1), 1) + 1 preds = idx.repeat(1, 1, 2).float() # batchsize * numPoints * 2 # 0 is x coord # 1 is y coord # shape = batchsize, numPoints, 2 preds[:, :, 0] = (preds[:, :, 0] - 1) % scores.size(3) + 1 preds[:, :, 1] = torch.floor((preds[:, :, 1] - 1) / scores.size(2)) + 1 pred_mask = maxval.gt(0).repeat(1, 1, 2).float() preds *= pred_mask return preds def calc_dists(preds, target, normalize): preds = preds.float() target = target.float() # dists = 68 x batch dists = torch.zeros(preds.size(1), preds.size(0)) for n in range(preds.size(0)): for c in range(preds.size(1)): if target[n, c, 0] > 1 and target[n, c, 1] > 1: dists[c, n] = torch.dist(preds[n, c, :], target[n, c, :]) / normalize[n] else: dists[c, n] = -1 return dists def dist_acc(dists, thr=0.5): ''' Return percentage below threshold while ignoring values with a -1 ''' if dists.ne(-1).sum() > 0: return dists.le(thr).eq(dists.ne(-1)).sum() * 1.0 / dists.ne(-1).sum() else: return -1 def calc_metrics(dists, path='', category=''): errors = torch.mean(dists, 0).view(dists.size(1)) axes1 = np.linspace(0, 1, 1000) axes2 = np.zeros(1000) for i in range(1000): axes2[i] = float((errors < axes1[i]).sum()) / float(errors.size(0)) auc = round(np.sum(axes2[:70]) / .7, 2) if path: label = '{}({}) : {}'.format(path.split('/')[2], category, str(auc)) plt.xlim(0, 7) plt.ylim(0, 100) plt.yticks(np.arange(0, 110, 10)) plt.xticks(np.arange(0, 8, 1)) plt.grid() plt.title('NME (%)', fontsize=20) plt.xlabel('NME (%)', fontsize=16) plt.ylabel('Test images (%)', fontsize=16) if category: if category in ['Easy', 'Category A']: plt.plot(axes1 * 100, axes2 * 100, 'b-', label=label, lw=3) if category in ['Media', 'Category B']: plt.plot(axes1 * 100, axes2 * 100, 'r-', label=label, lw=3) if category in ['Hard', 'Category C']: plt.plot(axes1 * 100, axes2 * 100, 'g-', label=label, lw=3) else: plt.plot(axes1 * 100, axes2 * 100, 'b-', label=label, lw=3) plt.legend(loc=4, fontsize=12) plt.savefig(os.path.join(path + '/CED.eps')) return auc def _get_bboxsize(iterable): # iterable = 68 x 2 # torch.min return values, idxs mins = torch.min(iterable, 0)[0].view(2) maxs = torch.max(iterable, 0)[0].view(2) center = torch.FloatTensor((maxs[0] - (maxs[0] - mins[0]) / 2, maxs[1] - (maxs[1] - mins[1]) / 2)) # center[1] = center[1] - ((maxs[1] - mins[1]) * 0.12) return np.sqrt(abs(maxs[0] - mins[0]) * abs(maxs[1] - mins[1])) def accuracy(output, target, idxs, thr=0.08): ''' Calculate accuracy according to NME, but uses ground truth heatmap rather than x,y locations First value to be returned is accuracy calculated based on overall 'idxs' followed by individual accuracies ''' # preds = batch, 68, 64, 64 preds = get_preds(output) gts = get_preds(target) # B * 2 norm = torch.ones(preds.size(0)) # use face bbox to normalize for i, gt in enumerate(gts): norm[i] = _get_bboxsize(gt) dists = calc_dists(preds, gts, norm) acc = torch.zeros(len(idxs) + 1) avg_acc = 0 cnt = 0 mean_dists = torch.mean(dists, 0) acc[0] = mean_dists.le(thr).sum() * 1.0 / preds.size(0) # for i in range(len(idxs)): # acc[i+1] = dist_acc(dists[idxs[i]-1], thr=thr) # if acc[i+1] >= 0: # avg_acc = avg_acc + acc[i+1] # cnt += 1 # if cnt != 0: # acc[0] = avg_acc / cnt return acc, dists def final_preds(output, center, scale, res): if output.size(1) == 136: coords = output.view((output.szie(0), 68, 2)) else: coords = get_preds(output) # float type # output shape is batch, 68, 64, 64 # coords shape is batch, 68, 2 # pose-processing for n in range(coords.size(0)): for p in range(coords.size(1)): hm = output[n][p] px = int(math.floor(coords[n][p][0])) py = int(math.floor(coords[n][p][1])) if px > 1 and px < res[0] and py > 1 and py < res[1]: diff = torch.Tensor( [hm[py - 1][px] - hm[py - 1][px - 2], hm[py][px - 1] - hm[py - 2][px - 1]]) coords[n][p] += diff.sign() * .25 coords += 0.5 preds = coords.clone() # Transform back for i in range(coords.size(0)): preds[i] = transform_preds(coords[i], center[i], scale[i], res) if preds.dim() < 3: preds = preds.view(1, preds.size()) return preds class AverageMeter(object): """Computes and stores the average and current value""" def __init__(self): self.reset() def reset(self): self.val = 0 self.avg = 0 self.sum = 0 self.count = 0 def update(self, val, n=1): self.val = val self.sum += val * n self.count += n self.avg = self.sum / self.count
31.193717
100
0.553206
from __future__ import absolute_import, print_function import math import numpy as np import matplotlib.pyplot as plt from random import randint from .misc import * from .transforms import transform, transform_preds __all__ = ['accuracy', 'AverageMeter'] def get_preds(scores): assert scores.dim() == 4, 'Score maps should be 4-dim' maxval, idx = torch.max(scores.view(scores.size(0), scores.size(1), -1), 2) maxval = maxval.view(scores.size(0), scores.size(1), 1) idx = idx.view(scores.size(0), scores.size(1), 1) + 1 preds = idx.repeat(1, 1, 2).float() preds[:, :, 0] = (preds[:, :, 0] - 1) % scores.size(3) + 1 preds[:, :, 1] = torch.floor((preds[:, :, 1] - 1) / scores.size(2)) + 1 pred_mask = maxval.gt(0).repeat(1, 1, 2).float() preds *= pred_mask return preds def calc_dists(preds, target, normalize): preds = preds.float() target = target.float() dists = torch.zeros(preds.size(1), preds.size(0)) for n in range(preds.size(0)): for c in range(preds.size(1)): if target[n, c, 0] > 1 and target[n, c, 1] > 1: dists[c, n] = torch.dist(preds[n, c, :], target[n, c, :]) / normalize[n] else: dists[c, n] = -1 return dists def dist_acc(dists, thr=0.5): if dists.ne(-1).sum() > 0: return dists.le(thr).eq(dists.ne(-1)).sum() * 1.0 / dists.ne(-1).sum() else: return -1 def calc_metrics(dists, path='', category=''): errors = torch.mean(dists, 0).view(dists.size(1)) axes1 = np.linspace(0, 1, 1000) axes2 = np.zeros(1000) for i in range(1000): axes2[i] = float((errors < axes1[i]).sum()) / float(errors.size(0)) auc = round(np.sum(axes2[:70]) / .7, 2) if path: label = '{}({}) : {}'.format(path.split('/')[2], category, str(auc)) plt.xlim(0, 7) plt.ylim(0, 100) plt.yticks(np.arange(0, 110, 10)) plt.xticks(np.arange(0, 8, 1)) plt.grid() plt.title('NME (%)', fontsize=20) plt.xlabel('NME (%)', fontsize=16) plt.ylabel('Test images (%)', fontsize=16) if category: if category in ['Easy', 'Category A']: plt.plot(axes1 * 100, axes2 * 100, 'b-', label=label, lw=3) if category in ['Media', 'Category B']: plt.plot(axes1 * 100, axes2 * 100, 'r-', label=label, lw=3) if category in ['Hard', 'Category C']: plt.plot(axes1 * 100, axes2 * 100, 'g-', label=label, lw=3) else: plt.plot(axes1 * 100, axes2 * 100, 'b-', label=label, lw=3) plt.legend(loc=4, fontsize=12) plt.savefig(os.path.join(path + '/CED.eps')) return auc def _get_bboxsize(iterable): mins = torch.min(iterable, 0)[0].view(2) maxs = torch.max(iterable, 0)[0].view(2) center = torch.FloatTensor((maxs[0] - (maxs[0] - mins[0]) / 2, maxs[1] - (maxs[1] - mins[1]) / 2)) return np.sqrt(abs(maxs[0] - mins[0]) * abs(maxs[1] - mins[1])) def accuracy(output, target, idxs, thr=0.08): preds = get_preds(output) gts = get_preds(target) norm = torch.ones(preds.size(0)) for i, gt in enumerate(gts): norm[i] = _get_bboxsize(gt) dists = calc_dists(preds, gts, norm) acc = torch.zeros(len(idxs) + 1) avg_acc = 0 cnt = 0 mean_dists = torch.mean(dists, 0) acc[0] = mean_dists.le(thr).sum() * 1.0 / preds.size(0) return acc, dists def final_preds(output, center, scale, res): if output.size(1) == 136: coords = output.view((output.szie(0), 68, 2)) else: coords = get_preds(output) for n in range(coords.size(0)): for p in range(coords.size(1)): hm = output[n][p] px = int(math.floor(coords[n][p][0])) py = int(math.floor(coords[n][p][1])) if px > 1 and px < res[0] and py > 1 and py < res[1]: diff = torch.Tensor( [hm[py - 1][px] - hm[py - 1][px - 2], hm[py][px - 1] - hm[py - 2][px - 1]]) coords[n][p] += diff.sign() * .25 coords += 0.5 preds = coords.clone() for i in range(coords.size(0)): preds[i] = transform_preds(coords[i], center[i], scale[i], res) if preds.dim() < 3: preds = preds.view(1, preds.size()) return preds class AverageMeter(object): def __init__(self): self.reset() def reset(self): self.val = 0 self.avg = 0 self.sum = 0 self.count = 0 def update(self, val, n=1): self.val = val self.sum += val * n self.count += n self.avg = self.sum / self.count
true
true
f72471beb538717956885400bdf193fde9f2aea9
5,531
py
Python
api/routes/admin/admin_student_routes.py
NoisyBotDude/MIS-Backend
fa402b0a6d5d6862634b0ed55bc57178856c1eba
[ "MIT" ]
null
null
null
api/routes/admin/admin_student_routes.py
NoisyBotDude/MIS-Backend
fa402b0a6d5d6862634b0ed55bc57178856c1eba
[ "MIT" ]
null
null
null
api/routes/admin/admin_student_routes.py
NoisyBotDude/MIS-Backend
fa402b0a6d5d6862634b0ed55bc57178856c1eba
[ "MIT" ]
null
null
null
from fileinput import filename from urllib.request import Request from api.drivers import student from api.drivers.student import student_drivers from api.middlewares import authentication_middleware from api.schemas.admin.admin_request_schema import admin_request_schemas from api.schemas.student.request_schemas import student_request_schemas from api.schemas.student.response_schemas import student_response_schemas from api.utils.exceptions import exceptions from fastapi import APIRouter, Depends, HTTPException, Request, status from fastapi.responses import JSONResponse from api.repository import admin_repo from api.utils.save_student_data import save_data from starlette.responses import FileResponse import json def construct_router(): admin = APIRouter(tags=["Admin"]) @admin.post("/notify/student") async def notify_by_batch(): pass @admin.post("/add/student/subscription") async def add_student_subscription( request: admin_request_schemas.ManipulateStudentSubscriptionSchema, ): try: response = await student_drivers.Student().update_array_of_str( request.__dict__ ) return JSONResponse(status_code=200, content={"message": "info updated"}) except exceptions.DuplicateStudent: return JSONResponse( status_code=409, content={"message": "info cannot be updated"} ) except exceptions.UnexpectedError: return JSONResponse( status_code=500, content={"message": "internal server error"} ) @admin.post("/remove/student/subscription") async def remove_student_subscription( request: admin_request_schemas.ManipulateStudentSubscriptionSchema, ): try: response = await student_drivers.Student().delete_from_array_of_str( request.__dict__ ) if response: return JSONResponse( status_code=200, content={"message": "subscription deleted successfully"}, ) return JSONResponse( status_code=500, content={"message": "subscription deletion failed"} ) except exceptions.DuplicateStudent: return JSONResponse( status_code=409, content={"message": "info cannot be updated"} ) except exceptions.UnexpectedError: return JSONResponse( status_code=500, content={"message": "internal server error"} ) @admin.post("/verify/student") async def verify_student(request: Request): request = await request.json() response = await admin_repo.assign_otp(request["student_ids"]) if response: return JSONResponse( status_code=200, content={"message": "otp assigned successfully"} ) return JSONResponse( status_code=500, content={ "message": """otp cannot be assigned successfully for all student""" }, ) @admin.get("/ban/student/{student_id}") async def ban_student_account(student_id: str): response = await student_drivers.Student().ban_student(student_id) if response == "already_banned": return JSONResponse( status_code=404, content={"message": "student aleady banned"} ) elif response: return JSONResponse( status_code=200, content={"message": "student banned successfully"} ) return JSONResponse( status_code=500, content={"message": "internal server error"} ) @admin.delete("/delete/student/{student_id}") async def delete_student_account(student_id: str): response = await student_drivers.Student().delete_student(student_id) if response: return JSONResponse( status_code=200, content={"message": "student deleted successfully"} ) return JSONResponse( status_code=404, content={"message": "student does not exist"} ) @admin.get("/all_student") async def get_student_profile(): try: response = await ( student_drivers.Student().get_all_students() ) return JSONResponse( status_code=200, content=response ) except Exception as e: print(e, "exception") @admin.post("/student/data") async def get_student_data(): students = await ( student_drivers.Student().get_all_students_data() ) # print(students) save_data(students) if students: return JSONResponse( status_code=200, content= { "message" : "training details saved succesfully" } ) return JSONResponse( status_code=500, content= { "message" : "training details cannot be saved" } ) @admin.get("/student/data") async def get_student_data(request: Request): filename = "student_data.xls" #send excel file return FileResponse( filename, filename="student_data.xls", status_code=200, media_type="application/vnd.ms-excel" ) return admin
31.248588
85
0.605496
from fileinput import filename from urllib.request import Request from api.drivers import student from api.drivers.student import student_drivers from api.middlewares import authentication_middleware from api.schemas.admin.admin_request_schema import admin_request_schemas from api.schemas.student.request_schemas import student_request_schemas from api.schemas.student.response_schemas import student_response_schemas from api.utils.exceptions import exceptions from fastapi import APIRouter, Depends, HTTPException, Request, status from fastapi.responses import JSONResponse from api.repository import admin_repo from api.utils.save_student_data import save_data from starlette.responses import FileResponse import json def construct_router(): admin = APIRouter(tags=["Admin"]) @admin.post("/notify/student") async def notify_by_batch(): pass @admin.post("/add/student/subscription") async def add_student_subscription( request: admin_request_schemas.ManipulateStudentSubscriptionSchema, ): try: response = await student_drivers.Student().update_array_of_str( request.__dict__ ) return JSONResponse(status_code=200, content={"message": "info updated"}) except exceptions.DuplicateStudent: return JSONResponse( status_code=409, content={"message": "info cannot be updated"} ) except exceptions.UnexpectedError: return JSONResponse( status_code=500, content={"message": "internal server error"} ) @admin.post("/remove/student/subscription") async def remove_student_subscription( request: admin_request_schemas.ManipulateStudentSubscriptionSchema, ): try: response = await student_drivers.Student().delete_from_array_of_str( request.__dict__ ) if response: return JSONResponse( status_code=200, content={"message": "subscription deleted successfully"}, ) return JSONResponse( status_code=500, content={"message": "subscription deletion failed"} ) except exceptions.DuplicateStudent: return JSONResponse( status_code=409, content={"message": "info cannot be updated"} ) except exceptions.UnexpectedError: return JSONResponse( status_code=500, content={"message": "internal server error"} ) @admin.post("/verify/student") async def verify_student(request: Request): request = await request.json() response = await admin_repo.assign_otp(request["student_ids"]) if response: return JSONResponse( status_code=200, content={"message": "otp assigned successfully"} ) return JSONResponse( status_code=500, content={ "message": """otp cannot be assigned successfully for all student""" }, ) @admin.get("/ban/student/{student_id}") async def ban_student_account(student_id: str): response = await student_drivers.Student().ban_student(student_id) if response == "already_banned": return JSONResponse( status_code=404, content={"message": "student aleady banned"} ) elif response: return JSONResponse( status_code=200, content={"message": "student banned successfully"} ) return JSONResponse( status_code=500, content={"message": "internal server error"} ) @admin.delete("/delete/student/{student_id}") async def delete_student_account(student_id: str): response = await student_drivers.Student().delete_student(student_id) if response: return JSONResponse( status_code=200, content={"message": "student deleted successfully"} ) return JSONResponse( status_code=404, content={"message": "student does not exist"} ) @admin.get("/all_student") async def get_student_profile(): try: response = await ( student_drivers.Student().get_all_students() ) return JSONResponse( status_code=200, content=response ) except Exception as e: print(e, "exception") @admin.post("/student/data") async def get_student_data(): students = await ( student_drivers.Student().get_all_students_data() ) save_data(students) if students: return JSONResponse( status_code=200, content= { "message" : "training details saved succesfully" } ) return JSONResponse( status_code=500, content= { "message" : "training details cannot be saved" } ) @admin.get("/student/data") async def get_student_data(request: Request): filename = "student_data.xls" return FileResponse( filename, filename="student_data.xls", status_code=200, media_type="application/vnd.ms-excel" ) return admin
true
true
f724734a995b0486052f20cb0dc53813c6e312e3
6,915
py
Python
analysis/views/views_karyomapping.py
SACGF/variantgrid
515195e2f03a0da3a3e5f2919d8e0431babfd9c9
[ "RSA-MD" ]
5
2021-01-14T03:34:42.000Z
2022-03-07T15:34:18.000Z
analysis/views/views_karyomapping.py
SACGF/variantgrid
515195e2f03a0da3a3e5f2919d8e0431babfd9c9
[ "RSA-MD" ]
551
2020-10-19T00:02:38.000Z
2022-03-30T02:18:22.000Z
analysis/views/views_karyomapping.py
SACGF/variantgrid
515195e2f03a0da3a3e5f2919d8e0431babfd9c9
[ "RSA-MD" ]
null
null
null
import csv from collections import defaultdict, OrderedDict from django.core.exceptions import PermissionDenied from django.http.response import StreamingHttpResponse from django.shortcuts import get_object_or_404, render, redirect from django.urls.base import reverse from django.views.decorators.cache import cache_page from django.views.decorators.vary import vary_on_cookie from analysis.forms import KaryomappingGeneForm, UserTrioForm from analysis.models.models_karyomapping import KaryomappingAnalysis, KaryotypeBins, \ KaryomappingGene from library.constants import DAY_SECS from library.django_utils import add_save_message from library.jqgrid_export import StashFile from patients.models_enums import Zygosity from snpdb.models import Trio from snpdb.models.models_variant import Variant def get_karyomapping_analysis_permission_check(request, pk): ka = get_object_or_404(KaryomappingAnalysis, pk=pk) if not request.user.has_perm(KaryomappingAnalysis.get_read_perm(), ka): msg = f"{request.user} does not have permission to access {ka}" raise PermissionDenied(msg) return ka def karyomapping_analyses(request): context = {"trio_form": UserTrioForm()} return render(request, 'analysis/karyomapping/karyomapping_analyses.html', context) def create_and_view_karyomapping_analysis_for_trio(trio, user): karyomapping = KaryomappingAnalysis.objects.create(user=user, name=trio.name, trio=trio) url = reverse("view_karyomapping_analysis", kwargs={"pk": karyomapping.pk}) return redirect(url) def create_karyomapping_analysis_for_trio_id(request, trio_id): trio = Trio.get_for_user(request.user, trio_id) return create_and_view_karyomapping_analysis_for_trio(trio, request.user) def view_karyomapping_analysis(request, pk): karyomapping_analysis = get_karyomapping_analysis_permission_check(request, pk) gene_form = KaryomappingGeneForm(request.POST or None, karyomapping_analysis=karyomapping_analysis, initial={"upstream_kb": 2000, "downstream_kb": 2000}) created_karyomapping_gene = None if request.method == "POST": valid = gene_form.is_valid() if valid: created_karyomapping_gene = gene_form.save() add_save_message(request, valid, "KaryomappingGene") context = {"karyomapping_analysis": karyomapping_analysis, "gene_form": gene_form, "has_write_permission": karyomapping_analysis.can_write(request.user), "created_karyomapping_gene": created_karyomapping_gene} return render(request, 'analysis/karyomapping/view_karyomapping_analysis.html', context) def get_variant_lookup_and_scatter_data(karyomapping_bins): """ Dumped to JS to be used by Plotly scatterplot karyomapping_bins : Have separate entries for ALT/REF, we merge these for output """ variant_id_lookup = {} data = defaultdict(lambda: defaultdict(list)) for karyotype_code, variant_data in karyomapping_bins.items(): x = [] text = [] for variant_id, chrom, position, ref, alt in variant_data: variant_string = Variant.format_tuple(chrom, position, ref, alt) variant_id_lookup[variant_string] = variant_id x.append(position) text.append(variant_string) collapsed_code = KaryotypeBins.COLLAPSED_BINS[karyotype_code] data[collapsed_code]["x"].extend(x) data[collapsed_code]["text"].extend(text) karyotype_bin_counts = OrderedDict() for kc in KaryotypeBins.KARYOTYPE_LABEL_ORDER: karyotype_bin_counts[kc] = len(data[kc]["x"]) return variant_id_lookup, data, karyotype_bin_counts @cache_page(DAY_SECS) # Only caching this for a day due to high amount of development @vary_on_cookie def view_karyomapping_gene(request, pk): karyomapping_gene = get_object_or_404(KaryomappingGene, pk=pk) # Permission check on parent karyomapping_analysis get_karyomapping_analysis_permission_check(request, karyomapping_gene.karyomapping_analysis.pk) iv, strand = karyomapping_gene.get_genomic_interval_and_strand() karyomapping_bins = karyomapping_gene.get_karyomapping_bins() variant_id_lookup, karyotype_bin_scatter_data, karyotype_bin_counts = get_variant_lookup_and_scatter_data(karyomapping_bins) context = {"kag": karyomapping_gene, "iv": iv, "strand": strand, "karyotype_bin_labels": KaryotypeBins.KARYOTYPE_LABEL_ORDER, "karyotype_bin_labels": KaryotypeBins.KARYOTYPE_LABEL_ORDER, # Want order "variant_id_lookup": variant_id_lookup, "karyotype_bin_scatter_data": karyotype_bin_scatter_data, "karyotype_bin_counts": karyotype_bin_counts} return render(request, 'analysis/karyomapping/view_karyomapping_gene.html', context) def download_karyomapping_gene_csv(request, pk): karyomapping_gene = get_object_or_404(KaryomappingGene, pk=pk) # Permission check on parent karyomapping_analysis get_karyomapping_analysis_permission_check(request, karyomapping_gene.karyomapping_analysis.pk) variant_and_genotypes = karyomapping_gene.get_variant_and_genotypes() filename = f"karyomapping_gene_{karyomapping_gene.pk}_{karyomapping_gene}.csv" # TODO: merge code w/library.jqgrid_export.grid_export_csv karotype_bin_lookup = KaryotypeBins.get_karotype_bin_lookup() header = ['chrom', 'position', 'ref', 'alt', 'proband_gt', 'father_gt', 'mother_gt', 'karyotype_bin'] pseudo_buffer = StashFile() writer = csv.DictWriter(pseudo_buffer, header, dialect='excel') def iter_row_writer(): writer.writeheader() yield pseudo_buffer.value for variant_data, genotype_tuple in variant_and_genotypes: _, chrom, position, ref, alt = variant_data proband_gt, father_gt, mother_gt = genotype_tuple try: karotype_bin = karotype_bin_lookup[proband_gt][father_gt][mother_gt] except: karotype_bin = '' row = {'chrom': chrom, 'position': position, 'ref': ref, 'alt': alt, 'proband_gt': Zygosity.get_genotype(proband_gt), 'father_gt': Zygosity.get_genotype(father_gt), 'mother_gt': Zygosity.get_genotype(mother_gt), 'karyotype_bin': karotype_bin} writer.writerow(row) yield pseudo_buffer.value response = StreamingHttpResponse(iter_row_writer(), content_type="text/csv") response['Content-Disposition'] = f'attachment; filename="{filename}"' return response
43.21875
128
0.707881
import csv from collections import defaultdict, OrderedDict from django.core.exceptions import PermissionDenied from django.http.response import StreamingHttpResponse from django.shortcuts import get_object_or_404, render, redirect from django.urls.base import reverse from django.views.decorators.cache import cache_page from django.views.decorators.vary import vary_on_cookie from analysis.forms import KaryomappingGeneForm, UserTrioForm from analysis.models.models_karyomapping import KaryomappingAnalysis, KaryotypeBins, \ KaryomappingGene from library.constants import DAY_SECS from library.django_utils import add_save_message from library.jqgrid_export import StashFile from patients.models_enums import Zygosity from snpdb.models import Trio from snpdb.models.models_variant import Variant def get_karyomapping_analysis_permission_check(request, pk): ka = get_object_or_404(KaryomappingAnalysis, pk=pk) if not request.user.has_perm(KaryomappingAnalysis.get_read_perm(), ka): msg = f"{request.user} does not have permission to access {ka}" raise PermissionDenied(msg) return ka def karyomapping_analyses(request): context = {"trio_form": UserTrioForm()} return render(request, 'analysis/karyomapping/karyomapping_analyses.html', context) def create_and_view_karyomapping_analysis_for_trio(trio, user): karyomapping = KaryomappingAnalysis.objects.create(user=user, name=trio.name, trio=trio) url = reverse("view_karyomapping_analysis", kwargs={"pk": karyomapping.pk}) return redirect(url) def create_karyomapping_analysis_for_trio_id(request, trio_id): trio = Trio.get_for_user(request.user, trio_id) return create_and_view_karyomapping_analysis_for_trio(trio, request.user) def view_karyomapping_analysis(request, pk): karyomapping_analysis = get_karyomapping_analysis_permission_check(request, pk) gene_form = KaryomappingGeneForm(request.POST or None, karyomapping_analysis=karyomapping_analysis, initial={"upstream_kb": 2000, "downstream_kb": 2000}) created_karyomapping_gene = None if request.method == "POST": valid = gene_form.is_valid() if valid: created_karyomapping_gene = gene_form.save() add_save_message(request, valid, "KaryomappingGene") context = {"karyomapping_analysis": karyomapping_analysis, "gene_form": gene_form, "has_write_permission": karyomapping_analysis.can_write(request.user), "created_karyomapping_gene": created_karyomapping_gene} return render(request, 'analysis/karyomapping/view_karyomapping_analysis.html', context) def get_variant_lookup_and_scatter_data(karyomapping_bins): variant_id_lookup = {} data = defaultdict(lambda: defaultdict(list)) for karyotype_code, variant_data in karyomapping_bins.items(): x = [] text = [] for variant_id, chrom, position, ref, alt in variant_data: variant_string = Variant.format_tuple(chrom, position, ref, alt) variant_id_lookup[variant_string] = variant_id x.append(position) text.append(variant_string) collapsed_code = KaryotypeBins.COLLAPSED_BINS[karyotype_code] data[collapsed_code]["x"].extend(x) data[collapsed_code]["text"].extend(text) karyotype_bin_counts = OrderedDict() for kc in KaryotypeBins.KARYOTYPE_LABEL_ORDER: karyotype_bin_counts[kc] = len(data[kc]["x"]) return variant_id_lookup, data, karyotype_bin_counts @cache_page(DAY_SECS) @vary_on_cookie def view_karyomapping_gene(request, pk): karyomapping_gene = get_object_or_404(KaryomappingGene, pk=pk) get_karyomapping_analysis_permission_check(request, karyomapping_gene.karyomapping_analysis.pk) iv, strand = karyomapping_gene.get_genomic_interval_and_strand() karyomapping_bins = karyomapping_gene.get_karyomapping_bins() variant_id_lookup, karyotype_bin_scatter_data, karyotype_bin_counts = get_variant_lookup_and_scatter_data(karyomapping_bins) context = {"kag": karyomapping_gene, "iv": iv, "strand": strand, "karyotype_bin_labels": KaryotypeBins.KARYOTYPE_LABEL_ORDER, "karyotype_bin_labels": KaryotypeBins.KARYOTYPE_LABEL_ORDER, "variant_id_lookup": variant_id_lookup, "karyotype_bin_scatter_data": karyotype_bin_scatter_data, "karyotype_bin_counts": karyotype_bin_counts} return render(request, 'analysis/karyomapping/view_karyomapping_gene.html', context) def download_karyomapping_gene_csv(request, pk): karyomapping_gene = get_object_or_404(KaryomappingGene, pk=pk) get_karyomapping_analysis_permission_check(request, karyomapping_gene.karyomapping_analysis.pk) variant_and_genotypes = karyomapping_gene.get_variant_and_genotypes() filename = f"karyomapping_gene_{karyomapping_gene.pk}_{karyomapping_gene}.csv" karotype_bin_lookup = KaryotypeBins.get_karotype_bin_lookup() header = ['chrom', 'position', 'ref', 'alt', 'proband_gt', 'father_gt', 'mother_gt', 'karyotype_bin'] pseudo_buffer = StashFile() writer = csv.DictWriter(pseudo_buffer, header, dialect='excel') def iter_row_writer(): writer.writeheader() yield pseudo_buffer.value for variant_data, genotype_tuple in variant_and_genotypes: _, chrom, position, ref, alt = variant_data proband_gt, father_gt, mother_gt = genotype_tuple try: karotype_bin = karotype_bin_lookup[proband_gt][father_gt][mother_gt] except: karotype_bin = '' row = {'chrom': chrom, 'position': position, 'ref': ref, 'alt': alt, 'proband_gt': Zygosity.get_genotype(proband_gt), 'father_gt': Zygosity.get_genotype(father_gt), 'mother_gt': Zygosity.get_genotype(mother_gt), 'karyotype_bin': karotype_bin} writer.writerow(row) yield pseudo_buffer.value response = StreamingHttpResponse(iter_row_writer(), content_type="text/csv") response['Content-Disposition'] = f'attachment; filename="{filename}"' return response
true
true
f724736b6941b37c7e6fc68854f6f1512721115e
1,762
py
Python
CondTools/IntegrationTest/python/validate_dt_devdb10_cfg.py
ckamtsikis/cmssw
ea19fe642bb7537cbf58451dcf73aa5fd1b66250
[ "Apache-2.0" ]
852
2015-01-11T21:03:51.000Z
2022-03-25T21:14:00.000Z
CondTools/IntegrationTest/python/validate_dt_devdb10_cfg.py
ckamtsikis/cmssw
ea19fe642bb7537cbf58451dcf73aa5fd1b66250
[ "Apache-2.0" ]
30,371
2015-01-02T00:14:40.000Z
2022-03-31T23:26:05.000Z
CondTools/IntegrationTest/python/validate_dt_devdb10_cfg.py
ckamtsikis/cmssw
ea19fe642bb7537cbf58451dcf73aa5fd1b66250
[ "Apache-2.0" ]
3,240
2015-01-02T05:53:18.000Z
2022-03-31T17:24:21.000Z
# The following comments couldn't be translated into the new config version: # Configuration file for EventSetupTest_t import FWCore.ParameterSet.Config as cms process = cms.Process("TEST") process.PoolDBESSource = cms.ESSource("PoolDBESSource", loadAll = cms.bool(True), toGet = cms.VPSet(cms.PSet( record = cms.string('DTT0Rcd'), tag = cms.string('MTCC_t0') ), cms.PSet( record = cms.string('DTTtrigRcd'), tag = cms.string('MTCC_tTrig') ), cms.PSet( record = cms.string('DTReadOutMappingRcd'), tag = cms.string('MTCC_map') )), messagelevel = cms.untracked.uint32(2), catalog = cms.untracked.string('relationalcatalog_oracle://devdb10/CMS_COND_GENERAL'), ##devdb10/CMS_COND_GENERAL" timetype = cms.string('runnumber'), connect = cms.string('oracle://devdb10/CMS_COND_DT'), ##devdb10/CMS_COND_DT" authenticationMethod = cms.untracked.uint32(1) ) process.source = cms.Source("EmptySource", maxEvents = cms.untracked.int32(5), numberEventsInRun = cms.untracked.uint32(1), firstRun = cms.untracked.uint32(1) ) process.get = cms.EDAnalyzer("EventSetupRecordDataGetter", toGet = cms.VPSet(cms.PSet( record = cms.string('DTT0Rcd'), data = cms.vstring('DTT0') ), cms.PSet( record = cms.string('DTTtrigRcd'), data = cms.vstring('DTTtrig') ), cms.PSet( record = cms.string('DTReadOutMappingRcd'), data = cms.vstring('DTReadOutMapping') )), verbose = cms.untracked.bool(True) ) process.printer = cms.OutputModule("AsciiOutputModule") process.p = cms.Path(process.get) process.ep = cms.EndPath(process.printer)
30.37931
118
0.641317
# Configuration file for EventSetupTest_t import FWCore.ParameterSet.Config as cms process = cms.Process("TEST") process.PoolDBESSource = cms.ESSource("PoolDBESSource", loadAll = cms.bool(True), toGet = cms.VPSet(cms.PSet( record = cms.string('DTT0Rcd'), tag = cms.string('MTCC_t0') ), cms.PSet( record = cms.string('DTTtrigRcd'), tag = cms.string('MTCC_tTrig') ), cms.PSet( record = cms.string('DTReadOutMappingRcd'), tag = cms.string('MTCC_map') )), messagelevel = cms.untracked.uint32(2), catalog = cms.untracked.string('relationalcatalog_oracle://devdb10/CMS_COND_GENERAL'), ##devdb10/CMS_COND_GENERAL" timetype = cms.string('runnumber'), connect = cms.string('oracle://devdb10/CMS_COND_DT'), ##devdb10/CMS_COND_DT" authenticationMethod = cms.untracked.uint32(1) ) process.source = cms.Source("EmptySource", maxEvents = cms.untracked.int32(5), numberEventsInRun = cms.untracked.uint32(1), firstRun = cms.untracked.uint32(1) ) process.get = cms.EDAnalyzer("EventSetupRecordDataGetter", toGet = cms.VPSet(cms.PSet( record = cms.string('DTT0Rcd'), data = cms.vstring('DTT0') ), cms.PSet( record = cms.string('DTTtrigRcd'), data = cms.vstring('DTTtrig') ), cms.PSet( record = cms.string('DTReadOutMappingRcd'), data = cms.vstring('DTReadOutMapping') )), verbose = cms.untracked.bool(True) ) process.printer = cms.OutputModule("AsciiOutputModule") process.p = cms.Path(process.get) process.ep = cms.EndPath(process.printer)
true
true
f724739e7899ac5f3fc808e74a2261f63bf6be67
2,010
py
Python
3_text/apache_log_parser_split.py
lluxury/P_U_S_A
1eb9d1fef74f9ce3618ae950f5223f598510be84
[ "MIT" ]
null
null
null
3_text/apache_log_parser_split.py
lluxury/P_U_S_A
1eb9d1fef74f9ce3618ae950f5223f598510be84
[ "MIT" ]
null
null
null
3_text/apache_log_parser_split.py
lluxury/P_U_S_A
1eb9d1fef74f9ce3618ae950f5223f598510be84
[ "MIT" ]
null
null
null
#!/usr/bin/env python """ USAGE: apache_log_parser_split.py some_log_file This script takes one command line argument: the name of a log file to parse. It then parses the log file and generates a report which associates remote hosts with number of bytes transferred to them. """ import sys def dictify_logline(line): '''return a dictionary of the pertinent pieces of an apache combined log file Currently, the only fields we are interested in are remote host and bytes sent, but we are putting status in there just for good measure. ''' split_line = line.split() return {'remote_host': split_line[0], 'status': split_line[8], 'bytes_sent': split_line[9], } def generate_log_report(logfile): '''return a dictionary of format remote_host=>[list of bytes sent] This function takes a file object, iterates through all the lines in the file, and generates a report of the number of bytes transferred to each remote host for each hit on the webserver. ''' report_dict = {} for line in logfile: line_dict = dictify_logline(line) # print (line_dict) try: bytes_sent = int(line_dict['bytes_sent']) except ValueError: ##totally disregard anything we don't understand continue report_dict.setdefault(line_dict['remote_host'], []).append(bytes_sent) return report_dict if __name__ == "__main__": if not len(sys.argv) > 1: print (__doc__) sys.exit(1) infile_name = sys.argv[1] try: infile = open(infile_name, 'r') except IOError: print ("You must specify a valid file to parse") print (__doc__) sys.exit(1) log_report = generate_log_report(infile) # print (log_report) infile.close() #__main__少量处理, 参数检查,尝试打开文件, 并传给generate_log_report() #generate_log_report()创建字典,迭代日志所有行,并每一行传给dictify_logline() #检查bytes_sent是不整数,利用dictify_logline()返回的数据升级字典,最后字典返回__main__
30.454545
83
0.676617
import sys def dictify_logline(line): split_line = line.split() return {'remote_host': split_line[0], 'status': split_line[8], 'bytes_sent': split_line[9], } def generate_log_report(logfile): report_dict = {} for line in logfile: line_dict = dictify_logline(line) print (line_dict) try: bytes_sent = int(line_dict['bytes_sent']) except ValueError: fault(line_dict['remote_host'], []).append(bytes_sent) return report_dict if __name__ == "__main__": if not len(sys.argv) > 1: print (__doc__) sys.exit(1) infile_name = sys.argv[1] try: infile = open(infile_name, 'r') except IOError: print ("You must specify a valid file to parse") print (__doc__) sys.exit(1) log_report = generate_log_report(infile) # print (log_report) infile.close() #__main__少量处理, 参数检查,尝试打开文件, 并传给generate_log_report() #generate_log_report()创建字典,迭代日志所有行,并每一行传给dictify_logline() #检查bytes_sent是不整数,利用dictify_logline()返回的数据升级字典,最后字典返回__main__
true
true
f724743cde7860172ea7e6028c7280410480dec1
7,225
py
Python
thx_bot/integration_conversations.py
thxprotocol/telegram-bot
d8c77060740f76ed50aab93cb7c6ca83567d1710
[ "Apache-2.0" ]
null
null
null
thx_bot/integration_conversations.py
thxprotocol/telegram-bot
d8c77060740f76ed50aab93cb7c6ca83567d1710
[ "Apache-2.0" ]
null
null
null
thx_bot/integration_conversations.py
thxprotocol/telegram-bot
d8c77060740f76ed50aab93cb7c6ca83567d1710
[ "Apache-2.0" ]
3
2021-10-31T19:20:39.000Z
2021-12-04T03:35:23.000Z
from telegram.ext import CommandHandler from telegram.ext import ConversationHandler from telegram.ext import Filters from telegram.ext import MessageHandler from thx_bot.commands import CHOOSING from thx_bot.commands import CHOOSING_ADD_MEMBER from thx_bot.commands import CHOOSING_REWARDS from thx_bot.commands import CHOOSING_SIGNUP from thx_bot.commands import CHOOSING_TOKENS from thx_bot.commands import CHOOSING_WALLET_UPDATE from thx_bot.commands import TYPING_REPLY from thx_bot.commands import TYPING_REPLY_MEMBER from thx_bot.commands import TYPING_REPLY_SIGNUP from thx_bot.commands import TYPING_REPLY_WALLET_UPDATE from thx_bot.commands import TYPING_REWARD_REPLY from thx_bot.commands import TYPING_TOKENS_REPLY from thx_bot.commands.add_member import start_adding_member from thx_bot.commands.add_member import done_member_add from thx_bot.commands.add_member import received_information_member_add from thx_bot.commands.add_member import regular_choice_member_add from thx_bot.commands.create_wallet import done_signup from thx_bot.commands.create_wallet import received_information_signup from thx_bot.commands.create_wallet import regular_choice_signup from thx_bot.commands.create_wallet import start_creating_wallet from thx_bot.commands.entrance import disable_entrance_checks from thx_bot.commands.entrance import done_permission from thx_bot.commands.entrance import permissions_entrypoint from thx_bot.commands.entrance import received_permission_amount from thx_bot.commands.entrance import regular_choice_permissions from thx_bot.commands.entrance import show_entrance_permision_for_channel from thx_bot.commands.entrance import toggle_users_with_rewards from thx_bot.commands.pool_rewards import done_rewards from thx_bot.commands.pool_rewards import pool_show_rewards_command from thx_bot.commands.pool_rewards import received_information_reward from thx_bot.commands.pool_rewards import regular_choice_reward from thx_bot.commands.pool_rewards import rewards_entrypoint from thx_bot.commands.register_channel import check_connection_channel from thx_bot.commands.register_channel import done_channel from thx_bot.commands.register_channel import received_information_channel from thx_bot.commands.register_channel import regular_choice_channel from thx_bot.commands.register_channel import start_setting_channel from thx_bot.commands.update_wallet import done_wallet_update from thx_bot.commands.update_wallet import received_information_wallet_update from thx_bot.commands.update_wallet import regular_choice_wallet_update from thx_bot.commands.update_wallet import start_updating_wallet register_channel_conversation = ConversationHandler( entry_points=[CommandHandler('register_channel', start_setting_channel)], # noqa states={ # noqa CHOOSING: [ MessageHandler( Filters.regex('^(Client id|Client secret|Pool address)$'), regular_choice_channel ), ], TYPING_REPLY: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_channel, ) ], }, fallbacks=[ # noqa MessageHandler(Filters.regex('^Done$'), done_channel), MessageHandler(Filters.regex('^Test Connection$'), check_connection_channel), ], name="register_channel", persistent=False, ) create_wallet_conversation = ConversationHandler( entry_points=[CommandHandler('create_wallet', start_creating_wallet)], # noqa states={ # noqa CHOOSING_SIGNUP: [ MessageHandler( Filters.regex('^(Email|Password)$'), regular_choice_signup ), ], TYPING_REPLY_SIGNUP: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_signup, ) ], }, fallbacks=[ # noqa MessageHandler(Filters.regex('^Done$'), done_signup), ], # noqa name="create_wallet", persistent=False, ) update_wallet_conversation = ConversationHandler( entry_points=[CommandHandler('update_wallet', start_updating_wallet)], # noqa states={ # noqa CHOOSING_WALLET_UPDATE: [ MessageHandler( Filters.regex('^Wallet Update$'), regular_choice_wallet_update ), ], TYPING_REPLY_WALLET_UPDATE: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_wallet_update, ) ], }, fallbacks=[ # noqa MessageHandler(Filters.regex('^Done$'), done_wallet_update), ], # noqa name="update_wallet", persistent=False, ) rewards_conversation = ConversationHandler( entry_points=[CommandHandler('rewards', rewards_entrypoint)], # noqa states={ # noqa CHOOSING_REWARDS: [ MessageHandler( Filters.regex('^Set Reward$'), regular_choice_reward ), ], TYPING_REWARD_REPLY: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_reward, ) ], }, fallbacks=[ # noqa MessageHandler(Filters.regex('^Done$'), done_rewards), MessageHandler(Filters.regex('^Show rewards$'), pool_show_rewards_command), ], # noqa name="rewards", persistent=False, ) entrance_tokens_conversation = ConversationHandler( entry_points=[CommandHandler('entrance', permissions_entrypoint)], states={ # noqa CHOOSING_TOKENS: [ MessageHandler( Filters.regex('^Set entrance amount$'), regular_choice_permissions ), ], TYPING_TOKENS_REPLY: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_permission_amount, ) ], }, fallbacks=[ # noqa MessageHandler(Filters.regex('^Done$'), done_permission), MessageHandler( Filters.regex('^Show entrance configuration$'), show_entrance_permision_for_channel), MessageHandler( Filters.regex('^Disable entrance checks$'), disable_entrance_checks), MessageHandler( Filters.regex('^Toggle only users with rewards$'), toggle_users_with_rewards), ], # noqa name="entrance", persistent=False, ) add_member_conversation = ConversationHandler( entry_points=[CommandHandler('add_me_to_pool', start_adding_member)], # noqa states={ # noqa CHOOSING_ADD_MEMBER: [ MessageHandler( Filters.regex('^Add your wallet$'), regular_choice_member_add ), ], TYPING_REPLY_MEMBER: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_member_add, ) ], }, fallbacks=[ # noqa MessageHandler(Filters.regex('^Done$'), done_member_add), ], # noqa name="add_member", persistent=False, )
37.827225
97
0.701315
from telegram.ext import CommandHandler from telegram.ext import ConversationHandler from telegram.ext import Filters from telegram.ext import MessageHandler from thx_bot.commands import CHOOSING from thx_bot.commands import CHOOSING_ADD_MEMBER from thx_bot.commands import CHOOSING_REWARDS from thx_bot.commands import CHOOSING_SIGNUP from thx_bot.commands import CHOOSING_TOKENS from thx_bot.commands import CHOOSING_WALLET_UPDATE from thx_bot.commands import TYPING_REPLY from thx_bot.commands import TYPING_REPLY_MEMBER from thx_bot.commands import TYPING_REPLY_SIGNUP from thx_bot.commands import TYPING_REPLY_WALLET_UPDATE from thx_bot.commands import TYPING_REWARD_REPLY from thx_bot.commands import TYPING_TOKENS_REPLY from thx_bot.commands.add_member import start_adding_member from thx_bot.commands.add_member import done_member_add from thx_bot.commands.add_member import received_information_member_add from thx_bot.commands.add_member import regular_choice_member_add from thx_bot.commands.create_wallet import done_signup from thx_bot.commands.create_wallet import received_information_signup from thx_bot.commands.create_wallet import regular_choice_signup from thx_bot.commands.create_wallet import start_creating_wallet from thx_bot.commands.entrance import disable_entrance_checks from thx_bot.commands.entrance import done_permission from thx_bot.commands.entrance import permissions_entrypoint from thx_bot.commands.entrance import received_permission_amount from thx_bot.commands.entrance import regular_choice_permissions from thx_bot.commands.entrance import show_entrance_permision_for_channel from thx_bot.commands.entrance import toggle_users_with_rewards from thx_bot.commands.pool_rewards import done_rewards from thx_bot.commands.pool_rewards import pool_show_rewards_command from thx_bot.commands.pool_rewards import received_information_reward from thx_bot.commands.pool_rewards import regular_choice_reward from thx_bot.commands.pool_rewards import rewards_entrypoint from thx_bot.commands.register_channel import check_connection_channel from thx_bot.commands.register_channel import done_channel from thx_bot.commands.register_channel import received_information_channel from thx_bot.commands.register_channel import regular_choice_channel from thx_bot.commands.register_channel import start_setting_channel from thx_bot.commands.update_wallet import done_wallet_update from thx_bot.commands.update_wallet import received_information_wallet_update from thx_bot.commands.update_wallet import regular_choice_wallet_update from thx_bot.commands.update_wallet import start_updating_wallet register_channel_conversation = ConversationHandler( entry_points=[CommandHandler('register_channel', start_setting_channel)], states={ CHOOSING: [ MessageHandler( Filters.regex('^(Client id|Client secret|Pool address)$'), regular_choice_channel ), ], TYPING_REPLY: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_channel, ) ], }, fallbacks=[ MessageHandler(Filters.regex('^Done$'), done_channel), MessageHandler(Filters.regex('^Test Connection$'), check_connection_channel), ], name="register_channel", persistent=False, ) create_wallet_conversation = ConversationHandler( entry_points=[CommandHandler('create_wallet', start_creating_wallet)], states={ CHOOSING_SIGNUP: [ MessageHandler( Filters.regex('^(Email|Password)$'), regular_choice_signup ), ], TYPING_REPLY_SIGNUP: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_signup, ) ], }, fallbacks=[ MessageHandler(Filters.regex('^Done$'), done_signup), ], name="create_wallet", persistent=False, ) update_wallet_conversation = ConversationHandler( entry_points=[CommandHandler('update_wallet', start_updating_wallet)], states={ CHOOSING_WALLET_UPDATE: [ MessageHandler( Filters.regex('^Wallet Update$'), regular_choice_wallet_update ), ], TYPING_REPLY_WALLET_UPDATE: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_wallet_update, ) ], }, fallbacks=[ MessageHandler(Filters.regex('^Done$'), done_wallet_update), ], name="update_wallet", persistent=False, ) rewards_conversation = ConversationHandler( entry_points=[CommandHandler('rewards', rewards_entrypoint)], states={ CHOOSING_REWARDS: [ MessageHandler( Filters.regex('^Set Reward$'), regular_choice_reward ), ], TYPING_REWARD_REPLY: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_reward, ) ], }, fallbacks=[ MessageHandler(Filters.regex('^Done$'), done_rewards), MessageHandler(Filters.regex('^Show rewards$'), pool_show_rewards_command), ], name="rewards", persistent=False, ) entrance_tokens_conversation = ConversationHandler( entry_points=[CommandHandler('entrance', permissions_entrypoint)], states={ CHOOSING_TOKENS: [ MessageHandler( Filters.regex('^Set entrance amount$'), regular_choice_permissions ), ], TYPING_TOKENS_REPLY: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_permission_amount, ) ], }, fallbacks=[ MessageHandler(Filters.regex('^Done$'), done_permission), MessageHandler( Filters.regex('^Show entrance configuration$'), show_entrance_permision_for_channel), MessageHandler( Filters.regex('^Disable entrance checks$'), disable_entrance_checks), MessageHandler( Filters.regex('^Toggle only users with rewards$'), toggle_users_with_rewards), ], name="entrance", persistent=False, ) add_member_conversation = ConversationHandler( entry_points=[CommandHandler('add_me_to_pool', start_adding_member)], states={ CHOOSING_ADD_MEMBER: [ MessageHandler( Filters.regex('^Add your wallet$'), regular_choice_member_add ), ], TYPING_REPLY_MEMBER: [ MessageHandler( Filters.text & ~(Filters.command | Filters.regex('^Done$')), received_information_member_add, ) ], }, fallbacks=[ MessageHandler(Filters.regex('^Done$'), done_member_add), ], name="add_member", persistent=False, )
true
true
f72474b80565c33b2edda35cd6580c085dbf16da
17,832
py
Python
pybind/nos/v6_0_2c/rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/__init__.py
shivharis/pybind
4e1c6d54b9fd722ccec25546ba2413d79ce337e6
[ "Apache-2.0" ]
null
null
null
pybind/nos/v6_0_2c/rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/__init__.py
shivharis/pybind
4e1c6d54b9fd722ccec25546ba2413d79ce337e6
[ "Apache-2.0" ]
null
null
null
pybind/nos/v6_0_2c/rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/__init__.py
shivharis/pybind
4e1c6d54b9fd722ccec25546ba2413d79ce337e6
[ "Apache-2.0" ]
1
2021-11-05T22:15:42.000Z
2021-11-05T22:15:42.000Z
from operator import attrgetter import pyangbind.lib.xpathhelper as xpathhelper from pyangbind.lib.yangtypes import RestrictedPrecisionDecimalType, RestrictedClassType, TypedListType from pyangbind.lib.yangtypes import YANGBool, YANGListType, YANGDynClass, ReferenceType from pyangbind.lib.base import PybindBase from decimal import Decimal from bitarray import bitarray import __builtin__ import ethernet_interface class update_source(PybindBase): """ This class was auto-generated by the PythonClass plugin for PYANG from YANG module brocade-rbridge - based on the path /rbridge-id/router/router-bgp/router-bgp-attributes/neighbor/peer-grps/neighbor-peer-grp/update-source. Each member element of the container is represented as a class variable - with a specific YANG type. """ __slots__ = ('_pybind_generated_by', '_path_helper', '_yang_name', '_rest_name', '_extmethods', '__sip_ipv4_address','__ethernet_interface','__loopback','__ve_interface',) _yang_name = 'update-source' _rest_name = 'update-source' _pybind_generated_by = 'container' def __init__(self, *args, **kwargs): path_helper_ = kwargs.pop("path_helper", None) if path_helper_ is False: self._path_helper = False elif path_helper_ is not None and isinstance(path_helper_, xpathhelper.YANGPathHelper): self._path_helper = path_helper_ elif hasattr(self, "_parent"): path_helper_ = getattr(self._parent, "_path_helper", False) self._path_helper = path_helper_ else: self._path_helper = False extmethods = kwargs.pop("extmethods", None) if extmethods is False: self._extmethods = False elif extmethods is not None and isinstance(extmethods, dict): self._extmethods = extmethods elif hasattr(self, "_parent"): extmethods = getattr(self._parent, "_extmethods", None) self._extmethods = extmethods else: self._extmethods = False self.__ve_interface = YANGDynClass(base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True) self.__sip_ipv4_address = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True) self.__loopback = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True) self.__ethernet_interface = YANGDynClass(base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True) load = kwargs.pop("load", None) if args: if len(args) > 1: raise TypeError("cannot create a YANG container with >1 argument") all_attr = True for e in self._pyangbind_elements: if not hasattr(args[0], e): all_attr = False break if not all_attr: raise ValueError("Supplied object did not have the correct attributes") for e in self._pyangbind_elements: nobj = getattr(args[0], e) if nobj._changed() is False: continue setmethod = getattr(self, "_set_%s" % e) if load is None: setmethod(getattr(args[0], e)) else: setmethod(getattr(args[0], e), load=load) def _path(self): if hasattr(self, "_parent"): return self._parent._path()+[self._yang_name] else: return [u'rbridge-id', u'router', u'router-bgp', u'router-bgp-attributes', u'neighbor', u'peer-grps', u'neighbor-peer-grp', u'update-source'] def _rest_path(self): if hasattr(self, "_parent"): if self._rest_name: return self._parent._rest_path()+[self._rest_name] else: return self._parent._rest_path() else: return [u'rbridge-id', u'router', u'bgp', u'neighbor', u'neighbor-peer-grp', u'update-source'] def _get_sip_ipv4_address(self): """ Getter method for sip_ipv4_address, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/sip_ipv4_address (sip-ipv4-address) """ return self.__sip_ipv4_address def _set_sip_ipv4_address(self, v, load=False): """ Setter method for sip_ipv4_address, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/sip_ipv4_address (sip-ipv4-address) If this variable is read-only (config: false) in the source YANG file, then _set_sip_ipv4_address is considered as a private method. Backends looking to populate this variable should do so via calling thisObj._set_sip_ipv4_address() directly. """ if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """sip_ipv4_address must be of a type compatible with sip-ipv4-address""", 'defined-type': "brocade-bgp:sip-ipv4-address", 'generated-type': """YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True)""", }) self.__sip_ipv4_address = t if hasattr(self, '_set'): self._set() def _unset_sip_ipv4_address(self): self.__sip_ipv4_address = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True) def _get_ethernet_interface(self): """ Getter method for ethernet_interface, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/ethernet_interface (container) """ return self.__ethernet_interface def _set_ethernet_interface(self, v, load=False): """ Setter method for ethernet_interface, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/ethernet_interface (container) If this variable is read-only (config: false) in the source YANG file, then _set_ethernet_interface is considered as a private method. Backends looking to populate this variable should do so via calling thisObj._set_ethernet_interface() directly. """ if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """ethernet_interface must be of a type compatible with container""", 'defined-type': "container", 'generated-type': """YANGDynClass(base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True)""", }) self.__ethernet_interface = t if hasattr(self, '_set'): self._set() def _unset_ethernet_interface(self): self.__ethernet_interface = YANGDynClass(base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True) def _get_loopback(self): """ Getter method for loopback, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/loopback (loopback-interface) """ return self.__loopback def _set_loopback(self, v, load=False): """ Setter method for loopback, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/loopback (loopback-interface) If this variable is read-only (config: false) in the source YANG file, then _set_loopback is considered as a private method. Backends looking to populate this variable should do so via calling thisObj._set_loopback() directly. """ if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """loopback must be of a type compatible with loopback-interface""", 'defined-type': "brocade-bgp:loopback-interface", 'generated-type': """YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True)""", }) self.__loopback = t if hasattr(self, '_set'): self._set() def _unset_loopback(self): self.__loopback = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True) def _get_ve_interface(self): """ Getter method for ve_interface, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/ve_interface (interface:ve-type) """ return self.__ve_interface def _set_ve_interface(self, v, load=False): """ Setter method for ve_interface, mapped from YANG variable /rbridge_id/router/router_bgp/router_bgp_attributes/neighbor/peer_grps/neighbor_peer_grp/update_source/ve_interface (interface:ve-type) If this variable is read-only (config: false) in the source YANG file, then _set_ve_interface is considered as a private method. Backends looking to populate this variable should do so via calling thisObj._set_ve_interface() directly. """ if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """ve_interface must be of a type compatible with interface:ve-type""", 'defined-type': "interface:ve-type", 'generated-type': """YANGDynClass(base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True)""", }) self.__ve_interface = t if hasattr(self, '_set'): self._set() def _unset_ve_interface(self): self.__ve_interface = YANGDynClass(base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True) sip_ipv4_address = __builtin__.property(_get_sip_ipv4_address, _set_sip_ipv4_address) ethernet_interface = __builtin__.property(_get_ethernet_interface, _set_ethernet_interface) loopback = __builtin__.property(_get_loopback, _set_loopback) ve_interface = __builtin__.property(_get_ve_interface, _set_ve_interface) __choices__ = {u'ch-update-source': {u'ca-eth': [u'ethernet_interface'], u'ca-ve': [u've_interface'], u'ca-ipv4': [u'sip_ipv4_address'], u'ca-loopback': [u'loopback']}} _pyangbind_elements = {'sip_ipv4_address': sip_ipv4_address, 'ethernet_interface': ethernet_interface, 'loopback': loopback, 've_interface': ve_interface, }
77.868996
648
0.730316
from operator import attrgetter import pyangbind.lib.xpathhelper as xpathhelper from pyangbind.lib.yangtypes import RestrictedPrecisionDecimalType, RestrictedClassType, TypedListType from pyangbind.lib.yangtypes import YANGBool, YANGListType, YANGDynClass, ReferenceType from pyangbind.lib.base import PybindBase from decimal import Decimal from bitarray import bitarray import __builtin__ import ethernet_interface class update_source(PybindBase): __slots__ = ('_pybind_generated_by', '_path_helper', '_yang_name', '_rest_name', '_extmethods', '__sip_ipv4_address','__ethernet_interface','__loopback','__ve_interface',) _yang_name = 'update-source' _rest_name = 'update-source' _pybind_generated_by = 'container' def __init__(self, *args, **kwargs): path_helper_ = kwargs.pop("path_helper", None) if path_helper_ is False: self._path_helper = False elif path_helper_ is not None and isinstance(path_helper_, xpathhelper.YANGPathHelper): self._path_helper = path_helper_ elif hasattr(self, "_parent"): path_helper_ = getattr(self._parent, "_path_helper", False) self._path_helper = path_helper_ else: self._path_helper = False extmethods = kwargs.pop("extmethods", None) if extmethods is False: self._extmethods = False elif extmethods is not None and isinstance(extmethods, dict): self._extmethods = extmethods elif hasattr(self, "_parent"): extmethods = getattr(self._parent, "_extmethods", None) self._extmethods = extmethods else: self._extmethods = False self.__ve_interface = YANGDynClass(base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True) self.__sip_ipv4_address = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True) self.__loopback = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True) self.__ethernet_interface = YANGDynClass(base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True) load = kwargs.pop("load", None) if args: if len(args) > 1: raise TypeError("cannot create a YANG container with >1 argument") all_attr = True for e in self._pyangbind_elements: if not hasattr(args[0], e): all_attr = False break if not all_attr: raise ValueError("Supplied object did not have the correct attributes") for e in self._pyangbind_elements: nobj = getattr(args[0], e) if nobj._changed() is False: continue setmethod = getattr(self, "_set_%s" % e) if load is None: setmethod(getattr(args[0], e)) else: setmethod(getattr(args[0], e), load=load) def _path(self): if hasattr(self, "_parent"): return self._parent._path()+[self._yang_name] else: return [u'rbridge-id', u'router', u'router-bgp', u'router-bgp-attributes', u'neighbor', u'peer-grps', u'neighbor-peer-grp', u'update-source'] def _rest_path(self): if hasattr(self, "_parent"): if self._rest_name: return self._parent._rest_path()+[self._rest_name] else: return self._parent._rest_path() else: return [u'rbridge-id', u'router', u'bgp', u'neighbor', u'neighbor-peer-grp', u'update-source'] def _get_sip_ipv4_address(self): return self.__sip_ipv4_address def _set_sip_ipv4_address(self, v, load=False): if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """sip_ipv4_address must be of a type compatible with sip-ipv4-address""", 'defined-type': "brocade-bgp:sip-ipv4-address", 'generated-type': """YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True)""", }) self.__sip_ipv4_address = t if hasattr(self, '_set'): self._set() def _unset_sip_ipv4_address(self): self.__sip_ipv4_address = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'pattern': u'(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\\.){3}([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])(%[\\p{N}\\p{L}]+)?'}), is_leaf=True, yang_name="sip-ipv4-address", rest_name="sip-ipv4-address", parent=self, choice=(u'ch-update-source', u'ca-ipv4'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-drop-node-name': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='sip-ipv4-address', is_config=True) def _get_ethernet_interface(self): return self.__ethernet_interface def _set_ethernet_interface(self, v, load=False): if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """ethernet_interface must be of a type compatible with container""", 'defined-type': "container", 'generated-type': """YANGDynClass(base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True)""", }) self.__ethernet_interface = t if hasattr(self, '_set'): self._set() def _unset_ethernet_interface(self): self.__ethernet_interface = YANGDynClass(base=ethernet_interface.ethernet_interface, is_container='container', presence=False, yang_name="ethernet-interface", rest_name="", parent=self, choice=(u'ch-update-source', u'ca-eth'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'cli-compact-syntax': None, u'cli-drop-node-name': None, u'cli-sequence-commands': None}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='container', is_config=True) def _get_loopback(self): return self.__loopback def _set_loopback(self, v, load=False): if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """loopback must be of a type compatible with loopback-interface""", 'defined-type': "brocade-bgp:loopback-interface", 'generated-type': """YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True)""", }) self.__loopback = t if hasattr(self, '_set'): self._set() def _unset_loopback(self): self.__loopback = YANGDynClass(base=RestrictedClassType(base_type=unicode, restriction_dict={'length': [u'1..63']}), is_leaf=True, yang_name="loopback", rest_name="loopback", parent=self, choice=(u'ch-update-source', u'ca-loopback'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Loopback Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='loopback-interface', is_config=True) def _get_ve_interface(self): return self.__ve_interface def _set_ve_interface(self, v, load=False): if hasattr(v, "_utype"): v = v._utype(v) try: t = YANGDynClass(v,base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True) except (TypeError, ValueError): raise ValueError({ 'error-string': """ve_interface must be of a type compatible with interface:ve-type""", 'defined-type': "interface:ve-type", 'generated-type': """YANGDynClass(base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True)""", }) self.__ve_interface = t if hasattr(self, '_set'): self._set() def _unset_ve_interface(self): self.__ve_interface = YANGDynClass(base=RestrictedClassType(base_type=RestrictedClassType(base_type=long, restriction_dict={'range': ['0..4294967295']}, int_size=32), restriction_dict={'range': [u'1..8191']}), is_leaf=True, yang_name="ve-interface", rest_name="ve-interface", parent=self, choice=(u'ch-update-source', u'ca-ve'), path_helper=self._path_helper, extmethods=self._extmethods, register_paths=True, extensions={u'tailf-common': {u'info': u'Virtual Interface'}}, namespace='urn:brocade.com:mgmt:brocade-bgp', defining_module='brocade-bgp', yang_type='interface:ve-type', is_config=True) sip_ipv4_address = __builtin__.property(_get_sip_ipv4_address, _set_sip_ipv4_address) ethernet_interface = __builtin__.property(_get_ethernet_interface, _set_ethernet_interface) loopback = __builtin__.property(_get_loopback, _set_loopback) ve_interface = __builtin__.property(_get_ve_interface, _set_ve_interface) __choices__ = {u'ch-update-source': {u'ca-eth': [u'ethernet_interface'], u'ca-ve': [u've_interface'], u'ca-ipv4': [u'sip_ipv4_address'], u'ca-loopback': [u'loopback']}} _pyangbind_elements = {'sip_ipv4_address': sip_ipv4_address, 'ethernet_interface': ethernet_interface, 'loopback': loopback, 've_interface': ve_interface, }
true
true
f7247582fc6b8d543be8129bb89d210bd8e927bf
7,404
py
Python
experiments/runtime/plot_runtime.py
patriotemeritus/LO-PHI
8f92c4efb94061cb08b7e9b0ff96346565c12653
[ "BSD-3-Clause" ]
28
2016-02-26T00:54:16.000Z
2022-02-24T12:21:15.000Z
experiments/runtime/plot_runtime.py
patriotemeritus/LO-PHI
8f92c4efb94061cb08b7e9b0ff96346565c12653
[ "BSD-3-Clause" ]
2
2016-03-15T21:49:09.000Z
2016-07-12T22:11:39.000Z
experiments/runtime/plot_runtime.py
patriotemeritus/LO-PHI
8f92c4efb94061cb08b7e9b0ff96346565c12653
[ "BSD-3-Clause" ]
9
2016-06-08T14:42:28.000Z
2021-11-11T03:51:34.000Z
""" Make a "broken" horizontal bar plot, i.e. one with gaps, of run times. (c) 2015 Massachusetts Institute of Technology """ import numpy import pprint import matplotlib matplotlib.use('GTKAgg') import matplotlib.pyplot as plt label_fontsize = 11 labels = ['Disk Reset', # 'Power On', 'OS Boot', 'OS Stabilize', 'Key Presses', 'Mem. (Clean)', 'Compress (Clean)', # 'Start Capture', 'Buttons (Clean)', 'Run Binary', 'Mem. (Interim)', 'Screenshot (Interim)', 'Buttons (Click)', 'Extra Sleep', 'Mem. (Dirty)', 'Screenshot (Final)', 'Compress (Dirty)', 'Shutdown', 'Store Results', 'wtf', 'wtf', 'wtf', 'wtf'] mal_executed_index = 7 flip_text = [6] def normalize_tuples(tuples): start = tuples[0][0] rtn_list = [] for tuple in tuples: start_x = tuple[0]-start x_len = tuple[1]-tuple[0] rtn_list.append((start_x, x_len)) return rtn_list # Get our virtual data virtual_tuples = [(1439831168.838292, 1439831169.377921), (1439831169.377968, 1439831190.231804), (1439831190.231869, 1439831250.232374), (1439831250.236563, 1439831287.317039), (1439831287.317097, 1439831309.774347), (1439831310.612543, 1439831402.00221), # Updated manually (1439831311.01773, 1439831319.4211), (1439831319.929066, 1439831379.980296), (1439831379.98037, 1439831403.835613), (1439831403.835616, 1439831404.160049), (1439831404.160206, 1439831412.36363), (1439831412.367247, 1439831499.982088), (1439831499.98215, 1439831522.069226), (1439831522.069228, 1439831522.378756), (1439831522.378882, 1439831622.912597), (1439831622.912614, 1439831628.073827), (1439831628.108982, 1439831661.06076)] virtual_tuples = normalize_tuples(virtual_tuples) pprint.pprint(virtual_tuples) # Get our physical data physical_tuples = [(1439830680.396736, 1439831070.997367), (1439831070.997433, 1439831114.95812), (1439831114.958218, 1439831175.002975), (1439831175.007641, 1439831216.18251), (1439831216.182679, 1439831305.710553), (1439831306.717004, 1439831454.234577), # Updated manually (1439831307.13812, 1439831317.108357), (1439831318.016684, 1439831378.074144), (1439831378.074319, 1439831455.997746), (1439831455.997755, 1439831460.148652), (1439831460.148693, 1439831475.965947), (1439831475.972392, 1439831498.053105), (1439831498.053454, 1439831589.70029), (1439831589.700302, 1439831594.548414), (1439831594.548729, 1439831744.423983), (1439831744.424003, 1439831772.876672), (1439831773.100489, 1439831795.210495)] physical_tuples = normalize_tuples(physical_tuples) pprint.pprint(physical_tuples) # physical_tuples = virtual_tuples fig, (ax1, ax2) = plt.subplots(2) y_val = len(virtual_tuples) for idx in range(len(virtual_tuples)): ax1.broken_barh([ physical_tuples[idx] ] , (y_val, 1), facecolors='grey') ax2.broken_barh([ virtual_tuples[idx] ] , (y_val, 1), facecolors='grey') print virtual_tuples[idx] if idx == mal_executed_index: ax1.annotate('Binary Executed', (physical_tuples[idx][0], y_val+.5), xytext=(physical_tuples[idx][0]-500, y_val-2), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) ax2.annotate('Binary Executed', (virtual_tuples[idx][0], y_val+.5), xytext=(virtual_tuples[idx][0]-125, y_val-2), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) elif idx in flip_text: annotate_x = physical_tuples[idx][0] ax1.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x-300, y_val+.5), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) annotate_x = virtual_tuples[idx][0] ax2.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x-125, y_val+1), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) else: annotate_x = physical_tuples[idx][1] + physical_tuples[idx][0] ax1.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x+20, y_val+1), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) annotate_x = virtual_tuples[idx][1] + virtual_tuples[idx][0] ax2.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x+20, y_val+1), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) y_val -= 1 idx += 1 # ax1.set_xlabel('Seconds Elapsed') ax1.set_ylabel('Physical Analysis', fontsize=20) ax2.set_ylabel('Virtual Analysis', fontsize=20) max_x_virt = virtual_tuples[-1][0]+virtual_tuples[-1][1] max_x_phy = physical_tuples[-1][0]+physical_tuples[-1][1] ax1.set_ylim([1,len(virtual_tuples)+1]) ax2.set_ylim([1,len(virtual_tuples)+1]) ax2.set_xlabel('Time Elapsed (Minutes)', fontsize=20) yticks = numpy.arange(len(physical_tuples))+1.5 # Remove top and right border ax1.spines['right'].set_visible(False) ax1.spines['top'].set_visible(False) ax2.spines['right'].set_visible(False) ax2.spines['top'].set_visible(False) # ax1.set_yticks(yticks) # ax1.set_yticklabels(['']*len(virtual_tuples)) # # # ax2.set_yticks(yticks) # ax2.set_yticklabels(['']*len(virtual_tuples)) ax1.set_yticks([]) ax2.set_yticks([]) # labels_reversed = [] # for x in reversed(labels): # labels_reversed.append(x) # ax2.set_yticklabels([''] + labels_reversed) ax2.grid(True) ax1.grid(True) ax1.set_xticks(range(0,int(max_x_phy*1.2),120)) ax1.set_xticklabels(range(0,200,2)) ax2.set_xticks(range(0,int(max_x_virt*1.2),60)) ax2.set_xticklabels(range(0,200,1)) ax1.set_xlim([0,max_x_phy*1.2]) ax2.set_xlim([0,max_x_virt*1.2]) for tick in ax1.xaxis.get_major_ticks(): tick.label.set_fontsize(15) for tick in ax1.yaxis.get_major_ticks(): tick.label.set_fontsize(15) for tick in ax2.xaxis.get_major_ticks(): tick.label.set_fontsize(15) for tick in ax2.yaxis.get_major_ticks(): tick.label.set_fontsize(15) # ax.annotate('race interrupted', (61, 25), # xytext=(0.8, 0.9), textcoords='axes fraction', # arrowprops=dict(facecolor='black', shrink=0.05), # fontsize=16, # horizontalalignment='right', verticalalignment='top') plt.tight_layout() plt.savefig("runtime.eps", format='eps', dpi=1000) # plt.show()
35.596154
450
0.595354
""" Make a "broken" horizontal bar plot, i.e. one with gaps, of run times. (c) 2015 Massachusetts Institute of Technology """ import numpy import pprint import matplotlib matplotlib.use('GTKAgg') import matplotlib.pyplot as plt label_fontsize = 11 labels = ['Disk Reset', 'OS Boot', 'OS Stabilize', 'Key Presses', 'Mem. (Clean)', 'Compress (Clean)', 'Buttons (Clean)', 'Run Binary', 'Mem. (Interim)', 'Screenshot (Interim)', 'Buttons (Click)', 'Extra Sleep', 'Mem. (Dirty)', 'Screenshot (Final)', 'Compress (Dirty)', 'Shutdown', 'Store Results', 'wtf', 'wtf', 'wtf', 'wtf'] mal_executed_index = 7 flip_text = [6] def normalize_tuples(tuples): start = tuples[0][0] rtn_list = [] for tuple in tuples: start_x = tuple[0]-start x_len = tuple[1]-tuple[0] rtn_list.append((start_x, x_len)) return rtn_list virtual_tuples = [(1439831168.838292, 1439831169.377921), (1439831169.377968, 1439831190.231804), (1439831190.231869, 1439831250.232374), (1439831250.236563, 1439831287.317039), (1439831287.317097, 1439831309.774347), (1439831310.612543, 1439831402.00221), (1439831311.01773, 1439831319.4211), (1439831319.929066, 1439831379.980296), (1439831379.98037, 1439831403.835613), (1439831403.835616, 1439831404.160049), (1439831404.160206, 1439831412.36363), (1439831412.367247, 1439831499.982088), (1439831499.98215, 1439831522.069226), (1439831522.069228, 1439831522.378756), (1439831522.378882, 1439831622.912597), (1439831622.912614, 1439831628.073827), (1439831628.108982, 1439831661.06076)] virtual_tuples = normalize_tuples(virtual_tuples) pprint.pprint(virtual_tuples) physical_tuples = [(1439830680.396736, 1439831070.997367), (1439831070.997433, 1439831114.95812), (1439831114.958218, 1439831175.002975), (1439831175.007641, 1439831216.18251), (1439831216.182679, 1439831305.710553), (1439831306.717004, 1439831454.234577), (1439831307.13812, 1439831317.108357), (1439831318.016684, 1439831378.074144), (1439831378.074319, 1439831455.997746), (1439831455.997755, 1439831460.148652), (1439831460.148693, 1439831475.965947), (1439831475.972392, 1439831498.053105), (1439831498.053454, 1439831589.70029), (1439831589.700302, 1439831594.548414), (1439831594.548729, 1439831744.423983), (1439831744.424003, 1439831772.876672), (1439831773.100489, 1439831795.210495)] physical_tuples = normalize_tuples(physical_tuples) pprint.pprint(physical_tuples) fig, (ax1, ax2) = plt.subplots(2) y_val = len(virtual_tuples) for idx in range(len(virtual_tuples)): ax1.broken_barh([ physical_tuples[idx] ] , (y_val, 1), facecolors='grey') ax2.broken_barh([ virtual_tuples[idx] ] , (y_val, 1), facecolors='grey') print virtual_tuples[idx] if idx == mal_executed_index: ax1.annotate('Binary Executed', (physical_tuples[idx][0], y_val+.5), xytext=(physical_tuples[idx][0]-500, y_val-2), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) ax2.annotate('Binary Executed', (virtual_tuples[idx][0], y_val+.5), xytext=(virtual_tuples[idx][0]-125, y_val-2), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) elif idx in flip_text: annotate_x = physical_tuples[idx][0] ax1.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x-300, y_val+.5), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) annotate_x = virtual_tuples[idx][0] ax2.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x-125, y_val+1), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) else: annotate_x = physical_tuples[idx][1] + physical_tuples[idx][0] ax1.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x+20, y_val+1), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) annotate_x = virtual_tuples[idx][1] + virtual_tuples[idx][0] ax2.annotate(labels[idx], (annotate_x, y_val+.5), xytext=(annotate_x+20, y_val+1), arrowprops=dict(facecolor='black', arrowstyle="->"), fontsize=label_fontsize) y_val -= 1 idx += 1 ax1.set_ylabel('Physical Analysis', fontsize=20) ax2.set_ylabel('Virtual Analysis', fontsize=20) max_x_virt = virtual_tuples[-1][0]+virtual_tuples[-1][1] max_x_phy = physical_tuples[-1][0]+physical_tuples[-1][1] ax1.set_ylim([1,len(virtual_tuples)+1]) ax2.set_ylim([1,len(virtual_tuples)+1]) ax2.set_xlabel('Time Elapsed (Minutes)', fontsize=20) yticks = numpy.arange(len(physical_tuples))+1.5 ax1.spines['right'].set_visible(False) ax1.spines['top'].set_visible(False) ax2.spines['right'].set_visible(False) ax2.spines['top'].set_visible(False) ax1.set_yticks([]) ax2.set_yticks([]) ax2.grid(True) ax1.grid(True) ax1.set_xticks(range(0,int(max_x_phy*1.2),120)) ax1.set_xticklabels(range(0,200,2)) ax2.set_xticks(range(0,int(max_x_virt*1.2),60)) ax2.set_xticklabels(range(0,200,1)) ax1.set_xlim([0,max_x_phy*1.2]) ax2.set_xlim([0,max_x_virt*1.2]) for tick in ax1.xaxis.get_major_ticks(): tick.label.set_fontsize(15) for tick in ax1.yaxis.get_major_ticks(): tick.label.set_fontsize(15) for tick in ax2.xaxis.get_major_ticks(): tick.label.set_fontsize(15) for tick in ax2.yaxis.get_major_ticks(): tick.label.set_fontsize(15) plt.tight_layout() plt.savefig("runtime.eps", format='eps', dpi=1000)
false
true
f72475dc8fb021a442a84a5e411f00ab6c251ab0
1,015
py
Python
mud.py
nparry0/mud
ec520795e2206d5e885c343c13e3ead5d2787cd5
[ "MIT" ]
2
2018-03-15T06:00:18.000Z
2018-03-22T03:19:38.000Z
mud.py
nparry0/mud
ec520795e2206d5e885c343c13e3ead5d2787cd5
[ "MIT" ]
null
null
null
mud.py
nparry0/mud
ec520795e2206d5e885c343c13e3ead5d2787cd5
[ "MIT" ]
null
null
null
import gevent.server from mud_telnet_handler import MudTelnetHandler from game_server import GameServer import argparse import logging # Set up logging log = logging.getLogger() handler = logging.StreamHandler() formatter = logging.Formatter('[%(asctime)s] [%(levelname)s] %(message)s') handler.setFormatter(formatter) log.addHandler(handler) log.setLevel(logging.DEBUG) parser = argparse.ArgumentParser() parser.add_argument("--playerdir", type=str, default="./players", help="Directory where all player data is kept.") parser.add_argument("--map", type=str, default="mud.map", help="Map file") parser.add_argument("--port", type=int, default=3000, help="Listening port.") args = parser.parse_args() log.info("Mud starting. Params: %s" % args) # Set up some class vars of MudTelnetHandler MudTelnetHandler.player_dir = args.playerdir + "/" MudTelnetHandler.game_server = GameServer(args.map) server = gevent.server.StreamServer(("", args.port), MudTelnetHandler.streamserver_handle) server.serve_forever()
32.741935
114
0.770443
import gevent.server from mud_telnet_handler import MudTelnetHandler from game_server import GameServer import argparse import logging log = logging.getLogger() handler = logging.StreamHandler() formatter = logging.Formatter('[%(asctime)s] [%(levelname)s] %(message)s') handler.setFormatter(formatter) log.addHandler(handler) log.setLevel(logging.DEBUG) parser = argparse.ArgumentParser() parser.add_argument("--playerdir", type=str, default="./players", help="Directory where all player data is kept.") parser.add_argument("--map", type=str, default="mud.map", help="Map file") parser.add_argument("--port", type=int, default=3000, help="Listening port.") args = parser.parse_args() log.info("Mud starting. Params: %s" % args) MudTelnetHandler.player_dir = args.playerdir + "/" MudTelnetHandler.game_server = GameServer(args.map) server = gevent.server.StreamServer(("", args.port), MudTelnetHandler.streamserver_handle) server.serve_forever()
true
true
f724762d197c2f0292cdab0ed9ca4350acb293d2
37,046
py
Python
allauth/account/tests.py
pkyad/django-allauth
1ffd9c2c4a121b9cdcb5814209933ce74d4303c5
[ "MIT" ]
null
null
null
allauth/account/tests.py
pkyad/django-allauth
1ffd9c2c4a121b9cdcb5814209933ce74d4303c5
[ "MIT" ]
null
null
null
allauth/account/tests.py
pkyad/django-allauth
1ffd9c2c4a121b9cdcb5814209933ce74d4303c5
[ "MIT" ]
null
null
null
from __future__ import absolute_import import json from datetime import timedelta import django from django.utils.timezone import now from django.test.utils import override_settings from django.conf import settings from django.core.urlresolvers import reverse from django.test.client import Client from django.core import mail from django.test.client import RequestFactory from django.contrib.auth.models import AnonymousUser, AbstractUser from django.db import models import unittest from allauth.tests import TestCase, patch from allauth.account.forms import BaseSignupForm from allauth.account.models import ( EmailAddress, EmailConfirmation, EmailConfirmationHMAC) from allauth.utils import ( get_current_site, get_user_model, get_username_max_length) from . import app_settings from .auth_backends import AuthenticationBackend from .adapter import get_adapter from .utils import url_str_to_user_pk, user_pk_to_url_str import uuid @override_settings( ACCOUNT_DEFAULT_HTTP_PROTOCOL='https', ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod.MANDATORY, ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.USERNAME, ACCOUNT_SIGNUP_FORM_CLASS=None, ACCOUNT_EMAIL_SUBJECT_PREFIX=None, LOGIN_REDIRECT_URL='/accounts/profile/', ACCOUNT_ADAPTER='allauth.account.adapter.DefaultAccountAdapter', ACCOUNT_USERNAME_REQUIRED=True) class AccountTests(TestCase): def setUp(self): if 'allauth.socialaccount' in settings.INSTALLED_APPS: # Otherwise ImproperlyConfigured exceptions may occur from ..socialaccount.models import SocialApp sa = SocialApp.objects.create(name='testfb', provider='facebook') sa.sites.add(get_current_site()) @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod .USERNAME_EMAIL) def test_username_containing_at(self): user = get_user_model().objects.create(username='@raymond.penners') user.set_password('psst') user.save() EmailAddress.objects.create(user=user, email='raymond.penners@gmail.com', primary=True, verified=True) resp = self.client.post(reverse('account_login'), {'login': '@raymond.penners', 'password': 'psst'}) self.assertRedirects(resp, 'http://testserver'+settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) def test_signup_same_email_verified_externally(self): user = self._test_signup_email_verified_externally('john@doe.com', 'john@doe.com') self.assertEqual(EmailAddress.objects.filter(user=user).count(), 1) EmailAddress.objects.get(verified=True, email='john@doe.com', user=user, primary=True) def test_signup_other_email_verified_externally(self): """ John is invited on john@work.com, but signs up via john@home.com. E-mail verification is by-passed, their home e-mail address is used as a secondary. """ user = self._test_signup_email_verified_externally('john@home.com', 'john@work.com') self.assertEqual(EmailAddress.objects.filter(user=user).count(), 2) EmailAddress.objects.get(verified=False, email='john@home.com', user=user, primary=False) EmailAddress.objects.get(verified=True, email='john@work.com', user=user, primary=True) def _test_signup_email_verified_externally(self, signup_email, verified_email): username = 'johndoe' request = RequestFactory().post(reverse('account_signup'), {'username': username, 'email': signup_email, 'password1': 'johndoe', 'password2': 'johndoe'}) # Fake stash_verified_email from django.contrib.messages.middleware import MessageMiddleware from django.contrib.sessions.middleware import SessionMiddleware SessionMiddleware().process_request(request) MessageMiddleware().process_request(request) request.user = AnonymousUser() request.session['account_verified_email'] = verified_email from .views import signup resp = signup(request) self.assertEqual(resp.status_code, 302) self.assertEqual(resp['location'], get_adapter().get_login_redirect_url(request)) self.assertEqual(len(mail.outbox), 0) return get_user_model().objects.get(username=username) @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_SIGNUP_EMAIL_ENTER_TWICE=True) def test_signup_email_twice(self): request = RequestFactory().post(reverse('account_signup'), {'username': 'johndoe', 'email1': 'john@work.com', 'email2': 'john@work.com', 'password1': 'johndoe', 'password2': 'johndoe'}) from django.contrib.messages.middleware import MessageMiddleware from django.contrib.sessions.middleware import SessionMiddleware SessionMiddleware().process_request(request) MessageMiddleware().process_request(request) request.user = AnonymousUser() from .views import signup signup(request) user = get_user_model().objects.get(username='johndoe') self.assertEqual(user.email, 'john@work.com') def _create_user(self): user = get_user_model().objects.create(username='john', is_active=True) user.set_password('doe') user.save() return user def _create_user_and_login(self): user = self._create_user() self.client.login(username='john', password='doe') return user def test_redirect_when_authenticated(self): self._create_user_and_login() c = self.client resp = c.get(reverse('account_login')) self.assertRedirects(resp, 'http://testserver/accounts/profile/', fetch_redirect_response=False) def test_password_reset_get(self): resp = self.client.get(reverse('account_reset_password')) self.assertTemplateUsed(resp, 'account/password_reset.html') def test_password_set_redirect(self): resp = self._password_set_or_reset_redirect('account_set_password', True) self.assertEqual(resp.status_code, 302) def test_password_reset_no_redirect(self): resp = self._password_set_or_reset_redirect('account_change_password', True) self.assertEqual(resp.status_code, 200) def test_password_set_no_redirect(self): resp = self._password_set_or_reset_redirect('account_set_password', False) self.assertEqual(resp.status_code, 200) def test_password_reset_redirect(self): resp = self._password_set_or_reset_redirect('account_change_password', False) self.assertEqual(resp.status_code, 302) def _password_set_or_reset_redirect(self, urlname, usable_password): user = self._create_user_and_login() c = self.client if not usable_password: user.set_unusable_password() user.save() resp = c.get(reverse(urlname)) return resp def test_password_forgotten_username_hint(self): user = self._request_new_password() body = mail.outbox[0].body assert user.username in body @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.EMAIL) def test_password_forgotten_no_username_hint(self): user = self._request_new_password() body = mail.outbox[0].body assert user.username not in body def _request_new_password(self): user = get_user_model().objects.create( username='john', email='john@doe.org', is_active=True) user.set_password('doe') user.save() self.client.post( reverse('account_reset_password'), data={'email': 'john@doe.org'}) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].to, ['john@doe.org']) return user def test_password_reset_flow(self): """ Tests the password reset flow: requesting a new password, receiving the reset link via email and finally resetting the password to a new value. """ # Request new password user = self._request_new_password() body = mail.outbox[0].body self.assertGreater(body.find('https://'), 0) # Extract URL for `password_reset_from_key` view and access it url = body[body.find('/password/reset/'):].split()[0] resp = self.client.get(url) self.assertTemplateUsed( resp, 'account/password_reset_from_key.%s' % app_settings.TEMPLATE_EXTENSION) self.assertFalse('token_fail' in resp.context_data) # Reset the password resp = self.client.post(url, {'password1': 'newpass123', 'password2': 'newpass123'}) self.assertRedirects(resp, reverse('account_reset_password_from_key_done')) # Check the new password is in effect user = get_user_model().objects.get(pk=user.pk) self.assertTrue(user.check_password('newpass123')) # Trying to reset the password against the same URL (or any other # invalid/obsolete URL) returns a bad token response resp = self.client.post(url, {'password1': 'newpass123', 'password2': 'newpass123'}) self.assertTemplateUsed( resp, 'account/password_reset_from_key.%s' % app_settings.TEMPLATE_EXTENSION) self.assertTrue(resp.context_data['token_fail']) # Same should happen when accessing the page directly response = self.client.get(url) self.assertTemplateUsed( response, 'account/password_reset_from_key.%s' % app_settings.TEMPLATE_EXTENSION) self.assertTrue(response.context_data['token_fail']) # When in XHR views, it should respond with a 400 bad request # code, and the response body should contain the JSON-encoded # error from the adapter response = self.client.post(url, {'password1': 'newpass123', 'password2': 'newpass123'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(response.status_code, 400) data = json.loads(response.content.decode('utf8')) self.assertTrue('form_errors' in data) self.assertTrue('__all__' in data['form_errors']) @override_settings(ACCOUNT_LOGIN_ON_PASSWORD_RESET=True) def test_password_reset_ACCOUNT_LOGIN_ON_PASSWORD_RESET(self): user = self._request_new_password() body = mail.outbox[0].body url = body[body.find('/password/reset/'):].split()[0] resp = self.client.post( url, {'password1': 'newpass123', 'password2': 'newpass123'}) self.assertTrue(user.is_authenticated()) # EmailVerificationMethod.MANDATORY sends us to the confirm-email page self.assertRedirects(resp, '/confirm-email/') @override_settings(ACCOUNT_EMAIL_CONFIRMATION_HMAC=False) def test_email_verification_mandatory(self): c = Client() # Signup resp = c.post(reverse('account_signup'), {'username': 'johndoe', 'email': 'john@doe.com', 'password1': 'johndoe', 'password2': 'johndoe'}, follow=True) self.assertEqual(resp.status_code, 200) self.assertEqual(mail.outbox[0].to, ['john@doe.com']) self.assertGreater(mail.outbox[0].body.find('https://'), 0) self.assertEqual(len(mail.outbox), 1) self.assertTemplateUsed( resp, 'account/verification_sent.%s' % app_settings.TEMPLATE_EXTENSION) # Attempt to login, unverified for attempt in [1, 2]: resp = c.post(reverse('account_login'), {'login': 'johndoe', 'password': 'johndoe'}, follow=True) # is_active is controlled by the admin to manually disable # users. I don't want this flag to flip automatically whenever # users verify their email adresses. self.assertTrue(get_user_model().objects.filter( username='johndoe', is_active=True).exists()) self.assertTemplateUsed( resp, 'account/verification_sent.' + app_settings.TEMPLATE_EXTENSION) # Attempt 1: no mail is sent due to cool-down , # but there was already a mail in the outbox. self.assertEqual(len(mail.outbox), attempt) self.assertEqual( EmailConfirmation.objects.filter( email_address__email='john@doe.com').count(), attempt) # Wait for cooldown EmailConfirmation.objects.update(sent=now() - timedelta(days=1)) # Verify, and re-attempt to login. confirmation = EmailConfirmation \ .objects \ .filter(email_address__user__username='johndoe')[:1] \ .get() resp = c.get(reverse('account_confirm_email', args=[confirmation.key])) self.assertTemplateUsed( resp, 'account/email_confirm.%s' % app_settings.TEMPLATE_EXTENSION) c.post(reverse('account_confirm_email', args=[confirmation.key])) resp = c.post(reverse('account_login'), {'login': 'johndoe', 'password': 'johndoe'}) self.assertRedirects(resp, 'http://testserver'+settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) def test_email_escaping(self): site = get_current_site() site.name = '<enc&"test>' site.save() u = get_user_model().objects.create( username='test', email='foo@bar.com') request = RequestFactory().get('/') EmailAddress.objects.add_email(request, u, u.email, confirm=True) self.assertTrue(mail.outbox[0].subject[1:].startswith(site.name)) @override_settings( ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod .OPTIONAL) def test_login_unverified_account_optional(self): """Tests login behavior when email verification is optional.""" user = get_user_model().objects.create(username='john') user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=False) resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}) self.assertRedirects(resp, 'http://testserver'+settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) @override_settings( ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod .OPTIONAL, ACCOUNT_LOGIN_ATTEMPTS_LIMIT=3) def test_login_failed_attempts_exceeded(self): user = get_user_model().objects.create(username='john') user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=False) for i in range(5): is_valid_attempt = (i == 4) is_locked = (i >= 3) resp = self.client.post( reverse('account_login'), {'login': 'john', 'password': ( 'doe' if is_valid_attempt else 'wrong')}) self.assertFormError( resp, 'form', None, 'Too many failed login attempts. Try again later.' if is_locked else 'The username and/or password you specified are not correct.') def test_login_unverified_account_mandatory(self): """Tests login behavior when email verification is mandatory.""" user = get_user_model().objects.create(username='john') user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=False) resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}) self.assertRedirects(resp, reverse('account_email_verification_sent')) def test_login_inactive_account(self): """ Tests login behavior with inactive accounts. Inactive user accounts should be prevented from performing any actions, regardless of their verified state. """ # Inactive and verified user account user = get_user_model().objects.create(username='john', is_active=False) user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=True) resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}) self.assertRedirects(resp, reverse('account_inactive')) # Inactive and unverified user account user = get_user_model().objects.create(username='doe', is_active=False) user.set_password('john') user.save() EmailAddress.objects.create(user=user, email='doe@example.com', primary=True, verified=False) resp = self.client.post(reverse('account_login'), {'login': 'doe', 'password': 'john'}) self.assertRedirects(resp, reverse('account_inactive')) def test_ajax_password_reset(self): get_user_model().objects.create( username='john', email='john@doe.org', is_active=True) resp = self.client.post( reverse('account_reset_password'), data={'email': 'john@doe.org'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].to, ['john@doe.org']) self.assertEqual(resp['content-type'], 'application/json') def test_ajax_login_fail(self): resp = self.client.post(reverse('account_login'), {}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(resp.status_code, 400) json.loads(resp.content.decode('utf8')) # TODO: Actually test something @override_settings( ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod .OPTIONAL) def test_ajax_login_success(self): user = get_user_model().objects.create(username='john', is_active=True) user.set_password('doe') user.save() resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(resp.status_code, 200) data = json.loads(resp.content.decode('utf8')) self.assertEqual(data['location'], '/accounts/profile/') def test_email_view(self): self._create_user_and_login() self.client.get(reverse('account_email')) # TODO: Actually test something @override_settings(ACCOUNT_LOGOUT_ON_GET=True) def test_logout_view_on_get(self): c, resp = self._logout_view('get') self.assertTemplateUsed(resp, 'account/messages/logged_out.txt') @override_settings(ACCOUNT_LOGOUT_ON_GET=False) def test_logout_view_on_post(self): c, resp = self._logout_view('get') self.assertTemplateUsed( resp, 'account/logout.%s' % app_settings.TEMPLATE_EXTENSION) resp = c.post(reverse('account_logout')) self.assertTemplateUsed(resp, 'account/messages/logged_out.txt') def _logout_view(self, method): c = Client() user = get_user_model().objects.create(username='john', is_active=True) user.set_password('doe') user.save() c = Client() c.login(username='john', password='doe') return c, getattr(c, method)(reverse('account_logout')) @override_settings(ACCOUNT_EMAIL_VERIFICATION=app_settings .EmailVerificationMethod.OPTIONAL) def test_optional_email_verification(self): c = Client() # Signup c.get(reverse('account_signup')) resp = c.post(reverse('account_signup'), {'username': 'johndoe', 'email': 'john@doe.com', 'password1': 'johndoe', 'password2': 'johndoe'}) # Logged in self.assertRedirects(resp, settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) self.assertEqual(mail.outbox[0].to, ['john@doe.com']) self.assertEqual(len(mail.outbox), 1) # Logout & login again c.logout() # Wait for cooldown EmailConfirmation.objects.update(sent=now() - timedelta(days=1)) # Signup resp = c.post(reverse('account_login'), {'login': 'johndoe', 'password': 'johndoe'}) self.assertRedirects(resp, settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) self.assertEqual(mail.outbox[0].to, ['john@doe.com']) # There was an issue that we sent out email confirmation mails # on each login in case of optional verification. Make sure # this is not the case: self.assertEqual(len(mail.outbox), 1) @override_settings(ACCOUNT_AUTHENTICATED_LOGIN_REDIRECTS=False) def test_account_authenticated_login_redirects_is_false(self): self._create_user_and_login() resp = self.client.get(reverse('account_login')) self.assertEqual(resp.status_code, 200) @override_settings(AUTH_PASSWORD_VALIDATORS=[{ 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 9, } }]) def test_django_password_validation(self): if django.VERSION < (1, 9, ): return resp = self.client.post( reverse('account_signup'), {'username': 'johndoe', 'email': 'john@doe.com', 'password1': 'johndoe', 'password2': 'johndoe'}) self.assertFormError(resp, 'form', None, []) self.assertFormError( resp, 'form', 'password1', ['This password is too short.' ' It must contain at least 9 characters.']) @override_settings(ACCOUNT_EMAIL_CONFIRMATION_HMAC=True) def test_email_confirmation_hmac_falls_back(self): user = self._create_user() email = EmailAddress.objects.create( user=user, email='a@b.com', verified=False, primary=True) confirmation = EmailConfirmation.create(email) confirmation.sent = now() confirmation.save() self.client.post( reverse('account_confirm_email', args=[confirmation.key])) email = EmailAddress.objects.get(pk=email.pk) self.assertTrue(email.verified) @override_settings(ACCOUNT_EMAIL_CONFIRMATION_HMAC=True) def test_email_confirmation_hmac(self): user = self._create_user() email = EmailAddress.objects.create( user=user, email='a@b.com', verified=False, primary=True) confirmation = EmailConfirmationHMAC(email) confirmation.send() self.assertEqual(len(mail.outbox), 1) self.client.post( reverse('account_confirm_email', args=[confirmation.key])) email = EmailAddress.objects.get(pk=email.pk) self.assertTrue(email.verified) @override_settings( ACCOUNT_EMAIL_CONFIRMATION_HMAC=True, ACCOUNT_EMAIL_CONFIRMATION_EXPIRE_DAYS=0) def test_email_confirmation_hmac_timeout(self): user = self._create_user() email = EmailAddress.objects.create( user=user, email='a@b.com', verified=False, primary=True) confirmation = EmailConfirmationHMAC(email) confirmation.send() self.assertEqual(len(mail.outbox), 1) self.client.post( reverse('account_confirm_email', args=[confirmation.key])) email = EmailAddress.objects.get(pk=email.pk) self.assertFalse(email.verified) class EmailFormTests(TestCase): def setUp(self): User = get_user_model() self.user = User.objects.create(username='john', email='john1@doe.org') self.user.set_password('doe') self.user.save() self.email_address = EmailAddress.objects.create( user=self.user, email=self.user.email, verified=True, primary=True) self.email_address2 = EmailAddress.objects.create( user=self.user, email='john2@doe.org', verified=False, primary=False) self.client.login(username='john', password='doe') def test_add(self): resp = self.client.post( reverse('account_email'), {'action_add': '', 'email': 'john3@doe.org'}) EmailAddress.objects.get( email='john3@doe.org', user=self.user, verified=False, primary=False) self.assertTemplateUsed(resp, 'account/messages/email_confirmation_sent.txt') def test_ajax_add(self): resp = self.client.post( reverse('account_email'), {'action_add': '', 'email': 'john3@doe.org'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') data = json.loads(resp.content.decode('utf8')) self.assertEqual(data['location'], reverse('account_email')) def test_ajax_add_invalid(self): resp = self.client.post( reverse('account_email'), {'action_add': '', 'email': 'john3#doe.org'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') data = json.loads(resp.content.decode('utf8')) self.assertTrue('form_errors' in data) self.assertTrue('email' in data['form_errors']) def test_remove_primary(self): resp = self.client.post( reverse('account_email'), {'action_remove': '', 'email': self.email_address.email}) EmailAddress.objects.get(pk=self.email_address.pk) self.assertTemplateUsed( resp, 'account/messages/cannot_delete_primary_email.txt') def test_ajax_remove_primary(self): resp = self.client.post( reverse('account_email'), {'action_remove': '', 'email': self.email_address.email}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertTemplateUsed( resp, 'account/messages/cannot_delete_primary_email.txt') data = json.loads(resp.content.decode('utf8')) self.assertEqual(data['location'], reverse('account_email')) def test_remove_secondary(self): resp = self.client.post( reverse('account_email'), {'action_remove': '', 'email': self.email_address2.email}) self.assertRaises(EmailAddress.DoesNotExist, lambda: EmailAddress.objects.get( pk=self.email_address2.pk)) self.assertTemplateUsed( resp, 'account/messages/email_deleted.txt') def test_set_primary_unverified(self): resp = self.client.post( reverse('account_email'), {'action_primary': '', 'email': self.email_address2.email}) email_address = EmailAddress.objects.get(pk=self.email_address.pk) email_address2 = EmailAddress.objects.get(pk=self.email_address2.pk) self.assertFalse(email_address2.primary) self.assertTrue(email_address.primary) self.assertTemplateUsed( resp, 'account/messages/unverified_primary_email.txt') def test_set_primary(self): email_address2 = EmailAddress.objects.get(pk=self.email_address2.pk) email_address2.verified = True email_address2.save() resp = self.client.post( reverse('account_email'), {'action_primary': '', 'email': self.email_address2.email}) email_address = EmailAddress.objects.get(pk=self.email_address.pk) email_address2 = EmailAddress.objects.get(pk=self.email_address2.pk) self.assertFalse(email_address.primary) self.assertTrue(email_address2.primary) self.assertTemplateUsed( resp, 'account/messages/primary_email_set.txt') def test_verify(self): resp = self.client.post( reverse('account_email'), {'action_send': '', 'email': self.email_address2.email}) self.assertTemplateUsed( resp, 'account/messages/email_confirmation_sent.txt') class BaseSignupFormTests(TestCase): @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_USERNAME_BLACKLIST=['username']) def test_username_in_blacklist(self): data = { 'username': 'username', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertFalse(form.is_valid()) @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_USERNAME_BLACKLIST=['username']) def test_username_not_in_blacklist(self): data = { 'username': 'theusername', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertTrue(form.is_valid()) @override_settings(ACCOUNT_USERNAME_REQUIRED=True) def test_username_maxlength(self): data = { 'username': 'username', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) max_length = get_username_max_length() field = form.fields['username'] self.assertEqual(field.max_length, max_length) widget = field.widget self.assertEqual(widget.attrs.get('maxlength'), str(max_length)) @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_SIGNUP_EMAIL_ENTER_TWICE=True) def test_signup_email_verification(self): data = { 'username': 'username', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertFalse(form.is_valid()) data = { 'username': 'username', 'email1': 'user@example.com', 'email2': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertTrue(form.is_valid()) data['email2'] = 'anotheruser@example.com' form = BaseSignupForm(data, email_required=True) self.assertFalse(form.is_valid()) class AuthenticationBackendTests(TestCase): def setUp(self): user = get_user_model().objects.create( is_active=True, email='john@doe.com', username='john') user.set_password(user.username) user.save() self.user = user @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.USERNAME) # noqa def test_auth_by_username(self): user = self.user backend = AuthenticationBackend() self.assertEqual( backend.authenticate( username=user.username, password=user.username).pk, user.pk) self.assertEqual( backend.authenticate( username=user.email, password=user.username), None) @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.EMAIL) # noqa def test_auth_by_email(self): user = self.user backend = AuthenticationBackend() self.assertEqual( backend.authenticate( username=user.email, password=user.username).pk, user.pk) self.assertEqual( backend.authenticate( username=user.username, password=user.username), None) @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.USERNAME_EMAIL) # noqa def test_auth_by_username_or_email(self): user = self.user backend = AuthenticationBackend() self.assertEqual( backend.authenticate( username=user.email, password=user.username).pk, user.pk) self.assertEqual( backend.authenticate( username=user.username, password=user.username).pk, user.pk) class UtilsTests(TestCase): def setUp(self): if hasattr(models, 'UUIDField'): self.user_id = uuid.uuid4().hex class UUIDUser(AbstractUser): id = models.UUIDField(primary_key=True, default=uuid.uuid4, editable=False) class Meta(AbstractUser.Meta): swappable = 'AUTH_USER_MODEL' else: UUIDUser = get_user_model() self.UUIDUser = UUIDUser @unittest.skipUnless(hasattr(models, 'UUIDField'), reason="No UUIDField in this django version") def test_url_str_to_pk_identifies_UUID_as_stringlike(self): with patch('allauth.account.utils.get_user_model') as mocked_gum: mocked_gum.return_value = self.UUIDUser self.assertEqual(url_str_to_user_pk(self.user_id), self.user_id) def test_pk_to_url_string_identifies_UUID_as_stringlike(self): user = self.UUIDUser( is_active=True, email='john@doe.com', username='john') self.assertEquals(user_pk_to_url_str(user), str(user.pk))
40.093074
95
0.582195
from __future__ import absolute_import import json from datetime import timedelta import django from django.utils.timezone import now from django.test.utils import override_settings from django.conf import settings from django.core.urlresolvers import reverse from django.test.client import Client from django.core import mail from django.test.client import RequestFactory from django.contrib.auth.models import AnonymousUser, AbstractUser from django.db import models import unittest from allauth.tests import TestCase, patch from allauth.account.forms import BaseSignupForm from allauth.account.models import ( EmailAddress, EmailConfirmation, EmailConfirmationHMAC) from allauth.utils import ( get_current_site, get_user_model, get_username_max_length) from . import app_settings from .auth_backends import AuthenticationBackend from .adapter import get_adapter from .utils import url_str_to_user_pk, user_pk_to_url_str import uuid @override_settings( ACCOUNT_DEFAULT_HTTP_PROTOCOL='https', ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod.MANDATORY, ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.USERNAME, ACCOUNT_SIGNUP_FORM_CLASS=None, ACCOUNT_EMAIL_SUBJECT_PREFIX=None, LOGIN_REDIRECT_URL='/accounts/profile/', ACCOUNT_ADAPTER='allauth.account.adapter.DefaultAccountAdapter', ACCOUNT_USERNAME_REQUIRED=True) class AccountTests(TestCase): def setUp(self): if 'allauth.socialaccount' in settings.INSTALLED_APPS: from ..socialaccount.models import SocialApp sa = SocialApp.objects.create(name='testfb', provider='facebook') sa.sites.add(get_current_site()) @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod .USERNAME_EMAIL) def test_username_containing_at(self): user = get_user_model().objects.create(username='@raymond.penners') user.set_password('psst') user.save() EmailAddress.objects.create(user=user, email='raymond.penners@gmail.com', primary=True, verified=True) resp = self.client.post(reverse('account_login'), {'login': '@raymond.penners', 'password': 'psst'}) self.assertRedirects(resp, 'http://testserver'+settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) def test_signup_same_email_verified_externally(self): user = self._test_signup_email_verified_externally('john@doe.com', 'john@doe.com') self.assertEqual(EmailAddress.objects.filter(user=user).count(), 1) EmailAddress.objects.get(verified=True, email='john@doe.com', user=user, primary=True) def test_signup_other_email_verified_externally(self): user = self._test_signup_email_verified_externally('john@home.com', 'john@work.com') self.assertEqual(EmailAddress.objects.filter(user=user).count(), 2) EmailAddress.objects.get(verified=False, email='john@home.com', user=user, primary=False) EmailAddress.objects.get(verified=True, email='john@work.com', user=user, primary=True) def _test_signup_email_verified_externally(self, signup_email, verified_email): username = 'johndoe' request = RequestFactory().post(reverse('account_signup'), {'username': username, 'email': signup_email, 'password1': 'johndoe', 'password2': 'johndoe'}) from django.contrib.messages.middleware import MessageMiddleware from django.contrib.sessions.middleware import SessionMiddleware SessionMiddleware().process_request(request) MessageMiddleware().process_request(request) request.user = AnonymousUser() request.session['account_verified_email'] = verified_email from .views import signup resp = signup(request) self.assertEqual(resp.status_code, 302) self.assertEqual(resp['location'], get_adapter().get_login_redirect_url(request)) self.assertEqual(len(mail.outbox), 0) return get_user_model().objects.get(username=username) @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_SIGNUP_EMAIL_ENTER_TWICE=True) def test_signup_email_twice(self): request = RequestFactory().post(reverse('account_signup'), {'username': 'johndoe', 'email1': 'john@work.com', 'email2': 'john@work.com', 'password1': 'johndoe', 'password2': 'johndoe'}) from django.contrib.messages.middleware import MessageMiddleware from django.contrib.sessions.middleware import SessionMiddleware SessionMiddleware().process_request(request) MessageMiddleware().process_request(request) request.user = AnonymousUser() from .views import signup signup(request) user = get_user_model().objects.get(username='johndoe') self.assertEqual(user.email, 'john@work.com') def _create_user(self): user = get_user_model().objects.create(username='john', is_active=True) user.set_password('doe') user.save() return user def _create_user_and_login(self): user = self._create_user() self.client.login(username='john', password='doe') return user def test_redirect_when_authenticated(self): self._create_user_and_login() c = self.client resp = c.get(reverse('account_login')) self.assertRedirects(resp, 'http://testserver/accounts/profile/', fetch_redirect_response=False) def test_password_reset_get(self): resp = self.client.get(reverse('account_reset_password')) self.assertTemplateUsed(resp, 'account/password_reset.html') def test_password_set_redirect(self): resp = self._password_set_or_reset_redirect('account_set_password', True) self.assertEqual(resp.status_code, 302) def test_password_reset_no_redirect(self): resp = self._password_set_or_reset_redirect('account_change_password', True) self.assertEqual(resp.status_code, 200) def test_password_set_no_redirect(self): resp = self._password_set_or_reset_redirect('account_set_password', False) self.assertEqual(resp.status_code, 200) def test_password_reset_redirect(self): resp = self._password_set_or_reset_redirect('account_change_password', False) self.assertEqual(resp.status_code, 302) def _password_set_or_reset_redirect(self, urlname, usable_password): user = self._create_user_and_login() c = self.client if not usable_password: user.set_unusable_password() user.save() resp = c.get(reverse(urlname)) return resp def test_password_forgotten_username_hint(self): user = self._request_new_password() body = mail.outbox[0].body assert user.username in body @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.EMAIL) def test_password_forgotten_no_username_hint(self): user = self._request_new_password() body = mail.outbox[0].body assert user.username not in body def _request_new_password(self): user = get_user_model().objects.create( username='john', email='john@doe.org', is_active=True) user.set_password('doe') user.save() self.client.post( reverse('account_reset_password'), data={'email': 'john@doe.org'}) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].to, ['john@doe.org']) return user def test_password_reset_flow(self): user = self._request_new_password() body = mail.outbox[0].body self.assertGreater(body.find('https://'), 0) url = body[body.find('/password/reset/'):].split()[0] resp = self.client.get(url) self.assertTemplateUsed( resp, 'account/password_reset_from_key.%s' % app_settings.TEMPLATE_EXTENSION) self.assertFalse('token_fail' in resp.context_data) resp = self.client.post(url, {'password1': 'newpass123', 'password2': 'newpass123'}) self.assertRedirects(resp, reverse('account_reset_password_from_key_done')) user = get_user_model().objects.get(pk=user.pk) self.assertTrue(user.check_password('newpass123')) resp = self.client.post(url, {'password1': 'newpass123', 'password2': 'newpass123'}) self.assertTemplateUsed( resp, 'account/password_reset_from_key.%s' % app_settings.TEMPLATE_EXTENSION) self.assertTrue(resp.context_data['token_fail']) response = self.client.get(url) self.assertTemplateUsed( response, 'account/password_reset_from_key.%s' % app_settings.TEMPLATE_EXTENSION) self.assertTrue(response.context_data['token_fail']) response = self.client.post(url, {'password1': 'newpass123', 'password2': 'newpass123'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(response.status_code, 400) data = json.loads(response.content.decode('utf8')) self.assertTrue('form_errors' in data) self.assertTrue('__all__' in data['form_errors']) @override_settings(ACCOUNT_LOGIN_ON_PASSWORD_RESET=True) def test_password_reset_ACCOUNT_LOGIN_ON_PASSWORD_RESET(self): user = self._request_new_password() body = mail.outbox[0].body url = body[body.find('/password/reset/'):].split()[0] resp = self.client.post( url, {'password1': 'newpass123', 'password2': 'newpass123'}) self.assertTrue(user.is_authenticated()) self.assertRedirects(resp, '/confirm-email/') @override_settings(ACCOUNT_EMAIL_CONFIRMATION_HMAC=False) def test_email_verification_mandatory(self): c = Client() resp = c.post(reverse('account_signup'), {'username': 'johndoe', 'email': 'john@doe.com', 'password1': 'johndoe', 'password2': 'johndoe'}, follow=True) self.assertEqual(resp.status_code, 200) self.assertEqual(mail.outbox[0].to, ['john@doe.com']) self.assertGreater(mail.outbox[0].body.find('https://'), 0) self.assertEqual(len(mail.outbox), 1) self.assertTemplateUsed( resp, 'account/verification_sent.%s' % app_settings.TEMPLATE_EXTENSION) for attempt in [1, 2]: resp = c.post(reverse('account_login'), {'login': 'johndoe', 'password': 'johndoe'}, follow=True) # users verify their email adresses. self.assertTrue(get_user_model().objects.filter( username='johndoe', is_active=True).exists()) self.assertTemplateUsed( resp, 'account/verification_sent.' + app_settings.TEMPLATE_EXTENSION) # Attempt 1: no mail is sent due to cool-down , # but there was already a mail in the outbox. self.assertEqual(len(mail.outbox), attempt) self.assertEqual( EmailConfirmation.objects.filter( email_address__email='john@doe.com').count(), attempt) # Wait for cooldown EmailConfirmation.objects.update(sent=now() - timedelta(days=1)) # Verify, and re-attempt to login. confirmation = EmailConfirmation \ .objects \ .filter(email_address__user__username='johndoe')[:1] \ .get() resp = c.get(reverse('account_confirm_email', args=[confirmation.key])) self.assertTemplateUsed( resp, 'account/email_confirm.%s' % app_settings.TEMPLATE_EXTENSION) c.post(reverse('account_confirm_email', args=[confirmation.key])) resp = c.post(reverse('account_login'), {'login': 'johndoe', 'password': 'johndoe'}) self.assertRedirects(resp, 'http://testserver'+settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) def test_email_escaping(self): site = get_current_site() site.name = '<enc&"test>' site.save() u = get_user_model().objects.create( username='test', email='foo@bar.com') request = RequestFactory().get('/') EmailAddress.objects.add_email(request, u, u.email, confirm=True) self.assertTrue(mail.outbox[0].subject[1:].startswith(site.name)) @override_settings( ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod .OPTIONAL) def test_login_unverified_account_optional(self): user = get_user_model().objects.create(username='john') user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=False) resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}) self.assertRedirects(resp, 'http://testserver'+settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) @override_settings( ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod .OPTIONAL, ACCOUNT_LOGIN_ATTEMPTS_LIMIT=3) def test_login_failed_attempts_exceeded(self): user = get_user_model().objects.create(username='john') user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=False) for i in range(5): is_valid_attempt = (i == 4) is_locked = (i >= 3) resp = self.client.post( reverse('account_login'), {'login': 'john', 'password': ( 'doe' if is_valid_attempt else 'wrong')}) self.assertFormError( resp, 'form', None, 'Too many failed login attempts. Try again later.' if is_locked else 'The username and/or password you specified are not correct.') def test_login_unverified_account_mandatory(self): user = get_user_model().objects.create(username='john') user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=False) resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}) self.assertRedirects(resp, reverse('account_email_verification_sent')) def test_login_inactive_account(self): # Inactive and verified user account user = get_user_model().objects.create(username='john', is_active=False) user.set_password('doe') user.save() EmailAddress.objects.create(user=user, email='john@example.com', primary=True, verified=True) resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}) self.assertRedirects(resp, reverse('account_inactive')) # Inactive and unverified user account user = get_user_model().objects.create(username='doe', is_active=False) user.set_password('john') user.save() EmailAddress.objects.create(user=user, email='doe@example.com', primary=True, verified=False) resp = self.client.post(reverse('account_login'), {'login': 'doe', 'password': 'john'}) self.assertRedirects(resp, reverse('account_inactive')) def test_ajax_password_reset(self): get_user_model().objects.create( username='john', email='john@doe.org', is_active=True) resp = self.client.post( reverse('account_reset_password'), data={'email': 'john@doe.org'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].to, ['john@doe.org']) self.assertEqual(resp['content-type'], 'application/json') def test_ajax_login_fail(self): resp = self.client.post(reverse('account_login'), {}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(resp.status_code, 400) json.loads(resp.content.decode('utf8')) # TODO: Actually test something @override_settings( ACCOUNT_EMAIL_VERIFICATION=app_settings.EmailVerificationMethod .OPTIONAL) def test_ajax_login_success(self): user = get_user_model().objects.create(username='john', is_active=True) user.set_password('doe') user.save() resp = self.client.post(reverse('account_login'), {'login': 'john', 'password': 'doe'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertEqual(resp.status_code, 200) data = json.loads(resp.content.decode('utf8')) self.assertEqual(data['location'], '/accounts/profile/') def test_email_view(self): self._create_user_and_login() self.client.get(reverse('account_email')) # TODO: Actually test something @override_settings(ACCOUNT_LOGOUT_ON_GET=True) def test_logout_view_on_get(self): c, resp = self._logout_view('get') self.assertTemplateUsed(resp, 'account/messages/logged_out.txt') @override_settings(ACCOUNT_LOGOUT_ON_GET=False) def test_logout_view_on_post(self): c, resp = self._logout_view('get') self.assertTemplateUsed( resp, 'account/logout.%s' % app_settings.TEMPLATE_EXTENSION) resp = c.post(reverse('account_logout')) self.assertTemplateUsed(resp, 'account/messages/logged_out.txt') def _logout_view(self, method): c = Client() user = get_user_model().objects.create(username='john', is_active=True) user.set_password('doe') user.save() c = Client() c.login(username='john', password='doe') return c, getattr(c, method)(reverse('account_logout')) @override_settings(ACCOUNT_EMAIL_VERIFICATION=app_settings .EmailVerificationMethod.OPTIONAL) def test_optional_email_verification(self): c = Client() # Signup c.get(reverse('account_signup')) resp = c.post(reverse('account_signup'), {'username': 'johndoe', 'email': 'john@doe.com', 'password1': 'johndoe', 'password2': 'johndoe'}) # Logged in self.assertRedirects(resp, settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) self.assertEqual(mail.outbox[0].to, ['john@doe.com']) self.assertEqual(len(mail.outbox), 1) # Logout & login again c.logout() # Wait for cooldown EmailConfirmation.objects.update(sent=now() - timedelta(days=1)) # Signup resp = c.post(reverse('account_login'), {'login': 'johndoe', 'password': 'johndoe'}) self.assertRedirects(resp, settings.LOGIN_REDIRECT_URL, fetch_redirect_response=False) self.assertEqual(mail.outbox[0].to, ['john@doe.com']) # There was an issue that we sent out email confirmation mails # on each login in case of optional verification. Make sure # this is not the case: self.assertEqual(len(mail.outbox), 1) @override_settings(ACCOUNT_AUTHENTICATED_LOGIN_REDIRECTS=False) def test_account_authenticated_login_redirects_is_false(self): self._create_user_and_login() resp = self.client.get(reverse('account_login')) self.assertEqual(resp.status_code, 200) @override_settings(AUTH_PASSWORD_VALIDATORS=[{ 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 9, } }]) def test_django_password_validation(self): if django.VERSION < (1, 9, ): return resp = self.client.post( reverse('account_signup'), {'username': 'johndoe', 'email': 'john@doe.com', 'password1': 'johndoe', 'password2': 'johndoe'}) self.assertFormError(resp, 'form', None, []) self.assertFormError( resp, 'form', 'password1', ['This password is too short.' ' It must contain at least 9 characters.']) @override_settings(ACCOUNT_EMAIL_CONFIRMATION_HMAC=True) def test_email_confirmation_hmac_falls_back(self): user = self._create_user() email = EmailAddress.objects.create( user=user, email='a@b.com', verified=False, primary=True) confirmation = EmailConfirmation.create(email) confirmation.sent = now() confirmation.save() self.client.post( reverse('account_confirm_email', args=[confirmation.key])) email = EmailAddress.objects.get(pk=email.pk) self.assertTrue(email.verified) @override_settings(ACCOUNT_EMAIL_CONFIRMATION_HMAC=True) def test_email_confirmation_hmac(self): user = self._create_user() email = EmailAddress.objects.create( user=user, email='a@b.com', verified=False, primary=True) confirmation = EmailConfirmationHMAC(email) confirmation.send() self.assertEqual(len(mail.outbox), 1) self.client.post( reverse('account_confirm_email', args=[confirmation.key])) email = EmailAddress.objects.get(pk=email.pk) self.assertTrue(email.verified) @override_settings( ACCOUNT_EMAIL_CONFIRMATION_HMAC=True, ACCOUNT_EMAIL_CONFIRMATION_EXPIRE_DAYS=0) def test_email_confirmation_hmac_timeout(self): user = self._create_user() email = EmailAddress.objects.create( user=user, email='a@b.com', verified=False, primary=True) confirmation = EmailConfirmationHMAC(email) confirmation.send() self.assertEqual(len(mail.outbox), 1) self.client.post( reverse('account_confirm_email', args=[confirmation.key])) email = EmailAddress.objects.get(pk=email.pk) self.assertFalse(email.verified) class EmailFormTests(TestCase): def setUp(self): User = get_user_model() self.user = User.objects.create(username='john', email='john1@doe.org') self.user.set_password('doe') self.user.save() self.email_address = EmailAddress.objects.create( user=self.user, email=self.user.email, verified=True, primary=True) self.email_address2 = EmailAddress.objects.create( user=self.user, email='john2@doe.org', verified=False, primary=False) self.client.login(username='john', password='doe') def test_add(self): resp = self.client.post( reverse('account_email'), {'action_add': '', 'email': 'john3@doe.org'}) EmailAddress.objects.get( email='john3@doe.org', user=self.user, verified=False, primary=False) self.assertTemplateUsed(resp, 'account/messages/email_confirmation_sent.txt') def test_ajax_add(self): resp = self.client.post( reverse('account_email'), {'action_add': '', 'email': 'john3@doe.org'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') data = json.loads(resp.content.decode('utf8')) self.assertEqual(data['location'], reverse('account_email')) def test_ajax_add_invalid(self): resp = self.client.post( reverse('account_email'), {'action_add': '', 'email': 'john3#doe.org'}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') data = json.loads(resp.content.decode('utf8')) self.assertTrue('form_errors' in data) self.assertTrue('email' in data['form_errors']) def test_remove_primary(self): resp = self.client.post( reverse('account_email'), {'action_remove': '', 'email': self.email_address.email}) EmailAddress.objects.get(pk=self.email_address.pk) self.assertTemplateUsed( resp, 'account/messages/cannot_delete_primary_email.txt') def test_ajax_remove_primary(self): resp = self.client.post( reverse('account_email'), {'action_remove': '', 'email': self.email_address.email}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertTemplateUsed( resp, 'account/messages/cannot_delete_primary_email.txt') data = json.loads(resp.content.decode('utf8')) self.assertEqual(data['location'], reverse('account_email')) def test_remove_secondary(self): resp = self.client.post( reverse('account_email'), {'action_remove': '', 'email': self.email_address2.email}) self.assertRaises(EmailAddress.DoesNotExist, lambda: EmailAddress.objects.get( pk=self.email_address2.pk)) self.assertTemplateUsed( resp, 'account/messages/email_deleted.txt') def test_set_primary_unverified(self): resp = self.client.post( reverse('account_email'), {'action_primary': '', 'email': self.email_address2.email}) email_address = EmailAddress.objects.get(pk=self.email_address.pk) email_address2 = EmailAddress.objects.get(pk=self.email_address2.pk) self.assertFalse(email_address2.primary) self.assertTrue(email_address.primary) self.assertTemplateUsed( resp, 'account/messages/unverified_primary_email.txt') def test_set_primary(self): email_address2 = EmailAddress.objects.get(pk=self.email_address2.pk) email_address2.verified = True email_address2.save() resp = self.client.post( reverse('account_email'), {'action_primary': '', 'email': self.email_address2.email}) email_address = EmailAddress.objects.get(pk=self.email_address.pk) email_address2 = EmailAddress.objects.get(pk=self.email_address2.pk) self.assertFalse(email_address.primary) self.assertTrue(email_address2.primary) self.assertTemplateUsed( resp, 'account/messages/primary_email_set.txt') def test_verify(self): resp = self.client.post( reverse('account_email'), {'action_send': '', 'email': self.email_address2.email}) self.assertTemplateUsed( resp, 'account/messages/email_confirmation_sent.txt') class BaseSignupFormTests(TestCase): @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_USERNAME_BLACKLIST=['username']) def test_username_in_blacklist(self): data = { 'username': 'username', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertFalse(form.is_valid()) @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_USERNAME_BLACKLIST=['username']) def test_username_not_in_blacklist(self): data = { 'username': 'theusername', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertTrue(form.is_valid()) @override_settings(ACCOUNT_USERNAME_REQUIRED=True) def test_username_maxlength(self): data = { 'username': 'username', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) max_length = get_username_max_length() field = form.fields['username'] self.assertEqual(field.max_length, max_length) widget = field.widget self.assertEqual(widget.attrs.get('maxlength'), str(max_length)) @override_settings( ACCOUNT_USERNAME_REQUIRED=True, ACCOUNT_SIGNUP_EMAIL_ENTER_TWICE=True) def test_signup_email_verification(self): data = { 'username': 'username', 'email': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertFalse(form.is_valid()) data = { 'username': 'username', 'email1': 'user@example.com', 'email2': 'user@example.com', } form = BaseSignupForm(data, email_required=True) self.assertTrue(form.is_valid()) data['email2'] = 'anotheruser@example.com' form = BaseSignupForm(data, email_required=True) self.assertFalse(form.is_valid()) class AuthenticationBackendTests(TestCase): def setUp(self): user = get_user_model().objects.create( is_active=True, email='john@doe.com', username='john') user.set_password(user.username) user.save() self.user = user @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.USERNAME) # noqa def test_auth_by_username(self): user = self.user backend = AuthenticationBackend() self.assertEqual( backend.authenticate( username=user.username, password=user.username).pk, user.pk) self.assertEqual( backend.authenticate( username=user.email, password=user.username), None) @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.EMAIL) # noqa def test_auth_by_email(self): user = self.user backend = AuthenticationBackend() self.assertEqual( backend.authenticate( username=user.email, password=user.username).pk, user.pk) self.assertEqual( backend.authenticate( username=user.username, password=user.username), None) @override_settings( ACCOUNT_AUTHENTICATION_METHOD=app_settings.AuthenticationMethod.USERNAME_EMAIL) # noqa def test_auth_by_username_or_email(self): user = self.user backend = AuthenticationBackend() self.assertEqual( backend.authenticate( username=user.email, password=user.username).pk, user.pk) self.assertEqual( backend.authenticate( username=user.username, password=user.username).pk, user.pk) class UtilsTests(TestCase): def setUp(self): if hasattr(models, 'UUIDField'): self.user_id = uuid.uuid4().hex class UUIDUser(AbstractUser): id = models.UUIDField(primary_key=True, default=uuid.uuid4, editable=False) class Meta(AbstractUser.Meta): swappable = 'AUTH_USER_MODEL' else: UUIDUser = get_user_model() self.UUIDUser = UUIDUser @unittest.skipUnless(hasattr(models, 'UUIDField'), reason="No UUIDField in this django version") def test_url_str_to_pk_identifies_UUID_as_stringlike(self): with patch('allauth.account.utils.get_user_model') as mocked_gum: mocked_gum.return_value = self.UUIDUser self.assertEqual(url_str_to_user_pk(self.user_id), self.user_id) def test_pk_to_url_string_identifies_UUID_as_stringlike(self): user = self.UUIDUser( is_active=True, email='john@doe.com', username='john') self.assertEquals(user_pk_to_url_str(user), str(user.pk))
true
true
f72476a51168fd61ef40256da67527b38bad600a
5,368
py
Python
core/cache/decorator.py
prorevizor/noc
37e44b8afc64318b10699c06a1138eee9e7d6a4e
[ "BSD-3-Clause" ]
84
2017-10-22T11:01:39.000Z
2022-02-27T03:43:48.000Z
core/cache/decorator.py
prorevizor/noc
37e44b8afc64318b10699c06a1138eee9e7d6a4e
[ "BSD-3-Clause" ]
22
2017-12-11T07:21:56.000Z
2021-09-23T02:53:50.000Z
core/cache/decorator.py
prorevizor/noc
37e44b8afc64318b10699c06a1138eee9e7d6a4e
[ "BSD-3-Clause" ]
23
2017-12-06T06:59:52.000Z
2022-02-24T00:02:25.000Z
# ---------------------------------------------------------------------- # Decorators # ---------------------------------------------------------------------- # Copyright (C) 2007-2020 The NOC Project # See LICENSE for details # ---------------------------------------------------------------------- # NOC modules from noc.core.perf import metrics from .base import cache as x_cache def cachedmethod(cache=None, key="cache-%s", lock=None, ttl=None, version=0): """ Decorator to wrap class instance or method with memoizing callable :param cache: In-memory function which follows dict protocol. None, when no in-memory caching required :param key: Key mask to convert args to string :param lock: Callable to get threading lock :param ttl: Record time-to-live :param version: External cache version :return: """ def decorator(method): if lock: def wrapper(self, *args, **kwargs): perf_key = key.replace("-%s", "").replace("-", "_") perf_key_requests = metrics["cache_requests", ("cache_key", perf_key)] perf_key_l1_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "internal") ] perf_key_l2_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "external") ] perf_key_misses = metrics["cache_misses", ("cache_key", perf_key)] perf_key_lock_acquires = metrics["cache_locks_acquires", ("cache_key", perf_key)] perf_key_requests += 1 k = key % args with lock(self): perf_key_lock_acquires += 1 if cache: # Try in-memory cache c = cache(self) if c is not None: # In-memory cache provided try: v = c[k] perf_key_l1_hits += 1 return v except KeyError: pass # Try external cache v = x_cache.get(k, version=version) if v: perf_key_l2_hits += 1 if cache: with lock(self): perf_key_lock_acquires += 1 # Backfill in-memory cache try: c[k] = v except ValueError: pass # Value too large return v # Fallback to function perf_key_misses += 1 v = method(self, *args, **kwargs) with lock(self): perf_key_lock_acquires += 1 if cache: # Backfill in-memory cache try: c[k] = v except ValueError: pass # Backfill external cache x_cache.set(k, v, ttl=ttl, version=version) # Done return v else: def wrapper(self, *args, **kwargs): perf_key = key.replace("-%s", "").replace("-", "_") perf_key_requests = metrics["cache_requests", ("cache_key", perf_key)] perf_key_l1_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "internal") ] perf_key_l2_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "external") ] perf_key_misses = metrics["cache_misses", ("cache_key", perf_key)] perf_key_requests += 1 k = key % args if cache: # Try in-memory cache c = cache(self) if c is not None: # In-memory cache provided try: v = c[k] perf_key_l1_hits += 1 return v except KeyError: pass # Try external cache v = x_cache.get(k, version=version) if v: perf_key_l2_hits += 1 if cache: # Backfill in-memory cache try: c[k] = v except ValueError: pass # Value too large return v # Fallback to function perf_key_misses += 1 v = method(self, *args, **kwargs) if cache: # Backfill in-memory cache try: c[k] = v except ValueError: pass # Backfill external cache x_cache.set(k, v, ttl=ttl, version=version) # Done return v return wrapper return decorator
39.182482
97
0.404434
from noc.core.perf import metrics from .base import cache as x_cache def cachedmethod(cache=None, key="cache-%s", lock=None, ttl=None, version=0): def decorator(method): if lock: def wrapper(self, *args, **kwargs): perf_key = key.replace("-%s", "").replace("-", "_") perf_key_requests = metrics["cache_requests", ("cache_key", perf_key)] perf_key_l1_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "internal") ] perf_key_l2_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "external") ] perf_key_misses = metrics["cache_misses", ("cache_key", perf_key)] perf_key_lock_acquires = metrics["cache_locks_acquires", ("cache_key", perf_key)] perf_key_requests += 1 k = key % args with lock(self): perf_key_lock_acquires += 1 if cache: c = cache(self) if c is not None: try: v = c[k] perf_key_l1_hits += 1 return v except KeyError: pass v = x_cache.get(k, version=version) if v: perf_key_l2_hits += 1 if cache: with lock(self): perf_key_lock_acquires += 1 try: c[k] = v except ValueError: pass return v perf_key_misses += 1 v = method(self, *args, **kwargs) with lock(self): perf_key_lock_acquires += 1 if cache: try: c[k] = v except ValueError: pass x_cache.set(k, v, ttl=ttl, version=version) return v else: def wrapper(self, *args, **kwargs): perf_key = key.replace("-%s", "").replace("-", "_") perf_key_requests = metrics["cache_requests", ("cache_key", perf_key)] perf_key_l1_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "internal") ] perf_key_l2_hits = metrics[ "cache_hits", ("cache_key", perf_key), ("cache_level", "external") ] perf_key_misses = metrics["cache_misses", ("cache_key", perf_key)] perf_key_requests += 1 k = key % args if cache: c = cache(self) if c is not None: try: v = c[k] perf_key_l1_hits += 1 return v except KeyError: pass v = x_cache.get(k, version=version) if v: perf_key_l2_hits += 1 if cache: try: c[k] = v except ValueError: pass return v perf_key_misses += 1 v = method(self, *args, **kwargs) if cache: try: c[k] = v except ValueError: pass x_cache.set(k, v, ttl=ttl, version=version) return v return wrapper return decorator
true
true
f72476bf2e961b26c53e96e9358bb4c0a54239b7
8,355
py
Python
tron/Vocab/hubCommands.py
sdss/tron
886c5c5fb6341ad85e4a9f5d6f5ecb6bbc0d8322
[ "BSD-3-Clause" ]
null
null
null
tron/Vocab/hubCommands.py
sdss/tron
886c5c5fb6341ad85e4a9f5d6f5ecb6bbc0d8322
[ "BSD-3-Clause" ]
null
null
null
tron/Vocab/hubCommands.py
sdss/tron
886c5c5fb6341ad85e4a9f5d6f5ecb6bbc0d8322
[ "BSD-3-Clause" ]
null
null
null
__all__ = ['hubCommands'] import sys import Vocab.InternalCmd as InternalCmd from tron import Misc, g, hub from tron.Hub.KV.KVDict import kvAsASCII class hubCommands(InternalCmd.InternalCmd): """ All the commands that the "hub" package provides. The user executes these from the command window: hub startNubs tspec hub status etc. """ def __init__(self, **argv): argv['safeCmds'] = r'^\s*(actors|commanders|actorInfo|version|status|ping)\s*$' argv['needsAuth'] = True InternalCmd.InternalCmd.__init__(self, 'hub', **argv) self.commands = { 'actors': self.actors, 'commanders': self.commanders, 'restart!': self.reallyReallyRestart, 'startNubs': self.startNubs, 'stopNubs': self.stopNubs, 'actorInfo': self.actorInfo, 'commands': self.commandInfo, 'setUsername': self.setUsername, 'status': self.status, 'loadWords': self.loadWords, 'getKeys': self.getKeys, 'listen': self.doListen, 'version': self.version, 'ping': self.status, 'relog': self.relog, } def version(self, cmd, finish=True): """ Return the hub's version number. """ hub.getSetHubVersion() vString = 'version=%s' % (g.KVs.getKV('hub', 'version', default='Unknown')) if finish: cmd.finish(vString) else: cmd.inform(vString) def doListen(self, cmd): """ Change what replies get sent to us. """ matched, unmatched, leftovers = cmd.match([('listen', None), ('addActors', None), ('delActors', None)]) cmdr = cmd.cmdr() if not cmdr: cmd.fail('debug=%s' % (Misc.qstr('cmdr=%s; cmd=%s' % (cmdr, cmd)))) return Misc.log('doListen', 'start: %s' % (cmdr.taster)) Misc.log('doListen', 'leftovers: %s' % (leftovers)) if 'addActors' in matched: actors = list(leftovers.keys()) Misc.log('doListen', 'addActors: %s' % (actors)) # cmd.inform('text="%s"' % (Misc.qstr("adding actors: %s" % (actors)))) cmdr.taster.addToFilter(actors, [], actors) cmd.finish() elif 'delActors' in matched: actors = list(leftovers.keys()) Misc.log('doListen', 'delActors: %s' % (actors)) # cmd.inform('text="%s"' % (Misc.qstr("removing actors: %s" % (actors)))) cmdr.taster.removeFromFilter(actors, [], actors) cmd.finish() else: cmd.fail('text="unknown listen command"') Misc.log('doListen', 'finish: %s' % (cmdr.taster)) def actors(self, cmd, finish=True): """ Return a list of the currently connected actors. """ g.actors.listSelf(cmd=cmd) if finish: cmd.finish('') def commanders(self, cmd, finish=True): """ Return a list of the currently connected commanders. """ g.commanders.listSelf(cmd=cmd) if finish: cmd.finish('') def status(self, cmd, finish=True): Misc.cfg.flush() self.version(cmd, finish=False) self.actors(cmd, finish=False) self.commanders(cmd, finish=False) if finish: cmd.finish('') def setUsername(self, cmd): """ Change the username for the cmd's commander. """ args = cmd.cmd.split() args = args[1:] if len(args) != 1: cmd.fail('cmdError="usage: setUsername newname"') return username = args[0] cmdr = cmd.cmdr() cmdr.setName(username) cmd.finish('') def stopNubs(self, cmd): """ stop a list of nubs. """ nubs = list(cmd.argDict.keys())[1:] if len(nubs) == 0: cmd.fail('text="must specify one or more nubs to stop..."') return for nub in nubs: try: cmd.inform('text=%s' % (Misc.qstr('stopping nub %s' % (nub)))) hub.stopNub(nub) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to stop nub %s: %s' % (nub, e)))) cmd.finish('') def startNubs(self, cmd): """ (re-)start a list of nubs. """ # Flush the configuration to force a reload later. This allows to change the # configuration or nubs during runtime without restarting tron. Misc.cfg.flush() nubs = list(cmd.argDict.keys())[1:] if len(nubs) == 0: cmd.fail('text="must specify one or more nubs to start..."') return for nub in nubs: try: cmd.inform('text=%s' % (Misc.qstr('(re-)starting nub %s' % (nub)))) hub.startNub(nub) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to start nub %s: %s' % (nub, e)))) cmd.finish('') def actorInfo(self, cmd): """ Get gory status about a list of actor nubs. """ # Query all actors if none are specified. names = list(cmd.argDict.keys())[1:] if len(names) == 0: names = list(g.actors.keys()) for n in names: try: nub = g.actors[n] nub.statusCmd(cmd, doFinish=False) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to query actor %s: %s' % (n, e)))) cmd.finish('') def commandInfo(self, cmd): """ Get gory status about a list of actor nubs. """ # Query all actors if none are specified. names = list(cmd.argDict.keys())[1:] if len(names) == 0: names = list(g.actors.keys()) for n in names: try: nub = g.actors[n] nub.listCommandsCmd(cmd, doFinish=False) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to query actor %s: %s' % (n, e)))) cmd.finish('') def loadWords(self, cmd, finish=True): """ (re-)load an internal vocabulary word. """ words = list(cmd.argDict.keys())[1:] if len(words) == 0: words = None Misc.log('hubCmd', 'loadWords loading %s' % (words)) try: hub.loadWords(words) except Exception as e: Misc.tback('hub.loadWords', e) cmd.fail('text=%s' % (Misc.qstr(e))) return if finish: cmd.finish() def getKeys(self, cmd): """ Return a bunch of keys for a given source. Cmd args: src - a key source name. keys - 1 or more key names. """ words = cmd.cmd.split() if len(words) < 3: cmd.fail('text="usage: getKeys srcName key1 [key2 ... keyN]"') return src = words[1] keys = words[2:] matched, unmatched = g.KVs.getValues(src, keys) Misc.log('hub.getKeys', 'matched=%s unmatched=%s' % (matched, unmatched)) for k, v in matched.items(): kvString = kvAsASCII(k, v) cmd.inform(kvString, src='hub.%s' % (src)) if unmatched: cmd.warn('text=%s' % (Misc.qstr('unmatched %s keys: %s' % (src, ', '.join(unmatched))))) cmd.finish('') def reallyReallyRestart(self, cmd): """ Restart the entire MC. Which among other things kills us now. """ cmd.warn('text=%s' % (Misc.qstr('Restarting the hub now... bye, bye, and please call back soon!'))) # Give the poller a chance to flush out the warning. g.poller.callMeIn(hub.restart, 1.0) def relog(self, cmd): """ Change where stderr goes to. """ args = cmd.cmd.split() args = args[1:] if len(args) != 1: cmd.fail('cmdError="usage: relog filename"') return filename = args[0] import os f = open(filename, 'a', 1) os.dup2(f.fileno(), 1) os.dup2(f.fileno(), 2) sys.stdout = os.fdopen(1, 'w', 1) sys.stderr = os.fdopen(2, 'w', 1) f.close() cmd.finish('text="Jeebus, you done it now, whatever it was"')
30.830258
95
0.518971
__all__ = ['hubCommands'] import sys import Vocab.InternalCmd as InternalCmd from tron import Misc, g, hub from tron.Hub.KV.KVDict import kvAsASCII class hubCommands(InternalCmd.InternalCmd): def __init__(self, **argv): argv['safeCmds'] = r'^\s*(actors|commanders|actorInfo|version|status|ping)\s*$' argv['needsAuth'] = True InternalCmd.InternalCmd.__init__(self, 'hub', **argv) self.commands = { 'actors': self.actors, 'commanders': self.commanders, 'restart!': self.reallyReallyRestart, 'startNubs': self.startNubs, 'stopNubs': self.stopNubs, 'actorInfo': self.actorInfo, 'commands': self.commandInfo, 'setUsername': self.setUsername, 'status': self.status, 'loadWords': self.loadWords, 'getKeys': self.getKeys, 'listen': self.doListen, 'version': self.version, 'ping': self.status, 'relog': self.relog, } def version(self, cmd, finish=True): hub.getSetHubVersion() vString = 'version=%s' % (g.KVs.getKV('hub', 'version', default='Unknown')) if finish: cmd.finish(vString) else: cmd.inform(vString) def doListen(self, cmd): matched, unmatched, leftovers = cmd.match([('listen', None), ('addActors', None), ('delActors', None)]) cmdr = cmd.cmdr() if not cmdr: cmd.fail('debug=%s' % (Misc.qstr('cmdr=%s; cmd=%s' % (cmdr, cmd)))) return Misc.log('doListen', 'start: %s' % (cmdr.taster)) Misc.log('doListen', 'leftovers: %s' % (leftovers)) if 'addActors' in matched: actors = list(leftovers.keys()) Misc.log('doListen', 'addActors: %s' % (actors)) cmdr.taster.addToFilter(actors, [], actors) cmd.finish() elif 'delActors' in matched: actors = list(leftovers.keys()) Misc.log('doListen', 'delActors: %s' % (actors)) cmdr.taster.removeFromFilter(actors, [], actors) cmd.finish() else: cmd.fail('text="unknown listen command"') Misc.log('doListen', 'finish: %s' % (cmdr.taster)) def actors(self, cmd, finish=True): g.actors.listSelf(cmd=cmd) if finish: cmd.finish('') def commanders(self, cmd, finish=True): g.commanders.listSelf(cmd=cmd) if finish: cmd.finish('') def status(self, cmd, finish=True): Misc.cfg.flush() self.version(cmd, finish=False) self.actors(cmd, finish=False) self.commanders(cmd, finish=False) if finish: cmd.finish('') def setUsername(self, cmd): args = cmd.cmd.split() args = args[1:] if len(args) != 1: cmd.fail('cmdError="usage: setUsername newname"') return username = args[0] cmdr = cmd.cmdr() cmdr.setName(username) cmd.finish('') def stopNubs(self, cmd): nubs = list(cmd.argDict.keys())[1:] if len(nubs) == 0: cmd.fail('text="must specify one or more nubs to stop..."') return for nub in nubs: try: cmd.inform('text=%s' % (Misc.qstr('stopping nub %s' % (nub)))) hub.stopNub(nub) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to stop nub %s: %s' % (nub, e)))) cmd.finish('') def startNubs(self, cmd): Misc.cfg.flush() nubs = list(cmd.argDict.keys())[1:] if len(nubs) == 0: cmd.fail('text="must specify one or more nubs to start..."') return for nub in nubs: try: cmd.inform('text=%s' % (Misc.qstr('(re-)starting nub %s' % (nub)))) hub.startNub(nub) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to start nub %s: %s' % (nub, e)))) cmd.finish('') def actorInfo(self, cmd): names = list(cmd.argDict.keys())[1:] if len(names) == 0: names = list(g.actors.keys()) for n in names: try: nub = g.actors[n] nub.statusCmd(cmd, doFinish=False) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to query actor %s: %s' % (n, e)))) cmd.finish('') def commandInfo(self, cmd): names = list(cmd.argDict.keys())[1:] if len(names) == 0: names = list(g.actors.keys()) for n in names: try: nub = g.actors[n] nub.listCommandsCmd(cmd, doFinish=False) except Exception as e: cmd.warn('text=%s' % (Misc.qstr('failed to query actor %s: %s' % (n, e)))) cmd.finish('') def loadWords(self, cmd, finish=True): words = list(cmd.argDict.keys())[1:] if len(words) == 0: words = None Misc.log('hubCmd', 'loadWords loading %s' % (words)) try: hub.loadWords(words) except Exception as e: Misc.tback('hub.loadWords', e) cmd.fail('text=%s' % (Misc.qstr(e))) return if finish: cmd.finish() def getKeys(self, cmd): words = cmd.cmd.split() if len(words) < 3: cmd.fail('text="usage: getKeys srcName key1 [key2 ... keyN]"') return src = words[1] keys = words[2:] matched, unmatched = g.KVs.getValues(src, keys) Misc.log('hub.getKeys', 'matched=%s unmatched=%s' % (matched, unmatched)) for k, v in matched.items(): kvString = kvAsASCII(k, v) cmd.inform(kvString, src='hub.%s' % (src)) if unmatched: cmd.warn('text=%s' % (Misc.qstr('unmatched %s keys: %s' % (src, ', '.join(unmatched))))) cmd.finish('') def reallyReallyRestart(self, cmd): cmd.warn('text=%s' % (Misc.qstr('Restarting the hub now... bye, bye, and please call back soon!'))) g.poller.callMeIn(hub.restart, 1.0) def relog(self, cmd): args = cmd.cmd.split() args = args[1:] if len(args) != 1: cmd.fail('cmdError="usage: relog filename"') return filename = args[0] import os f = open(filename, 'a', 1) os.dup2(f.fileno(), 1) os.dup2(f.fileno(), 2) sys.stdout = os.fdopen(1, 'w', 1) sys.stderr = os.fdopen(2, 'w', 1) f.close() cmd.finish('text="Jeebus, you done it now, whatever it was"')
true
true
f7247748c768db7db41eded5f66dc4d97b47480c
964
py
Python
mats/model/components/gmm2d.py
StanfordASL/MATS
b31a86eb56728fc6025c71c7202ab425b078e3e5
[ "MIT" ]
21
2020-12-03T05:27:19.000Z
2022-01-18T02:24:22.000Z
mats/model/components/gmm2d.py
StanfordASL/MATS
b31a86eb56728fc6025c71c7202ab425b078e3e5
[ "MIT" ]
1
2022-03-29T14:51:51.000Z
2022-03-29T14:51:51.000Z
mats/model/components/gmm2d.py
StanfordASL/MATS
b31a86eb56728fc6025c71c7202ab425b078e3e5
[ "MIT" ]
5
2021-01-09T18:12:47.000Z
2022-03-22T11:45:56.000Z
import torch import torch.distributions as td class GMM2D(td.MixtureSameFamily): def __init__(self, mixture_distribution, component_distribution): super(GMM2D, self).__init__(mixture_distribution, component_distribution) def mode_mode(self): mode_k = torch.argmax(self.mixture_distribution.probs[0, 0]).item() mode_gaussian = self.component_distribution.mean[:, 0, mode_k, :2] return mode_gaussian def position_log_prob(self, x): # Computing the log probability over only the positions. component_dist = td.MultivariateNormal(loc=self.component_distribution.mean[..., :2], scale_tril=self.component_distribution.scale_tril[..., :2, :2]) position_dist = td.MixtureSameFamily(self.mixture_distribution, component_dist) return position_dist.log_prob(x) @property def pis(self): return self.mixture_distribution.probs[0, 0]
40.166667
110
0.691909
import torch import torch.distributions as td class GMM2D(td.MixtureSameFamily): def __init__(self, mixture_distribution, component_distribution): super(GMM2D, self).__init__(mixture_distribution, component_distribution) def mode_mode(self): mode_k = torch.argmax(self.mixture_distribution.probs[0, 0]).item() mode_gaussian = self.component_distribution.mean[:, 0, mode_k, :2] return mode_gaussian def position_log_prob(self, x): component_dist = td.MultivariateNormal(loc=self.component_distribution.mean[..., :2], scale_tril=self.component_distribution.scale_tril[..., :2, :2]) position_dist = td.MixtureSameFamily(self.mixture_distribution, component_dist) return position_dist.log_prob(x) @property def pis(self): return self.mixture_distribution.probs[0, 0]
true
true
f72477b35e362dbce3d14f182fe8455bd0352f5f
3,916
py
Python
ironic/objects/base.py
hpproliant/ironic
4f62cd97196b2a0068700ffb17456912147778d0
[ "Apache-2.0" ]
null
null
null
ironic/objects/base.py
hpproliant/ironic
4f62cd97196b2a0068700ffb17456912147778d0
[ "Apache-2.0" ]
null
null
null
ironic/objects/base.py
hpproliant/ironic
4f62cd97196b2a0068700ffb17456912147778d0
[ "Apache-2.0" ]
null
null
null
# Copyright 2013 IBM Corp. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Ironic common internal object model""" from oslo_versionedobjects import base as object_base from ironic.objects import fields as object_fields class IronicObjectRegistry(object_base.VersionedObjectRegistry): pass class IronicObject(object_base.VersionedObject): """Base class and object factory. This forms the base of all objects that can be remoted or instantiated via RPC. Simply defining a class that inherits from this base class will make it remotely instantiatable. Objects should implement the necessary "get" classmethod routines as well as "save" object methods as appropriate. """ OBJ_SERIAL_NAMESPACE = 'ironic_object' OBJ_PROJECT_NAMESPACE = 'ironic' # TODO(lintan) Refactor these fields and create PersistentObject and # TimeStampObject like Nova when it is necessary. fields = { 'created_at': object_fields.DateTimeField(nullable=True), 'updated_at': object_fields.DateTimeField(nullable=True), } def as_dict(self): return dict((k, getattr(self, k)) for k in self.fields if hasattr(self, k)) def obj_refresh(self, loaded_object): """Applies updates for objects that inherit from base.IronicObject. Checks for updated attributes in an object. Updates are applied from the loaded object column by column in comparison with the current object. """ for field in self.fields: if (self.obj_attr_is_set(field) and self[field] != loaded_object[field]): self[field] = loaded_object[field] class IronicObjectIndirectionAPI(object_base.VersionedObjectIndirectionAPI): def __init__(self): super(IronicObjectIndirectionAPI, self).__init__() # FIXME(xek): importing here due to a cyclical import error from ironic.conductor import rpcapi as conductor_api self._conductor = conductor_api.ConductorAPI() def object_action(self, context, objinst, objmethod, args, kwargs): return self._conductor.object_action(context, objinst, objmethod, args, kwargs) def object_class_action(self, context, objname, objmethod, objver, args, kwargs): # NOTE(xek): This method is implemented for compatibility with # oslo.versionedobjects 0.10.0 and older. It will be replaced by # object_class_action_versions. versions = object_base.obj_tree_get_versions(objname) return self.object_class_action_versions( context, objname, objmethod, versions, args, kwargs) def object_class_action_versions(self, context, objname, objmethod, object_versions, args, kwargs): return self._conductor.object_class_action_versions( context, objname, objmethod, object_versions, args, kwargs) def object_backport_versions(self, context, objinst, object_versions): return self._conductor.object_backport_versions(context, objinst, object_versions) class IronicObjectSerializer(object_base.VersionedObjectSerializer): # Base class to use for object hydration OBJ_BASE_CLASS = IronicObject
40.371134
78
0.687692
from oslo_versionedobjects import base as object_base from ironic.objects import fields as object_fields class IronicObjectRegistry(object_base.VersionedObjectRegistry): pass class IronicObject(object_base.VersionedObject): OBJ_SERIAL_NAMESPACE = 'ironic_object' OBJ_PROJECT_NAMESPACE = 'ironic' fields = { 'created_at': object_fields.DateTimeField(nullable=True), 'updated_at': object_fields.DateTimeField(nullable=True), } def as_dict(self): return dict((k, getattr(self, k)) for k in self.fields if hasattr(self, k)) def obj_refresh(self, loaded_object): for field in self.fields: if (self.obj_attr_is_set(field) and self[field] != loaded_object[field]): self[field] = loaded_object[field] class IronicObjectIndirectionAPI(object_base.VersionedObjectIndirectionAPI): def __init__(self): super(IronicObjectIndirectionAPI, self).__init__() from ironic.conductor import rpcapi as conductor_api self._conductor = conductor_api.ConductorAPI() def object_action(self, context, objinst, objmethod, args, kwargs): return self._conductor.object_action(context, objinst, objmethod, args, kwargs) def object_class_action(self, context, objname, objmethod, objver, args, kwargs): versions = object_base.obj_tree_get_versions(objname) return self.object_class_action_versions( context, objname, objmethod, versions, args, kwargs) def object_class_action_versions(self, context, objname, objmethod, object_versions, args, kwargs): return self._conductor.object_class_action_versions( context, objname, objmethod, object_versions, args, kwargs) def object_backport_versions(self, context, objinst, object_versions): return self._conductor.object_backport_versions(context, objinst, object_versions) class IronicObjectSerializer(object_base.VersionedObjectSerializer): OBJ_BASE_CLASS = IronicObject
true
true
f7247810b61f545dbbf06766dccc172c15e03ef6
62,418
py
Python
superset/db_engine_specs.py
emacip/incubator-superset
594cd7096070a742209851ff9112d5bf4d16a7be
[ "Apache-2.0", "CC-BY-4.0", "MIT" ]
1
2019-02-05T04:53:37.000Z
2019-02-05T04:53:37.000Z
superset/db_engine_specs.py
mankoven/incubator-superset
bab7ee7ecf222250287e591d91b38be583c9a2f3
[ "Apache-2.0", "CC-BY-4.0", "MIT" ]
7
2021-02-02T23:08:19.000Z
2022-03-29T22:28:16.000Z
superset/db_engine_specs.py
g4brielvs/incubator-superset
83ee9178328c5193808fe356ceb3090a299477f6
[ "Apache-2.0", "CC-BY-4.0", "MIT" ]
null
null
null
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. # pylint: disable=C,R,W """Compatibility layer for different database engines This modules stores logic specific to different database engines. Things like time-related functions that are similar but not identical, or information as to expose certain features or not and how to expose them. For instance, Hive/Presto supports partitions and have a specific API to list partitions. Other databases like Vertica also support partitions but have different API to get to them. Other databases don't support partitions at all. The classes here will use a common interface to specify all this. The general idea is to use static classes and an inheritance scheme. """ from collections import namedtuple import hashlib import inspect import logging import os import re import textwrap import time from flask import g from flask_babel import lazy_gettext as _ import pandas import sqlalchemy as sqla from sqlalchemy import Column, select from sqlalchemy.engine import create_engine from sqlalchemy.engine.url import make_url from sqlalchemy.sql import quoted_name, text from sqlalchemy.sql.expression import TextAsFrom import sqlparse from werkzeug.utils import secure_filename from superset import app, conf, db, sql_parse from superset.exceptions import SupersetTemplateException from superset.utils import core as utils QueryStatus = utils.QueryStatus config = app.config tracking_url_trans = conf.get('TRACKING_URL_TRANSFORMER') hive_poll_interval = conf.get('HIVE_POLL_INTERVAL') Grain = namedtuple('Grain', 'name label function duration') builtin_time_grains = { None: 'Time Column', 'PT1S': 'second', 'PT1M': 'minute', 'PT5M': '5 minute', 'PT10M': '10 minute', 'PT15M': '15 minute', 'PT0.5H': 'half hour', 'PT1H': 'hour', 'P1D': 'day', 'P1W': 'week', 'P1M': 'month', 'P0.25Y': 'quarter', 'P1Y': 'year', '1969-12-28T00:00:00Z/P1W': 'week_start_sunday', '1969-12-29T00:00:00Z/P1W': 'week_start_monday', 'P1W/1970-01-03T00:00:00Z': 'week_ending_saturday', 'P1W/1970-01-04T00:00:00Z': 'week_ending_sunday', } def _create_time_grains_tuple(time_grains, time_grain_functions, blacklist): ret_list = [] blacklist = blacklist if blacklist else [] for duration, func in time_grain_functions.items(): if duration not in blacklist: name = time_grains.get(duration) ret_list.append(Grain(name, _(name), func, duration)) return tuple(ret_list) class LimitMethod(object): """Enum the ways that limits can be applied""" FETCH_MANY = 'fetch_many' WRAP_SQL = 'wrap_sql' FORCE_LIMIT = 'force_limit' class BaseEngineSpec(object): """Abstract class for database engine specific configurations""" engine = 'base' # str as defined in sqlalchemy.engine.engine time_grain_functions = {} time_groupby_inline = False limit_method = LimitMethod.FORCE_LIMIT time_secondary_columns = False inner_joins = True allows_subquery = True force_column_alias_quotes = False arraysize = None @classmethod def get_time_grains(cls): blacklist = config.get('TIME_GRAIN_BLACKLIST', []) grains = builtin_time_grains.copy() grains.update(config.get('TIME_GRAIN_ADDONS', {})) grain_functions = cls.time_grain_functions.copy() grain_addon_functions = config.get('TIME_GRAIN_ADDON_FUNCTIONS', {}) grain_functions.update(grain_addon_functions.get(cls.engine, {})) return _create_time_grains_tuple(grains, grain_functions, blacklist) @classmethod def fetch_data(cls, cursor, limit): if cls.arraysize: cursor.arraysize = cls.arraysize if cls.limit_method == LimitMethod.FETCH_MANY: return cursor.fetchmany(limit) return cursor.fetchall() @classmethod def epoch_to_dttm(cls): raise NotImplementedError() @classmethod def epoch_ms_to_dttm(cls): return cls.epoch_to_dttm().replace('{col}', '({col}/1000.000)') @classmethod def get_datatype(cls, type_code): if isinstance(type_code, str) and len(type_code): return type_code.upper() @classmethod def extra_table_metadata(cls, database, table_name, schema_name): """Returns engine-specific table metadata""" return {} @classmethod def apply_limit_to_sql(cls, sql, limit, database): """Alters the SQL statement to apply a LIMIT clause""" if cls.limit_method == LimitMethod.WRAP_SQL: sql = sql.strip('\t\n ;') qry = ( select('*') .select_from( TextAsFrom(text(sql), ['*']).alias('inner_qry'), ) .limit(limit) ) return database.compile_sqla_query(qry) elif LimitMethod.FORCE_LIMIT: parsed_query = sql_parse.ParsedQuery(sql) sql = parsed_query.get_query_with_new_limit(limit) return sql @classmethod def get_limit_from_sql(cls, sql): parsed_query = sql_parse.ParsedQuery(sql) return parsed_query.limit @classmethod def get_query_with_new_limit(cls, sql, limit): parsed_query = sql_parse.ParsedQuery(sql) return parsed_query.get_query_with_new_limit(limit) @staticmethod def csv_to_df(**kwargs): kwargs['filepath_or_buffer'] = \ config['UPLOAD_FOLDER'] + kwargs['filepath_or_buffer'] kwargs['encoding'] = 'utf-8' kwargs['iterator'] = True chunks = pandas.read_csv(**kwargs) df = pandas.DataFrame() df = pandas.concat(chunk for chunk in chunks) return df @staticmethod def df_to_db(df, table, **kwargs): df.to_sql(**kwargs) table.user_id = g.user.id table.schema = kwargs['schema'] table.fetch_metadata() db.session.add(table) db.session.commit() @staticmethod def create_table_from_csv(form, table): def _allowed_file(filename): # Only allow specific file extensions as specified in the config extension = os.path.splitext(filename)[1] return extension and extension[1:] in config['ALLOWED_EXTENSIONS'] filename = secure_filename(form.csv_file.data.filename) if not _allowed_file(filename): raise Exception('Invalid file type selected') kwargs = { 'filepath_or_buffer': filename, 'sep': form.sep.data, 'header': form.header.data if form.header.data else 0, 'index_col': form.index_col.data, 'mangle_dupe_cols': form.mangle_dupe_cols.data, 'skipinitialspace': form.skipinitialspace.data, 'skiprows': form.skiprows.data, 'nrows': form.nrows.data, 'skip_blank_lines': form.skip_blank_lines.data, 'parse_dates': form.parse_dates.data, 'infer_datetime_format': form.infer_datetime_format.data, 'chunksize': 10000, } df = BaseEngineSpec.csv_to_df(**kwargs) df_to_db_kwargs = { 'table': table, 'df': df, 'name': form.name.data, 'con': create_engine(form.con.data.sqlalchemy_uri_decrypted, echo=False), 'schema': form.schema.data, 'if_exists': form.if_exists.data, 'index': form.index.data, 'index_label': form.index_label.data, 'chunksize': 10000, } BaseEngineSpec.df_to_db(**df_to_db_kwargs) @classmethod def convert_dttm(cls, target_type, dttm): return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def fetch_result_sets(cls, db, datasource_type): """Returns a list of tables [schema1.table1, schema2.table2, ...] Datasource_type can be 'table' or 'view'. Empty schema corresponds to the list of full names of the all tables or views: <schema>.<result_set_name>. """ schemas = db.all_schema_names(cache=db.schema_cache_enabled, cache_timeout=db.schema_cache_timeout, force=True) all_result_sets = [] for schema in schemas: if datasource_type == 'table': all_datasource_names = db.all_table_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) elif datasource_type == 'view': all_datasource_names = db.all_view_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) all_result_sets += [ '{}.{}'.format(schema, t) for t in all_datasource_names] return all_result_sets @classmethod def handle_cursor(cls, cursor, query, session): """Handle a live cursor between the execute and fetchall calls The flow works without this method doing anything, but it allows for handling the cursor and updating progress information in the query object""" pass @classmethod def extract_error_message(cls, e): """Extract error message for queries""" return utils.error_msg_from_exception(e) @classmethod def adjust_database_uri(cls, uri, selected_schema): """Based on a URI and selected schema, return a new URI The URI here represents the URI as entered when saving the database, ``selected_schema`` is the schema currently active presumably in the SQL Lab dropdown. Based on that, for some database engine, we can return a new altered URI that connects straight to the active schema, meaning the users won't have to prefix the object names by the schema name. Some databases engines have 2 level of namespacing: database and schema (postgres, oracle, mssql, ...) For those it's probably better to not alter the database component of the URI with the schema name, it won't work. Some database drivers like presto accept '{catalog}/{schema}' in the database component of the URL, that can be handled here. """ return uri @classmethod def patch(cls): pass @classmethod def get_schema_names(cls, inspector): return sorted(inspector.get_schema_names()) @classmethod def get_table_names(cls, inspector, schema): return sorted(inspector.get_table_names(schema)) @classmethod def get_view_names(cls, inspector, schema): return sorted(inspector.get_view_names(schema)) @classmethod def where_latest_partition( cls, table_name, schema, database, qry, columns=None): return False @classmethod def _get_fields(cls, cols): return [sqla.column(c.get('name')) for c in cols] @classmethod def select_star(cls, my_db, table_name, engine, schema=None, limit=100, show_cols=False, indent=True, latest_partition=True, cols=None): fields = '*' cols = cols or [] if (show_cols or latest_partition) and not cols: cols = my_db.get_columns(table_name, schema) if show_cols: fields = cls._get_fields(cols) quote = engine.dialect.identifier_preparer.quote if schema: full_table_name = quote(schema) + '.' + quote(table_name) else: full_table_name = quote(table_name) qry = select(fields).select_from(text(full_table_name)) if limit: qry = qry.limit(limit) if latest_partition: partition_query = cls.where_latest_partition( table_name, schema, my_db, qry, columns=cols) if partition_query != False: # noqa qry = partition_query sql = my_db.compile_sqla_query(qry) if indent: sql = sqlparse.format(sql, reindent=True) return sql @classmethod def modify_url_for_impersonation(cls, url, impersonate_user, username): """ Modify the SQL Alchemy URL object with the user to impersonate if applicable. :param url: SQLAlchemy URL object :param impersonate_user: Bool indicating if impersonation is enabled :param username: Effective username """ if impersonate_user is not None and username is not None: url.username = username @classmethod def get_configuration_for_impersonation(cls, uri, impersonate_user, username): """ Return a configuration dictionary that can be merged with other configs that can set the correct properties for impersonating users :param uri: URI string :param impersonate_user: Bool indicating if impersonation is enabled :param username: Effective username :return: Dictionary with configs required for impersonation """ return {} @classmethod def execute(cls, cursor, query, **kwargs): if cls.arraysize: cursor.arraysize = cls.arraysize cursor.execute(query) @classmethod def make_label_compatible(cls, label): """ Conditionally mutate and/or quote a sql column/expression label. If force_column_alias_quotes is set to True, return the label as a sqlalchemy.sql.elements.quoted_name object to ensure that the select query and query results have same case. Otherwise return the mutated label as a regular string. """ label = cls.mutate_label(label) return quoted_name(label, True) if cls.force_column_alias_quotes else label @staticmethod def mutate_label(label): """ Most engines support mixed case aliases that can include numbers and special characters, like commas, parentheses etc. For engines that have restrictions on what types of aliases are supported, this method can be overridden to ensure that labels conform to the engine's limitations. Mutated labels should be deterministic (input label A always yields output label X) and unique (input labels A and B don't yield the same output label X). """ return label class PostgresBaseEngineSpec(BaseEngineSpec): """ Abstract class for Postgres 'like' databases """ engine = '' time_grain_functions = { None: '{col}', 'PT1S': "DATE_TRUNC('second', {col}) AT TIME ZONE 'UTC'", 'PT1M': "DATE_TRUNC('minute', {col}) AT TIME ZONE 'UTC'", 'PT1H': "DATE_TRUNC('hour', {col}) AT TIME ZONE 'UTC'", 'P1D': "DATE_TRUNC('day', {col}) AT TIME ZONE 'UTC'", 'P1W': "DATE_TRUNC('week', {col}) AT TIME ZONE 'UTC'", 'P1M': "DATE_TRUNC('month', {col}) AT TIME ZONE 'UTC'", 'P0.25Y': "DATE_TRUNC('quarter', {col}) AT TIME ZONE 'UTC'", 'P1Y': "DATE_TRUNC('year', {col}) AT TIME ZONE 'UTC'", } @classmethod def fetch_data(cls, cursor, limit): if not cursor.description: return [] if cls.limit_method == LimitMethod.FETCH_MANY: return cursor.fetchmany(limit) return cursor.fetchall() @classmethod def epoch_to_dttm(cls): return "(timestamp 'epoch' + {col} * interval '1 second')" @classmethod def convert_dttm(cls, target_type, dttm): return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) class PostgresEngineSpec(PostgresBaseEngineSpec): engine = 'postgresql' @classmethod def get_table_names(cls, inspector, schema): """Need to consider foreign tables for PostgreSQL""" tables = inspector.get_table_names(schema) tables.extend(inspector.get_foreign_table_names(schema)) return sorted(tables) class SnowflakeEngineSpec(PostgresBaseEngineSpec): engine = 'snowflake' force_column_alias_quotes = True time_grain_functions = { None: '{col}', 'PT1S': "DATE_TRUNC('SECOND', {col})", 'PT1M': "DATE_TRUNC('MINUTE', {col})", 'PT5M': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 5) * 5, \ DATE_TRUNC('HOUR', {col}))", 'PT10M': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 10) * 10, \ DATE_TRUNC('HOUR', {col}))", 'PT15M': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 15) * 15, \ DATE_TRUNC('HOUR', {col}))", 'PT0.5H': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 30) * 30, \ DATE_TRUNC('HOUR', {col}))", 'PT1H': "DATE_TRUNC('HOUR', {col})", 'P1D': "DATE_TRUNC('DAY', {col})", 'P1W': "DATE_TRUNC('WEEK', {col})", 'P1M': "DATE_TRUNC('MONTH', {col})", 'P0.25Y': "DATE_TRUNC('QUARTER', {col})", 'P1Y': "DATE_TRUNC('YEAR', {col})", } @classmethod def adjust_database_uri(cls, uri, selected_schema=None): database = uri.database if '/' in uri.database: database = uri.database.split('/')[0] if selected_schema: uri.database = database + '/' + selected_schema return uri class VerticaEngineSpec(PostgresBaseEngineSpec): engine = 'vertica' class RedshiftEngineSpec(PostgresBaseEngineSpec): engine = 'redshift' @staticmethod def mutate_label(label): """ Redshift only supports lowercase column names and aliases. :param str label: Original label which might include uppercase letters :return: String that is supported by the database """ return label.lower() class OracleEngineSpec(PostgresBaseEngineSpec): engine = 'oracle' limit_method = LimitMethod.WRAP_SQL force_column_alias_quotes = True time_grain_functions = { None: '{col}', 'PT1S': 'CAST({col} as DATE)', 'PT1M': "TRUNC(CAST({col} as DATE), 'MI')", 'PT1H': "TRUNC(CAST({col} as DATE), 'HH')", 'P1D': "TRUNC(CAST({col} as DATE), 'DDD')", 'P1W': "TRUNC(CAST({col} as DATE), 'WW')", 'P1M': "TRUNC(CAST({col} as DATE), 'MONTH')", 'P0.25Y': "TRUNC(CAST({col} as DATE), 'Q')", 'P1Y': "TRUNC(CAST({col} as DATE), 'YEAR')", } @classmethod def convert_dttm(cls, target_type, dttm): return ( """TO_TIMESTAMP('{}', 'YYYY-MM-DD"T"HH24:MI:SS.ff6')""" ).format(dttm.isoformat()) @staticmethod def mutate_label(label): """ Oracle 12.1 and earlier support a maximum of 30 byte length object names, which usually means 30 characters. :param str label: Original label which might include unsupported characters :return: String that is supported by the database """ if len(label) > 30: hashed_label = hashlib.md5(label.encode('utf-8')).hexdigest() # truncate the hash to first 30 characters return hashed_label[:30] return label class Db2EngineSpec(BaseEngineSpec): engine = 'ibm_db_sa' limit_method = LimitMethod.WRAP_SQL force_column_alias_quotes = True time_grain_functions = { None: '{col}', 'PT1S': 'CAST({col} as TIMESTAMP)' ' - MICROSECOND({col}) MICROSECONDS', 'PT1M': 'CAST({col} as TIMESTAMP)' ' - SECOND({col}) SECONDS' ' - MICROSECOND({col}) MICROSECONDS', 'PT1H': 'CAST({col} as TIMESTAMP)' ' - MINUTE({col}) MINUTES' ' - SECOND({col}) SECONDS' ' - MICROSECOND({col}) MICROSECONDS ', 'P1D': 'CAST({col} as TIMESTAMP)' ' - HOUR({col}) HOURS' ' - MINUTE({col}) MINUTES' ' - SECOND({col}) SECONDS' ' - MICROSECOND({col}) MICROSECONDS', 'P1W': '{col} - (DAYOFWEEK({col})) DAYS', 'P1M': '{col} - (DAY({col})-1) DAYS', 'P0.25Y': '{col} - (DAY({col})-1) DAYS' ' - (MONTH({col})-1) MONTHS' ' + ((QUARTER({col})-1) * 3) MONTHS', 'P1Y': '{col} - (DAY({col})-1) DAYS' ' - (MONTH({col})-1) MONTHS', } @classmethod def epoch_to_dttm(cls): return "(TIMESTAMP('1970-01-01', '00:00:00') + {col} SECONDS)" @classmethod def convert_dttm(cls, target_type, dttm): return "'{}'".format(dttm.strftime('%Y-%m-%d-%H.%M.%S')) @staticmethod def mutate_label(label): """ Db2 for z/OS supports a maximum of 30 byte length object names, which usually means 30 characters. :param str label: Original label which might include unsupported characters :return: String that is supported by the database """ if len(label) > 30: hashed_label = hashlib.md5(label.encode('utf-8')).hexdigest() # truncate the hash to first 30 characters return hashed_label[:30] return label class SqliteEngineSpec(BaseEngineSpec): engine = 'sqlite' time_grain_functions = { None: '{col}', 'PT1H': "DATETIME(STRFTIME('%Y-%m-%dT%H:00:00', {col}))", 'P1D': 'DATE({col})', 'P1W': "DATE({col}, -strftime('%W', {col}) || ' days')", 'P1M': "DATE({col}, -strftime('%d', {col}) || ' days', '+1 day')", 'P1Y': "DATETIME(STRFTIME('%Y-01-01T00:00:00', {col}))", 'P1W/1970-01-03T00:00:00Z': "DATE({col}, 'weekday 6')", '1969-12-28T00:00:00Z/P1W': "DATE({col}, 'weekday 0', '-7 days')", } @classmethod def epoch_to_dttm(cls): return "datetime({col}, 'unixepoch')" @classmethod def fetch_result_sets(cls, db, datasource_type): schemas = db.all_schema_names(cache=db.schema_cache_enabled, cache_timeout=db.schema_cache_timeout, force=True) all_result_sets = [] schema = schemas[0] if datasource_type == 'table': all_datasource_names = db.all_table_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) elif datasource_type == 'view': all_datasource_names = db.all_view_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) all_result_sets += [ '{}.{}'.format(schema, t) for t in all_datasource_names] return all_result_sets @classmethod def convert_dttm(cls, target_type, dttm): iso = dttm.isoformat().replace('T', ' ') if '.' not in iso: iso += '.000000' return "'{}'".format(iso) @classmethod def get_table_names(cls, inspector, schema): """Need to disregard the schema for Sqlite""" return sorted(inspector.get_table_names()) class MySQLEngineSpec(BaseEngineSpec): engine = 'mysql' time_grain_functions = { None: '{col}', 'PT1S': 'DATE_ADD(DATE({col}), ' 'INTERVAL (HOUR({col})*60*60 + MINUTE({col})*60' ' + SECOND({col})) SECOND)', 'PT1M': 'DATE_ADD(DATE({col}), ' 'INTERVAL (HOUR({col})*60 + MINUTE({col})) MINUTE)', 'PT1H': 'DATE_ADD(DATE({col}), ' 'INTERVAL HOUR({col}) HOUR)', 'P1D': 'DATE({col})', 'P1W': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFWEEK({col}) - 1 DAY))', 'P1M': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFMONTH({col}) - 1 DAY))', 'P0.25Y': 'MAKEDATE(YEAR({col}), 1) ' '+ INTERVAL QUARTER({col}) QUARTER - INTERVAL 1 QUARTER', 'P1Y': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFYEAR({col}) - 1 DAY))', '1969-12-29T00:00:00Z/P1W': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFWEEK(DATE_SUB({col}, INTERVAL 1 DAY)) - 1 DAY))', } type_code_map = {} # loaded from get_datatype only if needed @classmethod def convert_dttm(cls, target_type, dttm): if target_type.upper() in ('DATETIME', 'DATE'): return "STR_TO_DATE('{}', '%Y-%m-%d %H:%i:%s')".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def adjust_database_uri(cls, uri, selected_schema=None): if selected_schema: uri.database = selected_schema return uri @classmethod def get_datatype(cls, type_code): if not cls.type_code_map: # only import and store if needed at least once import MySQLdb ft = MySQLdb.constants.FIELD_TYPE cls.type_code_map = { getattr(ft, k): k for k in dir(ft) if not k.startswith('_') } datatype = type_code if isinstance(type_code, int): datatype = cls.type_code_map.get(type_code) if datatype and isinstance(datatype, str) and len(datatype): return datatype @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' @classmethod def extract_error_message(cls, e): """Extract error message for queries""" message = str(e) try: if isinstance(e.args, tuple) and len(e.args) > 1: message = e.args[1] except Exception: pass return message class PrestoEngineSpec(BaseEngineSpec): engine = 'presto' time_grain_functions = { None: '{col}', 'PT1S': "date_trunc('second', CAST({col} AS TIMESTAMP))", 'PT1M': "date_trunc('minute', CAST({col} AS TIMESTAMP))", 'PT1H': "date_trunc('hour', CAST({col} AS TIMESTAMP))", 'P1D': "date_trunc('day', CAST({col} AS TIMESTAMP))", 'P1W': "date_trunc('week', CAST({col} AS TIMESTAMP))", 'P1M': "date_trunc('month', CAST({col} AS TIMESTAMP))", 'P0.25Y': "date_trunc('quarter', CAST({col} AS TIMESTAMP))", 'P1Y': "date_trunc('year', CAST({col} AS TIMESTAMP))", 'P1W/1970-01-03T00:00:00Z': "date_add('day', 5, date_trunc('week', date_add('day', 1, \ CAST({col} AS TIMESTAMP))))", '1969-12-28T00:00:00Z/P1W': "date_add('day', -1, date_trunc('week', \ date_add('day', 1, CAST({col} AS TIMESTAMP))))", } @classmethod def get_view_names(cls, inspector, schema): """Returns an empty list get_table_names() function returns all table names and view names, and get_view_names() is not implemented in sqlalchemy_presto.py https://github.com/dropbox/PyHive/blob/e25fc8440a0686bbb7a5db5de7cb1a77bdb4167a/pyhive/sqlalchemy_presto.py """ return [] @classmethod def adjust_database_uri(cls, uri, selected_schema=None): database = uri.database if selected_schema and database: if '/' in database: database = database.split('/')[0] + '/' + selected_schema else: database += '/' + selected_schema uri.database = database return uri @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "from_iso8601_date('{}')".format(dttm.isoformat()[:10]) if tt == 'TIMESTAMP': return "from_iso8601_timestamp('{}')".format(dttm.isoformat()) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' @classmethod def fetch_result_sets(cls, db, datasource_type): """Returns a list of tables [schema1.table1, schema2.table2, ...] Datasource_type can be 'table' or 'view'. Empty schema corresponds to the list of full names of the all tables or views: <schema>.<result_set_name>. """ result_set_df = db.get_df( """SELECT table_schema, table_name FROM INFORMATION_SCHEMA.{}S ORDER BY concat(table_schema, '.', table_name)""".format( datasource_type.upper(), ), None) result_sets = [] for unused, row in result_set_df.iterrows(): result_sets.append('{}.{}'.format( row['table_schema'], row['table_name'])) return result_sets @classmethod def extra_table_metadata(cls, database, table_name, schema_name): indexes = database.get_indexes(table_name, schema_name) if not indexes: return {} cols = indexes[0].get('column_names', []) full_table_name = table_name if schema_name and '.' not in table_name: full_table_name = '{}.{}'.format(schema_name, table_name) pql = cls._partition_query(full_table_name) col_name, latest_part = cls.latest_partition( table_name, schema_name, database, show_first=True) return { 'partitions': { 'cols': cols, 'latest': {col_name: latest_part}, 'partitionQuery': pql, }, } @classmethod def handle_cursor(cls, cursor, query, session): """Updates progress information""" logging.info('Polling the cursor for progress') polled = cursor.poll() # poll returns dict -- JSON status information or ``None`` # if the query is done # https://github.com/dropbox/PyHive/blob/ # b34bdbf51378b3979eaf5eca9e956f06ddc36ca0/pyhive/presto.py#L178 while polled: # Update the object and wait for the kill signal. stats = polled.get('stats', {}) query = session.query(type(query)).filter_by(id=query.id).one() if query.status in [QueryStatus.STOPPED, QueryStatus.TIMED_OUT]: cursor.cancel() break if stats: state = stats.get('state') # if already finished, then stop polling if state == 'FINISHED': break completed_splits = float(stats.get('completedSplits')) total_splits = float(stats.get('totalSplits')) if total_splits and completed_splits: progress = 100 * (completed_splits / total_splits) logging.info( 'Query progress: {} / {} ' 'splits'.format(completed_splits, total_splits)) if progress > query.progress: query.progress = progress session.commit() time.sleep(1) logging.info('Polling the cursor for progress') polled = cursor.poll() @classmethod def extract_error_message(cls, e): if ( hasattr(e, 'orig') and type(e.orig).__name__ == 'DatabaseError' and isinstance(e.orig[0], dict)): error_dict = e.orig[0] return '{} at {}: {}'.format( error_dict.get('errorName'), error_dict.get('errorLocation'), error_dict.get('message'), ) if ( type(e).__name__ == 'DatabaseError' and hasattr(e, 'args') and len(e.args) > 0 ): error_dict = e.args[0] return error_dict.get('message') return utils.error_msg_from_exception(e) @classmethod def _partition_query( cls, table_name, limit=0, order_by=None, filters=None): """Returns a partition query :param table_name: the name of the table to get partitions from :type table_name: str :param limit: the number of partitions to be returned :type limit: int :param order_by: a list of tuples of field name and a boolean that determines if that field should be sorted in descending order :type order_by: list of (str, bool) tuples :param filters: a list of filters to apply :param filters: dict of field name and filter value combinations """ limit_clause = 'LIMIT {}'.format(limit) if limit else '' order_by_clause = '' if order_by: l = [] # noqa: E741 for field, desc in order_by: l.append(field + ' DESC' if desc else '') order_by_clause = 'ORDER BY ' + ', '.join(l) where_clause = '' if filters: l = [] # noqa: E741 for field, value in filters.items(): l.append(f"{field} = '{value}'") where_clause = 'WHERE ' + ' AND '.join(l) sql = textwrap.dedent(f"""\ SHOW PARTITIONS FROM {table_name} {where_clause} {order_by_clause} {limit_clause} """) return sql @classmethod def where_latest_partition( cls, table_name, schema, database, qry, columns=None): try: col_name, value = cls.latest_partition( table_name, schema, database, show_first=True) except Exception: # table is not partitioned return False for c in columns: if c.get('name') == col_name: return qry.where(Column(col_name) == value) return False @classmethod def _latest_partition_from_df(cls, df): recs = df.to_records(index=False) if recs: return recs[0][0] @classmethod def latest_partition(cls, table_name, schema, database, show_first=False): """Returns col name and the latest (max) partition value for a table :param table_name: the name of the table :type table_name: str :param schema: schema / database / namespace :type schema: str :param database: database query will be run against :type database: models.Database :param show_first: displays the value for the first partitioning key if there are many partitioning keys :type show_first: bool >>> latest_partition('foo_table') '2018-01-01' """ indexes = database.get_indexes(table_name, schema) if len(indexes[0]['column_names']) < 1: raise SupersetTemplateException( 'The table should have one partitioned field') elif not show_first and len(indexes[0]['column_names']) > 1: raise SupersetTemplateException( 'The table should have a single partitioned field ' 'to use this function. You may want to use ' '`presto.latest_sub_partition`') part_field = indexes[0]['column_names'][0] sql = cls._partition_query(table_name, 1, [(part_field, True)]) df = database.get_df(sql, schema) return part_field, cls._latest_partition_from_df(df) @classmethod def latest_sub_partition(cls, table_name, schema, database, **kwargs): """Returns the latest (max) partition value for a table A filtering criteria should be passed for all fields that are partitioned except for the field to be returned. For example, if a table is partitioned by (``ds``, ``event_type`` and ``event_category``) and you want the latest ``ds``, you'll want to provide a filter as keyword arguments for both ``event_type`` and ``event_category`` as in ``latest_sub_partition('my_table', event_category='page', event_type='click')`` :param table_name: the name of the table, can be just the table name or a fully qualified table name as ``schema_name.table_name`` :type table_name: str :param schema: schema / database / namespace :type schema: str :param database: database query will be run against :type database: models.Database :param kwargs: keyword arguments define the filtering criteria on the partition list. There can be many of these. :type kwargs: str >>> latest_sub_partition('sub_partition_table', event_type='click') '2018-01-01' """ indexes = database.get_indexes(table_name, schema) part_fields = indexes[0]['column_names'] for k in kwargs.keys(): if k not in k in part_fields: msg = 'Field [{k}] is not part of the portioning key' raise SupersetTemplateException(msg) if len(kwargs.keys()) != len(part_fields) - 1: msg = ( 'A filter needs to be specified for {} out of the ' '{} fields.' ).format(len(part_fields) - 1, len(part_fields)) raise SupersetTemplateException(msg) for field in part_fields: if field not in kwargs.keys(): field_to_return = field sql = cls._partition_query( table_name, 1, [(field_to_return, True)], kwargs) df = database.get_df(sql, schema) if df.empty: return '' return df.to_dict()[field_to_return][0] class HiveEngineSpec(PrestoEngineSpec): """Reuses PrestoEngineSpec functionality.""" engine = 'hive' # Scoping regex at class level to avoid recompiling # 17/02/07 19:36:38 INFO ql.Driver: Total jobs = 5 jobs_stats_r = re.compile( r'.*INFO.*Total jobs = (?P<max_jobs>[0-9]+)') # 17/02/07 19:37:08 INFO ql.Driver: Launching Job 2 out of 5 launching_job_r = re.compile( '.*INFO.*Launching Job (?P<job_number>[0-9]+) out of ' '(?P<max_jobs>[0-9]+)') # 17/02/07 19:36:58 INFO exec.Task: 2017-02-07 19:36:58,152 Stage-18 # map = 0%, reduce = 0% stage_progress_r = re.compile( r'.*INFO.*Stage-(?P<stage_number>[0-9]+).*' r'map = (?P<map_progress>[0-9]+)%.*' r'reduce = (?P<reduce_progress>[0-9]+)%.*') @classmethod def patch(cls): from pyhive import hive # pylint: disable=no-name-in-module from superset.db_engines import hive as patched_hive from TCLIService import ( constants as patched_constants, ttypes as patched_ttypes, TCLIService as patched_TCLIService) hive.TCLIService = patched_TCLIService hive.constants = patched_constants hive.ttypes = patched_ttypes hive.Cursor.fetch_logs = patched_hive.fetch_logs @classmethod def fetch_result_sets(cls, db, datasource_type): return BaseEngineSpec.fetch_result_sets( db, datasource_type) @classmethod def fetch_data(cls, cursor, limit): import pyhive from TCLIService import ttypes state = cursor.poll() if state.operationState == ttypes.TOperationState.ERROR_STATE: raise Exception('Query error', state.errorMessage) try: return super(HiveEngineSpec, cls).fetch_data(cursor, limit) except pyhive.exc.ProgrammingError: return [] @staticmethod def create_table_from_csv(form, table): """Uploads a csv file and creates a superset datasource in Hive.""" def convert_to_hive_type(col_type): """maps tableschema's types to hive types""" tableschema_to_hive_types = { 'boolean': 'BOOLEAN', 'integer': 'INT', 'number': 'DOUBLE', 'string': 'STRING', } return tableschema_to_hive_types.get(col_type, 'STRING') bucket_path = config['CSV_TO_HIVE_UPLOAD_S3_BUCKET'] if not bucket_path: logging.info('No upload bucket specified') raise Exception( 'No upload bucket specified. You can specify one in the config file.') table_name = form.name.data schema_name = form.schema.data if config.get('UPLOADED_CSV_HIVE_NAMESPACE'): if '.' in table_name or schema_name: raise Exception( "You can't specify a namespace. " 'All tables will be uploaded to the `{}` namespace'.format( config.get('HIVE_NAMESPACE'))) full_table_name = '{}.{}'.format( config.get('UPLOADED_CSV_HIVE_NAMESPACE'), table_name) else: if '.' in table_name and schema_name: raise Exception( "You can't specify a namespace both in the name of the table " 'and in the schema field. Please remove one') full_table_name = '{}.{}'.format( schema_name, table_name) if schema_name else table_name filename = form.csv_file.data.filename upload_prefix = config['CSV_TO_HIVE_UPLOAD_DIRECTORY'] upload_path = config['UPLOAD_FOLDER'] + \ secure_filename(filename) # Optional dependency from tableschema import Table # pylint: disable=import-error hive_table_schema = Table(upload_path).infer() column_name_and_type = [] for column_info in hive_table_schema['fields']: column_name_and_type.append( '`{}` {}'.format( column_info['name'], convert_to_hive_type(column_info['type']))) schema_definition = ', '.join(column_name_and_type) # Optional dependency import boto3 # pylint: disable=import-error s3 = boto3.client('s3') location = os.path.join('s3a://', bucket_path, upload_prefix, table_name) s3.upload_file( upload_path, bucket_path, os.path.join(upload_prefix, table_name, filename)) sql = f"""CREATE TABLE {full_table_name} ( {schema_definition} ) ROW FORMAT DELIMITED FIELDS TERMINATED BY ',' STORED AS TEXTFILE LOCATION '{location}' tblproperties ('skip.header.line.count'='1')""" logging.info(form.con.data) engine = create_engine(form.con.data.sqlalchemy_uri_decrypted) engine.execute(sql) @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "CAST('{}' AS DATE)".format(dttm.isoformat()[:10]) elif tt == 'TIMESTAMP': return "CAST('{}' AS TIMESTAMP)".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def adjust_database_uri(cls, uri, selected_schema=None): if selected_schema: uri.database = selected_schema return uri @classmethod def extract_error_message(cls, e): msg = str(e) match = re.search(r'errorMessage="(.*?)(?<!\\)"', msg) if match: msg = match.group(1) return msg @classmethod def progress(cls, log_lines): total_jobs = 1 # assuming there's at least 1 job current_job = 1 stages = {} for line in log_lines: match = cls.jobs_stats_r.match(line) if match: total_jobs = int(match.groupdict()['max_jobs']) or 1 match = cls.launching_job_r.match(line) if match: current_job = int(match.groupdict()['job_number']) total_jobs = int(match.groupdict()['max_jobs']) or 1 stages = {} match = cls.stage_progress_r.match(line) if match: stage_number = int(match.groupdict()['stage_number']) map_progress = int(match.groupdict()['map_progress']) reduce_progress = int(match.groupdict()['reduce_progress']) stages[stage_number] = (map_progress + reduce_progress) / 2 logging.info( 'Progress detail: {}, ' 'current job {}, ' 'total jobs: {}'.format(stages, current_job, total_jobs)) stage_progress = sum( stages.values()) / len(stages.values()) if stages else 0 progress = ( 100 * (current_job - 1) / total_jobs + stage_progress / total_jobs ) return int(progress) @classmethod def get_tracking_url(cls, log_lines): lkp = 'Tracking URL = ' for line in log_lines: if lkp in line: return line.split(lkp)[1] @classmethod def handle_cursor(cls, cursor, query, session): """Updates progress information""" from pyhive import hive # pylint: disable=no-name-in-module unfinished_states = ( hive.ttypes.TOperationState.INITIALIZED_STATE, hive.ttypes.TOperationState.RUNNING_STATE, ) polled = cursor.poll() last_log_line = 0 tracking_url = None job_id = None while polled.operationState in unfinished_states: query = session.query(type(query)).filter_by(id=query.id).one() if query.status == QueryStatus.STOPPED: cursor.cancel() break log = cursor.fetch_logs() or '' if log: log_lines = log.splitlines() progress = cls.progress(log_lines) logging.info('Progress total: {}'.format(progress)) needs_commit = False if progress > query.progress: query.progress = progress needs_commit = True if not tracking_url: tracking_url = cls.get_tracking_url(log_lines) if tracking_url: job_id = tracking_url.split('/')[-2] logging.info( 'Found the tracking url: {}'.format(tracking_url)) tracking_url = tracking_url_trans(tracking_url) logging.info( 'Transformation applied: {}'.format(tracking_url)) query.tracking_url = tracking_url logging.info('Job id: {}'.format(job_id)) needs_commit = True if job_id and len(log_lines) > last_log_line: # Wait for job id before logging things out # this allows for prefixing all log lines and becoming # searchable in something like Kibana for l in log_lines[last_log_line:]: logging.info('[{}] {}'.format(job_id, l)) last_log_line = len(log_lines) if needs_commit: session.commit() time.sleep(hive_poll_interval) polled = cursor.poll() @classmethod def where_latest_partition( cls, table_name, schema, database, qry, columns=None): try: col_name, value = cls.latest_partition( table_name, schema, database, show_first=True) except Exception: # table is not partitioned return False for c in columns: if c.get('name') == col_name: return qry.where(Column(col_name) == value) return False @classmethod def latest_sub_partition(cls, table_name, schema, database, **kwargs): # TODO(bogdan): implement` pass @classmethod def _latest_partition_from_df(cls, df): """Hive partitions look like ds={partition name}""" return df.ix[:, 0].max().split('=')[1] @classmethod def _partition_query( cls, table_name, limit=0, order_by=None, filters=None): return f'SHOW PARTITIONS {table_name}' @classmethod def modify_url_for_impersonation(cls, url, impersonate_user, username): """ Modify the SQL Alchemy URL object with the user to impersonate if applicable. :param url: SQLAlchemy URL object :param impersonate_user: Bool indicating if impersonation is enabled :param username: Effective username """ # Do nothing in the URL object since instead this should modify # the configuraiton dictionary. See get_configuration_for_impersonation pass @classmethod def get_configuration_for_impersonation(cls, uri, impersonate_user, username): """ Return a configuration dictionary that can be merged with other configs that can set the correct properties for impersonating users :param uri: URI string :param impersonate_user: Bool indicating if impersonation is enabled :param username: Effective username :return: Dictionary with configs required for impersonation """ configuration = {} url = make_url(uri) backend_name = url.get_backend_name() # Must be Hive connection, enable impersonation, and set param auth=LDAP|KERBEROS if (backend_name == 'hive' and 'auth' in url.query.keys() and impersonate_user is True and username is not None): configuration['hive.server2.proxy.user'] = username return configuration @staticmethod def execute(cursor, query, async_=False): kwargs = {'async': async_} cursor.execute(query, **kwargs) class MssqlEngineSpec(BaseEngineSpec): engine = 'mssql' epoch_to_dttm = "dateadd(S, {col}, '1970-01-01')" limit_method = LimitMethod.WRAP_SQL time_grain_functions = { None: '{col}', 'PT1S': "DATEADD(second, DATEDIFF(second, '2000-01-01', {col}), '2000-01-01')", 'PT1M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}), 0)', 'PT5M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 5 * 5, 0)', 'PT10M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 10 * 10, 0)', 'PT15M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 15 * 15, 0)', 'PT0.5H': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 30 * 30, 0)', 'PT1H': 'DATEADD(hour, DATEDIFF(hour, 0, {col}), 0)', 'P1D': 'DATEADD(day, DATEDIFF(day, 0, {col}), 0)', 'P1W': 'DATEADD(week, DATEDIFF(week, 0, {col}), 0)', 'P1M': 'DATEADD(month, DATEDIFF(month, 0, {col}), 0)', 'P0.25Y': 'DATEADD(quarter, DATEDIFF(quarter, 0, {col}), 0)', 'P1Y': 'DATEADD(year, DATEDIFF(year, 0, {col}), 0)', } @classmethod def convert_dttm(cls, target_type, dttm): return "CONVERT(DATETIME, '{}', 126)".format(dttm.isoformat()) @classmethod def fetch_data(cls, cursor, limit): data = super(MssqlEngineSpec, cls).fetch_data(cursor, limit) if len(data) != 0 and type(data[0]).__name__ == 'Row': data = [[elem for elem in r] for r in data] return data class AthenaEngineSpec(BaseEngineSpec): engine = 'awsathena' time_grain_functions = { None: '{col}', 'PT1S': "date_trunc('second', CAST({col} AS TIMESTAMP))", 'PT1M': "date_trunc('minute', CAST({col} AS TIMESTAMP))", 'PT1H': "date_trunc('hour', CAST({col} AS TIMESTAMP))", 'P1D': "date_trunc('day', CAST({col} AS TIMESTAMP))", 'P1W': "date_trunc('week', CAST({col} AS TIMESTAMP))", 'P1M': "date_trunc('month', CAST({col} AS TIMESTAMP))", 'P0.25Y': "date_trunc('quarter', CAST({col} AS TIMESTAMP))", 'P1Y': "date_trunc('year', CAST({col} AS TIMESTAMP))", 'P1W/1970-01-03T00:00:00Z': "date_add('day', 5, date_trunc('week', \ date_add('day', 1, CAST({col} AS TIMESTAMP))))", '1969-12-28T00:00:00Z/P1W': "date_add('day', -1, date_trunc('week', \ date_add('day', 1, CAST({col} AS TIMESTAMP))))", } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "from_iso8601_date('{}')".format(dttm.isoformat()[:10]) if tt == 'TIMESTAMP': return "from_iso8601_timestamp('{}')".format(dttm.isoformat()) return ("CAST ('{}' AS TIMESTAMP)" .format(dttm.strftime('%Y-%m-%d %H:%M:%S'))) @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' class ClickHouseEngineSpec(BaseEngineSpec): """Dialect for ClickHouse analytical DB.""" engine = 'clickhouse' time_secondary_columns = True time_groupby_inline = True time_grain_functions = { None: '{col}', 'PT1M': 'toStartOfMinute(toDateTime({col}))', 'PT5M': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 300)*300)', 'PT10M': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 600)*600)', 'PT15M': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 900)*900)', 'PT0.5H': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 1800)*1800)', 'PT1H': 'toStartOfHour(toDateTime({col}))', 'P1D': 'toStartOfDay(toDateTime({col}))', 'P1W': 'toMonday(toDateTime({col}))', 'P1M': 'toStartOfMonth(toDateTime({col}))', 'P0.25Y': 'toStartOfQuarter(toDateTime({col}))', 'P1Y': 'toStartOfYear(toDateTime({col}))', } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "toDate('{}')".format(dttm.strftime('%Y-%m-%d')) if tt == 'DATETIME': return "toDateTime('{}')".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) class BQEngineSpec(BaseEngineSpec): """Engine spec for Google's BigQuery As contributed by @mxmzdlv on issue #945""" engine = 'bigquery' """ https://www.python.org/dev/peps/pep-0249/#arraysize raw_connections bypass the pybigquery query execution context and deal with raw dbapi connection directly. If this value is not set, the default value is set to 1, as described here, https://googlecloudplatform.github.io/google-cloud-python/latest/_modules/google/cloud/bigquery/dbapi/cursor.html#Cursor The default value of 5000 is derived from the pybigquery. https://github.com/mxmzdlv/pybigquery/blob/d214bb089ca0807ca9aaa6ce4d5a01172d40264e/pybigquery/sqlalchemy_bigquery.py#L102 """ arraysize = 5000 time_grain_functions = { None: '{col}', 'PT1S': 'TIMESTAMP_TRUNC({col}, SECOND)', 'PT1M': 'TIMESTAMP_TRUNC({col}, MINUTE)', 'PT1H': 'TIMESTAMP_TRUNC({col}, HOUR)', 'P1D': 'TIMESTAMP_TRUNC({col}, DAY)', 'P1W': 'TIMESTAMP_TRUNC({col}, WEEK)', 'P1M': 'TIMESTAMP_TRUNC({col}, MONTH)', 'P0.25Y': 'TIMESTAMP_TRUNC({col}, QUARTER)', 'P1Y': 'TIMESTAMP_TRUNC({col}, YEAR)', } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "'{}'".format(dttm.strftime('%Y-%m-%d')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def fetch_data(cls, cursor, limit): data = super(BQEngineSpec, cls).fetch_data(cursor, limit) if len(data) != 0 and type(data[0]).__name__ == 'Row': data = [r.values() for r in data] return data @staticmethod def mutate_label(label): """ BigQuery field_name should start with a letter or underscore, contain only alphanumeric characters and be at most 128 characters long. Labels that start with a number are prefixed with an underscore. Any unsupported characters are replaced with underscores and an md5 hash is added to the end of the label to avoid possible collisions. If the resulting label exceeds 128 characters, only the md5 sum is returned. :param str label: the original label which might include unsupported characters :return: String that is supported by the database """ hashed_label = '_' + hashlib.md5(label.encode('utf-8')).hexdigest() # if label starts with number, add underscore as first character mutated_label = '_' + label if re.match(r'^\d', label) else label # replace non-alphanumeric characters with underscores mutated_label = re.sub(r'[^\w]+', '_', mutated_label) if mutated_label != label: # add md5 hash to label to avoid possible collisions mutated_label += hashed_label # return only hash if length of final label exceeds 128 chars return mutated_label if len(mutated_label) <= 128 else hashed_label @classmethod def extra_table_metadata(cls, database, table_name, schema_name): indexes = database.get_indexes(table_name, schema_name) if not indexes: return {} partitions_columns = [ index.get('column_names', []) for index in indexes if index.get('name') == 'partition' ] cluster_columns = [ index.get('column_names', []) for index in indexes if index.get('name') == 'clustering' ] return { 'partitions': { 'cols': partitions_columns, }, 'clustering': { 'cols': cluster_columns, }, } @classmethod def _get_fields(cls, cols): """ BigQuery dialect requires us to not use backtick in the fieldname which are nested. Using literal_column handles that issue. http://docs.sqlalchemy.org/en/latest/core/tutorial.html#using-more-specific-text-with-table-literal-column-and-column Also explicility specifying column names so we don't encounter duplicate column names in the result. """ return [sqla.literal_column(c.get('name')).label(c.get('name').replace('.', '__')) for c in cols] class ImpalaEngineSpec(BaseEngineSpec): """Engine spec for Cloudera's Impala""" engine = 'impala' time_grain_functions = { None: '{col}', 'PT1M': "TRUNC({col}, 'MI')", 'PT1H': "TRUNC({col}, 'HH')", 'P1D': "TRUNC({col}, 'DD')", 'P1W': "TRUNC({col}, 'WW')", 'P1M': "TRUNC({col}, 'MONTH')", 'P0.25Y': "TRUNC({col}, 'Q')", 'P1Y': "TRUNC({col}, 'YYYY')", } @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "'{}'".format(dttm.strftime('%Y-%m-%d')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def get_schema_names(cls, inspector): schemas = [row[0] for row in inspector.engine.execute('SHOW SCHEMAS') if not row[0].startswith('_')] return schemas class DruidEngineSpec(BaseEngineSpec): """Engine spec for Druid.io""" engine = 'druid' inner_joins = False allows_subquery = False time_grain_functions = { None: '{col}', 'PT1S': 'FLOOR({col} TO SECOND)', 'PT1M': 'FLOOR({col} TO MINUTE)', 'PT1H': 'FLOOR({col} TO HOUR)', 'P1D': 'FLOOR({col} TO DAY)', 'P1W': 'FLOOR({col} TO WEEK)', 'P1M': 'FLOOR({col} TO MONTH)', 'P0.25Y': 'FLOOR({col} TO QUARTER)', 'P1Y': 'FLOOR({col} TO YEAR)', } class GSheetsEngineSpec(SqliteEngineSpec): """Engine for Google spreadsheets""" engine = 'gsheets' inner_joins = False allows_subquery = False class KylinEngineSpec(BaseEngineSpec): """Dialect for Apache Kylin""" engine = 'kylin' time_grain_functions = { None: '{col}', 'PT1S': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO SECOND) AS TIMESTAMP)', 'PT1M': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO MINUTE) AS TIMESTAMP)', 'PT1H': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO HOUR) AS TIMESTAMP)', 'P1D': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO DAY) AS DATE)', 'P1W': 'CAST(TIMESTAMPADD(WEEK, WEEK(CAST({col} AS DATE)) - 1, \ FLOOR(CAST({col} AS TIMESTAMP) TO YEAR)) AS DATE)', 'P1M': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO MONTH) AS DATE)', 'P0.25Y': 'CAST(TIMESTAMPADD(QUARTER, QUARTER(CAST({col} AS DATE)) - 1, \ FLOOR(CAST({col} AS TIMESTAMP) TO YEAR)) AS DATE)', 'P1Y': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO YEAR) AS DATE)', } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "CAST('{}' AS DATE)".format(dttm.isoformat()[:10]) if tt == 'TIMESTAMP': return "CAST('{}' AS TIMESTAMP)".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) class TeradataEngineSpec(BaseEngineSpec): """Dialect for Teradata DB.""" engine = 'teradata' limit_method = LimitMethod.WRAP_SQL time_grain_functions = { None: '{col}', 'PT1M': "TRUNC(CAST({col} as DATE), 'MI')", 'PT1H': "TRUNC(CAST({col} as DATE), 'HH')", 'P1D': "TRUNC(CAST({col} as DATE), 'DDD')", 'P1W': "TRUNC(CAST({col} as DATE), 'WW')", 'P1M': "TRUNC(CAST({col} as DATE), 'MONTH')", 'P0.25Y': "TRUNC(CAST({col} as DATE), 'Q')", 'P1Y': "TRUNC(CAST({col} as DATE), 'YEAR')", } engines = { o.engine: o for o in globals().values() if inspect.isclass(o) and issubclass(o, BaseEngineSpec)}
37.829091
126
0.594156
from collections import namedtuple import hashlib import inspect import logging import os import re import textwrap import time from flask import g from flask_babel import lazy_gettext as _ import pandas import sqlalchemy as sqla from sqlalchemy import Column, select from sqlalchemy.engine import create_engine from sqlalchemy.engine.url import make_url from sqlalchemy.sql import quoted_name, text from sqlalchemy.sql.expression import TextAsFrom import sqlparse from werkzeug.utils import secure_filename from superset import app, conf, db, sql_parse from superset.exceptions import SupersetTemplateException from superset.utils import core as utils QueryStatus = utils.QueryStatus config = app.config tracking_url_trans = conf.get('TRACKING_URL_TRANSFORMER') hive_poll_interval = conf.get('HIVE_POLL_INTERVAL') Grain = namedtuple('Grain', 'name label function duration') builtin_time_grains = { None: 'Time Column', 'PT1S': 'second', 'PT1M': 'minute', 'PT5M': '5 minute', 'PT10M': '10 minute', 'PT15M': '15 minute', 'PT0.5H': 'half hour', 'PT1H': 'hour', 'P1D': 'day', 'P1W': 'week', 'P1M': 'month', 'P0.25Y': 'quarter', 'P1Y': 'year', '1969-12-28T00:00:00Z/P1W': 'week_start_sunday', '1969-12-29T00:00:00Z/P1W': 'week_start_monday', 'P1W/1970-01-03T00:00:00Z': 'week_ending_saturday', 'P1W/1970-01-04T00:00:00Z': 'week_ending_sunday', } def _create_time_grains_tuple(time_grains, time_grain_functions, blacklist): ret_list = [] blacklist = blacklist if blacklist else [] for duration, func in time_grain_functions.items(): if duration not in blacklist: name = time_grains.get(duration) ret_list.append(Grain(name, _(name), func, duration)) return tuple(ret_list) class LimitMethod(object): FETCH_MANY = 'fetch_many' WRAP_SQL = 'wrap_sql' FORCE_LIMIT = 'force_limit' class BaseEngineSpec(object): engine = 'base' time_grain_functions = {} time_groupby_inline = False limit_method = LimitMethod.FORCE_LIMIT time_secondary_columns = False inner_joins = True allows_subquery = True force_column_alias_quotes = False arraysize = None @classmethod def get_time_grains(cls): blacklist = config.get('TIME_GRAIN_BLACKLIST', []) grains = builtin_time_grains.copy() grains.update(config.get('TIME_GRAIN_ADDONS', {})) grain_functions = cls.time_grain_functions.copy() grain_addon_functions = config.get('TIME_GRAIN_ADDON_FUNCTIONS', {}) grain_functions.update(grain_addon_functions.get(cls.engine, {})) return _create_time_grains_tuple(grains, grain_functions, blacklist) @classmethod def fetch_data(cls, cursor, limit): if cls.arraysize: cursor.arraysize = cls.arraysize if cls.limit_method == LimitMethod.FETCH_MANY: return cursor.fetchmany(limit) return cursor.fetchall() @classmethod def epoch_to_dttm(cls): raise NotImplementedError() @classmethod def epoch_ms_to_dttm(cls): return cls.epoch_to_dttm().replace('{col}', '({col}/1000.000)') @classmethod def get_datatype(cls, type_code): if isinstance(type_code, str) and len(type_code): return type_code.upper() @classmethod def extra_table_metadata(cls, database, table_name, schema_name): return {} @classmethod def apply_limit_to_sql(cls, sql, limit, database): if cls.limit_method == LimitMethod.WRAP_SQL: sql = sql.strip('\t\n ;') qry = ( select('*') .select_from( TextAsFrom(text(sql), ['*']).alias('inner_qry'), ) .limit(limit) ) return database.compile_sqla_query(qry) elif LimitMethod.FORCE_LIMIT: parsed_query = sql_parse.ParsedQuery(sql) sql = parsed_query.get_query_with_new_limit(limit) return sql @classmethod def get_limit_from_sql(cls, sql): parsed_query = sql_parse.ParsedQuery(sql) return parsed_query.limit @classmethod def get_query_with_new_limit(cls, sql, limit): parsed_query = sql_parse.ParsedQuery(sql) return parsed_query.get_query_with_new_limit(limit) @staticmethod def csv_to_df(**kwargs): kwargs['filepath_or_buffer'] = \ config['UPLOAD_FOLDER'] + kwargs['filepath_or_buffer'] kwargs['encoding'] = 'utf-8' kwargs['iterator'] = True chunks = pandas.read_csv(**kwargs) df = pandas.DataFrame() df = pandas.concat(chunk for chunk in chunks) return df @staticmethod def df_to_db(df, table, **kwargs): df.to_sql(**kwargs) table.user_id = g.user.id table.schema = kwargs['schema'] table.fetch_metadata() db.session.add(table) db.session.commit() @staticmethod def create_table_from_csv(form, table): def _allowed_file(filename): extension = os.path.splitext(filename)[1] return extension and extension[1:] in config['ALLOWED_EXTENSIONS'] filename = secure_filename(form.csv_file.data.filename) if not _allowed_file(filename): raise Exception('Invalid file type selected') kwargs = { 'filepath_or_buffer': filename, 'sep': form.sep.data, 'header': form.header.data if form.header.data else 0, 'index_col': form.index_col.data, 'mangle_dupe_cols': form.mangle_dupe_cols.data, 'skipinitialspace': form.skipinitialspace.data, 'skiprows': form.skiprows.data, 'nrows': form.nrows.data, 'skip_blank_lines': form.skip_blank_lines.data, 'parse_dates': form.parse_dates.data, 'infer_datetime_format': form.infer_datetime_format.data, 'chunksize': 10000, } df = BaseEngineSpec.csv_to_df(**kwargs) df_to_db_kwargs = { 'table': table, 'df': df, 'name': form.name.data, 'con': create_engine(form.con.data.sqlalchemy_uri_decrypted, echo=False), 'schema': form.schema.data, 'if_exists': form.if_exists.data, 'index': form.index.data, 'index_label': form.index_label.data, 'chunksize': 10000, } BaseEngineSpec.df_to_db(**df_to_db_kwargs) @classmethod def convert_dttm(cls, target_type, dttm): return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def fetch_result_sets(cls, db, datasource_type): schemas = db.all_schema_names(cache=db.schema_cache_enabled, cache_timeout=db.schema_cache_timeout, force=True) all_result_sets = [] for schema in schemas: if datasource_type == 'table': all_datasource_names = db.all_table_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) elif datasource_type == 'view': all_datasource_names = db.all_view_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) all_result_sets += [ '{}.{}'.format(schema, t) for t in all_datasource_names] return all_result_sets @classmethod def handle_cursor(cls, cursor, query, session): pass @classmethod def extract_error_message(cls, e): return utils.error_msg_from_exception(e) @classmethod def adjust_database_uri(cls, uri, selected_schema): return uri @classmethod def patch(cls): pass @classmethod def get_schema_names(cls, inspector): return sorted(inspector.get_schema_names()) @classmethod def get_table_names(cls, inspector, schema): return sorted(inspector.get_table_names(schema)) @classmethod def get_view_names(cls, inspector, schema): return sorted(inspector.get_view_names(schema)) @classmethod def where_latest_partition( cls, table_name, schema, database, qry, columns=None): return False @classmethod def _get_fields(cls, cols): return [sqla.column(c.get('name')) for c in cols] @classmethod def select_star(cls, my_db, table_name, engine, schema=None, limit=100, show_cols=False, indent=True, latest_partition=True, cols=None): fields = '*' cols = cols or [] if (show_cols or latest_partition) and not cols: cols = my_db.get_columns(table_name, schema) if show_cols: fields = cls._get_fields(cols) quote = engine.dialect.identifier_preparer.quote if schema: full_table_name = quote(schema) + '.' + quote(table_name) else: full_table_name = quote(table_name) qry = select(fields).select_from(text(full_table_name)) if limit: qry = qry.limit(limit) if latest_partition: partition_query = cls.where_latest_partition( table_name, schema, my_db, qry, columns=cols) if partition_query != False: qry = partition_query sql = my_db.compile_sqla_query(qry) if indent: sql = sqlparse.format(sql, reindent=True) return sql @classmethod def modify_url_for_impersonation(cls, url, impersonate_user, username): if impersonate_user is not None and username is not None: url.username = username @classmethod def get_configuration_for_impersonation(cls, uri, impersonate_user, username): return {} @classmethod def execute(cls, cursor, query, **kwargs): if cls.arraysize: cursor.arraysize = cls.arraysize cursor.execute(query) @classmethod def make_label_compatible(cls, label): label = cls.mutate_label(label) return quoted_name(label, True) if cls.force_column_alias_quotes else label @staticmethod def mutate_label(label): return label class PostgresBaseEngineSpec(BaseEngineSpec): engine = '' time_grain_functions = { None: '{col}', 'PT1S': "DATE_TRUNC('second', {col}) AT TIME ZONE 'UTC'", 'PT1M': "DATE_TRUNC('minute', {col}) AT TIME ZONE 'UTC'", 'PT1H': "DATE_TRUNC('hour', {col}) AT TIME ZONE 'UTC'", 'P1D': "DATE_TRUNC('day', {col}) AT TIME ZONE 'UTC'", 'P1W': "DATE_TRUNC('week', {col}) AT TIME ZONE 'UTC'", 'P1M': "DATE_TRUNC('month', {col}) AT TIME ZONE 'UTC'", 'P0.25Y': "DATE_TRUNC('quarter', {col}) AT TIME ZONE 'UTC'", 'P1Y': "DATE_TRUNC('year', {col}) AT TIME ZONE 'UTC'", } @classmethod def fetch_data(cls, cursor, limit): if not cursor.description: return [] if cls.limit_method == LimitMethod.FETCH_MANY: return cursor.fetchmany(limit) return cursor.fetchall() @classmethod def epoch_to_dttm(cls): return "(timestamp 'epoch' + {col} * interval '1 second')" @classmethod def convert_dttm(cls, target_type, dttm): return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) class PostgresEngineSpec(PostgresBaseEngineSpec): engine = 'postgresql' @classmethod def get_table_names(cls, inspector, schema): tables = inspector.get_table_names(schema) tables.extend(inspector.get_foreign_table_names(schema)) return sorted(tables) class SnowflakeEngineSpec(PostgresBaseEngineSpec): engine = 'snowflake' force_column_alias_quotes = True time_grain_functions = { None: '{col}', 'PT1S': "DATE_TRUNC('SECOND', {col})", 'PT1M': "DATE_TRUNC('MINUTE', {col})", 'PT5M': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 5) * 5, \ DATE_TRUNC('HOUR', {col}))", 'PT10M': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 10) * 10, \ DATE_TRUNC('HOUR', {col}))", 'PT15M': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 15) * 15, \ DATE_TRUNC('HOUR', {col}))", 'PT0.5H': "DATEADD(MINUTE, FLOOR(DATE_PART(MINUTE, {col}) / 30) * 30, \ DATE_TRUNC('HOUR', {col}))", 'PT1H': "DATE_TRUNC('HOUR', {col})", 'P1D': "DATE_TRUNC('DAY', {col})", 'P1W': "DATE_TRUNC('WEEK', {col})", 'P1M': "DATE_TRUNC('MONTH', {col})", 'P0.25Y': "DATE_TRUNC('QUARTER', {col})", 'P1Y': "DATE_TRUNC('YEAR', {col})", } @classmethod def adjust_database_uri(cls, uri, selected_schema=None): database = uri.database if '/' in uri.database: database = uri.database.split('/')[0] if selected_schema: uri.database = database + '/' + selected_schema return uri class VerticaEngineSpec(PostgresBaseEngineSpec): engine = 'vertica' class RedshiftEngineSpec(PostgresBaseEngineSpec): engine = 'redshift' @staticmethod def mutate_label(label): return label.lower() class OracleEngineSpec(PostgresBaseEngineSpec): engine = 'oracle' limit_method = LimitMethod.WRAP_SQL force_column_alias_quotes = True time_grain_functions = { None: '{col}', 'PT1S': 'CAST({col} as DATE)', 'PT1M': "TRUNC(CAST({col} as DATE), 'MI')", 'PT1H': "TRUNC(CAST({col} as DATE), 'HH')", 'P1D': "TRUNC(CAST({col} as DATE), 'DDD')", 'P1W': "TRUNC(CAST({col} as DATE), 'WW')", 'P1M': "TRUNC(CAST({col} as DATE), 'MONTH')", 'P0.25Y': "TRUNC(CAST({col} as DATE), 'Q')", 'P1Y': "TRUNC(CAST({col} as DATE), 'YEAR')", } @classmethod def convert_dttm(cls, target_type, dttm): return ( """TO_TIMESTAMP('{}', 'YYYY-MM-DD"T"HH24:MI:SS.ff6')""" ).format(dttm.isoformat()) @staticmethod def mutate_label(label): if len(label) > 30: hashed_label = hashlib.md5(label.encode('utf-8')).hexdigest() return hashed_label[:30] return label class Db2EngineSpec(BaseEngineSpec): engine = 'ibm_db_sa' limit_method = LimitMethod.WRAP_SQL force_column_alias_quotes = True time_grain_functions = { None: '{col}', 'PT1S': 'CAST({col} as TIMESTAMP)' ' - MICROSECOND({col}) MICROSECONDS', 'PT1M': 'CAST({col} as TIMESTAMP)' ' - SECOND({col}) SECONDS' ' - MICROSECOND({col}) MICROSECONDS', 'PT1H': 'CAST({col} as TIMESTAMP)' ' - MINUTE({col}) MINUTES' ' - SECOND({col}) SECONDS' ' - MICROSECOND({col}) MICROSECONDS ', 'P1D': 'CAST({col} as TIMESTAMP)' ' - HOUR({col}) HOURS' ' - MINUTE({col}) MINUTES' ' - SECOND({col}) SECONDS' ' - MICROSECOND({col}) MICROSECONDS', 'P1W': '{col} - (DAYOFWEEK({col})) DAYS', 'P1M': '{col} - (DAY({col})-1) DAYS', 'P0.25Y': '{col} - (DAY({col})-1) DAYS' ' - (MONTH({col})-1) MONTHS' ' + ((QUARTER({col})-1) * 3) MONTHS', 'P1Y': '{col} - (DAY({col})-1) DAYS' ' - (MONTH({col})-1) MONTHS', } @classmethod def epoch_to_dttm(cls): return "(TIMESTAMP('1970-01-01', '00:00:00') + {col} SECONDS)" @classmethod def convert_dttm(cls, target_type, dttm): return "'{}'".format(dttm.strftime('%Y-%m-%d-%H.%M.%S')) @staticmethod def mutate_label(label): if len(label) > 30: hashed_label = hashlib.md5(label.encode('utf-8')).hexdigest() return hashed_label[:30] return label class SqliteEngineSpec(BaseEngineSpec): engine = 'sqlite' time_grain_functions = { None: '{col}', 'PT1H': "DATETIME(STRFTIME('%Y-%m-%dT%H:00:00', {col}))", 'P1D': 'DATE({col})', 'P1W': "DATE({col}, -strftime('%W', {col}) || ' days')", 'P1M': "DATE({col}, -strftime('%d', {col}) || ' days', '+1 day')", 'P1Y': "DATETIME(STRFTIME('%Y-01-01T00:00:00', {col}))", 'P1W/1970-01-03T00:00:00Z': "DATE({col}, 'weekday 6')", '1969-12-28T00:00:00Z/P1W': "DATE({col}, 'weekday 0', '-7 days')", } @classmethod def epoch_to_dttm(cls): return "datetime({col}, 'unixepoch')" @classmethod def fetch_result_sets(cls, db, datasource_type): schemas = db.all_schema_names(cache=db.schema_cache_enabled, cache_timeout=db.schema_cache_timeout, force=True) all_result_sets = [] schema = schemas[0] if datasource_type == 'table': all_datasource_names = db.all_table_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) elif datasource_type == 'view': all_datasource_names = db.all_view_names_in_schema( schema=schema, force=True, cache=db.table_cache_enabled, cache_timeout=db.table_cache_timeout) all_result_sets += [ '{}.{}'.format(schema, t) for t in all_datasource_names] return all_result_sets @classmethod def convert_dttm(cls, target_type, dttm): iso = dttm.isoformat().replace('T', ' ') if '.' not in iso: iso += '.000000' return "'{}'".format(iso) @classmethod def get_table_names(cls, inspector, schema): return sorted(inspector.get_table_names()) class MySQLEngineSpec(BaseEngineSpec): engine = 'mysql' time_grain_functions = { None: '{col}', 'PT1S': 'DATE_ADD(DATE({col}), ' 'INTERVAL (HOUR({col})*60*60 + MINUTE({col})*60' ' + SECOND({col})) SECOND)', 'PT1M': 'DATE_ADD(DATE({col}), ' 'INTERVAL (HOUR({col})*60 + MINUTE({col})) MINUTE)', 'PT1H': 'DATE_ADD(DATE({col}), ' 'INTERVAL HOUR({col}) HOUR)', 'P1D': 'DATE({col})', 'P1W': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFWEEK({col}) - 1 DAY))', 'P1M': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFMONTH({col}) - 1 DAY))', 'P0.25Y': 'MAKEDATE(YEAR({col}), 1) ' '+ INTERVAL QUARTER({col}) QUARTER - INTERVAL 1 QUARTER', 'P1Y': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFYEAR({col}) - 1 DAY))', '1969-12-29T00:00:00Z/P1W': 'DATE(DATE_SUB({col}, ' 'INTERVAL DAYOFWEEK(DATE_SUB({col}, INTERVAL 1 DAY)) - 1 DAY))', } type_code_map = {} @classmethod def convert_dttm(cls, target_type, dttm): if target_type.upper() in ('DATETIME', 'DATE'): return "STR_TO_DATE('{}', '%Y-%m-%d %H:%i:%s')".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def adjust_database_uri(cls, uri, selected_schema=None): if selected_schema: uri.database = selected_schema return uri @classmethod def get_datatype(cls, type_code): if not cls.type_code_map: import MySQLdb ft = MySQLdb.constants.FIELD_TYPE cls.type_code_map = { getattr(ft, k): k for k in dir(ft) if not k.startswith('_') } datatype = type_code if isinstance(type_code, int): datatype = cls.type_code_map.get(type_code) if datatype and isinstance(datatype, str) and len(datatype): return datatype @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' @classmethod def extract_error_message(cls, e): message = str(e) try: if isinstance(e.args, tuple) and len(e.args) > 1: message = e.args[1] except Exception: pass return message class PrestoEngineSpec(BaseEngineSpec): engine = 'presto' time_grain_functions = { None: '{col}', 'PT1S': "date_trunc('second', CAST({col} AS TIMESTAMP))", 'PT1M': "date_trunc('minute', CAST({col} AS TIMESTAMP))", 'PT1H': "date_trunc('hour', CAST({col} AS TIMESTAMP))", 'P1D': "date_trunc('day', CAST({col} AS TIMESTAMP))", 'P1W': "date_trunc('week', CAST({col} AS TIMESTAMP))", 'P1M': "date_trunc('month', CAST({col} AS TIMESTAMP))", 'P0.25Y': "date_trunc('quarter', CAST({col} AS TIMESTAMP))", 'P1Y': "date_trunc('year', CAST({col} AS TIMESTAMP))", 'P1W/1970-01-03T00:00:00Z': "date_add('day', 5, date_trunc('week', date_add('day', 1, \ CAST({col} AS TIMESTAMP))))", '1969-12-28T00:00:00Z/P1W': "date_add('day', -1, date_trunc('week', \ date_add('day', 1, CAST({col} AS TIMESTAMP))))", } @classmethod def get_view_names(cls, inspector, schema): return [] @classmethod def adjust_database_uri(cls, uri, selected_schema=None): database = uri.database if selected_schema and database: if '/' in database: database = database.split('/')[0] + '/' + selected_schema else: database += '/' + selected_schema uri.database = database return uri @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "from_iso8601_date('{}')".format(dttm.isoformat()[:10]) if tt == 'TIMESTAMP': return "from_iso8601_timestamp('{}')".format(dttm.isoformat()) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' @classmethod def fetch_result_sets(cls, db, datasource_type): result_set_df = db.get_df( """SELECT table_schema, table_name FROM INFORMATION_SCHEMA.{}S ORDER BY concat(table_schema, '.', table_name)""".format( datasource_type.upper(), ), None) result_sets = [] for unused, row in result_set_df.iterrows(): result_sets.append('{}.{}'.format( row['table_schema'], row['table_name'])) return result_sets @classmethod def extra_table_metadata(cls, database, table_name, schema_name): indexes = database.get_indexes(table_name, schema_name) if not indexes: return {} cols = indexes[0].get('column_names', []) full_table_name = table_name if schema_name and '.' not in table_name: full_table_name = '{}.{}'.format(schema_name, table_name) pql = cls._partition_query(full_table_name) col_name, latest_part = cls.latest_partition( table_name, schema_name, database, show_first=True) return { 'partitions': { 'cols': cols, 'latest': {col_name: latest_part}, 'partitionQuery': pql, }, } @classmethod def handle_cursor(cls, cursor, query, session): logging.info('Polling the cursor for progress') polled = cursor.poll() while polled: stats = polled.get('stats', {}) query = session.query(type(query)).filter_by(id=query.id).one() if query.status in [QueryStatus.STOPPED, QueryStatus.TIMED_OUT]: cursor.cancel() break if stats: state = stats.get('state') if state == 'FINISHED': break completed_splits = float(stats.get('completedSplits')) total_splits = float(stats.get('totalSplits')) if total_splits and completed_splits: progress = 100 * (completed_splits / total_splits) logging.info( 'Query progress: {} / {} ' 'splits'.format(completed_splits, total_splits)) if progress > query.progress: query.progress = progress session.commit() time.sleep(1) logging.info('Polling the cursor for progress') polled = cursor.poll() @classmethod def extract_error_message(cls, e): if ( hasattr(e, 'orig') and type(e.orig).__name__ == 'DatabaseError' and isinstance(e.orig[0], dict)): error_dict = e.orig[0] return '{} at {}: {}'.format( error_dict.get('errorName'), error_dict.get('errorLocation'), error_dict.get('message'), ) if ( type(e).__name__ == 'DatabaseError' and hasattr(e, 'args') and len(e.args) > 0 ): error_dict = e.args[0] return error_dict.get('message') return utils.error_msg_from_exception(e) @classmethod def _partition_query( cls, table_name, limit=0, order_by=None, filters=None): limit_clause = 'LIMIT {}'.format(limit) if limit else '' order_by_clause = '' if order_by: l = [] for field, desc in order_by: l.append(field + ' DESC' if desc else '') order_by_clause = 'ORDER BY ' + ', '.join(l) where_clause = '' if filters: l = [] for field, value in filters.items(): l.append(f"{field} = '{value}'") where_clause = 'WHERE ' + ' AND '.join(l) sql = textwrap.dedent(f"""\ SHOW PARTITIONS FROM {table_name} {where_clause} {order_by_clause} {limit_clause} """) return sql @classmethod def where_latest_partition( cls, table_name, schema, database, qry, columns=None): try: col_name, value = cls.latest_partition( table_name, schema, database, show_first=True) except Exception: return False for c in columns: if c.get('name') == col_name: return qry.where(Column(col_name) == value) return False @classmethod def _latest_partition_from_df(cls, df): recs = df.to_records(index=False) if recs: return recs[0][0] @classmethod def latest_partition(cls, table_name, schema, database, show_first=False): indexes = database.get_indexes(table_name, schema) if len(indexes[0]['column_names']) < 1: raise SupersetTemplateException( 'The table should have one partitioned field') elif not show_first and len(indexes[0]['column_names']) > 1: raise SupersetTemplateException( 'The table should have a single partitioned field ' 'to use this function. You may want to use ' '`presto.latest_sub_partition`') part_field = indexes[0]['column_names'][0] sql = cls._partition_query(table_name, 1, [(part_field, True)]) df = database.get_df(sql, schema) return part_field, cls._latest_partition_from_df(df) @classmethod def latest_sub_partition(cls, table_name, schema, database, **kwargs): indexes = database.get_indexes(table_name, schema) part_fields = indexes[0]['column_names'] for k in kwargs.keys(): if k not in k in part_fields: msg = 'Field [{k}] is not part of the portioning key' raise SupersetTemplateException(msg) if len(kwargs.keys()) != len(part_fields) - 1: msg = ( 'A filter needs to be specified for {} out of the ' '{} fields.' ).format(len(part_fields) - 1, len(part_fields)) raise SupersetTemplateException(msg) for field in part_fields: if field not in kwargs.keys(): field_to_return = field sql = cls._partition_query( table_name, 1, [(field_to_return, True)], kwargs) df = database.get_df(sql, schema) if df.empty: return '' return df.to_dict()[field_to_return][0] class HiveEngineSpec(PrestoEngineSpec): engine = 'hive' jobs_stats_r = re.compile( r'.*INFO.*Total jobs = (?P<max_jobs>[0-9]+)') launching_job_r = re.compile( '.*INFO.*Launching Job (?P<job_number>[0-9]+) out of ' '(?P<max_jobs>[0-9]+)') stage_progress_r = re.compile( r'.*INFO.*Stage-(?P<stage_number>[0-9]+).*' r'map = (?P<map_progress>[0-9]+)%.*' r'reduce = (?P<reduce_progress>[0-9]+)%.*') @classmethod def patch(cls): from pyhive import hive from superset.db_engines import hive as patched_hive from TCLIService import ( constants as patched_constants, ttypes as patched_ttypes, TCLIService as patched_TCLIService) hive.TCLIService = patched_TCLIService hive.constants = patched_constants hive.ttypes = patched_ttypes hive.Cursor.fetch_logs = patched_hive.fetch_logs @classmethod def fetch_result_sets(cls, db, datasource_type): return BaseEngineSpec.fetch_result_sets( db, datasource_type) @classmethod def fetch_data(cls, cursor, limit): import pyhive from TCLIService import ttypes state = cursor.poll() if state.operationState == ttypes.TOperationState.ERROR_STATE: raise Exception('Query error', state.errorMessage) try: return super(HiveEngineSpec, cls).fetch_data(cursor, limit) except pyhive.exc.ProgrammingError: return [] @staticmethod def create_table_from_csv(form, table): def convert_to_hive_type(col_type): tableschema_to_hive_types = { 'boolean': 'BOOLEAN', 'integer': 'INT', 'number': 'DOUBLE', 'string': 'STRING', } return tableschema_to_hive_types.get(col_type, 'STRING') bucket_path = config['CSV_TO_HIVE_UPLOAD_S3_BUCKET'] if not bucket_path: logging.info('No upload bucket specified') raise Exception( 'No upload bucket specified. You can specify one in the config file.') table_name = form.name.data schema_name = form.schema.data if config.get('UPLOADED_CSV_HIVE_NAMESPACE'): if '.' in table_name or schema_name: raise Exception( "You can't specify a namespace. " 'All tables will be uploaded to the `{}` namespace'.format( config.get('HIVE_NAMESPACE'))) full_table_name = '{}.{}'.format( config.get('UPLOADED_CSV_HIVE_NAMESPACE'), table_name) else: if '.' in table_name and schema_name: raise Exception( "You can't specify a namespace both in the name of the table " 'and in the schema field. Please remove one') full_table_name = '{}.{}'.format( schema_name, table_name) if schema_name else table_name filename = form.csv_file.data.filename upload_prefix = config['CSV_TO_HIVE_UPLOAD_DIRECTORY'] upload_path = config['UPLOAD_FOLDER'] + \ secure_filename(filename) from tableschema import Table hive_table_schema = Table(upload_path).infer() column_name_and_type = [] for column_info in hive_table_schema['fields']: column_name_and_type.append( '`{}` {}'.format( column_info['name'], convert_to_hive_type(column_info['type']))) schema_definition = ', '.join(column_name_and_type) import boto3 s3 = boto3.client('s3') location = os.path.join('s3a://', bucket_path, upload_prefix, table_name) s3.upload_file( upload_path, bucket_path, os.path.join(upload_prefix, table_name, filename)) sql = f"""CREATE TABLE {full_table_name} ( {schema_definition} ) ROW FORMAT DELIMITED FIELDS TERMINATED BY ',' STORED AS TEXTFILE LOCATION '{location}' tblproperties ('skip.header.line.count'='1')""" logging.info(form.con.data) engine = create_engine(form.con.data.sqlalchemy_uri_decrypted) engine.execute(sql) @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "CAST('{}' AS DATE)".format(dttm.isoformat()[:10]) elif tt == 'TIMESTAMP': return "CAST('{}' AS TIMESTAMP)".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def adjust_database_uri(cls, uri, selected_schema=None): if selected_schema: uri.database = selected_schema return uri @classmethod def extract_error_message(cls, e): msg = str(e) match = re.search(r'errorMessage="(.*?)(?<!\\)"', msg) if match: msg = match.group(1) return msg @classmethod def progress(cls, log_lines): total_jobs = 1 current_job = 1 stages = {} for line in log_lines: match = cls.jobs_stats_r.match(line) if match: total_jobs = int(match.groupdict()['max_jobs']) or 1 match = cls.launching_job_r.match(line) if match: current_job = int(match.groupdict()['job_number']) total_jobs = int(match.groupdict()['max_jobs']) or 1 stages = {} match = cls.stage_progress_r.match(line) if match: stage_number = int(match.groupdict()['stage_number']) map_progress = int(match.groupdict()['map_progress']) reduce_progress = int(match.groupdict()['reduce_progress']) stages[stage_number] = (map_progress + reduce_progress) / 2 logging.info( 'Progress detail: {}, ' 'current job {}, ' 'total jobs: {}'.format(stages, current_job, total_jobs)) stage_progress = sum( stages.values()) / len(stages.values()) if stages else 0 progress = ( 100 * (current_job - 1) / total_jobs + stage_progress / total_jobs ) return int(progress) @classmethod def get_tracking_url(cls, log_lines): lkp = 'Tracking URL = ' for line in log_lines: if lkp in line: return line.split(lkp)[1] @classmethod def handle_cursor(cls, cursor, query, session): from pyhive import hive # pylint: disable=no-name-in-module unfinished_states = ( hive.ttypes.TOperationState.INITIALIZED_STATE, hive.ttypes.TOperationState.RUNNING_STATE, ) polled = cursor.poll() last_log_line = 0 tracking_url = None job_id = None while polled.operationState in unfinished_states: query = session.query(type(query)).filter_by(id=query.id).one() if query.status == QueryStatus.STOPPED: cursor.cancel() break log = cursor.fetch_logs() or '' if log: log_lines = log.splitlines() progress = cls.progress(log_lines) logging.info('Progress total: {}'.format(progress)) needs_commit = False if progress > query.progress: query.progress = progress needs_commit = True if not tracking_url: tracking_url = cls.get_tracking_url(log_lines) if tracking_url: job_id = tracking_url.split('/')[-2] logging.info( 'Found the tracking url: {}'.format(tracking_url)) tracking_url = tracking_url_trans(tracking_url) logging.info( 'Transformation applied: {}'.format(tracking_url)) query.tracking_url = tracking_url logging.info('Job id: {}'.format(job_id)) needs_commit = True if job_id and len(log_lines) > last_log_line: # Wait for job id before logging things out # this allows for prefixing all log lines and becoming # searchable in something like Kibana for l in log_lines[last_log_line:]: logging.info('[{}] {}'.format(job_id, l)) last_log_line = len(log_lines) if needs_commit: session.commit() time.sleep(hive_poll_interval) polled = cursor.poll() @classmethod def where_latest_partition( cls, table_name, schema, database, qry, columns=None): try: col_name, value = cls.latest_partition( table_name, schema, database, show_first=True) except Exception: # table is not partitioned return False for c in columns: if c.get('name') == col_name: return qry.where(Column(col_name) == value) return False @classmethod def latest_sub_partition(cls, table_name, schema, database, **kwargs): # TODO(bogdan): implement` pass @classmethod def _latest_partition_from_df(cls, df): return df.ix[:, 0].max().split('=')[1] @classmethod def _partition_query( cls, table_name, limit=0, order_by=None, filters=None): return f'SHOW PARTITIONS {table_name}' @classmethod def modify_url_for_impersonation(cls, url, impersonate_user, username): # Do nothing in the URL object since instead this should modify # the configuraiton dictionary. See get_configuration_for_impersonation pass @classmethod def get_configuration_for_impersonation(cls, uri, impersonate_user, username): configuration = {} url = make_url(uri) backend_name = url.get_backend_name() # Must be Hive connection, enable impersonation, and set param auth=LDAP|KERBEROS if (backend_name == 'hive' and 'auth' in url.query.keys() and impersonate_user is True and username is not None): configuration['hive.server2.proxy.user'] = username return configuration @staticmethod def execute(cursor, query, async_=False): kwargs = {'async': async_} cursor.execute(query, **kwargs) class MssqlEngineSpec(BaseEngineSpec): engine = 'mssql' epoch_to_dttm = "dateadd(S, {col}, '1970-01-01')" limit_method = LimitMethod.WRAP_SQL time_grain_functions = { None: '{col}', 'PT1S': "DATEADD(second, DATEDIFF(second, '2000-01-01', {col}), '2000-01-01')", 'PT1M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}), 0)', 'PT5M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 5 * 5, 0)', 'PT10M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 10 * 10, 0)', 'PT15M': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 15 * 15, 0)', 'PT0.5H': 'DATEADD(minute, DATEDIFF(minute, 0, {col}) / 30 * 30, 0)', 'PT1H': 'DATEADD(hour, DATEDIFF(hour, 0, {col}), 0)', 'P1D': 'DATEADD(day, DATEDIFF(day, 0, {col}), 0)', 'P1W': 'DATEADD(week, DATEDIFF(week, 0, {col}), 0)', 'P1M': 'DATEADD(month, DATEDIFF(month, 0, {col}), 0)', 'P0.25Y': 'DATEADD(quarter, DATEDIFF(quarter, 0, {col}), 0)', 'P1Y': 'DATEADD(year, DATEDIFF(year, 0, {col}), 0)', } @classmethod def convert_dttm(cls, target_type, dttm): return "CONVERT(DATETIME, '{}', 126)".format(dttm.isoformat()) @classmethod def fetch_data(cls, cursor, limit): data = super(MssqlEngineSpec, cls).fetch_data(cursor, limit) if len(data) != 0 and type(data[0]).__name__ == 'Row': data = [[elem for elem in r] for r in data] return data class AthenaEngineSpec(BaseEngineSpec): engine = 'awsathena' time_grain_functions = { None: '{col}', 'PT1S': "date_trunc('second', CAST({col} AS TIMESTAMP))", 'PT1M': "date_trunc('minute', CAST({col} AS TIMESTAMP))", 'PT1H': "date_trunc('hour', CAST({col} AS TIMESTAMP))", 'P1D': "date_trunc('day', CAST({col} AS TIMESTAMP))", 'P1W': "date_trunc('week', CAST({col} AS TIMESTAMP))", 'P1M': "date_trunc('month', CAST({col} AS TIMESTAMP))", 'P0.25Y': "date_trunc('quarter', CAST({col} AS TIMESTAMP))", 'P1Y': "date_trunc('year', CAST({col} AS TIMESTAMP))", 'P1W/1970-01-03T00:00:00Z': "date_add('day', 5, date_trunc('week', \ date_add('day', 1, CAST({col} AS TIMESTAMP))))", '1969-12-28T00:00:00Z/P1W': "date_add('day', -1, date_trunc('week', \ date_add('day', 1, CAST({col} AS TIMESTAMP))))", } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "from_iso8601_date('{}')".format(dttm.isoformat()[:10]) if tt == 'TIMESTAMP': return "from_iso8601_timestamp('{}')".format(dttm.isoformat()) return ("CAST ('{}' AS TIMESTAMP)" .format(dttm.strftime('%Y-%m-%d %H:%M:%S'))) @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' class ClickHouseEngineSpec(BaseEngineSpec): engine = 'clickhouse' time_secondary_columns = True time_groupby_inline = True time_grain_functions = { None: '{col}', 'PT1M': 'toStartOfMinute(toDateTime({col}))', 'PT5M': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 300)*300)', 'PT10M': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 600)*600)', 'PT15M': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 900)*900)', 'PT0.5H': 'toDateTime(intDiv(toUInt32(toDateTime({col})), 1800)*1800)', 'PT1H': 'toStartOfHour(toDateTime({col}))', 'P1D': 'toStartOfDay(toDateTime({col}))', 'P1W': 'toMonday(toDateTime({col}))', 'P1M': 'toStartOfMonth(toDateTime({col}))', 'P0.25Y': 'toStartOfQuarter(toDateTime({col}))', 'P1Y': 'toStartOfYear(toDateTime({col}))', } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "toDate('{}')".format(dttm.strftime('%Y-%m-%d')) if tt == 'DATETIME': return "toDateTime('{}')".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) class BQEngineSpec(BaseEngineSpec): engine = 'bigquery' arraysize = 5000 time_grain_functions = { None: '{col}', 'PT1S': 'TIMESTAMP_TRUNC({col}, SECOND)', 'PT1M': 'TIMESTAMP_TRUNC({col}, MINUTE)', 'PT1H': 'TIMESTAMP_TRUNC({col}, HOUR)', 'P1D': 'TIMESTAMP_TRUNC({col}, DAY)', 'P1W': 'TIMESTAMP_TRUNC({col}, WEEK)', 'P1M': 'TIMESTAMP_TRUNC({col}, MONTH)', 'P0.25Y': 'TIMESTAMP_TRUNC({col}, QUARTER)', 'P1Y': 'TIMESTAMP_TRUNC({col}, YEAR)', } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "'{}'".format(dttm.strftime('%Y-%m-%d')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def fetch_data(cls, cursor, limit): data = super(BQEngineSpec, cls).fetch_data(cursor, limit) if len(data) != 0 and type(data[0]).__name__ == 'Row': data = [r.values() for r in data] return data @staticmethod def mutate_label(label): hashed_label = '_' + hashlib.md5(label.encode('utf-8')).hexdigest() # if label starts with number, add underscore as first character mutated_label = '_' + label if re.match(r'^\d', label) else label # replace non-alphanumeric characters with underscores mutated_label = re.sub(r'[^\w]+', '_', mutated_label) if mutated_label != label: # add md5 hash to label to avoid possible collisions mutated_label += hashed_label # return only hash if length of final label exceeds 128 chars return mutated_label if len(mutated_label) <= 128 else hashed_label @classmethod def extra_table_metadata(cls, database, table_name, schema_name): indexes = database.get_indexes(table_name, schema_name) if not indexes: return {} partitions_columns = [ index.get('column_names', []) for index in indexes if index.get('name') == 'partition' ] cluster_columns = [ index.get('column_names', []) for index in indexes if index.get('name') == 'clustering' ] return { 'partitions': { 'cols': partitions_columns, }, 'clustering': { 'cols': cluster_columns, }, } @classmethod def _get_fields(cls, cols): return [sqla.literal_column(c.get('name')).label(c.get('name').replace('.', '__')) for c in cols] class ImpalaEngineSpec(BaseEngineSpec): engine = 'impala' time_grain_functions = { None: '{col}', 'PT1M': "TRUNC({col}, 'MI')", 'PT1H': "TRUNC({col}, 'HH')", 'P1D': "TRUNC({col}, 'DD')", 'P1W': "TRUNC({col}, 'WW')", 'P1M': "TRUNC({col}, 'MONTH')", 'P0.25Y': "TRUNC({col}, 'Q')", 'P1Y': "TRUNC({col}, 'YYYY')", } @classmethod def epoch_to_dttm(cls): return 'from_unixtime({col})' @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "'{}'".format(dttm.strftime('%Y-%m-%d')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) @classmethod def get_schema_names(cls, inspector): schemas = [row[0] for row in inspector.engine.execute('SHOW SCHEMAS') if not row[0].startswith('_')] return schemas class DruidEngineSpec(BaseEngineSpec): engine = 'druid' inner_joins = False allows_subquery = False time_grain_functions = { None: '{col}', 'PT1S': 'FLOOR({col} TO SECOND)', 'PT1M': 'FLOOR({col} TO MINUTE)', 'PT1H': 'FLOOR({col} TO HOUR)', 'P1D': 'FLOOR({col} TO DAY)', 'P1W': 'FLOOR({col} TO WEEK)', 'P1M': 'FLOOR({col} TO MONTH)', 'P0.25Y': 'FLOOR({col} TO QUARTER)', 'P1Y': 'FLOOR({col} TO YEAR)', } class GSheetsEngineSpec(SqliteEngineSpec): engine = 'gsheets' inner_joins = False allows_subquery = False class KylinEngineSpec(BaseEngineSpec): engine = 'kylin' time_grain_functions = { None: '{col}', 'PT1S': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO SECOND) AS TIMESTAMP)', 'PT1M': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO MINUTE) AS TIMESTAMP)', 'PT1H': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO HOUR) AS TIMESTAMP)', 'P1D': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO DAY) AS DATE)', 'P1W': 'CAST(TIMESTAMPADD(WEEK, WEEK(CAST({col} AS DATE)) - 1, \ FLOOR(CAST({col} AS TIMESTAMP) TO YEAR)) AS DATE)', 'P1M': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO MONTH) AS DATE)', 'P0.25Y': 'CAST(TIMESTAMPADD(QUARTER, QUARTER(CAST({col} AS DATE)) - 1, \ FLOOR(CAST({col} AS TIMESTAMP) TO YEAR)) AS DATE)', 'P1Y': 'CAST(FLOOR(CAST({col} AS TIMESTAMP) TO YEAR) AS DATE)', } @classmethod def convert_dttm(cls, target_type, dttm): tt = target_type.upper() if tt == 'DATE': return "CAST('{}' AS DATE)".format(dttm.isoformat()[:10]) if tt == 'TIMESTAMP': return "CAST('{}' AS TIMESTAMP)".format( dttm.strftime('%Y-%m-%d %H:%M:%S')) return "'{}'".format(dttm.strftime('%Y-%m-%d %H:%M:%S')) class TeradataEngineSpec(BaseEngineSpec): engine = 'teradata' limit_method = LimitMethod.WRAP_SQL time_grain_functions = { None: '{col}', 'PT1M': "TRUNC(CAST({col} as DATE), 'MI')", 'PT1H': "TRUNC(CAST({col} as DATE), 'HH')", 'P1D': "TRUNC(CAST({col} as DATE), 'DDD')", 'P1W': "TRUNC(CAST({col} as DATE), 'WW')", 'P1M': "TRUNC(CAST({col} as DATE), 'MONTH')", 'P0.25Y': "TRUNC(CAST({col} as DATE), 'Q')", 'P1Y': "TRUNC(CAST({col} as DATE), 'YEAR')", } engines = { o.engine: o for o in globals().values() if inspect.isclass(o) and issubclass(o, BaseEngineSpec)}
true
true
f724783584f78b08b18463f09ec4dd4c262a7666
2,714
py
Python
lib/metrics.py
ppmdatix/rtdl
a01ecd9ae6b673f4e82e51f804ffd7031c7350a0
[ "Apache-2.0" ]
298
2021-06-22T15:41:18.000Z
2022-03-09T07:52:30.000Z
lib/metrics.py
ppmdatix/rtdl
a01ecd9ae6b673f4e82e51f804ffd7031c7350a0
[ "Apache-2.0" ]
15
2021-07-27T05:39:21.000Z
2022-02-25T11:33:32.000Z
lib/metrics.py
ppmdatix/rtdl
a01ecd9ae6b673f4e82e51f804ffd7031c7350a0
[ "Apache-2.0" ]
37
2021-06-25T03:56:37.000Z
2022-03-10T11:07:51.000Z
import typing as ty import numpy as np import scipy.special import sklearn.metrics as skm from . import util def calculate_metrics( task_type: str, y: np.ndarray, prediction: np.ndarray, classification_mode: str, y_info: ty.Optional[ty.Dict[str, ty.Any]], ) -> ty.Dict[str, float]: if task_type == util.REGRESSION: del classification_mode rmse = skm.mean_squared_error(y, prediction) ** 0.5 # type: ignore[code] if y_info: if y_info['policy'] == 'mean_std': rmse *= y_info['std'] else: assert False return {'rmse': rmse, 'score': -rmse} else: assert task_type in (util.BINCLASS, util.MULTICLASS) labels = None if classification_mode == 'probs': probs = prediction elif classification_mode == 'logits': probs = ( scipy.special.expit(prediction) if task_type == util.BINCLASS else scipy.special.softmax(prediction, axis=1) ) else: assert classification_mode == 'labels' probs = None labels = prediction if labels is None: labels = ( np.round(probs).astype('int64') if task_type == util.BINCLASS else probs.argmax(axis=1) # type: ignore[code] ) result = skm.classification_report(y, labels, output_dict=True) # type: ignore[code] if task_type == util.BINCLASS: result['roc_auc'] = skm.roc_auc_score(y, probs) # type: ignore[code] result['score'] = result['accuracy'] # type: ignore[code] return result # type: ignore[code] def make_summary(metrics: ty.Dict[str, ty.Any]) -> str: precision = 3 summary = {} for k, v in metrics.items(): if k.isdigit(): continue k = { 'score': 'SCORE', 'accuracy': 'acc', 'roc_auc': 'roc_auc', 'macro avg': 'm', 'weighted avg': 'w', }.get(k, k) if isinstance(v, float): v = round(v, precision) summary[k] = v else: v = { {'precision': 'p', 'recall': 'r', 'f1-score': 'f1', 'support': 's'}.get( x, x ): round(v[x], precision) for x in v } for item in v.items(): summary[k + item[0]] = item[1] s = [f'score = {summary.pop("SCORE"):.3f}'] for k, v in summary.items(): if k not in ['mp', 'mr', 'wp', 'wr']: # just to save screen space s.append(f'{k} = {v}') return ' | '.join(s)
31.55814
93
0.507369
import typing as ty import numpy as np import scipy.special import sklearn.metrics as skm from . import util def calculate_metrics( task_type: str, y: np.ndarray, prediction: np.ndarray, classification_mode: str, y_info: ty.Optional[ty.Dict[str, ty.Any]], ) -> ty.Dict[str, float]: if task_type == util.REGRESSION: del classification_mode rmse = skm.mean_squared_error(y, prediction) ** 0.5 if y_info: if y_info['policy'] == 'mean_std': rmse *= y_info['std'] else: assert False return {'rmse': rmse, 'score': -rmse} else: assert task_type in (util.BINCLASS, util.MULTICLASS) labels = None if classification_mode == 'probs': probs = prediction elif classification_mode == 'logits': probs = ( scipy.special.expit(prediction) if task_type == util.BINCLASS else scipy.special.softmax(prediction, axis=1) ) else: assert classification_mode == 'labels' probs = None labels = prediction if labels is None: labels = ( np.round(probs).astype('int64') if task_type == util.BINCLASS else probs.argmax(axis=1) ) result = skm.classification_report(y, labels, output_dict=True) if task_type == util.BINCLASS: result['roc_auc'] = skm.roc_auc_score(y, probs) result['score'] = result['accuracy'] return result def make_summary(metrics: ty.Dict[str, ty.Any]) -> str: precision = 3 summary = {} for k, v in metrics.items(): if k.isdigit(): continue k = { 'score': 'SCORE', 'accuracy': 'acc', 'roc_auc': 'roc_auc', 'macro avg': 'm', 'weighted avg': 'w', }.get(k, k) if isinstance(v, float): v = round(v, precision) summary[k] = v else: v = { {'precision': 'p', 'recall': 'r', 'f1-score': 'f1', 'support': 's'}.get( x, x ): round(v[x], precision) for x in v } for item in v.items(): summary[k + item[0]] = item[1] s = [f'score = {summary.pop("SCORE"):.3f}'] for k, v in summary.items(): if k not in ['mp', 'mr', 'wp', 'wr']: s.append(f'{k} = {v}') return ' | '.join(s)
true
true
f724797778a03ff70b6b2d2cacc77e8f0dc791c8
1,451
py
Python
api/tests.py
toast38coza/KongOAuth
827d6f0cb47c67903f0a0236f56cd20c18bb84bb
[ "MIT" ]
null
null
null
api/tests.py
toast38coza/KongOAuth
827d6f0cb47c67903f0a0236f56cd20c18bb84bb
[ "MIT" ]
null
null
null
api/tests.py
toast38coza/KongOAuth
827d6f0cb47c67903f0a0236f56cd20c18bb84bb
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.test import TestCase, override_settings from django.contrib.auth import get_user_model import json import responses ## responses: def kong_login_success(): responses.add( responses.POST, 'https://kong:8443/test/oauth2/token', body=json.dumps({'refresh_token': 'rtoken', 'token_type': 'bearer', 'access_token': 'atoken', 'expires_in': 7200}), status=200, content_type='application/json' ) class OAuthTestCase(TestCase): def login(self, data): return self.client.post('/oauth2/token/', json.dumps(data), content_type="application/json") @override_settings(KONG_GATEWAY_URL='https://kong:8443') @responses.activate def setUp(self): self.user = get_user_model().objects.create_user(username='admin', password='testtest1234') data = { "username": "admin", "password": "testtest1234", "client_id": "cliendid", "client_secret": "secret" } kong_login_success() self.result = self.login(data) def test_is_ok(self): assert self.result.status_code == 200 @responses.activate # assert no response is made def test_invalid_login_returns_401(self): data = { "username": "foo", "password": "bar", } result = self.login(data) assert result.status_code == 401
29.612245
123
0.637491
from __future__ import unicode_literals from django.test import TestCase, override_settings from django.contrib.auth import get_user_model import json import responses gin_success(): responses.add( responses.POST, 'https://kong:8443/test/oauth2/token', body=json.dumps({'refresh_token': 'rtoken', 'token_type': 'bearer', 'access_token': 'atoken', 'expires_in': 7200}), status=200, content_type='application/json' ) class OAuthTestCase(TestCase): def login(self, data): return self.client.post('/oauth2/token/', json.dumps(data), content_type="application/json") @override_settings(KONG_GATEWAY_URL='https://kong:8443') @responses.activate def setUp(self): self.user = get_user_model().objects.create_user(username='admin', password='testtest1234') data = { "username": "admin", "password": "testtest1234", "client_id": "cliendid", "client_secret": "secret" } kong_login_success() self.result = self.login(data) def test_is_ok(self): assert self.result.status_code == 200 @responses.activate def test_invalid_login_returns_401(self): data = { "username": "foo", "password": "bar", } result = self.login(data) assert result.status_code == 401
true
true
f7247a8886b4c59ba58b43b090bbe0a5d941f51a
9,304
py
Python
monai/transforms/__init__.py
marksgraham/MONAI
42591511e9493fedd70af857344cc91073b867e8
[ "Apache-2.0" ]
null
null
null
monai/transforms/__init__.py
marksgraham/MONAI
42591511e9493fedd70af857344cc91073b867e8
[ "Apache-2.0" ]
null
null
null
monai/transforms/__init__.py
marksgraham/MONAI
42591511e9493fedd70af857344cc91073b867e8
[ "Apache-2.0" ]
1
2021-01-19T19:35:00.000Z
2021-01-19T19:35:00.000Z
# Copyright 2020 - 2021 MONAI Consortium # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from .adaptors import FunctionSignature, adaptor, apply_alias, to_kwargs from .compose import Compose from .croppad.array import ( BorderPad, BoundingRect, CenterSpatialCrop, CropForeground, DivisiblePad, RandCropByPosNegLabel, RandSpatialCrop, RandSpatialCropSamples, RandWeightedCrop, ResizeWithPadOrCrop, SpatialCrop, SpatialPad, ) from .croppad.batch import PadListDataCollate from .croppad.dictionary import ( BorderPadd, BorderPadD, BorderPadDict, BoundingRectd, BoundingRectD, BoundingRectDict, CenterSpatialCropd, CenterSpatialCropD, CenterSpatialCropDict, CropForegroundd, CropForegroundD, CropForegroundDict, DivisiblePadd, DivisiblePadD, DivisiblePadDict, NumpyPadModeSequence, RandCropByPosNegLabeld, RandCropByPosNegLabelD, RandCropByPosNegLabelDict, RandSpatialCropd, RandSpatialCropD, RandSpatialCropDict, RandSpatialCropSamplesd, RandSpatialCropSamplesD, RandSpatialCropSamplesDict, RandWeightedCropd, RandWeightedCropD, RandWeightedCropDict, ResizeWithPadOrCropd, ResizeWithPadOrCropD, ResizeWithPadOrCropDict, SpatialCropd, SpatialCropD, SpatialCropDict, SpatialPadd, SpatialPadD, SpatialPadDict, ) from .intensity.array import ( AdjustContrast, DetectEnvelope, GaussianSharpen, GaussianSmooth, MaskIntensity, NormalizeIntensity, RandAdjustContrast, RandBiasField, RandGaussianNoise, RandGaussianSharpen, RandGaussianSmooth, RandHistogramShift, RandRicianNoise, RandScaleIntensity, RandShiftIntensity, RandStdShiftIntensity, SavitzkyGolaySmooth, ScaleIntensity, ScaleIntensityRange, ScaleIntensityRangePercentiles, ShiftIntensity, StdShiftIntensity, ThresholdIntensity, ) from .intensity.dictionary import ( AdjustContrastd, AdjustContrastD, AdjustContrastDict, GaussianSharpend, GaussianSharpenD, GaussianSharpenDict, GaussianSmoothd, GaussianSmoothD, GaussianSmoothDict, MaskIntensityd, MaskIntensityD, MaskIntensityDict, NormalizeIntensityd, NormalizeIntensityD, NormalizeIntensityDict, RandAdjustContrastd, RandAdjustContrastD, RandAdjustContrastDict, RandBiasFieldd, RandBiasFieldD, RandBiasFieldDict, RandGaussianNoised, RandGaussianNoiseD, RandGaussianNoiseDict, RandGaussianSharpend, RandGaussianSharpenD, RandGaussianSharpenDict, RandGaussianSmoothd, RandGaussianSmoothD, RandGaussianSmoothDict, RandHistogramShiftd, RandHistogramShiftD, RandHistogramShiftDict, RandRicianNoised, RandRicianNoiseD, RandRicianNoiseDict, RandScaleIntensityd, RandScaleIntensityD, RandScaleIntensityDict, RandShiftIntensityd, RandShiftIntensityD, RandShiftIntensityDict, RandStdShiftIntensityd, RandStdShiftIntensityD, RandStdShiftIntensityDict, ScaleIntensityd, ScaleIntensityD, ScaleIntensityDict, ScaleIntensityRanged, ScaleIntensityRangeD, ScaleIntensityRangeDict, ScaleIntensityRangePercentilesd, ScaleIntensityRangePercentilesD, ScaleIntensityRangePercentilesDict, ShiftIntensityd, ShiftIntensityD, ShiftIntensityDict, StdShiftIntensityd, StdShiftIntensityD, StdShiftIntensityDict, ThresholdIntensityd, ThresholdIntensityD, ThresholdIntensityDict, ) from .inverse import InvertibleTransform from .io.array import LoadImage, SaveImage from .io.dictionary import LoadImaged, LoadImageD, LoadImageDict, SaveImaged, SaveImageD, SaveImageDict from .post.array import ( Activations, AsDiscrete, KeepLargestConnectedComponent, LabelToContour, MeanEnsemble, ProbNMS, VoteEnsemble, ) from .post.dictionary import ( Activationsd, ActivationsD, ActivationsDict, AsDiscreted, AsDiscreteD, AsDiscreteDict, Decollated, DecollateD, DecollateDict, Ensembled, KeepLargestConnectedComponentd, KeepLargestConnectedComponentD, KeepLargestConnectedComponentDict, LabelToContourd, LabelToContourD, LabelToContourDict, MeanEnsembled, MeanEnsembleD, MeanEnsembleDict, ProbNMSd, ProbNMSD, ProbNMSDict, VoteEnsembled, VoteEnsembleD, VoteEnsembleDict, ) from .spatial.array import ( Affine, AffineGrid, Flip, Orientation, Rand2DElastic, Rand3DElastic, RandAffine, RandAffineGrid, RandAxisFlip, RandDeformGrid, RandFlip, RandRotate, RandRotate90, RandZoom, Resample, Resize, Rotate, Rotate90, Spacing, Zoom, ) from .spatial.dictionary import ( Affined, AffineD, AffineDict, Flipd, FlipD, FlipDict, Orientationd, OrientationD, OrientationDict, Rand2DElasticd, Rand2DElasticD, Rand2DElasticDict, Rand3DElasticd, Rand3DElasticD, Rand3DElasticDict, RandAffined, RandAffineD, RandAffineDict, RandAxisFlipd, RandAxisFlipD, RandAxisFlipDict, RandFlipd, RandFlipD, RandFlipDict, RandRotate90d, RandRotate90D, RandRotate90Dict, RandRotated, RandRotateD, RandRotateDict, RandZoomd, RandZoomD, RandZoomDict, Resized, ResizeD, ResizeDict, Rotate90d, Rotate90D, Rotate90Dict, Rotated, RotateD, RotateDict, Spacingd, SpacingD, SpacingDict, Zoomd, ZoomD, ZoomDict, ) from .transform import MapTransform, Randomizable, RandomizableTransform, Transform, apply_transform from .utility.array import ( AddChannel, AddExtremePointsChannel, AsChannelFirst, AsChannelLast, CastToType, ConvertToMultiChannelBasedOnBratsClasses, DataStats, EnsureChannelFirst, FgBgToIndices, Identity, LabelToMask, Lambda, MapLabelValue, RemoveRepeatedChannel, RepeatChannel, SimulateDelay, SplitChannel, SqueezeDim, ToCupy, ToNumpy, ToPIL, TorchVision, ToTensor, Transpose, ) from .utility.dictionary import ( AddChanneld, AddChannelD, AddChannelDict, AddExtremePointsChanneld, AddExtremePointsChannelD, AddExtremePointsChannelDict, AsChannelFirstd, AsChannelFirstD, AsChannelFirstDict, AsChannelLastd, AsChannelLastD, AsChannelLastDict, CastToTyped, CastToTypeD, CastToTypeDict, ConcatItemsd, ConcatItemsD, ConcatItemsDict, ConvertToMultiChannelBasedOnBratsClassesd, ConvertToMultiChannelBasedOnBratsClassesD, ConvertToMultiChannelBasedOnBratsClassesDict, CopyItemsd, CopyItemsD, CopyItemsDict, DataStatsd, DataStatsD, DataStatsDict, DeleteItemsd, DeleteItemsD, DeleteItemsDict, EnsureChannelFirstd, EnsureChannelFirstD, EnsureChannelFirstDict, FgBgToIndicesd, FgBgToIndicesD, FgBgToIndicesDict, Identityd, IdentityD, IdentityDict, LabelToMaskd, LabelToMaskD, LabelToMaskDict, Lambdad, LambdaD, LambdaDict, MapLabelValued, MapLabelValueD, MapLabelValueDict, RandLambdad, RandLambdaD, RandLambdaDict, RandTorchVisiond, RandTorchVisionD, RandTorchVisionDict, RemoveRepeatedChanneld, RemoveRepeatedChannelD, RemoveRepeatedChannelDict, RepeatChanneld, RepeatChannelD, RepeatChannelDict, SelectItemsd, SelectItemsD, SelectItemsDict, SimulateDelayd, SimulateDelayD, SimulateDelayDict, SplitChanneld, SplitChannelD, SplitChannelDict, SqueezeDimd, SqueezeDimD, SqueezeDimDict, ToCupyd, ToCupyD, ToCupyDict, ToNumpyd, ToNumpyD, ToNumpyDict, ToPILd, ToPILD, ToPILDict, TorchVisiond, TorchVisionD, TorchVisionDict, ToTensord, ToTensorD, ToTensorDict, Transposed, TransposeD, TransposeDict, ) from .utils import ( allow_missing_keys_mode, compute_divisible_spatial_size, convert_inverse_interp_mode, copypaste_arrays, create_control_grid, create_grid, create_rotate, create_scale, create_shear, create_translate, extreme_points_to_image, generate_pos_neg_label_crop_centers, generate_spatial_bounding_box, get_extreme_points, get_largest_connected_component_mask, img_bounds, in_bounds, is_empty, is_positive, map_binary_to_indices, map_spatial_axes, rand_choice, rescale_array, rescale_array_int_max, rescale_instance_array, resize_center, weighted_patch_samples, zero_margins, )
22.258373
103
0.725064
from .adaptors import FunctionSignature, adaptor, apply_alias, to_kwargs from .compose import Compose from .croppad.array import ( BorderPad, BoundingRect, CenterSpatialCrop, CropForeground, DivisiblePad, RandCropByPosNegLabel, RandSpatialCrop, RandSpatialCropSamples, RandWeightedCrop, ResizeWithPadOrCrop, SpatialCrop, SpatialPad, ) from .croppad.batch import PadListDataCollate from .croppad.dictionary import ( BorderPadd, BorderPadD, BorderPadDict, BoundingRectd, BoundingRectD, BoundingRectDict, CenterSpatialCropd, CenterSpatialCropD, CenterSpatialCropDict, CropForegroundd, CropForegroundD, CropForegroundDict, DivisiblePadd, DivisiblePadD, DivisiblePadDict, NumpyPadModeSequence, RandCropByPosNegLabeld, RandCropByPosNegLabelD, RandCropByPosNegLabelDict, RandSpatialCropd, RandSpatialCropD, RandSpatialCropDict, RandSpatialCropSamplesd, RandSpatialCropSamplesD, RandSpatialCropSamplesDict, RandWeightedCropd, RandWeightedCropD, RandWeightedCropDict, ResizeWithPadOrCropd, ResizeWithPadOrCropD, ResizeWithPadOrCropDict, SpatialCropd, SpatialCropD, SpatialCropDict, SpatialPadd, SpatialPadD, SpatialPadDict, ) from .intensity.array import ( AdjustContrast, DetectEnvelope, GaussianSharpen, GaussianSmooth, MaskIntensity, NormalizeIntensity, RandAdjustContrast, RandBiasField, RandGaussianNoise, RandGaussianSharpen, RandGaussianSmooth, RandHistogramShift, RandRicianNoise, RandScaleIntensity, RandShiftIntensity, RandStdShiftIntensity, SavitzkyGolaySmooth, ScaleIntensity, ScaleIntensityRange, ScaleIntensityRangePercentiles, ShiftIntensity, StdShiftIntensity, ThresholdIntensity, ) from .intensity.dictionary import ( AdjustContrastd, AdjustContrastD, AdjustContrastDict, GaussianSharpend, GaussianSharpenD, GaussianSharpenDict, GaussianSmoothd, GaussianSmoothD, GaussianSmoothDict, MaskIntensityd, MaskIntensityD, MaskIntensityDict, NormalizeIntensityd, NormalizeIntensityD, NormalizeIntensityDict, RandAdjustContrastd, RandAdjustContrastD, RandAdjustContrastDict, RandBiasFieldd, RandBiasFieldD, RandBiasFieldDict, RandGaussianNoised, RandGaussianNoiseD, RandGaussianNoiseDict, RandGaussianSharpend, RandGaussianSharpenD, RandGaussianSharpenDict, RandGaussianSmoothd, RandGaussianSmoothD, RandGaussianSmoothDict, RandHistogramShiftd, RandHistogramShiftD, RandHistogramShiftDict, RandRicianNoised, RandRicianNoiseD, RandRicianNoiseDict, RandScaleIntensityd, RandScaleIntensityD, RandScaleIntensityDict, RandShiftIntensityd, RandShiftIntensityD, RandShiftIntensityDict, RandStdShiftIntensityd, RandStdShiftIntensityD, RandStdShiftIntensityDict, ScaleIntensityd, ScaleIntensityD, ScaleIntensityDict, ScaleIntensityRanged, ScaleIntensityRangeD, ScaleIntensityRangeDict, ScaleIntensityRangePercentilesd, ScaleIntensityRangePercentilesD, ScaleIntensityRangePercentilesDict, ShiftIntensityd, ShiftIntensityD, ShiftIntensityDict, StdShiftIntensityd, StdShiftIntensityD, StdShiftIntensityDict, ThresholdIntensityd, ThresholdIntensityD, ThresholdIntensityDict, ) from .inverse import InvertibleTransform from .io.array import LoadImage, SaveImage from .io.dictionary import LoadImaged, LoadImageD, LoadImageDict, SaveImaged, SaveImageD, SaveImageDict from .post.array import ( Activations, AsDiscrete, KeepLargestConnectedComponent, LabelToContour, MeanEnsemble, ProbNMS, VoteEnsemble, ) from .post.dictionary import ( Activationsd, ActivationsD, ActivationsDict, AsDiscreted, AsDiscreteD, AsDiscreteDict, Decollated, DecollateD, DecollateDict, Ensembled, KeepLargestConnectedComponentd, KeepLargestConnectedComponentD, KeepLargestConnectedComponentDict, LabelToContourd, LabelToContourD, LabelToContourDict, MeanEnsembled, MeanEnsembleD, MeanEnsembleDict, ProbNMSd, ProbNMSD, ProbNMSDict, VoteEnsembled, VoteEnsembleD, VoteEnsembleDict, ) from .spatial.array import ( Affine, AffineGrid, Flip, Orientation, Rand2DElastic, Rand3DElastic, RandAffine, RandAffineGrid, RandAxisFlip, RandDeformGrid, RandFlip, RandRotate, RandRotate90, RandZoom, Resample, Resize, Rotate, Rotate90, Spacing, Zoom, ) from .spatial.dictionary import ( Affined, AffineD, AffineDict, Flipd, FlipD, FlipDict, Orientationd, OrientationD, OrientationDict, Rand2DElasticd, Rand2DElasticD, Rand2DElasticDict, Rand3DElasticd, Rand3DElasticD, Rand3DElasticDict, RandAffined, RandAffineD, RandAffineDict, RandAxisFlipd, RandAxisFlipD, RandAxisFlipDict, RandFlipd, RandFlipD, RandFlipDict, RandRotate90d, RandRotate90D, RandRotate90Dict, RandRotated, RandRotateD, RandRotateDict, RandZoomd, RandZoomD, RandZoomDict, Resized, ResizeD, ResizeDict, Rotate90d, Rotate90D, Rotate90Dict, Rotated, RotateD, RotateDict, Spacingd, SpacingD, SpacingDict, Zoomd, ZoomD, ZoomDict, ) from .transform import MapTransform, Randomizable, RandomizableTransform, Transform, apply_transform from .utility.array import ( AddChannel, AddExtremePointsChannel, AsChannelFirst, AsChannelLast, CastToType, ConvertToMultiChannelBasedOnBratsClasses, DataStats, EnsureChannelFirst, FgBgToIndices, Identity, LabelToMask, Lambda, MapLabelValue, RemoveRepeatedChannel, RepeatChannel, SimulateDelay, SplitChannel, SqueezeDim, ToCupy, ToNumpy, ToPIL, TorchVision, ToTensor, Transpose, ) from .utility.dictionary import ( AddChanneld, AddChannelD, AddChannelDict, AddExtremePointsChanneld, AddExtremePointsChannelD, AddExtremePointsChannelDict, AsChannelFirstd, AsChannelFirstD, AsChannelFirstDict, AsChannelLastd, AsChannelLastD, AsChannelLastDict, CastToTyped, CastToTypeD, CastToTypeDict, ConcatItemsd, ConcatItemsD, ConcatItemsDict, ConvertToMultiChannelBasedOnBratsClassesd, ConvertToMultiChannelBasedOnBratsClassesD, ConvertToMultiChannelBasedOnBratsClassesDict, CopyItemsd, CopyItemsD, CopyItemsDict, DataStatsd, DataStatsD, DataStatsDict, DeleteItemsd, DeleteItemsD, DeleteItemsDict, EnsureChannelFirstd, EnsureChannelFirstD, EnsureChannelFirstDict, FgBgToIndicesd, FgBgToIndicesD, FgBgToIndicesDict, Identityd, IdentityD, IdentityDict, LabelToMaskd, LabelToMaskD, LabelToMaskDict, Lambdad, LambdaD, LambdaDict, MapLabelValued, MapLabelValueD, MapLabelValueDict, RandLambdad, RandLambdaD, RandLambdaDict, RandTorchVisiond, RandTorchVisionD, RandTorchVisionDict, RemoveRepeatedChanneld, RemoveRepeatedChannelD, RemoveRepeatedChannelDict, RepeatChanneld, RepeatChannelD, RepeatChannelDict, SelectItemsd, SelectItemsD, SelectItemsDict, SimulateDelayd, SimulateDelayD, SimulateDelayDict, SplitChanneld, SplitChannelD, SplitChannelDict, SqueezeDimd, SqueezeDimD, SqueezeDimDict, ToCupyd, ToCupyD, ToCupyDict, ToNumpyd, ToNumpyD, ToNumpyDict, ToPILd, ToPILD, ToPILDict, TorchVisiond, TorchVisionD, TorchVisionDict, ToTensord, ToTensorD, ToTensorDict, Transposed, TransposeD, TransposeDict, ) from .utils import ( allow_missing_keys_mode, compute_divisible_spatial_size, convert_inverse_interp_mode, copypaste_arrays, create_control_grid, create_grid, create_rotate, create_scale, create_shear, create_translate, extreme_points_to_image, generate_pos_neg_label_crop_centers, generate_spatial_bounding_box, get_extreme_points, get_largest_connected_component_mask, img_bounds, in_bounds, is_empty, is_positive, map_binary_to_indices, map_spatial_axes, rand_choice, rescale_array, rescale_array_int_max, rescale_instance_array, resize_center, weighted_patch_samples, zero_margins, )
true
true
f7247b2dbd9cf7eb773ad8e4856771996587a897
48
py
Python
samcli/__init__.py
kylelaker/aws-sam-cli
d2917102ef56ac05b9973f96c716612f9638bb62
[ "BSD-2-Clause", "Apache-2.0" ]
null
null
null
samcli/__init__.py
kylelaker/aws-sam-cli
d2917102ef56ac05b9973f96c716612f9638bb62
[ "BSD-2-Clause", "Apache-2.0" ]
null
null
null
samcli/__init__.py
kylelaker/aws-sam-cli
d2917102ef56ac05b9973f96c716612f9638bb62
[ "BSD-2-Clause", "Apache-2.0" ]
null
null
null
""" SAM CLI version """ __version__ = "1.13.1"
8
22
0.583333
__version__ = "1.13.1"
true
true
f7247b7c5f90f8592a8c662974c56a475935ed18
1,394
py
Python
505 The Maze II.py
krishna13052001/LeetCode
cd6ec626bea61f0bd9e8493622074f9e69a7a1c3
[ "MIT" ]
872
2015-06-15T12:02:41.000Z
2022-03-30T08:44:35.000Z
505 The Maze II.py
nadeemshaikh-github/LeetCode
3fb14aeea62a960442e47dfde9f964c7ffce32be
[ "MIT" ]
8
2015-06-21T15:11:59.000Z
2022-02-01T11:22:34.000Z
505 The Maze II.py
nadeemshaikh-github/LeetCode
3fb14aeea62a960442e47dfde9f964c7ffce32be
[ "MIT" ]
328
2015-06-28T03:10:35.000Z
2022-03-29T11:05:28.000Z
#!/usr/bin/python3 """ premium question """ from typing import List import heapq dirs = [(0, -1), (0, 1), (-1, 0), (1, 0)] class Solution: def shortestDistance(self, maze: List[List[int]], start: List[int], destination: List[int]) -> int: """ No friction rolling ball F[i][j][dir] = min distance given direction S[i][j] = whether stoppable Dijkstra's algorith, reduce to a graph problem """ m, n = len(maze), len(maze[0]) D = [[float("inf") for _ in range(n)] for _ in range(m)] # distance matrix i, j = start D[i][j] = 0 q = [(0, i, j)] while q: dist, i, j = heapq.heappop(q) for di, dj in dirs: cur_dist = 0 I = i J = j # look ahead while 0 <= I + di < m and 0 <= J + dj < n and maze[I + di][J + dj] == 0: I += di J += dj cur_dist += 1 if dist + cur_dist < D[I][J]: D[I][J] = dist + cur_dist heapq.heappush(q, (D[I][J], I, J)) i, j = destination return D[i][j] if D[i][j] != float("inf") else -1 if __name__ == "__main__": assert Solution().shortestDistance([[0,0,1,0,0],[0,0,0,0,0],[0,0,0,1,0],[1,1,0,1,1],[0,0,0,0,0]], [0,4], [4,4]) == 12
28.44898
121
0.444763
from typing import List import heapq dirs = [(0, -1), (0, 1), (-1, 0), (1, 0)] class Solution: def shortestDistance(self, maze: List[List[int]], start: List[int], destination: List[int]) -> int: m, n = len(maze), len(maze[0]) D = [[float("inf") for _ in range(n)] for _ in range(m)] i, j = start D[i][j] = 0 q = [(0, i, j)] while q: dist, i, j = heapq.heappop(q) for di, dj in dirs: cur_dist = 0 I = i J = j while 0 <= I + di < m and 0 <= J + dj < n and maze[I + di][J + dj] == 0: I += di J += dj cur_dist += 1 if dist + cur_dist < D[I][J]: D[I][J] = dist + cur_dist heapq.heappush(q, (D[I][J], I, J)) i, j = destination return D[i][j] if D[i][j] != float("inf") else -1 if __name__ == "__main__": assert Solution().shortestDistance([[0,0,1,0,0],[0,0,0,0,0],[0,0,0,1,0],[1,1,0,1,1],[0,0,0,0,0]], [0,4], [4,4]) == 12
true
true
f7247bcaf5d604756097f5b9a64dc5e8efcee241
1,801
py
Python
src/augmented_pickle.py
opskrift/expman
637bbef34d79ce03311889ce310797e78a9f7710
[ "MIT" ]
null
null
null
src/augmented_pickle.py
opskrift/expman
637bbef34d79ce03311889ce310797e78a9f7710
[ "MIT" ]
16
2021-08-04T12:08:00.000Z
2021-09-12T13:01:27.000Z
src/augmented_pickle.py
opskrift/opskrift
637bbef34d79ce03311889ce310797e78a9f7710
[ "MIT" ]
null
null
null
""" Suppose you have some input data sources `data_in` on which you apply some process `F` parameterized by `args`: data_out = F(data_in, args) You want to serialize `data_out`, but also don't want to lose `args`, to preserve the exact setup that generated the output data. Now suppose you want to inspect `args` for a particular `data_out`: - Saving both `{"data": data_out, "args": args}` may not be a viable solution, as `data_out` needs to be fully loaded into memory without actually needing it. - Saving `data_out` and `args` separately necessitates extra care to keep them tied together. Solution: define a simple data format -- *augmented pickle* <metadata> <body (actual data)> Pickle both objects, but read body on-demand: res = read_augmented_pickle("./data.apkl", get_body=True) # get metadata (body is not loaded) meta = next(res) # query the generator again to get body (data) data = next(res) """ import pickle from os import PathLike from typing import Any, Iterable, Union def write_augmented_pickle( metadata: Any, body: Any, path: Union[str, PathLike], ) -> None: """Write an augmented pickle file containing `metadata` and `body`.""" with open(path, "wb") as fp: pickle.dump(metadata, fp) pickle.dump(body, fp) def read_augmented_pickle( path: Union[str, PathLike], get_body: bool, ) -> Iterable[Any]: """Read an augmented pickle file containing `metadata` and `body`. Returns a generator that can be queried on-demand using `next`. If `get_body` is False, only `metadata` is yielded. """ with open(path, "rb") as fp: metadata = pickle.load(fp) yield metadata if not get_body: return body = pickle.load(fp) yield body
27.287879
111
0.675736
import pickle from os import PathLike from typing import Any, Iterable, Union def write_augmented_pickle( metadata: Any, body: Any, path: Union[str, PathLike], ) -> None: with open(path, "wb") as fp: pickle.dump(metadata, fp) pickle.dump(body, fp) def read_augmented_pickle( path: Union[str, PathLike], get_body: bool, ) -> Iterable[Any]: with open(path, "rb") as fp: metadata = pickle.load(fp) yield metadata if not get_body: return body = pickle.load(fp) yield body
true
true
f7247d937c3d515dd43275659017e44fc03cb44c
1,247
py
Python
crawling/crawler.py
LukasTinnes/sPyRat
42e012e426befa3876e590be2ea83874d5351d12
[ "Unlicense" ]
null
null
null
crawling/crawler.py
LukasTinnes/sPyRat
42e012e426befa3876e590be2ea83874d5351d12
[ "Unlicense" ]
3
2022-02-07T19:53:47.000Z
2022-02-13T19:51:33.000Z
crawling/crawler.py
LukasTinnes/sPyRat
42e012e426befa3876e590be2ea83874d5351d12
[ "Unlicense" ]
null
null
null
from abc import abstractmethod from crawling.crawler_data_structures.crawl_data import CrawlData class Crawler: """ An abstract class for other Crawlers to inherit from. A Crawler should open a given file and attempt to find an associated file pattern at every byte in the given file. """ @abstractmethod def crawl(self, file: str) -> CrawlData: """ Crawls a file to find a certain file pattern at every byte. :param file: The file path :return: """ ... @abstractmethod def crawl_in_range(self, file: str, start_byte: int, end_byte: int) -> CrawlData: """ Crawls the file for a file pattern between the start byte (inclusive) and the end_byte (exclusive). :param file: Tjhe file path :param start_byte: The byte to start crawling at. :param end_byte: The byte to end crawling at. :return: """ ... @abstractmethod def crawl_at_byte(self, file:str, start_byte: int = 0) -> CrawlData: """ Crawls for a file pattern at the specific byte given. :param file: The filepath. :param start_byte: The byte to start crawling at. :return: """ ...
31.175
118
0.623095
from abc import abstractmethod from crawling.crawler_data_structures.crawl_data import CrawlData class Crawler: @abstractmethod def crawl(self, file: str) -> CrawlData: ... @abstractmethod def crawl_in_range(self, file: str, start_byte: int, end_byte: int) -> CrawlData: ... @abstractmethod def crawl_at_byte(self, file:str, start_byte: int = 0) -> CrawlData: ...
true
true
f7247d9b14431ca407254cad9d929acd151162dc
9,493
py
Python
docs/conf.py
benedikt-mangold/obfuscate
4e51b3c3c6d3d869a742f036234632c77cebcb54
[ "MIT" ]
null
null
null
docs/conf.py
benedikt-mangold/obfuscate
4e51b3c3c6d3d869a742f036234632c77cebcb54
[ "MIT" ]
1
2021-06-01T14:48:09.000Z
2021-06-01T14:48:09.000Z
docs/conf.py
benedikt-mangold/obfuscate
4e51b3c3c6d3d869a742f036234632c77cebcb54
[ "MIT" ]
null
null
null
# This file is execfile()d with the current directory set to its containing dir. # # This file only contains a selection of the most common options. For a full # list see the documentation: # https://www.sphinx-doc.org/en/master/usage/configuration.html # # All configuration values have a default; values that are commented out # serve to show the default. import os import sys import inspect import shutil # -- Path setup -------------------------------------------------------------- __location__ = os.path.join( os.getcwd(), os.path.dirname(inspect.getfile(inspect.currentframe())) ) # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. sys.path.insert(0, os.path.join(__location__, "../src")) # -- Run sphinx-apidoc ------------------------------------------------------- # This hack is necessary since RTD does not issue `sphinx-apidoc` before running # `sphinx-build -b html . _build/html`. See Issue: # https://github.com/rtfd/readthedocs.org/issues/1139 # DON'T FORGET: Check the box "Install your project inside a virtualenv using # setup.py install" in the RTD Advanced Settings. # Additionally it helps us to avoid running apidoc manually try: # for Sphinx >= 1.7 from sphinx.ext import apidoc except ImportError: from sphinx import apidoc output_dir = os.path.join(__location__, "api") module_dir = os.path.join(__location__, "../src/obfuscator") try: shutil.rmtree(output_dir) except FileNotFoundError: pass try: import sphinx cmd_line_template = ( "sphinx-apidoc --implicit-namespaces -f -o {outputdir} {moduledir}" ) cmd_line = cmd_line_template.format(outputdir=output_dir, moduledir=module_dir) args = cmd_line.split(" ") if tuple(sphinx.__version__.split(".")) >= ("1", "7"): # This is a rudimentary parse_version to avoid external dependencies args = args[1:] apidoc.main(args) except Exception as e: print("Running `sphinx-apidoc` failed!\n{}".format(e)) # -- General configuration --------------------------------------------------- # If your documentation needs a minimal Sphinx version, state it here. # needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be extensions # coming with Sphinx (named 'sphinx.ext.*') or your custom ones. extensions = [ "sphinx.ext.autodoc", "sphinx.ext.intersphinx", "sphinx.ext.todo", "sphinx.ext.autosummary", "sphinx.ext.viewcode", "sphinx.ext.coverage", "sphinx.ext.doctest", "sphinx.ext.ifconfig", "sphinx.ext.mathjax", "sphinx.ext.napoleon", ] # Add any paths that contain templates here, relative to this directory. templates_path = ["_templates"] # The suffix of source filenames. source_suffix = ".rst" # The encoding of source files. # source_encoding = 'utf-8-sig' # The master toctree document. master_doc = "index" # General information about the project. project = "obfuscator" copyright = "2021, Benedikt Mangold" # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = "" # Is set by calling `setup.py docs` # The full version, including alpha/beta/rc tags. release = "" # Is set by calling `setup.py docs` # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # language = None # There are two options for replacing |today|: either, you set today to some # non-false value, then it is used: # today = '' # Else, today_fmt is used as the format for a strftime call. # today_fmt = '%B %d, %Y' # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. exclude_patterns = ["_build", "Thumbs.db", ".DS_Store", ".venv"] # The reST default role (used for this markup: `text`) to use for all documents. # default_role = None # If true, '()' will be appended to :func: etc. cross-reference text. # add_function_parentheses = True # If true, the current module name will be prepended to all description # unit titles (such as .. function::). # add_module_names = True # If true, sectionauthor and moduleauthor directives will be shown in the # output. They are ignored by default. # show_authors = False # The name of the Pygments (syntax highlighting) style to use. pygments_style = "sphinx" # A list of ignored prefixes for module index sorting. # modindex_common_prefix = [] # If true, keep warnings as "system message" paragraphs in the built documents. # keep_warnings = False # -- Options for HTML output ------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. html_theme = "alabaster" # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. html_theme_options = { "sidebar_width": "300px", "page_width": "1200px" } # Add any paths that contain custom themes here, relative to this directory. # html_theme_path = [] # The name for this set of Sphinx documents. If None, it defaults to # "<project> v<release> documentation". try: from obfuscator import __version__ as version except ImportError: pass else: release = version # A shorter title for the navigation bar. Default is the same as html_title. # html_short_title = None # The name of an image file (relative to this directory) to place at the top # of the sidebar. # html_logo = "" # The name of an image file (within the static path) to use as favicon of the # docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. # html_favicon = None # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ["_static"] # If not '', a 'Last updated on:' timestamp is inserted at every page bottom, # using the given strftime format. # html_last_updated_fmt = '%b %d, %Y' # If true, SmartyPants will be used to convert quotes and dashes to # typographically correct entities. # html_use_smartypants = True # Custom sidebar templates, maps document names to template names. # html_sidebars = {} # Additional templates that should be rendered to pages, maps page names to # template names. # html_additional_pages = {} # If false, no module index is generated. # html_domain_indices = True # If false, no index is generated. # html_use_index = True # If true, the index is split into individual pages for each letter. # html_split_index = False # If true, links to the reST sources are added to the pages. # html_show_sourcelink = True # If true, "Created using Sphinx" is shown in the HTML footer. Default is True. # html_show_sphinx = True # If true, "(C) Copyright ..." is shown in the HTML footer. Default is True. # html_show_copyright = True # If true, an OpenSearch description file will be output, and all pages will # contain a <link> tag referring to it. The value of this option must be the # base URL from which the finished HTML is served. # html_use_opensearch = '' # This is the file name suffix for HTML files (e.g. ".xhtml"). # html_file_suffix = None # Output file base name for HTML help builder. htmlhelp_basename = "obfuscator-doc" # -- Options for LaTeX output ------------------------------------------------ latex_elements = { # The paper size ("letterpaper" or "a4paper"). # "papersize": "letterpaper", # The font size ("10pt", "11pt" or "12pt"). # "pointsize": "10pt", # Additional stuff for the LaTeX preamble. # "preamble": "", } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass [howto/manual]). latex_documents = [ ("index", "user_guide.tex", "obfuscator Documentation", "Benedikt Mangold", "manual") ] # The name of an image file (relative to this directory) to place at the top of # the title page. # latex_logo = "" # For "manual" documents, if this is true, then toplevel headings are parts, # not chapters. # latex_use_parts = False # If true, show page references after internal links. # latex_show_pagerefs = False # If true, show URL addresses after external links. # latex_show_urls = False # Documents to append as an appendix to all manuals. # latex_appendices = [] # If false, no module index is generated. # latex_domain_indices = True # -- External mapping -------------------------------------------------------- python_version = ".".join(map(str, sys.version_info[0:2])) intersphinx_mapping = { "sphinx": ("http://www.sphinx-doc.org/en/stable", None), "python": ("https://docs.python.org/" + python_version, None), "matplotlib": ("https://matplotlib.org", None), "numpy": ("https://docs.scipy.org/doc/numpy", None), "sklearn": ("https://scikit-learn.org/stable", None), "pandas": ("https://pandas.pydata.org/pandas-docs/stable", None), "scipy": ("https://docs.scipy.org/doc/scipy/reference", None), "pyscaffold": ("https://pyscaffold.org/en/stable", None), }
33.54417
89
0.696092
import os import sys import inspect import shutil __location__ = os.path.join( os.getcwd(), os.path.dirname(inspect.getfile(inspect.currentframe())) ) sys.path.insert(0, os.path.join(__location__, "../src")) # setup.py install" in the RTD Advanced Settings. # Additionally it helps us to avoid running apidoc manually try: # for Sphinx >= 1.7 from sphinx.ext import apidoc except ImportError: from sphinx import apidoc output_dir = os.path.join(__location__, "api") module_dir = os.path.join(__location__, "../src/obfuscator") try: shutil.rmtree(output_dir) except FileNotFoundError: pass try: import sphinx cmd_line_template = ( "sphinx-apidoc --implicit-namespaces -f -o {outputdir} {moduledir}" ) cmd_line = cmd_line_template.format(outputdir=output_dir, moduledir=module_dir) args = cmd_line.split(" ") if tuple(sphinx.__version__.split(".")) >= ("1", "7"): # This is a rudimentary parse_version to avoid external dependencies args = args[1:] apidoc.main(args) except Exception as e: print("Running `sphinx-apidoc` failed!\n{}".format(e)) # -- General configuration --------------------------------------------------- # If your documentation needs a minimal Sphinx version, state it here. # needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be extensions # coming with Sphinx (named 'sphinx.ext.*') or your custom ones. extensions = [ "sphinx.ext.autodoc", "sphinx.ext.intersphinx", "sphinx.ext.todo", "sphinx.ext.autosummary", "sphinx.ext.viewcode", "sphinx.ext.coverage", "sphinx.ext.doctest", "sphinx.ext.ifconfig", "sphinx.ext.mathjax", "sphinx.ext.napoleon", ] # Add any paths that contain templates here, relative to this directory. templates_path = ["_templates"] # The suffix of source filenames. source_suffix = ".rst" # The encoding of source files. # source_encoding = 'utf-8-sig' # The master toctree document. master_doc = "index" # General information about the project. project = "obfuscator" copyright = "2021, Benedikt Mangold" # The version info for the project you're documenting, acts as replacement for version = "" release = "" exclude_patterns = ["_build", "Thumbs.db", ".DS_Store", ".venv"] pygments_style = "sphinx" html_theme = "alabaster" html_theme_options = { "sidebar_width": "300px", "page_width": "1200px" } try: from obfuscator import __version__ as version except ImportError: pass else: release = version html_static_path = ["_static"] htmlhelp_basename = "obfuscator-doc" latex_elements = { } latex_documents = [ ("index", "user_guide.tex", "obfuscator Documentation", "Benedikt Mangold", "manual") ] python_version = ".".join(map(str, sys.version_info[0:2])) intersphinx_mapping = { "sphinx": ("http://www.sphinx-doc.org/en/stable", None), "python": ("https://docs.python.org/" + python_version, None), "matplotlib": ("https://matplotlib.org", None), "numpy": ("https://docs.scipy.org/doc/numpy", None), "sklearn": ("https://scikit-learn.org/stable", None), "pandas": ("https://pandas.pydata.org/pandas-docs/stable", None), "scipy": ("https://docs.scipy.org/doc/scipy/reference", None), "pyscaffold": ("https://pyscaffold.org/en/stable", None), }
true
true
f7247db16c62de200bc2c5deee5c7ca83220e585
4,738
py
Python
test/streams.py
gonsp/LotterySampling
92ff14f602c05d747708b522cf05b9f9066c43e0
[ "MIT" ]
4
2020-06-03T15:17:28.000Z
2020-09-29T20:52:15.000Z
test/streams.py
gonsp/LotterySampling
92ff14f602c05d747708b522cf05b9f9066c43e0
[ "MIT" ]
null
null
null
test/streams.py
gonsp/LotterySampling
92ff14f602c05d747708b522cf05b9f9066c43e0
[ "MIT" ]
null
null
null
import itertools import math import numpy as np from abc import abstractmethod from io import TextIOWrapper from sorted_list import SortedList class Stream(): def __init__(self, length, save=True): self.length = length self.N = 0 self.n = 0 self.save = save self.elements = SortedList() def __iter__(self): return self def __next__(self): self.N += 1 if self.N > self.length: raise StopIteration element = self.next_element() if self.save: # To speed-up tests in which it is not necessary to check accuracy self.elements.process_element(element) self.n = self.elements.size() return element @abstractmethod def next_element(self): pass def top_k_query(self, k): return [(str(id), count/self.N) for id, count in itertools.islice(iter(self.elements), k)] def frequent_query(self, freq): return [(str(id), count/self.N) for id, count in itertools.takewhile(lambda element: element[1] >= math.ceil(freq * self.N), iter(self.elements))] def chunk_stream(stream, chunk_size): it = iter(stream) while True: chunk = list(itertools.islice(it, chunk_size)) if len(chunk) > 0: yield chunk else: return None class MultiZipf(Stream): def __init__(self, length, alpha=1.5, segments=2, offset=10000, seed=None, save=True): super().__init__(length, save) self.alpha = alpha self.segments = segments self.offset = offset np.random.seed(seed) def next_element(self): element = np.random.zipf(self.alpha) element += self.offset * (self.N // (self.length / self.segments)) return int(element) class Zipf(MultiZipf): def __init__(self, length, alpha=1.5, seed=None, save=True): super().__init__(length, alpha=alpha, segments=1, seed=seed, save=save) class Uniform(Stream): def __init__(self, length, n_max, seed=None, save=True): super().__init__(length, save) self.n_max = n_max np.random.seed(seed) def next_element(self): return np.random.randint(0, self.n_max) class Unequal(Stream): def __init__(self, length, alpha, beta, seed=None, save=True): super().__init__(length, save) data = np.zeros(length, dtype=int) for i in range(alpha): for j in range(beta): data[i*beta + j] = i for i in range(alpha * beta, length): data[i] = i - alpha * (beta - 1) np.random.seed(seed) self.data = iter(np.random.permutation(data)) def next_element(self): return next(self.data) class File(Stream): def __init__(self, file_path, length=math.inf, shuffle=False, repetitions=1, seed=None, save=True): if shuffle or repetitions > 1: self.data = [] with open(file_path, 'r') as file: for line in file: element = line[:-1] self.data.append(element) self.data *= repetitions length = min(len(self.data), length) if shuffle: np.random.seed(seed) self.data = np.random.permutation(self.data) else: with open(file_path, 'r') as file: length = min(sum(1 for _ in file), length) self.data = open(file_path, 'r') super().__init__(length, save) def next_element(self): if isinstance(self.data, TextIOWrapper): element = self.data.readline()[:-1] if element == '': raise StopIteration return element else: if self.N == len(self.data): raise StopIteration return self.data[self.N] class ZipfNoiseZipf(Stream): def __init__(self, length, alpha=1.5, noise=0.3, offset=10000, seed=None, save=True): super().__init__(length, save) self.alpha = alpha self.noise = noise self.offset = offset np.random.seed(seed) def next_element(self): if self.N < self.length * (1 - self.noise) // 2: return int(np.random.zipf(self.alpha)) elif self.N < self.length - self.length * (1 - self.noise) // 2: return self.N else: return int(np.random.zipf(self.alpha) + self.offset) class ESA(Stream): def __init__(self, length, seed=None, save=True): super().__init__(length, save) np.random.seed(seed) def next_element(self): if self.N < self.length // 2: return self.N // 2 else: return self.length
27.387283
154
0.580625
import itertools import math import numpy as np from abc import abstractmethod from io import TextIOWrapper from sorted_list import SortedList class Stream(): def __init__(self, length, save=True): self.length = length self.N = 0 self.n = 0 self.save = save self.elements = SortedList() def __iter__(self): return self def __next__(self): self.N += 1 if self.N > self.length: raise StopIteration element = self.next_element() if self.save: self.elements.process_element(element) self.n = self.elements.size() return element @abstractmethod def next_element(self): pass def top_k_query(self, k): return [(str(id), count/self.N) for id, count in itertools.islice(iter(self.elements), k)] def frequent_query(self, freq): return [(str(id), count/self.N) for id, count in itertools.takewhile(lambda element: element[1] >= math.ceil(freq * self.N), iter(self.elements))] def chunk_stream(stream, chunk_size): it = iter(stream) while True: chunk = list(itertools.islice(it, chunk_size)) if len(chunk) > 0: yield chunk else: return None class MultiZipf(Stream): def __init__(self, length, alpha=1.5, segments=2, offset=10000, seed=None, save=True): super().__init__(length, save) self.alpha = alpha self.segments = segments self.offset = offset np.random.seed(seed) def next_element(self): element = np.random.zipf(self.alpha) element += self.offset * (self.N // (self.length / self.segments)) return int(element) class Zipf(MultiZipf): def __init__(self, length, alpha=1.5, seed=None, save=True): super().__init__(length, alpha=alpha, segments=1, seed=seed, save=save) class Uniform(Stream): def __init__(self, length, n_max, seed=None, save=True): super().__init__(length, save) self.n_max = n_max np.random.seed(seed) def next_element(self): return np.random.randint(0, self.n_max) class Unequal(Stream): def __init__(self, length, alpha, beta, seed=None, save=True): super().__init__(length, save) data = np.zeros(length, dtype=int) for i in range(alpha): for j in range(beta): data[i*beta + j] = i for i in range(alpha * beta, length): data[i] = i - alpha * (beta - 1) np.random.seed(seed) self.data = iter(np.random.permutation(data)) def next_element(self): return next(self.data) class File(Stream): def __init__(self, file_path, length=math.inf, shuffle=False, repetitions=1, seed=None, save=True): if shuffle or repetitions > 1: self.data = [] with open(file_path, 'r') as file: for line in file: element = line[:-1] self.data.append(element) self.data *= repetitions length = min(len(self.data), length) if shuffle: np.random.seed(seed) self.data = np.random.permutation(self.data) else: with open(file_path, 'r') as file: length = min(sum(1 for _ in file), length) self.data = open(file_path, 'r') super().__init__(length, save) def next_element(self): if isinstance(self.data, TextIOWrapper): element = self.data.readline()[:-1] if element == '': raise StopIteration return element else: if self.N == len(self.data): raise StopIteration return self.data[self.N] class ZipfNoiseZipf(Stream): def __init__(self, length, alpha=1.5, noise=0.3, offset=10000, seed=None, save=True): super().__init__(length, save) self.alpha = alpha self.noise = noise self.offset = offset np.random.seed(seed) def next_element(self): if self.N < self.length * (1 - self.noise) // 2: return int(np.random.zipf(self.alpha)) elif self.N < self.length - self.length * (1 - self.noise) // 2: return self.N else: return int(np.random.zipf(self.alpha) + self.offset) class ESA(Stream): def __init__(self, length, seed=None, save=True): super().__init__(length, save) np.random.seed(seed) def next_element(self): if self.N < self.length // 2: return self.N // 2 else: return self.length
true
true
f7247e8a17813fa402740c3c525d9fef0664b3d9
116
py
Python
web-app/backend/apps/common/routes/__init__.py
titoeb/kfserving
b072a76842b57e904dbdf46a136474a22051500d
[ "Apache-2.0" ]
47
2022-01-02T09:59:15.000Z
2022-01-25T11:11:17.000Z
web-app/backend/apps/common/routes/__init__.py
titoeb/kfserving
b072a76842b57e904dbdf46a136474a22051500d
[ "Apache-2.0" ]
7
2021-08-31T23:55:06.000Z
2022-03-02T11:34:58.000Z
web-app/backend/apps/common/routes/__init__.py
titoeb/kfserving
b072a76842b57e904dbdf46a136474a22051500d
[ "Apache-2.0" ]
4
2022-01-27T08:59:15.000Z
2022-02-27T14:42:19.000Z
from flask import Blueprint bp = Blueprint("base_routes", __name__) from . import delete, get # noqa: F401, E402
19.333333
45
0.732759
from flask import Blueprint bp = Blueprint("base_routes", __name__) from . import delete, get
true
true
f7247ef6bd54462db7b045b5ea78324bc3752082
256
py
Python
sessioncontroller/settings.py
synteny/AuroraBot
179919e1e6cc5f24d9cf3e9295d0f043174a6169
[ "MIT" ]
2
2015-11-27T11:08:24.000Z
2018-03-21T15:35:08.000Z
sessioncontroller/settings.py
synteny/AuroraBot
179919e1e6cc5f24d9cf3e9295d0f043174a6169
[ "MIT" ]
2
2015-10-27T15:06:09.000Z
2015-10-28T12:53:12.000Z
sessioncontroller/settings.py
synteny/AuroraBot
179919e1e6cc5f24d9cf3e9295d0f043174a6169
[ "MIT" ]
null
null
null
import os TELEGRAM_TOKEN = os.environ['TELEGRAM_TOKEN'] DATABASE = { 'HOST': os.getenv('DB_PORT_3306_TCP_ADDR', 'localhost'), 'USER': os.getenv('DB_MYSQL_USER', 'root'), 'PASSWORD': os.getenv('DB_MYSQL_PASSWORD', ''), 'NAME': 'aurora', }
23.272727
60
0.652344
import os TELEGRAM_TOKEN = os.environ['TELEGRAM_TOKEN'] DATABASE = { 'HOST': os.getenv('DB_PORT_3306_TCP_ADDR', 'localhost'), 'USER': os.getenv('DB_MYSQL_USER', 'root'), 'PASSWORD': os.getenv('DB_MYSQL_PASSWORD', ''), 'NAME': 'aurora', }
true
true
f7247f14b21d4ad2ba934ab6dab587b66188f368
8,305
py
Python
fpn/operator_py/fpn_roi_pooling.py
CosmosHua/Deformable-ConvNets
6aeda878a95bcb55eadffbe125804e730574de8d
[ "MIT" ]
3,976
2017-05-05T13:48:27.000Z
2022-03-30T13:37:48.000Z
fpn/operator_py/fpn_roi_pooling.py
CosmosHua/Deformable-ConvNets
6aeda878a95bcb55eadffbe125804e730574de8d
[ "MIT" ]
259
2017-05-06T13:30:11.000Z
2022-03-16T14:11:16.000Z
fpn/operator_py/fpn_roi_pooling.py
CosmosHua/Deformable-ConvNets
6aeda878a95bcb55eadffbe125804e730574de8d
[ "MIT" ]
1,051
2017-05-05T14:55:57.000Z
2022-03-23T01:02:47.000Z
# -------------------------------------------------------- # Deformable Convolutional Networks # Copyright (c) 2017 Microsoft # Licensed under The MIT License [see LICENSE for details] # Modified by Haozhi Qi, Yuwen Xiong # -------------------------------------------------------- import mxnet as mx import numpy as np from mxnet.contrib import autograd import gc class FPNROIPoolingOperator(mx.operator.CustomOp): def __init__(self, feat_strides, pooled_height, pooled_width, output_dim, with_deformable): self.pooled_height = pooled_height self.pooled_width = pooled_width self.feat_strides = feat_strides self.with_deformable = with_deformable self.output_dim = output_dim self.in_grad_hist_list = [] self.num_strides = len(self.feat_strides) self.roi_pool = [None for _ in range(self.num_strides)] self.feat_idx = [None for _ in range(self.num_strides)] def forward(self, is_train, req, in_data, out_data, aux): rois = in_data[-1].asnumpy() w = rois[:, 3] - rois[:, 1] + 1 h = rois[:, 4] - rois[:, 2] + 1 feat_id = np.clip(np.floor(2 + np.log2(np.sqrt(w * h) / 224)), 0, len(self.feat_strides) - 1) pyramid_idx = [] rois_p = [None for _ in range(self.num_strides)] for i in range(self.num_strides): self.feat_idx[i] = np.where(feat_id == i)[0] if len(self.feat_idx[i]) == 0: # padding dummy roi rois_p[i] = np.zeros((1, 5)) pyramid_idx.append(-1) else: rois_p[i] = rois[self.feat_idx[i]] pyramid_idx.append(self.feat_idx[i]) rois_idx = np.argsort(np.hstack(pyramid_idx))[-rois.shape[0]:] if is_train: for i in range(self.num_strides): self.in_grad_hist_list.append(mx.nd.zeros_like(in_data[i])) if self.with_deformable: for i in range(self.num_strides, self.num_strides * 3): self.in_grad_hist_list.append(mx.nd.zeros_like(in_data[i])) autograd.mark_variables([in_data[i] for i in range(self.num_strides * 3)], self.in_grad_hist_list) with autograd.train_section(): for i in range(self.num_strides): roi_offset_t = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), group_size=1, pooled_size=7, sample_per_part=4, no_trans=True, part_size=7, output_dim=256, spatial_scale=1.0 / self.feat_strides[i]) roi_offset = mx.nd.FullyConnected(data=roi_offset_t, num_hidden=7 * 7 * 2, weight=in_data[i * 2 + self.num_strides], bias=in_data[i * 2 + 1 + self.num_strides]) roi_offset_reshape = mx.nd.reshape(data=roi_offset, shape=(-1, 2, 7, 7)) self.roi_pool[i] = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), trans=roi_offset_reshape, group_size=1, pooled_size=7, sample_per_part=4, no_trans=False, part_size=7, output_dim=self.output_dim, spatial_scale=1.0 / self.feat_strides[i], trans_std=0.1) else: autograd.mark_variables([in_data[i] for i in range(self.num_strides)], self.in_grad_hist_list) with autograd.train_section(): for i in range(self.num_strides): self.roi_pool[i] = mx.nd.ROIPooling(in_data[i], mx.nd.array(rois_p[i], in_data[i].context), (7, 7), spatial_scale=1.0 / self.feat_strides[i]) roi_pool = mx.nd.concatenate(self.roi_pool, axis=0) else: # during testing, there is no need to record variable, thus saving memory roi_pool = [None for _ in range(self.num_strides)] if self.with_deformable: for i in range(self.num_strides): roi_offset_t = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), group_size=1, pooled_size=7, sample_per_part=4, no_trans=True, part_size=7, output_dim=256, spatial_scale=1.0 / self.feat_strides[i]) roi_offset = mx.nd.FullyConnected(data=roi_offset_t, num_hidden=7 * 7 * 2, weight=in_data[i * 2 + self.num_strides], bias=in_data[i * 2 + 1 + self.num_strides]) roi_offset_reshape = mx.nd.reshape(data=roi_offset, shape=(-1, 2, 7, 7)) roi_pool[i] = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), trans=roi_offset_reshape, group_size=1, pooled_size=7, sample_per_part=4, no_trans=False, part_size=7, output_dim=self.output_dim, spatial_scale=1.0 / self.feat_strides[i], trans_std=0.1) else: for i in range(self.num_strides): roi_pool[i] = mx.nd.ROIPooling(in_data[i], mx.nd.array(rois_p[i], in_data[i].context), (7, 7), spatial_scale=1.0 / self.feat_strides[i]) roi_pool = mx.nd.concatenate(roi_pool, axis=0) roi_pool = mx.nd.take(roi_pool, mx.nd.array(rois_idx, roi_pool.context)) self.assign(out_data[0], req[0], roi_pool) def backward(self, req, out_grad, in_data, out_data, in_grad, aux): for i in range(len(in_grad)): self.assign(in_grad[i], req[i], 0) with autograd.train_section(): for i in range(self.num_strides): if len(self.feat_idx[i] > 0): autograd.compute_gradient([mx.nd.take(out_grad[0], mx.nd.array(self.feat_idx[i], out_grad[0].context)) * self.roi_pool[i]]) if self.with_deformable: for i in range(0, self.num_strides * 3): self.assign(in_grad[i], req[i], self.in_grad_hist_list[i]) else: for i in range(0, self.num_strides): self.assign(in_grad[i], req[i], self.in_grad_hist_list[i]) gc.collect() @mx.operator.register('fpn_roi_pooling') class FPNROIPoolingProp(mx.operator.CustomOpProp): def __init__(self, feat_strides='(4,8,16,32)', pooled_height='7', pooled_width='7', with_deformable='False', output_dim='256'): super(FPNROIPoolingProp, self).__init__(need_top_grad=True) self.pooled_height = int(pooled_height) self.pooled_width = int(pooled_width) self.feat_strides = np.fromstring(feat_strides[1:-1], dtype=int, sep=',') self.with_deformable = with_deformable == 'True' self.output_dim = int(output_dim) self.num_strides = len(self.feat_strides) def list_arguments(self): args_list = [] for i in range(self.num_strides): args_list.append('data_p{}'.format(2 + i)) if self.with_deformable: for i in range(self.num_strides): args_list.extend(['offset_weight_p{}'.format(2 + i), 'offset_bias_p{}'.format(2 + i)]) args_list.append('rois') return args_list def list_outputs(self): return ['output'] def infer_shape(self, in_shape): output_feat_shape = [in_shape[-1][0], in_shape[0][1], self.pooled_height, self.pooled_width] if self.with_deformable: offset_dim = self.pooled_height * self.pooled_width * 2 input_dim = self.pooled_height * self.pooled_width * self.output_dim for i in range(self.num_strides): in_shape[i * 2 + self.num_strides], in_shape[i * 2 + 1 + self.num_strides] = [offset_dim, input_dim], [offset_dim, ] return in_shape, [output_feat_shape] def create_operator(self, ctx, shapes, dtypes): return FPNROIPoolingOperator(self.feat_strides, self.pooled_height, self.pooled_width, self.output_dim, self.with_deformable) def declare_backward_dependency(self, out_grad, in_data, out_data): return [out_grad[0]]
56.114865
184
0.593618
import mxnet as mx import numpy as np from mxnet.contrib import autograd import gc class FPNROIPoolingOperator(mx.operator.CustomOp): def __init__(self, feat_strides, pooled_height, pooled_width, output_dim, with_deformable): self.pooled_height = pooled_height self.pooled_width = pooled_width self.feat_strides = feat_strides self.with_deformable = with_deformable self.output_dim = output_dim self.in_grad_hist_list = [] self.num_strides = len(self.feat_strides) self.roi_pool = [None for _ in range(self.num_strides)] self.feat_idx = [None for _ in range(self.num_strides)] def forward(self, is_train, req, in_data, out_data, aux): rois = in_data[-1].asnumpy() w = rois[:, 3] - rois[:, 1] + 1 h = rois[:, 4] - rois[:, 2] + 1 feat_id = np.clip(np.floor(2 + np.log2(np.sqrt(w * h) / 224)), 0, len(self.feat_strides) - 1) pyramid_idx = [] rois_p = [None for _ in range(self.num_strides)] for i in range(self.num_strides): self.feat_idx[i] = np.where(feat_id == i)[0] if len(self.feat_idx[i]) == 0: rois_p[i] = np.zeros((1, 5)) pyramid_idx.append(-1) else: rois_p[i] = rois[self.feat_idx[i]] pyramid_idx.append(self.feat_idx[i]) rois_idx = np.argsort(np.hstack(pyramid_idx))[-rois.shape[0]:] if is_train: for i in range(self.num_strides): self.in_grad_hist_list.append(mx.nd.zeros_like(in_data[i])) if self.with_deformable: for i in range(self.num_strides, self.num_strides * 3): self.in_grad_hist_list.append(mx.nd.zeros_like(in_data[i])) autograd.mark_variables([in_data[i] for i in range(self.num_strides * 3)], self.in_grad_hist_list) with autograd.train_section(): for i in range(self.num_strides): roi_offset_t = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), group_size=1, pooled_size=7, sample_per_part=4, no_trans=True, part_size=7, output_dim=256, spatial_scale=1.0 / self.feat_strides[i]) roi_offset = mx.nd.FullyConnected(data=roi_offset_t, num_hidden=7 * 7 * 2, weight=in_data[i * 2 + self.num_strides], bias=in_data[i * 2 + 1 + self.num_strides]) roi_offset_reshape = mx.nd.reshape(data=roi_offset, shape=(-1, 2, 7, 7)) self.roi_pool[i] = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), trans=roi_offset_reshape, group_size=1, pooled_size=7, sample_per_part=4, no_trans=False, part_size=7, output_dim=self.output_dim, spatial_scale=1.0 / self.feat_strides[i], trans_std=0.1) else: autograd.mark_variables([in_data[i] for i in range(self.num_strides)], self.in_grad_hist_list) with autograd.train_section(): for i in range(self.num_strides): self.roi_pool[i] = mx.nd.ROIPooling(in_data[i], mx.nd.array(rois_p[i], in_data[i].context), (7, 7), spatial_scale=1.0 / self.feat_strides[i]) roi_pool = mx.nd.concatenate(self.roi_pool, axis=0) else: roi_pool = [None for _ in range(self.num_strides)] if self.with_deformable: for i in range(self.num_strides): roi_offset_t = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), group_size=1, pooled_size=7, sample_per_part=4, no_trans=True, part_size=7, output_dim=256, spatial_scale=1.0 / self.feat_strides[i]) roi_offset = mx.nd.FullyConnected(data=roi_offset_t, num_hidden=7 * 7 * 2, weight=in_data[i * 2 + self.num_strides], bias=in_data[i * 2 + 1 + self.num_strides]) roi_offset_reshape = mx.nd.reshape(data=roi_offset, shape=(-1, 2, 7, 7)) roi_pool[i] = mx.contrib.nd.DeformablePSROIPooling(data=in_data[i], rois=mx.nd.array(rois_p[i], in_data[i].context), trans=roi_offset_reshape, group_size=1, pooled_size=7, sample_per_part=4, no_trans=False, part_size=7, output_dim=self.output_dim, spatial_scale=1.0 / self.feat_strides[i], trans_std=0.1) else: for i in range(self.num_strides): roi_pool[i] = mx.nd.ROIPooling(in_data[i], mx.nd.array(rois_p[i], in_data[i].context), (7, 7), spatial_scale=1.0 / self.feat_strides[i]) roi_pool = mx.nd.concatenate(roi_pool, axis=0) roi_pool = mx.nd.take(roi_pool, mx.nd.array(rois_idx, roi_pool.context)) self.assign(out_data[0], req[0], roi_pool) def backward(self, req, out_grad, in_data, out_data, in_grad, aux): for i in range(len(in_grad)): self.assign(in_grad[i], req[i], 0) with autograd.train_section(): for i in range(self.num_strides): if len(self.feat_idx[i] > 0): autograd.compute_gradient([mx.nd.take(out_grad[0], mx.nd.array(self.feat_idx[i], out_grad[0].context)) * self.roi_pool[i]]) if self.with_deformable: for i in range(0, self.num_strides * 3): self.assign(in_grad[i], req[i], self.in_grad_hist_list[i]) else: for i in range(0, self.num_strides): self.assign(in_grad[i], req[i], self.in_grad_hist_list[i]) gc.collect() @mx.operator.register('fpn_roi_pooling') class FPNROIPoolingProp(mx.operator.CustomOpProp): def __init__(self, feat_strides='(4,8,16,32)', pooled_height='7', pooled_width='7', with_deformable='False', output_dim='256'): super(FPNROIPoolingProp, self).__init__(need_top_grad=True) self.pooled_height = int(pooled_height) self.pooled_width = int(pooled_width) self.feat_strides = np.fromstring(feat_strides[1:-1], dtype=int, sep=',') self.with_deformable = with_deformable == 'True' self.output_dim = int(output_dim) self.num_strides = len(self.feat_strides) def list_arguments(self): args_list = [] for i in range(self.num_strides): args_list.append('data_p{}'.format(2 + i)) if self.with_deformable: for i in range(self.num_strides): args_list.extend(['offset_weight_p{}'.format(2 + i), 'offset_bias_p{}'.format(2 + i)]) args_list.append('rois') return args_list def list_outputs(self): return ['output'] def infer_shape(self, in_shape): output_feat_shape = [in_shape[-1][0], in_shape[0][1], self.pooled_height, self.pooled_width] if self.with_deformable: offset_dim = self.pooled_height * self.pooled_width * 2 input_dim = self.pooled_height * self.pooled_width * self.output_dim for i in range(self.num_strides): in_shape[i * 2 + self.num_strides], in_shape[i * 2 + 1 + self.num_strides] = [offset_dim, input_dim], [offset_dim, ] return in_shape, [output_feat_shape] def create_operator(self, ctx, shapes, dtypes): return FPNROIPoolingOperator(self.feat_strides, self.pooled_height, self.pooled_width, self.output_dim, self.with_deformable) def declare_backward_dependency(self, out_grad, in_data, out_data): return [out_grad[0]]
true
true
f7247f42ef9c871c8ebd07fc747da69ad689d3a3
405
py
Python
05/iterator_example.py
alissonit/pythontrap
b7780913d49af2142be4a9674ac435e2a67da201
[ "MIT" ]
null
null
null
05/iterator_example.py
alissonit/pythontrap
b7780913d49af2142be4a9674ac435e2a67da201
[ "MIT" ]
null
null
null
05/iterator_example.py
alissonit/pythontrap
b7780913d49af2142be4a9674ac435e2a67da201
[ "MIT" ]
1
2021-03-15T18:26:14.000Z
2021-03-15T18:26:14.000Z
#CONSTRUINDO UMA CLASSE ITERATOR class GenItem(object): def __init__(self, first, last): self.first = first self.last = last def __iter__(self): return self def __next__(self): if self.first > self.last: raise StopIteration else: self.first += 1 return self.first - 1 n_list = GenItem(1,10) print(list(n_list))
22.5
36
0.577778
class GenItem(object): def __init__(self, first, last): self.first = first self.last = last def __iter__(self): return self def __next__(self): if self.first > self.last: raise StopIteration else: self.first += 1 return self.first - 1 n_list = GenItem(1,10) print(list(n_list))
true
true
f72480521f1fad6394a1656241b51fbd1c7d3230
14,939
py
Python
Lib/site-packages/wx-3.0-msw/wx/lib/gridmovers.py
jickieduan/python27
c752b552396bbed68d8555080d475718cea2edd0
[ "bzip2-1.0.6" ]
1
2021-02-13T22:40:50.000Z
2021-02-13T22:40:50.000Z
Lib/site-packages/wx-3.0-msw/wx/lib/gridmovers.py
jickieduan/python27
c752b552396bbed68d8555080d475718cea2edd0
[ "bzip2-1.0.6" ]
1
2018-07-28T20:07:04.000Z
2018-07-30T18:28:34.000Z
Lib/site-packages/wx-3.0-msw/wx/lib/gridmovers.py
jickieduan/python27
c752b552396bbed68d8555080d475718cea2edd0
[ "bzip2-1.0.6" ]
2
2019-12-02T01:39:10.000Z
2021-02-13T22:41:00.000Z
#---------------------------------------------------------------------------- # Name: GridColMover.py # Purpose: Grid Column Mover Extension # # Author: Gerrit van Dyk (email: gerritvd@decillion.net) # # Version 0.1 # Date: Nov 19, 2002 # RCS-ID: $Id$ # Licence: wxWindows license #---------------------------------------------------------------------------- # 12/07/2003 - Jeff Grimmett (grimmtooth@softhome.net) # # o 2.5 Compatability changes # # 12/18/2003 - Jeff Grimmett (grimmtooth@softhome.net) # # o wxGridColMoveEvent -> GridColMoveEvent # o wxGridRowMoveEvent -> GridRowMoveEvent # o wxGridColMover -> GridColMover # o wxGridRowMover -> GridRowMover # import wx import wx.grid #---------------------------------------------------------------------------- # event class and macros # # New style 12/7/03 # wxEVT_COMMAND_GRID_COL_MOVE = wx.NewEventType() wxEVT_COMMAND_GRID_ROW_MOVE = wx.NewEventType() EVT_GRID_COL_MOVE = wx.PyEventBinder(wxEVT_COMMAND_GRID_COL_MOVE, 1) EVT_GRID_ROW_MOVE = wx.PyEventBinder(wxEVT_COMMAND_GRID_ROW_MOVE, 1) #---------------------------------------------------------------------------- class GridColMoveEvent(wx.PyCommandEvent): def __init__(self, id, dCol, bCol): wx.PyCommandEvent.__init__(self, id = id) self.SetEventType(wxEVT_COMMAND_GRID_COL_MOVE) self.moveColumn = dCol self.beforeColumn = bCol def GetMoveColumn(self): return self.moveColumn def GetBeforeColumn(self): return self.beforeColumn class GridRowMoveEvent(wx.PyCommandEvent): def __init__(self, id, dRow, bRow): wx.PyCommandEvent.__init__(self,id = id) self.SetEventType(wxEVT_COMMAND_GRID_ROW_MOVE) self.moveRow = dRow self.beforeRow = bRow def GetMoveRow(self): return self.moveRow def GetBeforeRow(self): return self.beforeRow #---------------------------------------------------------------------------- # graft new methods into the wxGrid class def _ColToRect(self,col): if self.GetNumberRows() > 0: rect = self.CellToRect(0,col) else: rect = wx.Rect() rect.height = self.GetColLabelSize() rect.width = self.GetColSize(col) for cCol in range(0,col): rect.x += self.GetColSize(cCol) rect.y = self.GetGridColLabelWindow().GetPosition()[1] return rect wx.grid.Grid.ColToRect = _ColToRect def _RowToRect(self,row): if self.GetNumberCols() > 0: rect = self.CellToRect(row,0) else: rect = wx.Rect() rect.width = self.GetRowLabelSize() rect.height = self.GetRowSize(row) for cRow in range(0,row): rect.y += self.GetRowSize(cRow) rect.x = self.GetGridRowLabelWindow().GetPosition()[0] return rect wx.grid.Grid.RowToRect = _RowToRect #---------------------------------------------------------------------------- class ColDragWindow(wx.Window): def __init__(self,parent,image,dragCol): wx.Window.__init__(self,parent,-1, style=wx.SIMPLE_BORDER) self.image = image self.SetSize((self.image.GetWidth(),self.image.GetHeight())) self.ux = parent.GetScrollPixelsPerUnit()[0] self.moveColumn = dragCol self.Bind(wx.EVT_PAINT, self.OnPaint) def DisplayAt(self,pos,y): x = self.GetPositionTuple()[0] if x == pos: self.Refresh() # Need to display insertion point else: self.MoveXY(pos,y) def GetMoveColumn(self): return self.moveColumn def _GetInsertionInfo(self): parent = self.GetParent() sx = parent.GetViewStart()[0] * self.ux sx -= parent.GetRowLabelSize() x = self.GetPosition()[0] w = self.GetSize()[0] sCol = parent.XToCol(x + sx) eCol = parent.XToCol(x + w + sx) iPos = xPos = xCol = 99999 centerPos = x + sx + (w / 2) for col in range(sCol,eCol + 1): cx = parent.ColToRect(col)[0] if abs(cx - centerPos) < iPos: iPos = abs(cx - centerPos) xCol = col xPos = cx if xCol < 0 or xCol > parent.GetNumberCols(): xCol = parent.GetNumberCols() return (xPos - sx - x,xCol) def GetInsertionColumn(self): return self._GetInsertionInfo()[1] def GetInsertionPos(self): return self._GetInsertionInfo()[0] def OnPaint(self,evt): dc = wx.PaintDC(self) w,h = self.GetSize() dc.DrawBitmap(self.image, 0,0) dc.SetPen(wx.Pen(wx.BLACK,1,wx.SOLID)) dc.SetBrush(wx.TRANSPARENT_BRUSH) dc.DrawRectangle(0,0, w,h) iPos = self.GetInsertionPos() dc.DrawLine(iPos,h - 10, iPos,h) class RowDragWindow(wx.Window): def __init__(self,parent,image,dragRow): wx.Window.__init__(self,parent,-1, style=wx.SIMPLE_BORDER) self.image = image self.SetSize((self.image.GetWidth(),self.image.GetHeight())) self.uy = parent.GetScrollPixelsPerUnit()[1] self.moveRow = dragRow self.Bind(wx.EVT_PAINT, self.OnPaint) def DisplayAt(self,x,pos): y = self.GetPosition()[1] if y == pos: self.Refresh() # Need to display insertion point else: self.MoveXY(x,pos) def GetMoveRow(self): return self.moveRow def _GetInsertionInfo(self): parent = self.GetParent() sy = parent.GetViewStart()[1] * self.uy sy -= parent.GetColLabelSize() y = self.GetPosition()[1] h = self.GetSize()[1] sRow = parent.YToRow(y + sy) eRow = parent.YToRow(y + h + sy) iPos = yPos = yRow = 99999 centerPos = y + sy + (h / 2) for row in range(sRow,eRow + 1): cy = parent.RowToRect(row)[1] if abs(cy - centerPos) < iPos: iPos = abs(cy - centerPos) yRow = row yPos = cy if yRow < 0 or yRow > parent.GetNumberRows(): yRow = parent.GetNumberRows() return (yPos - sy - y,yRow) def GetInsertionRow(self): return self._GetInsertionInfo()[1] def GetInsertionPos(self): return self._GetInsertionInfo()[0] def OnPaint(self,evt): dc = wx.PaintDC(self) w,h = self.GetSize() dc.DrawBitmap(self.image, 0,0) dc.SetPen(wx.Pen(wx.BLACK,1,wx.SOLID)) dc.SetBrush(wx.TRANSPARENT_BRUSH) dc.DrawRectangle(0,0, w,h) iPos = self.GetInsertionPos() dc.DrawLine(w - 10,iPos, w,iPos) #---------------------------------------------------------------------------- class GridColMover(wx.EvtHandler): def __init__(self,grid): wx.EvtHandler.__init__(self) self.grid = grid self.lwin = grid.GetGridColLabelWindow() self.lwin.PushEventHandler(self) self.colWin = None self.ux = self.grid.GetScrollPixelsPerUnit()[0] self.startX = -10 self.cellX = 0 self.didMove = False self.isDragging = False self.Bind(wx.EVT_MOTION, self.OnMouseMove) self.Bind(wx.EVT_LEFT_DOWN, self.OnPress) self.Bind(wx.EVT_LEFT_UP, self.OnRelease) def OnMouseMove(self,evt): if not self.isDragging: evt.Skip() else: _rlSize = self.grid.GetRowLabelSize() if abs(self.startX - evt.X) >= 3 \ and abs(evt.X - self.lastX) >= 3: self.lastX = evt.X self.didMove = True sx,y = self.grid.GetViewStart() w,h = self.lwin.GetClientSize() x = sx * self.ux if (evt.X + x) < x: x = evt.X + x elif evt.X > w: x += evt.X - w if x < 1: x = 0 else: x /= self.ux if x != sx: if wx.Platform == '__WXMSW__': self.colWin.Show(False) self.grid.Scroll(x,y) x,y = self.lwin.ClientToScreenXY(evt.X,0) x,y = self.grid.ScreenToClientXY(x,y) if not self.colWin.IsShown(): self.colWin.Show(True) px = x - self.cellX if px < 0 + _rlSize: px = 0 + _rlSize if px > w - self.colWin.GetSize()[0] + _rlSize: px = w - self.colWin.GetSize()[0] + _rlSize self.colWin.DisplayAt(px,y) return def OnPress(self,evt): self.startX = self.lastX = evt.X _rlSize = self.grid.GetRowLabelSize() sx = self.grid.GetViewStart()[0] * self.ux sx -= _rlSize px,py = self.lwin.ClientToScreenXY(evt.X,evt.Y) px,py = self.grid.ScreenToClientXY(px,py) if self.grid.XToEdgeOfCol(px + sx) != wx.NOT_FOUND: evt.Skip() return self.isDragging = True self.didMove = False col = self.grid.XToCol(px + sx) rect = self.grid.ColToRect(col) self.cellX = px + sx - rect.x size = self.lwin.GetSize() rect.y = 0 rect.x -= sx + _rlSize rect.height = size[1] colImg = self._CaptureImage(rect) self.colWin = ColDragWindow(self.grid,colImg,col) self.colWin.Show(False) self.lwin.CaptureMouse() evt.Skip() def OnRelease(self,evt): if self.isDragging: self.lwin.ReleaseMouse() self.colWin.Show(False) self.isDragging = False if not self.didMove: px = self.lwin.ClientToScreenXY(self.startX,0)[0] px = self.grid.ScreenToClientXY(px,0)[0] sx = self.grid.GetViewStart()[0] * self.ux sx -= self.grid.GetRowLabelSize() col = self.grid.XToCol(px+sx) if col != wx.NOT_FOUND: self.grid.SelectCol(col,evt.ControlDown()) return else: bCol = self.colWin.GetInsertionColumn() dCol = self.colWin.GetMoveColumn() wx.PostEvent(self, GridColMoveEvent(self.grid.GetId(), dCol, bCol)) self.colWin.Destroy() evt.Skip() def _CaptureImage(self,rect): bmp = wx.EmptyBitmap(rect.width,rect.height) memdc = wx.MemoryDC() memdc.SelectObject(bmp) dc = wx.WindowDC(self.lwin) memdc.Blit(0,0, rect.width, rect.height, dc, rect.x, rect.y) memdc.SelectObject(wx.NullBitmap) return bmp class GridRowMover(wx.EvtHandler): def __init__(self,grid): wx.EvtHandler.__init__(self) self.grid = grid self.lwin = grid.GetGridRowLabelWindow() self.lwin.PushEventHandler(self) self.rowWin = None self.uy = self.grid.GetScrollPixelsPerUnit()[1] self.startY = -10 self.cellY = 0 self.didMove = False self.isDragging = False self.Bind(wx.EVT_MOTION, self.OnMouseMove) self.Bind(wx.EVT_LEFT_DOWN, self.OnPress) self.Bind(wx.EVT_LEFT_UP, self.OnRelease) def OnMouseMove(self,evt): if not self.isDragging: evt.Skip() else: _clSize = self.grid.GetColLabelSize() if abs(self.startY - evt.Y) >= 3 \ and abs(evt.Y - self.lastY) >= 3: self.lastY = evt.Y self.didMove = True x,sy = self.grid.GetViewStart() w,h = self.lwin.GetClientSizeTuple() y = sy * self.uy if (evt.Y + y) < y: y = evt.Y + y elif evt.Y > h: y += evt.Y - h if y < 1: y = 0 else: y /= self.uy if y != sy: if wx.Platform == '__WXMSW__': self.rowWin.Show(False) self.grid.Scroll(x,y) x,y = self.lwin.ClientToScreenXY(0,evt.Y) x,y = self.grid.ScreenToClientXY(x,y) if not self.rowWin.IsShown(): self.rowWin.Show(True) py = y - self.cellY if py < 0 + _clSize: py = 0 + _clSize if py > h - self.rowWin.GetSize()[1] + _clSize: py = h - self.rowWin.GetSize()[1] + _clSize self.rowWin.DisplayAt(x,py) return def OnPress(self,evt): self.startY = self.lastY = evt.Y _clSize = self.grid.GetColLabelSize() sy = self.grid.GetViewStart()[1] * self.uy sy -= _clSize px,py = self.lwin.ClientToScreenXY(evt.X,evt.Y) px,py = self.grid.ScreenToClientXY(px,py) if self.grid.YToEdgeOfRow(py + sy) != wx.NOT_FOUND: evt.Skip() return row = self.grid.YToRow(py + sy) if row == wx.NOT_FOUND: evt.Skip() return self.isDragging = True self.didMove = False rect = self.grid.RowToRect(row) self.cellY = py + sy - rect.y size = self.lwin.GetSize() rect.x = 0 rect.y -= sy + _clSize rect.width = size[0] rowImg = self._CaptureImage(rect) self.rowWin = RowDragWindow(self.grid,rowImg,row) self.rowWin.Show(False) self.lwin.CaptureMouse() evt.Skip() def OnRelease(self,evt): if self.isDragging: self.lwin.ReleaseMouse() self.rowWin.Show(False) self.isDragging = False if not self.didMove: py = self.lwin.ClientToScreenXY(0,self.startY)[1] py = self.grid.ScreenToClientXY(0,py)[1] sy = self.grid.GetViewStart()[1] * self.uy sy -= self.grid.GetColLabelSize() row = self.grid.YToRow(py + sy) if row != wx.NOT_FOUND: self.grid.SelectRow(row,evt.ControlDown()) return else: bRow = self.rowWin.GetInsertionRow() dRow = self.rowWin.GetMoveRow() wx.PostEvent(self, GridRowMoveEvent(self.grid.GetId(), dRow, bRow)) self.rowWin.Destroy() evt.Skip() def _CaptureImage(self,rect): bmp = wx.EmptyBitmap(rect.width,rect.height) memdc = wx.MemoryDC() memdc.SelectObject(bmp) dc = wx.WindowDC(self.lwin) memdc.Blit(0,0, rect.width, rect.height, dc, rect.x, rect.y) memdc.SelectObject(wx.NullBitmap) return bmp #----------------------------------------------------------------------------
30.240891
77
0.522391
import wx import wx.grid wxEVT_COMMAND_GRID_COL_MOVE = wx.NewEventType() wxEVT_COMMAND_GRID_ROW_MOVE = wx.NewEventType() EVT_GRID_COL_MOVE = wx.PyEventBinder(wxEVT_COMMAND_GRID_COL_MOVE, 1) EVT_GRID_ROW_MOVE = wx.PyEventBinder(wxEVT_COMMAND_GRID_ROW_MOVE, 1) class GridColMoveEvent(wx.PyCommandEvent): def __init__(self, id, dCol, bCol): wx.PyCommandEvent.__init__(self, id = id) self.SetEventType(wxEVT_COMMAND_GRID_COL_MOVE) self.moveColumn = dCol self.beforeColumn = bCol def GetMoveColumn(self): return self.moveColumn def GetBeforeColumn(self): return self.beforeColumn class GridRowMoveEvent(wx.PyCommandEvent): def __init__(self, id, dRow, bRow): wx.PyCommandEvent.__init__(self,id = id) self.SetEventType(wxEVT_COMMAND_GRID_ROW_MOVE) self.moveRow = dRow self.beforeRow = bRow def GetMoveRow(self): return self.moveRow def GetBeforeRow(self): return self.beforeRow def _ColToRect(self,col): if self.GetNumberRows() > 0: rect = self.CellToRect(0,col) else: rect = wx.Rect() rect.height = self.GetColLabelSize() rect.width = self.GetColSize(col) for cCol in range(0,col): rect.x += self.GetColSize(cCol) rect.y = self.GetGridColLabelWindow().GetPosition()[1] return rect wx.grid.Grid.ColToRect = _ColToRect def _RowToRect(self,row): if self.GetNumberCols() > 0: rect = self.CellToRect(row,0) else: rect = wx.Rect() rect.width = self.GetRowLabelSize() rect.height = self.GetRowSize(row) for cRow in range(0,row): rect.y += self.GetRowSize(cRow) rect.x = self.GetGridRowLabelWindow().GetPosition()[0] return rect wx.grid.Grid.RowToRect = _RowToRect class ColDragWindow(wx.Window): def __init__(self,parent,image,dragCol): wx.Window.__init__(self,parent,-1, style=wx.SIMPLE_BORDER) self.image = image self.SetSize((self.image.GetWidth(),self.image.GetHeight())) self.ux = parent.GetScrollPixelsPerUnit()[0] self.moveColumn = dragCol self.Bind(wx.EVT_PAINT, self.OnPaint) def DisplayAt(self,pos,y): x = self.GetPositionTuple()[0] if x == pos: self.Refresh() else: self.MoveXY(pos,y) def GetMoveColumn(self): return self.moveColumn def _GetInsertionInfo(self): parent = self.GetParent() sx = parent.GetViewStart()[0] * self.ux sx -= parent.GetRowLabelSize() x = self.GetPosition()[0] w = self.GetSize()[0] sCol = parent.XToCol(x + sx) eCol = parent.XToCol(x + w + sx) iPos = xPos = xCol = 99999 centerPos = x + sx + (w / 2) for col in range(sCol,eCol + 1): cx = parent.ColToRect(col)[0] if abs(cx - centerPos) < iPos: iPos = abs(cx - centerPos) xCol = col xPos = cx if xCol < 0 or xCol > parent.GetNumberCols(): xCol = parent.GetNumberCols() return (xPos - sx - x,xCol) def GetInsertionColumn(self): return self._GetInsertionInfo()[1] def GetInsertionPos(self): return self._GetInsertionInfo()[0] def OnPaint(self,evt): dc = wx.PaintDC(self) w,h = self.GetSize() dc.DrawBitmap(self.image, 0,0) dc.SetPen(wx.Pen(wx.BLACK,1,wx.SOLID)) dc.SetBrush(wx.TRANSPARENT_BRUSH) dc.DrawRectangle(0,0, w,h) iPos = self.GetInsertionPos() dc.DrawLine(iPos,h - 10, iPos,h) class RowDragWindow(wx.Window): def __init__(self,parent,image,dragRow): wx.Window.__init__(self,parent,-1, style=wx.SIMPLE_BORDER) self.image = image self.SetSize((self.image.GetWidth(),self.image.GetHeight())) self.uy = parent.GetScrollPixelsPerUnit()[1] self.moveRow = dragRow self.Bind(wx.EVT_PAINT, self.OnPaint) def DisplayAt(self,x,pos): y = self.GetPosition()[1] if y == pos: self.Refresh() else: self.MoveXY(x,pos) def GetMoveRow(self): return self.moveRow def _GetInsertionInfo(self): parent = self.GetParent() sy = parent.GetViewStart()[1] * self.uy sy -= parent.GetColLabelSize() y = self.GetPosition()[1] h = self.GetSize()[1] sRow = parent.YToRow(y + sy) eRow = parent.YToRow(y + h + sy) iPos = yPos = yRow = 99999 centerPos = y + sy + (h / 2) for row in range(sRow,eRow + 1): cy = parent.RowToRect(row)[1] if abs(cy - centerPos) < iPos: iPos = abs(cy - centerPos) yRow = row yPos = cy if yRow < 0 or yRow > parent.GetNumberRows(): yRow = parent.GetNumberRows() return (yPos - sy - y,yRow) def GetInsertionRow(self): return self._GetInsertionInfo()[1] def GetInsertionPos(self): return self._GetInsertionInfo()[0] def OnPaint(self,evt): dc = wx.PaintDC(self) w,h = self.GetSize() dc.DrawBitmap(self.image, 0,0) dc.SetPen(wx.Pen(wx.BLACK,1,wx.SOLID)) dc.SetBrush(wx.TRANSPARENT_BRUSH) dc.DrawRectangle(0,0, w,h) iPos = self.GetInsertionPos() dc.DrawLine(w - 10,iPos, w,iPos) class GridColMover(wx.EvtHandler): def __init__(self,grid): wx.EvtHandler.__init__(self) self.grid = grid self.lwin = grid.GetGridColLabelWindow() self.lwin.PushEventHandler(self) self.colWin = None self.ux = self.grid.GetScrollPixelsPerUnit()[0] self.startX = -10 self.cellX = 0 self.didMove = False self.isDragging = False self.Bind(wx.EVT_MOTION, self.OnMouseMove) self.Bind(wx.EVT_LEFT_DOWN, self.OnPress) self.Bind(wx.EVT_LEFT_UP, self.OnRelease) def OnMouseMove(self,evt): if not self.isDragging: evt.Skip() else: _rlSize = self.grid.GetRowLabelSize() if abs(self.startX - evt.X) >= 3 \ and abs(evt.X - self.lastX) >= 3: self.lastX = evt.X self.didMove = True sx,y = self.grid.GetViewStart() w,h = self.lwin.GetClientSize() x = sx * self.ux if (evt.X + x) < x: x = evt.X + x elif evt.X > w: x += evt.X - w if x < 1: x = 0 else: x /= self.ux if x != sx: if wx.Platform == '__WXMSW__': self.colWin.Show(False) self.grid.Scroll(x,y) x,y = self.lwin.ClientToScreenXY(evt.X,0) x,y = self.grid.ScreenToClientXY(x,y) if not self.colWin.IsShown(): self.colWin.Show(True) px = x - self.cellX if px < 0 + _rlSize: px = 0 + _rlSize if px > w - self.colWin.GetSize()[0] + _rlSize: px = w - self.colWin.GetSize()[0] + _rlSize self.colWin.DisplayAt(px,y) return def OnPress(self,evt): self.startX = self.lastX = evt.X _rlSize = self.grid.GetRowLabelSize() sx = self.grid.GetViewStart()[0] * self.ux sx -= _rlSize px,py = self.lwin.ClientToScreenXY(evt.X,evt.Y) px,py = self.grid.ScreenToClientXY(px,py) if self.grid.XToEdgeOfCol(px + sx) != wx.NOT_FOUND: evt.Skip() return self.isDragging = True self.didMove = False col = self.grid.XToCol(px + sx) rect = self.grid.ColToRect(col) self.cellX = px + sx - rect.x size = self.lwin.GetSize() rect.y = 0 rect.x -= sx + _rlSize rect.height = size[1] colImg = self._CaptureImage(rect) self.colWin = ColDragWindow(self.grid,colImg,col) self.colWin.Show(False) self.lwin.CaptureMouse() evt.Skip() def OnRelease(self,evt): if self.isDragging: self.lwin.ReleaseMouse() self.colWin.Show(False) self.isDragging = False if not self.didMove: px = self.lwin.ClientToScreenXY(self.startX,0)[0] px = self.grid.ScreenToClientXY(px,0)[0] sx = self.grid.GetViewStart()[0] * self.ux sx -= self.grid.GetRowLabelSize() col = self.grid.XToCol(px+sx) if col != wx.NOT_FOUND: self.grid.SelectCol(col,evt.ControlDown()) return else: bCol = self.colWin.GetInsertionColumn() dCol = self.colWin.GetMoveColumn() wx.PostEvent(self, GridColMoveEvent(self.grid.GetId(), dCol, bCol)) self.colWin.Destroy() evt.Skip() def _CaptureImage(self,rect): bmp = wx.EmptyBitmap(rect.width,rect.height) memdc = wx.MemoryDC() memdc.SelectObject(bmp) dc = wx.WindowDC(self.lwin) memdc.Blit(0,0, rect.width, rect.height, dc, rect.x, rect.y) memdc.SelectObject(wx.NullBitmap) return bmp class GridRowMover(wx.EvtHandler): def __init__(self,grid): wx.EvtHandler.__init__(self) self.grid = grid self.lwin = grid.GetGridRowLabelWindow() self.lwin.PushEventHandler(self) self.rowWin = None self.uy = self.grid.GetScrollPixelsPerUnit()[1] self.startY = -10 self.cellY = 0 self.didMove = False self.isDragging = False self.Bind(wx.EVT_MOTION, self.OnMouseMove) self.Bind(wx.EVT_LEFT_DOWN, self.OnPress) self.Bind(wx.EVT_LEFT_UP, self.OnRelease) def OnMouseMove(self,evt): if not self.isDragging: evt.Skip() else: _clSize = self.grid.GetColLabelSize() if abs(self.startY - evt.Y) >= 3 \ and abs(evt.Y - self.lastY) >= 3: self.lastY = evt.Y self.didMove = True x,sy = self.grid.GetViewStart() w,h = self.lwin.GetClientSizeTuple() y = sy * self.uy if (evt.Y + y) < y: y = evt.Y + y elif evt.Y > h: y += evt.Y - h if y < 1: y = 0 else: y /= self.uy if y != sy: if wx.Platform == '__WXMSW__': self.rowWin.Show(False) self.grid.Scroll(x,y) x,y = self.lwin.ClientToScreenXY(0,evt.Y) x,y = self.grid.ScreenToClientXY(x,y) if not self.rowWin.IsShown(): self.rowWin.Show(True) py = y - self.cellY if py < 0 + _clSize: py = 0 + _clSize if py > h - self.rowWin.GetSize()[1] + _clSize: py = h - self.rowWin.GetSize()[1] + _clSize self.rowWin.DisplayAt(x,py) return def OnPress(self,evt): self.startY = self.lastY = evt.Y _clSize = self.grid.GetColLabelSize() sy = self.grid.GetViewStart()[1] * self.uy sy -= _clSize px,py = self.lwin.ClientToScreenXY(evt.X,evt.Y) px,py = self.grid.ScreenToClientXY(px,py) if self.grid.YToEdgeOfRow(py + sy) != wx.NOT_FOUND: evt.Skip() return row = self.grid.YToRow(py + sy) if row == wx.NOT_FOUND: evt.Skip() return self.isDragging = True self.didMove = False rect = self.grid.RowToRect(row) self.cellY = py + sy - rect.y size = self.lwin.GetSize() rect.x = 0 rect.y -= sy + _clSize rect.width = size[0] rowImg = self._CaptureImage(rect) self.rowWin = RowDragWindow(self.grid,rowImg,row) self.rowWin.Show(False) self.lwin.CaptureMouse() evt.Skip() def OnRelease(self,evt): if self.isDragging: self.lwin.ReleaseMouse() self.rowWin.Show(False) self.isDragging = False if not self.didMove: py = self.lwin.ClientToScreenXY(0,self.startY)[1] py = self.grid.ScreenToClientXY(0,py)[1] sy = self.grid.GetViewStart()[1] * self.uy sy -= self.grid.GetColLabelSize() row = self.grid.YToRow(py + sy) if row != wx.NOT_FOUND: self.grid.SelectRow(row,evt.ControlDown()) return else: bRow = self.rowWin.GetInsertionRow() dRow = self.rowWin.GetMoveRow() wx.PostEvent(self, GridRowMoveEvent(self.grid.GetId(), dRow, bRow)) self.rowWin.Destroy() evt.Skip() def _CaptureImage(self,rect): bmp = wx.EmptyBitmap(rect.width,rect.height) memdc = wx.MemoryDC() memdc.SelectObject(bmp) dc = wx.WindowDC(self.lwin) memdc.Blit(0,0, rect.width, rect.height, dc, rect.x, rect.y) memdc.SelectObject(wx.NullBitmap) return bmp
true
true
f7248062a2abc3c1b4355687c2e16191aa358970
28,942
py
Python
front-end/testsuite-python-lib/Python-2.3/Lib/test/test_re.py
MalloyPower/parsing-python
b2bca5eed07ea2af7a2001cd4f63becdfb0570be
[ "MIT" ]
1
2020-11-26T18:53:46.000Z
2020-11-26T18:53:46.000Z
front-end/testsuite-python-lib/Python-2.3/Lib/test/test_re.py
MalloyPower/parsing-python
b2bca5eed07ea2af7a2001cd4f63becdfb0570be
[ "MIT" ]
null
null
null
front-end/testsuite-python-lib/Python-2.3/Lib/test/test_re.py
MalloyPower/parsing-python
b2bca5eed07ea2af7a2001cd4f63becdfb0570be
[ "MIT" ]
1
2019-04-11T11:27:01.000Z
2019-04-11T11:27:01.000Z
import sys sys.path = ['.'] + sys.path from test.test_support import verbose, run_unittest import re from sre import Scanner import sys, os, traceback # Misc tests from Tim Peters' re.doc # WARNING: Don't change details in these tests if you don't know # what you're doing. Some of these tests were carefuly modeled to # cover most of the code. import unittest class ReTests(unittest.TestCase): def test_search_star_plus(self): self.assertEqual(re.search('x*', 'axx').span(0), (0, 0)) self.assertEqual(re.search('x*', 'axx').span(), (0, 0)) self.assertEqual(re.search('x+', 'axx').span(0), (1, 3)) self.assertEqual(re.search('x+', 'axx').span(), (1, 3)) self.assertEqual(re.search('x', 'aaa'), None) self.assertEqual(re.match('a*', 'xxx').span(0), (0, 0)) self.assertEqual(re.match('a*', 'xxx').span(), (0, 0)) self.assertEqual(re.match('x*', 'xxxa').span(0), (0, 3)) self.assertEqual(re.match('x*', 'xxxa').span(), (0, 3)) self.assertEqual(re.match('a+', 'xxx'), None) def bump_num(self, matchobj): int_value = int(matchobj.group(0)) return str(int_value + 1) def test_basic_re_sub(self): self.assertEqual(re.sub("(?i)b+", "x", "bbbb BBBB"), 'x x') self.assertEqual(re.sub(r'\d+', self.bump_num, '08.2 -2 23x99y'), '9.3 -3 24x100y') self.assertEqual(re.sub(r'\d+', self.bump_num, '08.2 -2 23x99y', 3), '9.3 -3 23x99y') self.assertEqual(re.sub('.', lambda m: r"\n", 'x'), '\\n') self.assertEqual(re.sub('.', r"\n", 'x'), '\n') s = r"\1\1" self.assertEqual(re.sub('(.)', s, 'x'), 'xx') self.assertEqual(re.sub('(.)', re.escape(s), 'x'), s) self.assertEqual(re.sub('(.)', lambda m: s, 'x'), s) self.assertEqual(re.sub('(?P<a>x)', '\g<a>\g<a>', 'xx'), 'xxxx') self.assertEqual(re.sub('(?P<a>x)', '\g<a>\g<1>', 'xx'), 'xxxx') self.assertEqual(re.sub('(?P<unk>x)', '\g<unk>\g<unk>', 'xx'), 'xxxx') self.assertEqual(re.sub('(?P<unk>x)', '\g<1>\g<1>', 'xx'), 'xxxx') self.assertEqual(re.sub('a',r'\t\n\v\r\f\a\b\B\Z\a\A\w\W\s\S\d\D','a'), '\t\n\v\r\f\a\b\\B\\Z\a\\A\\w\\W\\s\\S\\d\\D') self.assertEqual(re.sub('a', '\t\n\v\r\f\a', 'a'), '\t\n\v\r\f\a') self.assertEqual(re.sub('a', '\t\n\v\r\f\a', 'a'), (chr(9)+chr(10)+chr(11)+chr(13)+chr(12)+chr(7))) self.assertEqual(re.sub('^\s*', 'X', 'test'), 'Xtest') def test_bug_449964(self): # fails for group followed by other escape self.assertEqual(re.sub(r'(?P<unk>x)', '\g<1>\g<1>\\b', 'xx'), 'xx\bxx\b') def test_bug_449000(self): # Test for sub() on escaped characters self.assertEqual(re.sub(r'\r\n', r'\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') self.assertEqual(re.sub('\r\n', r'\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') self.assertEqual(re.sub(r'\r\n', '\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') self.assertEqual(re.sub('\r\n', '\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') def test_qualified_re_sub(self): self.assertEqual(re.sub('a', 'b', 'aaaaa'), 'bbbbb') self.assertEqual(re.sub('a', 'b', 'aaaaa', 1), 'baaaa') def test_bug_114660(self): self.assertEqual(re.sub(r'(\S)\s+(\S)', r'\1 \2', 'hello there'), 'hello there') def test_bug_462270(self): # Test for empty sub() behaviour, see SF bug #462270 self.assertEqual(re.sub('x*', '-', 'abxd'), '-a-b-d-') self.assertEqual(re.sub('x+', '-', 'abxd'), 'ab-d') def test_symbolic_refs(self): self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<a', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<a a>', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<1a1>', 'xx') self.assertRaises(IndexError, re.sub, '(?P<a>x)', '\g<ab>', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)|(?P<b>y)', '\g<b>', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)|(?P<b>y)', '\\2', 'xx') def test_re_subn(self): self.assertEqual(re.subn("(?i)b+", "x", "bbbb BBBB"), ('x x', 2)) self.assertEqual(re.subn("b+", "x", "bbbb BBBB"), ('x BBBB', 1)) self.assertEqual(re.subn("b+", "x", "xyz"), ('xyz', 0)) self.assertEqual(re.subn("b*", "x", "xyz"), ('xxxyxzx', 4)) self.assertEqual(re.subn("b*", "x", "xyz", 2), ('xxxyz', 2)) def test_re_split(self): self.assertEqual(re.split(":", ":a:b::c"), ['', 'a', 'b', '', 'c']) self.assertEqual(re.split(":*", ":a:b::c"), ['', 'a', 'b', 'c']) self.assertEqual(re.split("(:*)", ":a:b::c"), ['', ':', 'a', ':', 'b', '::', 'c']) self.assertEqual(re.split("(?::*)", ":a:b::c"), ['', 'a', 'b', 'c']) self.assertEqual(re.split("(:)*", ":a:b::c"), ['', ':', 'a', ':', 'b', ':', 'c']) self.assertEqual(re.split("([b:]+)", ":a:b::c"), ['', ':', 'a', ':b::', 'c']) self.assertEqual(re.split("(b)|(:+)", ":a:b::c"), ['', None, ':', 'a', None, ':', '', 'b', None, '', None, '::', 'c']) self.assertEqual(re.split("(?:b)|(?::+)", ":a:b::c"), ['', 'a', '', '', 'c']) def test_qualified_re_split(self): self.assertEqual(re.split(":", ":a:b::c", 2), ['', 'a', 'b::c']) self.assertEqual(re.split(':', 'a:b:c:d', 2), ['a', 'b', 'c:d']) self.assertEqual(re.split("(:)", ":a:b::c", 2), ['', ':', 'a', ':', 'b::c']) self.assertEqual(re.split("(:*)", ":a:b::c", 2), ['', ':', 'a', ':', 'b::c']) def test_re_findall(self): self.assertEqual(re.findall(":+", "abc"), []) self.assertEqual(re.findall(":+", "a:b::c:::d"), [":", "::", ":::"]) self.assertEqual(re.findall("(:+)", "a:b::c:::d"), [":", "::", ":::"]) self.assertEqual(re.findall("(:)(:*)", "a:b::c:::d"), [(":", ""), (":", ":"), (":", "::")]) def test_bug_117612(self): self.assertEqual(re.findall(r"(a|(b))", "aba"), [("a", ""),("b", "b"),("a", "")]) def test_re_match(self): self.assertEqual(re.match('a', 'a').groups(), ()) self.assertEqual(re.match('(a)', 'a').groups(), ('a',)) self.assertEqual(re.match(r'(a)', 'a').group(0), 'a') self.assertEqual(re.match(r'(a)', 'a').group(1), 'a') self.assertEqual(re.match(r'(a)', 'a').group(1, 1), ('a', 'a')) pat = re.compile('((a)|(b))(c)?') self.assertEqual(pat.match('a').groups(), ('a', 'a', None, None)) self.assertEqual(pat.match('b').groups(), ('b', None, 'b', None)) self.assertEqual(pat.match('ac').groups(), ('a', 'a', None, 'c')) self.assertEqual(pat.match('bc').groups(), ('b', None, 'b', 'c')) self.assertEqual(pat.match('bc').groups(""), ('b', "", 'b', 'c')) # A single group m = re.match('(a)', 'a') self.assertEqual(m.group(0), 'a') self.assertEqual(m.group(0), 'a') self.assertEqual(m.group(1), 'a') self.assertEqual(m.group(1, 1), ('a', 'a')) pat = re.compile('(?:(?P<a1>a)|(?P<b2>b))(?P<c3>c)?') self.assertEqual(pat.match('a').group(1, 2, 3), ('a', None, None)) self.assertEqual(pat.match('b').group('a1', 'b2', 'c3'), (None, 'b', None)) self.assertEqual(pat.match('ac').group(1, 'b2', 3), ('a', None, 'c')) def test_re_groupref_exists(self): return # not yet self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', '(a)').groups(), ('(', 'a')) self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', 'a').groups(), (None, 'a')) self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', 'a)'), None) self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', '(a'), None) self.assertEqual(re.match('^(?:(a)|c)((?(1)b|d))$', 'ab').groups(), ('a', 'b')) self.assertEqual(re.match('^(?:(a)|c)((?(1)b|d))$', 'cd').groups(), (None, 'd')) self.assertEqual(re.match('^(?:(a)|c)((?(1)|d))$', 'cd').groups(), (None, 'd')) self.assertEqual(re.match('^(?:(a)|c)((?(1)|d))$', 'a').groups(), ('a', '')) def test_re_groupref(self): self.assertEqual(re.match(r'^(\|)?([^()]+)\1$', '|a|').groups(), ('|', 'a')) self.assertEqual(re.match(r'^(\|)?([^()]+)\1?$', 'a').groups(), (None, 'a')) self.assertEqual(re.match(r'^(\|)?([^()]+)\1$', 'a|'), None) self.assertEqual(re.match(r'^(\|)?([^()]+)\1$', '|a'), None) self.assertEqual(re.match(r'^(?:(a)|c)(\1)$', 'aa').groups(), ('a', 'a')) self.assertEqual(re.match(r'^(?:(a)|c)(\1)?$', 'c').groups(), (None, None)) def test_groupdict(self): self.assertEqual(re.match('(?P<first>first) (?P<second>second)', 'first second').groupdict(), {'first':'first', 'second':'second'}) def test_expand(self): self.assertEqual(re.match("(?P<first>first) (?P<second>second)", "first second") .expand(r"\2 \1 \g<second> \g<first>"), "second first second first") def test_repeat_minmax(self): self.assertEqual(re.match("^(\w){1}$", "abc"), None) self.assertEqual(re.match("^(\w){1}?$", "abc"), None) self.assertEqual(re.match("^(\w){1,2}$", "abc"), None) self.assertEqual(re.match("^(\w){1,2}?$", "abc"), None) self.assertEqual(re.match("^(\w){3}$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,3}$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,4}$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){3,4}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){3}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,3}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,4}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){3,4}?$", "abc").group(1), "c") self.assertEqual(re.match("^x{1}$", "xxx"), None) self.assertEqual(re.match("^x{1}?$", "xxx"), None) self.assertEqual(re.match("^x{1,2}$", "xxx"), None) self.assertEqual(re.match("^x{1,2}?$", "xxx"), None) self.assertNotEqual(re.match("^x{3}$", "xxx"), None) self.assertNotEqual(re.match("^x{1,3}$", "xxx"), None) self.assertNotEqual(re.match("^x{1,4}$", "xxx"), None) self.assertNotEqual(re.match("^x{3,4}?$", "xxx"), None) self.assertNotEqual(re.match("^x{3}?$", "xxx"), None) self.assertNotEqual(re.match("^x{1,3}?$", "xxx"), None) self.assertNotEqual(re.match("^x{1,4}?$", "xxx"), None) self.assertNotEqual(re.match("^x{3,4}?$", "xxx"), None) def test_getattr(self): self.assertEqual(re.match("(a)", "a").pos, 0) self.assertEqual(re.match("(a)", "a").endpos, 1) self.assertEqual(re.match("(a)", "a").string, "a") self.assertEqual(re.match("(a)", "a").regs, ((0, 1), (0, 1))) self.assertNotEqual(re.match("(a)", "a").re, None) def test_special_escapes(self): self.assertEqual(re.search(r"\b(b.)\b", "abcd abc bcd bx").group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", "abc bcd bc abxd").group(1), "bx") self.assertEqual(re.search(r"\b(b.)\b", "abcd abc bcd bx", re.LOCALE).group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", "abc bcd bc abxd", re.LOCALE).group(1), "bx") self.assertEqual(re.search(r"\b(b.)\b", "abcd abc bcd bx", re.UNICODE).group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", "abc bcd bc abxd", re.UNICODE).group(1), "bx") self.assertEqual(re.search(r"^abc$", "\nabc\n", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", "abc", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", "\nabc\n", re.M), None) self.assertEqual(re.search(r"\b(b.)\b", u"abcd abc bcd bx").group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", u"abc bcd bc abxd").group(1), "bx") self.assertEqual(re.search(r"^abc$", u"\nabc\n", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", u"abc", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", u"\nabc\n", re.M), None) self.assertEqual(re.search(r"\d\D\w\W\s\S", "1aa! a").group(0), "1aa! a") self.assertEqual(re.search(r"\d\D\w\W\s\S", "1aa! a", re.LOCALE).group(0), "1aa! a") self.assertEqual(re.search(r"\d\D\w\W\s\S", "1aa! a", re.UNICODE).group(0), "1aa! a") def test_ignore_case(self): self.assertEqual(re.match("abc", "ABC", re.I).group(0), "ABC") self.assertEqual(re.match("abc", u"ABC", re.I).group(0), "ABC") def test_bigcharset(self): self.assertEqual(re.match(u"([\u2222\u2223])", u"\u2222").group(1), u"\u2222") self.assertEqual(re.match(u"([\u2222\u2223])", u"\u2222", re.UNICODE).group(1), u"\u2222") def test_anyall(self): self.assertEqual(re.match("a.b", "a\nb", re.DOTALL).group(0), "a\nb") self.assertEqual(re.match("a.*b", "a\n\nb", re.DOTALL).group(0), "a\n\nb") def test_non_consuming(self): self.assertEqual(re.match("(a(?=\s[^a]))", "a b").group(1), "a") self.assertEqual(re.match("(a(?=\s[^a]*))", "a b").group(1), "a") self.assertEqual(re.match("(a(?=\s[abc]))", "a b").group(1), "a") self.assertEqual(re.match("(a(?=\s[abc]*))", "a bc").group(1), "a") self.assertEqual(re.match(r"(a)(?=\s\1)", "a a").group(1), "a") self.assertEqual(re.match(r"(a)(?=\s\1*)", "a aa").group(1), "a") self.assertEqual(re.match(r"(a)(?=\s(abc|a))", "a a").group(1), "a") self.assertEqual(re.match(r"(a(?!\s[^a]))", "a a").group(1), "a") self.assertEqual(re.match(r"(a(?!\s[abc]))", "a d").group(1), "a") self.assertEqual(re.match(r"(a)(?!\s\1)", "a b").group(1), "a") self.assertEqual(re.match(r"(a)(?!\s(abc|a))", "a b").group(1), "a") def test_ignore_case(self): self.assertEqual(re.match(r"(a\s[^a])", "a b", re.I).group(1), "a b") self.assertEqual(re.match(r"(a\s[^a]*)", "a bb", re.I).group(1), "a bb") self.assertEqual(re.match(r"(a\s[abc])", "a b", re.I).group(1), "a b") self.assertEqual(re.match(r"(a\s[abc]*)", "a bb", re.I).group(1), "a bb") self.assertEqual(re.match(r"((a)\s\2)", "a a", re.I).group(1), "a a") self.assertEqual(re.match(r"((a)\s\2*)", "a aa", re.I).group(1), "a aa") self.assertEqual(re.match(r"((a)\s(abc|a))", "a a", re.I).group(1), "a a") self.assertEqual(re.match(r"((a)\s(abc|a)*)", "a aa", re.I).group(1), "a aa") def test_category(self): self.assertEqual(re.match(r"(\s)", " ").group(1), " ") def test_getlower(self): import _sre self.assertEqual(_sre.getlower(ord('A'), 0), ord('a')) self.assertEqual(_sre.getlower(ord('A'), re.LOCALE), ord('a')) self.assertEqual(_sre.getlower(ord('A'), re.UNICODE), ord('a')) self.assertEqual(re.match("abc", "ABC", re.I).group(0), "ABC") self.assertEqual(re.match("abc", u"ABC", re.I).group(0), "ABC") def test_not_literal(self): self.assertEqual(re.search("\s([^a])", " b").group(1), "b") self.assertEqual(re.search("\s([^a]*)", " bb").group(1), "bb") def test_search_coverage(self): self.assertEqual(re.search("\s(b)", " b").group(1), "b") self.assertEqual(re.search("a\s", "a ").group(0), "a ") def test_re_escape(self): p="" for i in range(0, 256): p = p + chr(i) self.assertEqual(re.match(re.escape(chr(i)), chr(i)) is not None, True) self.assertEqual(re.match(re.escape(chr(i)), chr(i)).span(), (0,1)) pat=re.compile(re.escape(p)) self.assertEqual(pat.match(p) is not None, True) self.assertEqual(pat.match(p).span(), (0,256)) def test_pickling(self): import pickle self.pickle_test(pickle) import cPickle self.pickle_test(cPickle) def pickle_test(self, pickle): oldpat = re.compile('a(?:b|(c|e){1,2}?|d)+?(.)') s = pickle.dumps(oldpat) newpat = pickle.loads(s) self.assertEqual(oldpat, newpat) def test_constants(self): self.assertEqual(re.I, re.IGNORECASE) self.assertEqual(re.L, re.LOCALE) self.assertEqual(re.M, re.MULTILINE) self.assertEqual(re.S, re.DOTALL) self.assertEqual(re.X, re.VERBOSE) def test_flags(self): for flag in [re.I, re.M, re.X, re.S, re.L]: self.assertNotEqual(re.compile('^pattern$', flag), None) def test_sre_character_literals(self): for i in [0, 8, 16, 32, 64, 127, 128, 255]: self.assertNotEqual(re.match(r"\%03o" % i, chr(i)), None) self.assertNotEqual(re.match(r"\%03o0" % i, chr(i)+"0"), None) self.assertNotEqual(re.match(r"\%03o8" % i, chr(i)+"8"), None) self.assertNotEqual(re.match(r"\x%02x" % i, chr(i)), None) self.assertNotEqual(re.match(r"\x%02x0" % i, chr(i)+"0"), None) self.assertNotEqual(re.match(r"\x%02xz" % i, chr(i)+"z"), None) self.assertRaises(re.error, re.match, "\911", "") def test_bug_113254(self): self.assertEqual(re.match(r'(a)|(b)', 'b').start(1), -1) self.assertEqual(re.match(r'(a)|(b)', 'b').end(1), -1) self.assertEqual(re.match(r'(a)|(b)', 'b').span(1), (-1, -1)) def test_bug_527371(self): # bug described in patches 527371/672491 self.assertEqual(re.match(r'(a)?a','a').lastindex, None) self.assertEqual(re.match(r'(a)(b)?b','ab').lastindex, 1) self.assertEqual(re.match(r'(?P<a>a)(?P<b>b)?b','ab').lastgroup, 'a') self.assertEqual(re.match("(?P<a>a(b))", "ab").lastgroup, 'a') self.assertEqual(re.match("((a))", "a").lastindex, 1) def test_bug_545855(self): # bug 545855 -- This pattern failed to cause a compile error as it # should, instead provoking a TypeError. self.assertRaises(re.error, re.compile, 'foo[a-') def test_bug_418626(self): # bugs 418626 at al. -- Testing Greg Chapman's addition of op code # SRE_OP_MIN_REPEAT_ONE for eliminating recursion on simple uses of # pattern '*?' on a long string. self.assertEqual(re.match('.*?c', 10000*'ab'+'cd').end(0), 20001) self.assertEqual(re.match('.*?cd', 5000*'ab'+'c'+5000*'ab'+'cde').end(0), 20003) self.assertEqual(re.match('.*?cd', 20000*'abc'+'de').end(0), 60001) # non-simple '*?' still recurses and hits the recursion limit self.assertRaises(RuntimeError, re.search, '(a|b)*?c', 10000*'ab'+'cd') def test_bug_612074(self): pat=u"["+re.escape(u"\u2039")+u"]" self.assertEqual(re.compile(pat) and 1, 1) def test_stack_overflow(self): # nasty case that overflows the straightforward recursive # implementation of repeated groups. self.assertRaises(RuntimeError, re.match, '(x)*', 50000*'x') self.assertRaises(RuntimeError, re.match, '(x)*y', 50000*'x'+'y') self.assertRaises(RuntimeError, re.match, '(x)*?y', 50000*'x'+'y') def test_scanner(self): def s_ident(scanner, token): return token def s_operator(scanner, token): return "op%s" % token def s_float(scanner, token): return float(token) def s_int(scanner, token): return int(token) scanner = Scanner([ (r"[a-zA-Z_]\w*", s_ident), (r"\d+\.\d*", s_float), (r"\d+", s_int), (r"=|\+|-|\*|/", s_operator), (r"\s+", None), ]) self.assertNotEqual(scanner.scanner.scanner("").pattern, None) self.assertEqual(scanner.scan("sum = 3*foo + 312.50 + bar"), (['sum', 'op=', 3, 'op*', 'foo', 'op+', 312.5, 'op+', 'bar'], '')) def test_bug_448951(self): # bug 448951 (similar to 429357, but with single char match) # (Also test greedy matches.) for op in '','?','*': self.assertEqual(re.match(r'((.%s):)?z'%op, 'z').groups(), (None, None)) self.assertEqual(re.match(r'((.%s):)?z'%op, 'a:z').groups(), ('a:', 'a')) def test_bug_725106(self): # capturing groups in alternatives in repeats self.assertEqual(re.match('^((a)|b)*', 'abc').groups(), ('b', 'a')) self.assertEqual(re.match('^(([ab])|c)*', 'abc').groups(), ('c', 'b')) self.assertEqual(re.match('^((d)|[ab])*', 'abc').groups(), ('b', None)) self.assertEqual(re.match('^((a)c|[ab])*', 'abc').groups(), ('b', None)) self.assertEqual(re.match('^((a)|b)*?c', 'abc').groups(), ('b', 'a')) self.assertEqual(re.match('^(([ab])|c)*?d', 'abcd').groups(), ('c', 'b')) self.assertEqual(re.match('^((d)|[ab])*?c', 'abc').groups(), ('b', None)) self.assertEqual(re.match('^((a)c|[ab])*?c', 'abc').groups(), ('b', None)) def test_bug_725149(self): # mark_stack_base restoring before restoring marks self.assertEqual(re.match('(a)(?:(?=(b)*)c)*', 'abb').groups(), ('a', None)) self.assertEqual(re.match('(a)((?!(b)*))*', 'abb').groups(), ('a', None, None)) def test_bug_764548(self): # bug 764548, re.compile() barfs on str/unicode subclasses try: unicode except NameError: return # no problem if we have no unicode class my_unicode(unicode): pass pat = re.compile(my_unicode("abc")) self.assertEqual(pat.match("xyz"), None) def test_finditer(self): iter = re.finditer(r":+", "a:b::c:::d") self.assertEqual([item.group(0) for item in iter], [":", "::", ":::"]) def run_re_tests(): from test.re_tests import benchmarks, tests, SUCCEED, FAIL, SYNTAX_ERROR if verbose: print 'Running re_tests test suite' else: # To save time, only run the first and last 10 tests #tests = tests[:10] + tests[-10:] pass for t in tests: sys.stdout.flush() pattern = s = outcome = repl = expected = None if len(t) == 5: pattern, s, outcome, repl, expected = t elif len(t) == 3: pattern, s, outcome = t else: raise ValueError, ('Test tuples should have 3 or 5 fields', t) try: obj = re.compile(pattern) except re.error: if outcome == SYNTAX_ERROR: pass # Expected a syntax error else: print '=== Syntax error:', t except KeyboardInterrupt: raise KeyboardInterrupt except: print '*** Unexpected error ***', t if verbose: traceback.print_exc(file=sys.stdout) else: try: result = obj.search(s) except re.error, msg: print '=== Unexpected exception', t, repr(msg) if outcome == SYNTAX_ERROR: # This should have been a syntax error; forget it. pass elif outcome == FAIL: if result is None: pass # No match, as expected else: print '=== Succeeded incorrectly', t elif outcome == SUCCEED: if result is not None: # Matched, as expected, so now we compute the # result string and compare it to our expected result. start, end = result.span(0) vardict={'found': result.group(0), 'groups': result.group(), 'flags': result.re.flags} for i in range(1, 100): try: gi = result.group(i) # Special hack because else the string concat fails: if gi is None: gi = "None" except IndexError: gi = "Error" vardict['g%d' % i] = gi for i in result.re.groupindex.keys(): try: gi = result.group(i) if gi is None: gi = "None" except IndexError: gi = "Error" vardict[i] = gi repl = eval(repl, vardict) if repl != expected: print '=== grouping error', t, print repr(repl) + ' should be ' + repr(expected) else: print '=== Failed incorrectly', t # Try the match on a unicode string, and check that it # still succeeds. try: result = obj.search(unicode(s, "latin-1")) if result is None: print '=== Fails on unicode match', t except NameError: continue # 1.5.2 except TypeError: continue # unicode test case # Try the match on a unicode pattern, and check that it # still succeeds. obj=re.compile(unicode(pattern, "latin-1")) result = obj.search(s) if result is None: print '=== Fails on unicode pattern match', t # Try the match with the search area limited to the extent # of the match and see if it still succeeds. \B will # break (because it won't match at the end or start of a # string), so we'll ignore patterns that feature it. if pattern[:2] != '\\B' and pattern[-2:] != '\\B' \ and result is not None: obj = re.compile(pattern) result = obj.search(s, result.start(0), result.end(0) + 1) if result is None: print '=== Failed on range-limited match', t # Try the match with IGNORECASE enabled, and check that it # still succeeds. obj = re.compile(pattern, re.IGNORECASE) result = obj.search(s) if result is None: print '=== Fails on case-insensitive match', t # Try the match with LOCALE enabled, and check that it # still succeeds. obj = re.compile(pattern, re.LOCALE) result = obj.search(s) if result is None: print '=== Fails on locale-sensitive match', t # Try the match with UNICODE locale enabled, and check # that it still succeeds. obj = re.compile(pattern, re.UNICODE) result = obj.search(s) if result is None: print '=== Fails on unicode-sensitive match', t def test_main(): run_unittest(ReTests) run_re_tests() if __name__ == "__main__": test_main()
46.530547
85
0.478854
import sys sys.path = ['.'] + sys.path from test.test_support import verbose, run_unittest import re from sre import Scanner import sys, os, traceback # WARNING: Don't change details in these tests if you don't know # what you're doing. Some of these tests were carefuly modeled to import unittest class ReTests(unittest.TestCase): def test_search_star_plus(self): self.assertEqual(re.search('x*', 'axx').span(0), (0, 0)) self.assertEqual(re.search('x*', 'axx').span(), (0, 0)) self.assertEqual(re.search('x+', 'axx').span(0), (1, 3)) self.assertEqual(re.search('x+', 'axx').span(), (1, 3)) self.assertEqual(re.search('x', 'aaa'), None) self.assertEqual(re.match('a*', 'xxx').span(0), (0, 0)) self.assertEqual(re.match('a*', 'xxx').span(), (0, 0)) self.assertEqual(re.match('x*', 'xxxa').span(0), (0, 3)) self.assertEqual(re.match('x*', 'xxxa').span(), (0, 3)) self.assertEqual(re.match('a+', 'xxx'), None) def bump_num(self, matchobj): int_value = int(matchobj.group(0)) return str(int_value + 1) def test_basic_re_sub(self): self.assertEqual(re.sub("(?i)b+", "x", "bbbb BBBB"), 'x x') self.assertEqual(re.sub(r'\d+', self.bump_num, '08.2 -2 23x99y'), '9.3 -3 24x100y') self.assertEqual(re.sub(r'\d+', self.bump_num, '08.2 -2 23x99y', 3), '9.3 -3 23x99y') self.assertEqual(re.sub('.', lambda m: r"\n", 'x'), '\\n') self.assertEqual(re.sub('.', r"\n", 'x'), '\n') s = r"\1\1" self.assertEqual(re.sub('(.)', s, 'x'), 'xx') self.assertEqual(re.sub('(.)', re.escape(s), 'x'), s) self.assertEqual(re.sub('(.)', lambda m: s, 'x'), s) self.assertEqual(re.sub('(?P<a>x)', '\g<a>\g<a>', 'xx'), 'xxxx') self.assertEqual(re.sub('(?P<a>x)', '\g<a>\g<1>', 'xx'), 'xxxx') self.assertEqual(re.sub('(?P<unk>x)', '\g<unk>\g<unk>', 'xx'), 'xxxx') self.assertEqual(re.sub('(?P<unk>x)', '\g<1>\g<1>', 'xx'), 'xxxx') self.assertEqual(re.sub('a',r'\t\n\v\r\f\a\b\B\Z\a\A\w\W\s\S\d\D','a'), '\t\n\v\r\f\a\b\\B\\Z\a\\A\\w\\W\\s\\S\\d\\D') self.assertEqual(re.sub('a', '\t\n\v\r\f\a', 'a'), '\t\n\v\r\f\a') self.assertEqual(re.sub('a', '\t\n\v\r\f\a', 'a'), (chr(9)+chr(10)+chr(11)+chr(13)+chr(12)+chr(7))) self.assertEqual(re.sub('^\s*', 'X', 'test'), 'Xtest') def test_bug_449964(self): self.assertEqual(re.sub(r'(?P<unk>x)', '\g<1>\g<1>\\b', 'xx'), 'xx\bxx\b') def test_bug_449000(self): self.assertEqual(re.sub(r'\r\n', r'\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') self.assertEqual(re.sub('\r\n', r'\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') self.assertEqual(re.sub(r'\r\n', '\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') self.assertEqual(re.sub('\r\n', '\n', 'abc\r\ndef\r\n'), 'abc\ndef\n') def test_qualified_re_sub(self): self.assertEqual(re.sub('a', 'b', 'aaaaa'), 'bbbbb') self.assertEqual(re.sub('a', 'b', 'aaaaa', 1), 'baaaa') def test_bug_114660(self): self.assertEqual(re.sub(r'(\S)\s+(\S)', r'\1 \2', 'hello there'), 'hello there') def test_bug_462270(self): self.assertEqual(re.sub('x*', '-', 'abxd'), '-a-b-d-') self.assertEqual(re.sub('x+', '-', 'abxd'), 'ab-d') def test_symbolic_refs(self): self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<a', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<a a>', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)', '\g<1a1>', 'xx') self.assertRaises(IndexError, re.sub, '(?P<a>x)', '\g<ab>', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)|(?P<b>y)', '\g<b>', 'xx') self.assertRaises(re.error, re.sub, '(?P<a>x)|(?P<b>y)', '\\2', 'xx') def test_re_subn(self): self.assertEqual(re.subn("(?i)b+", "x", "bbbb BBBB"), ('x x', 2)) self.assertEqual(re.subn("b+", "x", "bbbb BBBB"), ('x BBBB', 1)) self.assertEqual(re.subn("b+", "x", "xyz"), ('xyz', 0)) self.assertEqual(re.subn("b*", "x", "xyz"), ('xxxyxzx', 4)) self.assertEqual(re.subn("b*", "x", "xyz", 2), ('xxxyz', 2)) def test_re_split(self): self.assertEqual(re.split(":", ":a:b::c"), ['', 'a', 'b', '', 'c']) self.assertEqual(re.split(":*", ":a:b::c"), ['', 'a', 'b', 'c']) self.assertEqual(re.split("(:*)", ":a:b::c"), ['', ':', 'a', ':', 'b', '::', 'c']) self.assertEqual(re.split("(?::*)", ":a:b::c"), ['', 'a', 'b', 'c']) self.assertEqual(re.split("(:)*", ":a:b::c"), ['', ':', 'a', ':', 'b', ':', 'c']) self.assertEqual(re.split("([b:]+)", ":a:b::c"), ['', ':', 'a', ':b::', 'c']) self.assertEqual(re.split("(b)|(:+)", ":a:b::c"), ['', None, ':', 'a', None, ':', '', 'b', None, '', None, '::', 'c']) self.assertEqual(re.split("(?:b)|(?::+)", ":a:b::c"), ['', 'a', '', '', 'c']) def test_qualified_re_split(self): self.assertEqual(re.split(":", ":a:b::c", 2), ['', 'a', 'b::c']) self.assertEqual(re.split(':', 'a:b:c:d', 2), ['a', 'b', 'c:d']) self.assertEqual(re.split("(:)", ":a:b::c", 2), ['', ':', 'a', ':', 'b::c']) self.assertEqual(re.split("(:*)", ":a:b::c", 2), ['', ':', 'a', ':', 'b::c']) def test_re_findall(self): self.assertEqual(re.findall(":+", "abc"), []) self.assertEqual(re.findall(":+", "a:b::c:::d"), [":", "::", ":::"]) self.assertEqual(re.findall("(:+)", "a:b::c:::d"), [":", "::", ":::"]) self.assertEqual(re.findall("(:)(:*)", "a:b::c:::d"), [(":", ""), (":", ":"), (":", "::")]) def test_bug_117612(self): self.assertEqual(re.findall(r"(a|(b))", "aba"), [("a", ""),("b", "b"),("a", "")]) def test_re_match(self): self.assertEqual(re.match('a', 'a').groups(), ()) self.assertEqual(re.match('(a)', 'a').groups(), ('a',)) self.assertEqual(re.match(r'(a)', 'a').group(0), 'a') self.assertEqual(re.match(r'(a)', 'a').group(1), 'a') self.assertEqual(re.match(r'(a)', 'a').group(1, 1), ('a', 'a')) pat = re.compile('((a)|(b))(c)?') self.assertEqual(pat.match('a').groups(), ('a', 'a', None, None)) self.assertEqual(pat.match('b').groups(), ('b', None, 'b', None)) self.assertEqual(pat.match('ac').groups(), ('a', 'a', None, 'c')) self.assertEqual(pat.match('bc').groups(), ('b', None, 'b', 'c')) self.assertEqual(pat.match('bc').groups(""), ('b', "", 'b', 'c')) m = re.match('(a)', 'a') self.assertEqual(m.group(0), 'a') self.assertEqual(m.group(0), 'a') self.assertEqual(m.group(1), 'a') self.assertEqual(m.group(1, 1), ('a', 'a')) pat = re.compile('(?:(?P<a1>a)|(?P<b2>b))(?P<c3>c)?') self.assertEqual(pat.match('a').group(1, 2, 3), ('a', None, None)) self.assertEqual(pat.match('b').group('a1', 'b2', 'c3'), (None, 'b', None)) self.assertEqual(pat.match('ac').group(1, 'b2', 3), ('a', None, 'c')) def test_re_groupref_exists(self): return self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', '(a)').groups(), ('(', 'a')) self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', 'a').groups(), (None, 'a')) self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', 'a)'), None) self.assertEqual(re.match('^(\()?([^()]+)(?(1)\))$', '(a'), None) self.assertEqual(re.match('^(?:(a)|c)((?(1)b|d))$', 'ab').groups(), ('a', 'b')) self.assertEqual(re.match('^(?:(a)|c)((?(1)b|d))$', 'cd').groups(), (None, 'd')) self.assertEqual(re.match('^(?:(a)|c)((?(1)|d))$', 'cd').groups(), (None, 'd')) self.assertEqual(re.match('^(?:(a)|c)((?(1)|d))$', 'a').groups(), ('a', '')) def test_re_groupref(self): self.assertEqual(re.match(r'^(\|)?([^()]+)\1$', '|a|').groups(), ('|', 'a')) self.assertEqual(re.match(r'^(\|)?([^()]+)\1?$', 'a').groups(), (None, 'a')) self.assertEqual(re.match(r'^(\|)?([^()]+)\1$', 'a|'), None) self.assertEqual(re.match(r'^(\|)?([^()]+)\1$', '|a'), None) self.assertEqual(re.match(r'^(?:(a)|c)(\1)$', 'aa').groups(), ('a', 'a')) self.assertEqual(re.match(r'^(?:(a)|c)(\1)?$', 'c').groups(), (None, None)) def test_groupdict(self): self.assertEqual(re.match('(?P<first>first) (?P<second>second)', 'first second').groupdict(), {'first':'first', 'second':'second'}) def test_expand(self): self.assertEqual(re.match("(?P<first>first) (?P<second>second)", "first second") .expand(r"\2 \1 \g<second> \g<first>"), "second first second first") def test_repeat_minmax(self): self.assertEqual(re.match("^(\w){1}$", "abc"), None) self.assertEqual(re.match("^(\w){1}?$", "abc"), None) self.assertEqual(re.match("^(\w){1,2}$", "abc"), None) self.assertEqual(re.match("^(\w){1,2}?$", "abc"), None) self.assertEqual(re.match("^(\w){3}$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,3}$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,4}$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){3,4}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){3}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,3}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){1,4}?$", "abc").group(1), "c") self.assertEqual(re.match("^(\w){3,4}?$", "abc").group(1), "c") self.assertEqual(re.match("^x{1}$", "xxx"), None) self.assertEqual(re.match("^x{1}?$", "xxx"), None) self.assertEqual(re.match("^x{1,2}$", "xxx"), None) self.assertEqual(re.match("^x{1,2}?$", "xxx"), None) self.assertNotEqual(re.match("^x{3}$", "xxx"), None) self.assertNotEqual(re.match("^x{1,3}$", "xxx"), None) self.assertNotEqual(re.match("^x{1,4}$", "xxx"), None) self.assertNotEqual(re.match("^x{3,4}?$", "xxx"), None) self.assertNotEqual(re.match("^x{3}?$", "xxx"), None) self.assertNotEqual(re.match("^x{1,3}?$", "xxx"), None) self.assertNotEqual(re.match("^x{1,4}?$", "xxx"), None) self.assertNotEqual(re.match("^x{3,4}?$", "xxx"), None) def test_getattr(self): self.assertEqual(re.match("(a)", "a").pos, 0) self.assertEqual(re.match("(a)", "a").endpos, 1) self.assertEqual(re.match("(a)", "a").string, "a") self.assertEqual(re.match("(a)", "a").regs, ((0, 1), (0, 1))) self.assertNotEqual(re.match("(a)", "a").re, None) def test_special_escapes(self): self.assertEqual(re.search(r"\b(b.)\b", "abcd abc bcd bx").group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", "abc bcd bc abxd").group(1), "bx") self.assertEqual(re.search(r"\b(b.)\b", "abcd abc bcd bx", re.LOCALE).group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", "abc bcd bc abxd", re.LOCALE).group(1), "bx") self.assertEqual(re.search(r"\b(b.)\b", "abcd abc bcd bx", re.UNICODE).group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", "abc bcd bc abxd", re.UNICODE).group(1), "bx") self.assertEqual(re.search(r"^abc$", "\nabc\n", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", "abc", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", "\nabc\n", re.M), None) self.assertEqual(re.search(r"\b(b.)\b", u"abcd abc bcd bx").group(1), "bx") self.assertEqual(re.search(r"\B(b.)\B", u"abc bcd bc abxd").group(1), "bx") self.assertEqual(re.search(r"^abc$", u"\nabc\n", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", u"abc", re.M).group(0), "abc") self.assertEqual(re.search(r"^\Aabc\Z$", u"\nabc\n", re.M), None) self.assertEqual(re.search(r"\d\D\w\W\s\S", "1aa! a").group(0), "1aa! a") self.assertEqual(re.search(r"\d\D\w\W\s\S", "1aa! a", re.LOCALE).group(0), "1aa! a") self.assertEqual(re.search(r"\d\D\w\W\s\S", "1aa! a", re.UNICODE).group(0), "1aa! a") def test_ignore_case(self): self.assertEqual(re.match("abc", "ABC", re.I).group(0), "ABC") self.assertEqual(re.match("abc", u"ABC", re.I).group(0), "ABC") def test_bigcharset(self): self.assertEqual(re.match(u"([\u2222\u2223])", u"\u2222").group(1), u"\u2222") self.assertEqual(re.match(u"([\u2222\u2223])", u"\u2222", re.UNICODE).group(1), u"\u2222") def test_anyall(self): self.assertEqual(re.match("a.b", "a\nb", re.DOTALL).group(0), "a\nb") self.assertEqual(re.match("a.*b", "a\n\nb", re.DOTALL).group(0), "a\n\nb") def test_non_consuming(self): self.assertEqual(re.match("(a(?=\s[^a]))", "a b").group(1), "a") self.assertEqual(re.match("(a(?=\s[^a]*))", "a b").group(1), "a") self.assertEqual(re.match("(a(?=\s[abc]))", "a b").group(1), "a") self.assertEqual(re.match("(a(?=\s[abc]*))", "a bc").group(1), "a") self.assertEqual(re.match(r"(a)(?=\s\1)", "a a").group(1), "a") self.assertEqual(re.match(r"(a)(?=\s\1*)", "a aa").group(1), "a") self.assertEqual(re.match(r"(a)(?=\s(abc|a))", "a a").group(1), "a") self.assertEqual(re.match(r"(a(?!\s[^a]))", "a a").group(1), "a") self.assertEqual(re.match(r"(a(?!\s[abc]))", "a d").group(1), "a") self.assertEqual(re.match(r"(a)(?!\s\1)", "a b").group(1), "a") self.assertEqual(re.match(r"(a)(?!\s(abc|a))", "a b").group(1), "a") def test_ignore_case(self): self.assertEqual(re.match(r"(a\s[^a])", "a b", re.I).group(1), "a b") self.assertEqual(re.match(r"(a\s[^a]*)", "a bb", re.I).group(1), "a bb") self.assertEqual(re.match(r"(a\s[abc])", "a b", re.I).group(1), "a b") self.assertEqual(re.match(r"(a\s[abc]*)", "a bb", re.I).group(1), "a bb") self.assertEqual(re.match(r"((a)\s\2)", "a a", re.I).group(1), "a a") self.assertEqual(re.match(r"((a)\s\2*)", "a aa", re.I).group(1), "a aa") self.assertEqual(re.match(r"((a)\s(abc|a))", "a a", re.I).group(1), "a a") self.assertEqual(re.match(r"((a)\s(abc|a)*)", "a aa", re.I).group(1), "a aa") def test_category(self): self.assertEqual(re.match(r"(\s)", " ").group(1), " ") def test_getlower(self): import _sre self.assertEqual(_sre.getlower(ord('A'), 0), ord('a')) self.assertEqual(_sre.getlower(ord('A'), re.LOCALE), ord('a')) self.assertEqual(_sre.getlower(ord('A'), re.UNICODE), ord('a')) self.assertEqual(re.match("abc", "ABC", re.I).group(0), "ABC") self.assertEqual(re.match("abc", u"ABC", re.I).group(0), "ABC") def test_not_literal(self): self.assertEqual(re.search("\s([^a])", " b").group(1), "b") self.assertEqual(re.search("\s([^a]*)", " bb").group(1), "bb") def test_search_coverage(self): self.assertEqual(re.search("\s(b)", " b").group(1), "b") self.assertEqual(re.search("a\s", "a ").group(0), "a ") def test_re_escape(self): p="" for i in range(0, 256): p = p + chr(i) self.assertEqual(re.match(re.escape(chr(i)), chr(i)) is not None, True) self.assertEqual(re.match(re.escape(chr(i)), chr(i)).span(), (0,1)) pat=re.compile(re.escape(p)) self.assertEqual(pat.match(p) is not None, True) self.assertEqual(pat.match(p).span(), (0,256)) def test_pickling(self): import pickle self.pickle_test(pickle) import cPickle self.pickle_test(cPickle) def pickle_test(self, pickle): oldpat = re.compile('a(?:b|(c|e){1,2}?|d)+?(.)') s = pickle.dumps(oldpat) newpat = pickle.loads(s) self.assertEqual(oldpat, newpat) def test_constants(self): self.assertEqual(re.I, re.IGNORECASE) self.assertEqual(re.L, re.LOCALE) self.assertEqual(re.M, re.MULTILINE) self.assertEqual(re.S, re.DOTALL) self.assertEqual(re.X, re.VERBOSE) def test_flags(self): for flag in [re.I, re.M, re.X, re.S, re.L]: self.assertNotEqual(re.compile('^pattern$', flag), None) def test_sre_character_literals(self): for i in [0, 8, 16, 32, 64, 127, 128, 255]: self.assertNotEqual(re.match(r"\%03o" % i, chr(i)), None) self.assertNotEqual(re.match(r"\%03o0" % i, chr(i)+"0"), None) self.assertNotEqual(re.match(r"\%03o8" % i, chr(i)+"8"), None) self.assertNotEqual(re.match(r"\x%02x" % i, chr(i)), None) self.assertNotEqual(re.match(r"\x%02x0" % i, chr(i)+"0"), None) self.assertNotEqual(re.match(r"\x%02xz" % i, chr(i)+"z"), None) self.assertRaises(re.error, re.match, "\911", "") def test_bug_113254(self): self.assertEqual(re.match(r'(a)|(b)', 'b').start(1), -1) self.assertEqual(re.match(r'(a)|(b)', 'b').end(1), -1) self.assertEqual(re.match(r'(a)|(b)', 'b').span(1), (-1, -1)) def test_bug_527371(self): self.assertEqual(re.match(r'(a)?a','a').lastindex, None) self.assertEqual(re.match(r'(a)(b)?b','ab').lastindex, 1) self.assertEqual(re.match(r'(?P<a>a)(?P<b>b)?b','ab').lastgroup, 'a') self.assertEqual(re.match("(?P<a>a(b))", "ab").lastgroup, 'a') self.assertEqual(re.match("((a))", "a").lastindex, 1) def test_bug_545855(self): self.assertRaises(re.error, re.compile, 'foo[a-') def test_bug_418626(self): # SRE_OP_MIN_REPEAT_ONE for eliminating recursion on simple uses of # pattern '*?' on a long string. self.assertEqual(re.match('.*?c', 10000*'ab'+'cd').end(0), 20001) self.assertEqual(re.match('.*?cd', 5000*'ab'+'c'+5000*'ab'+'cde').end(0), 20003) self.assertEqual(re.match('.*?cd', 20000*'abc'+'de').end(0), 60001) # non-simple '*?' still recurses and hits the recursion limit self.assertRaises(RuntimeError, re.search, '(a|b)*?c', 10000*'ab'+'cd') def test_bug_612074(self): pat=u"["+re.escape(u"\u2039")+u"]" self.assertEqual(re.compile(pat) and 1, 1) def test_stack_overflow(self): # nasty case that overflows the straightforward recursive # implementation of repeated groups. self.assertRaises(RuntimeError, re.match, '(x)*', 50000*'x') self.assertRaises(RuntimeError, re.match, '(x)*y', 50000*'x'+'y') self.assertRaises(RuntimeError, re.match, '(x)*?y', 50000*'x'+'y') def test_scanner(self): def s_ident(scanner, token): return token def s_operator(scanner, token): return "op%s" % token def s_float(scanner, token): return float(token) def s_int(scanner, token): return int(token) scanner = Scanner([ (r"[a-zA-Z_]\w*", s_ident), (r"\d+\.\d*", s_float), (r"\d+", s_int), (r"=|\+|-|\*|/", s_operator), (r"\s+", None), ]) self.assertNotEqual(scanner.scanner.scanner("").pattern, None) self.assertEqual(scanner.scan("sum = 3*foo + 312.50 + bar"), (['sum', 'op=', 3, 'op*', 'foo', 'op+', 312.5, 'op+', 'bar'], '')) def test_bug_448951(self): # bug 448951 (similar to 429357, but with single char match) # (Also test greedy matches.) for op in '','?','*': self.assertEqual(re.match(r'((.%s):)?z'%op, 'z').groups(), (None, None)) self.assertEqual(re.match(r'((.%s):)?z'%op, 'a:z').groups(), ('a:', 'a')) def test_bug_725106(self): # capturing groups in alternatives in repeats self.assertEqual(re.match('^((a)|b)*', 'abc').groups(), ('b', 'a')) self.assertEqual(re.match('^(([ab])|c)*', 'abc').groups(), ('c', 'b')) self.assertEqual(re.match('^((d)|[ab])*', 'abc').groups(), ('b', None)) self.assertEqual(re.match('^((a)c|[ab])*', 'abc').groups(), ('b', None)) self.assertEqual(re.match('^((a)|b)*?c', 'abc').groups(), ('b', 'a')) self.assertEqual(re.match('^(([ab])|c)*?d', 'abcd').groups(), ('c', 'b')) self.assertEqual(re.match('^((d)|[ab])*?c', 'abc').groups(), ('b', None)) self.assertEqual(re.match('^((a)c|[ab])*?c', 'abc').groups(), ('b', None)) def test_bug_725149(self): # mark_stack_base restoring before restoring marks self.assertEqual(re.match('(a)(?:(?=(b)*)c)*', 'abb').groups(), ('a', None)) self.assertEqual(re.match('(a)((?!(b)*))*', 'abb').groups(), ('a', None, None)) def test_bug_764548(self): # bug 764548, re.compile() barfs on str/unicode subclasses try: unicode except NameError: return # no problem if we have no unicode class my_unicode(unicode): pass pat = re.compile(my_unicode("abc")) self.assertEqual(pat.match("xyz"), None) def test_finditer(self): iter = re.finditer(r":+", "a:b::c:::d") self.assertEqual([item.group(0) for item in iter], [":", "::", ":::"]) def run_re_tests(): from test.re_tests import benchmarks, tests, SUCCEED, FAIL, SYNTAX_ERROR if verbose: print 'Running re_tests test suite' else: # To save time, only run the first and last 10 tests #tests = tests[:10] + tests[-10:] pass for t in tests: sys.stdout.flush() pattern = s = outcome = repl = expected = None if len(t) == 5: pattern, s, outcome, repl, expected = t elif len(t) == 3: pattern, s, outcome = t else: raise ValueError, ('Test tuples should have 3 or 5 fields', t) try: obj = re.compile(pattern) except re.error: if outcome == SYNTAX_ERROR: pass # Expected a syntax error else: print '=== Syntax error:', t except KeyboardInterrupt: raise KeyboardInterrupt except: print '*** Unexpected error ***', t if verbose: traceback.print_exc(file=sys.stdout) else: try: result = obj.search(s) except re.error, msg: print '=== Unexpected exception', t, repr(msg) if outcome == SYNTAX_ERROR: # This should have been a syntax error; forget it. pass elif outcome == FAIL: if result is None: pass # No match, as expected else: print '=== Succeeded incorrectly', t elif outcome == SUCCEED: if result is not None: # Matched, as expected, so now we compute the # result string and compare it to our expected result. start, end = result.span(0) vardict={'found': result.group(0), 'groups': result.group(), 'flags': result.re.flags} for i in range(1, 100): try: gi = result.group(i) # Special hack because else the string concat fails: if gi is None: gi = "None" except IndexError: gi = "Error" vardict['g%d' % i] = gi for i in result.re.groupindex.keys(): try: gi = result.group(i) if gi is None: gi = "None" except IndexError: gi = "Error" vardict[i] = gi repl = eval(repl, vardict) if repl != expected: print '=== grouping error', t, print repr(repl) + ' should be ' + repr(expected) else: print '=== Failed incorrectly', t # Try the match on a unicode string, and check that it # still succeeds. try: result = obj.search(unicode(s, "latin-1")) if result is None: print '=== Fails on unicode match', t except NameError: continue # 1.5.2 except TypeError: continue # unicode test case # Try the match on a unicode pattern, and check that it # still succeeds. obj=re.compile(unicode(pattern, "latin-1")) result = obj.search(s) if result is None: print '=== Fails on unicode pattern match', t # Try the match with the search area limited to the extent # of the match and see if it still succeeds. \B will # break (because it won't match at the end or start of a if pattern[:2] != '\\B' and pattern[-2:] != '\\B' \ and result is not None: obj = re.compile(pattern) result = obj.search(s, result.start(0), result.end(0) + 1) if result is None: print '=== Failed on range-limited match', t # Try the match with IGNORECASE enabled, and check that it # still succeeds. obj = re.compile(pattern, re.IGNORECASE) result = obj.search(s) if result is None: print '=== Fails on case-insensitive match', t # Try the match with LOCALE enabled, and check that it # still succeeds. obj = re.compile(pattern, re.LOCALE) result = obj.search(s) if result is None: print '=== Fails on locale-sensitive match', t # Try the match with UNICODE locale enabled, and check # that it still succeeds. obj = re.compile(pattern, re.UNICODE) result = obj.search(s) if result is None: print '=== Fails on unicode-sensitive match', t def test_main(): run_unittest(ReTests) run_re_tests() if __name__ == "__main__": test_main()
false
true
f72480fcb8551a59e4a32a3f79265c45343d673d
26,964
py
Python
fair/forward.py
shaheen19/FAIR
345c23b3d35918729e7aa49ecb39047494c48a6e
[ "Apache-2.0" ]
1
2019-09-15T02:35:47.000Z
2019-09-15T02:35:47.000Z
fair/forward.py
shaheen19/FAIR
345c23b3d35918729e7aa49ecb39047494c48a6e
[ "Apache-2.0" ]
null
null
null
fair/forward.py
shaheen19/FAIR
345c23b3d35918729e7aa49ecb39047494c48a6e
[ "Apache-2.0" ]
null
null
null
from __future__ import division import inspect import numpy as np import warnings from scipy.optimize import root from .ancil import natural, cmip6_volcanic, cmip6_solar, historical_scaling from .constants import molwt, lifetime, radeff from .constants.general import M_ATMOS, ppm_gtc from .defaults import carbon, thermal from .forcing import ozone_tr, ozone_st, h2o_st, contrails, aerosols, bc_snow,\ landuse from .forcing.ghg import co2_log def iirf_interp(alp_b,a,tau,iirf_h,targ_iirf): """Interpolation function for finding alpha, the CO2 decay time constant scaling factor, in iirf_h equation. See Eq. (7) of Millar et al ACP (2017). Inputs: alp_b : Guess for alpha, the scale factor, for tau a : partition fractions for CO2 boxes tau : time constants for CO2 boxes iirf_h : time horizon for time-integrated airborne fraction targ_iirf: iirf_h calculated using simple parameterisation (Eq. (8), Millar et al (2017)). """ iirf_arr = alp_b*(np.sum(a*tau*(1.0 - np.exp(-iirf_h/(tau*alp_b))))) return iirf_arr - targ_iirf def iirf_simple(c_acc, temp, r0, rc, rt, iirf_max): """Simple linear iIRF relationship. Eq. (8) of Millar et al ACP (2017). Inputs: c_acc : cumulative airborne carbon anomaly (GtC) since pre-industrial temp : temperature anomaly since pre-industrial r0 : pre-industrial time-integrated airborne fraction (yr) rc : sensitivity of time-integrated airborne fraction to airborne carbon (yr/GtC) rt : sensitivity of time-integrated airborne fraction to temperature (yr/K) iirf_max : maximum value of time-integrated airborne fraction (yr) Outputs: iirf : time-integrated airborne fraction of carbon (yr) """ return np.min([r0 + rc * c_acc + rt * temp, iirf_max]) def calculate_q(tcrecs, d, f2x, tcr_dbl, nt): """If TCR and ECS are supplied, calculate the q model coefficients. See Eqs. (4) and (5) of Millar et al ACP (2017). Inputs: tcrecs : 2-element array of transient climate response (TCR) and equilibrium climate sensitivity (ECS). d : The slow and fast thermal response time constants f2x : Effective radiative forcing from a doubling of CO2 tcr_dbl : time to a doubling of CO2 under 1% per year CO2 increase, yr nt : number of timesteps Outputs: q : coefficients of slow and fast temperature change in each timestep ((nt, 2) array). """ # TODO: # error checking before call # benchmark one call per timestep and if not slower do not convert to 2D # - will make code cleaner k = 1.0 - (d/tcr_dbl)*(1.0 - np.exp(-tcr_dbl/d)) # if ECS and TCR are not time-varying, expand them to 2D array anyway if tcrecs.ndim==1: if len(tcrecs)!=2: raise ValueError( "Constant TCR and ECS should be a 2-element array") tcrecs = np.ones((nt, 2)) * tcrecs elif tcrecs.ndim==2: if tcrecs.shape!=(nt, 2): raise ValueError( "Transient TCR and ECS should be a nt x 2 array") q = (1.0 / f2x) * (1.0/(k[0]-k[1])) * np.array([ tcrecs[:,0]-tcrecs[:,1]*k[1],tcrecs[:,1]*k[0]-tcrecs[:,0]]).T return q def carbon_cycle(e0, c_acc0, temp, r0, rc, rt, iirf_max, time_scale_sf0, a, tau, iirf_h, carbon_boxes0, c_pi, c0, e1): """Calculates CO2 concentrations from emissions. Inputs: e0 : emissions of CO2 (GtC) in timestep t-1 c_acc0 : cumulative airborne carbon anomaly (GtC) since pre-industrial, timestep t-1 temp : temperature anomaly above pre-industrial (K) r0 : pre-industrial time-integrated airborne fraction (yr) rc : sensitivity of time-integrated airborne fraction to airborne carbon (yr/GtC) rt : sensitivity of time-integrated airborne fraction to temperature (yr/K) iirf_max : maximum value of time-integrated airborne fraction (yr) time_scale_sf0: initial guess of alpha scaling factor a : partition coefficient of carbon boxes tau : present-day decay time constants of CO2 (yr) iirf_h : time horizon for time-integrated airborne fraction (yr) carbon_boxes0 : carbon stored in each atmospheric reservoir at timestep t-1 (GtC) c_pi : pre-industrial concentration of CO2, ppmv c0 : concentration of CO2 in timestep t-1, ppmv e1 : emissions of CO2 in timestep t, GtC Outputs: c1 : concentrations of CO2 in timestep t, ppmv c_acc1 : cumulative airborne carbon anomaly (GtC) since pre-industrial, timestep t carbon_boxes1 : carbon stored in each atmospheric reservoir at timestep t (GtC) time_scale_sf : scale factor for CO2 decay constants """ iirf = iirf_simple(c_acc0, temp, r0, rc, rt, iirf_max) time_scale_sf = root(iirf_interp, time_scale_sf0, args=(a, tau, iirf_h, iirf))['x'] tau_new = tau * time_scale_sf carbon_boxes1 = carbon_boxes0*np.exp(-1.0/tau_new) + a*e1 / ppm_gtc c1 = np.sum(carbon_boxes1) + c_pi c_acc1 = c_acc0 + 0.5*(e1 + e0) - (c1 - c0)*ppm_gtc return c1, c_acc1, carbon_boxes1, time_scale_sf def emis_to_conc(c0, e0, e1, ts, lt, vm): """Calculate concentrations of well mixed GHGs from emissions for simple one-box model. Inputs (all can be scalar or 1D arrays for multiple species): c0: concentrations in timestep t-1 e0: emissions in timestep t-1 e1: emissions in timestep t ts: length of timestep. Use 1 for sensible results in FaIR 1.3. lt: atmospheric (e-folding) lifetime of GHG vm: conversion from emissions units (e.g. Mt) to concentrations units (e.g. ppb) Outputs: c1: concentrations in timestep t """ c1 = c0 - c0 * (1.0 - np.exp(-ts/lt)) + 0.5 * ts * (e1 + e0) * vm return c1 def forc_to_temp(t0, q, d, f, e=1.0): """Calculate temperature from a given radiative forcing. Inputs: t0: Temperature in timestep t-1 q: The matrix contributions to slow and fast temperature change calculated from ECS and TCR (2 element array) d: The slow and fast thermal response time constants (2 element array) f: radiative forcing (can be scalar or 1D array representing multiple species) Keywords: e: efficacy factor (default 1); if f is an array, e should be an array of the same length. Outputs: t1: slow and fast contributions to total temperature (2 element array) in timestep t """ t1 = t0*np.exp(-1.0/d) + q*(1.0-np.exp((-1.0)/d))*np.sum(f*e) return t1 def fair_scm( emissions=False, emissions_driven=True, C=None, other_rf=0.0, q = thermal.q, tcrecs = thermal.tcrecs, d = thermal.d, F2x = thermal.f2x, tcr_dbl = thermal.tcr_dbl, a = carbon.a, tau = carbon.tau, r0 = carbon.r0, rc = carbon.rc, rt = carbon.rt, iirf_max = carbon.iirf_max, iirf_h = carbon.iirf_h, C_pi=np.array([278., 722., 273., 34.497] + [0.]*25 + [13.0975, 547.996]), restart_in=False, restart_out=False, F_tropO3 = 0., F_aerosol = 0., F_volcanic=cmip6_volcanic.Forcing.volcanic, F_solar=cmip6_solar.Forcing.solar, F_contrails=0., F_bcsnow=0., F_landuse=0., aviNOx_frac=0., fossilCH4_frac=0., natural=natural.Emissions.emissions, efficacy=np.array([1.]*9 + [3.] + [1.]*3), scale=None, oxCH4_frac=0.61, ghg_forcing="Etminan", stwv_from_ch4=None, b_aero = np.array([-6.2227e-3, 0.0, -3.8392e-4, -1.16551e-3, 1.601537e-2, -1.45339e-3, -1.55605e-3]), b_tro3 = np.array([2.8249e-4, 1.0695e-4, -9.3604e-4, 99.7831e-4]), ghan_params = np.array([-1.95011431, 0.01107147, 0.01387492]), stevens_params = np.array([0.001875, 0.634, 60.]), useMultigas=True, useStevenson=True, lifetimes=False, aerosol_forcing="aerocom+ghan", scaleAerosolAR5=True, fixPre1850RCP=True, useTropO3TFeedback=True, scaleHistoricalAR5=False, contrail_forcing='NOx', kerosene_supply=0., landuse_forcing='co2', ): # is iirf_h < iirf_max? Don't stop the code, but warn user if iirf_h < iirf_max: warnings.warn('iirf_h=%f, which is less than iirf_max (%f)' % (iirf_h, iirf_max), RuntimeWarning) # Conversion between ppb/ppt concentrations and Mt/kt emissions # in the RCP databases ppb = Mt and ppt = kt so factor always 1e18 emis2conc = M_ATMOS/1e18*np.asarray(molwt.aslist)/molwt.AIR # Funny units for nitrogen emissions - N2O is expressed in N2 equivalent n2o_sf = molwt.N2O/molwt.N2 emis2conc[2] = emis2conc[2] / n2o_sf # Convert any list to a numpy array for (a) speed and (b) consistency. # Goes through all variables in scope and converts them. frame = inspect.currentframe() args, _, _, values = inspect.getargvalues(frame) for arg_to_check in args: if type(values[arg_to_check]) is list: exec(arg_to_check + '= np.array(' + arg_to_check + ')') # Set up the output timeseries variables depending on options and perform # basic sense checks if useMultigas: ngas = 31 nF = 13 if emissions_driven: if type(emissions) is not np.ndarray or emissions.shape[1] != 40: raise ValueError( "emissions timeseries should be a nt x 40 numpy array") carbon_boxes_shape = (emissions.shape[0], a.shape[0]) thermal_boxes_shape = (emissions.shape[0], d.shape[0]) nt = emissions.shape[0] else: if type(C) is not np.ndarray or C.shape[1] != ngas: raise ValueError( "C timeseries should be a nt x %d numpy array" % ngas) thermal_boxes_shape = (C.shape[0], d.shape[0]) nt = C.shape[0] if np.isscalar(fossilCH4_frac): fossilCH4_frac = np.ones(nt) * fossilCH4_frac # If custom gas lifetimes are supplied, use them, else import defaults if type(lifetimes) is np.ndarray: if len(lifetimes)!=ngas: raise ValueError( "custom GHG lifetime array must have " + str(ngas) + " elements") else: lifetimes = lifetime.aslist # Select the desired GHG forcing relationship and populate # stratospheric water vapour from methane scale factor if not specified # by user if ghg_forcing.lower()=="etminan": from .forcing.ghg import etminan as ghg if stwv_from_ch4==None: stwv_from_ch4=0.12 elif ghg_forcing.lower()=="myhre": from .forcing.ghg import myhre as ghg if stwv_from_ch4==None: stwv_from_ch4=0.15 else: raise ValueError( "ghg_forcing should be 'etminan' (default) or 'myhre'") # Check natural emissions and convert to 2D array if necessary if type(natural) in [float,int]: natural = natural * np.ones((nt,2)) elif type(natural) is np.ndarray: if natural.ndim==1: if natural.shape[0]!=2: raise ValueError( "natural emissions should be a 2-element or nt x 2 " + "array") natural = np.tile(natural, nt).reshape((nt,2)) elif natural.ndim==2: if natural.shape[1]!=2 or natural.shape[0]!=nt: raise ValueError( "natural emissions should be a 2-element or nt x 2 " + "array") else: raise ValueError( "natural emissions should be a scalar, 2-element, or nt x 2 " + "array") # check scale factor is correct shape. If 1D inflate to 2D if scale is None: scale = np.ones((nt,nF)) elif scale.shape[-1]==nF: if scale.ndim==2 and scale.shape[0]==nt: pass elif scale.ndim==1: scale = np.tile(scale, nt).reshape((nt,nF)) else: raise ValueError("in multi-gas mode, scale should be None, or a "+ "(13,) or (nt, 13) array") # if scaling the historical time series to match AR5, apply these # factors to whatever the user specifies if scaleHistoricalAR5: scale=scale*historical_scaling.all[:nt,:] else: ngas = 1 nF = 1 if emissions_driven: if type(emissions) is np.ndarray: if emissions.ndim != 1: raise ValueError( "In CO2-only mode, emissions should be a 1D array") nt = emissions.shape[0] carbon_boxes_shape = (nt, a.shape[0]) thermal_boxes_shape = (nt, d.shape[0]) elif type(other_rf) is np.ndarray: if other_rf.ndim != 1: raise ValueError( "In CO2-only mode, other_rf should be a 1D array") nt = other_rf.shape[0] carbon_boxes_shape = (nt, a.shape[0]) thermal_boxes_shape = (nt, d.shape[0]) emissions = np.zeros(nt) else: raise ValueError( "Neither emissions or other_rf is defined as a timeseries") else: if type(C) is not np.ndarray or C.ndim != 1: raise ValueError( "In CO2-only mode, concentrations should be a 1D array") nt = C.shape[0] thermal_boxes_shape = (nt, d.shape[0]) # expand C to 2D array for consistency with other calcs C = C.reshape((nt, 1)) # check scale factor is correct shape - either scalar or 1D # needs try/except really if scale is None: scale = np.ones(nt) elif np.isscalar(scale): scale = np.ones(nt) * scale elif scale.ndim==1 and scale.shape[0]==nt: pass else: raise ValueError("in CO2-only mode, scale should be None, a "+ "scalar or a (nt,) array") # if scaling the historical time series to match AR5, apply these # factors to whatever the user specifies if scaleHistoricalAR5: scale=scale*historical_scaling.co2[:nt] # If TCR and ECS are supplied, calculate q coefficients if type(tcrecs) is np.ndarray: q = calculate_q(tcrecs, d, F2x, tcr_dbl, nt) # Check a and tau are same size if a.ndim != 1: raise ValueError("a should be a 1D array") if tau.ndim != 1: raise ValueError("tau should be a 1D array") if len(a) != len(tau): raise ValueError("a and tau should be the same size") if not np.isclose(np.sum(a), 1.0): raise ValueError("a should sum to one") # Allocate intermediate and output arrays F = np.zeros((nt, nF)) C_acc = np.zeros(nt) T_j = np.zeros(thermal_boxes_shape) T = np.zeros(nt) C_0 = np.copy(C_pi) if emissions_driven: C = np.zeros((nt, ngas)) R_i = np.zeros(carbon_boxes_shape) if restart_in: R_minus1 = restart_in[0] T_j_minus1 = restart_in[1] C_acc_minus1 = restart_in[2] E_minus1 = restart_in[3] C_minus1 = np.sum(R_minus1,axis=-1) + C_0[0] C[0,0], C_acc[0], R_i[0,:], time_scale_sf = carbon_cycle( E_minus1, C_acc_minus1, np.sum(T_j_minus1), r0, rc, rt, iirf_max, 0.16, a, tau, iirf_h, R_minus1, C_pi[0], C_minus1, emissions[0] ) if np.isscalar(other_rf): F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf else: F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf[0] F[0,0] = F[0,0] * scale[0] T_j[0,:] = forc_to_temp(T_j_minus1, q[0,:], d, F[0,:]) T[0]=np.sum(T_j[0,:],axis=-1) else: # Initialise the carbon pools to be correct for first timestep in # numerical method if emissions_driven: if useMultigas: R_i[0,:] = a * (np.sum(emissions[0,1:3])) / ppm_gtc C[0,1:] = C_0[1:] else: R_i[0,:] = a * emissions[0,np.newaxis] / ppm_gtc C[0,0] = np.sum(R_i[0,:],axis=-1) + C_0[0] if useMultigas: # CO2, CH4 and N2O are co-dependent F[0,0:3] = ghg(C[0,0:3], C_pi[0:3], F2x=F2x) # Minor (F- and H-gases) are linear in concentration # the factor of 0.001 here is because radiative efficiencies are given # in W/m2/ppb and concentrations of minor gases are in ppt. F[0,3] = np.sum((C[0,3:] - C_pi[3:]) * radeff.aslist[3:] * 0.001) # Tropospheric ozone: if emissions_driven: if useStevenson: F[0,4] = ozone_tr.stevenson(emissions[0,:], C[0,1], T=np.sum(T_j[0,:]), feedback=useTropO3TFeedback, fix_pre1850_RCP=fixPre1850RCP) else: F[0,4] = ozone_tr.regress(emissions[0,:], beta=b_tro3) else: F[:,4] = F_tropO3 # Stratospheric ozone depends on concentrations of ODSs (index 15-30) F[0,5] = ozone_st.magicc(C[0,15:], C_pi[15:]) # Stratospheric water vapour is a function of the methane ERF F[0,6] = h2o_st.linear(F[0,1], ratio=stwv_from_ch4) # Forcing from contrails. No climate feedback so can live outside # of forward model in this version if emissions_driven: if contrail_forcing.lower()[0]=='n': # from NOx emissions F[:,7] = contrails.from_aviNOx(emissions, aviNOx_frac) elif contrail_forcing.lower()[0]=='f': # from kerosene production F[:,7] = contrails.from_fuel(kerosene_supply) elif contrail_forcing.lower()[0]=='e': # external forcing timeseries F[:,7] = F_contrails else: raise ValueError("contrails must be one of 'NOx' (estimated "+ "from NOx emissions), 'fuel' (estimated from annual jet fuel "+ "supplied) or 'external' (an external forcing time series).") else: F[:,7] = F_contrails # Forcing from aerosols - again no feedback dependence if emissions_driven: if aerosol_forcing.lower()=='stevens': F[:,8] = aerosols.Stevens(emissions, stevens_params=stevens_params) elif 'aerocom' in aerosol_forcing.lower(): F[:,8] = aerosols.aerocom_direct(emissions, beta=b_aero) if 'ghan' in aerosol_forcing.lower(): F[:,8] = F[:,8] + aerosols.ghan_indirect(emissions, scale_AR5=scaleAerosolAR5, fix_pre1850_RCP=fixPre1850RCP, ghan_params=ghan_params) elif aerosol_forcing.lower()[0] == 'e': F[:,8] = F_aerosol else: raise ValueError("aerosol_forcing should be one of 'stevens', " + "aerocom, aerocom+ghan or external") else: F[:,8] = F_aerosol # Black carbon on snow - no feedback dependence if emissions_driven: F[:,9] = bc_snow.linear(emissions) else: F[:,9] = F_bcsnow # Land use change - either use a scaling with cumulative CO2 emissions # or an external time series if emissions_driven: if landuse_forcing.lower()[0]=='c': F[:,10] = landuse.cumulative(emissions) elif landuse_forcing.lower()[0]=='e': F[:,10] = F_landuse else: raise ValueError( "landuse_forcing should be one of 'co2' or 'external'") else: F[:,10] = F_landuse # Volcanic and solar copied straight to the output arrays F[:,11] = F_volcanic F[:,12] = F_solar # multiply by scale factors F[0,:] = F[0,:] * scale[0,:] else: if np.isscalar(other_rf): F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf else: F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf[0] F[0,0] = F[0,0] * scale[0] if restart_in == False: # Update the thermal response boxes T_j[0,:] = (q[0,:]/d)*(np.sum(F[0,:])) # Sum the thermal response boxes to get the total temperature anomaly T[0]=np.sum(T_j[0,:],axis=-1) for t in range(1,nt): if emissions_driven: if useMultigas: if t == 1: time_scale_sf = 0.16 # Calculate concentrations # a. CARBON DIOXIDE # Firstly add any oxidised methane from last year to the CO2 # pool oxidised_CH4 = ((C[t-1,1]-C_pi[1]) * (1.0 - np.exp(-1.0/lifetimes[1])) * (molwt.C/molwt.CH4 * 0.001 * oxCH4_frac * fossilCH4_frac[t])) oxidised_CH4 = np.max((oxidised_CH4, 0)) C[t,0], C_acc[t], R_i[t,:], time_scale_sf = carbon_cycle( np.sum(emissions[t-1,1:3]), C_acc[t-1], T[t-1], r0, rc, rt, iirf_max, time_scale_sf, a, tau, iirf_h, R_i[t-1,:] + oxidised_CH4, C_pi[0], C[t-1,0], np.sum(emissions[t,1:3]) ) # b. METHANE C[t,1] = emis_to_conc( C[t-1,1], emissions[t-1,3]+natural[t,0], emissions[t,3]+natural[t,0], 1.0, lifetimes[1], 1.0/emis2conc[1] ) # c. NITROUS OXIDE C[t,2] = emis_to_conc( C[t-1,2], emissions[t-1,4]+natural[t,1], emissions[t,4]+natural[t,1], 1.0, lifetimes[2], 1.0/emis2conc[2] ) # d. OTHER WMGHGs C[t,3:] = emis_to_conc( C[t-1,3:], emissions[t-1,12:], emissions[t,12:], 1.0, np.array(lifetimes[3:]), 1.0/emis2conc[3:] ) # 2. Radiative forcing F[t,0:3] = ghg(C[t,0:3], C_pi[0:3], F2x=F2x) F[t,3] = np.sum((C[t,3:] - C_pi[3:]) * radeff.aslist[3:] * 0.001) if useStevenson: F[t,4] = ozone_tr.stevenson(emissions[t,:], C[t,1], T=T[t-1], feedback=useTropO3TFeedback, fix_pre1850_RCP=fixPre1850RCP) else: F[t,4] = ozone_tr.regress(emissions[t,:], beta=b_tro3) F[t,5] = ozone_st.magicc(C[t,15:], C_pi[15:]) F[t,6] = h2o_st.linear(F[t,1], ratio=stwv_from_ch4) # multiply by scale factors F[t,:] = F[t,:] * scale[t,:] # 3. Temperature # Update the thermal response boxes T_j[t,:] = forc_to_temp( T_j[t-1,:], q[t,:], d, F[t,:], e=efficacy) # Sum the thermal response boxes to get the total temperature T[t]=np.sum(T_j[t,:],axis=-1) else: if t == 1: time_scale_sf = 0.16 C[t,0], C_acc[t], R_i[t,:], time_scale_sf = carbon_cycle( emissions[t-1], C_acc[t-1], T[t-1], r0, rc, rt, iirf_max, time_scale_sf, a, tau, iirf_h, R_i[t-1,:], C_pi[0], C[t-1,0], emissions[t] ) if np.isscalar(other_rf): F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf else: F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf[t] F[t,0] = F[t,0] * scale[t] T_j[t,:] = forc_to_temp(T_j[t-1,:], q[t,:], d, F[t,:]) T[t]=np.sum(T_j[t,:],axis=-1) else: if useMultigas: F[t,0:3] = ghg(C[t,0:3], C_pi[0:3], F2x=F2x) F[t,3] = np.sum((C[t,3:] - C_pi[3:]) * radeff.aslist[3:] * 0.001) F[t,5] = ozone_st.magicc(C[t,15:], C_pi[15:]) F[t,6] = h2o_st.linear(F[t,1], ratio=stwv_from_ch4) # multiply by scale factors F[t,:] = F[t,:] * scale[t,:] # 3. Temperature # Update the thermal response boxes T_j[t,:] = T_j[t,:] = forc_to_temp( T_j[t-1,:], q[t,:], d, F[t,:], e=efficacy) # Sum the thermal response boxes to get the total temperature T[t]=np.sum(T_j[t,:],axis=-1) else: if np.isscalar(other_rf): F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf else: F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf[t] F[t,0] = F[t,0] * scale[t] T_j[t,:] = forc_to_temp(T_j[t-1,:], q[t,:], d, F[t,:]) T[t]=np.sum(T_j[t,:],axis=-1) if not useMultigas: C = np.squeeze(C) F = np.squeeze(F) if restart_out: if useMultigas: E_minus1 = np.sum(emissions[-1,1:3]) else: E_minus1 = emissions[-1] restart_out_val=(R_i[-1],T_j[-1],C_acc[-1],E_minus1) return C, F, T, restart_out_val else: return C, F, T
37.870787
83
0.528371
from __future__ import division import inspect import numpy as np import warnings from scipy.optimize import root from .ancil import natural, cmip6_volcanic, cmip6_solar, historical_scaling from .constants import molwt, lifetime, radeff from .constants.general import M_ATMOS, ppm_gtc from .defaults import carbon, thermal from .forcing import ozone_tr, ozone_st, h2o_st, contrails, aerosols, bc_snow,\ landuse from .forcing.ghg import co2_log def iirf_interp(alp_b,a,tau,iirf_h,targ_iirf): iirf_arr = alp_b*(np.sum(a*tau*(1.0 - np.exp(-iirf_h/(tau*alp_b))))) return iirf_arr - targ_iirf def iirf_simple(c_acc, temp, r0, rc, rt, iirf_max): return np.min([r0 + rc * c_acc + rt * temp, iirf_max]) def calculate_q(tcrecs, d, f2x, tcr_dbl, nt): k = 1.0 - (d/tcr_dbl)*(1.0 - np.exp(-tcr_dbl/d)) if tcrecs.ndim==1: if len(tcrecs)!=2: raise ValueError( "Constant TCR and ECS should be a 2-element array") tcrecs = np.ones((nt, 2)) * tcrecs elif tcrecs.ndim==2: if tcrecs.shape!=(nt, 2): raise ValueError( "Transient TCR and ECS should be a nt x 2 array") q = (1.0 / f2x) * (1.0/(k[0]-k[1])) * np.array([ tcrecs[:,0]-tcrecs[:,1]*k[1],tcrecs[:,1]*k[0]-tcrecs[:,0]]).T return q def carbon_cycle(e0, c_acc0, temp, r0, rc, rt, iirf_max, time_scale_sf0, a, tau, iirf_h, carbon_boxes0, c_pi, c0, e1): iirf = iirf_simple(c_acc0, temp, r0, rc, rt, iirf_max) time_scale_sf = root(iirf_interp, time_scale_sf0, args=(a, tau, iirf_h, iirf))['x'] tau_new = tau * time_scale_sf carbon_boxes1 = carbon_boxes0*np.exp(-1.0/tau_new) + a*e1 / ppm_gtc c1 = np.sum(carbon_boxes1) + c_pi c_acc1 = c_acc0 + 0.5*(e1 + e0) - (c1 - c0)*ppm_gtc return c1, c_acc1, carbon_boxes1, time_scale_sf def emis_to_conc(c0, e0, e1, ts, lt, vm): c1 = c0 - c0 * (1.0 - np.exp(-ts/lt)) + 0.5 * ts * (e1 + e0) * vm return c1 def forc_to_temp(t0, q, d, f, e=1.0): t1 = t0*np.exp(-1.0/d) + q*(1.0-np.exp((-1.0)/d))*np.sum(f*e) return t1 def fair_scm( emissions=False, emissions_driven=True, C=None, other_rf=0.0, q = thermal.q, tcrecs = thermal.tcrecs, d = thermal.d, F2x = thermal.f2x, tcr_dbl = thermal.tcr_dbl, a = carbon.a, tau = carbon.tau, r0 = carbon.r0, rc = carbon.rc, rt = carbon.rt, iirf_max = carbon.iirf_max, iirf_h = carbon.iirf_h, C_pi=np.array([278., 722., 273., 34.497] + [0.]*25 + [13.0975, 547.996]), restart_in=False, restart_out=False, F_tropO3 = 0., F_aerosol = 0., F_volcanic=cmip6_volcanic.Forcing.volcanic, F_solar=cmip6_solar.Forcing.solar, F_contrails=0., F_bcsnow=0., F_landuse=0., aviNOx_frac=0., fossilCH4_frac=0., natural=natural.Emissions.emissions, efficacy=np.array([1.]*9 + [3.] + [1.]*3), scale=None, oxCH4_frac=0.61, ghg_forcing="Etminan", stwv_from_ch4=None, b_aero = np.array([-6.2227e-3, 0.0, -3.8392e-4, -1.16551e-3, 1.601537e-2, -1.45339e-3, -1.55605e-3]), b_tro3 = np.array([2.8249e-4, 1.0695e-4, -9.3604e-4, 99.7831e-4]), ghan_params = np.array([-1.95011431, 0.01107147, 0.01387492]), stevens_params = np.array([0.001875, 0.634, 60.]), useMultigas=True, useStevenson=True, lifetimes=False, aerosol_forcing="aerocom+ghan", scaleAerosolAR5=True, fixPre1850RCP=True, useTropO3TFeedback=True, scaleHistoricalAR5=False, contrail_forcing='NOx', kerosene_supply=0., landuse_forcing='co2', ): if iirf_h < iirf_max: warnings.warn('iirf_h=%f, which is less than iirf_max (%f)' % (iirf_h, iirf_max), RuntimeWarning) # Conversion between ppb/ppt concentrations and Mt/kt emissions # in the RCP databases ppb = Mt and ppt = kt so factor always 1e18 emis2conc = M_ATMOS/1e18*np.asarray(molwt.aslist)/molwt.AIR # Funny units for nitrogen emissions - N2O is expressed in N2 equivalent n2o_sf = molwt.N2O/molwt.N2 emis2conc[2] = emis2conc[2] / n2o_sf # Convert any list to a numpy array for (a) speed and (b) consistency. # Goes through all variables in scope and converts them. frame = inspect.currentframe() args, _, _, values = inspect.getargvalues(frame) for arg_to_check in args: if type(values[arg_to_check]) is list: exec(arg_to_check + '= np.array(' + arg_to_check + ')') # Set up the output timeseries variables depending on options and perform # basic sense checks if useMultigas: ngas = 31 nF = 13 if emissions_driven: if type(emissions) is not np.ndarray or emissions.shape[1] != 40: raise ValueError( "emissions timeseries should be a nt x 40 numpy array") carbon_boxes_shape = (emissions.shape[0], a.shape[0]) thermal_boxes_shape = (emissions.shape[0], d.shape[0]) nt = emissions.shape[0] else: if type(C) is not np.ndarray or C.shape[1] != ngas: raise ValueError( "C timeseries should be a nt x %d numpy array" % ngas) thermal_boxes_shape = (C.shape[0], d.shape[0]) nt = C.shape[0] if np.isscalar(fossilCH4_frac): fossilCH4_frac = np.ones(nt) * fossilCH4_frac # If custom gas lifetimes are supplied, use them, else import defaults if type(lifetimes) is np.ndarray: if len(lifetimes)!=ngas: raise ValueError( "custom GHG lifetime array must have " + str(ngas) + " elements") else: lifetimes = lifetime.aslist # Select the desired GHG forcing relationship and populate # stratospheric water vapour from methane scale factor if not specified # by user if ghg_forcing.lower()=="etminan": from .forcing.ghg import etminan as ghg if stwv_from_ch4==None: stwv_from_ch4=0.12 elif ghg_forcing.lower()=="myhre": from .forcing.ghg import myhre as ghg if stwv_from_ch4==None: stwv_from_ch4=0.15 else: raise ValueError( "ghg_forcing should be 'etminan' (default) or 'myhre'") # Check natural emissions and convert to 2D array if necessary if type(natural) in [float,int]: natural = natural * np.ones((nt,2)) elif type(natural) is np.ndarray: if natural.ndim==1: if natural.shape[0]!=2: raise ValueError( "natural emissions should be a 2-element or nt x 2 " + "array") natural = np.tile(natural, nt).reshape((nt,2)) elif natural.ndim==2: if natural.shape[1]!=2 or natural.shape[0]!=nt: raise ValueError( "natural emissions should be a 2-element or nt x 2 " + "array") else: raise ValueError( "natural emissions should be a scalar, 2-element, or nt x 2 " + "array") # check scale factor is correct shape. If 1D inflate to 2D if scale is None: scale = np.ones((nt,nF)) elif scale.shape[-1]==nF: if scale.ndim==2 and scale.shape[0]==nt: pass elif scale.ndim==1: scale = np.tile(scale, nt).reshape((nt,nF)) else: raise ValueError("in multi-gas mode, scale should be None, or a "+ "(13,) or (nt, 13) array") # if scaling the historical time series to match AR5, apply these # factors to whatever the user specifies if scaleHistoricalAR5: scale=scale*historical_scaling.all[:nt,:] else: ngas = 1 nF = 1 if emissions_driven: if type(emissions) is np.ndarray: if emissions.ndim != 1: raise ValueError( "In CO2-only mode, emissions should be a 1D array") nt = emissions.shape[0] carbon_boxes_shape = (nt, a.shape[0]) thermal_boxes_shape = (nt, d.shape[0]) elif type(other_rf) is np.ndarray: if other_rf.ndim != 1: raise ValueError( "In CO2-only mode, other_rf should be a 1D array") nt = other_rf.shape[0] carbon_boxes_shape = (nt, a.shape[0]) thermal_boxes_shape = (nt, d.shape[0]) emissions = np.zeros(nt) else: raise ValueError( "Neither emissions or other_rf is defined as a timeseries") else: if type(C) is not np.ndarray or C.ndim != 1: raise ValueError( "In CO2-only mode, concentrations should be a 1D array") nt = C.shape[0] thermal_boxes_shape = (nt, d.shape[0]) # expand C to 2D array for consistency with other calcs C = C.reshape((nt, 1)) # check scale factor is correct shape - either scalar or 1D # needs try/except really if scale is None: scale = np.ones(nt) elif np.isscalar(scale): scale = np.ones(nt) * scale elif scale.ndim==1 and scale.shape[0]==nt: pass else: raise ValueError("in CO2-only mode, scale should be None, a "+ "scalar or a (nt,) array") # if scaling the historical time series to match AR5, apply these # factors to whatever the user specifies if scaleHistoricalAR5: scale=scale*historical_scaling.co2[:nt] # If TCR and ECS are supplied, calculate q coefficients if type(tcrecs) is np.ndarray: q = calculate_q(tcrecs, d, F2x, tcr_dbl, nt) # Check a and tau are same size if a.ndim != 1: raise ValueError("a should be a 1D array") if tau.ndim != 1: raise ValueError("tau should be a 1D array") if len(a) != len(tau): raise ValueError("a and tau should be the same size") if not np.isclose(np.sum(a), 1.0): raise ValueError("a should sum to one") # Allocate intermediate and output arrays F = np.zeros((nt, nF)) C_acc = np.zeros(nt) T_j = np.zeros(thermal_boxes_shape) T = np.zeros(nt) C_0 = np.copy(C_pi) if emissions_driven: C = np.zeros((nt, ngas)) R_i = np.zeros(carbon_boxes_shape) if restart_in: R_minus1 = restart_in[0] T_j_minus1 = restart_in[1] C_acc_minus1 = restart_in[2] E_minus1 = restart_in[3] C_minus1 = np.sum(R_minus1,axis=-1) + C_0[0] C[0,0], C_acc[0], R_i[0,:], time_scale_sf = carbon_cycle( E_minus1, C_acc_minus1, np.sum(T_j_minus1), r0, rc, rt, iirf_max, 0.16, a, tau, iirf_h, R_minus1, C_pi[0], C_minus1, emissions[0] ) if np.isscalar(other_rf): F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf else: F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf[0] F[0,0] = F[0,0] * scale[0] T_j[0,:] = forc_to_temp(T_j_minus1, q[0,:], d, F[0,:]) T[0]=np.sum(T_j[0,:],axis=-1) else: # Initialise the carbon pools to be correct for first timestep in # numerical method if emissions_driven: if useMultigas: R_i[0,:] = a * (np.sum(emissions[0,1:3])) / ppm_gtc C[0,1:] = C_0[1:] else: R_i[0,:] = a * emissions[0,np.newaxis] / ppm_gtc C[0,0] = np.sum(R_i[0,:],axis=-1) + C_0[0] if useMultigas: # CO2, CH4 and N2O are co-dependent F[0,0:3] = ghg(C[0,0:3], C_pi[0:3], F2x=F2x) # Minor (F- and H-gases) are linear in concentration # the factor of 0.001 here is because radiative efficiencies are given # in W/m2/ppb and concentrations of minor gases are in ppt. F[0,3] = np.sum((C[0,3:] - C_pi[3:]) * radeff.aslist[3:] * 0.001) # Tropospheric ozone: if emissions_driven: if useStevenson: F[0,4] = ozone_tr.stevenson(emissions[0,:], C[0,1], T=np.sum(T_j[0,:]), feedback=useTropO3TFeedback, fix_pre1850_RCP=fixPre1850RCP) else: F[0,4] = ozone_tr.regress(emissions[0,:], beta=b_tro3) else: F[:,4] = F_tropO3 # Stratospheric ozone depends on concentrations of ODSs (index 15-30) F[0,5] = ozone_st.magicc(C[0,15:], C_pi[15:]) # Stratospheric water vapour is a function of the methane ERF F[0,6] = h2o_st.linear(F[0,1], ratio=stwv_from_ch4) # Forcing from contrails. No climate feedback so can live outside # of forward model in this version if emissions_driven: if contrail_forcing.lower()[0]=='n': # from NOx emissions F[:,7] = contrails.from_aviNOx(emissions, aviNOx_frac) elif contrail_forcing.lower()[0]=='f': # from kerosene production F[:,7] = contrails.from_fuel(kerosene_supply) elif contrail_forcing.lower()[0]=='e': # external forcing timeseries F[:,7] = F_contrails else: raise ValueError("contrails must be one of 'NOx' (estimated "+ "from NOx emissions), 'fuel' (estimated from annual jet fuel "+ "supplied) or 'external' (an external forcing time series).") else: F[:,7] = F_contrails # Forcing from aerosols - again no feedback dependence if emissions_driven: if aerosol_forcing.lower()=='stevens': F[:,8] = aerosols.Stevens(emissions, stevens_params=stevens_params) elif 'aerocom' in aerosol_forcing.lower(): F[:,8] = aerosols.aerocom_direct(emissions, beta=b_aero) if 'ghan' in aerosol_forcing.lower(): F[:,8] = F[:,8] + aerosols.ghan_indirect(emissions, scale_AR5=scaleAerosolAR5, fix_pre1850_RCP=fixPre1850RCP, ghan_params=ghan_params) elif aerosol_forcing.lower()[0] == 'e': F[:,8] = F_aerosol else: raise ValueError("aerosol_forcing should be one of 'stevens', " + "aerocom, aerocom+ghan or external") else: F[:,8] = F_aerosol # Black carbon on snow - no feedback dependence if emissions_driven: F[:,9] = bc_snow.linear(emissions) else: F[:,9] = F_bcsnow # Land use change - either use a scaling with cumulative CO2 emissions # or an external time series if emissions_driven: if landuse_forcing.lower()[0]=='c': F[:,10] = landuse.cumulative(emissions) elif landuse_forcing.lower()[0]=='e': F[:,10] = F_landuse else: raise ValueError( "landuse_forcing should be one of 'co2' or 'external'") else: F[:,10] = F_landuse # Volcanic and solar copied straight to the output arrays F[:,11] = F_volcanic F[:,12] = F_solar # multiply by scale factors F[0,:] = F[0,:] * scale[0,:] else: if np.isscalar(other_rf): F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf else: F[0,0] = co2_log(C[0,0], C_pi[0], F2x) + other_rf[0] F[0,0] = F[0,0] * scale[0] if restart_in == False: # Update the thermal response boxes T_j[0,:] = (q[0,:]/d)*(np.sum(F[0,:])) # Sum the thermal response boxes to get the total temperature anomaly T[0]=np.sum(T_j[0,:],axis=-1) for t in range(1,nt): if emissions_driven: if useMultigas: if t == 1: time_scale_sf = 0.16 # Calculate concentrations # a. CARBON DIOXIDE # Firstly add any oxidised methane from last year to the CO2 # pool oxidised_CH4 = ((C[t-1,1]-C_pi[1]) * (1.0 - np.exp(-1.0/lifetimes[1])) * (molwt.C/molwt.CH4 * 0.001 * oxCH4_frac * fossilCH4_frac[t])) oxidised_CH4 = np.max((oxidised_CH4, 0)) C[t,0], C_acc[t], R_i[t,:], time_scale_sf = carbon_cycle( np.sum(emissions[t-1,1:3]), C_acc[t-1], T[t-1], r0, rc, rt, iirf_max, time_scale_sf, a, tau, iirf_h, R_i[t-1,:] + oxidised_CH4, C_pi[0], C[t-1,0], np.sum(emissions[t,1:3]) ) # b. METHANE C[t,1] = emis_to_conc( C[t-1,1], emissions[t-1,3]+natural[t,0], emissions[t,3]+natural[t,0], 1.0, lifetimes[1], 1.0/emis2conc[1] ) # c. NITROUS OXIDE C[t,2] = emis_to_conc( C[t-1,2], emissions[t-1,4]+natural[t,1], emissions[t,4]+natural[t,1], 1.0, lifetimes[2], 1.0/emis2conc[2] ) # d. OTHER WMGHGs C[t,3:] = emis_to_conc( C[t-1,3:], emissions[t-1,12:], emissions[t,12:], 1.0, np.array(lifetimes[3:]), 1.0/emis2conc[3:] ) # 2. Radiative forcing F[t,0:3] = ghg(C[t,0:3], C_pi[0:3], F2x=F2x) F[t,3] = np.sum((C[t,3:] - C_pi[3:]) * radeff.aslist[3:] * 0.001) if useStevenson: F[t,4] = ozone_tr.stevenson(emissions[t,:], C[t,1], T=T[t-1], feedback=useTropO3TFeedback, fix_pre1850_RCP=fixPre1850RCP) else: F[t,4] = ozone_tr.regress(emissions[t,:], beta=b_tro3) F[t,5] = ozone_st.magicc(C[t,15:], C_pi[15:]) F[t,6] = h2o_st.linear(F[t,1], ratio=stwv_from_ch4) # multiply by scale factors F[t,:] = F[t,:] * scale[t,:] # 3. Temperature # Update the thermal response boxes T_j[t,:] = forc_to_temp( T_j[t-1,:], q[t,:], d, F[t,:], e=efficacy) # Sum the thermal response boxes to get the total temperature T[t]=np.sum(T_j[t,:],axis=-1) else: if t == 1: time_scale_sf = 0.16 C[t,0], C_acc[t], R_i[t,:], time_scale_sf = carbon_cycle( emissions[t-1], C_acc[t-1], T[t-1], r0, rc, rt, iirf_max, time_scale_sf, a, tau, iirf_h, R_i[t-1,:], C_pi[0], C[t-1,0], emissions[t] ) if np.isscalar(other_rf): F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf else: F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf[t] F[t,0] = F[t,0] * scale[t] T_j[t,:] = forc_to_temp(T_j[t-1,:], q[t,:], d, F[t,:]) T[t]=np.sum(T_j[t,:],axis=-1) else: if useMultigas: F[t,0:3] = ghg(C[t,0:3], C_pi[0:3], F2x=F2x) F[t,3] = np.sum((C[t,3:] - C_pi[3:]) * radeff.aslist[3:] * 0.001) F[t,5] = ozone_st.magicc(C[t,15:], C_pi[15:]) F[t,6] = h2o_st.linear(F[t,1], ratio=stwv_from_ch4) # multiply by scale factors F[t,:] = F[t,:] * scale[t,:] # 3. Temperature # Update the thermal response boxes T_j[t,:] = T_j[t,:] = forc_to_temp( T_j[t-1,:], q[t,:], d, F[t,:], e=efficacy) # Sum the thermal response boxes to get the total temperature T[t]=np.sum(T_j[t,:],axis=-1) else: if np.isscalar(other_rf): F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf else: F[t,0] = co2_log(C[t,0], C_pi[0], F2x) + other_rf[t] F[t,0] = F[t,0] * scale[t] T_j[t,:] = forc_to_temp(T_j[t-1,:], q[t,:], d, F[t,:]) T[t]=np.sum(T_j[t,:],axis=-1) if not useMultigas: C = np.squeeze(C) F = np.squeeze(F) if restart_out: if useMultigas: E_minus1 = np.sum(emissions[-1,1:3]) else: E_minus1 = emissions[-1] restart_out_val=(R_i[-1],T_j[-1],C_acc[-1],E_minus1) return C, F, T, restart_out_val else: return C, F, T
true
true
f7248131aa87bcae1465dd9f6fc9da5036cc235d
29,226
py
Python
absl/flags/tests/_validators_test.py
mcx/abseil-py
58ead8c22230a2493006fa0ab9f76776b6e7280f
[ "Apache-2.0" ]
1,969
2017-04-24T22:21:29.000Z
2022-03-30T13:27:09.000Z
absl/flags/tests/_validators_test.py
mcx/abseil-py
58ead8c22230a2493006fa0ab9f76776b6e7280f
[ "Apache-2.0" ]
111
2017-09-27T05:45:53.000Z
2022-03-29T16:48:49.000Z
absl/flags/tests/_validators_test.py
mcx/abseil-py
58ead8c22230a2493006fa0ab9f76776b6e7280f
[ "Apache-2.0" ]
240
2017-09-26T01:18:10.000Z
2022-03-31T06:24:40.000Z
# Copyright 2017 The Abseil Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Testing that flags validators framework does work. This file tests that each flag validator called when it should be, and that failed validator will throw an exception, etc. """ from __future__ import absolute_import from __future__ import division from __future__ import print_function import warnings from absl.flags import _defines from absl.flags import _exceptions from absl.flags import _flagvalues from absl.flags import _validators from absl.testing import absltest class SingleFlagValidatorTest(absltest.TestCase): """Testing _validators.register_validator() method.""" def setUp(self): super(SingleFlagValidatorTest, self).setUp() self.flag_values = _flagvalues.FlagValues() self.call_args = [] def test_success(self): def checker(x): self.call_args.append(x) return True _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.test_flag) self.flag_values.test_flag = 2 self.assertEqual(2, self.flag_values.test_flag) self.assertEqual([None, 2], self.call_args) def test_default_value_not_used_success(self): def checker(x): self.call_args.append(x) return True _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') self.flag_values(argv) self.assertEqual(1, self.flag_values.test_flag) self.assertEqual([1], self.call_args) def test_validator_not_called_when_other_flag_is_changed(self): def checker(x): self.call_args.append(x) return True _defines.DEFINE_integer( 'test_flag', 1, 'Usual integer flag', flag_values=self.flag_values) _defines.DEFINE_integer( 'other_flag', 2, 'Other integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.assertEqual(1, self.flag_values.test_flag) self.flag_values.other_flag = 3 self.assertEqual([1], self.call_args) def test_exception_raised_if_checker_fails(self): def checker(x): self.call_args.append(x) return x == 1 _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.test_flag = 2 self.assertEqual('flag --test_flag=2: Errors happen', str(cm.exception)) self.assertEqual([1, 2], self.call_args) def test_exception_raised_if_checker_raises_exception(self): def checker(x): self.call_args.append(x) if x == 1: return True raise _exceptions.ValidationError('Specific message') _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.test_flag = 2 self.assertEqual('flag --test_flag=2: Specific message', str(cm.exception)) self.assertEqual([1, 2], self.call_args) def test_error_message_when_checker_returns_false_on_start(self): def checker(x): self.call_args.append(x) return False _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual('flag --test_flag=1: Errors happen', str(cm.exception)) self.assertEqual([1], self.call_args) def test_error_message_when_checker_raises_exception_on_start(self): def checker(x): self.call_args.append(x) raise _exceptions.ValidationError('Specific message') _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual('flag --test_flag=1: Specific message', str(cm.exception)) self.assertEqual([1], self.call_args) def test_validators_checked_in_order(self): def required(x): self.calls.append('required') return x is not None def even(x): self.calls.append('even') return x % 2 == 0 self.calls = [] self._define_flag_and_validators(required, even) self.assertEqual(['required', 'even'], self.calls) self.calls = [] self._define_flag_and_validators(even, required) self.assertEqual(['even', 'required'], self.calls) def _define_flag_and_validators(self, first_validator, second_validator): local_flags = _flagvalues.FlagValues() _defines.DEFINE_integer( 'test_flag', 2, 'test flag', flag_values=local_flags) _validators.register_validator( 'test_flag', first_validator, message='', flag_values=local_flags) _validators.register_validator( 'test_flag', second_validator, message='', flag_values=local_flags) argv = ('./program',) local_flags(argv) def test_validator_as_decorator(self): _defines.DEFINE_integer( 'test_flag', None, 'Simple integer flag', flag_values=self.flag_values) @_validators.validator('test_flag', flag_values=self.flag_values) def checker(x): self.call_args.append(x) return True argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.test_flag) self.flag_values.test_flag = 2 self.assertEqual(2, self.flag_values.test_flag) self.assertEqual([None, 2], self.call_args) # Check that 'Checker' is still a function and has not been replaced. self.assertTrue(checker(3)) self.assertEqual([None, 2, 3], self.call_args) class MultiFlagsValidatorTest(absltest.TestCase): """Test flags multi-flag validators.""" def setUp(self): super(MultiFlagsValidatorTest, self).setUp() self.flag_values = _flagvalues.FlagValues() self.call_args = [] _defines.DEFINE_integer( 'foo', 1, 'Usual integer flag', flag_values=self.flag_values) _defines.DEFINE_integer( 'bar', 2, 'Usual integer flag', flag_values=self.flag_values) def test_success(self): def checker(flags_dict): self.call_args.append(flags_dict) return True _validators.register_multi_flags_validator( ['foo', 'bar'], checker, flag_values=self.flag_values) argv = ('./program', '--bar=2') self.flag_values(argv) self.assertEqual(1, self.flag_values.foo) self.assertEqual(2, self.flag_values.bar) self.assertEqual([{'foo': 1, 'bar': 2}], self.call_args) self.flag_values.foo = 3 self.assertEqual(3, self.flag_values.foo) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 3, 'bar': 2}], self.call_args) def test_validator_not_called_when_other_flag_is_changed(self): def checker(flags_dict): self.call_args.append(flags_dict) return True _defines.DEFINE_integer( 'other_flag', 3, 'Other integer flag', flag_values=self.flag_values) _validators.register_multi_flags_validator( ['foo', 'bar'], checker, flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.flag_values.other_flag = 3 self.assertEqual([{'foo': 1, 'bar': 2}], self.call_args) def test_exception_raised_if_checker_fails(self): def checker(flags_dict): self.call_args.append(flags_dict) values = flags_dict.values() # Make sure all the flags have different values. return len(set(values)) == len(values) _validators.register_multi_flags_validator( ['foo', 'bar'], checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.bar = 1 self.assertEqual('flags foo=1, bar=1: Errors happen', str(cm.exception)) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 1, 'bar': 1}], self.call_args) def test_exception_raised_if_checker_raises_exception(self): def checker(flags_dict): self.call_args.append(flags_dict) values = flags_dict.values() # Make sure all the flags have different values. if len(set(values)) != len(values): raise _exceptions.ValidationError('Specific message') return True _validators.register_multi_flags_validator( ['foo', 'bar'], checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.bar = 1 self.assertEqual('flags foo=1, bar=1: Specific message', str(cm.exception)) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 1, 'bar': 1}], self.call_args) def test_decorator(self): @_validators.multi_flags_validator( ['foo', 'bar'], message='Errors happen', flag_values=self.flag_values) def checker(flags_dict): # pylint: disable=unused-variable self.call_args.append(flags_dict) values = flags_dict.values() # Make sure all the flags have different values. return len(set(values)) == len(values) argv = ('./program',) self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.bar = 1 self.assertEqual('flags foo=1, bar=1: Errors happen', str(cm.exception)) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 1, 'bar': 1}], self.call_args) class MarkFlagsAsMutualExclusiveTest(absltest.TestCase): def setUp(self): super(MarkFlagsAsMutualExclusiveTest, self).setUp() self.flag_values = _flagvalues.FlagValues() _defines.DEFINE_string( 'flag_one', None, 'flag one', flag_values=self.flag_values) _defines.DEFINE_string( 'flag_two', None, 'flag two', flag_values=self.flag_values) _defines.DEFINE_string( 'flag_three', None, 'flag three', flag_values=self.flag_values) _defines.DEFINE_integer( 'int_flag_one', None, 'int flag one', flag_values=self.flag_values) _defines.DEFINE_integer( 'int_flag_two', None, 'int flag two', flag_values=self.flag_values) _defines.DEFINE_multi_string( 'multi_flag_one', None, 'multi flag one', flag_values=self.flag_values) _defines.DEFINE_multi_string( 'multi_flag_two', None, 'multi flag two', flag_values=self.flag_values) _defines.DEFINE_boolean( 'flag_not_none', False, 'false default', flag_values=self.flag_values) def _mark_flags_as_mutually_exclusive(self, flag_names, required): _validators.mark_flags_as_mutual_exclusive( flag_names, required=required, flag_values=self.flag_values) def test_no_flags_present(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], False) argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.flag_one) self.assertIsNone(self.flag_values.flag_two) def test_no_flags_present_required(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], True) argv = ('./program',) expected = ( 'flags flag_one=None, flag_two=None: ' 'Exactly one of (flag_one, flag_two) must have a value other than ' 'None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_one_flag_present(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], False) self.flag_values(('./program', '--flag_one=1')) self.assertEqual('1', self.flag_values.flag_one) def test_one_flag_present_required(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], True) self.flag_values(('./program', '--flag_two=2')) self.assertEqual('2', self.flag_values.flag_two) def test_one_flag_zero_required(self): self._mark_flags_as_mutually_exclusive( ['int_flag_one', 'int_flag_two'], True) self.flag_values(('./program', '--int_flag_one=0')) self.assertEqual(0, self.flag_values.int_flag_one) def test_mutual_exclusion_with_extra_flags(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], True) argv = ('./program', '--flag_two=2', '--flag_three=3') self.flag_values(argv) self.assertEqual('2', self.flag_values.flag_two) self.assertEqual('3', self.flag_values.flag_three) def test_mutual_exclusion_with_zero(self): self._mark_flags_as_mutually_exclusive( ['int_flag_one', 'int_flag_two'], False) argv = ('./program', '--int_flag_one=0', '--int_flag_two=0') expected = ( 'flags int_flag_one=0, int_flag_two=0: ' 'At most one of (int_flag_one, int_flag_two) must have a value other ' 'than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_multiple_flags_present(self): self._mark_flags_as_mutually_exclusive( ['flag_one', 'flag_two', 'flag_three'], False) argv = ('./program', '--flag_one=1', '--flag_two=2', '--flag_three=3') expected = ( 'flags flag_one=1, flag_two=2, flag_three=3: ' 'At most one of (flag_one, flag_two, flag_three) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_multiple_flags_present_required(self): self._mark_flags_as_mutually_exclusive( ['flag_one', 'flag_two', 'flag_three'], True) argv = ('./program', '--flag_one=1', '--flag_two=2', '--flag_three=3') expected = ( 'flags flag_one=1, flag_two=2, flag_three=3: ' 'Exactly one of (flag_one, flag_two, flag_three) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_no_multiflags_present(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], False) argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.multi_flag_one) self.assertIsNone(self.flag_values.multi_flag_two) def test_no_multistring_flags_present_required(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) argv = ('./program',) expected = ( 'flags multi_flag_one=None, multi_flag_two=None: ' 'Exactly one of (multi_flag_one, multi_flag_two) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_one_multiflag_present(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) self.flag_values(('./program', '--multi_flag_one=1')) self.assertEqual(['1'], self.flag_values.multi_flag_one) def test_one_multiflag_present_repeated(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) self.flag_values(('./program', '--multi_flag_one=1', '--multi_flag_one=1b')) self.assertEqual(['1', '1b'], self.flag_values.multi_flag_one) def test_multiple_multiflags_present(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], False) argv = ('./program', '--multi_flag_one=1', '--multi_flag_two=2') expected = ( "flags multi_flag_one=['1'], multi_flag_two=['2']: " 'At most one of (multi_flag_one, multi_flag_two) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_multiple_multiflags_present_required(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) argv = ('./program', '--multi_flag_one=1', '--multi_flag_two=2') expected = ( "flags multi_flag_one=['1'], multi_flag_two=['2']: " 'Exactly one of (multi_flag_one, multi_flag_two) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_flag_default_not_none_warning(self): with warnings.catch_warnings(record=True) as caught_warnings: warnings.simplefilter('always') self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_not_none'], False) self.assertLen(caught_warnings, 1) self.assertIn('--flag_not_none has a non-None default value', str(caught_warnings[0].message)) class MarkBoolFlagsAsMutualExclusiveTest(absltest.TestCase): def setUp(self): super(MarkBoolFlagsAsMutualExclusiveTest, self).setUp() self.flag_values = _flagvalues.FlagValues() _defines.DEFINE_boolean( 'false_1', False, 'default false 1', flag_values=self.flag_values) _defines.DEFINE_boolean( 'false_2', False, 'default false 2', flag_values=self.flag_values) _defines.DEFINE_boolean( 'true_1', True, 'default true 1', flag_values=self.flag_values) _defines.DEFINE_integer( 'non_bool', None, 'non bool', flag_values=self.flag_values) def _mark_bool_flags_as_mutually_exclusive(self, flag_names, required): _validators.mark_bool_flags_as_mutual_exclusive( flag_names, required=required, flag_values=self.flag_values) def test_no_flags_present(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'false_2'], False) self.flag_values(('./program',)) self.assertEqual(False, self.flag_values.false_1) self.assertEqual(False, self.flag_values.false_2) def test_no_flags_present_required(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'false_2'], True) argv = ('./program',) expected = ( 'flags false_1=False, false_2=False: ' 'Exactly one of (false_1, false_2) must be True.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_no_flags_present_with_default_true_required(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'true_1'], True) self.flag_values(('./program',)) self.assertEqual(False, self.flag_values.false_1) self.assertEqual(True, self.flag_values.true_1) def test_two_flags_true(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'false_2'], False) argv = ('./program', '--false_1', '--false_2') expected = ( 'flags false_1=True, false_2=True: At most one of (false_1, ' 'false_2) must be True.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_non_bool_flag(self): expected = ('Flag --non_bool is not Boolean, which is required for flags ' 'used in mark_bool_flags_as_mutual_exclusive.') with self.assertRaisesWithLiteralMatch(_exceptions.ValidationError, expected): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'non_bool'], False) class MarkFlagAsRequiredTest(absltest.TestCase): def setUp(self): super(MarkFlagAsRequiredTest, self).setUp() self.flag_values = _flagvalues.FlagValues() def test_success(self): _defines.DEFINE_string( 'string_flag', None, 'string flag', flag_values=self.flag_values) _validators.mark_flag_as_required( 'string_flag', flag_values=self.flag_values) argv = ('./program', '--string_flag=value') self.flag_values(argv) self.assertEqual('value', self.flag_values.string_flag) def test_catch_none_as_default(self): _defines.DEFINE_string( 'string_flag', None, 'string flag', flag_values=self.flag_values) _validators.mark_flag_as_required( 'string_flag', flag_values=self.flag_values) argv = ('./program',) expected = ( r'flag --string_flag=None: Flag --string_flag must have a value other ' r'than None\.') with self.assertRaisesRegex(_exceptions.IllegalFlagValueError, expected): self.flag_values(argv) def test_catch_setting_none_after_program_start(self): _defines.DEFINE_string( 'string_flag', 'value', 'string flag', flag_values=self.flag_values) _validators.mark_flag_as_required( 'string_flag', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.assertEqual('value', self.flag_values.string_flag) expected = ('flag --string_flag=None: Flag --string_flag must have a value ' 'other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.string_flag = None self.assertEqual(expected, str(cm.exception)) def test_flag_default_not_none_warning(self): _defines.DEFINE_string( 'flag_not_none', '', 'empty default', flag_values=self.flag_values) with warnings.catch_warnings(record=True) as caught_warnings: warnings.simplefilter('always') _validators.mark_flag_as_required( 'flag_not_none', flag_values=self.flag_values) self.assertLen(caught_warnings, 1) self.assertIn('--flag_not_none has a non-None default value', str(caught_warnings[0].message)) class MarkFlagsAsRequiredTest(absltest.TestCase): def setUp(self): super(MarkFlagsAsRequiredTest, self).setUp() self.flag_values = _flagvalues.FlagValues() def test_success(self): _defines.DEFINE_string( 'string_flag_1', None, 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_string( 'string_flag_2', None, 'string flag 2', flag_values=self.flag_values) flag_names = ['string_flag_1', 'string_flag_2'] _validators.mark_flags_as_required(flag_names, flag_values=self.flag_values) argv = ('./program', '--string_flag_1=value_1', '--string_flag_2=value_2') self.flag_values(argv) self.assertEqual('value_1', self.flag_values.string_flag_1) self.assertEqual('value_2', self.flag_values.string_flag_2) def test_catch_none_as_default(self): _defines.DEFINE_string( 'string_flag_1', None, 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_string( 'string_flag_2', None, 'string flag 2', flag_values=self.flag_values) _validators.mark_flags_as_required( ['string_flag_1', 'string_flag_2'], flag_values=self.flag_values) argv = ('./program', '--string_flag_1=value_1') expected = ( r'flag --string_flag_2=None: Flag --string_flag_2 must have a value ' r'other than None\.') with self.assertRaisesRegex(_exceptions.IllegalFlagValueError, expected): self.flag_values(argv) def test_catch_setting_none_after_program_start(self): _defines.DEFINE_string( 'string_flag_1', 'value_1', 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_string( 'string_flag_2', 'value_2', 'string flag 2', flag_values=self.flag_values) _validators.mark_flags_as_required( ['string_flag_1', 'string_flag_2'], flag_values=self.flag_values) argv = ('./program', '--string_flag_1=value_1') self.flag_values(argv) self.assertEqual('value_1', self.flag_values.string_flag_1) expected = ( 'flag --string_flag_1=None: Flag --string_flag_1 must have a value ' 'other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.string_flag_1 = None self.assertEqual(expected, str(cm.exception)) def test_catch_multiple_flags_as_none_at_program_start(self): _defines.DEFINE_float( 'float_flag_1', None, 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_float( 'float_flag_2', None, 'string flag 2', flag_values=self.flag_values) _validators.mark_flags_as_required( ['float_flag_1', 'float_flag_2'], flag_values=self.flag_values) argv = ('./program', '') expected = ( 'flag --float_flag_1=None: Flag --float_flag_1 must have a value ' 'other than None.\n' 'flag --float_flag_2=None: Flag --float_flag_2 must have a value ' 'other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual(expected, str(cm.exception)) def test_fail_fast_single_flag_and_skip_remaining_validators(self): def raise_unexpected_error(x): del x raise _exceptions.ValidationError('Should not be raised.') _defines.DEFINE_float( 'flag_1', None, 'flag 1', flag_values=self.flag_values) _defines.DEFINE_float( 'flag_2', 4.2, 'flag 2', flag_values=self.flag_values) _validators.mark_flag_as_required('flag_1', flag_values=self.flag_values) _validators.register_validator( 'flag_1', raise_unexpected_error, flag_values=self.flag_values) _validators.register_multi_flags_validator(['flag_2', 'flag_1'], raise_unexpected_error, flag_values=self.flag_values) argv = ('./program', '') expected = ( 'flag --flag_1=None: Flag --flag_1 must have a value other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual(expected, str(cm.exception)) def test_fail_fast_multi_flag_and_skip_remaining_validators(self): def raise_expected_error(x): del x raise _exceptions.ValidationError('Expected error.') def raise_unexpected_error(x): del x raise _exceptions.ValidationError('Got unexpected error.') _defines.DEFINE_float( 'flag_1', 5.1, 'flag 1', flag_values=self.flag_values) _defines.DEFINE_float( 'flag_2', 10.0, 'flag 2', flag_values=self.flag_values) _validators.register_multi_flags_validator(['flag_1', 'flag_2'], raise_expected_error, flag_values=self.flag_values) _validators.register_multi_flags_validator(['flag_2', 'flag_1'], raise_unexpected_error, flag_values=self.flag_values) _validators.register_validator( 'flag_1', raise_unexpected_error, flag_values=self.flag_values) _validators.register_validator( 'flag_2', raise_unexpected_error, flag_values=self.flag_values) argv = ('./program', '') expected = ('flags flag_1=5.1, flag_2=10.0: Expected error.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual(expected, str(cm.exception)) if __name__ == '__main__': absltest.main()
39.22953
80
0.685622
from __future__ import absolute_import from __future__ import division from __future__ import print_function import warnings from absl.flags import _defines from absl.flags import _exceptions from absl.flags import _flagvalues from absl.flags import _validators from absl.testing import absltest class SingleFlagValidatorTest(absltest.TestCase): def setUp(self): super(SingleFlagValidatorTest, self).setUp() self.flag_values = _flagvalues.FlagValues() self.call_args = [] def test_success(self): def checker(x): self.call_args.append(x) return True _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.test_flag) self.flag_values.test_flag = 2 self.assertEqual(2, self.flag_values.test_flag) self.assertEqual([None, 2], self.call_args) def test_default_value_not_used_success(self): def checker(x): self.call_args.append(x) return True _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') self.flag_values(argv) self.assertEqual(1, self.flag_values.test_flag) self.assertEqual([1], self.call_args) def test_validator_not_called_when_other_flag_is_changed(self): def checker(x): self.call_args.append(x) return True _defines.DEFINE_integer( 'test_flag', 1, 'Usual integer flag', flag_values=self.flag_values) _defines.DEFINE_integer( 'other_flag', 2, 'Other integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.assertEqual(1, self.flag_values.test_flag) self.flag_values.other_flag = 3 self.assertEqual([1], self.call_args) def test_exception_raised_if_checker_fails(self): def checker(x): self.call_args.append(x) return x == 1 _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.test_flag = 2 self.assertEqual('flag --test_flag=2: Errors happen', str(cm.exception)) self.assertEqual([1, 2], self.call_args) def test_exception_raised_if_checker_raises_exception(self): def checker(x): self.call_args.append(x) if x == 1: return True raise _exceptions.ValidationError('Specific message') _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.test_flag = 2 self.assertEqual('flag --test_flag=2: Specific message', str(cm.exception)) self.assertEqual([1, 2], self.call_args) def test_error_message_when_checker_returns_false_on_start(self): def checker(x): self.call_args.append(x) return False _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual('flag --test_flag=1: Errors happen', str(cm.exception)) self.assertEqual([1], self.call_args) def test_error_message_when_checker_raises_exception_on_start(self): def checker(x): self.call_args.append(x) raise _exceptions.ValidationError('Specific message') _defines.DEFINE_integer( 'test_flag', None, 'Usual integer flag', flag_values=self.flag_values) _validators.register_validator( 'test_flag', checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program', '--test_flag=1') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual('flag --test_flag=1: Specific message', str(cm.exception)) self.assertEqual([1], self.call_args) def test_validators_checked_in_order(self): def required(x): self.calls.append('required') return x is not None def even(x): self.calls.append('even') return x % 2 == 0 self.calls = [] self._define_flag_and_validators(required, even) self.assertEqual(['required', 'even'], self.calls) self.calls = [] self._define_flag_and_validators(even, required) self.assertEqual(['even', 'required'], self.calls) def _define_flag_and_validators(self, first_validator, second_validator): local_flags = _flagvalues.FlagValues() _defines.DEFINE_integer( 'test_flag', 2, 'test flag', flag_values=local_flags) _validators.register_validator( 'test_flag', first_validator, message='', flag_values=local_flags) _validators.register_validator( 'test_flag', second_validator, message='', flag_values=local_flags) argv = ('./program',) local_flags(argv) def test_validator_as_decorator(self): _defines.DEFINE_integer( 'test_flag', None, 'Simple integer flag', flag_values=self.flag_values) @_validators.validator('test_flag', flag_values=self.flag_values) def checker(x): self.call_args.append(x) return True argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.test_flag) self.flag_values.test_flag = 2 self.assertEqual(2, self.flag_values.test_flag) self.assertEqual([None, 2], self.call_args) self.assertTrue(checker(3)) self.assertEqual([None, 2, 3], self.call_args) class MultiFlagsValidatorTest(absltest.TestCase): def setUp(self): super(MultiFlagsValidatorTest, self).setUp() self.flag_values = _flagvalues.FlagValues() self.call_args = [] _defines.DEFINE_integer( 'foo', 1, 'Usual integer flag', flag_values=self.flag_values) _defines.DEFINE_integer( 'bar', 2, 'Usual integer flag', flag_values=self.flag_values) def test_success(self): def checker(flags_dict): self.call_args.append(flags_dict) return True _validators.register_multi_flags_validator( ['foo', 'bar'], checker, flag_values=self.flag_values) argv = ('./program', '--bar=2') self.flag_values(argv) self.assertEqual(1, self.flag_values.foo) self.assertEqual(2, self.flag_values.bar) self.assertEqual([{'foo': 1, 'bar': 2}], self.call_args) self.flag_values.foo = 3 self.assertEqual(3, self.flag_values.foo) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 3, 'bar': 2}], self.call_args) def test_validator_not_called_when_other_flag_is_changed(self): def checker(flags_dict): self.call_args.append(flags_dict) return True _defines.DEFINE_integer( 'other_flag', 3, 'Other integer flag', flag_values=self.flag_values) _validators.register_multi_flags_validator( ['foo', 'bar'], checker, flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.flag_values.other_flag = 3 self.assertEqual([{'foo': 1, 'bar': 2}], self.call_args) def test_exception_raised_if_checker_fails(self): def checker(flags_dict): self.call_args.append(flags_dict) values = flags_dict.values() return len(set(values)) == len(values) _validators.register_multi_flags_validator( ['foo', 'bar'], checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.bar = 1 self.assertEqual('flags foo=1, bar=1: Errors happen', str(cm.exception)) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 1, 'bar': 1}], self.call_args) def test_exception_raised_if_checker_raises_exception(self): def checker(flags_dict): self.call_args.append(flags_dict) values = flags_dict.values() if len(set(values)) != len(values): raise _exceptions.ValidationError('Specific message') return True _validators.register_multi_flags_validator( ['foo', 'bar'], checker, message='Errors happen', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.bar = 1 self.assertEqual('flags foo=1, bar=1: Specific message', str(cm.exception)) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 1, 'bar': 1}], self.call_args) def test_decorator(self): @_validators.multi_flags_validator( ['foo', 'bar'], message='Errors happen', flag_values=self.flag_values) def checker(flags_dict): self.call_args.append(flags_dict) values = flags_dict.values() return len(set(values)) == len(values) argv = ('./program',) self.flag_values(argv) with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.bar = 1 self.assertEqual('flags foo=1, bar=1: Errors happen', str(cm.exception)) self.assertEqual([{'foo': 1, 'bar': 2}, {'foo': 1, 'bar': 1}], self.call_args) class MarkFlagsAsMutualExclusiveTest(absltest.TestCase): def setUp(self): super(MarkFlagsAsMutualExclusiveTest, self).setUp() self.flag_values = _flagvalues.FlagValues() _defines.DEFINE_string( 'flag_one', None, 'flag one', flag_values=self.flag_values) _defines.DEFINE_string( 'flag_two', None, 'flag two', flag_values=self.flag_values) _defines.DEFINE_string( 'flag_three', None, 'flag three', flag_values=self.flag_values) _defines.DEFINE_integer( 'int_flag_one', None, 'int flag one', flag_values=self.flag_values) _defines.DEFINE_integer( 'int_flag_two', None, 'int flag two', flag_values=self.flag_values) _defines.DEFINE_multi_string( 'multi_flag_one', None, 'multi flag one', flag_values=self.flag_values) _defines.DEFINE_multi_string( 'multi_flag_two', None, 'multi flag two', flag_values=self.flag_values) _defines.DEFINE_boolean( 'flag_not_none', False, 'false default', flag_values=self.flag_values) def _mark_flags_as_mutually_exclusive(self, flag_names, required): _validators.mark_flags_as_mutual_exclusive( flag_names, required=required, flag_values=self.flag_values) def test_no_flags_present(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], False) argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.flag_one) self.assertIsNone(self.flag_values.flag_two) def test_no_flags_present_required(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], True) argv = ('./program',) expected = ( 'flags flag_one=None, flag_two=None: ' 'Exactly one of (flag_one, flag_two) must have a value other than ' 'None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_one_flag_present(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], False) self.flag_values(('./program', '--flag_one=1')) self.assertEqual('1', self.flag_values.flag_one) def test_one_flag_present_required(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], True) self.flag_values(('./program', '--flag_two=2')) self.assertEqual('2', self.flag_values.flag_two) def test_one_flag_zero_required(self): self._mark_flags_as_mutually_exclusive( ['int_flag_one', 'int_flag_two'], True) self.flag_values(('./program', '--int_flag_one=0')) self.assertEqual(0, self.flag_values.int_flag_one) def test_mutual_exclusion_with_extra_flags(self): self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_two'], True) argv = ('./program', '--flag_two=2', '--flag_three=3') self.flag_values(argv) self.assertEqual('2', self.flag_values.flag_two) self.assertEqual('3', self.flag_values.flag_three) def test_mutual_exclusion_with_zero(self): self._mark_flags_as_mutually_exclusive( ['int_flag_one', 'int_flag_two'], False) argv = ('./program', '--int_flag_one=0', '--int_flag_two=0') expected = ( 'flags int_flag_one=0, int_flag_two=0: ' 'At most one of (int_flag_one, int_flag_two) must have a value other ' 'than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_multiple_flags_present(self): self._mark_flags_as_mutually_exclusive( ['flag_one', 'flag_two', 'flag_three'], False) argv = ('./program', '--flag_one=1', '--flag_two=2', '--flag_three=3') expected = ( 'flags flag_one=1, flag_two=2, flag_three=3: ' 'At most one of (flag_one, flag_two, flag_three) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_multiple_flags_present_required(self): self._mark_flags_as_mutually_exclusive( ['flag_one', 'flag_two', 'flag_three'], True) argv = ('./program', '--flag_one=1', '--flag_two=2', '--flag_three=3') expected = ( 'flags flag_one=1, flag_two=2, flag_three=3: ' 'Exactly one of (flag_one, flag_two, flag_three) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_no_multiflags_present(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], False) argv = ('./program',) self.flag_values(argv) self.assertIsNone(self.flag_values.multi_flag_one) self.assertIsNone(self.flag_values.multi_flag_two) def test_no_multistring_flags_present_required(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) argv = ('./program',) expected = ( 'flags multi_flag_one=None, multi_flag_two=None: ' 'Exactly one of (multi_flag_one, multi_flag_two) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_one_multiflag_present(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) self.flag_values(('./program', '--multi_flag_one=1')) self.assertEqual(['1'], self.flag_values.multi_flag_one) def test_one_multiflag_present_repeated(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) self.flag_values(('./program', '--multi_flag_one=1', '--multi_flag_one=1b')) self.assertEqual(['1', '1b'], self.flag_values.multi_flag_one) def test_multiple_multiflags_present(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], False) argv = ('./program', '--multi_flag_one=1', '--multi_flag_two=2') expected = ( "flags multi_flag_one=['1'], multi_flag_two=['2']: " 'At most one of (multi_flag_one, multi_flag_two) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_multiple_multiflags_present_required(self): self._mark_flags_as_mutually_exclusive( ['multi_flag_one', 'multi_flag_two'], True) argv = ('./program', '--multi_flag_one=1', '--multi_flag_two=2') expected = ( "flags multi_flag_one=['1'], multi_flag_two=['2']: " 'Exactly one of (multi_flag_one, multi_flag_two) must have a value ' 'other than None.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_flag_default_not_none_warning(self): with warnings.catch_warnings(record=True) as caught_warnings: warnings.simplefilter('always') self._mark_flags_as_mutually_exclusive(['flag_one', 'flag_not_none'], False) self.assertLen(caught_warnings, 1) self.assertIn('--flag_not_none has a non-None default value', str(caught_warnings[0].message)) class MarkBoolFlagsAsMutualExclusiveTest(absltest.TestCase): def setUp(self): super(MarkBoolFlagsAsMutualExclusiveTest, self).setUp() self.flag_values = _flagvalues.FlagValues() _defines.DEFINE_boolean( 'false_1', False, 'default false 1', flag_values=self.flag_values) _defines.DEFINE_boolean( 'false_2', False, 'default false 2', flag_values=self.flag_values) _defines.DEFINE_boolean( 'true_1', True, 'default true 1', flag_values=self.flag_values) _defines.DEFINE_integer( 'non_bool', None, 'non bool', flag_values=self.flag_values) def _mark_bool_flags_as_mutually_exclusive(self, flag_names, required): _validators.mark_bool_flags_as_mutual_exclusive( flag_names, required=required, flag_values=self.flag_values) def test_no_flags_present(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'false_2'], False) self.flag_values(('./program',)) self.assertEqual(False, self.flag_values.false_1) self.assertEqual(False, self.flag_values.false_2) def test_no_flags_present_required(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'false_2'], True) argv = ('./program',) expected = ( 'flags false_1=False, false_2=False: ' 'Exactly one of (false_1, false_2) must be True.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_no_flags_present_with_default_true_required(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'true_1'], True) self.flag_values(('./program',)) self.assertEqual(False, self.flag_values.false_1) self.assertEqual(True, self.flag_values.true_1) def test_two_flags_true(self): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'false_2'], False) argv = ('./program', '--false_1', '--false_2') expected = ( 'flags false_1=True, false_2=True: At most one of (false_1, ' 'false_2) must be True.') self.assertRaisesWithLiteralMatch(_exceptions.IllegalFlagValueError, expected, self.flag_values, argv) def test_non_bool_flag(self): expected = ('Flag --non_bool is not Boolean, which is required for flags ' 'used in mark_bool_flags_as_mutual_exclusive.') with self.assertRaisesWithLiteralMatch(_exceptions.ValidationError, expected): self._mark_bool_flags_as_mutually_exclusive(['false_1', 'non_bool'], False) class MarkFlagAsRequiredTest(absltest.TestCase): def setUp(self): super(MarkFlagAsRequiredTest, self).setUp() self.flag_values = _flagvalues.FlagValues() def test_success(self): _defines.DEFINE_string( 'string_flag', None, 'string flag', flag_values=self.flag_values) _validators.mark_flag_as_required( 'string_flag', flag_values=self.flag_values) argv = ('./program', '--string_flag=value') self.flag_values(argv) self.assertEqual('value', self.flag_values.string_flag) def test_catch_none_as_default(self): _defines.DEFINE_string( 'string_flag', None, 'string flag', flag_values=self.flag_values) _validators.mark_flag_as_required( 'string_flag', flag_values=self.flag_values) argv = ('./program',) expected = ( r'flag --string_flag=None: Flag --string_flag must have a value other ' r'than None\.') with self.assertRaisesRegex(_exceptions.IllegalFlagValueError, expected): self.flag_values(argv) def test_catch_setting_none_after_program_start(self): _defines.DEFINE_string( 'string_flag', 'value', 'string flag', flag_values=self.flag_values) _validators.mark_flag_as_required( 'string_flag', flag_values=self.flag_values) argv = ('./program',) self.flag_values(argv) self.assertEqual('value', self.flag_values.string_flag) expected = ('flag --string_flag=None: Flag --string_flag must have a value ' 'other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.string_flag = None self.assertEqual(expected, str(cm.exception)) def test_flag_default_not_none_warning(self): _defines.DEFINE_string( 'flag_not_none', '', 'empty default', flag_values=self.flag_values) with warnings.catch_warnings(record=True) as caught_warnings: warnings.simplefilter('always') _validators.mark_flag_as_required( 'flag_not_none', flag_values=self.flag_values) self.assertLen(caught_warnings, 1) self.assertIn('--flag_not_none has a non-None default value', str(caught_warnings[0].message)) class MarkFlagsAsRequiredTest(absltest.TestCase): def setUp(self): super(MarkFlagsAsRequiredTest, self).setUp() self.flag_values = _flagvalues.FlagValues() def test_success(self): _defines.DEFINE_string( 'string_flag_1', None, 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_string( 'string_flag_2', None, 'string flag 2', flag_values=self.flag_values) flag_names = ['string_flag_1', 'string_flag_2'] _validators.mark_flags_as_required(flag_names, flag_values=self.flag_values) argv = ('./program', '--string_flag_1=value_1', '--string_flag_2=value_2') self.flag_values(argv) self.assertEqual('value_1', self.flag_values.string_flag_1) self.assertEqual('value_2', self.flag_values.string_flag_2) def test_catch_none_as_default(self): _defines.DEFINE_string( 'string_flag_1', None, 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_string( 'string_flag_2', None, 'string flag 2', flag_values=self.flag_values) _validators.mark_flags_as_required( ['string_flag_1', 'string_flag_2'], flag_values=self.flag_values) argv = ('./program', '--string_flag_1=value_1') expected = ( r'flag --string_flag_2=None: Flag --string_flag_2 must have a value ' r'other than None\.') with self.assertRaisesRegex(_exceptions.IllegalFlagValueError, expected): self.flag_values(argv) def test_catch_setting_none_after_program_start(self): _defines.DEFINE_string( 'string_flag_1', 'value_1', 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_string( 'string_flag_2', 'value_2', 'string flag 2', flag_values=self.flag_values) _validators.mark_flags_as_required( ['string_flag_1', 'string_flag_2'], flag_values=self.flag_values) argv = ('./program', '--string_flag_1=value_1') self.flag_values(argv) self.assertEqual('value_1', self.flag_values.string_flag_1) expected = ( 'flag --string_flag_1=None: Flag --string_flag_1 must have a value ' 'other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values.string_flag_1 = None self.assertEqual(expected, str(cm.exception)) def test_catch_multiple_flags_as_none_at_program_start(self): _defines.DEFINE_float( 'float_flag_1', None, 'string flag 1', flag_values=self.flag_values) _defines.DEFINE_float( 'float_flag_2', None, 'string flag 2', flag_values=self.flag_values) _validators.mark_flags_as_required( ['float_flag_1', 'float_flag_2'], flag_values=self.flag_values) argv = ('./program', '') expected = ( 'flag --float_flag_1=None: Flag --float_flag_1 must have a value ' 'other than None.\n' 'flag --float_flag_2=None: Flag --float_flag_2 must have a value ' 'other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual(expected, str(cm.exception)) def test_fail_fast_single_flag_and_skip_remaining_validators(self): def raise_unexpected_error(x): del x raise _exceptions.ValidationError('Should not be raised.') _defines.DEFINE_float( 'flag_1', None, 'flag 1', flag_values=self.flag_values) _defines.DEFINE_float( 'flag_2', 4.2, 'flag 2', flag_values=self.flag_values) _validators.mark_flag_as_required('flag_1', flag_values=self.flag_values) _validators.register_validator( 'flag_1', raise_unexpected_error, flag_values=self.flag_values) _validators.register_multi_flags_validator(['flag_2', 'flag_1'], raise_unexpected_error, flag_values=self.flag_values) argv = ('./program', '') expected = ( 'flag --flag_1=None: Flag --flag_1 must have a value other than None.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual(expected, str(cm.exception)) def test_fail_fast_multi_flag_and_skip_remaining_validators(self): def raise_expected_error(x): del x raise _exceptions.ValidationError('Expected error.') def raise_unexpected_error(x): del x raise _exceptions.ValidationError('Got unexpected error.') _defines.DEFINE_float( 'flag_1', 5.1, 'flag 1', flag_values=self.flag_values) _defines.DEFINE_float( 'flag_2', 10.0, 'flag 2', flag_values=self.flag_values) _validators.register_multi_flags_validator(['flag_1', 'flag_2'], raise_expected_error, flag_values=self.flag_values) _validators.register_multi_flags_validator(['flag_2', 'flag_1'], raise_unexpected_error, flag_values=self.flag_values) _validators.register_validator( 'flag_1', raise_unexpected_error, flag_values=self.flag_values) _validators.register_validator( 'flag_2', raise_unexpected_error, flag_values=self.flag_values) argv = ('./program', '') expected = ('flags flag_1=5.1, flag_2=10.0: Expected error.') with self.assertRaises(_exceptions.IllegalFlagValueError) as cm: self.flag_values(argv) self.assertEqual(expected, str(cm.exception)) if __name__ == '__main__': absltest.main()
true
true
f72481a010acb7f8d898500cf94f600286f5da8d
64,856
py
Python
pybit/__init__.py
leftcoastgeek/pybit
3564bd08a5e34c95a15f8a03b100282ddffd3edf
[ "MIT" ]
null
null
null
pybit/__init__.py
leftcoastgeek/pybit
3564bd08a5e34c95a15f8a03b100282ddffd3edf
[ "MIT" ]
null
null
null
pybit/__init__.py
leftcoastgeek/pybit
3564bd08a5e34c95a15f8a03b100282ddffd3edf
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ pybit ------------------------ pybit is a lightweight and high-performance API connector for the RESTful and WebSocket APIs of the Bybit exchange. Documentation can be found at https://github.com/verata-veritatis/pybit :copyright: (c) 2020-2021 verata-veritatis :license: MIT License """ import time import hmac import json import logging import threading import requests import websocket from datetime import datetime as dt from concurrent.futures import ThreadPoolExecutor from .exceptions import FailedRequestError, InvalidRequestError # Requests will use simplejson if available. try: from simplejson.errors import JSONDecodeError except ImportError: from json.decoder import JSONDecodeError # Versioning. VERSION = '1.1.18' class HTTP: """ Connector for Bybit's HTTP API. :param endpoint: The endpoint URL of the HTTP API, e.g. 'https://api-testnet.bybit.com'. :type endpoint: str :param api_key: Your API key. Required for authenticated endpoints. Defaults to None. :type api_key: str :param api_secret: Your API secret key. Required for authenticated endpoints. Defaults to None. :type api_secret: str :param logging_level: The logging level of the built-in logger. Defaults to logging.INFO. Options are CRITICAL (50), ERROR (40), WARNING (30), INFO (20), DEBUG (10), or NOTSET (0). :type logging_level: Union[int, logging.level] :param log_requests: Whether or not pybit should log each HTTP request. :type log_requests: bool :param request_timeout: The timeout of each API request in seconds. Defaults to 10 seconds. :type request_timeout: int :param recv_window: How long an HTTP request is valid in ms. Default is 5000. :type recv_window: int :param force_retry: Whether or not pybit should retry a timed-out request. :type force_retry: bool :param retry_codes: A list of non-fatal status codes to retry on. :type retry_codes: set :param ignore_codes: A list of non-fatal status codes to ignore. :type ignore_codes: set :param max_retries: The number of times to re-attempt a request. :type max_retries: int :param retry_delay: Seconds between retries for returned error or timed-out requests. Default is 3 seconds. :type retry_delay: int :param referral_id: An optional referer ID can be added to each request for identification. :type referral_id: str :returns: pybit.HTTP session. """ def __init__(self, endpoint=None, api_key=None, api_secret=None, logging_level=logging.INFO, log_requests=False, request_timeout=10, recv_window=5000, force_retry=False, retry_codes=None, ignore_codes=None, max_retries=3, retry_delay=3, referral_id=None): """Initializes the HTTP class.""" # Set the endpoint. if endpoint is None: self.endpoint = 'https://api.bybit.com' else: self.endpoint = endpoint # Setup logger. self.logger = logging.getLogger(__name__) if len(logging.root.handlers) == 0: #no handler on root logger set -> we add handler just for this logger to not mess with custom logic from outside handler = logging.StreamHandler() handler.setFormatter(logging.Formatter(fmt='%(asctime)s - %(name)s - %(levelname)s - %(message)s', datefmt='%Y-%m-%d %H:%M:%S' ) ) handler.setLevel(logging_level) self.logger.addHandler(handler) self.logger.debug('Initializing HTTP session.') self.log_requests = log_requests # Set API keys. self.api_key = api_key self.api_secret = api_secret # Set timeout. self.timeout = request_timeout self.recv_window = recv_window self.force_retry = force_retry self.max_retries = max_retries self.retry_delay = retry_delay # Set whitelist of non-fatal Bybit status codes to retry on. if retry_codes is None: self.retry_codes = {10002, 10006, 30034, 30035, 130035, 130150} else: self.retry_codes = retry_codes # Set whitelist of non-fatal Bybit status codes to ignore. if ignore_codes is None: self.ignore_codes = set() else: self.ignore_codes = ignore_codes # Initialize requests session. self.client = requests.Session() self.client.headers.update( { 'User-Agent': 'pybit-' + VERSION, 'Content-Type': 'application/json', 'Accept': 'application/json', } ) # Add referral ID to header. if referral_id: self.client.headers.update({'Referer': referral_id}) def _exit(self): """Closes the request session.""" self.client.close() self.logger.debug('HTTP session closed.') def orderbook(self, **kwargs): """ Get the orderbook. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-orderbook. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/orderBook/L2', query=kwargs ) def query_kline(self, **kwargs): """ Get kline. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-querykline. :returns: Request results as dictionary. """ # Replace query param 'from_time' since 'from' keyword is reserved. # Temporary workaround until Bybit updates official request params if 'from_time' in kwargs: kwargs['from'] = kwargs.pop('from_time') if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/kline' else: suffix = '/v2/public/kline/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def latest_information_for_symbol(self, **kwargs): """ Get the latest information for symbol. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-latestsymbolinfo. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/tickers', query=kwargs ) def public_trading_records(self, **kwargs): """ Get recent trades. You can find a complete history of trades on Bybit at https://public.bybit.com/. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-latestsymbolinfo. :returns: Request results as dictionary. """ # Replace query param 'from_id' since 'from' keyword is reserved. # Temporary workaround until Bybit updates official request params if 'from_id' in kwargs: kwargs['from'] = kwargs.pop('from_id') if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/recent-trading-records' else: suffix = '/v2/public/trading-records' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def query_symbol(self): """ Get symbol info. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/symbols' ) def liquidated_orders(self, **kwargs): """ Retrieve the liquidated orders. The query range is the last seven days of data. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-query_liqrecords. :returns: Request results as dictionary. """ # Replace query param 'from_id' since 'from' keyword is reserved. # Temporary workaround until Bybit updates official request params if 'from_id' in kwargs: kwargs['from'] = kwargs.pop('from_id') return self._submit_request( method='GET', path=self.endpoint + '/v2/public/liq-records', query=kwargs ) def query_mark_price_kline(self, **kwargs): """ Query mark price kline (like query_kline but for mark price). :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-markpricekline. :returns: Request results as dictionary. """ # Replace query param 'from_time' since 'from' keyword is reserved. # Temporary workaround until Bybit updates official request params if 'from_time' in kwargs: kwargs['from'] = kwargs.pop('from_time') if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/mark-price-kline' else: suffix = '/v2/public/mark-price-kline' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def open_interest(self, **kwargs): """ Gets the total amount of unsettled contracts. In other words, the total number of contracts held in open positions. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-marketopeninterest. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/open-interest', query=kwargs ) def latest_big_deal(self, **kwargs): """ Obtain filled orders worth more than 500,000 USD within the last 24h. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-marketbigdeal. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/big-deal', query=kwargs ) def long_short_ratio(self, **kwargs): """ Gets the Bybit long-short ratio. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-marketaccountratio. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/account-ratio', query=kwargs ) def place_active_order(self, **kwargs): """ Places an active order. For more information, see https://bybit-exchange.github.io/docs/inverse/#t-activeorders. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-activeorders. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/create' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/create' else: suffix = '/v2/private/order/create' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def place_active_order_bulk(self, orders: list, max_in_parallel=10): """ Places multiple active orders in bulk using multithreading. For more information on place_active_order, see https://bybit-exchange.github.io/docs/inverse/#t-activeorders. :param list orders: A list of orders and their parameters. :param max_in_parallel: The number of requests to be sent in parallel. Note that you are limited to 50 requests per second. :returns: Future request result dictionaries as a list. """ with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.place_active_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def get_active_order(self, **kwargs): """ Gets an active order. For more information, see https://bybit-exchange.github.io/docs/inverse/#t-getactive. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-getactive. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/v2/private/order/list' else: suffix = '/futures/private/order/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_active_order(self, **kwargs): """ Cancels an active order. For more information, see https://bybit-exchange.github.io/docs/inverse/#t-cancelactive. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-cancelactive. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/cancel' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/cancel' else: suffix = '/v2/private/order/cancel' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_active_order_bulk(self, orders: list, max_in_parallel=10): """ Cancels multiple active orders in bulk using multithreading. For more information on cancel_active_order, see https://bybit-exchange.github.io/docs/inverse/#t-activeorders. :param list orders: A list of orders and their parameters. :param max_in_parallel: The number of requests to be sent in parallel. Note that you are limited to 50 requests per second. :returns: Future request result dictionaries as a list. """ with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.cancel_active_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def cancel_all_active_orders(self, **kwargs): """ Cancel all active orders that are unfilled or partially filled. Fully filled orders cannot be cancelled. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-cancelallactive. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/cancel-all' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/cancelAll' else: suffix = '/v2/private/order/cancelAll' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_active_order(self, **kwargs): """ Replace order can modify/amend your active orders. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-replaceactive. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/replace' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/replace' else: suffix = '/v2/private/order/replace' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_active_order_bulk(self, orders: list, max_in_parallel=10): """ Replaces multiple active orders in bulk using multithreading. For more information on replace_active_order, see https://bybit-exchange.github.io/docs/inverse/#t-replaceactive. :param list orders: A list of orders and their parameters. :param max_in_parallel: The number of requests to be sent in parallel. Note that you are limited to 50 requests per second. :returns: Future request result dictionaries as a list. """ with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.replace_active_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def query_active_order(self, **kwargs): """ Query real-time active order information. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-queryactive. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/search' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order' else: suffix = '/v2/private/order' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def place_conditional_order(self, **kwargs): """ Places a conditional order. For more information, see https://bybit-exchange.github.io/docs/inverse/#t-placecond. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-placecond. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/create' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/create' else: suffix = '/v2/private/stop-order/create' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def place_conditional_order_bulk(self, orders: list, max_in_parallel=10): """ Places multiple conditional orders in bulk using multithreading. For more information on place_active_order, see https://bybit-exchange.github.io/docs/inverse/#t-placecond. :param orders: A list of orders and their parameters. :param max_in_parallel: The number of requests to be sent in parallel. Note that you are limited to 50 requests per second. :returns: Future request result dictionaries as a list. """ with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.place_conditional_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def get_conditional_order(self, **kwargs): """ Gets a conditional order. For more information, see https://bybit-exchange.github.io/docs/inverse/#t-getcond. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-getcond. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/list' else: suffix = '/v2/private/stop-order/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_conditional_order(self, **kwargs): """ Cancels a conditional order. For more information, see https://bybit-exchange.github.io/docs/inverse/#t-cancelcond. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-cancelcond. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/cancel' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/cancel' else: suffix = '/v2/private/stop-order/cancel' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_conditional_order_bulk(self, orders: list, max_in_parallel=10): """ Cancels multiple conditional orders in bulk using multithreading. For more information on cancel_active_order, see https://bybit-exchange.github.io/docs/inverse/#t-cancelcond. :param list orders: A list of orders and their parameters. :param max_in_parallel: The number of requests to be sent in parallel. Note that you are limited to 50 requests per second. :returns: Future request result dictionaries as a list. """ with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.cancel_conditional_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def cancel_all_conditional_orders(self, **kwargs): """ Cancel all conditional orders that are unfilled or partially filled. Fully filled orders cannot be cancelled. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-cancelallcond. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/cancel-all' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/cancelAll' else: suffix = '/v2/private/stop-order/cancelAll' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_conditional_order(self, **kwargs): """ Replace conditional order can modify/amend your conditional orders. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-replacecond. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/replace' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/replace' else: suffix = '/v2/private/stop-order/replace' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_conditional_order_bulk(self, orders: list, max_in_parallel=10): """ Replaces multiple conditional orders in bulk using multithreading. For more information on replace_active_order, see https://bybit-exchange.github.io/docs/inverse/#t-replacecond. :param list orders: A list of orders and their parameters. :param max_in_parallel: The number of requests to be sent in parallel. Note that you are limited to 50 requests per second. :returns: Future request result dictionaries as a list. """ with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.replace_conditional_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def query_conditional_order(self, **kwargs): """ Query real-time conditional order information. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-querycond. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/search' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order' else: suffix = '/v2/private/stop-order' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def my_position(self, **kwargs): """ Get my position list. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-myposition. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/list' else: suffix = '/v2/private/position/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def set_auto_add_margin(self, **kwargs): """ For linear markets only. Set auto add margin, or Auto-Margin Replenishment. :param kwargs: See https://bybit-exchange.github.io/docs/linear/#t-setautoaddmargin. :returns: Request results as dictionary. """ return self._submit_request( method='POST', path=self.endpoint + '/private/linear/position/set-auto-add-margin', query=kwargs, auth=True ) def set_leverage(self, **kwargs): """ Change user leverage. :param kwargs: See https://bybit-exchange.github.io/docs/linear/#t-setleverage. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/set-leverage' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/leverage/save' else: suffix = '/v2/private/position/leverage/save' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def cross_isolated_margin_switch(self, **kwargs): """ For linear markets only. Switch Cross/Isolated; must be leverage value when switching from Cross to Isolated. :param kwargs: See https://bybit-exchange.github.io/docs/linear/#t-marginswitch. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/switch-isolated' else: suffix = '/futures/private/position/switch-mode' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def position_mode_switch(self, **kwargs): """ For futures markets only. Switch Cross/Isolated; must set leverage value when switching from Cross to Isolated. :param kwargs: See https://bybit-exchange.github.io/docs/inverse_futures/#t-marginswitch. :returns: Request results as dictionary. """ return self._submit_request( method='POST', path=self.endpoint + '/futures/private/position/switch-mode', query=kwargs, auth=True ) def change_margin(self, **kwargs): """ Update margin. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-changemargin. :returns: Request results as dictionary. """ if kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/change-position-margin' else: suffix = '/v2/private/position/change-position-margin' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def set_trading_stop(self, **kwargs): """ Set take profit, stop loss, and trailing stop for your open position. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-tradingstop. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/trading-stop' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/trading-stop' else: suffix = '/v2/private/position/trading-stop' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def add_reduce_margin(self, **kwargs): """ For linear markets only. Add margin. :param kwargs: See https://bybit-exchange.github.io/docs/linear/#t-addmargin. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/private/linear/position/add-margin', query=kwargs, auth=True ) def user_leverage(self, **kwargs): """ ABANDONED! Please use my_position instead. Fetches user leverage by fetching user position. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-getleverage. :returns: Request results as dictionary. """ self.logger.warning('This endpoint is deprecated and will be removed. Use my_position()') return self._submit_request( method='GET', path=self.endpoint + '/v2/private/position/list', query=kwargs, auth=True ) def change_user_leverage(self, **kwargs): """ Change user leverage. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-changeleverage. :returns: Request results as dictionary. """ self.logger.warning('This endpoint is deprecated and will be removed. Use set_leverage()') return self._submit_request( method='POST', path=self.endpoint + '/user/leverage/save', query=kwargs, auth=True ) def user_trade_records(self, **kwargs): """ Get user's trading records. The results are ordered in ascending order (the first item is the oldest). :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-usertraderecords. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/trade/execution/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/execution/list' else: suffix = '/v2/private/execution/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def closed_profit_and_loss(self, **kwargs): """ Get user's closed profit and loss records. The results are ordered in descending order (the first item is the latest). :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-closedprofitandloss. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/trade/closed-pnl/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/trade/closed-pnl/list' else: suffix = '/v2/private/trade/closed-pnl/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def get_risk_limit(self, is_linear=False): """ Get risk limit. :param is_linear: True for linear, False for inverse. Defaults to False. :returns: Request results as dictionary. """ if is_linear: suffix = '/public/linear/risk-limit' else: suffix = '/open-api/wallet/risk-limit/list' return self._submit_request( method='GET', path=self.endpoint + suffix, auth=True ) def set_risk_limit(self, **kwargs): """ Set risk limit. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-setrisklimit. :returns: Request results as dictionary. """ return self._submit_request( method='POST', path=self.endpoint + '/open-api/wallet/risk-limit', query=kwargs, auth=True ) def get_the_last_funding_rate(self, **kwargs): """ The funding rate is generated every 8 hours at 00:00 UTC, 08:00 UTC and 16:00 UTC. For example, if a request is sent at 12:00 UTC, the funding rate generated earlier that day at 08:00 UTC will be sent. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-fundingrate. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/funding/prev-funding-rate' else: suffix = '/v2/private/funding/prev-funding-rate' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def my_last_funding_fee(self, **kwargs): """ Funding settlement occurs every 8 hours at 00:00 UTC, 08:00 UTC and 16:00 UTC. The current interval's fund fee settlement is based on the previous interval's fund rate. For example, at 16:00, the settlement is based on the fund rate generated at 8:00. The fund rate generated at 16:00 will be used at 0:00 the next day. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-mylastfundingfee. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/funding/prev-funding' else: suffix = '/v2/private/funding/prev-funding' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def predicted_funding_rate(self, **kwargs): """ Get predicted funding rate and my funding fee. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-predictedfunding. :returns: Request results as dictionary. """ if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/funding/predicted-funding' else: suffix = '/v2/private/funding/predicted-funding' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def api_key_info(self): """ Get user's API key info. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/private/account/api-key', auth=True ) def lcp_info(self, **kwargs): """ Get user's LCP (data refreshes once an hour). Only supports inverse perpetual at present. See https://bybit-exchange.github.io/docs/inverse/#t-liquidity to learn more. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-lcp. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/private/account/lcp', query=kwargs, auth=True ) def get_wallet_balance(self, **kwargs): """ Get wallet balance info. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-balance. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/private/wallet/balance', query=kwargs, auth=True ) def wallet_fund_records(self, **kwargs): """ Get wallet fund records. This endpoint also shows exchanges from the Asset Exchange, where the types for the exchange are ExchangeOrderWithdraw and ExchangeOrderDeposit. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-walletrecords. :returns: Request results as dictionary. """ # Replace query param 'from_id' since 'from' keyword is reserved. # Temporary workaround until Bybit updates official request params if 'from_id' in kwargs: kwargs['from'] = kwargs.pop('from_id') return self._submit_request( method='GET', path=self.endpoint + '/v2/private/wallet/fund/records', query=kwargs, auth=True ) def withdraw_records(self, **kwargs): """ Get withdrawal records. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-withdrawrecords. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/private/wallet/withdraw/list', query=kwargs, auth=True ) def asset_exchange_records(self, **kwargs): """ Get asset exchange records. :param kwargs: See https://bybit-exchange.github.io/docs/inverse/#t-assetexchangerecords. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/private/exchange-order/list', query=kwargs, auth=True ) def server_time(self): """ Get Bybit server time. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/time' ) def announcement(self): """ Get Bybit OpenAPI announcements in the last 30 days by reverse order. :returns: Request results as dictionary. """ return self._submit_request( method='GET', path=self.endpoint + '/v2/public/announcement' ) ''' Additional Methods These methods use two or more requests to perform a specific function and are exclusive to pybit. ''' def close_position(self, symbol): """ Closes your open position. Makes two requests (position, order). Parameters ------------------------ symbol : str Required parameter. The symbol of the market as a string, e.g. 'BTCUSD'. """ # First we fetch the user's position. try: r = self.my_position(symbol=symbol)['result'] # If there is no returned position, we want to handle that. except KeyError: return self.logger.error('No position detected.') # Next we generate a list of market orders orders = [ { 'symbol': symbol, 'order_type': 'Market', 'side': 'Buy' if p['side'] == 'Sell' else 'Sell', 'qty': p['size'], 'time_in_force': 'ImmediateOrCancel', 'reduce_only': True, 'close_on_trigger': True } for p in (r if isinstance(r, list) else [r]) if p['size'] > 0 ] if len(orders) == 0: return self.logger.error('No position detected.') # Submit a market order against each open position for the same qty. return self.place_active_order_bulk(orders) ''' Internal methods; signature and request submission. For more information about the request signature, see https://bybit-exchange.github.io/docs/inverse/#t-authentication. ''' def _auth(self, method, params, recv_window): """ Generates authentication signature per Bybit API specifications. Notes ------------------- Since the POST method requires a JSONified dict, we need to ensure the signature uses lowercase booleans instead of Python's capitalized booleans. This is done in the bug fix below. """ api_key = self.api_key api_secret = self.api_secret if api_key is None or api_secret is None: raise PermissionError('Authenticated endpoints require keys.') # Append required parameters. params['api_key'] = api_key params['recv_window'] = recv_window params['timestamp'] = int(time.time() * 10 ** 3) # Sort dictionary alphabetically to create querystring. _val = '&'.join( [str(k) + '=' + str(v) for k, v in sorted(params.items()) if (k != 'sign') and (v is not None)] ) # Bug fix. Replaces all capitalized booleans with lowercase. if method == 'POST': _val = _val.replace('True', 'true').replace('False', 'false') # Return signature. return str(hmac.new( bytes(api_secret, 'utf-8'), bytes(_val, 'utf-8'), digestmod='sha256' ).hexdigest()) def _submit_request(self, method=None, path=None, query=None, auth=False): """ Submits the request to the API. Notes ------------------- We use the params argument for the GET method, and data argument for the POST method. Dicts passed to the data argument must be JSONified prior to submitting request. """ # Store original recv_window. recv_window = self.recv_window # Bug fix: change floating whole numbers to integers to prevent # auth signature errors. if query is not None: for i in query.keys(): if isinstance(query[i], float) and query[i] == int(query[i]): query[i] = int(query[i]) # Send request and return headers with body. Retry if failed. retries_attempted = self.max_retries req_params = None while True: retries_attempted -= 1 if retries_attempted < 0: raise FailedRequestError( request=f'{method} {path}: {req_params}', message='Bad Request. Retries exceeded maximum.', status_code=400, time=dt.utcnow().strftime("%H:%M:%S") ) retries_remaining = f'{retries_attempted} retries remain.' # Authenticate if we are using a private endpoint. if auth: # Prepare signature. signature = self._auth( method=method, params=query, recv_window=recv_window, ) # Sort the dictionary alphabetically. query = dict(sorted(query.items(), key=lambda x: x)) # Append the signature to the dictionary. query['sign'] = signature # Define parameters and log the request. if query is not None: req_params = {k: v for k, v in query.items() if v is not None} else: req_params = {} # Log the request. if self.log_requests: self.logger.debug(f'Request -> {method} {path}: {req_params}') # Prepare request; use 'params' for GET and 'data' for POST. if method == 'GET': r = self.client.prepare_request( requests.Request(method, path, params=req_params) ) else: r = self.client.prepare_request( requests.Request(method, path, data=json.dumps(req_params)) ) # Attempt the request. try: s = self.client.send(r, timeout=self.timeout) # If requests fires an error, retry. except ( requests.exceptions.ReadTimeout, requests.exceptions.SSLError, requests.exceptions.ConnectionError ) as e: if self.force_retry: self.logger.error(f'{e}. {retries_remaining}') time.sleep(self.retry_delay) continue else: raise e # Convert response to dictionary, or raise if requests error. try: s_json = s.json() # If we have trouble converting, handle the error and retry. except JSONDecodeError as e: if self.force_retry: self.logger.error(f'{e}. {retries_remaining}') time.sleep(self.retry_delay) continue else: raise FailedRequestError( request=f'{method} {path}: {req_params}', message='Conflict. Could not decode JSON.', status_code=409, time=dt.utcnow().strftime("%H:%M:%S") ) # If Bybit returns an error, raise. if s_json['ret_code']: # Generate error message. error_msg = ( f'{s_json["ret_msg"]} (ErrCode: {s_json["ret_code"]})' ) # Set default retry delay. err_delay = self.retry_delay # Retry non-fatal whitelisted error requests. if s_json['ret_code'] in self.retry_codes: # 10002, recv_window error; add 2.5 seconds and retry. if s_json['ret_code'] == 10002: error_msg += '. Added 2.5 seconds to recv_window' recv_window += 2500 # 10006, ratelimit error; wait until rate_limit_reset_ms # and retry. elif s_json['ret_code'] == 10006: self.logger.error( f'{error_msg}. Ratelimited on current request. ' f'Sleeping, then trying again. Request: {path}' ) # Calculate how long we need to wait. limit_reset = s_json['rate_limit_reset_ms'] / 1000 reset_str = time.strftime( '%X', time.localtime(limit_reset) ) err_delay = int(limit_reset) - int(time.time()) error_msg = ( f'Ratelimit will reset at {reset_str}. ' f'Sleeping for {err_delay} seconds' ) # Log the error. self.logger.error(f'{error_msg}. {retries_remaining}') time.sleep(err_delay) continue elif s_json['ret_code'] in self.ignore_codes: pass else: raise InvalidRequestError( request=f'{method} {path}: {req_params}', message=s_json["ret_msg"], status_code=s_json["ret_code"], time=dt.utcnow().strftime("%H:%M:%S") ) else: return s_json class WebSocket: """ Connector for Bybit's WebSocket API. """ def __init__(self, endpoint, api_key=None, api_secret=None, subscriptions=None, logging_level=logging.INFO, max_data_length=200, ping_interval=30, ping_timeout=10, restart_on_error=True, purge_on_fetch=True, trim_data=True): """ Initializes the websocket session. :param endpoint: Required parameter. The endpoint of the remote websocket. :param api_key: Your API key. Required for authenticated endpoints. Defaults to None. :param api_secret: Your API secret key. Required for authenticated endpoints. Defaults to None. :param subscriptions: A list of desired topics to subscribe to. See API documentation for more information. Defaults to an empty list, which will raise an error. :param logging_level: The logging level of the built-in logger. Defaults to logging.INFO. Options are CRITICAL (50), ERROR (40), WARNING (30), INFO (20), DEBUG (10), or NOTSET (0). :param max_data_length: The maximum number of rows for the stored dataset. A smaller number will prevent performance or memory issues. :param ping_interval: The number of seconds between each automated ping. :param ping_timeout: The number of seconds to wait for 'pong' before an Exception is raised. :param restart_on_error: Whether or not the connection should restart on error. :param purge_on_fetch: Whether or not stored data should be purged each fetch. For example, if the user subscribes to the 'trade' topic, and fetches, should the data show all trade history up to the maximum length or only get the data since the last fetch? :param trim_data: Decide whether the returning data should be trimmed to only provide the data value. :returns: WebSocket session. """ if not subscriptions: raise Exception('Subscription list cannot be empty!') # Require symbol on 'trade' topic. if 'trade' in subscriptions: raise Exception('\'trade\' requires a ticker, e.g. ' '\'trade.BTCUSD\'.') # Require currency on 'insurance' topic. if 'insurance' in subscriptions: raise Exception('\'insurance\' requires a currency, e.g. ' '\'insurance.BTC\'.') # Require timeframe and ticker on 'klineV2' topic. if 'klineV2' in subscriptions: raise Exception('\'klineV2\' requires a timeframe and ticker, e.g.' ' \'klineV2.5.BTCUSD\'.') # set websocket name for logging purposes self.wsName = 'Authenticated' if api_key else 'Non-Authenticated' # Setup logger. self.logger = logging.getLogger(__name__) if len(logging.root.handlers) == 0: # no handler on root logger set -> we add handler just for this logger to not mess with custom logic from outside handler = logging.StreamHandler() handler.setFormatter(logging.Formatter(fmt='%(asctime)s - %(name)s - %(levelname)s - %(message)s', datefmt='%Y-%m-%d %H:%M:%S' ) ) handler.setLevel(logging_level) self.logger.addHandler(handler) self.logger.debug(f'Initializing {self.wsName} WebSocket.') # Ensure authentication for private topics. if any(i in subscriptions for i in [ 'position', 'execution', 'order', 'stop_order', 'wallet' ]) and api_key is None: raise PermissionError('You must be authorized to use ' 'private topics!') # Set endpoint. self.endpoint = endpoint # Set API keys. self.api_key = api_key self.api_secret = api_secret # Set topic subscriptions for WebSocket. self.subscriptions = subscriptions self.max_length = max_data_length # Set ping settings. self.ping_interval = ping_interval self.ping_timeout = ping_timeout # Other optional data handling settings. self.handle_error = restart_on_error self.purge = purge_on_fetch self.trim = trim_data # Set initial state, initialize dictionary and connnect. self._reset() self._connect(self.endpoint) def fetch(self, topic): """ Fetches data from the subscribed topic. :param topic: Required parameter. The subscribed topic to poll. :returns: Filtered data as dict. """ # If topic isn't a string. if not isinstance(topic, str): self.logger.error('Topic argument must be a string.') return # If the topic given isn't in the initial subscribed list. if topic not in self.subscriptions: self.logger.error(f'You aren\'t subscribed to the {topic} topic.') return # Pop all trade or execution data on each poll. # dont pop order or stop_order data as we will lose valuable state if topic.startswith(( 'trade', 'execution' )) and not topic.startswith('orderBook'): data = self.data[topic].copy() if self.purge: self.data[topic] = [] return data else: try: return self.data[topic] except KeyError: return [] def ping(self): """ Pings the remote server to test the connection. The status of the connection can be monitored using ws.ping(). """ self.ws.send(json.dumps({'op': 'ping'})) def exit(self): """ Closes the websocket connection. """ self.ws.close() while self.ws.sock: continue self.exited = True def _auth(self): """ Authorize websocket connection. """ # Generate expires. expires = int((time.time() + 1) * 1000) # Generate signature. _val = f'GET/realtime{expires}' signature = str(hmac.new( bytes(self.api_secret, 'utf-8'), bytes(_val, 'utf-8'), digestmod='sha256' ).hexdigest()) # Authenticate with API. self.ws.send( json.dumps({ 'op': 'auth', 'args': [self.api_key, expires, signature] }) ) def _connect(self, url): """ Open websocket in a thread. """ self.ws = websocket.WebSocketApp( url=url, on_message=lambda ws, msg: self._on_message(msg), on_close=self._on_close(), on_open=self._on_open(), on_error=lambda ws, err: self._on_error(err) ) # Setup the thread running WebSocketApp. self.wst = threading.Thread(target=lambda: self.ws.run_forever( ping_interval=self.ping_interval, ping_timeout=self.ping_timeout )) # Configure as daemon; start. self.wst.daemon = True self.wst.start() # Attempt to connect for X seconds. retries = 10 while retries > 0 and (not self.ws.sock or not self.ws.sock.connected): retries -= 1 time.sleep(1) # If connection was not successful, raise error. if retries <= 0: self.exit() raise websocket.WebSocketTimeoutException('Connection failed.') # If given an api_key, authenticate. if self.api_key and self.api_secret: self._auth() # Check if subscriptions is a list. if isinstance(self.subscriptions, str): self.subscriptions = [self.subscriptions] # Subscribe to the requested topics. self.ws.send( json.dumps({ 'op': 'subscribe', 'args': self.subscriptions }) ) # Initialize the topics. for topic in self.subscriptions: if topic not in self.data: self.data[topic] = {} @staticmethod def _find_index(source, target, key): """ Find the index in source list of the targeted ID. """ return next(i for i, j in enumerate(source) if j[key] == target[key]) def _on_message(self, message): """ Parse incoming messages. Similar structure to the official WS connector. """ # Load dict of message. msg_json = json.loads(message) # If 'success' exists if 'success' in msg_json: if msg_json['success']: # If 'request' exists. if 'request' in msg_json: # If we get succesful auth, notify user. if msg_json['request']['op'] == 'auth': self.logger.debug('Authorization successful.') self.auth = True # If we get successful subscription, notify user. if msg_json['request']['op'] == 'subscribe': sub = msg_json['request']['args'] self.logger.debug(f'Subscription to {sub} successful.') else: response = msg_json['ret_msg'] if 'unknown topic' in response: self.logger.error('Couldn\'t subscribe to topic.' f' Error: {response}.') # If we get unsuccesful auth, notify user. elif msg_json['request']['op'] == 'auth': self.logger.debug('Authorization failed. Please check your ' 'API keys and restart.') elif 'topic' in msg_json: topic = msg_json['topic'] # If incoming 'orderbookL2' data. if 'orderBook' in topic: # Make updates according to delta response. if 'delta' in msg_json['type']: # Delete. for entry in msg_json['data']['delete']: index = self._find_index(self.data[topic], entry, 'id') self.data[topic].pop(index) # Update. for entry in msg_json['data']['update']: index = self._find_index(self.data[topic], entry, 'id') self.data[topic][index] = entry # Insert. for entry in msg_json['data']['insert']: self.data[topic].append(entry) # Record the initial snapshot. elif 'snapshot' in msg_json['type']: self.data[topic] = msg_json['data'] # For incoming 'order' and 'stop_order' data. elif any(i in topic for i in ['order', 'stop_order']): # record incoming data for i in msg_json['data']: try: # update existing entries # temporary workaround for field anomaly in stop_order data ord_id = topic + '_id' if i['symbol'].endswith('USDT') else 'order_id' index = self._find_index(self.data[topic], i, ord_id) self.data[topic][index] = i except StopIteration: # Keep appending or create new list if not already created. try: self.data[topic].append(i) except AttributeError: self.data[topic] = msg_json['data'] # For incoming 'trade' and 'execution' data. elif any(i in topic for i in ['trade', 'execution']): # Keep appending or create new list if not already created. try: for i in msg_json['data']: self.data[topic].append(i) except AttributeError: self.data[topic] = msg_json['data'] # If list is too long, pop the first entry. if len(self.data[topic]) > self.max_length: self.data[topic].pop(0) # If incoming 'insurance', 'klineV2', or 'wallet' data. elif any(i in topic for i in ['insurance', 'klineV2', 'wallet', 'candle']): # Record incoming data. self.data[topic] = msg_json['data'][0] if self.trim else msg_json # If incoming 'instrument_info' data. elif 'instrument_info' in topic: # Make updates according to delta response. if 'delta' in msg_json['type']: for i in msg_json['data']['update'][0]: self.data[topic][i] = msg_json['data']['update'][0][i] # Record the initial snapshot. elif 'snapshot' in msg_json['type']: self.data[topic] = msg_json['data'] if self.trim else msg_json # If incoming 'position' data. elif 'position' in topic: # Record incoming position data. for p in msg_json['data']: # linear (USDT) positions have Buy|Sell side and # updates contain all USDT positions. # For linear tickers... if p['symbol'].endswith('USDT'): try: self.data[topic][p['symbol']][p['side']] = p # if side key hasn't been created yet... except KeyError: self.data[topic][p['symbol']] = {p['side']: p} # For non-linear tickers... else: self.data[topic][p['symbol']] = p def _on_error(self, error): """ Exit on errors and raise exception, or attempt reconnect. """ if not self.exited: self.logger.error(f'WebSocket {self.wsName} encountered error: {error}.') self.exit() # Reconnect. if self.handle_error: self._reset() self._connect(self.endpoint) def _on_open(self): """ Log WS open. """ self.logger.debug(f'WebSocket {self.wsName} opened.') def _on_close(self): """ Log WS close. """ self.logger.debug(f'WebSocket {self.wsName} closed.') def _reset(self): """ Set state booleans and initialize dictionary. """ self.exited = False self.auth = False self.data = {}
33.691429
125
0.556926
import time import hmac import json import logging import threading import requests import websocket from datetime import datetime as dt from concurrent.futures import ThreadPoolExecutor from .exceptions import FailedRequestError, InvalidRequestError try: from simplejson.errors import JSONDecodeError except ImportError: from json.decoder import JSONDecodeError VERSION = '1.1.18' class HTTP: def __init__(self, endpoint=None, api_key=None, api_secret=None, logging_level=logging.INFO, log_requests=False, request_timeout=10, recv_window=5000, force_retry=False, retry_codes=None, ignore_codes=None, max_retries=3, retry_delay=3, referral_id=None): if endpoint is None: self.endpoint = 'https://api.bybit.com' else: self.endpoint = endpoint self.logger = logging.getLogger(__name__) if len(logging.root.handlers) == 0: handler = logging.StreamHandler() handler.setFormatter(logging.Formatter(fmt='%(asctime)s - %(name)s - %(levelname)s - %(message)s', datefmt='%Y-%m-%d %H:%M:%S' ) ) handler.setLevel(logging_level) self.logger.addHandler(handler) self.logger.debug('Initializing HTTP session.') self.log_requests = log_requests self.api_key = api_key self.api_secret = api_secret self.timeout = request_timeout self.recv_window = recv_window self.force_retry = force_retry self.max_retries = max_retries self.retry_delay = retry_delay if retry_codes is None: self.retry_codes = {10002, 10006, 30034, 30035, 130035, 130150} else: self.retry_codes = retry_codes if ignore_codes is None: self.ignore_codes = set() else: self.ignore_codes = ignore_codes self.client = requests.Session() self.client.headers.update( { 'User-Agent': 'pybit-' + VERSION, 'Content-Type': 'application/json', 'Accept': 'application/json', } ) if referral_id: self.client.headers.update({'Referer': referral_id}) def _exit(self): self.client.close() self.logger.debug('HTTP session closed.') def orderbook(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/orderBook/L2', query=kwargs ) def query_kline(self, **kwargs): if 'from_time' in kwargs: kwargs['from'] = kwargs.pop('from_time') if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/kline' else: suffix = '/v2/public/kline/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def latest_information_for_symbol(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/tickers', query=kwargs ) def public_trading_records(self, **kwargs): if 'from_id' in kwargs: kwargs['from'] = kwargs.pop('from_id') if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/recent-trading-records' else: suffix = '/v2/public/trading-records' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def query_symbol(self): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/symbols' ) def liquidated_orders(self, **kwargs): if 'from_id' in kwargs: kwargs['from'] = kwargs.pop('from_id') return self._submit_request( method='GET', path=self.endpoint + '/v2/public/liq-records', query=kwargs ) def query_mark_price_kline(self, **kwargs): if 'from_time' in kwargs: kwargs['from'] = kwargs.pop('from_time') if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/mark-price-kline' else: suffix = '/v2/public/mark-price-kline' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def open_interest(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/open-interest', query=kwargs ) def latest_big_deal(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/big-deal', query=kwargs ) def long_short_ratio(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/account-ratio', query=kwargs ) def place_active_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/create' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/create' else: suffix = '/v2/private/order/create' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def place_active_order_bulk(self, orders: list, max_in_parallel=10): with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.place_active_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def get_active_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/v2/private/order/list' else: suffix = '/futures/private/order/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_active_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/cancel' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/cancel' else: suffix = '/v2/private/order/cancel' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_active_order_bulk(self, orders: list, max_in_parallel=10): with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.cancel_active_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def cancel_all_active_orders(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/cancel-all' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/cancelAll' else: suffix = '/v2/private/order/cancelAll' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_active_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/replace' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order/replace' else: suffix = '/v2/private/order/replace' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_active_order_bulk(self, orders: list, max_in_parallel=10): with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.replace_active_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def query_active_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/order/search' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/order' else: suffix = '/v2/private/order' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def place_conditional_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/create' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/create' else: suffix = '/v2/private/stop-order/create' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def place_conditional_order_bulk(self, orders: list, max_in_parallel=10): with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.place_conditional_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def get_conditional_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/list' else: suffix = '/v2/private/stop-order/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_conditional_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/cancel' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/cancel' else: suffix = '/v2/private/stop-order/cancel' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def cancel_conditional_order_bulk(self, orders: list, max_in_parallel=10): with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.cancel_conditional_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def cancel_all_conditional_orders(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/cancel-all' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/cancelAll' else: suffix = '/v2/private/stop-order/cancelAll' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_conditional_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/replace' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order/replace' else: suffix = '/v2/private/stop-order/replace' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def replace_conditional_order_bulk(self, orders: list, max_in_parallel=10): with ThreadPoolExecutor(max_workers=max_in_parallel) as executor: executions = [ executor.submit( self.replace_conditional_order, **order ) for order in orders ] executor.shutdown() return [execution.result() for execution in executions] def query_conditional_order(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/stop-order/search' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/stop-order' else: suffix = '/v2/private/stop-order' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def my_position(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/list' else: suffix = '/v2/private/position/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def set_auto_add_margin(self, **kwargs): return self._submit_request( method='POST', path=self.endpoint + '/private/linear/position/set-auto-add-margin', query=kwargs, auth=True ) def set_leverage(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/set-leverage' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/leverage/save' else: suffix = '/v2/private/position/leverage/save' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def cross_isolated_margin_switch(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/switch-isolated' else: suffix = '/futures/private/position/switch-mode' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def position_mode_switch(self, **kwargs): return self._submit_request( method='POST', path=self.endpoint + '/futures/private/position/switch-mode', query=kwargs, auth=True ) def change_margin(self, **kwargs): if kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/change-position-margin' else: suffix = '/v2/private/position/change-position-margin' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def set_trading_stop(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/position/trading-stop' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/position/trading-stop' else: suffix = '/v2/private/position/trading-stop' return self._submit_request( method='POST', path=self.endpoint + suffix, query=kwargs, auth=True ) def add_reduce_margin(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/private/linear/position/add-margin', query=kwargs, auth=True ) def user_leverage(self, **kwargs): self.logger.warning('This endpoint is deprecated and will be removed. Use my_position()') return self._submit_request( method='GET', path=self.endpoint + '/v2/private/position/list', query=kwargs, auth=True ) def change_user_leverage(self, **kwargs): self.logger.warning('This endpoint is deprecated and will be removed. Use set_leverage()') return self._submit_request( method='POST', path=self.endpoint + '/user/leverage/save', query=kwargs, auth=True ) def user_trade_records(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/trade/execution/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/execution/list' else: suffix = '/v2/private/execution/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def closed_profit_and_loss(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/trade/closed-pnl/list' elif kwargs.get('symbol', '')[-2:].isdigit(): suffix = '/futures/private/trade/closed-pnl/list' else: suffix = '/v2/private/trade/closed-pnl/list' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def get_risk_limit(self, is_linear=False): if is_linear: suffix = '/public/linear/risk-limit' else: suffix = '/open-api/wallet/risk-limit/list' return self._submit_request( method='GET', path=self.endpoint + suffix, auth=True ) def set_risk_limit(self, **kwargs): return self._submit_request( method='POST', path=self.endpoint + '/open-api/wallet/risk-limit', query=kwargs, auth=True ) def get_the_last_funding_rate(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/public/linear/funding/prev-funding-rate' else: suffix = '/v2/private/funding/prev-funding-rate' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs ) def my_last_funding_fee(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/funding/prev-funding' else: suffix = '/v2/private/funding/prev-funding' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def predicted_funding_rate(self, **kwargs): if kwargs.get('symbol', '').endswith('USDT'): suffix = '/private/linear/funding/predicted-funding' else: suffix = '/v2/private/funding/predicted-funding' return self._submit_request( method='GET', path=self.endpoint + suffix, query=kwargs, auth=True ) def api_key_info(self): return self._submit_request( method='GET', path=self.endpoint + '/v2/private/account/api-key', auth=True ) def lcp_info(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/private/account/lcp', query=kwargs, auth=True ) def get_wallet_balance(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/private/wallet/balance', query=kwargs, auth=True ) def wallet_fund_records(self, **kwargs): if 'from_id' in kwargs: kwargs['from'] = kwargs.pop('from_id') return self._submit_request( method='GET', path=self.endpoint + '/v2/private/wallet/fund/records', query=kwargs, auth=True ) def withdraw_records(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/private/wallet/withdraw/list', query=kwargs, auth=True ) def asset_exchange_records(self, **kwargs): return self._submit_request( method='GET', path=self.endpoint + '/v2/private/exchange-order/list', query=kwargs, auth=True ) def server_time(self): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/time' ) def announcement(self): return self._submit_request( method='GET', path=self.endpoint + '/v2/public/announcement' ) def close_position(self, symbol): try: r = self.my_position(symbol=symbol)['result'] # If there is no returned position, we want to handle that. except KeyError: return self.logger.error('No position detected.') # Next we generate a list of market orders orders = [ { 'symbol': symbol, 'order_type': 'Market', 'side': 'Buy' if p['side'] == 'Sell' else 'Sell', 'qty': p['size'], 'time_in_force': 'ImmediateOrCancel', 'reduce_only': True, 'close_on_trigger': True } for p in (r if isinstance(r, list) else [r]) if p['size'] > 0 ] if len(orders) == 0: return self.logger.error('No position detected.') # Submit a market order against each open position for the same qty. return self.place_active_order_bulk(orders) def _auth(self, method, params, recv_window): api_key = self.api_key api_secret = self.api_secret if api_key is None or api_secret is None: raise PermissionError('Authenticated endpoints require keys.') # Append required parameters. params['api_key'] = api_key params['recv_window'] = recv_window params['timestamp'] = int(time.time() * 10 ** 3) # Sort dictionary alphabetically to create querystring. _val = '&'.join( [str(k) + '=' + str(v) for k, v in sorted(params.items()) if (k != 'sign') and (v is not None)] ) # Bug fix. Replaces all capitalized booleans with lowercase. if method == 'POST': _val = _val.replace('True', 'true').replace('False', 'false') # Return signature. return str(hmac.new( bytes(api_secret, 'utf-8'), bytes(_val, 'utf-8'), digestmod='sha256' ).hexdigest()) def _submit_request(self, method=None, path=None, query=None, auth=False): # Store original recv_window. recv_window = self.recv_window # Bug fix: change floating whole numbers to integers to prevent # auth signature errors. if query is not None: for i in query.keys(): if isinstance(query[i], float) and query[i] == int(query[i]): query[i] = int(query[i]) # Send request and return headers with body. Retry if failed. retries_attempted = self.max_retries req_params = None while True: retries_attempted -= 1 if retries_attempted < 0: raise FailedRequestError( request=f'{method} {path}: {req_params}', message='Bad Request. Retries exceeded maximum.', status_code=400, time=dt.utcnow().strftime("%H:%M:%S") ) retries_remaining = f'{retries_attempted} retries remain.' # Authenticate if we are using a private endpoint. if auth: # Prepare signature. signature = self._auth( method=method, params=query, recv_window=recv_window, ) # Sort the dictionary alphabetically. query = dict(sorted(query.items(), key=lambda x: x)) # Append the signature to the dictionary. query['sign'] = signature # Define parameters and log the request. if query is not None: req_params = {k: v for k, v in query.items() if v is not None} else: req_params = {} # Log the request. if self.log_requests: self.logger.debug(f'Request -> {method} {path}: {req_params}') # Prepare request; use 'params' for GET and 'data' for POST. if method == 'GET': r = self.client.prepare_request( requests.Request(method, path, params=req_params) ) else: r = self.client.prepare_request( requests.Request(method, path, data=json.dumps(req_params)) ) # Attempt the request. try: s = self.client.send(r, timeout=self.timeout) # If requests fires an error, retry. except ( requests.exceptions.ReadTimeout, requests.exceptions.SSLError, requests.exceptions.ConnectionError ) as e: if self.force_retry: self.logger.error(f'{e}. {retries_remaining}') time.sleep(self.retry_delay) continue else: raise e # Convert response to dictionary, or raise if requests error. try: s_json = s.json() # If we have trouble converting, handle the error and retry. except JSONDecodeError as e: if self.force_retry: self.logger.error(f'{e}. {retries_remaining}') time.sleep(self.retry_delay) continue else: raise FailedRequestError( request=f'{method} {path}: {req_params}', message='Conflict. Could not decode JSON.', status_code=409, time=dt.utcnow().strftime("%H:%M:%S") ) # If Bybit returns an error, raise. if s_json['ret_code']: # Generate error message. error_msg = ( f'{s_json["ret_msg"]} (ErrCode: {s_json["ret_code"]})' ) # Set default retry delay. err_delay = self.retry_delay # Retry non-fatal whitelisted error requests. if s_json['ret_code'] in self.retry_codes: # 10002, recv_window error; add 2.5 seconds and retry. if s_json['ret_code'] == 10002: error_msg += '. Added 2.5 seconds to recv_window' recv_window += 2500 # 10006, ratelimit error; wait until rate_limit_reset_ms # and retry. elif s_json['ret_code'] == 10006: self.logger.error( f'{error_msg}. Ratelimited on current request. ' f'Sleeping, then trying again. Request: {path}' ) # Calculate how long we need to wait. limit_reset = s_json['rate_limit_reset_ms'] / 1000 reset_str = time.strftime( '%X', time.localtime(limit_reset) ) err_delay = int(limit_reset) - int(time.time()) error_msg = ( f'Ratelimit will reset at {reset_str}. ' f'Sleeping for {err_delay} seconds' ) # Log the error. self.logger.error(f'{error_msg}. {retries_remaining}') time.sleep(err_delay) continue elif s_json['ret_code'] in self.ignore_codes: pass else: raise InvalidRequestError( request=f'{method} {path}: {req_params}', message=s_json["ret_msg"], status_code=s_json["ret_code"], time=dt.utcnow().strftime("%H:%M:%S") ) else: return s_json class WebSocket: def __init__(self, endpoint, api_key=None, api_secret=None, subscriptions=None, logging_level=logging.INFO, max_data_length=200, ping_interval=30, ping_timeout=10, restart_on_error=True, purge_on_fetch=True, trim_data=True): if not subscriptions: raise Exception('Subscription list cannot be empty!') # Require symbol on 'trade' topic. if 'trade' in subscriptions: raise Exception('\'trade\' requires a ticker, e.g. ' '\'trade.BTCUSD\'.') # Require currency on 'insurance' topic. if 'insurance' in subscriptions: raise Exception('\'insurance\' requires a currency, e.g. ' '\'insurance.BTC\'.') # Require timeframe and ticker on 'klineV2' topic. if 'klineV2' in subscriptions: raise Exception('\'klineV2\' requires a timeframe and ticker, e.g.' ' \'klineV2.5.BTCUSD\'.') # set websocket name for logging purposes self.wsName = 'Authenticated' if api_key else 'Non-Authenticated' # Setup logger. self.logger = logging.getLogger(__name__) if len(logging.root.handlers) == 0: # no handler on root logger set -> we add handler just for this logger to not mess with custom logic from outside handler = logging.StreamHandler() handler.setFormatter(logging.Formatter(fmt='%(asctime)s - %(name)s - %(levelname)s - %(message)s', datefmt='%Y-%m-%d %H:%M:%S' ) ) handler.setLevel(logging_level) self.logger.addHandler(handler) self.logger.debug(f'Initializing {self.wsName} WebSocket.') # Ensure authentication for private topics. if any(i in subscriptions for i in [ 'position', 'execution', 'order', 'stop_order', 'wallet' ]) and api_key is None: raise PermissionError('You must be authorized to use ' 'private topics!') # Set endpoint. self.endpoint = endpoint # Set API keys. self.api_key = api_key self.api_secret = api_secret # Set topic subscriptions for WebSocket. self.subscriptions = subscriptions self.max_length = max_data_length # Set ping settings. self.ping_interval = ping_interval self.ping_timeout = ping_timeout # Other optional data handling settings. self.handle_error = restart_on_error self.purge = purge_on_fetch self.trim = trim_data # Set initial state, initialize dictionary and connnect. self._reset() self._connect(self.endpoint) def fetch(self, topic): # If topic isn't a string. if not isinstance(topic, str): self.logger.error('Topic argument must be a string.') return if topic not in self.subscriptions: self.logger.error(f'You aren\'t subscribed to the {topic} topic.') return if topic.startswith(( 'trade', 'execution' )) and not topic.startswith('orderBook'): data = self.data[topic].copy() if self.purge: self.data[topic] = [] return data else: try: return self.data[topic] except KeyError: return [] def ping(self): self.ws.send(json.dumps({'op': 'ping'})) def exit(self): self.ws.close() while self.ws.sock: continue self.exited = True def _auth(self): expires = int((time.time() + 1) * 1000) _val = f'GET/realtime{expires}' signature = str(hmac.new( bytes(self.api_secret, 'utf-8'), bytes(_val, 'utf-8'), digestmod='sha256' ).hexdigest()) self.ws.send( json.dumps({ 'op': 'auth', 'args': [self.api_key, expires, signature] }) ) def _connect(self, url): self.ws = websocket.WebSocketApp( url=url, on_message=lambda ws, msg: self._on_message(msg), on_close=self._on_close(), on_open=self._on_open(), on_error=lambda ws, err: self._on_error(err) ) self.wst = threading.Thread(target=lambda: self.ws.run_forever( ping_interval=self.ping_interval, ping_timeout=self.ping_timeout )) self.wst.daemon = True self.wst.start() retries = 10 while retries > 0 and (not self.ws.sock or not self.ws.sock.connected): retries -= 1 time.sleep(1) if retries <= 0: self.exit() raise websocket.WebSocketTimeoutException('Connection failed.') if self.api_key and self.api_secret: self._auth() if isinstance(self.subscriptions, str): self.subscriptions = [self.subscriptions] self.ws.send( json.dumps({ 'op': 'subscribe', 'args': self.subscriptions }) ) for topic in self.subscriptions: if topic not in self.data: self.data[topic] = {} @staticmethod def _find_index(source, target, key): return next(i for i, j in enumerate(source) if j[key] == target[key]) def _on_message(self, message): msg_json = json.loads(message) if 'success' in msg_json: if msg_json['success']: if 'request' in msg_json: if msg_json['request']['op'] == 'auth': self.logger.debug('Authorization successful.') self.auth = True if msg_json['request']['op'] == 'subscribe': sub = msg_json['request']['args'] self.logger.debug(f'Subscription to {sub} successful.') else: response = msg_json['ret_msg'] if 'unknown topic' in response: self.logger.error('Couldn\'t subscribe to topic.' f' Error: {response}.') # If we get unsuccesful auth, notify user. elif msg_json['request']['op'] == 'auth': self.logger.debug('Authorization failed. Please check your ' 'API keys and restart.') elif 'topic' in msg_json: topic = msg_json['topic'] # If incoming 'orderbookL2' data. if 'orderBook' in topic: # Make updates according to delta response. if 'delta' in msg_json['type']: # Delete. for entry in msg_json['data']['delete']: index = self._find_index(self.data[topic], entry, 'id') self.data[topic].pop(index) # Update. for entry in msg_json['data']['update']: index = self._find_index(self.data[topic], entry, 'id') self.data[topic][index] = entry # Insert. for entry in msg_json['data']['insert']: self.data[topic].append(entry) # Record the initial snapshot. elif 'snapshot' in msg_json['type']: self.data[topic] = msg_json['data'] # For incoming 'order' and 'stop_order' data. elif any(i in topic for i in ['order', 'stop_order']): # record incoming data for i in msg_json['data']: try: # update existing entries # temporary workaround for field anomaly in stop_order data ord_id = topic + '_id' if i['symbol'].endswith('USDT') else 'order_id' index = self._find_index(self.data[topic], i, ord_id) self.data[topic][index] = i except StopIteration: # Keep appending or create new list if not already created. try: self.data[topic].append(i) except AttributeError: self.data[topic] = msg_json['data'] # For incoming 'trade' and 'execution' data. elif any(i in topic for i in ['trade', 'execution']): # Keep appending or create new list if not already created. try: for i in msg_json['data']: self.data[topic].append(i) except AttributeError: self.data[topic] = msg_json['data'] # If list is too long, pop the first entry. if len(self.data[topic]) > self.max_length: self.data[topic].pop(0) # If incoming 'insurance', 'klineV2', or 'wallet' data. elif any(i in topic for i in ['insurance', 'klineV2', 'wallet', 'candle']): # Record incoming data. self.data[topic] = msg_json['data'][0] if self.trim else msg_json # If incoming 'instrument_info' data. elif 'instrument_info' in topic: # Make updates according to delta response. if 'delta' in msg_json['type']: for i in msg_json['data']['update'][0]: self.data[topic][i] = msg_json['data']['update'][0][i] # Record the initial snapshot. elif 'snapshot' in msg_json['type']: self.data[topic] = msg_json['data'] if self.trim else msg_json # If incoming 'position' data. elif 'position' in topic: # Record incoming position data. for p in msg_json['data']: # linear (USDT) positions have Buy|Sell side and # updates contain all USDT positions. # For linear tickers... if p['symbol'].endswith('USDT'): try: self.data[topic][p['symbol']][p['side']] = p # if side key hasn't been created yet... except KeyError: self.data[topic][p['symbol']] = {p['side']: p} else: self.data[topic][p['symbol']] = p def _on_error(self, error): if not self.exited: self.logger.error(f'WebSocket {self.wsName} encountered error: {error}.') self.exit() if self.handle_error: self._reset() self._connect(self.endpoint) def _on_open(self): self.logger.debug(f'WebSocket {self.wsName} opened.') def _on_close(self): self.logger.debug(f'WebSocket {self.wsName} closed.') def _reset(self): self.exited = False self.auth = False self.data = {}
true
true
f72482536502a08c92fdd47d1959c93914af950f
1,330
py
Python
Competition Codes/packageFunction.py
Harrdy2018/2018-Huawei-Code-Craft
62fa76c658746550b2e5c8ef059a5c748e93c06c
[ "Apache-2.0" ]
1
2019-04-08T04:15:51.000Z
2019-04-08T04:15:51.000Z
Competition Codes/packageFunction.py
Harrdy2018/2018-Huawei-Code-Craft
62fa76c658746550b2e5c8ef059a5c748e93c06c
[ "Apache-2.0" ]
null
null
null
Competition Codes/packageFunction.py
Harrdy2018/2018-Huawei-Code-Craft
62fa76c658746550b2e5c8ef059a5c748e93c06c
[ "Apache-2.0" ]
2
2018-04-16T10:11:24.000Z
2019-06-28T06:30:28.000Z
#coding=utf-8 def MultiplePackage(N,C,weight,value,num,physic): ''' 多重背包问题(每个物品都有次数限制) :param N: 预测的虚拟机种类,如N=pre_num :param C:输入文件是CPU,那么背包总容量就是MEM,如C= :param weight: 每个物品的容量数组表示,如weight=[0,5,4,7,2,6] :param value: 每个物品的价值数组表示,如value=[0,12,3,10,3,6] :param num:每个物品的个数限制,如num=[0,2,4,1,5,3] :return: 返回总价值矩阵 ''' #初始化f[N+1][C+1]为0,f[i][j]表示前i件物品恰好放入一个容器为j的背包可以获得的最大价值 f=[[0 for col in range(C+1)] for row in range(N+1)] for i in range(1,N+1): for j in range(1,C+1): #对于物品i最多能取的次数是j/weight[i]与num[i]的较小者 max_num_i=min(j/weight[i],num[i]) #初始取k=0为最大,下面的循环是把取了k个物品i能获得的最大价值赋值给f[i][j] f[i][j]=f[i-1][j] for k in range(max_num_i+1): if f[i][j]<f[i-1][j-k*weight[i]]+k*value[i]<=physic: #状态方程 f[i][j]=f[i-1][j-k*weight[i]]+k*value[i] return f def FindWhat(f,value,weight,i,j,item,num): if i>=0: if f[i][j]==f[i-1][j]: item[i]=0 FindWhat(f,value,weight,i-1,j,item,num) elif j-weight[i]>=0: for k in range(num[i]+1): if f[i][j]==f[i-1][j-k*weight[i]]+k*value[i]: item[i]=k break FindWhat(f,value,weight,i-1,j-item[i]*weight[i],item,num)
35
69
0.52406
def MultiplePackage(N,C,weight,value,num,physic): f=[[0 for col in range(C+1)] for row in range(N+1)] for i in range(1,N+1): for j in range(1,C+1): max_num_i=min(j/weight[i],num[i]) f[i][j]=f[i-1][j] for k in range(max_num_i+1): if f[i][j]<f[i-1][j-k*weight[i]]+k*value[i]<=physic: f[i][j]=f[i-1][j-k*weight[i]]+k*value[i] return f def FindWhat(f,value,weight,i,j,item,num): if i>=0: if f[i][j]==f[i-1][j]: item[i]=0 FindWhat(f,value,weight,i-1,j,item,num) elif j-weight[i]>=0: for k in range(num[i]+1): if f[i][j]==f[i-1][j-k*weight[i]]+k*value[i]: item[i]=k break FindWhat(f,value,weight,i-1,j-item[i]*weight[i],item,num)
true
true
f72482abf2030cf6d190809b6914b9bdbeec552b
3,074
py
Python
users/migrations/0001_initial.py
SohailAQ/Rest_Alpha
326009217f16164c7f4667e7b3dbb82e43cf2469
[ "MIT" ]
null
null
null
users/migrations/0001_initial.py
SohailAQ/Rest_Alpha
326009217f16164c7f4667e7b3dbb82e43cf2469
[ "MIT" ]
null
null
null
users/migrations/0001_initial.py
SohailAQ/Rest_Alpha
326009217f16164c7f4667e7b3dbb82e43cf2469
[ "MIT" ]
null
null
null
# Generated by Django 3.2.8 on 2021-10-21 16:43 import django.contrib.auth.models import django.contrib.auth.validators from django.db import migrations, models import django.utils.timezone class Migration(migrations.Migration): initial = True dependencies = [ ('auth', '0012_alter_user_first_name_max_length'), ] operations = [ migrations.CreateModel( name='CustomUser', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('password', models.CharField(max_length=128, verbose_name='password')), ('last_login', models.DateTimeField(blank=True, null=True, verbose_name='last login')), ('is_superuser', models.BooleanField(default=False, help_text='Designates that this user has all permissions without explicitly assigning them.', verbose_name='superuser status')), ('username', models.CharField(error_messages={'unique': 'A user with that username already exists.'}, help_text='Required. 150 characters or fewer. Letters, digits and @/./+/-/_ only.', max_length=150, unique=True, validators=[django.contrib.auth.validators.UnicodeUsernameValidator()], verbose_name='username')), ('first_name', models.CharField(blank=True, max_length=150, verbose_name='first name')), ('last_name', models.CharField(blank=True, max_length=150, verbose_name='last name')), ('email', models.EmailField(blank=True, max_length=254, verbose_name='email address')), ('is_staff', models.BooleanField(default=False, help_text='Designates whether the user can log into this admin site.', verbose_name='staff status')), ('is_active', models.BooleanField(default=True, help_text='Designates whether this user should be treated as active. Unselect this instead of deleting accounts.', verbose_name='active')), ('date_joined', models.DateTimeField(default=django.utils.timezone.now, verbose_name='date joined')), ('gender', models.CharField(choices=[('M', 'Male'), ('F', 'Female'), ('NS', 'Not Specified')], max_length=20)), ('phone_number', models.CharField(max_length=30)), ('groups', models.ManyToManyField(blank=True, help_text='The groups this user belongs to. A user will get all permissions granted to each of their groups.', related_name='user_set', related_query_name='user', to='auth.Group', verbose_name='groups')), ('user_permissions', models.ManyToManyField(blank=True, help_text='Specific permissions for this user.', related_name='user_set', related_query_name='user', to='auth.Permission', verbose_name='user permissions')), ], options={ 'verbose_name': 'user', 'verbose_name_plural': 'users', 'abstract': False, }, managers=[ ('objects', django.contrib.auth.models.UserManager()), ], ), ]
65.404255
329
0.656474
import django.contrib.auth.models import django.contrib.auth.validators from django.db import migrations, models import django.utils.timezone class Migration(migrations.Migration): initial = True dependencies = [ ('auth', '0012_alter_user_first_name_max_length'), ] operations = [ migrations.CreateModel( name='CustomUser', fields=[ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('password', models.CharField(max_length=128, verbose_name='password')), ('last_login', models.DateTimeField(blank=True, null=True, verbose_name='last login')), ('is_superuser', models.BooleanField(default=False, help_text='Designates that this user has all permissions without explicitly assigning them.', verbose_name='superuser status')), ('username', models.CharField(error_messages={'unique': 'A user with that username already exists.'}, help_text='Required. 150 characters or fewer. Letters, digits and @/./+/-/_ only.', max_length=150, unique=True, validators=[django.contrib.auth.validators.UnicodeUsernameValidator()], verbose_name='username')), ('first_name', models.CharField(blank=True, max_length=150, verbose_name='first name')), ('last_name', models.CharField(blank=True, max_length=150, verbose_name='last name')), ('email', models.EmailField(blank=True, max_length=254, verbose_name='email address')), ('is_staff', models.BooleanField(default=False, help_text='Designates whether the user can log into this admin site.', verbose_name='staff status')), ('is_active', models.BooleanField(default=True, help_text='Designates whether this user should be treated as active. Unselect this instead of deleting accounts.', verbose_name='active')), ('date_joined', models.DateTimeField(default=django.utils.timezone.now, verbose_name='date joined')), ('gender', models.CharField(choices=[('M', 'Male'), ('F', 'Female'), ('NS', 'Not Specified')], max_length=20)), ('phone_number', models.CharField(max_length=30)), ('groups', models.ManyToManyField(blank=True, help_text='The groups this user belongs to. A user will get all permissions granted to each of their groups.', related_name='user_set', related_query_name='user', to='auth.Group', verbose_name='groups')), ('user_permissions', models.ManyToManyField(blank=True, help_text='Specific permissions for this user.', related_name='user_set', related_query_name='user', to='auth.Permission', verbose_name='user permissions')), ], options={ 'verbose_name': 'user', 'verbose_name_plural': 'users', 'abstract': False, }, managers=[ ('objects', django.contrib.auth.models.UserManager()), ], ), ]
true
true
f72482c36144879a71a381f8ffacbf087f5e4594
28,655
py
Python
sdk/python/pulumi_kubernetes/core/v1/Event.py
polivbr/pulumi-kubernetes
36a5fb34240a38a60b52a5f4e55e66e248d9305f
[ "Apache-2.0" ]
277
2018-06-18T14:57:09.000Z
2022-03-29T04:05:06.000Z
sdk/python/pulumi_kubernetes/core/v1/Event.py
polivbr/pulumi-kubernetes
36a5fb34240a38a60b52a5f4e55e66e248d9305f
[ "Apache-2.0" ]
1,447
2018-06-20T00:58:34.000Z
2022-03-31T21:28:43.000Z
sdk/python/pulumi_kubernetes/core/v1/Event.py
polivbr/pulumi-kubernetes
36a5fb34240a38a60b52a5f4e55e66e248d9305f
[ "Apache-2.0" ]
95
2018-06-30T03:30:05.000Z
2022-03-29T04:05:09.000Z
# coding=utf-8 # *** WARNING: this file was generated by pulumigen. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from ... import _utilities from . import outputs from ... import meta as _meta from ._inputs import * __all__ = ['EventInitArgs', 'Event'] @pulumi.input_type class EventInitArgs: def __init__(__self__, *, involved_object: pulumi.Input['ObjectReferenceArgs'], metadata: pulumi.Input['_meta.v1.ObjectMetaArgs'], action: Optional[pulumi.Input[str]] = None, api_version: Optional[pulumi.Input[str]] = None, count: Optional[pulumi.Input[int]] = None, event_time: Optional[pulumi.Input[str]] = None, first_timestamp: Optional[pulumi.Input[str]] = None, kind: Optional[pulumi.Input[str]] = None, last_timestamp: Optional[pulumi.Input[str]] = None, message: Optional[pulumi.Input[str]] = None, reason: Optional[pulumi.Input[str]] = None, related: Optional[pulumi.Input['ObjectReferenceArgs']] = None, reporting_component: Optional[pulumi.Input[str]] = None, reporting_instance: Optional[pulumi.Input[str]] = None, series: Optional[pulumi.Input['EventSeriesArgs']] = None, source: Optional[pulumi.Input['EventSourceArgs']] = None, type: Optional[pulumi.Input[str]] = None): """ The set of arguments for constructing a Event resource. :param pulumi.Input['ObjectReferenceArgs'] involved_object: The object that this event is about. :param pulumi.Input['_meta.v1.ObjectMetaArgs'] metadata: Standard object's metadata. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#metadata :param pulumi.Input[str] action: What action was taken/failed regarding to the Regarding object. :param pulumi.Input[str] api_version: APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources :param pulumi.Input[int] count: The number of times this event has occurred. :param pulumi.Input[str] event_time: Time when this Event was first observed. :param pulumi.Input[str] first_timestamp: The time at which the event was first recorded. (Time of server receipt is in TypeMeta.) :param pulumi.Input[str] kind: Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds :param pulumi.Input[str] last_timestamp: The time at which the most recent occurrence of this event was recorded. :param pulumi.Input[str] message: A human-readable description of the status of this operation. :param pulumi.Input[str] reason: This should be a short, machine understandable string that gives the reason for the transition into the object's current status. :param pulumi.Input['ObjectReferenceArgs'] related: Optional secondary object for more complex actions. :param pulumi.Input[str] reporting_component: Name of the controller that emitted this Event, e.g. `kubernetes.io/kubelet`. :param pulumi.Input[str] reporting_instance: ID of the controller instance, e.g. `kubelet-xyzf`. :param pulumi.Input['EventSeriesArgs'] series: Data about the Event series this event represents or nil if it's a singleton Event. :param pulumi.Input['EventSourceArgs'] source: The component reporting this event. Should be a short machine understandable string. :param pulumi.Input[str] type: Type of this event (Normal, Warning), new types could be added in the future """ pulumi.set(__self__, "involved_object", involved_object) pulumi.set(__self__, "metadata", metadata) if action is not None: pulumi.set(__self__, "action", action) if api_version is not None: pulumi.set(__self__, "api_version", 'v1') if count is not None: pulumi.set(__self__, "count", count) if event_time is not None: pulumi.set(__self__, "event_time", event_time) if first_timestamp is not None: pulumi.set(__self__, "first_timestamp", first_timestamp) if kind is not None: pulumi.set(__self__, "kind", 'Event') if last_timestamp is not None: pulumi.set(__self__, "last_timestamp", last_timestamp) if message is not None: pulumi.set(__self__, "message", message) if reason is not None: pulumi.set(__self__, "reason", reason) if related is not None: pulumi.set(__self__, "related", related) if reporting_component is not None: pulumi.set(__self__, "reporting_component", reporting_component) if reporting_instance is not None: pulumi.set(__self__, "reporting_instance", reporting_instance) if series is not None: pulumi.set(__self__, "series", series) if source is not None: pulumi.set(__self__, "source", source) if type is not None: pulumi.set(__self__, "type", type) @property @pulumi.getter(name="involvedObject") def involved_object(self) -> pulumi.Input['ObjectReferenceArgs']: """ The object that this event is about. """ return pulumi.get(self, "involved_object") @involved_object.setter def involved_object(self, value: pulumi.Input['ObjectReferenceArgs']): pulumi.set(self, "involved_object", value) @property @pulumi.getter def metadata(self) -> pulumi.Input['_meta.v1.ObjectMetaArgs']: """ Standard object's metadata. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#metadata """ return pulumi.get(self, "metadata") @metadata.setter def metadata(self, value: pulumi.Input['_meta.v1.ObjectMetaArgs']): pulumi.set(self, "metadata", value) @property @pulumi.getter def action(self) -> Optional[pulumi.Input[str]]: """ What action was taken/failed regarding to the Regarding object. """ return pulumi.get(self, "action") @action.setter def action(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "action", value) @property @pulumi.getter(name="apiVersion") def api_version(self) -> Optional[pulumi.Input[str]]: """ APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources """ return pulumi.get(self, "api_version") @api_version.setter def api_version(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "api_version", value) @property @pulumi.getter def count(self) -> Optional[pulumi.Input[int]]: """ The number of times this event has occurred. """ return pulumi.get(self, "count") @count.setter def count(self, value: Optional[pulumi.Input[int]]): pulumi.set(self, "count", value) @property @pulumi.getter(name="eventTime") def event_time(self) -> Optional[pulumi.Input[str]]: """ Time when this Event was first observed. """ return pulumi.get(self, "event_time") @event_time.setter def event_time(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "event_time", value) @property @pulumi.getter(name="firstTimestamp") def first_timestamp(self) -> Optional[pulumi.Input[str]]: """ The time at which the event was first recorded. (Time of server receipt is in TypeMeta.) """ return pulumi.get(self, "first_timestamp") @first_timestamp.setter def first_timestamp(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "first_timestamp", value) @property @pulumi.getter def kind(self) -> Optional[pulumi.Input[str]]: """ Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds """ return pulumi.get(self, "kind") @kind.setter def kind(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "kind", value) @property @pulumi.getter(name="lastTimestamp") def last_timestamp(self) -> Optional[pulumi.Input[str]]: """ The time at which the most recent occurrence of this event was recorded. """ return pulumi.get(self, "last_timestamp") @last_timestamp.setter def last_timestamp(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "last_timestamp", value) @property @pulumi.getter def message(self) -> Optional[pulumi.Input[str]]: """ A human-readable description of the status of this operation. """ return pulumi.get(self, "message") @message.setter def message(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "message", value) @property @pulumi.getter def reason(self) -> Optional[pulumi.Input[str]]: """ This should be a short, machine understandable string that gives the reason for the transition into the object's current status. """ return pulumi.get(self, "reason") @reason.setter def reason(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "reason", value) @property @pulumi.getter def related(self) -> Optional[pulumi.Input['ObjectReferenceArgs']]: """ Optional secondary object for more complex actions. """ return pulumi.get(self, "related") @related.setter def related(self, value: Optional[pulumi.Input['ObjectReferenceArgs']]): pulumi.set(self, "related", value) @property @pulumi.getter(name="reportingComponent") def reporting_component(self) -> Optional[pulumi.Input[str]]: """ Name of the controller that emitted this Event, e.g. `kubernetes.io/kubelet`. """ return pulumi.get(self, "reporting_component") @reporting_component.setter def reporting_component(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "reporting_component", value) @property @pulumi.getter(name="reportingInstance") def reporting_instance(self) -> Optional[pulumi.Input[str]]: """ ID of the controller instance, e.g. `kubelet-xyzf`. """ return pulumi.get(self, "reporting_instance") @reporting_instance.setter def reporting_instance(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "reporting_instance", value) @property @pulumi.getter def series(self) -> Optional[pulumi.Input['EventSeriesArgs']]: """ Data about the Event series this event represents or nil if it's a singleton Event. """ return pulumi.get(self, "series") @series.setter def series(self, value: Optional[pulumi.Input['EventSeriesArgs']]): pulumi.set(self, "series", value) @property @pulumi.getter def source(self) -> Optional[pulumi.Input['EventSourceArgs']]: """ The component reporting this event. Should be a short machine understandable string. """ return pulumi.get(self, "source") @source.setter def source(self, value: Optional[pulumi.Input['EventSourceArgs']]): pulumi.set(self, "source", value) @property @pulumi.getter def type(self) -> Optional[pulumi.Input[str]]: """ Type of this event (Normal, Warning), new types could be added in the future """ return pulumi.get(self, "type") @type.setter def type(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "type", value) class Event(pulumi.CustomResource): @overload def __init__(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, action: Optional[pulumi.Input[str]] = None, api_version: Optional[pulumi.Input[str]] = None, count: Optional[pulumi.Input[int]] = None, event_time: Optional[pulumi.Input[str]] = None, first_timestamp: Optional[pulumi.Input[str]] = None, involved_object: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, kind: Optional[pulumi.Input[str]] = None, last_timestamp: Optional[pulumi.Input[str]] = None, message: Optional[pulumi.Input[str]] = None, metadata: Optional[pulumi.Input[pulumi.InputType['_meta.v1.ObjectMetaArgs']]] = None, reason: Optional[pulumi.Input[str]] = None, related: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, reporting_component: Optional[pulumi.Input[str]] = None, reporting_instance: Optional[pulumi.Input[str]] = None, series: Optional[pulumi.Input[pulumi.InputType['EventSeriesArgs']]] = None, source: Optional[pulumi.Input[pulumi.InputType['EventSourceArgs']]] = None, type: Optional[pulumi.Input[str]] = None, __props__=None): """ Event is a report of an event somewhere in the cluster. Events have a limited retention time and triggers and messages may evolve with time. Event consumers should not rely on the timing of an event with a given Reason reflecting a consistent underlying trigger, or the continued existence of events with that Reason. Events should be treated as informative, best-effort, supplemental data. :param str resource_name: The name of the resource. :param pulumi.ResourceOptions opts: Options for the resource. :param pulumi.Input[str] action: What action was taken/failed regarding to the Regarding object. :param pulumi.Input[str] api_version: APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources :param pulumi.Input[int] count: The number of times this event has occurred. :param pulumi.Input[str] event_time: Time when this Event was first observed. :param pulumi.Input[str] first_timestamp: The time at which the event was first recorded. (Time of server receipt is in TypeMeta.) :param pulumi.Input[pulumi.InputType['ObjectReferenceArgs']] involved_object: The object that this event is about. :param pulumi.Input[str] kind: Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds :param pulumi.Input[str] last_timestamp: The time at which the most recent occurrence of this event was recorded. :param pulumi.Input[str] message: A human-readable description of the status of this operation. :param pulumi.Input[pulumi.InputType['_meta.v1.ObjectMetaArgs']] metadata: Standard object's metadata. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#metadata :param pulumi.Input[str] reason: This should be a short, machine understandable string that gives the reason for the transition into the object's current status. :param pulumi.Input[pulumi.InputType['ObjectReferenceArgs']] related: Optional secondary object for more complex actions. :param pulumi.Input[str] reporting_component: Name of the controller that emitted this Event, e.g. `kubernetes.io/kubelet`. :param pulumi.Input[str] reporting_instance: ID of the controller instance, e.g. `kubelet-xyzf`. :param pulumi.Input[pulumi.InputType['EventSeriesArgs']] series: Data about the Event series this event represents or nil if it's a singleton Event. :param pulumi.Input[pulumi.InputType['EventSourceArgs']] source: The component reporting this event. Should be a short machine understandable string. :param pulumi.Input[str] type: Type of this event (Normal, Warning), new types could be added in the future """ ... @overload def __init__(__self__, resource_name: str, args: EventInitArgs, opts: Optional[pulumi.ResourceOptions] = None): """ Event is a report of an event somewhere in the cluster. Events have a limited retention time and triggers and messages may evolve with time. Event consumers should not rely on the timing of an event with a given Reason reflecting a consistent underlying trigger, or the continued existence of events with that Reason. Events should be treated as informative, best-effort, supplemental data. :param str resource_name: The name of the resource. :param EventInitArgs args: The arguments to use to populate this resource's properties. :param pulumi.ResourceOptions opts: Options for the resource. """ ... def __init__(__self__, resource_name: str, *args, **kwargs): resource_args, opts = _utilities.get_resource_args_opts(EventInitArgs, pulumi.ResourceOptions, *args, **kwargs) if resource_args is not None: __self__._internal_init(resource_name, opts, **resource_args.__dict__) else: __self__._internal_init(resource_name, *args, **kwargs) def _internal_init(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, action: Optional[pulumi.Input[str]] = None, api_version: Optional[pulumi.Input[str]] = None, count: Optional[pulumi.Input[int]] = None, event_time: Optional[pulumi.Input[str]] = None, first_timestamp: Optional[pulumi.Input[str]] = None, involved_object: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, kind: Optional[pulumi.Input[str]] = None, last_timestamp: Optional[pulumi.Input[str]] = None, message: Optional[pulumi.Input[str]] = None, metadata: Optional[pulumi.Input[pulumi.InputType['_meta.v1.ObjectMetaArgs']]] = None, reason: Optional[pulumi.Input[str]] = None, related: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, reporting_component: Optional[pulumi.Input[str]] = None, reporting_instance: Optional[pulumi.Input[str]] = None, series: Optional[pulumi.Input[pulumi.InputType['EventSeriesArgs']]] = None, source: Optional[pulumi.Input[pulumi.InputType['EventSourceArgs']]] = None, type: Optional[pulumi.Input[str]] = None, __props__=None): if opts is None: opts = pulumi.ResourceOptions() if not isinstance(opts, pulumi.ResourceOptions): raise TypeError('Expected resource options to be a ResourceOptions instance') if opts.version is None: opts.version = _utilities.get_version() if opts.id is None: if __props__ is not None: raise TypeError('__props__ is only valid when passed in combination with a valid opts.id to get an existing resource') __props__ = EventInitArgs.__new__(EventInitArgs) __props__.__dict__["action"] = action __props__.__dict__["api_version"] = 'v1' __props__.__dict__["count"] = count __props__.__dict__["event_time"] = event_time __props__.__dict__["first_timestamp"] = first_timestamp if involved_object is None and not opts.urn: raise TypeError("Missing required property 'involved_object'") __props__.__dict__["involved_object"] = involved_object __props__.__dict__["kind"] = 'Event' __props__.__dict__["last_timestamp"] = last_timestamp __props__.__dict__["message"] = message if metadata is None and not opts.urn: raise TypeError("Missing required property 'metadata'") __props__.__dict__["metadata"] = metadata __props__.__dict__["reason"] = reason __props__.__dict__["related"] = related __props__.__dict__["reporting_component"] = reporting_component __props__.__dict__["reporting_instance"] = reporting_instance __props__.__dict__["series"] = series __props__.__dict__["source"] = source __props__.__dict__["type"] = type alias_opts = pulumi.ResourceOptions(aliases=[pulumi.Alias(type_="kubernetes:events.k8s.io/v1:Event"), pulumi.Alias(type_="kubernetes:events.k8s.io/v1beta1:Event")]) opts = pulumi.ResourceOptions.merge(opts, alias_opts) super(Event, __self__).__init__( 'kubernetes:core/v1:Event', resource_name, __props__, opts) @staticmethod def get(resource_name: str, id: pulumi.Input[str], opts: Optional[pulumi.ResourceOptions] = None) -> 'Event': """ Get an existing Event resource's state with the given name, id, and optional extra properties used to qualify the lookup. :param str resource_name: The unique name of the resulting resource. :param pulumi.Input[str] id: The unique provider ID of the resource to lookup. :param pulumi.ResourceOptions opts: Options for the resource. """ opts = pulumi.ResourceOptions.merge(opts, pulumi.ResourceOptions(id=id)) __props__ = EventInitArgs.__new__(EventInitArgs) __props__.__dict__["action"] = None __props__.__dict__["api_version"] = None __props__.__dict__["count"] = None __props__.__dict__["event_time"] = None __props__.__dict__["first_timestamp"] = None __props__.__dict__["involved_object"] = None __props__.__dict__["kind"] = None __props__.__dict__["last_timestamp"] = None __props__.__dict__["message"] = None __props__.__dict__["metadata"] = None __props__.__dict__["reason"] = None __props__.__dict__["related"] = None __props__.__dict__["reporting_component"] = None __props__.__dict__["reporting_instance"] = None __props__.__dict__["series"] = None __props__.__dict__["source"] = None __props__.__dict__["type"] = None return Event(resource_name, opts=opts, __props__=__props__) @property @pulumi.getter def action(self) -> pulumi.Output[Optional[str]]: """ What action was taken/failed regarding to the Regarding object. """ return pulumi.get(self, "action") @property @pulumi.getter(name="apiVersion") def api_version(self) -> pulumi.Output[Optional[str]]: """ APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources """ return pulumi.get(self, "api_version") @property @pulumi.getter def count(self) -> pulumi.Output[Optional[int]]: """ The number of times this event has occurred. """ return pulumi.get(self, "count") @property @pulumi.getter(name="eventTime") def event_time(self) -> pulumi.Output[Optional[str]]: """ Time when this Event was first observed. """ return pulumi.get(self, "event_time") @property @pulumi.getter(name="firstTimestamp") def first_timestamp(self) -> pulumi.Output[Optional[str]]: """ The time at which the event was first recorded. (Time of server receipt is in TypeMeta.) """ return pulumi.get(self, "first_timestamp") @property @pulumi.getter(name="involvedObject") def involved_object(self) -> pulumi.Output['outputs.ObjectReference']: """ The object that this event is about. """ return pulumi.get(self, "involved_object") @property @pulumi.getter def kind(self) -> pulumi.Output[Optional[str]]: """ Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds """ return pulumi.get(self, "kind") @property @pulumi.getter(name="lastTimestamp") def last_timestamp(self) -> pulumi.Output[Optional[str]]: """ The time at which the most recent occurrence of this event was recorded. """ return pulumi.get(self, "last_timestamp") @property @pulumi.getter def message(self) -> pulumi.Output[Optional[str]]: """ A human-readable description of the status of this operation. """ return pulumi.get(self, "message") @property @pulumi.getter def metadata(self) -> pulumi.Output['_meta.v1.outputs.ObjectMeta']: """ Standard object's metadata. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#metadata """ return pulumi.get(self, "metadata") @property @pulumi.getter def reason(self) -> pulumi.Output[Optional[str]]: """ This should be a short, machine understandable string that gives the reason for the transition into the object's current status. """ return pulumi.get(self, "reason") @property @pulumi.getter def related(self) -> pulumi.Output[Optional['outputs.ObjectReference']]: """ Optional secondary object for more complex actions. """ return pulumi.get(self, "related") @property @pulumi.getter(name="reportingComponent") def reporting_component(self) -> pulumi.Output[Optional[str]]: """ Name of the controller that emitted this Event, e.g. `kubernetes.io/kubelet`. """ return pulumi.get(self, "reporting_component") @property @pulumi.getter(name="reportingInstance") def reporting_instance(self) -> pulumi.Output[Optional[str]]: """ ID of the controller instance, e.g. `kubelet-xyzf`. """ return pulumi.get(self, "reporting_instance") @property @pulumi.getter def series(self) -> pulumi.Output[Optional['outputs.EventSeries']]: """ Data about the Event series this event represents or nil if it's a singleton Event. """ return pulumi.get(self, "series") @property @pulumi.getter def source(self) -> pulumi.Output[Optional['outputs.EventSource']]: """ The component reporting this event. Should be a short machine understandable string. """ return pulumi.get(self, "source") @property @pulumi.getter def type(self) -> pulumi.Output[Optional[str]]: """ Type of this event (Normal, Warning), new types could be added in the future """ return pulumi.get(self, "type")
48.322091
401
0.658873
import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from ... import _utilities from . import outputs from ... import meta as _meta from ._inputs import * __all__ = ['EventInitArgs', 'Event'] @pulumi.input_type class EventInitArgs: def __init__(__self__, *, involved_object: pulumi.Input['ObjectReferenceArgs'], metadata: pulumi.Input['_meta.v1.ObjectMetaArgs'], action: Optional[pulumi.Input[str]] = None, api_version: Optional[pulumi.Input[str]] = None, count: Optional[pulumi.Input[int]] = None, event_time: Optional[pulumi.Input[str]] = None, first_timestamp: Optional[pulumi.Input[str]] = None, kind: Optional[pulumi.Input[str]] = None, last_timestamp: Optional[pulumi.Input[str]] = None, message: Optional[pulumi.Input[str]] = None, reason: Optional[pulumi.Input[str]] = None, related: Optional[pulumi.Input['ObjectReferenceArgs']] = None, reporting_component: Optional[pulumi.Input[str]] = None, reporting_instance: Optional[pulumi.Input[str]] = None, series: Optional[pulumi.Input['EventSeriesArgs']] = None, source: Optional[pulumi.Input['EventSourceArgs']] = None, type: Optional[pulumi.Input[str]] = None): pulumi.set(__self__, "involved_object", involved_object) pulumi.set(__self__, "metadata", metadata) if action is not None: pulumi.set(__self__, "action", action) if api_version is not None: pulumi.set(__self__, "api_version", 'v1') if count is not None: pulumi.set(__self__, "count", count) if event_time is not None: pulumi.set(__self__, "event_time", event_time) if first_timestamp is not None: pulumi.set(__self__, "first_timestamp", first_timestamp) if kind is not None: pulumi.set(__self__, "kind", 'Event') if last_timestamp is not None: pulumi.set(__self__, "last_timestamp", last_timestamp) if message is not None: pulumi.set(__self__, "message", message) if reason is not None: pulumi.set(__self__, "reason", reason) if related is not None: pulumi.set(__self__, "related", related) if reporting_component is not None: pulumi.set(__self__, "reporting_component", reporting_component) if reporting_instance is not None: pulumi.set(__self__, "reporting_instance", reporting_instance) if series is not None: pulumi.set(__self__, "series", series) if source is not None: pulumi.set(__self__, "source", source) if type is not None: pulumi.set(__self__, "type", type) @property @pulumi.getter(name="involvedObject") def involved_object(self) -> pulumi.Input['ObjectReferenceArgs']: return pulumi.get(self, "involved_object") @involved_object.setter def involved_object(self, value: pulumi.Input['ObjectReferenceArgs']): pulumi.set(self, "involved_object", value) @property @pulumi.getter def metadata(self) -> pulumi.Input['_meta.v1.ObjectMetaArgs']: return pulumi.get(self, "metadata") @metadata.setter def metadata(self, value: pulumi.Input['_meta.v1.ObjectMetaArgs']): pulumi.set(self, "metadata", value) @property @pulumi.getter def action(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "action") @action.setter def action(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "action", value) @property @pulumi.getter(name="apiVersion") def api_version(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "api_version") @api_version.setter def api_version(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "api_version", value) @property @pulumi.getter def count(self) -> Optional[pulumi.Input[int]]: return pulumi.get(self, "count") @count.setter def count(self, value: Optional[pulumi.Input[int]]): pulumi.set(self, "count", value) @property @pulumi.getter(name="eventTime") def event_time(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "event_time") @event_time.setter def event_time(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "event_time", value) @property @pulumi.getter(name="firstTimestamp") def first_timestamp(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "first_timestamp") @first_timestamp.setter def first_timestamp(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "first_timestamp", value) @property @pulumi.getter def kind(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "kind") @kind.setter def kind(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "kind", value) @property @pulumi.getter(name="lastTimestamp") def last_timestamp(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "last_timestamp") @last_timestamp.setter def last_timestamp(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "last_timestamp", value) @property @pulumi.getter def message(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "message") @message.setter def message(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "message", value) @property @pulumi.getter def reason(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "reason") @reason.setter def reason(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "reason", value) @property @pulumi.getter def related(self) -> Optional[pulumi.Input['ObjectReferenceArgs']]: return pulumi.get(self, "related") @related.setter def related(self, value: Optional[pulumi.Input['ObjectReferenceArgs']]): pulumi.set(self, "related", value) @property @pulumi.getter(name="reportingComponent") def reporting_component(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "reporting_component") @reporting_component.setter def reporting_component(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "reporting_component", value) @property @pulumi.getter(name="reportingInstance") def reporting_instance(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "reporting_instance") @reporting_instance.setter def reporting_instance(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "reporting_instance", value) @property @pulumi.getter def series(self) -> Optional[pulumi.Input['EventSeriesArgs']]: return pulumi.get(self, "series") @series.setter def series(self, value: Optional[pulumi.Input['EventSeriesArgs']]): pulumi.set(self, "series", value) @property @pulumi.getter def source(self) -> Optional[pulumi.Input['EventSourceArgs']]: return pulumi.get(self, "source") @source.setter def source(self, value: Optional[pulumi.Input['EventSourceArgs']]): pulumi.set(self, "source", value) @property @pulumi.getter def type(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "type") @type.setter def type(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "type", value) class Event(pulumi.CustomResource): @overload def __init__(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, action: Optional[pulumi.Input[str]] = None, api_version: Optional[pulumi.Input[str]] = None, count: Optional[pulumi.Input[int]] = None, event_time: Optional[pulumi.Input[str]] = None, first_timestamp: Optional[pulumi.Input[str]] = None, involved_object: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, kind: Optional[pulumi.Input[str]] = None, last_timestamp: Optional[pulumi.Input[str]] = None, message: Optional[pulumi.Input[str]] = None, metadata: Optional[pulumi.Input[pulumi.InputType['_meta.v1.ObjectMetaArgs']]] = None, reason: Optional[pulumi.Input[str]] = None, related: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, reporting_component: Optional[pulumi.Input[str]] = None, reporting_instance: Optional[pulumi.Input[str]] = None, series: Optional[pulumi.Input[pulumi.InputType['EventSeriesArgs']]] = None, source: Optional[pulumi.Input[pulumi.InputType['EventSourceArgs']]] = None, type: Optional[pulumi.Input[str]] = None, __props__=None): ... @overload def __init__(__self__, resource_name: str, args: EventInitArgs, opts: Optional[pulumi.ResourceOptions] = None): ... def __init__(__self__, resource_name: str, *args, **kwargs): resource_args, opts = _utilities.get_resource_args_opts(EventInitArgs, pulumi.ResourceOptions, *args, **kwargs) if resource_args is not None: __self__._internal_init(resource_name, opts, **resource_args.__dict__) else: __self__._internal_init(resource_name, *args, **kwargs) def _internal_init(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, action: Optional[pulumi.Input[str]] = None, api_version: Optional[pulumi.Input[str]] = None, count: Optional[pulumi.Input[int]] = None, event_time: Optional[pulumi.Input[str]] = None, first_timestamp: Optional[pulumi.Input[str]] = None, involved_object: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, kind: Optional[pulumi.Input[str]] = None, last_timestamp: Optional[pulumi.Input[str]] = None, message: Optional[pulumi.Input[str]] = None, metadata: Optional[pulumi.Input[pulumi.InputType['_meta.v1.ObjectMetaArgs']]] = None, reason: Optional[pulumi.Input[str]] = None, related: Optional[pulumi.Input[pulumi.InputType['ObjectReferenceArgs']]] = None, reporting_component: Optional[pulumi.Input[str]] = None, reporting_instance: Optional[pulumi.Input[str]] = None, series: Optional[pulumi.Input[pulumi.InputType['EventSeriesArgs']]] = None, source: Optional[pulumi.Input[pulumi.InputType['EventSourceArgs']]] = None, type: Optional[pulumi.Input[str]] = None, __props__=None): if opts is None: opts = pulumi.ResourceOptions() if not isinstance(opts, pulumi.ResourceOptions): raise TypeError('Expected resource options to be a ResourceOptions instance') if opts.version is None: opts.version = _utilities.get_version() if opts.id is None: if __props__ is not None: raise TypeError('__props__ is only valid when passed in combination with a valid opts.id to get an existing resource') __props__ = EventInitArgs.__new__(EventInitArgs) __props__.__dict__["action"] = action __props__.__dict__["api_version"] = 'v1' __props__.__dict__["count"] = count __props__.__dict__["event_time"] = event_time __props__.__dict__["first_timestamp"] = first_timestamp if involved_object is None and not opts.urn: raise TypeError("Missing required property 'involved_object'") __props__.__dict__["involved_object"] = involved_object __props__.__dict__["kind"] = 'Event' __props__.__dict__["last_timestamp"] = last_timestamp __props__.__dict__["message"] = message if metadata is None and not opts.urn: raise TypeError("Missing required property 'metadata'") __props__.__dict__["metadata"] = metadata __props__.__dict__["reason"] = reason __props__.__dict__["related"] = related __props__.__dict__["reporting_component"] = reporting_component __props__.__dict__["reporting_instance"] = reporting_instance __props__.__dict__["series"] = series __props__.__dict__["source"] = source __props__.__dict__["type"] = type alias_opts = pulumi.ResourceOptions(aliases=[pulumi.Alias(type_="kubernetes:events.k8s.io/v1:Event"), pulumi.Alias(type_="kubernetes:events.k8s.io/v1beta1:Event")]) opts = pulumi.ResourceOptions.merge(opts, alias_opts) super(Event, __self__).__init__( 'kubernetes:core/v1:Event', resource_name, __props__, opts) @staticmethod def get(resource_name: str, id: pulumi.Input[str], opts: Optional[pulumi.ResourceOptions] = None) -> 'Event': opts = pulumi.ResourceOptions.merge(opts, pulumi.ResourceOptions(id=id)) __props__ = EventInitArgs.__new__(EventInitArgs) __props__.__dict__["action"] = None __props__.__dict__["api_version"] = None __props__.__dict__["count"] = None __props__.__dict__["event_time"] = None __props__.__dict__["first_timestamp"] = None __props__.__dict__["involved_object"] = None __props__.__dict__["kind"] = None __props__.__dict__["last_timestamp"] = None __props__.__dict__["message"] = None __props__.__dict__["metadata"] = None __props__.__dict__["reason"] = None __props__.__dict__["related"] = None __props__.__dict__["reporting_component"] = None __props__.__dict__["reporting_instance"] = None __props__.__dict__["series"] = None __props__.__dict__["source"] = None __props__.__dict__["type"] = None return Event(resource_name, opts=opts, __props__=__props__) @property @pulumi.getter def action(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "action") @property @pulumi.getter(name="apiVersion") def api_version(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "api_version") @property @pulumi.getter def count(self) -> pulumi.Output[Optional[int]]: return pulumi.get(self, "count") @property @pulumi.getter(name="eventTime") def event_time(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "event_time") @property @pulumi.getter(name="firstTimestamp") def first_timestamp(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "first_timestamp") @property @pulumi.getter(name="involvedObject") def involved_object(self) -> pulumi.Output['outputs.ObjectReference']: return pulumi.get(self, "involved_object") @property @pulumi.getter def kind(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "kind") @property @pulumi.getter(name="lastTimestamp") def last_timestamp(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "last_timestamp") @property @pulumi.getter def message(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "message") @property @pulumi.getter def metadata(self) -> pulumi.Output['_meta.v1.outputs.ObjectMeta']: return pulumi.get(self, "metadata") @property @pulumi.getter def reason(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "reason") @property @pulumi.getter def related(self) -> pulumi.Output[Optional['outputs.ObjectReference']]: return pulumi.get(self, "related") @property @pulumi.getter(name="reportingComponent") def reporting_component(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "reporting_component") @property @pulumi.getter(name="reportingInstance") def reporting_instance(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "reporting_instance") @property @pulumi.getter def series(self) -> pulumi.Output[Optional['outputs.EventSeries']]: return pulumi.get(self, "series") @property @pulumi.getter def source(self) -> pulumi.Output[Optional['outputs.EventSource']]: return pulumi.get(self, "source") @property @pulumi.getter def type(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "type")
true
true
f724835605b65f1f1e1ae6d86dd97f931443263b
2,525
py
Python
stats.py
JoKalliauer/resvg-test-suite
c1a0e510bcdb89275b30caeb3725208304a26754
[ "MIT" ]
1
2021-06-02T11:21:41.000Z
2021-06-02T11:21:41.000Z
stats.py
adarshkrtiwari/resvg-test-suite
c2cb84b630332ea585fc54ba62e62d35fb4a33dd
[ "MIT" ]
null
null
null
stats.py
adarshkrtiwari/resvg-test-suite
c2cb84b630332ea585fc54ba62e62d35fb4a33dd
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Usage: # ./stats.py results.csv chart.svg # ./stats.py official.csv official_chart.svg import argparse import csv import json import subprocess UNKNOWN = 0 PASSED = 1 FAILED = 2 CRASHED = 3 PARTIAL = 4 OUT_OF_SCOPE = 5 class RowData: def __init__(self, name, flags): self.name = name self.flags = flags parser = argparse.ArgumentParser() parser.add_argument('input', help='CSV file') parser.add_argument('output', help='SVG file') args = parser.parse_args() rows = [] with open(args.input, 'r') as f: for row in csv.reader(f): if row[0] == 'title': continue file_name = row[0] flags = [int(row[1]), int(row[2]), int(row[3]), int(row[4]), int(row[5]), int(row[6]), int(row[7]), int(row[8]), int(row[9])] rows.append(RowData(file_name, flags)) passed = [0, 0, 0, 0, 0, 0, 0, 0, 0] for row in rows: for idx, flag in enumerate(row.flags): if flag == PASSED or flag == UNKNOWN: passed[idx] = passed[idx] + 1 barh_data = json.dumps( { "items_font": { "family": "Arial", "size": 12 }, "items": [ { "name": "resvg 0.14.1", "value": passed[2] }, { "name": "Chromium r856583", "value": passed[0] }, { "name": "Firefox 87", "value": passed[1] }, { "name": "Inkscape 1.0.2", "value": passed[4] }, { "name": "librsvg 2.51.1", "value": passed[5] }, { "name": "Batik 1.14", "value": passed[3] }, { "name": "SVG.NET 3.2.3", "value": passed[6] }, { "name": "QtSvg 5.15.2", "value": passed[8] }, { "name": "wxSvg 1.5.11", "value": passed[7] } ], "hor_axis": { "title": "Tests passed", "round_tick_values": True, "width": 700, "max_value": len(rows) } }, indent=4) with open('chart.json', 'w') as f: f.write(barh_data) try: subprocess.check_call(['./barh', 'chart.json', 'site/images/' + args.output]) except FileNotFoundError: print('Error: \'barh\' executable is not found.\n' 'You should build https://github.com/RazrFalcon/barh ' 'and link resultig binary to the current directory.')
22.747748
81
0.486337
import argparse import csv import json import subprocess UNKNOWN = 0 PASSED = 1 FAILED = 2 CRASHED = 3 PARTIAL = 4 OUT_OF_SCOPE = 5 class RowData: def __init__(self, name, flags): self.name = name self.flags = flags parser = argparse.ArgumentParser() parser.add_argument('input', help='CSV file') parser.add_argument('output', help='SVG file') args = parser.parse_args() rows = [] with open(args.input, 'r') as f: for row in csv.reader(f): if row[0] == 'title': continue file_name = row[0] flags = [int(row[1]), int(row[2]), int(row[3]), int(row[4]), int(row[5]), int(row[6]), int(row[7]), int(row[8]), int(row[9])] rows.append(RowData(file_name, flags)) passed = [0, 0, 0, 0, 0, 0, 0, 0, 0] for row in rows: for idx, flag in enumerate(row.flags): if flag == PASSED or flag == UNKNOWN: passed[idx] = passed[idx] + 1 barh_data = json.dumps( { "items_font": { "family": "Arial", "size": 12 }, "items": [ { "name": "resvg 0.14.1", "value": passed[2] }, { "name": "Chromium r856583", "value": passed[0] }, { "name": "Firefox 87", "value": passed[1] }, { "name": "Inkscape 1.0.2", "value": passed[4] }, { "name": "librsvg 2.51.1", "value": passed[5] }, { "name": "Batik 1.14", "value": passed[3] }, { "name": "SVG.NET 3.2.3", "value": passed[6] }, { "name": "QtSvg 5.15.2", "value": passed[8] }, { "name": "wxSvg 1.5.11", "value": passed[7] } ], "hor_axis": { "title": "Tests passed", "round_tick_values": True, "width": 700, "max_value": len(rows) } }, indent=4) with open('chart.json', 'w') as f: f.write(barh_data) try: subprocess.check_call(['./barh', 'chart.json', 'site/images/' + args.output]) except FileNotFoundError: print('Error: \'barh\' executable is not found.\n' 'You should build https://github.com/RazrFalcon/barh ' 'and link resultig binary to the current directory.')
true
true
f724837677091a92b829fe1dee99ea0c985b84da
4,804
py
Python
docs/conf.py
cartovarc/mac-to-ip
94098096297fe3d64022ecc850923d3cdc9691b1
[ "MIT" ]
null
null
null
docs/conf.py
cartovarc/mac-to-ip
94098096297fe3d64022ecc850923d3cdc9691b1
[ "MIT" ]
null
null
null
docs/conf.py
cartovarc/mac-to-ip
94098096297fe3d64022ecc850923d3cdc9691b1
[ "MIT" ]
null
null
null
#!/usr/bin/env python # # mac_to_ip documentation build configuration file, created by # sphinx-quickstart on Fri Jun 9 13:47:02 2017. # # This file is execfile()d with the current directory set to its # containing dir. # # Note that not all possible configuration values are present in this # autogenerated file. # # All configuration values have a default; values that are commented out # serve to show the default. # If extensions (or modules to document with autodoc) are in another # directory, add these directories to sys.path here. If the directory is # relative to the documentation root, use os.path.abspath to make it # absolute, like shown here. # import os import sys sys.path.insert(0, os.path.abspath('..')) import mac_to_ip # -- General configuration --------------------------------------------- # If your documentation needs a minimal Sphinx version, state it here. # # needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom ones. extensions = ['sphinx.ext.autodoc', 'sphinx.ext.viewcode'] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix(es) of source filenames. # You can specify multiple suffix as a list of string: # # source_suffix = ['.rst', '.md'] source_suffix = '.rst' # The master toctree document. master_doc = 'index' # General information about the project. project = 'MAC to IP' copyright = "2021, Carlos Tovar" author = "Carlos Tovar" # The version info for the project you're documenting, acts as replacement # for |version| and |release|, also used in various other places throughout # the built documents. # # The short X.Y version. version = mac_to_ip.__version__ # The full version, including alpha/beta/rc tags. release = mac_to_ip.__version__ # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This patterns also effect to html_static_path and html_extra_path exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # If true, `todo` and `todoList` produce output, else they produce nothing. todo_include_todos = False # -- Options for HTML output ------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'alabaster' # Theme options are theme-specific and customize the look and feel of a # theme further. For a list of options available for each theme, see the # documentation. # # html_theme_options = {} # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # -- Options for HTMLHelp output --------------------------------------- # Output file base name for HTML help builder. htmlhelp_basename = 'mac_to_ipdoc' # -- Options for LaTeX output ------------------------------------------ latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass # [howto, manual, or own class]). latex_documents = [ (master_doc, 'mac_to_ip.tex', 'MAC to IP Documentation', 'Carlos Tovar', 'manual'), ] # -- Options for manual page output ------------------------------------ # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'mac_to_ip', 'MAC to IP Documentation', [author], 1) ] # -- Options for Texinfo output ---------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'mac_to_ip', 'MAC to IP Documentation', author, 'mac_to_ip', 'One line description of project.', 'Miscellaneous'), ]
29.472393
77
0.684013
import os import sys sys.path.insert(0, os.path.abspath('..')) import mac_to_ip extensions = ['sphinx.ext.autodoc', 'sphinx.ext.viewcode'] templates_path = ['_templates'] source_suffix = '.rst' master_doc = 'index' project = 'MAC to IP' copyright = "2021, Carlos Tovar" author = "Carlos Tovar" # for |version| and |release|, also used in various other places throughout # the built documents. # # The short X.Y version. version = mac_to_ip.__version__ # The full version, including alpha/beta/rc tags. release = mac_to_ip.__version__ # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This patterns also effect to html_static_path and html_extra_path exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # If true, `todo` and `todoList` produce output, else they produce nothing. todo_include_todos = False # -- Options for HTML output ------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'alabaster' # Theme options are theme-specific and customize the look and feel of a # theme further. For a list of options available for each theme, see the # documentation. # # html_theme_options = {} # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # -- Options for HTMLHelp output --------------------------------------- # Output file base name for HTML help builder. htmlhelp_basename = 'mac_to_ipdoc' # -- Options for LaTeX output ------------------------------------------ latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, author, documentclass # [howto, manual, or own class]). latex_documents = [ (master_doc, 'mac_to_ip.tex', 'MAC to IP Documentation', 'Carlos Tovar', 'manual'), ] # -- Options for manual page output ------------------------------------ # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'mac_to_ip', 'MAC to IP Documentation', [author], 1) ] # -- Options for Texinfo output ---------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'mac_to_ip', 'MAC to IP Documentation', author, 'mac_to_ip', 'One line description of project.', 'Miscellaneous'), ]
true
true
f72483c20810353d6391f7a8ef332c319e49ecf0
2,956
py
Python
pygyver/etl/ometria.py
madedotcom/pygyver
77da52570951c4ddaba3d60f36a82c64828a9121
[ "MIT" ]
1
2020-11-25T11:33:11.000Z
2020-11-25T11:33:11.000Z
pygyver/etl/ometria.py
madedotcom/pygyver
77da52570951c4ddaba3d60f36a82c64828a9121
[ "MIT" ]
21
2020-04-17T17:21:05.000Z
2021-05-21T13:34:51.000Z
pygyver/etl/ometria.py
madedotcom/pygyver
77da52570951c4ddaba3d60f36a82c64828a9121
[ "MIT" ]
2
2021-03-05T14:13:00.000Z
2021-12-30T18:36:40.000Z
""" Ometria API http://docs.ometria.com/apis/data_api_v2/ - the env vars for the authentication are stored on the kubernetes cluster under 'ometria-access-credentials' - functionality: set api credentials send custom events """ import logging import os import requests class OmetriaExecutor: """ Ometria API handler. Args: env: switch between environments in Ometria, 'staging' - for testing 'prod_marketing' - for marketing emails 'prod_service' - for service emails Attributes: api_endpoint: the base API endpoint api_key: required for authentication api_headers: header to be included in the request payload: the formatted payload to be sent response: the response from the API call Returns: OmetriaExecutor object """ def __init__(self, env: str): """ Initiate and collect API credentials. """ self.env = env self.api_endpoint = "https://api.ometria.com/v2" self.api_key = None self.api_headers = None self.payload = None self.response = None self.set_api_credentials() def set_api_credentials(self): """ Collect API credentials depending on the environment. """ # api key if self.env == "staging": api_key_env_var = "OMETRIA_STAGING_API_KEY" elif self.env == "prod_marketing": api_key_env_var = "OMETRIA_MARKETING_API_KEY" elif self.env == "prod_service": api_key_env_var = "OMETRIA_SERVICE_API_KEY" else: raise KeyError(f"Unknown env - {self.env}") if api_key_env_var in os.environ: self.api_key = os.getenv(api_key_env_var) logging.info("API credentials set") else: raise KeyError(f"Env var {api_key_env_var} does not exist") # headers self.api_headers = { "X-Ometria-Auth": self.api_key, "Content-Type": "application/json" } def send_custom_events(self): """ Send custom_event type of payload to Ometria, save the API response. """ if self.payload: # check if payload length is valid - 100 items per send payload_len = len(self.payload) if payload_len <= 100: # request - not adding retry for POST request self.response = requests.post( json=self.payload, url=f"{self.api_endpoint}/push", headers=self.api_headers ) logging.info(f"Sent {payload_len} 'custom_events' items") self.payload = None else: raise ValueError( f"Payload too big - {payload_len}, max 100 items" ) else: logging.info("No send - empty payload")
30.163265
76
0.579838
import logging import os import requests class OmetriaExecutor: def __init__(self, env: str): self.env = env self.api_endpoint = "https://api.ometria.com/v2" self.api_key = None self.api_headers = None self.payload = None self.response = None self.set_api_credentials() def set_api_credentials(self): if self.env == "staging": api_key_env_var = "OMETRIA_STAGING_API_KEY" elif self.env == "prod_marketing": api_key_env_var = "OMETRIA_MARKETING_API_KEY" elif self.env == "prod_service": api_key_env_var = "OMETRIA_SERVICE_API_KEY" else: raise KeyError(f"Unknown env - {self.env}") if api_key_env_var in os.environ: self.api_key = os.getenv(api_key_env_var) logging.info("API credentials set") else: raise KeyError(f"Env var {api_key_env_var} does not exist") self.api_headers = { "X-Ometria-Auth": self.api_key, "Content-Type": "application/json" } def send_custom_events(self): if self.payload: payload_len = len(self.payload) if payload_len <= 100: self.response = requests.post( json=self.payload, url=f"{self.api_endpoint}/push", headers=self.api_headers ) logging.info(f"Sent {payload_len} 'custom_events' items") self.payload = None else: raise ValueError( f"Payload too big - {payload_len}, max 100 items" ) else: logging.info("No send - empty payload")
true
true
f724846c02029786eec80ed57f3b3c256cf3045a
1,366
py
Python
src/csharp/CSharpTemplate.py
slash-under/codenn
747a7c5c6788256cdb1564d0936b5ea91f43ba6c
[ "MIT" ]
216
2016-06-28T18:44:28.000Z
2022-03-26T10:24:03.000Z
src/csharp/CSharpTemplate.py
slash-under/codenn
747a7c5c6788256cdb1564d0936b5ea91f43ba6c
[ "MIT" ]
17
2016-07-22T23:43:27.000Z
2021-06-09T16:36:54.000Z
src/csharp/CSharpTemplate.py
slash-under/codenn
747a7c5c6788256cdb1564d0936b5ea91f43ba6c
[ "MIT" ]
86
2016-07-02T06:56:31.000Z
2021-09-14T06:24:46.000Z
import antlr4 from csharp.CSharp4Lexer import CSharp4Lexer import re def parseCSharp(code): code = code.replace('\\n', '\n') parsedVersion = [] stream = antlr4.InputStream(code) lexer = CSharp4Lexer(stream) toks = antlr4.CommonTokenStream(lexer) toks.fetch(500) identifiers = {} identCount = 0 for token in toks.tokens: if token.type == 109: parsedVersion += ["CODE_INTEGER"] elif token.type == 111: parsedVersion += ["CODE_REAL"] elif token.type == 112: parsedVersion += ["CODE_CHAR"] elif token.type == 113: parsedVersion += ["CODE_STRING"] elif token.type == 9 or token.type == 7 or token.type == 6: # whitespace and comments and newline pass else: parsedVersion += [str(token.text)] return parsedVersion if __name__ == '__main__': print parseCSharp("public Boolean SomeValue { get { return someValue; } set { someValue = value; } }") print parseCSharp("Console.WriteLine('cat'); int mouse = 5; int cat = 0.4; int cow = 'c'; int moo = \"mouse\"; ") print parseCSharp("int i = 4; // i is assigned the literal value of '4' \n int j = i // j is assigned the value of i. Since i is a variable, //it can change and is not a 'literal'") try: print parseCSharp('string `fixed = Regex.Replace(input, "\s*()","$1");'); except: print "Error"
32.52381
201
0.635432
import antlr4 from csharp.CSharp4Lexer import CSharp4Lexer import re def parseCSharp(code): code = code.replace('\\n', '\n') parsedVersion = [] stream = antlr4.InputStream(code) lexer = CSharp4Lexer(stream) toks = antlr4.CommonTokenStream(lexer) toks.fetch(500) identifiers = {} identCount = 0 for token in toks.tokens: if token.type == 109: parsedVersion += ["CODE_INTEGER"] elif token.type == 111: parsedVersion += ["CODE_REAL"] elif token.type == 112: parsedVersion += ["CODE_CHAR"] elif token.type == 113: parsedVersion += ["CODE_STRING"] elif token.type == 9 or token.type == 7 or token.type == 6: pass else: parsedVersion += [str(token.text)] return parsedVersion if __name__ == '__main__': print parseCSharp("public Boolean SomeValue { get { return someValue; } set { someValue = value; } }") print parseCSharp("Console.WriteLine('cat'); int mouse = 5; int cat = 0.4; int cow = 'c'; int moo = \"mouse\"; ") print parseCSharp("int i = 4; // i is assigned the literal value of '4' \n int j = i // j is assigned the value of i. Since i is a variable, //it can change and is not a 'literal'") try: print parseCSharp('string `fixed = Regex.Replace(input, "\s*()","$1");'); except: print "Error"
false
true
f724849d81b90b9dba25cf9ce12481c3d66b2f7c
38,765
py
Python
airflow/models/baseoperator.py
subrays/airflow
3c8c0b3b6411762a4e4977e519374d9fb16b541d
[ "Apache-2.0", "BSD-2-Clause", "MIT", "ECL-2.0", "BSD-3-Clause" ]
null
null
null
airflow/models/baseoperator.py
subrays/airflow
3c8c0b3b6411762a4e4977e519374d9fb16b541d
[ "Apache-2.0", "BSD-2-Clause", "MIT", "ECL-2.0", "BSD-3-Clause" ]
null
null
null
airflow/models/baseoperator.py
subrays/airflow
3c8c0b3b6411762a4e4977e519374d9fb16b541d
[ "Apache-2.0", "BSD-2-Clause", "MIT", "ECL-2.0", "BSD-3-Clause" ]
null
null
null
# -*- coding: utf-8 -*- # # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. from abc import ABCMeta, abstractmethod from cached_property import cached_property import copy import functools import logging import sys import warnings from datetime import timedelta, datetime from typing import Callable, Dict, Iterable, List, Optional, Set import jinja2 import six from airflow import configuration, settings from airflow.exceptions import AirflowException from airflow.lineage import prepare_lineage, apply_lineage, DataSet from airflow.models.dag import DAG from airflow.models.taskinstance import TaskInstance, clear_task_instances from airflow.models.xcom import XCOM_RETURN_KEY from airflow.ti_deps.deps.not_in_retry_period_dep import NotInRetryPeriodDep from airflow.ti_deps.deps.prev_dagrun_dep import PrevDagrunDep from airflow.ti_deps.deps.trigger_rule_dep import TriggerRuleDep from airflow.utils import timezone from airflow.utils.db import provide_session from airflow.utils.decorators import apply_defaults from airflow.utils.helpers import validate_key from airflow.utils.log.logging_mixin import LoggingMixin from airflow.utils.operator_resources import Resources from airflow.utils.trigger_rule import TriggerRule from airflow.utils.weight_rule import WeightRule @functools.total_ordering class BaseOperator(LoggingMixin): """ Abstract base class for all operators. Since operators create objects that become nodes in the dag, BaseOperator contains many recursive methods for dag crawling behavior. To derive this class, you are expected to override the constructor as well as the 'execute' method. Operators derived from this class should perform or trigger certain tasks synchronously (wait for completion). Example of operators could be an operator that runs a Pig job (PigOperator), a sensor operator that waits for a partition to land in Hive (HiveSensorOperator), or one that moves data from Hive to MySQL (Hive2MySqlOperator). Instances of these operators (tasks) target specific operations, running specific scripts, functions or data transfers. This class is abstract and shouldn't be instantiated. Instantiating a class derived from this one results in the creation of a task object, which ultimately becomes a node in DAG objects. Task dependencies should be set by using the set_upstream and/or set_downstream methods. :param task_id: a unique, meaningful id for the task :type task_id: str :param owner: the owner of the task, using the unix username is recommended :type owner: str :param retries: the number of retries that should be performed before failing the task :type retries: int :param retry_delay: delay between retries :type retry_delay: datetime.timedelta :param retry_exponential_backoff: allow progressive longer waits between retries by using exponential backoff algorithm on retry delay (delay will be converted into seconds) :type retry_exponential_backoff: bool :param max_retry_delay: maximum delay interval between retries :type max_retry_delay: datetime.timedelta :param start_date: The ``start_date`` for the task, determines the ``execution_date`` for the first task instance. The best practice is to have the start_date rounded to your DAG's ``schedule_interval``. Daily jobs have their start_date some day at 00:00:00, hourly jobs have their start_date at 00:00 of a specific hour. Note that Airflow simply looks at the latest ``execution_date`` and adds the ``schedule_interval`` to determine the next ``execution_date``. It is also very important to note that different tasks' dependencies need to line up in time. If task A depends on task B and their start_date are offset in a way that their execution_date don't line up, A's dependencies will never be met. If you are looking to delay a task, for example running a daily task at 2AM, look into the ``TimeSensor`` and ``TimeDeltaSensor``. We advise against using dynamic ``start_date`` and recommend using fixed ones. Read the FAQ entry about start_date for more information. :type start_date: datetime.datetime :param end_date: if specified, the scheduler won't go beyond this date :type end_date: datetime.datetime :param depends_on_past: when set to true, task instances will run sequentially while relying on the previous task's schedule to succeed. The task instance for the start_date is allowed to run. :type depends_on_past: bool :param wait_for_downstream: when set to true, an instance of task X will wait for tasks immediately downstream of the previous instance of task X to finish successfully before it runs. This is useful if the different instances of a task X alter the same asset, and this asset is used by tasks downstream of task X. Note that depends_on_past is forced to True wherever wait_for_downstream is used. :type wait_for_downstream: bool :param queue: which queue to target when running this job. Not all executors implement queue management, the CeleryExecutor does support targeting specific queues. :type queue: str :param dag: a reference to the dag the task is attached to (if any) :type dag: airflow.models.DAG :param priority_weight: priority weight of this task against other task. This allows the executor to trigger higher priority tasks before others when things get backed up. Set priority_weight as a higher number for more important tasks. :type priority_weight: int :param weight_rule: weighting method used for the effective total priority weight of the task. Options are: ``{ downstream | upstream | absolute }`` default is ``downstream`` When set to ``downstream`` the effective weight of the task is the aggregate sum of all downstream descendants. As a result, upstream tasks will have higher weight and will be scheduled more aggressively when using positive weight values. This is useful when you have multiple dag run instances and desire to have all upstream tasks to complete for all runs before each dag can continue processing downstream tasks. When set to ``upstream`` the effective weight is the aggregate sum of all upstream ancestors. This is the opposite where downtream tasks have higher weight and will be scheduled more aggressively when using positive weight values. This is useful when you have multiple dag run instances and prefer to have each dag complete before starting upstream tasks of other dags. When set to ``absolute``, the effective weight is the exact ``priority_weight`` specified without additional weighting. You may want to do this when you know exactly what priority weight each task should have. Additionally, when set to ``absolute``, there is bonus effect of significantly speeding up the task creation process as for very large DAGS. Options can be set as string or using the constants defined in the static class ``airflow.utils.WeightRule`` :type weight_rule: str :param pool: the slot pool this task should run in, slot pools are a way to limit concurrency for certain tasks :type pool: str :param sla: time by which the job is expected to succeed. Note that this represents the ``timedelta`` after the period is closed. For example if you set an SLA of 1 hour, the scheduler would send an email soon after 1:00AM on the ``2016-01-02`` if the ``2016-01-01`` instance has not succeeded yet. The scheduler pays special attention for jobs with an SLA and sends alert emails for sla misses. SLA misses are also recorded in the database for future reference. All tasks that share the same SLA time get bundled in a single email, sent soon after that time. SLA notification are sent once and only once for each task instance. :type sla: datetime.timedelta :param execution_timeout: max time allowed for the execution of this task instance, if it goes beyond it will raise and fail. :type execution_timeout: datetime.timedelta :param on_failure_callback: a function to be called when a task instance of this task fails. a context dictionary is passed as a single parameter to this function. Context contains references to related objects to the task instance and is documented under the macros section of the API. :type on_failure_callback: callable :param on_retry_callback: much like the ``on_failure_callback`` except that it is executed when retries occur. :type on_retry_callback: callable :param on_success_callback: much like the ``on_failure_callback`` except that it is executed when the task succeeds. :type on_success_callback: callable :param trigger_rule: defines the rule by which dependencies are applied for the task to get triggered. Options are: ``{ all_success | all_failed | all_done | one_success | one_failed | none_failed | none_skipped | dummy}`` default is ``all_success``. Options can be set as string or using the constants defined in the static class ``airflow.utils.TriggerRule`` :type trigger_rule: str :param resources: A map of resource parameter names (the argument names of the Resources constructor) to their values. :type resources: dict :param run_as_user: unix username to impersonate while running the task :type run_as_user: str :param task_concurrency: When set, a task will be able to limit the concurrent runs across execution_dates :type task_concurrency: int :param executor_config: Additional task-level configuration parameters that are interpreted by a specific executor. Parameters are namespaced by the name of executor. **Example**: to run this task in a specific docker container through the KubernetesExecutor :: MyOperator(..., executor_config={ "KubernetesExecutor": {"image": "myCustomDockerImage"} } ) :type executor_config: dict :param do_xcom_push: if True, an XCom is pushed containing the Operator's result :type do_xcom_push: bool """ # For derived classes to define which fields will get jinjaified template_fields = [] # type: Iterable[str] # Defines which files extensions to look for in the templated fields template_ext = [] # type: Iterable[str] # Defines the color in the UI ui_color = '#fff' ui_fgcolor = '#000' # base list which includes all the attrs that don't need deep copy. _base_operator_shallow_copy_attrs = ('user_defined_macros', 'user_defined_filters', 'params', '_log',) # each operator should override this class attr for shallow copy attrs. shallow_copy_attrs = () # type: Iterable[str] # Defines the operator level extra links operator_extra_links = () # type: Iterable[BaseOperatorLink] @apply_defaults def __init__( self, task_id: str, owner: str = configuration.conf.get('operators', 'DEFAULT_OWNER'), email: Optional[str] = None, email_on_retry: bool = True, email_on_failure: bool = True, retries: int = 0, retry_delay: timedelta = timedelta(seconds=300), retry_exponential_backoff: bool = False, max_retry_delay: Optional[datetime] = None, start_date: Optional[datetime] = None, end_date: Optional[datetime] = None, schedule_interval=None, # not hooked as of now depends_on_past: bool = False, wait_for_downstream: bool = False, dag: Optional[DAG] = None, params: Optional[Dict] = None, default_args: Optional[Dict] = None, priority_weight: int = 1, weight_rule: str = WeightRule.DOWNSTREAM, queue: str = configuration.conf.get('celery', 'default_queue'), pool: Optional[str] = None, sla: Optional[timedelta] = None, execution_timeout: Optional[timedelta] = None, on_failure_callback: Optional[Callable] = None, on_success_callback: Optional[Callable] = None, on_retry_callback: Optional[Callable] = None, trigger_rule: str = TriggerRule.ALL_SUCCESS, resources: Optional[Dict] = None, run_as_user: Optional[str] = None, task_concurrency: Optional[int] = None, executor_config: Optional[Dict] = None, do_xcom_push: bool = True, inlets: Optional[Dict] = None, outlets: Optional[Dict] = None, *args, **kwargs ): if args or kwargs: # TODO remove *args and **kwargs in Airflow 2.0 warnings.warn( 'Invalid arguments were passed to {c} (task_id: {t}). ' 'Support for passing such arguments will be dropped in ' 'Airflow 2.0. Invalid arguments were:' '\n*args: {a}\n**kwargs: {k}'.format( c=self.__class__.__name__, a=args, k=kwargs, t=task_id), category=PendingDeprecationWarning, stacklevel=3 ) validate_key(task_id) self.task_id = task_id self.owner = owner self.email = email self.email_on_retry = email_on_retry self.email_on_failure = email_on_failure self.start_date = start_date if start_date and not isinstance(start_date, datetime): self.log.warning("start_date for %s isn't datetime.datetime", self) elif start_date: self.start_date = timezone.convert_to_utc(start_date) self.end_date = end_date if end_date: self.end_date = timezone.convert_to_utc(end_date) if not TriggerRule.is_valid(trigger_rule): raise AirflowException( "The trigger_rule must be one of {all_triggers}," "'{d}.{t}'; received '{tr}'." .format(all_triggers=TriggerRule.all_triggers(), d=dag.dag_id if dag else "", t=task_id, tr=trigger_rule)) self.trigger_rule = trigger_rule self.depends_on_past = depends_on_past self.wait_for_downstream = wait_for_downstream if wait_for_downstream: self.depends_on_past = True if schedule_interval: self.log.warning( "schedule_interval is used for %s, though it has " "been deprecated as a task parameter, you need to " "specify it as a DAG parameter instead", self ) self._schedule_interval = schedule_interval self.retries = retries self.queue = queue self.pool = pool self.sla = sla self.execution_timeout = execution_timeout self.on_failure_callback = on_failure_callback self.on_success_callback = on_success_callback self.on_retry_callback = on_retry_callback if isinstance(retry_delay, timedelta): self.retry_delay = retry_delay else: self.log.debug("Retry_delay isn't timedelta object, assuming secs") self.retry_delay = timedelta(seconds=retry_delay) self.retry_exponential_backoff = retry_exponential_backoff self.max_retry_delay = max_retry_delay self.params = params or {} # Available in templates! self.priority_weight = priority_weight if not WeightRule.is_valid(weight_rule): raise AirflowException( "The weight_rule must be one of {all_weight_rules}," "'{d}.{t}'; received '{tr}'." .format(all_weight_rules=WeightRule.all_weight_rules, d=dag.dag_id if dag else "", t=task_id, tr=weight_rule)) self.weight_rule = weight_rule self.resources = Resources(**(resources or {})) self.run_as_user = run_as_user self.task_concurrency = task_concurrency self.executor_config = executor_config or {} self.do_xcom_push = do_xcom_push # Private attributes self._upstream_task_ids = set() # type: Set[str] self._downstream_task_ids = set() # type: Set[str] if not dag and settings.CONTEXT_MANAGER_DAG: dag = settings.CONTEXT_MANAGER_DAG if dag: self.dag = dag self._log = logging.getLogger("airflow.task.operators") # lineage self.inlets = [] # type: List[DataSet] self.outlets = [] # type: List[DataSet] self.lineage_data = None self._inlets = { "auto": False, "task_ids": [], "datasets": [], } self._outlets = { "datasets": [], } # type: Dict if inlets: self._inlets.update(inlets) if outlets: self._outlets.update(outlets) self._comps = { 'task_id', 'dag_id', 'owner', 'email', 'email_on_retry', 'retry_delay', 'retry_exponential_backoff', 'max_retry_delay', 'start_date', 'schedule_interval', 'depends_on_past', 'wait_for_downstream', 'priority_weight', 'sla', 'execution_timeout', 'on_failure_callback', 'on_success_callback', 'on_retry_callback', 'do_xcom_push', } def __eq__(self, other): if (type(self) == type(other) and self.task_id == other.task_id): return all(self.__dict__.get(c, None) == other.__dict__.get(c, None) for c in self._comps) return False def __ne__(self, other): return not self == other def __lt__(self, other): return self.task_id < other.task_id def __hash__(self): hash_components = [type(self)] for c in self._comps: val = getattr(self, c, None) try: hash(val) hash_components.append(val) except TypeError: hash_components.append(repr(val)) return hash(tuple(hash_components)) # Composing Operators ----------------------------------------------- def __rshift__(self, other): """ Implements Self >> Other == self.set_downstream(other) If "Other" is a DAG, the DAG is assigned to the Operator. """ if isinstance(other, DAG): # if this dag is already assigned, do nothing # otherwise, do normal dag assignment if not (self.has_dag() and self.dag is other): self.dag = other else: self.set_downstream(other) return other def __lshift__(self, other): """ Implements Self << Other == self.set_upstream(other) If "Other" is a DAG, the DAG is assigned to the Operator. """ if isinstance(other, DAG): # if this dag is already assigned, do nothing # otherwise, do normal dag assignment if not (self.has_dag() and self.dag is other): self.dag = other else: self.set_upstream(other) return other def __rrshift__(self, other): """ Called for [DAG] >> [Operator] because DAGs don't have __rshift__ operators. """ self.__lshift__(other) return self def __rlshift__(self, other): """ Called for [DAG] << [Operator] because DAGs don't have __lshift__ operators. """ self.__rshift__(other) return self # /Composing Operators --------------------------------------------- @property def dag(self): """ Returns the Operator's DAG if set, otherwise raises an error """ if self.has_dag(): return self._dag else: raise AirflowException( 'Operator {} has not been assigned to a DAG yet'.format(self)) @dag.setter def dag(self, dag): """ Operators can be assigned to one DAG, one time. Repeat assignments to that same DAG are ok. """ if not isinstance(dag, DAG): raise TypeError( 'Expected DAG; received {}'.format(dag.__class__.__name__)) elif self.has_dag() and self.dag is not dag: raise AirflowException( "The DAG assigned to {} can not be changed.".format(self)) elif self.task_id not in dag.task_dict: dag.add_task(self) self._dag = dag def has_dag(self): """ Returns True if the Operator has been assigned to a DAG. """ return getattr(self, '_dag', None) is not None @property def dag_id(self): if self.has_dag(): return self.dag.dag_id else: return 'adhoc_' + self.owner @property def deps(self): """ Returns the list of dependencies for the operator. These differ from execution context dependencies in that they are specific to tasks and can be extended/overridden by subclasses. """ return { NotInRetryPeriodDep(), PrevDagrunDep(), TriggerRuleDep(), } @property def schedule_interval(self): """ The schedule interval of the DAG always wins over individual tasks so that tasks within a DAG always line up. The task still needs a schedule_interval as it may not be attached to a DAG. """ if self.has_dag(): return self.dag._schedule_interval else: return self._schedule_interval @property def priority_weight_total(self): if self.weight_rule == WeightRule.ABSOLUTE: return self.priority_weight elif self.weight_rule == WeightRule.DOWNSTREAM: upstream = False elif self.weight_rule == WeightRule.UPSTREAM: upstream = True else: upstream = False return self.priority_weight + sum( map(lambda task_id: self._dag.task_dict[task_id].priority_weight, self.get_flat_relative_ids(upstream=upstream)) ) @cached_property def operator_extra_link_dict(self): return {link.name: link for link in self.operator_extra_links} @cached_property def global_operator_extra_link_dict(self): from airflow.plugins_manager import global_operator_extra_links return {link.name: link for link in global_operator_extra_links} @prepare_lineage def pre_execute(self, context): """ This hook is triggered right before self.execute() is called. """ def execute(self, context): """ This is the main method to derive when creating an operator. Context is the same dictionary used as when rendering jinja templates. Refer to get_template_context for more context. """ raise NotImplementedError() @apply_lineage def post_execute(self, context, result=None): """ This hook is triggered right after self.execute() is called. It is passed the execution context and any results returned by the operator. """ def on_kill(self): """ Override this method to cleanup subprocesses when a task instance gets killed. Any use of the threading, subprocess or multiprocessing module within an operator needs to be cleaned up or it will leave ghost processes behind. """ def __deepcopy__(self, memo): """ Hack sorting double chained task lists by task_id to avoid hitting max_depth on deepcopy operations. """ sys.setrecursionlimit(5000) # TODO fix this in a better way cls = self.__class__ result = cls.__new__(cls) memo[id(self)] = result shallow_copy = cls.shallow_copy_attrs + cls._base_operator_shallow_copy_attrs for k, v in self.__dict__.items(): if k not in shallow_copy: setattr(result, k, copy.deepcopy(v, memo)) else: setattr(result, k, copy.copy(v)) return result def __getstate__(self): state = dict(self.__dict__) del state['_log'] return state def __setstate__(self, state): self.__dict__ = state self._log = logging.getLogger("airflow.task.operators") def render_template_from_field(self, attr, content, context, jinja_env): """ Renders a template from a field. If the field is a string, it will simply render the string and return the result. If it is a collection or nested set of collections, it will traverse the structure and render all elements in it. If the field has another type, it will return it as it is. """ rt = self.render_template if isinstance(content, six.string_types): result = jinja_env.from_string(content).render(**context) elif isinstance(content, (list, tuple)): result = [rt(attr, e, context) for e in content] elif isinstance(content, dict): result = { k: rt("{}[{}]".format(attr, k), v, context) for k, v in list(content.items())} else: result = content return result def render_template(self, attr, content, context): """ Renders a template either from a file or directly in a field, and returns the rendered result. """ jinja_env = self.get_template_env() exts = self.__class__.template_ext if ( isinstance(content, six.string_types) and any([content.endswith(ext) for ext in exts])): return jinja_env.get_template(content).render(**context) else: return self.render_template_from_field(attr, content, context, jinja_env) def get_template_env(self): return self.dag.get_template_env() \ if hasattr(self, 'dag') \ else jinja2.Environment(cache_size=0) def prepare_template(self): """ Hook that is triggered after the templated fields get replaced by their content. If you need your operator to alter the content of the file before the template is rendered, it should override this method to do so. """ def resolve_template_files(self): # Getting the content of files for template_field / template_ext for attr in self.template_fields: content = getattr(self, attr) if content is None: continue elif isinstance(content, six.string_types) and \ any([content.endswith(ext) for ext in self.template_ext]): env = self.get_template_env() try: setattr(self, attr, env.loader.get_source(env, content)[0]) except Exception as e: self.log.exception(e) elif isinstance(content, list): env = self.dag.get_template_env() for i in range(len(content)): if isinstance(content[i], six.string_types) and \ any([content[i].endswith(ext) for ext in self.template_ext]): try: content[i] = env.loader.get_source(env, content[i])[0] except Exception as e: self.log.exception(e) self.prepare_template() @property def upstream_list(self): """@property: list of tasks directly upstream""" return [self.dag.get_task(tid) for tid in self._upstream_task_ids] @property def upstream_task_ids(self): return self._upstream_task_ids @property def downstream_list(self): """@property: list of tasks directly downstream""" return [self.dag.get_task(tid) for tid in self._downstream_task_ids] @property def downstream_task_ids(self): return self._downstream_task_ids @provide_session def clear(self, start_date=None, end_date=None, upstream=False, downstream=False, session=None): """ Clears the state of task instances associated with the task, following the parameters specified. """ TI = TaskInstance qry = session.query(TI).filter(TI.dag_id == self.dag_id) if start_date: qry = qry.filter(TI.execution_date >= start_date) if end_date: qry = qry.filter(TI.execution_date <= end_date) tasks = [self.task_id] if upstream: tasks += [ t.task_id for t in self.get_flat_relatives(upstream=True)] if downstream: tasks += [ t.task_id for t in self.get_flat_relatives(upstream=False)] qry = qry.filter(TI.task_id.in_(tasks)) count = qry.count() clear_task_instances(qry.all(), session, dag=self.dag) session.commit() return count @provide_session def get_task_instances(self, start_date=None, end_date=None, session=None): """ Get a set of task instance related to this task for a specific date range. """ end_date = end_date or timezone.utcnow() return session.query(TaskInstance)\ .filter(TaskInstance.dag_id == self.dag_id)\ .filter(TaskInstance.task_id == self.task_id)\ .filter(TaskInstance.execution_date >= start_date)\ .filter(TaskInstance.execution_date <= end_date)\ .order_by(TaskInstance.execution_date)\ .all() def get_flat_relative_ids(self, upstream=False, found_descendants=None): """ Get a flat list of relatives' ids, either upstream or downstream. """ if not found_descendants: found_descendants = set() relative_ids = self.get_direct_relative_ids(upstream) for relative_id in relative_ids: if relative_id not in found_descendants: found_descendants.add(relative_id) relative_task = self._dag.task_dict[relative_id] relative_task.get_flat_relative_ids(upstream, found_descendants) return found_descendants def get_flat_relatives(self, upstream=False): """ Get a flat list of relatives, either upstream or downstream. """ return list(map(lambda task_id: self._dag.task_dict[task_id], self.get_flat_relative_ids(upstream))) def run( self, start_date=None, end_date=None, ignore_first_depends_on_past=False, ignore_ti_state=False, mark_success=False): """ Run a set of task instances for a date range. """ start_date = start_date or self.start_date end_date = end_date or self.end_date or timezone.utcnow() for dt in self.dag.date_range(start_date, end_date=end_date): TaskInstance(self, dt).run( mark_success=mark_success, ignore_depends_on_past=( dt == start_date and ignore_first_depends_on_past), ignore_ti_state=ignore_ti_state) def dry_run(self): self.log.info('Dry run') for attr in self.template_fields: content = getattr(self, attr) if content and isinstance(content, six.string_types): self.log.info('Rendering template for %s', attr) self.log.info(content) def get_direct_relative_ids(self, upstream=False): """ Get the direct relative ids to the current task, upstream or downstream. """ if upstream: return self._upstream_task_ids else: return self._downstream_task_ids def get_direct_relatives(self, upstream=False): """ Get the direct relatives to the current task, upstream or downstream. """ if upstream: return self.upstream_list else: return self.downstream_list def __repr__(self): return "<Task({self.__class__.__name__}): {self.task_id}>".format( self=self) @property def task_type(self): return self.__class__.__name__ def add_only_new(self, item_set, item): if item in item_set: self.log.warning( 'Dependency {self}, {item} already registered' ''.format(self=self, item=item)) else: item_set.add(item) def _set_relatives(self, task_or_task_list, upstream=False): try: task_list = list(task_or_task_list) except TypeError: task_list = [task_or_task_list] for t in task_list: if not isinstance(t, BaseOperator): raise AirflowException( "Relationships can only be set between " "Operators; received {}".format(t.__class__.__name__)) # relationships can only be set if the tasks share a single DAG. Tasks # without a DAG are assigned to that DAG. dags = {t._dag.dag_id: t._dag for t in [self] + task_list if t.has_dag()} if len(dags) > 1: raise AirflowException( 'Tried to set relationships between tasks in ' 'more than one DAG: {}'.format(dags.values())) elif len(dags) == 1: dag = dags.popitem()[1] else: raise AirflowException( "Tried to create relationships between tasks that don't have " "DAGs yet. Set the DAG for at least one " "task and try again: {}".format([self] + task_list)) if dag and not self.has_dag(): self.dag = dag for task in task_list: if dag and not task.has_dag(): task.dag = dag if upstream: task.add_only_new(task.get_direct_relative_ids(upstream=False), self.task_id) self.add_only_new(self._upstream_task_ids, task.task_id) else: self.add_only_new(self._downstream_task_ids, task.task_id) task.add_only_new(task.get_direct_relative_ids(upstream=True), self.task_id) def set_downstream(self, task_or_task_list): """ Set a task or a task list to be directly downstream from the current task. """ self._set_relatives(task_or_task_list, upstream=False) def set_upstream(self, task_or_task_list): """ Set a task or a task list to be directly upstream from the current task. """ self._set_relatives(task_or_task_list, upstream=True) def xcom_push( self, context, key, value, execution_date=None): """ See TaskInstance.xcom_push() """ context['ti'].xcom_push( key=key, value=value, execution_date=execution_date) def xcom_pull( self, context, task_ids=None, dag_id=None, key=XCOM_RETURN_KEY, include_prior_dates=None): """ See TaskInstance.xcom_pull() """ return context['ti'].xcom_pull( key=key, task_ids=task_ids, dag_id=dag_id, include_prior_dates=include_prior_dates) @cached_property def extra_links(self) -> Iterable[str]: return list(set(self.operator_extra_link_dict.keys()) .union(self.global_operator_extra_link_dict.keys())) def get_extra_links(self, dttm, link_name): """ For an operator, gets the URL that the external links specified in `extra_links` should point to. :raise ValueError: The error message of a ValueError will be passed on through to the fronted to show up as a tooltip on the disabled link :param dttm: The datetime parsed execution date for the URL being searched for :param link_name: The name of the link we're looking for the URL for. Should be one of the options specified in `extra_links` :return: A URL """ if link_name in self.operator_extra_link_dict: return self.operator_extra_link_dict[link_name].get_link(self, dttm) elif link_name in self.global_operator_extra_link_dict: return self.global_operator_extra_link_dict[link_name].get_link(self, dttm) class BaseOperatorLink(metaclass=ABCMeta): """ Abstract base class that defines how we get an operator link. """ @property @abstractmethod def name(self) -> str: """ Name of the link. This will be the button name on the task UI. :return: link name """ @abstractmethod def get_link(self, operator: BaseOperator, dttm: datetime) -> str: """ Link to external system. :param operator: airflow operator :param dttm: datetime :return: link to external system """
38.765
102
0.629176
from abc import ABCMeta, abstractmethod from cached_property import cached_property import copy import functools import logging import sys import warnings from datetime import timedelta, datetime from typing import Callable, Dict, Iterable, List, Optional, Set import jinja2 import six from airflow import configuration, settings from airflow.exceptions import AirflowException from airflow.lineage import prepare_lineage, apply_lineage, DataSet from airflow.models.dag import DAG from airflow.models.taskinstance import TaskInstance, clear_task_instances from airflow.models.xcom import XCOM_RETURN_KEY from airflow.ti_deps.deps.not_in_retry_period_dep import NotInRetryPeriodDep from airflow.ti_deps.deps.prev_dagrun_dep import PrevDagrunDep from airflow.ti_deps.deps.trigger_rule_dep import TriggerRuleDep from airflow.utils import timezone from airflow.utils.db import provide_session from airflow.utils.decorators import apply_defaults from airflow.utils.helpers import validate_key from airflow.utils.log.logging_mixin import LoggingMixin from airflow.utils.operator_resources import Resources from airflow.utils.trigger_rule import TriggerRule from airflow.utils.weight_rule import WeightRule @functools.total_ordering class BaseOperator(LoggingMixin): template_fields = [] template_ext = [] ui_color = '#fff' ui_fgcolor = '#000' _base_operator_shallow_copy_attrs = ('user_defined_macros', 'user_defined_filters', 'params', '_log',) # each operator should override this class attr for shallow copy attrs. shallow_copy_attrs = () # type: Iterable[str] # Defines the operator level extra links operator_extra_links = () # type: Iterable[BaseOperatorLink] @apply_defaults def __init__( self, task_id: str, owner: str = configuration.conf.get('operators', 'DEFAULT_OWNER'), email: Optional[str] = None, email_on_retry: bool = True, email_on_failure: bool = True, retries: int = 0, retry_delay: timedelta = timedelta(seconds=300), retry_exponential_backoff: bool = False, max_retry_delay: Optional[datetime] = None, start_date: Optional[datetime] = None, end_date: Optional[datetime] = None, schedule_interval=None, # not hooked as of now depends_on_past: bool = False, wait_for_downstream: bool = False, dag: Optional[DAG] = None, params: Optional[Dict] = None, default_args: Optional[Dict] = None, priority_weight: int = 1, weight_rule: str = WeightRule.DOWNSTREAM, queue: str = configuration.conf.get('celery', 'default_queue'), pool: Optional[str] = None, sla: Optional[timedelta] = None, execution_timeout: Optional[timedelta] = None, on_failure_callback: Optional[Callable] = None, on_success_callback: Optional[Callable] = None, on_retry_callback: Optional[Callable] = None, trigger_rule: str = TriggerRule.ALL_SUCCESS, resources: Optional[Dict] = None, run_as_user: Optional[str] = None, task_concurrency: Optional[int] = None, executor_config: Optional[Dict] = None, do_xcom_push: bool = True, inlets: Optional[Dict] = None, outlets: Optional[Dict] = None, *args, **kwargs ): if args or kwargs: # TODO remove *args and **kwargs in Airflow 2.0 warnings.warn( 'Invalid arguments were passed to {c} (task_id: {t}). ' 'Support for passing such arguments will be dropped in ' 'Airflow 2.0. Invalid arguments were:' '\n*args: {a}\n**kwargs: {k}'.format( c=self.__class__.__name__, a=args, k=kwargs, t=task_id), category=PendingDeprecationWarning, stacklevel=3 ) validate_key(task_id) self.task_id = task_id self.owner = owner self.email = email self.email_on_retry = email_on_retry self.email_on_failure = email_on_failure self.start_date = start_date if start_date and not isinstance(start_date, datetime): self.log.warning("start_date for %s isn't datetime.datetime", self) elif start_date: self.start_date = timezone.convert_to_utc(start_date) self.end_date = end_date if end_date: self.end_date = timezone.convert_to_utc(end_date) if not TriggerRule.is_valid(trigger_rule): raise AirflowException( "The trigger_rule must be one of {all_triggers}," "'{d}.{t}'; received '{tr}'." .format(all_triggers=TriggerRule.all_triggers(), d=dag.dag_id if dag else "", t=task_id, tr=trigger_rule)) self.trigger_rule = trigger_rule self.depends_on_past = depends_on_past self.wait_for_downstream = wait_for_downstream if wait_for_downstream: self.depends_on_past = True if schedule_interval: self.log.warning( "schedule_interval is used for %s, though it has " "been deprecated as a task parameter, you need to " "specify it as a DAG parameter instead", self ) self._schedule_interval = schedule_interval self.retries = retries self.queue = queue self.pool = pool self.sla = sla self.execution_timeout = execution_timeout self.on_failure_callback = on_failure_callback self.on_success_callback = on_success_callback self.on_retry_callback = on_retry_callback if isinstance(retry_delay, timedelta): self.retry_delay = retry_delay else: self.log.debug("Retry_delay isn't timedelta object, assuming secs") self.retry_delay = timedelta(seconds=retry_delay) self.retry_exponential_backoff = retry_exponential_backoff self.max_retry_delay = max_retry_delay self.params = params or {} # Available in templates! self.priority_weight = priority_weight if not WeightRule.is_valid(weight_rule): raise AirflowException( "The weight_rule must be one of {all_weight_rules}," "'{d}.{t}'; received '{tr}'." .format(all_weight_rules=WeightRule.all_weight_rules, d=dag.dag_id if dag else "", t=task_id, tr=weight_rule)) self.weight_rule = weight_rule self.resources = Resources(**(resources or {})) self.run_as_user = run_as_user self.task_concurrency = task_concurrency self.executor_config = executor_config or {} self.do_xcom_push = do_xcom_push # Private attributes self._upstream_task_ids = set() # type: Set[str] self._downstream_task_ids = set() # type: Set[str] if not dag and settings.CONTEXT_MANAGER_DAG: dag = settings.CONTEXT_MANAGER_DAG if dag: self.dag = dag self._log = logging.getLogger("airflow.task.operators") # lineage self.inlets = [] # type: List[DataSet] self.outlets = [] # type: List[DataSet] self.lineage_data = None self._inlets = { "auto": False, "task_ids": [], "datasets": [], } self._outlets = { "datasets": [], } # type: Dict if inlets: self._inlets.update(inlets) if outlets: self._outlets.update(outlets) self._comps = { 'task_id', 'dag_id', 'owner', 'email', 'email_on_retry', 'retry_delay', 'retry_exponential_backoff', 'max_retry_delay', 'start_date', 'schedule_interval', 'depends_on_past', 'wait_for_downstream', 'priority_weight', 'sla', 'execution_timeout', 'on_failure_callback', 'on_success_callback', 'on_retry_callback', 'do_xcom_push', } def __eq__(self, other): if (type(self) == type(other) and self.task_id == other.task_id): return all(self.__dict__.get(c, None) == other.__dict__.get(c, None) for c in self._comps) return False def __ne__(self, other): return not self == other def __lt__(self, other): return self.task_id < other.task_id def __hash__(self): hash_components = [type(self)] for c in self._comps: val = getattr(self, c, None) try: hash(val) hash_components.append(val) except TypeError: hash_components.append(repr(val)) return hash(tuple(hash_components)) # Composing Operators ----------------------------------------------- def __rshift__(self, other): if isinstance(other, DAG): # if this dag is already assigned, do nothing # otherwise, do normal dag assignment if not (self.has_dag() and self.dag is other): self.dag = other else: self.set_downstream(other) return other def __lshift__(self, other): if isinstance(other, DAG): # if this dag is already assigned, do nothing # otherwise, do normal dag assignment if not (self.has_dag() and self.dag is other): self.dag = other else: self.set_upstream(other) return other def __rrshift__(self, other): self.__lshift__(other) return self def __rlshift__(self, other): self.__rshift__(other) return self # /Composing Operators --------------------------------------------- @property def dag(self): if self.has_dag(): return self._dag else: raise AirflowException( 'Operator {} has not been assigned to a DAG yet'.format(self)) @dag.setter def dag(self, dag): if not isinstance(dag, DAG): raise TypeError( 'Expected DAG; received {}'.format(dag.__class__.__name__)) elif self.has_dag() and self.dag is not dag: raise AirflowException( "The DAG assigned to {} can not be changed.".format(self)) elif self.task_id not in dag.task_dict: dag.add_task(self) self._dag = dag def has_dag(self): return getattr(self, '_dag', None) is not None @property def dag_id(self): if self.has_dag(): return self.dag.dag_id else: return 'adhoc_' + self.owner @property def deps(self): return { NotInRetryPeriodDep(), PrevDagrunDep(), TriggerRuleDep(), } @property def schedule_interval(self): if self.has_dag(): return self.dag._schedule_interval else: return self._schedule_interval @property def priority_weight_total(self): if self.weight_rule == WeightRule.ABSOLUTE: return self.priority_weight elif self.weight_rule == WeightRule.DOWNSTREAM: upstream = False elif self.weight_rule == WeightRule.UPSTREAM: upstream = True else: upstream = False return self.priority_weight + sum( map(lambda task_id: self._dag.task_dict[task_id].priority_weight, self.get_flat_relative_ids(upstream=upstream)) ) @cached_property def operator_extra_link_dict(self): return {link.name: link for link in self.operator_extra_links} @cached_property def global_operator_extra_link_dict(self): from airflow.plugins_manager import global_operator_extra_links return {link.name: link for link in global_operator_extra_links} @prepare_lineage def pre_execute(self, context): def execute(self, context): raise NotImplementedError() @apply_lineage def post_execute(self, context, result=None): def on_kill(self): def __deepcopy__(self, memo): sys.setrecursionlimit(5000) # TODO fix this in a better way cls = self.__class__ result = cls.__new__(cls) memo[id(self)] = result shallow_copy = cls.shallow_copy_attrs + cls._base_operator_shallow_copy_attrs for k, v in self.__dict__.items(): if k not in shallow_copy: setattr(result, k, copy.deepcopy(v, memo)) else: setattr(result, k, copy.copy(v)) return result def __getstate__(self): state = dict(self.__dict__) del state['_log'] return state def __setstate__(self, state): self.__dict__ = state self._log = logging.getLogger("airflow.task.operators") def render_template_from_field(self, attr, content, context, jinja_env): rt = self.render_template if isinstance(content, six.string_types): result = jinja_env.from_string(content).render(**context) elif isinstance(content, (list, tuple)): result = [rt(attr, e, context) for e in content] elif isinstance(content, dict): result = { k: rt("{}[{}]".format(attr, k), v, context) for k, v in list(content.items())} else: result = content return result def render_template(self, attr, content, context): jinja_env = self.get_template_env() exts = self.__class__.template_ext if ( isinstance(content, six.string_types) and any([content.endswith(ext) for ext in exts])): return jinja_env.get_template(content).render(**context) else: return self.render_template_from_field(attr, content, context, jinja_env) def get_template_env(self): return self.dag.get_template_env() \ if hasattr(self, 'dag') \ else jinja2.Environment(cache_size=0) def prepare_template(self): def resolve_template_files(self): # Getting the content of files for template_field / template_ext for attr in self.template_fields: content = getattr(self, attr) if content is None: continue elif isinstance(content, six.string_types) and \ any([content.endswith(ext) for ext in self.template_ext]): env = self.get_template_env() try: setattr(self, attr, env.loader.get_source(env, content)[0]) except Exception as e: self.log.exception(e) elif isinstance(content, list): env = self.dag.get_template_env() for i in range(len(content)): if isinstance(content[i], six.string_types) and \ any([content[i].endswith(ext) for ext in self.template_ext]): try: content[i] = env.loader.get_source(env, content[i])[0] except Exception as e: self.log.exception(e) self.prepare_template() @property def upstream_list(self): return [self.dag.get_task(tid) for tid in self._upstream_task_ids] @property def upstream_task_ids(self): return self._upstream_task_ids @property def downstream_list(self): return [self.dag.get_task(tid) for tid in self._downstream_task_ids] @property def downstream_task_ids(self): return self._downstream_task_ids @provide_session def clear(self, start_date=None, end_date=None, upstream=False, downstream=False, session=None): TI = TaskInstance qry = session.query(TI).filter(TI.dag_id == self.dag_id) if start_date: qry = qry.filter(TI.execution_date >= start_date) if end_date: qry = qry.filter(TI.execution_date <= end_date) tasks = [self.task_id] if upstream: tasks += [ t.task_id for t in self.get_flat_relatives(upstream=True)] if downstream: tasks += [ t.task_id for t in self.get_flat_relatives(upstream=False)] qry = qry.filter(TI.task_id.in_(tasks)) count = qry.count() clear_task_instances(qry.all(), session, dag=self.dag) session.commit() return count @provide_session def get_task_instances(self, start_date=None, end_date=None, session=None): end_date = end_date or timezone.utcnow() return session.query(TaskInstance)\ .filter(TaskInstance.dag_id == self.dag_id)\ .filter(TaskInstance.task_id == self.task_id)\ .filter(TaskInstance.execution_date >= start_date)\ .filter(TaskInstance.execution_date <= end_date)\ .order_by(TaskInstance.execution_date)\ .all() def get_flat_relative_ids(self, upstream=False, found_descendants=None): if not found_descendants: found_descendants = set() relative_ids = self.get_direct_relative_ids(upstream) for relative_id in relative_ids: if relative_id not in found_descendants: found_descendants.add(relative_id) relative_task = self._dag.task_dict[relative_id] relative_task.get_flat_relative_ids(upstream, found_descendants) return found_descendants def get_flat_relatives(self, upstream=False): return list(map(lambda task_id: self._dag.task_dict[task_id], self.get_flat_relative_ids(upstream))) def run( self, start_date=None, end_date=None, ignore_first_depends_on_past=False, ignore_ti_state=False, mark_success=False): start_date = start_date or self.start_date end_date = end_date or self.end_date or timezone.utcnow() for dt in self.dag.date_range(start_date, end_date=end_date): TaskInstance(self, dt).run( mark_success=mark_success, ignore_depends_on_past=( dt == start_date and ignore_first_depends_on_past), ignore_ti_state=ignore_ti_state) def dry_run(self): self.log.info('Dry run') for attr in self.template_fields: content = getattr(self, attr) if content and isinstance(content, six.string_types): self.log.info('Rendering template for %s', attr) self.log.info(content) def get_direct_relative_ids(self, upstream=False): if upstream: return self._upstream_task_ids else: return self._downstream_task_ids def get_direct_relatives(self, upstream=False): if upstream: return self.upstream_list else: return self.downstream_list def __repr__(self): return "<Task({self.__class__.__name__}): {self.task_id}>".format( self=self) @property def task_type(self): return self.__class__.__name__ def add_only_new(self, item_set, item): if item in item_set: self.log.warning( 'Dependency {self}, {item} already registered' ''.format(self=self, item=item)) else: item_set.add(item) def _set_relatives(self, task_or_task_list, upstream=False): try: task_list = list(task_or_task_list) except TypeError: task_list = [task_or_task_list] for t in task_list: if not isinstance(t, BaseOperator): raise AirflowException( "Relationships can only be set between " "Operators; received {}".format(t.__class__.__name__)) # relationships can only be set if the tasks share a single DAG. Tasks # without a DAG are assigned to that DAG. dags = {t._dag.dag_id: t._dag for t in [self] + task_list if t.has_dag()} if len(dags) > 1: raise AirflowException( 'Tried to set relationships between tasks in ' 'more than one DAG: {}'.format(dags.values())) elif len(dags) == 1: dag = dags.popitem()[1] else: raise AirflowException( "Tried to create relationships between tasks that don't have " "DAGs yet. Set the DAG for at least one " "task and try again: {}".format([self] + task_list)) if dag and not self.has_dag(): self.dag = dag for task in task_list: if dag and not task.has_dag(): task.dag = dag if upstream: task.add_only_new(task.get_direct_relative_ids(upstream=False), self.task_id) self.add_only_new(self._upstream_task_ids, task.task_id) else: self.add_only_new(self._downstream_task_ids, task.task_id) task.add_only_new(task.get_direct_relative_ids(upstream=True), self.task_id) def set_downstream(self, task_or_task_list): self._set_relatives(task_or_task_list, upstream=False) def set_upstream(self, task_or_task_list): self._set_relatives(task_or_task_list, upstream=True) def xcom_push( self, context, key, value, execution_date=None): context['ti'].xcom_push( key=key, value=value, execution_date=execution_date) def xcom_pull( self, context, task_ids=None, dag_id=None, key=XCOM_RETURN_KEY, include_prior_dates=None): return context['ti'].xcom_pull( key=key, task_ids=task_ids, dag_id=dag_id, include_prior_dates=include_prior_dates) @cached_property def extra_links(self) -> Iterable[str]: return list(set(self.operator_extra_link_dict.keys()) .union(self.global_operator_extra_link_dict.keys())) def get_extra_links(self, dttm, link_name): if link_name in self.operator_extra_link_dict: return self.operator_extra_link_dict[link_name].get_link(self, dttm) elif link_name in self.global_operator_extra_link_dict: return self.global_operator_extra_link_dict[link_name].get_link(self, dttm) class BaseOperatorLink(metaclass=ABCMeta): @property @abstractmethod def name(self) -> str: @abstractmethod def get_link(self, operator: BaseOperator, dttm: datetime) -> str:
true
true
f72484a7592ee8ca18c8b0897a938b18606428a4
6,800
py
Python
bindings/python/ensmallen_graph/datasets/string/paraprevotellaxylaniphila.py
caufieldjh/ensmallen_graph
14e98b1cdbc73193a84a913d7d4f2b2b3eb2c43a
[ "MIT" ]
null
null
null
bindings/python/ensmallen_graph/datasets/string/paraprevotellaxylaniphila.py
caufieldjh/ensmallen_graph
14e98b1cdbc73193a84a913d7d4f2b2b3eb2c43a
[ "MIT" ]
null
null
null
bindings/python/ensmallen_graph/datasets/string/paraprevotellaxylaniphila.py
caufieldjh/ensmallen_graph
14e98b1cdbc73193a84a913d7d4f2b2b3eb2c43a
[ "MIT" ]
null
null
null
""" This file offers the methods to automatically retrieve the graph Paraprevotella xylaniphila. The graph is automatically retrieved from the STRING repository. Report --------------------- At the time of rendering these methods (please see datetime below), the graph had the following characteristics: Datetime: 2021-02-02 21:42:47.483688 The undirected graph Paraprevotella xylaniphila has 3396 nodes and 309111 weighted edges, of which none are self-loops. The graph is dense as it has a density of 0.05362 and has 22 connected components, where the component with most nodes has 3350 nodes and the component with the least nodes has 2 nodes. The graph median node degree is 157, the mean node degree is 182.04, and the node degree mode is 4. The top 5 most central nodes are 762982.HMPREF9442_02244 (degree 997), 762982.HMPREF9442_00670 (degree 895), 762982.HMPREF9442_01031 (degree 865), 762982.HMPREF9442_03225 (degree 794) and 762982.HMPREF9442_00174 (degree 776). References --------------------- Please cite the following if you use the data: @article{szklarczyk2019string, title={STRING v11: protein--protein association networks with increased coverage, supporting functional discovery in genome-wide experimental datasets}, author={Szklarczyk, Damian and Gable, Annika L and Lyon, David and Junge, Alexander and Wyder, Stefan and Huerta-Cepas, Jaime and Simonovic, Milan and Doncheva, Nadezhda T and Morris, John H and Bork, Peer and others}, journal={Nucleic acids research}, volume={47}, number={D1}, pages={D607--D613}, year={2019}, publisher={Oxford University Press} } Usage example ---------------------- The usage of this graph is relatively straightforward: .. code:: python # First import the function to retrieve the graph from the datasets from ensmallen_graph.datasets.string import ParaprevotellaXylaniphila # Then load the graph graph = ParaprevotellaXylaniphila() # Finally, you can do anything with it, for instance, compute its report: print(graph) # If you need to run a link prediction task with validation, # you can split the graph using a connected holdout as follows: train_graph, validation_graph = graph.connected_holdout( # You can use an 80/20 split the holdout, for example. train_size=0.8, # The random state is used to reproduce the holdout. random_state=42, # Wether to show a loading bar. verbose=True ) # Remember that, if you need, you can enable the memory-time trade-offs: train_graph.enable( vector_sources=True, vector_destinations=True, vector_outbounds=True ) # Consider using the methods made available in the Embiggen package # to run graph embedding or link prediction tasks. """ from typing import Dict from ..automatic_graph_retrieval import AutomaticallyRetrievedGraph from ...ensmallen_graph import EnsmallenGraph # pylint: disable=import-error def ParaprevotellaXylaniphila( directed: bool = False, verbose: int = 2, cache_path: str = "graphs/string", **additional_graph_kwargs: Dict ) -> EnsmallenGraph: """Return new instance of the Paraprevotella xylaniphila graph. The graph is automatically retrieved from the STRING repository. Parameters ------------------- directed: bool = False, Wether to load the graph as directed or undirected. By default false. verbose: int = 2, Wether to show loading bars during the retrieval and building of the graph. cache_path: str = "graphs", Where to store the downloaded graphs. additional_graph_kwargs: Dict, Additional graph kwargs. Returns ----------------------- Instace of Paraprevotella xylaniphila graph. Report --------------------- At the time of rendering these methods (please see datetime below), the graph had the following characteristics: Datetime: 2021-02-02 21:42:47.483688 The undirected graph Paraprevotella xylaniphila has 3396 nodes and 309111 weighted edges, of which none are self-loops. The graph is dense as it has a density of 0.05362 and has 22 connected components, where the component with most nodes has 3350 nodes and the component with the least nodes has 2 nodes. The graph median node degree is 157, the mean node degree is 182.04, and the node degree mode is 4. The top 5 most central nodes are 762982.HMPREF9442_02244 (degree 997), 762982.HMPREF9442_00670 (degree 895), 762982.HMPREF9442_01031 (degree 865), 762982.HMPREF9442_03225 (degree 794) and 762982.HMPREF9442_00174 (degree 776). References --------------------- Please cite the following if you use the data: @article{szklarczyk2019string, title={STRING v11: protein--protein association networks with increased coverage, supporting functional discovery in genome-wide experimental datasets}, author={Szklarczyk, Damian and Gable, Annika L and Lyon, David and Junge, Alexander and Wyder, Stefan and Huerta-Cepas, Jaime and Simonovic, Milan and Doncheva, Nadezhda T and Morris, John H and Bork, Peer and others}, journal={Nucleic acids research}, volume={47}, number={D1}, pages={D607--D613}, year={2019}, publisher={Oxford University Press} } Usage example ---------------------- The usage of this graph is relatively straightforward: .. code:: python # First import the function to retrieve the graph from the datasets from ensmallen_graph.datasets.string import ParaprevotellaXylaniphila # Then load the graph graph = ParaprevotellaXylaniphila() # Finally, you can do anything with it, for instance, compute its report: print(graph) # If you need to run a link prediction task with validation, # you can split the graph using a connected holdout as follows: train_graph, validation_graph = graph.connected_holdout( # You can use an 80/20 split the holdout, for example. train_size=0.8, # The random state is used to reproduce the holdout. random_state=42, # Wether to show a loading bar. verbose=True ) # Remember that, if you need, you can enable the memory-time trade-offs: train_graph.enable( vector_sources=True, vector_destinations=True, vector_outbounds=True ) # Consider using the methods made available in the Embiggen package # to run graph embedding or link prediction tasks. """ return AutomaticallyRetrievedGraph( graph_name="ParaprevotellaXylaniphila", dataset="string", directed=directed, verbose=verbose, cache_path=cache_path, additional_graph_kwargs=additional_graph_kwargs )()
35.602094
223
0.708529
from typing import Dict from ..automatic_graph_retrieval import AutomaticallyRetrievedGraph from ...ensmallen_graph import EnsmallenGraph def ParaprevotellaXylaniphila( directed: bool = False, verbose: int = 2, cache_path: str = "graphs/string", **additional_graph_kwargs: Dict ) -> EnsmallenGraph: return AutomaticallyRetrievedGraph( graph_name="ParaprevotellaXylaniphila", dataset="string", directed=directed, verbose=verbose, cache_path=cache_path, additional_graph_kwargs=additional_graph_kwargs )()
true
true
f72484fc095b2c9a1f53f18824e2c7709dcae682
874
py
Python
spec_parser/spec_parser/util.py
Parnassius/domify
262a9b9bf68fd627d963f23abb68c06f424180f2
[ "MIT" ]
null
null
null
spec_parser/spec_parser/util.py
Parnassius/domify
262a9b9bf68fd627d963f23abb68c06f424180f2
[ "MIT" ]
5
2022-03-01T19:53:28.000Z
2022-03-28T01:32:30.000Z
spec_parser/spec_parser/util.py
Parnassius/domify
262a9b9bf68fd627d963f23abb68c06f424180f2
[ "MIT" ]
1
2021-11-08T20:36:36.000Z
2021-11-08T20:36:36.000Z
from typing import Dict, List import requests from bs4 import BeautifulSoup # type: ignore[import] class _RequestCache: def __init__(self) -> None: self._cache: Dict[str, BeautifulSoup] = {} def __call__(self, page: str) -> BeautifulSoup: if page.endswith(".html"): page = page[:-5] if page not in self._cache: html = requests.get( f"https://html.spec.whatwg.org/multipage/{page}.html" ).text self._cache[page] = BeautifulSoup(html, "html5lib") return self._cache[page] request_cache = _RequestCache() def get_input_type_keywords() -> List[str]: soup = request_cache("input") table = soup.find(id="attr-input-type-keywords") keywords = [ row.contents[0].find("code").string for row in table.find("tbody").children ] return keywords
26.484848
83
0.621281
from typing import Dict, List import requests from bs4 import BeautifulSoup class _RequestCache: def __init__(self) -> None: self._cache: Dict[str, BeautifulSoup] = {} def __call__(self, page: str) -> BeautifulSoup: if page.endswith(".html"): page = page[:-5] if page not in self._cache: html = requests.get( f"https://html.spec.whatwg.org/multipage/{page}.html" ).text self._cache[page] = BeautifulSoup(html, "html5lib") return self._cache[page] request_cache = _RequestCache() def get_input_type_keywords() -> List[str]: soup = request_cache("input") table = soup.find(id="attr-input-type-keywords") keywords = [ row.contents[0].find("code").string for row in table.find("tbody").children ] return keywords
true
true
f72485a6ca32241a57f395404a0c19eded7aae2d
415
py
Python
Data_Structures/Maps_Hash_Dict/DivisiblePairCount2.py
neha07kumari/algo_ds_101
b5f87feb4aac5ad45d934a609e7e73eedf280f10
[ "MIT" ]
1
2022-02-11T19:25:01.000Z
2022-02-11T19:25:01.000Z
Data_Structures/Maps_Hash_Dict/DivisiblePairCount2.py
neha07kumari/algo_ds_101
b5f87feb4aac5ad45d934a609e7e73eedf280f10
[ "MIT" ]
2
2020-10-13T06:49:54.000Z
2020-10-17T07:16:37.000Z
Data_Structures/Maps_Hash_Dict/DivisiblePairCount2.py
neha07kumari/algo_ds_101
b5f87feb4aac5ad45d934a609e7e73eedf280f10
[ "MIT" ]
14
2020-10-13T04:20:57.000Z
2021-10-01T16:16:13.000Z
def DivisiblePairCount(arr) : count = 0 k = len(arr) for i in range(0, k): for j in range(i+1, k): if (arr[i] % arr[j] == 0 or arr[j] % arr[i] == 0): count += 1 return count if __name__ == "__main__": #give input in form of a list -- [1,2,3] arr = [int(item) for item in ''.join(list(input())[1:-1]).split(',')] print(DivisiblePairCount(arr))
24.411765
73
0.508434
def DivisiblePairCount(arr) : count = 0 k = len(arr) for i in range(0, k): for j in range(i+1, k): if (arr[i] % arr[j] == 0 or arr[j] % arr[i] == 0): count += 1 return count if __name__ == "__main__": arr = [int(item) for item in ''.join(list(input())[1:-1]).split(',')] print(DivisiblePairCount(arr))
true
true
f72485e95740971bc6b7f5bd9e29a91909acdc48
92
py
Python
project_mysql/sales/modelsa.py
righ/djangomodel2alchemymap
c156cd14ff7bfd7d858449819072c18059ecdcd0
[ "MIT" ]
17
2019-08-20T16:58:18.000Z
2022-01-15T05:00:52.000Z
project_mysql/sales/modelsa.py
righ/djangomodel2alchemymap
c156cd14ff7bfd7d858449819072c18059ecdcd0
[ "MIT" ]
4
2020-06-02T00:14:38.000Z
2021-10-14T16:45:13.000Z
project_mysql/sales/modelsa.py
righ/djangomodel2alchemymap
c156cd14ff7bfd7d858449819072c18059ecdcd0
[ "MIT" ]
2
2019-12-17T13:15:48.000Z
2021-04-27T09:09:46.000Z
from d2a import transfer from . import models transfer(models, globals(), db_type='mysql')
18.4
44
0.76087
from d2a import transfer from . import models transfer(models, globals(), db_type='mysql')
true
true